the big three point oh (#1668)

Co-authored-by: Rob Ede <robjtede@icloud.com>

.appveyor.yml

@@ -1,41 +0,0 @@
-environment:
-  global:
-    PROJECT_NAME: actix-web
-  matrix:
-    # Stable channel
-    - TARGET: i686-pc-windows-msvc
-      CHANNEL: stable
-    - TARGET: x86_64-pc-windows-gnu
-      CHANNEL: stable
-    - TARGET: x86_64-pc-windows-msvc
-      CHANNEL: stable
-    # Nightly channel
-    - TARGET: i686-pc-windows-msvc
-      CHANNEL: nightly
-    - TARGET: x86_64-pc-windows-gnu
-      CHANNEL: nightly
-    - TARGET: x86_64-pc-windows-msvc
-      CHANNEL: nightly
-
-# Install Rust and Cargo
-# (Based on from https://github.com/rust-lang/libc/blob/master/appveyor.yml)
-install:
-  - ps: >-
-        If ($Env:TARGET -eq 'x86_64-pc-windows-gnu') {
-           $Env:PATH += ';C:\msys64\mingw64\bin'
-        } ElseIf ($Env:TARGET -eq 'i686-pc-windows-gnu') {
-           $Env:PATH += ';C:\MinGW\bin'
-        }
-  - curl -sSf -o rustup-init.exe https://win.rustup.rs
-  - rustup-init.exe --default-host %TARGET% --default-toolchain %CHANNEL% -y
-  - set PATH=%PATH%;C:\Users\appveyor\.cargo\bin
-  - rustc -Vv
-  - cargo -V
-
-# 'cargo test' takes care of building for us, so disable Appveyor's build stage.
-build: false
-
-# Equivalent to Travis' `script` phase
-test_script:
-  - cargo clean
-  - cargo test --no-default-features --features="flate2-rust"

.github/ISSUE_TEMPLATE/bug_report.md

@@ -0,0 +1,37 @@
+---
+name: Bug Report
+about: Create a bug report.
+---
+
+Your issue may already be reported!
+Please search on the [Actix Web issue tracker](https://github.com/actix/actix-web/issues) before creating one.
+
+## Expected Behavior
+<!--- If you're describing a bug, tell us what should happen -->
+<!--- If you're suggesting a change/improvement, tell us how it should work -->
+
+## Current Behavior
+<!--- If describing a bug, tell us what happens instead of the expected behavior -->
+<!--- If suggesting a change/improvement, explain the difference from current behavior -->
+
+## Possible Solution
+<!--- Not obligatory, but suggest a fix/reason for the bug, -->
+<!--- or ideas how to implement the addition or change -->
+
+## Steps to Reproduce (for bugs)
+<!--- Provide a link to a live example, or an unambiguous set of steps to -->
+<!--- reproduce this bug. Include code to reproduce, if relevant -->
+1.
+2.
+3.
+4.
+
+## Context
+<!--- How has this issue affected you? What are you trying to accomplish? -->
+<!--- Providing context helps us come up with a solution that is most useful in the real world -->
+
+## Your Environment
+<!--- Include as many relevant details about the environment you experienced the bug in -->
+
+* Rust Version (I.e, output of `rustc -V`):
+* Actix Web Version:

.github/ISSUE_TEMPLATE/config.yml

@@ -0,0 +1,8 @@
+blank_issues_enabled: true
+contact_links:
+  - name: Gitter channel (actix-web)
+    url: https://gitter.im/actix/actix-web
+    about: Please ask and answer questions about the actix-web here.
+  - name: Gitter channel (actix)
+    url: https://gitter.im/actix/actix
+    about: Please ask and answer questions about the actix here.

.github/PULL_REQUEST_TEMPLATE.md

@@ -0,0 +1,27 @@
+<!-- Thanks for considering contributing actix! -->
+<!-- Please fill out the following to make our reviews easy. -->
+
+## PR Type
+<!-- What kind of change does this PR make? -->
+<!-- Bug Fix / Feature / Refactor / Code Style / Other -->
+INSERT_PR_TYPE
+
+
+## PR Checklist
+Check your PR fulfills the following:
+
+<!-- For draft PRs check the boxes as you complete them. -->
+
+- [ ] Tests for the changes have been added / updated.
+- [ ] Documentation comments have been added / updated.
+- [ ] A changelog entry has been made for the appropriate packages.
+- [ ] Format code with the latest stable rustfmt
+
+
+## Overview
+<!-- Describe the current and new behavior. -->
+<!-- Emphasize any breaking changes. -->
+
+
+<!-- If this PR fixes or closes an issue, reference it here. -->
+<!-- Closes #000 -->

.github/workflows/bench.yml

@@ -0,0 +1,28 @@
+name: Benchmark (Linux)
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches:
+      - master
+
+jobs:
+  check_benchmark:
+    runs-on: ubuntu-latest
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: nightly
+          profile: minimal
+          override: true
+
+      - name: Check benchmark
+        uses: actions-rs/cargo@v1
+        with:
+          command: bench
+          args: --bench=server -- --sample-size=15

.github/workflows/clippy-fmt.yml

@@ -0,0 +1,32 @@
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+
+name: Clippy and rustfmt Check
+jobs:
+  clippy_check:
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v2
+
+      - uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable
+          components: rustfmt
+          override: true
+      - name: Check with rustfmt
+        uses: actions-rs/cargo@v1
+        with:
+          command: fmt
+          args: --all -- --check
+
+      - uses: actions-rs/toolchain@v1
+        with:
+          toolchain: nightly
+          components: clippy
+          override: true
+      - name: Check with Clippy
+        uses: actions-rs/clippy-check@v1
+        with:
+          token: ${{ secrets.GITHUB_TOKEN }}
+          args: --all-features --all --tests

.github/workflows/linux.yml

@@ -0,0 +1,69 @@
+name: CI (Linux)
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches:
+      - master
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        version:
+          - 1.42.0 # MSRV
+          - stable
+          - nightly
+
+    name: ${{ matrix.version }} - x86_64-unknown-linux-gnu
+    runs-on: ubuntu-latest
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-x86_64-unknown-linux-gnu
+          profile: minimal
+          override: true
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --all --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --all --all-features --no-fail-fast -- --nocapture
+
+      - name: tests (actix-http)
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --package=actix-http --no-default-features --features=rustls -- --nocapture
+
+      - name: tests (awc)
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --package=awc --no-default-features --features=rustls -- --nocapture
+
+      - name: Generate coverage file
+        if: matrix.version == 'stable' && (github.ref == 'refs/heads/master' || github.event_name == 'pull_request')
+        run: |
+          cargo install cargo-tarpaulin --vers "^0.13"
+          cargo tarpaulin --out Xml
+      - name: Upload to Codecov
+        if: matrix.version == 'stable' && (github.ref == 'refs/heads/master' || github.event_name == 'pull_request')
+        uses: codecov/codecov-action@v1
+        with:
+          file: cobertura.xml

.github/workflows/macos.yml

@@ -0,0 +1,44 @@
+name: CI (macOS)
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches:
+      - master
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        version:
+          - stable
+          - nightly
+
+    name: ${{ matrix.version }} - x86_64-apple-darwin
+    runs-on: macOS-latest
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-x86_64-apple-darwin
+          profile: minimal
+          override: true
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --all --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: test
+          args: --all --all-features --no-fail-fast -- --nocapture
+                --skip=test_h2_content_length
+                --skip=test_reading_deflate_encoding_large_random_rustls

.github/workflows/upload-doc.yml

@@ -0,0 +1,37 @@
+name: Upload documentation
+
+on:
+  push:
+    branches:
+      - master
+
+jobs:
+  build:
+    runs-on: ubuntu-latest
+    if: github.repository == 'actix/actix-web'
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable-x86_64-unknown-linux-gnu
+          profile: minimal
+          override: true
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: doc
+          args: --no-deps --workspace --all-features
+
+      - name: Tweak HTML
+        run: echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html
+
+      - name: Deploy to GitHub Pages
+        uses: JamesIves/github-pages-deploy-action@3.5.8
+        with:
+          GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+          BRANCH: gh-pages
+          FOLDER: target/doc

.github/workflows/windows.yml

@@ -0,0 +1,64 @@
+name: CI (Windows)
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches:
+      - master
+
+env:
+  VCPKGRS_DYNAMIC: 1
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        version:
+          - stable
+          - nightly
+
+    name: ${{ matrix.version }} - x86_64-pc-windows-msvc
+    runs-on: windows-latest
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-x86_64-pc-windows-msvc
+          profile: minimal
+          override: true
+
+      - name: Install OpenSSL
+        run: |
+          vcpkg integrate install
+          vcpkg install openssl:x64-windows
+          Copy-Item C:\vcpkg\installed\x64-windows\bin\libcrypto-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libcrypto.dll
+          Copy-Item C:\vcpkg\installed\x64-windows\bin\libssl-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libssl.dll
+          Get-ChildItem C:\vcpkg\installed\x64-windows\bin
+          Get-ChildItem C:\vcpkg\installed\x64-windows\lib
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --all --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: test
+          args: --all --all-features --no-fail-fast -- --nocapture
+                --skip=test_h2_content_length
+                --skip=test_reading_deflate_encoding_large_random_rustls
+                --skip=test_params
+                --skip=test_simple
+                --skip=test_expect_continue
+                --skip=test_http10_keepalive
+                --skip=test_slow_request
+                --skip=test_connection_force_close
+                --skip=test_connection_server_close
+                --skip=test_connection_wait_queue_force_close

.gitignore

@@ -9,6 +9,7 @@ guide/build/
 *.pid
 *.sock
 *~
+.DS_Store
 
 # These are backup files generated by rustfmt
 **/*.rs.bk

.travis.yml

@@ -1,58 +0,0 @@
-language: rust
-sudo: required
-dist: trusty
-
-cache:
-  # cargo: true
-  apt: true
-
-matrix:
-  include:
-    - rust: stable
-    - rust: beta
-    - rust: nightly-2019-08-10
-  allow_failures:
-    - rust: nightly-2019-08-10
-
-env:
-  global:
-    # - RUSTFLAGS="-C link-dead-code"
-    - OPENSSL_VERSION=openssl-1.0.2
-
-before_install:
-  - sudo add-apt-repository -y ppa:0k53d-karl-f830m/openssl
-  - sudo apt-get update -qq
-  - sudo apt-get install -y openssl libssl-dev libelf-dev libdw-dev cmake gcc binutils-dev libiberty-dev
-
-before_cache: |
-  if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-08-10" ]]; then
-    RUSTFLAGS="--cfg procmacro2_semver_exempt" cargo install --version 0.6.11 cargo-tarpaulin
-  fi
-
-# Add clippy
-before_script:
-  - export PATH=$PATH:~/.cargo/bin
-
-script:
-  - cargo update
-  - cargo check --all --no-default-features
-  - cargo test --all-features --all -- --nocapture
-  - cd actix-http; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd ..
-  - cd awc; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd ..
-
-# Upload docs
-after_success:
-  - |
-    if [[ "$TRAVIS_OS_NAME" == "linux" && "$TRAVIS_PULL_REQUEST" = "false" && "$TRAVIS_BRANCH" == "master" && "$TRAVIS_RUST_VERSION" == "stable" ]]; then
-      cargo doc --no-deps --all-features &&
-      echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html &&
-      git clone https://github.com/davisp/ghp-import.git &&
-      ./ghp-import/ghp_import.py -n -p -f -m "Documentation upload" -r https://"$GH_TOKEN"@github.com/"$TRAVIS_REPO_SLUG.git" target/doc &&
-      echo "Uploaded documentation"
-    fi
-  - |
-    if [[ "$TRAVIS_RUST_VERSION" ==  "nightly-2019-08-10" ]]; then
-        taskset -c 0 cargo tarpaulin --out Xml --all --all-features
-        bash <(curl -s https://codecov.io/bash)
-        echo "Uploaded code coverage"
-    fi

CHANGES.md

@@ -1,6 +1,220 @@
 # Changes
 
-## [1.0.6] - 2019-xx-xx
+## Unreleased - 2020-xx-xx
+
+
+## 3.0.0 - 2020-09-11
+* No significant changes from `3.0.0-beta.4`.
+
+
+## 3.0.0-beta.4 - 2020-09-09
+### Added
+* `middleware::NormalizePath` now has configurable behaviour for either always having a trailing
+  slash, or as the new addition, always trimming trailing slashes. [#1639]
+
+### Changed
+* Update actix-codec and actix-utils dependencies. [#1634]
+* `FormConfig` and `JsonConfig` configurations are now also considered when set
+  using `App::data`. [#1641]
+* `HttpServer::maxconn` is renamed to the more expressive `HttpServer::max_connections`. [#1655]
+* `HttpServer::maxconnrate` is renamed to the more expressive
+  `HttpServer::max_connection_rate`. [#1655]
+
+[#1639]: https://github.com/actix/actix-web/pull/1639
+[#1641]: https://github.com/actix/actix-web/pull/1641
+[#1634]: https://github.com/actix/actix-web/pull/1634
+[#1655]: https://github.com/actix/actix-web/pull/1655
+
+## 3.0.0-beta.3 - 2020-08-17
+### Changed
+* Update `rustls` to 0.18
+
+
+## 3.0.0-beta.2 - 2020-08-17
+### Changed
+* `PayloadConfig` is now also considered in `Bytes` and `String` extractors when set
+  using `App::data`. [#1610]
+* `web::Path` now has a public representation: `web::Path(pub T)` that enables
+  destructuring. [#1594]
+* `ServiceRequest::app_data` allows retrieval of non-Data data without splitting into parts to
+  access `HttpRequest` which already allows this. [#1618]
+* Re-export all error types from `awc`. [#1621]
+* MSRV is now 1.42.0.
+
+### Fixed
+* Memory leak of app data in pooled requests. [#1609]
+
+[#1594]: https://github.com/actix/actix-web/pull/1594
+[#1609]: https://github.com/actix/actix-web/pull/1609
+[#1610]: https://github.com/actix/actix-web/pull/1610
+[#1618]: https://github.com/actix/actix-web/pull/1618
+[#1621]: https://github.com/actix/actix-web/pull/1621
+
+
+## 3.0.0-beta.1 - 2020-07-13
+### Added
+* Re-export `actix_rt::main` as `actix_web::main`.
+* `HttpRequest::match_pattern` and `ServiceRequest::match_pattern` for extracting the matched
+  resource pattern.
+* `HttpRequest::match_name` and `ServiceRequest::match_name` for extracting matched resource name.
+
+### Changed
+* Fix actix_http::h1::dispatcher so it returns when HW_BUFFER_SIZE is reached. Should reduce peak memory consumption during large uploads. [#1550]
+* Migrate cookie handling to `cookie` crate. Actix-web no longer requires `ring` dependency.
+* MSRV is now 1.41.1
+
+### Fixed
+* `NormalizePath` improved consistency when path needs slashes added _and_ removed.
+
+
+## 3.0.0-alpha.3 - 2020-05-21
+### Added
+* Add option to create `Data<T>` from `Arc<T>` [#1509]
+
+### Changed
+* Resources and Scopes can now access non-overridden data types set on App (or containing scopes) when setting their own data. [#1486]
+* Fix audit issue logging by default peer address [#1485]
+* Bump minimum supported Rust version to 1.40
+* Replace deprecated `net2` crate with `socket2`
+
+[#1485]: https://github.com/actix/actix-web/pull/1485
+[#1509]: https://github.com/actix/actix-web/pull/1509
+
+## [3.0.0-alpha.2] - 2020-05-08
+
+### Changed
+
+* `{Resource,Scope}::default_service(f)` handlers now support app data extraction. [#1452]
+* Implement `std::error::Error` for our custom errors [#1422]
+* NormalizePath middleware now appends trailing / so that routes of form /example/ respond to /example requests. [#1433]
+* Remove the `failure` feature and support.
+
+[#1422]: https://github.com/actix/actix-web/pull/1422
+[#1433]: https://github.com/actix/actix-web/pull/1433
+[#1452]: https://github.com/actix/actix-web/pull/1452
+[#1486]: https://github.com/actix/actix-web/pull/1486
+
+
+## [3.0.0-alpha.1] - 2020-03-11
+
+### Added
+
+* Add helper function for creating routes with `TRACE` method guard `web::trace()`
+* Add convenience functions `test::read_body_json()` and `test::TestRequest::send_request()` for testing.
+
+### Changed
+
+* Use `sha-1` crate instead of unmaintained `sha1` crate
+* Skip empty chunks when returning response from a `Stream` [#1308]
+* Update the `time` dependency to 0.2.7
+* Update `actix-tls` dependency to 2.0.0-alpha.1
+* Update `rustls` dependency to 0.17
+
+[#1308]: https://github.com/actix/actix-web/pull/1308
+
+## [2.0.0] - 2019-12-25
+
+### Changed
+
+* Rename `HttpServer::start()` to `HttpServer::run()`
+
+* Allow to gracefully stop test server via `TestServer::stop()`
+
+* Allow to specify multi-patterns for resources
+
+## [2.0.0-rc] - 2019-12-20
+
+### Changed
+
+* Move `BodyEncoding` to `dev` module #1220
+
+* Allow to set `peer_addr` for TestRequest #1074
+
+* Make web::Data deref to Arc<T> #1214
+
+* Rename `App::register_data()` to `App::app_data()`
+
+* `HttpRequest::app_data<T>()` returns `Option<&T>` instead of `Option<&Data<T>>`
+
+### Fixed
+
+* Fix `AppConfig::secure()` is always false. #1202
+
+
+## [2.0.0-alpha.6] - 2019-12-15
+
+### Fixed
+
+* Fixed compilation with default features off
+
+## [2.0.0-alpha.5] - 2019-12-13
+
+### Added
+
+* Add test server, `test::start()` and `test::start_with()`
+
+## [2.0.0-alpha.4] - 2019-12-08
+
+### Deleted
+
+* Delete HttpServer::run(), it is not useful witht async/await
+
+## [2.0.0-alpha.3] - 2019-12-07
+
+### Changed
+
+* Migrate to tokio 0.2
+
+
+## [2.0.0-alpha.1] - 2019-11-22
+
+### Changed
+
+* Migrated to `std::future`
+
+* Remove implementation of `Responder` for `()`. (#1167)
+
+
+## [1.0.9] - 2019-11-14
+
+### Added
+
+* Add `Payload::into_inner` method and make stored `def::Payload` public. (#1110)
+
+### Changed
+
+* Support `Host` guards when the `Host` header is unset (e.g. HTTP/2 requests) (#1129)
+
+
+## [1.0.8] - 2019-09-25
+
+### Added
+
+* Add `Scope::register_data` and `Resource::register_data` methods, parallel to
+  `App::register_data`.
+
+* Add `middleware::Condition` that conditionally enables another middleware
+
+* Allow to re-construct `ServiceRequest` from `HttpRequest` and `Payload`
+
+* Add `HttpServer::listen_uds` for ability to listen on UDS FD rather than path,
+  which is useful for example with systemd.
+
+### Changed
+
+* Make UrlEncodedError::Overflow more informativve
+
+* Use actix-testing for testing utils
+
+
+## [1.0.7] - 2019-08-29
+
+### Fixed
+
+* Request Extensions leak #1062
+
+
+## [1.0.6] - 2019-08-28
 
 ### Added
 
@@ -8,10 +222,17 @@
 
 * Form immplements Responder, returning a `application/x-www-form-urlencoded` response
 
+* Add `into_inner` to `Data`
+
+* Add `test::TestRequest::set_form()` convenience method to automatically serialize data and set
+  the header in test requests.
+
 ### Changed
 
 * `Query` payload made `pub`. Allows user to pattern-match the payload.
 
+* Enable `rust-tls` feature for client #1045
+
 * Update serde_urlencoded to 0.6.1
 
 * Update url to 2.1

Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-web"
-version = "1.0.5"
+version = "3.0.0"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Actix web is a simple, pragmatic and extremely fast web framework for Rust."
 readme = "README.md"
@@ -11,12 +11,11 @@ documentation = "https://docs.rs/actix-web/"
 categories = ["network-programming", "asynchronous",
               "web-programming::http-server",
               "web-programming::websocket"]
-license = "MIT/Apache-2.0"
+license = "MIT OR Apache-2.0"
-exclude = [".gitignore", ".travis.yml", ".cargo/config", "appveyor.yml"]
 edition = "2018"
 
 [package.metadata.docs.rs]
-features = ["ssl", "brotli", "flate2-zlib", "secure-cookies", "client", "rust-tls", "uds"]
+features = ["openssl", "rustls", "compress", "secure-cookies"]
 
 [badges]
 travis-ci = { repository = "actix/actix-web", branch = "master" }
@@ -31,11 +30,7 @@ members = [
   ".",
   "awc",
   "actix-http",
-  "actix-cors",
   "actix-files",
-  "actix-framed",
-  "actix-session",
-  "actix-identity",
   "actix-multipart",
   "actix-web-actors",
   "actix-web-codegen",
@@ -43,77 +38,78 @@ members = [
 ]
 
 [features]
-default = ["brotli", "flate2-zlib", "client", "fail"]
+default = ["compress"]
 
-# http client
+# content-encoding support
-client = ["awc"]
+compress = ["actix-http/compress", "awc/compress"]
 
-# brotli encoding, requires c compiler
+# sessions feature
-brotli = ["actix-http/brotli"]
-
-# miniz-sys backend for flate2 crate
-flate2-zlib = ["actix-http/flate2-zlib"]
-
-# rust backend for flate2 crate
-flate2-rust = ["actix-http/flate2-rust"]
-
-# sessions feature, session require "ring" crate and c compiler
 secure-cookies = ["actix-http/secure-cookies"]
 
-fail = ["actix-http/fail"]
-
 # openssl
-ssl = ["openssl", "actix-server/ssl", "awc/ssl"]
+openssl = ["actix-tls/openssl", "awc/openssl", "open-ssl"]
 
 # rustls
-rust-tls = ["rustls", "actix-server/rust-tls"]
+rustls = ["actix-tls/rustls", "awc/rustls", "rust-tls"]
 
-# unix domain sockets support
+[[example]]
-uds = ["actix-server/uds"]
+name = "basic"
+required-features = ["compress"]
+
+[[example]]
+name = "uds"
+required-features = ["compress"]
+
+[[test]]
+name = "test_server"
+required-features = ["compress"]
 
 [dependencies]
-actix-codec = "0.1.2"
+actix-codec = "0.3.0"
-actix-service = "0.4.1"
+actix-service = "1.0.6"
-actix-utils = "0.4.4"
+actix-utils = "2.0.0"
-actix-router = "0.1.5"
+actix-router = "0.2.4"
-actix-rt = "0.2.4"
+actix-rt = "1.1.1"
-actix-web-codegen = "0.1.2"
+actix-server = "1.0.0"
-actix-http = "0.2.9"
+actix-testing = "1.0.0"
-actix-server = "0.6.0"
+actix-macros = "0.1.0"
-actix-server-config = "0.1.2"
+actix-threadpool = "0.3.1"
-actix-threadpool = "0.1.1"
+actix-tls = "2.0.0"
-awc = { version = "0.2.2", optional = true }
 
-bytes = "0.4"
+actix-web-codegen = "0.3.0"
-derive_more = "0.15.0"
+actix-http = "2.0.0"
+awc = { version = "2.0.0", default-features = false }
+
+bytes = "0.5.3"
+derive_more = "0.99.2"
 encoding_rs = "0.8"
-futures = "0.1.25"
+futures-channel = { version = "0.3.5", default-features = false }
-hashbrown = "0.5.0"
+futures-core = { version = "0.3.5", default-features = false }
+futures-util = { version = "0.3.5", default-features = false }
+fxhash = "0.2.1"
 log = "0.4"
 mime = "0.3"
-net2 = "0.2.33"
+socket2 = "0.3"
-parking_lot = "0.9"
+pin-project = "0.4.17"
-regex = "1.0"
+regex = "1.3"
 serde = { version = "1.0", features = ["derive"] }
 serde_json = "1.0"
 serde_urlencoded = "0.6.1"
-time = "0.1.42"
+time = { version = "0.2.7", default-features = false, features = ["std"] }
 url = "2.1"
-
+open-ssl = { package = "openssl", version = "0.10", optional = true }
-# ssl support
+rust-tls = { package = "rustls", version = "0.18.0", optional = true }
-openssl = { version="0.10", optional = true }
+tinyvec = { version = "0.3", features = ["alloc"] }
-rustls = { version = "0.15", optional = true }
 
 [dev-dependencies]
-actix = "0.8.3"
+actix = "0.10.0"
-actix-connect = "0.2.2"
+actix-http = { version = "2.0.0-beta.4", features = ["actors"] }
-actix-http-test = "0.2.4"
 rand = "0.7"
-env_logger = "0.6"
+env_logger = "0.7"
 serde_derive = "1.0"
-tokio-timer = "0.2.8"
 brotli2 = "0.3.2"
-flate2 = "1.0.2"
+flate2 = "1.0.13"
+criterion = "0.3"
 
 [profile.release]
 lto = true
@@ -125,8 +121,18 @@ actix-web = { path = "." }
 actix-http = { path = "actix-http" }
 actix-http-test = { path = "test-server" }
 actix-web-codegen = { path = "actix-web-codegen" }
-actix-web-actors = { path = "actix-web-actors" }
-actix-session = { path = "actix-session" }
 actix-files = { path = "actix-files" }
 actix-multipart = { path = "actix-multipart" }
 awc = { path = "awc" }
+
+[[example]]
+name = "client"
+required-features = ["rustls"]
+
+[[bench]]
+name = "server"
+harness = false
+
+[[bench]]
+name = "service"
+harness = false

LICENSE-APACHE

@@ -186,7 +186,7 @@
       same "printed page" as the copyright notice for easier
       identification within third-party archives.
 
-   Copyright 2017-NOW Nikolay Kim
+   Copyright 2017-NOW Actix Team
 
    Licensed under the Apache License, Version 2.0 (the "License");
    you may not use this file except in compliance with the License.

LICENSE-MIT

@@ -1,4 +1,4 @@
-Copyright (c) 2017 Nikolay Kim
+Copyright (c) 2017 Actix Team
 
 Permission is hereby granted, free of charge, to any
 person obtaining a copy of this software and associated

MIGRATION.md

@@ -1,3 +1,97 @@
+## Unreleased
+
+
+## 3.0.0
+
+* Setting a cookie's SameSite property, explicitly, to `SameSite::None` will now
+  result in `SameSite=None` being sent with the response Set-Cookie header.
+  To create a cookie without a SameSite attribute, remove any calls setting same_site.
+
+* actix-http support for Actors messages was moved to actix-http crate and is enabled 
+  with feature `actors`
+* content_length function is removed from actix-http.
+  You can set Content-Length by normally setting the response body or calling no_chunking function. 
+
+* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
+  `u64` instead of a `usize`.
+
+* Code that was using `path.<index>` to access a `web::Path<(A, B, C)>`s elements now needs to use
+  destructuring or `.into_inner()`. For example:
+
+  ```rust
+  // Previously:
+  async fn some_route(path: web::Path<(String, String)>) -> String {
+    format!("Hello, {} {}", path.0, path.1)
+  }
+
+  // Now (this also worked before):
+  async fn some_route(path: web::Path<(String, String)>) -> String {
+    let (first_name, last_name) = path.into_inner();
+    format!("Hello, {} {}", first_name, last_name)
+  }
+  // Or (this wasn't previously supported):
+  async fn some_route(web::Path((first_name, last_name)): web::Path<(String, String)>) -> String {
+    format!("Hello, {} {}", first_name, last_name)
+  }
+  ```
+
+* `middleware::NormalizePath` can now also be configured to trim trailing slashes instead of always keeping one.
+  It will need `middleware::normalize::TrailingSlash` when being constructed with `NormalizePath::new(...)`,
+  or for an easier migration you can replace `wrap(middleware::NormalizePath)` with `wrap(middleware::NormalizePath::default())`.
+
+* `HttpServer::maxconn` is renamed to the more expressive `HttpServer::max_connections`.
+
+* `HttpServer::maxconnrate` is renamed to the more expressive `HttpServer::max_connection_rate`.
+
+
+## 2.0.0
+
+* `HttpServer::start()` renamed to `HttpServer::run()`. It also possible to
+  `.await` on `run` method result, in that case it awaits server exit.
+
+* `App::register_data()` renamed to `App::app_data()` and accepts any type `T: 'static`.
+  Stored data is available via `HttpRequest::app_data()` method at runtime.
+
+* Extractor configuration must be registered with `App::app_data()` instead of `App::data()`
+
+* Sync handlers has been removed. `.to_async()` method has been renamed to `.to()`
+  replace `fn` with `async fn` to convert sync handler to async
+
+* `actix_http_test::TestServer` moved to `actix_web::test` module. To start
+  test server use `test::start()` or `test_start_with_config()` methods
+
+* `ResponseError` trait has been reafctored. `ResponseError::error_response()` renders
+  http response.
+
+* Feature `rust-tls` renamed to `rustls`
+
+  instead of
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["rust-tls"] }
+    ```
+
+  use
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["rustls"] }
+    ```
+
+* Feature `ssl` renamed to `openssl`
+
+  instead of
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["ssl"] }
+    ```
+
+  use
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["openssl"] }
+    ```
+* `Cors` builder now requires that you call `.finish()` to construct the middleware
+
 ## 1.0.1
 
 * Cors middleware has been moved to `actix-cors` crate
@@ -304,7 +398,7 @@
 
 * `actix_web::server` module has been removed. To start http server use `actix_web::HttpServer` type
 
-* StaticFiles and NamedFile has been move to separate create.
+* StaticFiles and NamedFile have been moved to a separate crate.
 
   instead of `use actix_web::fs::StaticFile`
 
@@ -314,7 +408,7 @@
 
   use `use actix_files::NamedFile`
 
-* Multipart has been move to separate create.
+* Multipart has been moved to a separate crate.
 
   instead of `use actix_web::multipart::Multipart`
 

README.md

@@ -1,79 +1,109 @@
-# Actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+<div align="center">
+  <h1>Actix web</h1>
+  <p>
+    <strong>Actix web is a powerful, pragmatic, and extremely fast web framework for Rust</strong>
+  </p>
+  <p>
 
-Actix web is a simple, pragmatic and extremely fast web framework for Rust.
+[![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web)
+[![Documentation](https://docs.rs/actix-web/badge.svg)](https://docs.rs/actix-web)
+[![Version](https://img.shields.io/badge/rustc-1.42+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.42.html)
+![License](https://img.shields.io/crates/l/actix-web.svg)
+<br />
+[![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) 
+[![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) 
+[![Download](https://img.shields.io/crates/d/actix-web.svg)](https://crates.io/crates/actix-web)
+[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
 
-* Supported *HTTP/1.x* and *HTTP/2.0* protocols
+  </p>
+</div>
+
+## Features
+
+* Supports *HTTP/1.x* and *HTTP/2*
 * Streaming and pipelining
 * Keep-alive and slow requests handling
 * Client/server [WebSockets](https://actix.rs/docs/websockets/) support
 * Transparent content compression/decompression (br, gzip, deflate)
-* Configurable [request routing](https://actix.rs/docs/url-dispatch/)
+* Powerful [request routing](https://actix.rs/docs/url-dispatch/)
 * Multipart streams
 * Static assets
-* SSL support with OpenSSL or Rustls
+* SSL support using OpenSSL or Rustls
 * Middlewares ([Logger, Session, CORS, etc](https://actix.rs/docs/middleware/))
-* Includes an asynchronous [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
+* Includes an async [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
 * Supports [Actix actor framework](https://github.com/actix/actix)
+* Runs on stable Rust 1.42+
 
-## Documentation & community resources
+## Documentation
 
-* [User Guide](https://actix.rs/docs/)
+* [Website & User Guide](https://actix.rs)
-* [API Documentation (1.0)](https://docs.rs/actix-web/)
+* [Examples Repository](https://github.com/actix/examples)
-* [API Documentation (0.7)](https://docs.rs/actix-web/0.7.19/actix_web/)
+* [API Documentation](https://docs.rs/actix-web)
-* [Chat on gitter](https://gitter.im/actix/actix)
+* [API Documentation (master branch)](https://actix.rs/actix-web/actix_web)
-* Cargo package: [actix-web](https://crates.io/crates/actix-web)
-* Minimum supported Rust version: 1.36 or later
 
 ## Example
 
-```rust
+Dependencies:
-use actix_web::{web, App, HttpServer, Responder};
 
-fn index(info: web::Path<(u32, String)>) -> impl Responder {
+```toml
-    format!("Hello {}! id:{}", info.1, info.0)
+[dependencies]
+actix-web = "3"
+```
+
+Code:
+
+```rust
+use actix_web::{get, web, App, HttpServer, Responder};
+
+#[get("/{id}/{name}/index.html")]
+async fn index(web::Path((id, name)): web::Path<(u32, String)>) -> impl Responder {
+    format!("Hello {}! id:{}", name, id)
 }
 
-fn main() -> std::io::Result<()> {
+#[actix_web::main]
-    HttpServer::new(
+async fn main() -> std::io::Result<()> {
-        || App::new().service(
+    HttpServer::new(|| App::new().service(index))
-              web::resource("/{id}/{name}/index.html").to(index)))
         .bind("127.0.0.1:8080")?
         .run()
+        .await
 }
 ```
 
 ### More examples
 
-* [Basics](https://github.com/actix/examples/tree/master/basics/)
+* [Basic Setup](https://github.com/actix/examples/tree/master/basics/)
-* [Stateful](https://github.com/actix/examples/tree/master/state/)
+* [Application State](https://github.com/actix/examples/tree/master/state/)
-* [Multipart streams](https://github.com/actix/examples/tree/master/multipart/)
+* [JSON Handling](https://github.com/actix/examples/tree/master/json/)
-* [Simple websocket](https://github.com/actix/examples/tree/master/websocket/)
+* [Multipart Streams](https://github.com/actix/examples/tree/master/multipart/)
-* [Tera](https://github.com/actix/examples/tree/master/template_tera/) /
+* [Diesel Integration](https://github.com/actix/examples/tree/master/diesel/)
-  [Askama](https://github.com/actix/examples/tree/master/template_askama/) templates
+* [r2d2 Integration](https://github.com/actix/examples/tree/master/r2d2/)
-* [Diesel integration](https://github.com/actix/examples/tree/master/diesel/)
+* [Simple WebSocket](https://github.com/actix/examples/tree/master/websocket/)
-* [r2d2](https://github.com/actix/examples/tree/master/r2d2/)
+* [Tera Templates](https://github.com/actix/examples/tree/master/template_tera/)
-* [SSL / HTTP/2.0](https://github.com/actix/examples/tree/master/tls/)
+* [Askama Templates](https://github.com/actix/examples/tree/master/template_askama/)
-* [Tcp/Websocket chat](https://github.com/actix/examples/tree/master/websocket-chat/)
+* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/rustls/)
-* [Json](https://github.com/actix/examples/tree/master/json/)
+* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/openssl/)
+* [WebSocket Chat](https://github.com/actix/examples/tree/master/websocket-chat/)
 
 You may consider checking out
 [this directory](https://github.com/actix/examples/tree/master/) for more examples.
 
 ## Benchmarks
 
-* [TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r18)
+One of the fastest web frameworks available according to the
+[TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r19).
 
 ## License
 
 This project is licensed under either of
 
-* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
+* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or
-* MIT license ([LICENSE-MIT](LICENSE-MIT) or [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
+  [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
+* MIT license ([LICENSE-MIT](LICENSE-MIT) or
+  [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
 
 at your option.
 
 ## Code of Conduct
 
-Contribution to the actix-web crate is organized under the terms of the
+Contribution to the actix-web crate is organized under the terms of the Contributor Covenant, the
-Contributor Covenant, the maintainer of actix-web, @fafhrd91, promises to
+maintainers of Actix web, promises to intervene to uphold that code of conduct.
-intervene to uphold that code of conduct.

actix-cors/CHANGES.md

@@ -1,9 +0,0 @@
-# Changes
-
-## [0.1.1] - unreleased
-
-* Bump `derive_more` crate version to 0.15.0
-
-## [0.1.0] - 2019-06-15
-
-* Move cors middleware to separate crate

actix-cors/Cargo.toml

@@ -1,23 +0,0 @@
-[package]
-name = "actix-cors"
-version = "0.1.0"
-authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
-description = "Cross-origin resource sharing (CORS) for Actix applications."
-readme = "README.md"
-keywords = ["web", "framework"]
-homepage = "https://actix.rs"
-repository = "https://github.com/actix/actix-web.git"
-documentation = "https://docs.rs/actix-cors/"
-license = "MIT/Apache-2.0"
-edition = "2018"
-#workspace = ".."
-
-[lib]
-name = "actix_cors"
-path = "src/lib.rs"
-
-[dependencies]
-actix-web = "1.0.0"
-actix-service = "0.4.0"
-derive_more = "0.15.0"
-futures = "0.1.25"

actix-cors/LICENSE-APACHE

@@ -1 +0,0 @@
-../LICENSE-APACHE

actix-cors/LICENSE-MIT

@@ -1 +0,0 @@
-../LICENSE-MIT

actix-cors/README.md

@@ -1,9 +0,0 @@
-# Identity service for actix web framework [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-identity)](https://crates.io/crates/actix-identity) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
-
-## Documentation & community resources
-
-* [User Guide](https://actix.rs/docs/)
-* [API Documentation](https://docs.rs/actix-cors/)
-* [Chat on gitter](https://gitter.im/actix/actix)
-* Cargo package: [actix-cors](https://crates.io/crates/actix-cors)
-* Minimum supported Rust version: 1.34 or later

actix-files/CHANGES.md

@@ -1,21 +1,55 @@
 # Changes
 
-## [0.1.5] - unreleased
+## [Unreleased] - 2020-xx-xx
+
+## [0.3.0-beta.1] - 2020-07-15
+* Update `v_htmlescape` to 0.10
+* Update `actix-web` and `actix-http` dependencies to beta.1
+
+## [0.3.0-alpha.1] - 2020-05-23
+* Update `actix-web` and `actix-http` dependencies to alpha
+* Fix some typos in the docs
+* Bump minimum supported Rust version to 1.40
+* Support sending Content-Length when Content-Range is specified [#1384]
+
+[#1384]: https://github.com/actix/actix-web/pull/1384
+
+## [0.2.1] - 2019-12-22
+
+* Use the same format for file URLs regardless of platforms
+
+## [0.2.0] - 2019-12-20
+
+* Fix BodyEncoding trait import #1220
+
+## [0.2.0-alpha.1] - 2019-12-07
+
+* Migrate to `std::future`
+
+## [0.1.7] - 2019-11-06
+
+* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
+
+## [0.1.6] - 2019-10-14
+
+* Add option to redirect to a slash-ended path `Files` #1132
+
+## [0.1.5] - 2019-10-08
 
 * Bump up `mime_guess` crate version to 2.0.1
 
 * Bump up `percent-encoding` crate version to 2.1
 
+* Allow user defined request guards for `Files` #1113
+
 ## [0.1.4] - 2019-07-20
 
 * Allow to disable `Content-Disposition` header #686
 
-
 ## [0.1.3] - 2019-06-28
 
 * Do not set `Content-Length` header, let actix-http set it #930
 
-
 ## [0.1.2] - 2019-06-13
 
 * Content-Length is 0 for NamedFile HEAD request #914

actix-files/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-files"
-version = "0.1.4"
+version = "0.3.0"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Static files support for actix web."
 readme = "README.md"
@@ -9,27 +9,28 @@ homepage = "https://actix.rs"
 repository = "https://github.com/actix/actix-web.git"
 documentation = "https://docs.rs/actix-files/"
 categories = ["asynchronous", "web-programming::http-server"]
-license = "MIT/Apache-2.0"
+license = "MIT OR Apache-2.0"
 edition = "2018"
-workspace = ".."
 
 [lib]
 name = "actix_files"
 path = "src/lib.rs"
 
 [dependencies]
-actix-web = { version = "1.0.2", default-features = false }
+actix-web = { version = "3.0.0", default-features = false }
-actix-http = "0.2.9"
+actix-http = "2.0.0"
-actix-service = "0.4.1"
+actix-service = "1.0.6"
 bitflags = "1"
-bytes = "0.4"
+bytes = "0.5.3"
-futures = "0.1.25"
+futures-core = { version = "0.3.5", default-features = false }
-derive_more = "0.15.0"
+futures-util = { version = "0.3.5", default-features = false }
+derive_more = "0.99.2"
 log = "0.4"
 mime = "0.3"
 mime_guess = "2.0.1"
 percent-encoding = "2.1"
-v_htmlescape = "0.4"
+v_htmlescape = "0.10"
 
 [dev-dependencies]
-actix-web = { version = "1.0.2", features=["ssl"] }
+actix-rt = "1.0.0"
+actix-web = { version = "3.0.0", features = ["openssl"] }

actix-files/README.md

@@ -6,4 +6,4 @@
 * [API Documentation](https://docs.rs/actix-files/)
 * [Chat on gitter](https://gitter.im/actix/actix)
 * Cargo package: [actix-files](https://crates.io/crates/actix-files)
-* Minimum supported Rust version: 1.33 or later
+* Minimum supported Rust version: 1.40 or later

actix-files/src/error.rs

@@ -5,6 +5,7 @@ use derive_more::Display;
 #[derive(Display, Debug, PartialEq)]
 pub enum FilesError {
     /// Path is not a directory
+    #[allow(dead_code)]
     #[display(fmt = "Path is not a directory. Unable to serve static files")]
     IsNotDirectory,
 
@@ -35,7 +36,7 @@ pub enum UriSegmentError {
 
 /// Return `BadRequest` for `UriSegmentError`
 impl ResponseError for UriSegmentError {
-    fn error_response(&self) -> HttpResponse {
+    fn status_code(&self) -> StatusCode {
-        HttpResponse::new(StatusCode::BAD_REQUEST)
+        StatusCode::BAD_REQUEST
     }
 }

actix-files/src/named.rs

@@ -8,16 +8,16 @@ use std::time::{SystemTime, UNIX_EPOCH};
 use std::os::unix::fs::MetadataExt;
 
 use bitflags::bitflags;
-use mime;
 use mime_guess::from_path;
 
 use actix_http::body::SizedStream;
+use actix_web::dev::BodyEncoding;
 use actix_web::http::header::{
-    self, ContentDisposition, DispositionParam, DispositionType,
+    self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
 };
-use actix_web::http::{ContentEncoding, Method, StatusCode};
+use actix_web::http::{ContentEncoding, StatusCode};
-use actix_web::middleware::BodyEncoding;
 use actix_web::{Error, HttpMessage, HttpRequest, HttpResponse, Responder};
+use futures_util::future::{ready, Ready};
 
 use crate::range::HttpRange;
 use crate::ChunkedReadFile;
@@ -89,13 +89,22 @@ impl NamedFile {
             };
 
             let ct = from_path(&path).first_or_octet_stream();
-            let disposition_type = match ct.type_() {
+            let disposition = match ct.type_() {
                 mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
                 _ => DispositionType::Attachment,
             };
+            let mut parameters =
+                vec![DispositionParam::Filename(String::from(filename.as_ref()))];
+            if !filename.is_ascii() {
+                parameters.push(DispositionParam::FilenameExt(ExtendedValue {
+                    charset: Charset::Ext(String::from("UTF-8")),
+                    language_tag: None,
+                    value: filename.into_owned().into_bytes(),
+                }))
+            }
             let cd = ContentDisposition {
-                disposition: disposition_type,
+                disposition,
-                parameters: vec![DispositionParam::Filename(filename.into_owned())],
+                parameters,
             };
             (ct, cd)
         };
@@ -246,62 +255,8 @@ impl NamedFile {
     pub(crate) fn last_modified(&self) -> Option<header::HttpDate> {
         self.modified.map(|mtime| mtime.into())
     }
-}
 
-impl Deref for NamedFile {
+    pub fn into_response(self, req: &HttpRequest) -> Result<HttpResponse, Error> {
-    type Target = File;
-
-    fn deref(&self) -> &File {
-        &self.file
-    }
-}
-
-impl DerefMut for NamedFile {
-    fn deref_mut(&mut self) -> &mut File {
-        &mut self.file
-    }
-}
-
-/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
-fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
-    match req.get_header::<header::IfMatch>() {
-        None | Some(header::IfMatch::Any) => true,
-        Some(header::IfMatch::Items(ref items)) => {
-            if let Some(some_etag) = etag {
-                for item in items {
-                    if item.strong_eq(some_etag) {
-                        return true;
-                    }
-                }
-            }
-            false
-        }
-    }
-}
-
-/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
-fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
-    match req.get_header::<header::IfNoneMatch>() {
-        Some(header::IfNoneMatch::Any) => false,
-        Some(header::IfNoneMatch::Items(ref items)) => {
-            if let Some(some_etag) = etag {
-                for item in items {
-                    if item.weak_eq(some_etag) {
-                        return false;
-                    }
-                }
-            }
-            true
-        }
-        None => true,
-    }
-}
-
-impl Responder for NamedFile {
-    type Error = Error;
-    type Future = Result<HttpResponse, Error>;
-
-    fn respond_to(self, req: &HttpRequest) -> Self::Future {
         if self.status_code != StatusCode::OK {
             let mut resp = HttpResponse::build(self.status_code);
             resp.set(header::ContentType(self.content_type.clone()))
@@ -324,16 +279,6 @@ impl Responder for NamedFile {
             return Ok(resp.streaming(reader));
         }
 
-        match *req.method() {
-            Method::HEAD | Method::GET => (),
-            _ => {
-                return Ok(HttpResponse::MethodNotAllowed()
-                    .header(header::CONTENT_TYPE, "text/plain")
-                    .header(header::ALLOW, "GET, HEAD")
-                    .body("This resource only supports GET and HEAD."));
-            }
-        }
-
         let etag = if self.flags.contains(Flags::ETAG) {
             self.etag()
         } else {
@@ -442,9 +387,69 @@ impl Responder for NamedFile {
             fut: None,
             counter: 0,
         };
+
         if offset != 0 || length != self.md.len() {
-            return Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader));
+            resp.status(StatusCode::PARTIAL_CONTENT);
-        };
+        }
+
         Ok(resp.body(SizedStream::new(length, reader)))
     }
 }
+
+impl Deref for NamedFile {
+    type Target = File;
+
+    fn deref(&self) -> &File {
+        &self.file
+    }
+}
+
+impl DerefMut for NamedFile {
+    fn deref_mut(&mut self) -> &mut File {
+        &mut self.file
+    }
+}
+
+/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
+fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
+    match req.get_header::<header::IfMatch>() {
+        None | Some(header::IfMatch::Any) => true,
+        Some(header::IfMatch::Items(ref items)) => {
+            if let Some(some_etag) = etag {
+                for item in items {
+                    if item.strong_eq(some_etag) {
+                        return true;
+                    }
+                }
+            }
+            false
+        }
+    }
+}
+
+/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
+fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
+    match req.get_header::<header::IfNoneMatch>() {
+        Some(header::IfNoneMatch::Any) => false,
+        Some(header::IfNoneMatch::Items(ref items)) => {
+            if let Some(some_etag) = etag {
+                for item in items {
+                    if item.weak_eq(some_etag) {
+                        return false;
+                    }
+                }
+            }
+            true
+        }
+        None => true,
+    }
+}
+
+impl Responder for NamedFile {
+    type Error = Error;
+    type Future = Ready<Result<HttpResponse, Error>>;
+
+    fn respond_to(self, req: &HttpRequest) -> Self::Future {
+        ready(self.into_response(req))
+    }
+}

actix-framed/Cargo.toml

@@ -1,38 +0,0 @@
-[package]
-name = "actix-framed"
-version = "0.2.1"
-authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
-description = "Actix framed app server"
-readme = "README.md"
-keywords = ["http", "web", "framework", "async", "futures"]
-homepage = "https://actix.rs"
-repository = "https://github.com/actix/actix-web.git"
-documentation = "https://docs.rs/actix-framed/"
-categories = ["network-programming", "asynchronous",
-              "web-programming::http-server",
-              "web-programming::websocket"]
-license = "MIT/Apache-2.0"
-edition = "2018"
-workspace =".."
-
-[lib]
-name = "actix_framed"
-path = "src/lib.rs"
-
-[dependencies]
-actix-codec = "0.1.2"
-actix-service = "0.4.1"
-actix-router = "0.1.2"
-actix-rt = "0.2.2"
-actix-http = "0.2.7"
-actix-server-config = "0.1.2"
-
-bytes = "0.4"
-futures = "0.1.25"
-log = "0.4"
-
-[dev-dependencies]
-actix-server = { version = "0.6.0", features=["ssl"] }
-actix-connect = { version = "0.2.0", features=["ssl"] }
-actix-http-test = { version = "0.2.4", features=["ssl"] }
-actix-utils = "0.4.4"

actix-framed/LICENSE-APACHE

@@ -1,201 +0,0 @@
-                                 Apache License
-                           Version 2.0, January 2004
-                        http://www.apache.org/licenses/
-
-   TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
-
-   1. Definitions.
-
-      "License" shall mean the terms and conditions for use, reproduction,
-      and distribution as defined by Sections 1 through 9 of this document.
-
-      "Licensor" shall mean the copyright owner or entity authorized by
-      the copyright owner that is granting the License.
-
-      "Legal Entity" shall mean the union of the acting entity and all
-      other entities that control, are controlled by, or are under common
-      control with that entity. For the purposes of this definition,
-      "control" means (i) the power, direct or indirect, to cause the
-      direction or management of such entity, whether by contract or
-      otherwise, or (ii) ownership of fifty percent (50%) or more of the
-      outstanding shares, or (iii) beneficial ownership of such entity.
-
-      "You" (or "Your") shall mean an individual or Legal Entity
-      exercising permissions granted by this License.
-
-      "Source" form shall mean the preferred form for making modifications,
-      including but not limited to software source code, documentation
-      source, and configuration files.
-
-      "Object" form shall mean any form resulting from mechanical
-      transformation or translation of a Source form, including but
-      not limited to compiled object code, generated documentation,
-      and conversions to other media types.
-
-      "Work" shall mean the work of authorship, whether in Source or
-      Object form, made available under the License, as indicated by a
-      copyright notice that is included in or attached to the work
-      (an example is provided in the Appendix below).
-
-      "Derivative Works" shall mean any work, whether in Source or Object
-      form, that is based on (or derived from) the Work and for which the
-      editorial revisions, annotations, elaborations, or other modifications
-      represent, as a whole, an original work of authorship. For the purposes
-      of this License, Derivative Works shall not include works that remain
-      separable from, or merely link (or bind by name) to the interfaces of,
-      the Work and Derivative Works thereof.
-
-      "Contribution" shall mean any work of authorship, including
-      the original version of the Work and any modifications or additions
-      to that Work or Derivative Works thereof, that is intentionally
-      submitted to Licensor for inclusion in the Work by the copyright owner
-      or by an individual or Legal Entity authorized to submit on behalf of
-      the copyright owner. For the purposes of this definition, "submitted"
-      means any form of electronic, verbal, or written communication sent
-      to the Licensor or its representatives, including but not limited to
-      communication on electronic mailing lists, source code control systems,
-      and issue tracking systems that are managed by, or on behalf of, the
-      Licensor for the purpose of discussing and improving the Work, but
-      excluding communication that is conspicuously marked or otherwise
-      designated in writing by the copyright owner as "Not a Contribution."
-
-      "Contributor" shall mean Licensor and any individual or Legal Entity
-      on behalf of whom a Contribution has been received by Licensor and
-      subsequently incorporated within the Work.
-
-   2. Grant of Copyright License. Subject to the terms and conditions of
-      this License, each Contributor hereby grants to You a perpetual,
-      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
-      copyright license to reproduce, prepare Derivative Works of,
-      publicly display, publicly perform, sublicense, and distribute the
-      Work and such Derivative Works in Source or Object form.
-
-   3. Grant of Patent License. Subject to the terms and conditions of
-      this License, each Contributor hereby grants to You a perpetual,
-      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
-      (except as stated in this section) patent license to make, have made,
-      use, offer to sell, sell, import, and otherwise transfer the Work,
-      where such license applies only to those patent claims licensable
-      by such Contributor that are necessarily infringed by their
-      Contribution(s) alone or by combination of their Contribution(s)
-      with the Work to which such Contribution(s) was submitted. If You
-      institute patent litigation against any entity (including a
-      cross-claim or counterclaim in a lawsuit) alleging that the Work
-      or a Contribution incorporated within the Work constitutes direct
-      or contributory patent infringement, then any patent licenses
-      granted to You under this License for that Work shall terminate
-      as of the date such litigation is filed.
-
-   4. Redistribution. You may reproduce and distribute copies of the
-      Work or Derivative Works thereof in any medium, with or without
-      modifications, and in Source or Object form, provided that You
-      meet the following conditions:
-
-      (a) You must give any other recipients of the Work or
-          Derivative Works a copy of this License; and
-
-      (b) You must cause any modified files to carry prominent notices
-          stating that You changed the files; and
-
-      (c) You must retain, in the Source form of any Derivative Works
-          that You distribute, all copyright, patent, trademark, and
-          attribution notices from the Source form of the Work,
-          excluding those notices that do not pertain to any part of
-          the Derivative Works; and
-
-      (d) If the Work includes a "NOTICE" text file as part of its
-          distribution, then any Derivative Works that You distribute must
-          include a readable copy of the attribution notices contained
-          within such NOTICE file, excluding those notices that do not
-          pertain to any part of the Derivative Works, in at least one
-          of the following places: within a NOTICE text file distributed
-          as part of the Derivative Works; within the Source form or
-          documentation, if provided along with the Derivative Works; or,
-          within a display generated by the Derivative Works, if and
-          wherever such third-party notices normally appear. The contents
-          of the NOTICE file are for informational purposes only and
-          do not modify the License. You may add Your own attribution
-          notices within Derivative Works that You distribute, alongside
-          or as an addendum to the NOTICE text from the Work, provided
-          that such additional attribution notices cannot be construed
-          as modifying the License.
-
-      You may add Your own copyright statement to Your modifications and
-      may provide additional or different license terms and conditions
-      for use, reproduction, or distribution of Your modifications, or
-      for any such Derivative Works as a whole, provided Your use,
-      reproduction, and distribution of the Work otherwise complies with
-      the conditions stated in this License.
-
-   5. Submission of Contributions. Unless You explicitly state otherwise,
-      any Contribution intentionally submitted for inclusion in the Work
-      by You to the Licensor shall be under the terms and conditions of
-      this License, without any additional terms or conditions.
-      Notwithstanding the above, nothing herein shall supersede or modify
-      the terms of any separate license agreement you may have executed
-      with Licensor regarding such Contributions.
-
-   6. Trademarks. This License does not grant permission to use the trade
-      names, trademarks, service marks, or product names of the Licensor,
-      except as required for reasonable and customary use in describing the
-      origin of the Work and reproducing the content of the NOTICE file.
-
-   7. Disclaimer of Warranty. Unless required by applicable law or
-      agreed to in writing, Licensor provides the Work (and each
-      Contributor provides its Contributions) on an "AS IS" BASIS,
-      WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
-      implied, including, without limitation, any warranties or conditions
-      of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
-      PARTICULAR PURPOSE. You are solely responsible for determining the
-      appropriateness of using or redistributing the Work and assume any
-      risks associated with Your exercise of permissions under this License.
-
-   8. Limitation of Liability. In no event and under no legal theory,
-      whether in tort (including negligence), contract, or otherwise,
-      unless required by applicable law (such as deliberate and grossly
-      negligent acts) or agreed to in writing, shall any Contributor be
-      liable to You for damages, including any direct, indirect, special,
-      incidental, or consequential damages of any character arising as a
-      result of this License or out of the use or inability to use the
-      Work (including but not limited to damages for loss of goodwill,
-      work stoppage, computer failure or malfunction, or any and all
-      other commercial damages or losses), even if such Contributor
-      has been advised of the possibility of such damages.
-
-   9. Accepting Warranty or Additional Liability. While redistributing
-      the Work or Derivative Works thereof, You may choose to offer,
-      and charge a fee for, acceptance of support, warranty, indemnity,
-      or other liability obligations and/or rights consistent with this
-      License. However, in accepting such obligations, You may act only
-      on Your own behalf and on Your sole responsibility, not on behalf
-      of any other Contributor, and only if You agree to indemnify,
-      defend, and hold each Contributor harmless for any liability
-      incurred by, or claims asserted against, such Contributor by reason
-      of your accepting any such warranty or additional liability.
-
-   END OF TERMS AND CONDITIONS
-
-   APPENDIX: How to apply the Apache License to your work.
-
-      To apply the Apache License to your work, attach the following
-      boilerplate notice, with the fields enclosed by brackets "{}"
-      replaced with your own identifying information. (Don't include
-      the brackets!)  The text should be enclosed in the appropriate
-      comment syntax for the file format. We also recommend that a
-      file or class name and description of purpose be included on the
-      same "printed page" as the copyright notice for easier
-      identification within third-party archives.
-
-   Copyright 2017-NOW Nikolay Kim
-
-   Licensed under the Apache License, Version 2.0 (the "License");
-   you may not use this file except in compliance with the License.
-   You may obtain a copy of the License at
-
-       http://www.apache.org/licenses/LICENSE-2.0
-
-   Unless required by applicable law or agreed to in writing, software
-   distributed under the License is distributed on an "AS IS" BASIS,
-   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-   See the License for the specific language governing permissions and
-   limitations under the License.

actix-framed/LICENSE-MIT

@@ -1,25 +0,0 @@
-Copyright (c) 2017 Nikolay Kim
-
-Permission is hereby granted, free of charge, to any
-person obtaining a copy of this software and associated
-documentation files (the "Software"), to deal in the
-Software without restriction, including without
-limitation the rights to use, copy, modify, merge,
-publish, distribute, sublicense, and/or sell copies of
-the Software, and to permit persons to whom the Software
-is furnished to do so, subject to the following
-conditions:
-
-The above copyright notice and this permission notice
-shall be included in all copies or substantial portions
-of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF
-ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED
-TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A
-PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT
-SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
-CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
-OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR
-IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
-DEALINGS IN THE SOFTWARE.

actix-framed/README.md

@@ -1,8 +0,0 @@
-# Framed app for actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-framed)](https://crates.io/crates/actix-framed) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
-
-## Documentation & community resources
-
-* [API Documentation](https://docs.rs/actix-framed/)
-* [Chat on gitter](https://gitter.im/actix/actix)
-* Cargo package: [actix-framed](https://crates.io/crates/actix-framed)
-* Minimum supported Rust version: 1.33 or later

actix-framed/changes.md

@@ -1,20 +0,0 @@
-# Changes
-
-## [0.2.1] - 2019-07-20
-
-* Remove unneeded actix-utils dependency
-
-
-## [0.2.0] - 2019-05-12
-
-* Update dependencies
-
-
-## [0.1.0] - 2019-04-16
-
-* Update tests
-
-
-## [0.1.0-alpha.1] - 2019-04-12
-
-* Initial release

actix-framed/src/app.rs

@@ -1,217 +0,0 @@
-use std::rc::Rc;
-
-use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use actix_http::h1::{Codec, SendResponse};
-use actix_http::{Error, Request, Response};
-use actix_router::{Path, Router, Url};
-use actix_server_config::ServerConfig;
-use actix_service::{IntoNewService, NewService, Service};
-use futures::{Async, Future, Poll};
-
-use crate::helpers::{BoxedHttpNewService, BoxedHttpService, HttpNewService};
-use crate::request::FramedRequest;
-use crate::state::State;
-
-type BoxedResponse = Box<dyn Future<Item = (), Error = Error>>;
-
-pub trait HttpServiceFactory {
-    type Factory: NewService;
-
-    fn path(&self) -> &str;
-
-    fn create(self) -> Self::Factory;
-}
-
-/// Application builder
-pub struct FramedApp<T, S = ()> {
-    state: State<S>,
-    services: Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>,
-}
-
-impl<T: 'static> FramedApp<T, ()> {
-    pub fn new() -> Self {
-        FramedApp {
-            state: State::new(()),
-            services: Vec::new(),
-        }
-    }
-}
-
-impl<T: 'static, S: 'static> FramedApp<T, S> {
-    pub fn with(state: S) -> FramedApp<T, S> {
-        FramedApp {
-            services: Vec::new(),
-            state: State::new(state),
-        }
-    }
-
-    pub fn service<U>(mut self, factory: U) -> Self
-    where
-        U: HttpServiceFactory,
-        U::Factory: NewService<
-                Config = (),
-                Request = FramedRequest<T, S>,
-                Response = (),
-                Error = Error,
-                InitError = (),
-            > + 'static,
-        <U::Factory as NewService>::Future: 'static,
-        <U::Factory as NewService>::Service: Service<
-            Request = FramedRequest<T, S>,
-            Response = (),
-            Error = Error,
-            Future = Box<dyn Future<Item = (), Error = Error>>,
-        >,
-    {
-        let path = factory.path().to_string();
-        self.services
-            .push((path, Box::new(HttpNewService::new(factory.create()))));
-        self
-    }
-}
-
-impl<T, S> IntoNewService<FramedAppFactory<T, S>> for FramedApp<T, S>
-where
-    T: AsyncRead + AsyncWrite + 'static,
-    S: 'static,
-{
-    fn into_new_service(self) -> FramedAppFactory<T, S> {
-        FramedAppFactory {
-            state: self.state,
-            services: Rc::new(self.services),
-        }
-    }
-}
-
-#[derive(Clone)]
-pub struct FramedAppFactory<T, S> {
-    state: State<S>,
-    services: Rc<Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>>,
-}
-
-impl<T, S> NewService for FramedAppFactory<T, S>
-where
-    T: AsyncRead + AsyncWrite + 'static,
-    S: 'static,
-{
-    type Config = ServerConfig;
-    type Request = (Request, Framed<T, Codec>);
-    type Response = ();
-    type Error = Error;
-    type InitError = ();
-    type Service = FramedAppService<T, S>;
-    type Future = CreateService<T, S>;
-
-    fn new_service(&self, _: &ServerConfig) -> Self::Future {
-        CreateService {
-            fut: self
-                .services
-                .iter()
-                .map(|(path, service)| {
-                    CreateServiceItem::Future(
-                        Some(path.clone()),
-                        service.new_service(&()),
-                    )
-                })
-                .collect(),
-            state: self.state.clone(),
-        }
-    }
-}
-
-#[doc(hidden)]
-pub struct CreateService<T, S> {
-    fut: Vec<CreateServiceItem<T, S>>,
-    state: State<S>,
-}
-
-enum CreateServiceItem<T, S> {
-    Future(
-        Option<String>,
-        Box<dyn Future<Item = BoxedHttpService<FramedRequest<T, S>>, Error = ()>>,
-    ),
-    Service(String, BoxedHttpService<FramedRequest<T, S>>),
-}
-
-impl<S: 'static, T: 'static> Future for CreateService<T, S>
-where
-    T: AsyncRead + AsyncWrite,
-{
-    type Item = FramedAppService<T, S>;
-    type Error = ();
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        let mut done = true;
-
-        // poll http services
-        for item in &mut self.fut {
-            let res = match item {
-                CreateServiceItem::Future(ref mut path, ref mut fut) => {
-                    match fut.poll()? {
-                        Async::Ready(service) => Some((path.take().unwrap(), service)),
-                        Async::NotReady => {
-                            done = false;
-                            None
-                        }
-                    }
-                }
-                CreateServiceItem::Service(_, _) => continue,
-            };
-
-            if let Some((path, service)) = res {
-                *item = CreateServiceItem::Service(path, service);
-            }
-        }
-
-        if done {
-            let router = self
-                .fut
-                .drain(..)
-                .fold(Router::build(), |mut router, item| {
-                    match item {
-                        CreateServiceItem::Service(path, service) => {
-                            router.path(&path, service);
-                        }
-                        CreateServiceItem::Future(_, _) => unreachable!(),
-                    }
-                    router
-                });
-            Ok(Async::Ready(FramedAppService {
-                router: router.finish(),
-                state: self.state.clone(),
-            }))
-        } else {
-            Ok(Async::NotReady)
-        }
-    }
-}
-
-pub struct FramedAppService<T, S> {
-    state: State<S>,
-    router: Router<BoxedHttpService<FramedRequest<T, S>>>,
-}
-
-impl<S: 'static, T: 'static> Service for FramedAppService<T, S>
-where
-    T: AsyncRead + AsyncWrite,
-{
-    type Request = (Request, Framed<T, Codec>);
-    type Response = ();
-    type Error = Error;
-    type Future = BoxedResponse;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
-    }
-
-    fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
-        let mut path = Path::new(Url::new(req.uri().clone()));
-
-        if let Some((srv, _info)) = self.router.recognize_mut(&mut path) {
-            return srv.call(FramedRequest::new(req, framed, path, self.state.clone()));
-        }
-        Box::new(
-            SendResponse::new(framed, Response::NotFound().finish()).then(|_| Ok(())),
-        )
-    }
-}

actix-framed/src/helpers.rs

@@ -1,90 +0,0 @@
-use actix_http::Error;
-use actix_service::{NewService, Service};
-use futures::{Future, Poll};
-
-pub(crate) type BoxedHttpService<Req> = Box<
-    dyn Service<
-        Request = Req,
-        Response = (),
-        Error = Error,
-        Future = Box<dyn Future<Item = (), Error = Error>>,
-    >,
->;
-
-pub(crate) type BoxedHttpNewService<Req> = Box<
-    dyn NewService<
-        Config = (),
-        Request = Req,
-        Response = (),
-        Error = Error,
-        InitError = (),
-        Service = BoxedHttpService<Req>,
-        Future = Box<dyn Future<Item = BoxedHttpService<Req>, Error = ()>>,
-    >,
->;
-
-pub(crate) struct HttpNewService<T: NewService>(T);
-
-impl<T> HttpNewService<T>
-where
-    T: NewService<Response = (), Error = Error>,
-    T::Response: 'static,
-    T::Future: 'static,
-    T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static,
-    <T::Service as Service>::Future: 'static,
-{
-    pub fn new(service: T) -> Self {
-        HttpNewService(service)
-    }
-}
-
-impl<T> NewService for HttpNewService<T>
-where
-    T: NewService<Config = (), Response = (), Error = Error>,
-    T::Request: 'static,
-    T::Future: 'static,
-    T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static,
-    <T::Service as Service>::Future: 'static,
-{
-    type Config = ();
-    type Request = T::Request;
-    type Response = ();
-    type Error = Error;
-    type InitError = ();
-    type Service = BoxedHttpService<T::Request>;
-    type Future = Box<dyn Future<Item = Self::Service, Error = ()>>;
-
-    fn new_service(&self, _: &()) -> Self::Future {
-        Box::new(self.0.new_service(&()).map_err(|_| ()).and_then(|service| {
-            let service: BoxedHttpService<_> = Box::new(HttpServiceWrapper { service });
-            Ok(service)
-        }))
-    }
-}
-
-struct HttpServiceWrapper<T: Service> {
-    service: T,
-}
-
-impl<T> Service for HttpServiceWrapper<T>
-where
-    T: Service<
-        Response = (),
-        Future = Box<dyn Future<Item = (), Error = Error>>,
-        Error = Error,
-    >,
-    T::Request: 'static,
-{
-    type Request = T::Request;
-    type Response = ();
-    type Error = Error;
-    type Future = Box<dyn Future<Item = (), Error = Error>>;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        self.service.poll_ready()
-    }
-
-    fn call(&mut self, req: Self::Request) -> Self::Future {
-        self.service.call(req)
-    }
-}

actix-framed/src/lib.rs

@@ -1,17 +0,0 @@
-#![allow(clippy::type_complexity, clippy::new_without_default, dead_code)]
-mod app;
-mod helpers;
-mod request;
-mod route;
-mod service;
-mod state;
-pub mod test;
-
-// re-export for convinience
-pub use actix_http::{http, Error, HttpMessage, Response, ResponseError};
-
-pub use self::app::{FramedApp, FramedAppService};
-pub use self::request::FramedRequest;
-pub use self::route::FramedRoute;
-pub use self::service::{SendError, VerifyWebSockets};
-pub use self::state::State;

actix-framed/src/request.rs

@@ -1,170 +0,0 @@
-use std::cell::{Ref, RefMut};
-
-use actix_codec::Framed;
-use actix_http::http::{HeaderMap, Method, Uri, Version};
-use actix_http::{h1::Codec, Extensions, Request, RequestHead};
-use actix_router::{Path, Url};
-
-use crate::state::State;
-
-pub struct FramedRequest<Io, S = ()> {
-    req: Request,
-    framed: Framed<Io, Codec>,
-    state: State<S>,
-    pub(crate) path: Path<Url>,
-}
-
-impl<Io, S> FramedRequest<Io, S> {
-    pub fn new(
-        req: Request,
-        framed: Framed<Io, Codec>,
-        path: Path<Url>,
-        state: State<S>,
-    ) -> Self {
-        Self {
-            req,
-            framed,
-            state,
-            path,
-        }
-    }
-}
-
-impl<Io, S> FramedRequest<Io, S> {
-    /// Split request into a parts
-    pub fn into_parts(self) -> (Request, Framed<Io, Codec>, State<S>) {
-        (self.req, self.framed, self.state)
-    }
-
-    /// This method returns reference to the request head
-    #[inline]
-    pub fn head(&self) -> &RequestHead {
-        self.req.head()
-    }
-
-    /// This method returns muttable reference to the request head.
-    /// panics if multiple references of http request exists.
-    #[inline]
-    pub fn head_mut(&mut self) -> &mut RequestHead {
-        self.req.head_mut()
-    }
-
-    /// Shared application state
-    #[inline]
-    pub fn state(&self) -> &S {
-        self.state.get_ref()
-    }
-
-    /// Request's uri.
-    #[inline]
-    pub fn uri(&self) -> &Uri {
-        &self.head().uri
-    }
-
-    /// Read the Request method.
-    #[inline]
-    pub fn method(&self) -> &Method {
-        &self.head().method
-    }
-
-    /// Read the Request Version.
-    #[inline]
-    pub fn version(&self) -> Version {
-        self.head().version
-    }
-
-    #[inline]
-    /// Returns request's headers.
-    pub fn headers(&self) -> &HeaderMap {
-        &self.head().headers
-    }
-
-    /// The target path of this Request.
-    #[inline]
-    pub fn path(&self) -> &str {
-        self.head().uri.path()
-    }
-
-    /// The query string in the URL.
-    ///
-    /// E.g., id=10
-    #[inline]
-    pub fn query_string(&self) -> &str {
-        if let Some(query) = self.uri().query().as_ref() {
-            query
-        } else {
-            ""
-        }
-    }
-
-    /// Get a reference to the Path parameters.
-    ///
-    /// Params is a container for url parameters.
-    /// A variable segment is specified in the form `{identifier}`,
-    /// where the identifier can be used later in a request handler to
-    /// access the matched value for that segment.
-    #[inline]
-    pub fn match_info(&self) -> &Path<Url> {
-        &self.path
-    }
-
-    /// Request extensions
-    #[inline]
-    pub fn extensions(&self) -> Ref<Extensions> {
-        self.head().extensions()
-    }
-
-    /// Mutable reference to a the request's extensions
-    #[inline]
-    pub fn extensions_mut(&self) -> RefMut<Extensions> {
-        self.head().extensions_mut()
-    }
-}
-
-#[cfg(test)]
-mod tests {
-    use actix_http::http::{HeaderName, HeaderValue, HttpTryFrom};
-    use actix_http::test::{TestBuffer, TestRequest};
-
-    use super::*;
-
-    #[test]
-    fn test_reqest() {
-        let buf = TestBuffer::empty();
-        let framed = Framed::new(buf, Codec::default());
-        let req = TestRequest::with_uri("/index.html?q=1")
-            .header("content-type", "test")
-            .finish();
-        let path = Path::new(Url::new(req.uri().clone()));
-
-        let mut freq = FramedRequest::new(req, framed, path, State::new(10u8));
-        assert_eq!(*freq.state(), 10);
-        assert_eq!(freq.version(), Version::HTTP_11);
-        assert_eq!(freq.method(), Method::GET);
-        assert_eq!(freq.path(), "/index.html");
-        assert_eq!(freq.query_string(), "q=1");
-        assert_eq!(
-            freq.headers()
-                .get("content-type")
-                .unwrap()
-                .to_str()
-                .unwrap(),
-            "test"
-        );
-
-        freq.head_mut().headers.insert(
-            HeaderName::try_from("x-hdr").unwrap(),
-            HeaderValue::from_static("test"),
-        );
-        assert_eq!(
-            freq.headers().get("x-hdr").unwrap().to_str().unwrap(),
-            "test"
-        );
-
-        freq.extensions_mut().insert(100usize);
-        assert_eq!(*freq.extensions().get::<usize>().unwrap(), 100usize);
-
-        let (_, _, state) = freq.into_parts();
-        assert_eq!(*state, 10);
-    }
-}

actix-framed/src/route.rs

@@ -1,157 +0,0 @@
-use std::fmt;
-use std::marker::PhantomData;
-
-use actix_codec::{AsyncRead, AsyncWrite};
-use actix_http::{http::Method, Error};
-use actix_service::{NewService, Service};
-use futures::future::{ok, FutureResult};
-use futures::{Async, Future, IntoFuture, Poll};
-use log::error;
-
-use crate::app::HttpServiceFactory;
-use crate::request::FramedRequest;
-
-/// Resource route definition
-///
-/// Route uses builder-like pattern for configuration.
-/// If handler is not explicitly set, default *404 Not Found* handler is used.
-pub struct FramedRoute<Io, S, F = (), R = ()> {
-    handler: F,
-    pattern: String,
-    methods: Vec<Method>,
-    state: PhantomData<(Io, S, R)>,
-}
-
-impl<Io, S> FramedRoute<Io, S> {
-    pub fn new(pattern: &str) -> Self {
-        FramedRoute {
-            handler: (),
-            pattern: pattern.to_string(),
-            methods: Vec::new(),
-            state: PhantomData,
-        }
-    }
-
-    pub fn get(path: &str) -> FramedRoute<Io, S> {
-        FramedRoute::new(path).method(Method::GET)
-    }
-
-    pub fn post(path: &str) -> FramedRoute<Io, S> {
-        FramedRoute::new(path).method(Method::POST)
-    }
-
-    pub fn put(path: &str) -> FramedRoute<Io, S> {
-        FramedRoute::new(path).method(Method::PUT)
-    }
-
-    pub fn delete(path: &str) -> FramedRoute<Io, S> {
-        FramedRoute::new(path).method(Method::DELETE)
-    }
-
-    pub fn method(mut self, method: Method) -> Self {
-        self.methods.push(method);
-        self
-    }
-
-    pub fn to<F, R>(self, handler: F) -> FramedRoute<Io, S, F, R>
-    where
-        F: FnMut(FramedRequest<Io, S>) -> R,
-        R: IntoFuture<Item = ()>,
-        R::Future: 'static,
-        R::Error: fmt::Debug,
-    {
-        FramedRoute {
-            handler,
-            pattern: self.pattern,
-            methods: self.methods,
-            state: PhantomData,
-        }
-    }
-}
-
-impl<Io, S, F, R> HttpServiceFactory for FramedRoute<Io, S, F, R>
-where
-    Io: AsyncRead + AsyncWrite + 'static,
-    F: FnMut(FramedRequest<Io, S>) -> R + Clone,
-    R: IntoFuture<Item = ()>,
-    R::Future: 'static,
-    R::Error: fmt::Display,
-{
-    type Factory = FramedRouteFactory<Io, S, F, R>;
-
-    fn path(&self) -> &str {
-        &self.pattern
-    }
-
-    fn create(self) -> Self::Factory {
-        FramedRouteFactory {
-            handler: self.handler,
-            methods: self.methods,
-            _t: PhantomData,
-        }
-    }
-}
-
-pub struct FramedRouteFactory<Io, S, F, R> {
-    handler: F,
-    methods: Vec<Method>,
-    _t: PhantomData<(Io, S, R)>,
-}
-
-impl<Io, S, F, R> NewService for FramedRouteFactory<Io, S, F, R>
-where
-    Io: AsyncRead + AsyncWrite + 'static,
-    F: FnMut(FramedRequest<Io, S>) -> R + Clone,
-    R: IntoFuture<Item = ()>,
-    R::Future: 'static,
-    R::Error: fmt::Display,
-{
-    type Config = ();
-    type Request = FramedRequest<Io, S>;
-    type Response = ();
-    type Error = Error;
-    type InitError = ();
-    type Service = FramedRouteService<Io, S, F, R>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
-
-    fn new_service(&self, _: &()) -> Self::Future {
-        ok(FramedRouteService {
-            handler: self.handler.clone(),
-            methods: self.methods.clone(),
-            _t: PhantomData,
-        })
-    }
-}
-
-pub struct FramedRouteService<Io, S, F, R> {
-    handler: F,
-    methods: Vec<Method>,
-    _t: PhantomData<(Io, S, R)>,
-}
-
-impl<Io, S, F, R> Service for FramedRouteService<Io, S, F, R>
-where
-    Io: AsyncRead + AsyncWrite + 'static,
-    F: FnMut(FramedRequest<Io, S>) -> R + Clone,
-    R: IntoFuture<Item = ()>,
-    R::Future: 'static,
-    R::Error: fmt::Display,
-{
-    type Request = FramedRequest<Io, S>;
-    type Response = ();
-    type Error = Error;
-    type Future = Box<dyn Future<Item = (), Error = Error>>;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
-    }
-
-    fn call(&mut self, req: FramedRequest<Io, S>) -> Self::Future {
-        Box::new((self.handler)(req).into_future().then(|res| {
-            if let Err(e) = res {
-                error!("Error in request handler: {}", e);
-            }
-            Ok(())
-        }))
-    }
-}

actix-framed/src/service.rs

@@ -1,149 +0,0 @@
-use std::marker::PhantomData;
-
-use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use actix_http::body::BodySize;
-use actix_http::error::ResponseError;
-use actix_http::h1::{Codec, Message};
-use actix_http::ws::{verify_handshake, HandshakeError};
-use actix_http::{Request, Response};
-use actix_service::{NewService, Service};
-use futures::future::{ok, Either, FutureResult};
-use futures::{Async, Future, IntoFuture, Poll, Sink};
-
-/// Service that verifies incoming request if it is valid websocket
-/// upgrade request. In case of error returns `HandshakeError`
-pub struct VerifyWebSockets<T, C> {
-    _t: PhantomData<(T, C)>,
-}
-
-impl<T, C> Default for VerifyWebSockets<T, C> {
-    fn default() -> Self {
-        VerifyWebSockets { _t: PhantomData }
-    }
-}
-
-impl<T, C> NewService for VerifyWebSockets<T, C> {
-    type Config = C;
-    type Request = (Request, Framed<T, Codec>);
-    type Response = (Request, Framed<T, Codec>);
-    type Error = (HandshakeError, Framed<T, Codec>);
-    type InitError = ();
-    type Service = VerifyWebSockets<T, C>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
-
-    fn new_service(&self, _: &C) -> Self::Future {
-        ok(VerifyWebSockets { _t: PhantomData })
-    }
-}
-
-impl<T, C> Service for VerifyWebSockets<T, C> {
-    type Request = (Request, Framed<T, Codec>);
-    type Response = (Request, Framed<T, Codec>);
-    type Error = (HandshakeError, Framed<T, Codec>);
-    type Future = FutureResult<Self::Response, Self::Error>;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
-    }
-
-    fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
-        match verify_handshake(req.head()) {
-            Err(e) => Err((e, framed)).into_future(),
-            Ok(_) => Ok((req, framed)).into_future(),
-        }
-    }
-}
-
-/// Send http/1 error response
-pub struct SendError<T, R, E, C>(PhantomData<(T, R, E, C)>);
-
-impl<T, R, E, C> Default for SendError<T, R, E, C>
-where
-    T: AsyncRead + AsyncWrite,
-    E: ResponseError,
-{
-    fn default() -> Self {
-        SendError(PhantomData)
-    }
-}
-
-impl<T, R, E, C> NewService for SendError<T, R, E, C>
-where
-    T: AsyncRead + AsyncWrite + 'static,
-    R: 'static,
-    E: ResponseError + 'static,
-{
-    type Config = C;
-    type Request = Result<R, (E, Framed<T, Codec>)>;
-    type Response = R;
-    type Error = (E, Framed<T, Codec>);
-    type InitError = ();
-    type Service = SendError<T, R, E, C>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
-
-    fn new_service(&self, _: &C) -> Self::Future {
-        ok(SendError(PhantomData))
-    }
-}
-
-impl<T, R, E, C> Service for SendError<T, R, E, C>
-where
-    T: AsyncRead + AsyncWrite + 'static,
-    R: 'static,
-    E: ResponseError + 'static,
-{
-    type Request = Result<R, (E, Framed<T, Codec>)>;
-    type Response = R;
-    type Error = (E, Framed<T, Codec>);
-    type Future = Either<FutureResult<R, (E, Framed<T, Codec>)>, SendErrorFut<T, R, E>>;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
-    }
-
-    fn call(&mut self, req: Result<R, (E, Framed<T, Codec>)>) -> Self::Future {
-        match req {
-            Ok(r) => Either::A(ok(r)),
-            Err((e, framed)) => {
-                let res = e.error_response().drop_body();
-                Either::B(SendErrorFut {
-                    framed: Some(framed),
-                    res: Some((res, BodySize::Empty).into()),
-                    err: Some(e),
-                    _t: PhantomData,
-                })
-            }
-        }
-    }
-}
-
-pub struct SendErrorFut<T, R, E> {
-    res: Option<Message<(Response<()>, BodySize)>>,
-    framed: Option<Framed<T, Codec>>,
-    err: Option<E>,
-    _t: PhantomData<R>,
-}
-
-impl<T, R, E> Future for SendErrorFut<T, R, E>
-where
-    E: ResponseError,
-    T: AsyncRead + AsyncWrite,
-{
-    type Item = R;
-    type Error = (E, Framed<T, Codec>);
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        if let Some(res) = self.res.take() {
-            if self.framed.as_mut().unwrap().force_send(res).is_err() {
-                return Err((self.err.take().unwrap(), self.framed.take().unwrap()));
-            }
-        }
-        match self.framed.as_mut().unwrap().poll_complete() {
-            Ok(Async::Ready(_)) => {
-                Err((self.err.take().unwrap(), self.framed.take().unwrap()))
-            }
-            Ok(Async::NotReady) => Ok(Async::NotReady),
-            Err(_) => Err((self.err.take().unwrap(), self.framed.take().unwrap())),
-        }
-    }
-}

actix-framed/src/state.rs

@@ -1,29 +0,0 @@
-use std::ops::Deref;
-use std::sync::Arc;
-
-/// Application state
-pub struct State<S>(Arc<S>);
-
-impl<S> State<S> {
-    pub fn new(state: S) -> State<S> {
-        State(Arc::new(state))
-    }
-
-    pub fn get_ref(&self) -> &S {
-        self.0.as_ref()
-    }
-}
-
-impl<S> Deref for State<S> {
-    type Target = S;
-
-    fn deref(&self) -> &S {
-        self.0.as_ref()
-    }
-}
-
-impl<S> Clone for State<S> {
-    fn clone(&self) -> State<S> {
-        State(self.0.clone())
-    }
-}

actix-framed/src/test.rs

@@ -1,153 +0,0 @@
-//! Various helpers for Actix applications to use during testing.
-use actix_codec::Framed;
-use actix_http::h1::Codec;
-use actix_http::http::header::{Header, HeaderName, IntoHeaderValue};
-use actix_http::http::{HttpTryFrom, Method, Uri, Version};
-use actix_http::test::{TestBuffer, TestRequest as HttpTestRequest};
-use actix_router::{Path, Url};
-use actix_rt::Runtime;
-use futures::IntoFuture;
-
-use crate::{FramedRequest, State};
-
-/// Test `Request` builder.
-pub struct TestRequest<S = ()> {
-    req: HttpTestRequest,
-    path: Path<Url>,
-    state: State<S>,
-}
-
-impl Default for TestRequest<()> {
-    fn default() -> TestRequest {
-        TestRequest {
-            req: HttpTestRequest::default(),
-            path: Path::new(Url::new(Uri::default())),
-            state: State::new(()),
-        }
-    }
-}
-
-impl TestRequest<()> {
-    /// Create TestRequest and set request uri
-    pub fn with_uri(path: &str) -> Self {
-        Self::get().uri(path)
-    }
-
-    /// Create TestRequest and set header
-    pub fn with_hdr<H: Header>(hdr: H) -> Self {
-        Self::default().set(hdr)
-    }
-
-    /// Create TestRequest and set header
-    pub fn with_header<K, V>(key: K, value: V) -> Self
-    where
-        HeaderName: HttpTryFrom<K>,
-        V: IntoHeaderValue,
-    {
-        Self::default().header(key, value)
-    }
-
-    /// Create TestRequest and set method to `Method::GET`
-    pub fn get() -> Self {
-        Self::default().method(Method::GET)
-    }
-
-    /// Create TestRequest and set method to `Method::POST`
-    pub fn post() -> Self {
-        Self::default().method(Method::POST)
-    }
-}
-
-impl<S> TestRequest<S> {
-    /// Create TestRequest and set request uri
-    pub fn with_state(state: S) -> TestRequest<S> {
-        let req = TestRequest::get();
-        TestRequest {
-            state: State::new(state),
-            req: req.req,
-            path: req.path,
-        }
-    }
-
-    /// Set HTTP version of this request
-    pub fn version(mut self, ver: Version) -> Self {
-        self.req.version(ver);
-        self
-    }
-
-    /// Set HTTP method of this request
-    pub fn method(mut self, meth: Method) -> Self {
-        self.req.method(meth);
-        self
-    }
-
-    /// Set HTTP Uri of this request
-    pub fn uri(mut self, path: &str) -> Self {
-        self.req.uri(path);
-        self
-    }
-
-    /// Set a header
-    pub fn set<H: Header>(mut self, hdr: H) -> Self {
-        self.req.set(hdr);
-        self
-    }
-
-    /// Set a header
-    pub fn header<K, V>(mut self, key: K, value: V) -> Self
-    where
-        HeaderName: HttpTryFrom<K>,
-        V: IntoHeaderValue,
-    {
-        self.req.header(key, value);
-        self
-    }
-
-    /// Set request path pattern parameter
-    pub fn param(mut self, name: &'static str, value: &'static str) -> Self {
-        self.path.add_static(name, value);
-        self
-    }
-
-    /// Complete request creation and generate `Request` instance
-    pub fn finish(mut self) -> FramedRequest<TestBuffer, S> {
-        let req = self.req.finish();
-        self.path.get_mut().update(req.uri());
-        let framed = Framed::new(TestBuffer::empty(), Codec::default());
-        FramedRequest::new(req, framed, self.path, self.state)
-    }
-
-    /// This method generates `FramedRequest` instance and executes async handler
-    pub fn run<F, R, I, E>(self, f: F) -> Result<I, E>
-    where
-        F: FnOnce(FramedRequest<TestBuffer, S>) -> R,
-        R: IntoFuture<Item = I, Error = E>,
-    {
-        let mut rt = Runtime::new().unwrap();
-        rt.block_on(f(self.finish()).into_future())
-    }
-}
-
-#[cfg(test)]
-mod tests {
-    use super::*;
-
-    #[test]
-    fn test() {
-        let req = TestRequest::with_uri("/index.html")
-            .header("x-test", "test")
-            .param("test", "123")
-            .finish();
-
-        assert_eq!(*req.state(), ());
-        assert_eq!(req.version(), Version::HTTP_11);
-        assert_eq!(req.method(), Method::GET);
-        assert_eq!(req.path(), "/index.html");
-        assert_eq!(req.query_string(), "");
-        assert_eq!(
-            req.headers().get("x-test").unwrap().to_str().unwrap(),
-            "test"
-        );
-        assert_eq!(&req.match_info()["test"], "123");
-    }
-}

actix-framed/tests/test_server.rs

@@ -1,141 +0,0 @@
-use actix_codec::{AsyncRead, AsyncWrite};
-use actix_http::{body, http::StatusCode, ws, Error, HttpService, Response};
-use actix_http_test::TestServer;
-use actix_service::{IntoNewService, NewService};
-use actix_utils::framed::FramedTransport;
-use bytes::{Bytes, BytesMut};
-use futures::future::{self, ok};
-use futures::{Future, Sink, Stream};
-
-use actix_framed::{FramedApp, FramedRequest, FramedRoute, SendError, VerifyWebSockets};
-
-fn ws_service<T: AsyncRead + AsyncWrite>(
-    req: FramedRequest<T>,
-) -> impl Future<Item = (), Error = Error> {
-    let (req, framed, _) = req.into_parts();
-    let res = ws::handshake(req.head()).unwrap().message_body(());
-
-    framed
-        .send((res, body::BodySize::None).into())
-        .map_err(|_| panic!())
-        .and_then(|framed| {
-            FramedTransport::new(framed.into_framed(ws::Codec::new()), service)
-                .map_err(|_| panic!())
-        })
-}
-
-fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> {
-    let msg = match msg {
-        ws::Frame::Ping(msg) => ws::Message::Pong(msg),
-        ws::Frame::Text(text) => {
-            ws::Message::Text(String::from_utf8_lossy(&text.unwrap()).to_string())
-        }
-        ws::Frame::Binary(bin) => ws::Message::Binary(bin.unwrap().freeze()),
-        ws::Frame::Close(reason) => ws::Message::Close(reason),
-        _ => panic!(),
-    };
-    ok(msg)
-}
-
-#[test]
-fn test_simple() {
-    let mut srv = TestServer::new(|| {
-        HttpService::build()
-            .upgrade(
-                FramedApp::new().service(FramedRoute::get("/index.html").to(ws_service)),
-            )
-            .finish(|_| future::ok::<_, Error>(Response::NotFound()))
-    });
-
-    assert!(srv.ws_at("/test").is_err());
-
-    // client service
-    let framed = srv.ws_at("/index.html").unwrap();
-    let framed = srv
-        .block_on(framed.send(ws::Message::Text("text".to_string())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Binary("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(
-        item,
-        Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
-    );
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Ping("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
-        .unwrap();
-
-    let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(
-        item,
-        Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
-    );
-}
-
-#[test]
-fn test_service() {
-    let mut srv = TestServer::new(|| {
-        actix_http::h1::OneRequest::new().map_err(|_| ()).and_then(
-            VerifyWebSockets::default()
-                .then(SendError::default())
-                .map_err(|_| ())
-                .and_then(
-                    FramedApp::new()
-                        .service(FramedRoute::get("/index.html").to(ws_service))
-                        .into_new_service()
-                        .map_err(|_| ()),
-                ),
-        )
-    });
-
-    // non ws request
-    let res = srv.block_on(srv.get("/index.html").send()).unwrap();
-    assert_eq!(res.status(), StatusCode::BAD_REQUEST);
-
-    // not found
-    assert!(srv.ws_at("/test").is_err());
-
-    // client service
-    let framed = srv.ws_at("/index.html").unwrap();
-    let framed = srv
-        .block_on(framed.send(ws::Message::Text("text".to_string())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Binary("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(
-        item,
-        Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
-    );
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Ping("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
-        .unwrap();
-
-    let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(
-        item,
-        Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
-    );
-}

actix-http/.appveyor.yml

@@ -1,41 +0,0 @@
-environment:
-  global:
-    PROJECT_NAME: actix-http
-  matrix:
-    # Stable channel
-    - TARGET: i686-pc-windows-msvc
-      CHANNEL: stable
-    - TARGET: x86_64-pc-windows-gnu
-      CHANNEL: stable
-    - TARGET: x86_64-pc-windows-msvc
-      CHANNEL: stable
-    # Nightly channel
-    - TARGET: i686-pc-windows-msvc
-      CHANNEL: nightly
-    - TARGET: x86_64-pc-windows-gnu
-      CHANNEL: nightly
-    - TARGET: x86_64-pc-windows-msvc
-      CHANNEL: nightly
-
-# Install Rust and Cargo
-# (Based on from https://github.com/rust-lang/libc/blob/master/appveyor.yml)
-install:
-  - ps: >-
-        If ($Env:TARGET -eq 'x86_64-pc-windows-gnu') {
-           $Env:PATH += ';C:\msys64\mingw64\bin'
-        } ElseIf ($Env:TARGET -eq 'i686-pc-windows-gnu') {
-           $Env:PATH += ';C:\MinGW\bin'
-        }
-  - curl -sSf -o rustup-init.exe https://win.rustup.rs
-  - rustup-init.exe --default-host %TARGET% --default-toolchain %CHANNEL% -y
-  - set PATH=%PATH%;C:\Users\appveyor\.cargo\bin
-  - rustc -Vv
-  - cargo -V
-
-# 'cargo test' takes care of building for us, so disable Appveyor's build stage.
-build: false
-
-# Equivalent to Travis' `script` phase
-test_script:
-  - cargo clean
-  - cargo test

actix-http/CHANGES.md

@@ -1,5 +1,190 @@
 # Changes
 
+## Unreleased - 2020-xx-xx
+
+
+## 2.0.0 - 2020-09-11
+* No significant changes from `2.0.0-beta.4`.
+
+
+## 2.0.0-beta.4 - 2020-09-09
+### Changed
+* Update actix-codec and actix-utils dependencies.
+* Update actix-connect and actix-tls dependencies.
+
+
+## [2.0.0-beta.3] - 2020-08-14
+
+### Fixed
+* Memory leak of `client::pool::ConnectorPoolSupport`. [#1626]
+
+[#1626]: https://github.com/actix/actix-web/pull/1626
+
+
+## [2.0.0-beta.2] - 2020-07-21
+### Fixed
+* Potential UB in h1 decoder using uninitialized memory. [#1614]
+
+### Changed
+* Fix illegal chunked encoding. [#1615]
+
+[#1614]: https://github.com/actix/actix-web/pull/1614
+[#1615]: https://github.com/actix/actix-web/pull/1615
+
+
+## [2.0.0-beta.1] - 2020-07-11
+
+### Changed
+
+* Migrate cookie handling to `cookie` crate. [#1558]
+* Update `sha-1` to 0.9. [#1586]
+* Fix leak in client pool. [#1580]
+* MSRV is now 1.41.1.
+
+[#1558]: https://github.com/actix/actix-web/pull/1558
+[#1586]: https://github.com/actix/actix-web/pull/1586
+[#1580]: https://github.com/actix/actix-web/pull/1580
+
+## [2.0.0-alpha.4] - 2020-05-21
+
+### Changed
+
+* Bump minimum supported Rust version to 1.40
+* content_length function is removed, and you can set Content-Length by calling no_chunking function [#1439]
+* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
+  `u64` instead of a `usize`.
+* Update `base64` dependency to 0.12
+
+### Fixed
+
+* Support parsing of `SameSite=None` [#1503]
+
+[#1439]: https://github.com/actix/actix-web/pull/1439
+[#1503]: https://github.com/actix/actix-web/pull/1503
+
+## [2.0.0-alpha.3] - 2020-05-08
+
+### Fixed
+
+* Correct spelling of ConnectError::Unresolved [#1487]
+* Fix a mistake in the encoding of websocket continuation messages wherein
+  Item::FirstText and Item::FirstBinary are each encoded as the other.
+
+### Changed
+
+* Implement `std::error::Error` for our custom errors [#1422]
+* Remove `failure` support for `ResponseError` since that crate
+  will be deprecated in the near future.
+
+[#1422]: https://github.com/actix/actix-web/pull/1422
+[#1487]: https://github.com/actix/actix-web/pull/1487
+
+## [2.0.0-alpha.2] - 2020-03-07
+
+### Changed
+
+* Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
+
+* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB respectively
+  to improve download speed for awc when downloading large objects. [#1394]
+
+* client::Connector accepts initial_window_size and initial_connection_window_size HTTP2 configuration. [#1394]
+
+* client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
+
+[#1394]: https://github.com/actix/actix-web/pull/1394
+[#1395]: https://github.com/actix/actix-web/pull/1395
+
+## [2.0.0-alpha.1] - 2020-02-27
+
+### Changed
+
+* Update the `time` dependency to 0.2.7.
+* Moved actors messages support from actix crate, enabled with feature `actors`.
+* Breaking change: trait MessageBody requires Unpin and accepting Pin<&mut Self> instead of &mut self in the poll_next().
+* MessageBody is not implemented for &'static [u8] anymore.
+
+### Fixed
+
+* Allow `SameSite=None` cookies to be sent in a response.
+
+## [1.0.1] - 2019-12-20
+
+### Fixed
+
+* Poll upgrade service's readiness from HTTP service handlers
+
+* Replace brotli with brotli2 #1224
+
+## [1.0.0] - 2019-12-13
+
+### Added
+
+* Add websockets continuation frame support
+
+### Changed
+
+* Replace `flate2-xxx` features with `compress`
+
+## [1.0.0-alpha.5] - 2019-12-09
+
+### Fixed
+
+* Check `Upgrade` service readiness before calling it
+
+* Fix buffer remaining capacity calcualtion
+
+### Changed
+
+* Websockets: Ping and Pong should have binary data #1049
+
+## [1.0.0-alpha.4] - 2019-12-08
+
+### Added
+
+* Add impl ResponseBuilder for Error
+
+### Changed
+
+* Use rust based brotli compression library
+
+## [1.0.0-alpha.3] - 2019-12-07
+
+### Changed
+
+* Migrate to tokio 0.2
+
+* Migrate to `std::future`
+
+
+## [0.2.11] - 2019-11-06
+
+### Added
+
+* Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
+
+* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
+
+* Allow to use `std::convert::Infallible` as `actix_http::error::Error`
+
+### Fixed
+
+* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain; charset=utf-8` header #1118
+
+
+## [0.2.10] - 2019-09-11
+
+### Added
+
+* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests with `RequestHead`
+
+### Fixed
+
+* h2 will use error response #1080
+
+* on_connect result isn't added to request extensions for http2 requests #1009
+
+
 ## [0.2.9] - 2019-08-13
 
 ### Changed

actix-http/Cargo.toml

@@ -1,8 +1,8 @@
 [package]
 name = "actix-http"
-version = "0.2.9"
+version = "2.0.0"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
-description = "Actix http primitives"
+description = "Actix HTTP primitives"
 readme = "README.md"
 keywords = ["actix", "http", "framework", "async", "futures"]
 homepage = "https://actix.rs"
@@ -11,12 +11,11 @@ documentation = "https://docs.rs/actix-http/"
 categories = ["network-programming", "asynchronous",
               "web-programming::http-server",
               "web-programming::websocket"]
-license = "MIT/Apache-2.0"
+license = "MIT OR Apache-2.0"
 edition = "2018"
-workspace = ".."
 
 [package.metadata.docs.rs]
-features = ["ssl", "fail", "brotli", "flate2-zlib", "secure-cookies"]
+features = ["openssl", "rustls", "compress", "secure-cookies", "actors"]
 
 [lib]
 name = "actix_http"
@@ -26,85 +25,85 @@ path = "src/lib.rs"
 default = []
 
 # openssl
-ssl = ["openssl", "actix-connect/ssl"]
+openssl = ["actix-tls/openssl", "actix-connect/openssl"]
 
 # rustls support
-rust-tls = ["rustls", "webpki-roots", "actix-connect/rust-tls"]
+rustls = ["actix-tls/rustls", "actix-connect/rustls"]
 
-# brotli encoding, requires c compiler
+# enable compressison support
-brotli = ["brotli2"]
+compress = ["flate2", "brotli2"]
-
-# miniz-sys backend for flate2 crate
-flate2-zlib = ["flate2/miniz-sys"]
-
-# rust backend for flate2 crate
-flate2-rust = ["flate2/rust_backend"]
-
-# failure integration. actix does not use failure anymore
-fail = ["failure"]
 
 # support for secure cookies
-secure-cookies = ["ring"]
+secure-cookies = ["cookie/secure"]
+
+# support for actix Actor messages
+actors = ["actix"]
 
 [dependencies]
-actix-service = "0.4.1"
+actix-service = "1.0.6"
-actix-codec = "0.1.2"
+actix-codec = "0.3.0"
-actix-connect = "0.2.2"
+actix-connect = "2.0.0"
-actix-utils = "0.4.4"
+actix-utils = "2.0.0"
-actix-server-config = "0.1.2"
+actix-rt = "1.0.0"
-actix-threadpool = "0.1.1"
+actix-threadpool = "0.3.1"
+actix-tls = { version = "2.0.0", optional = true }
+actix = { version = "0.10.0", optional = true }
 
-base64 = "0.10"
+base64 = "0.12"
-bitflags = "1.0"
+bitflags = "1.2"
-bytes = "0.4"
+bytes = "0.5.3"
+cookie = { version = "0.14.1", features = ["percent-encode"] }
 copyless = "0.1.4"
-derive_more = "0.15.0"
+derive_more = "0.99.2"
-either = "1.5.2"
+either = "1.5.3"
 encoding_rs = "0.8"
-futures = "0.1.25"
+futures-channel = { version = "0.3.5", default-features = false }
-hashbrown = "0.5.0"
+futures-core = { version = "0.3.5", default-features = false }
-h2 = "0.1.16"
+futures-util = { version = "0.3.5", default-features = false }
-http = "0.1.17"
+fxhash = "0.2.1"
+h2 = "0.2.1"
+http = "0.2.0"
 httparse = "1.3"
-indexmap = "1.0"
+indexmap = "1.3"
-lazy_static = "1.0"
+itoa = "0.4"
+lazy_static = "1.4"
 language-tags = "0.2"
 log = "0.4"
 mime = "0.3"
 percent-encoding = "2.1"
+pin-project = "0.4.17"
 rand = "0.7"
-regex = "1.0"
+regex = "1.3"
 serde = "1.0"
 serde_json = "1.0"
-sha1 = "0.6"
+sha-1 = "0.9"
 slab = "0.4"
 serde_urlencoded = "0.6.1"
-time = "0.1.42"
+time = { version = "0.2.7", default-features = false, features = ["std"] }
-tokio-tcp = "0.1.3"
-tokio-timer = "0.2.8"
-tokio-current-thread = "0.1"
-trust-dns-resolver = { version="0.11.1", default-features = false }
-
-# for secure cookie
-ring = { version = "0.14.6", optional = true }
 
 # compression
 brotli2 = { version="0.3.2", optional = true }
-flate2 = { version="1.0.7", optional = true, default-features = false }
+flate2 = { version = "1.0.13", optional = true }
-
-# optional deps
-failure = { version = "0.1.5", optional = true }
-openssl = { version="0.10", optional = true }
-rustls = { version = "0.15.2", optional = true }
-webpki-roots = { version = "0.16", optional = true }
-chrono = "0.4.6"
 
 [dev-dependencies]
-actix-rt = "0.2.2"
+actix-server = "1.0.1"
-actix-server = { version = "0.6.0", features=["ssl", "rust-tls"] }
+actix-connect = { version = "2.0.0", features = ["openssl"] }
-actix-connect = { version = "0.2.0", features=["ssl"] }
+actix-http-test = { version = "2.0.0", features = ["openssl"] }
-actix-http-test = { version = "0.2.4", features=["ssl"] }
+actix-tls = { version = "2.0.0", features = ["openssl"] }
-env_logger = "0.6"
+criterion = "0.3"
+env_logger = "0.7"
 serde_derive = "1.0"
-openssl = { version="0.10" }
+open-ssl = { version="0.10", package = "openssl" }
-tokio-tcp = "0.1"
+rust-tls = { version="0.18", package = "rustls" }
+
+[[bench]]
+name = "content-length"
+harness = false
+
+[[bench]]
+name = "status-line"
+harness = false
+
+[[bench]]
+name = "uninit-headers"
+harness = false

actix-http/LICENSE-APACHE

@@ -1,201 +0,0 @@
-                                 Apache License
-                           Version 2.0, January 2004
-                        http://www.apache.org/licenses/
-
-   TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
-
-   1. Definitions.
-
-      "License" shall mean the terms and conditions for use, reproduction,
-      and distribution as defined by Sections 1 through 9 of this document.
-
-      "Licensor" shall mean the copyright owner or entity authorized by
-      the copyright owner that is granting the License.
-
-      "Legal Entity" shall mean the union of the acting entity and all
-      other entities that control, are controlled by, or are under common
-      control with that entity. For the purposes of this definition,
-      "control" means (i) the power, direct or indirect, to cause the
-      direction or management of such entity, whether by contract or
-      otherwise, or (ii) ownership of fifty percent (50%) or more of the
-      outstanding shares, or (iii) beneficial ownership of such entity.
-
-      "You" (or "Your") shall mean an individual or Legal Entity
-      exercising permissions granted by this License.
-
-      "Source" form shall mean the preferred form for making modifications,
-      including but not limited to software source code, documentation
-      source, and configuration files.
-
-      "Object" form shall mean any form resulting from mechanical
-      transformation or translation of a Source form, including but
-      not limited to compiled object code, generated documentation,
-      and conversions to other media types.
-
-      "Work" shall mean the work of authorship, whether in Source or
-      Object form, made available under the License, as indicated by a
-      copyright notice that is included in or attached to the work
-      (an example is provided in the Appendix below).
-
-      "Derivative Works" shall mean any work, whether in Source or Object
-      form, that is based on (or derived from) the Work and for which the
-      editorial revisions, annotations, elaborations, or other modifications
-      represent, as a whole, an original work of authorship. For the purposes
-      of this License, Derivative Works shall not include works that remain
-      separable from, or merely link (or bind by name) to the interfaces of,
-      the Work and Derivative Works thereof.
-
-      "Contribution" shall mean any work of authorship, including
-      the original version of the Work and any modifications or additions
-      to that Work or Derivative Works thereof, that is intentionally
-      submitted to Licensor for inclusion in the Work by the copyright owner
-      or by an individual or Legal Entity authorized to submit on behalf of
-      the copyright owner. For the purposes of this definition, "submitted"
-      means any form of electronic, verbal, or written communication sent
-      to the Licensor or its representatives, including but not limited to
-      communication on electronic mailing lists, source code control systems,
-      and issue tracking systems that are managed by, or on behalf of, the
-      Licensor for the purpose of discussing and improving the Work, but
-      excluding communication that is conspicuously marked or otherwise
-      designated in writing by the copyright owner as "Not a Contribution."
-
-      "Contributor" shall mean Licensor and any individual or Legal Entity
-      on behalf of whom a Contribution has been received by Licensor and
-      subsequently incorporated within the Work.
-
-   2. Grant of Copyright License. Subject to the terms and conditions of
-      this License, each Contributor hereby grants to You a perpetual,
-      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
-      copyright license to reproduce, prepare Derivative Works of,
-      publicly display, publicly perform, sublicense, and distribute the
-      Work and such Derivative Works in Source or Object form.
-
-   3. Grant of Patent License. Subject to the terms and conditions of
-      this License, each Contributor hereby grants to You a perpetual,
-      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
-      (except as stated in this section) patent license to make, have made,
-      use, offer to sell, sell, import, and otherwise transfer the Work,
-      where such license applies only to those patent claims licensable
-      by such Contributor that are necessarily infringed by their
-      Contribution(s) alone or by combination of their Contribution(s)
-      with the Work to which such Contribution(s) was submitted. If You
-      institute patent litigation against any entity (including a
-      cross-claim or counterclaim in a lawsuit) alleging that the Work
-      or a Contribution incorporated within the Work constitutes direct
-      or contributory patent infringement, then any patent licenses
-      granted to You under this License for that Work shall terminate
-      as of the date such litigation is filed.
-
-   4. Redistribution. You may reproduce and distribute copies of the
-      Work or Derivative Works thereof in any medium, with or without
-      modifications, and in Source or Object form, provided that You
-      meet the following conditions:
-
-      (a) You must give any other recipients of the Work or
-          Derivative Works a copy of this License; and
-
-      (b) You must cause any modified files to carry prominent notices
-          stating that You changed the files; and
-
-      (c) You must retain, in the Source form of any Derivative Works
-          that You distribute, all copyright, patent, trademark, and
-          attribution notices from the Source form of the Work,
-          excluding those notices that do not pertain to any part of
-          the Derivative Works; and
-
-      (d) If the Work includes a "NOTICE" text file as part of its
-          distribution, then any Derivative Works that You distribute must
-          include a readable copy of the attribution notices contained
-          within such NOTICE file, excluding those notices that do not
-          pertain to any part of the Derivative Works, in at least one
-          of the following places: within a NOTICE text file distributed
-          as part of the Derivative Works; within the Source form or
-          documentation, if provided along with the Derivative Works; or,
-          within a display generated by the Derivative Works, if and
-          wherever such third-party notices normally appear. The contents
-          of the NOTICE file are for informational purposes only and
-          do not modify the License. You may add Your own attribution
-          notices within Derivative Works that You distribute, alongside
-          or as an addendum to the NOTICE text from the Work, provided
-          that such additional attribution notices cannot be construed
-          as modifying the License.
-
-      You may add Your own copyright statement to Your modifications and
-      may provide additional or different license terms and conditions
-      for use, reproduction, or distribution of Your modifications, or
-      for any such Derivative Works as a whole, provided Your use,
-      reproduction, and distribution of the Work otherwise complies with
-      the conditions stated in this License.
-
-   5. Submission of Contributions. Unless You explicitly state otherwise,
-      any Contribution intentionally submitted for inclusion in the Work
-      by You to the Licensor shall be under the terms and conditions of
-      this License, without any additional terms or conditions.
-      Notwithstanding the above, nothing herein shall supersede or modify
-      the terms of any separate license agreement you may have executed
-      with Licensor regarding such Contributions.
-
-   6. Trademarks. This License does not grant permission to use the trade
-      names, trademarks, service marks, or product names of the Licensor,
-      except as required for reasonable and customary use in describing the
-      origin of the Work and reproducing the content of the NOTICE file.
-
-   7. Disclaimer of Warranty. Unless required by applicable law or
-      agreed to in writing, Licensor provides the Work (and each
-      Contributor provides its Contributions) on an "AS IS" BASIS,
-      WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
-      implied, including, without limitation, any warranties or conditions
-      of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
-      PARTICULAR PURPOSE. You are solely responsible for determining the
-      appropriateness of using or redistributing the Work and assume any
-      risks associated with Your exercise of permissions under this License.
-
-   8. Limitation of Liability. In no event and under no legal theory,
-      whether in tort (including negligence), contract, or otherwise,
-      unless required by applicable law (such as deliberate and grossly
-      negligent acts) or agreed to in writing, shall any Contributor be
-      liable to You for damages, including any direct, indirect, special,
-      incidental, or consequential damages of any character arising as a
-      result of this License or out of the use or inability to use the
-      Work (including but not limited to damages for loss of goodwill,
-      work stoppage, computer failure or malfunction, or any and all
-      other commercial damages or losses), even if such Contributor
-      has been advised of the possibility of such damages.
-
-   9. Accepting Warranty or Additional Liability. While redistributing
-      the Work or Derivative Works thereof, You may choose to offer,
-      and charge a fee for, acceptance of support, warranty, indemnity,
-      or other liability obligations and/or rights consistent with this
-      License. However, in accepting such obligations, You may act only
-      on Your own behalf and on Your sole responsibility, not on behalf
-      of any other Contributor, and only if You agree to indemnify,
-      defend, and hold each Contributor harmless for any liability
-      incurred by, or claims asserted against, such Contributor by reason
-      of your accepting any such warranty or additional liability.
-
-   END OF TERMS AND CONDITIONS
-
-   APPENDIX: How to apply the Apache License to your work.
-
-      To apply the Apache License to your work, attach the following
-      boilerplate notice, with the fields enclosed by brackets "{}"
-      replaced with your own identifying information. (Don't include
-      the brackets!)  The text should be enclosed in the appropriate
-      comment syntax for the file format. We also recommend that a
-      file or class name and description of purpose be included on the
-      same "printed page" as the copyright notice for easier
-      identification within third-party archives.
-
-   Copyright 2017-NOW Nikolay Kim
-
-   Licensed under the Apache License, Version 2.0 (the "License");
-   you may not use this file except in compliance with the License.
-   You may obtain a copy of the License at
-
-       http://www.apache.org/licenses/LICENSE-2.0
-
-   Unless required by applicable law or agreed to in writing, software
-   distributed under the License is distributed on an "AS IS" BASIS,
-   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-   See the License for the specific language governing permissions and
-   limitations under the License.

actix-http/LICENSE-APACHE

@@ -0,0 +1 @@
+../LICENSE-APACHE

actix-http/LICENSE-MIT

@@ -1,25 +0,0 @@
-Copyright (c) 2017 Nikolay Kim
-
-Permission is hereby granted, free of charge, to any
-person obtaining a copy of this software and associated
-documentation files (the "Software"), to deal in the
-Software without restriction, including without
-limitation the rights to use, copy, modify, merge,
-publish, distribute, sublicense, and/or sell copies of
-the Software, and to permit persons to whom the Software
-is furnished to do so, subject to the following
-conditions:
-
-The above copyright notice and this permission notice
-shall be included in all copies or substantial portions
-of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF
-ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED
-TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A
-PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT
-SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
-CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
-OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR
-IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
-DEALINGS IN THE SOFTWARE.

actix-http/LICENSE-MIT

@@ -0,0 +1 @@
+../LICENSE-MIT

actix-http/README.md

@@ -8,25 +8,40 @@ Actix http
 * [API Documentation](https://docs.rs/actix-http/)
 * [Chat on gitter](https://gitter.im/actix/actix)
 * Cargo package: [actix-http](https://crates.io/crates/actix-http)
-* Minimum supported Rust version: 1.31 or later
+* Minimum supported Rust version: 1.40 or later
 
 ## Example
 
 ```rust
 // see examples/framed_hello.rs for complete list of used crates.
-extern crate actix_http;
+use std::{env, io};
-use actix_http::{h1, Response, ServiceConfig};
 
-fn main() {
+use actix_http::{HttpService, Response};
-    Server::new().bind("framed_hello", "127.0.0.1:8080", || {
+use actix_server::Server;
-        IntoFramed::new(|| h1::Codec::new(ServiceConfig::default()))	// <- create h1 codec
+use futures::future;
-            .and_then(TakeItem::new().map_err(|_| ()))	                // <- read one request
+use http::header::HeaderValue;
-            .and_then(|(_req, _framed): (_, Framed<_, _>)| {	        // <- send response and close conn
+use log::info;
-                SendResponse::send(_framed, Response::Ok().body("Hello world!"))
+
-                    .map_err(|_| ())
+#[actix_rt::main]
-                    .map(|_| ())
+async fn main() -> io::Result<()> {
+    env::set_var("RUST_LOG", "hello_world=info");
+    env_logger::init();
+
+    Server::build()
+        .bind("hello-world", "127.0.0.1:8080", || {
+            HttpService::build()
+                .client_timeout(1000)
+                .client_disconnect(1000)
+                .finish(|_req| {
+                    info!("{:?}", _req);
+                    let mut res = Response::Ok();
+                    res.header("x-head", HeaderValue::from_static("dummy value!"));
+                    future::ok::<_, ()>(res.body("Hello world!"))
                 })
-    }).unwrap().run();
+                .tcp()
+        })?
+        .run()
+        .await
 }
 ```
 

actix-http/benches/content-length.rs

@@ -0,0 +1,291 @@
+use criterion::{criterion_group, criterion_main, BenchmarkId, Criterion};
+
+use bytes::BytesMut;
+
+// benchmark sending all requests at the same time
+fn bench_write_content_length(c: &mut Criterion) {
+    let mut group = c.benchmark_group("write_content_length");
+
+    let sizes = [
+        0, 1, 11, 83, 101, 653, 1001, 6323, 10001, 56329, 100001, 123456, 98724245,
+        4294967202,
+    ];
+
+    for i in sizes.iter() {
+        group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _original::write_content_length(i, &mut b)
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _new::write_content_length(i, &mut b)
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("itoa", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _itoa::write_content_length(i, &mut b)
+            })
+        });
+    }
+
+    group.finish();
+}
+
+criterion_group!(benches, bench_write_content_length);
+criterion_main!(benches);
+
+mod _itoa {
+    use bytes::{BufMut, BytesMut};
+
+    pub fn write_content_length(n: usize, bytes: &mut BytesMut) {
+        if n == 0 {
+            bytes.put_slice(b"\r\ncontent-length: 0\r\n");
+            return;
+        }
+
+        let mut buf = itoa::Buffer::new();
+
+        bytes.put_slice(b"\r\ncontent-length: ");
+        bytes.put_slice(buf.format(n).as_bytes());
+        bytes.put_slice(b"\r\n");
+    }
+}
+
+mod _new {
+    use bytes::{BufMut, BytesMut};
+
+    const DIGITS_START: u8 = b'0';
+
+    /// NOTE: bytes object has to contain enough space
+    pub fn write_content_length(n: usize, bytes: &mut BytesMut) {
+        if n == 0 {
+            bytes.put_slice(b"\r\ncontent-length: 0\r\n");
+            return;
+        }
+
+        bytes.put_slice(b"\r\ncontent-length: ");
+
+        if n < 10 {
+            bytes.put_u8(DIGITS_START + (n as u8));
+        } else if n < 100 {
+            let n = n as u8;
+
+            let d10 = n / 10;
+            let d1 = n % 10;
+
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else if n < 1000 {
+            let n = n as u16;
+
+            let d100 = (n / 100) as u8;
+            let d10 = ((n / 10) % 10) as u8;
+            let d1 = (n % 10) as u8;
+
+            bytes.put_u8(DIGITS_START + d100);
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else if n < 10_000 {
+            let n = n as u16;
+
+            let d1000 = (n / 1000) as u8;
+            let d100 = ((n / 100) % 10) as u8;
+            let d10 = ((n / 10) % 10) as u8;
+            let d1 = (n % 10) as u8;
+
+            bytes.put_u8(DIGITS_START + d1000);
+            bytes.put_u8(DIGITS_START + d100);
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else if n < 100_000 {
+            let n = n as u32;
+
+            let d10000 = (n / 10000) as u8;
+            let d1000 = ((n / 1000) % 10) as u8;
+            let d100 = ((n / 100) % 10) as u8;
+            let d10 = ((n / 10) % 10) as u8;
+            let d1 = (n % 10) as u8;
+
+            bytes.put_u8(DIGITS_START + d10000);
+            bytes.put_u8(DIGITS_START + d1000);
+            bytes.put_u8(DIGITS_START + d100);
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else if n < 1_000_000 {
+            let n = n as u32;
+
+            let d100000 = (n / 100000) as u8;
+            let d10000 = ((n / 10000) % 10) as u8;
+            let d1000 = ((n / 1000) % 10) as u8;
+            let d100 = ((n / 100) % 10) as u8;
+            let d10 = ((n / 10) % 10) as u8;
+            let d1 = (n % 10) as u8;
+
+            bytes.put_u8(DIGITS_START + d100000);
+            bytes.put_u8(DIGITS_START + d10000);
+            bytes.put_u8(DIGITS_START + d1000);
+            bytes.put_u8(DIGITS_START + d100);
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else {
+            write_usize(n, bytes);
+        }
+
+        bytes.put_slice(b"\r\n");
+    }
+
+    fn write_usize(n: usize, bytes: &mut BytesMut) {
+        let mut n = n;
+
+        // 20 chars is max length of a usize (2^64)
+        // digits will be added to the buffer from lsd to msd
+        let mut buf = BytesMut::with_capacity(20);
+
+        while n > 9 {
+            // "pop" the least-significant digit
+            let lsd = (n % 10) as u8;
+
+            // remove the lsd from n
+            n = n / 10;
+
+            buf.put_u8(DIGITS_START + lsd);
+        }
+
+        // put msd to result buffer
+        bytes.put_u8(DIGITS_START + (n as u8));
+
+        // put, in reverse (msd to lsd), remaining digits to buffer
+        for i in (0..buf.len()).rev() {
+            bytes.put_u8(buf[i]);
+        }
+    }
+}
+
+mod _original {
+    use std::{mem, ptr, slice};
+
+    use bytes::{BufMut, BytesMut};
+
+    const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
+          2021222324252627282930313233343536373839\
+          4041424344454647484950515253545556575859\
+          6061626364656667686970717273747576777879\
+          8081828384858687888990919293949596979899";
+
+    /// NOTE: bytes object has to contain enough space
+    pub fn write_content_length(mut n: usize, bytes: &mut BytesMut) {
+        if n < 10 {
+            let mut buf: [u8; 21] = [
+                b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
+                b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'\r', b'\n',
+            ];
+            buf[18] = (n as u8) + b'0';
+            bytes.put_slice(&buf);
+        } else if n < 100 {
+            let mut buf: [u8; 22] = [
+                b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
+                b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'\r', b'\n',
+            ];
+            let d1 = n << 1;
+            unsafe {
+                ptr::copy_nonoverlapping(
+                    DEC_DIGITS_LUT.as_ptr().add(d1),
+                    buf.as_mut_ptr().offset(18),
+                    2,
+                );
+            }
+            bytes.put_slice(&buf);
+        } else if n < 1000 {
+            let mut buf: [u8; 23] = [
+                b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
+                b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'0', b'\r',
+                b'\n',
+            ];
+            // decode 2 more chars, if > 2 chars
+            let d1 = (n % 100) << 1;
+            n /= 100;
+            unsafe {
+                ptr::copy_nonoverlapping(
+                    DEC_DIGITS_LUT.as_ptr().add(d1),
+                    buf.as_mut_ptr().offset(19),
+                    2,
+                )
+            };
+
+            // decode last 1
+            buf[18] = (n as u8) + b'0';
+
+            bytes.put_slice(&buf);
+        } else {
+            bytes.put_slice(b"\r\ncontent-length: ");
+            convert_usize(n, bytes);
+        }
+    }
+
+    pub(crate) fn convert_usize(mut n: usize, bytes: &mut BytesMut) {
+        let mut curr: isize = 39;
+        let mut buf: [u8; 41] = unsafe { mem::MaybeUninit::uninit().assume_init() };
+        buf[39] = b'\r';
+        buf[40] = b'\n';
+        let buf_ptr = buf.as_mut_ptr();
+        let lut_ptr = DEC_DIGITS_LUT.as_ptr();
+
+        // eagerly decode 4 characters at a time
+        while n >= 10_000 {
+            let rem = (n % 10_000) as isize;
+            n /= 10_000;
+
+            let d1 = (rem / 100) << 1;
+            let d2 = (rem % 100) << 1;
+            curr -= 4;
+            unsafe {
+                ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
+                ptr::copy_nonoverlapping(
+                    lut_ptr.offset(d2),
+                    buf_ptr.offset(curr + 2),
+                    2,
+                );
+            }
+        }
+
+        // if we reach here numbers are <= 9999, so at most 4 chars long
+        let mut n = n as isize; // possibly reduce 64bit math
+
+        // decode 2 more chars, if > 2 chars
+        if n >= 100 {
+            let d1 = (n % 100) << 1;
+            n /= 100;
+            curr -= 2;
+            unsafe {
+                ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
+            }
+        }
+
+        // decode last 1 or 2 chars
+        if n < 10 {
+            curr -= 1;
+            unsafe {
+                *buf_ptr.offset(curr) = (n as u8) + b'0';
+            }
+        } else {
+            let d1 = n << 1;
+            curr -= 2;
+            unsafe {
+                ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
+            }
+        }
+
+        unsafe {
+            bytes.extend_from_slice(slice::from_raw_parts(
+                buf_ptr.offset(curr),
+                41 - curr as usize,
+            ));
+        }
+    }
+}

actix-http/benches/status-line.rs

@@ -0,0 +1,222 @@
+use criterion::{criterion_group, criterion_main, BenchmarkId, Criterion};
+
+use bytes::BytesMut;
+use http::Version;
+
+const CODES: &[u16] = &[201, 303, 404, 515];
+
+fn bench_write_status_line_11(c: &mut Criterion) {
+    let mut group = c.benchmark_group("write_status_line v1.1");
+
+    let version = Version::HTTP_11;
+
+    for i in CODES.iter() {
+        group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _original::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _new::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _naive::write_status_line(version, i, &mut b);
+            })
+        });
+    }
+
+    group.finish();
+}
+
+fn bench_write_status_line_10(c: &mut Criterion) {
+    let mut group = c.benchmark_group("write_status_line v1.0");
+
+    let version = Version::HTTP_10;
+
+    for i in CODES.iter() {
+        group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _original::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _new::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _naive::write_status_line(version, i, &mut b);
+            })
+        });
+    }
+
+    group.finish();
+}
+
+fn bench_write_status_line_09(c: &mut Criterion) {
+    let mut group = c.benchmark_group("write_status_line v0.9");
+
+    let version = Version::HTTP_09;
+
+    for i in CODES.iter() {
+        group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _original::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _new::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _naive::write_status_line(version, i, &mut b);
+            })
+        });
+    }
+
+    group.finish();
+}
+
+criterion_group!(
+    benches,
+    bench_write_status_line_11,
+    bench_write_status_line_10,
+    bench_write_status_line_09
+);
+criterion_main!(benches);
+
+mod _naive {
+    use bytes::{BufMut, BytesMut};
+    use http::Version;
+
+    pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
+        match version {
+            Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
+            Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
+            Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
+            _ => {
+                // other HTTP version handlers do not use this method
+            }
+        }
+
+        bytes.put_slice(n.to_string().as_bytes());
+    }
+}
+
+mod _new {
+    use bytes::{BufMut, BytesMut};
+    use http::Version;
+
+    const DIGITS_START: u8 = b'0';
+
+    pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
+        match version {
+            Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
+            Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
+            Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
+            _ => {
+                // other HTTP version handlers do not use this method
+            }
+        }
+
+        let d100 = (n / 100) as u8;
+        let d10 = ((n / 10) % 10) as u8;
+        let d1 = (n % 10) as u8;
+
+        bytes.put_u8(DIGITS_START + d100);
+        bytes.put_u8(DIGITS_START + d10);
+        bytes.put_u8(DIGITS_START + d1);
+
+        bytes.put_u8(b' ');
+    }
+}
+
+mod _original {
+    use std::ptr;
+
+    use bytes::{BufMut, BytesMut};
+    use http::Version;
+
+    const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
+        2021222324252627282930313233343536373839\
+        4041424344454647484950515253545556575859\
+        6061626364656667686970717273747576777879\
+        8081828384858687888990919293949596979899";
+
+    pub(crate) const STATUS_LINE_BUF_SIZE: usize = 13;
+
+    pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesMut) {
+        let mut buf: [u8; STATUS_LINE_BUF_SIZE] = *b"HTTP/1.1     ";
+
+        match version {
+            Version::HTTP_2 => buf[5] = b'2',
+            Version::HTTP_10 => buf[7] = b'0',
+            Version::HTTP_09 => {
+                buf[5] = b'0';
+                buf[7] = b'9';
+            }
+            _ => (),
+        }
+
+        let mut curr: isize = 12;
+        let buf_ptr = buf.as_mut_ptr();
+        let lut_ptr = DEC_DIGITS_LUT.as_ptr();
+        let four = n > 999;
+
+        // decode 2 more chars, if > 2 chars
+        let d1 = (n % 100) << 1;
+        n /= 100;
+        curr -= 2;
+        unsafe {
+            ptr::copy_nonoverlapping(
+                lut_ptr.offset(d1 as isize),
+                buf_ptr.offset(curr),
+                2,
+            );
+        }
+
+        // decode last 1 or 2 chars
+        if n < 10 {
+            curr -= 1;
+            unsafe {
+                *buf_ptr.offset(curr) = (n as u8) + b'0';
+            }
+        } else {
+            let d1 = n << 1;
+            curr -= 2;
+            unsafe {
+                ptr::copy_nonoverlapping(
+                    lut_ptr.offset(d1 as isize),
+                    buf_ptr.offset(curr),
+                    2,
+                );
+            }
+        }
+
+        bytes.put_slice(&buf);
+        if four {
+            bytes.put_u8(b' ');
+        }
+    }
+}

actix-http/benches/uninit-headers.rs

@@ -0,0 +1,137 @@
+use criterion::{criterion_group, criterion_main, Criterion};
+
+use bytes::BytesMut;
+
+// A Miri run detects UB, seen on this playground:
+// https://play.rust-lang.org/?version=stable&mode=debug&edition=2018&gist=f5d9aa166aa48df8dca05fce2b6c3915
+
+fn bench_header_parsing(c: &mut Criterion) {
+    c.bench_function("Original (Unsound) [short]", |b| {
+        b.iter(|| {
+            let mut buf = BytesMut::from(REQ_SHORT);
+            _original::parse_headers(&mut buf);
+        })
+    });
+
+    c.bench_function("New (safe) [short]", |b| {
+        b.iter(|| {
+            let mut buf = BytesMut::from(REQ_SHORT);
+            _new::parse_headers(&mut buf);
+        })
+    });
+
+    c.bench_function("Original (Unsound) [realistic]", |b| {
+        b.iter(|| {
+            let mut buf = BytesMut::from(REQ);
+            _original::parse_headers(&mut buf);
+        })
+    });
+
+    c.bench_function("New (safe) [realistic]", |b| {
+        b.iter(|| {
+            let mut buf = BytesMut::from(REQ);
+            _new::parse_headers(&mut buf);
+        })
+    });
+}
+
+criterion_group!(benches, bench_header_parsing);
+criterion_main!(benches);
+
+const MAX_HEADERS: usize = 96;
+
+const EMPTY_HEADER_ARRAY: [httparse::Header<'static>; MAX_HEADERS] =
+    [httparse::EMPTY_HEADER; MAX_HEADERS];
+
+#[derive(Clone, Copy)]
+struct HeaderIndex {
+    name: (usize, usize),
+    value: (usize, usize),
+}
+
+const EMPTY_HEADER_INDEX: HeaderIndex = HeaderIndex {
+    name: (0, 0),
+    value: (0, 0),
+};
+
+const EMPTY_HEADER_INDEX_ARRAY: [HeaderIndex; MAX_HEADERS] =
+    [EMPTY_HEADER_INDEX; MAX_HEADERS];
+
+impl HeaderIndex {
+    fn record(
+        bytes: &[u8],
+        headers: &[httparse::Header<'_>],
+        indices: &mut [HeaderIndex],
+    ) {
+        let bytes_ptr = bytes.as_ptr() as usize;
+        for (header, indices) in headers.iter().zip(indices.iter_mut()) {
+            let name_start = header.name.as_ptr() as usize - bytes_ptr;
+            let name_end = name_start + header.name.len();
+            indices.name = (name_start, name_end);
+            let value_start = header.value.as_ptr() as usize - bytes_ptr;
+            let value_end = value_start + header.value.len();
+            indices.value = (value_start, value_end);
+        }
+    }
+}
+
+// test cases taken from:
+// https://github.com/seanmonstar/httparse/blob/master/benches/parse.rs
+
+const REQ_SHORT: &'static [u8] = b"\
+GET / HTTP/1.0\r\n\
+Host: example.com\r\n\
+Cookie: session=60; user_id=1\r\n\r\n";
+
+const REQ: &'static [u8] = b"\
+GET /wp-content/uploads/2010/03/hello-kitty-darth-vader-pink.jpg HTTP/1.1\r\n\
+Host: www.kittyhell.com\r\n\
+User-Agent: Mozilla/5.0 (Macintosh; U; Intel Mac OS X 10.6; ja-JP-mac; rv:1.9.2.3) Gecko/20100401 Firefox/3.6.3 Pathtraq/0.9\r\n\
+Accept: text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8\r\n\
+Accept-Language: ja,en-us;q=0.7,en;q=0.3\r\n\
+Accept-Encoding: gzip,deflate\r\n\
+Accept-Charset: Shift_JIS,utf-8;q=0.7,*;q=0.7\r\n\
+Keep-Alive: 115\r\n\
+Connection: keep-alive\r\n\
+Cookie: wp_ozh_wsa_visits=2; wp_ozh_wsa_visit_lasttime=xxxxxxxxxx; __utma=xxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.x; __utmz=xxxxxxxxx.xxxxxxxxxx.x.x.utmccn=(referral)|utmcsr=reader.livedoor.com|utmcct=/reader/|utmcmd=referral|padding=under256\r\n\r\n";
+
+mod _new {
+    use super::*;
+
+    pub fn parse_headers(src: &mut BytesMut) -> usize {
+        let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
+        let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
+
+        let mut req = httparse::Request::new(&mut parsed);
+        match req.parse(src).unwrap() {
+            httparse::Status::Complete(_len) => {
+                HeaderIndex::record(src, req.headers, &mut headers);
+                req.headers.len()
+            }
+            _ => unreachable!(),
+        }
+    }
+}
+
+mod _original {
+    use super::*;
+
+    use std::mem::MaybeUninit;
+
+    pub fn parse_headers(src: &mut BytesMut) -> usize {
+        let mut headers: [HeaderIndex; MAX_HEADERS] =
+            unsafe { MaybeUninit::uninit().assume_init() };
+
+        let mut parsed: [httparse::Header<'_>; MAX_HEADERS] =
+            unsafe { MaybeUninit::uninit().assume_init() };
+
+        let mut req = httparse::Request::new(&mut parsed);
+        match req.parse(src).unwrap() {
+            httparse::Status::Complete(_len) => {
+                HeaderIndex::record(src, req.headers, &mut headers);
+                req.headers.len()
+            }
+            _ => unreachable!(),
+        }
+    }
+}

actix-http/examples/echo.rs

@@ -1,13 +1,14 @@
 use std::{env, io};
 
-use actix_http::{error::PayloadError, HttpService, Request, Response};
+use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures::{Future, Stream};
+use futures_util::StreamExt;
 use http::header::HeaderValue;
 use log::info;
 
-fn main() -> io::Result<()> {
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
     env::set_var("RUST_LOG", "echo=info");
     env_logger::init();
 
@@ -16,22 +17,21 @@ fn main() -> io::Result<()> {
             HttpService::build()
                 .client_timeout(1000)
                 .client_disconnect(1000)
-                .finish(|mut req: Request| {
+                .finish(|mut req: Request| async move {
-                    req.take_payload()
+                    let mut body = BytesMut::new();
-                        .fold(BytesMut::new(), move |mut body, chunk| {
+                    while let Some(item) = req.payload().next().await {
-                            body.extend_from_slice(&chunk);
+                        body.extend_from_slice(&item?);
-                            Ok::<_, PayloadError>(body)
+                    }
-                        })
+
-                        .and_then(|bytes| {
+                    info!("request body: {:?}", body);
-                            info!("request body: {:?}", bytes);
+                    Ok::<_, Error>(
-                            let mut res = Response::Ok();
+                        Response::Ok()
-                            res.header(
+                            .header("x-head", HeaderValue::from_static("dummy value!"))
-                                "x-head",
+                            .body(body),
-                                HeaderValue::from_static("dummy value!"),
+                    )
-                            );
-                            Ok(res.body(bytes))
-                        })
                 })
+                .tcp()
         })?
         .run()
+        .await
 }

actix-http/examples/echo2.rs

@@ -1,34 +1,33 @@
 use std::{env, io};
 
 use actix_http::http::HeaderValue;
-use actix_http::{error::PayloadError, Error, HttpService, Request, Response};
+use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures::{Future, Stream};
+use futures_util::StreamExt;
 use log::info;
 
-fn handle_request(mut req: Request) -> impl Future<Item = Response, Error = Error> {
+async fn handle_request(mut req: Request) -> Result<Response, Error> {
-    req.take_payload()
+    let mut body = BytesMut::new();
-        .fold(BytesMut::new(), move |mut body, chunk| {
+    while let Some(item) = req.payload().next().await {
-            body.extend_from_slice(&chunk);
+        body.extend_from_slice(&item?)
-            Ok::<_, PayloadError>(body)
-        })
-        .from_err()
-        .and_then(|bytes| {
-            info!("request body: {:?}", bytes);
-            let mut res = Response::Ok();
-            res.header("x-head", HeaderValue::from_static("dummy value!"));
-            Ok(res.body(bytes))
-        })
     }
 
-fn main() -> io::Result<()> {
+    info!("request body: {:?}", body);
+    Ok(Response::Ok()
+        .header("x-head", HeaderValue::from_static("dummy value!"))
+        .body(body))
+}
+
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
     env::set_var("RUST_LOG", "echo=info");
     env_logger::init();
 
     Server::build()
         .bind("echo", "127.0.0.1:8080", || {
-            HttpService::build().finish(|_req: Request| handle_request(_req))
+            HttpService::build().finish(handle_request).tcp()
         })?
         .run()
+        .await
 }

actix-http/examples/hello-world.rs

@@ -2,11 +2,12 @@ use std::{env, io};
 
 use actix_http::{HttpService, Response};
 use actix_server::Server;
-use futures::future;
+use futures_util::future;
 use http::header::HeaderValue;
 use log::info;
 
-fn main() -> io::Result<()> {
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
     env::set_var("RUST_LOG", "hello_world=info");
     env_logger::init();
 
@@ -21,6 +22,8 @@ fn main() -> io::Result<()> {
                     res.header("x-head", HeaderValue::from_static("dummy value!"));
                     future::ok::<_, ()>(res.body("Hello world!"))
                 })
+                .tcp()
         })?
         .run()
+        .await
 }

actix-http/src/body.rs

@@ -1,8 +1,12 @@
 use std::marker::PhantomData;
+use std::pin::Pin;
+use std::task::{Context, Poll};
 use std::{fmt, mem};
 
 use bytes::{Bytes, BytesMut};
-use futures::{Async, Poll, Stream};
+use futures_core::Stream;
+use futures_util::ready;
+use pin_project::pin_project;
 
 use crate::error::Error;
 
@@ -11,20 +15,13 @@ use crate::error::Error;
 pub enum BodySize {
     None,
     Empty,
-    Sized(usize),
+    Sized(u64),
-    Sized64(u64),
     Stream,
 }
 
 impl BodySize {
     pub fn is_eof(&self) -> bool {
-        match self {
+        matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
-            BodySize::None
-            | BodySize::Empty
-            | BodySize::Sized(0)
-            | BodySize::Sized64(0) => true,
-            _ => false,
-        }
     }
 }
 
@@ -32,32 +29,46 @@ impl BodySize {
 pub trait MessageBody {
     fn size(&self) -> BodySize;
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error>;
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>>;
+
+    downcast_get_type_id!();
 }
 
+downcast!(MessageBody);
+
 impl MessageBody for () {
     fn size(&self) -> BodySize {
         BodySize::Empty
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
-        Ok(Async::Ready(None))
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        Poll::Ready(None)
     }
 }
 
-impl<T: MessageBody> MessageBody for Box<T> {
+impl<T: MessageBody + Unpin> MessageBody for Box<T> {
     fn size(&self) -> BodySize {
         self.as_ref().size()
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
-        self.as_mut().poll_next()
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        Pin::new(self.get_mut().as_mut()).poll_next(cx)
     }
 }
 
+#[pin_project(project = ResponseBodyProj)]
 pub enum ResponseBody<B> {
-    Body(B),
+    Body(#[pin] B),
-    Other(Body),
+    Other(#[pin] Body),
 }
 
 impl ResponseBody<Body> {
@@ -93,23 +104,32 @@ impl<B: MessageBody> MessageBody for ResponseBody<B> {
         }
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
-        match self {
+        self: Pin<&mut Self>,
-            ResponseBody::Body(ref mut body) => body.poll_next(),
+        cx: &mut Context<'_>,
-            ResponseBody::Other(ref mut body) => body.poll_next(),
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        match self.project() {
+            ResponseBodyProj::Body(body) => body.poll_next(cx),
+            ResponseBodyProj::Other(body) => body.poll_next(cx),
         }
     }
 }
 
 impl<B: MessageBody> Stream for ResponseBody<B> {
-    type Item = Bytes;
+    type Item = Result<Bytes, Error>;
-    type Error = Error;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
+    fn poll_next(
-        self.poll_next()
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        match self.project() {
+            ResponseBodyProj::Body(body) => body.poll_next(cx),
+            ResponseBodyProj::Other(body) => body.poll_next(cx),
+        }
     }
 }
 
+#[pin_project(project = BodyProj)]
 /// Represents various types of http message body.
 pub enum Body {
     /// Empty response. `Content-Length` header is not set.
@@ -119,17 +139,17 @@ pub enum Body {
     /// Specific response body.
     Bytes(Bytes),
     /// Generic message body.
-    Message(Box<dyn MessageBody>),
+    Message(Box<dyn MessageBody + Unpin>),
 }
 
 impl Body {
     /// Create body from slice (copy)
     pub fn from_slice(s: &[u8]) -> Body {
-        Body::Bytes(Bytes::from(s))
+        Body::Bytes(Bytes::copy_from_slice(s))
     }
 
     /// Create body from generic message body.
-    pub fn from_message<B: MessageBody + 'static>(body: B) -> Body {
+    pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
         Body::Message(Box::new(body))
     }
 }
@@ -139,24 +159,27 @@ impl MessageBody for Body {
         match self {
             Body::None => BodySize::None,
             Body::Empty => BodySize::Empty,
-            Body::Bytes(ref bin) => BodySize::Sized(bin.len()),
+            Body::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
             Body::Message(ref body) => body.size(),
         }
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
-        match self {
+        self: Pin<&mut Self>,
-            Body::None => Ok(Async::Ready(None)),
+        cx: &mut Context<'_>,
-            Body::Empty => Ok(Async::Ready(None)),
+    ) -> Poll<Option<Result<Bytes, Error>>> {
-            Body::Bytes(ref mut bin) => {
+        match self.project() {
+            BodyProj::None => Poll::Ready(None),
+            BodyProj::Empty => Poll::Ready(None),
+            BodyProj::Bytes(ref mut bin) => {
                 let len = bin.len();
                 if len == 0 {
-                    Ok(Async::Ready(None))
+                    Poll::Ready(None)
                 } else {
-                    Ok(Async::Ready(Some(mem::replace(bin, Bytes::new()))))
+                    Poll::Ready(Some(Ok(mem::take(bin))))
                 }
             }
-            Body::Message(ref mut body) => body.poll_next(),
+            BodyProj::Message(ref mut body) => Pin::new(body.as_mut()).poll_next(cx),
         }
     }
 }
@@ -164,14 +187,8 @@ impl MessageBody for Body {
 impl PartialEq for Body {
     fn eq(&self, other: &Body) -> bool {
         match *self {
-            Body::None => match *other {
+            Body::None => matches!(*other, Body::None),
-                Body::None => true,
+            Body::Empty => matches!(*other, Body::Empty),
-                _ => false,
-            },
-            Body::Empty => match *other {
-                Body::Empty => true,
-                _ => false,
-            },
             Body::Bytes(ref b) => match *other {
                 Body::Bytes(ref b2) => b == b2,
                 _ => false,
@@ -182,7 +199,7 @@ impl PartialEq for Body {
 }
 
 impl fmt::Debug for Body {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match *self {
             Body::None => write!(f, "Body::None"),
             Body::Empty => write!(f, "Body::Empty"),
@@ -218,7 +235,7 @@ impl From<String> for Body {
 
 impl<'a> From<&'a String> for Body {
     fn from(s: &'a String) -> Body {
-        Body::Bytes(Bytes::from(AsRef::<[u8]>::as_ref(&s)))
+        Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
     }
 }
 
@@ -234,9 +251,15 @@ impl From<BytesMut> for Body {
     }
 }
 
+impl From<serde_json::Value> for Body {
+    fn from(v: serde_json::Value) -> Body {
+        Body::Bytes(v.to_string().into())
+    }
+}
+
 impl<S> From<SizedStream<S>> for Body
 where
-    S: Stream<Item = Bytes, Error = Error> + 'static,
+    S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
 {
     fn from(s: SizedStream<S>) -> Body {
         Body::from_message(s)
@@ -245,7 +268,7 @@ where
 
 impl<S, E> From<BodyStream<S, E>> for Body
 where
-    S: Stream<Item = Bytes, Error = E> + 'static,
+    S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
     E: Into<Error> + 'static,
 {
     fn from(s: BodyStream<S, E>) -> Body {
@@ -255,94 +278,88 @@ where
 
 impl MessageBody for Bytes {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(mem::replace(self, Bytes::new()))))
+            Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
         }
     }
 }
 
 impl MessageBody for BytesMut {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(
+            Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
-                mem::replace(self, BytesMut::new()).freeze(),
-            )))
         }
     }
 }
 
 impl MessageBody for &'static str {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(Bytes::from_static(
+            Poll::Ready(Some(Ok(Bytes::from_static(
-                mem::replace(self, "").as_ref(),
+                mem::take(self.get_mut()).as_ref(),
             ))))
         }
     }
 }
 
-impl MessageBody for &'static [u8] {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
-    }
-
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        if self.is_empty() {
-            Ok(Async::Ready(None))
-        } else {
-            Ok(Async::Ready(Some(Bytes::from_static(mem::replace(
-                self, b"",
-            )))))
-        }
-    }
-}
-
 impl MessageBody for Vec<u8> {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(Bytes::from(mem::replace(
+            Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
-                self,
-                Vec::new(),
-            )))))
         }
     }
 }
 
 impl MessageBody for String {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(Bytes::from(
+            Poll::Ready(Some(Ok(Bytes::from(
-                mem::replace(self, String::new()).into_bytes(),
+                mem::take(self.get_mut()).into_bytes(),
             ))))
         }
     }
@@ -350,14 +367,16 @@ impl MessageBody for String {
 
 /// Type represent streaming body.
 /// Response does not contain `content-length` header and appropriate transfer encoding is used.
-pub struct BodyStream<S, E> {
+#[pin_project]
+pub struct BodyStream<S: Unpin, E> {
+    #[pin]
     stream: S,
     _t: PhantomData<E>,
 }
 
 impl<S, E> BodyStream<S, E>
 where
-    S: Stream<Item = Bytes, Error = E>,
+    S: Stream<Item = Result<Bytes, E>> + Unpin,
     E: Into<Error>,
 {
     pub fn new(stream: S) -> Self {
@@ -370,28 +389,45 @@ where
 
 impl<S, E> MessageBody for BodyStream<S, E>
 where
-    S: Stream<Item = Bytes, Error = E>,
+    S: Stream<Item = Result<Bytes, E>> + Unpin,
     E: Into<Error>,
 {
     fn size(&self) -> BodySize {
         BodySize::Stream
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    /// Attempts to pull out the next value of the underlying [`Stream`].
-        self.stream.poll().map_err(std::convert::Into::into)
+    ///
+    /// Empty values are skipped to prevent [`BodyStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        let mut stream = self.project().stream;
+        loop {
+            let stream = stream.as_mut();
+            return Poll::Ready(match ready!(stream.poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                opt => opt.map(|res| res.map_err(Into::into)),
+            });
+        }
     }
 }
 
 /// Type represent streaming body. This body implementation should be used
 /// if total size of stream is known. Data get sent as is without using transfer encoding.
-pub struct SizedStream<S> {
+#[pin_project]
+pub struct SizedStream<S: Unpin> {
     size: u64,
+    #[pin]
     stream: S,
 }
 
 impl<S> SizedStream<S>
 where
-    S: Stream<Item = Bytes, Error = Error>,
+    S: Stream<Item = Result<Bytes, Error>> + Unpin,
 {
     pub fn new(size: u64, stream: S) -> Self {
         SizedStream { size, stream }
@@ -400,20 +436,38 @@ where
 
 impl<S> MessageBody for SizedStream<S>
 where
-    S: Stream<Item = Bytes, Error = Error>,
+    S: Stream<Item = Result<Bytes, Error>> + Unpin,
 {
     fn size(&self) -> BodySize {
-        BodySize::Sized64(self.size)
+        BodySize::Sized(self.size as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    /// Attempts to pull out the next value of the underlying [`Stream`].
-        self.stream.poll()
+    ///
+    /// Empty values are skipped to prevent [`SizedStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        let mut stream: Pin<&mut S> = self.project().stream;
+        loop {
+            let stream = stream.as_mut();
+            return Poll::Ready(match ready!(stream.poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                val => val,
+            });
+        }
     }
 }
 
 #[cfg(test)]
 mod tests {
     use super::*;
+    use futures_util::future::poll_fn;
+    use futures_util::pin_mut;
+    use futures_util::stream;
 
     impl Body {
         pub(crate) fn get_ref(&self) -> &[u8] {
@@ -433,21 +487,24 @@ mod tests {
         }
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_static_str() {
+    async fn test_static_str() {
         assert_eq!(Body::from("").size(), BodySize::Sized(0));
         assert_eq!(Body::from("test").size(), BodySize::Sized(4));
         assert_eq!(Body::from("test").get_ref(), b"test");
 
         assert_eq!("test".size(), BodySize::Sized(4));
         assert_eq!(
-            "test".poll_next().unwrap(),
+            poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
-            Async::Ready(Some(Bytes::from("test")))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_static_bytes() {
+    async fn test_static_bytes() {
         assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
         assert_eq!(
@@ -455,86 +512,95 @@ mod tests {
             BodySize::Sized(4)
         );
         assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
+        let sb = Bytes::from(&b"test"[..]);
+        pin_mut!(sb);
 
-        assert_eq!((&b"test"[..]).size(), BodySize::Sized(4));
+        assert_eq!(sb.size(), BodySize::Sized(4));
         assert_eq!(
-            (&b"test"[..]).poll_next().unwrap(),
+            poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Async::Ready(Some(Bytes::from("test")))
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_vec() {
+    async fn test_vec() {
         assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
         assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
+        let test_vec = Vec::from("test");
+        pin_mut!(test_vec);
 
-        assert_eq!(Vec::from("test").size(), BodySize::Sized(4));
+        assert_eq!(test_vec.size(), BodySize::Sized(4));
         assert_eq!(
-            Vec::from("test").poll_next().unwrap(),
+            poll_fn(|cx| test_vec.as_mut().poll_next(cx))
-            Async::Ready(Some(Bytes::from("test")))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_bytes() {
+    async fn test_bytes() {
-        let mut b = Bytes::from("test");
+        let b = Bytes::from("test");
         assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b.clone()).get_ref(), b"test");
+        pin_mut!(b);
 
         assert_eq!(b.size(), BodySize::Sized(4));
         assert_eq!(
-            b.poll_next().unwrap(),
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Async::Ready(Some(Bytes::from("test")))
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_bytes_mut() {
+    async fn test_bytes_mut() {
-        let mut b = BytesMut::from("test");
+        let b = BytesMut::from("test");
         assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b.clone()).get_ref(), b"test");
+        pin_mut!(b);
 
         assert_eq!(b.size(), BodySize::Sized(4));
         assert_eq!(
-            b.poll_next().unwrap(),
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Async::Ready(Some(Bytes::from("test")))
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_string() {
+    async fn test_string() {
-        let mut b = "test".to_owned();
+        let b = "test".to_owned();
         assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b.clone()).get_ref(), b"test");
         assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
         assert_eq!(Body::from(&b).get_ref(), b"test");
+        pin_mut!(b);
 
         assert_eq!(b.size(), BodySize::Sized(4));
         assert_eq!(
-            b.poll_next().unwrap(),
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Async::Ready(Some(Bytes::from("test")))
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_unit() {
+    async fn test_unit() {
         assert_eq!(().size(), BodySize::Empty);
-        assert_eq!(().poll_next().unwrap(), Async::Ready(None));
+        assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
+            .await
+            .is_none());
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_box() {
+    async fn test_box() {
-        let mut val = Box::new(());
+        let val = Box::new(());
+        pin_mut!(val);
         assert_eq!(val.size(), BodySize::Empty);
-        assert_eq!(val.poll_next().unwrap(), Async::Ready(None));
+        assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_body_eq() {
+    async fn test_body_eq() {
-        assert!(Body::None == Body::None);
-        assert!(Body::None != Body::Empty);
-        assert!(Body::Empty == Body::Empty);
-        assert!(Body::Empty != Body::None);
         assert!(
             Body::Bytes(Bytes::from_static(b"1"))
                 == Body::Bytes(Bytes::from_static(b"1"))
@@ -542,10 +608,116 @@ mod tests {
         assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_body_debug() {
+    async fn test_body_debug() {
         assert!(format!("{:?}", Body::None).contains("Body::None"));
         assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
-        assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains("1"));
+        assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
+    }
+
+    #[actix_rt::test]
+    async fn test_serde_json() {
+        use serde_json::json;
+        assert_eq!(
+            Body::from(serde_json::Value::String("test".into())).size(),
+            BodySize::Sized(6)
+        );
+        assert_eq!(
+            Body::from(json!({"test-key":"test-value"})).size(),
+            BodySize::Sized(25)
+        );
+    }
+
+    mod body_stream {
+        use super::*;
+        //use futures::task::noop_waker;
+        //use futures::stream::once;
+
+        #[actix_rt::test]
+        async fn skips_empty_chunks() {
+            let body = BodyStream::new(stream::iter(
+                ["1", "", "2"]
+                    .iter()
+                    .map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
+            ));
+            pin_mut!(body);
+
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("1")),
+            );
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("2")),
+            );
+        }
+
+        /* Now it does not compile as it should
+        #[actix_rt::test]
+        async fn move_pinned_pointer() {
+            let (sender, receiver) = futures::channel::oneshot::channel();
+            let mut body_stream = Ok(BodyStream::new(once(async {
+                let x = Box::new(0i32);
+                let y = &x;
+                receiver.await.unwrap();
+                let _z = **y;
+                Ok::<_, ()>(Bytes::new())
+            })));
+
+            let waker = noop_waker();
+            let mut context = Context::from_waker(&waker);
+            pin_mut!(body_stream);
+
+            let _ = body_stream.as_mut().unwrap().poll_next(&mut context);
+            sender.send(()).unwrap();
+            let _ = std::mem::replace(&mut body_stream, Err([0; 32])).unwrap().poll_next(&mut context);
+        }*/
+    }
+
+    mod sized_stream {
+        use super::*;
+
+        #[actix_rt::test]
+        async fn skips_empty_chunks() {
+            let body = SizedStream::new(
+                2,
+                stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
+            );
+            pin_mut!(body);
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("1")),
+            );
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("2")),
+            );
+        }
+    }
+
+    #[actix_rt::test]
+    async fn test_body_casting() {
+        let mut body = String::from("hello cast");
+        let resp_body: &mut dyn MessageBody = &mut body;
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast");
+        let body = &mut resp_body.downcast_mut::<String>().unwrap();
+        body.push('!');
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast!");
+        let not_body = resp_body.downcast_ref::<()>();
+        assert!(not_body.is_none());
     }
 }

actix-http/src/builder.rs

@@ -1,10 +1,9 @@
-use std::fmt;
 use std::marker::PhantomData;
 use std::rc::Rc;
+use std::{fmt, net};
 
 use actix_codec::Framed;
-use actix_server_config::ServerConfig as SrvConfig;
+use actix_service::{IntoServiceFactory, Service, ServiceFactory};
-use actix_service::{IntoNewService, NewService, Service};
 
 use crate::body::MessageBody;
 use crate::config::{KeepAlive, ServiceConfig};
@@ -24,6 +23,8 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
     keep_alive: KeepAlive,
     client_timeout: u64,
     client_disconnect: u64,
+    secure: bool,
+    local_addr: Option<net::SocketAddr>,
     expect: X,
     upgrade: Option<U>,
     on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
@@ -32,9 +33,10 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
 
 impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler<T>>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S: ServiceFactory<Config = (), Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
+    <S::Service as Service>::Future: 'static,
 {
     /// Create instance of `ServiceConfigBuilder`
     pub fn new() -> Self {
@@ -42,6 +44,8 @@ where
             keep_alive: KeepAlive::Timeout(5),
             client_timeout: 5000,
             client_disconnect: 0,
+            secure: false,
+            local_addr: None,
             expect: ExpectHandler,
             upgrade: None,
             on_connect: None,
@@ -52,19 +56,18 @@ where
 
 impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S: ServiceFactory<Config = (), Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
-    X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+    <S::Service as Service>::Future: 'static,
+    X: ServiceFactory<Config = (), Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<
+    <X::Service as Service>::Future: 'static,
-        Config = SrvConfig,
+    U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
-        Request = (Request, Framed<T, Codec>),
-        Response = (),
-    >,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
+    <U::Service as Service>::Future: 'static,
 {
     /// Set server keep-alive setting.
     ///
@@ -74,6 +77,18 @@ where
         self
     }
 
+    /// Set connection secure state
+    pub fn secure(mut self) -> Self {
+        self.secure = true;
+        self
+    }
+
+    /// Set the local address that this service is bound to.
+    pub fn local_addr(mut self, addr: net::SocketAddr) -> Self {
+        self.local_addr = Some(addr);
+        self
+    }
+
     /// Set server client timeout in milliseconds for first request.
     ///
     /// Defines a timeout for reading client request header. If a client does not transmit
@@ -108,16 +123,19 @@ where
     /// request will be forwarded to main service.
     pub fn expect<F, X1>(self, expect: F) -> HttpServiceBuilder<T, S, X1, U>
     where
-        F: IntoNewService<X1>,
+        F: IntoServiceFactory<X1>,
-        X1: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+        X1: ServiceFactory<Config = (), Request = Request, Response = Request>,
         X1::Error: Into<Error>,
         X1::InitError: fmt::Debug,
+        <X1::Service as Service>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
             client_timeout: self.client_timeout,
             client_disconnect: self.client_disconnect,
-            expect: expect.into_new_service(),
+            secure: self.secure,
+            local_addr: self.local_addr,
+            expect: expect.into_factory(),
             upgrade: self.upgrade,
             on_connect: self.on_connect,
             _t: PhantomData,
@@ -130,21 +148,24 @@ where
     /// and this service get called with original request and framed object.
     pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
     where
-        F: IntoNewService<U1>,
+        F: IntoServiceFactory<U1>,
-        U1: NewService<
+        U1: ServiceFactory<
-            Config = SrvConfig,
+            Config = (),
             Request = (Request, Framed<T, Codec>),
             Response = (),
         >,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
+        <U1::Service as Service>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
             client_timeout: self.client_timeout,
             client_disconnect: self.client_disconnect,
+            secure: self.secure,
+            local_addr: self.local_addr,
             expect: self.expect,
-            upgrade: Some(upgrade.into_new_service()),
+            upgrade: Some(upgrade.into_factory()),
             on_connect: self.on_connect,
             _t: PhantomData,
         }
@@ -164,10 +185,10 @@ where
     }
 
     /// Finish service configuration and create *http service* for HTTP/1 protocol.
-    pub fn h1<F, P, B>(self, service: F) -> H1Service<T, P, S, B, X, U>
+    pub fn h1<F, B>(self, service: F) -> H1Service<T, S, B, X, U>
     where
-        B: MessageBody + 'static,
+        B: MessageBody,
-        F: IntoNewService<S>,
+        F: IntoServiceFactory<S>,
         S::Error: Into<Error>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
@@ -176,47 +197,53 @@ where
             self.keep_alive,
             self.client_timeout,
             self.client_disconnect,
+            self.secure,
+            self.local_addr,
         );
-        H1Service::with_config(cfg, service.into_new_service())
+        H1Service::with_config(cfg, service.into_factory())
             .expect(self.expect)
             .upgrade(self.upgrade)
             .on_connect(self.on_connect)
     }
 
     /// Finish service configuration and create *http service* for HTTP/2 protocol.
-    pub fn h2<F, P, B>(self, service: F) -> H2Service<T, P, S, B>
+    pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
     where
         B: MessageBody + 'static,
-        F: IntoNewService<S>,
+        F: IntoServiceFactory<S>,
-        S::Error: Into<Error>,
+        S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
-        S::Response: Into<Response<B>>,
+        S::Response: Into<Response<B>> + 'static,
         <S::Service as Service>::Future: 'static,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,
             self.client_timeout,
             self.client_disconnect,
+            self.secure,
+            self.local_addr,
         );
-        H2Service::with_config(cfg, service.into_new_service())
+        H2Service::with_config(cfg, service.into_factory()).on_connect(self.on_connect)
     }
 
     /// Finish service configuration and create `HttpService` instance.
-    pub fn finish<F, P, B>(self, service: F) -> HttpService<T, P, S, B, X, U>
+    pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
     where
         B: MessageBody + 'static,
-        F: IntoNewService<S>,
+        F: IntoServiceFactory<S>,
-        S::Error: Into<Error>,
+        S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
-        S::Response: Into<Response<B>>,
+        S::Response: Into<Response<B>> + 'static,
         <S::Service as Service>::Future: 'static,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,
             self.client_timeout,
             self.client_disconnect,
+            self.secure,
+            self.local_addr,
         );
-        HttpService::with_config(cfg, service.into_new_service())
+        HttpService::with_config(cfg, service.into_factory())
             .expect(self.expect)
             .upgrade(self.upgrade)
             .on_connect(self.on_connect)

actix-http/src/client/config.rs

@@ -0,0 +1,39 @@
+use std::time::Duration;
+
+// These values are taken from hyper/src/proto/h2/client.rs
+const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2mb
+const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1mb
+
+/// Connector configuration
+#[derive(Clone)]
+pub(crate) struct ConnectorConfig {
+    pub(crate) timeout: Duration,
+    pub(crate) conn_lifetime: Duration,
+    pub(crate) conn_keep_alive: Duration,
+    pub(crate) disconnect_timeout: Option<Duration>,
+    pub(crate) limit: usize,
+    pub(crate) conn_window_size: u32,
+    pub(crate) stream_window_size: u32,
+}
+
+impl Default for ConnectorConfig {
+    fn default() -> Self {
+        Self {
+            timeout: Duration::from_secs(1),
+            conn_lifetime: Duration::from_secs(75),
+            conn_keep_alive: Duration::from_secs(15),
+            disconnect_timeout: Some(Duration::from_millis(3000)),
+            limit: 100,
+            conn_window_size: DEFAULT_H2_CONN_WINDOW,
+            stream_window_size: DEFAULT_H2_STREAM_WINDOW,
+        }
+    }
+}
+
+impl ConnectorConfig {
+    pub(crate) fn no_disconnect_timeout(&self) -> Self {
+        let mut res = self.clone();
+        res.disconnect_timeout = None;
+        res
+    }
+}

actix-http/src/client/connection.rs

@@ -1,14 +1,17 @@
-use std::{fmt, io, time};
+use std::future::Future;
+use std::pin::Pin;
+use std::task::{Context, Poll};
+use std::{fmt, io, mem, time};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use bytes::{Buf, Bytes};
-use futures::future::{err, Either, Future, FutureResult};
+use futures_util::future::{err, Either, FutureExt, LocalBoxFuture, Ready};
-use futures::Poll;
 use h2::client::SendRequest;
+use pin_project::pin_project;
 
 use crate::body::MessageBody;
 use crate::h1::ClientCodec;
-use crate::message::{RequestHead, ResponseHead};
+use crate::message::{RequestHeadType, ResponseHead};
 use crate::payload::Payload;
 
 use super::error::SendRequestError;
@@ -21,33 +24,32 @@ pub(crate) enum ConnectionType<Io> {
 }
 
 pub trait Connection {
-    type Io: AsyncRead + AsyncWrite;
+    type Io: AsyncRead + AsyncWrite + Unpin;
-    type Future: Future<Item = (ResponseHead, Payload), Error = SendRequestError>;
+    type Future: Future<Output = Result<(ResponseHead, Payload), SendRequestError>>;
 
     fn protocol(&self) -> Protocol;
 
     /// Send request and body
-    fn send_request<B: MessageBody + 'static>(
+    fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
         self,
-        head: RequestHead,
+        head: H,
         body: B,
     ) -> Self::Future;
 
     type TunnelFuture: Future<
-        Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
+        Output = Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
-        Error = SendRequestError,
     >;
 
     /// Send request, returns Response and Framed
-    fn open_tunnel(self, head: RequestHead) -> Self::TunnelFuture;
+    fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture;
 }
 
 pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
     /// Close connection
-    fn close(&mut self);
+    fn close(self: Pin<&mut Self>);
 
     /// Release connection to the connection pool
-    fn release(&mut self);
+    fn release(self: Pin<&mut Self>);
 }
 
 #[doc(hidden)]
@@ -62,7 +64,7 @@ impl<T> fmt::Debug for IoConnection<T>
 where
     T: fmt::Debug,
 {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match self.io {
             Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
             Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
@@ -71,7 +73,7 @@ where
     }
 }
 
-impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
+impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
     pub(crate) fn new(
         io: ConnectionType<T>,
         created: time::Instant,
@@ -91,11 +93,11 @@ impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
 
 impl<T> Connection for IoConnection<T>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     type Io = T;
     type Future =
-        Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
+        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
 
     fn protocol(&self) -> Protocol {
         match self.io {
@@ -105,44 +107,36 @@ where
         }
     }
 
-    fn send_request<B: MessageBody + 'static>(
+    fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
         mut self,
-        head: RequestHead,
+        head: H,
         body: B,
     ) -> Self::Future {
         match self.io.take().unwrap() {
-            ConnectionType::H1(io) => Box::new(h1proto::send_request(
+            ConnectionType::H1(io) => {
-                io,
+                h1proto::send_request(io, head.into(), body, self.created, self.pool)
-                head,
+                    .boxed_local()
-                body,
+            }
-                self.created,
+            ConnectionType::H2(io) => {
-                self.pool,
+                h2proto::send_request(io, head.into(), body, self.created, self.pool)
-            )),
+                    .boxed_local()
-            ConnectionType::H2(io) => Box::new(h2proto::send_request(
+            }
-                io,
-                head,
-                body,
-                self.created,
-                self.pool,
-            )),
         }
     }
 
     type TunnelFuture = Either<
-        Box<
+        LocalBoxFuture<
-            dyn Future<
+            'static,
-                Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
+            Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
-                Error = SendRequestError,
         >,
-        >,
+        Ready<Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>>,
-        FutureResult<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
     >;
 
     /// Send request, returns Response and Framed
-    fn open_tunnel(mut self, head: RequestHead) -> Self::TunnelFuture {
+    fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
         match self.io.take().unwrap() {
             ConnectionType::H1(io) => {
-                Either::A(Box::new(h1proto::open_tunnel(io, head)))
+                Either::Left(h1proto::open_tunnel(io, head.into()).boxed_local())
             }
             ConnectionType::H2(io) => {
                 if let Some(mut pool) = self.pool.take() {
@@ -152,7 +146,7 @@ where
                         None,
                     ));
                 }
-                Either::B(err(SendRequestError::TunnelNotSupported))
+                Either::Right(err(SendRequestError::TunnelNotSupported))
             }
         }
     }
@@ -166,12 +160,12 @@ pub(crate) enum EitherConnection<A, B> {
 
 impl<A, B> Connection for EitherConnection<A, B>
 where
-    A: AsyncRead + AsyncWrite + 'static,
+    A: AsyncRead + AsyncWrite + Unpin + 'static,
-    B: AsyncRead + AsyncWrite + 'static,
+    B: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     type Io = EitherIo<A, B>;
     type Future =
-        Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
+        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
 
     fn protocol(&self) -> Protocol {
         match self {
@@ -180,9 +174,9 @@ where
         }
     }
 
-    fn send_request<RB: MessageBody + 'static>(
+    fn send_request<RB: MessageBody + 'static, H: Into<RequestHeadType>>(
         self,
-        head: RequestHead,
+        head: H,
         body: RB,
     ) -> Self::Future {
         match self {
@@ -191,44 +185,34 @@ where
         }
     }
 
-    type TunnelFuture = Box<
+    type TunnelFuture = LocalBoxFuture<
-        dyn Future<
+        'static,
-            Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
+        Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
-            Error = SendRequestError,
-        >,
     >;
 
     /// Send request, returns Response and Framed
-    fn open_tunnel(self, head: RequestHead) -> Self::TunnelFuture {
+    fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
         match self {
-            EitherConnection::A(con) => Box::new(
+            EitherConnection::A(con) => con
-                con.open_tunnel(head)
+                .open_tunnel(head)
-                    .map(|(head, framed)| (head, framed.map_io(EitherIo::A))),
+                .map(|res| {
-            ),
+                    res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::A)))
-            EitherConnection::B(con) => Box::new(
+                })
-                con.open_tunnel(head)
+                .boxed_local(),
-                    .map(|(head, framed)| (head, framed.map_io(EitherIo::B))),
+            EitherConnection::B(con) => con
-            ),
+                .open_tunnel(head)
+                .map(|res| {
+                    res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::B)))
+                })
+                .boxed_local(),
         }
     }
 }
 
+#[pin_project(project = EitherIoProj)]
 pub enum EitherIo<A, B> {
-    A(A),
+    A(#[pin] A),
-    B(B),
+    B(#[pin] B),
-}
-
-impl<A, B> io::Read for EitherIo<A, B>
-where
-    A: io::Read,
-    B: io::Read,
-{
-    fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
-        match self {
-            EitherIo::A(ref mut val) => val.read(buf),
-            EitherIo::B(ref mut val) => val.read(buf),
-        }
-    }
 }
 
 impl<A, B> AsyncRead for EitherIo<A, B>
@@ -236,7 +220,21 @@ where
     A: AsyncRead,
     B: AsyncRead,
 {
-    unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool {
+    fn poll_read(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &mut [u8],
+    ) -> Poll<io::Result<usize>> {
+        match self.project() {
+            EitherIoProj::A(val) => val.poll_read(cx, buf),
+            EitherIoProj::B(val) => val.poll_read(cx, buf),
+        }
+    }
+
+    unsafe fn prepare_uninitialized_buffer(
+        &self,
+        buf: &mut [mem::MaybeUninit<u8>],
+    ) -> bool {
         match self {
             EitherIo::A(ref val) => val.prepare_uninitialized_buffer(buf),
             EitherIo::B(ref val) => val.prepare_uninitialized_buffer(buf),
@@ -244,45 +242,50 @@ where
     }
 }
 
-impl<A, B> io::Write for EitherIo<A, B>
-where
-    A: io::Write,
-    B: io::Write,
-{
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        match self {
-            EitherIo::A(ref mut val) => val.write(buf),
-            EitherIo::B(ref mut val) => val.write(buf),
-        }
-    }
-
-    fn flush(&mut self) -> io::Result<()> {
-        match self {
-            EitherIo::A(ref mut val) => val.flush(),
-            EitherIo::B(ref mut val) => val.flush(),
-        }
-    }
-}
-
 impl<A, B> AsyncWrite for EitherIo<A, B>
 where
     A: AsyncWrite,
     B: AsyncWrite,
 {
-    fn shutdown(&mut self) -> Poll<(), io::Error> {
+    fn poll_write(
-        match self {
+        self: Pin<&mut Self>,
-            EitherIo::A(ref mut val) => val.shutdown(),
+        cx: &mut Context<'_>,
-            EitherIo::B(ref mut val) => val.shutdown(),
+        buf: &[u8],
+    ) -> Poll<io::Result<usize>> {
+        match self.project() {
+            EitherIoProj::A(val) => val.poll_write(cx, buf),
+            EitherIoProj::B(val) => val.poll_write(cx, buf),
         }
     }
 
-    fn write_buf<U: Buf>(&mut self, buf: &mut U) -> Poll<usize, io::Error>
+    fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
+        match self.project() {
+            EitherIoProj::A(val) => val.poll_flush(cx),
+            EitherIoProj::B(val) => val.poll_flush(cx),
+        }
+    }
+
+    fn poll_shutdown(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<io::Result<()>> {
+        match self.project() {
+            EitherIoProj::A(val) => val.poll_shutdown(cx),
+            EitherIoProj::B(val) => val.poll_shutdown(cx),
+        }
+    }
+
+    fn poll_write_buf<U: Buf>(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &mut U,
+    ) -> Poll<Result<usize, io::Error>>
     where
         Self: Sized,
     {
-        match self {
+        match self.project() {
-            EitherIo::A(ref mut val) => val.write_buf(buf),
+            EitherIoProj::A(val) => val.poll_write_buf(cx, buf),
-            EitherIo::B(ref mut val) => val.write_buf(buf),
+            EitherIoProj::B(val) => val.poll_write_buf(cx, buf),
         }
     }
 }

actix-http/src/client/connector.rs

@@ -6,32 +6,33 @@ use actix_codec::{AsyncRead, AsyncWrite};
 use actix_connect::{
     default_connector, Connect as TcpConnect, Connection as TcpConnection,
 };
-use actix_service::{apply_fn, Service, ServiceExt};
+use actix_rt::net::TcpStream;
+use actix_service::{apply_fn, Service};
 use actix_utils::timeout::{TimeoutError, TimeoutService};
 use http::Uri;
-use tokio_tcp::TcpStream;
 
+use super::config::ConnectorConfig;
 use super::connection::Connection;
 use super::error::ConnectError;
 use super::pool::{ConnectionPool, Protocol};
 use super::Connect;
 
-#[cfg(feature = "ssl")]
+#[cfg(feature = "openssl")]
-use openssl::ssl::SslConnector as OpensslConnector;
+use actix_connect::ssl::openssl::SslConnector as OpensslConnector;
 
-#[cfg(feature = "rust-tls")]
+#[cfg(feature = "rustls")]
-use rustls::ClientConfig;
+use actix_connect::ssl::rustls::ClientConfig;
-#[cfg(feature = "rust-tls")]
+#[cfg(feature = "rustls")]
 use std::sync::Arc;
 
-#[cfg(any(feature = "ssl", feature = "rust-tls"))]
+#[cfg(any(feature = "openssl", feature = "rustls"))]
 enum SslConnector {
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     Openssl(OpensslConnector),
-    #[cfg(feature = "rust-tls")]
+    #[cfg(feature = "rustls")]
     Rustls(Arc<ClientConfig>),
 }
-#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+#[cfg(not(any(feature = "openssl", feature = "rustls")))]
 type SslConnector = ();
 
 /// Manages http client network connectivity
@@ -48,21 +49,17 @@ type SslConnector = ();
 /// ```
 pub struct Connector<T, U> {
     connector: T,
-    timeout: Duration,
+    config: ConnectorConfig,
-    conn_lifetime: Duration,
-    conn_keep_alive: Duration,
-    disconnect_timeout: Duration,
-    limit: usize,
     #[allow(dead_code)]
     ssl: SslConnector,
     _t: PhantomData<U>,
 }
 
-trait Io: AsyncRead + AsyncWrite {}
+trait Io: AsyncRead + AsyncWrite + Unpin {}
-impl<T: AsyncRead + AsyncWrite> Io for T {}
+impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
 
 impl Connector<(), ()> {
-    #[allow(clippy::new_ret_no_self)]
+    #[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
     pub fn new() -> Connector<
         impl Service<
                 Request = TcpConnect<Uri>,
@@ -71,49 +68,54 @@ impl Connector<(), ()> {
             > + Clone,
         TcpStream,
     > {
-        let ssl = {
-            #[cfg(feature = "ssl")]
-            {
-                use openssl::ssl::SslMethod;
-
-                let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
-                let _ = ssl
-                    .set_alpn_protos(b"\x02h2\x08http/1.1")
-                    .map_err(|e| error!("Can not set alpn protocol: {:?}", e));
-                SslConnector::Openssl(ssl.build())
-            }
-            #[cfg(all(not(feature = "ssl"), feature = "rust-tls"))]
-            {
-                let protos = vec![b"h2".to_vec(), b"http/1.1".to_vec()];
-                let mut config = ClientConfig::new();
-                config.set_protocols(&protos);
-                config
-                    .root_store
-                    .add_server_trust_anchors(&webpki_roots::TLS_SERVER_ROOTS);
-                SslConnector::Rustls(Arc::new(config))
-            }
-            #[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
-            {}
-        };
-
         Connector {
-            ssl,
+            ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
             connector: default_connector(),
-            timeout: Duration::from_secs(1),
+            config: ConnectorConfig::default(),
-            conn_lifetime: Duration::from_secs(75),
-            conn_keep_alive: Duration::from_secs(15),
-            disconnect_timeout: Duration::from_millis(3000),
-            limit: 100,
             _t: PhantomData,
         }
     }
+
+    // Build Ssl connector with openssl, based on supplied alpn protocols
+    #[cfg(feature = "openssl")]
+    fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
+        use actix_connect::ssl::openssl::SslMethod;
+        use bytes::{BufMut, BytesMut};
+
+        let mut alpn = BytesMut::with_capacity(20);
+        for proto in protocols.iter() {
+            alpn.put_u8(proto.len() as u8);
+            alpn.put(proto.as_slice());
+        }
+
+        let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
+        let _ = ssl
+            .set_alpn_protos(&alpn)
+            .map_err(|e| error!("Can not set alpn protocol: {:?}", e));
+        SslConnector::Openssl(ssl.build())
+    }
+
+    // Build Ssl connector with rustls, based on supplied alpn protocols
+    #[cfg(all(not(feature = "openssl"), feature = "rustls"))]
+    fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
+        let mut config = ClientConfig::new();
+        config.set_protocols(&protocols);
+        config
+            .root_store
+            .add_server_trust_anchors(&actix_tls::rustls::TLS_SERVER_ROOTS);
+        SslConnector::Rustls(Arc::new(config))
+    }
+
+    // ssl turned off, provides empty ssl connector
+    #[cfg(not(any(feature = "openssl", feature = "rustls")))]
+    fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
 }
 
 impl<T, U> Connector<T, U> {
     /// Use custom connector.
     pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
     where
-        U1: AsyncRead + AsyncWrite + fmt::Debug,
+        U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
         T1: Service<
                 Request = TcpConnect<Uri>,
                 Response = TcpConnection<Uri, U1>,
@@ -122,11 +124,7 @@ impl<T, U> Connector<T, U> {
     {
         Connector {
             connector,
-            timeout: self.timeout,
+            config: self.config,
-            conn_lifetime: self.conn_lifetime,
-            conn_keep_alive: self.conn_keep_alive,
-            disconnect_timeout: self.disconnect_timeout,
-            limit: self.limit,
             ssl: self.ssl,
             _t: PhantomData,
         }
@@ -135,7 +133,7 @@ impl<T, U> Connector<T, U> {
 
 impl<T, U> Connector<T, U>
 where
-    U: AsyncRead + AsyncWrite + fmt::Debug + 'static,
+    U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
     T: Service<
             Request = TcpConnect<Uri>,
             Response = TcpConnection<Uri, U>,
@@ -146,29 +144,61 @@ where
     /// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
     /// Set to 1 second by default.
     pub fn timeout(mut self, timeout: Duration) -> Self {
-        self.timeout = timeout;
+        self.config.timeout = timeout;
         self
     }
 
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     /// Use custom `SslConnector` instance.
     pub fn ssl(mut self, connector: OpensslConnector) -> Self {
         self.ssl = SslConnector::Openssl(connector);
         self
     }
 
-    #[cfg(feature = "rust-tls")]
+    #[cfg(feature = "rustls")]
     pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
         self.ssl = SslConnector::Rustls(connector);
         self
     }
 
+    /// Maximum supported http major version
+    /// Supported versions http/1.1, http/2
+    pub fn max_http_version(mut self, val: http::Version) -> Self {
+        let versions = match val {
+            http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
+            http::Version::HTTP_2 => vec![b"h2".to_vec(), b"http/1.1".to_vec()],
+            _ => {
+                unimplemented!("actix-http:client: supported versions http/1.1, http/2")
+            }
+        };
+        self.ssl = Connector::build_ssl(versions);
+        self
+    }
+
+    /// Indicates the initial window size (in octets) for
+    /// HTTP2 stream-level flow control for received data.
+    ///
+    /// The default value is 65,535 and is good for APIs, but not for big objects.
+    pub fn initial_window_size(mut self, size: u32) -> Self {
+        self.config.stream_window_size = size;
+        self
+    }
+
+    /// Indicates the initial window size (in octets) for
+    /// HTTP2 connection-level flow control for received data.
+    ///
+    /// The default value is 65,535 and is good for APIs, but not for big objects.
+    pub fn initial_connection_window_size(mut self, size: u32) -> Self {
+        self.config.conn_window_size = size;
+        self
+    }
+
     /// Set total number of simultaneous connections per type of scheme.
     ///
     /// If limit is 0, the connector has no limit.
     /// The default limit size is 100.
     pub fn limit(mut self, limit: usize) -> Self {
-        self.limit = limit;
+        self.config.limit = limit;
         self
     }
 
@@ -179,7 +209,7 @@ where
     /// exceeds this period, the connection is closed.
     /// Default keep-alive period is 15 seconds.
     pub fn conn_keep_alive(mut self, dur: Duration) -> Self {
-        self.conn_keep_alive = dur;
+        self.config.conn_keep_alive = dur;
         self
     }
 
@@ -189,7 +219,7 @@ where
     /// until it is closed regardless of keep-alive period.
     /// Default lifetime period is 75 seconds.
     pub fn conn_lifetime(mut self, dur: Duration) -> Self {
-        self.conn_lifetime = dur;
+        self.config.conn_lifetime = dur;
         self
     }
 
@@ -202,7 +232,7 @@ where
     ///
     /// By default disconnect timeout is set to 3000 milliseconds.
     pub fn disconnect_timeout(mut self, dur: Duration) -> Self {
-        self.disconnect_timeout = dur;
+        self.config.disconnect_timeout = Some(dur);
         self
     }
 
@@ -213,10 +243,10 @@ where
         self,
     ) -> impl Service<Request = Connect, Response = impl Connection, Error = ConnectError>
            + Clone {
-        #[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+        #[cfg(not(any(feature = "openssl", feature = "rustls")))]
         {
             let connector = TimeoutService::new(
-                self.timeout,
+                self.config.timeout,
                 apply_fn(self.connector, |msg: Connect, srv| {
                     srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
                 })
@@ -231,51 +261,47 @@ where
             connect_impl::InnerConnector {
                 tcp_pool: ConnectionPool::new(
                     connector,
-                    self.conn_lifetime,
+                    self.config.no_disconnect_timeout(),
-                    self.conn_keep_alive,
-                    None,
-                    self.limit,
                 ),
             }
         }
-        #[cfg(any(feature = "ssl", feature = "rust-tls"))]
+        #[cfg(any(feature = "openssl", feature = "rustls"))]
         {
             const H2: &[u8] = b"h2";
-            #[cfg(feature = "ssl")]
+            #[cfg(feature = "openssl")]
-            use actix_connect::ssl::OpensslConnector;
+            use actix_connect::ssl::openssl::OpensslConnector;
-            #[cfg(feature = "rust-tls")]
+            #[cfg(feature = "rustls")]
-            use actix_connect::ssl::RustlsConnector;
+            use actix_connect::ssl::rustls::{RustlsConnector, Session};
-            use actix_service::boxed::service;
+            use actix_service::{boxed::service, pipeline};
-            #[cfg(feature = "rust-tls")]
-            use rustls::Session;
 
             let ssl_service = TimeoutService::new(
-                self.timeout,
+                self.config.timeout,
+                pipeline(
                     apply_fn(self.connector.clone(), |msg: Connect, srv| {
                         srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
                     })
-                .map_err(ConnectError::from)
+                    .map_err(ConnectError::from),
+                )
                 .and_then(match self.ssl {
-                    #[cfg(feature = "ssl")]
+                    #[cfg(feature = "openssl")]
                     SslConnector::Openssl(ssl) => service(
                         OpensslConnector::service(ssl)
-                            .map_err(ConnectError::from)
                             .map(|stream| {
                                 let sock = stream.into_parts().0;
                                 let h2 = sock
-                                    .get_ref()
                                     .ssl()
                                     .selected_alpn_protocol()
                                     .map(|protos| protos.windows(2).any(|w| w == H2))
                                     .unwrap_or(false);
                                 if h2 {
-                                    (Box::new(sock) as Box<Io>, Protocol::Http2)
+                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
                                 } else {
-                                    (Box::new(sock) as Box<Io>, Protocol::Http1)
+                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
                                 }
-                            }),
+                            })
+                            .map_err(ConnectError::from),
                     ),
-                    #[cfg(feature = "rust-tls")]
+                    #[cfg(feature = "rustls")]
                     SslConnector::Rustls(ssl) => service(
                         RustlsConnector::service(ssl)
                             .map_err(ConnectError::from)
@@ -288,9 +314,9 @@ where
                                     .map(|protos| protos.windows(2).any(|w| w == H2))
                                     .unwrap_or(false);
                                 if h2 {
-                                    (Box::new(sock) as Box<Io>, Protocol::Http2)
+                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
                                 } else {
-                                    (Box::new(sock) as Box<Io>, Protocol::Http1)
+                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
                                 }
                             }),
                     ),
@@ -302,8 +328,8 @@ where
             });
 
             let tcp_service = TimeoutService::new(
-                self.timeout,
+                self.config.timeout,
-                apply_fn(self.connector.clone(), |msg: Connect, srv| {
+                apply_fn(self.connector, |msg: Connect, srv| {
                     srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
                 })
                 .map_err(ConnectError::from)
@@ -317,36 +343,27 @@ where
             connect_impl::InnerConnector {
                 tcp_pool: ConnectionPool::new(
                     tcp_service,
-                    self.conn_lifetime,
+                    self.config.no_disconnect_timeout(),
-                    self.conn_keep_alive,
-                    None,
-                    self.limit,
-                ),
-                ssl_pool: ConnectionPool::new(
-                    ssl_service,
-                    self.conn_lifetime,
-                    self.conn_keep_alive,
-                    Some(self.disconnect_timeout),
-                    self.limit,
                 ),
+                ssl_pool: ConnectionPool::new(ssl_service, self.config),
             }
         }
     }
 }
 
-#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+#[cfg(not(any(feature = "openssl", feature = "rustls")))]
 mod connect_impl {
-    use futures::future::{err, Either, FutureResult};
+    use std::task::{Context, Poll};
-    use futures::Poll;
+
+    use futures_util::future::{err, Either, Ready};
 
     use super::*;
     use crate::client::connection::IoConnection;
 
     pub(crate) struct InnerConnector<T, Io>
     where
-        Io: AsyncRead + AsyncWrite + 'static,
+        Io: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         pub(crate) tcp_pool: ConnectionPool<T, Io>,
@@ -354,9 +371,8 @@ mod connect_impl {
 
     impl<T, Io> Clone for InnerConnector<T, Io>
     where
-        Io: AsyncRead + AsyncWrite + 'static,
+        Io: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         fn clone(&self) -> Self {
@@ -368,9 +384,8 @@ mod connect_impl {
 
     impl<T, Io> Service for InnerConnector<T, Io>
     where
-        Io: AsyncRead + AsyncWrite + 'static,
+        Io: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         type Request = Connect;
@@ -378,38 +393,41 @@ mod connect_impl {
         type Error = ConnectError;
         type Future = Either<
             <ConnectionPool<T, Io> as Service>::Future,
-            FutureResult<IoConnection<Io>, ConnectError>,
+            Ready<Result<IoConnection<Io>, ConnectError>>,
         >;
 
-        fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-            self.tcp_pool.poll_ready()
+            self.tcp_pool.poll_ready(cx)
         }
 
         fn call(&mut self, req: Connect) -> Self::Future {
             match req.uri.scheme_str() {
                 Some("https") | Some("wss") => {
-                    Either::B(err(ConnectError::SslIsNotSupported))
+                    Either::Right(err(ConnectError::SslIsNotSupported))
                 }
-                _ => Either::A(self.tcp_pool.call(req)),
+                _ => Either::Left(self.tcp_pool.call(req)),
             }
         }
     }
 }
 
-#[cfg(any(feature = "ssl", feature = "rust-tls"))]
+#[cfg(any(feature = "openssl", feature = "rustls"))]
 mod connect_impl {
+    use std::future::Future;
     use std::marker::PhantomData;
+    use std::pin::Pin;
+    use std::task::{Context, Poll};
 
-    use futures::future::{Either, FutureResult};
+    use futures_core::ready;
-    use futures::{Async, Future, Poll};
+    use futures_util::future::Either;
 
     use super::*;
     use crate::client::connection::EitherConnection;
 
     pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
         T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>,
         T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>,
     {
@@ -419,13 +437,11 @@ mod connect_impl {
 
     impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
         T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
         T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         fn clone(&self) -> Self {
@@ -438,53 +454,47 @@ mod connect_impl {
 
     impl<T1, T2, Io1, Io2> Service for InnerConnector<T1, T2, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
         T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
         T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         type Request = Connect;
         type Response = EitherConnection<Io1, Io2>;
         type Error = ConnectError;
         type Future = Either<
-            FutureResult<Self::Response, Self::Error>,
-            Either<
             InnerConnectorResponseA<T1, Io1, Io2>,
             InnerConnectorResponseB<T2, Io1, Io2>,
-            >,
         >;
 
-        fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-            self.tcp_pool.poll_ready()
+            self.tcp_pool.poll_ready(cx)
         }
 
         fn call(&mut self, req: Connect) -> Self::Future {
             match req.uri.scheme_str() {
-                Some("https") | Some("wss") => {
+                Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
-                    Either::B(Either::B(InnerConnectorResponseB {
                     fut: self.ssl_pool.call(req),
                     _t: PhantomData,
-                    }))
+                }),
-                }
+                _ => Either::Left(InnerConnectorResponseA {
-                _ => Either::B(Either::A(InnerConnectorResponseA {
                     fut: self.tcp_pool.call(req),
                     _t: PhantomData,
-                })),
+                }),
             }
         }
     }
 
+    #[pin_project::pin_project]
     pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
+        #[pin]
         fut: <ConnectionPool<T, Io1> as Service>::Future,
         _t: PhantomData<Io2>,
     }
@@ -492,29 +502,28 @@ mod connect_impl {
     impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
     where
         T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
-        Io1: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
     {
-        type Item = EitherConnection<Io1, Io2>;
+        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
-        type Error = ConnectError;
 
-        fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-            match self.fut.poll()? {
+            Poll::Ready(
-                Async::NotReady => Ok(Async::NotReady),
+                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
-                Async::Ready(res) => Ok(Async::Ready(EitherConnection::A(res))),
+                    .map(EitherConnection::A),
-            }
+            )
         }
     }
 
+    #[pin_project::pin_project]
     pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
     where
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
+        #[pin]
         fut: <ConnectionPool<T, Io2> as Service>::Future,
         _t: PhantomData<Io1>,
     }
@@ -522,19 +531,17 @@ mod connect_impl {
     impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
     where
         T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
-        Io1: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
     {
-        type Item = EitherConnection<Io1, Io2>;
+        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
-        type Error = ConnectError;
 
-        fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-            match self.fut.poll()? {
+            Poll::Ready(
-                Async::NotReady => Ok(Async::NotReady),
+                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
-                Async::Ready(res) => Ok(Async::Ready(EitherConnection::B(res))),
+                    .map(EitherConnection::B),
-            }
+            )
         }
     }
 }

actix-http/src/client/error.rs

@@ -1,14 +1,13 @@
 use std::io;
 
+use actix_connect::resolver::ResolveError;
 use derive_more::{Display, From};
-use trust_dns_resolver::error::ResolveError;
 
-#[cfg(feature = "ssl")]
+#[cfg(feature = "openssl")]
-use openssl::ssl::{Error as SslError, HandshakeError};
+use actix_connect::ssl::openssl::{HandshakeError, SslError};
 
 use crate::error::{Error, ParseError, ResponseError};
-use crate::http::Error as HttpError;
+use crate::http::{Error as HttpError, StatusCode};
-use crate::response::Response;
 
 /// A set of errors that can occur while connecting to an HTTP host
 #[derive(Debug, Display, From)]
@@ -18,10 +17,15 @@ pub enum ConnectError {
     SslIsNotSupported,
 
     /// SSL error
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     #[display(fmt = "{}", _0)]
     SslError(SslError),
 
+    /// SSL Handshake error
+    #[cfg(feature = "openssl")]
+    #[display(fmt = "{}", _0)]
+    SslHandshakeError(String),
+
     /// Failed to resolve the hostname
     #[display(fmt = "Failed resolving hostname: {}", _0)]
     Resolver(ResolveError),
@@ -35,7 +39,7 @@ pub enum ConnectError {
     H2(h2::Error),
 
     /// Connecting took too long
-    #[display(fmt = "Timeout out while establishing connection")]
+    #[display(fmt = "Timeout while establishing connection")]
     Timeout,
 
     /// Connector has been disconnected
@@ -44,33 +48,31 @@ pub enum ConnectError {
 
     /// Unresolved host name
     #[display(fmt = "Connector received `Connect` method with unresolved host")]
-    Unresolverd,
+    Unresolved,
 
     /// Connection io error
     #[display(fmt = "{}", _0)]
     Io(io::Error),
 }
 
+impl std::error::Error for ConnectError {}
+
 impl From<actix_connect::ConnectError> for ConnectError {
     fn from(err: actix_connect::ConnectError) -> ConnectError {
         match err {
             actix_connect::ConnectError::Resolver(e) => ConnectError::Resolver(e),
             actix_connect::ConnectError::NoRecords => ConnectError::NoRecords,
             actix_connect::ConnectError::InvalidInput => panic!(),
-            actix_connect::ConnectError::Unresolverd => ConnectError::Unresolverd,
+            actix_connect::ConnectError::Unresolved => ConnectError::Unresolved,
             actix_connect::ConnectError::Io(e) => ConnectError::Io(e),
         }
     }
 }
 
-#[cfg(feature = "ssl")]
+#[cfg(feature = "openssl")]
-impl<T> From<HandshakeError<T>> for ConnectError {
+impl<T: std::fmt::Debug> From<HandshakeError<T>> for ConnectError {
     fn from(err: HandshakeError<T>) -> ConnectError {
-        match err {
+        ConnectError::SslHandshakeError(format!("{:?}", err))
-            HandshakeError::SetupFailure(stack) => SslError::from(stack).into(),
-            HandshakeError::Failure(stream) => stream.into_error().into(),
-            HandshakeError::WouldBlock(stream) => stream.into_error().into(),
-        }
     }
 }
 
@@ -86,6 +88,8 @@ pub enum InvalidUrl {
     HttpError(http::Error),
 }
 
+impl std::error::Error for InvalidUrl {}
+
 /// A set of errors that can occur during request sending and response reading
 #[derive(Debug, Display, From)]
 pub enum SendRequestError {
@@ -106,7 +110,7 @@ pub enum SendRequestError {
     #[display(fmt = "{}", _0)]
     H2(h2::Error),
     /// Response took too long
-    #[display(fmt = "Timeout out while waiting for response")]
+    #[display(fmt = "Timeout while waiting for response")]
     Timeout,
     /// Tunnels are not supported for http2 connection
     #[display(fmt = "Tunnels are not supported for http2 connection")]
@@ -115,16 +119,39 @@ pub enum SendRequestError {
     Body(Error),
 }
 
+impl std::error::Error for SendRequestError {}
+
 /// Convert `SendRequestError` to a server `Response`
 impl ResponseError for SendRequestError {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
         match *self {
             SendRequestError::Connect(ConnectError::Timeout) => {
-                Response::GatewayTimeout()
+                StatusCode::GATEWAY_TIMEOUT
+            }
+            SendRequestError::Connect(_) => StatusCode::BAD_REQUEST,
+            _ => StatusCode::INTERNAL_SERVER_ERROR,
+        }
+    }
+}
+
+/// A set of errors that can occur during freezing a request
+#[derive(Debug, Display, From)]
+pub enum FreezeRequestError {
+    /// Invalid URL
+    #[display(fmt = "Invalid URL: {}", _0)]
+    Url(InvalidUrl),
+    /// Http error
+    #[display(fmt = "{}", _0)]
+    Http(HttpError),
+}
+
+impl std::error::Error for FreezeRequestError {}
+
+impl From<FreezeRequestError> for SendRequestError {
+    fn from(e: FreezeRequestError) -> Self {
+        match e {
+            FreezeRequestError::Url(e) => e.into(),
+            FreezeRequestError::Http(e) => e.into(),
         }
-            SendRequestError::Connect(_) => Response::BadGateway(),
-            _ => Response::InternalServerError(),
-        }
-        .into()
     }
 }

actix-http/src/client/h1proto.rs

@@ -1,15 +1,20 @@
 use std::io::Write;
-use std::{io, time};
+use std::pin::Pin;
+use std::task::{Context, Poll};
+use std::{io, mem, time};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use bytes::{BufMut, Bytes, BytesMut};
+use bytes::buf::BufMutExt;
-use futures::future::{ok, Either};
+use bytes::{Bytes, BytesMut};
-use futures::{Async, Future, Poll, Sink, Stream};
+use futures_core::Stream;
+use futures_util::future::poll_fn;
+use futures_util::{pin_mut, SinkExt, StreamExt};
 
 use crate::error::PayloadError;
 use crate::h1;
+use crate::header::HeaderMap;
 use crate::http::header::{IntoHeaderValue, HOST};
-use crate::message::{RequestHead, ResponseHead};
+use crate::message::{RequestHeadType, ResponseHead};
 use crate::payload::{Payload, PayloadStream};
 
 use super::connection::{ConnectionLifetime, ConnectionType, IoConnection};
@@ -17,34 +22,40 @@ use super::error::{ConnectError, SendRequestError};
 use super::pool::Acquired;
 use crate::body::{BodySize, MessageBody};
 
-pub(crate) fn send_request<T, B>(
+pub(crate) async fn send_request<T, B>(
     io: T,
-    mut head: RequestHead,
+    mut head: RequestHeadType,
     body: B,
     created: time::Instant,
     pool: Option<Acquired<T>>,
-) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
+) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     B: MessageBody,
 {
     // set request host header
-    if !head.headers.contains_key(HOST) {
+    if !head.as_ref().headers.contains_key(HOST)
-        if let Some(host) = head.uri.host() {
+        && !head.extra_headers().iter().any(|h| h.contains_key(HOST))
+    {
+        if let Some(host) = head.as_ref().uri.host() {
             let mut wrt = BytesMut::with_capacity(host.len() + 5).writer();
 
-            let _ = match head.uri.port_u16() {
+            let _ = match head.as_ref().uri.port_u16() {
                 None | Some(80) | Some(443) => write!(wrt, "{}", host),
                 Some(port) => write!(wrt, "{}:{}", host, port),
             };
 
-            match wrt.get_mut().take().freeze().try_into() {
+            match wrt.get_mut().split().freeze().try_into() {
-                Ok(value) => {
+                Ok(value) => match head {
-                    head.headers.insert(HOST, value);
+                    RequestHeadType::Owned(ref mut head) => {
+                        head.headers.insert(HOST, value)
                     }
-                Err(e) => {
+                    RequestHeadType::Rc(_, ref mut extra_headers) => {
-                    log::error!("Can not set HOST header {}", e);
+                        let headers = extra_headers.get_or_insert(HeaderMap::new());
+                        headers.insert(HOST, value)
                     }
+                },
+                Err(e) => log::error!("Can not set HOST header {}", e),
             }
         }
     }
@@ -55,81 +66,118 @@ where
         io: Some(io),
     };
 
-    let len = body.size();
+    // create Framed and send request
+    let mut framed_inner = Framed::new(io, h1::ClientCodec::default());
+    framed_inner.send((head, body.size()).into()).await?;
 
-    // create Framed and send reqest
-    Framed::new(io, h1::ClientCodec::default())
-        .send((head, len).into())
-        .from_err()
     // send request body
-        .and_then(move |framed| match body.size() {
+    match body.size() {
-            BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
+        BodySize::None | BodySize::Empty | BodySize::Sized(0) => (),
-                Either::A(ok(framed))
+        _ => send_body(body, Pin::new(&mut framed_inner)).await?,
-            }
+    };
-            _ => Either::B(SendBody::new(body, framed)),
+
-        })
     // read response and init read body
-        .and_then(|framed| {
+    let res = Pin::new(&mut framed_inner).into_future().await;
-            framed
+    let (head, framed) = if let (Some(result), framed) = res {
-                .into_future()
+        let item = result.map_err(SendRequestError::from)?;
-                .map_err(|(e, _)| SendRequestError::from(e))
+        (item, framed)
-                .and_then(|(item, framed)| {
+    } else {
-                    if let Some(res) = item {
+        return Err(SendRequestError::from(ConnectError::Disconnected));
-                        match framed.get_codec().message_type() {
+    };
+
+    match framed.codec_ref().message_type() {
         h1::MessageType::None => {
-                                let force_close = !framed.get_codec().keepalive();
+            let force_close = !framed.codec_ref().keepalive();
             release_connection(framed, force_close);
-                                Ok((res, Payload::None))
+            Ok((head, Payload::None))
         }
         _ => {
-                                let pl: PayloadStream = Box::new(PlStream::new(framed));
+            let pl: PayloadStream = PlStream::new(framed_inner).boxed_local();
-                                Ok((res, pl.into()))
+            Ok((head, pl.into()))
         }
     }
-                    } else {
-                        Err(ConnectError::Disconnected.into())
-                    }
-                })
-        })
 }
 
-pub(crate) fn open_tunnel<T>(
+pub(crate) async fn open_tunnel<T>(
     io: T,
-    head: RequestHead,
+    head: RequestHeadType,
-) -> impl Future<Item = (ResponseHead, Framed<T, h1::ClientCodec>), Error = SendRequestError>
+) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    // create Framed and send reqest
+    // create Framed and send request
-    Framed::new(io, h1::ClientCodec::default())
+    let mut framed = Framed::new(io, h1::ClientCodec::default());
-        .send((head, BodySize::None).into())
+    framed.send((head, BodySize::None).into()).await?;
-        .from_err()
+
     // read response
-        .and_then(|framed| {
+    if let (Some(result), framed) = framed.into_future().await {
-            framed
+        let head = result.map_err(SendRequestError::from)?;
-                .into_future()
-                .map_err(|(e, _)| SendRequestError::from(e))
-                .and_then(|(head, framed)| {
-                    if let Some(head) = head {
         Ok((head, framed))
     } else {
         Err(SendRequestError::from(ConnectError::Disconnected))
     }
+}
+
+/// send request body to the peer
+pub(crate) async fn send_body<T, B>(
+    body: B,
+    mut framed: Pin<&mut Framed<T, h1::ClientCodec>>,
+) -> Result<(), SendRequestError>
+where
+    T: ConnectionLifetime + Unpin,
+    B: MessageBody,
+{
+    pin_mut!(body);
+
+    let mut eof = false;
+    while !eof {
+        while !eof && !framed.as_ref().is_write_buf_full() {
+            match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
+                Some(result) => {
+                    framed.as_mut().write(h1::Message::Chunk(Some(result?)))?;
+                }
+                None => {
+                    eof = true;
+                    framed.as_mut().write(h1::Message::Chunk(None))?;
+                }
+            }
+        }
+
+        if !framed.as_ref().is_write_buf_empty() {
+            poll_fn(|cx| match framed.as_mut().flush(cx) {
+                Poll::Ready(Ok(_)) => Poll::Ready(Ok(())),
+                Poll::Ready(Err(err)) => Poll::Ready(Err(err)),
+                Poll::Pending => {
+                    if !framed.as_ref().is_write_buf_full() {
+                        Poll::Ready(Ok(()))
+                    } else {
+                        Poll::Pending
+                    }
+                }
             })
-        })
+            .await?;
+        }
+    }
+
+    SinkExt::flush(Pin::into_inner(framed)).await?;
+    Ok(())
 }
 
 #[doc(hidden)]
 /// HTTP client connection
 pub struct H1Connection<T> {
+    /// T should be `Unpin`
     io: Option<T>,
     created: time::Instant,
     pool: Option<Acquired<T>>,
 }
 
-impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T> {
+impl<T> ConnectionLifetime for H1Connection<T>
+where
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
+{
     /// Close connection
-    fn close(&mut self) {
+    fn close(mut self: Pin<&mut Self>) {
         if let Some(mut pool) = self.pool.take() {
             if let Some(io) = self.io.take() {
                 pool.close(IoConnection::new(
@@ -142,7 +190,7 @@ impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T>
     }
 
     /// Release this connection to the connection pool
-    fn release(&mut self) {
+    fn release(mut self: Pin<&mut Self>) {
         if let Some(mut pool) = self.pool.take() {
             if let Some(io) = self.io.take() {
                 pool.release(IoConnection::new(
@@ -155,143 +203,96 @@ impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T>
     }
 }
 
-impl<T: AsyncRead + AsyncWrite + 'static> io::Read for H1Connection<T> {
+impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
-    fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
+    unsafe fn prepare_uninitialized_buffer(
-        self.io.as_mut().unwrap().read(buf)
+        &self,
+        buf: &mut [mem::MaybeUninit<u8>],
+    ) -> bool {
+        self.io.as_ref().unwrap().prepare_uninitialized_buffer(buf)
+    }
+
+    fn poll_read(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &mut [u8],
+    ) -> Poll<io::Result<usize>> {
+        Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
     }
 }
 
-impl<T: AsyncRead + AsyncWrite + 'static> AsyncRead for H1Connection<T> {}
+impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
-
+    fn poll_write(
-impl<T: AsyncRead + AsyncWrite + 'static> io::Write for H1Connection<T> {
+        mut self: Pin<&mut Self>,
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
+        cx: &mut Context<'_>,
-        self.io.as_mut().unwrap().write(buf)
+        buf: &[u8],
+    ) -> Poll<io::Result<usize>> {
+        Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
     }
 
-    fn flush(&mut self) -> io::Result<()> {
+    fn poll_flush(
-        self.io.as_mut().unwrap().flush()
+        mut self: Pin<&mut Self>,
-    }
+        cx: &mut Context<'_>,
-}
+    ) -> Poll<io::Result<()>> {
-
+        Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
-impl<T: AsyncRead + AsyncWrite + 'static> AsyncWrite for H1Connection<T> {
+    }
-    fn shutdown(&mut self) -> Poll<(), io::Error> {
+
-        self.io.as_mut().unwrap().shutdown()
+    fn poll_shutdown(
-    }
+        mut self: Pin<&mut Self>,
-}
+        cx: &mut Context<'_>,
-
+    ) -> Poll<Result<(), io::Error>> {
-/// Future responsible for sending request body to the peer
+        Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
-pub(crate) struct SendBody<I, B> {
-    body: Option<B>,
-    framed: Option<Framed<I, h1::ClientCodec>>,
-    flushed: bool,
-}
-
-impl<I, B> SendBody<I, B>
-where
-    I: AsyncRead + AsyncWrite + 'static,
-    B: MessageBody,
-{
-    pub(crate) fn new(body: B, framed: Framed<I, h1::ClientCodec>) -> Self {
-        SendBody {
-            body: Some(body),
-            framed: Some(framed),
-            flushed: true,
-        }
-    }
-}
-
-impl<I, B> Future for SendBody<I, B>
-where
-    I: ConnectionLifetime,
-    B: MessageBody,
-{
-    type Item = Framed<I, h1::ClientCodec>;
-    type Error = SendRequestError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        let mut body_ready = true;
-        loop {
-            while body_ready
-                && self.body.is_some()
-                && !self.framed.as_ref().unwrap().is_write_buf_full()
-            {
-                match self.body.as_mut().unwrap().poll_next()? {
-                    Async::Ready(item) => {
-                        // check if body is done
-                        if item.is_none() {
-                            let _ = self.body.take();
-                        }
-                        self.flushed = false;
-                        self.framed
-                            .as_mut()
-                            .unwrap()
-                            .force_send(h1::Message::Chunk(item))?;
-                        break;
-                    }
-                    Async::NotReady => body_ready = false,
-                }
-            }
-
-            if !self.flushed {
-                match self.framed.as_mut().unwrap().poll_complete()? {
-                    Async::Ready(_) => {
-                        self.flushed = true;
-                        continue;
-                    }
-                    Async::NotReady => return Ok(Async::NotReady),
-                }
-            }
-
-            if self.body.is_none() {
-                return Ok(Async::Ready(self.framed.take().unwrap()));
-            }
-            return Ok(Async::NotReady);
-        }
     }
 }
 
+#[pin_project::pin_project]
 pub(crate) struct PlStream<Io> {
+    #[pin]
     framed: Option<Framed<Io, h1::ClientPayloadCodec>>,
 }
 
 impl<Io: ConnectionLifetime> PlStream<Io> {
     fn new(framed: Framed<Io, h1::ClientCodec>) -> Self {
+        let framed = framed.into_map_codec(|codec| codec.into_payload_codec());
+
         PlStream {
-            framed: Some(framed.map_codec(|codec| codec.into_payload_codec())),
+            framed: Some(framed),
         }
     }
 }
 
 impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
-    type Item = Bytes;
+    type Item = Result<Bytes, PayloadError>;
-    type Error = PayloadError;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
+    fn poll_next(
-        match self.framed.as_mut().unwrap().poll()? {
+        self: Pin<&mut Self>,
-            Async::NotReady => Ok(Async::NotReady),
+        cx: &mut Context<'_>,
-            Async::Ready(Some(chunk)) => {
+    ) -> Poll<Option<Self::Item>> {
+        let mut this = self.project();
+
+        match this.framed.as_mut().as_pin_mut().unwrap().next_item(cx)? {
+            Poll::Pending => Poll::Pending,
+            Poll::Ready(Some(chunk)) => {
                 if let Some(chunk) = chunk {
-                    Ok(Async::Ready(Some(chunk)))
+                    Poll::Ready(Some(Ok(chunk)))
                 } else {
-                    let framed = self.framed.take().unwrap();
+                    let framed = this.framed.as_mut().as_pin_mut().unwrap();
-                    let force_close = !framed.get_codec().keepalive();
+                    let force_close = !framed.codec_ref().keepalive();
                     release_connection(framed, force_close);
-                    Ok(Async::Ready(None))
+                    Poll::Ready(None)
                 }
             }
-            Async::Ready(None) => Ok(Async::Ready(None)),
+            Poll::Ready(None) => Poll::Ready(None),
         }
     }
 }
 
-fn release_connection<T, U>(framed: Framed<T, U>, force_close: bool)
+fn release_connection<T, U>(framed: Pin<&mut Framed<T, U>>, force_close: bool)
 where
     T: ConnectionLifetime,
 {
-    let mut parts = framed.into_parts();
+    if !force_close && framed.is_read_buf_empty() && framed.is_write_buf_empty() {
-    if !force_close && parts.read_buf.is_empty() && parts.write_buf.is_empty() {
+        framed.io_pin().release()
-        parts.io.release()
     } else {
-        parts.io.close()
+        framed.io_pin().close()
     }
 }

actix-http/src/client/h2proto.rs

@@ -1,46 +1,50 @@
+use std::convert::TryFrom;
+use std::future::Future;
 use std::time;
 
 use actix_codec::{AsyncRead, AsyncWrite};
 use bytes::Bytes;
-use futures::future::{err, Either};
+use futures_util::future::poll_fn;
-use futures::{Async, Future, Poll};
+use futures_util::pin_mut;
-use h2::{client::SendRequest, SendStream};
+use h2::{
+    client::{Builder, Connection, SendRequest},
+    SendStream,
+};
 use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING};
-use http::{request::Request, HttpTryFrom, Method, Version};
+use http::{request::Request, Method, Version};
 
 use crate::body::{BodySize, MessageBody};
-use crate::message::{RequestHead, ResponseHead};
+use crate::header::HeaderMap;
+use crate::message::{RequestHeadType, ResponseHead};
 use crate::payload::Payload;
 
+use super::config::ConnectorConfig;
 use super::connection::{ConnectionType, IoConnection};
 use super::error::SendRequestError;
 use super::pool::Acquired;
 
-pub(crate) fn send_request<T, B>(
+pub(crate) async fn send_request<T, B>(
-    io: SendRequest<Bytes>,
+    mut io: SendRequest<Bytes>,
-    head: RequestHead,
+    head: RequestHeadType,
     body: B,
     created: time::Instant,
     pool: Option<Acquired<T>>,
-) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
+) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     B: MessageBody,
 {
     trace!("Sending client request: {:?} {:?}", head, body.size());
-    let head_req = head.method == Method::HEAD;
+    let head_req = head.as_ref().method == Method::HEAD;
     let length = body.size();
-    let eof = match length {
+    let eof = matches!(
-        BodySize::None | BodySize::Empty | BodySize::Sized(0) => true,
+        length,
-        _ => false,
+        BodySize::None | BodySize::Empty | BodySize::Sized(0)
-    };
+    );
 
-    io.ready()
-        .map_err(SendRequestError::from)
-        .and_then(move |mut io| {
     let mut req = Request::new(());
-            *req.uri_mut() = head.uri;
+    *req.uri_mut() = head.as_ref().uri.clone();
-            *req.method_mut() = head.method;
+    *req.method_mut() = head.as_ref().method.clone();
     *req.version_mut() = Version::HTTP_2;
 
     let mut skip_len = true;
@@ -60,14 +64,27 @@ where
             CONTENT_LENGTH,
             HeaderValue::try_from(format!("{}", len)).unwrap(),
         ),
-                BodySize::Sized64(len) => req.headers_mut().insert(
+    };
-                    CONTENT_LENGTH,
+
-                    HeaderValue::try_from(format!("{}", len)).unwrap(),
+    // Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
+    let (head, extra_headers) = match head {
+        RequestHeadType::Owned(head) => (RequestHeadType::Owned(head), HeaderMap::new()),
+        RequestHeadType::Rc(head, extra_headers) => (
+            RequestHeadType::Rc(head, None),
+            extra_headers.unwrap_or_else(HeaderMap::new),
         ),
     };
 
+    // merging headers from head and extra headers.
+    let headers = head
+        .as_ref()
+        .headers
+        .iter()
+        .filter(|(name, _)| !extra_headers.contains_key(*name))
+        .chain(extra_headers.iter());
+
     // copy headers
-            for (key, value) in head.headers.iter() {
+    for (key, value) in headers {
         match *key {
             CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
             CONTENT_LENGTH if skip_len => continue,
@@ -77,30 +94,27 @@ where
         req.headers_mut().append(key, value.clone());
     }
 
-            match io.send_request(req, eof) {
+    let res = poll_fn(|cx| io.poll_ready(cx)).await;
-                Ok((res, send)) => {
+    if let Err(e) = res {
+        release(io, pool, created, e.is_io());
+        return Err(SendRequestError::from(e));
+    }
+
+    let resp = match io.send_request(req, eof) {
+        Ok((fut, send)) => {
             release(io, pool, created, false);
 
             if !eof {
-                        Either::A(Either::B(
+                send_body(body, send).await?;
-                            SendBody {
-                                body,
-                                send,
-                                buf: None,
-                            }
-                            .and_then(move |_| res.map_err(SendRequestError::from)),
-                        ))
-                    } else {
-                        Either::B(res.map_err(SendRequestError::from))
             }
+            fut.await.map_err(SendRequestError::from)?
         }
         Err(e) => {
             release(io, pool, created, e.is_io());
-                    Either::A(Either::A(err(e.into())))
+            return Err(e.into());
         }
-            }
+    };
-        })
+
-        .and_then(move |resp| {
     let (parts, body) = resp.into_parts();
     let payload = if head_req { Payload::None } else { body.into() };
 
@@ -108,66 +122,57 @@ where
     head.version = parts.version;
     head.headers = parts.headers.into();
     Ok((head, payload))
-        })
-        .from_err()
 }
 
-struct SendBody<B: MessageBody> {
+async fn send_body<B: MessageBody>(
     body: B,
-    send: SendStream<Bytes>,
+    mut send: SendStream<Bytes>,
-    buf: Option<Bytes>,
+) -> Result<(), SendRequestError> {
-}
+    let mut buf = None;
-
+    pin_mut!(body);
-impl<B: MessageBody> Future for SendBody<B> {
-    type Item = ();
-    type Error = SendRequestError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
     loop {
-            if self.buf.is_none() {
+        if buf.is_none() {
-                match self.body.poll_next() {
+            match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
-                    Ok(Async::Ready(Some(buf))) => {
+                Some(Ok(b)) => {
-                        self.send.reserve_capacity(buf.len());
+                    send.reserve_capacity(b.len());
-                        self.buf = Some(buf);
+                    buf = Some(b);
                 }
-                    Ok(Async::Ready(None)) => {
+                Some(Err(e)) => return Err(e.into()),
-                        if let Err(e) = self.send.send_data(Bytes::new(), true) {
+                None => {
+                    if let Err(e) = send.send_data(Bytes::new(), true) {
                         return Err(e.into());
                     }
-                        self.send.reserve_capacity(0);
+                    send.reserve_capacity(0);
-                        return Ok(Async::Ready(()));
+                    return Ok(());
                 }
-                    Ok(Async::NotReady) => return Ok(Async::NotReady),
-                    Err(e) => return Err(e.into()),
             }
         }
 
-            match self.send.poll_capacity() {
+        match poll_fn(|cx| send.poll_capacity(cx)).await {
-                Ok(Async::NotReady) => return Ok(Async::NotReady),
+            None => return Ok(()),
-                Ok(Async::Ready(None)) => return Ok(Async::Ready(())),
+            Some(Ok(cap)) => {
-                Ok(Async::Ready(Some(cap))) => {
+                let b = buf.as_mut().unwrap();
-                    let mut buf = self.buf.take().unwrap();
+                let len = b.len();
-                    let len = buf.len();
+                let bytes = b.split_to(std::cmp::min(cap, len));
-                    let bytes = buf.split_to(std::cmp::min(cap, len));
 
-                    if let Err(e) = self.send.send_data(bytes, false) {
+                if let Err(e) = send.send_data(bytes, false) {
                     return Err(e.into());
                 } else {
-                        if !buf.is_empty() {
+                    if !b.is_empty() {
-                            self.send.reserve_capacity(buf.len());
+                        send.reserve_capacity(b.len());
-                            self.buf = Some(buf);
+                    } else {
+                        buf = None;
                     }
                     continue;
                 }
             }
-                Err(e) => return Err(e.into()),
+            Some(Err(e)) => return Err(e.into()),
-            }
         }
     }
 }
 
 // release SendRequest object
-fn release<T: AsyncRead + AsyncWrite + 'static>(
+fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
     io: SendRequest<Bytes>,
     pool: Option<Acquired<T>>,
     created: time::Instant,
@@ -181,3 +186,18 @@ fn release<T: AsyncRead + AsyncWrite + 'static>(
         }
     }
 }
+
+pub(crate) fn handshake<Io>(
+    io: Io,
+    config: &ConnectorConfig,
+) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
+where
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+{
+    let mut builder = Builder::new();
+    builder
+        .initial_window_size(config.stream_window_size)
+        .initial_connection_window_size(config.conn_window_size)
+        .enable_push(false);
+    builder.handshake(io)
+}

actix-http/src/client/mod.rs

@@ -1,6 +1,7 @@
 //! Http client api
 use http::Uri;
 
+mod config;
 mod connection;
 mod connector;
 mod error;
@@ -10,7 +11,7 @@ mod pool;
 
 pub use self::connection::Connection;
 pub use self::connector::Connector;
-pub use self::error::{ConnectError, InvalidUrl, SendRequestError};
+pub use self::error::{ConnectError, FreezeRequestError, InvalidUrl, SendRequestError};
 pub use self::pool::Protocol;
 
 #[derive(Clone)]

actix-http/src/client/pool.rs

@@ -1,25 +1,28 @@
 use std::cell::RefCell;
 use std::collections::VecDeque;
-use std::io;
+use std::future::Future;
+use std::pin::Pin;
 use std::rc::Rc;
+use std::task::{Context, Poll};
 use std::time::{Duration, Instant};
 
 use actix_codec::{AsyncRead, AsyncWrite};
+use actix_rt::time::{delay_for, Delay};
 use actix_service::Service;
+use actix_utils::{oneshot, task::LocalWaker};
 use bytes::Bytes;
-use futures::future::{err, ok, Either, FutureResult};
+use futures_util::future::{poll_fn, FutureExt, LocalBoxFuture};
-use futures::task::AtomicTask;
+use fxhash::FxHashMap;
-use futures::unsync::oneshot;
+use h2::client::{Connection, SendRequest};
-use futures::{Async, Future, Poll};
-use h2::client::{handshake, Handshake};
-use hashbrown::HashMap;
 use http::uri::Authority;
 use indexmap::IndexSet;
+use pin_project::pin_project;
 use slab::Slab;
-use tokio_timer::{sleep, Delay};
 
+use super::config::ConnectorConfig;
 use super::connection::{ConnectionType, IoConnection};
 use super::error::ConnectError;
+use super::h2proto::handshake;
 use super::Connect;
 
 #[derive(Clone, Copy, PartialEq)]
@@ -41,247 +44,202 @@ impl From<Authority> for Key {
 }
 
 /// Connections pool
-pub(crate) struct ConnectionPool<T, Io: AsyncRead + AsyncWrite + 'static>(
+pub(crate) struct ConnectionPool<T, Io: 'static>(Rc<RefCell<T>>, Rc<RefCell<Inner<Io>>>);
-    T,
-    Rc<RefCell<Inner<Io>>>,
-);
 
 impl<T, Io> ConnectionPool<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
     T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-        + Clone
         + 'static,
 {
-    pub(crate) fn new(
+    pub(crate) fn new(connector: T, config: ConnectorConfig) -> Self {
-        connector: T,
+        let connector_rc = Rc::new(RefCell::new(connector));
-        conn_lifetime: Duration,
+        let inner_rc = Rc::new(RefCell::new(Inner {
-        conn_keep_alive: Duration,
+            config,
-        disconnect_timeout: Option<Duration>,
-        limit: usize,
-    ) -> Self {
-        ConnectionPool(
-            connector,
-            Rc::new(RefCell::new(Inner {
-                conn_lifetime,
-                conn_keep_alive,
-                disconnect_timeout,
-                limit,
             acquired: 0,
             waiters: Slab::new(),
             waiters_queue: IndexSet::new(),
-                available: HashMap::new(),
+            available: FxHashMap::default(),
-                task: None,
+            waker: LocalWaker::new(),
-            })),
+        }));
-        )
+
+        // start support future
+        actix_rt::spawn(ConnectorPoolSupport {
+            connector: Rc::clone(&connector_rc),
+            inner: Rc::clone(&inner_rc),
+        });
+
+        ConnectionPool(connector_rc, inner_rc)
     }
 }
 
 impl<T, Io> Clone for ConnectionPool<T, Io>
 where
-    T: Clone,
+    Io: 'static,
-    Io: AsyncRead + AsyncWrite + 'static,
 {
     fn clone(&self) -> Self {
         ConnectionPool(self.0.clone(), self.1.clone())
     }
 }
 
+impl<T, Io> Drop for ConnectionPool<T, Io> {
+    fn drop(&mut self) {
+        // wake up the ConnectorPoolSupport when dropping so it can exit properly.
+        self.1.borrow().waker.wake();
+    }
+}
+
 impl<T, Io> Service for ConnectionPool<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
     T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-        + Clone
         + 'static,
 {
     type Request = Connect;
     type Response = IoConnection<Io>;
     type Error = ConnectError;
-    type Future = Either<
+    type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
-        FutureResult<Self::Response, Self::Error>,
-        Either<WaitForConnection<Io>, OpenConnection<T::Future, Io>>,
-    >;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        self.0.poll_ready()
+        self.0.poll_ready(cx)
     }
 
     fn call(&mut self, req: Connect) -> Self::Future {
-        let key = if let Some(authority) = req.uri.authority_part() {
+        let mut connector = self.0.clone();
+        let inner = self.1.clone();
+
+        let fut = async move {
+            let key = if let Some(authority) = req.uri.authority() {
                 authority.clone().into()
             } else {
-            return Either::A(err(ConnectError::Unresolverd));
+                return Err(ConnectError::Unresolved);
             };
 
             // acquire connection
-        match self.1.as_ref().borrow_mut().acquire(&key) {
+            match poll_fn(|cx| Poll::Ready(inner.borrow_mut().acquire(&key, cx))).await {
                 Acquire::Acquired(io, created) => {
                     // use existing connection
-                return Either::A(ok(IoConnection::new(
+                    Ok(IoConnection::new(
                         io,
                         created,
-                    Some(Acquired(key, Some(self.1.clone()))),
+                        Some(Acquired(key, Some(inner))),
-                )));
+                    ))
                 }
                 Acquire::Available => {
-                // open new connection
+                    // open tcp connection
-                return Either::B(Either::B(OpenConnection::new(
+                    let (io, proto) = connector.call(req).await?;
-                    key,
-                    self.1.clone(),
-                    self.0.call(req),
-                )));
-            }
-            _ => (),
-        }
 
+                    let config = inner.borrow().config.clone();
+
+                    let guard = OpenGuard::new(key, inner);
+
+                    if proto == Protocol::Http1 {
+                        Ok(IoConnection::new(
+                            ConnectionType::H1(io),
+                            Instant::now(),
+                            Some(guard.consume()),
+                        ))
+                    } else {
+                        let (snd, connection) = handshake(io, &config).await?;
+                        actix_rt::spawn(connection.map(|_| ()));
+                        Ok(IoConnection::new(
+                            ConnectionType::H2(snd),
+                            Instant::now(),
+                            Some(guard.consume()),
+                        ))
+                    }
+                }
+                _ => {
                     // connection is not available, wait
-        let (rx, token, support) = self.1.as_ref().borrow_mut().wait_for(req);
+                    let (rx, token) = inner.borrow_mut().wait_for(req);
 
-        // start support future
+                    let guard = WaiterGuard::new(key, token, inner);
-        if !support {
+                    let res = match rx.await {
-            self.1.as_ref().borrow_mut().task = Some(AtomicTask::new());
+                        Err(_) => Err(ConnectError::Disconnected),
-            tokio_current_thread::spawn(ConnectorPoolSupport {
+                        Ok(res) => res,
-                connector: self.0.clone(),
+                    };
-                inner: self.1.clone(),
+                    guard.consume();
-            })
+                    res
                 }
+            }
+        };
 
-        Either::B(Either::A(WaitForConnection {
+        fut.boxed_local()
-            rx,
-            key,
-            token,
-            inner: Some(self.1.clone()),
-        }))
     }
 }
 
-#[doc(hidden)]
+struct WaiterGuard<Io>
-pub struct WaitForConnection<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     key: Key,
     token: usize,
-    rx: oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
     inner: Option<Rc<RefCell<Inner<Io>>>>,
 }
 
-impl<Io> Drop for WaitForConnection<Io>
+impl<Io> WaiterGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+{
+    fn new(key: Key, token: usize, inner: Rc<RefCell<Inner<Io>>>) -> Self {
+        Self {
+            key,
+            token,
+            inner: Some(inner),
+        }
+    }
+
+    fn consume(mut self) {
+        let _ = self.inner.take();
+    }
+}
+
+impl<Io> Drop for WaiterGuard<Io>
+where
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     fn drop(&mut self) {
         if let Some(i) = self.inner.take() {
             let mut inner = i.as_ref().borrow_mut();
             inner.release_waiter(&self.key, self.token);
-            inner.check_availibility();
+            inner.check_availability();
         }
     }
 }
 
-impl<Io> Future for WaitForConnection<Io>
+struct OpenGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    type Item = IoConnection<Io>;
-    type Error = ConnectError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        match self.rx.poll() {
-            Ok(Async::Ready(item)) => match item {
-                Err(err) => Err(err),
-                Ok(conn) => {
-                    let _ = self.inner.take();
-                    Ok(Async::Ready(conn))
-                }
-            },
-            Ok(Async::NotReady) => Ok(Async::NotReady),
-            Err(_) => {
-                let _ = self.inner.take();
-                Err(ConnectError::Disconnected)
-            }
-        }
-    }
-}
-
-#[doc(hidden)]
-pub struct OpenConnection<F, Io>
-where
-    Io: AsyncRead + AsyncWrite + 'static,
-{
-    fut: F,
     key: Key,
-    h2: Option<Handshake<Io, Bytes>>,
     inner: Option<Rc<RefCell<Inner<Io>>>>,
 }
 
-impl<F, Io> OpenConnection<F, Io>
+impl<Io> OpenGuard<Io>
 where
-    F: Future<Item = (Io, Protocol), Error = ConnectError>,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-    Io: AsyncRead + AsyncWrite + 'static,
 {
-    fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>, fut: F) -> Self {
+    fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>) -> Self {
-        OpenConnection {
+        Self {
             key,
-            fut,
             inner: Some(inner),
-            h2: None,
-        }
         }
     }
 
-impl<F, Io> Drop for OpenConnection<F, Io>
+    fn consume(mut self) -> Acquired<Io> {
+        Acquired(self.key.clone(), self.inner.take())
+    }
+}
+
+impl<Io> Drop for OpenGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     fn drop(&mut self) {
-        if let Some(inner) = self.inner.take() {
+        if let Some(i) = self.inner.take() {
-            let mut inner = inner.as_ref().borrow_mut();
+            let mut inner = i.as_ref().borrow_mut();
             inner.release();
-            inner.check_availibility();
+            inner.check_availability();
-        }
-    }
-}
-
-impl<F, Io> Future for OpenConnection<F, Io>
-where
-    F: Future<Item = (Io, Protocol), Error = ConnectError>,
-    Io: AsyncRead + AsyncWrite,
-{
-    type Item = IoConnection<Io>;
-    type Error = ConnectError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        if let Some(ref mut h2) = self.h2 {
-            return match h2.poll() {
-                Ok(Async::Ready((snd, connection))) => {
-                    tokio_current_thread::spawn(connection.map_err(|_| ()));
-                    Ok(Async::Ready(IoConnection::new(
-                        ConnectionType::H2(snd),
-                        Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
-                    )))
-                }
-                Ok(Async::NotReady) => Ok(Async::NotReady),
-                Err(e) => Err(e.into()),
-            };
-        }
-
-        match self.fut.poll() {
-            Err(err) => Err(err),
-            Ok(Async::Ready((io, proto))) => {
-                if proto == Protocol::Http1 {
-                    Ok(Async::Ready(IoConnection::new(
-                        ConnectionType::H1(io),
-                        Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
-                    )))
-                } else {
-                    self.h2 = Some(handshake(io));
-                    self.poll()
-                }
-            }
-            Ok(Async::NotReady) => Ok(Async::NotReady),
         }
     }
 }
@@ -299,12 +257,9 @@ struct AvailableConnection<Io> {
 }
 
 pub(crate) struct Inner<Io> {
-    conn_lifetime: Duration,
+    config: ConnectorConfig,
-    conn_keep_alive: Duration,
-    disconnect_timeout: Option<Duration>,
-    limit: usize,
     acquired: usize,
-    available: HashMap<Key, VecDeque<AvailableConnection<Io>>>,
+    available: FxHashMap<Key, VecDeque<AvailableConnection<Io>>>,
     waiters: Slab<
         Option<(
             Connect,
@@ -312,7 +267,7 @@ pub(crate) struct Inner<Io> {
         )>,
     >,
     waiters_queue: IndexSet<(Key, usize)>,
-    task: Option<AtomicTask>,
+    waker: LocalWaker,
 }
 
 impl<Io> Inner<Io> {
@@ -326,13 +281,13 @@ impl<Io> Inner<Io> {
 
     fn release_waiter(&mut self, key: &Key, token: usize) {
         self.waiters.remove(token);
-        self.waiters_queue.remove(&(key.clone(), token));
+        let _ = self.waiters_queue.shift_remove(&(key.clone(), token));
     }
 }
 
 impl<Io> Inner<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     /// connection is not available, wait
     fn wait_for(
@@ -341,22 +296,21 @@ where
     ) -> (
         oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
         usize,
-        bool,
     ) {
         let (tx, rx) = oneshot::channel();
 
-        let key: Key = connect.uri.authority_part().unwrap().clone().into();
+        let key: Key = connect.uri.authority().unwrap().clone().into();
         let entry = self.waiters.vacant_entry();
         let token = entry.key();
         entry.insert(Some((connect, tx)));
         assert!(self.waiters_queue.insert((key, token)));
 
-        (rx, token, self.task.is_some())
+        (rx, token)
     }
 
-    fn acquire(&mut self, key: &Key) -> Acquire<Io> {
+    fn acquire(&mut self, key: &Key, cx: &mut Context<'_>) -> Acquire<Io> {
         // check limits
-        if self.limit > 0 && self.acquired >= self.limit {
+        if self.config.limit > 0 && self.acquired >= self.config.limit {
             return Acquire::NotAvailable;
         }
 
@@ -368,33 +322,31 @@ where
             let now = Instant::now();
             while let Some(conn) = connections.pop_back() {
                 // check if it still usable
-                if (now - conn.used) > self.conn_keep_alive
+                if (now - conn.used) > self.config.conn_keep_alive
-                    || (now - conn.created) > self.conn_lifetime
+                    || (now - conn.created) > self.config.conn_lifetime
                 {
-                    if let Some(timeout) = self.disconnect_timeout {
+                    if let Some(timeout) = self.config.disconnect_timeout {
                         if let ConnectionType::H1(io) = conn.io {
-                            tokio_current_thread::spawn(CloseConnection::new(
+                            actix_rt::spawn(CloseConnection::new(io, timeout))
-                                io, timeout,
-                            ))
                         }
                     }
                 } else {
                     let mut io = conn.io;
                     let mut buf = [0; 2];
                     if let ConnectionType::H1(ref mut s) = io {
-                        match s.read(&mut buf) {
+                        match Pin::new(s).poll_read(cx, &mut buf) {
-                            Err(ref e) if e.kind() == io::ErrorKind::WouldBlock => (),
+                            Poll::Pending => (),
-                            Ok(n) if n > 0 => {
+                            Poll::Ready(Ok(n)) if n > 0 => {
-                                if let Some(timeout) = self.disconnect_timeout {
+                                if let Some(timeout) = self.config.disconnect_timeout {
                                     if let ConnectionType::H1(io) = io {
-                                        tokio_current_thread::spawn(
+                                        actix_rt::spawn(CloseConnection::new(
-                                            CloseConnection::new(io, timeout),
+                                            io, timeout,
-                                        )
+                                        ))
                                     }
                                 }
                                 continue;
                             }
-                            Ok(_) | Err(_) => continue,
+                            _ => continue,
                         }
                     }
                     return Acquire::Acquired(io, conn.created);
@@ -414,24 +366,22 @@ where
                 created,
                 used: Instant::now(),
             });
-        self.check_availibility();
+        self.check_availability();
     }
 
     fn release_close(&mut self, io: ConnectionType<Io>) {
         self.acquired -= 1;
-        if let Some(timeout) = self.disconnect_timeout {
+        if let Some(timeout) = self.config.disconnect_timeout {
             if let ConnectionType::H1(io) = io {
-                tokio_current_thread::spawn(CloseConnection::new(io, timeout))
+                actix_rt::spawn(CloseConnection::new(io, timeout))
             }
         }
-        self.check_availibility();
+        self.check_availability();
     }
 
-    fn check_availibility(&self) {
+    fn check_availability(&self) {
-        if !self.waiters_queue.is_empty() && self.acquired < self.limit {
+        if !self.waiters_queue.is_empty() && self.acquired < self.config.limit {
-            if let Some(t) = self.task.as_ref() {
+            self.waker.wake();
-                t.notify()
-            }
         }
     }
 }
@@ -443,37 +393,39 @@ struct CloseConnection<T> {
 
 impl<T> CloseConnection<T>
 where
-    T: AsyncWrite,
+    T: AsyncWrite + Unpin,
 {
     fn new(io: T, timeout: Duration) -> Self {
         CloseConnection {
             io,
-            timeout: sleep(timeout),
+            timeout: delay_for(timeout),
         }
     }
 }
 
 impl<T> Future for CloseConnection<T>
 where
-    T: AsyncWrite,
+    T: AsyncWrite + Unpin,
 {
-    type Item = ();
+    type Output = ();
-    type Error = ();
 
-    fn poll(&mut self) -> Poll<(), ()> {
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<()> {
-        match self.timeout.poll() {
+        let this = self.get_mut();
-            Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
+
-            Ok(Async::NotReady) => match self.io.shutdown() {
+        match Pin::new(&mut this.timeout).poll(cx) {
-                Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
+            Poll::Ready(_) => Poll::Ready(()),
-                Ok(Async::NotReady) => Ok(Async::NotReady),
+            Poll::Pending => match Pin::new(&mut this.io).poll_shutdown(cx) {
+                Poll::Ready(_) => Poll::Ready(()),
+                Poll::Pending => Poll::Pending,
             },
         }
     }
 }
 
+#[pin_project]
 struct ConnectorPoolSupport<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     connector: T,
     inner: Rc<RefCell<Inner<Io>>>,
@@ -481,16 +433,23 @@ where
 
 impl<T, Io> Future for ConnectorPoolSupport<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
     T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>,
     T::Future: 'static,
 {
-    type Item = ();
+    type Output = ();
-    type Error = ();
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let mut inner = self.inner.as_ref().borrow_mut();
+        let this = self.project();
-        inner.task.as_ref().unwrap().register();
+
+        if Rc::strong_count(this.inner) == 1 {
+            // If we are last copy of Inner<Io> it means the ConnectionPool is already gone
+            // and we are safe to exit.
+            return Poll::Ready(());
+        }
+
+        let mut inner = this.inner.borrow_mut();
+        inner.waker.register(cx.waker());
 
         // check waiters
         loop {
@@ -505,14 +464,14 @@ where
                 continue;
             }
 
-            match inner.acquire(&key) {
+            match inner.acquire(&key, cx) {
                 Acquire::NotAvailable => break,
                 Acquire::Acquired(io, created) => {
                     let tx = inner.waiters.get_mut(token).unwrap().take().unwrap().1;
                     if let Err(conn) = tx.send(Ok(IoConnection::new(
                         io,
                         created,
-                        Some(Acquired(key.clone(), Some(self.inner.clone()))),
+                        Some(Acquired(key.clone(), Some(this.inner.clone()))),
                     ))) {
                         let (io, created) = conn.unwrap().into_inner();
                         inner.release_conn(&key, io, created);
@@ -524,118 +483,131 @@ where
                     OpenWaitingConnection::spawn(
                         key.clone(),
                         tx,
-                        self.inner.clone(),
+                        this.inner.clone(),
-                        self.connector.call(connect),
+                        this.connector.call(connect),
+                        inner.config.clone(),
                     );
                 }
             }
             let _ = inner.waiters_queue.swap_remove_index(0);
         }
 
-        Ok(Async::NotReady)
+        Poll::Pending
     }
 }
 
+#[pin_project::pin_project(PinnedDrop)]
 struct OpenWaitingConnection<F, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
+    #[pin]
     fut: F,
     key: Key,
-    h2: Option<Handshake<Io, Bytes>>,
+    h2: Option<
+        LocalBoxFuture<
+            'static,
+            Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>,
+        >,
+    >,
     rx: Option<oneshot::Sender<Result<IoConnection<Io>, ConnectError>>>,
     inner: Option<Rc<RefCell<Inner<Io>>>>,
+    config: ConnectorConfig,
 }
 
 impl<F, Io> OpenWaitingConnection<F, Io>
 where
-    F: Future<Item = (Io, Protocol), Error = ConnectError> + 'static,
+    F: Future<Output = Result<(Io, Protocol), ConnectError>> + 'static,
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     fn spawn(
         key: Key,
         rx: oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
         inner: Rc<RefCell<Inner<Io>>>,
         fut: F,
+        config: ConnectorConfig,
     ) {
-        tokio_current_thread::spawn(OpenWaitingConnection {
+        actix_rt::spawn(OpenWaitingConnection {
             key,
             fut,
             h2: None,
             rx: Some(rx),
             inner: Some(inner),
+            config,
         })
     }
 }
 
-impl<F, Io> Drop for OpenWaitingConnection<F, Io>
+#[pin_project::pinned_drop]
+impl<F, Io> PinnedDrop for OpenWaitingConnection<F, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    fn drop(&mut self) {
+    fn drop(self: Pin<&mut Self>) {
-        if let Some(inner) = self.inner.take() {
+        if let Some(inner) = self.project().inner.take() {
             let mut inner = inner.as_ref().borrow_mut();
             inner.release();
-            inner.check_availibility();
+            inner.check_availability();
         }
     }
 }
 
 impl<F, Io> Future for OpenWaitingConnection<F, Io>
 where
-    F: Future<Item = (Io, Protocol), Error = ConnectError>,
+    F: Future<Output = Result<(Io, Protocol), ConnectError>>,
-    Io: AsyncRead + AsyncWrite,
+    Io: AsyncRead + AsyncWrite + Unpin,
 {
-    type Item = ();
+    type Output = ();
-    type Error = ();
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        if let Some(ref mut h2) = self.h2 {
+        let this = self.as_mut().project();
-            return match h2.poll() {
+
-                Ok(Async::Ready((snd, connection))) => {
+        if let Some(ref mut h2) = this.h2 {
-                    tokio_current_thread::spawn(connection.map_err(|_| ()));
+            return match Pin::new(h2).poll(cx) {
-                    let rx = self.rx.take().unwrap();
+                Poll::Ready(Ok((snd, connection))) => {
+                    actix_rt::spawn(connection.map(|_| ()));
+                    let rx = this.rx.take().unwrap();
                     let _ = rx.send(Ok(IoConnection::new(
                         ConnectionType::H2(snd),
                         Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
+                        Some(Acquired(this.key.clone(), this.inner.take())),
                     )));
-                    Ok(Async::Ready(()))
+                    Poll::Ready(())
                 }
-                Ok(Async::NotReady) => Ok(Async::NotReady),
+                Poll::Pending => Poll::Pending,
-                Err(err) => {
+                Poll::Ready(Err(err)) => {
-                    let _ = self.inner.take();
+                    let _ = this.inner.take();
-                    if let Some(rx) = self.rx.take() {
+                    if let Some(rx) = this.rx.take() {
                         let _ = rx.send(Err(ConnectError::H2(err)));
                     }
-                    Err(())
+                    Poll::Ready(())
                 }
             };
         }
 
-        match self.fut.poll() {
+        match this.fut.poll(cx) {
-            Err(err) => {
+            Poll::Ready(Err(err)) => {
-                let _ = self.inner.take();
+                let _ = this.inner.take();
-                if let Some(rx) = self.rx.take() {
+                if let Some(rx) = this.rx.take() {
                     let _ = rx.send(Err(err));
                 }
-                Err(())
+                Poll::Ready(())
             }
-            Ok(Async::Ready((io, proto))) => {
+            Poll::Ready(Ok((io, proto))) => {
                 if proto == Protocol::Http1 {
-                    let rx = self.rx.take().unwrap();
+                    let rx = this.rx.take().unwrap();
                     let _ = rx.send(Ok(IoConnection::new(
                         ConnectionType::H1(io),
                         Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
+                        Some(Acquired(this.key.clone(), this.inner.take())),
                     )));
-                    Ok(Async::Ready(()))
+                    Poll::Ready(())
                 } else {
-                    self.h2 = Some(handshake(io));
+                    *this.h2 = Some(handshake(io, this.config).boxed_local());
-                    self.poll()
+                    self.poll(cx)
                 }
             }
-            Ok(Async::NotReady) => Ok(Async::NotReady),
+            Poll::Pending => Poll::Pending,
         }
     }
 }
@@ -644,7 +616,7 @@ pub(crate) struct Acquired<T>(Key, Option<Rc<RefCell<Inner<T>>>>);
 
 impl<T> Acquired<T>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     pub(crate) fn close(&mut self, conn: IoConnection<T>) {
         if let Some(inner) = self.1.take() {

actix-http/src/cloneable.rs

@@ -1,42 +1,40 @@
-use std::cell::UnsafeCell;
+use std::cell::RefCell;
 use std::rc::Rc;
+use std::task::{Context, Poll};
 
 use actix_service::Service;
-use futures::Poll;
 
 #[doc(hidden)]
 /// Service that allows to turn non-clone service to a service with `Clone` impl
-pub(crate) struct CloneableService<T>(Rc<UnsafeCell<T>>);
+///
+/// # Panics
+/// CloneableService might panic with some creative use of thread local storage.
+/// See https://github.com/actix/actix-web/issues/1295 for example
+pub(crate) struct CloneableService<T: Service>(Rc<RefCell<T>>);
 
-impl<T> CloneableService<T> {
+impl<T: Service> CloneableService<T> {
-    pub(crate) fn new(service: T) -> Self
+    pub(crate) fn new(service: T) -> Self {
-    where
+        Self(Rc::new(RefCell::new(service)))
-        T: Service,
-    {
-        Self(Rc::new(UnsafeCell::new(service)))
     }
 }
 
-impl<T> Clone for CloneableService<T> {
+impl<T: Service> Clone for CloneableService<T> {
     fn clone(&self) -> Self {
         Self(self.0.clone())
     }
 }
 
-impl<T> Service for CloneableService<T>
+impl<T: Service> Service for CloneableService<T> {
-where
-    T: Service,
-{
     type Request = T::Request;
     type Response = T::Response;
     type Error = T::Error;
     type Future = T::Future;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        unsafe { &mut *self.0.as_ref().get() }.poll_ready()
+        self.0.borrow_mut().poll_ready(cx)
     }
 
     fn call(&mut self, req: T::Request) -> Self::Future {
-        unsafe { &mut *self.0.as_ref().get() }.call(req)
+        self.0.borrow_mut().call(req)
     }
 }

actix-http/src/config.rs

@@ -1,13 +1,13 @@
-use std::cell::UnsafeCell;
+use std::cell::Cell;
-use std::fmt;
 use std::fmt::Write;
 use std::rc::Rc;
-use std::time::{Duration, Instant};
+use std::time::Duration;
+use std::{fmt, net};
 
+use actix_rt::time::{delay_for, delay_until, Delay, Instant};
 use bytes::BytesMut;
-use futures::{future, Future};
+use futures_util::{future, FutureExt};
-use time;
+use time::OffsetDateTime;
-use tokio_timer::{sleep, Delay};
 
 // "Sun, 06 Nov 1994 08:49:37 GMT".len()
 const DATE_VALUE_LENGTH: usize = 29;
@@ -17,7 +17,7 @@ const DATE_VALUE_LENGTH: usize = 29;
 pub enum KeepAlive {
     /// Keep alive in seconds
     Timeout(usize),
-    /// Relay on OS to shutdown tcp connection
+    /// Rely on OS to shutdown tcp connection
     Os,
     /// Disabled
     Disabled,
@@ -47,6 +47,8 @@ struct Inner {
     client_timeout: u64,
     client_disconnect: u64,
     ka_enabled: bool,
+    secure: bool,
+    local_addr: Option<std::net::SocketAddr>,
     timer: DateService,
 }
 
@@ -58,7 +60,7 @@ impl Clone for ServiceConfig {
 
 impl Default for ServiceConfig {
     fn default() -> Self {
-        Self::new(KeepAlive::Timeout(5), 0, 0)
+        Self::new(KeepAlive::Timeout(5), 0, 0, false, None)
     }
 }
 
@@ -68,6 +70,8 @@ impl ServiceConfig {
         keep_alive: KeepAlive,
         client_timeout: u64,
         client_disconnect: u64,
+        secure: bool,
+        local_addr: Option<net::SocketAddr>,
     ) -> ServiceConfig {
         let (keep_alive, ka_enabled) = match keep_alive {
             KeepAlive::Timeout(val) => (val as u64, true),
@@ -85,10 +89,24 @@ impl ServiceConfig {
             ka_enabled,
             client_timeout,
             client_disconnect,
+            secure,
+            local_addr,
             timer: DateService::new(),
         }))
     }
 
+    #[inline]
+    /// Returns true if connection is secure(https)
+    pub fn secure(&self) -> bool {
+        self.0.secure
+    }
+
+    #[inline]
+    /// Returns the local address that this server is bound to.
+    pub fn local_addr(&self) -> Option<net::SocketAddr> {
+        self.0.local_addr
+    }
+
     #[inline]
     /// Keep alive duration if configured.
     pub fn keep_alive(&self) -> Option<Duration> {
@@ -96,7 +114,7 @@ impl ServiceConfig {
     }
 
     #[inline]
-    /// Return state of connection keep-alive funcitonality
+    /// Return state of connection keep-alive functionality
     pub fn keep_alive_enabled(&self) -> bool {
         self.0.ka_enabled
     }
@@ -104,10 +122,10 @@ impl ServiceConfig {
     #[inline]
     /// Client timeout for first request.
     pub fn client_timer(&self) -> Option<Delay> {
-        let delay = self.0.client_timeout;
+        let delay_time = self.0.client_timeout;
-        if delay != 0 {
+        if delay_time != 0 {
-            Some(Delay::new(
+            Some(delay_until(
-                self.0.timer.now() + Duration::from_millis(delay),
+                self.0.timer.now() + Duration::from_millis(delay_time),
             ))
         } else {
             None
@@ -138,7 +156,7 @@ impl ServiceConfig {
     /// Return keep-alive timer delay is configured.
     pub fn keep_alive_timer(&self) -> Option<Delay> {
         if let Some(ka) = self.0.keep_alive {
-            Some(Delay::new(self.0.timer.now() + ka))
+            Some(delay_until(self.0.timer.now() + ka))
         } else {
             None
         }
@@ -191,9 +209,15 @@ impl Date {
         date.update();
         date
     }
+
     fn update(&mut self) {
         self.pos = 0;
-        write!(self, "{}", time::at_utc(time::get_time()).rfc822()).unwrap();
+        write!(
+            self,
+            "{}",
+            OffsetDateTime::now_utc().format("%a, %d %b %Y %H:%M:%S GMT")
+        )
+        .unwrap();
     }
 }
 
@@ -210,24 +234,24 @@ impl fmt::Write for Date {
 struct DateService(Rc<DateServiceInner>);
 
 struct DateServiceInner {
-    current: UnsafeCell<Option<(Date, Instant)>>,
+    current: Cell<Option<(Date, Instant)>>,
 }
 
 impl DateServiceInner {
     fn new() -> Self {
         DateServiceInner {
-            current: UnsafeCell::new(None),
+            current: Cell::new(None),
         }
     }
 
     fn reset(&self) {
-        unsafe { (&mut *self.current.get()).take() };
+        self.current.take();
     }
 
     fn update(&self) {
         let now = Instant::now();
         let date = Date::new();
-        *(unsafe { &mut *self.current.get() }) = Some((date, now));
+        self.current.set(Some((date, now)));
     }
 }
 
@@ -237,54 +261,55 @@ impl DateService {
     }
 
     fn check_date(&self) {
-        if unsafe { (&*self.0.current.get()).is_none() } {
+        if self.0.current.get().is_none() {
             self.0.update();
 
             // periodic date update
             let s = self.clone();
-            tokio_current_thread::spawn(sleep(Duration::from_millis(500)).then(
+            actix_rt::spawn(delay_for(Duration::from_millis(500)).then(move |_| {
-                move |_| {
                 s.0.reset();
-                    future::ok(())
+                future::ready(())
-                },
+            }));
-            ));
         }
     }
 
     fn now(&self) -> Instant {
         self.check_date();
-        unsafe { (&*self.0.current.get()).as_ref().unwrap().1 }
+        self.0.current.get().unwrap().1
     }
 
     fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
         self.check_date();
-        f(&unsafe { (&*self.0.current.get()).as_ref().unwrap().0 })
+        f(&self.0.current.get().unwrap().0);
     }
 }
 
 #[cfg(test)]
 mod tests {
     use super::*;
-    use actix_rt::System;
+
-    use futures::future;
+    // Test modifying the date from within the closure
+    // passed to `set_date`
+    #[test]
+    fn test_evil_date() {
+        let service = DateService::new();
+        // Make sure that `check_date` doesn't try to spawn a task
+        service.0.update();
+        service.set_date(|_| service.0.reset());
+    }
 
     #[test]
     fn test_date_len() {
         assert_eq!(DATE_VALUE_LENGTH, "Sun, 06 Nov 1994 08:49:37 GMT".len());
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_date() {
+    async fn test_date() {
-        let mut rt = System::new("test");
+        let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
-
-        let _ = rt.block_on(future::lazy(|| {
-            let settings = ServiceConfig::new(KeepAlive::Os, 0, 0);
         let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
         settings.set_date(&mut buf1);
         let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
         settings.set_date(&mut buf2);
         assert_eq!(buf1, buf2);
-            future::ok::<_, ()>(())
-        }));
     }
 }

actix-http/src/cookie/builder.rs

@@ -1,260 +0,0 @@
-use std::borrow::Cow;
-
-use chrono::Duration;
-use time::Tm;
-
-use super::{Cookie, SameSite};
-
-/// Structure that follows the builder pattern for building `Cookie` structs.
-///
-/// To construct a cookie:
-///
-///   1. Call [`Cookie::build`](struct.Cookie.html#method.build) to start building.
-///   2. Use any of the builder methods to set fields in the cookie.
-///   3. Call [finish](#method.finish) to retrieve the built cookie.
-///
-/// # Example
-///
-/// ```rust
-/// use actix_http::cookie::Cookie;
-///
-/// # fn main() {
-/// let cookie: Cookie = Cookie::build("name", "value")
-///     .domain("www.rust-lang.org")
-///     .path("/")
-///     .secure(true)
-///     .http_only(true)
-///     .max_age(84600)
-///     .finish();
-/// # }
-/// ```
-#[derive(Debug, Clone)]
-pub struct CookieBuilder {
-    /// The cookie being built.
-    cookie: Cookie<'static>,
-}
-
-impl CookieBuilder {
-    /// Creates a new `CookieBuilder` instance from the given name and value.
-    ///
-    /// This method is typically called indirectly via
-    /// [Cookie::build](struct.Cookie.html#method.build).
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar").finish();
-    /// assert_eq!(c.name_value(), ("foo", "bar"));
-    /// ```
-    pub fn new<N, V>(name: N, value: V) -> CookieBuilder
-    where
-        N: Into<Cow<'static, str>>,
-        V: Into<Cow<'static, str>>,
-    {
-        CookieBuilder {
-            cookie: Cookie::new(name, value),
-        }
-    }
-
-    /// Sets the `expires` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// # fn main() {
-    /// let c = Cookie::build("foo", "bar")
-    ///     .expires(time::now())
-    ///     .finish();
-    ///
-    /// assert!(c.expires().is_some());
-    /// # }
-    /// ```
-    #[inline]
-    pub fn expires(mut self, when: Tm) -> CookieBuilder {
-        self.cookie.set_expires(when);
-        self
-    }
-
-    /// Sets the `max_age` field in seconds in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// # fn main() {
-    /// let c = Cookie::build("foo", "bar")
-    ///     .max_age(1800)
-    ///     .finish();
-    ///
-    /// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
-    /// # }
-    /// ```
-    #[inline]
-    pub fn max_age(self, seconds: i64) -> CookieBuilder {
-        self.max_age_time(Duration::seconds(seconds))
-    }
-
-    /// Sets the `max_age` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// # fn main() {
-    /// let c = Cookie::build("foo", "bar")
-    ///     .max_age_time(time::Duration::minutes(30))
-    ///     .finish();
-    ///
-    /// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
-    /// # }
-    /// ```
-    #[inline]
-    pub fn max_age_time(mut self, value: Duration) -> CookieBuilder {
-        self.cookie.set_max_age(value);
-        self
-    }
-
-    /// Sets the `domain` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .domain("www.rust-lang.org")
-    ///     .finish();
-    ///
-    /// assert_eq!(c.domain(), Some("www.rust-lang.org"));
-    /// ```
-    pub fn domain<D: Into<Cow<'static, str>>>(mut self, value: D) -> CookieBuilder {
-        self.cookie.set_domain(value);
-        self
-    }
-
-    /// Sets the `path` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .path("/")
-    ///     .finish();
-    ///
-    /// assert_eq!(c.path(), Some("/"));
-    /// ```
-    pub fn path<P: Into<Cow<'static, str>>>(mut self, path: P) -> CookieBuilder {
-        self.cookie.set_path(path);
-        self
-    }
-
-    /// Sets the `secure` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .secure(true)
-    ///     .finish();
-    ///
-    /// assert_eq!(c.secure(), Some(true));
-    /// ```
-    #[inline]
-    pub fn secure(mut self, value: bool) -> CookieBuilder {
-        self.cookie.set_secure(value);
-        self
-    }
-
-    /// Sets the `http_only` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .http_only(true)
-    ///     .finish();
-    ///
-    /// assert_eq!(c.http_only(), Some(true));
-    /// ```
-    #[inline]
-    pub fn http_only(mut self, value: bool) -> CookieBuilder {
-        self.cookie.set_http_only(value);
-        self
-    }
-
-    /// Sets the `same_site` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{Cookie, SameSite};
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .same_site(SameSite::Strict)
-    ///     .finish();
-    ///
-    /// assert_eq!(c.same_site(), Some(SameSite::Strict));
-    /// ```
-    #[inline]
-    pub fn same_site(mut self, value: SameSite) -> CookieBuilder {
-        self.cookie.set_same_site(value);
-        self
-    }
-
-    /// Makes the cookie being built 'permanent' by extending its expiration and
-    /// max age 20 years into the future.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    /// use chrono::Duration;
-    ///
-    /// # fn main() {
-    /// let c = Cookie::build("foo", "bar")
-    ///     .permanent()
-    ///     .finish();
-    ///
-    /// assert_eq!(c.max_age(), Some(Duration::days(365 * 20)));
-    /// # assert!(c.expires().is_some());
-    /// # }
-    /// ```
-    #[inline]
-    pub fn permanent(mut self) -> CookieBuilder {
-        self.cookie.make_permanent();
-        self
-    }
-
-    /// Finishes building and returns the built `Cookie`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .domain("crates.io")
-    ///     .path("/")
-    ///     .finish();
-    ///
-    /// assert_eq!(c.name_value(), ("foo", "bar"));
-    /// assert_eq!(c.domain(), Some("crates.io"));
-    /// assert_eq!(c.path(), Some("/"));
-    /// ```
-    #[inline]
-    pub fn finish(self) -> Cookie<'static> {
-        self.cookie
-    }
-}

actix-http/src/cookie/delta.rs

@@ -1,71 +0,0 @@
-use std::borrow::Borrow;
-use std::hash::{Hash, Hasher};
-use std::ops::{Deref, DerefMut};
-
-use super::Cookie;
-
-/// A `DeltaCookie` is a helper structure used in a cookie jar. It wraps a
-/// `Cookie` so that it can be hashed and compared purely by name. It further
-/// records whether the wrapped cookie is a "removal" cookie, that is, a cookie
-/// that when sent to the client removes the named cookie on the client's
-/// machine.
-#[derive(Clone, Debug)]
-pub struct DeltaCookie {
-    pub cookie: Cookie<'static>,
-    pub removed: bool,
-}
-
-impl DeltaCookie {
-    /// Create a new `DeltaCookie` that is being added to a jar.
-    #[inline]
-    pub fn added(cookie: Cookie<'static>) -> DeltaCookie {
-        DeltaCookie {
-            cookie,
-            removed: false,
-        }
-    }
-
-    /// Create a new `DeltaCookie` that is being removed from a jar. The
-    /// `cookie` should be a "removal" cookie.
-    #[inline]
-    pub fn removed(cookie: Cookie<'static>) -> DeltaCookie {
-        DeltaCookie {
-            cookie,
-            removed: true,
-        }
-    }
-}
-
-impl Deref for DeltaCookie {
-    type Target = Cookie<'static>;
-
-    fn deref(&self) -> &Cookie<'static> {
-        &self.cookie
-    }
-}
-
-impl DerefMut for DeltaCookie {
-    fn deref_mut(&mut self) -> &mut Cookie<'static> {
-        &mut self.cookie
-    }
-}
-
-impl PartialEq for DeltaCookie {
-    fn eq(&self, other: &DeltaCookie) -> bool {
-        self.name() == other.name()
-    }
-}
-
-impl Eq for DeltaCookie {}
-
-impl Hash for DeltaCookie {
-    fn hash<H: Hasher>(&self, state: &mut H) {
-        self.name().hash(state);
-    }
-}
-
-impl Borrow<str> for DeltaCookie {
-    fn borrow(&self) -> &str {
-        self.name()
-    }
-}

actix-http/src/cookie/draft.rs

@@ -1,98 +0,0 @@
-//! This module contains types that represent cookie properties that are not yet
-//! standardized. That is, _draft_ features.
-
-use std::fmt;
-
-/// The `SameSite` cookie attribute.
-///
-/// A cookie with a `SameSite` attribute is imposed restrictions on when it is
-/// sent to the origin server in a cross-site request. If the `SameSite`
-/// attribute is "Strict", then the cookie is never sent in cross-site requests.
-/// If the `SameSite` attribute is "Lax", the cookie is only sent in cross-site
-/// requests with "safe" HTTP methods, i.e, `GET`, `HEAD`, `OPTIONS`, `TRACE`.
-/// If the `SameSite` attribute is not present (made explicit via the
-/// `SameSite::None` variant), then the cookie will be sent as normal.
-///
-/// **Note:** This cookie attribute is an HTTP draft! Its meaning and definition
-/// are subject to change.
-#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
-pub enum SameSite {
-    /// The "Strict" `SameSite` attribute.
-    Strict,
-    /// The "Lax" `SameSite` attribute.
-    Lax,
-    /// No `SameSite` attribute.
-    None,
-}
-
-impl SameSite {
-    /// Returns `true` if `self` is `SameSite::Strict` and `false` otherwise.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::SameSite;
-    ///
-    /// let strict = SameSite::Strict;
-    /// assert!(strict.is_strict());
-    /// assert!(!strict.is_lax());
-    /// assert!(!strict.is_none());
-    /// ```
-    #[inline]
-    pub fn is_strict(self) -> bool {
-        match self {
-            SameSite::Strict => true,
-            SameSite::Lax | SameSite::None => false,
-        }
-    }
-
-    /// Returns `true` if `self` is `SameSite::Lax` and `false` otherwise.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::SameSite;
-    ///
-    /// let lax = SameSite::Lax;
-    /// assert!(lax.is_lax());
-    /// assert!(!lax.is_strict());
-    /// assert!(!lax.is_none());
-    /// ```
-    #[inline]
-    pub fn is_lax(self) -> bool {
-        match self {
-            SameSite::Lax => true,
-            SameSite::Strict | SameSite::None => false,
-        }
-    }
-
-    /// Returns `true` if `self` is `SameSite::None` and `false` otherwise.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::SameSite;
-    ///
-    /// let none = SameSite::None;
-    /// assert!(none.is_none());
-    /// assert!(!none.is_lax());
-    /// assert!(!none.is_strict());
-    /// ```
-    #[inline]
-    pub fn is_none(self) -> bool {
-        match self {
-            SameSite::None => true,
-            SameSite::Lax | SameSite::Strict => false,
-        }
-    }
-}
-
-impl fmt::Display for SameSite {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
-        match *self {
-            SameSite::Strict => write!(f, "Strict"),
-            SameSite::Lax => write!(f, "Lax"),
-            SameSite::None => Ok(()),
-        }
-    }
-}

actix-http/src/cookie/jar.rs

@@ -1,655 +0,0 @@
-use std::collections::HashSet;
-use std::mem::replace;
-
-use chrono::Duration;
-
-use super::delta::DeltaCookie;
-use super::Cookie;
-
-#[cfg(feature = "secure-cookies")]
-use super::secure::{Key, PrivateJar, SignedJar};
-
-/// A collection of cookies that tracks its modifications.
-///
-/// A `CookieJar` provides storage for any number of cookies. Any changes made
-/// to the jar are tracked; the changes can be retrieved via the
-/// [delta](#method.delta) method which returns an interator over the changes.
-///
-/// # Usage
-///
-/// A jar's life begins via [new](#method.new) and calls to
-/// [`add_original`](#method.add_original):
-///
-/// ```rust
-/// use actix_http::cookie::{Cookie, CookieJar};
-///
-/// let mut jar = CookieJar::new();
-/// jar.add_original(Cookie::new("name", "value"));
-/// jar.add_original(Cookie::new("second", "another"));
-/// ```
-///
-/// Cookies can be added via [add](#method.add) and removed via
-/// [remove](#method.remove). Finally, cookies can be looked up via
-/// [get](#method.get):
-///
-/// ```rust
-/// # use actix_http::cookie::{Cookie, CookieJar};
-/// let mut jar = CookieJar::new();
-/// jar.add(Cookie::new("a", "one"));
-/// jar.add(Cookie::new("b", "two"));
-///
-/// assert_eq!(jar.get("a").map(|c| c.value()), Some("one"));
-/// assert_eq!(jar.get("b").map(|c| c.value()), Some("two"));
-///
-/// jar.remove(Cookie::named("b"));
-/// assert!(jar.get("b").is_none());
-/// ```
-///
-/// # Deltas
-///
-/// A jar keeps track of any modifications made to it over time. The
-/// modifications are recorded as cookies. The modifications can be retrieved
-/// via [delta](#method.delta). Any new `Cookie` added to a jar via `add`
-/// results in the same `Cookie` appearing in the `delta`; cookies added via
-/// `add_original` do not count towards the delta. Any _original_ cookie that is
-/// removed from a jar results in a "removal" cookie appearing in the delta. A
-/// "removal" cookie is a cookie that a server sends so that the cookie is
-/// removed from the client's machine.
-///
-/// Deltas are typically used to create `Set-Cookie` headers corresponding to
-/// the changes made to a cookie jar over a period of time.
-///
-/// ```rust
-/// # use actix_http::cookie::{Cookie, CookieJar};
-/// let mut jar = CookieJar::new();
-///
-/// // original cookies don't affect the delta
-/// jar.add_original(Cookie::new("original", "value"));
-/// assert_eq!(jar.delta().count(), 0);
-///
-/// // new cookies result in an equivalent `Cookie` in the delta
-/// jar.add(Cookie::new("a", "one"));
-/// jar.add(Cookie::new("b", "two"));
-/// assert_eq!(jar.delta().count(), 2);
-///
-/// // removing an original cookie adds a "removal" cookie to the delta
-/// jar.remove(Cookie::named("original"));
-/// assert_eq!(jar.delta().count(), 3);
-///
-/// // removing a new cookie that was added removes that `Cookie` from the delta
-/// jar.remove(Cookie::named("a"));
-/// assert_eq!(jar.delta().count(), 2);
-/// ```
-#[derive(Default, Debug, Clone)]
-pub struct CookieJar {
-    original_cookies: HashSet<DeltaCookie>,
-    delta_cookies: HashSet<DeltaCookie>,
-}
-
-impl CookieJar {
-    /// Creates an empty cookie jar.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::CookieJar;
-    ///
-    /// let jar = CookieJar::new();
-    /// assert_eq!(jar.iter().count(), 0);
-    /// ```
-    pub fn new() -> CookieJar {
-        CookieJar::default()
-    }
-
-    /// Returns a reference to the `Cookie` inside this jar with the name
-    /// `name`. If no such cookie exists, returns `None`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// assert!(jar.get("name").is_none());
-    ///
-    /// jar.add(Cookie::new("name", "value"));
-    /// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
-    /// ```
-    pub fn get(&self, name: &str) -> Option<&Cookie<'static>> {
-        self.delta_cookies
-            .get(name)
-            .or_else(|| self.original_cookies.get(name))
-            .and_then(|c| if !c.removed { Some(&c.cookie) } else { None })
-    }
-
-    /// Adds an "original" `cookie` to this jar. If an original cookie with the
-    /// same name already exists, it is replaced with `cookie`. Cookies added
-    /// with `add` take precedence and are not replaced by this method.
-    ///
-    /// Adding an original cookie does not affect the [delta](#method.delta)
-    /// computation. This method is intended to be used to seed the cookie jar
-    /// with cookies received from a client's HTTP message.
-    ///
-    /// For accurate `delta` computations, this method should not be called
-    /// after calling `remove`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// jar.add_original(Cookie::new("name", "value"));
-    /// jar.add_original(Cookie::new("second", "two"));
-    ///
-    /// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
-    /// assert_eq!(jar.get("second").map(|c| c.value()), Some("two"));
-    /// assert_eq!(jar.iter().count(), 2);
-    /// assert_eq!(jar.delta().count(), 0);
-    /// ```
-    pub fn add_original(&mut self, cookie: Cookie<'static>) {
-        self.original_cookies.replace(DeltaCookie::added(cookie));
-    }
-
-    /// Adds `cookie` to this jar. If a cookie with the same name already
-    /// exists, it is replaced with `cookie`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// jar.add(Cookie::new("name", "value"));
-    /// jar.add(Cookie::new("second", "two"));
-    ///
-    /// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
-    /// assert_eq!(jar.get("second").map(|c| c.value()), Some("two"));
-    /// assert_eq!(jar.iter().count(), 2);
-    /// assert_eq!(jar.delta().count(), 2);
-    /// ```
-    pub fn add(&mut self, cookie: Cookie<'static>) {
-        self.delta_cookies.replace(DeltaCookie::added(cookie));
-    }
-
-    /// Removes `cookie` from this jar. If an _original_ cookie with the same
-    /// name as `cookie` is present in the jar, a _removal_ cookie will be
-    /// present in the `delta` computation. To properly generate the removal
-    /// cookie, `cookie` must contain the same `path` and `domain` as the cookie
-    /// that was initially set.
-    ///
-    /// A "removal" cookie is a cookie that has the same name as the original
-    /// cookie but has an empty value, a max-age of 0, and an expiration date
-    /// far in the past.
-    ///
-    /// # Example
-    ///
-    /// Removing an _original_ cookie results in a _removal_ cookie:
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    /// use chrono::Duration;
-    ///
-    /// # fn main() {
-    /// let mut jar = CookieJar::new();
-    ///
-    /// // Assume this cookie originally had a path of "/" and domain of "a.b".
-    /// jar.add_original(Cookie::new("name", "value"));
-    ///
-    /// // If the path and domain were set, they must be provided to `remove`.
-    /// jar.remove(Cookie::build("name", "").path("/").domain("a.b").finish());
-    ///
-    /// // The delta will contain the removal cookie.
-    /// let delta: Vec<_> = jar.delta().collect();
-    /// assert_eq!(delta.len(), 1);
-    /// assert_eq!(delta[0].name(), "name");
-    /// assert_eq!(delta[0].max_age(), Some(Duration::seconds(0)));
-    /// # }
-    /// ```
-    ///
-    /// Removing a new cookie does not result in a _removal_ cookie:
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// jar.add(Cookie::new("name", "value"));
-    /// assert_eq!(jar.delta().count(), 1);
-    ///
-    /// jar.remove(Cookie::named("name"));
-    /// assert_eq!(jar.delta().count(), 0);
-    /// ```
-    pub fn remove(&mut self, mut cookie: Cookie<'static>) {
-        if self.original_cookies.contains(cookie.name()) {
-            cookie.set_value("");
-            cookie.set_max_age(Duration::seconds(0));
-            cookie.set_expires(time::now() - Duration::days(365));
-            self.delta_cookies.replace(DeltaCookie::removed(cookie));
-        } else {
-            self.delta_cookies.remove(cookie.name());
-        }
-    }
-
-    /// Removes `cookie` from this jar completely. This method differs from
-    /// `remove` in that no delta cookie is created under any condition. Neither
-    /// the `delta` nor `iter` methods will return a cookie that is removed
-    /// using this method.
-    ///
-    /// # Example
-    ///
-    /// Removing an _original_ cookie; no _removal_ cookie is generated:
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    /// use chrono::Duration;
-    ///
-    /// # fn main() {
-    /// let mut jar = CookieJar::new();
-    ///
-    /// // Add an original cookie and a new cookie.
-    /// jar.add_original(Cookie::new("name", "value"));
-    /// jar.add(Cookie::new("key", "value"));
-    /// assert_eq!(jar.delta().count(), 1);
-    /// assert_eq!(jar.iter().count(), 2);
-    ///
-    /// // Now force remove the original cookie.
-    /// jar.force_remove(Cookie::new("name", "value"));
-    /// assert_eq!(jar.delta().count(), 1);
-    /// assert_eq!(jar.iter().count(), 1);
-    ///
-    /// // Now force remove the new cookie.
-    /// jar.force_remove(Cookie::new("key", "value"));
-    /// assert_eq!(jar.delta().count(), 0);
-    /// assert_eq!(jar.iter().count(), 0);
-    /// # }
-    /// ```
-    pub fn force_remove<'a>(&mut self, cookie: Cookie<'a>) {
-        self.original_cookies.remove(cookie.name());
-        self.delta_cookies.remove(cookie.name());
-    }
-
-    /// Removes all cookies from this cookie jar.
-    #[deprecated(
-        since = "0.7.0",
-        note = "calling this method may not remove \
-                all cookies since the path and domain are not specified; use \
-                `remove` instead"
-    )]
-    pub fn clear(&mut self) {
-        self.delta_cookies.clear();
-        for delta in replace(&mut self.original_cookies, HashSet::new()) {
-            self.remove(delta.cookie);
-        }
-    }
-
-    /// Returns an iterator over cookies that represent the changes to this jar
-    /// over time. These cookies can be rendered directly as `Set-Cookie` header
-    /// values to affect the changes made to this jar on the client.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// jar.add_original(Cookie::new("name", "value"));
-    /// jar.add_original(Cookie::new("second", "two"));
-    ///
-    /// // Add new cookies.
-    /// jar.add(Cookie::new("new", "third"));
-    /// jar.add(Cookie::new("another", "fourth"));
-    /// jar.add(Cookie::new("yac", "fifth"));
-    ///
-    /// // Remove some cookies.
-    /// jar.remove(Cookie::named("name"));
-    /// jar.remove(Cookie::named("another"));
-    ///
-    /// // Delta contains two new cookies ("new", "yac") and a removal ("name").
-    /// assert_eq!(jar.delta().count(), 3);
-    /// ```
-    pub fn delta(&self) -> Delta {
-        Delta {
-            iter: self.delta_cookies.iter(),
-        }
-    }
-
-    /// Returns an iterator over all of the cookies present in this jar.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    ///
-    /// jar.add_original(Cookie::new("name", "value"));
-    /// jar.add_original(Cookie::new("second", "two"));
-    ///
-    /// jar.add(Cookie::new("new", "third"));
-    /// jar.add(Cookie::new("another", "fourth"));
-    /// jar.add(Cookie::new("yac", "fifth"));
-    ///
-    /// jar.remove(Cookie::named("name"));
-    /// jar.remove(Cookie::named("another"));
-    ///
-    /// // There are three cookies in the jar: "second", "new", and "yac".
-    /// # assert_eq!(jar.iter().count(), 3);
-    /// for cookie in jar.iter() {
-    ///     match cookie.name() {
-    ///         "second" => assert_eq!(cookie.value(), "two"),
-    ///         "new" => assert_eq!(cookie.value(), "third"),
-    ///         "yac" => assert_eq!(cookie.value(), "fifth"),
-    ///         _ => unreachable!("there are only three cookies in the jar")
-    ///     }
-    /// }
-    /// ```
-    pub fn iter(&self) -> Iter {
-        Iter {
-            delta_cookies: self
-                .delta_cookies
-                .iter()
-                .chain(self.original_cookies.difference(&self.delta_cookies)),
-        }
-    }
-
-    /// Returns a `PrivateJar` with `self` as its parent jar using the key `key`
-    /// to sign/encrypt and verify/decrypt cookies added/retrieved from the
-    /// child jar.
-    ///
-    /// Any modifications to the child jar will be reflected on the parent jar,
-    /// and any retrievals from the child jar will be made from the parent jar.
-    ///
-    /// This method is only available when the `secure` feature is enabled.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{Cookie, CookieJar, Key};
-    ///
-    /// // Generate a secure key.
-    /// let key = Key::generate();
-    ///
-    /// // Add a private (signed + encrypted) cookie.
-    /// let mut jar = CookieJar::new();
-    /// jar.private(&key).add(Cookie::new("private", "text"));
-    ///
-    /// // The cookie's contents are encrypted.
-    /// assert_ne!(jar.get("private").unwrap().value(), "text");
-    ///
-    /// // They can be decrypted and verified through the child jar.
-    /// assert_eq!(jar.private(&key).get("private").unwrap().value(), "text");
-    ///
-    /// // A tampered with cookie does not validate but still exists.
-    /// let mut cookie = jar.get("private").unwrap().clone();
-    /// jar.add(Cookie::new("private", cookie.value().to_string() + "!"));
-    /// assert!(jar.private(&key).get("private").is_none());
-    /// assert!(jar.get("private").is_some());
-    /// ```
-    #[cfg(feature = "secure-cookies")]
-    pub fn private(&mut self, key: &Key) -> PrivateJar {
-        PrivateJar::new(self, key)
-    }
-
-    /// Returns a `SignedJar` with `self` as its parent jar using the key `key`
-    /// to sign/verify cookies added/retrieved from the child jar.
-    ///
-    /// Any modifications to the child jar will be reflected on the parent jar,
-    /// and any retrievals from the child jar will be made from the parent jar.
-    ///
-    /// This method is only available when the `secure` feature is enabled.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{Cookie, CookieJar, Key};
-    ///
-    /// // Generate a secure key.
-    /// let key = Key::generate();
-    ///
-    /// // Add a signed cookie.
-    /// let mut jar = CookieJar::new();
-    /// jar.signed(&key).add(Cookie::new("signed", "text"));
-    ///
-    /// // The cookie's contents are signed but still in plaintext.
-    /// assert_ne!(jar.get("signed").unwrap().value(), "text");
-    /// assert!(jar.get("signed").unwrap().value().contains("text"));
-    ///
-    /// // They can be verified through the child jar.
-    /// assert_eq!(jar.signed(&key).get("signed").unwrap().value(), "text");
-    ///
-    /// // A tampered with cookie does not validate but still exists.
-    /// let mut cookie = jar.get("signed").unwrap().clone();
-    /// jar.add(Cookie::new("signed", cookie.value().to_string() + "!"));
-    /// assert!(jar.signed(&key).get("signed").is_none());
-    /// assert!(jar.get("signed").is_some());
-    /// ```
-    #[cfg(feature = "secure-cookies")]
-    pub fn signed(&mut self, key: &Key) -> SignedJar {
-        SignedJar::new(self, key)
-    }
-}
-
-use std::collections::hash_set::Iter as HashSetIter;
-
-/// Iterator over the changes to a cookie jar.
-pub struct Delta<'a> {
-    iter: HashSetIter<'a, DeltaCookie>,
-}
-
-impl<'a> Iterator for Delta<'a> {
-    type Item = &'a Cookie<'static>;
-
-    fn next(&mut self) -> Option<&'a Cookie<'static>> {
-        self.iter.next().map(|c| &c.cookie)
-    }
-}
-
-use std::collections::hash_map::RandomState;
-use std::collections::hash_set::Difference;
-use std::iter::Chain;
-
-/// Iterator over all of the cookies in a jar.
-pub struct Iter<'a> {
-    delta_cookies:
-        Chain<HashSetIter<'a, DeltaCookie>, Difference<'a, DeltaCookie, RandomState>>,
-}
-
-impl<'a> Iterator for Iter<'a> {
-    type Item = &'a Cookie<'static>;
-
-    fn next(&mut self) -> Option<&'a Cookie<'static>> {
-        for cookie in self.delta_cookies.by_ref() {
-            if !cookie.removed {
-                return Some(&*cookie);
-            }
-        }
-
-        None
-    }
-}
-
-#[cfg(test)]
-mod test {
-    #[cfg(feature = "secure-cookies")]
-    use super::Key;
-    use super::{Cookie, CookieJar};
-
-    #[test]
-    #[allow(deprecated)]
-    fn simple() {
-        let mut c = CookieJar::new();
-
-        c.add(Cookie::new("test", ""));
-        c.add(Cookie::new("test2", ""));
-        c.remove(Cookie::named("test"));
-
-        assert!(c.get("test").is_none());
-        assert!(c.get("test2").is_some());
-
-        c.add(Cookie::new("test3", ""));
-        c.clear();
-
-        assert!(c.get("test").is_none());
-        assert!(c.get("test2").is_none());
-        assert!(c.get("test3").is_none());
-    }
-
-    #[test]
-    fn jar_is_send() {
-        fn is_send<T: Send>(_: T) -> bool {
-            true
-        }
-
-        assert!(is_send(CookieJar::new()))
-    }
-
-    #[test]
-    #[cfg(feature = "secure-cookies")]
-    fn iter() {
-        let key = Key::generate();
-        let mut c = CookieJar::new();
-
-        c.add_original(Cookie::new("original", "original"));
-
-        c.add(Cookie::new("test", "test"));
-        c.add(Cookie::new("test2", "test2"));
-        c.add(Cookie::new("test3", "test3"));
-        assert_eq!(c.iter().count(), 4);
-
-        c.signed(&key).add(Cookie::new("signed", "signed"));
-        c.private(&key).add(Cookie::new("encrypted", "encrypted"));
-        assert_eq!(c.iter().count(), 6);
-
-        c.remove(Cookie::named("test"));
-        assert_eq!(c.iter().count(), 5);
-
-        c.remove(Cookie::named("signed"));
-        c.remove(Cookie::named("test2"));
-        assert_eq!(c.iter().count(), 3);
-
-        c.add(Cookie::new("test2", "test2"));
-        assert_eq!(c.iter().count(), 4);
-
-        c.remove(Cookie::named("test2"));
-        assert_eq!(c.iter().count(), 3);
-    }
-
-    #[test]
-    #[cfg(feature = "secure-cookies")]
-    fn delta() {
-        use chrono::Duration;
-        use std::collections::HashMap;
-
-        let mut c = CookieJar::new();
-
-        c.add_original(Cookie::new("original", "original"));
-        c.add_original(Cookie::new("original1", "original1"));
-
-        c.add(Cookie::new("test", "test"));
-        c.add(Cookie::new("test2", "test2"));
-        c.add(Cookie::new("test3", "test3"));
-        c.add(Cookie::new("test4", "test4"));
-
-        c.remove(Cookie::named("test"));
-        c.remove(Cookie::named("original"));
-
-        assert_eq!(c.delta().count(), 4);
-
-        let names: HashMap<_, _> = c.delta().map(|c| (c.name(), c.max_age())).collect();
-
-        assert!(names.get("test2").unwrap().is_none());
-        assert!(names.get("test3").unwrap().is_none());
-        assert!(names.get("test4").unwrap().is_none());
-        assert_eq!(names.get("original").unwrap(), &Some(Duration::seconds(0)));
-    }
-
-    #[test]
-    fn replace_original() {
-        let mut jar = CookieJar::new();
-        jar.add_original(Cookie::new("original_a", "a"));
-        jar.add_original(Cookie::new("original_b", "b"));
-        assert_eq!(jar.get("original_a").unwrap().value(), "a");
-
-        jar.add(Cookie::new("original_a", "av2"));
-        assert_eq!(jar.get("original_a").unwrap().value(), "av2");
-    }
-
-    #[test]
-    fn empty_delta() {
-        let mut jar = CookieJar::new();
-        jar.add(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().count(), 0);
-
-        jar.add_original(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 0);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.add(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().count(), 1);
-    }
-
-    #[test]
-    fn add_remove_add() {
-        let mut jar = CookieJar::new();
-        jar.add_original(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 0);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-
-        // The cookie's been deleted. Another original doesn't change that.
-        jar.add_original(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.add(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().filter(|c| !c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-    }
-
-    #[test]
-    fn replace_remove() {
-        let mut jar = CookieJar::new();
-        jar.add_original(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 0);
-
-        jar.add(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 1);
-        assert_eq!(jar.delta().filter(|c| !c.value().is_empty()).count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-    }
-
-    #[test]
-    fn remove_with_path() {
-        let mut jar = CookieJar::new();
-        jar.add_original(Cookie::build("name", "val").finish());
-        assert_eq!(jar.iter().count(), 1);
-        assert_eq!(jar.delta().count(), 0);
-        assert_eq!(jar.iter().filter(|c| c.path().is_none()).count(), 1);
-
-        jar.remove(Cookie::build("name", "").path("/").finish());
-        assert_eq!(jar.iter().count(), 0);
-        assert_eq!(jar.delta().count(), 1);
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().filter(|c| c.path() == Some("/")).count(), 1);
-    }
-}

actix-http/src/cookie/parse.rs

@@ -1,425 +0,0 @@
-use std::borrow::Cow;
-use std::cmp;
-use std::convert::From;
-use std::error::Error;
-use std::fmt;
-use std::str::Utf8Error;
-
-use chrono::Duration;
-use percent_encoding::percent_decode;
-
-use super::{Cookie, CookieStr, SameSite};
-
-/// Enum corresponding to a parsing error.
-#[derive(Debug, PartialEq, Eq, Clone, Copy)]
-pub enum ParseError {
-    /// The cookie did not contain a name/value pair.
-    MissingPair,
-    /// The cookie's name was empty.
-    EmptyName,
-    /// Decoding the cookie's name or value resulted in invalid UTF-8.
-    Utf8Error(Utf8Error),
-    /// It is discouraged to exhaustively match on this enum as its variants may
-    /// grow without a breaking-change bump in version numbers.
-    #[doc(hidden)]
-    __Nonexhasutive,
-}
-
-impl ParseError {
-    /// Returns a description of this error as a string
-    pub fn as_str(&self) -> &'static str {
-        match *self {
-            ParseError::MissingPair => "the cookie is missing a name/value pair",
-            ParseError::EmptyName => "the cookie's name is empty",
-            ParseError::Utf8Error(_) => {
-                "decoding the cookie's name or value resulted in invalid UTF-8"
-            }
-            ParseError::__Nonexhasutive => unreachable!("__Nonexhasutive ParseError"),
-        }
-    }
-}
-
-impl fmt::Display for ParseError {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
-        write!(f, "{}", self.as_str())
-    }
-}
-
-impl From<Utf8Error> for ParseError {
-    fn from(error: Utf8Error) -> ParseError {
-        ParseError::Utf8Error(error)
-    }
-}
-
-impl Error for ParseError {
-    fn description(&self) -> &str {
-        self.as_str()
-    }
-}
-
-fn indexes_of(needle: &str, haystack: &str) -> Option<(usize, usize)> {
-    let haystack_start = haystack.as_ptr() as usize;
-    let needle_start = needle.as_ptr() as usize;
-
-    if needle_start < haystack_start {
-        return None;
-    }
-
-    if (needle_start + needle.len()) > (haystack_start + haystack.len()) {
-        return None;
-    }
-
-    let start = needle_start - haystack_start;
-    let end = start + needle.len();
-    Some((start, end))
-}
-
-fn name_val_decoded(
-    name: &str,
-    val: &str,
-) -> Result<(CookieStr, CookieStr), ParseError> {
-    let decoded_name = percent_decode(name.as_bytes()).decode_utf8()?;
-    let decoded_value = percent_decode(val.as_bytes()).decode_utf8()?;
-    let name = CookieStr::Concrete(Cow::Owned(decoded_name.into_owned()));
-    let val = CookieStr::Concrete(Cow::Owned(decoded_value.into_owned()));
-
-    Ok((name, val))
-}
-
-// This function does the real parsing but _does not_ set the `cookie_string` in
-// the returned cookie object. This only exists so that the borrow to `s` is
-// returned at the end of the call, allowing the `cookie_string` field to be
-// set in the outer `parse` function.
-fn parse_inner<'c>(s: &str, decode: bool) -> Result<Cookie<'c>, ParseError> {
-    let mut attributes = s.split(';');
-    let key_value = match attributes.next() {
-        Some(s) => s,
-        _ => panic!(),
-    };
-
-    // Determine the name = val.
-    let (name, value) = match key_value.find('=') {
-        Some(i) => (key_value[..i].trim(), key_value[(i + 1)..].trim()),
-        None => return Err(ParseError::MissingPair),
-    };
-
-    if name.is_empty() {
-        return Err(ParseError::EmptyName);
-    }
-
-    // Create a cookie with all of the defaults. We'll fill things in while we
-    // iterate through the parameters below.
-    let (name, value) = if decode {
-        name_val_decoded(name, value)?
-    } else {
-        let name_indexes = indexes_of(name, s).expect("name sub");
-        let value_indexes = indexes_of(value, s).expect("value sub");
-        let name = CookieStr::Indexed(name_indexes.0, name_indexes.1);
-        let value = CookieStr::Indexed(value_indexes.0, value_indexes.1);
-
-        (name, value)
-    };
-
-    let mut cookie = Cookie {
-        name,
-        value,
-        cookie_string: None,
-        expires: None,
-        max_age: None,
-        domain: None,
-        path: None,
-        secure: None,
-        http_only: None,
-        same_site: None,
-    };
-
-    for attr in attributes {
-        let (key, value) = match attr.find('=') {
-            Some(i) => (attr[..i].trim(), Some(attr[(i + 1)..].trim())),
-            None => (attr.trim(), None),
-        };
-
-        match (&*key.to_ascii_lowercase(), value) {
-            ("secure", _) => cookie.secure = Some(true),
-            ("httponly", _) => cookie.http_only = Some(true),
-            ("max-age", Some(v)) => {
-                // See RFC 6265 Section 5.2.2, negative values indicate that the
-                // earliest possible expiration time should be used, so set the
-                // max age as 0 seconds.
-                cookie.max_age = match v.parse() {
-                    Ok(val) if val <= 0 => Some(Duration::zero()),
-                    Ok(val) => {
-                        // Don't panic if the max age seconds is greater than what's supported by
-                        // `Duration`.
-                        let val = cmp::min(val, Duration::max_value().num_seconds());
-                        Some(Duration::seconds(val))
-                    }
-                    Err(_) => continue,
-                };
-            }
-            ("domain", Some(mut domain)) if !domain.is_empty() => {
-                if domain.starts_with('.') {
-                    domain = &domain[1..];
-                }
-
-                let (i, j) = indexes_of(domain, s).expect("domain sub");
-                cookie.domain = Some(CookieStr::Indexed(i, j));
-            }
-            ("path", Some(v)) => {
-                let (i, j) = indexes_of(v, s).expect("path sub");
-                cookie.path = Some(CookieStr::Indexed(i, j));
-            }
-            ("samesite", Some(v)) => {
-                if v.eq_ignore_ascii_case("strict") {
-                    cookie.same_site = Some(SameSite::Strict);
-                } else if v.eq_ignore_ascii_case("lax") {
-                    cookie.same_site = Some(SameSite::Lax);
-                } else {
-                    // We do nothing here, for now. When/if the `SameSite`
-                    // attribute becomes standard, the spec says that we should
-                    // ignore this cookie, i.e, fail to parse it, when an
-                    // invalid value is passed in. The draft is at
-                    // http://httpwg.org/http-extensions/draft-ietf-httpbis-cookie-same-site.html.
-                }
-            }
-            ("expires", Some(v)) => {
-                // Try strptime with three date formats according to
-                // http://tools.ietf.org/html/rfc2616#section-3.3.1. Try
-                // additional ones as encountered in the real world.
-                let tm = time::strptime(v, "%a, %d %b %Y %H:%M:%S %Z")
-                    .or_else(|_| time::strptime(v, "%A, %d-%b-%y %H:%M:%S %Z"))
-                    .or_else(|_| time::strptime(v, "%a, %d-%b-%Y %H:%M:%S %Z"))
-                    .or_else(|_| time::strptime(v, "%a %b %d %H:%M:%S %Y"));
-
-                if let Ok(time) = tm {
-                    cookie.expires = Some(time)
-                }
-            }
-            _ => {
-                // We're going to be permissive here. If we have no idea what
-                // this is, then it's something nonstandard. We're not going to
-                // store it (because it's not compliant), but we're also not
-                // going to emit an error.
-            }
-        }
-    }
-
-    Ok(cookie)
-}
-
-pub fn parse_cookie<'c, S>(cow: S, decode: bool) -> Result<Cookie<'c>, ParseError>
-where
-    S: Into<Cow<'c, str>>,
-{
-    let s = cow.into();
-    let mut cookie = parse_inner(&s, decode)?;
-    cookie.cookie_string = Some(s);
-    Ok(cookie)
-}
-
-#[cfg(test)]
-mod tests {
-    use super::{Cookie, SameSite};
-    use chrono::Duration;
-    use time::strptime;
-
-    macro_rules! assert_eq_parse {
-        ($string:expr, $expected:expr) => {
-            let cookie = match Cookie::parse($string) {
-                Ok(cookie) => cookie,
-                Err(e) => panic!("Failed to parse {:?}: {:?}", $string, e),
-            };
-
-            assert_eq!(cookie, $expected);
-        };
-    }
-
-    macro_rules! assert_ne_parse {
-        ($string:expr, $expected:expr) => {
-            let cookie = match Cookie::parse($string) {
-                Ok(cookie) => cookie,
-                Err(e) => panic!("Failed to parse {:?}: {:?}", $string, e),
-            };
-
-            assert_ne!(cookie, $expected);
-        };
-    }
-
-    #[test]
-    fn parse_same_site() {
-        let expected = Cookie::build("foo", "bar")
-            .same_site(SameSite::Lax)
-            .finish();
-
-        assert_eq_parse!("foo=bar; SameSite=Lax", expected);
-        assert_eq_parse!("foo=bar; SameSite=lax", expected);
-        assert_eq_parse!("foo=bar; SameSite=LAX", expected);
-        assert_eq_parse!("foo=bar; samesite=Lax", expected);
-        assert_eq_parse!("foo=bar; SAMESITE=Lax", expected);
-
-        let expected = Cookie::build("foo", "bar")
-            .same_site(SameSite::Strict)
-            .finish();
-
-        assert_eq_parse!("foo=bar; SameSite=Strict", expected);
-        assert_eq_parse!("foo=bar; SameSITE=Strict", expected);
-        assert_eq_parse!("foo=bar; SameSite=strict", expected);
-        assert_eq_parse!("foo=bar; SameSite=STrICT", expected);
-        assert_eq_parse!("foo=bar; SameSite=STRICT", expected);
-    }
-
-    #[test]
-    fn parse() {
-        assert!(Cookie::parse("bar").is_err());
-        assert!(Cookie::parse("=bar").is_err());
-        assert!(Cookie::parse(" =bar").is_err());
-        assert!(Cookie::parse("foo=").is_ok());
-
-        let expected = Cookie::build("foo", "bar=baz").finish();
-        assert_eq_parse!("foo=bar=baz", expected);
-
-        let mut expected = Cookie::build("foo", "bar").finish();
-        assert_eq_parse!("foo=bar", expected);
-        assert_eq_parse!("foo = bar", expected);
-        assert_eq_parse!(" foo=bar ", expected);
-        assert_eq_parse!(" foo=bar ;Domain=", expected);
-        assert_eq_parse!(" foo=bar ;Domain= ", expected);
-        assert_eq_parse!(" foo=bar ;Ignored", expected);
-
-        let mut unexpected = Cookie::build("foo", "bar").http_only(false).finish();
-        assert_ne_parse!(" foo=bar ;HttpOnly", unexpected);
-        assert_ne_parse!(" foo=bar; httponly", unexpected);
-
-        expected.set_http_only(true);
-        assert_eq_parse!(" foo=bar ;HttpOnly", expected);
-        assert_eq_parse!(" foo=bar ;httponly", expected);
-        assert_eq_parse!(" foo=bar ;HTTPONLY=whatever", expected);
-        assert_eq_parse!(" foo=bar ; sekure; HTTPONLY", expected);
-
-        expected.set_secure(true);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure=aaaa", expected);
-
-        unexpected.set_http_only(true);
-        unexpected.set_secure(true);
-        assert_ne_parse!(" foo=bar ;HttpOnly; skeure", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; =secure", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly;", unexpected);
-
-        unexpected.set_secure(false);
-        assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
-
-        expected.set_max_age(Duration::zero());
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=0", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 0 ", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=-1", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = -1 ", expected);
-
-        expected.set_max_age(Duration::minutes(1));
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=60", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age =   60 ", expected);
-
-        expected.set_max_age(Duration::seconds(4));
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=4", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 4 ", expected);
-
-        unexpected.set_secure(true);
-        unexpected.set_max_age(Duration::minutes(1));
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=122", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 38 ", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=51", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = -1 ", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 0", unexpected);
-
-        expected.set_path("/");
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/", expected);
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/", expected);
-
-        expected.set_path("/foo");
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/foo", expected);
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/foo", expected);
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;path=/foo", expected);
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;path = /foo", expected);
-
-        unexpected.set_max_age(Duration::seconds(4));
-        unexpected.set_path("/bar");
-        assert_ne_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/foo", unexpected);
-        assert_ne_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/baz", unexpected);
-
-        expected.set_domain("www.foo.com");
-        assert_eq_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=www.foo.com",
-            expected
-        );
-
-        expected.set_domain("foo.com");
-        assert_eq_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=foo.com",
-            expected
-        );
-        assert_eq_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=FOO.COM",
-            expected
-        );
-
-        unexpected.set_path("/foo");
-        unexpected.set_domain("bar.com");
-        assert_ne_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=foo.com",
-            unexpected
-        );
-        assert_ne_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=FOO.COM",
-            unexpected
-        );
-
-        let time_str = "Wed, 21 Oct 2015 07:28:00 GMT";
-        let expires = strptime(time_str, "%a, %d %b %Y %H:%M:%S %Z").unwrap();
-        expected.set_expires(expires);
-        assert_eq_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=foo.com; Expires=Wed, 21 Oct 2015 07:28:00 GMT",
-            expected
-        );
-
-        unexpected.set_domain("foo.com");
-        let bad_expires = strptime(time_str, "%a, %d %b %Y %H:%S:%M %Z").unwrap();
-        expected.set_expires(bad_expires);
-        assert_ne_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=foo.com; Expires=Wed, 21 Oct 2015 07:28:00 GMT",
-            unexpected
-        );
-    }
-
-    #[test]
-    fn odd_characters() {
-        let expected = Cookie::new("foo", "b%2Fr");
-        assert_eq_parse!("foo=b%2Fr", expected);
-    }
-
-    #[test]
-    fn odd_characters_encoded() {
-        let expected = Cookie::new("foo", "b/r");
-        let cookie = match Cookie::parse_encoded("foo=b%2Fr") {
-            Ok(cookie) => cookie,
-            Err(e) => panic!("Failed to parse: {:?}", e),
-        };
-
-        assert_eq!(cookie, expected);
-    }
-
-    #[test]
-    fn do_not_panic_on_large_max_ages() {
-        let max_seconds = Duration::max_value().num_seconds();
-        let expected = Cookie::build("foo", "bar").max_age(max_seconds).finish();
-        assert_eq_parse!(format!(" foo=bar; Max-Age={:?}", max_seconds + 1), expected);
-    }
-}

actix-http/src/cookie/secure/key.rs

@@ -1,180 +0,0 @@
-use ring::digest::{Algorithm, SHA256};
-use ring::hkdf::expand;
-use ring::hmac::SigningKey;
-use ring::rand::{SecureRandom, SystemRandom};
-
-use super::private::KEY_LEN as PRIVATE_KEY_LEN;
-use super::signed::KEY_LEN as SIGNED_KEY_LEN;
-
-static HKDF_DIGEST: &Algorithm = &SHA256;
-const KEYS_INFO: &str = "COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM";
-
-/// A cryptographic master key for use with `Signed` and/or `Private` jars.
-///
-/// This structure encapsulates secure, cryptographic keys for use with both
-/// [PrivateJar](struct.PrivateJar.html) and [SignedJar](struct.SignedJar.html).
-/// It can be derived from a single master key via
-/// [from_master](#method.from_master) or generated from a secure random source
-/// via [generate](#method.generate). A single instance of `Key` can be used for
-/// both a `PrivateJar` and a `SignedJar`.
-///
-/// This type is only available when the `secure` feature is enabled.
-#[derive(Clone)]
-pub struct Key {
-    signing_key: [u8; SIGNED_KEY_LEN],
-    encryption_key: [u8; PRIVATE_KEY_LEN],
-}
-
-impl Key {
-    /// Derives new signing/encryption keys from a master key.
-    ///
-    /// The master key must be at least 256-bits (32 bytes). For security, the
-    /// master key _must_ be cryptographically random. The keys are derived
-    /// deterministically from the master key.
-    ///
-    /// # Panics
-    ///
-    /// Panics if `key` is less than 32 bytes in length.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// # /*
-    /// let master_key = { /* a cryptographically random key >= 32 bytes */ };
-    /// # */
-    /// # let master_key: &Vec<u8> = &(0..32).collect();
-    ///
-    /// let key = Key::from_master(master_key);
-    /// ```
-    pub fn from_master(key: &[u8]) -> Key {
-        if key.len() < 32 {
-            panic!(
-                "bad master key length: expected at least 32 bytes, found {}",
-                key.len()
-            );
-        }
-
-        // Expand the user's key into two.
-        let prk = SigningKey::new(HKDF_DIGEST, key);
-        let mut both_keys = [0; SIGNED_KEY_LEN + PRIVATE_KEY_LEN];
-        expand(&prk, KEYS_INFO.as_bytes(), &mut both_keys);
-
-        // Copy the keys into their respective arrays.
-        let mut signing_key = [0; SIGNED_KEY_LEN];
-        let mut encryption_key = [0; PRIVATE_KEY_LEN];
-        signing_key.copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
-        encryption_key.copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
-
-        Key {
-            signing_key,
-            encryption_key,
-        }
-    }
-
-    /// Generates signing/encryption keys from a secure, random source. Keys are
-    /// generated nondeterministically.
-    ///
-    /// # Panics
-    ///
-    /// Panics if randomness cannot be retrieved from the operating system. See
-    /// [try_generate](#method.try_generate) for a non-panicking version.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// let key = Key::generate();
-    /// ```
-    pub fn generate() -> Key {
-        Self::try_generate().expect("failed to generate `Key` from randomness")
-    }
-
-    /// Attempts to generate signing/encryption keys from a secure, random
-    /// source. Keys are generated nondeterministically. If randomness cannot be
-    /// retrieved from the underlying operating system, returns `None`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// let key = Key::try_generate();
-    /// ```
-    pub fn try_generate() -> Option<Key> {
-        let mut sign_key = [0; SIGNED_KEY_LEN];
-        let mut enc_key = [0; PRIVATE_KEY_LEN];
-
-        let rng = SystemRandom::new();
-        if rng.fill(&mut sign_key).is_err() || rng.fill(&mut enc_key).is_err() {
-            return None;
-        }
-
-        Some(Key {
-            signing_key: sign_key,
-            encryption_key: enc_key,
-        })
-    }
-
-    /// Returns the raw bytes of a key suitable for signing cookies.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// let key = Key::generate();
-    /// let signing_key = key.signing();
-    /// ```
-    pub fn signing(&self) -> &[u8] {
-        &self.signing_key[..]
-    }
-
-    /// Returns the raw bytes of a key suitable for encrypting cookies.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// let key = Key::generate();
-    /// let encryption_key = key.encryption();
-    /// ```
-    pub fn encryption(&self) -> &[u8] {
-        &self.encryption_key[..]
-    }
-}
-
-#[cfg(test)]
-mod test {
-    use super::Key;
-
-    #[test]
-    fn deterministic_from_master() {
-        let master_key: Vec<u8> = (0..32).collect();
-
-        let key_a = Key::from_master(&master_key);
-        let key_b = Key::from_master(&master_key);
-
-        assert_eq!(key_a.signing(), key_b.signing());
-        assert_eq!(key_a.encryption(), key_b.encryption());
-        assert_ne!(key_a.encryption(), key_a.signing());
-
-        let master_key_2: Vec<u8> = (32..64).collect();
-        let key_2 = Key::from_master(&master_key_2);
-
-        assert_ne!(key_2.signing(), key_a.signing());
-        assert_ne!(key_2.encryption(), key_a.encryption());
-    }
-
-    #[test]
-    fn non_deterministic_generate() {
-        let key_a = Key::generate();
-        let key_b = Key::generate();
-
-        assert_ne!(key_a.signing(), key_b.signing());
-        assert_ne!(key_a.encryption(), key_b.encryption());
-    }
-}

actix-http/src/cookie/secure/macros.rs

@@ -1,40 +0,0 @@
-#[cfg(test)]
-macro_rules! assert_simple_behaviour {
-    ($clear:expr, $secure:expr) => {{
-        assert_eq!($clear.iter().count(), 0);
-
-        $secure.add(Cookie::new("name", "val"));
-        assert_eq!($clear.iter().count(), 1);
-        assert_eq!($secure.get("name").unwrap().value(), "val");
-        assert_ne!($clear.get("name").unwrap().value(), "val");
-
-        $secure.add(Cookie::new("another", "two"));
-        assert_eq!($clear.iter().count(), 2);
-
-        $clear.remove(Cookie::named("another"));
-        assert_eq!($clear.iter().count(), 1);
-
-        $secure.remove(Cookie::named("name"));
-        assert_eq!($clear.iter().count(), 0);
-    }};
-}
-
-#[cfg(test)]
-macro_rules! assert_secure_behaviour {
-    ($clear:expr, $secure:expr) => {{
-        $secure.add(Cookie::new("secure", "secure"));
-        assert!($clear.get("secure").unwrap().value() != "secure");
-        assert!($secure.get("secure").unwrap().value() == "secure");
-
-        let mut cookie = $clear.get("secure").unwrap().clone();
-        let new_val = format!("{}l", cookie.value());
-        cookie.set_value(new_val);
-        $clear.add(cookie);
-        assert!($secure.get("secure").is_none());
-
-        let mut cookie = $clear.get("secure").unwrap().clone();
-        cookie.set_value("foobar");
-        $clear.add(cookie);
-        assert!($secure.get("secure").is_none());
-    }};
-}

actix-http/src/cookie/secure/mod.rs

@@ -1,10 +0,0 @@
-//! Fork of https://github.com/alexcrichton/cookie-rs
-#[macro_use]
-mod macros;
-mod key;
-mod private;
-mod signed;
-
-pub use self::key::*;
-pub use self::private::*;
-pub use self::signed::*;

actix-http/src/cookie/secure/private.rs

@@ -1,269 +0,0 @@
-use std::str;
-
-use log::warn;
-use ring::aead::{open_in_place, seal_in_place, Aad, Algorithm, Nonce, AES_256_GCM};
-use ring::aead::{OpeningKey, SealingKey};
-use ring::rand::{SecureRandom, SystemRandom};
-
-use super::Key;
-use crate::cookie::{Cookie, CookieJar};
-
-// Keep these in sync, and keep the key len synced with the `private` docs as
-// well as the `KEYS_INFO` const in secure::Key.
-static ALGO: &Algorithm = &AES_256_GCM;
-const NONCE_LEN: usize = 12;
-pub const KEY_LEN: usize = 32;
-
-/// A child cookie jar that provides authenticated encryption for its cookies.
-///
-/// A _private_ child jar signs and encrypts all the cookies added to it and
-/// verifies and decrypts cookies retrieved from it. Any cookies stored in a
-/// `PrivateJar` are simultaneously assured confidentiality, integrity, and
-/// authenticity. In other words, clients cannot discover nor tamper with the
-/// contents of a cookie, nor can they fabricate cookie data.
-///
-/// This type is only available when the `secure` feature is enabled.
-pub struct PrivateJar<'a> {
-    parent: &'a mut CookieJar,
-    key: [u8; KEY_LEN],
-}
-
-impl<'a> PrivateJar<'a> {
-    /// Creates a new child `PrivateJar` with parent `parent` and key `key`.
-    /// This method is typically called indirectly via the `signed` method of
-    /// `CookieJar`.
-    #[doc(hidden)]
-    pub fn new(parent: &'a mut CookieJar, key: &Key) -> PrivateJar<'a> {
-        let mut key_array = [0u8; KEY_LEN];
-        key_array.copy_from_slice(key.encryption());
-        PrivateJar {
-            parent,
-            key: key_array,
-        }
-    }
-
-    /// Given a sealed value `str` and a key name `name`, where the nonce is
-    /// prepended to the original value and then both are Base64 encoded,
-    /// verifies and decrypts the sealed value and returns it. If there's a
-    /// problem, returns an `Err` with a string describing the issue.
-    fn unseal(&self, name: &str, value: &str) -> Result<String, &'static str> {
-        let mut data = base64::decode(value).map_err(|_| "bad base64 value")?;
-        if data.len() <= NONCE_LEN {
-            return Err("length of decoded data is <= NONCE_LEN");
-        }
-
-        let ad = Aad::from(name.as_bytes());
-        let key = OpeningKey::new(ALGO, &self.key).expect("opening key");
-        let (nonce, sealed) = data.split_at_mut(NONCE_LEN);
-        let nonce =
-            Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
-        let unsealed = open_in_place(&key, nonce, ad, 0, sealed)
-            .map_err(|_| "invalid key/nonce/value: bad seal")?;
-
-        if let Ok(unsealed_utf8) = str::from_utf8(unsealed) {
-            Ok(unsealed_utf8.to_string())
-        } else {
-            warn!(
-                "Private cookie does not have utf8 content!
-It is likely the secret key used to encrypt them has been leaked.
-Please change it as soon as possible."
-            );
-            Err("bad unsealed utf8")
-        }
-    }
-
-    /// Returns a reference to the `Cookie` inside this jar with the name `name`
-    /// and authenticates and decrypts the cookie's value, returning a `Cookie`
-    /// with the decrypted value. If the cookie cannot be found, or the cookie
-    /// fails to authenticate or decrypt, `None` is returned.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// let mut private_jar = jar.private(&key);
-    /// assert!(private_jar.get("name").is_none());
-    ///
-    /// private_jar.add(Cookie::new("name", "value"));
-    /// assert_eq!(private_jar.get("name").unwrap().value(), "value");
-    /// ```
-    pub fn get(&self, name: &str) -> Option<Cookie<'static>> {
-        if let Some(cookie_ref) = self.parent.get(name) {
-            let mut cookie = cookie_ref.clone();
-            if let Ok(value) = self.unseal(name, cookie.value()) {
-                cookie.set_value(value);
-                return Some(cookie);
-            }
-        }
-
-        None
-    }
-
-    /// Adds `cookie` to the parent jar. The cookie's value is encrypted with
-    /// authenticated encryption assuring confidentiality, integrity, and
-    /// authenticity.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// jar.private(&key).add(Cookie::new("name", "value"));
-    ///
-    /// assert_ne!(jar.get("name").unwrap().value(), "value");
-    /// assert_eq!(jar.private(&key).get("name").unwrap().value(), "value");
-    /// ```
-    pub fn add(&mut self, mut cookie: Cookie<'static>) {
-        self.encrypt_cookie(&mut cookie);
-
-        // Add the sealed cookie to the parent.
-        self.parent.add(cookie);
-    }
-
-    /// Adds an "original" `cookie` to parent jar. The cookie's value is
-    /// encrypted with authenticated encryption assuring confidentiality,
-    /// integrity, and authenticity. Adding an original cookie does not affect
-    /// the [`CookieJar::delta()`](struct.CookieJar.html#method.delta)
-    /// computation. This method is intended to be used to seed the cookie jar
-    /// with cookies received from a client's HTTP message.
-    ///
-    /// For accurate `delta` computations, this method should not be called
-    /// after calling `remove`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// jar.private(&key).add_original(Cookie::new("name", "value"));
-    ///
-    /// assert_eq!(jar.iter().count(), 1);
-    /// assert_eq!(jar.delta().count(), 0);
-    /// ```
-    pub fn add_original(&mut self, mut cookie: Cookie<'static>) {
-        self.encrypt_cookie(&mut cookie);
-
-        // Add the sealed cookie to the parent.
-        self.parent.add_original(cookie);
-    }
-
-    /// Encrypts the cookie's value with
-    /// authenticated encryption assuring confidentiality, integrity, and authenticity.
-    fn encrypt_cookie(&self, cookie: &mut Cookie) {
-        let name = cookie.name().as_bytes();
-        let value = cookie.value().as_bytes();
-        let data = encrypt_name_value(name, value, &self.key);
-
-        // Base64 encode the nonce and encrypted value.
-        let sealed_value = base64::encode(&data);
-        cookie.set_value(sealed_value);
-    }
-
-    /// Removes `cookie` from the parent jar.
-    ///
-    /// For correct removal, the passed in `cookie` must contain the same `path`
-    /// and `domain` as the cookie that was initially set.
-    ///
-    /// See [CookieJar::remove](struct.CookieJar.html#method.remove) for more
-    /// details.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// let mut private_jar = jar.private(&key);
-    ///
-    /// private_jar.add(Cookie::new("name", "value"));
-    /// assert!(private_jar.get("name").is_some());
-    ///
-    /// private_jar.remove(Cookie::named("name"));
-    /// assert!(private_jar.get("name").is_none());
-    /// ```
-    pub fn remove(&mut self, cookie: Cookie<'static>) {
-        self.parent.remove(cookie);
-    }
-}
-
-fn encrypt_name_value(name: &[u8], value: &[u8], key: &[u8]) -> Vec<u8> {
-    // Create the `SealingKey` structure.
-    let key = SealingKey::new(ALGO, key).expect("sealing key creation");
-
-    // Create a vec to hold the [nonce | cookie value | overhead].
-    let overhead = ALGO.tag_len();
-    let mut data = vec![0; NONCE_LEN + value.len() + overhead];
-
-    // Randomly generate the nonce, then copy the cookie value as input.
-    let (nonce, in_out) = data.split_at_mut(NONCE_LEN);
-    SystemRandom::new()
-        .fill(nonce)
-        .expect("couldn't random fill nonce");
-    in_out[..value.len()].copy_from_slice(value);
-    let nonce =
-        Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
-
-    // Use cookie's name as associated data to prevent value swapping.
-    let ad = Aad::from(name);
-
-    // Perform the actual sealing operation and get the output length.
-    let output_len =
-        seal_in_place(&key, nonce, ad, in_out, overhead).expect("in-place seal");
-
-    // Remove the overhead and return the sealed content.
-    data.truncate(NONCE_LEN + output_len);
-    data
-}
-
-#[cfg(test)]
-mod test {
-    use super::{encrypt_name_value, Cookie, CookieJar, Key};
-
-    #[test]
-    fn simple() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-        assert_simple_behaviour!(jar, jar.private(&key));
-    }
-
-    #[test]
-    fn private() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-        assert_secure_behaviour!(jar, jar.private(&key));
-    }
-
-    #[test]
-    fn non_utf8() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-
-        let name = "malicious";
-        let mut assert_non_utf8 = |value: &[u8]| {
-            let sealed = encrypt_name_value(name.as_bytes(), value, &key.encryption());
-            let encoded = base64::encode(&sealed);
-            assert_eq!(
-                jar.private(&key).unseal(name, &encoded),
-                Err("bad unsealed utf8")
-            );
-            jar.add(Cookie::new(name, encoded));
-            assert_eq!(jar.private(&key).get(name), None);
-        };
-
-        assert_non_utf8(&[0x72, 0xfb, 0xdf, 0x74]); // rûst in ISO/IEC 8859-1
-
-        let mut malicious =
-            String::from(r#"{"id":"abc123??%X","admin":true}"#).into_bytes();
-        malicious[8] |= 0b1100_0000;
-        malicious[9] |= 0b1100_0000;
-        assert_non_utf8(&malicious);
-    }
-}

actix-http/src/cookie/secure/signed.rs

@@ -1,185 +0,0 @@
-use ring::digest::{Algorithm, SHA256};
-use ring::hmac::{sign, verify_with_own_key as verify, SigningKey};
-
-use super::Key;
-use crate::cookie::{Cookie, CookieJar};
-
-// Keep these in sync, and keep the key len synced with the `signed` docs as
-// well as the `KEYS_INFO` const in secure::Key.
-static HMAC_DIGEST: &Algorithm = &SHA256;
-const BASE64_DIGEST_LEN: usize = 44;
-pub const KEY_LEN: usize = 32;
-
-/// A child cookie jar that authenticates its cookies.
-///
-/// A _signed_ child jar signs all the cookies added to it and verifies cookies
-/// retrieved from it. Any cookies stored in a `SignedJar` are assured integrity
-/// and authenticity. In other words, clients cannot tamper with the contents of
-/// a cookie nor can they fabricate cookie values, but the data is visible in
-/// plaintext.
-///
-/// This type is only available when the `secure` feature is enabled.
-pub struct SignedJar<'a> {
-    parent: &'a mut CookieJar,
-    key: SigningKey,
-}
-
-impl<'a> SignedJar<'a> {
-    /// Creates a new child `SignedJar` with parent `parent` and key `key`. This
-    /// method is typically called indirectly via the `signed` method of
-    /// `CookieJar`.
-    #[doc(hidden)]
-    pub fn new(parent: &'a mut CookieJar, key: &Key) -> SignedJar<'a> {
-        SignedJar {
-            parent,
-            key: SigningKey::new(HMAC_DIGEST, key.signing()),
-        }
-    }
-
-    /// Given a signed value `str` where the signature is prepended to `value`,
-    /// verifies the signed value and returns it. If there's a problem, returns
-    /// an `Err` with a string describing the issue.
-    fn verify(&self, cookie_value: &str) -> Result<String, &'static str> {
-        if cookie_value.len() < BASE64_DIGEST_LEN {
-            return Err("length of value is <= BASE64_DIGEST_LEN");
-        }
-
-        let (digest_str, value) = cookie_value.split_at(BASE64_DIGEST_LEN);
-        let sig = base64::decode(digest_str).map_err(|_| "bad base64 digest")?;
-
-        verify(&self.key, value.as_bytes(), &sig)
-            .map(|_| value.to_string())
-            .map_err(|_| "value did not verify")
-    }
-
-    /// Returns a reference to the `Cookie` inside this jar with the name `name`
-    /// and verifies the authenticity and integrity of the cookie's value,
-    /// returning a `Cookie` with the authenticated value. If the cookie cannot
-    /// be found, or the cookie fails to verify, `None` is returned.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// let mut signed_jar = jar.signed(&key);
-    /// assert!(signed_jar.get("name").is_none());
-    ///
-    /// signed_jar.add(Cookie::new("name", "value"));
-    /// assert_eq!(signed_jar.get("name").unwrap().value(), "value");
-    /// ```
-    pub fn get(&self, name: &str) -> Option<Cookie<'static>> {
-        if let Some(cookie_ref) = self.parent.get(name) {
-            let mut cookie = cookie_ref.clone();
-            if let Ok(value) = self.verify(cookie.value()) {
-                cookie.set_value(value);
-                return Some(cookie);
-            }
-        }
-
-        None
-    }
-
-    /// Adds `cookie` to the parent jar. The cookie's value is signed assuring
-    /// integrity and authenticity.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// jar.signed(&key).add(Cookie::new("name", "value"));
-    ///
-    /// assert_ne!(jar.get("name").unwrap().value(), "value");
-    /// assert!(jar.get("name").unwrap().value().contains("value"));
-    /// assert_eq!(jar.signed(&key).get("name").unwrap().value(), "value");
-    /// ```
-    pub fn add(&mut self, mut cookie: Cookie<'static>) {
-        self.sign_cookie(&mut cookie);
-        self.parent.add(cookie);
-    }
-
-    /// Adds an "original" `cookie` to this jar. The cookie's value is signed
-    /// assuring integrity and authenticity. Adding an original cookie does not
-    /// affect the [`CookieJar::delta()`](struct.CookieJar.html#method.delta)
-    /// computation. This method is intended to be used to seed the cookie jar
-    /// with cookies received from a client's HTTP message.
-    ///
-    /// For accurate `delta` computations, this method should not be called
-    /// after calling `remove`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// jar.signed(&key).add_original(Cookie::new("name", "value"));
-    ///
-    /// assert_eq!(jar.iter().count(), 1);
-    /// assert_eq!(jar.delta().count(), 0);
-    /// ```
-    pub fn add_original(&mut self, mut cookie: Cookie<'static>) {
-        self.sign_cookie(&mut cookie);
-        self.parent.add_original(cookie);
-    }
-
-    /// Signs the cookie's value assuring integrity and authenticity.
-    fn sign_cookie(&self, cookie: &mut Cookie) {
-        let digest = sign(&self.key, cookie.value().as_bytes());
-        let mut new_value = base64::encode(digest.as_ref());
-        new_value.push_str(cookie.value());
-        cookie.set_value(new_value);
-    }
-
-    /// Removes `cookie` from the parent jar.
-    ///
-    /// For correct removal, the passed in `cookie` must contain the same `path`
-    /// and `domain` as the cookie that was initially set.
-    ///
-    /// See [CookieJar::remove](struct.CookieJar.html#method.remove) for more
-    /// details.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// let mut signed_jar = jar.signed(&key);
-    ///
-    /// signed_jar.add(Cookie::new("name", "value"));
-    /// assert!(signed_jar.get("name").is_some());
-    ///
-    /// signed_jar.remove(Cookie::named("name"));
-    /// assert!(signed_jar.get("name").is_none());
-    /// ```
-    pub fn remove(&mut self, cookie: Cookie<'static>) {
-        self.parent.remove(cookie);
-    }
-}
-
-#[cfg(test)]
-mod test {
-    use super::{Cookie, CookieJar, Key};
-
-    #[test]
-    fn simple() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-        assert_simple_behaviour!(jar, jar.signed(&key));
-    }
-
-    #[test]
-    fn private() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-        assert_secure_behaviour!(jar, jar.signed(&key));
-    }
-}

actix-http/src/encoding/decoder.rs

@@ -1,12 +1,13 @@
+use std::future::Future;
 use std::io::{self, Write};
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use actix_threadpool::{run, CpuFuture};
-#[cfg(feature = "brotli")]
 use brotli2::write::BrotliDecoder;
 use bytes::Bytes;
-#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
 use flate2::write::{GzDecoder, ZlibDecoder};
-use futures::{try_ready, Async, Future, Poll, Stream};
+use futures_core::{ready, Stream};
 
 use super::Writer;
 use crate::error::PayloadError;
@@ -23,21 +24,18 @@ pub struct Decoder<S> {
 
 impl<S> Decoder<S>
 where
-    S: Stream<Item = Bytes, Error = PayloadError>,
+    S: Stream<Item = Result<Bytes, PayloadError>>,
 {
     /// Construct a decoder.
     #[inline]
     pub fn new(stream: S, encoding: ContentEncoding) -> Decoder<S> {
         let decoder = match encoding {
-            #[cfg(feature = "brotli")]
             ContentEncoding::Br => Some(ContentDecoder::Br(Box::new(
                 BrotliDecoder::new(Writer::new()),
             ))),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Deflate => Some(ContentDecoder::Deflate(Box::new(
                 ZlibDecoder::new(Writer::new()),
             ))),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Gzip => Some(ContentDecoder::Gzip(Box::new(
                 GzDecoder::new(Writer::new()),
             ))),
@@ -71,34 +69,40 @@ where
 
 impl<S> Stream for Decoder<S>
 where
-    S: Stream<Item = Bytes, Error = PayloadError>,
+    S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
 {
-    type Item = Bytes;
+    type Item = Result<Bytes, PayloadError>;
-    type Error = PayloadError;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
         loop {
             if let Some(ref mut fut) = self.fut {
-                let (chunk, decoder) = try_ready!(fut.poll());
+                let (chunk, decoder) = match ready!(Pin::new(fut).poll(cx)) {
+                    Ok(item) => item,
+                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
+                };
                 self.decoder = Some(decoder);
                 self.fut.take();
                 if let Some(chunk) = chunk {
-                    return Ok(Async::Ready(Some(chunk)));
+                    return Poll::Ready(Some(Ok(chunk)));
                 }
             }
 
             if self.eof {
-                return Ok(Async::Ready(None));
+                return Poll::Ready(None);
             }
 
-            match self.stream.poll()? {
+            match Pin::new(&mut self.stream).poll_next(cx) {
-                Async::Ready(Some(chunk)) => {
+                Poll::Ready(Some(Err(err))) => return Poll::Ready(Some(Err(err))),
+                Poll::Ready(Some(Ok(chunk))) => {
                     if let Some(mut decoder) = self.decoder.take() {
                         if chunk.len() < INPLACE {
                             let chunk = decoder.feed_data(chunk)?;
                             self.decoder = Some(decoder);
                             if let Some(chunk) = chunk {
-                                return Ok(Async::Ready(Some(chunk)));
+                                return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
                             self.fut = Some(run(move || {
@@ -108,41 +112,40 @@ where
                         }
                         continue;
                     } else {
-                        return Ok(Async::Ready(Some(chunk)));
+                        return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Async::Ready(None) => {
+                Poll::Ready(None) => {
                     self.eof = true;
                     return if let Some(mut decoder) = self.decoder.take() {
-                        Ok(Async::Ready(decoder.feed_eof()?))
+                        match decoder.feed_eof() {
+                            Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
+                            Ok(None) => Poll::Ready(None),
+                            Err(err) => Poll::Ready(Some(Err(err.into()))),
+                        }
                     } else {
-                        Ok(Async::Ready(None))
+                        Poll::Ready(None)
                     };
                 }
-                Async::NotReady => break,
+                Poll::Pending => break,
             }
         }
-        Ok(Async::NotReady)
+        Poll::Pending
     }
 }
 
 enum ContentDecoder {
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Deflate(Box<ZlibDecoder<Writer>>),
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Gzip(Box<GzDecoder<Writer>>),
-    #[cfg(feature = "brotli")]
     Br(Box<BrotliDecoder<Writer>>),
 }
 
 impl ContentDecoder {
-    #[allow(unreachable_patterns)]
     fn feed_eof(&mut self) -> io::Result<Option<Bytes>> {
         match self {
-            #[cfg(feature = "brotli")]
+            ContentDecoder::Br(ref mut decoder) => match decoder.flush() {
-            ContentDecoder::Br(ref mut decoder) => match decoder.finish() {
+                Ok(()) => {
-                Ok(mut writer) => {
+                    let b = decoder.get_mut().take();
-                    let b = writer.take();
                     if !b.is_empty() {
                         Ok(Some(b))
                     } else {
@@ -151,7 +154,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.try_finish() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
@@ -163,7 +165,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
@@ -175,14 +176,11 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            _ => Ok(None),
         }
     }
 
-    #[allow(unreachable_patterns)]
     fn feed_data(&mut self, data: Bytes) -> io::Result<Option<Bytes>> {
         match self {
-            #[cfg(feature = "brotli")]
             ContentDecoder::Br(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
@@ -195,7 +193,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
@@ -208,7 +205,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
@@ -221,7 +217,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            _ => Ok(Some(data)),
         }
     }
 }

actix-http/src/encoding/encoder.rs

@@ -1,25 +1,29 @@
 //! Stream encoder
+use std::future::Future;
 use std::io::{self, Write};
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use actix_threadpool::{run, CpuFuture};
-#[cfg(feature = "brotli")]
 use brotli2::write::BrotliEncoder;
 use bytes::Bytes;
-#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
 use flate2::write::{GzEncoder, ZlibEncoder};
-use futures::{Async, Future, Poll};
+use futures_core::ready;
+use pin_project::pin_project;
 
 use crate::body::{Body, BodySize, MessageBody, ResponseBody};
 use crate::http::header::{ContentEncoding, CONTENT_ENCODING};
-use crate::http::{HeaderValue, HttpTryFrom, StatusCode};
+use crate::http::{HeaderValue, StatusCode};
 use crate::{Error, ResponseHead};
 
 use super::Writer;
 
-const INPLACE: usize = 2049;
+const INPLACE: usize = 1024;
 
+#[pin_project]
 pub struct Encoder<B> {
     eof: bool,
+    #[pin]
     body: EncoderBody<B>,
     encoder: Option<ContentEncoder>,
     fut: Option<CpuFuture<ContentEncoder, io::Error>>,
@@ -75,86 +79,110 @@ impl<B: MessageBody> Encoder<B> {
     }
 }
 
+#[pin_project(project = EncoderBodyProj)]
 enum EncoderBody<B> {
     Bytes(Bytes),
-    Stream(B),
+    Stream(#[pin] B),
-    BoxedStream(Box<dyn MessageBody>),
+    BoxedStream(Box<dyn MessageBody + Unpin>),
+}
+
+impl<B: MessageBody> MessageBody for EncoderBody<B> {
+    fn size(&self) -> BodySize {
+        match self {
+            EncoderBody::Bytes(ref b) => b.size(),
+            EncoderBody::Stream(ref b) => b.size(),
+            EncoderBody::BoxedStream(ref b) => b.size(),
+        }
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        match self.project() {
+            EncoderBodyProj::Bytes(b) => {
+                if b.is_empty() {
+                    Poll::Ready(None)
+                } else {
+                    Poll::Ready(Some(Ok(std::mem::take(b))))
+                }
+            }
+            EncoderBodyProj::Stream(b) => b.poll_next(cx),
+            EncoderBodyProj::BoxedStream(ref mut b) => {
+                Pin::new(b.as_mut()).poll_next(cx)
+            }
+        }
+    }
 }
 
 impl<B: MessageBody> MessageBody for Encoder<B> {
     fn size(&self) -> BodySize {
         if self.encoder.is_none() {
-            match self.body {
+            self.body.size()
-                EncoderBody::Bytes(ref b) => b.size(),
-                EncoderBody::Stream(ref b) => b.size(),
-                EncoderBody::BoxedStream(ref b) => b.size(),
-            }
         } else {
             BodySize::Stream
         }
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        let mut this = self.project();
         loop {
-            if self.eof {
+            if *this.eof {
-                return Ok(Async::Ready(None));
+                return Poll::Ready(None);
             }
 
-            if let Some(ref mut fut) = self.fut {
+            if let Some(ref mut fut) = this.fut {
-                let mut encoder = futures::try_ready!(fut.poll());
+                let mut encoder = match ready!(Pin::new(fut).poll(cx)) {
-                let chunk = encoder.take();
+                    Ok(item) => item,
-                self.encoder = Some(encoder);
+                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
-                self.fut.take();
-                if !chunk.is_empty() {
-                    return Ok(Async::Ready(Some(chunk)));
-                }
-            }
-
-            let result = match self.body {
-                EncoderBody::Bytes(ref mut b) => {
-                    if b.is_empty() {
-                        Async::Ready(None)
-                    } else {
-                        Async::Ready(Some(std::mem::replace(b, Bytes::new())))
-                    }
-                }
-                EncoderBody::Stream(ref mut b) => b.poll_next()?,
-                EncoderBody::BoxedStream(ref mut b) => b.poll_next()?,
                 };
+                let chunk = encoder.take();
+                *this.encoder = Some(encoder);
+                this.fut.take();
+                if !chunk.is_empty() {
+                    return Poll::Ready(Some(Ok(chunk)));
+                }
+            }
+
+            let result = this.body.as_mut().poll_next(cx);
+
             match result {
-                Async::NotReady => return Ok(Async::NotReady),
+                Poll::Ready(Some(Ok(chunk))) => {
-                Async::Ready(Some(chunk)) => {
+                    if let Some(mut encoder) = this.encoder.take() {
-                    if let Some(mut encoder) = self.encoder.take() {
                         if chunk.len() < INPLACE {
                             encoder.write(&chunk)?;
                             let chunk = encoder.take();
-                            self.encoder = Some(encoder);
+                            *this.encoder = Some(encoder);
                             if !chunk.is_empty() {
-                                return Ok(Async::Ready(Some(chunk)));
+                                return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
-                            self.fut = Some(run(move || {
+                            *this.fut = Some(run(move || {
                                 encoder.write(&chunk)?;
                                 Ok(encoder)
                             }));
                         }
                     } else {
-                        return Ok(Async::Ready(Some(chunk)));
+                        return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Async::Ready(None) => {
+                Poll::Ready(None) => {
-                    if let Some(encoder) = self.encoder.take() {
+                    if let Some(encoder) = this.encoder.take() {
                         let chunk = encoder.finish()?;
                         if chunk.is_empty() {
-                            return Ok(Async::Ready(None));
+                            return Poll::Ready(None);
                         } else {
-                            self.eof = true;
+                            *this.eof = true;
-                            return Ok(Async::Ready(Some(chunk)));
+                            return Poll::Ready(Some(Ok(chunk)));
                         }
                     } else {
-                        return Ok(Async::Ready(None));
+                        return Poll::Ready(None);
                     }
                 }
+                val => return val,
             }
         }
     }
@@ -163,33 +191,27 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
 fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) {
     head.headers_mut().insert(
         CONTENT_ENCODING,
-        HeaderValue::try_from(Bytes::from_static(encoding.as_str().as_bytes())).unwrap(),
+        HeaderValue::from_static(encoding.as_str()),
     );
 }
 
 enum ContentEncoder {
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Deflate(ZlibEncoder<Writer>),
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Gzip(GzEncoder<Writer>),
-    #[cfg(feature = "brotli")]
     Br(BrotliEncoder<Writer>),
 }
 
 impl ContentEncoder {
     fn encoder(encoding: ContentEncoding) -> Option<Self> {
         match encoding {
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Deflate => Some(ContentEncoder::Deflate(ZlibEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Gzip => Some(ContentEncoder::Gzip(GzEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
-            #[cfg(feature = "brotli")]
             ContentEncoding::Br => {
                 Some(ContentEncoder::Br(BrotliEncoder::new(Writer::new(), 3)))
             }
@@ -200,28 +222,22 @@ impl ContentEncoder {
     #[inline]
     pub(crate) fn take(&mut self) -> Bytes {
         match *self {
-            #[cfg(feature = "brotli")]
             ContentEncoder::Br(ref mut encoder) => encoder.get_mut().take(),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Deflate(ref mut encoder) => encoder.get_mut().take(),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Gzip(ref mut encoder) => encoder.get_mut().take(),
         }
     }
 
     fn finish(self) -> Result<Bytes, io::Error> {
         match self {
-            #[cfg(feature = "brotli")]
             ContentEncoder::Br(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Gzip(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Deflate(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
@@ -231,7 +247,6 @@ impl ContentEncoder {
 
     fn write(&mut self, data: &[u8]) -> Result<(), io::Error> {
         match *self {
-            #[cfg(feature = "brotli")]
             ContentEncoder::Br(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -239,7 +254,6 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Gzip(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -247,7 +261,6 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Deflate(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {

actix-http/src/encoding/mod.rs

@@ -19,8 +19,9 @@ impl Writer {
             buf: BytesMut::with_capacity(8192),
         }
     }
+
     fn take(&mut self) -> Bytes {
-        self.buf.take().freeze()
+        self.buf.split().freeze()
     }
 }
 
@@ -29,6 +30,7 @@ impl io::Write for Writer {
         self.buf.extend_from_slice(buf);
         Ok(buf.len())
     }
+
     fn flush(&mut self) -> io::Result<()> {
         Ok(())
     }

actix-http/src/error.rs

@@ -1,29 +1,29 @@
 //! Error and Result module
-use std::any::TypeId;
+
 use std::cell::RefCell;
 use std::io::Write;
 use std::str::Utf8Error;
 use std::string::FromUtf8Error;
 use std::{fmt, io, result};
 
+use actix_codec::{Decoder, Encoder};
 pub use actix_threadpool::BlockingError;
+use actix_utils::dispatcher::DispatcherError as FramedDispatcherError;
 use actix_utils::timeout::TimeoutError;
 use bytes::BytesMut;
 use derive_more::{Display, From};
-use futures::Canceled;
+pub use futures_channel::oneshot::Canceled;
 use http::uri::InvalidUri;
 use http::{header, Error as HttpError, StatusCode};
-use httparse;
 use serde::de::value::Error as DeError;
 use serde_json::error::Error as JsonError;
 use serde_urlencoded::ser::Error as FormError;
-use tokio_timer::Error as TimerError;
 
-// re-export for convinience
+// re-export for convenience
 use crate::body::Body;
 pub use crate::cookie::ParseError as CookieParseError;
 use crate::helpers::Writer;
-use crate::response::Response;
+use crate::response::{Response, ResponseBuilder};
 
 /// A specialized [`Result`](https://doc.rust-lang.org/std/result/enum.Result.html)
 /// for actix web operations
@@ -35,7 +35,7 @@ pub type Result<T, E = Error> = result::Result<T, E>;
 
 /// General purpose actix web error.
 ///
-/// An actix web error is used to carry errors from `failure` or `std::error`
+/// An actix web error is used to carry errors from `std::error`
 /// through actix in a convenient way.  It can be created through
 /// converting errors with `into()`.
 ///
@@ -61,54 +61,51 @@ impl Error {
 
 /// Error that can be converted to `Response`
 pub trait ResponseError: fmt::Debug + fmt::Display {
+    /// Response's status code
+    ///
+    /// Internal server error is generated by default.
+    fn status_code(&self) -> StatusCode {
+        StatusCode::INTERNAL_SERVER_ERROR
+    }
+
     /// Create response for error
     ///
     /// Internal server error is generated by default.
     fn error_response(&self) -> Response {
-        Response::new(StatusCode::INTERNAL_SERVER_ERROR)
+        let mut resp = Response::new(self.status_code());
-    }
-
-    /// Constructs an error response
-    fn render_response(&self) -> Response {
-        let mut resp = self.error_response();
         let mut buf = BytesMut::new();
         let _ = write!(Writer(&mut buf), "{}", self);
         resp.headers_mut().insert(
             header::CONTENT_TYPE,
-            header::HeaderValue::from_static("text/plain"),
+            header::HeaderValue::from_static("text/plain; charset=utf-8"),
         );
         resp.set_body(Body::from(buf))
     }
 
-    #[doc(hidden)]
+    downcast_get_type_id!();
-    fn __private_get_type_id__(&self) -> TypeId
-    where
-        Self: 'static,
-    {
-        TypeId::of::<Self>()
-    }
 }
 
-impl dyn ResponseError + 'static {
+downcast!(ResponseError);
-    /// Downcasts a response error to a specific type.
-    pub fn downcast_ref<T: ResponseError + 'static>(&self) -> Option<&T> {
-        if self.__private_get_type_id__() == TypeId::of::<T>() {
-            unsafe { Some(&*(self as *const dyn ResponseError as *const T)) }
-        } else {
-            None
-        }
-    }
-}
 
 impl fmt::Display for Error {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt::Display::fmt(&self.cause, f)
     }
 }
 
 impl fmt::Debug for Error {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        writeln!(f, "{:?}", &self.cause)
+        write!(f, "{:?}", &self.cause)
+    }
+}
+
+impl std::error::Error for Error {
+    fn cause(&self) -> Option<&dyn std::error::Error> {
+        None
+    }
+
+    fn source(&self) -> Option<&(dyn std::error::Error + 'static)> {
+        None
     }
 }
 
@@ -118,17 +115,11 @@ impl From<()> for Error {
     }
 }
 
-impl std::error::Error for Error {
+impl From<std::convert::Infallible> for Error {
-    fn description(&self) -> &str {
+    fn from(_: std::convert::Infallible) -> Self {
-        "actix-http::Error"
+        // `std::convert::Infallible` indicates an error
-    }
+        // that will never happen
-
+        unreachable!()
-    fn cause(&self) -> Option<&dyn std::error::Error> {
-        None
-    }
-
-    fn source(&self) -> Option<&(dyn std::error::Error + 'static)> {
-        None
     }
 }
 
@@ -148,12 +139,26 @@ impl<T: ResponseError + 'static> From<T> for Error {
     }
 }
 
+/// Convert Response to a Error
+impl From<Response> for Error {
+    fn from(res: Response) -> Error {
+        InternalError::from_response("", res).into()
+    }
+}
+
+/// Convert ResponseBuilder to a Error
+impl From<ResponseBuilder> for Error {
+    fn from(mut res: ResponseBuilder) -> Error {
+        InternalError::from_response("", res.finish()).into()
+    }
+}
+
 /// Return `GATEWAY_TIMEOUT` for `TimeoutError`
 impl<E: ResponseError> ResponseError for TimeoutError<E> {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
         match self {
-            TimeoutError::Service(e) => e.error_response(),
+            TimeoutError::Service(e) => e.status_code(),
-            TimeoutError::Timeout => Response::new(StatusCode::GATEWAY_TIMEOUT),
+            TimeoutError::Timeout => StatusCode::GATEWAY_TIMEOUT,
         }
     }
 }
@@ -171,31 +176,31 @@ impl ResponseError for JsonError {}
 /// `InternalServerError` for `FormError`
 impl ResponseError for FormError {}
 
-/// `InternalServerError` for `TimerError`
+#[cfg(feature = "openssl")]
-impl ResponseError for TimerError {}
-
-#[cfg(feature = "ssl")]
 /// `InternalServerError` for `openssl::ssl::Error`
-impl ResponseError for openssl::ssl::Error {}
+impl ResponseError for actix_connect::ssl::openssl::SslError {}
 
-#[cfg(feature = "ssl")]
+#[cfg(feature = "openssl")]
 /// `InternalServerError` for `openssl::ssl::HandshakeError`
-impl ResponseError for openssl::ssl::HandshakeError<tokio_tcp::TcpStream> {}
+impl<T: std::fmt::Debug> ResponseError for actix_tls::openssl::HandshakeError<T> {}
 
 /// Return `BAD_REQUEST` for `de::value::Error`
 impl ResponseError for DeError {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
-        Response::new(StatusCode::BAD_REQUEST)
+        StatusCode::BAD_REQUEST
     }
 }
 
+/// `InternalServerError` for `Canceled`
+impl ResponseError for Canceled {}
+
 /// `InternalServerError` for `BlockingError`
 impl<E: fmt::Debug> ResponseError for BlockingError<E> {}
 
 /// Return `BAD_REQUEST` for `Utf8Error`
 impl ResponseError for Utf8Error {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
-        Response::new(StatusCode::BAD_REQUEST)
+        StatusCode::BAD_REQUEST
     }
 }
 
@@ -205,32 +210,22 @@ impl ResponseError for HttpError {}
 
 /// Return `InternalServerError` for `io::Error`
 impl ResponseError for io::Error {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
         match self.kind() {
-            io::ErrorKind::NotFound => Response::new(StatusCode::NOT_FOUND),
+            io::ErrorKind::NotFound => StatusCode::NOT_FOUND,
-            io::ErrorKind::PermissionDenied => Response::new(StatusCode::FORBIDDEN),
+            io::ErrorKind::PermissionDenied => StatusCode::FORBIDDEN,
-            _ => Response::new(StatusCode::INTERNAL_SERVER_ERROR),
+            _ => StatusCode::INTERNAL_SERVER_ERROR,
         }
     }
 }
 
 /// `BadRequest` for `InvalidHeaderValue`
 impl ResponseError for header::InvalidHeaderValue {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
-        Response::new(StatusCode::BAD_REQUEST)
+        StatusCode::BAD_REQUEST
     }
 }
 
-/// `BadRequest` for `InvalidHeaderValue`
-impl ResponseError for header::InvalidHeaderValueBytes {
-    fn error_response(&self) -> Response {
-        Response::new(StatusCode::BAD_REQUEST)
-    }
-}
-
-/// `InternalServerError` for `futures::Canceled`
-impl ResponseError for Canceled {}
-
 /// A set of errors that can occur during parsing HTTP streams
 #[derive(Debug, Display)]
 pub enum ParseError {
@@ -270,8 +265,8 @@ pub enum ParseError {
 
 /// Return `BadRequest` for `ParseError`
 impl ResponseError for ParseError {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
-        Response::new(StatusCode::BAD_REQUEST)
+        StatusCode::BAD_REQUEST
     }
 }
 
@@ -339,6 +334,8 @@ pub enum PayloadError {
     Io(io::Error),
 }
 
+impl std::error::Error for PayloadError {}
+
 impl From<h2::Error> for PayloadError {
     fn from(err: h2::Error) -> Self {
         PayloadError::Http2Payload(err)
@@ -363,7 +360,7 @@ impl From<BlockingError<io::Error>> for PayloadError {
             BlockingError::Error(e) => PayloadError::Io(e),
             BlockingError::Canceled => PayloadError::Io(io::Error::new(
                 io::ErrorKind::Other,
-                "Thread pool is gone",
+                "Operation is canceled",
             )),
         }
     }
@@ -374,18 +371,18 @@ impl From<BlockingError<io::Error>> for PayloadError {
 /// - `Overflow` returns `PayloadTooLarge`
 /// - Other errors returns `BadRequest`
 impl ResponseError for PayloadError {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
         match *self {
-            PayloadError::Overflow => Response::new(StatusCode::PAYLOAD_TOO_LARGE),
+            PayloadError::Overflow => StatusCode::PAYLOAD_TOO_LARGE,
-            _ => Response::new(StatusCode::BAD_REQUEST),
+            _ => StatusCode::BAD_REQUEST,
         }
     }
 }
 
 /// Return `BadRequest` for `cookie::ParseError`
 impl ResponseError for crate::cookie::ParseError {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
-        Response::new(StatusCode::BAD_REQUEST)
+        StatusCode::BAD_REQUEST
     }
 }
 
@@ -436,7 +433,7 @@ pub enum DispatchError {
     Unknown,
 }
 
-/// A set of error that can occure during parsing content type
+/// A set of error that can occur during parsing content type
 #[derive(PartialEq, Debug, Display)]
 pub enum ContentTypeError {
     /// Can not parse content type
@@ -447,13 +444,23 @@ pub enum ContentTypeError {
     UnknownEncoding,
 }
 
+impl std::error::Error for ContentTypeError {}
+
 /// Return `BadRequest` for `ContentTypeError`
 impl ResponseError for ContentTypeError {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
-        Response::new(StatusCode::BAD_REQUEST)
+        StatusCode::BAD_REQUEST
     }
 }
 
+impl<E, U: Encoder<I> + Decoder, I> ResponseError for FramedDispatcherError<E, U, I>
+where
+    E: fmt::Debug + fmt::Display,
+    <U as Encoder<I>>::Error: fmt::Debug,
+    <U as Decoder>::Error: fmt::Debug,
+{
+}
+
 /// Helper type that can wrap any error and generate custom response.
 ///
 /// In following example any `io::Error` will be converted into "BAD REQUEST"
@@ -461,14 +468,12 @@ impl ResponseError for ContentTypeError {
 /// default.
 ///
 /// ```rust
-/// # extern crate actix_http;
 /// # use std::io;
 /// # use actix_http::*;
 ///
 /// fn index(req: Request) -> Result<&'static str> {
 ///     Err(error::ErrorBadRequest(io::Error::new(io::ErrorKind::Other, "error")))
 /// }
-/// # fn main() {}
 /// ```
 pub struct InternalError<T> {
     cause: T,
@@ -502,7 +507,7 @@ impl<T> fmt::Debug for InternalError<T>
 where
     T: fmt::Debug + 'static,
 {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt::Debug::fmt(&self.cause, f)
     }
 }
@@ -511,7 +516,7 @@ impl<T> fmt::Display for InternalError<T>
 where
     T: fmt::Display + 'static,
 {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt::Display::fmt(&self.cause, f)
     }
 }
@@ -520,6 +525,19 @@ impl<T> ResponseError for InternalError<T>
 where
     T: fmt::Debug + fmt::Display + 'static,
 {
+    fn status_code(&self) -> StatusCode {
+        match self.status {
+            InternalErrorType::Status(st) => st,
+            InternalErrorType::Response(ref resp) => {
+                if let Some(resp) = resp.borrow().as_ref() {
+                    resp.head().status
+                } else {
+                    StatusCode::INTERNAL_SERVER_ERROR
+                }
+            }
+        }
+    }
+
     fn error_response(&self) -> Response {
         match self.status {
             InternalErrorType::Status(st) => {
@@ -528,7 +546,7 @@ where
                 let _ = write!(Writer(&mut buf), "{}", self);
                 res.headers_mut().insert(
                     header::CONTENT_TYPE,
-                    header::HeaderValue::from_static("text/plain"),
+                    header::HeaderValue::from_static("text/plain; charset=utf-8"),
                 );
                 res.set_body(Body::from(buf))
             }
@@ -541,18 +559,6 @@ where
             }
         }
     }
-
-    /// Constructs an error response
-    fn render_response(&self) -> Response {
-        self.error_response()
-    }
-}
-
-/// Convert Response to a Error
-impl From<Response> for Error {
-    fn from(res: Response) -> Error {
-        InternalError::from_response("", res).into()
-    }
 }
 
 /// Helper function that creates wrapper of any error and generate *BAD
@@ -945,24 +951,20 @@ where
     InternalError::new(err, StatusCode::NETWORK_AUTHENTICATION_REQUIRED).into()
 }
 
-#[cfg(feature = "fail")]
+#[cfg(feature = "actors")]
-mod failure_integration {
+/// `InternalServerError` for `actix::MailboxError`
-    use super::*;
+/// This is supported on feature=`actors` only
+impl ResponseError for actix::MailboxError {}
 
-    /// Compatibility for `failure::Error`
+#[cfg(feature = "actors")]
-    impl ResponseError for failure::Error {
+/// `InternalServerError` for `actix::ResolverError`
-        fn error_response(&self) -> Response {
+/// This is supported on feature=`actors` only
-            Response::new(StatusCode::INTERNAL_SERVER_ERROR)
+impl ResponseError for actix::actors::resolver::ResolverError {}
-        }
-    }
-}
 
 #[cfg(test)]
 mod tests {
     use super::*;
     use http::{Error as HttpError, StatusCode};
-    use httparse;
-    use std::error::Error as StdError;
     use std::io;
 
     #[test]
@@ -991,7 +993,7 @@ mod tests {
     #[test]
     fn test_error_cause() {
         let orig = io::Error::new(io::ErrorKind::Other, "other");
-        let desc = orig.description().to_owned();
+        let desc = orig.to_string();
         let e = Error::from(orig);
         assert_eq!(format!("{}", e.as_response_error()), desc);
     }
@@ -999,7 +1001,7 @@ mod tests {
     #[test]
     fn test_error_display() {
         let orig = io::Error::new(io::ErrorKind::Other, "other");
-        let desc = orig.description().to_owned();
+        let desc = orig.to_string();
         let e = Error::from(orig);
         assert_eq!(format!("{}", e), desc);
     }
@@ -1041,7 +1043,7 @@ mod tests {
             match ParseError::from($from) {
                 e @ $error => {
                     let desc = format!("{}", e);
-                    assert_eq!(desc, format!("IO error: {}", $from.description()));
+                    assert_eq!(desc, format!("IO error: {}", $from));
                 }
                 _ => unreachable!("{:?}", $from),
             }
@@ -1072,7 +1074,7 @@ mod tests {
     #[test]
     fn test_error_casting() {
         let err = PayloadError::Overflow;
-        let resp_err: &ResponseError = &err;
+        let resp_err: &dyn ResponseError = &err;
         let err = resp_err.downcast_ref::<PayloadError>().unwrap();
         assert_eq!(err.to_string(), "A payload reached size limit.");
         let not_err = resp_err.downcast_ref::<ContentTypeError>();

actix-http/src/extensions.rs

@@ -1,12 +1,14 @@
 use std::any::{Any, TypeId};
 use std::fmt;
 
-use hashbrown::HashMap;
+use fxhash::FxHashMap;
 
 #[derive(Default)]
 /// A type map of request extensions.
 pub struct Extensions {
-    map: HashMap<TypeId, Box<dyn Any>>,
+    /// Use FxHasher with a std HashMap with for faster
+    /// lookups on the small `TypeId` (u64 equivalent) keys.
+    map: FxHashMap<TypeId, Box<dyn Any>>,
 }
 
 impl Extensions {
@@ -14,7 +16,7 @@ impl Extensions {
     #[inline]
     pub fn new() -> Extensions {
         Extensions {
-            map: HashMap::default(),
+            map: FxHashMap::default(),
         }
     }
 
@@ -28,33 +30,30 @@ impl Extensions {
 
     /// Check if container contains entry
     pub fn contains<T: 'static>(&self) -> bool {
-        self.map.get(&TypeId::of::<T>()).is_some()
+        self.map.contains_key(&TypeId::of::<T>())
     }
 
     /// Get a reference to a type previously inserted on this `Extensions`.
     pub fn get<T: 'static>(&self) -> Option<&T> {
         self.map
             .get(&TypeId::of::<T>())
-            .and_then(|boxed| (&**boxed as &(dyn Any + 'static)).downcast_ref())
+            .and_then(|boxed| boxed.downcast_ref())
     }
 
     /// Get a mutable reference to a type previously inserted on this `Extensions`.
     pub fn get_mut<T: 'static>(&mut self) -> Option<&mut T> {
         self.map
             .get_mut(&TypeId::of::<T>())
-            .and_then(|boxed| (&mut **boxed as &mut (dyn Any + 'static)).downcast_mut())
+            .and_then(|boxed| boxed.downcast_mut())
     }
 
     /// Remove a type from this `Extensions`.
     ///
     /// If a extension of this type existed, it will be returned.
     pub fn remove<T: 'static>(&mut self) -> Option<T> {
-        self.map.remove(&TypeId::of::<T>()).and_then(|boxed| {
+        self.map
-            (boxed as Box<dyn Any + 'static>)
+            .remove(&TypeId::of::<T>())
-                .downcast()
+            .and_then(|boxed| boxed.downcast().ok().map(|boxed| *boxed))
-                .ok()
-                .map(|boxed| *boxed)
-        })
     }
 
     /// Clear the `Extensions` of all inserted extensions.
@@ -65,11 +64,101 @@ impl Extensions {
 }
 
 impl fmt::Debug for Extensions {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         f.debug_struct("Extensions").finish()
     }
 }
 
+#[cfg(test)]
+mod tests {
+    use super::*;
+
+    #[test]
+    fn test_remove() {
+        let mut map = Extensions::new();
+
+        map.insert::<i8>(123);
+        assert!(map.get::<i8>().is_some());
+
+        map.remove::<i8>();
+        assert!(map.get::<i8>().is_none());
+    }
+
+    #[test]
+    fn test_clear() {
+        let mut map = Extensions::new();
+
+        map.insert::<i8>(8);
+        map.insert::<i16>(16);
+        map.insert::<i32>(32);
+
+        assert!(map.contains::<i8>());
+        assert!(map.contains::<i16>());
+        assert!(map.contains::<i32>());
+
+        map.clear();
+
+        assert!(!map.contains::<i8>());
+        assert!(!map.contains::<i16>());
+        assert!(!map.contains::<i32>());
+
+        map.insert::<i8>(10);
+        assert_eq!(*map.get::<i8>().unwrap(), 10);
+    }
+
+    #[test]
+    fn test_integers() {
+        let mut map = Extensions::new();
+
+        map.insert::<i8>(8);
+        map.insert::<i16>(16);
+        map.insert::<i32>(32);
+        map.insert::<i64>(64);
+        map.insert::<i128>(128);
+        map.insert::<u8>(8);
+        map.insert::<u16>(16);
+        map.insert::<u32>(32);
+        map.insert::<u64>(64);
+        map.insert::<u128>(128);
+        assert!(map.get::<i8>().is_some());
+        assert!(map.get::<i16>().is_some());
+        assert!(map.get::<i32>().is_some());
+        assert!(map.get::<i64>().is_some());
+        assert!(map.get::<i128>().is_some());
+        assert!(map.get::<u8>().is_some());
+        assert!(map.get::<u16>().is_some());
+        assert!(map.get::<u32>().is_some());
+        assert!(map.get::<u64>().is_some());
+        assert!(map.get::<u128>().is_some());
+    }
+
+    #[test]
+    fn test_composition() {
+        struct Magi<T>(pub T);
+
+        struct Madoka {
+            pub god: bool,
+        }
+
+        struct Homura {
+            pub attempts: usize,
+        }
+
+        struct Mami {
+            pub guns: usize,
+        }
+
+        let mut map = Extensions::new();
+
+        map.insert(Magi(Madoka { god: false }));
+        map.insert(Magi(Homura { attempts: 0 }));
+        map.insert(Magi(Mami { guns: 999 }));
+
+        assert!(!map.get::<Magi<Madoka>>().unwrap().0.god);
+        assert_eq!(0, map.get::<Magi<Homura>>().unwrap().0.attempts);
+        assert_eq!(999, map.get::<Magi<Mami>>().unwrap().0.guns);
+    }
+
     #[test]
     fn test_extensions() {
         #[derive(Debug, PartialEq)]
@@ -89,3 +178,4 @@ fn test_extensions() {
         assert_eq!(extensions.get::<bool>(), None);
         assert_eq!(extensions.get(), Some(&MyType(10)));
     }
+}

actix-http/src/h1/client.rs

@@ -1,12 +1,8 @@
-#![allow(unused_imports, unused_variables, dead_code)]
+use std::io;
-use std::io::{self, Write};
 
 use actix_codec::{Decoder, Encoder};
 use bitflags::bitflags;
-use bytes::{BufMut, Bytes, BytesMut};
+use bytes::{Bytes, BytesMut};
-use http::header::{
-    HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING, UPGRADE,
-};
 use http::{Method, Version};
 
 use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
@@ -15,8 +11,7 @@ use super::{Message, MessageType};
 use crate::body::BodySize;
 use crate::config::ServiceConfig;
 use crate::error::{ParseError, PayloadError};
-use crate::helpers;
+use crate::message::{ConnectionType, RequestHeadType, ResponseHead};
-use crate::message::{ConnectionType, Head, MessagePool, RequestHead, ResponseHead};
 
 bitflags! {
     struct Flags: u8 {
@@ -26,8 +21,6 @@ bitflags! {
     }
 }
 
-const AVERAGE_HEADER_SIZE: usize = 30;
-
 /// HTTP/1 Codec
 pub struct ClientCodec {
     inner: ClientCodecInner,
@@ -47,8 +40,7 @@ struct ClientCodecInner {
 
     // encoder part
     flags: Flags,
-    headers_size: u32,
+    encoder: encoder::MessageEncoder<RequestHeadType>,
-    encoder: encoder::MessageEncoder<RequestHead>,
 }
 
 impl Default for ClientCodec {
@@ -76,7 +68,6 @@ impl ClientCodec {
                 ctype: ConnectionType::Close,
 
                 flags,
-                headers_size: 0,
                 encoder: encoder::MessageEncoder::default(),
             },
         }
@@ -182,23 +173,24 @@ impl Decoder for ClientPayloadCodec {
     }
 }
 
-impl Encoder for ClientCodec {
+impl Encoder<Message<(RequestHeadType, BodySize)>> for ClientCodec {
-    type Item = Message<(RequestHead, BodySize)>;
     type Error = io::Error;
 
     fn encode(
         &mut self,
-        item: Self::Item,
+        item: Message<(RequestHeadType, BodySize)>,
         dst: &mut BytesMut,
     ) -> Result<(), Self::Error> {
         match item {
-            Message::Item((mut msg, length)) => {
+            Message::Item((mut head, length)) => {
                 let inner = &mut self.inner;
-                inner.version = msg.version;
+                inner.version = head.as_ref().version;
-                inner.flags.set(Flags::HEAD, msg.method == Method::HEAD);
+                inner
+                    .flags
+                    .set(Flags::HEAD, head.as_ref().method == Method::HEAD);
 
                 // connection status
-                inner.ctype = match msg.connection_type() {
+                inner.ctype = match head.as_ref().connection_type() {
                     ConnectionType::KeepAlive => {
                         if inner.flags.contains(Flags::KEEPALIVE_ENABLED) {
                             ConnectionType::KeepAlive
@@ -212,7 +204,7 @@ impl Encoder for ClientCodec {
 
                 inner.encoder.encode(
                     dst,
-                    &mut msg,
+                    &mut head,
                     false,
                     false,
                     inner.version,

actix-http/src/h1/codec.rs

@@ -1,12 +1,9 @@
-#![allow(unused_imports, unused_variables, dead_code)]
+use std::{fmt, io};
-use std::io::Write;
-use std::{fmt, io, net};
 
 use actix_codec::{Decoder, Encoder};
 use bitflags::bitflags;
-use bytes::{BufMut, Bytes, BytesMut};
+use bytes::BytesMut;
-use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
+use http::{Method, Version};
-use http::{Method, StatusCode, Version};
 
 use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
 use super::{decoder, encoder};
@@ -14,8 +11,7 @@ use super::{Message, MessageType};
 use crate::body::BodySize;
 use crate::config::ServiceConfig;
 use crate::error::ParseError;
-use crate::helpers;
+use crate::message::ConnectionType;
-use crate::message::{ConnectionType, Head, ResponseHead};
 use crate::request::Request;
 use crate::response::Response;
 
@@ -27,8 +23,6 @@ bitflags! {
     }
 }
 
-const AVERAGE_HEADER_SIZE: usize = 30;
-
 /// HTTP/1 Codec
 pub struct Codec {
     config: ServiceConfig,
@@ -49,7 +43,7 @@ impl Default for Codec {
 }
 
 impl fmt::Debug for Codec {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         write!(f, "h1::Codec({:?})", self.flags)
     }
 }
@@ -150,13 +144,12 @@ impl Decoder for Codec {
     }
 }
 
-impl Encoder for Codec {
+impl Encoder<Message<(Response<()>, BodySize)>> for Codec {
-    type Item = Message<(Response<()>, BodySize)>;
     type Error = io::Error;
 
     fn encode(
         &mut self,
-        item: Self::Item,
+        item: Message<(Response<()>, BodySize)>,
         dst: &mut BytesMut,
     ) -> Result<(), Self::Error> {
         match item {
@@ -176,7 +169,6 @@ impl Encoder for Codec {
                 };
 
                 // encode message
-                let len = dst.len();
                 self.encoder.encode(
                     dst,
                     &mut res,
@@ -202,17 +194,11 @@ impl Encoder for Codec {
 
 #[cfg(test)]
 mod tests {
-    use std::{cmp, io};
+    use bytes::BytesMut;
-
+    use http::Method;
-    use actix_codec::{AsyncRead, AsyncWrite};
-    use bytes::{Buf, Bytes, BytesMut};
-    use http::{Method, Version};
 
     use super::*;
-    use crate::error::ParseError;
-    use crate::h1::Message;
     use crate::httpmessage::HttpMessage;
-    use crate::request::Request;
 
     #[test]
     fn test_http_request_chunked_payload_and_next_message() {

actix-http/src/h1/decoder.rs

@@ -1,12 +1,12 @@
+use std::convert::TryFrom;
+use std::io;
 use std::marker::PhantomData;
-use std::{io, mem};
+use std::task::Poll;
 
 use actix_codec::Decoder;
-use bytes::{Bytes, BytesMut};
+use bytes::{Buf, Bytes, BytesMut};
-use futures::{Async, Poll};
 use http::header::{HeaderName, HeaderValue};
-use http::{header, HttpTryFrom, Method, StatusCode, Uri, Version};
+use http::{header, Method, StatusCode, Uri, Version};
-use httparse;
 use log::{debug, error, trace};
 
 use crate::error::ParseError;
@@ -17,7 +17,7 @@ use crate::request::Request;
 const MAX_BUFFER_SIZE: usize = 131_072;
 const MAX_HEADERS: usize = 96;
 
-/// Incoming messagd decoder
+/// Incoming message decoder
 pub(crate) struct MessageDecoder<T: MessageType>(PhantomData<T>);
 
 #[derive(Debug)]
@@ -45,7 +45,7 @@ impl<T: MessageType> Decoder for MessageDecoder<T> {
 
 pub(crate) enum PayloadLength {
     Payload(PayloadType),
-    Upgrade,
+    UpgradeWebSocket,
     None,
 }
 
@@ -64,7 +64,7 @@ pub(crate) trait MessageType: Sized {
         raw_headers: &[HeaderIndex],
     ) -> Result<PayloadLength, ParseError> {
         let mut ka = None;
-        let mut has_upgrade = false;
+        let mut has_upgrade_websocket = false;
         let mut expect = false;
         let mut chunked = false;
         let mut content_length = None;
@@ -76,12 +76,14 @@ pub(crate) trait MessageType: Sized {
                 let name =
                     HeaderName::from_bytes(&slice[idx.name.0..idx.name.1]).unwrap();
 
-                // Unsafe: httparse check header value for valid utf-8
+                // SAFETY: httparse already checks header value is only visible ASCII bytes
+                // from_maybe_shared_unchecked contains debug assertions so they are omitted here
                 let value = unsafe {
-                    HeaderValue::from_shared_unchecked(
+                    HeaderValue::from_maybe_shared_unchecked(
-                        slice.slice(idx.value.0, idx.value.1),
+                        slice.slice(idx.value.0..idx.value.1),
                     )
                 };
+
                 match name {
                     header::CONTENT_LENGTH => {
                         if let Ok(s) = value.to_str() {
@@ -123,12 +125,9 @@ pub(crate) trait MessageType: Sized {
                         };
                     }
                     header::UPGRADE => {
-                        has_upgrade = true;
-                        // check content-length, some clients (dart)
-                        // sends "content-length: 0" with websocket upgrade
                         if let Ok(val) = value.to_str().map(|val| val.trim()) {
                             if val.eq_ignore_ascii_case("websocket") {
-                                content_length = None;
+                                has_upgrade_websocket = true;
                             }
                         }
                     }
@@ -155,13 +154,13 @@ pub(crate) trait MessageType: Sized {
             Ok(PayloadLength::Payload(PayloadType::Payload(
                 PayloadDecoder::chunked(),
             )))
+        } else if has_upgrade_websocket {
+            Ok(PayloadLength::UpgradeWebSocket)
         } else if let Some(len) = content_length {
             // Content-Length
             Ok(PayloadLength::Payload(PayloadType::Payload(
                 PayloadDecoder::length(len),
             )))
-        } else if has_upgrade {
-            Ok(PayloadLength::Upgrade)
         } else {
             Ok(PayloadLength::None)
         }
@@ -184,13 +183,10 @@ impl MessageType for Request {
     }
 
     fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
-        // Unsafe: we read only this data only after httparse parses headers into.
+        let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
-        // performance bump for pipeline benchmarks.
-        let mut headers: [HeaderIndex; MAX_HEADERS] = unsafe { mem::uninitialized() };
 
         let (len, method, uri, ver, h_len) = {
-            let mut parsed: [httparse::Header; MAX_HEADERS] =
+            let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
-                unsafe { mem::uninitialized() };
 
             let mut req = httparse::Request::new(&mut parsed);
             match req.parse(src)? {
@@ -219,7 +215,7 @@ impl MessageType for Request {
         // payload decoder
         let decoder = match length {
             PayloadLength::Payload(pl) => pl,
-            PayloadLength::Upgrade => {
+            PayloadLength::UpgradeWebSocket => {
                 // upgrade(websocket)
                 PayloadType::Stream(PayloadDecoder::eof())
             }
@@ -258,13 +254,10 @@ impl MessageType for ResponseHead {
     }
 
     fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
-        // Unsafe: we read only this data only after httparse parses headers into.
+        let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
-        // performance bump for pipeline benchmarks.
-        let mut headers: [HeaderIndex; MAX_HEADERS] = unsafe { mem::uninitialized() };
 
         let (len, ver, status, h_len) = {
-            let mut parsed: [httparse::Header; MAX_HEADERS] =
+            let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
-                unsafe { mem::uninitialized() };
 
             let mut res = httparse::Response::new(&mut parsed);
             match res.parse(src)? {
@@ -319,10 +312,21 @@ pub(crate) struct HeaderIndex {
     pub(crate) value: (usize, usize),
 }
 
+pub(crate) const EMPTY_HEADER_INDEX: HeaderIndex = HeaderIndex {
+    name: (0, 0),
+    value: (0, 0),
+};
+
+pub(crate) const EMPTY_HEADER_INDEX_ARRAY: [HeaderIndex; MAX_HEADERS] =
+    [EMPTY_HEADER_INDEX; MAX_HEADERS];
+
+pub(crate) const EMPTY_HEADER_ARRAY: [httparse::Header<'static>; MAX_HEADERS] =
+    [httparse::EMPTY_HEADER; MAX_HEADERS];
+
 impl HeaderIndex {
     pub(crate) fn record(
         bytes: &[u8],
-        headers: &[httparse::Header],
+        headers: &[httparse::Header<'_>],
         indices: &mut [HeaderIndex],
     ) {
         let bytes_ptr = bytes.as_ptr() as usize;
@@ -425,7 +429,7 @@ impl Decoder for PayloadDecoder {
                     let len = src.len() as u64;
                     let buf;
                     if *remaining > len {
-                        buf = src.take().freeze();
+                        buf = src.split().freeze();
                         *remaining -= len;
                     } else {
                         buf = src.split_to(*remaining as usize).freeze();
@@ -439,9 +443,10 @@ impl Decoder for PayloadDecoder {
                 loop {
                     let mut buf = None;
                     // advances the chunked state
-                    *state = match state.step(src, size, &mut buf)? {
+                    *state = match state.step(src, size, &mut buf) {
-                        Async::NotReady => return Ok(None),
+                        Poll::Pending => return Ok(None),
-                        Async::Ready(state) => state,
+                        Poll::Ready(Ok(state)) => state,
+                        Poll::Ready(Err(e)) => return Err(e),
                     };
                     if *state == ChunkedState::End {
                         trace!("End of chunked stream");
@@ -459,7 +464,7 @@ impl Decoder for PayloadDecoder {
                 if src.is_empty() {
                     Ok(None)
                 } else {
-                    Ok(Some(PayloadItem::Chunk(src.take().freeze())))
+                    Ok(Some(PayloadItem::Chunk(src.split().freeze())))
                 }
             }
         }
@@ -470,10 +475,10 @@ macro_rules! byte (
     ($rdr:ident) => ({
         if $rdr.len() > 0 {
             let b = $rdr[0];
-            $rdr.split_to(1);
+            $rdr.advance(1);
             b
         } else {
-            return Ok(Async::NotReady)
+            return Poll::Pending
         }
     })
 );
@@ -484,7 +489,7 @@ impl ChunkedState {
         body: &mut BytesMut,
         size: &mut u64,
         buf: &mut Option<Bytes>,
-    ) -> Poll<ChunkedState, io::Error> {
+    ) -> Poll<Result<ChunkedState, io::Error>> {
         use self::ChunkedState::*;
         match *self {
             Size => ChunkedState::read_size(body, size),
@@ -496,10 +501,14 @@ impl ChunkedState {
             BodyLf => ChunkedState::read_body_lf(body),
             EndCr => ChunkedState::read_end_cr(body),
             EndLf => ChunkedState::read_end_lf(body),
-            End => Ok(Async::Ready(ChunkedState::End)),
+            End => Poll::Ready(Ok(ChunkedState::End)),
         }
     }
-    fn read_size(rdr: &mut BytesMut, size: &mut u64) -> Poll<ChunkedState, io::Error> {
+
+    fn read_size(
+        rdr: &mut BytesMut,
+        size: &mut u64,
+    ) -> Poll<Result<ChunkedState, io::Error>> {
         let radix = 16;
         match byte!(rdr) {
             b @ b'0'..=b'9' => {
@@ -514,48 +523,49 @@ impl ChunkedState {
                 *size *= radix;
                 *size += u64::from(b + 10 - b'A');
             }
-            b'\t' | b' ' => return Ok(Async::Ready(ChunkedState::SizeLws)),
+            b'\t' | b' ' => return Poll::Ready(Ok(ChunkedState::SizeLws)),
-            b';' => return Ok(Async::Ready(ChunkedState::Extension)),
+            b';' => return Poll::Ready(Ok(ChunkedState::Extension)),
-            b'\r' => return Ok(Async::Ready(ChunkedState::SizeLf)),
+            b'\r' => return Poll::Ready(Ok(ChunkedState::SizeLf)),
             _ => {
-                return Err(io::Error::new(
+                return Poll::Ready(Err(io::Error::new(
                     io::ErrorKind::InvalidInput,
                     "Invalid chunk size line: Invalid Size",
-                ));
+                )));
             }
         }
-        Ok(Async::Ready(ChunkedState::Size))
+        Poll::Ready(Ok(ChunkedState::Size))
     }
-    fn read_size_lws(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+
+    fn read_size_lws(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         trace!("read_size_lws");
         match byte!(rdr) {
             // LWS can follow the chunk size, but no more digits can come
-            b'\t' | b' ' => Ok(Async::Ready(ChunkedState::SizeLws)),
+            b'\t' | b' ' => Poll::Ready(Ok(ChunkedState::SizeLws)),
-            b';' => Ok(Async::Ready(ChunkedState::Extension)),
+            b';' => Poll::Ready(Ok(ChunkedState::Extension)),
-            b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)),
+            b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
-            _ => Err(io::Error::new(
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk size linear white space",
-            )),
+            ))),
         }
     }
-    fn read_extension(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_extension(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)),
+            b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
-            _ => Ok(Async::Ready(ChunkedState::Extension)), // no supported extensions
+            _ => Poll::Ready(Ok(ChunkedState::Extension)), // no supported extensions
         }
     }
     fn read_size_lf(
         rdr: &mut BytesMut,
         size: &mut u64,
-    ) -> Poll<ChunkedState, io::Error> {
+    ) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\n' if *size > 0 => Ok(Async::Ready(ChunkedState::Body)),
+            b'\n' if *size > 0 => Poll::Ready(Ok(ChunkedState::Body)),
-            b'\n' if *size == 0 => Ok(Async::Ready(ChunkedState::EndCr)),
+            b'\n' if *size == 0 => Poll::Ready(Ok(ChunkedState::EndCr)),
-            _ => Err(io::Error::new(
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk size LF",
-            )),
+            ))),
         }
     }
 
@@ -563,16 +573,16 @@ impl ChunkedState {
         rdr: &mut BytesMut,
         rem: &mut u64,
         buf: &mut Option<Bytes>,
-    ) -> Poll<ChunkedState, io::Error> {
+    ) -> Poll<Result<ChunkedState, io::Error>> {
         trace!("Chunked read, remaining={:?}", rem);
 
         let len = rdr.len() as u64;
         if len == 0 {
-            Ok(Async::Ready(ChunkedState::Body))
+            Poll::Ready(Ok(ChunkedState::Body))
         } else {
             let slice;
             if *rem > len {
-                slice = rdr.take().freeze();
+                slice = rdr.split().freeze();
                 *rem -= len;
             } else {
                 slice = rdr.split_to(*rem as usize).freeze();
@@ -580,47 +590,47 @@ impl ChunkedState {
             }
             *buf = Some(slice);
             if *rem > 0 {
-                Ok(Async::Ready(ChunkedState::Body))
+                Poll::Ready(Ok(ChunkedState::Body))
             } else {
-                Ok(Async::Ready(ChunkedState::BodyCr))
+                Poll::Ready(Ok(ChunkedState::BodyCr))
             }
         }
     }
 
-    fn read_body_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_body_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\r' => Ok(Async::Ready(ChunkedState::BodyLf)),
+            b'\r' => Poll::Ready(Ok(ChunkedState::BodyLf)),
-            _ => Err(io::Error::new(
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk body CR",
-            )),
+            ))),
         }
     }
-    fn read_body_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_body_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\n' => Ok(Async::Ready(ChunkedState::Size)),
+            b'\n' => Poll::Ready(Ok(ChunkedState::Size)),
-            _ => Err(io::Error::new(
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk body LF",
-            )),
+            ))),
         }
     }
-    fn read_end_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_end_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\r' => Ok(Async::Ready(ChunkedState::EndLf)),
+            b'\r' => Poll::Ready(Ok(ChunkedState::EndLf)),
-            _ => Err(io::Error::new(
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk end CR",
-            )),
+            ))),
         }
     }
-    fn read_end_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_end_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\n' => Ok(Async::Ready(ChunkedState::End)),
+            b'\n' => Poll::Ready(Ok(ChunkedState::End)),
-            _ => Err(io::Error::new(
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk end LF",
-            )),
+            ))),
         }
     }
 }
@@ -644,10 +654,7 @@ mod tests {
         }
 
         fn is_unhandled(&self) -> bool {
-            match self {
+            matches!(self, PayloadType::Stream(_))
-                PayloadType::Stream(_) => true,
-                _ => false,
-            }
         }
     }
 
@@ -659,10 +666,7 @@ mod tests {
             }
         }
         fn eof(&self) -> bool {
-            match *self {
+            matches!(*self, PayloadItem::Eof)
-                PayloadItem::Eof => true,
-                _ => false,
-            }
         }
     }
 
@@ -968,7 +972,7 @@ mod tests {
             unreachable!("Error");
         }
 
-        // type in chunked
+        // intentional typo in "chunked"
         let mut buf = BytesMut::from(
             "GET /test HTTP/1.1\r\n\
              transfer-encoding: chnked\r\n\r\n",
@@ -1029,7 +1033,7 @@ mod tests {
     }
 
     #[test]
-    fn test_http_request_upgrade() {
+    fn test_http_request_upgrade_websocket() {
         let mut buf = BytesMut::from(
             "GET /test HTTP/1.1\r\n\
              connection: upgrade\r\n\
@@ -1043,6 +1047,26 @@ mod tests {
         assert!(pl.is_unhandled());
     }
 
+    #[test]
+    fn test_http_request_upgrade_h2c() {
+        let mut buf = BytesMut::from(
+            "GET /test HTTP/1.1\r\n\
+             connection: upgrade, http2-settings\r\n\
+             upgrade: h2c\r\n\
+             http2-settings: dummy\r\n\r\n",
+        );
+        let mut reader = MessageDecoder::<Request>::default();
+        let (req, pl) = reader.decode(&mut buf).unwrap().unwrap();
+        // `connection: upgrade, http2-settings` doesn't work properly..
+        // see MessageType::set_headers().
+        //
+        // The line below should be:
+        // assert_eq!(req.head().connection_type(), ConnectionType::Upgrade);
+        assert_eq!(req.head().connection_type(), ConnectionType::KeepAlive);
+        assert!(req.upgrade());
+        assert!(!pl.is_unhandled());
+    }
+
     #[test]
     fn test_http_request_parser_utf8() {
         let mut buf = BytesMut::from(

actix-http/src/h1/encoder.rs

@@ -1,22 +1,18 @@
-#![allow(unused_imports, unused_variables, dead_code)]
-use std::fmt::Write as FmtWrite;
 use std::io::Write;
 use std::marker::PhantomData;
-use std::str::FromStr;
+use std::ptr::copy_nonoverlapping;
-use std::{cmp, fmt, io, mem};
+use std::slice::from_raw_parts_mut;
+use std::{cmp, io};
 
-use bytes::{BufMut, Bytes, BytesMut};
+use bytes::{BufMut, BytesMut};
 
 use crate::body::BodySize;
 use crate::config::ServiceConfig;
-use crate::header::{map, ContentEncoding};
+use crate::header::map;
 use crate::helpers;
-use crate::http::header::{
+use crate::http::header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
-    HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING,
+use crate::http::{HeaderMap, StatusCode, Version};
-};
+use crate::message::{ConnectionType, RequestHeadType};
-use crate::http::{HeaderMap, Method, StatusCode, Version};
-use crate::message::{ConnectionType, Head, RequestHead, ResponseHead};
-use crate::request::Request;
 use crate::response::Response;
 
 const AVERAGE_HEADER_SIZE: usize = 30;
@@ -43,6 +39,8 @@ pub(crate) trait MessageType: Sized {
 
     fn headers(&self) -> &HeaderMap;
 
+    fn extra_headers(&self) -> Option<&HeaderMap>;
+
     fn camel_case(&self) -> bool {
         false
     }
@@ -97,14 +95,6 @@ pub(crate) trait MessageType: Sized {
                 }
             }
             BodySize::Sized(len) => helpers::write_content_length(len, dst),
-            BodySize::Sized64(len) => {
-                if camel_case {
-                    dst.put_slice(b"\r\nContent-Length: ");
-                } else {
-                    dst.put_slice(b"\r\ncontent-length: ");
-                }
-                write!(dst.writer(), "{}\r\n", len)?;
-            }
             BodySize::None => dst.put_slice(b"\r\n"),
         }
 
@@ -128,84 +118,144 @@ pub(crate) trait MessageType: Sized {
             _ => (),
         }
 
+        // merging headers from head and extra headers. HeaderMap::new() does not allocate.
+        let empty_headers = HeaderMap::new();
+        let extra_headers = self.extra_headers().unwrap_or(&empty_headers);
+        let headers = self
+            .headers()
+            .inner
+            .iter()
+            .filter(|(name, _)| !extra_headers.contains_key(*name))
+            .chain(extra_headers.inner.iter());
+
         // write headers
-        let mut pos = 0;
+
         let mut has_date = false;
-        let mut remaining = dst.remaining_mut();
+
-        let mut buf = unsafe { &mut *(dst.bytes_mut() as *mut [u8]) };
+        let mut buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
-        for (key, value) in self.headers().inner.iter() {
+        let mut remaining = dst.capacity() - dst.len();
+
+        // tracks bytes written since last buffer resize
+        // since buf is a raw pointer to a bytes container storage but is written to without the
+        // container's knowledge, this is used to sync the containers cursor after data is written
+        let mut pos = 0;
+
+        for (key, value) in headers {
             match *key {
                 CONNECTION => continue,
                 TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => continue,
-                DATE => {
+                DATE => has_date = true,
-                    has_date = true;
-                }
                 _ => (),
             }
+
             let k = key.as_str().as_bytes();
+            let k_len = k.len();
+
             match value {
                 map::Value::One(ref val) => {
                     let v = val.as_ref();
-                    let len = k.len() + v.len() + 4;
+                    let v_len = v.len();
+
+                    // key length + value length + colon + space + \r\n
+                    let len = k_len + v_len + 4;
+
                     if len > remaining {
+                        // not enough room in buffer for this header; reserve more space
+
+                        // SAFETY: all the bytes written up to position "pos" are initialized
+                        // the written byte count and pointer advancement are kept in sync
                         unsafe {
                             dst.advance_mut(pos);
                         }
+
                         pos = 0;
                         dst.reserve(len * 2);
-                        remaining = dst.remaining_mut();
+                        remaining = dst.capacity() - dst.len();
+
+                        // re-assign buf raw pointer since it's possible that the buffer was
+                        // reallocated and/or resized
+                        buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
+                    }
+
+                    // SAFETY: on each write, it is enough to ensure that the advancement of the
+                    // cursor matches the number of bytes written
                     unsafe {
-                            buf = &mut *(dst.bytes_mut() as *mut _);
-                        }
-                    }
                         // use upper Camel-Case
                         if camel_case {
-                        write_camel_case(k, &mut buf[pos..pos + k.len()]);
+                            write_camel_case(k, from_raw_parts_mut(buf, k_len))
                         } else {
-                        buf[pos..pos + k.len()].copy_from_slice(k);
+                            write_data(k, buf, k_len)
                         }
-                    pos += k.len();
+
-                    buf[pos..pos + 2].copy_from_slice(b": ");
+                        buf = buf.add(k_len);
-                    pos += 2;
+
-                    buf[pos..pos + v.len()].copy_from_slice(v);
+                        write_data(b": ", buf, 2);
-                    pos += v.len();
+                        buf = buf.add(2);
-                    buf[pos..pos + 2].copy_from_slice(b"\r\n");
+
-                    pos += 2;
+                        write_data(v, buf, v_len);
+                        buf = buf.add(v_len);
+
+                        write_data(b"\r\n", buf, 2);
+                        buf = buf.add(2);
+                    }
+
+                    pos += len;
                     remaining -= len;
                 }
+
                 map::Value::Multi(ref vec) => {
                     for val in vec {
                         let v = val.as_ref();
-                        let len = k.len() + v.len() + 4;
+                        let v_len = v.len();
+                        let len = k_len + v_len + 4;
+
                         if len > remaining {
+                            // SAFETY: all the bytes written up to position "pos" are initialized
+                            // the written byte count and pointer advancement are kept in sync
                             unsafe {
                                 dst.advance_mut(pos);
                             }
                             pos = 0;
                             dst.reserve(len * 2);
-                            remaining = dst.remaining_mut();
+                            remaining = dst.capacity() - dst.len();
+
+                            // re-assign buf raw pointer since it's possible that the buffer was
+                            // reallocated and/or resized
+                            buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
+                        }
+
+                        // SAFETY: on each write, it is enough to ensure that the advancement of
+                        // the cursor matches the number of bytes written
                         unsafe {
-                                buf = &mut *(dst.bytes_mut() as *mut _);
-                            }
-                        }
-                        // use upper Camel-Case
                             if camel_case {
-                            write_camel_case(k, &mut buf[pos..pos + k.len()]);
+                                write_camel_case(k, from_raw_parts_mut(buf, k_len));
                             } else {
-                            buf[pos..pos + k.len()].copy_from_slice(k);
+                                write_data(k, buf, k_len);
                             }
-                        pos += k.len();
+
-                        buf[pos..pos + 2].copy_from_slice(b": ");
+                            buf = buf.add(k_len);
-                        pos += 2;
+
-                        buf[pos..pos + v.len()].copy_from_slice(v);
+                            write_data(b": ", buf, 2);
-                        pos += v.len();
+                            buf = buf.add(2);
-                        buf[pos..pos + 2].copy_from_slice(b"\r\n");
+
-                        pos += 2;
+                            write_data(v, buf, v_len);
+                            buf = buf.add(v_len);
+
+                            write_data(b"\r\n", buf, 2);
+                            buf = buf.add(2);
+                        };
+
+                        pos += len;
                         remaining -= len;
                     }
                 }
             }
         }
+
+        // final cursor synchronization with the bytes container
+        //
+        // SAFETY: all the bytes written up to position "pos" are initialized
+        // the written byte count and pointer advancement are kept in sync
         unsafe {
             dst.advance_mut(pos);
         }
@@ -235,6 +285,10 @@ impl MessageType for Response<()> {
         &self.head().headers
     }
 
+    fn extra_headers(&self) -> Option<&HeaderMap> {
+        None
+    }
+
     fn encode_status(&mut self, dst: &mut BytesMut) -> io::Result<()> {
         let head = self.head();
         let reason = head.reason().as_bytes();
@@ -247,35 +301,46 @@ impl MessageType for Response<()> {
     }
 }
 
-impl MessageType for RequestHead {
+impl MessageType for RequestHeadType {
     fn status(&self) -> Option<StatusCode> {
         None
     }
 
     fn chunked(&self) -> bool {
-        self.chunked()
+        self.as_ref().chunked()
     }
 
     fn camel_case(&self) -> bool {
-        RequestHead::camel_case_headers(self)
+        self.as_ref().camel_case_headers()
     }
 
     fn headers(&self) -> &HeaderMap {
-        &self.headers
+        self.as_ref().headers()
+    }
+
+    fn extra_headers(&self) -> Option<&HeaderMap> {
+        self.extra_headers()
     }
 
     fn encode_status(&mut self, dst: &mut BytesMut) -> io::Result<()> {
-        dst.reserve(256 + self.headers.len() * AVERAGE_HEADER_SIZE);
+        let head = self.as_ref();
+        dst.reserve(256 + head.headers.len() * AVERAGE_HEADER_SIZE);
         write!(
             Writer(dst),
             "{} {} {}",
-            self.method,
+            head.method,
-            self.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
+            head.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
-            match self.version {
+            match head.version {
                 Version::HTTP_09 => "HTTP/0.9",
                 Version::HTTP_10 => "HTTP/1.0",
                 Version::HTTP_11 => "HTTP/1.1",
                 Version::HTTP_2 => "HTTP/2.0",
+                Version::HTTP_3 => "HTTP/3.0",
+                _ =>
+                    return Err(io::Error::new(
+                        io::ErrorKind::Other,
+                        "unsupported version"
+                    )),
             }
         )
         .map_err(|e| io::Error::new(io::ErrorKind::Other, e))
@@ -308,8 +373,7 @@ impl<T: MessageType> MessageEncoder<T> {
         if !head {
             self.te = match length {
                 BodySize::Empty => TransferEncoding::empty(),
-                BodySize::Sized(len) => TransferEncoding::length(len as u64),
+                BodySize::Sized(len) => TransferEncoding::length(len),
-                BodySize::Sized64(len) => TransferEncoding::length(len),
                 BodySize::Stream => {
                     if message.chunked() && !stream {
                         TransferEncoding::chunked()
@@ -457,6 +521,13 @@ impl<'a> io::Write for Writer<'a> {
     }
 }
 
+/// # Safety
+/// Callers must ensure that the given length matches given value length.
+unsafe fn write_data(value: &[u8], buf: *mut u8, len: usize) {
+    debug_assert_eq!(value.len(), len);
+    copy_nonoverlapping(value.as_ptr(), buf, len);
+}
+
 fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
     let mut index = 0;
     let key = value;
@@ -487,10 +558,14 @@ fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
 
 #[cfg(test)]
 mod tests {
+    use std::rc::Rc;
+
     use bytes::Bytes;
+    use http::header::AUTHORIZATION;
 
     use super::*;
     use crate::http::header::{HeaderValue, CONTENT_TYPE};
+    use crate::RequestHead;
 
     #[test]
     fn test_chunked_te() {
@@ -501,7 +576,7 @@ mod tests {
             assert!(enc.encode(b"", &mut bytes).ok().unwrap());
         }
         assert_eq!(
-            bytes.take().freeze(),
+            bytes.split().freeze(),
             Bytes::from_static(b"4\r\ntest\r\n0\r\n\r\n")
         );
     }
@@ -515,6 +590,8 @@ mod tests {
         head.headers
             .insert(CONTENT_TYPE, HeaderValue::from_static("plain/text"));
 
+        let mut head = RequestHeadType::Owned(head);
+
         let _ = head.encode_headers(
             &mut bytes,
             Version::HTTP_11,
@@ -522,10 +599,12 @@ mod tests {
             ConnectionType::Close,
             &ServiceConfig::default(),
         );
-        assert_eq!(
+        let data =
-            bytes.take().freeze(),
+            String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
-            Bytes::from_static(b"\r\nContent-Length: 0\r\nConnection: close\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n")
+        assert!(data.contains("Content-Length: 0\r\n"));
-        );
+        assert!(data.contains("Connection: close\r\n"));
+        assert!(data.contains("Content-Type: plain/text\r\n"));
+        assert!(data.contains("Date: date\r\n"));
 
         let _ = head.encode_headers(
             &mut bytes,
@@ -534,25 +613,21 @@ mod tests {
             ConnectionType::KeepAlive,
             &ServiceConfig::default(),
         );
-        assert_eq!(
+        let data =
-            bytes.take().freeze(),
+            String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
-            Bytes::from_static(b"\r\nTransfer-Encoding: chunked\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n")
+        assert!(data.contains("Transfer-Encoding: chunked\r\n"));
-        );
+        assert!(data.contains("Content-Type: plain/text\r\n"));
-
+        assert!(data.contains("Date: date\r\n"));
-        let _ = head.encode_headers(
-            &mut bytes,
-            Version::HTTP_11,
-            BodySize::Sized64(100),
-            ConnectionType::KeepAlive,
-            &ServiceConfig::default(),
-        );
-        assert_eq!(
-            bytes.take().freeze(),
-            Bytes::from_static(b"\r\nContent-Length: 100\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n")
-        );
 
+        let mut head = RequestHead::default();
+        head.set_camel_case_headers(false);
+        head.headers.insert(DATE, HeaderValue::from_static("date"));
+        head.headers
+            .insert(CONTENT_TYPE, HeaderValue::from_static("plain/text"));
         head.headers
             .append(CONTENT_TYPE, HeaderValue::from_static("xml"));
+
+        let mut head = RequestHeadType::Owned(head);
         let _ = head.encode_headers(
             &mut bytes,
             Version::HTTP_11,
@@ -560,22 +635,45 @@ mod tests {
             ConnectionType::KeepAlive,
             &ServiceConfig::default(),
         );
-        assert_eq!(
+        let data =
-            bytes.take().freeze(),
+            String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
-            Bytes::from_static(b"\r\nTransfer-Encoding: chunked\r\nDate: date\r\nContent-Type: xml\r\nContent-Type: plain/text\r\n\r\n")
+        assert!(data.contains("transfer-encoding: chunked\r\n"));
+        assert!(data.contains("content-type: xml\r\n"));
+        assert!(data.contains("content-type: plain/text\r\n"));
+        assert!(data.contains("date: date\r\n"));
+    }
+
+    #[test]
+    fn test_extra_headers() {
+        let mut bytes = BytesMut::with_capacity(2048);
+
+        let mut head = RequestHead::default();
+        head.headers.insert(
+            AUTHORIZATION,
+            HeaderValue::from_static("some authorization"),
         );
 
-        head.set_camel_case_headers(false);
+        let mut extra_headers = HeaderMap::new();
+        extra_headers.insert(
+            AUTHORIZATION,
+            HeaderValue::from_static("another authorization"),
+        );
+        extra_headers.insert(DATE, HeaderValue::from_static("date"));
+
+        let mut head = RequestHeadType::Rc(Rc::new(head), Some(extra_headers));
+
         let _ = head.encode_headers(
             &mut bytes,
             Version::HTTP_11,
-            BodySize::Stream,
+            BodySize::Empty,
-            ConnectionType::KeepAlive,
+            ConnectionType::Close,
             &ServiceConfig::default(),
         );
-        assert_eq!(
+        let data =
-            bytes.take().freeze(),
+            String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
-            Bytes::from_static(b"\r\ntransfer-encoding: chunked\r\ndate: date\r\ncontent-type: xml\r\ncontent-type: plain/text\r\n\r\n")
+        assert!(data.contains("content-length: 0\r\n"));
-        );
+        assert!(data.contains("connection: close\r\n"));
+        assert!(data.contains("authorization: another authorization\r\n"));
+        assert!(data.contains("date: date\r\n"));
     }
 }

actix-http/src/h1/expect.rs

@@ -1,23 +1,23 @@
-use actix_server_config::ServerConfig;
+use std::task::{Context, Poll};
-use actix_service::{NewService, Service};
+
-use futures::future::{ok, FutureResult};
+use actix_service::{Service, ServiceFactory};
-use futures::{Async, Poll};
+use futures_util::future::{ok, Ready};
 
 use crate::error::Error;
 use crate::request::Request;
 
 pub struct ExpectHandler;
 
-impl NewService for ExpectHandler {
+impl ServiceFactory for ExpectHandler {
-    type Config = ServerConfig;
+    type Config = ();
     type Request = Request;
     type Response = Request;
     type Error = Error;
     type Service = ExpectHandler;
     type InitError = Error;
-    type Future = FutureResult<Self::Service, Self::InitError>;
+    type Future = Ready<Result<Self::Service, Self::InitError>>;
 
-    fn new_service(&self, _: &ServerConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         ok(ExpectHandler)
     }
 }
@@ -26,10 +26,10 @@ impl Service for ExpectHandler {
     type Request = Request;
     type Response = Request;
     type Error = Error;
-    type Future = FutureResult<Self::Response, Self::Error>;
+    type Future = Ready<Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        Ok(Async::Ready(()))
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, req: Request) -> Self::Future {

actix-http/src/h1/payload.rs

@@ -1,12 +1,13 @@
 //! Payload stream
 use std::cell::RefCell;
 use std::collections::VecDeque;
+use std::pin::Pin;
 use std::rc::{Rc, Weak};
+use std::task::{Context, Poll};
 
+use actix_utils::task::LocalWaker;
 use bytes::Bytes;
-use futures::task::current as current_task;
+use futures_core::Stream;
-use futures::task::Task;
-use futures::{Async, Poll, Stream};
 
 use crate::error::PayloadError;
 
@@ -77,15 +78,24 @@ impl Payload {
     pub fn unread_data(&mut self, data: Bytes) {
         self.inner.borrow_mut().unread_data(data);
     }
+
+    #[inline]
+    pub fn readany(
+        &mut self,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, PayloadError>>> {
+        self.inner.borrow_mut().readany(cx)
+    }
 }
 
 impl Stream for Payload {
-    type Item = Bytes;
+    type Item = Result<Bytes, PayloadError>;
-    type Error = PayloadError;
 
-    #[inline]
+    fn poll_next(
-    fn poll(&mut self) -> Poll<Option<Bytes>, PayloadError> {
+        self: Pin<&mut Self>,
-        self.inner.borrow_mut().readany()
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, PayloadError>>> {
+        self.inner.borrow_mut().readany(cx)
     }
 }
 
@@ -117,19 +127,14 @@ impl PayloadSender {
     }
 
     #[inline]
-    pub fn need_read(&self) -> PayloadStatus {
+    pub fn need_read(&self, cx: &mut Context<'_>) -> PayloadStatus {
         // we check need_read only if Payload (other side) is alive,
         // otherwise always return true (consume payload)
         if let Some(shared) = self.inner.upgrade() {
             if shared.borrow().need_read {
                 PayloadStatus::Read
             } else {
-                #[cfg(not(test))]
+                shared.borrow_mut().io_task.register(cx.waker());
-                {
-                    if shared.borrow_mut().io_task.is_none() {
-                        shared.borrow_mut().io_task = Some(current_task());
-                    }
-                }
                 PayloadStatus::Pause
             }
         } else {
@@ -145,8 +150,8 @@ struct Inner {
     err: Option<PayloadError>,
     need_read: bool,
     items: VecDeque<Bytes>,
-    task: Option<Task>,
+    task: LocalWaker,
-    io_task: Option<Task>,
+    io_task: LocalWaker,
 }
 
 impl Inner {
@@ -157,8 +162,8 @@ impl Inner {
             err: None,
             items: VecDeque::new(),
             need_read: true,
-            task: None,
+            task: LocalWaker::new(),
-            io_task: None,
+            io_task: LocalWaker::new(),
         }
     }
 
@@ -178,7 +183,7 @@ impl Inner {
         self.items.push_back(data);
         self.need_read = self.len < MAX_BUFFER_SIZE;
         if let Some(task) = self.task.take() {
-            task.notify()
+            task.wake()
         }
     }
 
@@ -187,34 +192,28 @@ impl Inner {
         self.len
     }
 
-    fn readany(&mut self) -> Poll<Option<Bytes>, PayloadError> {
+    fn readany(
+        &mut self,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, PayloadError>>> {
         if let Some(data) = self.items.pop_front() {
             self.len -= data.len();
             self.need_read = self.len < MAX_BUFFER_SIZE;
 
-            if self.need_read && self.task.is_none() && !self.eof {
+            if self.need_read && !self.eof {
-                self.task = Some(current_task());
+                self.task.register(cx.waker());
             }
-            if let Some(task) = self.io_task.take() {
+            self.io_task.wake();
-                task.notify()
+            Poll::Ready(Some(Ok(data)))
-            }
-            Ok(Async::Ready(Some(data)))
         } else if let Some(err) = self.err.take() {
-            Err(err)
+            Poll::Ready(Some(Err(err)))
         } else if self.eof {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
             self.need_read = true;
-            #[cfg(not(test))]
+            self.task.register(cx.waker());
-            {
+            self.io_task.wake();
-                if self.task.is_none() {
+            Poll::Pending
-                    self.task = Some(current_task());
-                }
-                if let Some(task) = self.io_task.take() {
-                    task.notify()
-                }
-            }
-            Ok(Async::NotReady)
         }
     }
 
@@ -227,14 +226,10 @@ impl Inner {
 #[cfg(test)]
 mod tests {
     use super::*;
-    use actix_rt::Runtime;
+    use futures_util::future::poll_fn;
-    use futures::future::{lazy, result};
 
-    #[test]
+    #[actix_rt::test]
-    fn test_unread_data() {
+    async fn test_unread_data() {
-        Runtime::new()
-            .unwrap()
-            .block_on(lazy(|| {
         let (_, mut payload) = Payload::create(false);
 
         payload.unread_data(Bytes::from("data"));
@@ -242,13 +237,8 @@ mod tests {
         assert_eq!(payload.len(), 4);
 
         assert_eq!(
-                    Async::Ready(Some(Bytes::from("data"))),
+            Bytes::from("data"),
-                    payload.poll().ok().unwrap()
+            poll_fn(|cx| payload.readany(cx)).await.unwrap().unwrap()
         );
-
-                let res: Result<(), ()> = Ok(());
-                result(res)
-            }))
-            .unwrap();
     }
 }

actix-http/src/h1/service.rs

@@ -1,16 +1,19 @@
-use std::fmt;
+use std::future::Future;
 use std::marker::PhantomData;
+use std::pin::Pin;
 use std::rc::Rc;
+use std::task::{Context, Poll};
+use std::{fmt, net};
 
-use actix_codec::Framed;
+use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig};
+use actix_rt::net::TcpStream;
-use actix_service::{IntoNewService, NewService, Service};
+use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
-use futures::future::{ok, FutureResult};
+use futures_core::ready;
-use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream};
+use futures_util::future::{ok, Ready};
 
 use crate::body::MessageBody;
 use crate::cloneable::CloneableService;
-use crate::config::{KeepAlive, ServiceConfig};
+use crate::config::ServiceConfig;
 use crate::error::{DispatchError, Error, ParseError};
 use crate::helpers::DataFactory;
 use crate::request::Request;
@@ -20,43 +23,32 @@ use super::codec::Codec;
 use super::dispatcher::Dispatcher;
 use super::{ExpectHandler, Message, UpgradeHandler};
 
-/// `NewService` implementation for HTTP1 transport
+/// `ServiceFactory` implementation for HTTP1 transport
-pub struct H1Service<T, P, S, B, X = ExpectHandler, U = UpgradeHandler<T>> {
+pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler<T>> {
     srv: S,
     cfg: ServiceConfig,
     expect: X,
     upgrade: Option<U>,
     on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
-    _t: PhantomData<(T, P, B)>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B> H1Service<T, P, S, B>
+impl<T, S, B> H1Service<T, S, B>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S: ServiceFactory<Config = (), Request = Request>,
     S::Error: Into<Error>,
     S::InitError: fmt::Debug,
     S::Response: Into<Response<B>>,
     B: MessageBody,
 {
-    /// Create new `HttpService` instance with default config.
-    pub fn new<F: IntoNewService<S>>(service: F) -> Self {
-        let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
-
-        H1Service {
-            cfg,
-            srv: service.into_new_service(),
-            expect: ExpectHandler,
-            upgrade: None,
-            on_connect: None,
-            _t: PhantomData,
-        }
-    }
-
     /// Create new `HttpService` instance with config.
-    pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self {
+    pub(crate) fn with_config<F: IntoServiceFactory<S>>(
+        cfg: ServiceConfig,
+        service: F,
+    ) -> Self {
         H1Service {
             cfg,
-            srv: service.into_new_service(),
+            srv: service.into_factory(),
             expect: ExpectHandler,
             upgrade: None,
             on_connect: None,
@@ -65,17 +57,153 @@ where
     }
 }
 
-impl<T, P, S, B, X, U> H1Service<T, P, S, B, X, U>
+impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error>,
+    S::InitError: fmt::Debug,
+    S::Response: Into<Response<B>>,
+    B: MessageBody,
+    X: ServiceFactory<Config = (), Request = Request, Response = Request>,
+    X::Error: Into<Error>,
+    X::InitError: fmt::Debug,
+    U: ServiceFactory<
+        Config = (),
+        Request = (Request, Framed<TcpStream, Codec>),
+        Response = (),
+    >,
+    U::Error: fmt::Display + Into<Error>,
+    U::InitError: fmt::Debug,
+{
+    /// Create simple tcp stream service
+    pub fn tcp(
+        self,
+    ) -> impl ServiceFactory<
+        Config = (),
+        Request = TcpStream,
+        Response = (),
+        Error = DispatchError,
+        InitError = (),
+    > {
+        pipeline_factory(|io: TcpStream| {
+            let peer_addr = io.peer_addr().ok();
+            ok((io, peer_addr))
+        })
+        .and_then(self)
+    }
+}
+
+#[cfg(feature = "openssl")]
+mod openssl {
+    use super::*;
+
+    use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
+    use actix_tls::{openssl::HandshakeError, TlsError};
+
+    impl<S, B, X, U> H1Service<SslStream<TcpStream>, S, B, X, U>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error>,
+        S::InitError: fmt::Debug,
+        S::Response: Into<Response<B>>,
+        B: MessageBody,
+        X: ServiceFactory<Config = (), Request = Request, Response = Request>,
+        X::Error: Into<Error>,
+        X::InitError: fmt::Debug,
+        U: ServiceFactory<
+            Config = (),
+            Request = (Request, Framed<SslStream<TcpStream>, Codec>),
+            Response = (),
+        >,
+        U::Error: fmt::Display + Into<Error>,
+        U::InitError: fmt::Debug,
+    {
+        /// Create openssl based service
+        pub fn openssl(
+            self,
+            acceptor: SslAcceptor,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = TlsError<HandshakeError<TcpStream>, DispatchError>,
+            InitError = (),
+        > {
+            pipeline_factory(
+                Acceptor::new(acceptor)
+                    .map_err(TlsError::Tls)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(|io: SslStream<TcpStream>| {
+                let peer_addr = io.get_ref().peer_addr().ok();
+                ok((io, peer_addr))
+            })
+            .and_then(self.map_err(TlsError::Service))
+        }
+    }
+}
+
+#[cfg(feature = "rustls")]
+mod rustls {
+    use super::*;
+    use actix_tls::rustls::{Acceptor, ServerConfig, TlsStream};
+    use actix_tls::TlsError;
+    use std::{fmt, io};
+
+    impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error>,
+        S::InitError: fmt::Debug,
+        S::Response: Into<Response<B>>,
+        B: MessageBody,
+        X: ServiceFactory<Config = (), Request = Request, Response = Request>,
+        X::Error: Into<Error>,
+        X::InitError: fmt::Debug,
+        U: ServiceFactory<
+            Config = (),
+            Request = (Request, Framed<TlsStream<TcpStream>, Codec>),
+            Response = (),
+        >,
+        U::Error: fmt::Display + Into<Error>,
+        U::InitError: fmt::Debug,
+    {
+        /// Create rustls based service
+        pub fn rustls(
+            self,
+            config: ServerConfig,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = TlsError<io::Error, DispatchError>,
+            InitError = (),
+        > {
+            pipeline_factory(
+                Acceptor::new(config)
+                    .map_err(TlsError::Tls)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(|io: TlsStream<TcpStream>| {
+                let peer_addr = io.get_ref().0.peer_addr().ok();
+                ok((io, peer_addr))
+            })
+            .and_then(self.map_err(TlsError::Service))
+        }
+    }
+}
+
+impl<T, S, B, X, U> H1Service<T, S, B, X, U>
+where
+    S: ServiceFactory<Config = (), Request = Request>,
     S::Error: Into<Error>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
     B: MessageBody,
 {
-    pub fn expect<X1>(self, expect: X1) -> H1Service<T, P, S, B, X1, U>
+    pub fn expect<X1>(self, expect: X1) -> H1Service<T, S, B, X1, U>
     where
-        X1: NewService<Request = Request, Response = Request>,
+        X1: ServiceFactory<Request = Request, Response = Request>,
         X1::Error: Into<Error>,
         X1::InitError: fmt::Debug,
     {
@@ -89,9 +217,9 @@ where
         }
     }
 
-    pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, P, S, B, X, U1>
+    pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, S, B, X, U1>
     where
-        U1: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
+        U1: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
     {
@@ -115,38 +243,34 @@ where
     }
 }
 
-impl<T, P, S, B, X, U> NewService for H1Service<T, P, S, B, X, U>
+impl<T, S, B, X, U> ServiceFactory for H1Service<T, S, B, X, U>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S: ServiceFactory<Config = (), Request = Request>,
     S::Error: Into<Error>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
     B: MessageBody,
-    X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+    X: ServiceFactory<Config = (), Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<
+    U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
-        Config = SrvConfig,
+    U::Error: fmt::Display + Into<Error>,
-        Request = (Request, Framed<T, Codec>),
-        Response = (),
-    >,
-    U::Error: fmt::Display,
     U::InitError: fmt::Debug,
 {
-    type Config = SrvConfig;
+    type Config = ();
-    type Request = Io<T, P>;
+    type Request = (T, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type InitError = ();
-    type Service = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
+    type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
-    type Future = H1ServiceResponse<T, P, S, B, X, U>;
+    type Future = H1ServiceResponse<T, S, B, X, U>;
 
-    fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         H1ServiceResponse {
-            fut: self.srv.new_service(cfg).into_future(),
+            fut: self.srv.new_service(()),
-            fut_ex: Some(self.expect.new_service(cfg)),
+            fut_ex: Some(self.expect.new_service(())),
-            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(cfg)),
+            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
             expect: None,
             upgrade: None,
             on_connect: self.on_connect.clone(),
@@ -157,88 +281,99 @@ where
 }
 
 #[doc(hidden)]
-pub struct H1ServiceResponse<T, P, S, B, X, U>
+#[pin_project::pin_project]
+pub struct H1ServiceResponse<T, S, B, X, U>
 where
-    S: NewService<Request = Request>,
+    S: ServiceFactory<Request = Request>,
     S::Error: Into<Error>,
     S::InitError: fmt::Debug,
-    X: NewService<Request = Request, Response = Request>,
+    X: ServiceFactory<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
+    U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
 {
+    #[pin]
     fut: S::Future,
+    #[pin]
     fut_ex: Option<X::Future>,
+    #[pin]
     fut_upg: Option<U::Future>,
     expect: Option<X::Service>,
     upgrade: Option<U::Service>,
     on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
     cfg: Option<ServiceConfig>,
-    _t: PhantomData<(T, P, B)>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B, X, U> Future for H1ServiceResponse<T, P, S, B, X, U>
+impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
-    S: NewService<Request = Request>,
+    S: ServiceFactory<Request = Request>,
     S::Error: Into<Error>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
     B: MessageBody,
-    X: NewService<Request = Request, Response = Request>,
+    X: ServiceFactory<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
+    U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
 {
-    type Item = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
+    type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
-    type Error = ();
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        if let Some(ref mut fut) = self.fut_ex {
+        let mut this = self.as_mut().project();
-            let expect = try_ready!(fut
+
-                .poll()
+        if let Some(fut) = this.fut_ex.as_pin_mut() {
-                .map_err(|e| log::error!("Init http service error: {:?}", e)));
+            let expect = ready!(fut
-            self.expect = Some(expect);
+                .poll(cx)
-            self.fut_ex.take();
+                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
+            this = self.as_mut().project();
+            *this.expect = Some(expect);
+            this.fut_ex.set(None);
         }
 
-        if let Some(ref mut fut) = self.fut_upg {
+        if let Some(fut) = this.fut_upg.as_pin_mut() {
-            let upgrade = try_ready!(fut
+            let upgrade = ready!(fut
-                .poll()
+                .poll(cx)
-                .map_err(|e| log::error!("Init http service error: {:?}", e)));
+                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
-            self.upgrade = Some(upgrade);
+            this = self.as_mut().project();
-            self.fut_ex.take();
+            *this.upgrade = Some(upgrade);
+            this.fut_ex.set(None);
         }
 
-        let service = try_ready!(self
+        let result = ready!(this
             .fut
-            .poll()
+            .poll(cx)
             .map_err(|e| log::error!("Init http service error: {:?}", e)));
-        Ok(Async::Ready(H1ServiceHandler::new(
+
-            self.cfg.take().unwrap(),
+        Poll::Ready(result.map(|service| {
+            let this = self.as_mut().project();
+            H1ServiceHandler::new(
+                this.cfg.take().unwrap(),
                 service,
-            self.expect.take().unwrap(),
+                this.expect.take().unwrap(),
-            self.upgrade.take(),
+                this.upgrade.take(),
-            self.on_connect.clone(),
+                this.on_connect.clone(),
-        )))
+            )
+        }))
     }
 }
 
 /// `Service` implementation for HTTP1 transport
-pub struct H1ServiceHandler<T, P, S, B, X, U> {
+pub struct H1ServiceHandler<T, S: Service, B, X: Service, U: Service> {
     srv: CloneableService<S>,
     expect: CloneableService<X>,
     upgrade: Option<CloneableService<U>>,
     on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
     cfg: ServiceConfig,
-    _t: PhantomData<(T, P, B)>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B, X, U> H1ServiceHandler<T, P, S, B, X, U>
+impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
 where
     S: Service<Request = Request>,
     S::Error: Into<Error>,
@@ -255,7 +390,7 @@ where
         expect: X,
         upgrade: Option<U>,
         on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
-    ) -> H1ServiceHandler<T, P, S, B, X, U> {
+    ) -> H1ServiceHandler<T, S, B, X, U> {
         H1ServiceHandler {
             srv: CloneableService::new(srv),
             expect: CloneableService::new(expect),
@@ -267,9 +402,9 @@ where
     }
 }
 
-impl<T, P, S, B, X, U> Service for H1ServiceHandler<T, P, S, B, X, U>
+impl<T, S, B, X, U> Service for H1ServiceHandler<T, S, B, X, U>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
     S::Error: Into<Error>,
     S::Response: Into<Response<B>>,
@@ -277,17 +412,17 @@ where
     X: Service<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     U: Service<Request = (Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
+    U::Error: fmt::Display + Into<Error>,
 {
-    type Request = Io<T, P>;
+    type Request = (T, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type Future = Dispatcher<T, S, B, X, U>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
         let ready = self
             .expect
-            .poll_ready()
+            .poll_ready(cx)
             .map_err(|e| {
                 let e = e.into();
                 log::error!("Http service readiness error: {:?}", e);
@@ -297,7 +432,7 @@ where
 
         let ready = self
             .srv
-            .poll_ready()
+            .poll_ready(cx)
             .map_err(|e| {
                 let e = e.into();
                 log::error!("Http service readiness error: {:?}", e);
@@ -306,16 +441,27 @@ where
             .is_ready()
             && ready;
 
-        if ready {
+        let ready = if let Some(ref mut upg) = self.upgrade {
-            Ok(Async::Ready(()))
+            upg.poll_ready(cx)
+                .map_err(|e| {
+                    let e = e.into();
+                    log::error!("Http service readiness error: {:?}", e);
+                    DispatchError::Service(e)
+                })?
+                .is_ready()
+                && ready
         } else {
-            Ok(Async::NotReady)
+            ready
+        };
+
+        if ready {
+            Poll::Ready(Ok(()))
+        } else {
+            Poll::Pending
         }
     }
 
-    fn call(&mut self, req: Self::Request) -> Self::Future {
+    fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
-        let io = req.into_parts().0;
-
         let on_connect = if let Some(ref on_connect) = self.on_connect {
             Some(on_connect(&io))
         } else {
@@ -329,20 +475,21 @@ where
             self.expect.clone(),
             self.upgrade.clone(),
             on_connect,
+            addr,
         )
     }
 }
 
-/// `NewService` implementation for `OneRequestService` service
+/// `ServiceFactory` implementation for `OneRequestService` service
 #[derive(Default)]
-pub struct OneRequest<T, P> {
+pub struct OneRequest<T> {
     config: ServiceConfig,
-    _t: PhantomData<(T, P)>,
+    _t: PhantomData<T>,
 }
 
-impl<T, P> OneRequest<T, P>
+impl<T> OneRequest<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
     /// Create new `H1SimpleService` instance.
     pub fn new() -> Self {
@@ -353,81 +500,82 @@ where
     }
 }
 
-impl<T, P> NewService for OneRequest<T, P>
+impl<T> ServiceFactory for OneRequest<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
-    type Config = SrvConfig;
+    type Config = ();
-    type Request = Io<T, P>;
+    type Request = T;
     type Response = (Request, Framed<T, Codec>);
     type Error = ParseError;
     type InitError = ();
-    type Service = OneRequestService<T, P>;
+    type Service = OneRequestService<T>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
+    type Future = Ready<Result<Self::Service, Self::InitError>>;
 
-    fn new_service(&self, _: &SrvConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         ok(OneRequestService {
-            config: self.config.clone(),
             _t: PhantomData,
+            config: self.config.clone(),
         })
     }
 }
 
 /// `Service` implementation for HTTP1 transport. Reads one request and returns
 /// request and framed object.
-pub struct OneRequestService<T, P> {
+pub struct OneRequestService<T> {
+    _t: PhantomData<T>,
     config: ServiceConfig,
-    _t: PhantomData<(T, P)>,
 }
 
-impl<T, P> Service for OneRequestService<T, P>
+impl<T> Service for OneRequestService<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
-    type Request = Io<T, P>;
+    type Request = T;
     type Response = (Request, Framed<T, Codec>);
     type Error = ParseError;
     type Future = OneRequestServiceResponse<T>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        Ok(Async::Ready(()))
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, req: Self::Request) -> Self::Future {
         OneRequestServiceResponse {
-            framed: Some(Framed::new(
+            framed: Some(Framed::new(req, Codec::new(self.config.clone()))),
-                req.into_parts().0,
-                Codec::new(self.config.clone()),
-            )),
         }
     }
 }
 
 #[doc(hidden)]
+#[pin_project::pin_project]
 pub struct OneRequestServiceResponse<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
+    #[pin]
     framed: Option<Framed<T, Codec>>,
 }
 
 impl<T> Future for OneRequestServiceResponse<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
-    type Item = (Request, Framed<T, Codec>);
+    type Output = Result<(Request, Framed<T, Codec>), ParseError>;
-    type Error = ParseError;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        match self.framed.as_mut().unwrap().poll()? {
+        let this = self.as_mut().project();
-            Async::Ready(Some(req)) => match req {
+
+        match ready!(this.framed.as_pin_mut().unwrap().next_item(cx)) {
+            Some(Ok(req)) => match req {
                 Message::Item(req) => {
-                    Ok(Async::Ready((req, self.framed.take().unwrap())))
+                    let mut this = self.as_mut().project();
+                    Poll::Ready(Ok((req, this.framed.take().unwrap())))
                 }
                 Message::Chunk(_) => unreachable!("Something is wrong"),
             },
-            Async::Ready(None) => Err(ParseError::Incomplete),
+            Some(Err(err)) => Poll::Ready(Err(err)),
-            Async::NotReady => Ok(Async::NotReady),
+            None => Poll::Ready(Err(ParseError::Incomplete)),
         }
     }
 }

actix-http/src/h1/upgrade.rs

@@ -1,10 +1,9 @@
 use std::marker::PhantomData;
+use std::task::{Context, Poll};
 
 use actix_codec::Framed;
-use actix_server_config::ServerConfig;
+use actix_service::{Service, ServiceFactory};
-use actix_service::{NewService, Service};
+use futures_util::future::Ready;
-use futures::future::FutureResult;
-use futures::{Async, Poll};
 
 use crate::error::Error;
 use crate::h1::Codec;
@@ -12,16 +11,16 @@ use crate::request::Request;
 
 pub struct UpgradeHandler<T>(PhantomData<T>);
 
-impl<T> NewService for UpgradeHandler<T> {
+impl<T> ServiceFactory for UpgradeHandler<T> {
-    type Config = ServerConfig;
+    type Config = ();
     type Request = (Request, Framed<T, Codec>);
     type Response = ();
     type Error = Error;
     type Service = UpgradeHandler<T>;
     type InitError = Error;
-    type Future = FutureResult<Self::Service, Self::InitError>;
+    type Future = Ready<Result<Self::Service, Self::InitError>>;
 
-    fn new_service(&self, _: &ServerConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         unimplemented!()
     }
 }
@@ -30,10 +29,10 @@ impl<T> Service for UpgradeHandler<T> {
     type Request = (Request, Framed<T, Codec>);
     type Response = ();
     type Error = Error;
-    type Future = FutureResult<Self::Response, Self::Error>;
+    type Future = Ready<Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        Ok(Async::Ready(()))
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, _: Self::Request) -> Self::Future {

actix-http/src/h1/utils.rs

@@ -1,15 +1,21 @@
+use std::future::Future;
+use std::pin::Pin;
+use std::task::{Context, Poll};
+
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use futures::{Async, Future, Poll, Sink};
 
 use crate::body::{BodySize, MessageBody, ResponseBody};
 use crate::error::Error;
 use crate::h1::{Codec, Message};
 use crate::response::Response;
 
-/// Send http/1 response
+/// Send HTTP/1 response
+#[pin_project::pin_project]
 pub struct SendResponse<T, B> {
     res: Option<Message<(Response<()>, BodySize)>>,
+    #[pin]
     body: Option<ResponseBody<B>>,
+    #[pin]
     framed: Option<Framed<T, Codec>>,
 }
 
@@ -30,63 +36,80 @@ where
 
 impl<T, B> Future for SendResponse<T, B>
 where
-    T: AsyncRead + AsyncWrite,
+    T: AsyncRead + AsyncWrite + Unpin,
-    B: MessageBody,
+    B: MessageBody + Unpin,
 {
-    type Item = Framed<T, Codec>;
+    type Output = Result<Framed<T, Codec>, Error>;
-    type Error = Error;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    // TODO: rethink if we need loops in polls
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let mut this = self.as_mut().project();
+
+        let mut body_done = this.body.is_none();
         loop {
-            let mut body_ready = self.body.is_some();
+            let mut body_ready = !body_done;
-            let framed = self.framed.as_mut().unwrap();
 
             // send body
-            if self.res.is_none() && self.body.is_some() {
+            if this.res.is_none() && body_ready {
-                while body_ready && self.body.is_some() && !framed.is_write_buf_full() {
+                while body_ready
-                    match self.body.as_mut().unwrap().poll_next()? {
+                    && !body_done
-                        Async::Ready(item) => {
+                    && !this
-                            // body is done
+                        .framed
-                            if item.is_none() {
+                        .as_ref()
-                                let _ = self.body.take();
+                        .as_pin_ref()
+                        .unwrap()
+                        .is_write_buf_full()
+                {
+                    match this.body.as_mut().as_pin_mut().unwrap().poll_next(cx)? {
+                        Poll::Ready(item) => {
+                            // body is done when item is None
+                            body_done = item.is_none();
+                            if body_done {
+                                let _ = this.body.take();
                             }
-                            framed.force_send(Message::Chunk(item))?;
+                            let framed = this.framed.as_mut().as_pin_mut().unwrap();
+                            framed.write(Message::Chunk(item))?;
                         }
-                        Async::NotReady => body_ready = false,
+                        Poll::Pending => body_ready = false,
                     }
                 }
             }
 
+            let framed = this.framed.as_mut().as_pin_mut().unwrap();
+
             // flush write buffer
             if !framed.is_write_buf_empty() {
-                match framed.poll_complete()? {
+                match framed.flush(cx)? {
-                    Async::Ready(_) => {
+                    Poll::Ready(_) => {
                         if body_ready {
                             continue;
                         } else {
-                            return Ok(Async::NotReady);
+                            return Poll::Pending;
                         }
                     }
-                    Async::NotReady => return Ok(Async::NotReady),
+                    Poll::Pending => return Poll::Pending,
                 }
             }
 
             // send response
-            if let Some(res) = self.res.take() {
+            if let Some(res) = this.res.take() {
-                framed.force_send(res)?;
+                framed.write(res)?;
                 continue;
             }
 
-            if self.body.is_some() {
+            if !body_done {
                 if body_ready {
                     continue;
                 } else {
-                    return Ok(Async::NotReady);
+                    return Poll::Pending;
                 }
             } else {
                 break;
             }
         }
-        Ok(Async::Ready(self.framed.take().unwrap()))
+
+        let framed = this.framed.take().unwrap();
+
+        Poll::Ready(Ok(framed))
     }
 }

actix-http/src/h2/dispatcher.rs

@@ -1,28 +1,25 @@
-use std::collections::VecDeque;
+use std::convert::TryFrom;
+use std::future::Future;
 use std::marker::PhantomData;
-use std::time::Instant;
+use std::net;
-use std::{fmt, mem, net};
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite};
-use actix_server_config::IoStream;
+use actix_rt::time::{Delay, Instant};
 use actix_service::Service;
-use bitflags::bitflags;
 use bytes::{Bytes, BytesMut};
-use futures::{try_ready, Async, Future, Poll, Sink, Stream};
 use h2::server::{Connection, SendResponse};
-use h2::{RecvStream, SendStream};
+use h2::SendStream;
-use http::header::{
+use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
-    HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING,
+use log::{error, trace};
-};
-use http::HttpTryFrom;
-use log::{debug, error, trace};
-use tokio_timer::Delay;
 
-use crate::body::{Body, BodySize, MessageBody, ResponseBody};
+use crate::body::{BodySize, MessageBody, ResponseBody};
 use crate::cloneable::CloneableService;
 use crate::config::ServiceConfig;
-use crate::error::{DispatchError, Error, ParseError, PayloadError, ResponseError};
+use crate::error::{DispatchError, Error};
 use crate::helpers::DataFactory;
+use crate::httpmessage::HttpMessage;
 use crate::message::ResponseHead;
 use crate::payload::Payload;
 use crate::request::Request;
@@ -31,7 +28,11 @@ use crate::response::Response;
 const CHUNK_SIZE: usize = 16_384;
 
 /// Dispatcher for HTTP/2 protocol
-pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody> {
+#[pin_project::pin_project]
+pub struct Dispatcher<T, S: Service<Request = Request>, B: MessageBody>
+where
+    T: AsyncRead + AsyncWrite + Unpin,
+{
     service: CloneableService<S>,
     connection: Connection<T, Bytes>,
     on_connect: Option<Box<dyn DataFactory>>,
@@ -44,12 +45,12 @@ pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody
 
 impl<T, S, B> Dispatcher<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
     S::Error: Into<Error>,
-    S::Future: 'static,
+    // S::Future: 'static,
     S::Response: Into<Response<B>>,
-    B: MessageBody + 'static,
+    B: MessageBody,
 {
     pub(crate) fn new(
         service: CloneableService<S>,
@@ -90,70 +91,92 @@ where
 
 impl<T, S, B> Future for Dispatcher<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
 {
-    type Item = ();
+    type Output = Result<(), DispatchError>;
-    type Error = DispatchError;
 
     #[inline]
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let this = self.get_mut();
+
         loop {
-            match self.connection.poll()? {
+            match Pin::new(&mut this.connection).poll_accept(cx) {
-                Async::Ready(None) => return Ok(Async::Ready(())),
+                Poll::Ready(None) => return Poll::Ready(Ok(())),
-                Async::Ready(Some((req, res))) => {
+                Poll::Ready(Some(Err(err))) => return Poll::Ready(Err(err.into())),
+                Poll::Ready(Some(Ok((req, res)))) => {
                     // update keep-alive expire
-                    if self.ka_timer.is_some() {
+                    if this.ka_timer.is_some() {
-                        if let Some(expire) = self.config.keep_alive_expire() {
+                        if let Some(expire) = this.config.keep_alive_expire() {
-                            self.ka_expire = expire;
+                            this.ka_expire = expire;
                         }
                     }
 
                     let (parts, body) = req.into_parts();
-                    let mut req = Request::with_payload(body.into());
+                    let mut req = Request::with_payload(Payload::<
+                        crate::payload::PayloadStream,
+                    >::H2(
+                        crate::h2::Payload::new(body)
+                    ));
 
                     let head = &mut req.head_mut();
                     head.uri = parts.uri;
                     head.method = parts.method;
                     head.version = parts.version;
                     head.headers = parts.headers.into();
-                    head.peer_addr = self.peer_addr;
+                    head.peer_addr = this.peer_addr;
-                    tokio_current_thread::spawn(ServiceResponse::<S::Future, B> {
+
+                    // set on_connect data
+                    if let Some(ref on_connect) = this.on_connect {
+                        on_connect.set(&mut req.extensions_mut());
+                    }
+
+                    actix_rt::spawn(ServiceResponse::<
+                        S::Future,
+                        S::Response,
+                        S::Error,
+                        B,
+                    > {
                         state: ServiceResponseState::ServiceCall(
-                            self.service.call(req),
+                            this.service.call(req),
                             Some(res),
                         ),
-                        config: self.config.clone(),
+                        config: this.config.clone(),
                         buffer: None,
-                    })
+                        _t: PhantomData,
+                    });
                 }
-                Async::NotReady => return Ok(Async::NotReady),
+                Poll::Pending => return Poll::Pending,
             }
         }
     }
 }
 
-struct ServiceResponse<F, B> {
+#[pin_project::pin_project]
+struct ServiceResponse<F, I, E, B> {
+    #[pin]
     state: ServiceResponseState<F, B>,
     config: ServiceConfig,
     buffer: Option<Bytes>,
+    _t: PhantomData<(I, E)>,
 }
 
+#[pin_project::pin_project(project = ServiceResponseStateProj)]
 enum ServiceResponseState<F, B> {
-    ServiceCall(F, Option<SendResponse<Bytes>>),
+    ServiceCall(#[pin] F, Option<SendResponse<Bytes>>),
-    SendPayload(SendStream<Bytes>, ResponseBody<B>),
+    SendPayload(SendStream<Bytes>, #[pin] ResponseBody<B>),
 }
 
-impl<F, B> ServiceResponse<F, B>
+impl<F, I, E, B> ServiceResponse<F, I, E, B>
 where
-    F: Future,
+    F: Future<Output = Result<I, E>>,
-    F::Error: Into<Error>,
+    E: Into<Error>,
-    F::Item: Into<Response<B>>,
+    I: Into<Response<B>>,
-    B: MessageBody + 'static,
+    B: MessageBody,
 {
     fn prepare_response(
         &self,
@@ -187,10 +210,6 @@ where
                 CONTENT_LENGTH,
                 HeaderValue::try_from(format!("{}", len)).unwrap(),
             ),
-            BodySize::Sized64(len) => res.headers_mut().insert(
-                CONTENT_LENGTH,
-                HeaderValue::try_from(format!("{}", len)).unwrap(),
-            ),
         };
 
         // copy headers
@@ -208,122 +227,137 @@ where
         if !has_date {
             let mut bytes = BytesMut::with_capacity(29);
             self.config.set_date_header(&mut bytes);
-            res.headers_mut()
+            res.headers_mut().insert(
-                .insert(DATE, HeaderValue::try_from(bytes.freeze()).unwrap());
+                DATE,
+                // SAFETY: serialized date-times are known ASCII strings
+                unsafe { HeaderValue::from_maybe_shared_unchecked(bytes.freeze()) },
+            );
         }
 
         res
     }
 }
 
-impl<F, B> Future for ServiceResponse<F, B>
+impl<F, I, E, B> Future for ServiceResponse<F, I, E, B>
 where
-    F: Future,
+    F: Future<Output = Result<I, E>>,
-    F::Error: Into<Error>,
+    E: Into<Error>,
-    F::Item: Into<Response<B>>,
+    I: Into<Response<B>>,
-    B: MessageBody + 'static,
+    B: MessageBody,
 {
-    type Item = ();
+    type Output = ();
-    type Error = ();
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        match self.state {
+        let mut this = self.as_mut().project();
-            ServiceResponseState::ServiceCall(ref mut call, ref mut send) => {
+
-                match call.poll() {
+        match this.state.project() {
-                    Ok(Async::Ready(res)) => {
+            ServiceResponseStateProj::ServiceCall(call, send) => match call.poll(cx) {
+                Poll::Ready(Ok(res)) => {
                     let (res, body) = res.into().replace_body(());
 
                     let mut send = send.take().unwrap();
                     let mut size = body.size();
-                        let h2_res = self.prepare_response(res.head(), &mut size);
+                    let h2_res = self.as_mut().prepare_response(res.head(), &mut size);
+                    this = self.as_mut().project();
 
-                        let stream =
+                    let stream = match send.send_response(h2_res, size.is_eof()) {
-                            send.send_response(h2_res, size.is_eof()).map_err(|e| {
+                        Err(e) => {
                             trace!("Error sending h2 response: {:?}", e);
-                            })?;
+                            return Poll::Ready(());
+                        }
+                        Ok(stream) => stream,
+                    };
 
                     if size.is_eof() {
-                            Ok(Async::Ready(()))
+                        Poll::Ready(())
                     } else {
-                            self.state = ServiceResponseState::SendPayload(stream, body);
+                        this.state
-                            self.poll()
+                            .set(ServiceResponseState::SendPayload(stream, body));
+                        self.poll(cx)
                     }
                 }
-                    Ok(Async::NotReady) => Ok(Async::NotReady),
+                Poll::Pending => Poll::Pending,
-                    Err(_e) => {
+                Poll::Ready(Err(e)) => {
-                        let res: Response = Response::InternalServerError().finish();
+                    let res: Response = e.into().into();
                     let (res, body) = res.replace_body(());
 
                     let mut send = send.take().unwrap();
                     let mut size = body.size();
-                        let h2_res = self.prepare_response(res.head(), &mut size);
+                    let h2_res = self.as_mut().prepare_response(res.head(), &mut size);
+                    this = self.as_mut().project();
 
-                        let stream =
+                    let stream = match send.send_response(h2_res, size.is_eof()) {
-                            send.send_response(h2_res, size.is_eof()).map_err(|e| {
+                        Err(e) => {
                             trace!("Error sending h2 response: {:?}", e);
-                            })?;
+                            return Poll::Ready(());
+                        }
+                        Ok(stream) => stream,
+                    };
 
                     if size.is_eof() {
-                            Ok(Async::Ready(()))
+                        Poll::Ready(())
                     } else {
-                            self.state = ServiceResponseState::SendPayload(
+                        this.state.set(ServiceResponseState::SendPayload(
                             stream,
                             body.into_body(),
-                            );
+                        ));
-                            self.poll()
+                        self.poll(cx)
                     }
                 }
-                }
+            },
-            }
+            ServiceResponseStateProj::SendPayload(ref mut stream, ref mut body) => {
-            ServiceResponseState::SendPayload(ref mut stream, ref mut body) => loop {
                 loop {
-                    if let Some(ref mut buffer) = self.buffer {
+                    loop {
-                        match stream.poll_capacity().map_err(|e| warn!("{:?}", e))? {
+                        if let Some(ref mut buffer) = this.buffer {
-                            Async::NotReady => return Ok(Async::NotReady),
+                            match stream.poll_capacity(cx) {
-                            Async::Ready(None) => return Ok(Async::Ready(())),
+                                Poll::Pending => return Poll::Pending,
-                            Async::Ready(Some(cap)) => {
+                                Poll::Ready(None) => return Poll::Ready(()),
+                                Poll::Ready(Some(Ok(cap))) => {
                                     let len = buffer.len();
                                     let bytes = buffer.split_to(std::cmp::min(cap, len));
 
                                     if let Err(e) = stream.send_data(bytes, false) {
                                         warn!("{:?}", e);
-                                    return Err(());
+                                        return Poll::Ready(());
                                     } else if !buffer.is_empty() {
-                                    let cap = std::cmp::min(buffer.len(), CHUNK_SIZE);
+                                        let cap =
+                                            std::cmp::min(buffer.len(), CHUNK_SIZE);
                                         stream.reserve_capacity(cap);
                                     } else {
-                                    self.buffer.take();
+                                        this.buffer.take();
                                     }
                                 }
-                        }
+                                Poll::Ready(Some(Err(e))) => {
-                    } else {
-                        match body.poll_next() {
-                            Ok(Async::NotReady) => {
-                                return Ok(Async::NotReady);
-                            }
-                            Ok(Async::Ready(None)) => {
-                                if let Err(e) = stream.send_data(Bytes::new(), true) {
                                     warn!("{:?}", e);
-                                    return Err(());
+                                    return Poll::Ready(());
+                                }
+                            }
                         } else {
-                                    return Ok(Async::Ready(()));
+                            match body.as_mut().poll_next(cx) {
+                                Poll::Pending => return Poll::Pending,
+                                Poll::Ready(None) => {
+                                    if let Err(e) = stream.send_data(Bytes::new(), true)
+                                    {
+                                        warn!("{:?}", e);
                                     }
+                                    return Poll::Ready(());
                                 }
-                            Ok(Async::Ready(Some(chunk))) => {
+                                Poll::Ready(Some(Ok(chunk))) => {
                                     stream.reserve_capacity(std::cmp::min(
                                         chunk.len(),
                                         CHUNK_SIZE,
                                     ));
-                                self.buffer = Some(chunk);
+                                    *this.buffer = Some(chunk);
                                 }
-                            Err(e) => {
+                                Poll::Ready(Some(Err(e))) => {
                                     error!("Response payload stream error: {:?}", e);
-                                return Err(());
+                                    return Poll::Ready(());
+                                }
+                            }
                         }
                     }
                 }
             }
-            },
         }
     }
 }

actix-http/src/h2/mod.rs

@@ -1,9 +1,9 @@
-#![allow(dead_code, unused_imports)]
+//! HTTP/2 implementation
-
+use std::pin::Pin;
-use std::fmt;
+use std::task::{Context, Poll};
 
 use bytes::Bytes;
-use futures::{Async, Poll, Stream};
+use futures_core::Stream;
 use h2::RecvStream;
 
 mod dispatcher;
@@ -25,22 +25,26 @@ impl Payload {
 }
 
 impl Stream for Payload {
-    type Item = Bytes;
+    type Item = Result<Bytes, PayloadError>;
-    type Error = PayloadError;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
+    fn poll_next(
-        match self.pl.poll() {
+        self: Pin<&mut Self>,
-            Ok(Async::Ready(Some(chunk))) => {
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        let this = self.get_mut();
+
+        match Pin::new(&mut this.pl).poll_data(cx) {
+            Poll::Ready(Some(Ok(chunk))) => {
                 let len = chunk.len();
-                if let Err(err) = self.pl.release_capacity().release_capacity(len) {
+                if let Err(err) = this.pl.flow_control().release_capacity(len) {
-                    Err(err.into())
+                    Poll::Ready(Some(Err(err.into())))
                 } else {
-                    Ok(Async::Ready(Some(chunk)))
+                    Poll::Ready(Some(Ok(chunk)))
                 }
             }
-            Ok(Async::Ready(None)) => Ok(Async::Ready(None)),
+            Poll::Ready(Some(Err(err))) => Poll::Ready(Some(Err(err.into()))),
-            Ok(Async::NotReady) => Ok(Async::NotReady),
+            Poll::Pending => Poll::Pending,
-            Err(err) => Err(err.into()),
+            Poll::Ready(None) => Poll::Ready(None),
         }
     }
 }

actix-http/src/h2/service.rs

@@ -1,62 +1,56 @@
-use std::fmt::Debug;
+use std::future::Future;
 use std::marker::PhantomData;
-use std::{io, net, rc};
+use std::pin::Pin;
+use std::task::{Context, Poll};
+use std::{net, rc};
 
-use actix_codec::{AsyncRead, AsyncWrite, Framed};
+use actix_codec::{AsyncRead, AsyncWrite};
-use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig};
+use actix_rt::net::TcpStream;
-use actix_service::{IntoNewService, NewService, Service};
+use actix_service::{
+    fn_factory, fn_service, pipeline_factory, IntoServiceFactory, Service,
+    ServiceFactory,
+};
 use bytes::Bytes;
-use futures::future::{ok, FutureResult};
+use futures_core::ready;
-use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream};
+use futures_util::future::ok;
-use h2::server::{self, Connection, Handshake};
+use h2::server::{self, Handshake};
-use h2::RecvStream;
 use log::error;
 
 use crate::body::MessageBody;
 use crate::cloneable::CloneableService;
-use crate::config::{KeepAlive, ServiceConfig};
+use crate::config::ServiceConfig;
-use crate::error::{DispatchError, Error, ParseError, ResponseError};
+use crate::error::{DispatchError, Error};
 use crate::helpers::DataFactory;
-use crate::payload::Payload;
 use crate::request::Request;
 use crate::response::Response;
 
 use super::dispatcher::Dispatcher;
 
-/// `NewService` implementation for HTTP2 transport
+/// `ServiceFactory` implementation for HTTP2 transport
-pub struct H2Service<T, P, S, B> {
+pub struct H2Service<T, S, B> {
     srv: S,
     cfg: ServiceConfig,
     on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
-    _t: PhantomData<(T, P, B)>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B> H2Service<T, P, S, B>
+impl<T, S, B> H2Service<T, S, B>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S: ServiceFactory<Config = (), Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
 {
-    /// Create new `HttpService` instance.
-    pub fn new<F: IntoNewService<S>>(service: F) -> Self {
-        let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
-
-        H2Service {
-            cfg,
-            on_connect: None,
-            srv: service.into_new_service(),
-            _t: PhantomData,
-        }
-    }
-
     /// Create new `HttpService` instance with config.
-    pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self {
+    pub(crate) fn with_config<F: IntoServiceFactory<S>>(
+        cfg: ServiceConfig,
+        service: F,
+    ) -> Self {
         H2Service {
             cfg,
             on_connect: None,
-            srv: service.into_new_service(),
+            srv: service.into_factory(),
             _t: PhantomData,
         }
     }
@@ -71,26 +65,142 @@ where
     }
 }
 
-impl<T, P, S, B> NewService for H2Service<T, P, S, B>
+impl<S, B> H2Service<TcpStream, S, B>
 where
-    T: IoStream,
+    S: ServiceFactory<Config = (), Request = Request>,
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S::Error: Into<Error> + 'static,
-    S::Error: Into<Error>,
+    S::Response: Into<Response<B>> + 'static,
-    S::Response: Into<Response<B>>,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
 {
-    type Config = SrvConfig;
+    /// Create simple tcp based service
-    type Request = Io<T, P>;
+    pub fn tcp(
+        self,
+    ) -> impl ServiceFactory<
+        Config = (),
+        Request = TcpStream,
+        Response = (),
+        Error = DispatchError,
+        InitError = S::InitError,
+    > {
+        pipeline_factory(fn_factory(|| async {
+            Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
+                let peer_addr = io.peer_addr().ok();
+                ok::<_, DispatchError>((io, peer_addr))
+            }))
+        }))
+        .and_then(self)
+    }
+}
+
+#[cfg(feature = "openssl")]
+mod openssl {
+    use actix_service::{fn_factory, fn_service};
+    use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
+    use actix_tls::{openssl::HandshakeError, TlsError};
+
+    use super::*;
+
+    impl<S, B> H2Service<SslStream<TcpStream>, S, B>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error> + 'static,
+        S::Response: Into<Response<B>> + 'static,
+        <S::Service as Service>::Future: 'static,
+        B: MessageBody + 'static,
+    {
+        /// Create ssl based service
+        pub fn openssl(
+            self,
+            acceptor: SslAcceptor,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = TlsError<HandshakeError<TcpStream>, DispatchError>,
+            InitError = S::InitError,
+        > {
+            pipeline_factory(
+                Acceptor::new(acceptor)
+                    .map_err(TlsError::Tls)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(fn_factory(|| {
+                ok::<_, S::InitError>(fn_service(|io: SslStream<TcpStream>| {
+                    let peer_addr = io.get_ref().peer_addr().ok();
+                    ok((io, peer_addr))
+                }))
+            }))
+            .and_then(self.map_err(TlsError::Service))
+        }
+    }
+}
+
+#[cfg(feature = "rustls")]
+mod rustls {
+    use super::*;
+    use actix_tls::rustls::{Acceptor, ServerConfig, TlsStream};
+    use actix_tls::TlsError;
+    use std::io;
+
+    impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error> + 'static,
+        S::Response: Into<Response<B>> + 'static,
+        <S::Service as Service>::Future: 'static,
+        B: MessageBody + 'static,
+    {
+        /// Create openssl based service
+        pub fn rustls(
+            self,
+            mut config: ServerConfig,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = TlsError<io::Error, DispatchError>,
+            InitError = S::InitError,
+        > {
+            let protos = vec!["h2".to_string().into()];
+            config.set_protocols(&protos);
+
+            pipeline_factory(
+                Acceptor::new(config)
+                    .map_err(TlsError::Tls)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(fn_factory(|| {
+                ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
+                    let peer_addr = io.get_ref().0.peer_addr().ok();
+                    ok((io, peer_addr))
+                }))
+            }))
+            .and_then(self.map_err(TlsError::Service))
+        }
+    }
+}
+
+impl<T, S, B> ServiceFactory for H2Service<T, S, B>
+where
+    T: AsyncRead + AsyncWrite + Unpin,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
+    S::Response: Into<Response<B>> + 'static,
+    <S::Service as Service>::Future: 'static,
+    B: MessageBody + 'static,
+{
+    type Config = ();
+    type Request = (T, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type InitError = S::InitError;
-    type Service = H2ServiceHandler<T, P, S::Service, B>;
+    type Service = H2ServiceHandler<T, S::Service, B>;
-    type Future = H2ServiceResponse<T, P, S, B>;
+    type Future = H2ServiceResponse<T, S, B>;
 
-    fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         H2ServiceResponse {
-            fut: self.srv.new_service(cfg).into_future(),
+            fut: self.srv.new_service(()),
             cfg: Some(self.cfg.clone()),
             on_connect: self.on_connect.clone(),
             _t: PhantomData,
@@ -99,56 +209,61 @@ where
 }
 
 #[doc(hidden)]
-pub struct H2ServiceResponse<T, P, S: NewService, B> {
+#[pin_project::pin_project]
-    fut: <S::Future as IntoFuture>::Future,
+pub struct H2ServiceResponse<T, S: ServiceFactory, B> {
+    #[pin]
+    fut: S::Future,
     cfg: Option<ServiceConfig>,
     on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
-    _t: PhantomData<(T, P, B)>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B> Future for H2ServiceResponse<T, P, S, B>
+impl<T, S, B> Future for H2ServiceResponse<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S: ServiceFactory<Config = (), Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
 {
-    type Item = H2ServiceHandler<T, P, S::Service, B>;
+    type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
-    type Error = S::InitError;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let service = try_ready!(self.fut.poll());
+        let this = self.as_mut().project();
-        Ok(Async::Ready(H2ServiceHandler::new(
+
-            self.cfg.take().unwrap(),
+        Poll::Ready(ready!(this.fut.poll(cx)).map(|service| {
-            self.on_connect.clone(),
+            let this = self.as_mut().project();
+            H2ServiceHandler::new(
+                this.cfg.take().unwrap(),
+                this.on_connect.clone(),
                 service,
-        )))
+            )
+        }))
     }
 }
 
 /// `Service` implementation for http/2 transport
-pub struct H2ServiceHandler<T, P, S, B> {
+pub struct H2ServiceHandler<T, S: Service, B> {
     srv: CloneableService<S>,
     cfg: ServiceConfig,
     on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
-    _t: PhantomData<(T, P, B)>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B> H2ServiceHandler<T, P, S, B>
+impl<T, S, B> H2ServiceHandler<T, S, B>
 where
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
 {
     fn new(
         cfg: ServiceConfig,
         on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
         srv: S,
-    ) -> H2ServiceHandler<T, P, S, B> {
+    ) -> H2ServiceHandler<T, S, B> {
         H2ServiceHandler {
             cfg,
             on_connect,
@@ -158,31 +273,29 @@ where
     }
 }
 
-impl<T, P, S, B> Service for H2ServiceHandler<T, P, S, B>
+impl<T, S, B> Service for H2ServiceHandler<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
 {
-    type Request = Io<T, P>;
+    type Request = (T, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type Future = H2ServiceHandlerResponse<T, S, B>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        self.srv.poll_ready().map_err(|e| {
+        self.srv.poll_ready(cx).map_err(|e| {
             let e = e.into();
             error!("Service readiness error: {:?}", e);
             DispatchError::Service(e)
         })
     }
 
-    fn call(&mut self, req: Self::Request) -> Self::Future {
+    fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
-        let io = req.into_parts().0;
-        let peer_addr = io.peer_addr();
         let on_connect = if let Some(ref on_connect) = self.on_connect {
             Some(on_connect(&io))
         } else {
@@ -193,7 +306,7 @@ where
             state: State::Handshake(
                 Some(self.srv.clone()),
                 Some(self.cfg.clone()),
-                peer_addr,
+                addr,
                 on_connect,
                 server::handshake(io),
             ),
@@ -201,8 +314,9 @@ where
     }
 }
 
-enum State<T: IoStream, S: Service<Request = Request>, B: MessageBody>
+enum State<T, S: Service<Request = Request>, B: MessageBody>
 where
+    T: AsyncRead + AsyncWrite + Unpin,
     S::Future: 'static,
 {
     Incoming(Dispatcher<T, S, B>),
@@ -217,11 +331,11 @@ where
 
 pub struct H2ServiceHandlerResponse<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
 {
     state: State<T, S, B>,
@@ -229,27 +343,26 @@ where
 
 impl<T, S, B> Future for H2ServiceHandlerResponse<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody,
 {
-    type Item = ();
+    type Output = Result<(), DispatchError>;
-    type Error = DispatchError;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
         match self.state {
-            State::Incoming(ref mut disp) => disp.poll(),
+            State::Incoming(ref mut disp) => Pin::new(disp).poll(cx),
             State::Handshake(
                 ref mut srv,
                 ref mut config,
                 ref peer_addr,
                 ref mut on_connect,
                 ref mut handshake,
-            ) => match handshake.poll() {
+            ) => match Pin::new(handshake).poll(cx) {
-                Ok(Async::Ready(conn)) => {
+                Poll::Ready(Ok(conn)) => {
                     self.state = State::Incoming(Dispatcher::new(
                         srv.take().unwrap(),
                         conn,
@@ -258,13 +371,13 @@ where
                         None,
                         *peer_addr,
                     ));
-                    self.poll()
+                    self.poll(cx)
                 }
-                Ok(Async::NotReady) => Ok(Async::NotReady),
+                Poll::Ready(Err(err)) => {
-                Err(err) => {
                     trace!("H2 handshake error: {}", err);
-                    Err(err.into())
+                    Poll::Ready(Err(err.into()))
                 }
+                Poll::Pending => Poll::Pending,
             },
         }
     }

actix-http/src/header/common/accept_charset.rs

@@ -63,7 +63,7 @@ header! {
     (AcceptCharset, ACCEPT_CHARSET) => (QualityItem<Charset>)+
 
     test_accept_charset {
-        /// Test case from RFC
+        // Test case from RFC
         test_header!(test1, vec![b"iso-8859-5, unicode-1-1;q=0.8"]);
     }
 }