1
0
mirror of https://github.com/fafhrd91/actix-web synced 2025-08-16 19:09:02 +02:00

Compare commits

...

87 Commits

Author SHA1 Message Date
Nikolay Kim
1729a52f8b prepare alpha.3 release 2019-12-07 13:00:03 +06:00
Nikolay Kim
ed2f3fe80d use actix-net alpha.3 release 2019-12-07 12:28:26 +06:00
Nikolay Kim
7dd676439c update changes for actix-session 2019-12-06 11:24:25 +06:00
tglman
fbead137f0 feat: add access to UserSession from RequestHead (#1164)
* feat: add access to UserSession from RequestHead

* add test case for session from RequestHead and changes entry for the new feature
2019-12-06 11:21:43 +06:00
Nikolay Kim
205a964d8f upgrade to tokio 0.2 2019-12-05 23:35:43 +06:00
Nikolay Kim
b45c6cd66b replace hashbrown with std hashmap 2019-12-04 18:33:43 +06:00
Nikolay Kim
0015a204aa update version 2019-12-03 19:03:53 +06:00
Nikolay Kim
c7ed6d3428 update version 2019-12-03 16:35:31 +06:00
Nikolay Kim
cf30eafb49 update md 2019-12-03 00:49:12 +06:00
Nikolay Kim
14075ebf7f use released versions of actix-net 2019-12-02 23:33:39 +06:00
Nikolay Kim
068f047dd5 update service factory config 2019-12-02 21:37:13 +06:00
Nikolay Kim
f4c01384ec update to latest actix-net 2019-12-02 17:33:11 +06:00
Yuki Okushi
33574403b5 Remove rustls from package.metadata.docs.rs (#1182) 2019-11-28 06:25:21 +06:00
Nikolay Kim
dcc6efa3e6 Merge branch 'master' of github.com:actix/actix-web 2019-11-27 21:08:13 +06:00
Nikolay Kim
56b9f11c98 disable rustls 2019-11-27 21:07:49 +06:00
Folyd
f43a706364 Set name for each generated resource 2019-11-26 19:25:28 +06:00
Nikolay Kim
f2b3dc5625 update examples 2019-11-26 17:16:33 +06:00
Nikolay Kim
f73f97353b refactor ResponseError trait 2019-11-26 16:07:39 +06:00
Nikolay Kim
4dc31aac93 use actix_rt::test for test setup 2019-11-26 11:25:50 +06:00
Nikolay Kim
c1c44a7dd6 upgrade derive_more 2019-11-25 17:59:14 +06:00
Jim Blandy
c5907747ad Remove implementation of Responder for (). Fixes #1108.
Rationale:

- In Rust, one can omit a semicolon after a function's final expression to make
  its value the function's return value. It's common for people to include a
  semicolon after the last expression by mistake - common enough that the Rust
  compiler suggests removing the semicolon when there's a type mismatch between
  the function's signature and body. By implementing Responder for (), Actix makes
  this common mistake a silent error in handler functions.

- Functions returning an empty body should return HTTP status 204 ("No Content"),
  so the current Responder impl for (), which returns status 200 ("OK"), is not
  really what one wants anyway.

- It's not much of a burden to ask handlers to explicitly return
  `HttpResponse::Ok()` if that is what they want; all the examples in the
  documentation do this already.
2019-11-23 21:10:02 +06:00
Martell Malone
525c22de15 fix typos from updating to futures 0.3 2019-11-22 13:25:55 +06:00
Nikolay Kim
57981ca04a update tests to async handlers 2019-11-22 11:49:35 +06:00
Nikolay Kim
e668acc596 update travis config 2019-11-22 10:13:32 +06:00
Nikolay Kim
512dd2be63 disable rustls support 2019-11-22 07:01:05 +06:00
Nikolay Kim
8683ba8bb0 rename .to_async() to .to() 2019-11-21 21:36:35 +06:00
Nikolay Kim
0b9e3d381b add test with custom connector 2019-11-21 17:36:18 +06:00
Nikolay Kim
1f0577f8d5 cleanup api doc examples 2019-11-21 16:02:17 +06:00
Nikolay Kim
53c5151692 use response instead of result for asyn c handlers 2019-11-21 16:02:17 +06:00
Nikolay Kim
55698f2524 migrade rest of middlewares 2019-11-21 16:02:17 +06:00
Nikolay Kim
471f82f0e0 migrate actix-multipart 2019-11-21 16:02:17 +06:00
Nikolay Kim
60ada97b3d migrate actix-session 2019-11-21 16:02:17 +06:00
Nikolay Kim
0de101bc4d update actix-web-codegen tests 2019-11-21 16:02:17 +06:00
Nikolay Kim
95e2a0ef2e migrate actix-framed 2019-11-21 16:02:17 +06:00
Nikolay Kim
69cadcdedb migrate actix-files 2019-11-21 16:02:17 +06:00
Nikolay Kim
6ac4ac66b9 migrate actix-cors 2019-11-21 16:02:17 +06:00
Nikolay Kim
3646725cf6 migrate actix-identity 2019-11-21 16:02:17 +06:00
Nikolay Kim
ff62facc0d disable unmigrated crates 2019-11-21 16:02:17 +06:00
Nikolay Kim
b510527a9f update awc tests 2019-11-21 16:02:17 +06:00
Nikolay Kim
3127dd4db6 migrate actix-web to std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
d081e57316 fix h2 client send body 2019-11-21 16:02:17 +06:00
Nikolay Kim
1ffa7d18d3 drop unpin constraint 2019-11-21 16:02:17 +06:00
Nikolay Kim
687884fb94 update test-server tests 2019-11-21 16:02:17 +06:00
Nikolay Kim
5ab29b2e62 migrate awc and test-server to std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
a6a2d2f444 update ssl impls 2019-11-21 16:02:17 +06:00
Nikolay Kim
9e95efcc16 migrate client to std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
8cba1170e6 make actix-http compile with std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
5cb2d500d1 update actix-web-actors 2019-11-14 08:58:24 +06:00
Nikolay Kim
0212c618c6 prepare actix-web release 2019-11-14 08:55:37 +06:00
Feiko Nanninga
88110ed268 Add security note to ConnectionInfo::remote() (#1158) 2019-11-14 08:32:47 +06:00
Nikolay Kim
fba02fdd8c prep awc release 2019-11-06 11:33:25 -08:00
Nikolay Kim
b2934ad8d2 prep actix-file release 2019-11-06 11:25:26 -08:00
Nikolay Kim
f7f410d033 fix test order dep 2019-11-06 11:20:47 -08:00
Nikolay Kim
885ff7396e prepare actox-http release 2019-11-06 10:35:13 -08:00
Erlend Langseth
61b38e8d0d Increase timeouts in test-server (#1153) 2019-11-06 06:09:22 -08:00
Hung-I Wang
edcde67076 Fix escaping/encoding problems in Content-Disposition header (#1151)
* Fix filename encoding in Content-Disposition of acitx_files::NamedFile

* Add more comments on how to use Content-Disposition header properly & Fix some trivial problems

* Improve Content-Disposition filename(*) parameters of actix_files::NamedFile

* Tweak Content-Disposition parse to accept empty param value in quoted-string

* Fix typos in comments in .../content_disposition.rs (pointed out by @JohnTitor)

* Update CHANGES.md

* Update CHANGES.md again
2019-11-06 06:08:37 -08:00
Jonathas Conceição
f0612f7570 awc: Add support for setting query from Serialize type for client request (#1130)
Signed-off-by: Jonathas-Conceicao <jadoliveira@inf.ufpel.edu.br>
2019-10-26 08:27:14 +03:00
Anton Lazarev
ace98e3a1e support Host guards when Host header is unset (#1129) 2019-10-15 05:05:54 +06:00
Nikolay Kim
1ca9d87f0a prep actix-web-codegen release 2019-10-14 21:35:53 +06:00
DanSnow
967f965405 Update syn & quote to 1.0 (#1133)
* chore(actix-web-codegen): Upgrade syn and quote to 1.0

* feat(actix-web-codegen): Generate better error message

* doc(actix-web-codegen): Update CHANGES.md

* fix: Build with stable rust
2019-10-14 21:34:17 +06:00
Nikolay Kim
062e51e8ce prep actix-file release 2019-10-14 21:26:26 +06:00
Roberto Huertas
a48e616def feat(files): add possibility to redirect to slash-ended path (#1134)
When accessing to a folder without a final slash, the index file will be loaded ok, but if it has
references (like a css or an image in an html file) these resources won't be loaded correctly if
they are using relative paths. In order to solve this, this PR adds the possibility to detect
folders without a final slash and make a 302 redirect to mitigate this issue. The behavior is off by
default. We're adding a new method called `redirect_to_slash_directory` which can be used to enable
this behavior.
2019-10-14 21:23:15 +06:00
MaySantucci
effa96f5e4 Removed httpcode 'MovedPermanenty'. (#1128) 2019-10-12 06:45:12 +06:00
Nathan
cc0b4be5b7 Fix typo in response.rs body() comment (#1126)
Fixes https://github.com/actix/actix-web/issues/1125
2019-10-09 19:11:55 +06:00
Nikolay Kim
a464ffc23d prepare actix-files release 2019-10-08 10:13:16 +06:00
Naim A
4de2e8a898 [actix-files] Allow user defined guards for NamedFile (actix#1113) (#1115)
* [actix-files] remove request method checks from NamedFile

* [actix-files] added custom guard checks to FilesService

* [actix-files] modify method check tests (NamedFile -> Files)

* [actix-files] add test for custom guards in Files

* [actix-files] update changelog
2019-10-08 10:09:40 +06:00
Priit Laes
0f09415469 Convert documentation examples to Rust 2018 edition (#1120)
* Convert types::query examples to rust-2018 edition

* Convert types::json examples to rust-2018 edition

* Convert types::path examples to rust-2018 edition

* Convert types::form examples to rust-2018 edition

* Convert rest of the examples to rust-2018 edition.
2019-10-07 11:29:11 +06:00
SuperHacker-liuan
f089cf185b Let ResponseError render w/ 'text/plain; charset=utf-8' header (#1118) (#1119)
* Let ResponseError render w/ 'text/plain; charset=utf-8' header (#1118)

Trait ResponseError originally render Error messages with header
`text/plain` , which causes browsers (i.e. Firefox 70.0) with
Non-English locale unable to render UTF-8 responses with non-English
characters correctly. i.e. emoji.

This fix solved this problem by specifying the charset of `text/plain`
as utf-8, which is the default charset in rust.

Before actix-web consider to support other charsets, this hotfix is
 enough.

Test case:

fn test() -> Result<String, actix_web::Error> {
    Err(actix_web::error::ErrorForbidden("😋test"))
}

* Update actix-http/CHANGES.md for #1118
2019-10-07 10:56:24 +06:00
Koen Hoeijmakers
15d3c1ae81 Update docs of guard.rs (#1116)
* Update guard.rs
2019-10-07 12:05:17 +09:00
Zac Pullar-Strecker
fba31d4e0a Expose ContentDisposition in actix-multipart to fix broken doc link (#1114)
* Expose ContentDisposition in actix-multipart to fix broken doc link

* Revert "Expose ContentDisposition in actix-multipart to fix broken doc link"

This reverts commit e90d71d16c.

* Unhide actix-http::header::common docs

These types are used in other exported documented interfaces and create
broken links if not documented.
See `actix_multipart::Field.content_disposition`
2019-10-02 09:48:25 +06:00
Igor Aleksanov
f81ae37677 Add From<Payload> for crate::dev::Payload (#1110)
* Add From<Payload> for crate::dev::Payload

* Make dev::Payload field of Payload public and add into_inner method

* Add changelog entry
2019-10-01 14:05:38 +06:00
Nikolay Kim
5169d306ae update ConnectionInfo.remote() doc string 2019-09-27 07:03:12 +06:00
Nikolay Kim
4f3e97fff8 prepare actix-web release 2019-09-25 15:39:09 +06:00
Sven-Hendrik Haase
3ff01a9fc4 Add changelog entry for #1101 (#1102) 2019-09-25 15:35:28 +06:00
Nikolay Kim
3d4e45a0e5 prepare release 2019-09-25 15:30:20 +06:00
karlri
c659c33919 Feature uds: Add listen_uds to ServerBuilder (#1085)
Allows using an existing Unix Listener instead of binding to a path.
Useful for when running as a daemon under systemd.

Change-Id: I54a0e78c321d8b7a9ded381083217af590e9a7fa
2019-09-25 15:16:51 +06:00
Sven-Hendrik Haase
959f7754b2 Merge pull request #1101 from actix/add-awc-get-head-methods
Add remaining getter methods from private head field
2019-09-25 10:23:23 +02:00
Sven-Hendrik Haase
23f04c4f38 Add remaining getter methods from private head field 2019-09-25 08:50:45 +02:00
Nikolay Kim
d9af8f66ba Use actix-testing for testing utils 2019-09-25 10:28:41 +06:00
Sarfaraz Nawaz
aa39b8ca6f Add support for serde_json::Value to be passed as argument to ResponseBuilder.body() (#1096)
* Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()

* Update actix-http/CHANGES.md
2019-09-25 09:33:52 +06:00
Jim Blandy
58c7065f08 Implement register_data method on Resource and Scope. (#1094)
* Implement `register_data` method on `Resource` and `Scope`.

* Split Scope::register_data tests out from Scope::data tests.

* CHANGES.md: Mention {Scope,Resource}::register_data.
2019-09-18 06:36:39 +06:00
Nikolay Kim
b3783b403e Merge branch 'master' of github.com:actix/actix-web 2019-09-17 21:46:45 +06:00
Nikolay Kim
e4503046de Do not override current System 2019-09-17 21:45:06 +06:00
Jos van den Oever
32a1c36597 Make UrlencodedError::Overflow more informative (#1089) 2019-09-17 06:58:04 +06:00
nWacky
7c9f9afc46 Add ability to use Infallible as HttpResponse error type (#1093)
* Add `std::convert::Infallible` implementantion for `ResponseError`

* Add from `std::convert::Infallible` to `Error`

* Remove `ResponseError` implementantion for `Infallible`

* Remove useless docs

* Better comment

* Update changelog

* Update actix_http::changelog
2019-09-17 06:57:38 +06:00
Yuki Okushi
c1f99e0775 Remove mem::uninitialized() (#1090) 2019-09-16 07:52:23 +09:00
Nikolay Kim
a32573bb58 Allow to re-construct ServiceRequest from HttpRequest and Payload #1088 2019-09-13 11:56:24 +06:00
160 changed files with 9463 additions and 8473 deletions

View File

@@ -10,9 +10,9 @@ matrix:
include: include:
- rust: stable - rust: stable
- rust: beta - rust: beta
- rust: nightly-2019-08-10 - rust: nightly-2019-11-20
allow_failures: allow_failures:
- rust: nightly-2019-08-10 - rust: nightly-2019-11-20
env: env:
global: global:
@@ -25,7 +25,7 @@ before_install:
- sudo apt-get install -y openssl libssl-dev libelf-dev libdw-dev cmake gcc binutils-dev libiberty-dev - sudo apt-get install -y openssl libssl-dev libelf-dev libdw-dev cmake gcc binutils-dev libiberty-dev
before_cache: | before_cache: |
if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-08-10" ]]; then if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-11-20" ]]; then
RUSTFLAGS="--cfg procmacro2_semver_exempt" cargo install --version 0.6.11 cargo-tarpaulin RUSTFLAGS="--cfg procmacro2_semver_exempt" cargo install --version 0.6.11 cargo-tarpaulin
fi fi
@@ -36,9 +36,12 @@ before_script:
script: script:
- cargo update - cargo update
- cargo check --all --no-default-features - cargo check --all --no-default-features
- cargo test --all-features --all -- --nocapture - |
- cd actix-http; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd .. if [[ "$TRAVIS_RUST_VERSION" == "stable" || "$TRAVIS_RUST_VERSION" == "beta" ]]; then
- cd awc; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd .. cargo test --all-features --all -- --nocapture
cd actix-http; cargo test --no-default-features --features="rustls" -- --nocapture; cd ..
cd awc; cargo test --no-default-features --features="rustls" -- --nocapture; cd ..
fi
# Upload docs # Upload docs
after_success: after_success:
@@ -51,7 +54,7 @@ after_success:
echo "Uploaded documentation" echo "Uploaded documentation"
fi fi
- | - |
if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-08-10" ]]; then if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-11-20" ]]; then
taskset -c 0 cargo tarpaulin --out Xml --all --all-features taskset -c 0 cargo tarpaulin --out Xml --all --all-features
bash <(curl -s https://codecov.io/bash) bash <(curl -s https://codecov.io/bash)
echo "Uploaded code coverage" echo "Uploaded code coverage"

View File

@@ -1,13 +1,52 @@
# Changes # Changes
## not released yet
## [2.0.0-alpha.3] - 2019-12-07
### Changed
* Migrate to tokio 0.2
## [2.0.0-alpha.1] - 2019-11-22
### Changed
* Migrated to `std::future`
* Remove implementation of `Responder` for `()`. (#1167)
## [1.0.9] - 2019-11-14
### Added ### Added
* Add `middleware::Conditon` that conditionally enables another middleware * Add `Payload::into_inner` method and make stored `def::Payload` public. (#1110)
### Fixed ### Changed
* Support `Host` guards when the `Host` header is unset (e.g. HTTP/2 requests) (#1129)
## [1.0.8] - 2019-09-25
### Added
* Add `Scope::register_data` and `Resource::register_data` methods, parallel to
`App::register_data`.
* Add `middleware::Condition` that conditionally enables another middleware
* Allow to re-construct `ServiceRequest` from `HttpRequest` and `Payload`
* Add `HttpServer::listen_uds` for ability to listen on UDS FD rather than path,
which is useful for example with systemd.
### Changed
* Make UrlEncodedError::Overflow more informativve
* Use actix-testing for testing utils
* h2 will use error response #1080
## [1.0.7] - 2019-08-29 ## [1.0.7] - 2019-08-29

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-web" name = "actix-web"
version = "1.0.7" version = "2.0.0-alpha.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix web is a simple, pragmatic and extremely fast web framework for Rust." description = "Actix web is a simple, pragmatic and extremely fast web framework for Rust."
readme = "README.md" readme = "README.md"
@@ -16,7 +16,7 @@ exclude = [".gitignore", ".travis.yml", ".cargo/config", "appveyor.yml"]
edition = "2018" edition = "2018"
[package.metadata.docs.rs] [package.metadata.docs.rs]
features = ["ssl", "brotli", "flate2-zlib", "secure-cookies", "client", "rust-tls", "uds"] features = ["openssl", "brotli", "flate2-zlib", "secure-cookies", "client"]
[badges] [badges]
travis-ci = { repository = "actix/actix-web", branch = "master" } travis-ci = { repository = "actix/actix-web", branch = "master" }
@@ -63,37 +63,37 @@ secure-cookies = ["actix-http/secure-cookies"]
fail = ["actix-http/fail"] fail = ["actix-http/fail"]
# openssl # openssl
ssl = ["openssl", "actix-server/ssl", "awc/ssl"] openssl = ["open-ssl", "actix-tls/openssl", "awc/openssl"]
# rustls # rustls
rust-tls = ["rustls", "actix-server/rust-tls", "awc/rust-tls"] rustls = ["rust-tls", "actix-tls/rustls", "awc/rustls"]
# unix domain sockets support
uds = ["actix-server/uds"]
[dependencies] [dependencies]
actix-codec = "0.1.2" actix-codec = "0.2.0-alpha.3"
actix-service = "0.4.1" actix-service = "1.0.0-alpha.3"
actix-utils = "0.4.4" actix-utils = "1.0.0-alpha.3"
actix-router = "0.1.5" actix-router = "0.2.0"
actix-rt = "0.2.4" actix-rt = "1.0.0-alpha.3"
actix-web-codegen = "0.1.2" actix-server = "1.0.0-alpha.3"
actix-http = "0.2.9" actix-testing = "1.0.0-alpha.3"
actix-server = "0.6.0" actix-threadpool = "0.3.0"
actix-server-config = "0.1.2" actix-tls = { version = "1.0.0-alpha.3" }
actix-threadpool = "0.1.1"
awc = { version = "0.2.4", optional = true }
bytes = "0.4" actix-web-codegen = "0.2.0-alpha.2"
derive_more = "0.15.0" actix-http = "1.0.0-alpha.3"
awc = { version = "1.0.0-alpha.3", optional = true }
bytes = "0.5.2"
derive_more = "0.99.2"
encoding_rs = "0.8" encoding_rs = "0.8"
futures = "0.1.25" futures = "0.3.1"
hashbrown = "0.5.0" fxhash = "0.2.1"
log = "0.4" log = "0.4"
mime = "0.3" mime = "0.3"
net2 = "0.2.33" net2 = "0.2.33"
parking_lot = "0.9" parking_lot = "0.9"
regex = "1.0" pin-project = "0.4.6"
regex = "1.3"
serde = { version = "1.0", features=["derive"] } serde = { version = "1.0", features=["derive"] }
serde_json = "1.0" serde_json = "1.0"
serde_urlencoded = "0.6.1" serde_urlencoded = "0.6.1"
@@ -101,17 +101,16 @@ time = "0.1.42"
url = "2.1" url = "2.1"
# ssl support # ssl support
openssl = { version="0.10", optional = true } open-ssl = { version="0.10", package="openssl", optional = true }
rustls = { version = "0.15", optional = true } rust-tls = { version = "0.16", package="rustls", optional = true }
[dev-dependencies] [dev-dependencies]
actix = "0.8.3" # actix = "0.8.3"
actix-connect = "0.2.2" actix-connect = "1.0.0-alpha.3"
actix-http-test = "0.2.4" actix-http-test = "1.0.0-alpha.3"
rand = "0.7" rand = "0.7"
env_logger = "0.6" env_logger = "0.6"
serde_derive = "1.0" serde_derive = "1.0"
tokio-timer = "0.2.8"
brotli2 = "0.3.2" brotli2 = "0.3.2"
flate2 = "1.0.2" flate2 = "1.0.2"
@@ -125,7 +124,8 @@ actix-web = { path = "." }
actix-http = { path = "actix-http" } actix-http = { path = "actix-http" }
actix-http-test = { path = "test-server" } actix-http-test = { path = "test-server" }
actix-web-codegen = { path = "actix-web-codegen" } actix-web-codegen = { path = "actix-web-codegen" }
actix-web-actors = { path = "actix-web-actors" } actix-cors = { path = "actix-cors" }
actix-identity = { path = "actix-identity" }
actix-session = { path = "actix-session" } actix-session = { path = "actix-session" }
actix-files = { path = "actix-files" } actix-files = { path = "actix-files" }
actix-multipart = { path = "actix-multipart" } actix-multipart = { path = "actix-multipart" }

View File

@@ -1,3 +1,12 @@
## 2.0.0
* Sync handlers has been removed. `.to_async()` method has been renamed to `.to()`
replace `fn` with `async fn` to convert sync handler to async
* `TestServer::new()` renamed to `TestServer::start()`
## 1.0.1 ## 1.0.1
* Cors middleware has been moved to `actix-cors` crate * Cors middleware has been moved to `actix-cors` crate

View File

@@ -19,26 +19,26 @@ Actix web is a simple, pragmatic and extremely fast web framework for Rust.
* [User Guide](https://actix.rs/docs/) * [User Guide](https://actix.rs/docs/)
* [API Documentation (1.0)](https://docs.rs/actix-web/) * [API Documentation (1.0)](https://docs.rs/actix-web/)
* [API Documentation (0.7)](https://docs.rs/actix-web/0.7.19/actix_web/)
* [Chat on gitter](https://gitter.im/actix/actix) * [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-web](https://crates.io/crates/actix-web) * Cargo package: [actix-web](https://crates.io/crates/actix-web)
* Minimum supported Rust version: 1.36 or later * Minimum supported Rust version: 1.39 or later
## Example ## Example
```rust ```rust
use actix_web::{web, App, HttpServer, Responder}; use actix_web::{get, App, HttpServer, Responder};
fn index(info: web::Path<(u32, String)>) -> impl Responder { #[get("/{id}/{name}/index.html")]
async fn index(info: web::Path<(u32, String)>) -> impl Responder {
format!("Hello {}! id:{}", info.1, info.0) format!("Hello {}! id:{}", info.1, info.0)
} }
fn main() -> std::io::Result<()> { #[actix_rt::main]
HttpServer::new( async fn main() -> std::io::Result<()> {
|| App::new().service( HttpServer::new(|| App::new().service(index))
web::resource("/{id}/{name}/index.html").to(index)))
.bind("127.0.0.1:8080")? .bind("127.0.0.1:8080")?
.run() .start()
.await
} }
``` ```

View File

@@ -1,8 +1,10 @@
# Changes # Changes
## [0.1.1] - unreleased ## [0.2.0-alpha.3] - 2019-12-07
* Bump `derive_more` crate version to 0.15.0 * Migrate to actix-web 2.0.0
* Bump `derive_more` crate version to 0.99.0
## [0.1.0] - 2019-06-15 ## [0.1.0] - 2019-06-15

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-cors" name = "actix-cors"
version = "0.1.0" version = "0.2.0-alpha.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Cross-origin resource sharing (CORS) for Actix applications." description = "Cross-origin resource sharing (CORS) for Actix applications."
readme = "README.md" readme = "README.md"
@@ -10,14 +10,17 @@ repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-cors/" documentation = "https://docs.rs/actix-cors/"
license = "MIT/Apache-2.0" license = "MIT/Apache-2.0"
edition = "2018" edition = "2018"
#workspace = ".." workspace = ".."
[lib] [lib]
name = "actix_cors" name = "actix_cors"
path = "src/lib.rs" path = "src/lib.rs"
[dependencies] [dependencies]
actix-web = "1.0.0" actix-web = "2.0.0-alpha.3"
actix-service = "0.4.0" actix-service = "1.0.0-alpha.3"
derive_more = "0.15.0" derive_more = "0.99.2"
futures = "0.1.25" futures = "0.3.1"
[dev-dependencies]
actix-rt = "1.0.0-alpha.3"

View File

@@ -11,7 +11,7 @@
//! use actix_cors::Cors; //! use actix_cors::Cors;
//! use actix_web::{http, web, App, HttpRequest, HttpResponse, HttpServer}; //! use actix_web::{http, web, App, HttpRequest, HttpResponse, HttpServer};
//! //!
//! fn index(req: HttpRequest) -> &'static str { //! async fn index(req: HttpRequest) -> &'static str {
//! "Hello world" //! "Hello world"
//! } //! }
//! //!
@@ -23,7 +23,8 @@
//! .allowed_methods(vec!["GET", "POST"]) //! .allowed_methods(vec!["GET", "POST"])
//! .allowed_headers(vec![http::header::AUTHORIZATION, http::header::ACCEPT]) //! .allowed_headers(vec![http::header::AUTHORIZATION, http::header::ACCEPT])
//! .allowed_header(http::header::CONTENT_TYPE) //! .allowed_header(http::header::CONTENT_TYPE)
//! .max_age(3600)) //! .max_age(3600)
//! .finish())
//! .service( //! .service(
//! web::resource("/index.html") //! web::resource("/index.html")
//! .route(web::get().to(index)) //! .route(web::get().to(index))
@@ -39,18 +40,19 @@
//! //!
//! Cors middleware automatically handle *OPTIONS* preflight request. //! Cors middleware automatically handle *OPTIONS* preflight request.
use std::collections::HashSet; use std::collections::HashSet;
use std::convert::TryFrom;
use std::iter::FromIterator; use std::iter::FromIterator;
use std::rc::Rc; use std::rc::Rc;
use std::task::{Context, Poll};
use actix_service::{IntoTransform, Service, Transform}; use actix_service::{Service, Transform};
use actix_web::dev::{RequestHead, ServiceRequest, ServiceResponse}; use actix_web::dev::{RequestHead, ServiceRequest, ServiceResponse};
use actix_web::error::{Error, ResponseError, Result}; use actix_web::error::{Error, ResponseError, Result};
use actix_web::http::header::{self, HeaderName, HeaderValue}; use actix_web::http::header::{self, HeaderName, HeaderValue};
use actix_web::http::{self, HttpTryFrom, Method, StatusCode, Uri}; use actix_web::http::{self, Error as HttpError, Method, StatusCode, Uri};
use actix_web::HttpResponse; use actix_web::HttpResponse;
use derive_more::Display; use derive_more::Display;
use futures::future::{ok, Either, Future, FutureResult}; use futures::future::{ok, Either, FutureExt, LocalBoxFuture, Ready};
use futures::Poll;
/// A set of errors that can occur during processing CORS /// A set of errors that can occur during processing CORS
#[derive(Debug, Display)] #[derive(Debug, Display)]
@@ -92,6 +94,10 @@ pub enum CorsError {
} }
impl ResponseError for CorsError { impl ResponseError for CorsError {
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
fn error_response(&self) -> HttpResponse { fn error_response(&self) -> HttpResponse {
HttpResponse::with_body(StatusCode::BAD_REQUEST, format!("{}", self).into()) HttpResponse::with_body(StatusCode::BAD_REQUEST, format!("{}", self).into())
} }
@@ -269,7 +275,8 @@ impl Cors {
pub fn allowed_methods<U, M>(mut self, methods: U) -> Cors pub fn allowed_methods<U, M>(mut self, methods: U) -> Cors
where where
U: IntoIterator<Item = M>, U: IntoIterator<Item = M>,
Method: HttpTryFrom<M>, Method: TryFrom<M>,
<Method as TryFrom<M>>::Error: Into<HttpError>,
{ {
self.methods = true; self.methods = true;
if let Some(cors) = cors(&mut self.cors, &self.error) { if let Some(cors) = cors(&mut self.cors, &self.error) {
@@ -291,7 +298,8 @@ impl Cors {
/// Set an allowed header /// Set an allowed header
pub fn allowed_header<H>(mut self, header: H) -> Cors pub fn allowed_header<H>(mut self, header: H) -> Cors
where where
HeaderName: HttpTryFrom<H>, HeaderName: TryFrom<H>,
<HeaderName as TryFrom<H>>::Error: Into<HttpError>,
{ {
if let Some(cors) = cors(&mut self.cors, &self.error) { if let Some(cors) = cors(&mut self.cors, &self.error) {
match HeaderName::try_from(header) { match HeaderName::try_from(header) {
@@ -323,7 +331,8 @@ impl Cors {
pub fn allowed_headers<U, H>(mut self, headers: U) -> Cors pub fn allowed_headers<U, H>(mut self, headers: U) -> Cors
where where
U: IntoIterator<Item = H>, U: IntoIterator<Item = H>,
HeaderName: HttpTryFrom<H>, HeaderName: TryFrom<H>,
<HeaderName as TryFrom<H>>::Error: Into<HttpError>,
{ {
if let Some(cors) = cors(&mut self.cors, &self.error) { if let Some(cors) = cors(&mut self.cors, &self.error) {
for h in headers { for h in headers {
@@ -357,7 +366,8 @@ impl Cors {
pub fn expose_headers<U, H>(mut self, headers: U) -> Cors pub fn expose_headers<U, H>(mut self, headers: U) -> Cors
where where
U: IntoIterator<Item = H>, U: IntoIterator<Item = H>,
HeaderName: HttpTryFrom<H>, HeaderName: TryFrom<H>,
<HeaderName as TryFrom<H>>::Error: Into<HttpError>,
{ {
for h in headers { for h in headers {
match HeaderName::try_from(h) { match HeaderName::try_from(h) {
@@ -456,25 +466,9 @@ impl Cors {
} }
self self
} }
}
fn cors<'a>( /// Construct cors middleware
parts: &'a mut Option<Inner>, pub fn finish(self) -> CorsFactory {
err: &Option<http::Error>,
) -> Option<&'a mut Inner> {
if err.is_some() {
return None;
}
parts.as_mut()
}
impl<S, B> IntoTransform<CorsFactory, S> for Cors
where
S: Service<Request = ServiceRequest, Response = ServiceResponse<B>, Error = Error>,
S::Future: 'static,
B: 'static,
{
fn into_transform(self) -> CorsFactory {
let mut slf = if !self.methods { let mut slf = if !self.methods {
self.allowed_methods(vec![ self.allowed_methods(vec![
Method::GET, Method::GET,
@@ -521,6 +515,16 @@ where
} }
} }
fn cors<'a>(
parts: &'a mut Option<Inner>,
err: &Option<http::Error>,
) -> Option<&'a mut Inner> {
if err.is_some() {
return None;
}
parts.as_mut()
}
/// `Middleware` for Cross-origin resource sharing support /// `Middleware` for Cross-origin resource sharing support
/// ///
/// The Cors struct contains the settings for CORS requests to be validated and /// The Cors struct contains the settings for CORS requests to be validated and
@@ -540,7 +544,7 @@ where
type Error = Error; type Error = Error;
type InitError = (); type InitError = ();
type Transform = CorsMiddleware<S>; type Transform = CorsMiddleware<S>;
type Future = FutureResult<Self::Transform, Self::InitError>; type Future = Ready<Result<Self::Transform, Self::InitError>>;
fn new_transform(&self, service: S) -> Self::Future { fn new_transform(&self, service: S) -> Self::Future {
ok(CorsMiddleware { ok(CorsMiddleware {
@@ -682,12 +686,12 @@ where
type Response = ServiceResponse<B>; type Response = ServiceResponse<B>;
type Error = Error; type Error = Error;
type Future = Either< type Future = Either<
FutureResult<Self::Response, Error>, Ready<Result<Self::Response, Error>>,
Either<S::Future, Box<dyn Future<Item = Self::Response, Error = Error>>>, LocalBoxFuture<'static, Result<Self::Response, Error>>,
>; >;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.service.poll_ready() self.service.poll_ready(cx)
} }
fn call(&mut self, req: ServiceRequest) -> Self::Future { fn call(&mut self, req: ServiceRequest) -> Self::Future {
@@ -698,7 +702,7 @@ where
.and_then(|_| self.inner.validate_allowed_method(req.head())) .and_then(|_| self.inner.validate_allowed_method(req.head()))
.and_then(|_| self.inner.validate_allowed_headers(req.head())) .and_then(|_| self.inner.validate_allowed_headers(req.head()))
{ {
return Either::A(ok(req.error_response(e))); return Either::Left(ok(req.error_response(e)));
} }
// allowed headers // allowed headers
@@ -751,22 +755,32 @@ where
.finish() .finish()
.into_body(); .into_body();
Either::A(ok(req.into_response(res))) Either::Left(ok(req.into_response(res)))
} else if req.headers().contains_key(&header::ORIGIN) { } else {
if req.headers().contains_key(&header::ORIGIN) {
// Only check requests with a origin header. // Only check requests with a origin header.
if let Err(e) = self.inner.validate_origin(req.head()) { if let Err(e) = self.inner.validate_origin(req.head()) {
return Either::A(ok(req.error_response(e))); return Either::Left(ok(req.error_response(e)));
}
} }
let inner = self.inner.clone(); let inner = self.inner.clone();
let has_origin = req.headers().contains_key(&header::ORIGIN);
let fut = self.service.call(req);
Either::B(Either::B(Box::new(self.service.call(req).and_then( Either::Right(
move |mut res| { async move {
let res = fut.await;
if has_origin {
let mut res = res?;
if let Some(origin) = if let Some(origin) =
inner.access_control_allow_origin(res.request().head()) inner.access_control_allow_origin(res.request().head())
{ {
res.headers_mut() res.headers_mut().insert(
.insert(header::ACCESS_CONTROL_ALLOW_ORIGIN, origin.clone()); header::ACCESS_CONTROL_ALLOW_ORIGIN,
origin.clone(),
);
}; };
if let Some(ref expose) = inner.expose_hdrs { if let Some(ref expose) = inner.expose_hdrs {
@@ -782,8 +796,9 @@ where
); );
} }
if inner.vary_header { if inner.vary_header {
let value = let value = if let Some(hdr) =
if let Some(hdr) = res.headers_mut().get(&header::VARY) { res.headers_mut().get(&header::VARY)
{
let mut val: Vec<u8> = let mut val: Vec<u8> =
Vec::with_capacity(hdr.as_bytes().len() + 8); Vec::with_capacity(hdr.as_bytes().len() + 8);
val.extend(hdr.as_bytes()); val.extend(hdr.as_bytes());
@@ -795,80 +810,68 @@ where
res.headers_mut().insert(header::VARY, value); res.headers_mut().insert(header::VARY, value);
} }
Ok(res) Ok(res)
},
))))
} else { } else {
Either::B(Either::A(self.service.call(req))) res
}
}
.boxed_local(),
)
} }
} }
} }
#[cfg(test)] #[cfg(test)]
mod tests { mod tests {
use actix_service::{IntoService, Transform}; use actix_service::{service_fn2, Transform};
use actix_web::test::{self, block_on, TestRequest}; use actix_web::test::{self, TestRequest};
use super::*; use super::*;
impl Cors { #[actix_rt::test]
fn finish<F, S, B>(self, srv: F) -> CorsMiddleware<S>
where
F: IntoService<S>,
S: Service<
Request = ServiceRequest,
Response = ServiceResponse<B>,
Error = Error,
> + 'static,
S::Future: 'static,
B: 'static,
{
block_on(
IntoTransform::<CorsFactory, S>::into_transform(self)
.new_transform(srv.into_service()),
)
.unwrap()
}
}
#[test]
#[should_panic(expected = "Credentials are allowed, but the Origin is set to")] #[should_panic(expected = "Credentials are allowed, but the Origin is set to")]
fn cors_validates_illegal_allow_credentials() { async fn cors_validates_illegal_allow_credentials() {
let _cors = Cors::new() let _cors = Cors::new().supports_credentials().send_wildcard().finish();
.supports_credentials()
.send_wildcard()
.finish(test::ok_service());
} }
#[test] #[actix_rt::test]
fn validate_origin_allows_all_origins() { async fn validate_origin_allows_all_origins() {
let mut cors = Cors::new().finish(test::ok_service()); let mut cors = Cors::new()
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com") let req = TestRequest::with_header("Origin", "https://www.example.com")
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::OK); assert_eq!(resp.status(), StatusCode::OK);
} }
#[test] #[actix_rt::test]
fn default() { async fn default() {
let mut cors = let mut cors = Cors::default()
block_on(Cors::default().new_transform(test::ok_service())).unwrap(); .new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com") let req = TestRequest::with_header("Origin", "https://www.example.com")
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::OK); assert_eq!(resp.status(), StatusCode::OK);
} }
#[test] #[actix_rt::test]
fn test_preflight() { async fn test_preflight() {
let mut cors = Cors::new() let mut cors = Cors::new()
.send_wildcard() .send_wildcard()
.max_age(3600) .max_age(3600)
.allowed_methods(vec![Method::GET, Method::OPTIONS, Method::POST]) .allowed_methods(vec![Method::GET, Method::OPTIONS, Method::POST])
.allowed_headers(vec![header::AUTHORIZATION, header::ACCEPT]) .allowed_headers(vec![header::AUTHORIZATION, header::ACCEPT])
.allowed_header(header::CONTENT_TYPE) .allowed_header(header::CONTENT_TYPE)
.finish(test::ok_service()); .finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com") let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS) .method(Method::OPTIONS)
@@ -877,7 +880,7 @@ mod tests {
assert!(cors.inner.validate_allowed_method(req.head()).is_err()); assert!(cors.inner.validate_allowed_method(req.head()).is_err());
assert!(cors.inner.validate_allowed_headers(req.head()).is_err()); assert!(cors.inner.validate_allowed_headers(req.head()).is_err());
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::BAD_REQUEST); assert_eq!(resp.status(), StatusCode::BAD_REQUEST);
let req = TestRequest::with_header("Origin", "https://www.example.com") let req = TestRequest::with_header("Origin", "https://www.example.com")
@@ -897,7 +900,7 @@ mod tests {
.method(Method::OPTIONS) .method(Method::OPTIONS)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!( assert_eq!(
&b"*"[..], &b"*"[..],
resp.headers() resp.headers()
@@ -943,13 +946,13 @@ mod tests {
.method(Method::OPTIONS) .method(Method::OPTIONS)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::OK); assert_eq!(resp.status(), StatusCode::OK);
} }
// #[test] // #[actix_rt::test]
// #[should_panic(expected = "MissingOrigin")] // #[should_panic(expected = "MissingOrigin")]
// fn test_validate_missing_origin() { // async fn test_validate_missing_origin() {
// let cors = Cors::build() // let cors = Cors::build()
// .allowed_origin("https://www.example.com") // .allowed_origin("https://www.example.com")
// .finish(); // .finish();
@@ -957,12 +960,15 @@ mod tests {
// cors.start(&req).unwrap(); // cors.start(&req).unwrap();
// } // }
#[test] #[actix_rt::test]
#[should_panic(expected = "OriginNotAllowed")] #[should_panic(expected = "OriginNotAllowed")]
fn test_validate_not_allowed_origin() { async fn test_validate_not_allowed_origin() {
let cors = Cors::new() let cors = Cors::new()
.allowed_origin("https://www.example.com") .allowed_origin("https://www.example.com")
.finish(test::ok_service()); .finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.unknown.com") let req = TestRequest::with_header("Origin", "https://www.unknown.com")
.method(Method::GET) .method(Method::GET)
@@ -972,26 +978,34 @@ mod tests {
cors.inner.validate_allowed_headers(req.head()).unwrap(); cors.inner.validate_allowed_headers(req.head()).unwrap();
} }
#[test] #[actix_rt::test]
fn test_validate_origin() { async fn test_validate_origin() {
let mut cors = Cors::new() let mut cors = Cors::new()
.allowed_origin("https://www.example.com") .allowed_origin("https://www.example.com")
.finish(test::ok_service()); .finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com") let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::GET) .method(Method::GET)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::OK); assert_eq!(resp.status(), StatusCode::OK);
} }
#[test] #[actix_rt::test]
fn test_no_origin_response() { async fn test_no_origin_response() {
let mut cors = Cors::new().disable_preflight().finish(test::ok_service()); let mut cors = Cors::new()
.disable_preflight()
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::default().method(Method::GET).to_srv_request(); let req = TestRequest::default().method(Method::GET).to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert!(resp assert!(resp
.headers() .headers()
.get(header::ACCESS_CONTROL_ALLOW_ORIGIN) .get(header::ACCESS_CONTROL_ALLOW_ORIGIN)
@@ -1000,7 +1014,7 @@ mod tests {
let req = TestRequest::with_header("Origin", "https://www.example.com") let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS) .method(Method::OPTIONS)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!( assert_eq!(
&b"https://www.example.com"[..], &b"https://www.example.com"[..],
resp.headers() resp.headers()
@@ -1010,8 +1024,8 @@ mod tests {
); );
} }
#[test] #[actix_rt::test]
fn test_response() { async fn test_response() {
let exposed_headers = vec![header::AUTHORIZATION, header::ACCEPT]; let exposed_headers = vec![header::AUTHORIZATION, header::ACCEPT];
let mut cors = Cors::new() let mut cors = Cors::new()
.send_wildcard() .send_wildcard()
@@ -1021,13 +1035,16 @@ mod tests {
.allowed_headers(exposed_headers.clone()) .allowed_headers(exposed_headers.clone())
.expose_headers(exposed_headers.clone()) .expose_headers(exposed_headers.clone())
.allowed_header(header::CONTENT_TYPE) .allowed_header(header::CONTENT_TYPE)
.finish(test::ok_service()); .finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com") let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS) .method(Method::OPTIONS)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!( assert_eq!(
&b"*"[..], &b"*"[..],
resp.headers() resp.headers()
@@ -1065,15 +1082,18 @@ mod tests {
.allowed_headers(exposed_headers.clone()) .allowed_headers(exposed_headers.clone())
.expose_headers(exposed_headers.clone()) .expose_headers(exposed_headers.clone())
.allowed_header(header::CONTENT_TYPE) .allowed_header(header::CONTENT_TYPE)
.finish(|req: ServiceRequest| { .finish()
req.into_response( .new_transform(service_fn2(|req: ServiceRequest| {
ok(req.into_response(
HttpResponse::Ok().header(header::VARY, "Accept").finish(), HttpResponse::Ok().header(header::VARY, "Accept").finish(),
) ))
}); }))
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com") let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS) .method(Method::OPTIONS)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!( assert_eq!(
&b"Accept, Origin"[..], &b"Accept, Origin"[..],
resp.headers().get(header::VARY).unwrap().as_bytes() resp.headers().get(header::VARY).unwrap().as_bytes()
@@ -1083,13 +1103,16 @@ mod tests {
.disable_vary_header() .disable_vary_header()
.allowed_origin("https://www.example.com") .allowed_origin("https://www.example.com")
.allowed_origin("https://www.google.com") .allowed_origin("https://www.google.com")
.finish(test::ok_service()); .finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com") let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS) .method(Method::OPTIONS)
.header(header::ACCESS_CONTROL_REQUEST_METHOD, "POST") .header(header::ACCESS_CONTROL_REQUEST_METHOD, "POST")
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
let origins_str = resp let origins_str = resp
.headers() .headers()
@@ -1101,19 +1124,22 @@ mod tests {
assert_eq!("https://www.example.com", origins_str); assert_eq!("https://www.example.com", origins_str);
} }
#[test] #[actix_rt::test]
fn test_multiple_origins() { async fn test_multiple_origins() {
let mut cors = Cors::new() let mut cors = Cors::new()
.allowed_origin("https://example.com") .allowed_origin("https://example.com")
.allowed_origin("https://example.org") .allowed_origin("https://example.org")
.allowed_methods(vec![Method::GET]) .allowed_methods(vec![Method::GET])
.finish(test::ok_service()); .finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://example.com") let req = TestRequest::with_header("Origin", "https://example.com")
.method(Method::GET) .method(Method::GET)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!( assert_eq!(
&b"https://example.com"[..], &b"https://example.com"[..],
resp.headers() resp.headers()
@@ -1126,7 +1152,7 @@ mod tests {
.method(Method::GET) .method(Method::GET)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!( assert_eq!(
&b"https://example.org"[..], &b"https://example.org"[..],
resp.headers() resp.headers()
@@ -1136,20 +1162,23 @@ mod tests {
); );
} }
#[test] #[actix_rt::test]
fn test_multiple_origins_preflight() { async fn test_multiple_origins_preflight() {
let mut cors = Cors::new() let mut cors = Cors::new()
.allowed_origin("https://example.com") .allowed_origin("https://example.com")
.allowed_origin("https://example.org") .allowed_origin("https://example.org")
.allowed_methods(vec![Method::GET]) .allowed_methods(vec![Method::GET])
.finish(test::ok_service()); .finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://example.com") let req = TestRequest::with_header("Origin", "https://example.com")
.header(header::ACCESS_CONTROL_REQUEST_METHOD, "GET") .header(header::ACCESS_CONTROL_REQUEST_METHOD, "GET")
.method(Method::OPTIONS) .method(Method::OPTIONS)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!( assert_eq!(
&b"https://example.com"[..], &b"https://example.com"[..],
resp.headers() resp.headers()
@@ -1163,7 +1192,7 @@ mod tests {
.method(Method::OPTIONS) .method(Method::OPTIONS)
.to_srv_request(); .to_srv_request();
let resp = test::call_service(&mut cors, req); let resp = test::call_service(&mut cors, req).await;
assert_eq!( assert_eq!(
&b"https://example.org"[..], &b"https://example.org"[..],
resp.headers() resp.headers()

View File

@@ -1,21 +1,33 @@
# Changes # Changes
## [0.1.5] - unreleased ## [0.2.0-alpha.7] - 2019-12-07
* Migrate to `std::future`
## [0.1.7] - 2019-11-06
* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
## [0.1.6] - 2019-10-14
* Add option to redirect to a slash-ended path `Files` #1132
## [0.1.5] - 2019-10-08
* Bump up `mime_guess` crate version to 2.0.1 * Bump up `mime_guess` crate version to 2.0.1
* Bump up `percent-encoding` crate version to 2.1 * Bump up `percent-encoding` crate version to 2.1
* Allow user defined request guards for `Files` #1113
## [0.1.4] - 2019-07-20 ## [0.1.4] - 2019-07-20
* Allow to disable `Content-Disposition` header #686 * Allow to disable `Content-Disposition` header #686
## [0.1.3] - 2019-06-28 ## [0.1.3] - 2019-06-28
* Do not set `Content-Length` header, let actix-http set it #930 * Do not set `Content-Length` header, let actix-http set it #930
## [0.1.2] - 2019-06-13 ## [0.1.2] - 2019-06-13
* Content-Length is 0 for NamedFile HEAD request #914 * Content-Length is 0 for NamedFile HEAD request #914

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-files" name = "actix-files"
version = "0.1.4" version = "0.2.0-alpha.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Static files support for actix web." description = "Static files support for actix web."
readme = "README.md" readme = "README.md"
@@ -18,13 +18,13 @@ name = "actix_files"
path = "src/lib.rs" path = "src/lib.rs"
[dependencies] [dependencies]
actix-web = { version = "1.0.2", default-features = false } actix-web = { version = "2.0.0-alpha.3", default-features = false }
actix-http = "0.2.9" actix-http = "1.0.0-alpha.3"
actix-service = "0.4.1" actix-service = "1.0.0-alpha.3"
bitflags = "1" bitflags = "1"
bytes = "0.4" bytes = "0.5.2"
futures = "0.1.25" futures = "0.3.1"
derive_more = "0.15.0" derive_more = "0.99.2"
log = "0.4" log = "0.4"
mime = "0.3" mime = "0.3"
mime_guess = "2.0.1" mime_guess = "2.0.1"
@@ -32,4 +32,5 @@ percent-encoding = "2.1"
v_htmlescape = "0.4" v_htmlescape = "0.4"
[dev-dependencies] [dev-dependencies]
actix-web = { version = "1.0.2", features=["ssl"] } actix-rt = "1.0.0-alpha.3"
actix-web = { version = "2.0.0-alpha.3", features=["openssl"] }

View File

@@ -35,7 +35,7 @@ pub enum UriSegmentError {
/// Return `BadRequest` for `UriSegmentError` /// Return `BadRequest` for `UriSegmentError`
impl ResponseError for UriSegmentError { impl ResponseError for UriSegmentError {
fn error_response(&self) -> HttpResponse { fn status_code(&self) -> StatusCode {
HttpResponse::new(StatusCode::BAD_REQUEST) StatusCode::BAD_REQUEST
} }
} }

File diff suppressed because it is too large Load Diff

View File

@@ -13,11 +13,12 @@ use mime_guess::from_path;
use actix_http::body::SizedStream; use actix_http::body::SizedStream;
use actix_web::http::header::{ use actix_web::http::header::{
self, ContentDisposition, DispositionParam, DispositionType, self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
}; };
use actix_web::http::{ContentEncoding, Method, StatusCode}; use actix_web::http::{ContentEncoding, StatusCode};
use actix_web::middleware::BodyEncoding; use actix_web::middleware::BodyEncoding;
use actix_web::{Error, HttpMessage, HttpRequest, HttpResponse, Responder}; use actix_web::{Error, HttpMessage, HttpRequest, HttpResponse, Responder};
use futures::future::{ready, Ready};
use crate::range::HttpRange; use crate::range::HttpRange;
use crate::ChunkedReadFile; use crate::ChunkedReadFile;
@@ -93,9 +94,18 @@ impl NamedFile {
mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline, mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
_ => DispositionType::Attachment, _ => DispositionType::Attachment,
}; };
let mut parameters =
vec![DispositionParam::Filename(String::from(filename.as_ref()))];
if !filename.is_ascii() {
parameters.push(DispositionParam::FilenameExt(ExtendedValue {
charset: Charset::Ext(String::from("UTF-8")),
language_tag: None,
value: filename.into_owned().into_bytes(),
}))
}
let cd = ContentDisposition { let cd = ContentDisposition {
disposition: disposition_type, disposition: disposition_type,
parameters: vec![DispositionParam::Filename(filename.into_owned())], parameters: parameters,
}; };
(ct, cd) (ct, cd)
}; };
@@ -246,62 +256,8 @@ impl NamedFile {
pub(crate) fn last_modified(&self) -> Option<header::HttpDate> { pub(crate) fn last_modified(&self) -> Option<header::HttpDate> {
self.modified.map(|mtime| mtime.into()) self.modified.map(|mtime| mtime.into())
} }
}
impl Deref for NamedFile { pub fn into_response(self, req: &HttpRequest) -> Result<HttpResponse, Error> {
type Target = File;
fn deref(&self) -> &File {
&self.file
}
}
impl DerefMut for NamedFile {
fn deref_mut(&mut self) -> &mut File {
&mut self.file
}
}
/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfMatch>() {
None | Some(header::IfMatch::Any) => true,
Some(header::IfMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.strong_eq(some_etag) {
return true;
}
}
}
false
}
}
}
/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfNoneMatch>() {
Some(header::IfNoneMatch::Any) => false,
Some(header::IfNoneMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.weak_eq(some_etag) {
return false;
}
}
}
true
}
None => true,
}
}
impl Responder for NamedFile {
type Error = Error;
type Future = Result<HttpResponse, Error>;
fn respond_to(self, req: &HttpRequest) -> Self::Future {
if self.status_code != StatusCode::OK { if self.status_code != StatusCode::OK {
let mut resp = HttpResponse::build(self.status_code); let mut resp = HttpResponse::build(self.status_code);
resp.set(header::ContentType(self.content_type.clone())) resp.set(header::ContentType(self.content_type.clone()))
@@ -324,16 +280,6 @@ impl Responder for NamedFile {
return Ok(resp.streaming(reader)); return Ok(resp.streaming(reader));
} }
match *req.method() {
Method::HEAD | Method::GET => (),
_ => {
return Ok(HttpResponse::MethodNotAllowed()
.header(header::CONTENT_TYPE, "text/plain")
.header(header::ALLOW, "GET, HEAD")
.body("This resource only supports GET and HEAD."));
}
}
let etag = if self.flags.contains(Flags::ETAG) { let etag = if self.flags.contains(Flags::ETAG) {
self.etag() self.etag()
} else { } else {
@@ -443,8 +389,67 @@ impl Responder for NamedFile {
counter: 0, counter: 0,
}; };
if offset != 0 || length != self.md.len() { if offset != 0 || length != self.md.len() {
return Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader)); Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader))
}; } else {
Ok(resp.body(SizedStream::new(length, reader))) Ok(resp.body(SizedStream::new(length, reader)))
} }
}
}
impl Deref for NamedFile {
type Target = File;
fn deref(&self) -> &File {
&self.file
}
}
impl DerefMut for NamedFile {
fn deref_mut(&mut self) -> &mut File {
&mut self.file
}
}
/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfMatch>() {
None | Some(header::IfMatch::Any) => true,
Some(header::IfMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.strong_eq(some_etag) {
return true;
}
}
}
false
}
}
}
/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfNoneMatch>() {
Some(header::IfNoneMatch::Any) => false,
Some(header::IfNoneMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.weak_eq(some_etag) {
return false;
}
}
}
true
}
None => true,
}
}
impl Responder for NamedFile {
type Error = Error;
type Future = Ready<Result<HttpResponse, Error>>;
fn respond_to(self, req: &HttpRequest) -> Self::Future {
ready(self.into_response(req))
}
} }

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-framed" name = "actix-framed"
version = "0.2.1" version = "0.3.0-alpha.1"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix framed app server" description = "Actix framed app server"
readme = "README.md" readme = "README.md"
@@ -20,19 +20,19 @@ name = "actix_framed"
path = "src/lib.rs" path = "src/lib.rs"
[dependencies] [dependencies]
actix-codec = "0.1.2" actix-codec = "0.2.0-alpha.3"
actix-service = "0.4.1" actix-service = "1.0.0-alpha.3"
actix-router = "0.1.2" actix-router = "0.2.0"
actix-rt = "0.2.2" actix-rt = "1.0.0-alpha.3"
actix-http = "0.2.7" actix-http = "1.0.0-alpha.3"
actix-server-config = "0.1.2"
bytes = "0.4" bytes = "0.5.2"
futures = "0.1.25" futures = "0.3.1"
pin-project = "0.4.6"
log = "0.4" log = "0.4"
[dev-dependencies] [dev-dependencies]
actix-server = { version = "0.6.0", features=["ssl"] } actix-server = { version = "1.0.0-alpha.3" }
actix-connect = { version = "0.2.0", features=["ssl"] } actix-connect = { version = "1.0.0-alpha.3", features=["openssl"] }
actix-http-test = { version = "0.2.4", features=["ssl"] } actix-http-test = { version = "1.0.0-alpha.3", features=["openssl"] }
actix-utils = "0.4.4" actix-utils = "1.0.0-alpha.3"

View File

@@ -1,21 +1,23 @@
use std::future::Future;
use std::pin::Pin;
use std::rc::Rc; use std::rc::Rc;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed}; use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_http::h1::{Codec, SendResponse}; use actix_http::h1::{Codec, SendResponse};
use actix_http::{Error, Request, Response}; use actix_http::{Error, Request, Response};
use actix_router::{Path, Router, Url}; use actix_router::{Path, Router, Url};
use actix_server_config::ServerConfig; use actix_service::{IntoServiceFactory, Service, ServiceFactory};
use actix_service::{IntoNewService, NewService, Service}; use futures::future::{ok, FutureExt, LocalBoxFuture};
use futures::{Async, Future, Poll};
use crate::helpers::{BoxedHttpNewService, BoxedHttpService, HttpNewService}; use crate::helpers::{BoxedHttpNewService, BoxedHttpService, HttpNewService};
use crate::request::FramedRequest; use crate::request::FramedRequest;
use crate::state::State; use crate::state::State;
type BoxedResponse = Box<dyn Future<Item = (), Error = Error>>; type BoxedResponse = LocalBoxFuture<'static, Result<(), Error>>;
pub trait HttpServiceFactory { pub trait HttpServiceFactory {
type Factory: NewService; type Factory: ServiceFactory;
fn path(&self) -> &str; fn path(&self) -> &str;
@@ -48,19 +50,19 @@ impl<T: 'static, S: 'static> FramedApp<T, S> {
pub fn service<U>(mut self, factory: U) -> Self pub fn service<U>(mut self, factory: U) -> Self
where where
U: HttpServiceFactory, U: HttpServiceFactory,
U::Factory: NewService< U::Factory: ServiceFactory<
Config = (), Config = (),
Request = FramedRequest<T, S>, Request = FramedRequest<T, S>,
Response = (), Response = (),
Error = Error, Error = Error,
InitError = (), InitError = (),
> + 'static, > + 'static,
<U::Factory as NewService>::Future: 'static, <U::Factory as ServiceFactory>::Future: 'static,
<U::Factory as NewService>::Service: Service< <U::Factory as ServiceFactory>::Service: Service<
Request = FramedRequest<T, S>, Request = FramedRequest<T, S>,
Response = (), Response = (),
Error = Error, Error = Error,
Future = Box<dyn Future<Item = (), Error = Error>>, Future = LocalBoxFuture<'static, Result<(), Error>>,
>, >,
{ {
let path = factory.path().to_string(); let path = factory.path().to_string();
@@ -70,12 +72,12 @@ impl<T: 'static, S: 'static> FramedApp<T, S> {
} }
} }
impl<T, S> IntoNewService<FramedAppFactory<T, S>> for FramedApp<T, S> impl<T, S> IntoServiceFactory<FramedAppFactory<T, S>> for FramedApp<T, S>
where where
T: AsyncRead + AsyncWrite + 'static, T: AsyncRead + AsyncWrite + Unpin + 'static,
S: 'static, S: 'static,
{ {
fn into_new_service(self) -> FramedAppFactory<T, S> { fn into_factory(self) -> FramedAppFactory<T, S> {
FramedAppFactory { FramedAppFactory {
state: self.state, state: self.state,
services: Rc::new(self.services), services: Rc::new(self.services),
@@ -89,12 +91,12 @@ pub struct FramedAppFactory<T, S> {
services: Rc<Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>>, services: Rc<Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>>,
} }
impl<T, S> NewService for FramedAppFactory<T, S> impl<T, S> ServiceFactory for FramedAppFactory<T, S>
where where
T: AsyncRead + AsyncWrite + 'static, T: AsyncRead + AsyncWrite + Unpin + 'static,
S: 'static, S: 'static,
{ {
type Config = ServerConfig; type Config = ();
type Request = (Request, Framed<T, Codec>); type Request = (Request, Framed<T, Codec>);
type Response = (); type Response = ();
type Error = Error; type Error = Error;
@@ -102,7 +104,7 @@ where
type Service = FramedAppService<T, S>; type Service = FramedAppService<T, S>;
type Future = CreateService<T, S>; type Future = CreateService<T, S>;
fn new_service(&self, _: &ServerConfig) -> Self::Future { fn new_service(&self, _: ()) -> Self::Future {
CreateService { CreateService {
fut: self fut: self
.services .services
@@ -110,7 +112,7 @@ where
.map(|(path, service)| { .map(|(path, service)| {
CreateServiceItem::Future( CreateServiceItem::Future(
Some(path.clone()), Some(path.clone()),
service.new_service(&()), service.new_service(()),
) )
}) })
.collect(), .collect(),
@@ -128,28 +130,30 @@ pub struct CreateService<T, S> {
enum CreateServiceItem<T, S> { enum CreateServiceItem<T, S> {
Future( Future(
Option<String>, Option<String>,
Box<dyn Future<Item = BoxedHttpService<FramedRequest<T, S>>, Error = ()>>, LocalBoxFuture<'static, Result<BoxedHttpService<FramedRequest<T, S>>, ()>>,
), ),
Service(String, BoxedHttpService<FramedRequest<T, S>>), Service(String, BoxedHttpService<FramedRequest<T, S>>),
} }
impl<S: 'static, T: 'static> Future for CreateService<T, S> impl<S: 'static, T: 'static> Future for CreateService<T, S>
where where
T: AsyncRead + AsyncWrite, T: AsyncRead + AsyncWrite + Unpin,
{ {
type Item = FramedAppService<T, S>; type Output = Result<FramedAppService<T, S>, ()>;
type Error = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
let mut done = true; let mut done = true;
// poll http services // poll http services
for item in &mut self.fut { for item in &mut self.fut {
let res = match item { let res = match item {
CreateServiceItem::Future(ref mut path, ref mut fut) => { CreateServiceItem::Future(ref mut path, ref mut fut) => {
match fut.poll()? { match Pin::new(fut).poll(cx) {
Async::Ready(service) => Some((path.take().unwrap(), service)), Poll::Ready(Ok(service)) => {
Async::NotReady => { Some((path.take().unwrap(), service))
}
Poll::Ready(Err(e)) => return Poll::Ready(Err(e)),
Poll::Pending => {
done = false; done = false;
None None
} }
@@ -176,12 +180,12 @@ where
} }
router router
}); });
Ok(Async::Ready(FramedAppService { Poll::Ready(Ok(FramedAppService {
router: router.finish(), router: router.finish(),
state: self.state.clone(), state: self.state.clone(),
})) }))
} else { } else {
Ok(Async::NotReady) Poll::Pending
} }
} }
} }
@@ -193,15 +197,15 @@ pub struct FramedAppService<T, S> {
impl<S: 'static, T: 'static> Service for FramedAppService<T, S> impl<S: 'static, T: 'static> Service for FramedAppService<T, S>
where where
T: AsyncRead + AsyncWrite, T: AsyncRead + AsyncWrite + Unpin,
{ {
type Request = (Request, Framed<T, Codec>); type Request = (Request, Framed<T, Codec>);
type Response = (); type Response = ();
type Error = Error; type Error = Error;
type Future = BoxedResponse; type Future = BoxedResponse;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} }
fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future { fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
@@ -210,8 +214,8 @@ where
if let Some((srv, _info)) = self.router.recognize_mut(&mut path) { if let Some((srv, _info)) = self.router.recognize_mut(&mut path) {
return srv.call(FramedRequest::new(req, framed, path, self.state.clone())); return srv.call(FramedRequest::new(req, framed, path, self.state.clone()));
} }
Box::new( SendResponse::new(framed, Response::NotFound().finish())
SendResponse::new(framed, Response::NotFound().finish()).then(|_| Ok(())), .then(|_| ok(()))
) .boxed_local()
} }
} }

View File

@@ -1,36 +1,38 @@
use std::task::{Context, Poll};
use actix_http::Error; use actix_http::Error;
use actix_service::{NewService, Service}; use actix_service::{Service, ServiceFactory};
use futures::{Future, Poll}; use futures::future::{FutureExt, LocalBoxFuture};
pub(crate) type BoxedHttpService<Req> = Box< pub(crate) type BoxedHttpService<Req> = Box<
dyn Service< dyn Service<
Request = Req, Request = Req,
Response = (), Response = (),
Error = Error, Error = Error,
Future = Box<dyn Future<Item = (), Error = Error>>, Future = LocalBoxFuture<'static, Result<(), Error>>,
>, >,
>; >;
pub(crate) type BoxedHttpNewService<Req> = Box< pub(crate) type BoxedHttpNewService<Req> = Box<
dyn NewService< dyn ServiceFactory<
Config = (), Config = (),
Request = Req, Request = Req,
Response = (), Response = (),
Error = Error, Error = Error,
InitError = (), InitError = (),
Service = BoxedHttpService<Req>, Service = BoxedHttpService<Req>,
Future = Box<dyn Future<Item = BoxedHttpService<Req>, Error = ()>>, Future = LocalBoxFuture<'static, Result<BoxedHttpService<Req>, ()>>,
>, >,
>; >;
pub(crate) struct HttpNewService<T: NewService>(T); pub(crate) struct HttpNewService<T: ServiceFactory>(T);
impl<T> HttpNewService<T> impl<T> HttpNewService<T>
where where
T: NewService<Response = (), Error = Error>, T: ServiceFactory<Response = (), Error = Error>,
T::Response: 'static, T::Response: 'static,
T::Future: 'static, T::Future: 'static,
T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static, T::Service: Service<Future = LocalBoxFuture<'static, Result<(), Error>>> + 'static,
<T::Service as Service>::Future: 'static, <T::Service as Service>::Future: 'static,
{ {
pub fn new(service: T) -> Self { pub fn new(service: T) -> Self {
@@ -38,12 +40,12 @@ where
} }
} }
impl<T> NewService for HttpNewService<T> impl<T> ServiceFactory for HttpNewService<T>
where where
T: NewService<Config = (), Response = (), Error = Error>, T: ServiceFactory<Config = (), Response = (), Error = Error>,
T::Request: 'static, T::Request: 'static,
T::Future: 'static, T::Future: 'static,
T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static, T::Service: Service<Future = LocalBoxFuture<'static, Result<(), Error>>> + 'static,
<T::Service as Service>::Future: 'static, <T::Service as Service>::Future: 'static,
{ {
type Config = (); type Config = ();
@@ -52,13 +54,19 @@ where
type Error = Error; type Error = Error;
type InitError = (); type InitError = ();
type Service = BoxedHttpService<T::Request>; type Service = BoxedHttpService<T::Request>;
type Future = Box<dyn Future<Item = Self::Service, Error = ()>>; type Future = LocalBoxFuture<'static, Result<Self::Service, ()>>;
fn new_service(&self, _: &()) -> Self::Future { fn new_service(&self, _: ()) -> Self::Future {
Box::new(self.0.new_service(&()).map_err(|_| ()).and_then(|service| { let fut = self.0.new_service(());
let service: BoxedHttpService<_> = Box::new(HttpServiceWrapper { service });
Ok(service) async move {
})) fut.await.map_err(|_| ()).map(|service| {
let service: BoxedHttpService<_> =
Box::new(HttpServiceWrapper { service });
service
})
}
.boxed_local()
} }
} }
@@ -70,7 +78,7 @@ impl<T> Service for HttpServiceWrapper<T>
where where
T: Service< T: Service<
Response = (), Response = (),
Future = Box<dyn Future<Item = (), Error = Error>>, Future = LocalBoxFuture<'static, Result<(), Error>>,
Error = Error, Error = Error,
>, >,
T::Request: 'static, T::Request: 'static,
@@ -78,10 +86,10 @@ where
type Request = T::Request; type Request = T::Request;
type Response = (); type Response = ();
type Error = Error; type Error = Error;
type Future = Box<dyn Future<Item = (), Error = Error>>; type Future = LocalBoxFuture<'static, Result<(), Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.service.poll_ready() self.service.poll_ready(cx)
} }
fn call(&mut self, req: Self::Request) -> Self::Future { fn call(&mut self, req: Self::Request) -> Self::Future {

View File

@@ -123,7 +123,9 @@ impl<Io, S> FramedRequest<Io, S> {
#[cfg(test)] #[cfg(test)]
mod tests { mod tests {
use actix_http::http::{HeaderName, HeaderValue, HttpTryFrom}; use std::convert::TryFrom;
use actix_http::http::{HeaderName, HeaderValue};
use actix_http::test::{TestBuffer, TestRequest}; use actix_http::test::{TestBuffer, TestRequest};
use super::*; use super::*;

View File

@@ -1,11 +1,12 @@
use std::fmt; use std::fmt;
use std::future::Future;
use std::marker::PhantomData; use std::marker::PhantomData;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite}; use actix_codec::{AsyncRead, AsyncWrite};
use actix_http::{http::Method, Error}; use actix_http::{http::Method, Error};
use actix_service::{NewService, Service}; use actix_service::{Service, ServiceFactory};
use futures::future::{ok, FutureResult}; use futures::future::{ok, FutureExt, LocalBoxFuture, Ready};
use futures::{Async, Future, IntoFuture, Poll};
use log::error; use log::error;
use crate::app::HttpServiceFactory; use crate::app::HttpServiceFactory;
@@ -15,11 +16,11 @@ use crate::request::FramedRequest;
/// ///
/// Route uses builder-like pattern for configuration. /// Route uses builder-like pattern for configuration.
/// If handler is not explicitly set, default *404 Not Found* handler is used. /// If handler is not explicitly set, default *404 Not Found* handler is used.
pub struct FramedRoute<Io, S, F = (), R = ()> { pub struct FramedRoute<Io, S, F = (), R = (), E = ()> {
handler: F, handler: F,
pattern: String, pattern: String,
methods: Vec<Method>, methods: Vec<Method>,
state: PhantomData<(Io, S, R)>, state: PhantomData<(Io, S, R, E)>,
} }
impl<Io, S> FramedRoute<Io, S> { impl<Io, S> FramedRoute<Io, S> {
@@ -53,12 +54,12 @@ impl<Io, S> FramedRoute<Io, S> {
self self
} }
pub fn to<F, R>(self, handler: F) -> FramedRoute<Io, S, F, R> pub fn to<F, R, E>(self, handler: F) -> FramedRoute<Io, S, F, R, E>
where where
F: FnMut(FramedRequest<Io, S>) -> R, F: FnMut(FramedRequest<Io, S>) -> R,
R: IntoFuture<Item = ()>, R: Future<Output = Result<(), E>> + 'static,
R::Future: 'static,
R::Error: fmt::Debug, E: fmt::Debug,
{ {
FramedRoute { FramedRoute {
handler, handler,
@@ -69,15 +70,14 @@ impl<Io, S> FramedRoute<Io, S> {
} }
} }
impl<Io, S, F, R> HttpServiceFactory for FramedRoute<Io, S, F, R> impl<Io, S, F, R, E> HttpServiceFactory for FramedRoute<Io, S, F, R, E>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone, F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>, R: Future<Output = Result<(), E>> + 'static,
R::Future: 'static, E: fmt::Display,
R::Error: fmt::Display,
{ {
type Factory = FramedRouteFactory<Io, S, F, R>; type Factory = FramedRouteFactory<Io, S, F, R, E>;
fn path(&self) -> &str { fn path(&self) -> &str {
&self.pattern &self.pattern
@@ -92,29 +92,28 @@ where
} }
} }
pub struct FramedRouteFactory<Io, S, F, R> { pub struct FramedRouteFactory<Io, S, F, R, E> {
handler: F, handler: F,
methods: Vec<Method>, methods: Vec<Method>,
_t: PhantomData<(Io, S, R)>, _t: PhantomData<(Io, S, R, E)>,
} }
impl<Io, S, F, R> NewService for FramedRouteFactory<Io, S, F, R> impl<Io, S, F, R, E> ServiceFactory for FramedRouteFactory<Io, S, F, R, E>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone, F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>, R: Future<Output = Result<(), E>> + 'static,
R::Future: 'static, E: fmt::Display,
R::Error: fmt::Display,
{ {
type Config = (); type Config = ();
type Request = FramedRequest<Io, S>; type Request = FramedRequest<Io, S>;
type Response = (); type Response = ();
type Error = Error; type Error = Error;
type InitError = (); type InitError = ();
type Service = FramedRouteService<Io, S, F, R>; type Service = FramedRouteService<Io, S, F, R, E>;
type Future = FutureResult<Self::Service, Self::InitError>; type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &()) -> Self::Future { fn new_service(&self, _: ()) -> Self::Future {
ok(FramedRouteService { ok(FramedRouteService {
handler: self.handler.clone(), handler: self.handler.clone(),
methods: self.methods.clone(), methods: self.methods.clone(),
@@ -123,35 +122,38 @@ where
} }
} }
pub struct FramedRouteService<Io, S, F, R> { pub struct FramedRouteService<Io, S, F, R, E> {
handler: F, handler: F,
methods: Vec<Method>, methods: Vec<Method>,
_t: PhantomData<(Io, S, R)>, _t: PhantomData<(Io, S, R, E)>,
} }
impl<Io, S, F, R> Service for FramedRouteService<Io, S, F, R> impl<Io, S, F, R, E> Service for FramedRouteService<Io, S, F, R, E>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone, F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>, R: Future<Output = Result<(), E>> + 'static,
R::Future: 'static, E: fmt::Display,
R::Error: fmt::Display,
{ {
type Request = FramedRequest<Io, S>; type Request = FramedRequest<Io, S>;
type Response = (); type Response = ();
type Error = Error; type Error = Error;
type Future = Box<dyn Future<Item = (), Error = Error>>; type Future = LocalBoxFuture<'static, Result<(), Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} }
fn call(&mut self, req: FramedRequest<Io, S>) -> Self::Future { fn call(&mut self, req: FramedRequest<Io, S>) -> Self::Future {
Box::new((self.handler)(req).into_future().then(|res| { let fut = (self.handler)(req);
async move {
let res = fut.await;
if let Err(e) = res { if let Err(e) = res {
error!("Error in request handler: {}", e); error!("Error in request handler: {}", e);
} }
Ok(()) Ok(())
})) }
.boxed_local()
} }
} }

View File

@@ -1,4 +1,6 @@
use std::marker::PhantomData; use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed}; use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_http::body::BodySize; use actix_http::body::BodySize;
@@ -6,9 +8,9 @@ use actix_http::error::ResponseError;
use actix_http::h1::{Codec, Message}; use actix_http::h1::{Codec, Message};
use actix_http::ws::{verify_handshake, HandshakeError}; use actix_http::ws::{verify_handshake, HandshakeError};
use actix_http::{Request, Response}; use actix_http::{Request, Response};
use actix_service::{NewService, Service}; use actix_service::{Service, ServiceFactory};
use futures::future::{ok, Either, FutureResult}; use futures::future::{err, ok, Either, Ready};
use futures::{Async, Future, IntoFuture, Poll, Sink}; use futures::Future;
/// Service that verifies incoming request if it is valid websocket /// Service that verifies incoming request if it is valid websocket
/// upgrade request. In case of error returns `HandshakeError` /// upgrade request. In case of error returns `HandshakeError`
@@ -22,16 +24,16 @@ impl<T, C> Default for VerifyWebSockets<T, C> {
} }
} }
impl<T, C> NewService for VerifyWebSockets<T, C> { impl<T, C> ServiceFactory for VerifyWebSockets<T, C> {
type Config = C; type Config = C;
type Request = (Request, Framed<T, Codec>); type Request = (Request, Framed<T, Codec>);
type Response = (Request, Framed<T, Codec>); type Response = (Request, Framed<T, Codec>);
type Error = (HandshakeError, Framed<T, Codec>); type Error = (HandshakeError, Framed<T, Codec>);
type InitError = (); type InitError = ();
type Service = VerifyWebSockets<T, C>; type Service = VerifyWebSockets<T, C>;
type Future = FutureResult<Self::Service, Self::InitError>; type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &C) -> Self::Future { fn new_service(&self, _: C) -> Self::Future {
ok(VerifyWebSockets { _t: PhantomData }) ok(VerifyWebSockets { _t: PhantomData })
} }
} }
@@ -40,16 +42,16 @@ impl<T, C> Service for VerifyWebSockets<T, C> {
type Request = (Request, Framed<T, Codec>); type Request = (Request, Framed<T, Codec>);
type Response = (Request, Framed<T, Codec>); type Response = (Request, Framed<T, Codec>);
type Error = (HandshakeError, Framed<T, Codec>); type Error = (HandshakeError, Framed<T, Codec>);
type Future = FutureResult<Self::Response, Self::Error>; type Future = Ready<Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} }
fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future { fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
match verify_handshake(req.head()) { match verify_handshake(req.head()) {
Err(e) => Err((e, framed)).into_future(), Err(e) => err((e, framed)),
Ok(_) => Ok((req, framed)).into_future(), Ok(_) => ok((req, framed)),
} }
} }
} }
@@ -67,9 +69,9 @@ where
} }
} }
impl<T, R, E, C> NewService for SendError<T, R, E, C> impl<T, R, E, C> ServiceFactory for SendError<T, R, E, C>
where where
T: AsyncRead + AsyncWrite + 'static, T: AsyncRead + AsyncWrite + Unpin + 'static,
R: 'static, R: 'static,
E: ResponseError + 'static, E: ResponseError + 'static,
{ {
@@ -79,34 +81,34 @@ where
type Error = (E, Framed<T, Codec>); type Error = (E, Framed<T, Codec>);
type InitError = (); type InitError = ();
type Service = SendError<T, R, E, C>; type Service = SendError<T, R, E, C>;
type Future = FutureResult<Self::Service, Self::InitError>; type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &C) -> Self::Future { fn new_service(&self, _: C) -> Self::Future {
ok(SendError(PhantomData)) ok(SendError(PhantomData))
} }
} }
impl<T, R, E, C> Service for SendError<T, R, E, C> impl<T, R, E, C> Service for SendError<T, R, E, C>
where where
T: AsyncRead + AsyncWrite + 'static, T: AsyncRead + AsyncWrite + Unpin + 'static,
R: 'static, R: 'static,
E: ResponseError + 'static, E: ResponseError + 'static,
{ {
type Request = Result<R, (E, Framed<T, Codec>)>; type Request = Result<R, (E, Framed<T, Codec>)>;
type Response = R; type Response = R;
type Error = (E, Framed<T, Codec>); type Error = (E, Framed<T, Codec>);
type Future = Either<FutureResult<R, (E, Framed<T, Codec>)>, SendErrorFut<T, R, E>>; type Future = Either<Ready<Result<R, (E, Framed<T, Codec>)>>, SendErrorFut<T, R, E>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} }
fn call(&mut self, req: Result<R, (E, Framed<T, Codec>)>) -> Self::Future { fn call(&mut self, req: Result<R, (E, Framed<T, Codec>)>) -> Self::Future {
match req { match req {
Ok(r) => Either::A(ok(r)), Ok(r) => Either::Left(ok(r)),
Err((e, framed)) => { Err((e, framed)) => {
let res = e.error_response().drop_body(); let res = e.error_response().drop_body();
Either::B(SendErrorFut { Either::Right(SendErrorFut {
framed: Some(framed), framed: Some(framed),
res: Some((res, BodySize::Empty).into()), res: Some((res, BodySize::Empty).into()),
err: Some(e), err: Some(e),
@@ -117,6 +119,7 @@ where
} }
} }
#[pin_project::pin_project]
pub struct SendErrorFut<T, R, E> { pub struct SendErrorFut<T, R, E> {
res: Option<Message<(Response<()>, BodySize)>>, res: Option<Message<(Response<()>, BodySize)>>,
framed: Option<Framed<T, Codec>>, framed: Option<Framed<T, Codec>>,
@@ -127,23 +130,27 @@ pub struct SendErrorFut<T, R, E> {
impl<T, R, E> Future for SendErrorFut<T, R, E> impl<T, R, E> Future for SendErrorFut<T, R, E>
where where
E: ResponseError, E: ResponseError,
T: AsyncRead + AsyncWrite, T: AsyncRead + AsyncWrite + Unpin,
{ {
type Item = R; type Output = Result<R, (E, Framed<T, Codec>)>;
type Error = (E, Framed<T, Codec>);
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
if let Some(res) = self.res.take() { if let Some(res) = self.res.take() {
if self.framed.as_mut().unwrap().force_send(res).is_err() { if self.framed.as_mut().unwrap().write(res).is_err() {
return Err((self.err.take().unwrap(), self.framed.take().unwrap())); return Poll::Ready(Err((
self.err.take().unwrap(),
self.framed.take().unwrap(),
)));
} }
} }
match self.framed.as_mut().unwrap().poll_complete() { match self.framed.as_mut().unwrap().flush(cx) {
Ok(Async::Ready(_)) => { Poll::Ready(Ok(_)) => {
Err((self.err.take().unwrap(), self.framed.take().unwrap())) Poll::Ready(Err((self.err.take().unwrap(), self.framed.take().unwrap())))
} }
Ok(Async::NotReady) => Ok(Async::NotReady), Poll::Ready(Err(_)) => {
Err(_) => Err((self.err.take().unwrap(), self.framed.take().unwrap())), Poll::Ready(Err((self.err.take().unwrap(), self.framed.take().unwrap())))
}
Poll::Pending => Poll::Pending,
} }
} }
} }

View File

@@ -1,12 +1,13 @@
//! Various helpers for Actix applications to use during testing. //! Various helpers for Actix applications to use during testing.
use std::convert::TryFrom;
use std::future::Future;
use actix_codec::Framed; use actix_codec::Framed;
use actix_http::h1::Codec; use actix_http::h1::Codec;
use actix_http::http::header::{Header, HeaderName, IntoHeaderValue}; use actix_http::http::header::{Header, HeaderName, IntoHeaderValue};
use actix_http::http::{HttpTryFrom, Method, Uri, Version}; use actix_http::http::{Error as HttpError, Method, Uri, Version};
use actix_http::test::{TestBuffer, TestRequest as HttpTestRequest}; use actix_http::test::{TestBuffer, TestRequest as HttpTestRequest};
use actix_router::{Path, Url}; use actix_router::{Path, Url};
use actix_rt::Runtime;
use futures::IntoFuture;
use crate::{FramedRequest, State}; use crate::{FramedRequest, State};
@@ -41,7 +42,8 @@ impl TestRequest<()> {
/// Create TestRequest and set header /// Create TestRequest and set header
pub fn with_header<K, V>(key: K, value: V) -> Self pub fn with_header<K, V>(key: K, value: V) -> Self
where where
HeaderName: HttpTryFrom<K>, HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue, V: IntoHeaderValue,
{ {
Self::default().header(key, value) Self::default().header(key, value)
@@ -96,7 +98,8 @@ impl<S> TestRequest<S> {
/// Set a header /// Set a header
pub fn header<K, V>(mut self, key: K, value: V) -> Self pub fn header<K, V>(mut self, key: K, value: V) -> Self
where where
HeaderName: HttpTryFrom<K>, HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue, V: IntoHeaderValue,
{ {
self.req.header(key, value); self.req.header(key, value);
@@ -118,13 +121,12 @@ impl<S> TestRequest<S> {
} }
/// This method generates `FramedRequest` instance and executes async handler /// This method generates `FramedRequest` instance and executes async handler
pub fn run<F, R, I, E>(self, f: F) -> Result<I, E> pub async fn run<F, R, I, E>(self, f: F) -> Result<I, E>
where where
F: FnOnce(FramedRequest<TestBuffer, S>) -> R, F: FnOnce(FramedRequest<TestBuffer, S>) -> R,
R: IntoFuture<Item = I, Error = E>, R: Future<Output = Result<I, E>>,
{ {
let mut rt = Runtime::new().unwrap(); f(self.finish()).await
rt.block_on(f(self.finish()).into_future())
} }
} }

View File

@@ -1,30 +1,31 @@
use actix_codec::{AsyncRead, AsyncWrite}; use actix_codec::{AsyncRead, AsyncWrite};
use actix_http::{body, http::StatusCode, ws, Error, HttpService, Response}; use actix_http::{body, http::StatusCode, ws, Error, HttpService, Response};
use actix_http_test::TestServer; use actix_http_test::TestServer;
use actix_service::{IntoNewService, NewService}; use actix_service::{pipeline_factory, IntoServiceFactory, ServiceFactory};
use actix_utils::framed::FramedTransport; use actix_utils::framed::FramedTransport;
use bytes::{Bytes, BytesMut}; use bytes::BytesMut;
use futures::future::{self, ok}; use futures::{future, SinkExt, StreamExt};
use futures::{Future, Sink, Stream};
use actix_framed::{FramedApp, FramedRequest, FramedRoute, SendError, VerifyWebSockets}; use actix_framed::{FramedApp, FramedRequest, FramedRoute, SendError, VerifyWebSockets};
fn ws_service<T: AsyncRead + AsyncWrite>( async fn ws_service<T: AsyncRead + AsyncWrite>(
req: FramedRequest<T>, req: FramedRequest<T>,
) -> impl Future<Item = (), Error = Error> { ) -> Result<(), Error> {
let (req, framed, _) = req.into_parts(); let (req, mut framed, _) = req.into_parts();
let res = ws::handshake(req.head()).unwrap().message_body(()); let res = ws::handshake(req.head()).unwrap().message_body(());
framed framed
.send((res, body::BodySize::None).into()) .send((res, body::BodySize::None).into())
.map_err(|_| panic!()) .await
.and_then(|framed| { .unwrap();
FramedTransport::new(framed.into_framed(ws::Codec::new()), service) FramedTransport::new(framed.into_framed(ws::Codec::new()), service)
.map_err(|_| panic!()) .await
}) .unwrap();
Ok(())
} }
fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> { async fn service(msg: ws::Frame) -> Result<ws::Message, Error> {
let msg = match msg { let msg = match msg {
ws::Frame::Ping(msg) => ws::Message::Pong(msg), ws::Frame::Ping(msg) => ws::Message::Pong(msg),
ws::Frame::Text(text) => { ws::Frame::Text(text) => {
@@ -34,108 +35,125 @@ fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> {
ws::Frame::Close(reason) => ws::Message::Close(reason), ws::Frame::Close(reason) => ws::Message::Close(reason),
_ => panic!(), _ => panic!(),
}; };
ok(msg) Ok(msg)
} }
#[test] #[actix_rt::test]
fn test_simple() { async fn test_simple() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.upgrade( .upgrade(
FramedApp::new().service(FramedRoute::get("/index.html").to(ws_service)), FramedApp::new().service(FramedRoute::get("/index.html").to(ws_service)),
) )
.finish(|_| future::ok::<_, Error>(Response::NotFound())) .finish(|_| future::ok::<_, Error>(Response::NotFound()))
.tcp()
}); });
assert!(srv.ws_at("/test").is_err()); assert!(srv.ws_at("/test").await.is_err());
// client service // client service
let framed = srv.ws_at("/index.html").unwrap(); let mut framed = srv.ws_at("/index.html").await.unwrap();
let framed = srv framed
.block_on(framed.send(ws::Message::Text("text".to_string()))) .send(ws::Message::Text("text".to_string()))
.await
.unwrap(); .unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap(); let (item, mut framed) = framed.into_future().await;
assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
let framed = srv
.block_on(framed.send(ws::Message::Binary("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!( assert_eq!(
item, item.unwrap().unwrap(),
Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into()))) ws::Frame::Text(Some(BytesMut::from("text")))
); );
let framed = srv framed
.block_on(framed.send(ws::Message::Ping("text".into()))) .send(ws::Message::Binary("text".into()))
.await
.unwrap(); .unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap(); let (item, mut framed) = framed.into_future().await;
assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
let framed = srv
.block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
.unwrap();
let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!( assert_eq!(
item, item.unwrap().unwrap(),
Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into()))) ws::Frame::Binary(Some(BytesMut::from(&b"text"[..])))
);
framed.send(ws::Message::Ping("text".into())).await.unwrap();
let (item, mut framed) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Pong("text".to_string().into())
);
framed
.send(ws::Message::Close(Some(ws::CloseCode::Normal.into())))
.await
.unwrap();
let (item, _) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Close(Some(ws::CloseCode::Normal.into()))
); );
} }
#[test] #[actix_rt::test]
fn test_service() { async fn test_service() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
actix_http::h1::OneRequest::new().map_err(|_| ()).and_then( pipeline_factory(actix_http::h1::OneRequest::new().map_err(|_| ())).and_then(
VerifyWebSockets::default() pipeline_factory(
pipeline_factory(VerifyWebSockets::default())
.then(SendError::default()) .then(SendError::default())
.map_err(|_| ()) .map_err(|_| ()),
)
.and_then( .and_then(
FramedApp::new() FramedApp::new()
.service(FramedRoute::get("/index.html").to(ws_service)) .service(FramedRoute::get("/index.html").to(ws_service))
.into_new_service() .into_factory()
.map_err(|_| ()), .map_err(|_| ()),
), ),
) )
}); });
// non ws request // non ws request
let res = srv.block_on(srv.get("/index.html").send()).unwrap(); let res = srv.get("/index.html").send().await.unwrap();
assert_eq!(res.status(), StatusCode::BAD_REQUEST); assert_eq!(res.status(), StatusCode::BAD_REQUEST);
// not found // not found
assert!(srv.ws_at("/test").is_err()); assert!(srv.ws_at("/test").await.is_err());
// client service // client service
let framed = srv.ws_at("/index.html").unwrap(); let mut framed = srv.ws_at("/index.html").await.unwrap();
let framed = srv framed
.block_on(framed.send(ws::Message::Text("text".to_string()))) .send(ws::Message::Text("text".to_string()))
.await
.unwrap(); .unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap(); let (item, mut framed) = framed.into_future().await;
assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
let framed = srv
.block_on(framed.send(ws::Message::Binary("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!( assert_eq!(
item, item.unwrap().unwrap(),
Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into()))) ws::Frame::Text(Some(BytesMut::from("text")))
); );
let framed = srv framed
.block_on(framed.send(ws::Message::Ping("text".into()))) .send(ws::Message::Binary("text".into()))
.await
.unwrap(); .unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap(); let (item, mut framed) = framed.into_future().await;
assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
let framed = srv
.block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
.unwrap();
let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!( assert_eq!(
item, item.unwrap().unwrap(),
Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into()))) ws::Frame::Binary(Some(BytesMut::from(&b"text"[..])))
);
framed.send(ws::Message::Ping("text".into())).await.unwrap();
let (item, mut framed) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Pong("text".to_string().into())
);
framed
.send(ws::Message::Close(Some(ws::CloseCode::Normal.into())))
.await
.unwrap();
let (item, _) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Close(Some(ws::CloseCode::Normal.into()))
); );
} }

View File

@@ -1,6 +1,30 @@
# Changes # Changes
## [0.2.11] - 2019-09-11 ## [1.0.0-alpha.3] - 2019-12-07
### Changed
* Migrate to tokio 0.2
* Migrate to `std::future`
## [0.2.11] - 2019-11-06
### Added
* Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
* Allow to use `std::convert::Infallible` as `actix_http::error::Error`
### Fixed
* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain; charset=utf-8` header #1118
## [0.2.10] - 2019-09-11
### Added ### Added
@@ -8,6 +32,8 @@
### Fixed ### Fixed
* h2 will use error response #1080
* on_connect result isn't added to request extensions for http2 requests #1009 * on_connect result isn't added to request extensions for http2 requests #1009

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-http" name = "actix-http"
version = "0.2.10" version = "1.0.0-alpha.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix http primitives" description = "Actix http primitives"
readme = "README.md" readme = "README.md"
@@ -16,7 +16,7 @@ edition = "2018"
workspace = ".." workspace = ".."
[package.metadata.docs.rs] [package.metadata.docs.rs]
features = ["ssl", "fail", "brotli", "flate2-zlib", "secure-cookies"] features = ["openssl", "rustls", "fail", "brotli", "flate2-zlib", "secure-cookies"]
[lib] [lib]
name = "actix_http" name = "actix_http"
@@ -26,10 +26,10 @@ path = "src/lib.rs"
default = [] default = []
# openssl # openssl
ssl = ["openssl", "actix-connect/ssl"] openssl = ["actix-tls/openssl", "actix-connect/openssl"]
# rustls support # rustls support
rust-tls = ["rustls", "webpki-roots", "actix-connect/rust-tls"] rustls = ["actix-tls/rustls", "actix-connect/rustls"]
# brotli encoding, requires c compiler # brotli encoding, requires c compiler
brotli = ["brotli2"] brotli = ["brotli2"]
@@ -47,24 +47,26 @@ fail = ["failure"]
secure-cookies = ["ring"] secure-cookies = ["ring"]
[dependencies] [dependencies]
actix-service = "0.4.1" actix-service = "1.0.0-alpha.3"
actix-codec = "0.1.2" actix-codec = "0.2.0-alpha.3"
actix-connect = "0.2.4" actix-connect = "1.0.0-alpha.3"
actix-utils = "0.4.4" actix-utils = "1.0.0-alpha.3"
actix-server-config = "0.1.2" actix-rt = "1.0.0-alpha.3"
actix-threadpool = "0.1.1" actix-threadpool = "0.3.0"
actix-tls = { version = "1.0.0-alpha.3", optional = true }
base64 = "0.10" base64 = "0.11"
bitflags = "1.0" bitflags = "1.0"
bytes = "0.4" bytes = "0.5.2"
copyless = "0.1.4" copyless = "0.1.4"
derive_more = "0.15.0" chrono = "0.4.6"
derive_more = "0.99.2"
either = "1.5.2" either = "1.5.2"
encoding_rs = "0.8" encoding_rs = "0.8"
futures = "0.1.25" futures = "0.3.1"
hashbrown = "0.5.0" fxhash = "0.2.1"
h2 = "0.1.16" h2 = "0.2.1"
http = "0.1.17" http = "0.2.0"
httparse = "1.3" httparse = "1.3"
indexmap = "1.2" indexmap = "1.2"
lazy_static = "1.0" lazy_static = "1.0"
@@ -72,21 +74,18 @@ language-tags = "0.2"
log = "0.4" log = "0.4"
mime = "0.3" mime = "0.3"
percent-encoding = "2.1" percent-encoding = "2.1"
pin-project = "0.4.6"
rand = "0.7" rand = "0.7"
regex = "1.0" regex = "1.3"
serde = "1.0" serde = "1.0"
serde_json = "1.0" serde_json = "1.0"
sha1 = "0.6" sha1 = "0.6"
slab = "0.4" slab = "0.4"
serde_urlencoded = "0.6.1" serde_urlencoded = "0.6.1"
time = "0.1.42" time = "0.1.42"
tokio-tcp = "0.1.3"
tokio-timer = "0.2.8"
tokio-current-thread = "0.1"
trust-dns-resolver = { version="0.11.1", default-features = false }
# for secure cookie # for secure cookie
ring = { version = "0.14.6", optional = true } ring = { version = "0.16.9", optional = true }
# compression # compression
brotli2 = { version="0.3.2", optional = true } brotli2 = { version="0.3.2", optional = true }
@@ -94,17 +93,13 @@ flate2 = { version="1.0.7", optional = true, default-features = false }
# optional deps # optional deps
failure = { version = "0.1.5", optional = true } failure = { version = "0.1.5", optional = true }
openssl = { version="0.10", optional = true }
rustls = { version = "0.15.2", optional = true }
webpki-roots = { version = "0.16", optional = true }
chrono = "0.4.6"
[dev-dependencies] [dev-dependencies]
actix-rt = "0.2.2" actix-server = { version = "1.0.0-alpha.3" }
actix-server = { version = "0.6.0", features=["ssl", "rust-tls"] } actix-connect = { version = "1.0.0-alpha.3", features=["openssl"] }
actix-connect = { version = "0.2.0", features=["ssl"] } actix-http-test = { version = "1.0.0-alpha.3", features=["openssl"] }
actix-http-test = { version = "0.2.4", features=["ssl"] } actix-tls = { version = "1.0.0-alpha.3", features=["openssl"] }
env_logger = "0.6" env_logger = "0.6"
serde_derive = "1.0" serde_derive = "1.0"
openssl = { version="0.10" } open-ssl = { version="0.10", package = "openssl" }
tokio-tcp = "0.1" rust-tls = { version="0.16", package = "rustls" }

View File

@@ -1,9 +1,9 @@
use std::{env, io}; use std::{env, io};
use actix_http::{error::PayloadError, HttpService, Request, Response}; use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server; use actix_server::Server;
use bytes::BytesMut; use bytes::BytesMut;
use futures::{Future, Stream}; use futures::StreamExt;
use http::header::HeaderValue; use http::header::HeaderValue;
use log::info; use log::info;
@@ -17,21 +17,24 @@ fn main() -> io::Result<()> {
.client_timeout(1000) .client_timeout(1000)
.client_disconnect(1000) .client_disconnect(1000)
.finish(|mut req: Request| { .finish(|mut req: Request| {
req.take_payload() async move {
.fold(BytesMut::new(), move |mut body, chunk| { let mut body = BytesMut::new();
body.extend_from_slice(&chunk); while let Some(item) = req.payload().next().await {
Ok::<_, PayloadError>(body) body.extend_from_slice(&item?);
}) }
.and_then(|bytes| {
info!("request body: {:?}", bytes); info!("request body: {:?}", body);
let mut res = Response::Ok(); Ok::<_, Error>(
res.header( Response::Ok()
.header(
"x-head", "x-head",
HeaderValue::from_static("dummy value!"), HeaderValue::from_static("dummy value!"),
); )
Ok(res.body(bytes)) .body(body),
}) )
}
}) })
.tcp()
})? })?
.run() .run()
} }

View File

@@ -1,25 +1,22 @@
use std::{env, io}; use std::{env, io};
use actix_http::http::HeaderValue; use actix_http::http::HeaderValue;
use actix_http::{error::PayloadError, Error, HttpService, Request, Response}; use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server; use actix_server::Server;
use bytes::BytesMut; use bytes::BytesMut;
use futures::{Future, Stream}; use futures::StreamExt;
use log::info; use log::info;
fn handle_request(mut req: Request) -> impl Future<Item = Response, Error = Error> { async fn handle_request(mut req: Request) -> Result<Response, Error> {
req.take_payload() let mut body = BytesMut::new();
.fold(BytesMut::new(), move |mut body, chunk| { while let Some(item) = req.payload().next().await {
body.extend_from_slice(&chunk); body.extend_from_slice(&item?)
Ok::<_, PayloadError>(body) }
})
.from_err() info!("request body: {:?}", body);
.and_then(|bytes| { Ok(Response::Ok()
info!("request body: {:?}", bytes); .header("x-head", HeaderValue::from_static("dummy value!"))
let mut res = Response::Ok(); .body(body))
res.header("x-head", HeaderValue::from_static("dummy value!"));
Ok(res.body(bytes))
})
} }
fn main() -> io::Result<()> { fn main() -> io::Result<()> {
@@ -28,7 +25,7 @@ fn main() -> io::Result<()> {
Server::build() Server::build()
.bind("echo", "127.0.0.1:8080", || { .bind("echo", "127.0.0.1:8080", || {
HttpService::build().finish(|_req: Request| handle_request(_req)) HttpService::build().finish(handle_request).tcp()
})? })?
.run() .run()
} }

View File

@@ -21,6 +21,7 @@ fn main() -> io::Result<()> {
res.header("x-head", HeaderValue::from_static("dummy value!")); res.header("x-head", HeaderValue::from_static("dummy value!"));
future::ok::<_, ()>(res.body("Hello world!")) future::ok::<_, ()>(res.body("Hello world!"))
}) })
.tcp()
})? })?
.run() .run()
} }

View File

@@ -1,8 +1,11 @@
use std::marker::PhantomData; use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, mem}; use std::{fmt, mem};
use bytes::{Bytes, BytesMut}; use bytes::{Bytes, BytesMut};
use futures::{Async, Poll, Stream}; use futures::Stream;
use pin_project::{pin_project, project};
use crate::error::Error; use crate::error::Error;
@@ -32,7 +35,7 @@ impl BodySize {
pub trait MessageBody { pub trait MessageBody {
fn size(&self) -> BodySize; fn size(&self) -> BodySize;
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error>; fn poll_next(&mut self, cx: &mut Context) -> Poll<Option<Result<Bytes, Error>>>;
} }
impl MessageBody for () { impl MessageBody for () {
@@ -40,8 +43,8 @@ impl MessageBody for () {
BodySize::Empty BodySize::Empty
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, _: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
Ok(Async::Ready(None)) Poll::Ready(None)
} }
} }
@@ -50,11 +53,12 @@ impl<T: MessageBody> MessageBody for Box<T> {
self.as_ref().size() self.as_ref().size()
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, cx: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
self.as_mut().poll_next() self.as_mut().poll_next(cx)
} }
} }
#[pin_project]
pub enum ResponseBody<B> { pub enum ResponseBody<B> {
Body(B), Body(B),
Other(Body), Other(Body),
@@ -93,20 +97,24 @@ impl<B: MessageBody> MessageBody for ResponseBody<B> {
} }
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, cx: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
match self { match self {
ResponseBody::Body(ref mut body) => body.poll_next(), ResponseBody::Body(ref mut body) => body.poll_next(cx),
ResponseBody::Other(ref mut body) => body.poll_next(), ResponseBody::Other(ref mut body) => body.poll_next(cx),
} }
} }
} }
impl<B: MessageBody> Stream for ResponseBody<B> { impl<B: MessageBody> Stream for ResponseBody<B> {
type Item = Bytes; type Item = Result<Bytes, Error>;
type Error = Error;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> { #[project]
self.poll_next() fn poll_next(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Option<Self::Item>> {
#[project]
match self.project() {
ResponseBody::Body(ref mut body) => body.poll_next(cx),
ResponseBody::Other(ref mut body) => body.poll_next(cx),
}
} }
} }
@@ -125,7 +133,7 @@ pub enum Body {
impl Body { impl Body {
/// Create body from slice (copy) /// Create body from slice (copy)
pub fn from_slice(s: &[u8]) -> Body { pub fn from_slice(s: &[u8]) -> Body {
Body::Bytes(Bytes::from(s)) Body::Bytes(Bytes::copy_from_slice(s))
} }
/// Create body from generic message body. /// Create body from generic message body.
@@ -144,19 +152,19 @@ impl MessageBody for Body {
} }
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, cx: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
match self { match self {
Body::None => Ok(Async::Ready(None)), Body::None => Poll::Ready(None),
Body::Empty => Ok(Async::Ready(None)), Body::Empty => Poll::Ready(None),
Body::Bytes(ref mut bin) => { Body::Bytes(ref mut bin) => {
let len = bin.len(); let len = bin.len();
if len == 0 { if len == 0 {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
Ok(Async::Ready(Some(mem::replace(bin, Bytes::new())))) Poll::Ready(Some(Ok(mem::replace(bin, Bytes::new()))))
} }
} }
Body::Message(ref mut body) => body.poll_next(), Body::Message(ref mut body) => body.poll_next(cx),
} }
} }
} }
@@ -218,7 +226,7 @@ impl From<String> for Body {
impl<'a> From<&'a String> for Body { impl<'a> From<&'a String> for Body {
fn from(s: &'a String) -> Body { fn from(s: &'a String) -> Body {
Body::Bytes(Bytes::from(AsRef::<[u8]>::as_ref(&s))) Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
} }
} }
@@ -234,9 +242,15 @@ impl From<BytesMut> for Body {
} }
} }
impl From<serde_json::Value> for Body {
fn from(v: serde_json::Value) -> Body {
Body::Bytes(v.to_string().into())
}
}
impl<S> From<SizedStream<S>> for Body impl<S> From<SizedStream<S>> for Body
where where
S: Stream<Item = Bytes, Error = Error> + 'static, S: Stream<Item = Result<Bytes, Error>> + 'static,
{ {
fn from(s: SizedStream<S>) -> Body { fn from(s: SizedStream<S>) -> Body {
Body::from_message(s) Body::from_message(s)
@@ -245,7 +259,7 @@ where
impl<S, E> From<BodyStream<S, E>> for Body impl<S, E> From<BodyStream<S, E>> for Body
where where
S: Stream<Item = Bytes, Error = E> + 'static, S: Stream<Item = Result<Bytes, E>> + 'static,
E: Into<Error> + 'static, E: Into<Error> + 'static,
{ {
fn from(s: BodyStream<S, E>) -> Body { fn from(s: BodyStream<S, E>) -> Body {
@@ -258,11 +272,11 @@ impl MessageBody for Bytes {
BodySize::Sized(self.len()) BodySize::Sized(self.len())
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, _: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() { if self.is_empty() {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
Ok(Async::Ready(Some(mem::replace(self, Bytes::new())))) Poll::Ready(Some(Ok(mem::replace(self, Bytes::new()))))
} }
} }
} }
@@ -272,13 +286,11 @@ impl MessageBody for BytesMut {
BodySize::Sized(self.len()) BodySize::Sized(self.len())
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, _: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() { if self.is_empty() {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
Ok(Async::Ready(Some( Poll::Ready(Some(Ok(mem::replace(self, BytesMut::new()).freeze())))
mem::replace(self, BytesMut::new()).freeze(),
)))
} }
} }
} }
@@ -288,11 +300,11 @@ impl MessageBody for &'static str {
BodySize::Sized(self.len()) BodySize::Sized(self.len())
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, _: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() { if self.is_empty() {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
Ok(Async::Ready(Some(Bytes::from_static( Poll::Ready(Some(Ok(Bytes::from_static(
mem::replace(self, "").as_ref(), mem::replace(self, "").as_ref(),
)))) ))))
} }
@@ -304,13 +316,11 @@ impl MessageBody for &'static [u8] {
BodySize::Sized(self.len()) BodySize::Sized(self.len())
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, _: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() { if self.is_empty() {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
Ok(Async::Ready(Some(Bytes::from_static(mem::replace( Poll::Ready(Some(Ok(Bytes::from_static(mem::replace(self, b"")))))
self, b"",
)))))
} }
} }
} }
@@ -320,14 +330,11 @@ impl MessageBody for Vec<u8> {
BodySize::Sized(self.len()) BodySize::Sized(self.len())
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, _: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() { if self.is_empty() {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
Ok(Async::Ready(Some(Bytes::from(mem::replace( Poll::Ready(Some(Ok(Bytes::from(mem::replace(self, Vec::new())))))
self,
Vec::new(),
)))))
} }
} }
} }
@@ -337,11 +344,11 @@ impl MessageBody for String {
BodySize::Sized(self.len()) BodySize::Sized(self.len())
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, _: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() { if self.is_empty() {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
Ok(Async::Ready(Some(Bytes::from( Poll::Ready(Some(Ok(Bytes::from(
mem::replace(self, String::new()).into_bytes(), mem::replace(self, String::new()).into_bytes(),
)))) ))))
} }
@@ -350,14 +357,16 @@ impl MessageBody for String {
/// Type represent streaming body. /// Type represent streaming body.
/// Response does not contain `content-length` header and appropriate transfer encoding is used. /// Response does not contain `content-length` header and appropriate transfer encoding is used.
#[pin_project]
pub struct BodyStream<S, E> { pub struct BodyStream<S, E> {
#[pin]
stream: S, stream: S,
_t: PhantomData<E>, _t: PhantomData<E>,
} }
impl<S, E> BodyStream<S, E> impl<S, E> BodyStream<S, E>
where where
S: Stream<Item = Bytes, Error = E>, S: Stream<Item = Result<Bytes, E>>,
E: Into<Error>, E: Into<Error>,
{ {
pub fn new(stream: S) -> Self { pub fn new(stream: S) -> Self {
@@ -370,28 +379,34 @@ where
impl<S, E> MessageBody for BodyStream<S, E> impl<S, E> MessageBody for BodyStream<S, E>
where where
S: Stream<Item = Bytes, Error = E>, S: Stream<Item = Result<Bytes, E>>,
E: Into<Error>, E: Into<Error>,
{ {
fn size(&self) -> BodySize { fn size(&self) -> BodySize {
BodySize::Stream BodySize::Stream
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, cx: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
self.stream.poll().map_err(std::convert::Into::into) unsafe { Pin::new_unchecked(self) }
.project()
.stream
.poll_next(cx)
.map(|res| res.map(|res| res.map_err(std::convert::Into::into)))
} }
} }
/// Type represent streaming body. This body implementation should be used /// Type represent streaming body. This body implementation should be used
/// if total size of stream is known. Data get sent as is without using transfer encoding. /// if total size of stream is known. Data get sent as is without using transfer encoding.
#[pin_project]
pub struct SizedStream<S> { pub struct SizedStream<S> {
size: u64, size: u64,
#[pin]
stream: S, stream: S,
} }
impl<S> SizedStream<S> impl<S> SizedStream<S>
where where
S: Stream<Item = Bytes, Error = Error>, S: Stream<Item = Result<Bytes, Error>>,
{ {
pub fn new(size: u64, stream: S) -> Self { pub fn new(size: u64, stream: S) -> Self {
SizedStream { size, stream } SizedStream { size, stream }
@@ -400,20 +415,24 @@ where
impl<S> MessageBody for SizedStream<S> impl<S> MessageBody for SizedStream<S>
where where
S: Stream<Item = Bytes, Error = Error>, S: Stream<Item = Result<Bytes, Error>>,
{ {
fn size(&self) -> BodySize { fn size(&self) -> BodySize {
BodySize::Sized64(self.size) BodySize::Sized64(self.size)
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, cx: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
self.stream.poll() unsafe { Pin::new_unchecked(self) }
.project()
.stream
.poll_next(cx)
} }
} }
#[cfg(test)] #[cfg(test)]
mod tests { mod tests {
use super::*; use super::*;
use futures::future::poll_fn;
impl Body { impl Body {
pub(crate) fn get_ref(&self) -> &[u8] { pub(crate) fn get_ref(&self) -> &[u8] {
@@ -433,21 +452,21 @@ mod tests {
} }
} }
#[test] #[actix_rt::test]
fn test_static_str() { async fn test_static_str() {
assert_eq!(Body::from("").size(), BodySize::Sized(0)); assert_eq!(Body::from("").size(), BodySize::Sized(0));
assert_eq!(Body::from("test").size(), BodySize::Sized(4)); assert_eq!(Body::from("test").size(), BodySize::Sized(4));
assert_eq!(Body::from("test").get_ref(), b"test"); assert_eq!(Body::from("test").get_ref(), b"test");
assert_eq!("test".size(), BodySize::Sized(4)); assert_eq!("test".size(), BodySize::Sized(4));
assert_eq!( assert_eq!(
"test".poll_next().unwrap(), poll_fn(|cx| "test".poll_next(cx)).await.unwrap().ok(),
Async::Ready(Some(Bytes::from("test"))) Some(Bytes::from("test"))
); );
} }
#[test] #[actix_rt::test]
fn test_static_bytes() { async fn test_static_bytes() {
assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4)); assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test"); assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
assert_eq!( assert_eq!(
@@ -458,51 +477,57 @@ mod tests {
assert_eq!((&b"test"[..]).size(), BodySize::Sized(4)); assert_eq!((&b"test"[..]).size(), BodySize::Sized(4));
assert_eq!( assert_eq!(
(&b"test"[..]).poll_next().unwrap(), poll_fn(|cx| (&b"test"[..]).poll_next(cx))
Async::Ready(Some(Bytes::from("test"))) .await
.unwrap()
.ok(),
Some(Bytes::from("test"))
); );
} }
#[test] #[actix_rt::test]
fn test_vec() { async fn test_vec() {
assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4)); assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test"); assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
assert_eq!(Vec::from("test").size(), BodySize::Sized(4)); assert_eq!(Vec::from("test").size(), BodySize::Sized(4));
assert_eq!( assert_eq!(
Vec::from("test").poll_next().unwrap(), poll_fn(|cx| Vec::from("test").poll_next(cx))
Async::Ready(Some(Bytes::from("test"))) .await
.unwrap()
.ok(),
Some(Bytes::from("test"))
); );
} }
#[test] #[actix_rt::test]
fn test_bytes() { async fn test_bytes() {
let mut b = Bytes::from("test"); let mut b = Bytes::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4)); assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test"); assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(b.size(), BodySize::Sized(4)); assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!( assert_eq!(
b.poll_next().unwrap(), poll_fn(|cx| b.poll_next(cx)).await.unwrap().ok(),
Async::Ready(Some(Bytes::from("test"))) Some(Bytes::from("test"))
); );
} }
#[test] #[actix_rt::test]
fn test_bytes_mut() { async fn test_bytes_mut() {
let mut b = BytesMut::from("test"); let mut b = BytesMut::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4)); assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test"); assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(b.size(), BodySize::Sized(4)); assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!( assert_eq!(
b.poll_next().unwrap(), poll_fn(|cx| b.poll_next(cx)).await.unwrap().ok(),
Async::Ready(Some(Bytes::from("test"))) Some(Bytes::from("test"))
); );
} }
#[test] #[actix_rt::test]
fn test_string() { async fn test_string() {
let mut b = "test".to_owned(); let mut b = "test".to_owned();
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4)); assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test"); assert_eq!(Body::from(b.clone()).get_ref(), b"test");
@@ -511,26 +536,26 @@ mod tests {
assert_eq!(b.size(), BodySize::Sized(4)); assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!( assert_eq!(
b.poll_next().unwrap(), poll_fn(|cx| b.poll_next(cx)).await.unwrap().ok(),
Async::Ready(Some(Bytes::from("test"))) Some(Bytes::from("test"))
); );
} }
#[test] #[actix_rt::test]
fn test_unit() { async fn test_unit() {
assert_eq!(().size(), BodySize::Empty); assert_eq!(().size(), BodySize::Empty);
assert_eq!(().poll_next().unwrap(), Async::Ready(None)); assert!(poll_fn(|cx| ().poll_next(cx)).await.is_none());
} }
#[test] #[actix_rt::test]
fn test_box() { async fn test_box() {
let mut val = Box::new(()); let mut val = Box::new(());
assert_eq!(val.size(), BodySize::Empty); assert_eq!(val.size(), BodySize::Empty);
assert_eq!(val.poll_next().unwrap(), Async::Ready(None)); assert!(poll_fn(|cx| val.poll_next(cx)).await.is_none());
} }
#[test] #[actix_rt::test]
fn test_body_eq() { async fn test_body_eq() {
assert!(Body::None == Body::None); assert!(Body::None == Body::None);
assert!(Body::None != Body::Empty); assert!(Body::None != Body::Empty);
assert!(Body::Empty == Body::Empty); assert!(Body::Empty == Body::Empty);
@@ -542,10 +567,23 @@ mod tests {
assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None); assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
} }
#[test] #[actix_rt::test]
fn test_body_debug() { async fn test_body_debug() {
assert!(format!("{:?}", Body::None).contains("Body::None")); assert!(format!("{:?}", Body::None).contains("Body::None"));
assert!(format!("{:?}", Body::Empty).contains("Body::Empty")); assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains("1")); assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains("1"));
} }
#[actix_rt::test]
async fn test_serde_json() {
use serde_json::json;
assert_eq!(
Body::from(serde_json::Value::String("test".into())).size(),
BodySize::Sized(6)
);
assert_eq!(
Body::from(json!({"test-key":"test-value"})).size(),
BodySize::Sized(25)
);
}
} }

View File

@@ -1,10 +1,9 @@
use std::fmt;
use std::marker::PhantomData; use std::marker::PhantomData;
use std::rc::Rc; use std::rc::Rc;
use std::{fmt, net};
use actix_codec::Framed; use actix_codec::Framed;
use actix_server_config::ServerConfig as SrvConfig; use actix_service::{IntoServiceFactory, Service, ServiceFactory};
use actix_service::{IntoNewService, NewService, Service};
use crate::body::MessageBody; use crate::body::MessageBody;
use crate::config::{KeepAlive, ServiceConfig}; use crate::config::{KeepAlive, ServiceConfig};
@@ -24,6 +23,8 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
keep_alive: KeepAlive, keep_alive: KeepAlive,
client_timeout: u64, client_timeout: u64,
client_disconnect: u64, client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
expect: X, expect: X,
upgrade: Option<U>, upgrade: Option<U>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
@@ -32,9 +33,10 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler<T>> impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler<T>>
where where
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
<S::Service as Service>::Future: 'static,
{ {
/// Create instance of `ServiceConfigBuilder` /// Create instance of `ServiceConfigBuilder`
pub fn new() -> Self { pub fn new() -> Self {
@@ -42,6 +44,8 @@ where
keep_alive: KeepAlive::Timeout(5), keep_alive: KeepAlive::Timeout(5),
client_timeout: 5000, client_timeout: 5000,
client_disconnect: 0, client_disconnect: 0,
secure: false,
local_addr: None,
expect: ExpectHandler, expect: ExpectHandler,
upgrade: None, upgrade: None,
on_connect: None, on_connect: None,
@@ -52,19 +56,18 @@ where
impl<T, S, X, U> HttpServiceBuilder<T, S, X, U> impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
where where
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
X: NewService<Config = SrvConfig, Request = Request, Response = Request>, <S::Service as Service>::Future: 'static,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
X::InitError: fmt::Debug, X::InitError: fmt::Debug,
U: NewService< <X::Service as Service>::Future: 'static,
Config = SrvConfig, U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
Request = (Request, Framed<T, Codec>),
Response = (),
>,
U::Error: fmt::Display, U::Error: fmt::Display,
U::InitError: fmt::Debug, U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{ {
/// Set server keep-alive setting. /// Set server keep-alive setting.
/// ///
@@ -74,6 +77,18 @@ where
self self
} }
/// Set connection secure state
pub fn secure(mut self) -> Self {
self.secure = true;
self
}
/// Set the local address that this service is bound to.
pub fn local_addr(mut self, addr: net::SocketAddr) -> Self {
self.local_addr = Some(addr);
self
}
/// Set server client timeout in milliseconds for first request. /// Set server client timeout in milliseconds for first request.
/// ///
/// Defines a timeout for reading client request header. If a client does not transmit /// Defines a timeout for reading client request header. If a client does not transmit
@@ -108,16 +123,19 @@ where
/// request will be forwarded to main service. /// request will be forwarded to main service.
pub fn expect<F, X1>(self, expect: F) -> HttpServiceBuilder<T, S, X1, U> pub fn expect<F, X1>(self, expect: F) -> HttpServiceBuilder<T, S, X1, U>
where where
F: IntoNewService<X1>, F: IntoServiceFactory<X1>,
X1: NewService<Config = SrvConfig, Request = Request, Response = Request>, X1: ServiceFactory<Config = (), Request = Request, Response = Request>,
X1::Error: Into<Error>, X1::Error: Into<Error>,
X1::InitError: fmt::Debug, X1::InitError: fmt::Debug,
<X1::Service as Service>::Future: 'static,
{ {
HttpServiceBuilder { HttpServiceBuilder {
keep_alive: self.keep_alive, keep_alive: self.keep_alive,
client_timeout: self.client_timeout, client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect, client_disconnect: self.client_disconnect,
expect: expect.into_new_service(), secure: self.secure,
local_addr: self.local_addr,
expect: expect.into_factory(),
upgrade: self.upgrade, upgrade: self.upgrade,
on_connect: self.on_connect, on_connect: self.on_connect,
_t: PhantomData, _t: PhantomData,
@@ -130,21 +148,24 @@ where
/// and this service get called with original request and framed object. /// and this service get called with original request and framed object.
pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1> pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
where where
F: IntoNewService<U1>, F: IntoServiceFactory<U1>,
U1: NewService< U1: ServiceFactory<
Config = SrvConfig, Config = (),
Request = (Request, Framed<T, Codec>), Request = (Request, Framed<T, Codec>),
Response = (), Response = (),
>, >,
U1::Error: fmt::Display, U1::Error: fmt::Display,
U1::InitError: fmt::Debug, U1::InitError: fmt::Debug,
<U1::Service as Service>::Future: 'static,
{ {
HttpServiceBuilder { HttpServiceBuilder {
keep_alive: self.keep_alive, keep_alive: self.keep_alive,
client_timeout: self.client_timeout, client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect, client_disconnect: self.client_disconnect,
secure: self.secure,
local_addr: self.local_addr,
expect: self.expect, expect: self.expect,
upgrade: Some(upgrade.into_new_service()), upgrade: Some(upgrade.into_factory()),
on_connect: self.on_connect, on_connect: self.on_connect,
_t: PhantomData, _t: PhantomData,
} }
@@ -164,10 +185,10 @@ where
} }
/// Finish service configuration and create *http service* for HTTP/1 protocol. /// Finish service configuration and create *http service* for HTTP/1 protocol.
pub fn h1<F, P, B>(self, service: F) -> H1Service<T, P, S, B, X, U> pub fn h1<F, B>(self, service: F) -> H1Service<T, S, B, X, U>
where where
B: MessageBody + 'static, B: MessageBody,
F: IntoNewService<S>, F: IntoServiceFactory<S>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
@@ -176,48 +197,53 @@ where
self.keep_alive, self.keep_alive,
self.client_timeout, self.client_timeout,
self.client_disconnect, self.client_disconnect,
self.secure,
self.local_addr,
); );
H1Service::with_config(cfg, service.into_new_service()) H1Service::with_config(cfg, service.into_factory())
.expect(self.expect) .expect(self.expect)
.upgrade(self.upgrade) .upgrade(self.upgrade)
.on_connect(self.on_connect) .on_connect(self.on_connect)
} }
/// Finish service configuration and create *http service* for HTTP/2 protocol. /// Finish service configuration and create *http service* for HTTP/2 protocol.
pub fn h2<F, P, B>(self, service: F) -> H2Service<T, P, S, B> pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
where where
B: MessageBody + 'static, B: MessageBody + 'static,
F: IntoNewService<S>, F: IntoServiceFactory<S>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static, <S::Service as Service>::Future: 'static,
{ {
let cfg = ServiceConfig::new( let cfg = ServiceConfig::new(
self.keep_alive, self.keep_alive,
self.client_timeout, self.client_timeout,
self.client_disconnect, self.client_disconnect,
self.secure,
self.local_addr,
); );
H2Service::with_config(cfg, service.into_new_service()) H2Service::with_config(cfg, service.into_factory()).on_connect(self.on_connect)
.on_connect(self.on_connect)
} }
/// Finish service configuration and create `HttpService` instance. /// Finish service configuration and create `HttpService` instance.
pub fn finish<F, P, B>(self, service: F) -> HttpService<T, P, S, B, X, U> pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
where where
B: MessageBody + 'static, B: MessageBody + 'static,
F: IntoNewService<S>, F: IntoServiceFactory<S>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static, <S::Service as Service>::Future: 'static,
{ {
let cfg = ServiceConfig::new( let cfg = ServiceConfig::new(
self.keep_alive, self.keep_alive,
self.client_timeout, self.client_timeout,
self.client_disconnect, self.client_disconnect,
self.secure,
self.local_addr,
); );
HttpService::with_config(cfg, service.into_new_service()) HttpService::with_config(cfg, service.into_factory())
.expect(self.expect) .expect(self.expect)
.upgrade(self.upgrade) .upgrade(self.upgrade)
.on_connect(self.on_connect) .on_connect(self.on_connect)

View File

@@ -1,10 +1,12 @@
use std::{fmt, io, time}; use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, io, mem, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed}; use actix_codec::{AsyncRead, AsyncWrite, Framed};
use bytes::{Buf, Bytes}; use bytes::{Buf, Bytes};
use futures::future::{err, Either, Future, FutureResult}; use futures::future::{err, Either, Future, FutureExt, LocalBoxFuture, Ready};
use futures::Poll;
use h2::client::SendRequest; use h2::client::SendRequest;
use pin_project::{pin_project, project};
use crate::body::MessageBody; use crate::body::MessageBody;
use crate::h1::ClientCodec; use crate::h1::ClientCodec;
@@ -21,8 +23,8 @@ pub(crate) enum ConnectionType<Io> {
} }
pub trait Connection { pub trait Connection {
type Io: AsyncRead + AsyncWrite; type Io: AsyncRead + AsyncWrite + Unpin;
type Future: Future<Item = (ResponseHead, Payload), Error = SendRequestError>; type Future: Future<Output = Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol; fn protocol(&self) -> Protocol;
@@ -34,8 +36,7 @@ pub trait Connection {
) -> Self::Future; ) -> Self::Future;
type TunnelFuture: Future< type TunnelFuture: Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>), Output = Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
Error = SendRequestError,
>; >;
/// Send request, returns Response and Framed /// Send request, returns Response and Framed
@@ -71,7 +72,7 @@ where
} }
} }
impl<T: AsyncRead + AsyncWrite> IoConnection<T> { impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
pub(crate) fn new( pub(crate) fn new(
io: ConnectionType<T>, io: ConnectionType<T>,
created: time::Instant, created: time::Instant,
@@ -91,11 +92,11 @@ impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
impl<T> Connection for IoConnection<T> impl<T> Connection for IoConnection<T>
where where
T: AsyncRead + AsyncWrite + 'static, T: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
type Io = T; type Io = T;
type Future = type Future =
Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>; LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol { fn protocol(&self) -> Protocol {
match self.io { match self.io {
@@ -111,38 +112,30 @@ where
body: B, body: B,
) -> Self::Future { ) -> Self::Future {
match self.io.take().unwrap() { match self.io.take().unwrap() {
ConnectionType::H1(io) => Box::new(h1proto::send_request( ConnectionType::H1(io) => {
io, h1proto::send_request(io, head.into(), body, self.created, self.pool)
head.into(), .boxed_local()
body, }
self.created, ConnectionType::H2(io) => {
self.pool, h2proto::send_request(io, head.into(), body, self.created, self.pool)
)), .boxed_local()
ConnectionType::H2(io) => Box::new(h2proto::send_request( }
io,
head.into(),
body,
self.created,
self.pool,
)),
} }
} }
type TunnelFuture = Either< type TunnelFuture = Either<
Box< LocalBoxFuture<
dyn Future< 'static,
Item = (ResponseHead, Framed<Self::Io, ClientCodec>), Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
Error = SendRequestError,
>, >,
>, Ready<Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>>,
FutureResult<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>; >;
/// Send request, returns Response and Framed /// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture { fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
match self.io.take().unwrap() { match self.io.take().unwrap() {
ConnectionType::H1(io) => { ConnectionType::H1(io) => {
Either::A(Box::new(h1proto::open_tunnel(io, head.into()))) Either::Left(h1proto::open_tunnel(io, head.into()).boxed_local())
} }
ConnectionType::H2(io) => { ConnectionType::H2(io) => {
if let Some(mut pool) = self.pool.take() { if let Some(mut pool) = self.pool.take() {
@@ -152,7 +145,7 @@ where
None, None,
)); ));
} }
Either::B(err(SendRequestError::TunnelNotSupported)) Either::Right(err(SendRequestError::TunnelNotSupported))
} }
} }
} }
@@ -166,12 +159,12 @@ pub(crate) enum EitherConnection<A, B> {
impl<A, B> Connection for EitherConnection<A, B> impl<A, B> Connection for EitherConnection<A, B>
where where
A: AsyncRead + AsyncWrite + 'static, A: AsyncRead + AsyncWrite + Unpin + 'static,
B: AsyncRead + AsyncWrite + 'static, B: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
type Io = EitherIo<A, B>; type Io = EitherIo<A, B>;
type Future = type Future =
Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>; LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol { fn protocol(&self) -> Protocol {
match self { match self {
@@ -191,44 +184,30 @@ where
} }
} }
type TunnelFuture = Box< type TunnelFuture = LocalBoxFuture<
dyn Future< 'static,
Item = (ResponseHead, Framed<Self::Io, ClientCodec>), Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
Error = SendRequestError,
>,
>; >;
/// Send request, returns Response and Framed /// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture { fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
match self { match self {
EitherConnection::A(con) => Box::new( EitherConnection::A(con) => con
con.open_tunnel(head) .open_tunnel(head)
.map(|(head, framed)| (head, framed.map_io(EitherIo::A))), .map(|res| res.map(|(head, framed)| (head, framed.map_io(EitherIo::A))))
), .boxed_local(),
EitherConnection::B(con) => Box::new( EitherConnection::B(con) => con
con.open_tunnel(head) .open_tunnel(head)
.map(|(head, framed)| (head, framed.map_io(EitherIo::B))), .map(|res| res.map(|(head, framed)| (head, framed.map_io(EitherIo::B))))
), .boxed_local(),
} }
} }
} }
#[pin_project]
pub enum EitherIo<A, B> { pub enum EitherIo<A, B> {
A(A), A(#[pin] A),
B(B), B(#[pin] B),
}
impl<A, B> io::Read for EitherIo<A, B>
where
A: io::Read,
B: io::Read,
{
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
match self {
EitherIo::A(ref mut val) => val.read(buf),
EitherIo::B(ref mut val) => val.read(buf),
}
}
} }
impl<A, B> AsyncRead for EitherIo<A, B> impl<A, B> AsyncRead for EitherIo<A, B>
@@ -236,7 +215,23 @@ where
A: AsyncRead, A: AsyncRead,
B: AsyncRead, B: AsyncRead,
{ {
unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool { #[project]
fn poll_read(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut [u8],
) -> Poll<io::Result<usize>> {
#[project]
match self.project() {
EitherIo::A(val) => val.poll_read(cx, buf),
EitherIo::B(val) => val.poll_read(cx, buf),
}
}
unsafe fn prepare_uninitialized_buffer(
&self,
buf: &mut [mem::MaybeUninit<u8>],
) -> bool {
match self { match self {
EitherIo::A(ref val) => val.prepare_uninitialized_buffer(buf), EitherIo::A(ref val) => val.prepare_uninitialized_buffer(buf),
EitherIo::B(ref val) => val.prepare_uninitialized_buffer(buf), EitherIo::B(ref val) => val.prepare_uninitialized_buffer(buf),
@@ -244,45 +239,58 @@ where
} }
} }
impl<A, B> io::Write for EitherIo<A, B>
where
A: io::Write,
B: io::Write,
{
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
match self {
EitherIo::A(ref mut val) => val.write(buf),
EitherIo::B(ref mut val) => val.write(buf),
}
}
fn flush(&mut self) -> io::Result<()> {
match self {
EitherIo::A(ref mut val) => val.flush(),
EitherIo::B(ref mut val) => val.flush(),
}
}
}
impl<A, B> AsyncWrite for EitherIo<A, B> impl<A, B> AsyncWrite for EitherIo<A, B>
where where
A: AsyncWrite, A: AsyncWrite,
B: AsyncWrite, B: AsyncWrite,
{ {
fn shutdown(&mut self) -> Poll<(), io::Error> { #[project]
match self { fn poll_write(
EitherIo::A(ref mut val) => val.shutdown(), self: Pin<&mut Self>,
EitherIo::B(ref mut val) => val.shutdown(), cx: &mut Context,
buf: &[u8],
) -> Poll<io::Result<usize>> {
#[project]
match self.project() {
EitherIo::A(val) => val.poll_write(cx, buf),
EitherIo::B(val) => val.poll_write(cx, buf),
} }
} }
fn write_buf<U: Buf>(&mut self, buf: &mut U) -> Poll<usize, io::Error> #[project]
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
#[project]
match self.project() {
EitherIo::A(val) => val.poll_flush(cx),
EitherIo::B(val) => val.poll_flush(cx),
}
}
#[project]
fn poll_shutdown(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
#[project]
match self.project() {
EitherIo::A(val) => val.poll_shutdown(cx),
EitherIo::B(val) => val.poll_shutdown(cx),
}
}
#[project]
fn poll_write_buf<U: Buf>(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut U,
) -> Poll<Result<usize, io::Error>>
where where
Self: Sized, Self: Sized,
{ {
match self { #[project]
EitherIo::A(ref mut val) => val.write_buf(buf), match self.project() {
EitherIo::B(ref mut val) => val.write_buf(buf), EitherIo::A(val) => val.poll_write_buf(cx, buf),
EitherIo::B(val) => val.poll_write_buf(cx, buf),
} }
} }
} }

View File

@@ -6,32 +6,32 @@ use actix_codec::{AsyncRead, AsyncWrite};
use actix_connect::{ use actix_connect::{
default_connector, Connect as TcpConnect, Connection as TcpConnection, default_connector, Connect as TcpConnect, Connection as TcpConnection,
}; };
use actix_service::{apply_fn, Service, ServiceExt}; use actix_rt::net::TcpStream;
use actix_service::{apply_fn, Service};
use actix_utils::timeout::{TimeoutError, TimeoutService}; use actix_utils::timeout::{TimeoutError, TimeoutService};
use http::Uri; use http::Uri;
use tokio_tcp::TcpStream;
use super::connection::Connection; use super::connection::Connection;
use super::error::ConnectError; use super::error::ConnectError;
use super::pool::{ConnectionPool, Protocol}; use super::pool::{ConnectionPool, Protocol};
use super::Connect; use super::Connect;
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
use openssl::ssl::SslConnector as OpensslConnector; use actix_connect::ssl::openssl::SslConnector as OpensslConnector;
#[cfg(feature = "rust-tls")] #[cfg(feature = "rustls")]
use rustls::ClientConfig; use actix_connect::ssl::rustls::ClientConfig;
#[cfg(feature = "rust-tls")] #[cfg(feature = "rustls")]
use std::sync::Arc; use std::sync::Arc;
#[cfg(any(feature = "ssl", feature = "rust-tls"))] #[cfg(any(feature = "openssl", feature = "rustls"))]
enum SslConnector { enum SslConnector {
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
Openssl(OpensslConnector), Openssl(OpensslConnector),
#[cfg(feature = "rust-tls")] #[cfg(feature = "rustls")]
Rustls(Arc<ClientConfig>), Rustls(Arc<ClientConfig>),
} }
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))] #[cfg(not(any(feature = "openssl", feature = "rustls")))]
type SslConnector = (); type SslConnector = ();
/// Manages http client network connectivity /// Manages http client network connectivity
@@ -58,8 +58,8 @@ pub struct Connector<T, U> {
_t: PhantomData<U>, _t: PhantomData<U>,
} }
trait Io: AsyncRead + AsyncWrite {} trait Io: AsyncRead + AsyncWrite + Unpin {}
impl<T: AsyncRead + AsyncWrite> Io for T {} impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
impl Connector<(), ()> { impl Connector<(), ()> {
#[allow(clippy::new_ret_no_self)] #[allow(clippy::new_ret_no_self)]
@@ -72,9 +72,9 @@ impl Connector<(), ()> {
TcpStream, TcpStream,
> { > {
let ssl = { let ssl = {
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
{ {
use openssl::ssl::SslMethod; use actix_connect::ssl::openssl::SslMethod;
let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap(); let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
let _ = ssl let _ = ssl
@@ -82,17 +82,17 @@ impl Connector<(), ()> {
.map_err(|e| error!("Can not set alpn protocol: {:?}", e)); .map_err(|e| error!("Can not set alpn protocol: {:?}", e));
SslConnector::Openssl(ssl.build()) SslConnector::Openssl(ssl.build())
} }
#[cfg(all(not(feature = "ssl"), feature = "rust-tls"))] #[cfg(all(not(feature = "openssl"), feature = "rustls"))]
{ {
let protos = vec![b"h2".to_vec(), b"http/1.1".to_vec()]; let protos = vec![b"h2".to_vec(), b"http/1.1".to_vec()];
let mut config = ClientConfig::new(); let mut config = ClientConfig::new();
config.set_protocols(&protos); config.set_protocols(&protos);
config config.root_store.add_server_trust_anchors(
.root_store &actix_connect::ssl::rustls::TLS_SERVER_ROOTS,
.add_server_trust_anchors(&webpki_roots::TLS_SERVER_ROOTS); );
SslConnector::Rustls(Arc::new(config)) SslConnector::Rustls(Arc::new(config))
} }
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))] #[cfg(not(any(feature = "openssl", feature = "rustls")))]
{} {}
}; };
@@ -113,7 +113,7 @@ impl<T, U> Connector<T, U> {
/// Use custom connector. /// Use custom connector.
pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1> pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
where where
U1: AsyncRead + AsyncWrite + fmt::Debug, U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
T1: Service< T1: Service<
Request = TcpConnect<Uri>, Request = TcpConnect<Uri>,
Response = TcpConnection<Uri, U1>, Response = TcpConnection<Uri, U1>,
@@ -135,7 +135,7 @@ impl<T, U> Connector<T, U> {
impl<T, U> Connector<T, U> impl<T, U> Connector<T, U>
where where
U: AsyncRead + AsyncWrite + fmt::Debug + 'static, U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
T: Service< T: Service<
Request = TcpConnect<Uri>, Request = TcpConnect<Uri>,
Response = TcpConnection<Uri, U>, Response = TcpConnection<Uri, U>,
@@ -150,14 +150,14 @@ where
self self
} }
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
/// Use custom `SslConnector` instance. /// Use custom `SslConnector` instance.
pub fn ssl(mut self, connector: OpensslConnector) -> Self { pub fn ssl(mut self, connector: OpensslConnector) -> Self {
self.ssl = SslConnector::Openssl(connector); self.ssl = SslConnector::Openssl(connector);
self self
} }
#[cfg(feature = "rust-tls")] #[cfg(feature = "rustls")]
pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self { pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
self.ssl = SslConnector::Rustls(connector); self.ssl = SslConnector::Rustls(connector);
self self
@@ -213,7 +213,7 @@ where
self, self,
) -> impl Service<Request = Connect, Response = impl Connection, Error = ConnectError> ) -> impl Service<Request = Connect, Response = impl Connection, Error = ConnectError>
+ Clone { + Clone {
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))] #[cfg(not(any(feature = "openssl", feature = "rustls")))]
{ {
let connector = TimeoutService::new( let connector = TimeoutService::new(
self.timeout, self.timeout,
@@ -238,32 +238,30 @@ where
), ),
} }
} }
#[cfg(any(feature = "ssl", feature = "rust-tls"))] #[cfg(any(feature = "openssl", feature = "rustls"))]
{ {
const H2: &[u8] = b"h2"; const H2: &[u8] = b"h2";
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
use actix_connect::ssl::OpensslConnector; use actix_connect::ssl::openssl::OpensslConnector;
#[cfg(feature = "rust-tls")] #[cfg(feature = "rustls")]
use actix_connect::ssl::RustlsConnector; use actix_connect::ssl::rustls::{RustlsConnector, Session};
use actix_service::boxed::service; use actix_service::{boxed::service, pipeline};
#[cfg(feature = "rust-tls")]
use rustls::Session;
let ssl_service = TimeoutService::new( let ssl_service = TimeoutService::new(
self.timeout, self.timeout,
pipeline(
apply_fn(self.connector.clone(), |msg: Connect, srv| { apply_fn(self.connector.clone(), |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr)) srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
}) })
.map_err(ConnectError::from) .map_err(ConnectError::from),
)
.and_then(match self.ssl { .and_then(match self.ssl {
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
SslConnector::Openssl(ssl) => service( SslConnector::Openssl(ssl) => service(
OpensslConnector::service(ssl) OpensslConnector::service(ssl)
.map_err(ConnectError::from)
.map(|stream| { .map(|stream| {
let sock = stream.into_parts().0; let sock = stream.into_parts().0;
let h2 = sock let h2 = sock
.get_ref()
.ssl() .ssl()
.selected_alpn_protocol() .selected_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2)) .map(|protos| protos.windows(2).any(|w| w == H2))
@@ -273,9 +271,10 @@ where
} else { } else {
(Box::new(sock) as Box<dyn Io>, Protocol::Http1) (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
} }
}), })
.map_err(ConnectError::from),
), ),
#[cfg(feature = "rust-tls")] #[cfg(feature = "rustls")]
SslConnector::Rustls(ssl) => service( SslConnector::Rustls(ssl) => service(
RustlsConnector::service(ssl) RustlsConnector::service(ssl)
.map_err(ConnectError::from) .map_err(ConnectError::from)
@@ -303,7 +302,7 @@ where
let tcp_service = TimeoutService::new( let tcp_service = TimeoutService::new(
self.timeout, self.timeout,
apply_fn(self.connector.clone(), |msg: Connect, srv| { apply_fn(self.connector, |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr)) srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
}) })
.map_err(ConnectError::from) .map_err(ConnectError::from)
@@ -334,19 +333,19 @@ where
} }
} }
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))] #[cfg(not(any(feature = "openssl", feature = "rustls")))]
mod connect_impl { mod connect_impl {
use futures::future::{err, Either, FutureResult}; use std::task::{Context, Poll};
use futures::Poll;
use futures::future::{err, Either, Ready};
use super::*; use super::*;
use crate::client::connection::IoConnection; use crate::client::connection::IoConnection;
pub(crate) struct InnerConnector<T, Io> pub(crate) struct InnerConnector<T, Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError> T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
{ {
pub(crate) tcp_pool: ConnectionPool<T, Io>, pub(crate) tcp_pool: ConnectionPool<T, Io>,
@@ -354,9 +353,8 @@ mod connect_impl {
impl<T, Io> Clone for InnerConnector<T, Io> impl<T, Io> Clone for InnerConnector<T, Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError> T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
{ {
fn clone(&self) -> Self { fn clone(&self) -> Self {
@@ -368,9 +366,8 @@ mod connect_impl {
impl<T, Io> Service for InnerConnector<T, Io> impl<T, Io> Service for InnerConnector<T, Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError> T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
{ {
type Request = Connect; type Request = Connect;
@@ -378,38 +375,41 @@ mod connect_impl {
type Error = ConnectError; type Error = ConnectError;
type Future = Either< type Future = Either<
<ConnectionPool<T, Io> as Service>::Future, <ConnectionPool<T, Io> as Service>::Future,
FutureResult<IoConnection<Io>, ConnectError>, Ready<Result<IoConnection<Io>, ConnectError>>,
>; >;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready() self.tcp_pool.poll_ready(cx)
} }
fn call(&mut self, req: Connect) -> Self::Future { fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() { match req.uri.scheme_str() {
Some("https") | Some("wss") => { Some("https") | Some("wss") => {
Either::B(err(ConnectError::SslIsNotSupported)) Either::Right(err(ConnectError::SslIsNotSupported))
} }
_ => Either::A(self.tcp_pool.call(req)), _ => Either::Left(self.tcp_pool.call(req)),
} }
} }
} }
} }
#[cfg(any(feature = "ssl", feature = "rust-tls"))] #[cfg(any(feature = "openssl", feature = "rustls"))]
mod connect_impl { mod connect_impl {
use std::future::Future;
use std::marker::PhantomData; use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use futures::future::{Either, FutureResult}; use futures::future::Either;
use futures::{Async, Future, Poll}; use futures::ready;
use super::*; use super::*;
use crate::client::connection::EitherConnection; use crate::client::connection::EitherConnection;
pub(crate) struct InnerConnector<T1, T2, Io1, Io2> pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
where where
Io1: AsyncRead + AsyncWrite + 'static, Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + 'static, Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>, T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>, T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>,
{ {
@@ -419,13 +419,11 @@ mod connect_impl {
impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2> impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
where where
Io1: AsyncRead + AsyncWrite + 'static, Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + 'static, Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError> T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError> T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
{ {
fn clone(&self) -> Self { fn clone(&self) -> Self {
@@ -438,53 +436,47 @@ mod connect_impl {
impl<T1, T2, Io1, Io2> Service for InnerConnector<T1, T2, Io1, Io2> impl<T1, T2, Io1, Io2> Service for InnerConnector<T1, T2, Io1, Io2>
where where
Io1: AsyncRead + AsyncWrite + 'static, Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + 'static, Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError> T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError> T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
{ {
type Request = Connect; type Request = Connect;
type Response = EitherConnection<Io1, Io2>; type Response = EitherConnection<Io1, Io2>;
type Error = ConnectError; type Error = ConnectError;
type Future = Either< type Future = Either<
FutureResult<Self::Response, Self::Error>,
Either<
InnerConnectorResponseA<T1, Io1, Io2>, InnerConnectorResponseA<T1, Io1, Io2>,
InnerConnectorResponseB<T2, Io1, Io2>, InnerConnectorResponseB<T2, Io1, Io2>,
>,
>; >;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready() self.tcp_pool.poll_ready(cx)
} }
fn call(&mut self, req: Connect) -> Self::Future { fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() { match req.uri.scheme_str() {
Some("https") | Some("wss") => { Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
Either::B(Either::B(InnerConnectorResponseB {
fut: self.ssl_pool.call(req), fut: self.ssl_pool.call(req),
_t: PhantomData, _t: PhantomData,
})) }),
} _ => Either::Left(InnerConnectorResponseA {
_ => Either::B(Either::A(InnerConnectorResponseA {
fut: self.tcp_pool.call(req), fut: self.tcp_pool.call(req),
_t: PhantomData, _t: PhantomData,
})), }),
} }
} }
} }
#[pin_project::pin_project]
pub(crate) struct InnerConnectorResponseA<T, Io1, Io2> pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
where where
Io1: AsyncRead + AsyncWrite + 'static, Io1: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError> T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
{ {
#[pin]
fut: <ConnectionPool<T, Io1> as Service>::Future, fut: <ConnectionPool<T, Io1> as Service>::Future,
_t: PhantomData<Io2>, _t: PhantomData<Io2>,
} }
@@ -492,29 +484,28 @@ mod connect_impl {
impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2> impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
where where
T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError> T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
Io1: AsyncRead + AsyncWrite + 'static, Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + 'static, Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
type Item = EitherConnection<Io1, Io2>; type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
match self.fut.poll()? { Poll::Ready(
Async::NotReady => Ok(Async::NotReady), ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
Async::Ready(res) => Ok(Async::Ready(EitherConnection::A(res))), .map(|res| EitherConnection::A(res)),
} )
} }
} }
#[pin_project::pin_project]
pub(crate) struct InnerConnectorResponseB<T, Io1, Io2> pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
where where
Io2: AsyncRead + AsyncWrite + 'static, Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError> T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
{ {
#[pin]
fut: <ConnectionPool<T, Io2> as Service>::Future, fut: <ConnectionPool<T, Io2> as Service>::Future,
_t: PhantomData<Io1>, _t: PhantomData<Io1>,
} }
@@ -522,19 +513,17 @@ mod connect_impl {
impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2> impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
where where
T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError> T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
Io1: AsyncRead + AsyncWrite + 'static, Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + 'static, Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
type Item = EitherConnection<Io1, Io2>; type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
match self.fut.poll()? { Poll::Ready(
Async::NotReady => Ok(Async::NotReady), ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
Async::Ready(res) => Ok(Async::Ready(EitherConnection::B(res))), .map(|res| EitherConnection::B(res)),
} )
} }
} }
} }

View File

@@ -1,14 +1,13 @@
use std::io; use std::io;
use actix_connect::resolver::ResolveError;
use derive_more::{Display, From}; use derive_more::{Display, From};
use trust_dns_resolver::error::ResolveError;
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
use openssl::ssl::{Error as SslError, HandshakeError}; use actix_connect::ssl::openssl::{HandshakeError, SslError};
use crate::error::{Error, ParseError, ResponseError}; use crate::error::{Error, ParseError, ResponseError};
use crate::http::Error as HttpError; use crate::http::{Error as HttpError, StatusCode};
use crate::response::Response;
/// A set of errors that can occur while connecting to an HTTP host /// A set of errors that can occur while connecting to an HTTP host
#[derive(Debug, Display, From)] #[derive(Debug, Display, From)]
@@ -18,10 +17,15 @@ pub enum ConnectError {
SslIsNotSupported, SslIsNotSupported,
/// SSL error /// SSL error
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
#[display(fmt = "{}", _0)] #[display(fmt = "{}", _0)]
SslError(SslError), SslError(SslError),
/// SSL Handshake error
#[cfg(feature = "openssl")]
#[display(fmt = "{}", _0)]
SslHandshakeError(String),
/// Failed to resolve the hostname /// Failed to resolve the hostname
#[display(fmt = "Failed resolving hostname: {}", _0)] #[display(fmt = "Failed resolving hostname: {}", _0)]
Resolver(ResolveError), Resolver(ResolveError),
@@ -63,14 +67,10 @@ impl From<actix_connect::ConnectError> for ConnectError {
} }
} }
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
impl<T> From<HandshakeError<T>> for ConnectError { impl<T: std::fmt::Debug> From<HandshakeError<T>> for ConnectError {
fn from(err: HandshakeError<T>) -> ConnectError { fn from(err: HandshakeError<T>) -> ConnectError {
match err { ConnectError::SslHandshakeError(format!("{:?}", err))
HandshakeError::SetupFailure(stack) => SslError::from(stack).into(),
HandshakeError::Failure(stream) => stream.into_error().into(),
HandshakeError::WouldBlock(stream) => stream.into_error().into(),
}
} }
} }
@@ -117,15 +117,14 @@ pub enum SendRequestError {
/// Convert `SendRequestError` to a server `Response` /// Convert `SendRequestError` to a server `Response`
impl ResponseError for SendRequestError { impl ResponseError for SendRequestError {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
match *self { match *self {
SendRequestError::Connect(ConnectError::Timeout) => { SendRequestError::Connect(ConnectError::Timeout) => {
Response::GatewayTimeout() StatusCode::GATEWAY_TIMEOUT
} }
SendRequestError::Connect(_) => Response::BadGateway(), SendRequestError::Connect(_) => StatusCode::BAD_REQUEST,
_ => Response::InternalServerError(), _ => StatusCode::INTERNAL_SERVER_ERROR,
} }
.into()
} }
} }

View File

@@ -1,10 +1,13 @@
use std::io::Write; use std::io::Write;
use std::{io, time}; use std::pin::Pin;
use std::task::{Context, Poll};
use std::{io, mem, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed}; use actix_codec::{AsyncRead, AsyncWrite, Framed};
use bytes::{BufMut, Bytes, BytesMut}; use bytes::buf::BufMutExt;
use futures::future::{ok, Either}; use bytes::{Bytes, BytesMut};
use futures::{Async, Future, Poll, Sink, Stream}; use futures::future::poll_fn;
use futures::{SinkExt, Stream, StreamExt};
use crate::error::PayloadError; use crate::error::PayloadError;
use crate::h1; use crate::h1;
@@ -18,15 +21,15 @@ use super::error::{ConnectError, SendRequestError};
use super::pool::Acquired; use super::pool::Acquired;
use crate::body::{BodySize, MessageBody}; use crate::body::{BodySize, MessageBody};
pub(crate) fn send_request<T, B>( pub(crate) async fn send_request<T, B>(
io: T, io: T,
mut head: RequestHeadType, mut head: RequestHeadType,
body: B, body: B,
created: time::Instant, created: time::Instant,
pool: Option<Acquired<T>>, pool: Option<Acquired<T>>,
) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError> ) -> Result<(ResponseHead, Payload), SendRequestError>
where where
T: AsyncRead + AsyncWrite + 'static, T: AsyncRead + AsyncWrite + Unpin + 'static,
B: MessageBody, B: MessageBody,
{ {
// set request host header // set request host header
@@ -41,7 +44,7 @@ where
Some(port) => write!(wrt, "{}:{}", host, port), Some(port) => write!(wrt, "{}:{}", host, port),
}; };
match wrt.get_mut().take().freeze().try_into() { match wrt.get_mut().split().freeze().try_into() {
Ok(value) => match head { Ok(value) => match head {
RequestHeadType::Owned(ref mut head) => { RequestHeadType::Owned(ref mut head) => {
head.headers.insert(HOST, value) head.headers.insert(HOST, value)
@@ -62,68 +65,99 @@ where
io: Some(io), io: Some(io),
}; };
let len = body.size();
// create Framed and send request // create Framed and send request
Framed::new(io, h1::ClientCodec::default()) let mut framed = Framed::new(io, h1::ClientCodec::default());
.send((head, len).into()) framed.send((head, body.size()).into()).await?;
.from_err()
// send request body // send request body
.and_then(move |framed| match body.size() { match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => { BodySize::None | BodySize::Empty | BodySize::Sized(0) => (),
Either::A(ok(framed)) _ => send_body(body, &mut framed).await?,
} };
_ => Either::B(SendBody::new(body, framed)),
})
// read response and init read body // read response and init read body
.and_then(|framed| { let res = framed.into_future().await;
framed let (head, framed) = if let (Some(result), framed) = res {
.into_future() let item = result.map_err(SendRequestError::from)?;
.map_err(|(e, _)| SendRequestError::from(e)) (item, framed)
.and_then(|(item, framed)| { } else {
if let Some(res) = item { return Err(SendRequestError::from(ConnectError::Disconnected));
};
match framed.get_codec().message_type() { match framed.get_codec().message_type() {
h1::MessageType::None => { h1::MessageType::None => {
let force_close = !framed.get_codec().keepalive(); let force_close = !framed.get_codec().keepalive();
release_connection(framed, force_close); release_connection(framed, force_close);
Ok((res, Payload::None)) Ok((head, Payload::None))
} }
_ => { _ => {
let pl: PayloadStream = Box::new(PlStream::new(framed)); let pl: PayloadStream = PlStream::new(framed).boxed_local();
Ok((res, pl.into())) Ok((head, pl.into()))
} }
} }
} else {
Err(ConnectError::Disconnected.into())
}
})
})
} }
pub(crate) fn open_tunnel<T>( pub(crate) async fn open_tunnel<T>(
io: T, io: T,
head: RequestHeadType, head: RequestHeadType,
) -> impl Future<Item = (ResponseHead, Framed<T, h1::ClientCodec>), Error = SendRequestError> ) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
where where
T: AsyncRead + AsyncWrite + 'static, T: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
// create Framed and send request // create Framed and send request
Framed::new(io, h1::ClientCodec::default()) let mut framed = Framed::new(io, h1::ClientCodec::default());
.send((head, BodySize::None).into()) framed.send((head, BodySize::None).into()).await?;
.from_err()
// read response // read response
.and_then(|framed| { if let (Some(result), framed) = framed.into_future().await {
framed let head = result.map_err(SendRequestError::from)?;
.into_future()
.map_err(|(e, _)| SendRequestError::from(e))
.and_then(|(head, framed)| {
if let Some(head) = head {
Ok((head, framed)) Ok((head, framed))
} else { } else {
Err(SendRequestError::from(ConnectError::Disconnected)) Err(SendRequestError::from(ConnectError::Disconnected))
} }
}
/// send request body to the peer
pub(crate) async fn send_body<I, B>(
mut body: B,
framed: &mut Framed<I, h1::ClientCodec>,
) -> Result<(), SendRequestError>
where
I: ConnectionLifetime,
B: MessageBody,
{
let mut eof = false;
while !eof {
while !eof && !framed.is_write_buf_full() {
match poll_fn(|cx| body.poll_next(cx)).await {
Some(result) => {
framed.write(h1::Message::Chunk(Some(result?)))?;
}
None => {
eof = true;
framed.write(h1::Message::Chunk(None))?;
}
}
}
if !framed.is_write_buf_empty() {
poll_fn(|cx| match framed.flush(cx) {
Poll::Ready(Ok(_)) => Poll::Ready(Ok(())),
Poll::Ready(Err(err)) => Poll::Ready(Err(err)),
Poll::Pending => {
if !framed.is_write_buf_full() {
Poll::Ready(Ok(()))
} else {
Poll::Pending
}
}
}) })
}) .await?;
}
}
SinkExt::flush(framed).await?;
Ok(())
} }
#[doc(hidden)] #[doc(hidden)]
@@ -134,7 +168,10 @@ pub struct H1Connection<T> {
pool: Option<Acquired<T>>, pool: Option<Acquired<T>>,
} }
impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T> { impl<T> ConnectionLifetime for H1Connection<T>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
/// Close connection /// Close connection
fn close(&mut self) { fn close(&mut self) {
if let Some(mut pool) = self.pool.take() { if let Some(mut pool) = self.pool.take() {
@@ -162,98 +199,44 @@ impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T>
} }
} }
impl<T: AsyncRead + AsyncWrite + 'static> io::Read for H1Connection<T> { impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> { unsafe fn prepare_uninitialized_buffer(
self.io.as_mut().unwrap().read(buf) &self,
buf: &mut [mem::MaybeUninit<u8>],
) -> bool {
self.io.as_ref().unwrap().prepare_uninitialized_buffer(buf)
}
fn poll_read(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut [u8],
) -> Poll<io::Result<usize>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
} }
} }
impl<T: AsyncRead + AsyncWrite + 'static> AsyncRead for H1Connection<T> {} impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
fn poll_write(
impl<T: AsyncRead + AsyncWrite + 'static> io::Write for H1Connection<T> { mut self: Pin<&mut Self>,
fn write(&mut self, buf: &[u8]) -> io::Result<usize> { cx: &mut Context<'_>,
self.io.as_mut().unwrap().write(buf) buf: &[u8],
) -> Poll<io::Result<usize>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
} }
fn flush(&mut self) -> io::Result<()> { fn poll_flush(
self.io.as_mut().unwrap().flush() mut self: Pin<&mut Self>,
} cx: &mut Context<'_>,
} ) -> Poll<io::Result<()>> {
Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
impl<T: AsyncRead + AsyncWrite + 'static> AsyncWrite for H1Connection<T> {
fn shutdown(&mut self) -> Poll<(), io::Error> {
self.io.as_mut().unwrap().shutdown()
}
}
/// Future responsible for sending request body to the peer
pub(crate) struct SendBody<I, B> {
body: Option<B>,
framed: Option<Framed<I, h1::ClientCodec>>,
flushed: bool,
}
impl<I, B> SendBody<I, B>
where
I: AsyncRead + AsyncWrite + 'static,
B: MessageBody,
{
pub(crate) fn new(body: B, framed: Framed<I, h1::ClientCodec>) -> Self {
SendBody {
body: Some(body),
framed: Some(framed),
flushed: true,
}
}
}
impl<I, B> Future for SendBody<I, B>
where
I: ConnectionLifetime,
B: MessageBody,
{
type Item = Framed<I, h1::ClientCodec>;
type Error = SendRequestError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let mut body_ready = true;
loop {
while body_ready
&& self.body.is_some()
&& !self.framed.as_ref().unwrap().is_write_buf_full()
{
match self.body.as_mut().unwrap().poll_next()? {
Async::Ready(item) => {
// check if body is done
if item.is_none() {
let _ = self.body.take();
}
self.flushed = false;
self.framed
.as_mut()
.unwrap()
.force_send(h1::Message::Chunk(item))?;
break;
}
Async::NotReady => body_ready = false,
}
} }
if !self.flushed { fn poll_shutdown(
match self.framed.as_mut().unwrap().poll_complete()? { mut self: Pin<&mut Self>,
Async::Ready(_) => { cx: &mut Context,
self.flushed = true; ) -> Poll<Result<(), io::Error>> {
continue; Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
}
Async::NotReady => return Ok(Async::NotReady),
}
}
if self.body.is_none() {
return Ok(Async::Ready(self.framed.take().unwrap()));
}
return Ok(Async::NotReady);
}
} }
} }
@@ -270,23 +253,24 @@ impl<Io: ConnectionLifetime> PlStream<Io> {
} }
impl<Io: ConnectionLifetime> Stream for PlStream<Io> { impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
type Item = Bytes; type Item = Result<Bytes, PayloadError>;
type Error = PayloadError;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> { fn poll_next(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Option<Self::Item>> {
match self.framed.as_mut().unwrap().poll()? { let this = self.get_mut();
Async::NotReady => Ok(Async::NotReady),
Async::Ready(Some(chunk)) => { match this.framed.as_mut().unwrap().next_item(cx)? {
Poll::Pending => Poll::Pending,
Poll::Ready(Some(chunk)) => {
if let Some(chunk) = chunk { if let Some(chunk) = chunk {
Ok(Async::Ready(Some(chunk))) Poll::Ready(Some(Ok(chunk)))
} else { } else {
let framed = self.framed.take().unwrap(); let framed = this.framed.take().unwrap();
let force_close = !framed.get_codec().keepalive(); let force_close = !framed.get_codec().keepalive();
release_connection(framed, force_close); release_connection(framed, force_close);
Ok(Async::Ready(None)) Poll::Ready(None)
} }
} }
Async::Ready(None) => Ok(Async::Ready(None)), Poll::Ready(None) => Poll::Ready(None),
} }
} }
} }

View File

@@ -1,12 +1,12 @@
use std::convert::TryFrom;
use std::time; use std::time;
use actix_codec::{AsyncRead, AsyncWrite}; use actix_codec::{AsyncRead, AsyncWrite};
use bytes::Bytes; use bytes::Bytes;
use futures::future::{err, Either}; use futures::future::poll_fn;
use futures::{Async, Future, Poll};
use h2::{client::SendRequest, SendStream}; use h2::{client::SendRequest, SendStream};
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING}; use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING};
use http::{request::Request, HttpTryFrom, Method, Version}; use http::{request::Request, Method, Version};
use crate::body::{BodySize, MessageBody}; use crate::body::{BodySize, MessageBody};
use crate::header::HeaderMap; use crate::header::HeaderMap;
@@ -17,15 +17,15 @@ use super::connection::{ConnectionType, IoConnection};
use super::error::SendRequestError; use super::error::SendRequestError;
use super::pool::Acquired; use super::pool::Acquired;
pub(crate) fn send_request<T, B>( pub(crate) async fn send_request<T, B>(
io: SendRequest<Bytes>, mut io: SendRequest<Bytes>,
head: RequestHeadType, head: RequestHeadType,
body: B, body: B,
created: time::Instant, created: time::Instant,
pool: Option<Acquired<T>>, pool: Option<Acquired<T>>,
) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError> ) -> Result<(ResponseHead, Payload), SendRequestError>
where where
T: AsyncRead + AsyncWrite + 'static, T: AsyncRead + AsyncWrite + Unpin + 'static,
B: MessageBody, B: MessageBody,
{ {
trace!("Sending client request: {:?} {:?}", head, body.size()); trace!("Sending client request: {:?} {:?}", head, body.size());
@@ -36,9 +36,6 @@ where
_ => false, _ => false,
}; };
io.ready()
.map_err(SendRequestError::from)
.and_then(move |mut io| {
let mut req = Request::new(()); let mut req = Request::new(());
*req.uri_mut() = head.as_ref().uri.clone(); *req.uri_mut() = head.as_ref().uri.clone();
*req.method_mut() = head.as_ref().method.clone(); *req.method_mut() = head.as_ref().method.clone();
@@ -69,9 +66,7 @@ where
// Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate. // Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
let (head, extra_headers) = match head { let (head, extra_headers) = match head {
RequestHeadType::Owned(head) => { RequestHeadType::Owned(head) => (RequestHeadType::Owned(head), HeaderMap::new()),
(RequestHeadType::Owned(head), HeaderMap::new())
}
RequestHeadType::Rc(head, extra_headers) => ( RequestHeadType::Rc(head, extra_headers) => (
RequestHeadType::Rc(head, None), RequestHeadType::Rc(head, None),
extra_headers.unwrap_or_else(HeaderMap::new), extra_headers.unwrap_or_else(HeaderMap::new),
@@ -97,30 +92,27 @@ where
req.headers_mut().append(key, value.clone()); req.headers_mut().append(key, value.clone());
} }
match io.send_request(req, eof) { let res = poll_fn(|cx| io.poll_ready(cx)).await;
Ok((res, send)) => { if let Err(e) = res {
release(io, pool, created, e.is_io());
return Err(SendRequestError::from(e));
}
let resp = match io.send_request(req, eof) {
Ok((fut, send)) => {
release(io, pool, created, false); release(io, pool, created, false);
if !eof { if !eof {
Either::A(Either::B( send_body(body, send).await?;
SendBody {
body,
send,
buf: None,
}
.and_then(move |_| res.map_err(SendRequestError::from)),
))
} else {
Either::B(res.map_err(SendRequestError::from))
} }
fut.await.map_err(SendRequestError::from)?
} }
Err(e) => { Err(e) => {
release(io, pool, created, e.is_io()); release(io, pool, created, e.is_io());
Either::A(Either::A(err(e.into()))) return Err(e.into());
} }
} };
})
.and_then(move |resp| {
let (parts, body) = resp.into_parts(); let (parts, body) = resp.into_parts();
let payload = if head_req { Payload::None } else { body.into() }; let payload = if head_req { Payload::None } else { body.into() };
@@ -128,66 +120,56 @@ where
head.version = parts.version; head.version = parts.version;
head.headers = parts.headers.into(); head.headers = parts.headers.into();
Ok((head, payload)) Ok((head, payload))
})
.from_err()
} }
struct SendBody<B: MessageBody> { async fn send_body<B: MessageBody>(
body: B, mut body: B,
send: SendStream<Bytes>, mut send: SendStream<Bytes>,
buf: Option<Bytes>, ) -> Result<(), SendRequestError> {
} let mut buf = None;
impl<B: MessageBody> Future for SendBody<B> {
type Item = ();
type Error = SendRequestError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
loop { loop {
if self.buf.is_none() { if buf.is_none() {
match self.body.poll_next() { match poll_fn(|cx| body.poll_next(cx)).await {
Ok(Async::Ready(Some(buf))) => { Some(Ok(b)) => {
self.send.reserve_capacity(buf.len()); send.reserve_capacity(b.len());
self.buf = Some(buf); buf = Some(b);
} }
Ok(Async::Ready(None)) => { Some(Err(e)) => return Err(e.into()),
if let Err(e) = self.send.send_data(Bytes::new(), true) { None => {
if let Err(e) = send.send_data(Bytes::new(), true) {
return Err(e.into()); return Err(e.into());
} }
self.send.reserve_capacity(0); send.reserve_capacity(0);
return Ok(Async::Ready(())); return Ok(());
} }
Ok(Async::NotReady) => return Ok(Async::NotReady),
Err(e) => return Err(e.into()),
} }
} }
match self.send.poll_capacity() { match poll_fn(|cx| send.poll_capacity(cx)).await {
Ok(Async::NotReady) => return Ok(Async::NotReady), None => return Ok(()),
Ok(Async::Ready(None)) => return Ok(Async::Ready(())), Some(Ok(cap)) => {
Ok(Async::Ready(Some(cap))) => { let b = buf.as_mut().unwrap();
let mut buf = self.buf.take().unwrap(); let len = b.len();
let len = buf.len(); let bytes = b.split_to(std::cmp::min(cap, len));
let bytes = buf.split_to(std::cmp::min(cap, len));
if let Err(e) = self.send.send_data(bytes, false) { if let Err(e) = send.send_data(bytes, false) {
return Err(e.into()); return Err(e.into());
} else { } else {
if !buf.is_empty() { if !b.is_empty() {
self.send.reserve_capacity(buf.len()); send.reserve_capacity(b.len());
self.buf = Some(buf); } else {
buf = None;
} }
continue; continue;
} }
} }
Err(e) => return Err(e.into()), Some(Err(e)) => return Err(e.into()),
}
} }
} }
} }
// release SendRequest object // release SendRequest object
fn release<T: AsyncRead + AsyncWrite + 'static>( fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
io: SendRequest<Bytes>, io: SendRequest<Bytes>,
pool: Option<Acquired<T>>, pool: Option<Acquired<T>>,
created: time::Instant, created: time::Instant,

View File

@@ -1,22 +1,22 @@
use std::cell::RefCell; use std::cell::RefCell;
use std::collections::VecDeque; use std::collections::VecDeque;
use std::io; use std::future::Future;
use std::pin::Pin;
use std::rc::Rc; use std::rc::Rc;
use std::task::{Context, Poll};
use std::time::{Duration, Instant}; use std::time::{Duration, Instant};
use actix_codec::{AsyncRead, AsyncWrite}; use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::time::{delay_for, Delay};
use actix_service::Service; use actix_service::Service;
use actix_utils::{oneshot, task::LocalWaker};
use bytes::Bytes; use bytes::Bytes;
use futures::future::{err, ok, Either, FutureResult}; use futures::future::{poll_fn, FutureExt, LocalBoxFuture};
use futures::task::AtomicTask; use fxhash::FxHashMap;
use futures::unsync::oneshot; use h2::client::{handshake, Connection, SendRequest};
use futures::{Async, Future, Poll};
use h2::client::{handshake, Handshake};
use hashbrown::HashMap;
use http::uri::Authority; use http::uri::Authority;
use indexmap::IndexSet; use indexmap::IndexSet;
use slab::Slab; use slab::Slab;
use tokio_timer::{sleep, Delay};
use super::connection::{ConnectionType, IoConnection}; use super::connection::{ConnectionType, IoConnection};
use super::error::ConnectError; use super::error::ConnectError;
@@ -41,16 +41,12 @@ impl From<Authority> for Key {
} }
/// Connections pool /// Connections pool
pub(crate) struct ConnectionPool<T, Io: AsyncRead + AsyncWrite + 'static>( pub(crate) struct ConnectionPool<T, Io: 'static>(Rc<RefCell<T>>, Rc<RefCell<Inner<Io>>>);
T,
Rc<RefCell<Inner<Io>>>,
);
impl<T, Io> ConnectionPool<T, Io> impl<T, Io> ConnectionPool<T, Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError> T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
{ {
pub(crate) fn new( pub(crate) fn new(
@@ -61,7 +57,7 @@ where
limit: usize, limit: usize,
) -> Self { ) -> Self {
ConnectionPool( ConnectionPool(
connector, Rc::new(RefCell::new(connector)),
Rc::new(RefCell::new(Inner { Rc::new(RefCell::new(Inner {
conn_lifetime, conn_lifetime,
conn_keep_alive, conn_keep_alive,
@@ -70,8 +66,8 @@ where
acquired: 0, acquired: 0,
waiters: Slab::new(), waiters: Slab::new(),
waiters_queue: IndexSet::new(), waiters_queue: IndexSet::new(),
available: HashMap::new(), available: FxHashMap::default(),
task: None, waker: LocalWaker::new(),
})), })),
) )
} }
@@ -79,8 +75,7 @@ where
impl<T, Io> Clone for ConnectionPool<T, Io> impl<T, Io> Clone for ConnectionPool<T, Io>
where where
T: Clone, Io: 'static,
Io: AsyncRead + AsyncWrite + 'static,
{ {
fn clone(&self) -> Self { fn clone(&self) -> Self {
ConnectionPool(self.0.clone(), self.1.clone()) ConnectionPool(self.0.clone(), self.1.clone())
@@ -89,86 +84,116 @@ where
impl<T, Io> Service for ConnectionPool<T, Io> impl<T, Io> Service for ConnectionPool<T, Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError> T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static, + 'static,
{ {
type Request = Connect; type Request = Connect;
type Response = IoConnection<Io>; type Response = IoConnection<Io>;
type Error = ConnectError; type Error = ConnectError;
type Future = Either< type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
FutureResult<Self::Response, Self::Error>,
Either<WaitForConnection<Io>, OpenConnection<T::Future, Io>>,
>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.0.poll_ready() self.0.poll_ready(cx)
} }
fn call(&mut self, req: Connect) -> Self::Future { fn call(&mut self, req: Connect) -> Self::Future {
let key = if let Some(authority) = req.uri.authority_part() { // start support future
actix_rt::spawn(ConnectorPoolSupport {
connector: self.0.clone(),
inner: self.1.clone(),
});
let mut connector = self.0.clone();
let inner = self.1.clone();
let fut = async move {
let key = if let Some(authority) = req.uri.authority() {
authority.clone().into() authority.clone().into()
} else { } else {
return Either::A(err(ConnectError::Unresolverd)); return Err(ConnectError::Unresolverd);
}; };
// acquire connection // acquire connection
match self.1.as_ref().borrow_mut().acquire(&key) { match poll_fn(|cx| Poll::Ready(inner.borrow_mut().acquire(&key, cx))).await {
Acquire::Acquired(io, created) => { Acquire::Acquired(io, created) => {
// use existing connection // use existing connection
return Either::A(ok(IoConnection::new( return Ok(IoConnection::new(
io, io,
created, created,
Some(Acquired(key, Some(self.1.clone()))), Some(Acquired(key, Some(inner))),
))); ));
} }
Acquire::Available => { Acquire::Available => {
// open new connection // open tcp connection
return Either::B(Either::B(OpenConnection::new( let (io, proto) = connector.call(req).await?;
key,
self.1.clone(),
self.0.call(req),
)));
}
_ => (),
}
let guard = OpenGuard::new(key, inner);
if proto == Protocol::Http1 {
Ok(IoConnection::new(
ConnectionType::H1(io),
Instant::now(),
Some(guard.consume()),
))
} else {
let (snd, connection) = handshake(io).await?;
actix_rt::spawn(connection.map(|_| ()));
Ok(IoConnection::new(
ConnectionType::H2(snd),
Instant::now(),
Some(guard.consume()),
))
}
}
_ => {
// connection is not available, wait // connection is not available, wait
let (rx, token, support) = self.1.as_ref().borrow_mut().wait_for(req); let (rx, token) = inner.borrow_mut().wait_for(req);
// start support future let guard = WaiterGuard::new(key, token, inner);
if !support { let res = match rx.await {
self.1.as_ref().borrow_mut().task = Some(AtomicTask::new()); Err(_) => Err(ConnectError::Disconnected),
tokio_current_thread::spawn(ConnectorPoolSupport { Ok(res) => res,
connector: self.0.clone(), };
inner: self.1.clone(), guard.consume();
}) res
} }
}
};
Either::B(Either::A(WaitForConnection { fut.boxed_local()
rx,
key,
token,
inner: Some(self.1.clone()),
}))
} }
} }
#[doc(hidden)] struct WaiterGuard<Io>
pub struct WaitForConnection<Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
key: Key, key: Key,
token: usize, token: usize,
rx: oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
inner: Option<Rc<RefCell<Inner<Io>>>>, inner: Option<Rc<RefCell<Inner<Io>>>>,
} }
impl<Io> Drop for WaitForConnection<Io> impl<Io> WaiterGuard<Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn new(key: Key, token: usize, inner: Rc<RefCell<Inner<Io>>>) -> Self {
Self {
key,
token,
inner: Some(inner),
}
}
fn consume(mut self) {
let _ = self.inner.take();
}
}
impl<Io> Drop for WaiterGuard<Io>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
fn drop(&mut self) { fn drop(&mut self) {
if let Some(i) = self.inner.take() { if let Some(i) = self.inner.take() {
@@ -179,113 +204,43 @@ where
} }
} }
impl<Io> Future for WaitForConnection<Io> struct OpenGuard<Io>
where where
Io: AsyncRead + AsyncWrite, Io: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
type Item = IoConnection<Io>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.rx.poll() {
Ok(Async::Ready(item)) => match item {
Err(err) => Err(err),
Ok(conn) => {
let _ = self.inner.take();
Ok(Async::Ready(conn))
}
},
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(_) => {
let _ = self.inner.take();
Err(ConnectError::Disconnected)
}
}
}
}
#[doc(hidden)]
pub struct OpenConnection<F, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
{
fut: F,
key: Key, key: Key,
h2: Option<Handshake<Io, Bytes>>,
inner: Option<Rc<RefCell<Inner<Io>>>>, inner: Option<Rc<RefCell<Inner<Io>>>>,
} }
impl<F, Io> OpenConnection<F, Io> impl<Io> OpenGuard<Io>
where where
F: Future<Item = (Io, Protocol), Error = ConnectError>, Io: AsyncRead + AsyncWrite + Unpin + 'static,
Io: AsyncRead + AsyncWrite + 'static,
{ {
fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>, fut: F) -> Self { fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>) -> Self {
OpenConnection { Self {
key, key,
fut,
inner: Some(inner), inner: Some(inner),
h2: None,
} }
} }
fn consume(mut self) -> Acquired<Io> {
Acquired(self.key.clone(), self.inner.take())
}
} }
impl<F, Io> Drop for OpenConnection<F, Io> impl<Io> Drop for OpenGuard<Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
fn drop(&mut self) { fn drop(&mut self) {
if let Some(inner) = self.inner.take() { if let Some(i) = self.inner.take() {
let mut inner = inner.as_ref().borrow_mut(); let mut inner = i.as_ref().borrow_mut();
inner.release(); inner.release();
inner.check_availibility(); inner.check_availibility();
} }
} }
} }
impl<F, Io> Future for OpenConnection<F, Io>
where
F: Future<Item = (Io, Protocol), Error = ConnectError>,
Io: AsyncRead + AsyncWrite,
{
type Item = IoConnection<Io>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
if let Some(ref mut h2) = self.h2 {
return match h2.poll() {
Ok(Async::Ready((snd, connection))) => {
tokio_current_thread::spawn(connection.map_err(|_| ()));
Ok(Async::Ready(IoConnection::new(
ConnectionType::H2(snd),
Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())),
)))
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(e) => Err(e.into()),
};
}
match self.fut.poll() {
Err(err) => Err(err),
Ok(Async::Ready((io, proto))) => {
if proto == Protocol::Http1 {
Ok(Async::Ready(IoConnection::new(
ConnectionType::H1(io),
Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())),
)))
} else {
self.h2 = Some(handshake(io));
self.poll()
}
}
Ok(Async::NotReady) => Ok(Async::NotReady),
}
}
}
enum Acquire<T> { enum Acquire<T> {
Acquired(ConnectionType<T>, Instant), Acquired(ConnectionType<T>, Instant),
Available, Available,
@@ -304,7 +259,7 @@ pub(crate) struct Inner<Io> {
disconnect_timeout: Option<Duration>, disconnect_timeout: Option<Duration>,
limit: usize, limit: usize,
acquired: usize, acquired: usize,
available: HashMap<Key, VecDeque<AvailableConnection<Io>>>, available: FxHashMap<Key, VecDeque<AvailableConnection<Io>>>,
waiters: Slab< waiters: Slab<
Option<( Option<(
Connect, Connect,
@@ -312,7 +267,7 @@ pub(crate) struct Inner<Io> {
)>, )>,
>, >,
waiters_queue: IndexSet<(Key, usize)>, waiters_queue: IndexSet<(Key, usize)>,
task: Option<AtomicTask>, waker: LocalWaker,
} }
impl<Io> Inner<Io> { impl<Io> Inner<Io> {
@@ -332,7 +287,7 @@ impl<Io> Inner<Io> {
impl<Io> Inner<Io> impl<Io> Inner<Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
/// connection is not available, wait /// connection is not available, wait
fn wait_for( fn wait_for(
@@ -341,20 +296,19 @@ where
) -> ( ) -> (
oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>, oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
usize, usize,
bool,
) { ) {
let (tx, rx) = oneshot::channel(); let (tx, rx) = oneshot::channel();
let key: Key = connect.uri.authority_part().unwrap().clone().into(); let key: Key = connect.uri.authority().unwrap().clone().into();
let entry = self.waiters.vacant_entry(); let entry = self.waiters.vacant_entry();
let token = entry.key(); let token = entry.key();
entry.insert(Some((connect, tx))); entry.insert(Some((connect, tx)));
assert!(self.waiters_queue.insert((key, token))); assert!(self.waiters_queue.insert((key, token)));
(rx, token, self.task.is_some()) (rx, token)
} }
fn acquire(&mut self, key: &Key) -> Acquire<Io> { fn acquire(&mut self, key: &Key, cx: &mut Context) -> Acquire<Io> {
// check limits // check limits
if self.limit > 0 && self.acquired >= self.limit { if self.limit > 0 && self.acquired >= self.limit {
return Acquire::NotAvailable; return Acquire::NotAvailable;
@@ -373,28 +327,26 @@ where
{ {
if let Some(timeout) = self.disconnect_timeout { if let Some(timeout) = self.disconnect_timeout {
if let ConnectionType::H1(io) = conn.io { if let ConnectionType::H1(io) = conn.io {
tokio_current_thread::spawn(CloseConnection::new( actix_rt::spawn(CloseConnection::new(io, timeout))
io, timeout,
))
} }
} }
} else { } else {
let mut io = conn.io; let mut io = conn.io;
let mut buf = [0; 2]; let mut buf = [0; 2];
if let ConnectionType::H1(ref mut s) = io { if let ConnectionType::H1(ref mut s) = io {
match s.read(&mut buf) { match Pin::new(s).poll_read(cx, &mut buf) {
Err(ref e) if e.kind() == io::ErrorKind::WouldBlock => (), Poll::Pending => (),
Ok(n) if n > 0 => { Poll::Ready(Ok(n)) if n > 0 => {
if let Some(timeout) = self.disconnect_timeout { if let Some(timeout) = self.disconnect_timeout {
if let ConnectionType::H1(io) = io { if let ConnectionType::H1(io) = io {
tokio_current_thread::spawn( actix_rt::spawn(CloseConnection::new(
CloseConnection::new(io, timeout), io, timeout,
) ))
} }
} }
continue; continue;
} }
Ok(_) | Err(_) => continue, _ => continue,
} }
} }
return Acquire::Acquired(io, conn.created); return Acquire::Acquired(io, conn.created);
@@ -421,7 +373,7 @@ where
self.acquired -= 1; self.acquired -= 1;
if let Some(timeout) = self.disconnect_timeout { if let Some(timeout) = self.disconnect_timeout {
if let ConnectionType::H1(io) = io { if let ConnectionType::H1(io) = io {
tokio_current_thread::spawn(CloseConnection::new(io, timeout)) actix_rt::spawn(CloseConnection::new(io, timeout))
} }
} }
self.check_availibility(); self.check_availibility();
@@ -429,9 +381,7 @@ where
fn check_availibility(&self) { fn check_availibility(&self) {
if !self.waiters_queue.is_empty() && self.acquired < self.limit { if !self.waiters_queue.is_empty() && self.acquired < self.limit {
if let Some(t) = self.task.as_ref() { self.waker.wake();
t.notify()
}
} }
} }
} }
@@ -443,29 +393,30 @@ struct CloseConnection<T> {
impl<T> CloseConnection<T> impl<T> CloseConnection<T>
where where
T: AsyncWrite, T: AsyncWrite + Unpin,
{ {
fn new(io: T, timeout: Duration) -> Self { fn new(io: T, timeout: Duration) -> Self {
CloseConnection { CloseConnection {
io, io,
timeout: sleep(timeout), timeout: delay_for(timeout),
} }
} }
} }
impl<T> Future for CloseConnection<T> impl<T> Future for CloseConnection<T>
where where
T: AsyncWrite, T: AsyncWrite + Unpin,
{ {
type Item = (); type Output = ();
type Error = ();
fn poll(&mut self) -> Poll<(), ()> { fn poll(self: Pin<&mut Self>, cx: &mut Context) -> Poll<()> {
match self.timeout.poll() { let this = self.get_mut();
Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
Ok(Async::NotReady) => match self.io.shutdown() { match Pin::new(&mut this.timeout).poll(cx) {
Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())), Poll::Ready(_) => Poll::Ready(()),
Ok(Async::NotReady) => Ok(Async::NotReady), Poll::Pending => match Pin::new(&mut this.io).poll_shutdown(cx) {
Poll::Ready(_) => Poll::Ready(()),
Poll::Pending => Poll::Pending,
}, },
} }
} }
@@ -473,7 +424,7 @@ where
struct ConnectorPoolSupport<T, Io> struct ConnectorPoolSupport<T, Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
connector: T, connector: T,
inner: Rc<RefCell<Inner<Io>>>, inner: Rc<RefCell<Inner<Io>>>,
@@ -481,16 +432,17 @@ where
impl<T, Io> Future for ConnectorPoolSupport<T, Io> impl<T, Io> Future for ConnectorPoolSupport<T, Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>, T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>,
T::Future: 'static, T::Future: 'static,
{ {
type Item = (); type Output = ();
type Error = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
let mut inner = self.inner.as_ref().borrow_mut(); let this = unsafe { self.get_unchecked_mut() };
inner.task.as_ref().unwrap().register();
let mut inner = this.inner.as_ref().borrow_mut();
inner.waker.register(cx.waker());
// check waiters // check waiters
loop { loop {
@@ -505,14 +457,14 @@ where
continue; continue;
} }
match inner.acquire(&key) { match inner.acquire(&key, cx) {
Acquire::NotAvailable => break, Acquire::NotAvailable => break,
Acquire::Acquired(io, created) => { Acquire::Acquired(io, created) => {
let tx = inner.waiters.get_mut(token).unwrap().take().unwrap().1; let tx = inner.waiters.get_mut(token).unwrap().take().unwrap().1;
if let Err(conn) = tx.send(Ok(IoConnection::new( if let Err(conn) = tx.send(Ok(IoConnection::new(
io, io,
created, created,
Some(Acquired(key.clone(), Some(self.inner.clone()))), Some(Acquired(key.clone(), Some(this.inner.clone()))),
))) { ))) {
let (io, created) = conn.unwrap().into_inner(); let (io, created) = conn.unwrap().into_inner();
inner.release_conn(&key, io, created); inner.release_conn(&key, io, created);
@@ -524,33 +476,38 @@ where
OpenWaitingConnection::spawn( OpenWaitingConnection::spawn(
key.clone(), key.clone(),
tx, tx,
self.inner.clone(), this.inner.clone(),
self.connector.call(connect), this.connector.call(connect),
); );
} }
} }
let _ = inner.waiters_queue.swap_remove_index(0); let _ = inner.waiters_queue.swap_remove_index(0);
} }
Ok(Async::NotReady) Poll::Pending
} }
} }
struct OpenWaitingConnection<F, Io> struct OpenWaitingConnection<F, Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
fut: F, fut: F,
key: Key, key: Key,
h2: Option<Handshake<Io, Bytes>>, h2: Option<
LocalBoxFuture<
'static,
Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>,
>,
>,
rx: Option<oneshot::Sender<Result<IoConnection<Io>, ConnectError>>>, rx: Option<oneshot::Sender<Result<IoConnection<Io>, ConnectError>>>,
inner: Option<Rc<RefCell<Inner<Io>>>>, inner: Option<Rc<RefCell<Inner<Io>>>>,
} }
impl<F, Io> OpenWaitingConnection<F, Io> impl<F, Io> OpenWaitingConnection<F, Io>
where where
F: Future<Item = (Io, Protocol), Error = ConnectError> + 'static, F: Future<Output = Result<(Io, Protocol), ConnectError>> + 'static,
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
fn spawn( fn spawn(
key: Key, key: Key,
@@ -558,7 +515,7 @@ where
inner: Rc<RefCell<Inner<Io>>>, inner: Rc<RefCell<Inner<Io>>>,
fut: F, fut: F,
) { ) {
tokio_current_thread::spawn(OpenWaitingConnection { actix_rt::spawn(OpenWaitingConnection {
key, key,
fut, fut,
h2: None, h2: None,
@@ -570,7 +527,7 @@ where
impl<F, Io> Drop for OpenWaitingConnection<F, Io> impl<F, Io> Drop for OpenWaitingConnection<F, Io>
where where
Io: AsyncRead + AsyncWrite + 'static, Io: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
fn drop(&mut self) { fn drop(&mut self) {
if let Some(inner) = self.inner.take() { if let Some(inner) = self.inner.take() {
@@ -583,59 +540,60 @@ where
impl<F, Io> Future for OpenWaitingConnection<F, Io> impl<F, Io> Future for OpenWaitingConnection<F, Io>
where where
F: Future<Item = (Io, Protocol), Error = ConnectError>, F: Future<Output = Result<(Io, Protocol), ConnectError>>,
Io: AsyncRead + AsyncWrite, Io: AsyncRead + AsyncWrite + Unpin,
{ {
type Item = (); type Output = ();
type Error = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
if let Some(ref mut h2) = self.h2 { let this = unsafe { self.get_unchecked_mut() };
return match h2.poll() {
Ok(Async::Ready((snd, connection))) => { if let Some(ref mut h2) = this.h2 {
tokio_current_thread::spawn(connection.map_err(|_| ())); return match Pin::new(h2).poll(cx) {
let rx = self.rx.take().unwrap(); Poll::Ready(Ok((snd, connection))) => {
actix_rt::spawn(connection.map(|_| ()));
let rx = this.rx.take().unwrap();
let _ = rx.send(Ok(IoConnection::new( let _ = rx.send(Ok(IoConnection::new(
ConnectionType::H2(snd), ConnectionType::H2(snd),
Instant::now(), Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())), Some(Acquired(this.key.clone(), this.inner.take())),
))); )));
Ok(Async::Ready(())) Poll::Ready(())
} }
Ok(Async::NotReady) => Ok(Async::NotReady), Poll::Pending => Poll::Pending,
Err(err) => { Poll::Ready(Err(err)) => {
let _ = self.inner.take(); let _ = this.inner.take();
if let Some(rx) = self.rx.take() { if let Some(rx) = this.rx.take() {
let _ = rx.send(Err(ConnectError::H2(err))); let _ = rx.send(Err(ConnectError::H2(err)));
} }
Err(()) Poll::Ready(())
} }
}; };
} }
match self.fut.poll() { match unsafe { Pin::new_unchecked(&mut this.fut) }.poll(cx) {
Err(err) => { Poll::Ready(Err(err)) => {
let _ = self.inner.take(); let _ = this.inner.take();
if let Some(rx) = self.rx.take() { if let Some(rx) = this.rx.take() {
let _ = rx.send(Err(err)); let _ = rx.send(Err(err));
} }
Err(()) Poll::Ready(())
} }
Ok(Async::Ready((io, proto))) => { Poll::Ready(Ok((io, proto))) => {
if proto == Protocol::Http1 { if proto == Protocol::Http1 {
let rx = self.rx.take().unwrap(); let rx = this.rx.take().unwrap();
let _ = rx.send(Ok(IoConnection::new( let _ = rx.send(Ok(IoConnection::new(
ConnectionType::H1(io), ConnectionType::H1(io),
Instant::now(), Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())), Some(Acquired(this.key.clone(), this.inner.take())),
))); )));
Ok(Async::Ready(())) Poll::Ready(())
} else { } else {
self.h2 = Some(handshake(io)); this.h2 = Some(handshake(io).boxed_local());
self.poll() unsafe { Pin::new_unchecked(this) }.poll(cx)
} }
} }
Ok(Async::NotReady) => Ok(Async::NotReady), Poll::Pending => Poll::Pending,
} }
} }
} }
@@ -644,7 +602,7 @@ pub(crate) struct Acquired<T>(Key, Option<Rc<RefCell<Inner<T>>>>);
impl<T> Acquired<T> impl<T> Acquired<T>
where where
T: AsyncRead + AsyncWrite + 'static, T: AsyncRead + AsyncWrite + Unpin + 'static,
{ {
pub(crate) fn close(&mut self, conn: IoConnection<T>) { pub(crate) fn close(&mut self, conn: IoConnection<T>) {
if let Some(inner) = self.1.take() { if let Some(inner) = self.1.take() {

View File

@@ -1,8 +1,8 @@
use std::cell::UnsafeCell; use std::cell::UnsafeCell;
use std::rc::Rc; use std::rc::Rc;
use std::task::{Context, Poll};
use actix_service::Service; use actix_service::Service;
use futures::Poll;
#[doc(hidden)] #[doc(hidden)]
/// Service that allows to turn non-clone service to a service with `Clone` impl /// Service that allows to turn non-clone service to a service with `Clone` impl
@@ -32,8 +32,8 @@ where
type Error = T::Error; type Error = T::Error;
type Future = T::Future; type Future = T::Future;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
unsafe { &mut *self.0.as_ref().get() }.poll_ready() unsafe { &mut *self.0.as_ref().get() }.poll_ready(cx)
} }
fn call(&mut self, req: T::Request) -> Self::Future { fn call(&mut self, req: T::Request) -> Self::Future {

View File

@@ -1,13 +1,13 @@
use std::cell::UnsafeCell; use std::cell::UnsafeCell;
use std::fmt;
use std::fmt::Write; use std::fmt::Write;
use std::rc::Rc; use std::rc::Rc;
use std::time::{Duration, Instant}; use std::time::Duration;
use std::{fmt, net};
use actix_rt::time::{delay_for, delay_until, Delay, Instant};
use bytes::BytesMut; use bytes::BytesMut;
use futures::{future, Future}; use futures::{future, FutureExt};
use time; use time;
use tokio_timer::{sleep, Delay};
// "Sun, 06 Nov 1994 08:49:37 GMT".len() // "Sun, 06 Nov 1994 08:49:37 GMT".len()
const DATE_VALUE_LENGTH: usize = 29; const DATE_VALUE_LENGTH: usize = 29;
@@ -47,6 +47,8 @@ struct Inner {
client_timeout: u64, client_timeout: u64,
client_disconnect: u64, client_disconnect: u64,
ka_enabled: bool, ka_enabled: bool,
secure: bool,
local_addr: Option<std::net::SocketAddr>,
timer: DateService, timer: DateService,
} }
@@ -58,7 +60,7 @@ impl Clone for ServiceConfig {
impl Default for ServiceConfig { impl Default for ServiceConfig {
fn default() -> Self { fn default() -> Self {
Self::new(KeepAlive::Timeout(5), 0, 0) Self::new(KeepAlive::Timeout(5), 0, 0, false, None)
} }
} }
@@ -68,6 +70,8 @@ impl ServiceConfig {
keep_alive: KeepAlive, keep_alive: KeepAlive,
client_timeout: u64, client_timeout: u64,
client_disconnect: u64, client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
) -> ServiceConfig { ) -> ServiceConfig {
let (keep_alive, ka_enabled) = match keep_alive { let (keep_alive, ka_enabled) = match keep_alive {
KeepAlive::Timeout(val) => (val as u64, true), KeepAlive::Timeout(val) => (val as u64, true),
@@ -85,10 +89,24 @@ impl ServiceConfig {
ka_enabled, ka_enabled,
client_timeout, client_timeout,
client_disconnect, client_disconnect,
secure,
local_addr,
timer: DateService::new(), timer: DateService::new(),
})) }))
} }
#[inline]
/// Returns true if connection is secure(https)
pub fn secure(&self) -> bool {
self.0.secure
}
#[inline]
/// Returns the local address that this server is bound to.
pub fn local_addr(&self) -> Option<net::SocketAddr> {
self.0.local_addr
}
#[inline] #[inline]
/// Keep alive duration if configured. /// Keep alive duration if configured.
pub fn keep_alive(&self) -> Option<Duration> { pub fn keep_alive(&self) -> Option<Duration> {
@@ -104,10 +122,10 @@ impl ServiceConfig {
#[inline] #[inline]
/// Client timeout for first request. /// Client timeout for first request.
pub fn client_timer(&self) -> Option<Delay> { pub fn client_timer(&self) -> Option<Delay> {
let delay = self.0.client_timeout; let delay_time = self.0.client_timeout;
if delay != 0 { if delay_time != 0 {
Some(Delay::new( Some(delay_until(
self.0.timer.now() + Duration::from_millis(delay), self.0.timer.now() + Duration::from_millis(delay_time),
)) ))
} else { } else {
None None
@@ -138,7 +156,7 @@ impl ServiceConfig {
/// Return keep-alive timer delay is configured. /// Return keep-alive timer delay is configured.
pub fn keep_alive_timer(&self) -> Option<Delay> { pub fn keep_alive_timer(&self) -> Option<Delay> {
if let Some(ka) = self.0.keep_alive { if let Some(ka) = self.0.keep_alive {
Some(Delay::new(self.0.timer.now() + ka)) Some(delay_until(self.0.timer.now() + ka))
} else { } else {
None None
} }
@@ -242,12 +260,10 @@ impl DateService {
// periodic date update // periodic date update
let s = self.clone(); let s = self.clone();
tokio_current_thread::spawn(sleep(Duration::from_millis(500)).then( actix_rt::spawn(delay_for(Duration::from_millis(500)).then(move |_| {
move |_| {
s.0.reset(); s.0.reset();
future::ok(()) future::ready(())
}, }));
));
} }
} }
@@ -265,26 +281,19 @@ impl DateService {
#[cfg(test)] #[cfg(test)]
mod tests { mod tests {
use super::*; use super::*;
use actix_rt::System;
use futures::future;
#[test] #[test]
fn test_date_len() { fn test_date_len() {
assert_eq!(DATE_VALUE_LENGTH, "Sun, 06 Nov 1994 08:49:37 GMT".len()); assert_eq!(DATE_VALUE_LENGTH, "Sun, 06 Nov 1994 08:49:37 GMT".len());
} }
#[test] #[actix_rt::test]
fn test_date() { async fn test_date() {
let mut rt = System::new("test"); let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
let _ = rt.block_on(future::lazy(|| {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0);
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10); let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1); settings.set_date(&mut buf1);
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10); let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2); settings.set_date(&mut buf2);
assert_eq!(buf1, buf2); assert_eq!(buf1, buf2);
future::ok::<_, ()>(())
}));
} }
} }

View File

@@ -1,13 +1,11 @@
use ring::digest::{Algorithm, SHA256}; use ring::hkdf::{Algorithm, KeyType, Prk, HKDF_SHA256};
use ring::hkdf::expand;
use ring::hmac::SigningKey;
use ring::rand::{SecureRandom, SystemRandom}; use ring::rand::{SecureRandom, SystemRandom};
use super::private::KEY_LEN as PRIVATE_KEY_LEN; use super::private::KEY_LEN as PRIVATE_KEY_LEN;
use super::signed::KEY_LEN as SIGNED_KEY_LEN; use super::signed::KEY_LEN as SIGNED_KEY_LEN;
static HKDF_DIGEST: &Algorithm = &SHA256; static HKDF_DIGEST: Algorithm = HKDF_SHA256;
const KEYS_INFO: &str = "COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM"; const KEYS_INFO: &[&[u8]] = &[b"COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM"];
/// A cryptographic master key for use with `Signed` and/or `Private` jars. /// A cryptographic master key for use with `Signed` and/or `Private` jars.
/// ///
@@ -25,6 +23,13 @@ pub struct Key {
encryption_key: [u8; PRIVATE_KEY_LEN], encryption_key: [u8; PRIVATE_KEY_LEN],
} }
impl KeyType for &Key {
#[inline]
fn len(&self) -> usize {
SIGNED_KEY_LEN + PRIVATE_KEY_LEN
}
}
impl Key { impl Key {
/// Derives new signing/encryption keys from a master key. /// Derives new signing/encryption keys from a master key.
/// ///
@@ -56,21 +61,26 @@ impl Key {
); );
} }
// Expand the user's key into two. // An empty `Key` structure; will be filled in with HKDF derived keys.
let prk = SigningKey::new(HKDF_DIGEST, key); let mut output_key = Key {
signing_key: [0; SIGNED_KEY_LEN],
encryption_key: [0; PRIVATE_KEY_LEN],
};
// Expand the master key into two HKDF generated keys.
let mut both_keys = [0; SIGNED_KEY_LEN + PRIVATE_KEY_LEN]; let mut both_keys = [0; SIGNED_KEY_LEN + PRIVATE_KEY_LEN];
expand(&prk, KEYS_INFO.as_bytes(), &mut both_keys); let prk = Prk::new_less_safe(HKDF_DIGEST, key);
let okm = prk.expand(KEYS_INFO, &output_key).expect("okm expand");
okm.fill(&mut both_keys).expect("fill keys");
// Copy the keys into their respective arrays. // Copy the key parts into their respective fields.
let mut signing_key = [0; SIGNED_KEY_LEN]; output_key
let mut encryption_key = [0; PRIVATE_KEY_LEN]; .signing_key
signing_key.copy_from_slice(&both_keys[..SIGNED_KEY_LEN]); .copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
encryption_key.copy_from_slice(&both_keys[SIGNED_KEY_LEN..]); output_key
.encryption_key
Key { .copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
signing_key, output_key
encryption_key,
}
} }
/// Generates signing/encryption keys from a secure, random source. Keys are /// Generates signing/encryption keys from a secure, random source. Keys are

View File

@@ -1,8 +1,8 @@
use std::str; use std::str;
use log::warn; use log::warn;
use ring::aead::{open_in_place, seal_in_place, Aad, Algorithm, Nonce, AES_256_GCM}; use ring::aead::{Aad, Algorithm, Nonce, AES_256_GCM};
use ring::aead::{OpeningKey, SealingKey}; use ring::aead::{LessSafeKey, UnboundKey};
use ring::rand::{SecureRandom, SystemRandom}; use ring::rand::{SecureRandom, SystemRandom};
use super::Key; use super::Key;
@@ -10,7 +10,7 @@ use crate::cookie::{Cookie, CookieJar};
// Keep these in sync, and keep the key len synced with the `private` docs as // Keep these in sync, and keep the key len synced with the `private` docs as
// well as the `KEYS_INFO` const in secure::Key. // well as the `KEYS_INFO` const in secure::Key.
static ALGO: &Algorithm = &AES_256_GCM; static ALGO: &'static Algorithm = &AES_256_GCM;
const NONCE_LEN: usize = 12; const NONCE_LEN: usize = 12;
pub const KEY_LEN: usize = 32; pub const KEY_LEN: usize = 32;
@@ -53,11 +53,14 @@ impl<'a> PrivateJar<'a> {
} }
let ad = Aad::from(name.as_bytes()); let ad = Aad::from(name.as_bytes());
let key = OpeningKey::new(ALGO, &self.key).expect("opening key"); let key = LessSafeKey::new(
let (nonce, sealed) = data.split_at_mut(NONCE_LEN); UnboundKey::new(&ALGO, &self.key).expect("matching key length"),
);
let (nonce, mut sealed) = data.split_at_mut(NONCE_LEN);
let nonce = let nonce =
Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`"); Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
let unsealed = open_in_place(&key, nonce, ad, 0, sealed) let unsealed = key
.open_in_place(nonce, ad, &mut sealed)
.map_err(|_| "invalid key/nonce/value: bad seal")?; .map_err(|_| "invalid key/nonce/value: bad seal")?;
if let Ok(unsealed_utf8) = str::from_utf8(unsealed) { if let Ok(unsealed_utf8) = str::from_utf8(unsealed) {
@@ -196,30 +199,33 @@ Please change it as soon as possible."
fn encrypt_name_value(name: &[u8], value: &[u8], key: &[u8]) -> Vec<u8> { fn encrypt_name_value(name: &[u8], value: &[u8], key: &[u8]) -> Vec<u8> {
// Create the `SealingKey` structure. // Create the `SealingKey` structure.
let key = SealingKey::new(ALGO, key).expect("sealing key creation"); let unbound = UnboundKey::new(&ALGO, key).expect("matching key length");
let key = LessSafeKey::new(unbound);
// Create a vec to hold the [nonce | cookie value | overhead]. // Create a vec to hold the [nonce | cookie value | overhead].
let overhead = ALGO.tag_len(); let mut data = vec![0; NONCE_LEN + value.len() + ALGO.tag_len()];
let mut data = vec![0; NONCE_LEN + value.len() + overhead];
// Randomly generate the nonce, then copy the cookie value as input. // Randomly generate the nonce, then copy the cookie value as input.
let (nonce, in_out) = data.split_at_mut(NONCE_LEN); let (nonce, in_out) = data.split_at_mut(NONCE_LEN);
let (in_out, tag) = in_out.split_at_mut(value.len());
in_out.copy_from_slice(value);
// Randomly generate the nonce into the nonce piece.
SystemRandom::new() SystemRandom::new()
.fill(nonce) .fill(nonce)
.expect("couldn't random fill nonce"); .expect("couldn't random fill nonce");
in_out[..value.len()].copy_from_slice(value); let nonce = Nonce::try_assume_unique_for_key(nonce).expect("invalid `nonce` length");
let nonce =
Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
// Use cookie's name as associated data to prevent value swapping. // Use cookie's name as associated data to prevent value swapping.
let ad = Aad::from(name); let ad = Aad::from(name);
let ad_tag = key
.seal_in_place_separate_tag(nonce, ad, in_out)
.expect("in-place seal");
// Perform the actual sealing operation and get the output length. // Copy the tag into the tag piece.
let output_len = tag.copy_from_slice(ad_tag.as_ref());
seal_in_place(&key, nonce, ad, in_out, overhead).expect("in-place seal");
// Remove the overhead and return the sealed content. // Remove the overhead and return the sealed content.
data.truncate(NONCE_LEN + output_len);
data data
} }

View File

@@ -1,12 +1,11 @@
use ring::digest::{Algorithm, SHA256}; use ring::hmac::{self, sign, verify};
use ring::hmac::{sign, verify_with_own_key as verify, SigningKey};
use super::Key; use super::Key;
use crate::cookie::{Cookie, CookieJar}; use crate::cookie::{Cookie, CookieJar};
// Keep these in sync, and keep the key len synced with the `signed` docs as // Keep these in sync, and keep the key len synced with the `signed` docs as
// well as the `KEYS_INFO` const in secure::Key. // well as the `KEYS_INFO` const in secure::Key.
static HMAC_DIGEST: &Algorithm = &SHA256; static HMAC_DIGEST: hmac::Algorithm = hmac::HMAC_SHA256;
const BASE64_DIGEST_LEN: usize = 44; const BASE64_DIGEST_LEN: usize = 44;
pub const KEY_LEN: usize = 32; pub const KEY_LEN: usize = 32;
@@ -21,7 +20,7 @@ pub const KEY_LEN: usize = 32;
/// This type is only available when the `secure` feature is enabled. /// This type is only available when the `secure` feature is enabled.
pub struct SignedJar<'a> { pub struct SignedJar<'a> {
parent: &'a mut CookieJar, parent: &'a mut CookieJar,
key: SigningKey, key: hmac::Key,
} }
impl<'a> SignedJar<'a> { impl<'a> SignedJar<'a> {
@@ -32,7 +31,7 @@ impl<'a> SignedJar<'a> {
pub fn new(parent: &'a mut CookieJar, key: &Key) -> SignedJar<'a> { pub fn new(parent: &'a mut CookieJar, key: &Key) -> SignedJar<'a> {
SignedJar { SignedJar {
parent, parent,
key: SigningKey::new(HMAC_DIGEST, key.signing()), key: hmac::Key::new(HMAC_DIGEST, key.signing()),
} }
} }

View File

@@ -1,4 +1,7 @@
use std::future::Future;
use std::io::{self, Write}; use std::io::{self, Write};
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_threadpool::{run, CpuFuture}; use actix_threadpool::{run, CpuFuture};
#[cfg(feature = "brotli")] #[cfg(feature = "brotli")]
@@ -6,7 +9,7 @@ use brotli2::write::BrotliDecoder;
use bytes::Bytes; use bytes::Bytes;
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))] #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
use flate2::write::{GzDecoder, ZlibDecoder}; use flate2::write::{GzDecoder, ZlibDecoder};
use futures::{try_ready, Async, Future, Poll, Stream}; use futures::{ready, Stream};
use super::Writer; use super::Writer;
use crate::error::PayloadError; use crate::error::PayloadError;
@@ -23,7 +26,7 @@ pub struct Decoder<S> {
impl<S> Decoder<S> impl<S> Decoder<S>
where where
S: Stream<Item = Bytes, Error = PayloadError>, S: Stream<Item = Result<Bytes, PayloadError>>,
{ {
/// Construct a decoder. /// Construct a decoder.
#[inline] #[inline]
@@ -71,34 +74,40 @@ where
impl<S> Stream for Decoder<S> impl<S> Stream for Decoder<S>
where where
S: Stream<Item = Bytes, Error = PayloadError>, S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
{ {
type Item = Bytes; type Item = Result<Bytes, PayloadError>;
type Error = PayloadError;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> { fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context,
) -> Poll<Option<Self::Item>> {
loop { loop {
if let Some(ref mut fut) = self.fut { if let Some(ref mut fut) = self.fut {
let (chunk, decoder) = try_ready!(fut.poll()); let (chunk, decoder) = match ready!(Pin::new(fut).poll(cx)) {
Ok(item) => item,
Err(e) => return Poll::Ready(Some(Err(e.into()))),
};
self.decoder = Some(decoder); self.decoder = Some(decoder);
self.fut.take(); self.fut.take();
if let Some(chunk) = chunk { if let Some(chunk) = chunk {
return Ok(Async::Ready(Some(chunk))); return Poll::Ready(Some(Ok(chunk)));
} }
} }
if self.eof { if self.eof {
return Ok(Async::Ready(None)); return Poll::Ready(None);
} }
match self.stream.poll()? { match Pin::new(&mut self.stream).poll_next(cx) {
Async::Ready(Some(chunk)) => { Poll::Ready(Some(Err(err))) => return Poll::Ready(Some(Err(err))),
Poll::Ready(Some(Ok(chunk))) => {
if let Some(mut decoder) = self.decoder.take() { if let Some(mut decoder) = self.decoder.take() {
if chunk.len() < INPLACE { if chunk.len() < INPLACE {
let chunk = decoder.feed_data(chunk)?; let chunk = decoder.feed_data(chunk)?;
self.decoder = Some(decoder); self.decoder = Some(decoder);
if let Some(chunk) = chunk { if let Some(chunk) = chunk {
return Ok(Async::Ready(Some(chunk))); return Poll::Ready(Some(Ok(chunk)));
} }
} else { } else {
self.fut = Some(run(move || { self.fut = Some(run(move || {
@@ -108,21 +117,25 @@ where
} }
continue; continue;
} else { } else {
return Ok(Async::Ready(Some(chunk))); return Poll::Ready(Some(Ok(chunk)));
} }
} }
Async::Ready(None) => { Poll::Ready(None) => {
self.eof = true; self.eof = true;
return if let Some(mut decoder) = self.decoder.take() { return if let Some(mut decoder) = self.decoder.take() {
Ok(Async::Ready(decoder.feed_eof()?)) match decoder.feed_eof() {
Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
Ok(None) => Poll::Ready(None),
Err(err) => Poll::Ready(Some(Err(err.into()))),
}
} else { } else {
Ok(Async::Ready(None)) Poll::Ready(None)
}; };
} }
Async::NotReady => break, Poll::Pending => break,
} }
} }
Ok(Async::NotReady) Poll::Pending
} }
} }

View File

@@ -1,5 +1,8 @@
//! Stream encoder //! Stream encoder
use std::future::Future;
use std::io::{self, Write}; use std::io::{self, Write};
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_threadpool::{run, CpuFuture}; use actix_threadpool::{run, CpuFuture};
#[cfg(feature = "brotli")] #[cfg(feature = "brotli")]
@@ -7,11 +10,10 @@ use brotli2::write::BrotliEncoder;
use bytes::Bytes; use bytes::Bytes;
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))] #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
use flate2::write::{GzEncoder, ZlibEncoder}; use flate2::write::{GzEncoder, ZlibEncoder};
use futures::{Async, Future, Poll};
use crate::body::{Body, BodySize, MessageBody, ResponseBody}; use crate::body::{Body, BodySize, MessageBody, ResponseBody};
use crate::http::header::{ContentEncoding, CONTENT_ENCODING}; use crate::http::header::{ContentEncoding, CONTENT_ENCODING};
use crate::http::{HeaderValue, HttpTryFrom, StatusCode}; use crate::http::{HeaderValue, StatusCode};
use crate::{Error, ResponseHead}; use crate::{Error, ResponseHead};
use super::Writer; use super::Writer;
@@ -94,43 +96,45 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
} }
} }
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> { fn poll_next(&mut self, cx: &mut Context) -> Poll<Option<Result<Bytes, Error>>> {
loop { loop {
if self.eof { if self.eof {
return Ok(Async::Ready(None)); return Poll::Ready(None);
} }
if let Some(ref mut fut) = self.fut { if let Some(ref mut fut) = self.fut {
let mut encoder = futures::try_ready!(fut.poll()); let mut encoder = match futures::ready!(Pin::new(fut).poll(cx)) {
Ok(item) => item,
Err(e) => return Poll::Ready(Some(Err(e.into()))),
};
let chunk = encoder.take(); let chunk = encoder.take();
self.encoder = Some(encoder); self.encoder = Some(encoder);
self.fut.take(); self.fut.take();
if !chunk.is_empty() { if !chunk.is_empty() {
return Ok(Async::Ready(Some(chunk))); return Poll::Ready(Some(Ok(chunk)));
} }
} }
let result = match self.body { let result = match self.body {
EncoderBody::Bytes(ref mut b) => { EncoderBody::Bytes(ref mut b) => {
if b.is_empty() { if b.is_empty() {
Async::Ready(None) Poll::Ready(None)
} else { } else {
Async::Ready(Some(std::mem::replace(b, Bytes::new()))) Poll::Ready(Some(Ok(std::mem::replace(b, Bytes::new()))))
} }
} }
EncoderBody::Stream(ref mut b) => b.poll_next()?, EncoderBody::Stream(ref mut b) => b.poll_next(cx),
EncoderBody::BoxedStream(ref mut b) => b.poll_next()?, EncoderBody::BoxedStream(ref mut b) => b.poll_next(cx),
}; };
match result { match result {
Async::NotReady => return Ok(Async::NotReady), Poll::Ready(Some(Ok(chunk))) => {
Async::Ready(Some(chunk)) => {
if let Some(mut encoder) = self.encoder.take() { if let Some(mut encoder) = self.encoder.take() {
if chunk.len() < INPLACE { if chunk.len() < INPLACE {
encoder.write(&chunk)?; encoder.write(&chunk)?;
let chunk = encoder.take(); let chunk = encoder.take();
self.encoder = Some(encoder); self.encoder = Some(encoder);
if !chunk.is_empty() { if !chunk.is_empty() {
return Ok(Async::Ready(Some(chunk))); return Poll::Ready(Some(Ok(chunk)));
} }
} else { } else {
self.fut = Some(run(move || { self.fut = Some(run(move || {
@@ -139,22 +143,23 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
})); }));
} }
} else { } else {
return Ok(Async::Ready(Some(chunk))); return Poll::Ready(Some(Ok(chunk)));
} }
} }
Async::Ready(None) => { Poll::Ready(None) => {
if let Some(encoder) = self.encoder.take() { if let Some(encoder) = self.encoder.take() {
let chunk = encoder.finish()?; let chunk = encoder.finish()?;
if chunk.is_empty() { if chunk.is_empty() {
return Ok(Async::Ready(None)); return Poll::Ready(None);
} else { } else {
self.eof = true; self.eof = true;
return Ok(Async::Ready(Some(chunk))); return Poll::Ready(Some(Ok(chunk)));
} }
} else { } else {
return Ok(Async::Ready(None)); return Poll::Ready(None);
} }
} }
val => return val,
} }
} }
} }
@@ -163,7 +168,7 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) { fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) {
head.headers_mut().insert( head.headers_mut().insert(
CONTENT_ENCODING, CONTENT_ENCODING,
HeaderValue::try_from(Bytes::from_static(encoding.as_str().as_bytes())).unwrap(), HeaderValue::from_static(encoding.as_str()),
); );
} }

View File

@@ -20,7 +20,7 @@ impl Writer {
} }
} }
fn take(&mut self) -> Bytes { fn take(&mut self) -> Bytes {
self.buf.take().freeze() self.buf.split().freeze()
} }
} }

View File

@@ -10,14 +10,13 @@ pub use actix_threadpool::BlockingError;
use actix_utils::timeout::TimeoutError; use actix_utils::timeout::TimeoutError;
use bytes::BytesMut; use bytes::BytesMut;
use derive_more::{Display, From}; use derive_more::{Display, From};
use futures::Canceled; pub use futures::channel::oneshot::Canceled;
use http::uri::InvalidUri; use http::uri::InvalidUri;
use http::{header, Error as HttpError, StatusCode}; use http::{header, Error as HttpError, StatusCode};
use httparse; use httparse;
use serde::de::value::Error as DeError; use serde::de::value::Error as DeError;
use serde_json::error::Error as JsonError; use serde_json::error::Error as JsonError;
use serde_urlencoded::ser::Error as FormError; use serde_urlencoded::ser::Error as FormError;
use tokio_timer::Error as TimerError;
// re-export for convinience // re-export for convinience
use crate::body::Body; use crate::body::Body;
@@ -61,21 +60,23 @@ impl Error {
/// Error that can be converted to `Response` /// Error that can be converted to `Response`
pub trait ResponseError: fmt::Debug + fmt::Display { pub trait ResponseError: fmt::Debug + fmt::Display {
/// Response's status code
///
/// Internal server error is generated by default.
fn status_code(&self) -> StatusCode {
StatusCode::INTERNAL_SERVER_ERROR
}
/// Create response for error /// Create response for error
/// ///
/// Internal server error is generated by default. /// Internal server error is generated by default.
fn error_response(&self) -> Response { fn error_response(&self) -> Response {
Response::new(StatusCode::INTERNAL_SERVER_ERROR) let mut resp = Response::new(self.status_code());
}
/// Constructs an error response
fn render_response(&self) -> Response {
let mut resp = self.error_response();
let mut buf = BytesMut::new(); let mut buf = BytesMut::new();
let _ = write!(Writer(&mut buf), "{}", self); let _ = write!(Writer(&mut buf), "{}", self);
resp.headers_mut().insert( resp.headers_mut().insert(
header::CONTENT_TYPE, header::CONTENT_TYPE,
header::HeaderValue::from_static("text/plain"), header::HeaderValue::from_static("text/plain; charset=utf-8"),
); );
resp.set_body(Body::from(buf)) resp.set_body(Body::from(buf))
} }
@@ -112,12 +113,6 @@ impl fmt::Debug for Error {
} }
} }
impl From<()> for Error {
fn from(_: ()) -> Self {
Error::from(UnitError)
}
}
impl std::error::Error for Error { impl std::error::Error for Error {
fn description(&self) -> &str { fn description(&self) -> &str {
"actix-http::Error" "actix-http::Error"
@@ -132,6 +127,20 @@ impl std::error::Error for Error {
} }
} }
impl From<()> for Error {
fn from(_: ()) -> Self {
Error::from(UnitError)
}
}
impl From<std::convert::Infallible> for Error {
fn from(_: std::convert::Infallible) -> Self {
// `std::convert::Infallible` indicates an error
// that will never happen
unreachable!()
}
}
/// Convert `Error` to a `Response` instance /// Convert `Error` to a `Response` instance
impl From<Error> for Response { impl From<Error> for Response {
fn from(err: Error) -> Self { fn from(err: Error) -> Self {
@@ -150,10 +159,10 @@ impl<T: ResponseError + 'static> From<T> for Error {
/// Return `GATEWAY_TIMEOUT` for `TimeoutError` /// Return `GATEWAY_TIMEOUT` for `TimeoutError`
impl<E: ResponseError> ResponseError for TimeoutError<E> { impl<E: ResponseError> ResponseError for TimeoutError<E> {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
match self { match self {
TimeoutError::Service(e) => e.error_response(), TimeoutError::Service(e) => e.status_code(),
TimeoutError::Timeout => Response::new(StatusCode::GATEWAY_TIMEOUT), TimeoutError::Timeout => StatusCode::GATEWAY_TIMEOUT,
} }
} }
} }
@@ -171,31 +180,31 @@ impl ResponseError for JsonError {}
/// `InternalServerError` for `FormError` /// `InternalServerError` for `FormError`
impl ResponseError for FormError {} impl ResponseError for FormError {}
/// `InternalServerError` for `TimerError` #[cfg(feature = "openssl")]
impl ResponseError for TimerError {}
#[cfg(feature = "ssl")]
/// `InternalServerError` for `openssl::ssl::Error` /// `InternalServerError` for `openssl::ssl::Error`
impl ResponseError for openssl::ssl::Error {} impl ResponseError for actix_connect::ssl::openssl::SslError {}
#[cfg(feature = "ssl")] #[cfg(feature = "openssl")]
/// `InternalServerError` for `openssl::ssl::HandshakeError` /// `InternalServerError` for `openssl::ssl::HandshakeError`
impl ResponseError for openssl::ssl::HandshakeError<tokio_tcp::TcpStream> {} impl<T: std::fmt::Debug> ResponseError for actix_tls::openssl::HandshakeError<T> {}
/// Return `BAD_REQUEST` for `de::value::Error` /// Return `BAD_REQUEST` for `de::value::Error`
impl ResponseError for DeError { impl ResponseError for DeError {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
Response::new(StatusCode::BAD_REQUEST) StatusCode::BAD_REQUEST
} }
} }
/// `InternalServerError` for `Canceled`
impl ResponseError for Canceled {}
/// `InternalServerError` for `BlockingError` /// `InternalServerError` for `BlockingError`
impl<E: fmt::Debug> ResponseError for BlockingError<E> {} impl<E: fmt::Debug> ResponseError for BlockingError<E> {}
/// Return `BAD_REQUEST` for `Utf8Error` /// Return `BAD_REQUEST` for `Utf8Error`
impl ResponseError for Utf8Error { impl ResponseError for Utf8Error {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
Response::new(StatusCode::BAD_REQUEST) StatusCode::BAD_REQUEST
} }
} }
@@ -205,32 +214,22 @@ impl ResponseError for HttpError {}
/// Return `InternalServerError` for `io::Error` /// Return `InternalServerError` for `io::Error`
impl ResponseError for io::Error { impl ResponseError for io::Error {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
match self.kind() { match self.kind() {
io::ErrorKind::NotFound => Response::new(StatusCode::NOT_FOUND), io::ErrorKind::NotFound => StatusCode::NOT_FOUND,
io::ErrorKind::PermissionDenied => Response::new(StatusCode::FORBIDDEN), io::ErrorKind::PermissionDenied => StatusCode::FORBIDDEN,
_ => Response::new(StatusCode::INTERNAL_SERVER_ERROR), _ => StatusCode::INTERNAL_SERVER_ERROR,
} }
} }
} }
/// `BadRequest` for `InvalidHeaderValue` /// `BadRequest` for `InvalidHeaderValue`
impl ResponseError for header::InvalidHeaderValue { impl ResponseError for header::InvalidHeaderValue {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
Response::new(StatusCode::BAD_REQUEST) StatusCode::BAD_REQUEST
} }
} }
/// `BadRequest` for `InvalidHeaderValue`
impl ResponseError for header::InvalidHeaderValueBytes {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
}
}
/// `InternalServerError` for `futures::Canceled`
impl ResponseError for Canceled {}
/// A set of errors that can occur during parsing HTTP streams /// A set of errors that can occur during parsing HTTP streams
#[derive(Debug, Display)] #[derive(Debug, Display)]
pub enum ParseError { pub enum ParseError {
@@ -270,8 +269,8 @@ pub enum ParseError {
/// Return `BadRequest` for `ParseError` /// Return `BadRequest` for `ParseError`
impl ResponseError for ParseError { impl ResponseError for ParseError {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
Response::new(StatusCode::BAD_REQUEST) StatusCode::BAD_REQUEST
} }
} }
@@ -363,7 +362,7 @@ impl From<BlockingError<io::Error>> for PayloadError {
BlockingError::Error(e) => PayloadError::Io(e), BlockingError::Error(e) => PayloadError::Io(e),
BlockingError::Canceled => PayloadError::Io(io::Error::new( BlockingError::Canceled => PayloadError::Io(io::Error::new(
io::ErrorKind::Other, io::ErrorKind::Other,
"Thread pool is gone", "Operation is canceled",
)), )),
} }
} }
@@ -374,18 +373,18 @@ impl From<BlockingError<io::Error>> for PayloadError {
/// - `Overflow` returns `PayloadTooLarge` /// - `Overflow` returns `PayloadTooLarge`
/// - Other errors returns `BadRequest` /// - Other errors returns `BadRequest`
impl ResponseError for PayloadError { impl ResponseError for PayloadError {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
match *self { match *self {
PayloadError::Overflow => Response::new(StatusCode::PAYLOAD_TOO_LARGE), PayloadError::Overflow => StatusCode::PAYLOAD_TOO_LARGE,
_ => Response::new(StatusCode::BAD_REQUEST), _ => StatusCode::BAD_REQUEST,
} }
} }
} }
/// Return `BadRequest` for `cookie::ParseError` /// Return `BadRequest` for `cookie::ParseError`
impl ResponseError for crate::cookie::ParseError { impl ResponseError for crate::cookie::ParseError {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
Response::new(StatusCode::BAD_REQUEST) StatusCode::BAD_REQUEST
} }
} }
@@ -449,8 +448,8 @@ pub enum ContentTypeError {
/// Return `BadRequest` for `ContentTypeError` /// Return `BadRequest` for `ContentTypeError`
impl ResponseError for ContentTypeError { impl ResponseError for ContentTypeError {
fn error_response(&self) -> Response { fn status_code(&self) -> StatusCode {
Response::new(StatusCode::BAD_REQUEST) StatusCode::BAD_REQUEST
} }
} }
@@ -520,6 +519,19 @@ impl<T> ResponseError for InternalError<T>
where where
T: fmt::Debug + fmt::Display + 'static, T: fmt::Debug + fmt::Display + 'static,
{ {
fn status_code(&self) -> StatusCode {
match self.status {
InternalErrorType::Status(st) => st,
InternalErrorType::Response(ref resp) => {
if let Some(resp) = resp.borrow().as_ref() {
resp.head().status
} else {
StatusCode::INTERNAL_SERVER_ERROR
}
}
}
}
fn error_response(&self) -> Response { fn error_response(&self) -> Response {
match self.status { match self.status {
InternalErrorType::Status(st) => { InternalErrorType::Status(st) => {
@@ -528,7 +540,7 @@ where
let _ = write!(Writer(&mut buf), "{}", self); let _ = write!(Writer(&mut buf), "{}", self);
res.headers_mut().insert( res.headers_mut().insert(
header::CONTENT_TYPE, header::CONTENT_TYPE,
header::HeaderValue::from_static("text/plain"), header::HeaderValue::from_static("text/plain; charset=utf-8"),
); );
res.set_body(Body::from(buf)) res.set_body(Body::from(buf))
} }
@@ -541,11 +553,6 @@ where
} }
} }
} }
/// Constructs an error response
fn render_response(&self) -> Response {
self.error_response()
}
} }
/// Convert Response to a Error /// Convert Response to a Error
@@ -950,11 +957,7 @@ mod failure_integration {
use super::*; use super::*;
/// Compatibility for `failure::Error` /// Compatibility for `failure::Error`
impl ResponseError for failure::Error { impl ResponseError for failure::Error {}
fn error_response(&self) -> Response {
Response::new(StatusCode::INTERNAL_SERVER_ERROR)
}
}
} }
#[cfg(test)] #[cfg(test)]

View File

@@ -1,12 +1,12 @@
use std::any::{Any, TypeId}; use std::any::{Any, TypeId};
use std::fmt; use std::fmt;
use hashbrown::HashMap; use fxhash::FxHashMap;
#[derive(Default)] #[derive(Default)]
/// A type map of request extensions. /// A type map of request extensions.
pub struct Extensions { pub struct Extensions {
map: HashMap<TypeId, Box<dyn Any>>, map: FxHashMap<TypeId, Box<dyn Any>>,
} }
impl Extensions { impl Extensions {
@@ -14,7 +14,7 @@ impl Extensions {
#[inline] #[inline]
pub fn new() -> Extensions { pub fn new() -> Extensions {
Extensions { Extensions {
map: HashMap::default(), map: FxHashMap::default(),
} }
} }

View File

@@ -1,11 +1,13 @@
use std::convert::TryFrom;
use std::io;
use std::marker::PhantomData; use std::marker::PhantomData;
use std::{io, mem}; use std::mem::MaybeUninit;
use std::task::Poll;
use actix_codec::Decoder; use actix_codec::Decoder;
use bytes::{Bytes, BytesMut}; use bytes::{Bytes, BytesMut};
use futures::{Async, Poll};
use http::header::{HeaderName, HeaderValue}; use http::header::{HeaderName, HeaderValue};
use http::{header, HttpTryFrom, Method, StatusCode, Uri, Version}; use http::{header, Method, StatusCode, Uri, Version};
use httparse; use httparse;
use log::{debug, error, trace}; use log::{debug, error, trace};
@@ -78,8 +80,8 @@ pub(crate) trait MessageType: Sized {
// Unsafe: httparse check header value for valid utf-8 // Unsafe: httparse check header value for valid utf-8
let value = unsafe { let value = unsafe {
HeaderValue::from_shared_unchecked( HeaderValue::from_maybe_shared_unchecked(
slice.slice(idx.value.0, idx.value.1), slice.slice(idx.value.0..idx.value.1),
) )
}; };
match name { match name {
@@ -186,11 +188,12 @@ impl MessageType for Request {
fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> { fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
// Unsafe: we read only this data only after httparse parses headers into. // Unsafe: we read only this data only after httparse parses headers into.
// performance bump for pipeline benchmarks. // performance bump for pipeline benchmarks.
let mut headers: [HeaderIndex; MAX_HEADERS] = unsafe { mem::uninitialized() }; let mut headers: [HeaderIndex; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let (len, method, uri, ver, h_len) = { let (len, method, uri, ver, h_len) = {
let mut parsed: [httparse::Header; MAX_HEADERS] = let mut parsed: [httparse::Header; MAX_HEADERS] =
unsafe { mem::uninitialized() }; unsafe { MaybeUninit::uninit().assume_init() };
let mut req = httparse::Request::new(&mut parsed); let mut req = httparse::Request::new(&mut parsed);
match req.parse(src)? { match req.parse(src)? {
@@ -260,11 +263,12 @@ impl MessageType for ResponseHead {
fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> { fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
// Unsafe: we read only this data only after httparse parses headers into. // Unsafe: we read only this data only after httparse parses headers into.
// performance bump for pipeline benchmarks. // performance bump for pipeline benchmarks.
let mut headers: [HeaderIndex; MAX_HEADERS] = unsafe { mem::uninitialized() }; let mut headers: [HeaderIndex; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let (len, ver, status, h_len) = { let (len, ver, status, h_len) = {
let mut parsed: [httparse::Header; MAX_HEADERS] = let mut parsed: [httparse::Header; MAX_HEADERS] =
unsafe { mem::uninitialized() }; unsafe { MaybeUninit::uninit().assume_init() };
let mut res = httparse::Response::new(&mut parsed); let mut res = httparse::Response::new(&mut parsed);
match res.parse(src)? { match res.parse(src)? {
@@ -425,7 +429,7 @@ impl Decoder for PayloadDecoder {
let len = src.len() as u64; let len = src.len() as u64;
let buf; let buf;
if *remaining > len { if *remaining > len {
buf = src.take().freeze(); buf = src.split().freeze();
*remaining -= len; *remaining -= len;
} else { } else {
buf = src.split_to(*remaining as usize).freeze(); buf = src.split_to(*remaining as usize).freeze();
@@ -439,9 +443,10 @@ impl Decoder for PayloadDecoder {
loop { loop {
let mut buf = None; let mut buf = None;
// advances the chunked state // advances the chunked state
*state = match state.step(src, size, &mut buf)? { *state = match state.step(src, size, &mut buf) {
Async::NotReady => return Ok(None), Poll::Pending => return Ok(None),
Async::Ready(state) => state, Poll::Ready(Ok(state)) => state,
Poll::Ready(Err(e)) => return Err(e),
}; };
if *state == ChunkedState::End { if *state == ChunkedState::End {
trace!("End of chunked stream"); trace!("End of chunked stream");
@@ -459,7 +464,7 @@ impl Decoder for PayloadDecoder {
if src.is_empty() { if src.is_empty() {
Ok(None) Ok(None)
} else { } else {
Ok(Some(PayloadItem::Chunk(src.take().freeze()))) Ok(Some(PayloadItem::Chunk(src.split().freeze())))
} }
} }
} }
@@ -473,7 +478,7 @@ macro_rules! byte (
$rdr.split_to(1); $rdr.split_to(1);
b b
} else { } else {
return Ok(Async::NotReady) return Poll::Pending
} }
}) })
); );
@@ -484,7 +489,7 @@ impl ChunkedState {
body: &mut BytesMut, body: &mut BytesMut,
size: &mut u64, size: &mut u64,
buf: &mut Option<Bytes>, buf: &mut Option<Bytes>,
) -> Poll<ChunkedState, io::Error> { ) -> Poll<Result<ChunkedState, io::Error>> {
use self::ChunkedState::*; use self::ChunkedState::*;
match *self { match *self {
Size => ChunkedState::read_size(body, size), Size => ChunkedState::read_size(body, size),
@@ -496,10 +501,14 @@ impl ChunkedState {
BodyLf => ChunkedState::read_body_lf(body), BodyLf => ChunkedState::read_body_lf(body),
EndCr => ChunkedState::read_end_cr(body), EndCr => ChunkedState::read_end_cr(body),
EndLf => ChunkedState::read_end_lf(body), EndLf => ChunkedState::read_end_lf(body),
End => Ok(Async::Ready(ChunkedState::End)), End => Poll::Ready(Ok(ChunkedState::End)),
} }
} }
fn read_size(rdr: &mut BytesMut, size: &mut u64) -> Poll<ChunkedState, io::Error> {
fn read_size(
rdr: &mut BytesMut,
size: &mut u64,
) -> Poll<Result<ChunkedState, io::Error>> {
let radix = 16; let radix = 16;
match byte!(rdr) { match byte!(rdr) {
b @ b'0'..=b'9' => { b @ b'0'..=b'9' => {
@@ -514,48 +523,49 @@ impl ChunkedState {
*size *= radix; *size *= radix;
*size += u64::from(b + 10 - b'A'); *size += u64::from(b + 10 - b'A');
} }
b'\t' | b' ' => return Ok(Async::Ready(ChunkedState::SizeLws)), b'\t' | b' ' => return Poll::Ready(Ok(ChunkedState::SizeLws)),
b';' => return Ok(Async::Ready(ChunkedState::Extension)), b';' => return Poll::Ready(Ok(ChunkedState::Extension)),
b'\r' => return Ok(Async::Ready(ChunkedState::SizeLf)), b'\r' => return Poll::Ready(Ok(ChunkedState::SizeLf)),
_ => { _ => {
return Err(io::Error::new( return Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput, io::ErrorKind::InvalidInput,
"Invalid chunk size line: Invalid Size", "Invalid chunk size line: Invalid Size",
)); )));
} }
} }
Ok(Async::Ready(ChunkedState::Size)) Poll::Ready(Ok(ChunkedState::Size))
} }
fn read_size_lws(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_size_lws(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
trace!("read_size_lws"); trace!("read_size_lws");
match byte!(rdr) { match byte!(rdr) {
// LWS can follow the chunk size, but no more digits can come // LWS can follow the chunk size, but no more digits can come
b'\t' | b' ' => Ok(Async::Ready(ChunkedState::SizeLws)), b'\t' | b' ' => Poll::Ready(Ok(ChunkedState::SizeLws)),
b';' => Ok(Async::Ready(ChunkedState::Extension)), b';' => Poll::Ready(Ok(ChunkedState::Extension)),
b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)), b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
_ => Err(io::Error::new( _ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput, io::ErrorKind::InvalidInput,
"Invalid chunk size linear white space", "Invalid chunk size linear white space",
)), ))),
} }
} }
fn read_extension(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> { fn read_extension(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) { match byte!(rdr) {
b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)), b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
_ => Ok(Async::Ready(ChunkedState::Extension)), // no supported extensions _ => Poll::Ready(Ok(ChunkedState::Extension)), // no supported extensions
} }
} }
fn read_size_lf( fn read_size_lf(
rdr: &mut BytesMut, rdr: &mut BytesMut,
size: &mut u64, size: &mut u64,
) -> Poll<ChunkedState, io::Error> { ) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) { match byte!(rdr) {
b'\n' if *size > 0 => Ok(Async::Ready(ChunkedState::Body)), b'\n' if *size > 0 => Poll::Ready(Ok(ChunkedState::Body)),
b'\n' if *size == 0 => Ok(Async::Ready(ChunkedState::EndCr)), b'\n' if *size == 0 => Poll::Ready(Ok(ChunkedState::EndCr)),
_ => Err(io::Error::new( _ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput, io::ErrorKind::InvalidInput,
"Invalid chunk size LF", "Invalid chunk size LF",
)), ))),
} }
} }
@@ -563,16 +573,16 @@ impl ChunkedState {
rdr: &mut BytesMut, rdr: &mut BytesMut,
rem: &mut u64, rem: &mut u64,
buf: &mut Option<Bytes>, buf: &mut Option<Bytes>,
) -> Poll<ChunkedState, io::Error> { ) -> Poll<Result<ChunkedState, io::Error>> {
trace!("Chunked read, remaining={:?}", rem); trace!("Chunked read, remaining={:?}", rem);
let len = rdr.len() as u64; let len = rdr.len() as u64;
if len == 0 { if len == 0 {
Ok(Async::Ready(ChunkedState::Body)) Poll::Ready(Ok(ChunkedState::Body))
} else { } else {
let slice; let slice;
if *rem > len { if *rem > len {
slice = rdr.take().freeze(); slice = rdr.split().freeze();
*rem -= len; *rem -= len;
} else { } else {
slice = rdr.split_to(*rem as usize).freeze(); slice = rdr.split_to(*rem as usize).freeze();
@@ -580,47 +590,47 @@ impl ChunkedState {
} }
*buf = Some(slice); *buf = Some(slice);
if *rem > 0 { if *rem > 0 {
Ok(Async::Ready(ChunkedState::Body)) Poll::Ready(Ok(ChunkedState::Body))
} else { } else {
Ok(Async::Ready(ChunkedState::BodyCr)) Poll::Ready(Ok(ChunkedState::BodyCr))
} }
} }
} }
fn read_body_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> { fn read_body_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) { match byte!(rdr) {
b'\r' => Ok(Async::Ready(ChunkedState::BodyLf)), b'\r' => Poll::Ready(Ok(ChunkedState::BodyLf)),
_ => Err(io::Error::new( _ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput, io::ErrorKind::InvalidInput,
"Invalid chunk body CR", "Invalid chunk body CR",
)), ))),
} }
} }
fn read_body_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> { fn read_body_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) { match byte!(rdr) {
b'\n' => Ok(Async::Ready(ChunkedState::Size)), b'\n' => Poll::Ready(Ok(ChunkedState::Size)),
_ => Err(io::Error::new( _ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput, io::ErrorKind::InvalidInput,
"Invalid chunk body LF", "Invalid chunk body LF",
)), ))),
} }
} }
fn read_end_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> { fn read_end_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) { match byte!(rdr) {
b'\r' => Ok(Async::Ready(ChunkedState::EndLf)), b'\r' => Poll::Ready(Ok(ChunkedState::EndLf)),
_ => Err(io::Error::new( _ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput, io::ErrorKind::InvalidInput,
"Invalid chunk end CR", "Invalid chunk end CR",
)), ))),
} }
} }
fn read_end_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> { fn read_end_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) { match byte!(rdr) {
b'\n' => Ok(Async::Ready(ChunkedState::End)), b'\n' => Poll::Ready(Ok(ChunkedState::End)),
_ => Err(io::Error::new( _ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput, io::ErrorKind::InvalidInput,
"Invalid chunk end LF", "Invalid chunk end LF",
)), ))),
} }
} }
} }

View File

@@ -1,15 +1,15 @@
use std::collections::VecDeque; use std::collections::VecDeque;
use std::time::Instant; use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, io, net}; use std::{fmt, io, net};
use actix_codec::{Decoder, Encoder, Framed, FramedParts}; use actix_codec::{AsyncRead, AsyncWrite, Decoder, Encoder, Framed, FramedParts};
use actix_server_config::IoStream; use actix_rt::time::{delay_until, Delay, Instant};
use actix_service::Service; use actix_service::Service;
use bitflags::bitflags; use bitflags::bitflags;
use bytes::{BufMut, BytesMut}; use bytes::{BufMut, BytesMut};
use futures::{Async, Future, Poll};
use log::{error, trace}; use log::{error, trace};
use tokio_timer::Delay;
use crate::body::{Body, BodySize, MessageBody, ResponseBody}; use crate::body::{Body, BodySize, MessageBody, ResponseBody};
use crate::cloneable::CloneableService; use crate::cloneable::CloneableService;
@@ -166,7 +166,7 @@ impl PartialEq for PollResponse {
impl<T, S, B, X, U> Dispatcher<T, S, B, X, U> impl<T, S, B, X, U> Dispatcher<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
@@ -184,6 +184,7 @@ where
expect: CloneableService<X>, expect: CloneableService<X>,
upgrade: Option<CloneableService<U>>, upgrade: Option<CloneableService<U>>,
on_connect: Option<Box<dyn DataFactory>>, on_connect: Option<Box<dyn DataFactory>>,
peer_addr: Option<net::SocketAddr>,
) -> Self { ) -> Self {
Dispatcher::with_timeout( Dispatcher::with_timeout(
stream, stream,
@@ -195,6 +196,7 @@ where
expect, expect,
upgrade, upgrade,
on_connect, on_connect,
peer_addr,
) )
} }
@@ -209,6 +211,7 @@ where
expect: CloneableService<X>, expect: CloneableService<X>,
upgrade: Option<CloneableService<U>>, upgrade: Option<CloneableService<U>>,
on_connect: Option<Box<dyn DataFactory>>, on_connect: Option<Box<dyn DataFactory>>,
peer_addr: Option<net::SocketAddr>,
) -> Self { ) -> Self {
let keepalive = config.keep_alive_enabled(); let keepalive = config.keep_alive_enabled();
let flags = if keepalive { let flags = if keepalive {
@@ -232,7 +235,6 @@ where
payload: None, payload: None,
state: State::None, state: State::None,
error: None, error: None,
peer_addr: io.peer_addr(),
messages: VecDeque::new(), messages: VecDeque::new(),
io, io,
codec, codec,
@@ -242,6 +244,7 @@ where
upgrade, upgrade,
on_connect, on_connect,
flags, flags,
peer_addr,
ka_expire, ka_expire,
ka_timer, ka_timer,
}), }),
@@ -251,7 +254,7 @@ where
impl<T, S, B, X, U> InnerDispatcher<T, S, B, X, U> impl<T, S, B, X, U> InnerDispatcher<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
@@ -261,14 +264,14 @@ where
U: Service<Request = (Request, Framed<T, Codec>), Response = ()>, U: Service<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
{ {
fn can_read(&self) -> bool { fn can_read(&self, cx: &mut Context) -> bool {
if self if self
.flags .flags
.intersects(Flags::READ_DISCONNECT | Flags::UPGRADE) .intersects(Flags::READ_DISCONNECT | Flags::UPGRADE)
{ {
false false
} else if let Some(ref info) = self.payload { } else if let Some(ref info) = self.payload {
info.need_read() == PayloadStatus::Read info.need_read(cx) == PayloadStatus::Read
} else { } else {
true true
} }
@@ -287,7 +290,7 @@ where
/// ///
/// true - got whouldblock /// true - got whouldblock
/// false - didnt get whouldblock /// false - didnt get whouldblock
fn poll_flush(&mut self) -> Result<bool, DispatchError> { fn poll_flush(&mut self, cx: &mut Context) -> Result<bool, DispatchError> {
if self.write_buf.is_empty() { if self.write_buf.is_empty() {
return Ok(false); return Ok(false);
} }
@@ -295,32 +298,32 @@ where
let len = self.write_buf.len(); let len = self.write_buf.len();
let mut written = 0; let mut written = 0;
while written < len { while written < len {
match self.io.write(&self.write_buf[written..]) { match unsafe { Pin::new_unchecked(&mut self.io) }
Ok(0) => { .poll_write(cx, &self.write_buf[written..])
{
Poll::Ready(Ok(0)) => {
return Err(DispatchError::Io(io::Error::new( return Err(DispatchError::Io(io::Error::new(
io::ErrorKind::WriteZero, io::ErrorKind::WriteZero,
"", "",
))); )));
} }
Ok(n) => { Poll::Ready(Ok(n)) => {
written += n; written += n;
} }
Err(ref e) if e.kind() == io::ErrorKind::WouldBlock => { Poll::Pending => {
if written > 0 { if written > 0 {
let _ = self.write_buf.split_to(written); let _ = self.write_buf.split_to(written);
} }
return Ok(true); return Ok(true);
} }
Err(err) => return Err(DispatchError::Io(err)), Poll::Ready(Err(err)) => return Err(DispatchError::Io(err)),
} }
} }
if written > 0 {
if written == self.write_buf.len() { if written == self.write_buf.len() {
unsafe { self.write_buf.set_len(0) } unsafe { self.write_buf.set_len(0) }
} else { } else {
let _ = self.write_buf.split_to(written); let _ = self.write_buf.split_to(written);
} }
}
Ok(false) Ok(false)
} }
@@ -350,12 +353,15 @@ where
.extend_from_slice(b"HTTP/1.1 100 Continue\r\n\r\n"); .extend_from_slice(b"HTTP/1.1 100 Continue\r\n\r\n");
} }
fn poll_response(&mut self) -> Result<PollResponse, DispatchError> { fn poll_response(
&mut self,
cx: &mut Context,
) -> Result<PollResponse, DispatchError> {
loop { loop {
let state = match self.state { let state = match self.state {
State::None => match self.messages.pop_front() { State::None => match self.messages.pop_front() {
Some(DispatcherMessage::Item(req)) => { Some(DispatcherMessage::Item(req)) => {
Some(self.handle_request(req)?) Some(self.handle_request(req, cx)?)
} }
Some(DispatcherMessage::Error(res)) => { Some(DispatcherMessage::Error(res)) => {
Some(self.send_response(res, ResponseBody::Other(Body::Empty))?) Some(self.send_response(res, ResponseBody::Other(Body::Empty))?)
@@ -365,54 +371,58 @@ where
} }
None => None, None => None,
}, },
State::ExpectCall(ref mut fut) => match fut.poll() { State::ExpectCall(ref mut fut) => {
Ok(Async::Ready(req)) => { match unsafe { Pin::new_unchecked(fut) }.poll(cx) {
Poll::Ready(Ok(req)) => {
self.send_continue(); self.send_continue();
self.state = State::ServiceCall(self.service.call(req)); self.state = State::ServiceCall(self.service.call(req));
continue; continue;
} }
Ok(Async::NotReady) => None, Poll::Ready(Err(e)) => {
Err(e) => {
let res: Response = e.into().into(); let res: Response = e.into().into();
let (res, body) = res.replace_body(()); let (res, body) = res.replace_body(());
Some(self.send_response(res, body.into_body())?) Some(self.send_response(res, body.into_body())?)
} }
}, Poll::Pending => None,
State::ServiceCall(ref mut fut) => match fut.poll() { }
Ok(Async::Ready(res)) => { }
State::ServiceCall(ref mut fut) => {
match unsafe { Pin::new_unchecked(fut) }.poll(cx) {
Poll::Ready(Ok(res)) => {
let (res, body) = res.into().replace_body(()); let (res, body) = res.into().replace_body(());
self.state = self.send_response(res, body)?; self.state = self.send_response(res, body)?;
continue; continue;
} }
Ok(Async::NotReady) => None, Poll::Ready(Err(e)) => {
Err(e) => {
let res: Response = e.into().into(); let res: Response = e.into().into();
let (res, body) = res.replace_body(()); let (res, body) = res.replace_body(());
Some(self.send_response(res, body.into_body())?) Some(self.send_response(res, body.into_body())?)
} }
}, Poll::Pending => None,
}
}
State::SendPayload(ref mut stream) => { State::SendPayload(ref mut stream) => {
loop { loop {
if self.write_buf.len() < HW_BUFFER_SIZE { if self.write_buf.len() < HW_BUFFER_SIZE {
match stream match stream.poll_next(cx) {
.poll_next() Poll::Ready(Some(Ok(item))) => {
.map_err(|_| DispatchError::Unknown)?
{
Async::Ready(Some(item)) => {
self.codec.encode( self.codec.encode(
Message::Chunk(Some(item)), Message::Chunk(Some(item)),
&mut self.write_buf, &mut self.write_buf,
)?; )?;
continue; continue;
} }
Async::Ready(None) => { Poll::Ready(None) => {
self.codec.encode( self.codec.encode(
Message::Chunk(None), Message::Chunk(None),
&mut self.write_buf, &mut self.write_buf,
)?; )?;
self.state = State::None; self.state = State::None;
} }
Async::NotReady => return Ok(PollResponse::DoNothing), Poll::Ready(Some(Err(_))) => {
return Err(DispatchError::Unknown)
}
Poll::Pending => return Ok(PollResponse::DoNothing),
} }
} else { } else {
return Ok(PollResponse::DrainWriteBuf); return Ok(PollResponse::DrainWriteBuf);
@@ -433,7 +443,7 @@ where
// if read-backpressure is enabled and we consumed some data. // if read-backpressure is enabled and we consumed some data.
// we may read more data and retry // we may read more data and retry
if self.state.is_call() { if self.state.is_call() {
if self.poll_request()? { if self.poll_request(cx)? {
continue; continue;
} }
} else if !self.messages.is_empty() { } else if !self.messages.is_empty() {
@@ -446,17 +456,21 @@ where
Ok(PollResponse::DoNothing) Ok(PollResponse::DoNothing)
} }
fn handle_request(&mut self, req: Request) -> Result<State<S, B, X>, DispatchError> { fn handle_request(
&mut self,
req: Request,
cx: &mut Context,
) -> Result<State<S, B, X>, DispatchError> {
// Handle `EXPECT: 100-Continue` header // Handle `EXPECT: 100-Continue` header
let req = if req.head().expect() { let req = if req.head().expect() {
let mut task = self.expect.call(req); let mut task = self.expect.call(req);
match task.poll() { match unsafe { Pin::new_unchecked(&mut task) }.poll(cx) {
Ok(Async::Ready(req)) => { Poll::Ready(Ok(req)) => {
self.send_continue(); self.send_continue();
req req
} }
Ok(Async::NotReady) => return Ok(State::ExpectCall(task)), Poll::Pending => return Ok(State::ExpectCall(task)),
Err(e) => { Poll::Ready(Err(e)) => {
let e = e.into(); let e = e.into();
let res: Response = e.into(); let res: Response = e.into();
let (res, body) = res.replace_body(()); let (res, body) = res.replace_body(());
@@ -469,13 +483,13 @@ where
// Call service // Call service
let mut task = self.service.call(req); let mut task = self.service.call(req);
match task.poll() { match unsafe { Pin::new_unchecked(&mut task) }.poll(cx) {
Ok(Async::Ready(res)) => { Poll::Ready(Ok(res)) => {
let (res, body) = res.into().replace_body(()); let (res, body) = res.into().replace_body(());
self.send_response(res, body) self.send_response(res, body)
} }
Ok(Async::NotReady) => Ok(State::ServiceCall(task)), Poll::Pending => Ok(State::ServiceCall(task)),
Err(e) => { Poll::Ready(Err(e)) => {
let res: Response = e.into().into(); let res: Response = e.into().into();
let (res, body) = res.replace_body(()); let (res, body) = res.replace_body(());
self.send_response(res, body.into_body()) self.send_response(res, body.into_body())
@@ -484,9 +498,12 @@ where
} }
/// Process one incoming requests /// Process one incoming requests
pub(self) fn poll_request(&mut self) -> Result<bool, DispatchError> { pub(self) fn poll_request(
&mut self,
cx: &mut Context,
) -> Result<bool, DispatchError> {
// limit a mount of non processed requests // limit a mount of non processed requests
if self.messages.len() >= MAX_PIPELINED_MESSAGES || !self.can_read() { if self.messages.len() >= MAX_PIPELINED_MESSAGES || !self.can_read(cx) {
return Ok(false); return Ok(false);
} }
@@ -521,7 +538,7 @@ where
// handle request early // handle request early
if self.state.is_empty() { if self.state.is_empty() {
self.state = self.handle_request(req)?; self.state = self.handle_request(req, cx)?;
} else { } else {
self.messages.push_back(DispatcherMessage::Item(req)); self.messages.push_back(DispatcherMessage::Item(req));
} }
@@ -587,12 +604,12 @@ where
} }
/// keep-alive timer /// keep-alive timer
fn poll_keepalive(&mut self) -> Result<(), DispatchError> { fn poll_keepalive(&mut self, cx: &mut Context) -> Result<(), DispatchError> {
if self.ka_timer.is_none() { if self.ka_timer.is_none() {
// shutdown timeout // shutdown timeout
if self.flags.contains(Flags::SHUTDOWN) { if self.flags.contains(Flags::SHUTDOWN) {
if let Some(interval) = self.codec.config().client_disconnect_timer() { if let Some(interval) = self.codec.config().client_disconnect_timer() {
self.ka_timer = Some(Delay::new(interval)); self.ka_timer = Some(delay_until(interval));
} else { } else {
self.flags.insert(Flags::READ_DISCONNECT); self.flags.insert(Flags::READ_DISCONNECT);
if let Some(mut payload) = self.payload.take() { if let Some(mut payload) = self.payload.take() {
@@ -605,11 +622,8 @@ where
} }
} }
match self.ka_timer.as_mut().unwrap().poll().map_err(|e| { match Pin::new(&mut self.ka_timer.as_mut().unwrap()).poll(cx) {
error!("Timer error {:?}", e); Poll::Ready(()) => {
DispatchError::Unknown
})? {
Async::Ready(_) => {
// if we get timeout during shutdown, drop connection // if we get timeout during shutdown, drop connection
if self.flags.contains(Flags::SHUTDOWN) { if self.flags.contains(Flags::SHUTDOWN) {
return Err(DispatchError::DisconnectTimeout); return Err(DispatchError::DisconnectTimeout);
@@ -624,9 +638,9 @@ where
if let Some(deadline) = if let Some(deadline) =
self.codec.config().client_disconnect_timer() self.codec.config().client_disconnect_timer()
{ {
if let Some(timer) = self.ka_timer.as_mut() { if let Some(mut timer) = self.ka_timer.as_mut() {
timer.reset(deadline); timer.reset(deadline);
let _ = timer.poll(); let _ = Pin::new(&mut timer).poll(cx);
} }
} else { } else {
// no shutdown timeout, drop socket // no shutdown timeout, drop socket
@@ -650,26 +664,26 @@ where
} else if let Some(deadline) = } else if let Some(deadline) =
self.codec.config().keep_alive_expire() self.codec.config().keep_alive_expire()
{ {
if let Some(timer) = self.ka_timer.as_mut() { if let Some(mut timer) = self.ka_timer.as_mut() {
timer.reset(deadline); timer.reset(deadline);
let _ = timer.poll(); let _ = Pin::new(&mut timer).poll(cx);
} }
} }
} else if let Some(timer) = self.ka_timer.as_mut() { } else if let Some(mut timer) = self.ka_timer.as_mut() {
timer.reset(self.ka_expire); timer.reset(self.ka_expire);
let _ = timer.poll(); let _ = Pin::new(&mut timer).poll(cx);
} }
} }
Async::NotReady => (), Poll::Pending => (),
} }
Ok(()) Ok(())
} }
} }
impl<T, S, B, X, U> Future for Dispatcher<T, S, B, X, U> impl<T, S, B, X, U> Unpin for Dispatcher<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
@@ -679,27 +693,42 @@ where
U: Service<Request = (Request, Framed<T, Codec>), Response = ()>, U: Service<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
{ {
type Item = (); }
type Error = DispatchError;
impl<T, S, B, X, U> Future for Dispatcher<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
B: MessageBody,
X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
{
type Output = Result<(), DispatchError>;
#[inline] #[inline]
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
match self.inner { match self.as_mut().inner {
DispatcherState::Normal(ref mut inner) => { DispatcherState::Normal(ref mut inner) => {
inner.poll_keepalive()?; inner.poll_keepalive(cx)?;
if inner.flags.contains(Flags::SHUTDOWN) { if inner.flags.contains(Flags::SHUTDOWN) {
if inner.flags.contains(Flags::WRITE_DISCONNECT) { if inner.flags.contains(Flags::WRITE_DISCONNECT) {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} else { } else {
// flush buffer // flush buffer
inner.poll_flush()?; inner.poll_flush(cx)?;
if !inner.write_buf.is_empty() { if !inner.write_buf.is_empty() {
Ok(Async::NotReady) Poll::Pending
} else { } else {
match inner.io.shutdown()? { match Pin::new(&mut inner.io).poll_shutdown(cx) {
Async::Ready(_) => Ok(Async::Ready(())), Poll::Ready(res) => {
Async::NotReady => Ok(Async::NotReady), Poll::Ready(res.map_err(DispatchError::from))
}
Poll::Pending => Poll::Pending,
} }
} }
} }
@@ -707,12 +736,12 @@ where
// read socket into a buf // read socket into a buf
let should_disconnect = let should_disconnect =
if !inner.flags.contains(Flags::READ_DISCONNECT) { if !inner.flags.contains(Flags::READ_DISCONNECT) {
read_available(&mut inner.io, &mut inner.read_buf)? read_available(cx, &mut inner.io, &mut inner.read_buf)?
} else { } else {
None None
}; };
inner.poll_request()?; inner.poll_request(cx)?;
if let Some(true) = should_disconnect { if let Some(true) = should_disconnect {
inner.flags.insert(Flags::READ_DISCONNECT); inner.flags.insert(Flags::READ_DISCONNECT);
if let Some(mut payload) = inner.payload.take() { if let Some(mut payload) = inner.payload.take() {
@@ -724,7 +753,7 @@ where
if inner.write_buf.remaining_mut() < LW_BUFFER_SIZE { if inner.write_buf.remaining_mut() < LW_BUFFER_SIZE {
inner.write_buf.reserve(HW_BUFFER_SIZE); inner.write_buf.reserve(HW_BUFFER_SIZE);
} }
let result = inner.poll_response()?; let result = inner.poll_response(cx)?;
let drain = result == PollResponse::DrainWriteBuf; let drain = result == PollResponse::DrainWriteBuf;
// switch to upgrade handler // switch to upgrade handler
@@ -742,7 +771,7 @@ where
self.inner = DispatcherState::Upgrade( self.inner = DispatcherState::Upgrade(
inner.upgrade.unwrap().call((req, framed)), inner.upgrade.unwrap().call((req, framed)),
); );
return self.poll(); return self.poll(cx);
} else { } else {
panic!() panic!()
} }
@@ -751,14 +780,14 @@ where
// we didnt get WouldBlock from write operation, // we didnt get WouldBlock from write operation,
// so data get written to kernel completely (OSX) // so data get written to kernel completely (OSX)
// and we have to write again otherwise response can get stuck // and we have to write again otherwise response can get stuck
if inner.poll_flush()? || !drain { if inner.poll_flush(cx)? || !drain {
break; break;
} }
} }
// client is gone // client is gone
if inner.flags.contains(Flags::WRITE_DISCONNECT) { if inner.flags.contains(Flags::WRITE_DISCONNECT) {
return Ok(Async::Ready(())); return Poll::Ready(Ok(()));
} }
let is_empty = inner.state.is_empty(); let is_empty = inner.state.is_empty();
@@ -771,38 +800,44 @@ where
// keep-alive and stream errors // keep-alive and stream errors
if is_empty && inner.write_buf.is_empty() { if is_empty && inner.write_buf.is_empty() {
if let Some(err) = inner.error.take() { if let Some(err) = inner.error.take() {
Err(err) Poll::Ready(Err(err))
} }
// disconnect if keep-alive is not enabled // disconnect if keep-alive is not enabled
else if inner.flags.contains(Flags::STARTED) else if inner.flags.contains(Flags::STARTED)
&& !inner.flags.intersects(Flags::KEEPALIVE) && !inner.flags.intersects(Flags::KEEPALIVE)
{ {
inner.flags.insert(Flags::SHUTDOWN); inner.flags.insert(Flags::SHUTDOWN);
self.poll() self.poll(cx)
} }
// disconnect if shutdown // disconnect if shutdown
else if inner.flags.contains(Flags::SHUTDOWN) { else if inner.flags.contains(Flags::SHUTDOWN) {
self.poll() self.poll(cx)
} else { } else {
Ok(Async::NotReady) Poll::Pending
} }
} else { } else {
Ok(Async::NotReady) Poll::Pending
} }
} }
} }
DispatcherState::Upgrade(ref mut fut) => fut.poll().map_err(|e| { DispatcherState::Upgrade(ref mut fut) => {
unsafe { Pin::new_unchecked(fut) }.poll(cx).map_err(|e| {
error!("Upgrade handler error: {}", e); error!("Upgrade handler error: {}", e);
DispatchError::Upgrade DispatchError::Upgrade
}), })
}
DispatcherState::None => panic!(), DispatcherState::None => panic!(),
} }
} }
} }
fn read_available<T>(io: &mut T, buf: &mut BytesMut) -> Result<Option<bool>, io::Error> fn read_available<T>(
cx: &mut Context,
io: &mut T,
buf: &mut BytesMut,
) -> Result<Option<bool>, io::Error>
where where
T: io::Read, T: AsyncRead + Unpin,
{ {
let mut read_some = false; let mut read_some = false;
loop { loop {
@@ -810,19 +845,18 @@ where
buf.reserve(HW_BUFFER_SIZE); buf.reserve(HW_BUFFER_SIZE);
} }
let read = unsafe { io.read(buf.bytes_mut()) }; match read(cx, io, buf) {
match read { Poll::Pending => {
Ok(n) => { return if read_some { Ok(Some(false)) } else { Ok(None) };
}
Poll::Ready(Ok(n)) => {
if n == 0 { if n == 0 {
return Ok(Some(true)); return Ok(Some(true));
} else { } else {
read_some = true; read_some = true;
unsafe {
buf.advance_mut(n);
} }
} }
} Poll::Ready(Err(e)) => {
Err(e) => {
return if e.kind() == io::ErrorKind::WouldBlock { return if e.kind() == io::ErrorKind::WouldBlock {
if read_some { if read_some {
Ok(Some(false)) Ok(Some(false))
@@ -833,10 +867,21 @@ where
Ok(Some(true)) Ok(Some(true))
} else { } else {
Err(e) Err(e)
};
} }
} }
} }
}
}
fn read<T>(
cx: &mut Context,
io: &mut T,
buf: &mut BytesMut,
) -> Poll<Result<usize, io::Error>>
where
T: AsyncRead + Unpin,
{
Pin::new(io).poll_read_buf(cx, buf)
} }
#[cfg(test)] #[cfg(test)]
@@ -849,10 +894,9 @@ mod tests {
use crate::h1::{ExpectHandler, UpgradeHandler}; use crate::h1::{ExpectHandler, UpgradeHandler};
use crate::test::TestBuffer; use crate::test::TestBuffer;
#[test] #[actix_rt::test]
fn test_req_parse_err() { async fn test_req_parse_err() {
let mut sys = actix_rt::System::new("test"); lazy(|cx| {
let _ = sys.block_on(lazy(|| {
let buf = TestBuffer::new("GET /test HTTP/1\r\n\r\n"); let buf = TestBuffer::new("GET /test HTTP/1\r\n\r\n");
let mut h1 = Dispatcher::<_, _, _, _, UpgradeHandler<TestBuffer>>::new( let mut h1 = Dispatcher::<_, _, _, _, UpgradeHandler<TestBuffer>>::new(
@@ -864,14 +908,18 @@ mod tests {
CloneableService::new(ExpectHandler), CloneableService::new(ExpectHandler),
None, None,
None, None,
None,
); );
assert!(h1.poll().is_err()); match Pin::new(&mut h1).poll(cx) {
Poll::Pending => panic!(),
Poll::Ready(res) => assert!(res.is_err()),
}
if let DispatcherState::Normal(ref inner) = h1.inner { if let DispatcherState::Normal(ref inner) = h1.inner {
assert!(inner.flags.contains(Flags::READ_DISCONNECT)); assert!(inner.flags.contains(Flags::READ_DISCONNECT));
assert_eq!(&inner.io.write_buf[..26], b"HTTP/1.1 400 Bad Request\r\n"); assert_eq!(&inner.io.write_buf[..26], b"HTTP/1.1 400 Bad Request\r\n");
} }
ok::<_, ()>(()) })
})); .await;
} }
} }

View File

@@ -2,11 +2,13 @@
use std::fmt::Write as FmtWrite; use std::fmt::Write as FmtWrite;
use std::io::Write; use std::io::Write;
use std::marker::PhantomData; use std::marker::PhantomData;
use std::ptr::copy_nonoverlapping;
use std::rc::Rc; use std::rc::Rc;
use std::slice::from_raw_parts_mut;
use std::str::FromStr; use std::str::FromStr;
use std::{cmp, fmt, io, mem}; use std::{cmp, fmt, io, mem};
use bytes::{BufMut, Bytes, BytesMut}; use bytes::{buf::BufMutExt, BufMut, Bytes, BytesMut};
use crate::body::BodySize; use crate::body::BodySize;
use crate::config::ServiceConfig; use crate::config::ServiceConfig;
@@ -144,8 +146,8 @@ pub(crate) trait MessageType: Sized {
// write headers // write headers
let mut pos = 0; let mut pos = 0;
let mut has_date = false; let mut has_date = false;
let mut remaining = dst.remaining_mut(); let mut remaining = dst.capacity() - dst.len();
let mut buf = unsafe { &mut *(dst.bytes_mut() as *mut [u8]) }; let mut buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
for (key, value) in headers { for (key, value) in headers {
match *key { match *key {
CONNECTION => continue, CONNECTION => continue,
@@ -159,61 +161,67 @@ pub(crate) trait MessageType: Sized {
match value { match value {
map::Value::One(ref val) => { map::Value::One(ref val) => {
let v = val.as_ref(); let v = val.as_ref();
let len = k.len() + v.len() + 4; let v_len = v.len();
let k_len = k.len();
let len = k_len + v_len + 4;
if len > remaining { if len > remaining {
unsafe { unsafe {
dst.advance_mut(pos); dst.advance_mut(pos);
} }
pos = 0; pos = 0;
dst.reserve(len * 2); dst.reserve(len * 2);
remaining = dst.remaining_mut(); remaining = dst.capacity() - dst.len();
unsafe { buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
buf = &mut *(dst.bytes_mut() as *mut _);
}
} }
// use upper Camel-Case // use upper Camel-Case
unsafe {
if camel_case { if camel_case {
write_camel_case(k, &mut buf[pos..pos + k.len()]); write_camel_case(k, from_raw_parts_mut(buf, k_len))
} else { } else {
buf[pos..pos + k.len()].copy_from_slice(k); write_data(k, buf, k_len)
} }
pos += k.len(); buf = buf.add(k_len);
buf[pos..pos + 2].copy_from_slice(b": "); write_data(b": ", buf, 2);
pos += 2; buf = buf.add(2);
buf[pos..pos + v.len()].copy_from_slice(v); write_data(v, buf, v_len);
pos += v.len(); buf = buf.add(v_len);
buf[pos..pos + 2].copy_from_slice(b"\r\n"); write_data(b"\r\n", buf, 2);
pos += 2; buf = buf.add(2);
pos += len;
remaining -= len; remaining -= len;
} }
}
map::Value::Multi(ref vec) => { map::Value::Multi(ref vec) => {
for val in vec { for val in vec {
let v = val.as_ref(); let v = val.as_ref();
let len = k.len() + v.len() + 4; let v_len = v.len();
let k_len = k.len();
let len = k_len + v_len + 4;
if len > remaining { if len > remaining {
unsafe { unsafe {
dst.advance_mut(pos); dst.advance_mut(pos);
} }
pos = 0; pos = 0;
dst.reserve(len * 2); dst.reserve(len * 2);
remaining = dst.remaining_mut(); remaining = dst.capacity() - dst.len();
unsafe { buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
buf = &mut *(dst.bytes_mut() as *mut _);
}
} }
// use upper Camel-Case // use upper Camel-Case
unsafe {
if camel_case { if camel_case {
write_camel_case(k, &mut buf[pos..pos + k.len()]); write_camel_case(k, from_raw_parts_mut(buf, k_len));
} else { } else {
buf[pos..pos + k.len()].copy_from_slice(k); write_data(k, buf, k_len);
} }
pos += k.len(); buf = buf.add(k_len);
buf[pos..pos + 2].copy_from_slice(b": "); write_data(b": ", buf, 2);
pos += 2; buf = buf.add(2);
buf[pos..pos + v.len()].copy_from_slice(v); write_data(v, buf, v_len);
pos += v.len(); buf = buf.add(v_len);
buf[pos..pos + 2].copy_from_slice(b"\r\n"); write_data(b"\r\n", buf, 2);
pos += 2; buf = buf.add(2);
};
pos += len;
remaining -= len; remaining -= len;
} }
} }
@@ -298,6 +306,12 @@ impl MessageType for RequestHeadType {
Version::HTTP_10 => "HTTP/1.0", Version::HTTP_10 => "HTTP/1.0",
Version::HTTP_11 => "HTTP/1.1", Version::HTTP_11 => "HTTP/1.1",
Version::HTTP_2 => "HTTP/2.0", Version::HTTP_2 => "HTTP/2.0",
Version::HTTP_3 => "HTTP/3.0",
_ =>
return Err(io::Error::new(
io::ErrorKind::Other,
"unsupported version"
)),
} }
) )
.map_err(|e| io::Error::new(io::ErrorKind::Other, e)) .map_err(|e| io::Error::new(io::ErrorKind::Other, e))
@@ -479,6 +493,10 @@ impl<'a> io::Write for Writer<'a> {
} }
} }
unsafe fn write_data(value: &[u8], buf: *mut u8, len: usize) {
copy_nonoverlapping(value.as_ptr(), buf, len);
}
fn write_camel_case(value: &[u8], buffer: &mut [u8]) { fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
let mut index = 0; let mut index = 0;
let key = value; let key = value;
@@ -525,7 +543,7 @@ mod tests {
assert!(enc.encode(b"", &mut bytes).ok().unwrap()); assert!(enc.encode(b"", &mut bytes).ok().unwrap());
} }
assert_eq!( assert_eq!(
bytes.take().freeze(), bytes.split().freeze(),
Bytes::from_static(b"4\r\ntest\r\n0\r\n\r\n") Bytes::from_static(b"4\r\ntest\r\n0\r\n\r\n")
); );
} }
@@ -548,10 +566,12 @@ mod tests {
ConnectionType::Close, ConnectionType::Close,
&ServiceConfig::default(), &ServiceConfig::default(),
); );
assert_eq!( let data =
bytes.take().freeze(), String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
Bytes::from_static(b"\r\nContent-Length: 0\r\nConnection: close\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n") assert!(data.contains("Content-Length: 0\r\n"));
); assert!(data.contains("Connection: close\r\n"));
assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let _ = head.encode_headers( let _ = head.encode_headers(
&mut bytes, &mut bytes,
@@ -560,10 +580,11 @@ mod tests {
ConnectionType::KeepAlive, ConnectionType::KeepAlive,
&ServiceConfig::default(), &ServiceConfig::default(),
); );
assert_eq!( let data =
bytes.take().freeze(), String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
Bytes::from_static(b"\r\nTransfer-Encoding: chunked\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n") assert!(data.contains("Transfer-Encoding: chunked\r\n"));
); assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let _ = head.encode_headers( let _ = head.encode_headers(
&mut bytes, &mut bytes,
@@ -572,10 +593,11 @@ mod tests {
ConnectionType::KeepAlive, ConnectionType::KeepAlive,
&ServiceConfig::default(), &ServiceConfig::default(),
); );
assert_eq!( let data =
bytes.take().freeze(), String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
Bytes::from_static(b"\r\nContent-Length: 100\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n") assert!(data.contains("Content-Length: 100\r\n"));
); assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let mut head = RequestHead::default(); let mut head = RequestHead::default();
head.set_camel_case_headers(false); head.set_camel_case_headers(false);
@@ -586,7 +608,6 @@ mod tests {
.append(CONTENT_TYPE, HeaderValue::from_static("xml")); .append(CONTENT_TYPE, HeaderValue::from_static("xml"));
let mut head = RequestHeadType::Owned(head); let mut head = RequestHeadType::Owned(head);
let _ = head.encode_headers( let _ = head.encode_headers(
&mut bytes, &mut bytes,
Version::HTTP_11, Version::HTTP_11,
@@ -594,10 +615,12 @@ mod tests {
ConnectionType::KeepAlive, ConnectionType::KeepAlive,
&ServiceConfig::default(), &ServiceConfig::default(),
); );
assert_eq!( let data =
bytes.take().freeze(), String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
Bytes::from_static(b"\r\ntransfer-encoding: chunked\r\ndate: date\r\ncontent-type: xml\r\ncontent-type: plain/text\r\n\r\n") assert!(data.contains("transfer-encoding: chunked\r\n"));
); assert!(data.contains("content-type: xml\r\n"));
assert!(data.contains("content-type: plain/text\r\n"));
assert!(data.contains("date: date\r\n"));
} }
#[test] #[test]
@@ -626,9 +649,11 @@ mod tests {
ConnectionType::Close, ConnectionType::Close,
&ServiceConfig::default(), &ServiceConfig::default(),
); );
assert_eq!( let data =
bytes.take().freeze(), String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
Bytes::from_static(b"\r\ncontent-length: 0\r\nconnection: close\r\nauthorization: another authorization\r\ndate: date\r\n\r\n") assert!(data.contains("content-length: 0\r\n"));
); assert!(data.contains("connection: close\r\n"));
assert!(data.contains("authorization: another authorization\r\n"));
assert!(data.contains("date: date\r\n"));
} }
} }

View File

@@ -1,23 +1,23 @@
use actix_server_config::ServerConfig; use std::task::{Context, Poll};
use actix_service::{NewService, Service};
use futures::future::{ok, FutureResult}; use actix_service::{Service, ServiceFactory};
use futures::{Async, Poll}; use futures::future::{ok, Ready};
use crate::error::Error; use crate::error::Error;
use crate::request::Request; use crate::request::Request;
pub struct ExpectHandler; pub struct ExpectHandler;
impl NewService for ExpectHandler { impl ServiceFactory for ExpectHandler {
type Config = ServerConfig; type Config = ();
type Request = Request; type Request = Request;
type Response = Request; type Response = Request;
type Error = Error; type Error = Error;
type Service = ExpectHandler; type Service = ExpectHandler;
type InitError = Error; type InitError = Error;
type Future = FutureResult<Self::Service, Self::InitError>; type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &ServerConfig) -> Self::Future { fn new_service(&self, _: ()) -> Self::Future {
ok(ExpectHandler) ok(ExpectHandler)
} }
} }
@@ -26,10 +26,10 @@ impl Service for ExpectHandler {
type Request = Request; type Request = Request;
type Response = Request; type Response = Request;
type Error = Error; type Error = Error;
type Future = FutureResult<Self::Response, Self::Error>; type Future = Ready<Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} }
fn call(&mut self, req: Request) -> Self::Future { fn call(&mut self, req: Request) -> Self::Future {

View File

@@ -1,12 +1,13 @@
//! Payload stream //! Payload stream
use std::cell::RefCell; use std::cell::RefCell;
use std::collections::VecDeque; use std::collections::VecDeque;
use std::pin::Pin;
use std::rc::{Rc, Weak}; use std::rc::{Rc, Weak};
use std::task::{Context, Poll};
use actix_utils::task::LocalWaker;
use bytes::Bytes; use bytes::Bytes;
use futures::task::current as current_task; use futures::Stream;
use futures::task::Task;
use futures::{Async, Poll, Stream};
use crate::error::PayloadError; use crate::error::PayloadError;
@@ -77,15 +78,24 @@ impl Payload {
pub fn unread_data(&mut self, data: Bytes) { pub fn unread_data(&mut self, data: Bytes) {
self.inner.borrow_mut().unread_data(data); self.inner.borrow_mut().unread_data(data);
} }
#[inline]
pub fn readany(
&mut self,
cx: &mut Context,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
self.inner.borrow_mut().readany(cx)
}
} }
impl Stream for Payload { impl Stream for Payload {
type Item = Bytes; type Item = Result<Bytes, PayloadError>;
type Error = PayloadError;
#[inline] fn poll_next(
fn poll(&mut self) -> Poll<Option<Bytes>, PayloadError> { self: Pin<&mut Self>,
self.inner.borrow_mut().readany() cx: &mut Context,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
self.inner.borrow_mut().readany(cx)
} }
} }
@@ -117,19 +127,14 @@ impl PayloadSender {
} }
#[inline] #[inline]
pub fn need_read(&self) -> PayloadStatus { pub fn need_read(&self, cx: &mut Context) -> PayloadStatus {
// we check need_read only if Payload (other side) is alive, // we check need_read only if Payload (other side) is alive,
// otherwise always return true (consume payload) // otherwise always return true (consume payload)
if let Some(shared) = self.inner.upgrade() { if let Some(shared) = self.inner.upgrade() {
if shared.borrow().need_read { if shared.borrow().need_read {
PayloadStatus::Read PayloadStatus::Read
} else { } else {
#[cfg(not(test))] shared.borrow_mut().io_task.register(cx.waker());
{
if shared.borrow_mut().io_task.is_none() {
shared.borrow_mut().io_task = Some(current_task());
}
}
PayloadStatus::Pause PayloadStatus::Pause
} }
} else { } else {
@@ -145,8 +150,8 @@ struct Inner {
err: Option<PayloadError>, err: Option<PayloadError>,
need_read: bool, need_read: bool,
items: VecDeque<Bytes>, items: VecDeque<Bytes>,
task: Option<Task>, task: LocalWaker,
io_task: Option<Task>, io_task: LocalWaker,
} }
impl Inner { impl Inner {
@@ -157,8 +162,8 @@ impl Inner {
err: None, err: None,
items: VecDeque::new(), items: VecDeque::new(),
need_read: true, need_read: true,
task: None, task: LocalWaker::new(),
io_task: None, io_task: LocalWaker::new(),
} }
} }
@@ -178,7 +183,7 @@ impl Inner {
self.items.push_back(data); self.items.push_back(data);
self.need_read = self.len < MAX_BUFFER_SIZE; self.need_read = self.len < MAX_BUFFER_SIZE;
if let Some(task) = self.task.take() { if let Some(task) = self.task.take() {
task.notify() task.wake()
} }
} }
@@ -187,34 +192,28 @@ impl Inner {
self.len self.len
} }
fn readany(&mut self) -> Poll<Option<Bytes>, PayloadError> { fn readany(
&mut self,
cx: &mut Context,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
if let Some(data) = self.items.pop_front() { if let Some(data) = self.items.pop_front() {
self.len -= data.len(); self.len -= data.len();
self.need_read = self.len < MAX_BUFFER_SIZE; self.need_read = self.len < MAX_BUFFER_SIZE;
if self.need_read && self.task.is_none() && !self.eof { if self.need_read && !self.eof {
self.task = Some(current_task()); self.task.register(cx.waker());
} }
if let Some(task) = self.io_task.take() { self.io_task.wake();
task.notify() Poll::Ready(Some(Ok(data)))
}
Ok(Async::Ready(Some(data)))
} else if let Some(err) = self.err.take() { } else if let Some(err) = self.err.take() {
Err(err) Poll::Ready(Some(Err(err)))
} else if self.eof { } else if self.eof {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
self.need_read = true; self.need_read = true;
#[cfg(not(test))] self.task.register(cx.waker());
{ self.io_task.wake();
if self.task.is_none() { Poll::Pending
self.task = Some(current_task());
}
if let Some(task) = self.io_task.take() {
task.notify()
}
}
Ok(Async::NotReady)
} }
} }
@@ -227,14 +226,10 @@ impl Inner {
#[cfg(test)] #[cfg(test)]
mod tests { mod tests {
use super::*; use super::*;
use actix_rt::Runtime; use futures::future::poll_fn;
use futures::future::{lazy, result};
#[test] #[actix_rt::test]
fn test_unread_data() { async fn test_unread_data() {
Runtime::new()
.unwrap()
.block_on(lazy(|| {
let (_, mut payload) = Payload::create(false); let (_, mut payload) = Payload::create(false);
payload.unread_data(Bytes::from("data")); payload.unread_data(Bytes::from("data"));
@@ -242,13 +237,8 @@ mod tests {
assert_eq!(payload.len(), 4); assert_eq!(payload.len(), 4);
assert_eq!( assert_eq!(
Async::Ready(Some(Bytes::from("data"))), Bytes::from("data"),
payload.poll().ok().unwrap() poll_fn(|cx| payload.readany(cx)).await.unwrap().unwrap()
); );
let res: Result<(), ()> = Ok(());
result(res)
}))
.unwrap();
} }
} }

View File

@@ -1,16 +1,19 @@
use std::fmt; use std::future::Future;
use std::marker::PhantomData; use std::marker::PhantomData;
use std::pin::Pin;
use std::rc::Rc; use std::rc::Rc;
use std::task::{Context, Poll};
use std::{fmt, net};
use actix_codec::Framed; use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig}; use actix_rt::net::TcpStream;
use actix_service::{IntoNewService, NewService, Service}; use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
use futures::future::{ok, FutureResult}; use futures::future::{ok, Ready};
use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream}; use futures::ready;
use crate::body::MessageBody; use crate::body::MessageBody;
use crate::cloneable::CloneableService; use crate::cloneable::CloneableService;
use crate::config::{KeepAlive, ServiceConfig}; use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error, ParseError}; use crate::error::{DispatchError, Error, ParseError};
use crate::helpers::DataFactory; use crate::helpers::DataFactory;
use crate::request::Request; use crate::request::Request;
@@ -20,43 +23,32 @@ use super::codec::Codec;
use super::dispatcher::Dispatcher; use super::dispatcher::Dispatcher;
use super::{ExpectHandler, Message, UpgradeHandler}; use super::{ExpectHandler, Message, UpgradeHandler};
/// `NewService` implementation for HTTP1 transport /// `ServiceFactory` implementation for HTTP1 transport
pub struct H1Service<T, P, S, B, X = ExpectHandler, U = UpgradeHandler<T>> { pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler<T>> {
srv: S, srv: S,
cfg: ServiceConfig, cfg: ServiceConfig,
expect: X, expect: X,
upgrade: Option<U>, upgrade: Option<U>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>, _t: PhantomData<(T, B)>,
} }
impl<T, P, S, B> H1Service<T, P, S, B> impl<T, S, B> H1Service<T, S, B>
where where
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
B: MessageBody, B: MessageBody,
{ {
/// Create new `HttpService` instance with default config.
pub fn new<F: IntoNewService<S>>(service: F) -> Self {
let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
H1Service {
cfg,
srv: service.into_new_service(),
expect: ExpectHandler,
upgrade: None,
on_connect: None,
_t: PhantomData,
}
}
/// Create new `HttpService` instance with config. /// Create new `HttpService` instance with config.
pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self { pub(crate) fn with_config<F: IntoServiceFactory<S>>(
cfg: ServiceConfig,
service: F,
) -> Self {
H1Service { H1Service {
cfg, cfg,
srv: service.into_new_service(), srv: service.into_factory(),
expect: ExpectHandler, expect: ExpectHandler,
upgrade: None, upgrade: None,
on_connect: None, on_connect: None,
@@ -65,17 +57,153 @@ where
} }
} }
impl<T, P, S, B, X, U> H1Service<T, P, S, B, X, U> impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
where where
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<TcpStream, Codec>),
Response = (),
>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
/// Create simple tcp stream service
pub fn tcp(
self,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = DispatchError,
InitError = (),
> {
pipeline_factory(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok((io, peer_addr))
})
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use super::*;
use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
use actix_tls::{openssl::HandshakeError, SslError};
impl<S, B, X, U> H1Service<SslStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<SslStream<TcpStream>, Codec>),
Response = (),
>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
/// Create openssl based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<HandshakeError<TcpStream>, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: SslStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_tls::rustls::{Acceptor, ServerConfig, TlsStream};
use actix_tls::SslError;
use std::{fmt, io};
impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<TlsStream<TcpStream>, Codec>),
Response = (),
>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
/// Create rustls based service
pub fn rustls(
self,
config: ServerConfig,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<io::Error, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(config)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
impl<T, S, B, X, U> H1Service<T, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
B: MessageBody, B: MessageBody,
{ {
pub fn expect<X1>(self, expect: X1) -> H1Service<T, P, S, B, X1, U> pub fn expect<X1>(self, expect: X1) -> H1Service<T, S, B, X1, U>
where where
X1: NewService<Request = Request, Response = Request>, X1: ServiceFactory<Request = Request, Response = Request>,
X1::Error: Into<Error>, X1::Error: Into<Error>,
X1::InitError: fmt::Debug, X1::InitError: fmt::Debug,
{ {
@@ -89,9 +217,9 @@ where
} }
} }
pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, P, S, B, X, U1> pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, S, B, X, U1>
where where
U1: NewService<Request = (Request, Framed<T, Codec>), Response = ()>, U1: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
U1::Error: fmt::Display, U1::Error: fmt::Display,
U1::InitError: fmt::Debug, U1::InitError: fmt::Debug,
{ {
@@ -115,38 +243,34 @@ where
} }
} }
impl<T, P, S, B, X, U> NewService for H1Service<T, P, S, B, X, U> impl<T, S, B, X, U> ServiceFactory for H1Service<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
B: MessageBody, B: MessageBody,
X: NewService<Config = SrvConfig, Request = Request, Response = Request>, X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
X::InitError: fmt::Debug, X::InitError: fmt::Debug,
U: NewService< U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
Config = SrvConfig,
Request = (Request, Framed<T, Codec>),
Response = (),
>,
U::Error: fmt::Display, U::Error: fmt::Display,
U::InitError: fmt::Debug, U::InitError: fmt::Debug,
{ {
type Config = SrvConfig; type Config = ();
type Request = Io<T, P>; type Request = (T, Option<net::SocketAddr>);
type Response = (); type Response = ();
type Error = DispatchError; type Error = DispatchError;
type InitError = (); type InitError = ();
type Service = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>; type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
type Future = H1ServiceResponse<T, P, S, B, X, U>; type Future = H1ServiceResponse<T, S, B, X, U>;
fn new_service(&self, cfg: &SrvConfig) -> Self::Future { fn new_service(&self, _: ()) -> Self::Future {
H1ServiceResponse { H1ServiceResponse {
fut: self.srv.new_service(cfg).into_future(), fut: self.srv.new_service(()),
fut_ex: Some(self.expect.new_service(cfg)), fut_ex: Some(self.expect.new_service(())),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(cfg)), fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
expect: None, expect: None,
upgrade: None, upgrade: None,
on_connect: self.on_connect.clone(), on_connect: self.on_connect.clone(),
@@ -157,88 +281,99 @@ where
} }
#[doc(hidden)] #[doc(hidden)]
pub struct H1ServiceResponse<T, P, S, B, X, U> #[pin_project::pin_project]
pub struct H1ServiceResponse<T, S, B, X, U>
where where
S: NewService<Request = Request>, S: ServiceFactory<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
X: NewService<Request = Request, Response = Request>, X: ServiceFactory<Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
X::InitError: fmt::Debug, X::InitError: fmt::Debug,
U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>, U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
U::InitError: fmt::Debug, U::InitError: fmt::Debug,
{ {
#[pin]
fut: S::Future, fut: S::Future,
#[pin]
fut_ex: Option<X::Future>, fut_ex: Option<X::Future>,
#[pin]
fut_upg: Option<U::Future>, fut_upg: Option<U::Future>,
expect: Option<X::Service>, expect: Option<X::Service>,
upgrade: Option<U::Service>, upgrade: Option<U::Service>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
cfg: Option<ServiceConfig>, cfg: Option<ServiceConfig>,
_t: PhantomData<(T, P, B)>, _t: PhantomData<(T, B)>,
} }
impl<T, P, S, B, X, U> Future for H1ServiceResponse<T, P, S, B, X, U> impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: NewService<Request = Request>, S: ServiceFactory<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
B: MessageBody, B: MessageBody,
X: NewService<Request = Request, Response = Request>, X: ServiceFactory<Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
X::InitError: fmt::Debug, X::InitError: fmt::Debug,
U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>, U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
U::InitError: fmt::Debug, U::InitError: fmt::Debug,
{ {
type Item = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>; type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
type Error = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
if let Some(ref mut fut) = self.fut_ex { let mut this = self.as_mut().project();
let expect = try_ready!(fut
.poll() if let Some(fut) = this.fut_ex.as_pin_mut() {
.map_err(|e| log::error!("Init http service error: {:?}", e))); let expect = ready!(fut
self.expect = Some(expect); .poll(cx)
self.fut_ex.take(); .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.expect = Some(expect);
this.fut_ex.set(None);
} }
if let Some(ref mut fut) = self.fut_upg { if let Some(fut) = this.fut_upg.as_pin_mut() {
let upgrade = try_ready!(fut let upgrade = ready!(fut
.poll() .poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e))); .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
self.upgrade = Some(upgrade); this = self.as_mut().project();
self.fut_ex.take(); *this.upgrade = Some(upgrade);
this.fut_ex.set(None);
} }
let service = try_ready!(self let result = ready!(this
.fut .fut
.poll() .poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e))); .map_err(|e| log::error!("Init http service error: {:?}", e)));
Ok(Async::Ready(H1ServiceHandler::new(
self.cfg.take().unwrap(), Poll::Ready(result.map(|service| {
let this = self.as_mut().project();
H1ServiceHandler::new(
this.cfg.take().unwrap(),
service, service,
self.expect.take().unwrap(), this.expect.take().unwrap(),
self.upgrade.take(), this.upgrade.take(),
self.on_connect.clone(), this.on_connect.clone(),
))) )
}))
} }
} }
/// `Service` implementation for HTTP1 transport /// `Service` implementation for HTTP1 transport
pub struct H1ServiceHandler<T, P, S, B, X, U> { pub struct H1ServiceHandler<T, S, B, X, U> {
srv: CloneableService<S>, srv: CloneableService<S>,
expect: CloneableService<X>, expect: CloneableService<X>,
upgrade: Option<CloneableService<U>>, upgrade: Option<CloneableService<U>>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
cfg: ServiceConfig, cfg: ServiceConfig,
_t: PhantomData<(T, P, B)>, _t: PhantomData<(T, B)>,
} }
impl<T, P, S, B, X, U> H1ServiceHandler<T, P, S, B, X, U> impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
where where
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
@@ -255,7 +390,7 @@ where
expect: X, expect: X,
upgrade: Option<U>, upgrade: Option<U>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
) -> H1ServiceHandler<T, P, S, B, X, U> { ) -> H1ServiceHandler<T, S, B, X, U> {
H1ServiceHandler { H1ServiceHandler {
srv: CloneableService::new(srv), srv: CloneableService::new(srv),
expect: CloneableService::new(expect), expect: CloneableService::new(expect),
@@ -267,9 +402,9 @@ where
} }
} }
impl<T, P, S, B, X, U> Service for H1ServiceHandler<T, P, S, B, X, U> impl<T, S, B, X, U> Service for H1ServiceHandler<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
@@ -279,15 +414,15 @@ where
U: Service<Request = (Request, Framed<T, Codec>), Response = ()>, U: Service<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
{ {
type Request = Io<T, P>; type Request = (T, Option<net::SocketAddr>);
type Response = (); type Response = ();
type Error = DispatchError; type Error = DispatchError;
type Future = Dispatcher<T, S, B, X, U>; type Future = Dispatcher<T, S, B, X, U>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
let ready = self let ready = self
.expect .expect
.poll_ready() .poll_ready(cx)
.map_err(|e| { .map_err(|e| {
let e = e.into(); let e = e.into();
log::error!("Http service readiness error: {:?}", e); log::error!("Http service readiness error: {:?}", e);
@@ -297,7 +432,7 @@ where
let ready = self let ready = self
.srv .srv
.poll_ready() .poll_ready(cx)
.map_err(|e| { .map_err(|e| {
let e = e.into(); let e = e.into();
log::error!("Http service readiness error: {:?}", e); log::error!("Http service readiness error: {:?}", e);
@@ -307,15 +442,13 @@ where
&& ready; && ready;
if ready { if ready {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} else { } else {
Ok(Async::NotReady) Poll::Pending
} }
} }
fn call(&mut self, req: Self::Request) -> Self::Future { fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
let io = req.into_parts().0;
let on_connect = if let Some(ref on_connect) = self.on_connect { let on_connect = if let Some(ref on_connect) = self.on_connect {
Some(on_connect(&io)) Some(on_connect(&io))
} else { } else {
@@ -329,20 +462,21 @@ where
self.expect.clone(), self.expect.clone(),
self.upgrade.clone(), self.upgrade.clone(),
on_connect, on_connect,
addr,
) )
} }
} }
/// `NewService` implementation for `OneRequestService` service /// `ServiceFactory` implementation for `OneRequestService` service
#[derive(Default)] #[derive(Default)]
pub struct OneRequest<T, P> { pub struct OneRequest<T> {
config: ServiceConfig, config: ServiceConfig,
_t: PhantomData<(T, P)>, _t: PhantomData<T>,
} }
impl<T, P> OneRequest<T, P> impl<T> OneRequest<T>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
{ {
/// Create new `H1SimpleService` instance. /// Create new `H1SimpleService` instance.
pub fn new() -> Self { pub fn new() -> Self {
@@ -353,52 +487,49 @@ where
} }
} }
impl<T, P> NewService for OneRequest<T, P> impl<T> ServiceFactory for OneRequest<T>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
{ {
type Config = SrvConfig; type Config = ();
type Request = Io<T, P>; type Request = T;
type Response = (Request, Framed<T, Codec>); type Response = (Request, Framed<T, Codec>);
type Error = ParseError; type Error = ParseError;
type InitError = (); type InitError = ();
type Service = OneRequestService<T, P>; type Service = OneRequestService<T>;
type Future = FutureResult<Self::Service, Self::InitError>; type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &SrvConfig) -> Self::Future { fn new_service(&self, _: ()) -> Self::Future {
ok(OneRequestService { ok(OneRequestService {
config: self.config.clone(),
_t: PhantomData, _t: PhantomData,
config: self.config.clone(),
}) })
} }
} }
/// `Service` implementation for HTTP1 transport. Reads one request and returns /// `Service` implementation for HTTP1 transport. Reads one request and returns
/// request and framed object. /// request and framed object.
pub struct OneRequestService<T, P> { pub struct OneRequestService<T> {
_t: PhantomData<T>,
config: ServiceConfig, config: ServiceConfig,
_t: PhantomData<(T, P)>,
} }
impl<T, P> Service for OneRequestService<T, P> impl<T> Service for OneRequestService<T>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
{ {
type Request = Io<T, P>; type Request = T;
type Response = (Request, Framed<T, Codec>); type Response = (Request, Framed<T, Codec>);
type Error = ParseError; type Error = ParseError;
type Future = OneRequestServiceResponse<T>; type Future = OneRequestServiceResponse<T>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} }
fn call(&mut self, req: Self::Request) -> Self::Future { fn call(&mut self, req: Self::Request) -> Self::Future {
OneRequestServiceResponse { OneRequestServiceResponse {
framed: Some(Framed::new( framed: Some(Framed::new(req, Codec::new(self.config.clone()))),
req.into_parts().0,
Codec::new(self.config.clone()),
)),
} }
} }
} }
@@ -406,28 +537,28 @@ where
#[doc(hidden)] #[doc(hidden)]
pub struct OneRequestServiceResponse<T> pub struct OneRequestServiceResponse<T>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
{ {
framed: Option<Framed<T, Codec>>, framed: Option<Framed<T, Codec>>,
} }
impl<T> Future for OneRequestServiceResponse<T> impl<T> Future for OneRequestServiceResponse<T>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
{ {
type Item = (Request, Framed<T, Codec>); type Output = Result<(Request, Framed<T, Codec>), ParseError>;
type Error = ParseError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
match self.framed.as_mut().unwrap().poll()? { match self.framed.as_mut().unwrap().next_item(cx) {
Async::Ready(Some(req)) => match req { Poll::Ready(Some(Ok(req))) => match req {
Message::Item(req) => { Message::Item(req) => {
Ok(Async::Ready((req, self.framed.take().unwrap()))) Poll::Ready(Ok((req, self.framed.take().unwrap())))
} }
Message::Chunk(_) => unreachable!("Something is wrong"), Message::Chunk(_) => unreachable!("Something is wrong"),
}, },
Async::Ready(None) => Err(ParseError::Incomplete), Poll::Ready(Some(Err(err))) => Poll::Ready(Err(err)),
Async::NotReady => Ok(Async::NotReady), Poll::Ready(None) => Poll::Ready(Err(ParseError::Incomplete)),
Poll::Pending => Poll::Pending,
} }
} }
} }

View File

@@ -1,10 +1,9 @@
use std::marker::PhantomData; use std::marker::PhantomData;
use std::task::{Context, Poll};
use actix_codec::Framed; use actix_codec::Framed;
use actix_server_config::ServerConfig; use actix_service::{Service, ServiceFactory};
use actix_service::{NewService, Service}; use futures::future::Ready;
use futures::future::FutureResult;
use futures::{Async, Poll};
use crate::error::Error; use crate::error::Error;
use crate::h1::Codec; use crate::h1::Codec;
@@ -12,16 +11,16 @@ use crate::request::Request;
pub struct UpgradeHandler<T>(PhantomData<T>); pub struct UpgradeHandler<T>(PhantomData<T>);
impl<T> NewService for UpgradeHandler<T> { impl<T> ServiceFactory for UpgradeHandler<T> {
type Config = ServerConfig; type Config = ();
type Request = (Request, Framed<T, Codec>); type Request = (Request, Framed<T, Codec>);
type Response = (); type Response = ();
type Error = Error; type Error = Error;
type Service = UpgradeHandler<T>; type Service = UpgradeHandler<T>;
type InitError = Error; type InitError = Error;
type Future = FutureResult<Self::Service, Self::InitError>; type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &ServerConfig) -> Self::Future { fn new_service(&self, _: ()) -> Self::Future {
unimplemented!() unimplemented!()
} }
} }
@@ -30,10 +29,10 @@ impl<T> Service for UpgradeHandler<T> {
type Request = (Request, Framed<T, Codec>); type Request = (Request, Framed<T, Codec>);
type Response = (); type Response = ();
type Error = Error; type Error = Error;
type Future = FutureResult<Self::Response, Self::Error>; type Future = Ready<Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} }
fn call(&mut self, _: Self::Request) -> Self::Future { fn call(&mut self, _: Self::Request) -> Self::Future {

View File

@@ -1,5 +1,8 @@
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed}; use actix_codec::{AsyncRead, AsyncWrite, Framed};
use futures::{Async, Future, Poll, Sink};
use crate::body::{BodySize, MessageBody, ResponseBody}; use crate::body::{BodySize, MessageBody, ResponseBody};
use crate::error::Error; use crate::error::Error;
@@ -7,6 +10,7 @@ use crate::h1::{Codec, Message};
use crate::response::Response; use crate::response::Response;
/// Send http/1 response /// Send http/1 response
#[pin_project::pin_project]
pub struct SendResponse<T, B> { pub struct SendResponse<T, B> {
res: Option<Message<(Response<()>, BodySize)>>, res: Option<Message<(Response<()>, BodySize)>>,
body: Option<ResponseBody<B>>, body: Option<ResponseBody<B>>,
@@ -33,60 +37,61 @@ where
T: AsyncRead + AsyncWrite, T: AsyncRead + AsyncWrite,
B: MessageBody, B: MessageBody,
{ {
type Item = Framed<T, Codec>; type Output = Result<Framed<T, Codec>, Error>;
type Error = Error;
fn poll(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
let this = self.get_mut();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
loop { loop {
let mut body_ready = self.body.is_some(); let mut body_ready = this.body.is_some();
let framed = self.framed.as_mut().unwrap(); let framed = this.framed.as_mut().unwrap();
// send body // send body
if self.res.is_none() && self.body.is_some() { if this.res.is_none() && this.body.is_some() {
while body_ready && self.body.is_some() && !framed.is_write_buf_full() { while body_ready && this.body.is_some() && !framed.is_write_buf_full() {
match self.body.as_mut().unwrap().poll_next()? { match this.body.as_mut().unwrap().poll_next(cx)? {
Async::Ready(item) => { Poll::Ready(item) => {
// body is done // body is done
if item.is_none() { if item.is_none() {
let _ = self.body.take(); let _ = this.body.take();
} }
framed.force_send(Message::Chunk(item))?; framed.write(Message::Chunk(item))?;
} }
Async::NotReady => body_ready = false, Poll::Pending => body_ready = false,
} }
} }
} }
// flush write buffer // flush write buffer
if !framed.is_write_buf_empty() { if !framed.is_write_buf_empty() {
match framed.poll_complete()? { match framed.flush(cx)? {
Async::Ready(_) => { Poll::Ready(_) => {
if body_ready { if body_ready {
continue; continue;
} else { } else {
return Ok(Async::NotReady); return Poll::Pending;
} }
} }
Async::NotReady => return Ok(Async::NotReady), Poll::Pending => return Poll::Pending,
} }
} }
// send response // send response
if let Some(res) = self.res.take() { if let Some(res) = this.res.take() {
framed.force_send(res)?; framed.write(res)?;
continue; continue;
} }
if self.body.is_some() { if this.body.is_some() {
if body_ready { if body_ready {
continue; continue;
} else { } else {
return Ok(Async::NotReady); return Poll::Pending;
} }
} else { } else {
break; break;
} }
} }
Ok(Async::Ready(self.framed.take().unwrap())) Poll::Ready(Ok(this.framed.take().unwrap()))
} }
} }

View File

@@ -1,22 +1,23 @@
use std::collections::VecDeque; use std::collections::VecDeque;
use std::convert::TryFrom;
use std::future::Future;
use std::marker::PhantomData; use std::marker::PhantomData;
use std::time::Instant; use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, mem, net}; use std::{fmt, mem, net};
use actix_codec::{AsyncRead, AsyncWrite}; use actix_codec::{AsyncRead, AsyncWrite};
use actix_server_config::IoStream; use actix_rt::time::{Delay, Instant};
use actix_service::Service; use actix_service::Service;
use bitflags::bitflags; use bitflags::bitflags;
use bytes::{Bytes, BytesMut}; use bytes::{Bytes, BytesMut};
use futures::{try_ready, Async, Future, Poll, Sink, Stream}; use futures::{ready, Sink, Stream};
use h2::server::{Connection, SendResponse}; use h2::server::{Connection, SendResponse};
use h2::{RecvStream, SendStream}; use h2::{RecvStream, SendStream};
use http::header::{ use http::header::{
HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING, HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING,
}; };
use http::HttpTryFrom;
use log::{debug, error, trace}; use log::{debug, error, trace};
use tokio_timer::Delay;
use crate::body::{Body, BodySize, MessageBody, ResponseBody}; use crate::body::{Body, BodySize, MessageBody, ResponseBody};
use crate::cloneable::CloneableService; use crate::cloneable::CloneableService;
@@ -32,7 +33,11 @@ use crate::response::Response;
const CHUNK_SIZE: usize = 16_384; const CHUNK_SIZE: usize = 16_384;
/// Dispatcher for HTTP/2 protocol /// Dispatcher for HTTP/2 protocol
pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody> { #[pin_project::pin_project]
pub struct Dispatcher<T, S: Service<Request = Request>, B: MessageBody>
where
T: AsyncRead + AsyncWrite + Unpin,
{
service: CloneableService<S>, service: CloneableService<S>,
connection: Connection<T, Bytes>, connection: Connection<T, Bytes>,
on_connect: Option<Box<dyn DataFactory>>, on_connect: Option<Box<dyn DataFactory>>,
@@ -45,12 +50,12 @@ pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody
impl<T, S, B> Dispatcher<T, S, B> impl<T, S, B> Dispatcher<T, S, B>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error>,
S::Future: 'static, // S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>>,
B: MessageBody + 'static, B: MessageBody,
{ {
pub(crate) fn new( pub(crate) fn new(
service: CloneableService<S>, service: CloneableService<S>,
@@ -91,63 +96,77 @@ where
impl<T, S, B> Future for Dispatcher<T, S, B> impl<T, S, B> Future for Dispatcher<T, S, B>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Future: 'static, S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
{ {
type Item = (); type Output = Result<(), DispatchError>;
type Error = DispatchError;
#[inline] #[inline]
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
let this = self.get_mut();
loop { loop {
match self.connection.poll()? { match Pin::new(&mut this.connection).poll_accept(cx) {
Async::Ready(None) => return Ok(Async::Ready(())), Poll::Ready(None) => return Poll::Ready(Ok(())),
Async::Ready(Some((req, res))) => { Poll::Ready(Some(Err(err))) => return Poll::Ready(Err(err.into())),
Poll::Ready(Some(Ok((req, res)))) => {
// update keep-alive expire // update keep-alive expire
if self.ka_timer.is_some() { if this.ka_timer.is_some() {
if let Some(expire) = self.config.keep_alive_expire() { if let Some(expire) = this.config.keep_alive_expire() {
self.ka_expire = expire; this.ka_expire = expire;
} }
} }
let (parts, body) = req.into_parts(); let (parts, body) = req.into_parts();
let mut req = Request::with_payload(body.into()); let mut req = Request::with_payload(Payload::<
crate::payload::PayloadStream,
>::H2(
crate::h2::Payload::new(body)
));
let head = &mut req.head_mut(); let head = &mut req.head_mut();
head.uri = parts.uri; head.uri = parts.uri;
head.method = parts.method; head.method = parts.method;
head.version = parts.version; head.version = parts.version;
head.headers = parts.headers.into(); head.headers = parts.headers.into();
head.peer_addr = self.peer_addr; head.peer_addr = this.peer_addr;
// set on_connect data // set on_connect data
if let Some(ref on_connect) = self.on_connect { if let Some(ref on_connect) = this.on_connect {
on_connect.set(&mut req.extensions_mut()); on_connect.set(&mut req.extensions_mut());
} }
tokio_current_thread::spawn(ServiceResponse::<S::Future, B> { actix_rt::spawn(ServiceResponse::<
S::Future,
S::Response,
S::Error,
B,
> {
state: ServiceResponseState::ServiceCall( state: ServiceResponseState::ServiceCall(
self.service.call(req), this.service.call(req),
Some(res), Some(res),
), ),
config: self.config.clone(), config: this.config.clone(),
buffer: None, buffer: None,
}) _t: PhantomData,
});
} }
Async::NotReady => return Ok(Async::NotReady), Poll::Pending => return Poll::Pending,
} }
} }
} }
} }
struct ServiceResponse<F, B> { #[pin_project::pin_project]
struct ServiceResponse<F, I, E, B> {
state: ServiceResponseState<F, B>, state: ServiceResponseState<F, B>,
config: ServiceConfig, config: ServiceConfig,
buffer: Option<Bytes>, buffer: Option<Bytes>,
_t: PhantomData<(I, E)>,
} }
enum ServiceResponseState<F, B> { enum ServiceResponseState<F, B> {
@@ -155,12 +174,12 @@ enum ServiceResponseState<F, B> {
SendPayload(SendStream<Bytes>, ResponseBody<B>), SendPayload(SendStream<Bytes>, ResponseBody<B>),
} }
impl<F, B> ServiceResponse<F, B> impl<F, I, E, B> ServiceResponse<F, I, E, B>
where where
F: Future, F: Future<Output = Result<I, E>>,
F::Error: Into<Error>, E: Into<Error>,
F::Item: Into<Response<B>>, I: Into<Response<B>>,
B: MessageBody + 'static, B: MessageBody,
{ {
fn prepare_response( fn prepare_response(
&self, &self,
@@ -215,117 +234,130 @@ where
if !has_date { if !has_date {
let mut bytes = BytesMut::with_capacity(29); let mut bytes = BytesMut::with_capacity(29);
self.config.set_date_header(&mut bytes); self.config.set_date_header(&mut bytes);
res.headers_mut() res.headers_mut().insert(DATE, unsafe {
.insert(DATE, HeaderValue::try_from(bytes.freeze()).unwrap()); HeaderValue::from_maybe_shared_unchecked(bytes.freeze())
});
} }
res res
} }
} }
impl<F, B> Future for ServiceResponse<F, B> impl<F, I, E, B> Future for ServiceResponse<F, I, E, B>
where where
F: Future, F: Future<Output = Result<I, E>>,
F::Error: Into<Error>, E: Into<Error>,
F::Item: Into<Response<B>>, I: Into<Response<B>>,
B: MessageBody + 'static, B: MessageBody,
{ {
type Item = (); type Output = ();
type Error = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
match self.state { let mut this = self.as_mut().project();
match this.state {
ServiceResponseState::ServiceCall(ref mut call, ref mut send) => { ServiceResponseState::ServiceCall(ref mut call, ref mut send) => {
match call.poll() { match unsafe { Pin::new_unchecked(call) }.poll(cx) {
Ok(Async::Ready(res)) => { Poll::Ready(Ok(res)) => {
let (res, body) = res.into().replace_body(()); let (res, body) = res.into().replace_body(());
let mut send = send.take().unwrap(); let mut send = send.take().unwrap();
let mut size = body.size(); let mut size = body.size();
let h2_res = self.prepare_response(res.head(), &mut size); let h2_res =
self.as_mut().prepare_response(res.head(), &mut size);
this = self.as_mut().project();
let stream = let stream = match send.send_response(h2_res, size.is_eof()) {
send.send_response(h2_res, size.is_eof()).map_err(|e| { Err(e) => {
trace!("Error sending h2 response: {:?}", e); trace!("Error sending h2 response: {:?}", e);
})?; return Poll::Ready(());
}
Ok(stream) => stream,
};
if size.is_eof() { if size.is_eof() {
Ok(Async::Ready(())) Poll::Ready(())
} else { } else {
self.state = ServiceResponseState::SendPayload(stream, body); *this.state =
self.poll() ServiceResponseState::SendPayload(stream, body);
self.poll(cx)
} }
} }
Ok(Async::NotReady) => Ok(Async::NotReady), Poll::Pending => Poll::Pending,
Err(e) => { Poll::Ready(Err(e)) => {
let res: Response = e.into().into(); let res: Response = e.into().into();
let (res, body) = res.replace_body(()); let (res, body) = res.replace_body(());
let mut send = send.take().unwrap(); let mut send = send.take().unwrap();
let mut size = body.size(); let mut size = body.size();
let h2_res = self.prepare_response(res.head(), &mut size); let h2_res =
self.as_mut().prepare_response(res.head(), &mut size);
this = self.as_mut().project();
let stream = let stream = match send.send_response(h2_res, size.is_eof()) {
send.send_response(h2_res, size.is_eof()).map_err(|e| { Err(e) => {
trace!("Error sending h2 response: {:?}", e); trace!("Error sending h2 response: {:?}", e);
})?; return Poll::Ready(());
}
Ok(stream) => stream,
};
if size.is_eof() { if size.is_eof() {
Ok(Async::Ready(())) Poll::Ready(())
} else { } else {
self.state = ServiceResponseState::SendPayload( *this.state = ServiceResponseState::SendPayload(
stream, stream,
body.into_body(), body.into_body(),
); );
self.poll() self.poll(cx)
} }
} }
} }
} }
ServiceResponseState::SendPayload(ref mut stream, ref mut body) => loop { ServiceResponseState::SendPayload(ref mut stream, ref mut body) => loop {
loop { loop {
if let Some(ref mut buffer) = self.buffer { if let Some(ref mut buffer) = this.buffer {
match stream.poll_capacity().map_err(|e| warn!("{:?}", e))? { match stream.poll_capacity(cx) {
Async::NotReady => return Ok(Async::NotReady), Poll::Pending => return Poll::Pending,
Async::Ready(None) => return Ok(Async::Ready(())), Poll::Ready(None) => return Poll::Ready(()),
Async::Ready(Some(cap)) => { Poll::Ready(Some(Ok(cap))) => {
let len = buffer.len(); let len = buffer.len();
let bytes = buffer.split_to(std::cmp::min(cap, len)); let bytes = buffer.split_to(std::cmp::min(cap, len));
if let Err(e) = stream.send_data(bytes, false) { if let Err(e) = stream.send_data(bytes, false) {
warn!("{:?}", e); warn!("{:?}", e);
return Err(()); return Poll::Ready(());
} else if !buffer.is_empty() { } else if !buffer.is_empty() {
let cap = std::cmp::min(buffer.len(), CHUNK_SIZE); let cap = std::cmp::min(buffer.len(), CHUNK_SIZE);
stream.reserve_capacity(cap); stream.reserve_capacity(cap);
} else { } else {
self.buffer.take(); this.buffer.take();
} }
} }
Poll::Ready(Some(Err(e))) => {
warn!("{:?}", e);
return Poll::Ready(());
}
} }
} else { } else {
match body.poll_next() { match body.poll_next(cx) {
Ok(Async::NotReady) => { Poll::Pending => return Poll::Pending,
return Ok(Async::NotReady); Poll::Ready(None) => {
}
Ok(Async::Ready(None)) => {
if let Err(e) = stream.send_data(Bytes::new(), true) { if let Err(e) = stream.send_data(Bytes::new(), true) {
warn!("{:?}", e); warn!("{:?}", e);
return Err(());
} else {
return Ok(Async::Ready(()));
} }
return Poll::Ready(());
} }
Ok(Async::Ready(Some(chunk))) => { Poll::Ready(Some(Ok(chunk))) => {
stream.reserve_capacity(std::cmp::min( stream.reserve_capacity(std::cmp::min(
chunk.len(), chunk.len(),
CHUNK_SIZE, CHUNK_SIZE,
)); ));
self.buffer = Some(chunk); *this.buffer = Some(chunk);
} }
Err(e) => { Poll::Ready(Some(Err(e))) => {
error!("Response payload stream error: {:?}", e); error!("Response payload stream error: {:?}", e);
return Err(()); return Poll::Ready(());
} }
} }
} }

View File

@@ -1,9 +1,11 @@
#![allow(dead_code, unused_imports)] #![allow(dead_code, unused_imports)]
use std::fmt; use std::fmt;
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use bytes::Bytes; use bytes::Bytes;
use futures::{Async, Poll, Stream}; use futures::Stream;
use h2::RecvStream; use h2::RecvStream;
mod dispatcher; mod dispatcher;
@@ -25,22 +27,23 @@ impl Payload {
} }
impl Stream for Payload { impl Stream for Payload {
type Item = Bytes; type Item = Result<Bytes, PayloadError>;
type Error = PayloadError;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> { fn poll_next(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Option<Self::Item>> {
match self.pl.poll() { let this = self.get_mut();
Ok(Async::Ready(Some(chunk))) => {
match Pin::new(&mut this.pl).poll_data(cx) {
Poll::Ready(Some(Ok(chunk))) => {
let len = chunk.len(); let len = chunk.len();
if let Err(err) = self.pl.release_capacity().release_capacity(len) { if let Err(err) = this.pl.flow_control().release_capacity(len) {
Err(err.into()) Poll::Ready(Some(Err(err.into())))
} else { } else {
Ok(Async::Ready(Some(chunk))) Poll::Ready(Some(Ok(chunk)))
} }
} }
Ok(Async::Ready(None)) => Ok(Async::Ready(None)), Poll::Ready(Some(Err(err))) => Poll::Ready(Some(Err(err.into()))),
Ok(Async::NotReady) => Ok(Async::NotReady), Poll::Pending => Poll::Pending,
Err(err) => Err(err.into()), Poll::Ready(None) => Poll::Ready(None),
} }
} }
} }

View File

@@ -1,13 +1,19 @@
use std::fmt::Debug; use std::fmt::Debug;
use std::future::Future;
use std::marker::PhantomData; use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{io, net, rc}; use std::{io, net, rc};
use actix_codec::{AsyncRead, AsyncWrite, Framed}; use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig}; use actix_rt::net::TcpStream;
use actix_service::{IntoNewService, NewService, Service}; use actix_service::{
factory_fn, pipeline_factory, service_fn2, IntoServiceFactory, Service,
ServiceFactory,
};
use bytes::Bytes; use bytes::Bytes;
use futures::future::{ok, FutureResult}; use futures::future::{ok, Ready};
use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream}; use futures::{ready, Stream};
use h2::server::{self, Connection, Handshake}; use h2::server::{self, Connection, Handshake};
use h2::RecvStream; use h2::RecvStream;
use log::error; use log::error;
@@ -20,43 +26,35 @@ use crate::helpers::DataFactory;
use crate::payload::Payload; use crate::payload::Payload;
use crate::request::Request; use crate::request::Request;
use crate::response::Response; use crate::response::Response;
use crate::Protocol;
use super::dispatcher::Dispatcher; use super::dispatcher::Dispatcher;
/// `NewService` implementation for HTTP2 transport /// `ServiceFactory` implementation for HTTP2 transport
pub struct H2Service<T, P, S, B> { pub struct H2Service<T, S, B> {
srv: S, srv: S,
cfg: ServiceConfig, cfg: ServiceConfig,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>, _t: PhantomData<(T, B)>,
} }
impl<T, P, S, B> H2Service<T, P, S, B> impl<T, S, B> H2Service<T, S, B>
where where
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static, <S::Service as Service>::Future: 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
{ {
/// Create new `HttpService` instance.
pub fn new<F: IntoNewService<S>>(service: F) -> Self {
let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
H2Service {
cfg,
on_connect: None,
srv: service.into_new_service(),
_t: PhantomData,
}
}
/// Create new `HttpService` instance with config. /// Create new `HttpService` instance with config.
pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self { pub(crate) fn with_config<F: IntoServiceFactory<S>>(
cfg: ServiceConfig,
service: F,
) -> Self {
H2Service { H2Service {
cfg, cfg,
on_connect: None, on_connect: None,
srv: service.into_new_service(), srv: service.into_factory(),
_t: PhantomData, _t: PhantomData,
} }
} }
@@ -71,26 +69,144 @@ where
} }
} }
impl<T, P, S, B> NewService for H2Service<T, P, S, B> impl<S, B> H2Service<TcpStream, S, B>
where where
T: IoStream, S: ServiceFactory<Config = (), Request = Request>,
S: NewService<Config = SrvConfig, Request = Request>, S::Error: Into<Error> + 'static,
S::Error: Into<Error>, S::Response: Into<Response<B>> + 'static,
S::Response: Into<Response<B>>,
<S::Service as Service>::Future: 'static, <S::Service as Service>::Future: 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
{ {
type Config = SrvConfig; /// Create simple tcp based service
type Request = Io<T, P>; pub fn tcp(
self,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = DispatchError,
InitError = S::InitError,
> {
pipeline_factory(factory_fn(|| {
async {
Ok::<_, S::InitError>(service_fn2(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok::<_, DispatchError>((io, peer_addr))
}))
}
}))
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use actix_service::{factory_fn, service_fn2};
use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
use actix_tls::{openssl::HandshakeError, SslError};
use super::*;
impl<S, B> H2Service<SslStream<TcpStream>, S, B>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
/// Create ssl based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<HandshakeError<TcpStream>, DispatchError>,
InitError = S::InitError,
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(factory_fn(|| {
ok::<_, S::InitError>(service_fn2(|io: SslStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, peer_addr))
}))
}))
.and_then(self.map_err(SslError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_tls::rustls::{Acceptor, ServerConfig, Session, TlsStream};
use actix_tls::SslError;
use std::{fmt, io};
impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
/// Create openssl based service
pub fn rustls(
self,
mut config: ServerConfig,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<io::Error, DispatchError>,
InitError = S::InitError,
> {
let protos = vec!["h2".to_string().into()];
config.set_protocols(&protos);
pipeline_factory(
Acceptor::new(config)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(factory_fn(|| {
ok::<_, S::InitError>(service_fn2(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, peer_addr))
}))
}))
.and_then(self.map_err(SslError::Service))
}
}
}
impl<T, S, B> ServiceFactory for H2Service<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
type Config = ();
type Request = (T, Option<net::SocketAddr>);
type Response = (); type Response = ();
type Error = DispatchError; type Error = DispatchError;
type InitError = S::InitError; type InitError = S::InitError;
type Service = H2ServiceHandler<T, P, S::Service, B>; type Service = H2ServiceHandler<T, S::Service, B>;
type Future = H2ServiceResponse<T, P, S, B>; type Future = H2ServiceResponse<T, S, B>;
fn new_service(&self, cfg: &SrvConfig) -> Self::Future { fn new_service(&self, _: ()) -> Self::Future {
H2ServiceResponse { H2ServiceResponse {
fut: self.srv.new_service(cfg).into_future(), fut: self.srv.new_service(()),
cfg: Some(self.cfg.clone()), cfg: Some(self.cfg.clone()),
on_connect: self.on_connect.clone(), on_connect: self.on_connect.clone(),
_t: PhantomData, _t: PhantomData,
@@ -99,56 +215,61 @@ where
} }
#[doc(hidden)] #[doc(hidden)]
pub struct H2ServiceResponse<T, P, S: NewService, B> { #[pin_project::pin_project]
fut: <S::Future as IntoFuture>::Future, pub struct H2ServiceResponse<T, S: ServiceFactory, B> {
#[pin]
fut: S::Future,
cfg: Option<ServiceConfig>, cfg: Option<ServiceConfig>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>, _t: PhantomData<(T, B)>,
} }
impl<T, P, S, B> Future for H2ServiceResponse<T, P, S, B> impl<T, S, B> Future for H2ServiceResponse<T, S, B>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static, <S::Service as Service>::Future: 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
{ {
type Item = H2ServiceHandler<T, P, S::Service, B>; type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
type Error = S::InitError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
let service = try_ready!(self.fut.poll()); let this = self.as_mut().project();
Ok(Async::Ready(H2ServiceHandler::new(
self.cfg.take().unwrap(), Poll::Ready(ready!(this.fut.poll(cx)).map(|service| {
self.on_connect.clone(), let this = self.as_mut().project();
H2ServiceHandler::new(
this.cfg.take().unwrap(),
this.on_connect.clone(),
service, service,
))) )
}))
} }
} }
/// `Service` implementation for http/2 transport /// `Service` implementation for http/2 transport
pub struct H2ServiceHandler<T, P, S, B> { pub struct H2ServiceHandler<T, S, B> {
srv: CloneableService<S>, srv: CloneableService<S>,
cfg: ServiceConfig, cfg: ServiceConfig,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>, _t: PhantomData<(T, B)>,
} }
impl<T, P, S, B> H2ServiceHandler<T, P, S, B> impl<T, S, B> H2ServiceHandler<T, S, B>
where where
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Future: 'static, S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
{ {
fn new( fn new(
cfg: ServiceConfig, cfg: ServiceConfig,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
srv: S, srv: S,
) -> H2ServiceHandler<T, P, S, B> { ) -> H2ServiceHandler<T, S, B> {
H2ServiceHandler { H2ServiceHandler {
cfg, cfg,
on_connect, on_connect,
@@ -158,31 +279,29 @@ where
} }
} }
impl<T, P, S, B> Service for H2ServiceHandler<T, P, S, B> impl<T, S, B> Service for H2ServiceHandler<T, S, B>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Future: 'static, S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
{ {
type Request = Io<T, P>; type Request = (T, Option<net::SocketAddr>);
type Response = (); type Response = ();
type Error = DispatchError; type Error = DispatchError;
type Future = H2ServiceHandlerResponse<T, S, B>; type Future = H2ServiceHandlerResponse<T, S, B>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.srv.poll_ready().map_err(|e| { self.srv.poll_ready(cx).map_err(|e| {
let e = e.into(); let e = e.into();
error!("Service readiness error: {:?}", e); error!("Service readiness error: {:?}", e);
DispatchError::Service(e) DispatchError::Service(e)
}) })
} }
fn call(&mut self, req: Self::Request) -> Self::Future { fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
let io = req.into_parts().0;
let peer_addr = io.peer_addr();
let on_connect = if let Some(ref on_connect) = self.on_connect { let on_connect = if let Some(ref on_connect) = self.on_connect {
Some(on_connect(&io)) Some(on_connect(&io))
} else { } else {
@@ -193,7 +312,7 @@ where
state: State::Handshake( state: State::Handshake(
Some(self.srv.clone()), Some(self.srv.clone()),
Some(self.cfg.clone()), Some(self.cfg.clone()),
peer_addr, addr,
on_connect, on_connect,
server::handshake(io), server::handshake(io),
), ),
@@ -201,8 +320,9 @@ where
} }
} }
enum State<T: IoStream, S: Service<Request = Request>, B: MessageBody> enum State<T, S: Service<Request = Request>, B: MessageBody>
where where
T: AsyncRead + AsyncWrite + Unpin,
S::Future: 'static, S::Future: 'static,
{ {
Incoming(Dispatcher<T, S, B>), Incoming(Dispatcher<T, S, B>),
@@ -217,11 +337,11 @@ where
pub struct H2ServiceHandlerResponse<T, S, B> pub struct H2ServiceHandlerResponse<T, S, B>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Future: 'static, S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
{ {
state: State<T, S, B>, state: State<T, S, B>,
@@ -229,27 +349,26 @@ where
impl<T, S, B> Future for H2ServiceHandlerResponse<T, S, B> impl<T, S, B> Future for H2ServiceHandlerResponse<T, S, B>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Future: 'static, S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
B: MessageBody, B: MessageBody,
{ {
type Item = (); type Output = Result<(), DispatchError>;
type Error = DispatchError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
match self.state { match self.state {
State::Incoming(ref mut disp) => disp.poll(), State::Incoming(ref mut disp) => Pin::new(disp).poll(cx),
State::Handshake( State::Handshake(
ref mut srv, ref mut srv,
ref mut config, ref mut config,
ref peer_addr, ref peer_addr,
ref mut on_connect, ref mut on_connect,
ref mut handshake, ref mut handshake,
) => match handshake.poll() { ) => match Pin::new(handshake).poll(cx) {
Ok(Async::Ready(conn)) => { Poll::Ready(Ok(conn)) => {
self.state = State::Incoming(Dispatcher::new( self.state = State::Incoming(Dispatcher::new(
srv.take().unwrap(), srv.take().unwrap(),
conn, conn,
@@ -258,13 +377,13 @@ where
None, None,
*peer_addr, *peer_addr,
)); ));
self.poll() self.poll(cx)
} }
Ok(Async::NotReady) => Ok(Async::NotReady), Poll::Ready(Err(err)) => {
Err(err) => {
trace!("H2 handshake error: {}", err); trace!("H2 handshake error: {}", err);
Err(err.into()) Poll::Ready(Err(err.into()))
} }
Poll::Pending => Poll::Pending,
}, },
} }
} }

View File

@@ -80,12 +80,12 @@ impl fmt::Display for CacheControl {
} }
impl IntoHeaderValue for CacheControl { impl IntoHeaderValue for CacheControl {
type Error = header::InvalidHeaderValueBytes; type Error = header::InvalidHeaderValue;
fn try_into(self) -> Result<header::HeaderValue, Self::Error> { fn try_into(self) -> Result<header::HeaderValue, Self::Error> {
let mut writer = Writer::new(); let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self); let _ = write!(&mut writer, "{}", self);
header::HeaderValue::from_shared(writer.take()) header::HeaderValue::from_maybe_shared(writer.take())
} }
} }

View File

@@ -76,6 +76,11 @@ pub enum DispositionParam {
/// the form. /// the form.
Name(String), Name(String),
/// A plain file name. /// A plain file name.
///
/// It is [not supposed](https://tools.ietf.org/html/rfc6266#appendix-D) to contain any
/// non-ASCII characters when used in a *Content-Disposition* HTTP response header, where
/// [`FilenameExt`](DispositionParam::FilenameExt) with charset UTF-8 may be used instead
/// in case there are Unicode characters in file names.
Filename(String), Filename(String),
/// An extended file name. It must not exist for `ContentType::Formdata` according to /// An extended file name. It must not exist for `ContentType::Formdata` according to
/// [RFC7578 Section 4.2](https://tools.ietf.org/html/rfc7578#section-4.2). /// [RFC7578 Section 4.2](https://tools.ietf.org/html/rfc7578#section-4.2).
@@ -220,7 +225,16 @@ impl DispositionParam {
/// ext-token = <the characters in token, followed by "*"> /// ext-token = <the characters in token, followed by "*">
/// ``` /// ```
/// ///
/// **Note**: filename* [must not](https://tools.ietf.org/html/rfc7578#section-4.2) be used within /// # Note
///
/// filename is [not supposed](https://tools.ietf.org/html/rfc6266#appendix-D) to contain any
/// non-ASCII characters when used in a *Content-Disposition* HTTP response header, where
/// filename* with charset UTF-8 may be used instead in case there are Unicode characters in file
/// names.
/// filename is [acceptable](https://tools.ietf.org/html/rfc7578#section-4.2) to be UTF-8 encoded
/// directly in a *Content-Disposition* header for *multipart/form-data*, though.
///
/// filename* [must not](https://tools.ietf.org/html/rfc7578#section-4.2) be used within
/// *multipart/form-data*. /// *multipart/form-data*.
/// ///
/// # Example /// # Example
@@ -251,6 +265,22 @@ impl DispositionParam {
/// }; /// };
/// assert_eq!(cd2.get_name(), Some("file")); // field name /// assert_eq!(cd2.get_name(), Some("file")); // field name
/// assert_eq!(cd2.get_filename(), Some("bill.odt")); /// assert_eq!(cd2.get_filename(), Some("bill.odt"));
///
/// // HTTP response header with Unicode characters in file names
/// let cd3 = ContentDisposition {
/// disposition: DispositionType::Attachment,
/// parameters: vec![
/// DispositionParam::FilenameExt(ExtendedValue {
/// charset: Charset::Ext(String::from("UTF-8")),
/// language_tag: None,
/// value: String::from("\u{1f600}.svg").into_bytes(),
/// }),
/// // fallback for better compatibility
/// DispositionParam::Filename(String::from("Grinning-Face-Emoji.svg"))
/// ],
/// };
/// assert_eq!(cd3.get_filename_ext().map(|ev| ev.value.as_ref()),
/// Some("\u{1f600}.svg".as_bytes()));
/// ``` /// ```
/// ///
/// # WARN /// # WARN
@@ -333,15 +363,17 @@ impl ContentDisposition {
// token: won't contains semicolon according to RFC 2616 Section 2.2 // token: won't contains semicolon according to RFC 2616 Section 2.2
let (token, new_left) = split_once_and_trim(left, ';'); let (token, new_left) = split_once_and_trim(left, ';');
left = new_left; left = new_left;
token.to_owned() if token.is_empty() {
}; // quoted-string can be empty, but token cannot be empty
if value.is_empty() {
return Err(crate::error::ParseError::Header); return Err(crate::error::ParseError::Header);
} }
token.to_owned()
};
let param = if param_name.eq_ignore_ascii_case("name") { let param = if param_name.eq_ignore_ascii_case("name") {
DispositionParam::Name(value) DispositionParam::Name(value)
} else if param_name.eq_ignore_ascii_case("filename") { } else if param_name.eq_ignore_ascii_case("filename") {
// See also comments in test_from_raw_uncessary_percent_decode.
DispositionParam::Filename(value) DispositionParam::Filename(value)
} else { } else {
DispositionParam::Unknown(param_name.to_owned(), value) DispositionParam::Unknown(param_name.to_owned(), value)
@@ -430,12 +462,12 @@ impl ContentDisposition {
} }
impl IntoHeaderValue for ContentDisposition { impl IntoHeaderValue for ContentDisposition {
type Error = header::InvalidHeaderValueBytes; type Error = header::InvalidHeaderValue;
fn try_into(self) -> Result<header::HeaderValue, Self::Error> { fn try_into(self) -> Result<header::HeaderValue, Self::Error> {
let mut writer = Writer::new(); let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self); let _ = write!(&mut writer, "{}", self);
header::HeaderValue::from_shared(writer.take()) header::HeaderValue::from_maybe_shared(writer.take())
} }
} }
@@ -466,11 +498,40 @@ impl fmt::Display for DispositionType {
impl fmt::Display for DispositionParam { impl fmt::Display for DispositionParam {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
// All ASCII control charaters (0-30, 127) excepting horizontal tab, double quote, and // All ASCII control characters (0-30, 127) including horizontal tab, double quote, and
// backslash should be escaped in quoted-string (i.e. "foobar"). // backslash should be escaped in quoted-string (i.e. "foobar").
// Ref: RFC6266 S4.1 -> RFC2616 S2.2; RFC 7578 S4.2 -> RFC2183 S2 -> ... . // Ref: RFC6266 S4.1 -> RFC2616 S3.6
// filename-parm = "filename" "=" value
// value = token | quoted-string
// quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
// qdtext = <any TEXT except <">>
// quoted-pair = "\" CHAR
// TEXT = <any OCTET except CTLs,
// but including LWS>
// LWS = [CRLF] 1*( SP | HT )
// OCTET = <any 8-bit sequence of data>
// CHAR = <any US-ASCII character (octets 0 - 127)>
// CTL = <any US-ASCII control character
// (octets 0 - 31) and DEL (127)>
//
// Ref: RFC7578 S4.2 -> RFC2183 S2 -> RFC2045 S5.1
// parameter := attribute "=" value
// attribute := token
// ; Matching of attributes
// ; is ALWAYS case-insensitive.
// value := token / quoted-string
// token := 1*<any (US-ASCII) CHAR except SPACE, CTLs,
// or tspecials>
// tspecials := "(" / ")" / "<" / ">" / "@" /
// "," / ";" / ":" / "\" / <">
// "/" / "[" / "]" / "?" / "="
// ; Must be in quoted-string,
// ; to use within parameter values
//
//
// See also comments in test_from_raw_uncessary_percent_decode.
lazy_static! { lazy_static! {
static ref RE: Regex = Regex::new("[\x01-\x08\x10\x1F\x7F\"\\\\]").unwrap(); static ref RE: Regex = Regex::new("[\x00-\x08\x10-\x1F\x7F\"\\\\]").unwrap();
} }
match self { match self {
DispositionParam::Name(ref value) => write!(f, "name={}", value), DispositionParam::Name(ref value) => write!(f, "name={}", value),
@@ -707,8 +768,7 @@ mod tests {
Mainstream browsers like Firefox (gecko) and Chrome use UTF-8 directly as above. Mainstream browsers like Firefox (gecko) and Chrome use UTF-8 directly as above.
(And now, only UTF-8 is handled by this implementation.) (And now, only UTF-8 is handled by this implementation.)
*/ */
let a = let a = HeaderValue::from_str("form-data; name=upload; filename=\"文件.webp\"")
HeaderValue::from_str("form-data; name=upload; filename=\"文件.webp\"")
.unwrap(); .unwrap();
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap(); let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition { let b = ContentDisposition {
@@ -774,8 +834,18 @@ mod tests {
#[test] #[test]
fn test_from_raw_uncessary_percent_decode() { fn test_from_raw_uncessary_percent_decode() {
// In fact, RFC7578 (multipart/form-data) Section 2 and 4.2 suggests that filename with
// non-ASCII characters MAY be percent-encoded.
// On the contrary, RFC6266 or other RFCs related to Content-Disposition response header
// do not mention such percent-encoding.
// So, it appears to be undecidable whether to percent-decode or not without
// knowing the usage scenario (multipart/form-data v.s. HTTP response header) and
// inevitable to unnecessarily percent-decode filename with %XX in the former scenario.
// Fortunately, it seems that almost all mainstream browsers just send UTF-8 encoded file
// names in quoted-string format (tested on Edge, IE11, Chrome and Firefox) without
// percent-encoding. So we do not bother to attempt to percent-decode.
let a = HeaderValue::from_static( let a = HeaderValue::from_static(
"form-data; name=photo; filename=\"%74%65%73%74%2e%70%6e%67\"", // Should not be decoded! "form-data; name=photo; filename=\"%74%65%73%74%2e%70%6e%67\"",
); );
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap(); let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition { let b = ContentDisposition {
@@ -811,6 +881,13 @@ mod tests {
let a = HeaderValue::from_static("inline; filename= "); let a = HeaderValue::from_static("inline; filename= ");
assert!(ContentDisposition::from_raw(&a).is_err()); assert!(ContentDisposition::from_raw(&a).is_err());
let a = HeaderValue::from_static("inline; filename=\"\"");
assert!(ContentDisposition::from_raw(&a)
.expect("parse cd")
.get_filename()
.expect("filename")
.is_empty());
} }
#[test] #[test]

View File

@@ -3,7 +3,7 @@ use std::str::FromStr;
use crate::error::ParseError; use crate::error::ParseError;
use crate::header::{ use crate::header::{
HeaderValue, IntoHeaderValue, InvalidHeaderValueBytes, Writer, CONTENT_RANGE, HeaderValue, IntoHeaderValue, InvalidHeaderValue, Writer, CONTENT_RANGE,
}; };
header! { header! {
@@ -198,11 +198,11 @@ impl Display for ContentRangeSpec {
} }
impl IntoHeaderValue for ContentRangeSpec { impl IntoHeaderValue for ContentRangeSpec {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut writer = Writer::new(); let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self); let _ = write!(&mut writer, "{}", self);
HeaderValue::from_shared(writer.take()) HeaderValue::from_maybe_shared(writer.take())
} }
} }

View File

@@ -3,7 +3,7 @@ use std::fmt::{self, Display, Write};
use crate::error::ParseError; use crate::error::ParseError;
use crate::header::{ use crate::header::{
self, from_one_raw_str, EntityTag, Header, HeaderName, HeaderValue, HttpDate, self, from_one_raw_str, EntityTag, Header, HeaderName, HeaderValue, HttpDate,
IntoHeaderValue, InvalidHeaderValueBytes, Writer, IntoHeaderValue, InvalidHeaderValue, Writer,
}; };
use crate::httpmessage::HttpMessage; use crate::httpmessage::HttpMessage;
@@ -96,12 +96,12 @@ impl Display for IfRange {
} }
impl IntoHeaderValue for IfRange { impl IntoHeaderValue for IfRange {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut writer = Writer::new(); let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self); let _ = write!(&mut writer, "{}", self);
HeaderValue::from_shared(writer.take()) HeaderValue::from_maybe_shared(writer.take())
} }
} }

View File

@@ -164,13 +164,13 @@ macro_rules! header {
} }
} }
impl $crate::http::header::IntoHeaderValue for $id { impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes; type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> { fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
use std::fmt::Write; use std::fmt::Write;
let mut writer = $crate::http::header::Writer::new(); let mut writer = $crate::http::header::Writer::new();
let _ = write!(&mut writer, "{}", self); let _ = write!(&mut writer, "{}", self);
$crate::http::header::HeaderValue::from_shared(writer.take()) $crate::http::header::HeaderValue::from_maybe_shared(writer.take())
} }
} }
}; };
@@ -200,13 +200,13 @@ macro_rules! header {
} }
} }
impl $crate::http::header::IntoHeaderValue for $id { impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes; type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> { fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
use std::fmt::Write; use std::fmt::Write;
let mut writer = $crate::http::header::Writer::new(); let mut writer = $crate::http::header::Writer::new();
let _ = write!(&mut writer, "{}", self); let _ = write!(&mut writer, "{}", self);
$crate::http::header::HeaderValue::from_shared(writer.take()) $crate::http::header::HeaderValue::from_maybe_shared(writer.take())
} }
} }
}; };
@@ -236,7 +236,7 @@ macro_rules! header {
} }
} }
impl $crate::http::header::IntoHeaderValue for $id { impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes; type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> { fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
self.0.try_into() self.0.try_into()
@@ -285,13 +285,13 @@ macro_rules! header {
} }
} }
impl $crate::http::header::IntoHeaderValue for $id { impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes; type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> { fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
use std::fmt::Write; use std::fmt::Write;
let mut writer = $crate::http::header::Writer::new(); let mut writer = $crate::http::header::Writer::new();
let _ = write!(&mut writer, "{}", self); let _ = write!(&mut writer, "{}", self);
$crate::http::header::HeaderValue::from_shared(writer.take()) $crate::http::header::HeaderValue::from_maybe_shared(writer.take())
} }
} }
}; };

View File

@@ -1,8 +1,9 @@
use std::collections::hash_map::{self, Entry};
use std::convert::TryFrom;
use either::Either; use either::Either;
use hashbrown::hash_map::{self, Entry}; use fxhash::FxHashMap;
use hashbrown::HashMap;
use http::header::{HeaderName, HeaderValue}; use http::header::{HeaderName, HeaderValue};
use http::HttpTryFrom;
/// A set of HTTP headers /// A set of HTTP headers
/// ///
@@ -11,7 +12,7 @@ use http::HttpTryFrom;
/// [`HeaderName`]: struct.HeaderName.html /// [`HeaderName`]: struct.HeaderName.html
#[derive(Debug, Clone)] #[derive(Debug, Clone)]
pub struct HeaderMap { pub struct HeaderMap {
pub(crate) inner: HashMap<HeaderName, Value>, pub(crate) inner: FxHashMap<HeaderName, Value>,
} }
#[derive(Debug, Clone)] #[derive(Debug, Clone)]
@@ -56,7 +57,7 @@ impl HeaderMap {
/// allocate. /// allocate.
pub fn new() -> Self { pub fn new() -> Self {
HeaderMap { HeaderMap {
inner: HashMap::new(), inner: FxHashMap::default(),
} }
} }
@@ -70,7 +71,7 @@ impl HeaderMap {
/// More capacity than requested may be allocated. /// More capacity than requested may be allocated.
pub fn with_capacity(capacity: usize) -> HeaderMap { pub fn with_capacity(capacity: usize) -> HeaderMap {
HeaderMap { HeaderMap {
inner: HashMap::with_capacity(capacity), inner: FxHashMap::with_capacity_and_hasher(capacity, Default::default()),
} }
} }

View File

@@ -1,6 +1,7 @@
//! Various http headers //! Various http headers
// This is mostly copy of [hyper](https://github.com/hyperium/hyper/tree/master/src/header) // This is mostly copy of [hyper](https://github.com/hyperium/hyper/tree/master/src/header)
use std::convert::TryFrom;
use std::{fmt, str::FromStr}; use std::{fmt, str::FromStr};
use bytes::{Bytes, BytesMut}; use bytes::{Bytes, BytesMut};
@@ -16,7 +17,6 @@ use crate::httpmessage::HttpMessage;
mod common; mod common;
pub(crate) mod map; pub(crate) mod map;
mod shared; mod shared;
#[doc(hidden)]
pub use self::common::*; pub use self::common::*;
#[doc(hidden)] #[doc(hidden)]
pub use self::shared::*; pub use self::shared::*;
@@ -74,58 +74,58 @@ impl<'a> IntoHeaderValue for &'a [u8] {
} }
impl IntoHeaderValue for Bytes { impl IntoHeaderValue for Bytes {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
#[inline] #[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_shared(self) HeaderValue::from_maybe_shared(self)
} }
} }
impl IntoHeaderValue for Vec<u8> { impl IntoHeaderValue for Vec<u8> {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
#[inline] #[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_shared(Bytes::from(self)) HeaderValue::try_from(self)
} }
} }
impl IntoHeaderValue for String { impl IntoHeaderValue for String {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
#[inline] #[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_shared(Bytes::from(self)) HeaderValue::try_from(self)
} }
} }
impl IntoHeaderValue for usize { impl IntoHeaderValue for usize {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
#[inline] #[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
let s = format!("{}", self); let s = format!("{}", self);
HeaderValue::from_shared(Bytes::from(s)) HeaderValue::try_from(s)
} }
} }
impl IntoHeaderValue for u64 { impl IntoHeaderValue for u64 {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
#[inline] #[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
let s = format!("{}", self); let s = format!("{}", self);
HeaderValue::from_shared(Bytes::from(s)) HeaderValue::try_from(s)
} }
} }
impl IntoHeaderValue for Mime { impl IntoHeaderValue for Mime {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
#[inline] #[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_shared(Bytes::from(format!("{}", self))) HeaderValue::try_from(format!("{}", self))
} }
} }
@@ -205,7 +205,7 @@ impl Writer {
} }
} }
fn take(&mut self) -> Bytes { fn take(&mut self) -> Bytes {
self.buf.take().freeze() self.buf.split().freeze()
} }
} }

View File

@@ -1,7 +1,7 @@
use std::fmt::{self, Display, Write}; use std::fmt::{self, Display, Write};
use std::str::FromStr; use std::str::FromStr;
use crate::header::{HeaderValue, IntoHeaderValue, InvalidHeaderValueBytes, Writer}; use crate::header::{HeaderValue, IntoHeaderValue, InvalidHeaderValue, Writer};
/// check that each char in the slice is either: /// check that each char in the slice is either:
/// 1. `%x21`, or /// 1. `%x21`, or
@@ -157,12 +157,12 @@ impl FromStr for EntityTag {
} }
impl IntoHeaderValue for EntityTag { impl IntoHeaderValue for EntityTag {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut wrt = Writer::new(); let mut wrt = Writer::new();
write!(wrt, "{}", self).unwrap(); write!(wrt, "{}", self).unwrap();
HeaderValue::from_shared(wrt.take()) HeaderValue::from_maybe_shared(wrt.take())
} }
} }

View File

@@ -3,8 +3,8 @@ use std::io::Write;
use std::str::FromStr; use std::str::FromStr;
use std::time::{Duration, SystemTime, UNIX_EPOCH}; use std::time::{Duration, SystemTime, UNIX_EPOCH};
use bytes::{BufMut, BytesMut}; use bytes::{buf::BufMutExt, BytesMut};
use http::header::{HeaderValue, InvalidHeaderValueBytes}; use http::header::{HeaderValue, InvalidHeaderValue};
use crate::error::ParseError; use crate::error::ParseError;
use crate::header::IntoHeaderValue; use crate::header::IntoHeaderValue;
@@ -58,12 +58,12 @@ impl From<SystemTime> for HttpDate {
} }
impl IntoHeaderValue for HttpDate { impl IntoHeaderValue for HttpDate {
type Error = InvalidHeaderValueBytes; type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> { fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut wrt = BytesMut::with_capacity(29).writer(); let mut wrt = BytesMut::with_capacity(29).writer();
write!(wrt, "{}", self.0.rfc822()).unwrap(); write!(wrt, "{}", self.0.rfc822()).unwrap();
HeaderValue::from_shared(wrt.get_mut().take().freeze()) HeaderValue::from_maybe_shared(wrt.get_mut().split().freeze())
} }
} }

View File

@@ -60,7 +60,7 @@ pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesM
bytes.put_slice(&buf); bytes.put_slice(&buf);
if four { if four {
bytes.put(b' '); bytes.put_u8(b' ');
} }
} }
@@ -115,7 +115,7 @@ pub fn write_content_length(mut n: usize, bytes: &mut BytesMut) {
pub(crate) fn convert_usize(mut n: usize, bytes: &mut BytesMut) { pub(crate) fn convert_usize(mut n: usize, bytes: &mut BytesMut) {
let mut curr: isize = 39; let mut curr: isize = 39;
let mut buf: [u8; 41] = unsafe { mem::uninitialized() }; let mut buf: [u8; 41] = unsafe { mem::MaybeUninit::uninit().assume_init() };
buf[39] = b'\r'; buf[39] = b'\r';
buf[40] = b'\n'; buf[40] = b'\n';
let buf_ptr = buf.as_mut_ptr(); let buf_ptr = buf.as_mut_ptr();
@@ -203,33 +203,33 @@ mod tests {
let mut bytes = BytesMut::new(); let mut bytes = BytesMut::new();
bytes.reserve(50); bytes.reserve(50);
write_content_length(0, &mut bytes); write_content_length(0, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 0\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 0\r\n"[..]);
bytes.reserve(50); bytes.reserve(50);
write_content_length(9, &mut bytes); write_content_length(9, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 9\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 9\r\n"[..]);
bytes.reserve(50); bytes.reserve(50);
write_content_length(10, &mut bytes); write_content_length(10, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 10\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 10\r\n"[..]);
bytes.reserve(50); bytes.reserve(50);
write_content_length(99, &mut bytes); write_content_length(99, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 99\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 99\r\n"[..]);
bytes.reserve(50); bytes.reserve(50);
write_content_length(100, &mut bytes); write_content_length(100, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 100\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 100\r\n"[..]);
bytes.reserve(50); bytes.reserve(50);
write_content_length(101, &mut bytes); write_content_length(101, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 101\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 101\r\n"[..]);
bytes.reserve(50); bytes.reserve(50);
write_content_length(998, &mut bytes); write_content_length(998, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 998\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 998\r\n"[..]);
bytes.reserve(50); bytes.reserve(50);
write_content_length(1000, &mut bytes); write_content_length(1000, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 1000\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 1000\r\n"[..]);
bytes.reserve(50); bytes.reserve(50);
write_content_length(1001, &mut bytes); write_content_length(1001, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 1001\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 1001\r\n"[..]);
bytes.reserve(50); bytes.reserve(50);
write_content_length(5909, &mut bytes); write_content_length(5909, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 5909\r\n"[..]); assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 5909\r\n"[..]);
} }
} }

View File

@@ -29,7 +29,6 @@ impl Response {
STATIC_RESP!(AlreadyReported, StatusCode::ALREADY_REPORTED); STATIC_RESP!(AlreadyReported, StatusCode::ALREADY_REPORTED);
STATIC_RESP!(MultipleChoices, StatusCode::MULTIPLE_CHOICES); STATIC_RESP!(MultipleChoices, StatusCode::MULTIPLE_CHOICES);
STATIC_RESP!(MovedPermanenty, StatusCode::MOVED_PERMANENTLY);
STATIC_RESP!(MovedPermanently, StatusCode::MOVED_PERMANENTLY); STATIC_RESP!(MovedPermanently, StatusCode::MOVED_PERMANENTLY);
STATIC_RESP!(Found, StatusCode::FOUND); STATIC_RESP!(Found, StatusCode::FOUND);
STATIC_RESP!(SeeOther, StatusCode::SEE_OTHER); STATIC_RESP!(SeeOther, StatusCode::SEE_OTHER);

View File

@@ -51,7 +51,7 @@ pub mod http {
// re-exports // re-exports
pub use http::header::{HeaderName, HeaderValue}; pub use http::header::{HeaderName, HeaderValue};
pub use http::uri::PathAndQuery; pub use http::uri::PathAndQuery;
pub use http::{uri, Error, HttpTryFrom, Uri}; pub use http::{uri, Error, Uri};
pub use http::{Method, StatusCode, Version}; pub use http::{Method, StatusCode, Version};
pub use crate::cookie::{Cookie, CookieBuilder}; pub use crate::cookie::{Cookie, CookieBuilder};
@@ -64,3 +64,10 @@ pub mod http {
pub use crate::header::ContentEncoding; pub use crate::header::ContentEncoding;
pub use crate::message::ConnectionType; pub use crate::message::ConnectionType;
} }
/// Http protocol
#[derive(Copy, Clone, Debug, PartialEq, Eq, Hash)]
pub enum Protocol {
Http1,
Http2,
}

View File

@@ -388,6 +388,12 @@ impl BoxedResponseHead {
pub fn new(status: StatusCode) -> Self { pub fn new(status: StatusCode) -> Self {
RESPONSE_POOL.with(|p| p.get_message(status)) RESPONSE_POOL.with(|p| p.get_message(status))
} }
pub(crate) fn take(&mut self) -> Self {
BoxedResponseHead {
head: self.head.take(),
}
}
} }
impl std::ops::Deref for BoxedResponseHead { impl std::ops::Deref for BoxedResponseHead {
@@ -406,7 +412,9 @@ impl std::ops::DerefMut for BoxedResponseHead {
impl Drop for BoxedResponseHead { impl Drop for BoxedResponseHead {
fn drop(&mut self) { fn drop(&mut self) {
RESPONSE_POOL.with(|p| p.release(self.head.take().unwrap())) if let Some(head) = self.head.take() {
RESPONSE_POOL.with(move |p| p.release(head))
}
} }
} }

View File

@@ -1,11 +1,14 @@
use std::pin::Pin;
use std::task::{Context, Poll};
use bytes::Bytes; use bytes::Bytes;
use futures::{Async, Poll, Stream}; use futures::Stream;
use h2::RecvStream; use h2::RecvStream;
use crate::error::PayloadError; use crate::error::PayloadError;
/// Type represent boxed payload /// Type represent boxed payload
pub type PayloadStream = Box<dyn Stream<Item = Bytes, Error = PayloadError>>; pub type PayloadStream = Pin<Box<dyn Stream<Item = Result<Bytes, PayloadError>>>>;
/// Type represent streaming payload /// Type represent streaming payload
pub enum Payload<S = PayloadStream> { pub enum Payload<S = PayloadStream> {
@@ -48,18 +51,17 @@ impl<S> Payload<S> {
impl<S> Stream for Payload<S> impl<S> Stream for Payload<S>
where where
S: Stream<Item = Bytes, Error = PayloadError>, S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
{ {
type Item = Bytes; type Item = Result<Bytes, PayloadError>;
type Error = PayloadError;
#[inline] #[inline]
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> { fn poll_next(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Option<Self::Item>> {
match self { match self.get_mut() {
Payload::None => Ok(Async::Ready(None)), Payload::None => Poll::Ready(None),
Payload::H1(ref mut pl) => pl.poll(), Payload::H1(ref mut pl) => pl.readany(cx),
Payload::H2(ref mut pl) => pl.poll(), Payload::H2(ref mut pl) => Pin::new(pl).poll_next(cx),
Payload::Stream(ref mut pl) => pl.poll(), Payload::Stream(ref mut pl) => Pin::new(pl).poll_next(cx),
} }
} }
} }

View File

@@ -80,6 +80,11 @@ impl<P> Request<P> {
) )
} }
/// Get request's payload
pub fn payload(&mut self) -> &mut Payload<P> {
&mut self.payload
}
/// Get request's payload /// Get request's payload
pub fn take_payload(&mut self) -> Payload<P> { pub fn take_payload(&mut self) -> Payload<P> {
std::mem::replace(&mut self.payload, Payload::None) std::mem::replace(&mut self.payload, Payload::None)
@@ -182,7 +187,7 @@ impl<P> fmt::Debug for Request<P> {
#[cfg(test)] #[cfg(test)]
mod tests { mod tests {
use super::*; use super::*;
use http::HttpTryFrom; use std::convert::TryFrom;
#[test] #[test]
fn test_basics() { fn test_basics() {
@@ -199,7 +204,6 @@ mod tests {
assert_eq!(req.uri().query(), Some("q=1")); assert_eq!(req.uri().query(), Some("q=1"));
let s = format!("{:?}", req); let s = format!("{:?}", req);
println!("T: {:?}", s);
assert!(s.contains("Request HTTP/1.1 GET:/index.html")); assert!(s.contains("Request HTTP/1.1 GET:/index.html"));
} }
} }

View File

@@ -1,11 +1,13 @@
//! Http response //! Http response
use std::cell::{Ref, RefMut}; use std::cell::{Ref, RefMut};
use std::io::Write; use std::convert::TryFrom;
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, str}; use std::{fmt, str};
use bytes::{BufMut, Bytes, BytesMut}; use bytes::{Bytes, BytesMut};
use futures::future::{ok, FutureResult, IntoFuture}; use futures::stream::Stream;
use futures::Stream;
use serde::Serialize; use serde::Serialize;
use serde_json; use serde_json;
@@ -15,7 +17,7 @@ use crate::error::Error;
use crate::extensions::Extensions; use crate::extensions::Extensions;
use crate::header::{Header, IntoHeaderValue}; use crate::header::{Header, IntoHeaderValue};
use crate::http::header::{self, HeaderName, HeaderValue}; use crate::http::header::{self, HeaderName, HeaderValue};
use crate::http::{Error as HttpError, HeaderMap, HttpTryFrom, StatusCode}; use crate::http::{Error as HttpError, HeaderMap, StatusCode};
use crate::message::{BoxedResponseHead, ConnectionType, ResponseHead}; use crate::message::{BoxedResponseHead, ConnectionType, ResponseHead};
/// An HTTP Response /// An HTTP Response
@@ -51,7 +53,7 @@ impl Response<Body> {
/// Constructs an error response /// Constructs an error response
#[inline] #[inline]
pub fn from_error(error: Error) -> Response { pub fn from_error(error: Error) -> Response {
let mut resp = error.as_response_error().render_response(); let mut resp = error.as_response_error().error_response();
if resp.head.status == StatusCode::INTERNAL_SERVER_ERROR { if resp.head.status == StatusCode::INTERNAL_SERVER_ERROR {
error!("Internal Server Error: {:?}", error); error!("Internal Server Error: {:?}", error);
} }
@@ -194,7 +196,7 @@ impl<B> Response<B> {
self.head.extensions.borrow_mut() self.head.extensions.borrow_mut()
} }
/// Get body os this response /// Get body of this response
#[inline] #[inline]
pub fn body(&self) -> &ResponseBody<B> { pub fn body(&self) -> &ResponseBody<B> {
&self.body &self.body
@@ -280,13 +282,15 @@ impl<B: MessageBody> fmt::Debug for Response<B> {
} }
} }
impl IntoFuture for Response { impl Future for Response {
type Item = Response; type Output = Result<Response, Error>;
type Error = Error;
type Future = FutureResult<Response, Error>;
fn into_future(self) -> Self::Future { fn poll(mut self: Pin<&mut Self>, _: &mut Context) -> Poll<Self::Output> {
ok(self) Poll::Ready(Ok(Response {
head: self.head.take(),
body: self.body.take_body(),
error: self.error.take(),
}))
} }
} }
@@ -380,7 +384,8 @@ impl ResponseBuilder {
/// ``` /// ```
pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self
where where
HeaderName: HttpTryFrom<K>, HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue, V: IntoHeaderValue,
{ {
if let Some(parts) = parts(&mut self.head, &self.err) { if let Some(parts) = parts(&mut self.head, &self.err) {
@@ -412,7 +417,8 @@ impl ResponseBuilder {
/// ``` /// ```
pub fn set_header<K, V>(&mut self, key: K, value: V) -> &mut Self pub fn set_header<K, V>(&mut self, key: K, value: V) -> &mut Self
where where
HeaderName: HttpTryFrom<K>, HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue, V: IntoHeaderValue,
{ {
if let Some(parts) = parts(&mut self.head, &self.err) { if let Some(parts) = parts(&mut self.head, &self.err) {
@@ -481,7 +487,8 @@ impl ResponseBuilder {
#[inline] #[inline]
pub fn content_type<V>(&mut self, value: V) -> &mut Self pub fn content_type<V>(&mut self, value: V) -> &mut Self
where where
HeaderValue: HttpTryFrom<V>, HeaderValue: TryFrom<V>,
<HeaderValue as TryFrom<V>>::Error: Into<HttpError>,
{ {
if let Some(parts) = parts(&mut self.head, &self.err) { if let Some(parts) = parts(&mut self.head, &self.err) {
match HeaderValue::try_from(value) { match HeaderValue::try_from(value) {
@@ -497,9 +504,7 @@ impl ResponseBuilder {
/// Set content length /// Set content length
#[inline] #[inline]
pub fn content_length(&mut self, len: u64) -> &mut Self { pub fn content_length(&mut self, len: u64) -> &mut Self {
let mut wrt = BytesMut::new().writer(); self.header(header::CONTENT_LENGTH, len)
let _ = write!(wrt, "{}", len);
self.header(header::CONTENT_LENGTH, wrt.get_mut().take().freeze())
} }
/// Set a cookie /// Set a cookie
@@ -635,7 +640,7 @@ impl ResponseBuilder {
/// `ResponseBuilder` can not be used after this call. /// `ResponseBuilder` can not be used after this call.
pub fn streaming<S, E>(&mut self, stream: S) -> Response pub fn streaming<S, E>(&mut self, stream: S) -> Response
where where
S: Stream<Item = Bytes, Error = E> + 'static, S: Stream<Item = Result<Bytes, E>> + 'static,
E: Into<Error> + 'static, E: Into<Error> + 'static,
{ {
self.body(Body::from_message(BodyStream::new(stream))) self.body(Body::from_message(BodyStream::new(stream)))
@@ -757,13 +762,11 @@ impl<'a> From<&'a ResponseHead> for ResponseBuilder {
} }
} }
impl IntoFuture for ResponseBuilder { impl Future for ResponseBuilder {
type Item = Response; type Output = Result<Response, Error>;
type Error = Error;
type Future = FutureResult<Response, Error>;
fn into_future(mut self) -> Self::Future { fn poll(mut self: Pin<&mut Self>, _: &mut Context) -> Poll<Self::Output> {
ok(self.finish()) Poll::Ready(Ok(self.finish()))
} }
} }
@@ -992,6 +995,14 @@ mod tests {
assert_eq!(resp.body().get_ref(), b"[\"v1\",\"v2\",\"v3\"]"); assert_eq!(resp.body().get_ref(), b"[\"v1\",\"v2\",\"v3\"]");
} }
#[test]
fn test_serde_json_in_body() {
use serde_json::json;
let resp =
Response::build(StatusCode::OK).body(json!({"test-key":"test-value"}));
assert_eq!(resp.body().get_ref(), br#"{"test-key":"test-value"}"#);
}
#[test] #[test]
fn test_into_response() { fn test_into_response() {
let resp: Response = "test".into(); let resp: Response = "test".into();

View File

@@ -1,14 +1,15 @@
use std::marker::PhantomData; use std::marker::PhantomData;
use std::{fmt, io, net, rc}; use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, net, rc};
use actix_codec::{AsyncRead, AsyncWrite, Framed}; use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_server_config::{ use actix_rt::net::TcpStream;
Io as ServerIo, IoStream, Protocol, ServerConfig as SrvConfig, use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
}; use bytes::Bytes;
use actix_service::{IntoNewService, NewService, Service}; use futures::{future::ok, ready, Future};
use bytes::{Buf, BufMut, Bytes, BytesMut};
use futures::{try_ready, Async, Future, IntoFuture, Poll};
use h2::server::{self, Handshake}; use h2::server::{self, Handshake};
use pin_project::{pin_project, project};
use crate::body::MessageBody; use crate::body::MessageBody;
use crate::builder::HttpServiceBuilder; use crate::builder::HttpServiceBuilder;
@@ -18,24 +19,24 @@ use crate::error::{DispatchError, Error};
use crate::helpers::DataFactory; use crate::helpers::DataFactory;
use crate::request::Request; use crate::request::Request;
use crate::response::Response; use crate::response::Response;
use crate::{h1, h2::Dispatcher}; use crate::{h1, h2::Dispatcher, Protocol};
/// `NewService` HTTP1.1/HTTP2 transport implementation /// `ServiceFactory` HTTP1.1/HTTP2 transport implementation
pub struct HttpService<T, P, S, B, X = h1::ExpectHandler, U = h1::UpgradeHandler<T>> { pub struct HttpService<T, S, B, X = h1::ExpectHandler, U = h1::UpgradeHandler<T>> {
srv: S, srv: S,
cfg: ServiceConfig, cfg: ServiceConfig,
expect: X, expect: X,
upgrade: Option<U>, upgrade: Option<U>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>, _t: PhantomData<(T, B)>,
} }
impl<T, S, B> HttpService<T, (), S, B> impl<T, S, B> HttpService<T, S, B>
where where
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static, <S::Service as Service>::Future: 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
{ {
@@ -45,22 +46,22 @@ where
} }
} }
impl<T, P, S, B> HttpService<T, P, S, B> impl<T, S, B> HttpService<T, S, B>
where where
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static, <S::Service as Service>::Future: 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
{ {
/// Create new `HttpService` instance. /// Create new `HttpService` instance.
pub fn new<F: IntoNewService<S>>(service: F) -> Self { pub fn new<F: IntoServiceFactory<S>>(service: F) -> Self {
let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0); let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0, false, None);
HttpService { HttpService {
cfg, cfg,
srv: service.into_new_service(), srv: service.into_factory(),
expect: h1::ExpectHandler, expect: h1::ExpectHandler,
upgrade: None, upgrade: None,
on_connect: None, on_connect: None,
@@ -69,13 +70,13 @@ where
} }
/// Create new `HttpService` instance with config. /// Create new `HttpService` instance with config.
pub(crate) fn with_config<F: IntoNewService<S>>( pub(crate) fn with_config<F: IntoServiceFactory<S>>(
cfg: ServiceConfig, cfg: ServiceConfig,
service: F, service: F,
) -> Self { ) -> Self {
HttpService { HttpService {
cfg, cfg,
srv: service.into_new_service(), srv: service.into_factory(),
expect: h1::ExpectHandler, expect: h1::ExpectHandler,
upgrade: None, upgrade: None,
on_connect: None, on_connect: None,
@@ -84,12 +85,13 @@ where
} }
} }
impl<T, P, S, B, X, U> HttpService<T, P, S, B, X, U> impl<T, S, B, X, U> HttpService<T, S, B, X, U>
where where
S: NewService<Config = SrvConfig, Request = Request>, S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody, B: MessageBody,
{ {
/// Provide service for `EXPECT: 100-Continue` support. /// Provide service for `EXPECT: 100-Continue` support.
@@ -97,11 +99,12 @@ where
/// Service get called with request that contains `EXPECT` header. /// Service get called with request that contains `EXPECT` header.
/// Service must return request in case of success, in that case /// Service must return request in case of success, in that case
/// request will be forwarded to main service. /// request will be forwarded to main service.
pub fn expect<X1>(self, expect: X1) -> HttpService<T, P, S, B, X1, U> pub fn expect<X1>(self, expect: X1) -> HttpService<T, S, B, X1, U>
where where
X1: NewService<Config = SrvConfig, Request = Request, Response = Request>, X1: ServiceFactory<Config = (), Request = Request, Response = Request>,
X1::Error: Into<Error>, X1::Error: Into<Error>,
X1::InitError: fmt::Debug, X1::InitError: fmt::Debug,
<X1::Service as Service>::Future: 'static,
{ {
HttpService { HttpService {
expect, expect,
@@ -117,15 +120,16 @@ where
/// ///
/// If service is provided then normal requests handling get halted /// If service is provided then normal requests handling get halted
/// and this service get called with original request and framed object. /// and this service get called with original request and framed object.
pub fn upgrade<U1>(self, upgrade: Option<U1>) -> HttpService<T, P, S, B, X, U1> pub fn upgrade<U1>(self, upgrade: Option<U1>) -> HttpService<T, S, B, X, U1>
where where
U1: NewService< U1: ServiceFactory<
Config = SrvConfig, Config = (),
Request = (Request, Framed<T, h1::Codec>), Request = (Request, Framed<T, h1::Codec>),
Response = (), Response = (),
>, >,
U1::Error: fmt::Display, U1::Error: fmt::Display,
U1::InitError: fmt::Debug, U1::InitError: fmt::Debug,
<U1::Service as Service>::Future: 'static,
{ {
HttpService { HttpService {
upgrade, upgrade,
@@ -147,126 +151,312 @@ where
} }
} }
impl<T, P, S, B, X, U> NewService for HttpService<T, P, S, B, X, U> impl<S, B, X, U> HttpService<TcpStream, S, B, X, U>
where where
T: IoStream, S: ServiceFactory<Config = (), Request = Request>,
S: NewService<Config = SrvConfig, Request = Request>, S::Error: Into<Error> + 'static,
S::Error: Into<Error>,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static, <S::Service as Service>::Future: 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
X: NewService<Config = SrvConfig, Request = Request, Response = Request>, X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
X::InitError: fmt::Debug, X::InitError: fmt::Debug,
U: NewService< <X::Service as Service>::Future: 'static,
Config = SrvConfig, U: ServiceFactory<
Config = (),
Request = (Request, Framed<TcpStream, h1::Codec>),
Response = (),
>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
/// Create simple tcp stream service
pub fn tcp(
self,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = DispatchError,
InitError = (),
> {
pipeline_factory(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok((io, Protocol::Http1, peer_addr))
})
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use super::*;
use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
use actix_tls::{openssl::HandshakeError, SslError};
impl<S, B, X, U> HttpService<SslStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<SslStream<TcpStream>, h1::Codec>),
Response = (),
>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
/// Create openssl based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<HandshakeError<TcpStream>, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: SslStream<TcpStream>| {
let proto = if let Some(protos) = io.ssl().selected_alpn_protocol() {
if protos.windows(2).any(|window| window == b"h2") {
Protocol::Http2
} else {
Protocol::Http1
}
} else {
Protocol::Http1
};
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, proto, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_tls::rustls::{Acceptor, ServerConfig, Session, TlsStream};
use actix_tls::SslError;
use std::io;
impl<S, B, X, U> HttpService<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<TlsStream<TcpStream>, h1::Codec>),
Response = (),
>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
/// Create openssl based service
pub fn rustls(
self,
mut config: ServerConfig,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<io::Error, DispatchError>,
InitError = (),
> {
let protos = vec!["h2".to_string().into(), "http/1.1".to_string().into()];
config.set_protocols(&protos);
pipeline_factory(
Acceptor::new(config)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: TlsStream<TcpStream>| {
let proto = if let Some(protos) = io.get_ref().1.get_alpn_protocol() {
if protos.windows(2).any(|window| window == b"h2") {
Protocol::Http2
} else {
Protocol::Http1
}
} else {
Protocol::Http1
};
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, proto, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
impl<T, S, B, X, U> ServiceFactory for HttpService<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<T, h1::Codec>), Request = (Request, Framed<T, h1::Codec>),
Response = (), Response = (),
>, >,
U::Error: fmt::Display, U::Error: fmt::Display,
U::InitError: fmt::Debug, U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{ {
type Config = SrvConfig; type Config = ();
type Request = ServerIo<T, P>; type Request = (T, Protocol, Option<net::SocketAddr>);
type Response = (); type Response = ();
type Error = DispatchError; type Error = DispatchError;
type InitError = (); type InitError = ();
type Service = HttpServiceHandler<T, P, S::Service, B, X::Service, U::Service>; type Service = HttpServiceHandler<T, S::Service, B, X::Service, U::Service>;
type Future = HttpServiceResponse<T, P, S, B, X, U>; type Future = HttpServiceResponse<T, S, B, X, U>;
fn new_service(&self, cfg: &SrvConfig) -> Self::Future { fn new_service(&self, _: ()) -> Self::Future {
HttpServiceResponse { HttpServiceResponse {
fut: self.srv.new_service(cfg).into_future(), fut: self.srv.new_service(()),
fut_ex: Some(self.expect.new_service(cfg)), fut_ex: Some(self.expect.new_service(())),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(cfg)), fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
expect: None, expect: None,
upgrade: None, upgrade: None,
on_connect: self.on_connect.clone(), on_connect: self.on_connect.clone(),
cfg: Some(self.cfg.clone()), cfg: self.cfg.clone(),
_t: PhantomData, _t: PhantomData,
} }
} }
} }
#[doc(hidden)] #[doc(hidden)]
pub struct HttpServiceResponse<T, P, S: NewService, B, X: NewService, U: NewService> { #[pin_project]
pub struct HttpServiceResponse<
T,
S: ServiceFactory,
B,
X: ServiceFactory,
U: ServiceFactory,
> {
#[pin]
fut: S::Future, fut: S::Future,
#[pin]
fut_ex: Option<X::Future>, fut_ex: Option<X::Future>,
#[pin]
fut_upg: Option<U::Future>, fut_upg: Option<U::Future>,
expect: Option<X::Service>, expect: Option<X::Service>,
upgrade: Option<U::Service>, upgrade: Option<U::Service>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
cfg: Option<ServiceConfig>, cfg: ServiceConfig,
_t: PhantomData<(T, P, B)>, _t: PhantomData<(T, B)>,
} }
impl<T, P, S, B, X, U> Future for HttpServiceResponse<T, P, S, B, X, U> impl<T, S, B, X, U> Future for HttpServiceResponse<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: NewService<Request = Request>, S: ServiceFactory<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug, S::InitError: fmt::Debug,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static, <S::Service as Service>::Future: 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
X: NewService<Request = Request, Response = Request>, X: ServiceFactory<Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
X::InitError: fmt::Debug, X::InitError: fmt::Debug,
U: NewService<Request = (Request, Framed<T, h1::Codec>), Response = ()>, <X::Service as Service>::Future: 'static,
U: ServiceFactory<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
U::InitError: fmt::Debug, U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{ {
type Item = HttpServiceHandler<T, P, S::Service, B, X::Service, U::Service>; type Output =
type Error = (); Result<HttpServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
if let Some(ref mut fut) = self.fut_ex { let mut this = self.as_mut().project();
let expect = try_ready!(fut
.poll() if let Some(fut) = this.fut_ex.as_pin_mut() {
.map_err(|e| log::error!("Init http service error: {:?}", e))); let expect = ready!(fut
self.expect = Some(expect); .poll(cx)
self.fut_ex.take(); .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.expect = Some(expect);
this.fut_ex.set(None);
} }
if let Some(ref mut fut) = self.fut_upg { if let Some(fut) = this.fut_upg.as_pin_mut() {
let upgrade = try_ready!(fut let upgrade = ready!(fut
.poll() .poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e))); .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
self.upgrade = Some(upgrade); this = self.as_mut().project();
self.fut_ex.take(); *this.upgrade = Some(upgrade);
this.fut_ex.set(None);
} }
let service = try_ready!(self let result = ready!(this
.fut .fut
.poll() .poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e))); .map_err(|e| log::error!("Init http service error: {:?}", e)));
Ok(Async::Ready(HttpServiceHandler::new( Poll::Ready(result.map(|service| {
self.cfg.take().unwrap(), let this = self.as_mut().project();
HttpServiceHandler::new(
this.cfg.clone(),
service, service,
self.expect.take().unwrap(), this.expect.take().unwrap(),
self.upgrade.take(), this.upgrade.take(),
self.on_connect.clone(), this.on_connect.clone(),
))) )
}))
} }
} }
/// `Service` implementation for http transport /// `Service` implementation for http transport
pub struct HttpServiceHandler<T, P, S, B, X, U> { pub struct HttpServiceHandler<T, S, B, X, U> {
srv: CloneableService<S>, srv: CloneableService<S>,
expect: CloneableService<X>, expect: CloneableService<X>,
upgrade: Option<CloneableService<U>>, upgrade: Option<CloneableService<U>>,
cfg: ServiceConfig, cfg: ServiceConfig,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B, X)>, _t: PhantomData<(T, B, X)>,
} }
impl<T, P, S, B, X, U> HttpServiceHandler<T, P, S, B, X, U> impl<T, S, B, X, U> HttpServiceHandler<T, S, B, X, U>
where where
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Future: 'static, S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
X: Service<Request = Request, Response = Request>, X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
@@ -279,7 +469,7 @@ where
expect: X, expect: X,
upgrade: Option<U>, upgrade: Option<U>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>, on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
) -> HttpServiceHandler<T, P, S, B, X, U> { ) -> HttpServiceHandler<T, S, B, X, U> {
HttpServiceHandler { HttpServiceHandler {
cfg, cfg,
on_connect, on_connect,
@@ -291,28 +481,28 @@ where
} }
} }
impl<T, P, S, B, X, U> Service for HttpServiceHandler<T, P, S, B, X, U> impl<T, S, B, X, U> Service for HttpServiceHandler<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Future: 'static, S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
X: Service<Request = Request, Response = Request>, X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>, U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
{ {
type Request = ServerIo<T, P>; type Request = (T, Protocol, Option<net::SocketAddr>);
type Response = (); type Response = ();
type Error = DispatchError; type Error = DispatchError;
type Future = HttpServiceHandlerResponse<T, S, B, X, U>; type Future = HttpServiceHandlerResponse<T, S, B, X, U>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
let ready = self let ready = self
.expect .expect
.poll_ready() .poll_ready(cx)
.map_err(|e| { .map_err(|e| {
let e = e.into(); let e = e.into();
log::error!("Http service readiness error: {:?}", e); log::error!("Http service readiness error: {:?}", e);
@@ -322,7 +512,7 @@ where
let ready = self let ready = self
.srv .srv
.poll_ready() .poll_ready(cx)
.map_err(|e| { .map_err(|e| {
let e = e.into(); let e = e.into();
log::error!("Http service readiness error: {:?}", e); log::error!("Http service readiness error: {:?}", e);
@@ -332,15 +522,13 @@ where
&& ready; && ready;
if ready { if ready {
Ok(Async::Ready(())) Poll::Ready(Ok(()))
} else { } else {
Ok(Async::NotReady) Poll::Pending
} }
} }
fn call(&mut self, req: Self::Request) -> Self::Future { fn call(&mut self, (io, proto, peer_addr): Self::Request) -> Self::Future {
let (io, _, proto) = req.into_parts();
let on_connect = if let Some(ref on_connect) = self.on_connect { let on_connect = if let Some(ref on_connect) = self.on_connect {
Some(on_connect(&io)) Some(on_connect(&io))
} else { } else {
@@ -348,23 +536,16 @@ where
}; };
match proto { match proto {
Protocol::Http2 => { Protocol::Http2 => HttpServiceHandlerResponse {
let peer_addr = io.peer_addr(); state: State::H2Handshake(Some((
let io = Io {
inner: io,
unread: None,
};
HttpServiceHandlerResponse {
state: State::Handshake(Some((
server::handshake(io), server::handshake(io),
self.cfg.clone(), self.cfg.clone(),
self.srv.clone(), self.srv.clone(),
peer_addr,
on_connect, on_connect,
peer_addr,
))), ))),
} },
} Protocol::Http1 => HttpServiceHandlerResponse {
Protocol::Http10 | Protocol::Http11 => HttpServiceHandlerResponse {
state: State::H1(h1::Dispatcher::new( state: State::H1(h1::Dispatcher::new(
io, io,
self.cfg.clone(), self.cfg.clone(),
@@ -372,234 +553,117 @@ where
self.expect.clone(), self.expect.clone(),
self.upgrade.clone(), self.upgrade.clone(),
on_connect, on_connect,
peer_addr,
)), )),
}, },
_ => HttpServiceHandlerResponse {
state: State::Unknown(Some((
io,
BytesMut::with_capacity(14),
self.cfg.clone(),
self.srv.clone(),
self.expect.clone(),
self.upgrade.clone(),
on_connect,
))),
},
} }
} }
} }
#[pin_project]
enum State<T, S, B, X, U> enum State<T, S, B, X, U>
where where
S: Service<Request = Request>, S: Service<Request = Request>,
S::Future: 'static, S::Future: 'static,
S::Error: Into<Error>, S::Error: Into<Error>,
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
B: MessageBody, B: MessageBody,
X: Service<Request = Request, Response = Request>, X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>, U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
{ {
H1(h1::Dispatcher<T, S, B, X, U>), H1(#[pin] h1::Dispatcher<T, S, B, X, U>),
H2(Dispatcher<Io<T>, S, B>), H2(#[pin] Dispatcher<T, S, B>),
Unknown( H2Handshake(
Option<( Option<(
T, Handshake<T, Bytes>,
BytesMut,
ServiceConfig, ServiceConfig,
CloneableService<S>, CloneableService<S>,
CloneableService<X>,
Option<CloneableService<U>>,
Option<Box<dyn DataFactory>>, Option<Box<dyn DataFactory>>,
)>,
),
Handshake(
Option<(
Handshake<Io<T>, Bytes>,
ServiceConfig,
CloneableService<S>,
Option<net::SocketAddr>, Option<net::SocketAddr>,
Option<Box<dyn DataFactory>>,
)>, )>,
), ),
} }
#[pin_project]
pub struct HttpServiceHandlerResponse<T, S, B, X, U> pub struct HttpServiceHandlerResponse<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Future: 'static, S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static, B: MessageBody + 'static,
X: Service<Request = Request, Response = Request>, X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>, U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
{ {
#[pin]
state: State<T, S, B, X, U>, state: State<T, S, B, X, U>,
} }
const HTTP2_PREFACE: [u8; 14] = *b"PRI * HTTP/2.0";
impl<T, S, B, X, U> Future for HttpServiceHandlerResponse<T, S, B, X, U> impl<T, S, B, X, U> Future for HttpServiceHandlerResponse<T, S, B, X, U>
where where
T: IoStream, T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>, S: Service<Request = Request>,
S::Error: Into<Error>, S::Error: Into<Error> + 'static,
S::Future: 'static, S::Future: 'static,
S::Response: Into<Response<B>>, S::Response: Into<Response<B>> + 'static,
B: MessageBody, B: MessageBody,
X: Service<Request = Request, Response = Request>, X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>, X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>, U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display, U::Error: fmt::Display,
{ {
type Item = (); type Output = Result<(), DispatchError>;
type Error = DispatchError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
match self.state { self.project().state.poll(cx)
State::H1(ref mut disp) => disp.poll(),
State::H2(ref mut disp) => disp.poll(),
State::Unknown(ref mut data) => {
if let Some(ref mut item) = data {
loop {
// Safety - we only write to the returned slice.
let b = unsafe { item.1.bytes_mut() };
let n = try_ready!(item.0.poll_read(b));
if n == 0 {
return Ok(Async::Ready(()));
} }
// Safety - we know that 'n' bytes have }
// been initialized via the contract of
// 'poll_read' impl<T, S, B, X, U> State<T, S, B, X, U>
unsafe { item.1.advance_mut(n) }; where
if item.1.len() >= HTTP2_PREFACE.len() { T: AsyncRead + AsyncWrite + Unpin,
break; S: Service<Request = Request>,
} S::Error: Into<Error> + 'static,
} S::Response: Into<Response<B>> + 'static,
} else { B: MessageBody + 'static,
panic!() X: Service<Request = Request, Response = Request>,
} X::Error: Into<Error>,
let (io, buf, cfg, srv, expect, upgrade, on_connect) = U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
data.take().unwrap(); U::Error: fmt::Display,
if buf[..14] == HTTP2_PREFACE[..] { {
let peer_addr = io.peer_addr(); #[project]
let io = Io { fn poll(
inner: io, mut self: Pin<&mut Self>,
unread: Some(buf), cx: &mut Context,
}; ) -> Poll<Result<(), DispatchError>> {
self.state = State::Handshake(Some(( #[project]
server::handshake(io), match self.as_mut().project() {
cfg, State::H1(disp) => disp.poll(cx),
srv, State::H2(disp) => disp.poll(cx),
peer_addr, State::H2Handshake(ref mut data) => {
on_connect,
)));
} else {
self.state = State::H1(h1::Dispatcher::with_timeout(
io,
h1::Codec::new(cfg.clone()),
cfg,
buf,
None,
srv,
expect,
upgrade,
on_connect,
))
}
self.poll()
}
State::Handshake(ref mut data) => {
let conn = if let Some(ref mut item) = data { let conn = if let Some(ref mut item) = data {
match item.0.poll() { match Pin::new(&mut item.0).poll(cx) {
Ok(Async::Ready(conn)) => conn, Poll::Ready(Ok(conn)) => conn,
Ok(Async::NotReady) => return Ok(Async::NotReady), Poll::Ready(Err(err)) => {
Err(err) => {
trace!("H2 handshake error: {}", err); trace!("H2 handshake error: {}", err);
return Err(err.into()); return Poll::Ready(Err(err.into()));
} }
Poll::Pending => return Poll::Pending,
} }
} else { } else {
panic!() panic!()
}; };
let (_, cfg, srv, peer_addr, on_connect) = data.take().unwrap(); let (_, cfg, srv, on_connect, peer_addr) = data.take().unwrap();
self.state = State::H2(Dispatcher::new( self.set(State::H2(Dispatcher::new(
srv, conn, on_connect, cfg, None, peer_addr, srv, conn, on_connect, cfg, None, peer_addr,
)); )));
self.poll() self.poll(cx)
} }
} }
} }
} }
/// Wrapper for `AsyncRead + AsyncWrite` types
struct Io<T> {
unread: Option<BytesMut>,
inner: T,
}
impl<T: io::Read> io::Read for Io<T> {
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
if let Some(mut bytes) = self.unread.take() {
let size = std::cmp::min(buf.len(), bytes.len());
buf[..size].copy_from_slice(&bytes[..size]);
if bytes.len() > size {
bytes.split_to(size);
self.unread = Some(bytes);
}
Ok(size)
} else {
self.inner.read(buf)
}
}
}
impl<T: io::Write> io::Write for Io<T> {
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
self.inner.write(buf)
}
fn flush(&mut self) -> io::Result<()> {
self.inner.flush()
}
}
impl<T: AsyncRead> AsyncRead for Io<T> {
unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool {
self.inner.prepare_uninitialized_buffer(buf)
}
}
impl<T: AsyncWrite> AsyncWrite for Io<T> {
fn shutdown(&mut self) -> Poll<(), io::Error> {
self.inner.shutdown()
}
fn write_buf<B: Buf>(&mut self, buf: &mut B) -> Poll<usize, io::Error> {
self.inner.write_buf(buf)
}
}
impl<T: IoStream> IoStream for Io<T> {
#[inline]
fn peer_addr(&self) -> Option<net::SocketAddr> {
self.inner.peer_addr()
}
#[inline]
fn set_nodelay(&mut self, nodelay: bool) -> io::Result<()> {
self.inner.set_nodelay(nodelay)
}
#[inline]
fn set_linger(&mut self, dur: Option<std::time::Duration>) -> io::Result<()> {
self.inner.set_linger(dur)
}
#[inline]
fn set_keepalive(&mut self, dur: Option<std::time::Duration>) -> io::Result<()> {
self.inner.set_keepalive(dur)
}
}

View File

@@ -1,14 +1,15 @@
//! Test Various helpers for Actix applications to use during testing. //! Test Various helpers for Actix applications to use during testing.
use std::convert::TryFrom;
use std::fmt::Write as FmtWrite; use std::fmt::Write as FmtWrite;
use std::io; use std::io::{self, Read, Write};
use std::pin::Pin;
use std::str::FromStr; use std::str::FromStr;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite}; use actix_codec::{AsyncRead, AsyncWrite};
use actix_server_config::IoStream; use bytes::{Bytes, BytesMut};
use bytes::{Buf, Bytes, BytesMut};
use futures::{Async, Poll};
use http::header::{self, HeaderName, HeaderValue}; use http::header::{self, HeaderName, HeaderValue};
use http::{HttpTryFrom, Method, Uri, Version}; use http::{Error as HttpError, Method, Uri, Version};
use percent_encoding::percent_encode; use percent_encoding::percent_encode;
use crate::cookie::{Cookie, CookieJar, USERINFO}; use crate::cookie::{Cookie, CookieJar, USERINFO};
@@ -82,7 +83,8 @@ impl TestRequest {
/// Create TestRequest and set header /// Create TestRequest and set header
pub fn with_header<K, V>(key: K, value: V) -> TestRequest pub fn with_header<K, V>(key: K, value: V) -> TestRequest
where where
HeaderName: HttpTryFrom<K>, HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue, V: IntoHeaderValue,
{ {
TestRequest::default().header(key, value).take() TestRequest::default().header(key, value).take()
@@ -118,7 +120,8 @@ impl TestRequest {
/// Set a header /// Set a header
pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self
where where
HeaderName: HttpTryFrom<K>, HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue, V: IntoHeaderValue,
{ {
if let Ok(key) = HeaderName::try_from(key) { if let Ok(key) = HeaderName::try_from(key) {
@@ -150,7 +153,7 @@ impl TestRequest {
/// Complete request creation and generate `Request` instance /// Complete request creation and generate `Request` instance
pub fn finish(&mut self) -> Request { pub fn finish(&mut self) -> Request {
let inner = self.0.take().expect("cannot reuse test request builder");; let inner = self.0.take().expect("cannot reuse test request builder");
let mut req = if let Some(pl) = inner.payload { let mut req = if let Some(pl) = inner.payload {
Request::with_payload(pl) Request::with_payload(pl)
@@ -244,27 +247,30 @@ impl io::Write for TestBuffer {
} }
} }
impl AsyncRead for TestBuffer {} impl AsyncRead for TestBuffer {
fn poll_read(
self: Pin<&mut Self>,
_: &mut Context<'_>,
buf: &mut [u8],
) -> Poll<io::Result<usize>> {
Poll::Ready(self.get_mut().read(buf))
}
}
impl AsyncWrite for TestBuffer { impl AsyncWrite for TestBuffer {
fn shutdown(&mut self) -> Poll<(), io::Error> { fn poll_write(
Ok(Async::Ready(())) self: Pin<&mut Self>,
_: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
Poll::Ready(self.get_mut().write(buf))
} }
fn write_buf<B: Buf>(&mut self, _: &mut B) -> Poll<usize, io::Error> {
Ok(Async::NotReady) fn poll_flush(self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<io::Result<()>> {
} Poll::Ready(Ok(()))
} }
impl IoStream for TestBuffer { fn poll_shutdown(self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<io::Result<()>> {
fn set_nodelay(&mut self, _nodelay: bool) -> io::Result<()> { Poll::Ready(Ok(()))
Ok(())
}
fn set_linger(&mut self, _dur: Option<std::time::Duration>) -> io::Result<()> {
Ok(())
}
fn set_keepalive(&mut self, _dur: Option<std::time::Duration>) -> io::Result<()> {
Ok(())
} }
} }

View File

@@ -180,11 +180,11 @@ impl Parser {
} else if payload_len <= 65_535 { } else if payload_len <= 65_535 {
dst.reserve(p_len + 4 + if mask { 4 } else { 0 }); dst.reserve(p_len + 4 + if mask { 4 } else { 0 });
dst.put_slice(&[one, two | 126]); dst.put_slice(&[one, two | 126]);
dst.put_u16_be(payload_len as u16); dst.put_u16(payload_len as u16);
} else { } else {
dst.reserve(p_len + 10 + if mask { 4 } else { 0 }); dst.reserve(p_len + 10 + if mask { 4 } else { 0 });
dst.put_slice(&[one, two | 127]); dst.put_slice(&[one, two | 127]);
dst.put_u64_be(payload_len as u64); dst.put_u64(payload_len as u64);
}; };
if mask { if mask {

View File

@@ -1,7 +1,10 @@
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed}; use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_service::{IntoService, Service}; use actix_service::{IntoService, Service};
use actix_utils::framed::{FramedTransport, FramedTransportError}; use actix_utils::framed::{FramedTransport, FramedTransportError};
use futures::{Future, Poll};
use super::{Codec, Frame, Message}; use super::{Codec, Frame, Message};
@@ -40,10 +43,9 @@ where
S::Future: 'static, S::Future: 'static,
S::Error: 'static, S::Error: 'static,
{ {
type Item = (); type Output = Result<(), FramedTransportError<S::Error, Codec>>;
type Error = FramedTransportError<S::Error, Codec>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> { fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
self.inner.poll() Pin::new(&mut self.inner).poll(cx)
} }
} }

View File

@@ -1,4 +1,4 @@
use actix_service::NewService; use actix_service::ServiceFactory;
use bytes::Bytes; use bytes::Bytes;
use futures::future::{self, ok}; use futures::future::{self, ok};
@@ -27,45 +27,49 @@ const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \ Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World"; Hello World Hello World Hello World Hello World Hello World";
#[test] #[actix_rt::test]
fn test_h1_v2() { async fn test_h1_v2() {
env_logger::init(); let srv = TestServer::start(move || {
let mut srv = TestServer::new(move || { HttpService::build()
HttpService::build().finish(|_| future::ok::<_, ()>(Response::Ok().body(STR))) .finish(|_| future::ok::<_, ()>(Response::Ok().body(STR)))
.tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap();
let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
let request = srv.get("/").header("x-test", "111").send(); let request = srv.get("/").header("x-test", "111").send();
let response = srv.block_on(request).unwrap(); let mut response = request.await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = response.body().await.unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref())); assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
let response = srv.block_on(srv.post("/").send()).unwrap(); let mut response = srv.post("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = response.body().await.unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref())); assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
} }
#[test] #[actix_rt::test]
fn test_connection_close() { async fn test_connection_close() {
let mut srv = TestServer::new(move || { let srv = TestServer::start(move || {
HttpService::build() HttpService::build()
.finish(|_| ok::<_, ()>(Response::Ok().body(STR))) .finish(|_| ok::<_, ()>(Response::Ok().body(STR)))
.tcp()
.map(|_| ()) .map(|_| ())
}); });
let response = srv.block_on(srv.get("/").force_close().send()).unwrap();
let response = srv.get("/").force_close().send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
} }
#[test] #[actix_rt::test]
fn test_with_query_parameter() { async fn test_with_query_parameter() {
let mut srv = TestServer::new(move || { let srv = TestServer::start(move || {
HttpService::build() HttpService::build()
.finish(|req: Request| { .finish(|req: Request| {
if req.uri().query().unwrap().contains("qp=") { if req.uri().query().unwrap().contains("qp=") {
@@ -74,10 +78,11 @@ fn test_with_query_parameter() {
ok::<_, ()>(Response::BadRequest().finish()) ok::<_, ()>(Response::BadRequest().finish())
} }
}) })
.tcp()
.map(|_| ()) .map(|_| ())
}); });
let request = srv.request(http::Method::GET, srv.url("/?qp=5")).send(); let request = srv.request(http::Method::GET, srv.url("/?qp=5"));
let response = srv.block_on(request).unwrap(); let response = request.send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
} }

View File

@@ -0,0 +1,416 @@
#![cfg(feature = "openssl")]
use std::io;
use actix_http_test::TestServer;
use actix_service::{service_fn, ServiceFactory};
use bytes::{Bytes, BytesMut};
use futures::future::{err, ok, ready};
use futures::stream::{once, Stream, StreamExt};
use open_ssl::ssl::{AlpnError, SslAcceptor, SslFiletype, SslMethod};
use actix_http::error::{ErrorBadRequest, PayloadError};
use actix_http::http::header::{self, HeaderName, HeaderValue};
use actix_http::http::{Method, StatusCode, Version};
use actix_http::httpmessage::HttpMessage;
use actix_http::{body, Error, HttpService, Request, Response};
async fn load_body<S>(stream: S) -> Result<BytesMut, PayloadError>
where
S: Stream<Item = Result<Bytes, PayloadError>>,
{
let body = stream
.map(|res| match res {
Ok(chunk) => chunk,
Err(_) => panic!(),
})
.fold(BytesMut::new(), move |mut body, chunk| {
body.extend_from_slice(&chunk);
ready(body)
})
.await;
Ok(body)
}
fn ssl_acceptor() -> SslAcceptor {
// load ssl keys
let mut builder = SslAcceptor::mozilla_intermediate(SslMethod::tls()).unwrap();
builder
.set_private_key_file("../tests/key.pem", SslFiletype::PEM)
.unwrap();
builder
.set_certificate_chain_file("../tests/cert.pem")
.unwrap();
builder.set_alpn_select_callback(|_, protos| {
const H2: &[u8] = b"\x02h2";
const H11: &[u8] = b"\x08http/1.1";
if protos.windows(3).any(|window| window == H2) {
Ok(b"h2")
} else if protos.windows(9).any(|window| window == H11) {
Ok(b"http/1.1")
} else {
Err(AlpnError::NOACK)
}
});
builder
.set_alpn_protos(b"\x08http/1.1\x02h2")
.expect("Can not contrust SslAcceptor");
builder.build()
}
#[actix_rt::test]
async fn test_h2() -> io::Result<()> {
let srv = TestServer::start(move || {
HttpService::build()
.h2(|_| ok::<_, Error>(Response::Ok().finish()))
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
Ok(())
}
#[actix_rt::test]
async fn test_h2_1() -> io::Result<()> {
let srv = TestServer::start(move || {
HttpService::build()
.finish(|req: Request| {
assert!(req.peer_addr().is_some());
assert_eq!(req.version(), Version::HTTP_2);
ok::<_, Error>(Response::Ok().finish())
})
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
Ok(())
}
#[actix_rt::test]
async fn test_h2_body() -> io::Result<()> {
let data = "HELLOWORLD".to_owned().repeat(64 * 1024);
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|mut req: Request<_>| {
async move {
let body = load_body(req.take_payload()).await?;
Ok::<_, Error>(Response::Ok().body(body))
}
})
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send_body(data.clone()).await.unwrap();
assert!(response.status().is_success());
let body = srv.load_body(response).await.unwrap();
assert_eq!(&body, data.as_bytes());
Ok(())
}
#[actix_rt::test]
async fn test_h2_content_length() {
let srv = TestServer::start(move || {
HttpService::build()
.h2(|req: Request| {
let indx: usize = req.uri().path()[1..].parse().unwrap();
let statuses = [
StatusCode::NO_CONTENT,
StatusCode::CONTINUE,
StatusCode::SWITCHING_PROTOCOLS,
StatusCode::PROCESSING,
StatusCode::OK,
StatusCode::NOT_FOUND,
];
ok::<_, ()>(Response::new(statuses[indx]))
})
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let header = HeaderName::from_static("content-length");
let value = HeaderValue::from_static("0");
{
for i in 0..4 {
let req = srv
.request(Method::GET, srv.surl(&format!("/{}", i)))
.send();
let response = req.await.unwrap();
assert_eq!(response.headers().get(&header), None);
let req = srv
.request(Method::HEAD, srv.surl(&format!("/{}", i)))
.send();
let response = req.await.unwrap();
assert_eq!(response.headers().get(&header), None);
}
for i in 4..6 {
let req = srv
.request(Method::GET, srv.surl(&format!("/{}", i)))
.send();
let response = req.await.unwrap();
assert_eq!(response.headers().get(&header), Some(&value));
}
}
}
#[actix_rt::test]
async fn test_h2_headers() {
let data = STR.repeat(10);
let data2 = data.clone();
let mut srv = TestServer::start(move || {
let data = data.clone();
HttpService::build().h2(move |_| {
let mut builder = Response::Ok();
for idx in 0..90 {
builder.header(
format!("X-TEST-{}", idx).as_str(),
"TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST ",
);
}
ok::<_, ()>(builder.body(data.clone()))
})
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from(data2));
}
const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World";
#[actix_rt::test]
async fn test_h2_body2() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| ok::<_, ()>(Response::Ok().body(STR)))
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[actix_rt::test]
async fn test_h2_head_empty() {
let mut srv = TestServer::start(move || {
HttpService::build()
.finish(|_| ok::<_, ()>(Response::Ok().body(STR)))
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.shead("/").send().await.unwrap();
assert!(response.status().is_success());
assert_eq!(response.version(), Version::HTTP_2);
{
let len = response.headers().get(header::CONTENT_LENGTH).unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
// read response
let bytes = srv.load_body(response).await.unwrap();
assert!(bytes.is_empty());
}
#[actix_rt::test]
async fn test_h2_head_binary() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| {
ok::<_, ()>(Response::Ok().content_length(STR.len() as u64).body(STR))
})
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.shead("/").send().await.unwrap();
assert!(response.status().is_success());
{
let len = response.headers().get(header::CONTENT_LENGTH).unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
// read response
let bytes = srv.load_body(response).await.unwrap();
assert!(bytes.is_empty());
}
#[actix_rt::test]
async fn test_h2_head_binary2() {
let srv = TestServer::start(move || {
HttpService::build()
.h2(|_| ok::<_, ()>(Response::Ok().body(STR)))
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.shead("/").send().await.unwrap();
assert!(response.status().is_success());
{
let len = response.headers().get(header::CONTENT_LENGTH).unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
}
#[actix_rt::test]
async fn test_h2_body_length() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| {
let body = once(ok(Bytes::from_static(STR.as_ref())));
ok::<_, ()>(
Response::Ok().body(body::SizedStream::new(STR.len() as u64, body)),
)
})
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[actix_rt::test]
async fn test_h2_body_chunked_explicit() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| {
let body = once(ok::<_, Error>(Bytes::from_static(STR.as_ref())));
ok::<_, ()>(
Response::Ok()
.header(header::TRANSFER_ENCODING, "chunked")
.streaming(body),
)
})
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
assert!(!response.headers().contains_key(header::TRANSFER_ENCODING));
// read response
let bytes = srv.load_body(response).await.unwrap();
// decode
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[actix_rt::test]
async fn test_h2_response_http_error_handling() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(service_fn(|_| {
let broken_header = Bytes::from_static(b"\0\0\0");
ok::<_, ()>(
Response::Ok()
.header(header::CONTENT_TYPE, broken_header)
.body(STR),
)
}))
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send().await.unwrap();
assert_eq!(response.status(), StatusCode::INTERNAL_SERVER_ERROR);
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(b"failed to parse header value"));
}
#[actix_rt::test]
async fn test_h2_service_error() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| err::<Response, Error>(ErrorBadRequest("error")))
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send().await.unwrap();
assert_eq!(response.status(), StatusCode::BAD_REQUEST);
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(b"error"));
}
#[actix_rt::test]
async fn test_h2_on_connect() {
let srv = TestServer::start(move || {
HttpService::build()
.on_connect(|_| 10usize)
.h2(|req: Request| {
assert!(req.extensions().contains::<usize>());
ok::<_, ()>(Response::Ok().finish())
})
.openssl(ssl_acceptor())
.map_err(|_| ())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
}

View File

@@ -0,0 +1,421 @@
#![cfg(feature = "rustls")]
use actix_http::error::PayloadError;
use actix_http::http::header::{self, HeaderName, HeaderValue};
use actix_http::http::{Method, StatusCode, Version};
use actix_http::{body, error, Error, HttpService, Request, Response};
use actix_http_test::TestServer;
use actix_service::{factory_fn_cfg, service_fn2};
use bytes::{Bytes, BytesMut};
use futures::future::{self, err, ok};
use futures::stream::{once, Stream, StreamExt};
use rust_tls::{
internal::pemfile::{certs, pkcs8_private_keys},
NoClientAuth, ServerConfig as RustlsServerConfig,
};
use std::fs::File;
use std::io::{self, BufReader};
async fn load_body<S>(mut stream: S) -> Result<BytesMut, PayloadError>
where
S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
{
let mut body = BytesMut::new();
while let Some(item) = stream.next().await {
body.extend_from_slice(&item?)
}
Ok(body)
}
fn ssl_acceptor() -> RustlsServerConfig {
// load ssl keys
let mut config = RustlsServerConfig::new(NoClientAuth::new());
let cert_file = &mut BufReader::new(File::open("../tests/cert.pem").unwrap());
let key_file = &mut BufReader::new(File::open("../tests/key.pem").unwrap());
let cert_chain = certs(cert_file).unwrap();
let mut keys = pkcs8_private_keys(key_file).unwrap();
config.set_single_cert(cert_chain, keys.remove(0)).unwrap();
config
}
#[actix_rt::test]
async fn test_h1() -> io::Result<()> {
let srv = TestServer::start(move || {
HttpService::build()
.h1(|_| future::ok::<_, Error>(Response::Ok().finish()))
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
Ok(())
}
#[actix_rt::test]
async fn test_h2() -> io::Result<()> {
let srv = TestServer::start(move || {
HttpService::build()
.h2(|_| future::ok::<_, Error>(Response::Ok().finish()))
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
Ok(())
}
#[actix_rt::test]
async fn test_h1_1() -> io::Result<()> {
let srv = TestServer::start(move || {
HttpService::build()
.h1(|req: Request| {
assert!(req.peer_addr().is_some());
assert_eq!(req.version(), Version::HTTP_11);
future::ok::<_, Error>(Response::Ok().finish())
})
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
Ok(())
}
#[actix_rt::test]
async fn test_h2_1() -> io::Result<()> {
let srv = TestServer::start(move || {
HttpService::build()
.finish(|req: Request| {
assert!(req.peer_addr().is_some());
assert_eq!(req.version(), Version::HTTP_2);
future::ok::<_, Error>(Response::Ok().finish())
})
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
Ok(())
}
#[actix_rt::test]
async fn test_h2_body1() -> io::Result<()> {
let data = "HELLOWORLD".to_owned().repeat(64 * 1024);
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|mut req: Request<_>| {
async move {
let body = load_body(req.take_payload()).await?;
Ok::<_, Error>(Response::Ok().body(body))
}
})
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send_body(data.clone()).await.unwrap();
assert!(response.status().is_success());
let body = srv.load_body(response).await.unwrap();
assert_eq!(&body, data.as_bytes());
Ok(())
}
#[actix_rt::test]
async fn test_h2_content_length() {
let srv = TestServer::start(move || {
HttpService::build()
.h2(|req: Request| {
let indx: usize = req.uri().path()[1..].parse().unwrap();
let statuses = [
StatusCode::NO_CONTENT,
StatusCode::CONTINUE,
StatusCode::SWITCHING_PROTOCOLS,
StatusCode::PROCESSING,
StatusCode::OK,
StatusCode::NOT_FOUND,
];
future::ok::<_, ()>(Response::new(statuses[indx]))
})
.rustls(ssl_acceptor())
});
let header = HeaderName::from_static("content-length");
let value = HeaderValue::from_static("0");
{
for i in 0..4 {
let req = srv
.request(Method::GET, srv.surl(&format!("/{}", i)))
.send();
let response = req.await.unwrap();
assert_eq!(response.headers().get(&header), None);
let req = srv
.request(Method::HEAD, srv.surl(&format!("/{}", i)))
.send();
let response = req.await.unwrap();
assert_eq!(response.headers().get(&header), None);
}
for i in 4..6 {
let req = srv
.request(Method::GET, srv.surl(&format!("/{}", i)))
.send();
let response = req.await.unwrap();
assert_eq!(response.headers().get(&header), Some(&value));
}
}
}
#[actix_rt::test]
async fn test_h2_headers() {
let data = STR.repeat(10);
let data2 = data.clone();
let mut srv = TestServer::start(move || {
let data = data.clone();
HttpService::build().h2(move |_| {
let mut config = Response::Ok();
for idx in 0..90 {
config.header(
format!("X-TEST-{}", idx).as_str(),
"TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST ",
);
}
future::ok::<_, ()>(config.body(data.clone()))
})
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from(data2));
}
const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World";
#[actix_rt::test]
async fn test_h2_body2() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| future::ok::<_, ()>(Response::Ok().body(STR)))
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[actix_rt::test]
async fn test_h2_head_empty() {
let mut srv = TestServer::start(move || {
HttpService::build()
.finish(|_| ok::<_, ()>(Response::Ok().body(STR)))
.rustls(ssl_acceptor())
});
let response = srv.shead("/").send().await.unwrap();
assert!(response.status().is_success());
assert_eq!(response.version(), Version::HTTP_2);
{
let len = response
.headers()
.get(http::header::CONTENT_LENGTH)
.unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
// read response
let bytes = srv.load_body(response).await.unwrap();
assert!(bytes.is_empty());
}
#[actix_rt::test]
async fn test_h2_head_binary() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| {
ok::<_, ()>(Response::Ok().content_length(STR.len() as u64).body(STR))
})
.rustls(ssl_acceptor())
});
let response = srv.shead("/").send().await.unwrap();
assert!(response.status().is_success());
{
let len = response
.headers()
.get(http::header::CONTENT_LENGTH)
.unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
// read response
let bytes = srv.load_body(response).await.unwrap();
assert!(bytes.is_empty());
}
#[actix_rt::test]
async fn test_h2_head_binary2() {
let srv = TestServer::start(move || {
HttpService::build()
.h2(|_| ok::<_, ()>(Response::Ok().body(STR)))
.rustls(ssl_acceptor())
});
let response = srv.shead("/").send().await.unwrap();
assert!(response.status().is_success());
{
let len = response
.headers()
.get(http::header::CONTENT_LENGTH)
.unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
}
#[actix_rt::test]
async fn test_h2_body_length() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| {
let body = once(ok(Bytes::from_static(STR.as_ref())));
ok::<_, ()>(
Response::Ok().body(body::SizedStream::new(STR.len() as u64, body)),
)
})
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[actix_rt::test]
async fn test_h2_body_chunked_explicit() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| {
let body = once(ok::<_, Error>(Bytes::from_static(STR.as_ref())));
ok::<_, ()>(
Response::Ok()
.header(header::TRANSFER_ENCODING, "chunked")
.streaming(body),
)
})
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert!(response.status().is_success());
assert!(!response.headers().contains_key(header::TRANSFER_ENCODING));
// read response
let bytes = srv.load_body(response).await.unwrap();
// decode
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[actix_rt::test]
async fn test_h2_response_http_error_handling() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(factory_fn_cfg(|_: ()| {
ok::<_, ()>(service_fn2(|_| {
let broken_header = Bytes::from_static(b"\0\0\0");
ok::<_, ()>(
Response::Ok()
.header(http::header::CONTENT_TYPE, broken_header)
.body(STR),
)
}))
}))
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert_eq!(response.status(), http::StatusCode::INTERNAL_SERVER_ERROR);
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(b"failed to parse header value"));
}
#[actix_rt::test]
async fn test_h2_service_error() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h2(|_| err::<Response, Error>(error::ErrorBadRequest("error")))
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert_eq!(response.status(), http::StatusCode::BAD_REQUEST);
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(b"error"));
}
#[actix_rt::test]
async fn test_h1_service_error() {
let mut srv = TestServer::start(move || {
HttpService::build()
.h1(|_| err::<Response, Error>(error::ErrorBadRequest("error")))
.rustls(ssl_acceptor())
});
let response = srv.sget("/").send().await.unwrap();
assert_eq!(response.status(), http::StatusCode::BAD_REQUEST);
// read response
let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(b"error"));
}

View File

@@ -1,462 +0,0 @@
#![cfg(feature = "rust-tls")]
use actix_codec::{AsyncRead, AsyncWrite};
use actix_http::error::PayloadError;
use actix_http::http::header::{self, HeaderName, HeaderValue};
use actix_http::http::{Method, StatusCode, Version};
use actix_http::{body, error, Error, HttpService, Request, Response};
use actix_http_test::TestServer;
use actix_server::ssl::RustlsAcceptor;
use actix_server_config::ServerConfig;
use actix_service::{new_service_cfg, NewService};
use bytes::{Bytes, BytesMut};
use futures::future::{self, ok, Future};
use futures::stream::{once, Stream};
use rustls::{
internal::pemfile::{certs, pkcs8_private_keys},
NoClientAuth, ServerConfig as RustlsServerConfig,
};
use std::fs::File;
use std::io::{BufReader, Result};
fn load_body<S>(stream: S) -> impl Future<Item = BytesMut, Error = PayloadError>
where
S: Stream<Item = Bytes, Error = PayloadError>,
{
stream.fold(BytesMut::new(), move |mut body, chunk| {
body.extend_from_slice(&chunk);
Ok::<_, PayloadError>(body)
})
}
fn ssl_acceptor<T: AsyncRead + AsyncWrite>() -> Result<RustlsAcceptor<T, ()>> {
// load ssl keys
let mut config = RustlsServerConfig::new(NoClientAuth::new());
let cert_file = &mut BufReader::new(File::open("../tests/cert.pem").unwrap());
let key_file = &mut BufReader::new(File::open("../tests/key.pem").unwrap());
let cert_chain = certs(cert_file).unwrap();
let mut keys = pkcs8_private_keys(key_file).unwrap();
config.set_single_cert(cert_chain, keys.remove(0)).unwrap();
let protos = vec![b"h2".to_vec()];
config.set_protocols(&protos);
Ok(RustlsAcceptor::new(config))
}
#[test]
fn test_h2() -> Result<()> {
let rustls = ssl_acceptor()?;
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(|_| future::ok::<_, Error>(Response::Ok().finish()))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
Ok(())
}
#[test]
fn test_h2_1() -> Result<()> {
let rustls = ssl_acceptor()?;
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.finish(|req: Request| {
assert!(req.peer_addr().is_some());
assert_eq!(req.version(), Version::HTTP_2);
future::ok::<_, Error>(Response::Ok().finish())
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
Ok(())
}
#[test]
fn test_h2_body() -> Result<()> {
let data = "HELLOWORLD".to_owned().repeat(64 * 1024);
let rustls = ssl_acceptor()?;
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(|mut req: Request<_>| {
load_body(req.take_payload())
.and_then(|body| Ok(Response::Ok().body(body)))
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send_body(data.clone())).unwrap();
assert!(response.status().is_success());
let body = srv.load_body(response).unwrap();
assert_eq!(&body, data.as_bytes());
Ok(())
}
#[test]
fn test_h2_content_length() {
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(|req: Request| {
let indx: usize = req.uri().path()[1..].parse().unwrap();
let statuses = [
StatusCode::NO_CONTENT,
StatusCode::CONTINUE,
StatusCode::SWITCHING_PROTOCOLS,
StatusCode::PROCESSING,
StatusCode::OK,
StatusCode::NOT_FOUND,
];
future::ok::<_, ()>(Response::new(statuses[indx]))
})
.map_err(|_| ()),
)
});
let header = HeaderName::from_static("content-length");
let value = HeaderValue::from_static("0");
{
for i in 0..4 {
let req = srv
.request(Method::GET, srv.surl(&format!("/{}", i)))
.send();
let response = srv.block_on(req).unwrap();
assert_eq!(response.headers().get(&header), None);
let req = srv
.request(Method::HEAD, srv.surl(&format!("/{}", i)))
.send();
let response = srv.block_on(req).unwrap();
assert_eq!(response.headers().get(&header), None);
}
for i in 4..6 {
let req = srv
.request(Method::GET, srv.surl(&format!("/{}", i)))
.send();
let response = srv.block_on(req).unwrap();
assert_eq!(response.headers().get(&header), Some(&value));
}
}
}
#[test]
fn test_h2_headers() {
let data = STR.repeat(10);
let data2 = data.clone();
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
let data = data.clone();
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build().h2(move |_| {
let mut config = Response::Ok();
for idx in 0..90 {
config.header(
format!("X-TEST-{}", idx).as_str(),
"TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST ",
);
}
future::ok::<_, ()>(config.body(data.clone()))
}).map_err(|_| ()))
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from(data2));
}
const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World";
#[test]
fn test_h2_body2() {
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(|_| future::ok::<_, ()>(Response::Ok().body(STR)))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[test]
fn test_h2_head_empty() {
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.finish(|_| ok::<_, ()>(Response::Ok().body(STR)))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.shead("/").send()).unwrap();
assert!(response.status().is_success());
assert_eq!(response.version(), Version::HTTP_2);
{
let len = response
.headers()
.get(http::header::CONTENT_LENGTH)
.unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
// read response
let bytes = srv.load_body(response).unwrap();
assert!(bytes.is_empty());
}
#[test]
fn test_h2_head_binary() {
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(|_| {
ok::<_, ()>(
Response::Ok().content_length(STR.len() as u64).body(STR),
)
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.shead("/").send()).unwrap();
assert!(response.status().is_success());
{
let len = response
.headers()
.get(http::header::CONTENT_LENGTH)
.unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
// read response
let bytes = srv.load_body(response).unwrap();
assert!(bytes.is_empty());
}
#[test]
fn test_h2_head_binary2() {
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(|_| ok::<_, ()>(Response::Ok().body(STR)))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.shead("/").send()).unwrap();
assert!(response.status().is_success());
{
let len = response
.headers()
.get(http::header::CONTENT_LENGTH)
.unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
}
#[test]
fn test_h2_body_length() {
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(|_| {
let body = once(Ok(Bytes::from_static(STR.as_ref())));
ok::<_, ()>(
Response::Ok()
.body(body::SizedStream::new(STR.len() as u64, body)),
)
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[test]
fn test_h2_body_chunked_explicit() {
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(|_| {
let body =
once::<_, Error>(Ok(Bytes::from_static(STR.as_ref())));
ok::<_, ()>(
Response::Ok()
.header(header::TRANSFER_ENCODING, "chunked")
.streaming(body),
)
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
assert!(!response.headers().contains_key(header::TRANSFER_ENCODING));
// read response
let bytes = srv.load_body(response).unwrap();
// decode
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[test]
fn test_h2_response_http_error_handling() {
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(new_service_cfg(|_: &ServerConfig| {
Ok::<_, ()>(|_| {
let broken_header = Bytes::from_static(b"\0\0\0");
ok::<_, ()>(
Response::Ok()
.header(http::header::CONTENT_TYPE, broken_header)
.body(STR),
)
})
}))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert_eq!(response.status(), http::StatusCode::INTERNAL_SERVER_ERROR);
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from_static(b"failed to parse header value"));
}
#[test]
fn test_h2_service_error() {
let rustls = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
rustls
.clone()
.map_err(|e| println!("Rustls error: {}", e))
.and_then(
HttpService::build()
.h2(|_| Err::<Response, Error>(error::ErrorBadRequest("error")))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert_eq!(response.status(), http::StatusCode::BAD_REQUEST);
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from_static(b"error"));
}

View File

@@ -3,22 +3,21 @@ use std::time::Duration;
use std::{net, thread}; use std::{net, thread};
use actix_http_test::TestServer; use actix_http_test::TestServer;
use actix_server_config::ServerConfig; use actix_rt::time::delay_for;
use actix_service::{new_service_cfg, service_fn, NewService}; use actix_service::service_fn;
use bytes::Bytes; use bytes::Bytes;
use futures::future::{self, ok, Future}; use futures::future::{self, err, ok, ready, FutureExt};
use futures::stream::{once, Stream}; use futures::stream::{once, StreamExt};
use regex::Regex; use regex::Regex;
use tokio_timer::sleep;
use actix_http::httpmessage::HttpMessage; use actix_http::httpmessage::HttpMessage;
use actix_http::{ use actix_http::{
body, error, http, http::header, Error, HttpService, KeepAlive, Request, Response, body, error, http, http::header, Error, HttpService, KeepAlive, Request, Response,
}; };
#[test] #[actix_rt::test]
fn test_h1() { async fn test_h1() {
let mut srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.keep_alive(KeepAlive::Disabled) .keep_alive(KeepAlive::Disabled)
.client_timeout(1000) .client_timeout(1000)
@@ -27,15 +26,16 @@ fn test_h1() {
assert!(req.peer_addr().is_some()); assert!(req.peer_addr().is_some());
future::ok::<_, ()>(Response::Ok().finish()) future::ok::<_, ()>(Response::Ok().finish())
}) })
.tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
} }
#[test] #[actix_rt::test]
fn test_h1_2() { async fn test_h1_2() {
let mut srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.keep_alive(KeepAlive::Disabled) .keep_alive(KeepAlive::Disabled)
.client_timeout(1000) .client_timeout(1000)
@@ -45,25 +45,26 @@ fn test_h1_2() {
assert_eq!(req.version(), http::Version::HTTP_11); assert_eq!(req.version(), http::Version::HTTP_11);
future::ok::<_, ()>(Response::Ok().finish()) future::ok::<_, ()>(Response::Ok().finish())
}) })
.map(|_| ()) .tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
} }
#[test] #[actix_rt::test]
fn test_expect_continue() { async fn test_expect_continue() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.expect(service_fn(|req: Request| { .expect(service_fn(|req: Request| {
if req.head().uri.query() == Some("yes=") { if req.head().uri.query() == Some("yes=") {
Ok(req) ok(req)
} else { } else {
Err(error::ErrorPreconditionFailed("error")) err(error::ErrorPreconditionFailed("error"))
} }
})) }))
.finish(|_| future::ok::<_, ()>(Response::Ok().finish())) .finish(|_| future::ok::<_, ()>(Response::Ok().finish()))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -79,20 +80,21 @@ fn test_expect_continue() {
assert!(data.starts_with("HTTP/1.1 100 Continue\r\n\r\nHTTP/1.1 200 OK\r\n")); assert!(data.starts_with("HTTP/1.1 100 Continue\r\n\r\nHTTP/1.1 200 OK\r\n"));
} }
#[test] #[actix_rt::test]
fn test_expect_continue_h1() { async fn test_expect_continue_h1() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.expect(service_fn(|req: Request| { .expect(service_fn(|req: Request| {
sleep(Duration::from_millis(20)).then(move |_| { delay_for(Duration::from_millis(20)).then(move |_| {
if req.head().uri.query() == Some("yes=") { if req.head().uri.query() == Some("yes=") {
Ok(req) ok(req)
} else { } else {
Err(error::ErrorPreconditionFailed("error")) err(error::ErrorPreconditionFailed("error"))
} }
}) })
})) }))
.h1(|_| future::ok::<_, ()>(Response::Ok().finish())) .h1(service_fn(|_| future::ok::<_, ()>(Response::Ok().finish())))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -108,19 +110,26 @@ fn test_expect_continue_h1() {
assert!(data.starts_with("HTTP/1.1 100 Continue\r\n\r\nHTTP/1.1 200 OK\r\n")); assert!(data.starts_with("HTTP/1.1 100 Continue\r\n\r\nHTTP/1.1 200 OK\r\n"));
} }
#[test] #[actix_rt::test]
fn test_chunked_payload() { async fn test_chunked_payload() {
let chunk_sizes = vec![32768, 32, 32768]; let chunk_sizes = vec![32768, 32, 32768];
let total_size: usize = chunk_sizes.iter().sum(); let total_size: usize = chunk_sizes.iter().sum();
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build().h1(|mut request: Request| { HttpService::build()
.h1(service_fn(|mut request: Request| {
request request
.take_payload() .take_payload()
.map_err(|e| panic!(format!("Error reading payload: {}", e))) .map(|res| match res {
.fold(0usize, |acc, chunk| future::ok::<_, ()>(acc + chunk.len())) Ok(pl) => pl,
.map(|req_size| Response::Ok().body(format!("size={}", req_size))) Err(e) => panic!(format!("Error reading payload: {}", e)),
}) })
.fold(0usize, |acc, chunk| ready(acc + chunk.len()))
.map(|req_size| {
Ok::<_, Error>(Response::Ok().body(format!("size={}", req_size)))
})
}))
.tcp()
}); });
let returned_size = { let returned_size = {
@@ -156,12 +165,13 @@ fn test_chunked_payload() {
assert_eq!(returned_size, total_size); assert_eq!(returned_size, total_size);
} }
#[test] #[actix_rt::test]
fn test_slow_request() { async fn test_slow_request() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.client_timeout(100) .client_timeout(100)
.finish(|_| future::ok::<_, ()>(Response::Ok().finish())) .finish(|_| future::ok::<_, ()>(Response::Ok().finish()))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -171,10 +181,12 @@ fn test_slow_request() {
assert!(data.starts_with("HTTP/1.1 408 Request Timeout")); assert!(data.starts_with("HTTP/1.1 408 Request Timeout"));
} }
#[test] #[actix_rt::test]
fn test_http1_malformed_request() { async fn test_http1_malformed_request() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build().h1(|_| future::ok::<_, ()>(Response::Ok().finish())) HttpService::build()
.h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -184,10 +196,12 @@ fn test_http1_malformed_request() {
assert!(data.starts_with("HTTP/1.1 400 Bad Request")); assert!(data.starts_with("HTTP/1.1 400 Bad Request"));
} }
#[test] #[actix_rt::test]
fn test_http1_keepalive() { async fn test_http1_keepalive() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build().h1(|_| future::ok::<_, ()>(Response::Ok().finish())) HttpService::build()
.h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -202,12 +216,13 @@ fn test_http1_keepalive() {
assert_eq!(&data[..17], b"HTTP/1.1 200 OK\r\n"); assert_eq!(&data[..17], b"HTTP/1.1 200 OK\r\n");
} }
#[test] #[actix_rt::test]
fn test_http1_keepalive_timeout() { async fn test_http1_keepalive_timeout() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.keep_alive(1) .keep_alive(1)
.h1(|_| future::ok::<_, ()>(Response::Ok().finish())) .h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -222,10 +237,12 @@ fn test_http1_keepalive_timeout() {
assert_eq!(res, 0); assert_eq!(res, 0);
} }
#[test] #[actix_rt::test]
fn test_http1_keepalive_close() { async fn test_http1_keepalive_close() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build().h1(|_| future::ok::<_, ()>(Response::Ok().finish())) HttpService::build()
.h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -240,10 +257,12 @@ fn test_http1_keepalive_close() {
assert_eq!(res, 0); assert_eq!(res, 0);
} }
#[test] #[actix_rt::test]
fn test_http10_keepalive_default_close() { async fn test_http10_keepalive_default_close() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build().h1(|_| future::ok::<_, ()>(Response::Ok().finish())) HttpService::build()
.h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -257,10 +276,12 @@ fn test_http10_keepalive_default_close() {
assert_eq!(res, 0); assert_eq!(res, 0);
} }
#[test] #[actix_rt::test]
fn test_http10_keepalive() { async fn test_http10_keepalive() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build().h1(|_| future::ok::<_, ()>(Response::Ok().finish())) HttpService::build()
.h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -281,12 +302,13 @@ fn test_http10_keepalive() {
assert_eq!(res, 0); assert_eq!(res, 0);
} }
#[test] #[actix_rt::test]
fn test_http1_keepalive_disabled() { async fn test_http1_keepalive_disabled() {
let srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.keep_alive(KeepAlive::Disabled) .keep_alive(KeepAlive::Disabled)
.h1(|_| future::ok::<_, ()>(Response::Ok().finish())) .h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
.tcp()
}); });
let mut stream = net::TcpStream::connect(srv.addr()).unwrap(); let mut stream = net::TcpStream::connect(srv.addr()).unwrap();
@@ -300,15 +322,16 @@ fn test_http1_keepalive_disabled() {
assert_eq!(res, 0); assert_eq!(res, 0);
} }
#[test] #[actix_rt::test]
fn test_content_length() { async fn test_content_length() {
use actix_http::http::{ use actix_http::http::{
header::{HeaderName, HeaderValue}, header::{HeaderName, HeaderValue},
StatusCode, StatusCode,
}; };
let mut srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build().h1(|req: Request| { HttpService::build()
.h1(|req: Request| {
let indx: usize = req.uri().path()[1..].parse().unwrap(); let indx: usize = req.uri().path()[1..].parse().unwrap();
let statuses = [ let statuses = [
StatusCode::NO_CONTENT, StatusCode::NO_CONTENT,
@@ -320,6 +343,7 @@ fn test_content_length() {
]; ];
future::ok::<_, ()>(Response::new(statuses[indx])) future::ok::<_, ()>(Response::new(statuses[indx]))
}) })
.tcp()
}); });
let header = HeaderName::from_static("content-length"); let header = HeaderName::from_static("content-length");
@@ -327,35 +351,29 @@ fn test_content_length() {
{ {
for i in 0..4 { for i in 0..4 {
let req = srv let req = srv.request(http::Method::GET, srv.url(&format!("/{}", i)));
.request(http::Method::GET, srv.url(&format!("/{}", i))) let response = req.send().await.unwrap();
.send();
let response = srv.block_on(req).unwrap();
assert_eq!(response.headers().get(&header), None); assert_eq!(response.headers().get(&header), None);
let req = srv let req = srv.request(http::Method::HEAD, srv.url(&format!("/{}", i)));
.request(http::Method::HEAD, srv.url(&format!("/{}", i))) let response = req.send().await.unwrap();
.send();
let response = srv.block_on(req).unwrap();
assert_eq!(response.headers().get(&header), None); assert_eq!(response.headers().get(&header), None);
} }
for i in 4..6 { for i in 4..6 {
let req = srv let req = srv.request(http::Method::GET, srv.url(&format!("/{}", i)));
.request(http::Method::GET, srv.url(&format!("/{}", i))) let response = req.send().await.unwrap();
.send();
let response = srv.block_on(req).unwrap();
assert_eq!(response.headers().get(&header), Some(&value)); assert_eq!(response.headers().get(&header), Some(&value));
} }
} }
} }
#[test] #[actix_rt::test]
fn test_h1_headers() { async fn test_h1_headers() {
let data = STR.repeat(10); let data = STR.repeat(10);
let data2 = data.clone(); let data2 = data.clone();
let mut srv = TestServer::new(move || { let mut srv = TestServer::start(move || {
let data = data.clone(); let data = data.clone();
HttpService::build().h1(move |_| { HttpService::build().h1(move |_| {
let mut builder = Response::Ok(); let mut builder = Response::Ok();
@@ -378,14 +396,14 @@ fn test_h1_headers() {
); );
} }
future::ok::<_, ()>(builder.body(data.clone())) future::ok::<_, ()>(builder.body(data.clone()))
}) }).tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from(data2)); assert_eq!(bytes, Bytes::from(data2));
} }
@@ -411,27 +429,31 @@ const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \ Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World"; Hello World Hello World Hello World Hello World Hello World";
#[test] #[actix_rt::test]
fn test_h1_body() { async fn test_h1_body() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build().h1(|_| future::ok::<_, ()>(Response::Ok().body(STR))) HttpService::build()
.h1(|_| ok::<_, ()>(Response::Ok().body(STR)))
.tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref())); assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
} }
#[test] #[actix_rt::test]
fn test_h1_head_empty() { async fn test_h1_head_empty() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build().h1(|_| ok::<_, ()>(Response::Ok().body(STR))) HttpService::build()
.h1(|_| ok::<_, ()>(Response::Ok().body(STR)))
.tcp()
}); });
let response = srv.block_on(srv.head("/").send()).unwrap(); let response = srv.head("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
{ {
@@ -443,19 +465,21 @@ fn test_h1_head_empty() {
} }
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = srv.load_body(response).await.unwrap();
assert!(bytes.is_empty()); assert!(bytes.is_empty());
} }
#[test] #[actix_rt::test]
fn test_h1_head_binary() { async fn test_h1_head_binary() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build().h1(|_| { HttpService::build()
.h1(|_| {
ok::<_, ()>(Response::Ok().content_length(STR.len() as u64).body(STR)) ok::<_, ()>(Response::Ok().content_length(STR.len() as u64).body(STR))
}) })
.tcp()
}); });
let response = srv.block_on(srv.head("/").send()).unwrap(); let response = srv.head("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
{ {
@@ -467,17 +491,19 @@ fn test_h1_head_binary() {
} }
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = srv.load_body(response).await.unwrap();
assert!(bytes.is_empty()); assert!(bytes.is_empty());
} }
#[test] #[actix_rt::test]
fn test_h1_head_binary2() { async fn test_h1_head_binary2() {
let mut srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build().h1(|_| ok::<_, ()>(Response::Ok().body(STR))) HttpService::build()
.h1(|_| ok::<_, ()>(Response::Ok().body(STR)))
.tcp()
}); });
let response = srv.block_on(srv.head("/").send()).unwrap(); let response = srv.head("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
{ {
@@ -489,39 +515,43 @@ fn test_h1_head_binary2() {
} }
} }
#[test] #[actix_rt::test]
fn test_h1_body_length() { async fn test_h1_body_length() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build().h1(|_| { HttpService::build()
let body = once(Ok(Bytes::from_static(STR.as_ref()))); .h1(|_| {
let body = once(ok(Bytes::from_static(STR.as_ref())));
ok::<_, ()>( ok::<_, ()>(
Response::Ok().body(body::SizedStream::new(STR.len() as u64, body)), Response::Ok().body(body::SizedStream::new(STR.len() as u64, body)),
) )
}) })
.tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref())); assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
} }
#[test] #[actix_rt::test]
fn test_h1_body_chunked_explicit() { async fn test_h1_body_chunked_explicit() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build().h1(|_| { HttpService::build()
let body = once::<_, Error>(Ok(Bytes::from_static(STR.as_ref()))); .h1(|_| {
let body = once(ok::<_, Error>(Bytes::from_static(STR.as_ref())));
ok::<_, ()>( ok::<_, ()>(
Response::Ok() Response::Ok()
.header(header::TRANSFER_ENCODING, "chunked") .header(header::TRANSFER_ENCODING, "chunked")
.streaming(body), .streaming(body),
) )
}) })
.tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
assert_eq!( assert_eq!(
response response
@@ -534,22 +564,24 @@ fn test_h1_body_chunked_explicit() {
); );
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = srv.load_body(response).await.unwrap();
// decode // decode
assert_eq!(bytes, Bytes::from_static(STR.as_ref())); assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
} }
#[test] #[actix_rt::test]
fn test_h1_body_chunked_implicit() { async fn test_h1_body_chunked_implicit() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build().h1(|_| { HttpService::build()
let body = once::<_, Error>(Ok(Bytes::from_static(STR.as_ref()))); .h1(|_| {
let body = once(ok::<_, Error>(Bytes::from_static(STR.as_ref())));
ok::<_, ()>(Response::Ok().streaming(body)) ok::<_, ()>(Response::Ok().streaming(body))
}) })
.tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
assert_eq!( assert_eq!(
response response
@@ -562,59 +594,61 @@ fn test_h1_body_chunked_implicit() {
); );
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref())); assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
} }
#[test] #[actix_rt::test]
fn test_h1_response_http_error_handling() { async fn test_h1_response_http_error_handling() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build().h1(new_service_cfg(|_: &ServerConfig| { HttpService::build()
Ok::<_, ()>(|_| { .h1(service_fn(|_| {
let broken_header = Bytes::from_static(b"\0\0\0"); let broken_header = Bytes::from_static(b"\0\0\0");
ok::<_, ()>( ok::<_, ()>(
Response::Ok() Response::Ok()
.header(http::header::CONTENT_TYPE, broken_header) .header(http::header::CONTENT_TYPE, broken_header)
.body(STR), .body(STR),
) )
})
})) }))
.tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert_eq!(response.status(), http::StatusCode::INTERNAL_SERVER_ERROR); assert_eq!(response.status(), http::StatusCode::INTERNAL_SERVER_ERROR);
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(b"failed to parse header value")); assert_eq!(bytes, Bytes::from_static(b"failed to parse header value"));
} }
#[test] #[actix_rt::test]
fn test_h1_service_error() { async fn test_h1_service_error() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.h1(|_| Err::<Response, Error>(error::ErrorBadRequest("error"))) .h1(|_| future::err::<Response, Error>(error::ErrorBadRequest("error")))
.tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert_eq!(response.status(), http::StatusCode::BAD_REQUEST); assert_eq!(response.status(), http::StatusCode::BAD_REQUEST);
// read response // read response
let bytes = srv.load_body(response).unwrap(); let bytes = srv.load_body(response).await.unwrap();
assert_eq!(bytes, Bytes::from_static(b"error")); assert_eq!(bytes, Bytes::from_static(b"error"));
} }
#[test] #[actix_rt::test]
fn test_h1_on_connect() { async fn test_h1_on_connect() {
let mut srv = TestServer::new(|| { let srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.on_connect(|_| 10usize) .on_connect(|_| 10usize)
.h1(|req: Request| { .h1(|req: Request| {
assert!(req.extensions().contains::<usize>()); assert!(req.extensions().contains::<usize>());
future::ok::<_, ()>(Response::Ok().finish()) future::ok::<_, ()>(Response::Ok().finish())
}) })
.tcp()
}); });
let response = srv.block_on(srv.get("/").send()).unwrap(); let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success()); assert!(response.status().is_success());
} }

View File

@@ -1,480 +0,0 @@
#![cfg(feature = "ssl")]
use actix_codec::{AsyncRead, AsyncWrite};
use actix_http_test::TestServer;
use actix_server::ssl::OpensslAcceptor;
use actix_server_config::ServerConfig;
use actix_service::{new_service_cfg, NewService};
use bytes::{Bytes, BytesMut};
use futures::future::{ok, Future};
use futures::stream::{once, Stream};
use openssl::ssl::{AlpnError, SslAcceptor, SslFiletype, SslMethod};
use std::io::Result;
use actix_http::error::{ErrorBadRequest, PayloadError};
use actix_http::http::header::{self, HeaderName, HeaderValue};
use actix_http::http::{Method, StatusCode, Version};
use actix_http::httpmessage::HttpMessage;
use actix_http::{body, Error, HttpService, Request, Response};
fn load_body<S>(stream: S) -> impl Future<Item = BytesMut, Error = PayloadError>
where
S: Stream<Item = Bytes, Error = PayloadError>,
{
stream.fold(BytesMut::new(), move |mut body, chunk| {
body.extend_from_slice(&chunk);
Ok::<_, PayloadError>(body)
})
}
fn ssl_acceptor<T: AsyncRead + AsyncWrite>() -> Result<OpensslAcceptor<T, ()>> {
// load ssl keys
let mut builder = SslAcceptor::mozilla_intermediate(SslMethod::tls()).unwrap();
builder
.set_private_key_file("../tests/key.pem", SslFiletype::PEM)
.unwrap();
builder
.set_certificate_chain_file("../tests/cert.pem")
.unwrap();
builder.set_alpn_select_callback(|_, protos| {
const H2: &[u8] = b"\x02h2";
if protos.windows(3).any(|window| window == H2) {
Ok(b"h2")
} else {
Err(AlpnError::NOACK)
}
});
builder.set_alpn_protos(b"\x02h2")?;
Ok(OpensslAcceptor::new(builder.build()))
}
#[test]
fn test_h2() -> Result<()> {
let openssl = ssl_acceptor()?;
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(|_| ok::<_, Error>(Response::Ok().finish()))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
Ok(())
}
#[test]
fn test_h2_1() -> Result<()> {
let openssl = ssl_acceptor()?;
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.finish(|req: Request| {
assert!(req.peer_addr().is_some());
assert_eq!(req.version(), Version::HTTP_2);
ok::<_, Error>(Response::Ok().finish())
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
Ok(())
}
#[test]
fn test_h2_body() -> Result<()> {
let data = "HELLOWORLD".to_owned().repeat(64 * 1024);
let openssl = ssl_acceptor()?;
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(|mut req: Request<_>| {
load_body(req.take_payload())
.and_then(|body| Ok(Response::Ok().body(body)))
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send_body(data.clone())).unwrap();
assert!(response.status().is_success());
let body = srv.load_body(response).unwrap();
assert_eq!(&body, data.as_bytes());
Ok(())
}
#[test]
fn test_h2_content_length() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(|req: Request| {
let indx: usize = req.uri().path()[1..].parse().unwrap();
let statuses = [
StatusCode::NO_CONTENT,
StatusCode::CONTINUE,
StatusCode::SWITCHING_PROTOCOLS,
StatusCode::PROCESSING,
StatusCode::OK,
StatusCode::NOT_FOUND,
];
ok::<_, ()>(Response::new(statuses[indx]))
})
.map_err(|_| ()),
)
});
let header = HeaderName::from_static("content-length");
let value = HeaderValue::from_static("0");
{
for i in 0..4 {
let req = srv
.request(Method::GET, srv.surl(&format!("/{}", i)))
.send();
let response = srv.block_on(req).unwrap();
assert_eq!(response.headers().get(&header), None);
let req = srv
.request(Method::HEAD, srv.surl(&format!("/{}", i)))
.send();
let response = srv.block_on(req).unwrap();
assert_eq!(response.headers().get(&header), None);
}
for i in 4..6 {
let req = srv
.request(Method::GET, srv.surl(&format!("/{}", i)))
.send();
let response = srv.block_on(req).unwrap();
assert_eq!(response.headers().get(&header), Some(&value));
}
}
}
#[test]
fn test_h2_headers() {
let data = STR.repeat(10);
let data2 = data.clone();
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
let data = data.clone();
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build().h2(move |_| {
let mut builder = Response::Ok();
for idx in 0..90 {
builder.header(
format!("X-TEST-{}", idx).as_str(),
"TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST \
TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST ",
);
}
ok::<_, ()>(builder.body(data.clone()))
}).map_err(|_| ()))
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from(data2));
}
const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World";
#[test]
fn test_h2_body2() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(|_| ok::<_, ()>(Response::Ok().body(STR)))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[test]
fn test_h2_head_empty() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.finish(|_| ok::<_, ()>(Response::Ok().body(STR)))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.shead("/").send()).unwrap();
assert!(response.status().is_success());
assert_eq!(response.version(), Version::HTTP_2);
{
let len = response.headers().get(header::CONTENT_LENGTH).unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
// read response
let bytes = srv.load_body(response).unwrap();
assert!(bytes.is_empty());
}
#[test]
fn test_h2_head_binary() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(|_| {
ok::<_, ()>(
Response::Ok().content_length(STR.len() as u64).body(STR),
)
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.shead("/").send()).unwrap();
assert!(response.status().is_success());
{
let len = response.headers().get(header::CONTENT_LENGTH).unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
// read response
let bytes = srv.load_body(response).unwrap();
assert!(bytes.is_empty());
}
#[test]
fn test_h2_head_binary2() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(|_| ok::<_, ()>(Response::Ok().body(STR)))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.shead("/").send()).unwrap();
assert!(response.status().is_success());
{
let len = response.headers().get(header::CONTENT_LENGTH).unwrap();
assert_eq!(format!("{}", STR.len()), len.to_str().unwrap());
}
}
#[test]
fn test_h2_body_length() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(|_| {
let body = once(Ok(Bytes::from_static(STR.as_ref())));
ok::<_, ()>(
Response::Ok()
.body(body::SizedStream::new(STR.len() as u64, body)),
)
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[test]
fn test_h2_body_chunked_explicit() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(|_| {
let body =
once::<_, Error>(Ok(Bytes::from_static(STR.as_ref())));
ok::<_, ()>(
Response::Ok()
.header(header::TRANSFER_ENCODING, "chunked")
.streaming(body),
)
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
assert!(!response.headers().contains_key(header::TRANSFER_ENCODING));
// read response
let bytes = srv.load_body(response).unwrap();
// decode
assert_eq!(bytes, Bytes::from_static(STR.as_ref()));
}
#[test]
fn test_h2_response_http_error_handling() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(new_service_cfg(|_: &ServerConfig| {
Ok::<_, ()>(|_| {
let broken_header = Bytes::from_static(b"\0\0\0");
ok::<_, ()>(
Response::Ok()
.header(header::CONTENT_TYPE, broken_header)
.body(STR),
)
})
}))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert_eq!(response.status(), StatusCode::INTERNAL_SERVER_ERROR);
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from_static(b"failed to parse header value"));
}
#[test]
fn test_h2_service_error() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.h2(|_| Err::<Response, Error>(ErrorBadRequest("error")))
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert_eq!(response.status(), StatusCode::BAD_REQUEST);
// read response
let bytes = srv.load_body(response).unwrap();
assert_eq!(bytes, Bytes::from_static(b"error"));
}
#[test]
fn test_h2_on_connect() {
let openssl = ssl_acceptor().unwrap();
let mut srv = TestServer::new(move || {
openssl
.clone()
.map_err(|e| println!("Openssl error: {}", e))
.and_then(
HttpService::build()
.on_connect(|_| 10usize)
.h2(|req: Request| {
assert!(req.extensions().contains::<usize>());
ok::<_, ()>(Response::Ok().finish())
})
.map_err(|_| ()),
)
});
let response = srv.block_on(srv.sget("/").send()).unwrap();
assert!(response.status().is_success());
}

View File

@@ -2,25 +2,26 @@ use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_http::{body, h1, ws, Error, HttpService, Request, Response}; use actix_http::{body, h1, ws, Error, HttpService, Request, Response};
use actix_http_test::TestServer; use actix_http_test::TestServer;
use actix_utils::framed::FramedTransport; use actix_utils::framed::FramedTransport;
use bytes::{Bytes, BytesMut}; use bytes::BytesMut;
use futures::future::{self, ok}; use futures::future;
use futures::{Future, Sink, Stream}; use futures::{SinkExt, StreamExt};
fn ws_service<T: AsyncRead + AsyncWrite>( async fn ws_service<T: AsyncRead + AsyncWrite + Unpin>(
(req, framed): (Request, Framed<T, h1::Codec>), (req, mut framed): (Request, Framed<T, h1::Codec>),
) -> impl Future<Item = (), Error = Error> { ) -> Result<(), Error> {
let res = ws::handshake(req.head()).unwrap().message_body(()); let res = ws::handshake(req.head()).unwrap().message_body(());
framed framed
.send((res, body::BodySize::None).into()) .send((res, body::BodySize::None).into())
.map_err(|_| panic!()) .await
.and_then(|framed| { .unwrap();
FramedTransport::new(framed.into_framed(ws::Codec::new()), service) FramedTransport::new(framed.into_framed(ws::Codec::new()), service)
.await
.map_err(|_| panic!()) .map_err(|_| panic!())
})
} }
fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> { async fn service(msg: ws::Frame) -> Result<ws::Message, Error> {
let msg = match msg { let msg = match msg {
ws::Frame::Ping(msg) => ws::Message::Pong(msg), ws::Frame::Ping(msg) => ws::Message::Pong(msg),
ws::Frame::Text(text) => { ws::Frame::Text(text) => {
@@ -30,47 +31,55 @@ fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> {
ws::Frame::Close(reason) => ws::Message::Close(reason), ws::Frame::Close(reason) => ws::Message::Close(reason),
_ => panic!(), _ => panic!(),
}; };
ok(msg) Ok(msg)
} }
#[test] #[actix_rt::test]
fn test_simple() { async fn test_simple() {
let mut srv = TestServer::new(|| { let mut srv = TestServer::start(|| {
HttpService::build() HttpService::build()
.upgrade(ws_service) .upgrade(actix_service::service_fn(ws_service))
.finish(|_| future::ok::<_, ()>(Response::NotFound())) .finish(|_| future::ok::<_, ()>(Response::NotFound()))
.tcp()
}); });
// client service // client service
let framed = srv.ws().unwrap(); let mut framed = srv.ws().await.unwrap();
let framed = srv framed
.block_on(framed.send(ws::Message::Text("text".to_string()))) .send(ws::Message::Text("text".to_string()))
.await
.unwrap(); .unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap(); let (item, mut framed) = framed.into_future().await;
assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
let framed = srv
.block_on(framed.send(ws::Message::Binary("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!( assert_eq!(
item, item.unwrap().unwrap(),
Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into()))) ws::Frame::Text(Some(BytesMut::from("text")))
); );
let framed = srv framed
.block_on(framed.send(ws::Message::Ping("text".into()))) .send(ws::Message::Binary("text".into()))
.await
.unwrap(); .unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap(); let (item, mut framed) = framed.into_future().await;
assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
let framed = srv
.block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
.unwrap();
let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!( assert_eq!(
item, item.unwrap().unwrap(),
Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into()))) ws::Frame::Binary(Some(BytesMut::from(&b"text"[..]).into()))
);
framed.send(ws::Message::Ping("text".into())).await.unwrap();
let (item, mut framed) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Pong("text".to_string().into())
);
framed
.send(ws::Message::Close(Some(ws::CloseCode::Normal.into())))
.await
.unwrap();
let (item, _framed) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Close(Some(ws::CloseCode::Normal.into()))
); );
} }

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-identity" name = "actix-identity"
version = "0.1.0" version = "0.2.0-alpha.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Identity service for actix web framework." description = "Identity service for actix web framework."
readme = "README.md" readme = "README.md"
@@ -17,14 +17,14 @@ name = "actix_identity"
path = "src/lib.rs" path = "src/lib.rs"
[dependencies] [dependencies]
actix-web = { version = "1.0.0", default-features = false, features = ["secure-cookies"] } actix-web = { version = "2.0.0-alpha.3", default-features = false, features = ["secure-cookies"] }
actix-service = "0.4.0" actix-service = "1.0.0-alpha.3"
futures = "0.1.25" futures = "0.3.1"
serde = "1.0" serde = "1.0"
serde_json = "1.0" serde_json = "1.0"
time = "0.1.42" time = "0.1.42"
[dev-dependencies] [dev-dependencies]
actix-rt = "0.2.2" actix-rt = "1.0.0-alpha.3"
actix-http = "0.2.3" actix-http = "1.0.0-alpha.3"
bytes = "0.4" bytes = "0.5.2"

View File

@@ -16,7 +16,7 @@
//! use actix_web::*; //! use actix_web::*;
//! use actix_identity::{Identity, CookieIdentityPolicy, IdentityService}; //! use actix_identity::{Identity, CookieIdentityPolicy, IdentityService};
//! //!
//! fn index(id: Identity) -> String { //! async fn index(id: Identity) -> String {
//! // access request identity //! // access request identity
//! if let Some(id) = id.identity() { //! if let Some(id) = id.identity() {
//! format!("Welcome! {}", id) //! format!("Welcome! {}", id)
@@ -25,12 +25,12 @@
//! } //! }
//! } //! }
//! //!
//! fn login(id: Identity) -> HttpResponse { //! async fn login(id: Identity) -> HttpResponse {
//! id.remember("User1".to_owned()); // <- remember identity //! id.remember("User1".to_owned()); // <- remember identity
//! HttpResponse::Ok().finish() //! HttpResponse::Ok().finish()
//! } //! }
//! //!
//! fn logout(id: Identity) -> HttpResponse { //! async fn logout(id: Identity) -> HttpResponse {
//! id.forget(); // <- remove identity //! id.forget(); // <- remove identity
//! HttpResponse::Ok().finish() //! HttpResponse::Ok().finish()
//! } //! }
@@ -47,12 +47,13 @@
//! } //! }
//! ``` //! ```
use std::cell::RefCell; use std::cell::RefCell;
use std::future::Future;
use std::rc::Rc; use std::rc::Rc;
use std::task::{Context, Poll};
use std::time::SystemTime; use std::time::SystemTime;
use actix_service::{Service, Transform}; use actix_service::{Service, Transform};
use futures::future::{ok, Either, FutureResult}; use futures::future::{ok, FutureExt, LocalBoxFuture, Ready};
use futures::{Future, IntoFuture, Poll};
use serde::{Deserialize, Serialize}; use serde::{Deserialize, Serialize};
use time::Duration; use time::Duration;
@@ -165,21 +166,21 @@ where
impl FromRequest for Identity { impl FromRequest for Identity {
type Config = (); type Config = ();
type Error = Error; type Error = Error;
type Future = Result<Identity, Error>; type Future = Ready<Result<Identity, Error>>;
#[inline] #[inline]
fn from_request(req: &HttpRequest, _: &mut Payload) -> Self::Future { fn from_request(req: &HttpRequest, _: &mut Payload) -> Self::Future {
Ok(Identity(req.clone())) ok(Identity(req.clone()))
} }
} }
/// Identity policy definition. /// Identity policy definition.
pub trait IdentityPolicy: Sized + 'static { pub trait IdentityPolicy: Sized + 'static {
/// The return type of the middleware /// The return type of the middleware
type Future: IntoFuture<Item = Option<String>, Error = Error>; type Future: Future<Output = Result<Option<String>, Error>>;
/// The return type of the middleware /// The return type of the middleware
type ResponseFuture: IntoFuture<Item = (), Error = Error>; type ResponseFuture: Future<Output = Result<(), Error>>;
/// Parse the session from request and load data from a service identity. /// Parse the session from request and load data from a service identity.
fn from_request(&self, request: &mut ServiceRequest) -> Self::Future; fn from_request(&self, request: &mut ServiceRequest) -> Self::Future;
@@ -234,7 +235,7 @@ where
type Error = Error; type Error = Error;
type InitError = (); type InitError = ();
type Transform = IdentityServiceMiddleware<S, T>; type Transform = IdentityServiceMiddleware<S, T>;
type Future = FutureResult<Self::Transform, Self::InitError>; type Future = Ready<Result<Self::Transform, Self::InitError>>;
fn new_transform(&self, service: S) -> Self::Future { fn new_transform(&self, service: S) -> Self::Future {
ok(IdentityServiceMiddleware { ok(IdentityServiceMiddleware {
@@ -261,46 +262,39 @@ where
type Request = ServiceRequest; type Request = ServiceRequest;
type Response = ServiceResponse<B>; type Response = ServiceResponse<B>;
type Error = Error; type Error = Error;
type Future = Box<dyn Future<Item = Self::Response, Error = Self::Error>>; type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.service.borrow_mut().poll_ready() self.service.borrow_mut().poll_ready(cx)
} }
fn call(&mut self, mut req: ServiceRequest) -> Self::Future { fn call(&mut self, mut req: ServiceRequest) -> Self::Future {
let srv = self.service.clone(); let srv = self.service.clone();
let backend = self.backend.clone(); let backend = self.backend.clone();
let fut = self.backend.from_request(&mut req);
Box::new( async move {
self.backend.from_request(&mut req).into_future().then( match fut.await {
move |res| match res {
Ok(id) => { Ok(id) => {
req.extensions_mut() req.extensions_mut()
.insert(IdentityItem { id, changed: false }); .insert(IdentityItem { id, changed: false });
Either::A(srv.borrow_mut().call(req).and_then(move |mut res| { let mut res = srv.borrow_mut().call(req).await?;
let id = let id = res.request().extensions_mut().remove::<IdentityItem>();
res.request().extensions_mut().remove::<IdentityItem>();
if let Some(id) = id { if let Some(id) = id {
Either::A( match backend.to_response(id.id, id.changed, &mut res).await {
backend
.to_response(id.id, id.changed, &mut res)
.into_future()
.then(move |t| match t {
Ok(_) => Ok(res), Ok(_) => Ok(res),
Err(e) => Ok(res.error_response(e)), Err(e) => Ok(res.error_response(e)),
}), }
)
} else { } else {
Either::B(ok(res)) Ok(res)
} }
}))
} }
Err(err) => Either::B(ok(req.error_response(err))), Err(err) => Ok(req.error_response(err)),
}, }
), }
) .boxed_local()
} }
} }
@@ -547,11 +541,11 @@ impl CookieIdentityPolicy {
} }
impl IdentityPolicy for CookieIdentityPolicy { impl IdentityPolicy for CookieIdentityPolicy {
type Future = Result<Option<String>, Error>; type Future = Ready<Result<Option<String>, Error>>;
type ResponseFuture = Result<(), Error>; type ResponseFuture = Ready<Result<(), Error>>;
fn from_request(&self, req: &mut ServiceRequest) -> Self::Future { fn from_request(&self, req: &mut ServiceRequest) -> Self::Future {
Ok(self.0.load(req).map( ok(self.0.load(req).map(
|CookieValue { |CookieValue {
identity, identity,
login_timestamp, login_timestamp,
@@ -603,7 +597,7 @@ impl IdentityPolicy for CookieIdentityPolicy {
} else { } else {
Ok(()) Ok(())
}; };
Ok(()) ok(())
} }
} }
@@ -620,8 +614,8 @@ mod tests {
const COOKIE_NAME: &'static str = "actix_auth"; const COOKIE_NAME: &'static str = "actix_auth";
const COOKIE_LOGIN: &'static str = "test"; const COOKIE_LOGIN: &'static str = "test";
#[test] #[actix_rt::test]
fn test_identity() { async fn test_identity() {
let mut srv = test::init_service( let mut srv = test::init_service(
App::new() App::new()
.wrap(IdentityService::new( .wrap(IdentityService::new(
@@ -650,13 +644,16 @@ mod tests {
HttpResponse::BadRequest() HttpResponse::BadRequest()
} }
})), })),
); )
.await;
let resp = let resp =
test::call_service(&mut srv, TestRequest::with_uri("/index").to_request()); test::call_service(&mut srv, TestRequest::with_uri("/index").to_request())
.await;
assert_eq!(resp.status(), StatusCode::OK); assert_eq!(resp.status(), StatusCode::OK);
let resp = let resp =
test::call_service(&mut srv, TestRequest::with_uri("/login").to_request()); test::call_service(&mut srv, TestRequest::with_uri("/login").to_request())
.await;
assert_eq!(resp.status(), StatusCode::OK); assert_eq!(resp.status(), StatusCode::OK);
let c = resp.response().cookies().next().unwrap().to_owned(); let c = resp.response().cookies().next().unwrap().to_owned();
@@ -665,7 +662,8 @@ mod tests {
TestRequest::with_uri("/index") TestRequest::with_uri("/index")
.cookie(c.clone()) .cookie(c.clone())
.to_request(), .to_request(),
); )
.await;
assert_eq!(resp.status(), StatusCode::CREATED); assert_eq!(resp.status(), StatusCode::CREATED);
let resp = test::call_service( let resp = test::call_service(
@@ -673,13 +671,14 @@ mod tests {
TestRequest::with_uri("/logout") TestRequest::with_uri("/logout")
.cookie(c.clone()) .cookie(c.clone())
.to_request(), .to_request(),
); )
.await;
assert_eq!(resp.status(), StatusCode::OK); assert_eq!(resp.status(), StatusCode::OK);
assert!(resp.headers().contains_key(header::SET_COOKIE)) assert!(resp.headers().contains_key(header::SET_COOKIE))
} }
#[test] #[actix_rt::test]
fn test_identity_max_age_time() { async fn test_identity_max_age_time() {
let duration = Duration::days(1); let duration = Duration::days(1);
let mut srv = test::init_service( let mut srv = test::init_service(
App::new() App::new()
@@ -695,17 +694,19 @@ mod tests {
id.remember("test".to_string()); id.remember("test".to_string());
HttpResponse::Ok() HttpResponse::Ok()
})), })),
); )
.await;
let resp = let resp =
test::call_service(&mut srv, TestRequest::with_uri("/login").to_request()); test::call_service(&mut srv, TestRequest::with_uri("/login").to_request())
.await;
assert_eq!(resp.status(), StatusCode::OK); assert_eq!(resp.status(), StatusCode::OK);
assert!(resp.headers().contains_key(header::SET_COOKIE)); assert!(resp.headers().contains_key(header::SET_COOKIE));
let c = resp.response().cookies().next().unwrap().to_owned(); let c = resp.response().cookies().next().unwrap().to_owned();
assert_eq!(duration, c.max_age().unwrap()); assert_eq!(duration, c.max_age().unwrap());
} }
#[test] #[actix_rt::test]
fn test_identity_max_age() { async fn test_identity_max_age() {
let seconds = 60; let seconds = 60;
let mut srv = test::init_service( let mut srv = test::init_service(
App::new() App::new()
@@ -721,16 +722,18 @@ mod tests {
id.remember("test".to_string()); id.remember("test".to_string());
HttpResponse::Ok() HttpResponse::Ok()
})), })),
); )
.await;
let resp = let resp =
test::call_service(&mut srv, TestRequest::with_uri("/login").to_request()); test::call_service(&mut srv, TestRequest::with_uri("/login").to_request())
.await;
assert_eq!(resp.status(), StatusCode::OK); assert_eq!(resp.status(), StatusCode::OK);
assert!(resp.headers().contains_key(header::SET_COOKIE)); assert!(resp.headers().contains_key(header::SET_COOKIE));
let c = resp.response().cookies().next().unwrap().to_owned(); let c = resp.response().cookies().next().unwrap().to_owned();
assert_eq!(Duration::seconds(seconds as i64), c.max_age().unwrap()); assert_eq!(Duration::seconds(seconds as i64), c.max_age().unwrap());
} }
fn create_identity_server< async fn create_identity_server<
F: Fn(CookieIdentityPolicy) -> CookieIdentityPolicy + Sync + Send + Clone + 'static, F: Fn(CookieIdentityPolicy) -> CookieIdentityPolicy + Sync + Send + Clone + 'static,
>( >(
f: F, f: F,
@@ -747,13 +750,16 @@ mod tests {
.secure(false) .secure(false)
.name(COOKIE_NAME)))) .name(COOKIE_NAME))))
.service(web::resource("/").to(|id: Identity| { .service(web::resource("/").to(|id: Identity| {
async move {
let identity = id.identity(); let identity = id.identity();
if identity.is_none() { if identity.is_none() {
id.remember(COOKIE_LOGIN.to_string()) id.remember(COOKIE_LOGIN.to_string())
} }
web::Json(identity) web::Json(identity)
}
})), })),
) )
.await
} }
fn legacy_login_cookie(identity: &'static str) -> Cookie<'static> { fn legacy_login_cookie(identity: &'static str) -> Cookie<'static> {
@@ -786,15 +792,8 @@ mod tests {
jar.get(COOKIE_NAME).unwrap().clone() jar.get(COOKIE_NAME).unwrap().clone()
} }
fn assert_logged_in(response: &mut ServiceResponse, identity: Option<&str>) { async fn assert_logged_in(response: ServiceResponse, identity: Option<&str>) {
use bytes::BytesMut; let bytes = test::read_body(response).await;
use futures::Stream;
let bytes =
test::block_on(response.take_body().fold(BytesMut::new(), |mut b, c| {
b.extend(c);
Ok::<_, Error>(b)
}))
.unwrap();
let resp: Option<String> = serde_json::from_slice(&bytes[..]).unwrap(); let resp: Option<String> = serde_json::from_slice(&bytes[..]).unwrap();
assert_eq!(resp.as_ref().map(|s| s.borrow()), identity); assert_eq!(resp.as_ref().map(|s| s.borrow()), identity);
} }
@@ -872,108 +871,118 @@ mod tests {
assert!(cookies.get(COOKIE_NAME).is_none()); assert!(cookies.get(COOKIE_NAME).is_none());
} }
#[test] #[actix_rt::test]
fn test_identity_legacy_cookie_is_set() { async fn test_identity_legacy_cookie_is_set() {
let mut srv = create_identity_server(|c| c); let mut srv = create_identity_server(|c| c).await;
let mut resp = let mut resp =
test::call_service(&mut srv, TestRequest::with_uri("/").to_request()); test::call_service(&mut srv, TestRequest::with_uri("/").to_request()).await;
assert_logged_in(&mut resp, None);
assert_legacy_login_cookie(&mut resp, COOKIE_LOGIN); assert_legacy_login_cookie(&mut resp, COOKIE_LOGIN);
assert_logged_in(resp, None).await;
} }
#[test] #[actix_rt::test]
fn test_identity_legacy_cookie_works() { async fn test_identity_legacy_cookie_works() {
let mut srv = create_identity_server(|c| c); let mut srv = create_identity_server(|c| c).await;
let cookie = legacy_login_cookie(COOKIE_LOGIN); let cookie = legacy_login_cookie(COOKIE_LOGIN);
let mut resp = test::call_service( let mut resp = test::call_service(
&mut srv, &mut srv,
TestRequest::with_uri("/") TestRequest::with_uri("/")
.cookie(cookie.clone()) .cookie(cookie.clone())
.to_request(), .to_request(),
); )
assert_logged_in(&mut resp, Some(COOKIE_LOGIN)); .await;
assert_no_login_cookie(&mut resp); assert_no_login_cookie(&mut resp);
assert_logged_in(resp, Some(COOKIE_LOGIN)).await;
} }
#[test] #[actix_rt::test]
fn test_identity_legacy_cookie_rejected_if_visit_timestamp_needed() { async fn test_identity_legacy_cookie_rejected_if_visit_timestamp_needed() {
let mut srv = create_identity_server(|c| c.visit_deadline(Duration::days(90))); let mut srv =
create_identity_server(|c| c.visit_deadline(Duration::days(90))).await;
let cookie = legacy_login_cookie(COOKIE_LOGIN); let cookie = legacy_login_cookie(COOKIE_LOGIN);
let mut resp = test::call_service( let mut resp = test::call_service(
&mut srv, &mut srv,
TestRequest::with_uri("/") TestRequest::with_uri("/")
.cookie(cookie.clone()) .cookie(cookie.clone())
.to_request(), .to_request(),
); )
assert_logged_in(&mut resp, None); .await;
assert_login_cookie( assert_login_cookie(
&mut resp, &mut resp,
COOKIE_LOGIN, COOKIE_LOGIN,
LoginTimestampCheck::NoTimestamp, LoginTimestampCheck::NoTimestamp,
VisitTimeStampCheck::NewTimestamp, VisitTimeStampCheck::NewTimestamp,
); );
assert_logged_in(resp, None).await;
} }
#[test] #[actix_rt::test]
fn test_identity_legacy_cookie_rejected_if_login_timestamp_needed() { async fn test_identity_legacy_cookie_rejected_if_login_timestamp_needed() {
let mut srv = create_identity_server(|c| c.login_deadline(Duration::days(90))); let mut srv =
create_identity_server(|c| c.login_deadline(Duration::days(90))).await;
let cookie = legacy_login_cookie(COOKIE_LOGIN); let cookie = legacy_login_cookie(COOKIE_LOGIN);
let mut resp = test::call_service( let mut resp = test::call_service(
&mut srv, &mut srv,
TestRequest::with_uri("/") TestRequest::with_uri("/")
.cookie(cookie.clone()) .cookie(cookie.clone())
.to_request(), .to_request(),
); )
assert_logged_in(&mut resp, None); .await;
assert_login_cookie( assert_login_cookie(
&mut resp, &mut resp,
COOKIE_LOGIN, COOKIE_LOGIN,
LoginTimestampCheck::NewTimestamp, LoginTimestampCheck::NewTimestamp,
VisitTimeStampCheck::NoTimestamp, VisitTimeStampCheck::NoTimestamp,
); );
assert_logged_in(resp, None).await;
} }
#[test] #[actix_rt::test]
fn test_identity_cookie_rejected_if_login_timestamp_needed() { async fn test_identity_cookie_rejected_if_login_timestamp_needed() {
let mut srv = create_identity_server(|c| c.login_deadline(Duration::days(90))); let mut srv =
create_identity_server(|c| c.login_deadline(Duration::days(90))).await;
let cookie = login_cookie(COOKIE_LOGIN, None, Some(SystemTime::now())); let cookie = login_cookie(COOKIE_LOGIN, None, Some(SystemTime::now()));
let mut resp = test::call_service( let mut resp = test::call_service(
&mut srv, &mut srv,
TestRequest::with_uri("/") TestRequest::with_uri("/")
.cookie(cookie.clone()) .cookie(cookie.clone())
.to_request(), .to_request(),
); )
assert_logged_in(&mut resp, None); .await;
assert_login_cookie( assert_login_cookie(
&mut resp, &mut resp,
COOKIE_LOGIN, COOKIE_LOGIN,
LoginTimestampCheck::NewTimestamp, LoginTimestampCheck::NewTimestamp,
VisitTimeStampCheck::NoTimestamp, VisitTimeStampCheck::NoTimestamp,
); );
assert_logged_in(resp, None).await;
} }
#[test] #[actix_rt::test]
fn test_identity_cookie_rejected_if_visit_timestamp_needed() { async fn test_identity_cookie_rejected_if_visit_timestamp_needed() {
let mut srv = create_identity_server(|c| c.visit_deadline(Duration::days(90))); let mut srv =
create_identity_server(|c| c.visit_deadline(Duration::days(90))).await;
let cookie = login_cookie(COOKIE_LOGIN, Some(SystemTime::now()), None); let cookie = login_cookie(COOKIE_LOGIN, Some(SystemTime::now()), None);
let mut resp = test::call_service( let mut resp = test::call_service(
&mut srv, &mut srv,
TestRequest::with_uri("/") TestRequest::with_uri("/")
.cookie(cookie.clone()) .cookie(cookie.clone())
.to_request(), .to_request(),
); )
assert_logged_in(&mut resp, None); .await;
assert_login_cookie( assert_login_cookie(
&mut resp, &mut resp,
COOKIE_LOGIN, COOKIE_LOGIN,
LoginTimestampCheck::NoTimestamp, LoginTimestampCheck::NoTimestamp,
VisitTimeStampCheck::NewTimestamp, VisitTimeStampCheck::NewTimestamp,
); );
assert_logged_in(resp, None).await;
} }
#[test] #[actix_rt::test]
fn test_identity_cookie_rejected_if_login_timestamp_too_old() { async fn test_identity_cookie_rejected_if_login_timestamp_too_old() {
let mut srv = create_identity_server(|c| c.login_deadline(Duration::days(90))); let mut srv =
create_identity_server(|c| c.login_deadline(Duration::days(90))).await;
let cookie = login_cookie( let cookie = login_cookie(
COOKIE_LOGIN, COOKIE_LOGIN,
Some(SystemTime::now() - Duration::days(180).to_std().unwrap()), Some(SystemTime::now() - Duration::days(180).to_std().unwrap()),
@@ -984,19 +993,21 @@ mod tests {
TestRequest::with_uri("/") TestRequest::with_uri("/")
.cookie(cookie.clone()) .cookie(cookie.clone())
.to_request(), .to_request(),
); )
assert_logged_in(&mut resp, None); .await;
assert_login_cookie( assert_login_cookie(
&mut resp, &mut resp,
COOKIE_LOGIN, COOKIE_LOGIN,
LoginTimestampCheck::NewTimestamp, LoginTimestampCheck::NewTimestamp,
VisitTimeStampCheck::NoTimestamp, VisitTimeStampCheck::NoTimestamp,
); );
assert_logged_in(resp, None).await;
} }
#[test] #[actix_rt::test]
fn test_identity_cookie_rejected_if_visit_timestamp_too_old() { async fn test_identity_cookie_rejected_if_visit_timestamp_too_old() {
let mut srv = create_identity_server(|c| c.visit_deadline(Duration::days(90))); let mut srv =
create_identity_server(|c| c.visit_deadline(Duration::days(90))).await;
let cookie = login_cookie( let cookie = login_cookie(
COOKIE_LOGIN, COOKIE_LOGIN,
None, None,
@@ -1007,36 +1018,40 @@ mod tests {
TestRequest::with_uri("/") TestRequest::with_uri("/")
.cookie(cookie.clone()) .cookie(cookie.clone())
.to_request(), .to_request(),
); )
assert_logged_in(&mut resp, None); .await;
assert_login_cookie( assert_login_cookie(
&mut resp, &mut resp,
COOKIE_LOGIN, COOKIE_LOGIN,
LoginTimestampCheck::NoTimestamp, LoginTimestampCheck::NoTimestamp,
VisitTimeStampCheck::NewTimestamp, VisitTimeStampCheck::NewTimestamp,
); );
assert_logged_in(resp, None).await;
} }
#[test] #[actix_rt::test]
fn test_identity_cookie_not_updated_on_login_deadline() { async fn test_identity_cookie_not_updated_on_login_deadline() {
let mut srv = create_identity_server(|c| c.login_deadline(Duration::days(90))); let mut srv =
create_identity_server(|c| c.login_deadline(Duration::days(90))).await;
let cookie = login_cookie(COOKIE_LOGIN, Some(SystemTime::now()), None); let cookie = login_cookie(COOKIE_LOGIN, Some(SystemTime::now()), None);
let mut resp = test::call_service( let mut resp = test::call_service(
&mut srv, &mut srv,
TestRequest::with_uri("/") TestRequest::with_uri("/")
.cookie(cookie.clone()) .cookie(cookie.clone())
.to_request(), .to_request(),
); )
assert_logged_in(&mut resp, Some(COOKIE_LOGIN)); .await;
assert_no_login_cookie(&mut resp); assert_no_login_cookie(&mut resp);
assert_logged_in(resp, Some(COOKIE_LOGIN)).await;
} }
#[test] #[actix_rt::test]
fn test_identity_cookie_updated_on_visit_deadline() { async fn test_identity_cookie_updated_on_visit_deadline() {
let mut srv = create_identity_server(|c| { let mut srv = create_identity_server(|c| {
c.visit_deadline(Duration::days(90)) c.visit_deadline(Duration::days(90))
.login_deadline(Duration::days(90)) .login_deadline(Duration::days(90))
}); })
.await;
let timestamp = SystemTime::now() - Duration::days(1).to_std().unwrap(); let timestamp = SystemTime::now() - Duration::days(1).to_std().unwrap();
let cookie = login_cookie(COOKIE_LOGIN, Some(timestamp), Some(timestamp)); let cookie = login_cookie(COOKIE_LOGIN, Some(timestamp), Some(timestamp));
let mut resp = test::call_service( let mut resp = test::call_service(
@@ -1044,13 +1059,14 @@ mod tests {
TestRequest::with_uri("/") TestRequest::with_uri("/")
.cookie(cookie.clone()) .cookie(cookie.clone())
.to_request(), .to_request(),
); )
assert_logged_in(&mut resp, Some(COOKIE_LOGIN)); .await;
assert_login_cookie( assert_login_cookie(
&mut resp, &mut resp,
COOKIE_LOGIN, COOKIE_LOGIN,
LoginTimestampCheck::OldTimestamp(timestamp), LoginTimestampCheck::OldTimestamp(timestamp),
VisitTimeStampCheck::NewTimestamp, VisitTimeStampCheck::NewTimestamp,
); );
assert_logged_in(resp, Some(COOKIE_LOGIN)).await;
} }
} }

View File

@@ -1,5 +1,9 @@
# Changes # Changes
## [0.2.0-alpha.2] - 2019-12-03
* Migrate to `std::future`
## [0.1.4] - 2019-09-12 ## [0.1.4] - 2019-09-12
* Multipart handling now parses requests which do not end in CRLF #1038 * Multipart handling now parses requests which do not end in CRLF #1038

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-multipart" name = "actix-multipart"
version = "0.1.4" version = "0.2.0-alpha.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Multipart support for actix web framework." description = "Multipart support for actix web framework."
readme = "README.md" readme = "README.md"
@@ -18,17 +18,18 @@ name = "actix_multipart"
path = "src/lib.rs" path = "src/lib.rs"
[dependencies] [dependencies]
actix-web = { version = "1.0.0", default-features = false } actix-web = { version = "2.0.0-alpha.3", default-features = false }
actix-service = "0.4.1" actix-service = "1.0.0-alpha.3"
bytes = "0.4" actix-utils = "1.0.0-alpha.3"
derive_more = "0.15.0" bytes = "0.5.2"
derive_more = "0.99.2"
httparse = "1.3" httparse = "1.3"
futures = "0.1.25" futures = "0.3.1"
log = "0.4" log = "0.4"
mime = "0.3" mime = "0.3"
time = "0.1" time = "0.1"
twoway = "0.2" twoway = "0.2"
[dev-dependencies] [dev-dependencies]
actix-rt = "0.2.2" actix-rt = "1.0.0-alpha.3"
actix-http = "0.2.4" actix-http = "1.0.0-alpha.3"

View File

@@ -5,4 +5,4 @@
* [API Documentation](https://docs.rs/actix-multipart/) * [API Documentation](https://docs.rs/actix-multipart/)
* [Chat on gitter](https://gitter.im/actix/actix) * [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-multipart](https://crates.io/crates/actix-multipart) * Cargo package: [actix-multipart](https://crates.io/crates/actix-multipart)
* Minimum supported Rust version: 1.33 or later * Minimum supported Rust version: 1.39 or later

View File

@@ -1,7 +1,7 @@
//! Error and Result module //! Error and Result module
use actix_web::error::{ParseError, PayloadError}; use actix_web::error::{ParseError, PayloadError};
use actix_web::http::StatusCode; use actix_web::http::StatusCode;
use actix_web::{HttpResponse, ResponseError}; use actix_web::ResponseError;
use derive_more::{Display, From}; use derive_more::{Display, From};
/// A set of errors that can occur during parsing multipart streams /// A set of errors that can occur during parsing multipart streams
@@ -35,14 +35,15 @@ pub enum MultipartError {
/// Return `BadRequest` for `MultipartError` /// Return `BadRequest` for `MultipartError`
impl ResponseError for MultipartError { impl ResponseError for MultipartError {
fn error_response(&self) -> HttpResponse { fn status_code(&self) -> StatusCode {
HttpResponse::new(StatusCode::BAD_REQUEST) StatusCode::BAD_REQUEST
} }
} }
#[cfg(test)] #[cfg(test)]
mod tests { mod tests {
use super::*; use super::*;
use actix_web::HttpResponse;
#[test] #[test]
fn test_multipart_error() { fn test_multipart_error() {

View File

@@ -1,5 +1,6 @@
//! Multipart payload support //! Multipart payload support
use actix_web::{dev::Payload, Error, FromRequest, HttpRequest}; use actix_web::{dev::Payload, Error, FromRequest, HttpRequest};
use futures::future::{ok, Ready};
use crate::server::Multipart; use crate::server::Multipart;
@@ -10,33 +11,31 @@ use crate::server::Multipart;
/// ## Server example /// ## Server example
/// ///
/// ```rust /// ```rust
/// # use futures::{Future, Stream}; /// use futures::{Stream, StreamExt};
/// # use futures::future::{ok, result, Either};
/// use actix_web::{web, HttpResponse, Error}; /// use actix_web::{web, HttpResponse, Error};
/// use actix_multipart as mp; /// use actix_multipart as mp;
/// ///
/// fn index(payload: mp::Multipart) -> impl Future<Item = HttpResponse, Error = Error> { /// async fn index(mut payload: mp::Multipart) -> Result<HttpResponse, Error> {
/// payload.from_err() // <- get multipart stream for current request /// // iterate over multipart stream
/// .and_then(|field| { // <- iterate over multipart items /// while let Some(item) = payload.next().await {
/// let mut field = item?;
///
/// // Field in turn is stream of *Bytes* object /// // Field in turn is stream of *Bytes* object
/// field.from_err() /// while let Some(chunk) = field.next().await {
/// .fold((), |_, chunk| { /// println!("-- CHUNK: \n{:?}", std::str::from_utf8(&chunk?));
/// println!("-- CHUNK: \n{:?}", std::str::from_utf8(&chunk)); /// }
/// Ok::<_, Error>(()) /// }
/// }) /// Ok(HttpResponse::Ok().into())
/// })
/// .fold((), |_, _| Ok::<_, Error>(()))
/// .map(|_| HttpResponse::Ok().into())
/// } /// }
/// # fn main() {} /// # fn main() {}
/// ``` /// ```
impl FromRequest for Multipart { impl FromRequest for Multipart {
type Error = Error; type Error = Error;
type Future = Result<Multipart, Error>; type Future = Ready<Result<Multipart, Error>>;
type Config = (); type Config = ();
#[inline] #[inline]
fn from_request(req: &HttpRequest, payload: &mut Payload) -> Self::Future { fn from_request(req: &HttpRequest, payload: &mut Payload) -> Self::Future {
Ok(Multipart::new(req.headers(), payload.take())) ok(Multipart::new(req.headers(), payload.take()))
} }
} }

View File

@@ -1,20 +1,22 @@
//! Multipart payload support //! Multipart payload support
use std::cell::{Cell, RefCell, RefMut}; use std::cell::{Cell, RefCell, RefMut};
use std::convert::TryFrom;
use std::marker::PhantomData; use std::marker::PhantomData;
use std::pin::Pin;
use std::rc::Rc; use std::rc::Rc;
use std::task::{Context, Poll};
use std::{cmp, fmt}; use std::{cmp, fmt};
use bytes::{Bytes, BytesMut}; use bytes::{Bytes, BytesMut};
use futures::task::{current as current_task, Task}; use futures::stream::{LocalBoxStream, Stream, StreamExt};
use futures::{Async, Poll, Stream};
use httparse; use httparse;
use mime; use mime;
use actix_utils::task::LocalWaker;
use actix_web::error::{ParseError, PayloadError}; use actix_web::error::{ParseError, PayloadError};
use actix_web::http::header::{ use actix_web::http::header::{
self, ContentDisposition, HeaderMap, HeaderName, HeaderValue, self, ContentDisposition, HeaderMap, HeaderName, HeaderValue,
}; };
use actix_web::http::HttpTryFrom;
use crate::error::MultipartError; use crate::error::MultipartError;
@@ -60,7 +62,7 @@ impl Multipart {
/// Create multipart instance for boundary. /// Create multipart instance for boundary.
pub fn new<S>(headers: &HeaderMap, stream: S) -> Multipart pub fn new<S>(headers: &HeaderMap, stream: S) -> Multipart
where where
S: Stream<Item = Bytes, Error = PayloadError> + 'static, S: Stream<Item = Result<Bytes, PayloadError>> + Unpin + 'static,
{ {
match Self::boundary(headers) { match Self::boundary(headers) {
Ok(boundary) => Multipart { Ok(boundary) => Multipart {
@@ -104,22 +106,25 @@ impl Multipart {
} }
impl Stream for Multipart { impl Stream for Multipart {
type Item = Field; type Item = Result<Field, MultipartError>;
type Error = MultipartError;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> { fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context,
) -> Poll<Option<Self::Item>> {
if let Some(err) = self.error.take() { if let Some(err) = self.error.take() {
Err(err) Poll::Ready(Some(Err(err)))
} else if self.safety.current() { } else if self.safety.current() {
let mut inner = self.inner.as_mut().unwrap().borrow_mut(); let this = self.get_mut();
if let Some(mut payload) = inner.payload.get_mut(&self.safety) { let mut inner = this.inner.as_mut().unwrap().borrow_mut();
payload.poll_stream()?; if let Some(mut payload) = inner.payload.get_mut(&this.safety) {
payload.poll_stream(cx)?;
} }
inner.poll(&self.safety) inner.poll(&this.safety, cx)
} else if !self.safety.is_clean() { } else if !self.safety.is_clean() {
Err(MultipartError::NotConsumed) Poll::Ready(Some(Err(MultipartError::NotConsumed)))
} else { } else {
Ok(Async::NotReady) Poll::Pending
} }
} }
} }
@@ -238,9 +243,13 @@ impl InnerMultipart {
Ok(Some(eof)) Ok(Some(eof))
} }
fn poll(&mut self, safety: &Safety) -> Poll<Option<Field>, MultipartError> { fn poll(
&mut self,
safety: &Safety,
cx: &mut Context,
) -> Poll<Option<Result<Field, MultipartError>>> {
if self.state == InnerState::Eof { if self.state == InnerState::Eof {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
// release field // release field
loop { loop {
@@ -249,10 +258,13 @@ impl InnerMultipart {
if safety.current() { if safety.current() {
let stop = match self.item { let stop = match self.item {
InnerMultipartItem::Field(ref mut field) => { InnerMultipartItem::Field(ref mut field) => {
match field.borrow_mut().poll(safety)? { match field.borrow_mut().poll(safety) {
Async::NotReady => return Ok(Async::NotReady), Poll::Pending => return Poll::Pending,
Async::Ready(Some(_)) => continue, Poll::Ready(Some(Ok(_))) => continue,
Async::Ready(None) => true, Poll::Ready(Some(Err(e))) => {
return Poll::Ready(Some(Err(e)))
}
Poll::Ready(None) => true,
} }
} }
InnerMultipartItem::None => false, InnerMultipartItem::None => false,
@@ -277,12 +289,12 @@ impl InnerMultipart {
Some(eof) => { Some(eof) => {
if eof { if eof {
self.state = InnerState::Eof; self.state = InnerState::Eof;
return Ok(Async::Ready(None)); return Poll::Ready(None);
} else { } else {
self.state = InnerState::Headers; self.state = InnerState::Headers;
} }
} }
None => return Ok(Async::NotReady), None => return Poll::Pending,
} }
} }
// read boundary // read boundary
@@ -291,11 +303,11 @@ impl InnerMultipart {
&mut *payload, &mut *payload,
&self.boundary, &self.boundary,
)? { )? {
None => return Ok(Async::NotReady), None => return Poll::Pending,
Some(eof) => { Some(eof) => {
if eof { if eof {
self.state = InnerState::Eof; self.state = InnerState::Eof;
return Ok(Async::Ready(None)); return Poll::Ready(None);
} else { } else {
self.state = InnerState::Headers; self.state = InnerState::Headers;
} }
@@ -311,14 +323,14 @@ impl InnerMultipart {
self.state = InnerState::Boundary; self.state = InnerState::Boundary;
headers headers
} else { } else {
return Ok(Async::NotReady); return Poll::Pending;
} }
} else { } else {
unreachable!() unreachable!()
} }
} else { } else {
log::debug!("NotReady: field is in flight"); log::debug!("NotReady: field is in flight");
return Ok(Async::NotReady); return Poll::Pending;
}; };
// content type // content type
@@ -335,7 +347,7 @@ impl InnerMultipart {
// nested multipart stream // nested multipart stream
if mt.type_() == mime::MULTIPART { if mt.type_() == mime::MULTIPART {
Err(MultipartError::Nested) Poll::Ready(Some(Err(MultipartError::Nested)))
} else { } else {
let field = Rc::new(RefCell::new(InnerField::new( let field = Rc::new(RefCell::new(InnerField::new(
self.payload.clone(), self.payload.clone(),
@@ -344,12 +356,7 @@ impl InnerMultipart {
)?)); )?));
self.item = InnerMultipartItem::Field(Rc::clone(&field)); self.item = InnerMultipartItem::Field(Rc::clone(&field));
Ok(Async::Ready(Some(Field::new( Poll::Ready(Some(Ok(Field::new(safety.clone(cx), headers, mt, field))))
safety.clone(),
headers,
mt,
field,
))))
} }
} }
} }
@@ -409,23 +416,21 @@ impl Field {
} }
impl Stream for Field { impl Stream for Field {
type Item = Bytes; type Item = Result<Bytes, MultipartError>;
type Error = MultipartError;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> { fn poll_next(self: Pin<&mut Self>, cx: &mut Context) -> Poll<Option<Self::Item>> {
if self.safety.current() { if self.safety.current() {
let mut inner = self.inner.borrow_mut(); let mut inner = self.inner.borrow_mut();
if let Some(mut payload) = if let Some(mut payload) =
inner.payload.as_ref().unwrap().get_mut(&self.safety) inner.payload.as_ref().unwrap().get_mut(&self.safety)
{ {
payload.poll_stream()?; payload.poll_stream(cx)?;
} }
inner.poll(&self.safety) inner.poll(&self.safety)
} else if !self.safety.is_clean() { } else if !self.safety.is_clean() {
Err(MultipartError::NotConsumed) Poll::Ready(Some(Err(MultipartError::NotConsumed)))
} else { } else {
Ok(Async::NotReady) Poll::Pending
} }
} }
} }
@@ -482,9 +487,9 @@ impl InnerField {
fn read_len( fn read_len(
payload: &mut PayloadBuffer, payload: &mut PayloadBuffer,
size: &mut u64, size: &mut u64,
) -> Poll<Option<Bytes>, MultipartError> { ) -> Poll<Option<Result<Bytes, MultipartError>>> {
if *size == 0 { if *size == 0 {
Ok(Async::Ready(None)) Poll::Ready(None)
} else { } else {
match payload.read_max(*size)? { match payload.read_max(*size)? {
Some(mut chunk) => { Some(mut chunk) => {
@@ -494,13 +499,13 @@ impl InnerField {
if !chunk.is_empty() { if !chunk.is_empty() {
payload.unprocessed(chunk); payload.unprocessed(chunk);
} }
Ok(Async::Ready(Some(ch))) Poll::Ready(Some(Ok(ch)))
} }
None => { None => {
if payload.eof && (*size != 0) { if payload.eof && (*size != 0) {
Err(MultipartError::Incomplete) Poll::Ready(Some(Err(MultipartError::Incomplete)))
} else { } else {
Ok(Async::NotReady) Poll::Pending
} }
} }
} }
@@ -512,15 +517,15 @@ impl InnerField {
fn read_stream( fn read_stream(
payload: &mut PayloadBuffer, payload: &mut PayloadBuffer,
boundary: &str, boundary: &str,
) -> Poll<Option<Bytes>, MultipartError> { ) -> Poll<Option<Result<Bytes, MultipartError>>> {
let mut pos = 0; let mut pos = 0;
let len = payload.buf.len(); let len = payload.buf.len();
if len == 0 { if len == 0 {
return if payload.eof { return if payload.eof {
Err(MultipartError::Incomplete) Poll::Ready(Some(Err(MultipartError::Incomplete)))
} else { } else {
Ok(Async::NotReady) Poll::Pending
}; };
} }
@@ -537,10 +542,10 @@ impl InnerField {
if let Some(b_len) = b_len { if let Some(b_len) = b_len {
let b_size = boundary.len() + b_len; let b_size = boundary.len() + b_len;
if len < b_size { if len < b_size {
return Ok(Async::NotReady); return Poll::Pending;
} else if &payload.buf[b_len..b_size] == boundary.as_bytes() { } else if &payload.buf[b_len..b_size] == boundary.as_bytes() {
// found boundary // found boundary
return Ok(Async::Ready(None)); return Poll::Ready(None);
} }
} }
} }
@@ -552,9 +557,9 @@ impl InnerField {
// check if we have enough data for boundary detection // check if we have enough data for boundary detection
if cur + 4 > len { if cur + 4 > len {
if cur > 0 { if cur > 0 {
Ok(Async::Ready(Some(payload.buf.split_to(cur).freeze()))) Poll::Ready(Some(Ok(payload.buf.split_to(cur).freeze())))
} else { } else {
Ok(Async::NotReady) Poll::Pending
} }
} else { } else {
// check boundary // check boundary
@@ -565,7 +570,7 @@ impl InnerField {
{ {
if cur != 0 { if cur != 0 {
// return buffer // return buffer
Ok(Async::Ready(Some(payload.buf.split_to(cur).freeze()))) Poll::Ready(Some(Ok(payload.buf.split_to(cur).freeze())))
} else { } else {
pos = cur + 1; pos = cur + 1;
continue; continue;
@@ -577,49 +582,51 @@ impl InnerField {
} }
} }
} else { } else {
Ok(Async::Ready(Some(payload.buf.take().freeze()))) Poll::Ready(Some(Ok(payload.buf.split().freeze())))
}; };
} }
} }
fn poll(&mut self, s: &Safety) -> Poll<Option<Bytes>, MultipartError> { fn poll(&mut self, s: &Safety) -> Poll<Option<Result<Bytes, MultipartError>>> {
if self.payload.is_none() { if self.payload.is_none() {
return Ok(Async::Ready(None)); return Poll::Ready(None);
} }
let result = if let Some(mut payload) = self.payload.as_ref().unwrap().get_mut(s) let result = if let Some(mut payload) = self.payload.as_ref().unwrap().get_mut(s)
{ {
if !self.eof { if !self.eof {
let res = if let Some(ref mut len) = self.length { let res = if let Some(ref mut len) = self.length {
InnerField::read_len(&mut *payload, len)? InnerField::read_len(&mut *payload, len)
} else { } else {
InnerField::read_stream(&mut *payload, &self.boundary)? InnerField::read_stream(&mut *payload, &self.boundary)
}; };
match res { match res {
Async::NotReady => return Ok(Async::NotReady), Poll::Pending => return Poll::Pending,
Async::Ready(Some(bytes)) => return Ok(Async::Ready(Some(bytes))), Poll::Ready(Some(Ok(bytes))) => return Poll::Ready(Some(Ok(bytes))),
Async::Ready(None) => self.eof = true, Poll::Ready(Some(Err(e))) => return Poll::Ready(Some(Err(e))),
Poll::Ready(None) => self.eof = true,
} }
} }
match payload.readline()? { match payload.readline() {
None => Async::Ready(None), Ok(None) => Poll::Ready(None),
Some(line) => { Ok(Some(line)) => {
if line.as_ref() != b"\r\n" { if line.as_ref() != b"\r\n" {
log::warn!("multipart field did not read all the data or it is malformed"); log::warn!("multipart field did not read all the data or it is malformed");
} }
Async::Ready(None) Poll::Ready(None)
} }
Err(e) => Poll::Ready(Some(Err(e))),
} }
} else { } else {
Async::NotReady Poll::Pending
}; };
if Async::Ready(None) == result { if let Poll::Ready(None) = result {
self.payload.take(); self.payload.take();
} }
Ok(result) result
} }
} }
@@ -659,7 +666,7 @@ impl Clone for PayloadRef {
/// most task. /// most task.
#[derive(Debug)] #[derive(Debug)]
struct Safety { struct Safety {
task: Option<Task>, task: LocalWaker,
level: usize, level: usize,
payload: Rc<PhantomData<bool>>, payload: Rc<PhantomData<bool>>,
clean: Rc<Cell<bool>>, clean: Rc<Cell<bool>>,
@@ -669,7 +676,7 @@ impl Safety {
fn new() -> Safety { fn new() -> Safety {
let payload = Rc::new(PhantomData); let payload = Rc::new(PhantomData);
Safety { Safety {
task: None, task: LocalWaker::new(),
level: Rc::strong_count(&payload), level: Rc::strong_count(&payload),
clean: Rc::new(Cell::new(true)), clean: Rc::new(Cell::new(true)),
payload, payload,
@@ -683,17 +690,17 @@ impl Safety {
fn is_clean(&self) -> bool { fn is_clean(&self) -> bool {
self.clean.get() self.clean.get()
} }
}
impl Clone for Safety { fn clone(&self, cx: &mut Context) -> Safety {
fn clone(&self) -> Safety {
let payload = Rc::clone(&self.payload); let payload = Rc::clone(&self.payload);
Safety { let s = Safety {
task: Some(current_task()), task: LocalWaker::new(),
level: Rc::strong_count(&payload), level: Rc::strong_count(&payload),
clean: self.clean.clone(), clean: self.clean.clone(),
payload, payload,
} };
s.task.register(cx.waker());
s
} }
} }
@@ -704,7 +711,7 @@ impl Drop for Safety {
self.clean.set(true); self.clean.set(true);
} }
if let Some(task) = self.task.take() { if let Some(task) = self.task.take() {
task.notify() task.wake()
} }
} }
} }
@@ -713,31 +720,32 @@ impl Drop for Safety {
struct PayloadBuffer { struct PayloadBuffer {
eof: bool, eof: bool,
buf: BytesMut, buf: BytesMut,
stream: Box<dyn Stream<Item = Bytes, Error = PayloadError>>, stream: LocalBoxStream<'static, Result<Bytes, PayloadError>>,
} }
impl PayloadBuffer { impl PayloadBuffer {
/// Create new `PayloadBuffer` instance /// Create new `PayloadBuffer` instance
fn new<S>(stream: S) -> Self fn new<S>(stream: S) -> Self
where where
S: Stream<Item = Bytes, Error = PayloadError> + 'static, S: Stream<Item = Result<Bytes, PayloadError>> + 'static,
{ {
PayloadBuffer { PayloadBuffer {
eof: false, eof: false,
buf: BytesMut::new(), buf: BytesMut::new(),
stream: Box::new(stream), stream: stream.boxed_local(),
} }
} }
fn poll_stream(&mut self) -> Result<(), PayloadError> { fn poll_stream(&mut self, cx: &mut Context) -> Result<(), PayloadError> {
loop { loop {
match self.stream.poll()? { match Pin::new(&mut self.stream).poll_next(cx) {
Async::Ready(Some(data)) => self.buf.extend_from_slice(&data), Poll::Ready(Some(Ok(data))) => self.buf.extend_from_slice(&data),
Async::Ready(None) => { Poll::Ready(Some(Err(e))) => return Err(e),
Poll::Ready(None) => {
self.eof = true; self.eof = true;
return Ok(()); return Ok(());
} }
Async::NotReady => return Ok(()), Poll::Pending => return Ok(()),
} }
} }
} }
@@ -784,7 +792,7 @@ impl PayloadBuffer {
pub fn readline_or_eof(&mut self) -> Result<Option<Bytes>, MultipartError> { pub fn readline_or_eof(&mut self) -> Result<Option<Bytes>, MultipartError> {
match self.readline() { match self.readline() {
Err(MultipartError::Incomplete) if self.eof => { Err(MultipartError::Incomplete) if self.eof => {
Ok(Some(self.buf.take().freeze())) Ok(Some(self.buf.split().freeze()))
} }
line => line, line => line,
} }
@@ -792,7 +800,7 @@ impl PayloadBuffer {
/// Put unprocessed data back to the buffer /// Put unprocessed data back to the buffer
pub fn unprocessed(&mut self, data: Bytes) { pub fn unprocessed(&mut self, data: Bytes) {
let buf = BytesMut::from(data); let buf = BytesMut::from(data.as_ref());
let buf = std::mem::replace(&mut self.buf, buf); let buf = std::mem::replace(&mut self.buf, buf);
self.buf.extend_from_slice(&buf); self.buf.extend_from_slice(&buf);
} }
@@ -800,16 +808,16 @@ impl PayloadBuffer {
#[cfg(test)] #[cfg(test)]
mod tests { mod tests {
use actix_http::h1::Payload;
use bytes::Bytes;
use futures::unsync::mpsc;
use super::*; use super::*;
use actix_web::http::header::{DispositionParam, DispositionType};
use actix_web::test::run_on;
#[test] use actix_http::h1::Payload;
fn test_boundary() { use actix_utils::mpsc;
use actix_web::http::header::{DispositionParam, DispositionType};
use bytes::Bytes;
use futures::future::lazy;
#[actix_rt::test]
async fn test_boundary() {
let headers = HeaderMap::new(); let headers = HeaderMap::new();
match Multipart::boundary(&headers) { match Multipart::boundary(&headers) {
Err(MultipartError::NoContentType) => (), Err(MultipartError::NoContentType) => (),
@@ -852,12 +860,12 @@ mod tests {
} }
fn create_stream() -> ( fn create_stream() -> (
mpsc::UnboundedSender<Result<Bytes, PayloadError>>, mpsc::Sender<Result<Bytes, PayloadError>>,
impl Stream<Item = Bytes, Error = PayloadError>, impl Stream<Item = Result<Bytes, PayloadError>>,
) { ) {
let (tx, rx) = mpsc::unbounded(); let (tx, rx) = mpsc::channel();
(tx, rx.map_err(|_| panic!()).and_then(|res| res)) (tx, rx.map(|res| res.map_err(|_| panic!())))
} }
fn create_simple_request_with_header() -> (Bytes, HeaderMap) { fn create_simple_request_with_header() -> (Bytes, HeaderMap) {
@@ -882,46 +890,43 @@ mod tests {
(bytes, headers) (bytes, headers)
} }
#[test] #[actix_rt::test]
fn test_multipart_no_end_crlf() { async fn test_multipart_no_end_crlf() {
run_on(|| {
let (sender, payload) = create_stream(); let (sender, payload) = create_stream();
let (bytes, headers) = create_simple_request_with_header(); let (mut bytes, headers) = create_simple_request_with_header();
let bytes_stripped = bytes.slice_to(bytes.len()); // strip crlf let bytes_stripped = bytes.split_to(bytes.len()); // strip crlf
sender.unbounded_send(Ok(bytes_stripped)).unwrap(); sender.send(Ok(bytes_stripped)).unwrap();
drop(sender); // eof drop(sender); // eof
let mut multipart = Multipart::new(&headers, payload); let mut multipart = Multipart::new(&headers, payload);
match multipart.poll().unwrap() { match multipart.next().await.unwrap() {
Async::Ready(Some(_)) => (), Ok(_) => (),
_ => unreachable!(), _ => unreachable!(),
} }
match multipart.poll().unwrap() { match multipart.next().await.unwrap() {
Async::Ready(Some(_)) => (), Ok(_) => (),
_ => unreachable!(), _ => unreachable!(),
} }
match multipart.poll().unwrap() { match multipart.next().await {
Async::Ready(None) => (), None => (),
_ => unreachable!(), _ => unreachable!(),
} }
})
} }
#[test] #[actix_rt::test]
fn test_multipart() { async fn test_multipart() {
run_on(|| {
let (sender, payload) = create_stream(); let (sender, payload) = create_stream();
let (bytes, headers) = create_simple_request_with_header(); let (bytes, headers) = create_simple_request_with_header();
sender.unbounded_send(Ok(bytes)).unwrap(); sender.send(Ok(bytes)).unwrap();
let mut multipart = Multipart::new(&headers, payload); let mut multipart = Multipart::new(&headers, payload);
match multipart.poll().unwrap() { match multipart.next().await {
Async::Ready(Some(mut field)) => { Some(Ok(mut field)) => {
let cd = field.content_disposition().unwrap(); let cd = field.content_disposition().unwrap();
assert_eq!(cd.disposition, DispositionType::FormData); assert_eq!(cd.disposition, DispositionType::FormData);
assert_eq!(cd.parameters[0], DispositionParam::Name("file".into())); assert_eq!(cd.parameters[0], DispositionParam::Name("file".into()));
@@ -929,53 +934,51 @@ mod tests {
assert_eq!(field.content_type().type_(), mime::TEXT); assert_eq!(field.content_type().type_(), mime::TEXT);
assert_eq!(field.content_type().subtype(), mime::PLAIN); assert_eq!(field.content_type().subtype(), mime::PLAIN);
match field.poll().unwrap() { match field.next().await.unwrap() {
Async::Ready(Some(chunk)) => assert_eq!(chunk, "test"), Ok(chunk) => assert_eq!(chunk, "test"),
_ => unreachable!(), _ => unreachable!(),
} }
match field.poll().unwrap() { match field.next().await {
Async::Ready(None) => (), None => (),
_ => unreachable!(), _ => unreachable!(),
} }
} }
_ => unreachable!(), _ => unreachable!(),
} }
match multipart.poll().unwrap() { match multipart.next().await.unwrap() {
Async::Ready(Some(mut field)) => { Ok(mut field) => {
assert_eq!(field.content_type().type_(), mime::TEXT); assert_eq!(field.content_type().type_(), mime::TEXT);
assert_eq!(field.content_type().subtype(), mime::PLAIN); assert_eq!(field.content_type().subtype(), mime::PLAIN);
match field.poll() { match field.next().await {
Ok(Async::Ready(Some(chunk))) => assert_eq!(chunk, "data"), Some(Ok(chunk)) => assert_eq!(chunk, "data"),
_ => unreachable!(), _ => unreachable!(),
} }
match field.poll() { match field.next().await {
Ok(Async::Ready(None)) => (), None => (),
_ => unreachable!(), _ => unreachable!(),
} }
} }
_ => unreachable!(), _ => unreachable!(),
} }
match multipart.poll().unwrap() { match multipart.next().await {
Async::Ready(None) => (), None => (),
_ => unreachable!(), _ => unreachable!(),
} }
});
} }
#[test] #[actix_rt::test]
fn test_stream() { async fn test_stream() {
run_on(|| {
let (sender, payload) = create_stream(); let (sender, payload) = create_stream();
let (bytes, headers) = create_simple_request_with_header(); let (bytes, headers) = create_simple_request_with_header();
sender.unbounded_send(Ok(bytes)).unwrap(); sender.send(Ok(bytes)).unwrap();
let mut multipart = Multipart::new(&headers, payload); let mut multipart = Multipart::new(&headers, payload);
match multipart.poll().unwrap() { match multipart.next().await.unwrap() {
Async::Ready(Some(mut field)) => { Ok(mut field) => {
let cd = field.content_disposition().unwrap(); let cd = field.content_disposition().unwrap();
assert_eq!(cd.disposition, DispositionType::FormData); assert_eq!(cd.disposition, DispositionType::FormData);
assert_eq!(cd.parameters[0], DispositionParam::Name("file".into())); assert_eq!(cd.parameters[0], DispositionParam::Name("file".into()));
@@ -983,92 +986,84 @@ mod tests {
assert_eq!(field.content_type().type_(), mime::TEXT); assert_eq!(field.content_type().type_(), mime::TEXT);
assert_eq!(field.content_type().subtype(), mime::PLAIN); assert_eq!(field.content_type().subtype(), mime::PLAIN);
match field.poll().unwrap() { match field.next().await.unwrap() {
Async::Ready(Some(chunk)) => assert_eq!(chunk, "test"), Ok(chunk) => assert_eq!(chunk, "test"),
_ => unreachable!(), _ => unreachable!(),
} }
match field.poll().unwrap() { match field.next().await {
Async::Ready(None) => (), None => (),
_ => unreachable!(), _ => unreachable!(),
} }
} }
_ => unreachable!(), _ => unreachable!(),
} }
match multipart.poll().unwrap() { match multipart.next().await {
Async::Ready(Some(mut field)) => { Some(Ok(mut field)) => {
assert_eq!(field.content_type().type_(), mime::TEXT); assert_eq!(field.content_type().type_(), mime::TEXT);
assert_eq!(field.content_type().subtype(), mime::PLAIN); assert_eq!(field.content_type().subtype(), mime::PLAIN);
match field.poll() { match field.next().await {
Ok(Async::Ready(Some(chunk))) => assert_eq!(chunk, "data"), Some(Ok(chunk)) => assert_eq!(chunk, "data"),
_ => unreachable!(), _ => unreachable!(),
} }
match field.poll() { match field.next().await {
Ok(Async::Ready(None)) => (), None => (),
_ => unreachable!(), _ => unreachable!(),
} }
} }
_ => unreachable!(), _ => unreachable!(),
} }
match multipart.poll().unwrap() { match multipart.next().await {
Async::Ready(None) => (), None => (),
_ => unreachable!(), _ => unreachable!(),
} }
});
} }
#[test] #[actix_rt::test]
fn test_basic() { async fn test_basic() {
run_on(|| {
let (_, payload) = Payload::create(false); let (_, payload) = Payload::create(false);
let mut payload = PayloadBuffer::new(payload); let mut payload = PayloadBuffer::new(payload);
assert_eq!(payload.buf.len(), 0); assert_eq!(payload.buf.len(), 0);
payload.poll_stream().unwrap(); lazy(|cx| payload.poll_stream(cx)).await.unwrap();
assert_eq!(None, payload.read_max(1).unwrap()); assert_eq!(None, payload.read_max(1).unwrap());
})
} }
#[test] #[actix_rt::test]
fn test_eof() { async fn test_eof() {
run_on(|| {
let (mut sender, payload) = Payload::create(false); let (mut sender, payload) = Payload::create(false);
let mut payload = PayloadBuffer::new(payload); let mut payload = PayloadBuffer::new(payload);
assert_eq!(None, payload.read_max(4).unwrap()); assert_eq!(None, payload.read_max(4).unwrap());
sender.feed_data(Bytes::from("data")); sender.feed_data(Bytes::from("data"));
sender.feed_eof(); sender.feed_eof();
payload.poll_stream().unwrap(); lazy(|cx| payload.poll_stream(cx)).await.unwrap();
assert_eq!(Some(Bytes::from("data")), payload.read_max(4).unwrap()); assert_eq!(Some(Bytes::from("data")), payload.read_max(4).unwrap());
assert_eq!(payload.buf.len(), 0); assert_eq!(payload.buf.len(), 0);
assert!(payload.read_max(1).is_err()); assert!(payload.read_max(1).is_err());
assert!(payload.eof); assert!(payload.eof);
})
} }
#[test] #[actix_rt::test]
fn test_err() { async fn test_err() {
run_on(|| {
let (mut sender, payload) = Payload::create(false); let (mut sender, payload) = Payload::create(false);
let mut payload = PayloadBuffer::new(payload); let mut payload = PayloadBuffer::new(payload);
assert_eq!(None, payload.read_max(1).unwrap()); assert_eq!(None, payload.read_max(1).unwrap());
sender.set_error(PayloadError::Incomplete(None)); sender.set_error(PayloadError::Incomplete(None));
payload.poll_stream().err().unwrap(); lazy(|cx| payload.poll_stream(cx)).await.err().unwrap();
})
} }
#[test] #[actix_rt::test]
fn test_readmax() { async fn test_readmax() {
run_on(|| {
let (mut sender, payload) = Payload::create(false); let (mut sender, payload) = Payload::create(false);
let mut payload = PayloadBuffer::new(payload); let mut payload = PayloadBuffer::new(payload);
sender.feed_data(Bytes::from("line1")); sender.feed_data(Bytes::from("line1"));
sender.feed_data(Bytes::from("line2")); sender.feed_data(Bytes::from("line2"));
payload.poll_stream().unwrap(); lazy(|cx| payload.poll_stream(cx)).await.unwrap();
assert_eq!(payload.buf.len(), 10); assert_eq!(payload.buf.len(), 10);
assert_eq!(Some(Bytes::from("line1")), payload.read_max(5).unwrap()); assert_eq!(Some(Bytes::from("line1")), payload.read_max(5).unwrap());
@@ -1076,12 +1071,10 @@ mod tests {
assert_eq!(Some(Bytes::from("line2")), payload.read_max(5).unwrap()); assert_eq!(Some(Bytes::from("line2")), payload.read_max(5).unwrap());
assert_eq!(payload.buf.len(), 0); assert_eq!(payload.buf.len(), 0);
})
} }
#[test] #[actix_rt::test]
fn test_readexactly() { async fn test_readexactly() {
run_on(|| {
let (mut sender, payload) = Payload::create(false); let (mut sender, payload) = Payload::create(false);
let mut payload = PayloadBuffer::new(payload); let mut payload = PayloadBuffer::new(payload);
@@ -1089,19 +1082,17 @@ mod tests {
sender.feed_data(Bytes::from("line1")); sender.feed_data(Bytes::from("line1"));
sender.feed_data(Bytes::from("line2")); sender.feed_data(Bytes::from("line2"));
payload.poll_stream().unwrap(); lazy(|cx| payload.poll_stream(cx)).await.unwrap();
assert_eq!(Some(Bytes::from_static(b"li")), payload.read_exact(2)); assert_eq!(Some(Bytes::from_static(b"li")), payload.read_exact(2));
assert_eq!(payload.buf.len(), 8); assert_eq!(payload.buf.len(), 8);
assert_eq!(Some(Bytes::from_static(b"ne1l")), payload.read_exact(4)); assert_eq!(Some(Bytes::from_static(b"ne1l")), payload.read_exact(4));
assert_eq!(payload.buf.len(), 4); assert_eq!(payload.buf.len(), 4);
})
} }
#[test] #[actix_rt::test]
fn test_readuntil() { async fn test_readuntil() {
run_on(|| {
let (mut sender, payload) = Payload::create(false); let (mut sender, payload) = Payload::create(false);
let mut payload = PayloadBuffer::new(payload); let mut payload = PayloadBuffer::new(payload);
@@ -1109,7 +1100,7 @@ mod tests {
sender.feed_data(Bytes::from("line1")); sender.feed_data(Bytes::from("line1"));
sender.feed_data(Bytes::from("line2")); sender.feed_data(Bytes::from("line2"));
payload.poll_stream().unwrap(); lazy(|cx| payload.poll_stream(cx)).await.unwrap();
assert_eq!( assert_eq!(
Some(Bytes::from("line")), Some(Bytes::from("line")),
@@ -1122,6 +1113,5 @@ mod tests {
payload.read_until(b"2").unwrap() payload.read_until(b"2").unwrap()
); );
assert_eq!(payload.buf.len(), 0); assert_eq!(payload.buf.len(), 0);
})
} }
} }

View File

@@ -1,5 +1,13 @@
# Changes # Changes
## [0.3.0-alpha.3] - 2019-12-xx
* Add access to the session from RequestHead for use of session from guard methods
* Migrate to `std::future`
* Migrate to `actix-web` 2.0
## [0.2.0] - 2019-07-08 ## [0.2.0] - 2019-07-08
* Enhanced ``actix-session`` to facilitate state changes. Use ``Session.renew()`` * Enhanced ``actix-session`` to facilitate state changes. Use ``Session.renew()``

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-session" name = "actix-session"
version = "0.2.0" version = "0.3.0-alpha.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Session for actix web framework." description = "Session for actix web framework."
readme = "README.md" readme = "README.md"
@@ -24,15 +24,14 @@ default = ["cookie-session"]
cookie-session = ["actix-web/secure-cookies"] cookie-session = ["actix-web/secure-cookies"]
[dependencies] [dependencies]
actix-web = "1.0.0" actix-web = "2.0.0-alpha.3"
actix-service = "0.4.1" actix-service = "1.0.0-alpha.3"
bytes = "0.4" bytes = "0.5.2"
derive_more = "0.15.0" derive_more = "0.99.2"
futures = "0.1.25" futures = "0.3.1"
hashbrown = "0.5.0"
serde = "1.0" serde = "1.0"
serde_json = "1.0" serde_json = "1.0"
time = "0.1.42" time = "0.1.42"
[dev-dependencies] [dev-dependencies]
actix-rt = "0.2.2" actix-rt = "1.0.0-alpha.3"

View File

@@ -17,6 +17,7 @@
use std::collections::HashMap; use std::collections::HashMap;
use std::rc::Rc; use std::rc::Rc;
use std::task::{Context, Poll};
use actix_service::{Service, Transform}; use actix_service::{Service, Transform};
use actix_web::cookie::{Cookie, CookieJar, Key, SameSite}; use actix_web::cookie::{Cookie, CookieJar, Key, SameSite};
@@ -24,8 +25,7 @@ use actix_web::dev::{ServiceRequest, ServiceResponse};
use actix_web::http::{header::SET_COOKIE, HeaderValue}; use actix_web::http::{header::SET_COOKIE, HeaderValue};
use actix_web::{Error, HttpMessage, ResponseError}; use actix_web::{Error, HttpMessage, ResponseError};
use derive_more::{Display, From}; use derive_more::{Display, From};
use futures::future::{ok, Future, FutureResult}; use futures::future::{ok, FutureExt, LocalBoxFuture, Ready};
use futures::Poll;
use serde_json::error::Error as JsonError; use serde_json::error::Error as JsonError;
use crate::{Session, SessionStatus}; use crate::{Session, SessionStatus};
@@ -284,7 +284,7 @@ where
type Error = S::Error; type Error = S::Error;
type InitError = (); type InitError = ();
type Transform = CookieSessionMiddleware<S>; type Transform = CookieSessionMiddleware<S>;
type Future = FutureResult<Self::Transform, Self::InitError>; type Future = Ready<Result<Self::Transform, Self::InitError>>;
fn new_transform(&self, service: S) -> Self::Future { fn new_transform(&self, service: S) -> Self::Future {
ok(CookieSessionMiddleware { ok(CookieSessionMiddleware {
@@ -309,10 +309,10 @@ where
type Request = ServiceRequest; type Request = ServiceRequest;
type Response = ServiceResponse<B>; type Response = ServiceResponse<B>;
type Error = S::Error; type Error = S::Error;
type Future = Box<dyn Future<Item = Self::Response, Error = Self::Error>>; type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> { fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.service.poll_ready() self.service.poll_ready(cx)
} }
/// On first request, a new session cookie is returned in response, regardless /// On first request, a new session cookie is returned in response, regardless
@@ -325,7 +325,10 @@ where
let (is_new, state) = self.inner.load(&req); let (is_new, state) = self.inner.load(&req);
Session::set_session(state.into_iter(), &mut req); Session::set_session(state.into_iter(), &mut req);
Box::new(self.service.call(req).map(move |mut res| { let fut = self.service.call(req);
async move {
fut.await.map(|mut res| {
match Session::get_changes(&mut res) { match Session::get_changes(&mut res) {
(SessionStatus::Changed, Some(state)) (SessionStatus::Changed, Some(state))
| (SessionStatus::Renewed, Some(state)) => { | (SessionStatus::Renewed, Some(state)) => {
@@ -336,7 +339,9 @@ where
{ {
if is_new { if is_new {
let state: HashMap<String, String> = HashMap::new(); let state: HashMap<String, String> = HashMap::new();
res.checked_expr(|res| inner.set_cookie(res, state.into_iter())) res.checked_expr(|res| {
inner.set_cookie(res, state.into_iter())
})
} else { } else {
res res
} }
@@ -347,7 +352,9 @@ where
} }
_ => res, _ => res,
} }
})) })
}
.boxed_local()
} }
} }
@@ -357,19 +364,22 @@ mod tests {
use actix_web::{test, web, App}; use actix_web::{test, web, App};
use bytes::Bytes; use bytes::Bytes;
#[test] #[actix_rt::test]
fn cookie_session() { async fn cookie_session() {
let mut app = test::init_service( let mut app = test::init_service(
App::new() App::new()
.wrap(CookieSession::signed(&[0; 32]).secure(false)) .wrap(CookieSession::signed(&[0; 32]).secure(false))
.service(web::resource("/").to(|ses: Session| { .service(web::resource("/").to(|ses: Session| {
async move {
let _ = ses.set("counter", 100); let _ = ses.set("counter", 100);
"test" "test"
}
})), })),
); )
.await;
let request = test::TestRequest::get().to_request(); let request = test::TestRequest::get().to_request();
let response = test::block_on(app.call(request)).unwrap(); let response = app.call(request).await.unwrap();
assert!(response assert!(response
.response() .response()
.cookies() .cookies()
@@ -377,19 +387,22 @@ mod tests {
.is_some()); .is_some());
} }
#[test] #[actix_rt::test]
fn private_cookie() { async fn private_cookie() {
let mut app = test::init_service( let mut app = test::init_service(
App::new() App::new()
.wrap(CookieSession::private(&[0; 32]).secure(false)) .wrap(CookieSession::private(&[0; 32]).secure(false))
.service(web::resource("/").to(|ses: Session| { .service(web::resource("/").to(|ses: Session| {
async move {
let _ = ses.set("counter", 100); let _ = ses.set("counter", 100);
"test" "test"
}
})), })),
); )
.await;
let request = test::TestRequest::get().to_request(); let request = test::TestRequest::get().to_request();
let response = test::block_on(app.call(request)).unwrap(); let response = app.call(request).await.unwrap();
assert!(response assert!(response
.response() .response()
.cookies() .cookies()
@@ -397,19 +410,22 @@ mod tests {
.is_some()); .is_some());
} }
#[test] #[actix_rt::test]
fn cookie_session_extractor() { async fn cookie_session_extractor() {
let mut app = test::init_service( let mut app = test::init_service(
App::new() App::new()
.wrap(CookieSession::signed(&[0; 32]).secure(false)) .wrap(CookieSession::signed(&[0; 32]).secure(false))
.service(web::resource("/").to(|ses: Session| { .service(web::resource("/").to(|ses: Session| {
async move {
let _ = ses.set("counter", 100); let _ = ses.set("counter", 100);
"test" "test"
}
})), })),
); )
.await;
let request = test::TestRequest::get().to_request(); let request = test::TestRequest::get().to_request();
let response = test::block_on(app.call(request)).unwrap(); let response = app.call(request).await.unwrap();
assert!(response assert!(response
.response() .response()
.cookies() .cookies()
@@ -417,8 +433,8 @@ mod tests {
.is_some()); .is_some());
} }
#[test] #[actix_rt::test]
fn basics() { async fn basics() {
let mut app = test::init_service( let mut app = test::init_service(
App::new() App::new()
.wrap( .wrap(
@@ -431,17 +447,22 @@ mod tests {
.max_age(100), .max_age(100),
) )
.service(web::resource("/").to(|ses: Session| { .service(web::resource("/").to(|ses: Session| {
async move {
let _ = ses.set("counter", 100); let _ = ses.set("counter", 100);
"test" "test"
}
})) }))
.service(web::resource("/test/").to(|ses: Session| { .service(web::resource("/test/").to(|ses: Session| {
async move {
let val: usize = ses.get("counter").unwrap().unwrap(); let val: usize = ses.get("counter").unwrap().unwrap();
format!("counter: {}", val) format!("counter: {}", val)
}
})), })),
); )
.await;
let request = test::TestRequest::get().to_request(); let request = test::TestRequest::get().to_request();
let response = test::block_on(app.call(request)).unwrap(); let response = app.call(request).await.unwrap();
let cookie = response let cookie = response
.response() .response()
.cookies() .cookies()
@@ -453,7 +474,7 @@ mod tests {
let request = test::TestRequest::with_uri("/test/") let request = test::TestRequest::with_uri("/test/")
.cookie(cookie) .cookie(cookie)
.to_request(); .to_request();
let body = test::read_response(&mut app, request); let body = test::read_response(&mut app, request).await;
assert_eq!(body, Bytes::from_static(b"counter: 100")); assert_eq!(body, Bytes::from_static(b"counter: 100"));
} }
} }

View File

@@ -43,11 +43,14 @@
//! } //! }
//! ``` //! ```
use std::cell::RefCell; use std::cell::RefCell;
use std::collections::HashMap;
use std::rc::Rc; use std::rc::Rc;
use actix_web::dev::{Extensions, Payload, ServiceRequest, ServiceResponse}; use actix_web::dev::{
Extensions, Payload, RequestHead, ServiceRequest, ServiceResponse,
};
use actix_web::{Error, FromRequest, HttpMessage, HttpRequest}; use actix_web::{Error, FromRequest, HttpMessage, HttpRequest};
use hashbrown::HashMap; use futures::future::{ok, Ready};
use serde::de::DeserializeOwned; use serde::de::DeserializeOwned;
use serde::Serialize; use serde::Serialize;
use serde_json; use serde_json;
@@ -98,6 +101,12 @@ impl UserSession for ServiceRequest {
} }
} }
impl UserSession for RequestHead {
fn get_session(&mut self) -> Session {
Session::get_session(&mut *self.extensions_mut())
}
}
#[derive(PartialEq, Clone, Debug)] #[derive(PartialEq, Clone, Debug)]
pub enum SessionStatus { pub enum SessionStatus {
Changed, Changed,
@@ -230,12 +239,12 @@ impl Session {
/// ``` /// ```
impl FromRequest for Session { impl FromRequest for Session {
type Error = Error; type Error = Error;
type Future = Result<Session, Error>; type Future = Ready<Result<Session, Error>>;
type Config = (); type Config = ();
#[inline] #[inline]
fn from_request(req: &HttpRequest, _: &mut Payload) -> Self::Future { fn from_request(req: &HttpRequest, _: &mut Payload) -> Self::Future {
Ok(Session::get_session(&mut *req.extensions_mut())) ok(Session::get_session(&mut *req.extensions_mut()))
} }
} }
@@ -280,6 +289,20 @@ mod tests {
assert_eq!(res, Some("value".to_string())); assert_eq!(res, Some("value".to_string()));
} }
#[test]
fn get_session_from_request_head() {
let mut req = test::TestRequest::default().to_srv_request();
Session::set_session(
vec![("key".to_string(), "\"value\"".to_string())].into_iter(),
&mut req,
);
let session = req.head_mut().get_session();
let res = session.get::<String>("key").unwrap();
assert_eq!(res, Some("value".to_string()));
}
#[test] #[test]
fn purge_session() { fn purge_session() {
let req = test::TestRequest::default().to_srv_request(); let req = test::TestRequest::default().to_srv_request();

View File

@@ -1,5 +1,9 @@
# Changes # Changes
## [1.0.3] - 2019-11-14
* Update actix-web and actix-http dependencies
## [1.0.2] - 2019-07-20 ## [1.0.2] - 2019-07-20
* Add `ws::start_with_addr()`, returning the address of the created actor, along * Add `ws::start_with_addr()`, returning the address of the created actor, along

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-web-actors" name = "actix-web-actors"
version = "1.0.2" version = "1.0.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix actors support for actix web framework." description = "Actix actors support for actix web framework."
readme = "README.md" readme = "README.md"
@@ -19,8 +19,8 @@ path = "src/lib.rs"
[dependencies] [dependencies]
actix = "0.8.3" actix = "0.8.3"
actix-web = "1.0.3" actix-web = "1.0.9"
actix-http = "0.2.5" actix-http = "0.2.11"
actix-codec = "0.1.2" actix-codec = "0.1.2"
bytes = "0.4" bytes = "0.4"
futures = "0.1.25" futures = "0.1.25"

View File

@@ -1,5 +1,11 @@
# Changes # Changes
## [0.1.3] - 2019-10-14
* Bump up `syn` & `quote` to 1.0
* Provide better error message
## [0.1.2] - 2019-06-04 ## [0.1.2] - 2019-06-04
* Add macros for head, options, trace, connect and patch http methods * Add macros for head, options, trace, connect and patch http methods

View File

@@ -1,6 +1,6 @@
[package] [package]
name = "actix-web-codegen" name = "actix-web-codegen"
version = "0.1.2" version = "0.2.0-alpha.2"
description = "Actix web proc macros" description = "Actix web proc macros"
readme = "README.md" readme = "README.md"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
@@ -12,11 +12,13 @@ workspace = ".."
proc-macro = true proc-macro = true
[dependencies] [dependencies]
quote = "0.6.12" quote = "^1"
syn = { version = "0.15.34", features = ["full", "parsing", "extra-traits"] } syn = { version = "^1", features = ["full", "parsing"] }
proc-macro2 = "^1"
[dev-dependencies] [dev-dependencies]
actix-web = { version = "1.0.0" } actix-rt = { version = "1.0.0-alpha.2" }
actix-http = { version = "0.2.4", features=["ssl"] } actix-web = { version = "2.0.0-alpha.2" }
actix-http-test = { version = "0.2.0", features=["ssl"] } actix-http = { version = "0.3.0-alpha.2", features=["openssl"] }
futures = { version = "0.1" } actix-http-test = { version = "0.3.0-alpha.2", features=["openssl"] }
futures = { version = "0.3.1" }

View File

@@ -35,8 +35,8 @@
//! use futures::{future, Future}; //! use futures::{future, Future};
//! //!
//! #[get("/test")] //! #[get("/test")]
//! fn async_test() -> impl Future<Item=HttpResponse, Error=actix_web::Error> { //! async fn async_test() -> Result<HttpResponse, actix_web::Error> {
//! future::ok(HttpResponse::Ok().finish()) //! Ok(HttpResponse::Ok().finish())
//! } //! }
//! ``` //! ```
@@ -58,7 +58,10 @@ use syn::parse_macro_input;
#[proc_macro_attribute] #[proc_macro_attribute]
pub fn get(args: TokenStream, input: TokenStream) -> TokenStream { pub fn get(args: TokenStream, input: TokenStream) -> TokenStream {
let args = parse_macro_input!(args as syn::AttributeArgs); let args = parse_macro_input!(args as syn::AttributeArgs);
let gen = route::Args::new(&args, input, route::GuardType::Get); let gen = match route::Route::new(args, input, route::GuardType::Get) {
Ok(gen) => gen,
Err(err) => return err.to_compile_error().into(),
};
gen.generate() gen.generate()
} }
@@ -70,7 +73,10 @@ pub fn get(args: TokenStream, input: TokenStream) -> TokenStream {
#[proc_macro_attribute] #[proc_macro_attribute]
pub fn post(args: TokenStream, input: TokenStream) -> TokenStream { pub fn post(args: TokenStream, input: TokenStream) -> TokenStream {
let args = parse_macro_input!(args as syn::AttributeArgs); let args = parse_macro_input!(args as syn::AttributeArgs);
let gen = route::Args::new(&args, input, route::GuardType::Post); let gen = match route::Route::new(args, input, route::GuardType::Post) {
Ok(gen) => gen,
Err(err) => return err.to_compile_error().into(),
};
gen.generate() gen.generate()
} }
@@ -82,7 +88,10 @@ pub fn post(args: TokenStream, input: TokenStream) -> TokenStream {
#[proc_macro_attribute] #[proc_macro_attribute]
pub fn put(args: TokenStream, input: TokenStream) -> TokenStream { pub fn put(args: TokenStream, input: TokenStream) -> TokenStream {
let args = parse_macro_input!(args as syn::AttributeArgs); let args = parse_macro_input!(args as syn::AttributeArgs);
let gen = route::Args::new(&args, input, route::GuardType::Put); let gen = match route::Route::new(args, input, route::GuardType::Put) {
Ok(gen) => gen,
Err(err) => return err.to_compile_error().into(),
};
gen.generate() gen.generate()
} }
@@ -94,7 +103,10 @@ pub fn put(args: TokenStream, input: TokenStream) -> TokenStream {
#[proc_macro_attribute] #[proc_macro_attribute]
pub fn delete(args: TokenStream, input: TokenStream) -> TokenStream { pub fn delete(args: TokenStream, input: TokenStream) -> TokenStream {
let args = parse_macro_input!(args as syn::AttributeArgs); let args = parse_macro_input!(args as syn::AttributeArgs);
let gen = route::Args::new(&args, input, route::GuardType::Delete); let gen = match route::Route::new(args, input, route::GuardType::Delete) {
Ok(gen) => gen,
Err(err) => return err.to_compile_error().into(),
};
gen.generate() gen.generate()
} }
@@ -106,7 +118,10 @@ pub fn delete(args: TokenStream, input: TokenStream) -> TokenStream {
#[proc_macro_attribute] #[proc_macro_attribute]
pub fn head(args: TokenStream, input: TokenStream) -> TokenStream { pub fn head(args: TokenStream, input: TokenStream) -> TokenStream {
let args = parse_macro_input!(args as syn::AttributeArgs); let args = parse_macro_input!(args as syn::AttributeArgs);
let gen = route::Args::new(&args, input, route::GuardType::Head); let gen = match route::Route::new(args, input, route::GuardType::Head) {
Ok(gen) => gen,
Err(err) => return err.to_compile_error().into(),
};
gen.generate() gen.generate()
} }
@@ -118,7 +133,10 @@ pub fn head(args: TokenStream, input: TokenStream) -> TokenStream {
#[proc_macro_attribute] #[proc_macro_attribute]
pub fn connect(args: TokenStream, input: TokenStream) -> TokenStream { pub fn connect(args: TokenStream, input: TokenStream) -> TokenStream {
let args = parse_macro_input!(args as syn::AttributeArgs); let args = parse_macro_input!(args as syn::AttributeArgs);
let gen = route::Args::new(&args, input, route::GuardType::Connect); let gen = match route::Route::new(args, input, route::GuardType::Connect) {
Ok(gen) => gen,
Err(err) => return err.to_compile_error().into(),
};
gen.generate() gen.generate()
} }
@@ -130,7 +148,10 @@ pub fn connect(args: TokenStream, input: TokenStream) -> TokenStream {
#[proc_macro_attribute] #[proc_macro_attribute]
pub fn options(args: TokenStream, input: TokenStream) -> TokenStream { pub fn options(args: TokenStream, input: TokenStream) -> TokenStream {
let args = parse_macro_input!(args as syn::AttributeArgs); let args = parse_macro_input!(args as syn::AttributeArgs);
let gen = route::Args::new(&args, input, route::GuardType::Options); let gen = match route::Route::new(args, input, route::GuardType::Options) {
Ok(gen) => gen,
Err(err) => return err.to_compile_error().into(),
};
gen.generate() gen.generate()
} }
@@ -142,7 +163,10 @@ pub fn options(args: TokenStream, input: TokenStream) -> TokenStream {
#[proc_macro_attribute] #[proc_macro_attribute]
pub fn trace(args: TokenStream, input: TokenStream) -> TokenStream { pub fn trace(args: TokenStream, input: TokenStream) -> TokenStream {
let args = parse_macro_input!(args as syn::AttributeArgs); let args = parse_macro_input!(args as syn::AttributeArgs);
let gen = route::Args::new(&args, input, route::GuardType::Trace); let gen = match route::Route::new(args, input, route::GuardType::Trace) {
Ok(gen) => gen,
Err(err) => return err.to_compile_error().into(),
};
gen.generate() gen.generate()
} }
@@ -154,6 +178,9 @@ pub fn trace(args: TokenStream, input: TokenStream) -> TokenStream {
#[proc_macro_attribute] #[proc_macro_attribute]
pub fn patch(args: TokenStream, input: TokenStream) -> TokenStream { pub fn patch(args: TokenStream, input: TokenStream) -> TokenStream {
let args = parse_macro_input!(args as syn::AttributeArgs); let args = parse_macro_input!(args as syn::AttributeArgs);
let gen = route::Args::new(&args, input, route::GuardType::Patch); let gen = match route::Route::new(args, input, route::GuardType::Patch) {
Ok(gen) => gen,
Err(err) => return err.to_compile_error().into(),
};
gen.generate() gen.generate()
} }

View File

@@ -1,21 +1,23 @@
extern crate proc_macro; extern crate proc_macro;
use std::fmt;
use proc_macro::TokenStream; use proc_macro::TokenStream;
use quote::quote; use proc_macro2::{Span, TokenStream as TokenStream2};
use quote::{quote, ToTokens, TokenStreamExt};
use syn::{AttributeArgs, Ident, NestedMeta};
enum ResourceType { enum ResourceType {
Async, Async,
Sync, Sync,
} }
impl fmt::Display for ResourceType { impl ToTokens for ResourceType {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { fn to_tokens(&self, stream: &mut TokenStream2) {
match *self { let ident = match self {
ResourceType::Async => write!(f, "to_async"), ResourceType::Async => "to",
ResourceType::Sync => write!(f, "to"), ResourceType::Sync => "to",
} };
let ident = Ident::new(ident, Span::call_site());
stream.append(ident);
} }
} }
@@ -32,61 +34,87 @@ pub enum GuardType {
Patch, Patch,
} }
impl fmt::Display for GuardType { impl GuardType {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { fn as_str(&self) -> &'static str {
match *self { match self {
GuardType::Get => write!(f, "Get"), GuardType::Get => "Get",
GuardType::Post => write!(f, "Post"), GuardType::Post => "Post",
GuardType::Put => write!(f, "Put"), GuardType::Put => "Put",
GuardType::Delete => write!(f, "Delete"), GuardType::Delete => "Delete",
GuardType::Head => write!(f, "Head"), GuardType::Head => "Head",
GuardType::Connect => write!(f, "Connect"), GuardType::Connect => "Connect",
GuardType::Options => write!(f, "Options"), GuardType::Options => "Options",
GuardType::Trace => write!(f, "Trace"), GuardType::Trace => "Trace",
GuardType::Patch => write!(f, "Patch"), GuardType::Patch => "Patch",
} }
} }
} }
pub struct Args { impl ToTokens for GuardType {
fn to_tokens(&self, stream: &mut TokenStream2) {
let ident = self.as_str();
let ident = Ident::new(ident, Span::call_site());
stream.append(ident);
}
}
struct Args {
path: syn::LitStr,
guards: Vec<Ident>,
}
impl Args {
fn new(args: AttributeArgs) -> syn::Result<Self> {
let mut path = None;
let mut guards = Vec::new();
for arg in args {
match arg {
NestedMeta::Lit(syn::Lit::Str(lit)) => match path {
None => {
path = Some(lit);
}
_ => {
return Err(syn::Error::new_spanned(
lit,
"Multiple paths specified! Should be only one!",
));
}
},
NestedMeta::Meta(syn::Meta::NameValue(nv)) => {
if nv.path.is_ident("guard") {
if let syn::Lit::Str(lit) = nv.lit {
guards.push(Ident::new(&lit.value(), Span::call_site()));
} else {
return Err(syn::Error::new_spanned(
nv.lit,
"Attribute guard expects literal string!",
));
}
} else {
return Err(syn::Error::new_spanned(
nv.path,
"Unknown attribute key is specified. Allowed: guard",
));
}
}
arg => {
return Err(syn::Error::new_spanned(arg, "Unknown attribute"));
}
}
}
Ok(Args {
path: path.unwrap(),
guards,
})
}
}
pub struct Route {
name: syn::Ident, name: syn::Ident,
path: String, args: Args,
ast: syn::ItemFn, ast: syn::ItemFn,
resource_type: ResourceType, resource_type: ResourceType,
pub guard: GuardType, guard: GuardType,
pub extra_guards: Vec<String>,
}
impl fmt::Display for Args {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
let ast = &self.ast;
let guards = format!(".guard(actix_web::guard::{}())", self.guard);
let guards = self.extra_guards.iter().fold(guards, |acc, val| {
format!("{}.guard(actix_web::guard::fn_guard({}))", acc, val)
});
write!(
f,
"
#[allow(non_camel_case_types)]
pub struct {name};
impl actix_web::dev::HttpServiceFactory for {name} {{
fn register(self, config: &mut actix_web::dev::AppService) {{
{ast}
let resource = actix_web::Resource::new(\"{path}\"){guards}.{to}({name});
actix_web::dev::HttpServiceFactory::register(resource, config)
}}
}}",
name = self.name,
ast = quote!(#ast),
path = self.path,
guards = guards,
to = self.resource_type
)
}
} }
fn guess_resource_type(typ: &syn::Type) -> ResourceType { fn guess_resource_type(typ: &syn::Type) -> ResourceType {
@@ -111,75 +139,74 @@ fn guess_resource_type(typ: &syn::Type) -> ResourceType {
guess guess
} }
impl Args { impl Route {
pub fn new(args: &[syn::NestedMeta], input: TokenStream, guard: GuardType) -> Self { pub fn new(
args: AttributeArgs,
input: TokenStream,
guard: GuardType,
) -> syn::Result<Self> {
if args.is_empty() { if args.is_empty() {
panic!( return Err(syn::Error::new(
"invalid server definition, expected: #[{}(\"some path\")]", Span::call_site(),
guard format!(
); r#"invalid server definition, expected #[{}("<some path>")]"#,
} guard.as_str().to_ascii_lowercase()
let ast: syn::ItemFn = syn::parse(input).expect("Parse input as function");
let name = ast.ident.clone();
let mut extra_guards = Vec::new();
let mut path = None;
for arg in args {
match arg {
syn::NestedMeta::Literal(syn::Lit::Str(ref fname)) => {
if path.is_some() {
panic!("Multiple paths specified! Should be only one!")
}
let fname = quote!(#fname).to_string();
path = Some(fname.as_str()[1..fname.len() - 1].to_owned())
}
syn::NestedMeta::Meta(syn::Meta::NameValue(ident)) => {
match ident.ident.to_string().to_lowercase().as_str() {
"guard" => match ident.lit {
syn::Lit::Str(ref text) => extra_guards.push(text.value()),
_ => panic!("Attribute guard expects literal string!"),
},
attr => panic!(
"Unknown attribute key is specified: {}. Allowed: guard",
attr
), ),
));
} }
} let ast: syn::ItemFn = syn::parse(input)?;
attr => panic!("Unknown attribute{:?}", attr), let name = ast.sig.ident.clone();
}
}
let resource_type = if ast.asyncness.is_some() { let args = Args::new(args)?;
let resource_type = if ast.sig.asyncness.is_some() {
ResourceType::Async ResourceType::Async
} else { } else {
match ast.decl.output { match ast.sig.output {
syn::ReturnType::Default => panic!( syn::ReturnType::Default => {
"Function {} has no return type. Cannot be used as handler", return Err(syn::Error::new_spanned(
name ast,
), "Function has no return type. Cannot be used as handler",
));
}
syn::ReturnType::Type(_, ref typ) => guess_resource_type(typ.as_ref()), syn::ReturnType::Type(_, ref typ) => guess_resource_type(typ.as_ref()),
} }
}; };
let path = path.unwrap(); Ok(Self {
Self {
name, name,
path, args,
ast, ast,
resource_type, resource_type,
guard, guard,
extra_guards, })
}
} }
pub fn generate(&self) -> TokenStream { pub fn generate(&self) -> TokenStream {
let text = self.to_string(); let name = &self.name;
let resource_name = name.to_string();
let guard = &self.guard;
let ast = &self.ast;
let path = &self.args.path;
let extra_guards = &self.args.guards;
let resource_type = &self.resource_type;
let stream = quote! {
#[allow(non_camel_case_types)]
pub struct #name;
match text.parse() { impl actix_web::dev::HttpServiceFactory for #name {
Ok(res) => res, fn register(self, config: &mut actix_web::dev::AppService) {
Err(error) => panic!("Error: {:?}\nGenerated code: {}", error, text), #ast
let resource = actix_web::Resource::new(#path)
.name(#resource_name)
.guard(actix_web::guard::#guard())
#(.guard(actix_web::guard::fn_guard(#extra_guards)))*
.#resource_type(#name);
actix_web::dev::HttpServiceFactory::register(resource, config)
} }
} }
};
stream.into()
}
} }

Some files were not shown because too many files have changed in this diff Show More