prepare actix-test release 0.1.0-beta.3

Add compress-* feature flags in actix-http / actix-web / awc.
This allow enable / disable not wanted compression algorithm.

.cargo/config.toml

@@ -0,0 +1,8 @@
+[alias]
+chk = "check --workspace --all-features --tests --examples --bins"
+lint = "clippy --workspace --tests --examples"
+ci-min = "hack check --workspace --no-default-features"
+ci-min-test = "hack check --workspace --no-default-features --tests --examples"
+ci-default = "hack check --workspace"
+ci-full = "check --workspace --bins --examples --tests"
+ci-test = "test --workspace --all-features --no-fail-fast"

.github/PULL_REQUEST_TEMPLATE.md

@@ -1,21 +1,21 @@
 <!-- Thanks for considering contributing actix! -->
-<!-- Please fill out the following to make our reviews easy. -->
+<!-- Please fill out the following to get your PR reviewed quicker. -->
 
 ## PR Type
 <!-- What kind of change does this PR make? -->
 <!-- Bug Fix / Feature / Refactor / Code Style / Other -->
-INSERT_PR_TYPE
+PR_TYPE
 
 
 ## PR Checklist
-Check your PR fulfills the following:
+<!-- Check your PR fulfills the following items. ->>
-
 <!-- For draft PRs check the boxes as you complete them. -->
 
 - [ ] Tests for the changes have been added / updated.
 - [ ] Documentation comments have been added / updated.
 - [ ] A changelog entry has been made for the appropriate packages.
-- [ ] Format code with the latest stable rustfmt
+- [ ] Format code with the latest stable rustfmt.
+- [ ] (Team) Label with affected crates and semver status.
 
 
 ## Overview

.github/workflows/bench.yml

@@ -1,4 +1,4 @@
-name: Benchmark (Linux)
+name: Benchmark
 
 on:
   pull_request:

.github/workflows/ci.yml

@@ -0,0 +1,127 @@
+name: CI
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches: [master]
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        target:
+          - { name: Linux, os: ubuntu-latest, triple: x86_64-unknown-linux-gnu }
+          - { name: macOS, os: macos-latest, triple: x86_64-apple-darwin }
+          - { name: Windows, os: windows-latest, triple: x86_64-pc-windows-msvc }
+        version:
+          - 1.46.0 # MSRV
+          - stable
+          - nightly
+
+    name: ${{ matrix.target.name }} / ${{ matrix.version }}
+    runs-on: ${{ matrix.target.os }}
+
+    env:
+      VCPKGRS_DYNAMIC: 1
+
+    steps:
+      - uses: actions/checkout@v2
+
+      # install OpenSSL on Windows
+      - name: Set vcpkg root
+        if: matrix.target.triple == 'x86_64-pc-windows-msvc'
+        run: echo "VCPKG_ROOT=$env:VCPKG_INSTALLATION_ROOT" | Out-File -FilePath $env:GITHUB_ENV -Append
+      - name: Install OpenSSL
+        if: matrix.target.triple == 'x86_64-pc-windows-msvc'
+        run: vcpkg install openssl:x64-windows
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-${{ matrix.target.triple }}
+          profile: minimal
+          override: true
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-${{ matrix.target.triple }}
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with:
+          command: generate-lockfile
+      - name: Cache Dependencies
+        uses: Swatinem/rust-cache@v1.2.0
+
+      - name: Install cargo-hack
+        uses: actions-rs/cargo@v1
+        with:
+          command: install
+          args: cargo-hack
+
+      - name: check minimal
+        uses: actions-rs/cargo@v1
+        with:
+          command: hack
+          args: check --workspace --no-default-features
+
+      - name: check minimal + tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: hack
+          args: check --workspace --no-default-features --tests --examples
+
+      - name: check full
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --workspace --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: test
+          args: --workspace --all-features --no-fail-fast -- --nocapture
+            --skip=test_h2_content_length
+            --skip=test_reading_deflate_encoding_large_random_rustls
+
+      - name: tests (actix-http)
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --package=actix-http --no-default-features --features=rustls -- --nocapture
+
+      - name: tests (awc)
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --package=awc --no-default-features --features=rustls -- --nocapture
+
+      - name: Generate coverage file
+        if: >
+          matrix.target.os == 'ubuntu-latest'
+          && matrix.version == 'stable'
+          && github.ref == 'refs/heads/master'
+        run: |
+          cargo install cargo-tarpaulin --vers "^0.13"
+          cargo tarpaulin --out Xml --verbose
+      - name: Upload to Codecov
+        if: >
+          matrix.target.os == 'ubuntu-latest'
+          && matrix.version == 'stable'
+          && github.ref == 'refs/heads/master'
+        uses: codecov/codecov-action@v1
+        with:
+          file: cobertura.xml
+
+      - name: Clear the cargo caches
+        run: |
+          cargo install cargo-cache --version 0.6.2 --no-default-features --features ci-autoclean
+          cargo-cache

.github/workflows/clippy-fmt.yml

@@ -1,32 +1,39 @@
+name: Lint
+
 on:
   pull_request:
     types: [opened, synchronize, reopened]
 
-name: Clippy and rustfmt Check
 jobs:
-  clippy_check:
+  fmt:
     runs-on: ubuntu-latest
     steps:
       - uses: actions/checkout@v2
 
-      - uses: actions-rs/toolchain@v1
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
         with:
           toolchain: stable
           components: rustfmt
-          override: true
       - name: Check with rustfmt
         uses: actions-rs/cargo@v1
         with:
           command: fmt
           args: --all -- --check
 
-      - uses: actions-rs/toolchain@v1
+  clippy:
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
         with:
-          toolchain: nightly
+          toolchain: stable
           components: clippy
           override: true
       - name: Check with Clippy
         uses: actions-rs/clippy-check@v1
         with:
           token: ${{ secrets.GITHUB_TOKEN }}
-          args: --all-features --all --tests
+          args: --workspace --tests --all-features

.github/workflows/linux.yml

@@ -1,81 +0,0 @@
-name: CI (Linux)
-
-on:
-  pull_request:
-    types: [opened, synchronize, reopened]
-  push:
-    branches:
-      - master
-
-jobs:
-  build_and_test:
-    strategy:
-      fail-fast: false
-      matrix:
-        version:
-          - 1.46.0 # MSRV
-          - stable
-          - nightly
-
-    name: ${{ matrix.version }} - x86_64-unknown-linux-gnu
-    runs-on: ubuntu-latest
-
-    steps:
-      - uses: actions/checkout@v2
-
-      - name: Install ${{ matrix.version }}
-        uses: actions-rs/toolchain@v1
-        with:
-          toolchain: ${{ matrix.version }}-x86_64-unknown-linux-gnu
-          profile: minimal
-          override: true
-
-      - name: Generate Cargo.lock
-        uses: actions-rs/cargo@v1
-        with:
-          command: generate-lockfile
-      - name: Cache Dependencies
-        uses: Swatinem/rust-cache@v1.0.1
-
-      - name: check build
-        uses: actions-rs/cargo@v1
-        with:
-          command: check
-          args: --all --bins --examples --tests
-
-      - name: tests
-        uses: actions-rs/cargo@v1
-        timeout-minutes: 40
-        with:
-          command: test
-          args: --all --all-features --no-fail-fast -- --nocapture
-
-      - name: tests (actix-http)
-        uses: actions-rs/cargo@v1
-        timeout-minutes: 40
-        with:
-          command: test
-          args: --package=actix-http --no-default-features --features=rustls -- --nocapture
-
-      - name: tests (awc)
-        uses: actions-rs/cargo@v1
-        timeout-minutes: 40
-        with:
-          command: test
-          args: --package=awc --no-default-features --features=rustls -- --nocapture
-
-      - name: Generate coverage file
-        if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
-        run: |
-          cargo install cargo-tarpaulin --vers "^0.13"
-          cargo tarpaulin --out Xml
-      - name: Upload to Codecov
-        if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
-        uses: codecov/codecov-action@v1
-        with:
-          file: cobertura.xml
-
-      - name: Clear the cargo caches
-        run: |
-          cargo install cargo-cache --no-default-features --features ci-autoclean
-          cargo-cache

.github/workflows/macos.yml

@@ -1,56 +0,0 @@
-name: CI (macOS)
-
-on:
-  pull_request:
-    types: [opened, synchronize, reopened]
-  push:
-    branches:
-      - master
-
-jobs:
-  build_and_test:
-    strategy:
-      fail-fast: false
-      matrix:
-        version:
-          - stable
-          - nightly
-
-    name: ${{ matrix.version }} - x86_64-apple-darwin
-    runs-on: macOS-latest
-
-    steps:
-      - uses: actions/checkout@v2
-
-      - name: Install ${{ matrix.version }}
-        uses: actions-rs/toolchain@v1
-        with:
-          toolchain: ${{ matrix.version }}-x86_64-apple-darwin
-          profile: minimal
-          override: true
-
-      - name: Generate Cargo.lock
-        uses: actions-rs/cargo@v1
-        with:
-          command: generate-lockfile
-      - name: Cache Dependencies
-        uses: Swatinem/rust-cache@v1.0.1
-
-      - name: check build
-        uses: actions-rs/cargo@v1
-        with:
-          command: check
-          args: --all --bins --examples --tests
-
-      - name: tests
-        uses: actions-rs/cargo@v1
-        with:
-          command: test
-          args: --all --all-features --no-fail-fast -- --nocapture
-                --skip=test_h2_content_length
-                --skip=test_reading_deflate_encoding_large_random_rustls
-
-      - name: Clear the cargo caches
-        run: |
-          cargo install cargo-cache --no-default-features --features ci-autoclean
-          cargo-cache

.github/workflows/upload-doc.yml

@@ -1,14 +1,12 @@
-name: Upload documentation
+name: Upload Documentation
 
 on:
   push:
-    branches:
+    branches: [master]
-      - master
 
 jobs:
   build:
     runs-on: ubuntu-latest
-    if: github.repository == 'actix/actix-web'
 
     steps:
       - uses: actions/checkout@v2
@@ -20,14 +18,14 @@ jobs:
           profile: minimal
           override: true
 
-      - name: check build
+      - name: Build Docs
         uses: actions-rs/cargo@v1
         with:
           command: doc
-          args: --no-deps --workspace --all-features
+          args: --workspace --all-features --no-deps
 
       - name: Tweak HTML
-        run: echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html
+        run: echo '<meta http-equiv="refresh" content="0;url=actix_web/index.html">' > target/doc/index.html
 
       - name: Deploy to GitHub Pages
         uses: JamesIves/github-pages-deploy-action@3.7.1

.github/workflows/windows.yml

@@ -1,76 +0,0 @@
-name: CI (Windows)
-
-on:
-  pull_request:
-    types: [opened, synchronize, reopened]
-  push:
-    branches:
-      - master
-
-env:
-  VCPKGRS_DYNAMIC: 1
-
-jobs:
-  build_and_test:
-    strategy:
-      fail-fast: false
-      matrix:
-        version:
-          - stable
-          - nightly
-
-    name: ${{ matrix.version }} - x86_64-pc-windows-msvc
-    runs-on: windows-latest
-
-    steps:
-      - uses: actions/checkout@v2
-
-      - name: Install ${{ matrix.version }}
-        uses: actions-rs/toolchain@v1
-        with:
-          toolchain: ${{ matrix.version }}-x86_64-pc-windows-msvc
-          profile: minimal
-          override: true
-
-      - name: Install OpenSSL
-        run: |
-          vcpkg integrate install
-          vcpkg install openssl:x64-windows
-          Copy-Item C:\vcpkg\installed\x64-windows\bin\libcrypto-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libcrypto.dll
-          Copy-Item C:\vcpkg\installed\x64-windows\bin\libssl-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libssl.dll
-          Get-ChildItem C:\vcpkg\installed\x64-windows\bin
-          Get-ChildItem C:\vcpkg\installed\x64-windows\lib
-
-      - name: Generate Cargo.lock
-        uses: actions-rs/cargo@v1
-        with:
-          command: generate-lockfile
-      - name: Cache Dependencies
-        uses: Swatinem/rust-cache@v1.0.1
-
-      - name: check build
-        uses: actions-rs/cargo@v1
-        with:
-          command: check
-          args: --all --bins --examples --tests
-
-      - name: tests
-        uses: actions-rs/cargo@v1
-        with:
-          command: test
-          args: --all --all-features --no-fail-fast -- --nocapture
-                --skip=test_h2_content_length
-                --skip=test_reading_deflate_encoding_large_random_rustls
-                --skip=test_params
-                --skip=test_simple
-                --skip=test_expect_continue
-                --skip=test_http10_keepalive
-                --skip=test_slow_request
-                --skip=test_connection_force_close
-                --skip=test_connection_server_close
-                --skip=test_connection_wait_queue_force_close
-
-      - name: Clear the cargo caches
-        run: |
-          cargo install cargo-cache --no-default-features --features ci-autoclean
-          cargo-cache

CHANGES.md

@@ -1,6 +1,127 @@
 # Changes
 
 ## Unreleased - 2021-xx-xx
+### Changed
+* Change compression algorithm features flags. [#2250]
+
+[#2250]: https://github.com/actix/actix-web/pull/2250
+
+
+## 4.0.0-beta.7 - 2021-06-17
+### Added
+* `HttpServer::worker_max_blocking_threads` for setting block thread pool. [#2200]
+
+### Changed
+* Adjusted default JSON payload limit to 2MB (from 32kb) and included size and limits in the `JsonPayloadError::Overflow` error variant. [#2162]
+[#2162]: (https://github.com/actix/actix-web/pull/2162)
+* `ServiceResponse::error_response` now uses body type of `Body`. [#2201]
+* `ServiceResponse::checked_expr` now returns a `Result`. [#2201]
+* Update `language-tags` to `0.3`.
+* `ServiceResponse::take_body`. [#2201]
+* `ServiceResponse::map_body` closure receives and returns `B` instead of `ResponseBody<B>` types. [#2201]
+* All error trait bounds in server service builders have changed from `Into<Error>` to `Into<Response<AnyBody>>`. [#2253]
+* All error trait bounds in message body and stream impls changed from `Into<Error>` to `Into<Box<dyn std::error::Error>>`. [#2253]
+* `HttpServer::{listen_rustls(), bind_rustls()}` now honor the ALPN protocols in the configuation parameter. [#2226]
+* `middleware::normalize` now will not try to normalize URIs with no valid path [#2246]
+
+### Removed
+* `HttpResponse::take_body` and old `HttpResponse::into_body` method that casted body type. [#2201]
+
+[#2200]: https://github.com/actix/actix-web/pull/2200
+[#2201]: https://github.com/actix/actix-web/pull/2201
+[#2253]: https://github.com/actix/actix-web/pull/2253
+[#2246]: https://github.com/actix/actix-web/pull/2246
+
+
+## 4.0.0-beta.6 - 2021-04-17
+### Added
+* `HttpResponse` and `HttpResponseBuilder` structs. [#2065]
+
+### Changed
+* Most error types are now marked `#[non_exhaustive]`. [#2148]
+* Methods on `ContentDisposition` that took `T: AsRef<str>` now take `impl AsRef<str>`.
+
+[#2065]: https://github.com/actix/actix-web/pull/2065
+[#2148]: https://github.com/actix/actix-web/pull/2148
+
+
+## 4.0.0-beta.5 - 2021-04-02
+### Added
+* `Header` extractor for extracting common HTTP headers in handlers. [#2094]
+* Added `TestServer::client_headers` method. [#2097]
+
+### Fixed
+* Double ampersand in Logger format is escaped correctly. [#2067]
+
+### Changed
+* `CustomResponder` would return error as `HttpResponse` when `CustomResponder::with_header` failed
+  instead of skipping. (Only the first error is kept when multiple error occur) [#2093]
+
+### Removed
+* The `client` mod was removed. Clients should now use `awc` directly.
+  [871ca5e4](https://github.com/actix/actix-web/commit/871ca5e4ae2bdc22d1ea02701c2992fa8d04aed7)
+* Integration testing was moved to new `actix-test` crate. Namely these items from the `test`
+  module: `TestServer`, `TestServerConfig`, `start`, `start_with`, and `unused_addr`. [#2112]
+
+[#2067]: https://github.com/actix/actix-web/pull/2067
+[#2093]: https://github.com/actix/actix-web/pull/2093
+[#2094]: https://github.com/actix/actix-web/pull/2094
+[#2097]: https://github.com/actix/actix-web/pull/2097
+[#2112]: https://github.com/actix/actix-web/pull/2112
+
+
+## 4.0.0-beta.4 - 2021-03-09
+### Changed
+* Feature `cookies` is now optional and enabled by default. [#1981]
+* `JsonBody::new` returns a default limit of 32kB to be consistent with `JsonConfig` and the default
+  behaviour of the `web::Json<T>` extractor. [#2010]
+
+[#1981]: https://github.com/actix/actix-web/pull/1981
+[#2010]: https://github.com/actix/actix-web/pull/2010
+
+
+## 4.0.0-beta.3 - 2021-02-10
+* Update `actix-web-codegen` to `0.5.0-beta.1`.
+
+
+## 4.0.0-beta.2 - 2021-02-10
+### Added
+* The method `Either<web::Json<T>, web::Form<T>>::into_inner()` which returns the inner type for
+  whichever variant was created. Also works for `Either<web::Form<T>, web::Json<T>>`. [#1894]
+* Add `services!` macro for helping register multiple services to `App`. [#1933]
+* Enable registering a vec of services of the same type to `App` [#1933]
+
+### Changed
+* Rework `Responder` trait to be sync and returns `Response`/`HttpResponse` directly.
+  Making it simpler and more performant. [#1891]
+* `ServiceRequest::into_parts` and `ServiceRequest::from_parts` can no longer fail. [#1893]
+* `ServiceRequest::from_request` can no longer fail. [#1893]
+* Our `Either` type now uses `Left`/`Right` variants (instead of `A`/`B`) [#1894]
+* `test::{call_service, read_response, read_response_json, send_request}` take `&Service`
+  in argument [#1905]
+* `App::wrap_fn`, `Resource::wrap_fn` and `Scope::wrap_fn` provide `&Service` in closure
+  argument. [#1905]
+* `web::block` no longer requires the output is a Result. [#1957]
+
+### Fixed
+* Multiple calls to `App::data` with the same type now keeps the latest call's data. [#1906]
+
+### Removed
+* Public field of `web::Path` has been made private. [#1894]
+* Public field of `web::Query` has been made private. [#1894]
+* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
+* `AppService::set_service_data`; for custom HTTP service factories adding application data, use the
+  layered data model by calling `ServiceRequest::add_data_container` when handling
+  requests instead. [#1906]
+
+[#1891]: https://github.com/actix/actix-web/pull/1891
+[#1893]: https://github.com/actix/actix-web/pull/1893
+[#1894]: https://github.com/actix/actix-web/pull/1894
+[#1869]: https://github.com/actix/actix-web/pull/1869
+[#1905]: https://github.com/actix/actix-web/pull/1905
+[#1906]: https://github.com/actix/actix-web/pull/1906
+[#1933]: https://github.com/actix/actix-web/pull/1933
+[#1957]: https://github.com/actix/actix-web/pull/1957
 
 
 ## 4.0.0-beta.1 - 2021-01-07
@@ -24,13 +145,15 @@
 ### Removed
 * Public modules `middleware::{normalize, err_handlers}`. All necessary middleware structs are now
   exposed directly by the `middleware` module.
+* Remove `actix-threadpool` as dependency. `actix_threadpool::BlockingError` error type can be imported 
+  from `actix_web::error` module. [#1878]
 
 [#1812]: https://github.com/actix/actix-web/pull/1812
 [#1813]: https://github.com/actix/actix-web/pull/1813
 [#1852]: https://github.com/actix/actix-web/pull/1852
 [#1865]: https://github.com/actix/actix-web/pull/1865
 [#1875]: https://github.com/actix/actix-web/pull/1875
-
+[#1878]: https://github.com/actix/actix-web/pull/1878
 
 ## 3.3.2 - 2020-12-01
 ### Fixed
@@ -115,7 +238,7 @@
 
 ## 3.0.0-beta.4 - 2020-09-09
 ### Added
-* `middleware::NormalizePath` now has configurable behaviour for either always having a trailing
+* `middleware::NormalizePath` now has configurable behavior for either always having a trailing 
   slash, or as the new addition, always trimming trailing slashes. [#1639]
 
 ### Changed
@@ -443,7 +566,7 @@
 
 ## [1.0.0-rc] - 2019-05-18
 
-### Add
+### Added
 
 * Add `Query<T>::from_query()` to extract parameters from a query string. #846
 * `QueryConfig`, similar to `JsonConfig` for customizing error handling of query extractors.
@@ -459,7 +582,7 @@
 
 ## [1.0.0-beta.4] - 2019-05-12
 
-### Add
+### Added
 
 * Allow to set/override app data on scope level
 
@@ -485,7 +608,7 @@
 
 * CORS handling without headers #702
 
-* Allow to construct `Data` instances to avoid double `Arc` for `Send + Sync` types.
+* Allow constructing `Data` instances to avoid double `Arc` for `Send + Sync` types.
 
 ### Fixed
 
@@ -549,7 +672,7 @@
 
 ### Changed
 
-* Allow to use any service as default service.
+* Allow using any service as default service.
 
 * Remove generic type for request payload, always use default.
 
@@ -612,13 +735,13 @@
 
 ### Added
 
-* rustls support
+* Rustls support
 
 ### Changed
 
-* use forked cookie
+* Use forked cookie
 
-* multipart::Field renamed to MultipartField
+* Multipart::Field renamed to MultipartField
 
 ## [1.0.0-alpha.1] - 2019-03-28
 

Cargo.toml

@@ -1,25 +1,23 @@
 [package]
 name = "actix-web"
-version = "4.0.0-beta.1"
+version = "4.0.0-beta.7"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust"
-readme = "README.md"
 keywords = ["actix", "http", "web", "framework", "async"]
+categories = [
+    "network-programming",
+    "asynchronous",
+    "web-programming::http-server",
+    "web-programming::websocket"
+]
 homepage = "https://actix.rs"
-repository = "https://github.com/actix/actix-web.git"
+repository = "https://github.com/actix/actix-web"
-documentation = "https://docs.rs/actix-web/"
-categories = ["network-programming", "asynchronous",
-              "web-programming::http-server",
-              "web-programming::websocket"]
 license = "MIT OR Apache-2.0"
 edition = "2018"
 
 [package.metadata.docs.rs]
-features = ["openssl", "rustls", "compress", "secure-cookies"]
+# features that docs.rs will build with
-
+features = ["openssl", "rustls", "compress-brotli", "compress-gzip", "compress-zstd", "cookies", "secure-cookies"]
-[badges]
-travis-ci = { repository = "actix/actix-web", branch = "master" }
-codecov = { repository = "actix/actix-web", branch = "master", service = "github" }
 
 [lib]
 name = "actix_web"
@@ -27,95 +25,97 @@ path = "src/lib.rs"
 
 [workspace]
 members = [
-  ".",
+    ".",
-  "awc",
+    "awc",
-  "actix-http",
+    "actix-http",
-  "actix-files",
+    "actix-files",
-  "actix-multipart",
+    "actix-multipart",
-  "actix-web-actors",
+    "actix-web-actors",
-  "actix-web-codegen",
+    "actix-web-codegen",
-  "actix-http-test",
+    "actix-http-test",
+    "actix-test",
 ]
+# enable when MSRV is 1.51+
+# resolver = "2"
 
 [features]
-default = ["compress"]
+default = ["compress-brotli", "compress-gzip", "compress-zstd", "cookies"]
 
-# content-encoding support
+# Brotli algorithm content-encoding support
-compress = ["actix-http/compress", "awc/compress"]
+compress-brotli = ["actix-http/compress-brotli", "__compress"]
+# Gzip and deflate algorithms content-encoding support
+compress-gzip = ["actix-http/compress-gzip", "__compress"]
+# Zstd algorithm content-encoding support
+compress-zstd = ["actix-http/compress-zstd", "__compress"]
 
-# sessions feature
+# support for cookies
-secure-cookies = ["actix-http/secure-cookies"]
+cookies = ["cookie"]
+
+# secure cookies feature
+secure-cookies = ["cookie/secure"]
 
 # openssl
-openssl = ["actix-tls/accept", "actix-tls/openssl", "awc/openssl", "open-ssl"]
+openssl = ["actix-http/openssl", "actix-tls/accept", "actix-tls/openssl"]
 
 # rustls
-rustls = ["actix-tls/accept", "actix-tls/rustls", "awc/rustls", "rust-tls"]
+rustls = ["actix-http/rustls", "actix-tls/accept", "actix-tls/rustls"]
 
-[[example]]
+# Internal (PRIVATE!) features used to aid testing and cheking feature status.
-name = "basic"
+# Don't rely on these whatsoever. They may disappear at anytime.
-required-features = ["compress"]
+__compress = []
-
-[[example]]
-name = "uds"
-required-features = ["compress"]
-
-[[test]]
-name = "test_server"
-required-features = ["compress"]
-
-[[example]]
-name = "on_connect"
-required-features = []
-
-[[example]]
-name = "client"
-required-features = ["rustls"]
 
 [dependencies]
-actix-codec = "0.4.0-beta.1"
+actix-codec = "0.4.0"
-actix-macros = "0.1.0"
+actix-macros = "0.2.1"
-actix-router = "0.2.4"
+actix-router = "0.2.7"
-actix-rt = "2.0.0-beta.1"
+actix-rt = "2.2"
-actix-server = "2.0.0-beta.2"
+actix-server = "2.0.0-beta.3"
-actix-service = "2.0.0-beta.2"
+actix-service = "2.0.0"
-actix-utils = "3.0.0-beta.1"
+actix-utils = "3.0.0"
-actix-threadpool = "0.3.1"
+actix-tls = { version = "3.0.0-beta.5", default-features = false, optional = true }
-actix-tls = { version = "3.0.0-beta.2", default-features = false, optional = true }
 
-actix-web-codegen = "0.4.0"
+actix-web-codegen = "0.5.0-beta.2"
-actix-http = "3.0.0-beta.1"
+actix-http = "3.0.0-beta.7"
-awc = { version = "3.0.0-beta.1", default-features = false }
 
-ahash = "0.6"
+ahash = "0.7"
 bytes = "1"
+cfg-if = "1"
+cookie = { version = "0.15", features = ["percent-encode"], optional = true }
 derive_more = "0.99.5"
+either = "1.5.3"
 encoding_rs = "0.8"
 futures-core = { version = "0.3.7", default-features = false }
 futures-util = { version = "0.3.7", default-features = false }
+itoa = "0.4"
+language-tags = "0.3"
+once_cell = "1.5"
 log = "0.4"
 mime = "0.3"
-socket2 = "0.3.16"
+paste = "1"
 pin-project = "1.0.0"
 regex = "1.4"
 serde = { version = "1.0", features = ["derive"] }
 serde_json = "1.0"
 serde_urlencoded = "0.7"
-time = { version = "0.2.7", default-features = false, features = ["std"] }
-url = "2.1"
-open-ssl = { package = "openssl", version = "0.10", optional = true }
-rust-tls = { package = "rustls", version = "0.19.0", optional = true }
 smallvec = "1.6"
+socket2 = "0.4.0"
+time = { version = "0.2.23", default-features = false, features = ["std"] }
+url = "2.1"
 
 [dev-dependencies]
-actix = "0.11.0-beta.1"
+actix-test = { version = "0.1.0-beta.3", features = ["openssl", "rustls"] }
-actix-http = { version = "3.0.0-beta.1", features = ["actors"] }
+awc = { version = "3.0.0-beta.6", features = ["openssl"] }
-rand = "0.8"
+
-env_logger = "0.8"
-serde_derive = "1.0"
 brotli2 = "0.3.2"
-flate2 = "1.0.13"
 criterion = "0.3"
+env_logger = "0.8"
+flate2 = "1.0.13"
+zstd = "0.7"
+rand = "0.8"
+rcgen = "0.8"
+serde_derive = "1.0"
+tls-openssl = { package = "openssl", version = "0.10.9" }
+tls-rustls = { package = "rustls", version = "0.19.0" }
 
 [profile.release]
 lto = true
@@ -123,15 +123,32 @@ opt-level = 3
 codegen-units = 1
 
 [patch.crates-io]
-actix-web = { path = "." }
+actix-files = { path = "actix-files" }
 actix-http = { path = "actix-http" }
 actix-http-test = { path = "actix-http-test" }
+actix-multipart = { path = "actix-multipart" }
+actix-test = { path = "actix-test" }
+actix-web = { path = "." }
 actix-web-actors = { path = "actix-web-actors" }
 actix-web-codegen = { path = "actix-web-codegen" }
-actix-multipart = { path = "actix-multipart" }
-actix-files = { path = "actix-files" }
 awc = { path = "awc" }
 
+[[test]]
+name = "test_server"
+required-features = ["compress-brotli", "compress-gzip", "compress-zstd", "cookies"]
+
+[[example]]
+name = "basic"
+required-features = ["compress-gzip"]
+
+[[example]]
+name = "uds"
+required-features = ["compress-gzip"]
+
+[[example]]
+name = "on_connect"
+required-features = []
+
 [[bench]]
 name = "server"
 harness = false
@@ -139,3 +156,7 @@ harness = false
 [[bench]]
 name = "service"
 harness = false
+
+[[bench]]
+name = "responder"
+harness = false

LICENSE-MIT

@@ -1,4 +1,4 @@
-Copyright (c) 2017 Actix Team
+Copyright (c) 2017-NOW Actix Team
 
 Permission is hereby granted, free of charge, to any
 person obtaining a copy of this software and associated

MIGRATION.md

@@ -10,6 +10,18 @@
 
   Alternatively, explicitly require trailing slashes: `NormalizePath::new(TrailingSlash::Always)`.
 
+* Feature flag `compress` has been split into its supported algorithm (brotli, gzip, zstd).
+  By default all compression algorithms are enabled.
+  To select algorithm you want to include with `middleware::Compress` use following flags:
+  - `compress-brotli`
+  - `compress-gzip`
+  - `compress-zstd`
+  If you have set in your `Cargo.toml` dedicated `actix-web` features and you still want
+  to have compression enabled. Please change features selection like bellow:
+
+  Before: `"compress"`
+  After: `"compress-brotli", "compress-gzip", "compress-zstd"`
+
 
 ## 3.0.0
 

README.md

@@ -1,20 +1,19 @@
 <div align="center">
-  <h1>Actix web</h1>
+  <h1>Actix Web</h1>
   <p>
     <strong>Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust</strong>
   </p>
   <p>
 
 [![crates.io](https://img.shields.io/crates/v/actix-web?label=latest)](https://crates.io/crates/actix-web)
-[![Documentation](https://docs.rs/actix-web/badge.svg?version=3.3.2)](https://docs.rs/actix-web/3.3.2)
+[![Documentation](https://docs.rs/actix-web/badge.svg?version=4.0.0-beta.7)](https://docs.rs/actix-web/4.0.0-beta.7)
 [![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
-![License](https://img.shields.io/crates/l/actix-web.svg)
+![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-web.svg)
-[![Dependency Status](https://deps.rs/crate/actix-web/3.3.2/status.svg)](https://deps.rs/crate/actix-web/3.3.2)
+[![Dependency Status](https://deps.rs/crate/actix-web/4.0.0-beta.7/status.svg)](https://deps.rs/crate/actix-web/4.0.0-beta.7)
 <br />
-[![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) 
+[![build status](https://github.com/actix/actix-web/workflows/CI%20%28Linux%29/badge.svg?branch=master&event=push)](https://github.com/actix/actix-web/actions)
 [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) 
-[![Download](https://img.shields.io/crates/d/actix-web.svg)](https://crates.io/crates/actix-web)
+![downloads](https://img.shields.io/crates/d/actix-web.svg)
-[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
 [![Chat on Discord](https://img.shields.io/discord/771444961383153695?label=chat&logo=discord)](https://discord.gg/NWpN5mmg3x)
 
   </p>
@@ -26,14 +25,13 @@
 * Streaming and pipelining
 * Keep-alive and slow requests handling
 * Client/server [WebSockets](https://actix.rs/docs/websockets/) support
-* Transparent content compression/decompression (br, gzip, deflate)
+* Transparent content compression/decompression (br, gzip, deflate, zstd)
 * Powerful [request routing](https://actix.rs/docs/url-dispatch/)
 * Multipart streams
 * Static assets
 * SSL support using OpenSSL or Rustls
 * Middlewares ([Logger, Session, CORS, etc](https://actix.rs/docs/middleware/))
-* Includes an async [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
+* Includes an async [HTTP client](https://docs.rs/awc/)
-* Supports [Actix actor framework](https://github.com/actix/actix)
 * Runs on stable Rust 1.46+
 
 ## Documentation
@@ -73,18 +71,18 @@ async fn main() -> std::io::Result<()> {
 
 ### More examples
 
-* [Basic Setup](https://github.com/actix/examples/tree/master/basics/)
+* [Basic Setup](https://github.com/actix/examples/tree/master/basics/basics/)
-* [Application State](https://github.com/actix/examples/tree/master/state/)
+* [Application State](https://github.com/actix/examples/tree/master/basics/state/)
-* [JSON Handling](https://github.com/actix/examples/tree/master/json/)
+* [JSON Handling](https://github.com/actix/examples/tree/master/json/json/)
-* [Multipart Streams](https://github.com/actix/examples/tree/master/multipart/)
+* [Multipart Streams](https://github.com/actix/examples/tree/master/forms/multipart/)
-* [Diesel Integration](https://github.com/actix/examples/tree/master/diesel/)
+* [Diesel Integration](https://github.com/actix/examples/tree/master/database_interactions/diesel/)
-* [r2d2 Integration](https://github.com/actix/examples/tree/master/r2d2/)
+* [r2d2 Integration](https://github.com/actix/examples/tree/master/database_interactions/r2d2/)
-* [Simple WebSocket](https://github.com/actix/examples/tree/master/websocket/)
+* [Simple WebSocket](https://github.com/actix/examples/tree/master/websockets/websocket/)
-* [Tera Templates](https://github.com/actix/examples/tree/master/template_tera/)
+* [Tera Templates](https://github.com/actix/examples/tree/master/template_engines/tera/)
-* [Askama Templates](https://github.com/actix/examples/tree/master/template_askama/)
+* [Askama Templates](https://github.com/actix/examples/tree/master/template_engines/askama/)
-* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/rustls/)
+* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/security/rustls/)
-* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/openssl/)
+* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/security/openssl/)
-* [WebSocket Chat](https://github.com/actix/examples/tree/master/websocket-chat/)
+* [WebSocket Chat](https://github.com/actix/examples/tree/master/websockets/chat/)
 
 You may consider checking out
 [this directory](https://github.com/actix/examples/tree/master/) for more examples.
@@ -92,16 +90,16 @@ You may consider checking out
 ## Benchmarks
 
 One of the fastest web frameworks available according to the
-[TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r19).
+[TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r20&test=composite).
 
 ## License
 
 This project is licensed under either of
 
 * Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or
-  [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
+  [http://www.apache.org/licenses/LICENSE-2.0])
 * MIT license ([LICENSE-MIT](LICENSE-MIT) or
-  [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
+  [http://opensource.org/licenses/MIT])
 
 at your option.
 

actix-files/CHANGES.md

@@ -3,6 +3,39 @@
 ## Unreleased - 2021-xx-xx
 
 
+## 0.6.0-beta.5 - 2021-06-17
+* `NamedFile` now implements `ServiceFactory` and `HttpServiceFactory` making it much more useful in routing. For example, it can be used directly as a default service. [#2135]
+* For symbolic links, `Content-Disposition` header no longer shows the filename of the original file. [#2156]
+* `Files::redirect_to_slash_directory()` now works as expected when used with `Files::show_files_listing()`. [#2225]
+* `application/{javascript, json, wasm}` mime type now have `inline` disposition by default. [#2257]
+* `Files::show_files_listing()` can now be used with `Files::index_file()` to show files listing as a fallback when the index file is not found. [#2228]
+
+[#2135]: https://github.com/actix/actix-web/pull/2135
+[#2156]: https://github.com/actix/actix-web/pull/2156
+[#2225]: https://github.com/actix/actix-web/pull/2225
+[#2257]: https://github.com/actix/actix-web/pull/2257
+[#2228]: https://github.com/actix/actix-web/pull/2228
+
+
+## 0.6.0-beta.4 - 2021-04-02
+* No notable changes.
+
+* Add support for `.guard` in `Files` to selectively filter `Files` services. [#2046]
+
+[#2046]: https://github.com/actix/actix-web/pull/2046
+
+## 0.6.0-beta.3 - 2021-03-09
+* No notable changes.
+
+
+## 0.6.0-beta.2 - 2021-02-10
+* Fix If-Modified-Since and If-Unmodified-Since to not compare using sub-second timestamps. [#1887]
+* Replace `v_htmlescape` with `askama_escape`. [#1953]
+
+[#1887]: https://github.com/actix/actix-web/pull/1887
+[#1953]: https://github.com/actix/actix-web/pull/1953
+
+
 ## 0.6.0-beta.1 - 2021-01-07
 * `HttpRange::parse` now has its own error type.
 * Update `bytes` to `1.0`. [#1813]

actix-files/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-files"
-version = "0.6.0-beta.1"
+version = "0.6.0-beta.5"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Static file serving for Actix Web"
 readme = "README.md"
@@ -17,19 +17,23 @@ name = "actix_files"
 path = "src/lib.rs"
 
 [dependencies]
-actix-web = { version = "4.0.0-beta.1", default-features = false }
+actix-web = { version = "4.0.0-beta.7", default-features = false }
-actix-service = "2.0.0-beta.2"
+actix-http = "3.0.0-beta.7"
+actix-service = "2.0.0"
+actix-utils = "3.0.0"
+
+askama_escape = "0.10"
 bitflags = "1"
 bytes = "1"
-futures-core = { version = "0.3.7", default-features = false }
+futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
-futures-util = { version = "0.3.7", default-features = false }
+http-range = "0.1.4"
 derive_more = "0.99.5"
 log = "0.4"
 mime = "0.3"
 mime_guess = "2.0.1"
 percent-encoding = "2.1"
-v_htmlescape = "0.12"
 
 [dev-dependencies]
-actix-rt = "2.0.0-beta.1"
+actix-rt = "2.2"
-actix-web = "4.0.0-beta.1"
+actix-web = "4.0.0-beta.7"
+actix-test = "0.1.0-beta.3"

actix-files/README.md

@@ -3,17 +3,17 @@
 > Static file serving for Actix Web
 
 [![crates.io](https://img.shields.io/crates/v/actix-files?label=latest)](https://crates.io/crates/actix-files)
-[![Documentation](https://docs.rs/actix-files/badge.svg?version=0.5.0)](https://docs.rs/actix-files/0.5.0)
+[![Documentation](https://docs.rs/actix-files/badge.svg?version=0.6.0-beta.5)](https://docs.rs/actix-files/0.6.0-beta.5)
 [![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
 ![License](https://img.shields.io/crates/l/actix-files.svg)
 <br />
-[![dependency status](https://deps.rs/crate/actix-files/0.5.0/status.svg)](https://deps.rs/crate/actix-files/0.5.0)
+[![dependency status](https://deps.rs/crate/actix-files/0.6.0-beta.5/status.svg)](https://deps.rs/crate/actix-files/0.6.0-beta.5)
 [![Download](https://img.shields.io/crates/d/actix-files.svg)](https://crates.io/crates/actix-files)
 [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
 
 ## Documentation & Resources
 
 - [API Documentation](https://docs.rs/actix-files/)
-- [Example Project](https://github.com/actix/examples/tree/master/static_index)
+- [Example Project](https://github.com/actix/examples/tree/master/basics/static_index)
 - [Chat on Gitter](https://gitter.im/actix/actix-web)
 - Minimum supported Rust version: 1.46 or later

actix-files/src/chunked.rs

@@ -9,26 +9,35 @@ use std::{
 
 use actix_web::{
     error::{BlockingError, Error},
-    web,
+    rt::task::{spawn_blocking, JoinHandle},
 };
 use bytes::Bytes;
 use futures_core::{ready, Stream};
-use futures_util::future::{FutureExt, LocalBoxFuture};
-
-use crate::handle_error;
-
-type ChunkedBoxFuture =
-    LocalBoxFuture<'static, Result<(File, Bytes), BlockingError<io::Error>>>;
 
 #[doc(hidden)]
 /// A helper created from a `std::fs::File` which reads the file
 /// chunk-by-chunk on a `ThreadPool`.
 pub struct ChunkedReadFile {
-    pub(crate) size: u64,
+    size: u64,
-    pub(crate) offset: u64,
+    offset: u64,
-    pub(crate) file: Option<File>,
+    state: ChunkedReadFileState,
-    pub(crate) fut: Option<ChunkedBoxFuture>,
+    counter: u64,
-    pub(crate) counter: u64,
+}
+
+enum ChunkedReadFileState {
+    File(Option<File>),
+    Future(JoinHandle<Result<(File, Bytes), io::Error>>),
+}
+
+impl ChunkedReadFile {
+    pub(crate) fn new(size: u64, offset: u64, file: File) -> Self {
+        Self {
+            size,
+            offset,
+            state: ChunkedReadFileState::File(Some(file)),
+            counter: 0,
+        }
+    }
 }
 
 impl fmt::Debug for ChunkedReadFile {
@@ -40,55 +49,50 @@ impl fmt::Debug for ChunkedReadFile {
 impl Stream for ChunkedReadFile {
     type Item = Result<Bytes, Error>;
 
-    fn poll_next(
+    fn poll_next(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Option<Self::Item>> {
-        mut self: Pin<&mut Self>,
+        let this = self.as_mut().get_mut();
-        cx: &mut Context<'_>,
+        match this.state {
-    ) -> Poll<Option<Self::Item>> {
+            ChunkedReadFileState::File(ref mut file) => {
-        if let Some(ref mut fut) = self.fut {
+                let size = this.size;
-            return match ready!(Pin::new(fut).poll(cx)) {
+                let offset = this.offset;
-                Ok((file, bytes)) => {
+                let counter = this.counter;
-                    self.fut.take();
-                    self.file = Some(file);
 
-                    self.offset += bytes.len() as u64;
+                if size == counter {
-                    self.counter += bytes.len() as u64;
+                    Poll::Ready(None)
+                } else {
+                    let mut file = file
+                        .take()
+                        .expect("ChunkedReadFile polled after completion");
 
-                    Poll::Ready(Some(Ok(bytes)))
+                    let fut = spawn_blocking(move || {
+                        let max_bytes = cmp::min(size.saturating_sub(counter), 65_536) as usize;
+
+                        let mut buf = Vec::with_capacity(max_bytes);
+                        file.seek(io::SeekFrom::Start(offset))?;
+
+                        let n_bytes =
+                            file.by_ref().take(max_bytes as u64).read_to_end(&mut buf)?;
+
+                        if n_bytes == 0 {
+                            return Err(io::ErrorKind::UnexpectedEof.into());
+                        }
+
+                        Ok((file, Bytes::from(buf)))
+                    });
+                    this.state = ChunkedReadFileState::Future(fut);
+                    self.poll_next(cx)
                 }
-                Err(e) => Poll::Ready(Some(Err(handle_error(e)))),
+            }
-            };
+            ChunkedReadFileState::Future(ref mut fut) => {
-        }
+                let (file, bytes) =
+                    ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
+                this.state = ChunkedReadFileState::File(Some(file));
 
-        let size = self.size;
+                this.offset += bytes.len() as u64;
-        let offset = self.offset;
+                this.counter += bytes.len() as u64;
-        let counter = self.counter;
 
-        if size == counter {
+                Poll::Ready(Some(Ok(bytes)))
-            Poll::Ready(None)
+            }
-        } else {
-            let mut file = self.file.take().expect("Use after completion");
-
-            self.fut = Some(
-                web::block(move || {
-                    let max_bytes =
-                        cmp::min(size.saturating_sub(counter), 65_536) as usize;
-
-                    let mut buf = Vec::with_capacity(max_bytes);
-                    file.seek(io::SeekFrom::Start(offset))?;
-
-                    let n_bytes =
-                        file.by_ref().take(max_bytes as u64).read_to_end(&mut buf)?;
-
-                    if n_bytes == 0 {
-                        return Err(io::ErrorKind::UnexpectedEof.into());
-                    }
-
-                    Ok((file, Bytes::from(buf)))
-                })
-                .boxed_local(),
-            );
-
-            self.poll_next(cx)
         }
     }
 }

actix-files/src/directory.rs

@@ -1,8 +1,8 @@
 use std::{fmt::Write, fs::DirEntry, io, path::Path, path::PathBuf};
 
 use actix_web::{dev::ServiceResponse, HttpRequest, HttpResponse};
+use askama_escape::{escape as escape_html_entity, Html};
 use percent_encoding::{utf8_percent_encode, CONTROLS};
-use v_htmlescape::escape as escape_html_entity;
 
 /// A directory; responds with the generated directory listing.
 #[derive(Debug)]
@@ -50,7 +50,7 @@ macro_rules! encode_file_url {
 // " -- &quot;  & -- &amp;  ' -- &#x27;  < -- &lt;  > -- &gt;  / -- &#x2f;
 macro_rules! encode_file_name {
     ($entry:ident) => {
-        escape_html_entity(&$entry.file_name().to_string_lossy())
+        escape_html_entity(&$entry.file_name().to_string_lossy(), Html)
     };
 }
 
@@ -66,9 +66,7 @@ pub(crate) fn directory_listing(
         if dir.is_visible(&entry) {
             let entry = entry.unwrap();
             let p = match entry.path().strip_prefix(&dir.path) {
-                Ok(p) if cfg!(windows) => {
+                Ok(p) if cfg!(windows) => base.join(p).to_string_lossy().replace("\\", "/"),
-                    base.join(p).to_string_lossy().replace("\\", "/")
-                }
                 Ok(p) => base.join(p).to_string_lossy().into_owned(),
                 Err(_) => continue,
             };

actix-files/src/error.rs

@@ -1,4 +1,4 @@
-use actix_web::{http::StatusCode, HttpResponse, ResponseError};
+use actix_web::{http::StatusCode, ResponseError};
 use derive_more::Display;
 
 /// Errors which can occur when serving static files.
@@ -16,8 +16,8 @@ pub enum FilesError {
 
 /// Return `NotFound` for `FilesError`
 impl ResponseError for FilesError {
-    fn error_response(&self) -> HttpResponse {
+    fn status_code(&self) -> StatusCode {
-        HttpResponse::new(StatusCode::NOT_FOUND)
+        StatusCode::NOT_FOUND
     }
 }
 

actix-files/src/files.rs

@@ -1,27 +1,26 @@
 use std::{cell::RefCell, fmt, io, path::PathBuf, rc::Rc};
 
 use actix_service::{boxed, IntoServiceFactory, ServiceFactory, ServiceFactoryExt};
+use actix_utils::future::ok;
 use actix_web::{
-    dev::{
+    dev::{AppService, HttpServiceFactory, ResourceDef, ServiceRequest, ServiceResponse},
-        AppService, HttpServiceFactory, ResourceDef, ServiceRequest, ServiceResponse,
-    },
     error::Error,
     guard::Guard,
     http::header::DispositionType,
     HttpRequest,
 };
-use futures_util::future::{ok, FutureExt, LocalBoxFuture};
+use futures_core::future::LocalBoxFuture;
 
 use crate::{
-    directory_listing, named, Directory, DirectoryRenderer, FilesService,
+    directory_listing, named, Directory, DirectoryRenderer, FilesService, HttpNewService,
-    HttpNewService, MimeOverride,
+    MimeOverride,
 };
 
 /// Static files handling service.
 ///
 /// `Files` service must be registered with `App::service()` method.
 ///
-/// ```rust
+/// ```
 /// use actix_web::App;
 /// use actix_files::Files;
 ///
@@ -38,7 +37,8 @@ pub struct Files {
     renderer: Rc<DirectoryRenderer>,
     mime_override: Option<Rc<MimeOverride>>,
     file_flags: named::Flags,
-    guards: Option<Rc<dyn Guard>>,
+    use_guards: Option<Rc<dyn Guard>>,
+    guards: Vec<Rc<dyn Guard>>,
     hidden_files: bool,
 }
 
@@ -60,6 +60,7 @@ impl Clone for Files {
             file_flags: self.file_flags,
             path: self.path.clone(),
             mime_override: self.mime_override.clone(),
+            use_guards: self.use_guards.clone(),
             guards: self.guards.clone(),
             hidden_files: self.hidden_files,
         }
@@ -81,9 +82,9 @@ impl Files {
     /// If the mount path is set as the root path `/`, services registered after this one will
     /// be inaccessible. Register more specific handlers and services first.
     ///
-    /// `Files` uses a threadpool for blocking filesystem operations. By default, the pool uses a
+    /// `Files` utilizes the existing Tokio thread-pool for blocking filesystem operations.
-    /// number of threads equal to 5x the number of available logical CPUs. Pool size can be changed
+    /// The number of running threads is adjusted over time as needed, up to a maximum of 512 times
-    /// by setting ACTIX_THREADPOOL environment variable.
+    /// the number of server [workers](actix_web::HttpServer::workers), by default.
     pub fn new<T: Into<PathBuf>>(mount_path: &str, serve_from: T) -> Files {
         let orig_dir = serve_from.into();
         let dir = match orig_dir.canonicalize() {
@@ -104,7 +105,8 @@ impl Files {
             renderer: Rc::new(directory_listing),
             mime_override: None,
             file_flags: named::Flags::default(),
-            guards: None,
+            use_guards: None,
+            guards: Vec::new(),
             hidden_files: false,
         }
     }
@@ -112,6 +114,9 @@ impl Files {
     /// Show files listing for directories.
     ///
     /// By default show files listing is disabled.
+    ///
+    /// When used with [`Files::index_file()`], files listing is shown as a fallback
+    /// when the index file is not found.
     pub fn show_files_listing(mut self) -> Self {
         self.show_index = true;
         self
@@ -128,8 +133,8 @@ impl Files {
     /// Set custom directory renderer
     pub fn files_listing_renderer<F>(mut self, f: F) -> Self
     where
-        for<'r, 's> F: Fn(&'r Directory, &'s HttpRequest) -> Result<ServiceResponse, io::Error>
+        for<'r, 's> F:
-            + 'static,
+            Fn(&'r Directory, &'s HttpRequest) -> Result<ServiceResponse, io::Error> + 'static,
     {
         self.renderer = Rc::new(f);
         self
@@ -146,8 +151,11 @@ impl Files {
 
     /// Set index file
     ///
-    /// Shows specific index file for directory "/" instead of
+    /// Shows specific index file for directories instead of
     /// showing files listing.
+    ///
+    /// If the index file is not found, files listing is shown as a fallback if
+    /// [`Files::show_files_listing()`] is set.
     pub fn index_file<T: Into<String>>(mut self, index: T) -> Self {
         self.index = Some(index.into());
         self
@@ -156,7 +164,6 @@ impl Files {
     /// Specifies whether to use ETag or not.
     ///
     /// Default is true.
-    #[inline]
     pub fn use_etag(mut self, value: bool) -> Self {
         self.file_flags.set(named::Flags::ETAG, value);
         self
@@ -165,7 +172,6 @@ impl Files {
     /// Specifies whether to use Last-Modified or not.
     ///
     /// Default is true.
-    #[inline]
     pub fn use_last_modified(mut self, value: bool) -> Self {
         self.file_flags.set(named::Flags::LAST_MD, value);
         self
@@ -174,31 +180,74 @@ impl Files {
     /// Specifies whether text responses should signal a UTF-8 encoding.
     ///
     /// Default is false (but will default to true in a future version).
-    #[inline]
     pub fn prefer_utf8(mut self, value: bool) -> Self {
         self.file_flags.set(named::Flags::PREFER_UTF8, value);
         self
     }
 
-    /// Specifies custom guards to use for directory listings and files.
+    /// Adds a routing guard.
     ///
-    /// Default behaviour allows GET and HEAD.
+    /// Use this to allow multiple chained file services that respond to strictly different
-    #[inline]
+    /// properties of a request. Due to the way routing works, if a guard check returns true and the
-    pub fn use_guards<G: Guard + 'static>(mut self, guards: G) -> Self {
+    /// request starts being handled by the file service, it will not be able to back-out and try
-        self.guards = Some(Rc::new(guards));
+    /// the next service, you will simply get a 404 (or 405) error response.
+    ///
+    /// To allow `POST` requests to retrieve files, see [`Files::use_guards`].
+    ///
+    /// # Examples
+    /// ```
+    /// use actix_web::{guard::Header, App};
+    /// use actix_files::Files;
+    ///
+    /// App::new().service(
+    ///     Files::new("/","/my/site/files")
+    ///         .guard(Header("Host", "example.com"))
+    /// );
+    /// ```
+    pub fn guard<G: Guard + 'static>(mut self, guard: G) -> Self {
+        self.guards.push(Rc::new(guard));
         self
     }
 
+    /// Specifies guard to check before fetching directory listings or files.
+    ///
+    /// Note that this guard has no effect on routing; it's main use is to guard on the request's
+    /// method just before serving the file, only allowing `GET` and `HEAD` requests by default.
+    /// See [`Files::guard`] for routing guards.
+    pub fn method_guard<G: Guard + 'static>(mut self, guard: G) -> Self {
+        self.use_guards = Some(Rc::new(guard));
+        self
+    }
+
+    #[doc(hidden)]
+    #[deprecated(since = "0.6.0", note = "Renamed to `method_guard`.")]
+    /// See [`Files::method_guard`].
+    pub fn use_guards<G: Guard + 'static>(self, guard: G) -> Self {
+        self.method_guard(guard)
+    }
+
     /// Disable `Content-Disposition` header.
     ///
     /// By default Content-Disposition` header is enabled.
-    #[inline]
     pub fn disable_content_disposition(mut self) -> Self {
         self.file_flags.remove(named::Flags::CONTENT_DISPOSITION);
         self
     }
 
     /// Sets default handler which is used when no matched file could be found.
+    ///
+    /// # Examples
+    /// Setting a fallback static file handler:
+    /// ```
+    /// use actix_files::{Files, NamedFile};
+    ///
+    /// # fn run() -> Result<(), actix_web::Error> {
+    /// let files = Files::new("/", "./static")
+    ///     .index_file("index.html")
+    ///     .default_handler(NamedFile::open("./static/404.html")?);
+    /// # Ok(())
+    /// # }
+    /// ```
     pub fn default_handler<F, U>(mut self, f: F) -> Self
     where
         F: IntoServiceFactory<U, ServiceRequest>,
@@ -218,7 +267,6 @@ impl Files {
     }
 
     /// Enables serving hidden files and directories, allowing a leading dots in url fragments.
-    #[inline]
     pub fn use_hidden_files(mut self) -> Self {
         self.hidden_files = true;
         self
@@ -226,7 +274,19 @@ impl Files {
 }
 
 impl HttpServiceFactory for Files {
-    fn register(self, config: &mut AppService) {
+    fn register(mut self, config: &mut AppService) {
+        let guards = if self.guards.is_empty() {
+            None
+        } else {
+            let guards = std::mem::take(&mut self.guards);
+            Some(
+                guards
+                    .into_iter()
+                    .map(|guard| -> Box<dyn Guard> { Box::new(guard) })
+                    .collect::<Vec<_>>(),
+            )
+        };
+
         if self.default.borrow().is_none() {
             *self.default.borrow_mut() = Some(config.default_service());
         }
@@ -237,7 +297,7 @@ impl HttpServiceFactory for Files {
             ResourceDef::prefix(&self.path)
         };
 
-        config.register_service(rdef, None, self, None)
+        config.register_service(rdef, guards, self, None)
     }
 }
 
@@ -259,23 +319,23 @@ impl ServiceFactory<ServiceRequest> for Files {
             renderer: self.renderer.clone(),
             mime_override: self.mime_override.clone(),
             file_flags: self.file_flags,
-            guards: self.guards.clone(),
+            guards: self.use_guards.clone(),
             hidden_files: self.hidden_files,
         };
 
         if let Some(ref default) = *self.default.borrow() {
-            default
+            let fut = default.new_service(());
-                .new_service(())
+            Box::pin(async {
-                .map(move |result| match result {
+                match fut.await {
                     Ok(default) => {
                         srv.default = Some(default);
                         Ok(srv)
                     }
                     Err(_) => Err(()),
-                })
+                }
-                .boxed_local()
+            })
         } else {
-            ok(srv).boxed_local()
+            Box::pin(ok(srv))
         }
     }
 }

actix-files/src/lib.rs

@@ -3,7 +3,7 @@
 //! Provides a non-blocking service for serving static files from disk.
 //!
 //! # Example
-//! ```rust
+//! ```
 //! use actix_web::App;
 //! use actix_files::Files;
 //!
@@ -14,12 +14,10 @@
 #![deny(rust_2018_idioms)]
 #![warn(missing_docs, missing_debug_implementations)]
 
-use std::io;
-
 use actix_service::boxed::{BoxService, BoxServiceFactory};
 use actix_web::{
     dev::{ServiceRequest, ServiceResponse},
-    error::{BlockingError, Error, ErrorInternalServerError},
+    error::Error,
     http::header::DispositionType,
 };
 use mime_guess::from_ext;
@@ -56,13 +54,6 @@ pub fn file_extension_to_mime(ext: &str) -> mime::Mime {
     from_ext(ext).first_or_octet_stream()
 }
 
-pub(crate) fn handle_error(err: BlockingError<io::Error>) -> Error {
-    match err {
-        BlockingError::Error(err) => err.into(),
-        BlockingError::Canceled => ErrorInternalServerError("Unexpected error"),
-    }
-}
-
 type MimeOverride = dyn Fn(&mime::Name<'_>) -> DispositionType;
 
 #[cfg(test)]
@@ -74,6 +65,7 @@ mod tests {
     };
 
     use actix_service::ServiceFactory;
+    use actix_utils::future::ok;
     use actix_web::{
         guard,
         http::{
@@ -82,9 +74,9 @@ mod tests {
         },
         middleware::Compress,
         test::{self, TestRequest},
-        web, App, HttpResponse, Responder,
+        web::{self, Bytes},
+        App, HttpResponse, Responder,
     };
-    use futures_util::future::ok;
 
     use super::*;
 
@@ -106,11 +98,22 @@ mod tests {
     #[actix_rt::test]
     async fn test_if_modified_since_without_if_none_match() {
         let file = NamedFile::open("Cargo.toml").unwrap();
-        let since =
+        let since = header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
-            header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
 
         let req = TestRequest::default()
-            .header(header::IF_MODIFIED_SINCE, since)
+            .insert_header((header::IF_MODIFIED_SINCE, since))
+            .to_http_request();
+        let resp = file.respond_to(&req).await.unwrap();
+        assert_eq!(resp.status(), StatusCode::NOT_MODIFIED);
+    }
+
+    #[actix_rt::test]
+    async fn test_if_modified_since_without_if_none_match_same() {
+        let file = NamedFile::open("Cargo.toml").unwrap();
+        let since = file.last_modified().unwrap();
+
+        let req = TestRequest::default()
+            .insert_header((header::IF_MODIFIED_SINCE, since))
             .to_http_request();
         let resp = file.respond_to(&req).await.unwrap();
         assert_eq!(resp.status(), StatusCode::NOT_MODIFIED);
@@ -119,17 +122,40 @@ mod tests {
     #[actix_rt::test]
     async fn test_if_modified_since_with_if_none_match() {
         let file = NamedFile::open("Cargo.toml").unwrap();
-        let since =
+        let since = header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
-            header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
 
         let req = TestRequest::default()
-            .header(header::IF_NONE_MATCH, "miss_etag")
+            .insert_header((header::IF_NONE_MATCH, "miss_etag"))
-            .header(header::IF_MODIFIED_SINCE, since)
+            .insert_header((header::IF_MODIFIED_SINCE, since))
             .to_http_request();
         let resp = file.respond_to(&req).await.unwrap();
         assert_ne!(resp.status(), StatusCode::NOT_MODIFIED);
     }
 
+    #[actix_rt::test]
+    async fn test_if_unmodified_since() {
+        let file = NamedFile::open("Cargo.toml").unwrap();
+        let since = file.last_modified().unwrap();
+
+        let req = TestRequest::default()
+            .insert_header((header::IF_UNMODIFIED_SINCE, since))
+            .to_http_request();
+        let resp = file.respond_to(&req).await.unwrap();
+        assert_eq!(resp.status(), StatusCode::OK);
+    }
+
+    #[actix_rt::test]
+    async fn test_if_unmodified_since_failed() {
+        let file = NamedFile::open("Cargo.toml").unwrap();
+        let since = header::HttpDate::from(SystemTime::UNIX_EPOCH);
+
+        let req = TestRequest::default()
+            .insert_header((header::IF_UNMODIFIED_SINCE, since))
+            .to_http_request();
+        let resp = file.respond_to(&req).await.unwrap();
+        assert_eq!(resp.status(), StatusCode::PRECONDITION_FAILED);
+    }
+
     #[actix_rt::test]
     async fn test_named_file_text() {
         assert!(NamedFile::open("test--").is_err());
@@ -184,8 +210,7 @@ mod tests {
     #[actix_rt::test]
     async fn test_named_file_non_ascii_file_name() {
         let mut file =
-            NamedFile::from_file(File::open("Cargo.toml").unwrap(), "貨物.toml")
+            NamedFile::from_file(File::open("Cargo.toml").unwrap(), "貨物.toml").unwrap();
-                .unwrap();
         {
             file.file();
             let _f: &File = &file;
@@ -254,6 +279,22 @@ mod tests {
         );
     }
 
+    #[actix_rt::test]
+    async fn test_named_file_javascript() {
+        let file = NamedFile::open("tests/test.js").unwrap();
+
+        let req = TestRequest::default().to_http_request();
+        let resp = file.respond_to(&req).await.unwrap();
+        assert_eq!(
+            resp.headers().get(header::CONTENT_TYPE).unwrap(),
+            "application/javascript"
+        );
+        assert_eq!(
+            resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
+            "inline; filename=\"test.js\""
+        );
+    }
+
     #[actix_rt::test]
     async fn test_named_file_image_attachment() {
         let cd = ContentDisposition {
@@ -338,7 +379,7 @@ mod tests {
             DispositionType::Attachment
         }
 
-        let mut srv = test::init_service(
+        let srv = test::init_service(
             App::new().service(
                 Files::new("/", ".")
                     .mime_override(all_attachment)
@@ -348,7 +389,7 @@ mod tests {
         .await;
 
         let request = TestRequest::get().uri("/").to_request();
-        let response = test::call_service(&mut srv, request).await;
+        let response = test::call_service(&srv, request).await;
         assert_eq!(response.status(), StatusCode::OK);
 
         let content_disposition = response
@@ -363,7 +404,7 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_ranges_status_code() {
-        let mut srv = test::init_service(
+        let srv = test::init_service(
             App::new().service(Files::new("/test", ".").index_file("Cargo.toml")),
         )
         .await;
@@ -371,29 +412,29 @@ mod tests {
         // Valid range header
         let request = TestRequest::get()
             .uri("/t%65st/Cargo.toml")
-            .header(header::RANGE, "bytes=10-20")
+            .insert_header((header::RANGE, "bytes=10-20"))
             .to_request();
-        let response = test::call_service(&mut srv, request).await;
+        let response = test::call_service(&srv, request).await;
         assert_eq!(response.status(), StatusCode::PARTIAL_CONTENT);
 
         // Invalid range header
         let request = TestRequest::get()
             .uri("/t%65st/Cargo.toml")
-            .header(header::RANGE, "bytes=1-0")
+            .insert_header((header::RANGE, "bytes=1-0"))
             .to_request();
-        let response = test::call_service(&mut srv, request).await;
+        let response = test::call_service(&srv, request).await;
 
         assert_eq!(response.status(), StatusCode::RANGE_NOT_SATISFIABLE);
     }
 
     #[actix_rt::test]
     async fn test_named_file_content_range_headers() {
-        let srv = test::start(|| App::new().service(Files::new("/", ".")));
+        let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
 
         // Valid range header
         let response = srv
             .get("/tests/test.binary")
-            .header(header::RANGE, "bytes=10-20")
+            .insert_header((header::RANGE, "bytes=10-20"))
             .send()
             .await
             .unwrap();
@@ -403,7 +444,7 @@ mod tests {
         // Invalid range header
         let response = srv
             .get("/tests/test.binary")
-            .header(header::RANGE, "bytes=10-5")
+            .insert_header((header::RANGE, "bytes=10-5"))
             .send()
             .await
             .unwrap();
@@ -413,12 +454,12 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_content_length_headers() {
-        let srv = test::start(|| App::new().service(Files::new("/", ".")));
+        let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
 
         // Valid range header
         let response = srv
             .get("/tests/test.binary")
-            .header(header::RANGE, "bytes=10-20")
+            .insert_header((header::RANGE, "bytes=10-20"))
             .send()
             .await
             .unwrap();
@@ -428,7 +469,7 @@ mod tests {
         // Valid range header, starting from 0
         let response = srv
             .get("/tests/test.binary")
-            .header(header::RANGE, "bytes=0-20")
+            .insert_header((header::RANGE, "bytes=0-20"))
             .send()
             .await
             .unwrap();
@@ -452,7 +493,7 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_head_content_length_headers() {
-        let srv = test::start(|| App::new().service(Files::new("/", ".")));
+        let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
 
         let response = srv.head("/tests/test.binary").send().await.unwrap();
 
@@ -468,14 +509,14 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_static_files_with_spaces() {
-        let mut srv = test::init_service(
+        let srv = test::init_service(
             App::new().service(Files::new("/", ".").index_file("Cargo.toml")),
         )
         .await;
         let request = TestRequest::get()
             .uri("/tests/test%20space.binary")
             .to_request();
-        let response = test::call_service(&mut srv, request).await;
+        let response = test::call_service(&srv, request).await;
         assert_eq!(response.status(), StatusCode::OK);
 
         let bytes = test::read_body(response).await;
@@ -485,29 +526,29 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_files_not_allowed() {
-        let mut srv = test::init_service(App::new().service(Files::new("/", "."))).await;
+        let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
 
         let req = TestRequest::default()
             .uri("/Cargo.toml")
             .method(Method::POST)
             .to_request();
 
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::METHOD_NOT_ALLOWED);
 
-        let mut srv = test::init_service(App::new().service(Files::new("/", "."))).await;
+        let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
         let req = TestRequest::default()
             .method(Method::PUT)
             .uri("/Cargo.toml")
             .to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::METHOD_NOT_ALLOWED);
     }
 
     #[actix_rt::test]
     async fn test_files_guards() {
-        let mut srv = test::init_service(
+        let srv = test::init_service(
-            App::new().service(Files::new("/", ".").use_guards(guard::Post())),
+            App::new().service(Files::new("/", ".").method_guard(guard::Post())),
         )
         .await;
 
@@ -516,13 +557,13 @@ mod tests {
             .method(Method::POST)
             .to_request();
 
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::OK);
     }
 
     #[actix_rt::test]
     async fn test_named_file_content_encoding() {
-        let mut srv = test::init_service(App::new().wrap(Compress::default()).service(
+        let srv = test::init_service(App::new().wrap(Compress::default()).service(
             web::resource("/").to(|| async {
                 NamedFile::open("Cargo.toml")
                     .unwrap()
@@ -533,16 +574,16 @@ mod tests {
 
         let request = TestRequest::get()
             .uri("/")
-            .header(header::ACCEPT_ENCODING, "gzip")
+            .insert_header((header::ACCEPT_ENCODING, "gzip"))
             .to_request();
-        let res = test::call_service(&mut srv, request).await;
+        let res = test::call_service(&srv, request).await;
         assert_eq!(res.status(), StatusCode::OK);
         assert!(!res.headers().contains_key(header::CONTENT_ENCODING));
     }
 
     #[actix_rt::test]
     async fn test_named_file_content_encoding_gzip() {
-        let mut srv = test::init_service(App::new().wrap(Compress::default()).service(
+        let srv = test::init_service(App::new().wrap(Compress::default()).service(
             web::resource("/").to(|| async {
                 NamedFile::open("Cargo.toml")
                     .unwrap()
@@ -553,9 +594,9 @@ mod tests {
 
         let request = TestRequest::get()
             .uri("/")
-            .header(header::ACCEPT_ENCODING, "gzip")
+            .insert_header((header::ACCEPT_ENCODING, "gzip"))
             .to_request();
-        let res = test::call_service(&mut srv, request).await;
+        let res = test::call_service(&srv, request).await;
         assert_eq!(res.status(), StatusCode::OK);
         assert_eq!(
             res.headers()
@@ -577,27 +618,25 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_static_files() {
-        let mut srv = test::init_service(
+        let srv =
-            App::new().service(Files::new("/", ".").show_files_listing()),
+            test::init_service(App::new().service(Files::new("/", ".").show_files_listing()))
-        )
+                .await;
-        .await;
         let req = TestRequest::with_uri("/missing").to_request();
 
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
 
-        let mut srv = test::init_service(App::new().service(Files::new("/", "."))).await;
+        let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
 
         let req = TestRequest::default().to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
 
-        let mut srv = test::init_service(
+        let srv =
-            App::new().service(Files::new("/", ".").show_files_listing()),
+            test::init_service(App::new().service(Files::new("/", ".").show_files_listing()))
-        )
+                .await;
-        .await;
         let req = TestRequest::with_uri("/tests").to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(
             resp.headers().get(header::CONTENT_TYPE).unwrap(),
             "text/html; charset=utf-8"
@@ -609,17 +648,17 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_redirect_to_slash_directory() {
-        // should not redirect if no index
+        // should not redirect if no index and files listing is disabled
-        let mut srv = test::init_service(
+        let srv = test::init_service(
             App::new().service(Files::new("/", ".").redirect_to_slash_directory()),
         )
         .await;
         let req = TestRequest::with_uri("/tests").to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
 
         // should redirect if index present
-        let mut srv = test::init_service(
+        let srv = test::init_service(
             App::new().service(
                 Files::new("/", ".")
                     .index_file("test.png")
@@ -628,24 +667,41 @@ mod tests {
         )
         .await;
         let req = TestRequest::with_uri("/tests").to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
+        assert_eq!(resp.status(), StatusCode::FOUND);
+
+        // should redirect if files listing is enabled
+        let srv = test::init_service(
+            App::new().service(
+                Files::new("/", ".")
+                    .show_files_listing()
+                    .redirect_to_slash_directory(),
+            ),
+        )
+        .await;
+        let req = TestRequest::with_uri("/tests").to_request();
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::FOUND);
 
         // should not redirect if the path is wrong
         let req = TestRequest::with_uri("/not_existing").to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
     }
 
     #[actix_rt::test]
     async fn test_static_files_bad_directory() {
-        let _st: Files = Files::new("/", "missing");
+        let service = Files::new("/", "./missing").new_service(()).await.unwrap();
-        let _st: Files = Files::new("/", "Cargo.toml");
+
+        let req = TestRequest::with_uri("/").to_srv_request();
+        let resp = test::call_service(&service, req).await;
+
+        assert_eq!(resp.status(), StatusCode::NOT_FOUND);
     }
 
     #[actix_rt::test]
     async fn test_default_handler_file_missing() {
-        let mut st = Files::new("/", ".")
+        let st = Files::new("/", ".")
             .default_handler(|req: ServiceRequest| {
                 ok(req.into_response(HttpResponse::Ok().body("default content")))
             })
@@ -653,124 +709,196 @@ mod tests {
             .await
             .unwrap();
         let req = TestRequest::with_uri("/missing").to_srv_request();
+        let resp = test::call_service(&st, req).await;
 
-        let resp = test::call_service(&mut st, req).await;
         assert_eq!(resp.status(), StatusCode::OK);
         let bytes = test::read_body(resp).await;
         assert_eq!(bytes, web::Bytes::from_static(b"default content"));
     }
 
-    //     #[actix_rt::test]
+    #[actix_rt::test]
-    //     async fn test_serve_index() {
+    async fn test_serve_index_nested() {
-    //         let st = Files::new(".").index_file("test.binary");
+        let service = Files::new(".", ".")
-    //         let req = TestRequest::default().uri("/tests").finish();
+            .index_file("lib.rs")
+            .new_service(())
+            .await
+            .unwrap();
 
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
+        let req = TestRequest::default().uri("/src").to_srv_request();
-    //         let resp = resp.as_msg();
+        let resp = test::call_service(&service, req).await;
-    //         assert_eq!(resp.status(), StatusCode::OK);
-    //         assert_eq!(
-    //             resp.headers()
-    //                 .get(header::CONTENT_TYPE)
-    //                 .expect("content type"),
-    //             "application/octet-stream"
-    //         );
-    //         assert_eq!(
-    //             resp.headers()
-    //                 .get(header::CONTENT_DISPOSITION)
-    //                 .expect("content disposition"),
-    //             "attachment; filename=\"test.binary\""
-    //         );
 
-    //         let req = TestRequest::default().uri("/tests/").finish();
+        assert_eq!(resp.status(), StatusCode::OK);
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
+        assert_eq!(
-    //         let resp = resp.as_msg();
+            resp.headers().get(header::CONTENT_TYPE).unwrap(),
-    //         assert_eq!(resp.status(), StatusCode::OK);
+            "text/x-rust"
-    //         assert_eq!(
+        );
-    //             resp.headers().get(header::CONTENT_TYPE).unwrap(),
+        assert_eq!(
-    //             "application/octet-stream"
+            resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
-    //         );
+            "inline; filename=\"lib.rs\""
-    //         assert_eq!(
+        );
-    //             resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
+    }
-    //             "attachment; filename=\"test.binary\""
-    //         );
 
-    //         // nonexistent index file
+    #[actix_rt::test]
-    //         let req = TestRequest::default().uri("/tests/unknown").finish();
+    async fn integration_serve_index() {
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
+        let srv = test::init_service(
-    //         let resp = resp.as_msg();
+            App::new().service(Files::new("test", ".").index_file("Cargo.toml")),
-    //         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
+        )
+        .await;
 
-    //         let req = TestRequest::default().uri("/tests/unknown/").finish();
+        let req = TestRequest::get().uri("/test").to_request();
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
+        let res = test::call_service(&srv, req).await;
-    //         let resp = resp.as_msg();
+        assert_eq!(res.status(), StatusCode::OK);
-    //         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
-    //     }
 
-    //     #[actix_rt::test]
+        let bytes = test::read_body(res).await;
-    //     async fn test_serve_index_nested() {
-    //         let st = Files::new(".").index_file("mod.rs");
-    //         let req = TestRequest::default().uri("/src/client").finish();
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
-    //         let resp = resp.as_msg();
-    //         assert_eq!(resp.status(), StatusCode::OK);
-    //         assert_eq!(
-    //             resp.headers().get(header::CONTENT_TYPE).unwrap(),
-    //             "text/x-rust"
-    //         );
-    //         assert_eq!(
-    //             resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
-    //             "inline; filename=\"mod.rs\""
-    //         );
-    //     }
 
-    //     #[actix_rt::test]
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
-    //     fn integration_serve_index() {
+        assert_eq!(bytes, data);
-    //         let mut srv = test::TestServer::with_factory(|| {
-    //             App::new().handler(
-    //                 "test",
-    //                 Files::new(".").index_file("Cargo.toml"),
-    //             )
-    //         });
 
-    //         let request = srv.get().uri(srv.url("/test")).finish().unwrap();
+        let req = TestRequest::get().uri("/test/").to_request();
-    //         let response = srv.execute(request.send()).unwrap();
+        let res = test::call_service(&srv, req).await;
-    //         assert_eq!(response.status(), StatusCode::OK);
+        assert_eq!(res.status(), StatusCode::OK);
-    //         let bytes = srv.execute(response.body()).unwrap();
-    //         let data = Bytes::from(fs::read("Cargo.toml").unwrap());
-    //         assert_eq!(bytes, data);
 
-    //         let request = srv.get().uri(srv.url("/test/")).finish().unwrap();
+        let bytes = test::read_body(res).await;
-    //         let response = srv.execute(request.send()).unwrap();
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
-    //         assert_eq!(response.status(), StatusCode::OK);
+        assert_eq!(bytes, data);
-    //         let bytes = srv.execute(response.body()).unwrap();
-    //         let data = Bytes::from(fs::read("Cargo.toml").unwrap());
-    //         assert_eq!(bytes, data);
 
-    //         // nonexistent index file
+        // nonexistent index file
-    //         let request = srv.get().uri(srv.url("/test/unknown")).finish().unwrap();
+        let req = TestRequest::get().uri("/test/unknown").to_request();
-    //         let response = srv.execute(request.send()).unwrap();
+        let res = test::call_service(&srv, req).await;
-    //         assert_eq!(response.status(), StatusCode::NOT_FOUND);
+        assert_eq!(res.status(), StatusCode::NOT_FOUND);
 
-    //         let request = srv.get().uri(srv.url("/test/unknown/")).finish().unwrap();
+        let req = TestRequest::get().uri("/test/unknown/").to_request();
-    //         let response = srv.execute(request.send()).unwrap();
+        let res = test::call_service(&srv, req).await;
-    //         assert_eq!(response.status(), StatusCode::NOT_FOUND);
+        assert_eq!(res.status(), StatusCode::NOT_FOUND);
-    //     }
+    }
 
-    //     #[actix_rt::test]
+    #[actix_rt::test]
-    //     fn integration_percent_encoded() {
+    async fn integration_percent_encoded() {
-    //         let mut srv = test::TestServer::with_factory(|| {
+        let srv = test::init_service(
-    //             App::new().handler(
+            App::new().service(Files::new("test", ".").index_file("Cargo.toml")),
-    //                 "test",
+        )
-    //                 Files::new(".").index_file("Cargo.toml"),
+        .await;
-    //             )
-    //         });
 
-    //         let request = srv
+        let req = TestRequest::get().uri("/test/%43argo.toml").to_request();
-    //             .get()
+        let res = test::call_service(&srv, req).await;
-    //             .uri(srv.url("/test/%43argo.toml"))
+        assert_eq!(res.status(), StatusCode::OK);
-    //             .finish()
+    }
-    //             .unwrap();
+
-    //         let response = srv.execute(request.send()).unwrap();
+    #[actix_rt::test]
-    //         assert_eq!(response.status(), StatusCode::OK);
+    async fn test_serve_named_file() {
-    //     }
+        let srv =
+            test::init_service(App::new().service(NamedFile::open("Cargo.toml").unwrap()))
+                .await;
+
+        let req = TestRequest::get().uri("/Cargo.toml").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::OK);
+
+        let bytes = test::read_body(res).await;
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+        assert_eq!(bytes, data);
+
+        let req = TestRequest::get().uri("/test/unknown").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::NOT_FOUND);
+    }
+
+    #[actix_rt::test]
+    async fn test_serve_named_file_prefix() {
+        let srv = test::init_service(
+            App::new()
+                .service(web::scope("/test").service(NamedFile::open("Cargo.toml").unwrap())),
+        )
+        .await;
+
+        let req = TestRequest::get().uri("/test/Cargo.toml").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::OK);
+
+        let bytes = test::read_body(res).await;
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+        assert_eq!(bytes, data);
+
+        let req = TestRequest::get().uri("/Cargo.toml").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::NOT_FOUND);
+    }
+
+    #[actix_rt::test]
+    async fn test_named_file_default_service() {
+        let srv = test::init_service(
+            App::new().default_service(NamedFile::open("Cargo.toml").unwrap()),
+        )
+        .await;
+
+        for route in ["/foobar", "/baz", "/"].iter() {
+            let req = TestRequest::get().uri(route).to_request();
+            let res = test::call_service(&srv, req).await;
+            assert_eq!(res.status(), StatusCode::OK);
+
+            let bytes = test::read_body(res).await;
+            let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+            assert_eq!(bytes, data);
+        }
+    }
+
+    #[actix_rt::test]
+    async fn test_default_handler_named_file() {
+        let st = Files::new("/", ".")
+            .default_handler(NamedFile::open("Cargo.toml").unwrap())
+            .new_service(())
+            .await
+            .unwrap();
+        let req = TestRequest::with_uri("/missing").to_srv_request();
+        let resp = test::call_service(&st, req).await;
+
+        assert_eq!(resp.status(), StatusCode::OK);
+        let bytes = test::read_body(resp).await;
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+        assert_eq!(bytes, data);
+    }
+
+    #[actix_rt::test]
+    async fn test_symlinks() {
+        let srv = test::init_service(App::new().service(Files::new("test", "."))).await;
+
+        let req = TestRequest::get()
+            .uri("/test/tests/symlink-test.png")
+            .to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::OK);
+        assert_eq!(
+            res.headers().get(header::CONTENT_DISPOSITION).unwrap(),
+            "inline; filename=\"symlink-test.png\""
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_index_with_show_files_listing() {
+        let service = Files::new(".", ".")
+            .index_file("lib.rs")
+            .show_files_listing()
+            .new_service(())
+            .await
+            .unwrap();
+
+        // Serve the index if exists
+        let req = TestRequest::default().uri("/src").to_srv_request();
+        let resp = test::call_service(&service, req).await;
+        assert_eq!(resp.status(), StatusCode::OK);
+        assert_eq!(
+            resp.headers().get(header::CONTENT_TYPE).unwrap(),
+            "text/x-rust"
+        );
+
+        // Show files listing, otherwise.
+        let req = TestRequest::default().uri("/tests").to_srv_request();
+        let resp = test::call_service(&service, req).await;
+        assert_eq!(
+            resp.headers().get(header::CONTENT_TYPE).unwrap(),
+            "text/html; charset=utf-8"
+        );
+        let bytes = test::read_body(resp).await;
+        assert!(format!("{:?}", bytes).contains("/tests/test.png"));
+    }
 }

actix-files/src/named.rs

@@ -1,3 +1,6 @@
+use actix_service::{Service, ServiceFactory};
+use actix_utils::future::{ok, ready, Ready};
+use actix_web::dev::{AppService, HttpServiceFactory, ResourceDef};
 use std::fs::{File, Metadata};
 use std::io;
 use std::ops::{Deref, DerefMut};
@@ -8,18 +11,16 @@ use std::time::{SystemTime, UNIX_EPOCH};
 use std::os::unix::fs::MetadataExt;
 
 use actix_web::{
-    dev::{BodyEncoding, SizedStream},
+    dev::{BodyEncoding, ServiceRequest, ServiceResponse, SizedStream},
     http::{
         header::{
-            self, Charset, ContentDisposition, DispositionParam, DispositionType,
+            self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
-            ExtendedValue,
         },
         ContentEncoding, StatusCode,
     },
     Error, HttpMessage, HttpRequest, HttpResponse, Responder,
 };
 use bitflags::bitflags;
-use futures_util::future::{ready, Ready};
 use mime_guess::from_path;
 
 use crate::ChunkedReadFile;
@@ -41,6 +42,29 @@ impl Default for Flags {
 }
 
 /// A file with an associated name.
+///
+/// `NamedFile` can be registered as services:
+/// ```
+/// use actix_web::App;
+/// use actix_files::NamedFile;
+///
+/// # fn run() -> Result<(), Box<dyn std::error::Error>> {
+/// let app = App::new()
+///     .service(NamedFile::open("./static/index.html")?);
+/// # Ok(())
+/// # }
+/// ```
+///
+/// They can also be returned from handlers:
+/// ```
+/// use actix_web::{Responder, get};
+/// use actix_files::NamedFile;
+///
+/// #[get("/")]
+/// async fn index() -> impl Responder {
+///     NamedFile::open("./static/index.html")
+/// }
+/// ```
 #[derive(Debug)]
 pub struct NamedFile {
     path: PathBuf,
@@ -62,7 +86,7 @@ impl NamedFile {
     ///
     /// # Examples
     ///
-    /// ```rust
+    /// ```
     /// use actix_files::NamedFile;
     /// use std::io::{self, Write};
     /// use std::env;
@@ -96,6 +120,11 @@ impl NamedFile {
 
             let disposition = match ct.type_() {
                 mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
+                mime::APPLICATION => match ct.subtype() {
+                    mime::JAVASCRIPT | mime::JSON => DispositionType::Inline,
+                    name if name == "wasm" => DispositionType::Inline,
+                    _ => DispositionType::Attachment,
+                },
                 _ => DispositionType::Attachment,
             };
 
@@ -139,7 +168,7 @@ impl NamedFile {
     ///
     /// # Examples
     ///
-    /// ```rust
+    /// ```
     /// use actix_files::NamedFile;
     ///
     /// let file = NamedFile::open("foo.txt");
@@ -158,7 +187,7 @@ impl NamedFile {
     ///
     /// # Examples
     ///
-    /// ```rust
+    /// ```
     /// # use std::io;
     /// use actix_files::NamedFile;
     ///
@@ -189,9 +218,11 @@ impl NamedFile {
 
     /// Set the Content-Disposition for serving this file. This allows
     /// changing the inline/attachment disposition as well as the filename
-    /// sent to the peer. By default the disposition is `inline` for text,
+    /// sent to the peer.
-    /// image, and video content types, and `attachment` otherwise, and
+    ///
-    /// the filename is taken from the path provided in the `open` method
+    /// By default the disposition is `inline` for `text/*`, `image/*`, `video/*` and
+    /// `application/{javascript, json, wasm}` mime types, and `attachment` otherwise,
+    /// and the filename is taken from the path provided in the `open` method
     /// after converting it to UTF-8 using.
     /// [`std::ffi::OsStr::to_string_lossy`]
     #[inline]
@@ -211,6 +242,8 @@ impl NamedFile {
     }
 
     /// Set content encoding for serving this file
+    ///
+    /// Must be used with [`actix_web::middleware::Compress`] to take effect.
     #[inline]
     pub fn set_content_encoding(mut self, enc: ContentEncoding) -> Self {
         self.encoding = Some(enc);
@@ -277,37 +310,31 @@ impl NamedFile {
     }
 
     /// Creates an `HttpResponse` with file as a streaming body.
-    pub fn into_response(self, req: &HttpRequest) -> Result<HttpResponse, Error> {
+    pub fn into_response(self, req: &HttpRequest) -> HttpResponse {
         if self.status_code != StatusCode::OK {
             let mut res = HttpResponse::build(self.status_code);
 
             if self.flags.contains(Flags::PREFER_UTF8) {
                 let ct = equiv_utf8_text(self.content_type.clone());
-                res.header(header::CONTENT_TYPE, ct.to_string());
+                res.insert_header((header::CONTENT_TYPE, ct.to_string()));
             } else {
-                res.header(header::CONTENT_TYPE, self.content_type.to_string());
+                res.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
             }
 
             if self.flags.contains(Flags::CONTENT_DISPOSITION) {
-                res.header(
+                res.insert_header((
                     header::CONTENT_DISPOSITION,
                     self.content_disposition.to_string(),
-                );
+                ));
             }
 
             if let Some(current_encoding) = self.encoding {
                 res.encoding(current_encoding);
             }
 
-            let reader = ChunkedReadFile {
+            let reader = ChunkedReadFile::new(self.md.len(), 0, self.file);
-                size: self.md.len(),
-                offset: 0,
-                file: Some(self.file),
-                fut: None,
-                counter: 0,
-            };
 
-            return Ok(res.streaming(reader));
+            return res.streaming(reader);
         }
 
         let etag = if self.flags.contains(Flags::ETAG) {
@@ -332,7 +359,7 @@ impl NamedFile {
             let t2: SystemTime = since.clone().into();
 
             match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
-                (Ok(t1), Ok(t2)) => t1 > t2,
+                (Ok(t1), Ok(t2)) => t1.as_secs() > t2.as_secs(),
                 _ => false,
             }
         } else {
@@ -351,7 +378,7 @@ impl NamedFile {
             let t2: SystemTime = since.clone().into();
 
             match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
-                (Ok(t1), Ok(t2)) => t1 <= t2,
+                (Ok(t1), Ok(t2)) => t1.as_secs() <= t2.as_secs(),
                 _ => false,
             }
         } else {
@@ -362,16 +389,16 @@ impl NamedFile {
 
         if self.flags.contains(Flags::PREFER_UTF8) {
             let ct = equiv_utf8_text(self.content_type.clone());
-            resp.header(header::CONTENT_TYPE, ct.to_string());
+            resp.insert_header((header::CONTENT_TYPE, ct.to_string()));
         } else {
-            resp.header(header::CONTENT_TYPE, self.content_type.to_string());
+            resp.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
         }
 
         if self.flags.contains(Flags::CONTENT_DISPOSITION) {
-            resp.header(
+            resp.insert_header((
                 header::CONTENT_DISPOSITION,
                 self.content_disposition.to_string(),
-            );
+            ));
         }
 
         // default compressing
@@ -380,14 +407,14 @@ impl NamedFile {
         }
 
         if let Some(lm) = last_modified {
-            resp.header(header::LAST_MODIFIED, lm.to_string());
+            resp.insert_header((header::LAST_MODIFIED, lm.to_string()));
         }
 
         if let Some(etag) = etag {
-            resp.header(header::ETAG, etag.to_string());
+            resp.insert_header((header::ETAG, etag.to_string()));
         }
 
-        resp.header(header::ACCEPT_RANGES, "bytes");
+        resp.insert_header((header::ACCEPT_RANGES, "bytes"));
 
         let mut length = self.md.len();
         let mut offset = 0;
@@ -400,43 +427,32 @@ impl NamedFile {
                     offset = ranges[0].start;
 
                     resp.encoding(ContentEncoding::Identity);
-                    resp.header(
+                    resp.insert_header((
                         header::CONTENT_RANGE,
-                        format!(
+                        format!("bytes {}-{}/{}", offset, offset + length - 1, self.md.len()),
-                            "bytes {}-{}/{}",
+                    ));
-                            offset,
-                            offset + length - 1,
-                            self.md.len()
-                        ),
-                    );
                 } else {
-                    resp.header(header::CONTENT_RANGE, format!("bytes */{}", length));
+                    resp.insert_header((header::CONTENT_RANGE, format!("bytes */{}", length)));
-                    return Ok(resp.status(StatusCode::RANGE_NOT_SATISFIABLE).finish());
+                    return resp.status(StatusCode::RANGE_NOT_SATISFIABLE).finish();
                 };
             } else {
-                return Ok(resp.status(StatusCode::BAD_REQUEST).finish());
+                return resp.status(StatusCode::BAD_REQUEST).finish();
             };
         };
 
         if precondition_failed {
-            return Ok(resp.status(StatusCode::PRECONDITION_FAILED).finish());
+            return resp.status(StatusCode::PRECONDITION_FAILED).finish();
         } else if not_modified {
-            return Ok(resp.status(StatusCode::NOT_MODIFIED).finish());
+            return resp.status(StatusCode::NOT_MODIFIED).finish();
         }
 
-        let reader = ChunkedReadFile {
+        let reader = ChunkedReadFile::new(length, offset, self.file);
-            offset,
-            size: length,
-            file: Some(self.file),
-            fut: None,
-            counter: 0,
-        };
 
         if offset != 0 || length != self.md.len() {
             resp.status(StatusCode::PARTIAL_CONTENT);
         }
 
-        Ok(resp.body(SizedStream::new(length, reader)))
+        resp.body(SizedStream::new(length, reader))
     }
 }
 
@@ -495,10 +511,57 @@ fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
 }
 
 impl Responder for NamedFile {
-    type Error = Error;
+    fn respond_to(self, req: &HttpRequest) -> HttpResponse {
-    type Future = Ready<Result<HttpResponse, Error>>;
+        self.into_response(req)
-
+    }
-    fn respond_to(self, req: &HttpRequest) -> Self::Future {
+}
-        ready(self.into_response(req))
+
+impl ServiceFactory<ServiceRequest> for NamedFile {
+    type Response = ServiceResponse;
+    type Error = Error;
+    type Config = ();
+    type InitError = ();
+    type Service = NamedFileService;
+    type Future = Ready<Result<Self::Service, ()>>;
+
+    fn new_service(&self, _: ()) -> Self::Future {
+        ok(NamedFileService {
+            path: self.path.clone(),
+        })
+    }
+}
+
+#[doc(hidden)]
+#[derive(Debug)]
+pub struct NamedFileService {
+    path: PathBuf,
+}
+
+impl Service<ServiceRequest> for NamedFileService {
+    type Response = ServiceResponse;
+    type Error = Error;
+    type Future = Ready<Result<Self::Response, Self::Error>>;
+
+    actix_service::always_ready!();
+
+    fn call(&self, req: ServiceRequest) -> Self::Future {
+        let (req, _) = req.into_parts();
+        ready(
+            NamedFile::open(&self.path)
+                .map_err(|e| e.into())
+                .map(|f| f.into_response(&req))
+                .map(|res| ServiceResponse::new(req, res)),
+        )
+    }
+}
+
+impl HttpServiceFactory for NamedFile {
+    fn register(self, config: &mut AppService) {
+        config.register_service(
+            ResourceDef::root_prefix(self.path.to_string_lossy().as_ref()),
+            None,
+            self,
+            None,
+        )
     }
 }

actix-files/src/path_buf.rs

@@ -3,8 +3,8 @@ use std::{
     str::FromStr,
 };
 
+use actix_utils::future::{ready, Ready};
 use actix_web::{dev::Payload, FromRequest, HttpRequest};
-use futures_util::future::{ready, Ready};
 
 use crate::error::UriSegmentError;
 

actix-files/src/range.rs

@@ -10,9 +10,6 @@ pub struct HttpRange {
     pub length: u64,
 }
 
-const PREFIX: &str = "bytes=";
-const PREFIX_LEN: usize = 6;
-
 #[derive(Debug, Clone, Display, Error)]
 #[display(fmt = "Parse HTTP Range failed")]
 pub struct ParseRangeErr(#[error(not(source))] ());
@@ -23,84 +20,16 @@ impl HttpRange {
     /// `header` is HTTP Range header (e.g. `bytes=bytes=0-9`).
     /// `size` is full size of response (file).
     pub fn parse(header: &str, size: u64) -> Result<Vec<HttpRange>, ParseRangeErr> {
-        if header.is_empty() {
+        match http_range::HttpRange::parse(header, size) {
-            return Ok(Vec::new());
+            Ok(ranges) => Ok(ranges
+                .iter()
+                .map(|range| HttpRange {
+                    start: range.start,
+                    length: range.length,
+                })
+                .collect()),
+            Err(_) => Err(ParseRangeErr(())),
         }
-        if !header.starts_with(PREFIX) {
-            return Err(ParseRangeErr(()));
-        }
-
-        let size_sig = size as i64;
-        let mut no_overlap = false;
-
-        let all_ranges: Vec<Option<HttpRange>> = header[PREFIX_LEN..]
-            .split(',')
-            .map(|x| x.trim())
-            .filter(|x| !x.is_empty())
-            .map(|ra| {
-                let mut start_end_iter = ra.split('-');
-
-                let start_str = start_end_iter.next().ok_or(ParseRangeErr(()))?.trim();
-                let end_str = start_end_iter.next().ok_or(ParseRangeErr(()))?.trim();
-
-                if start_str.is_empty() {
-                    // If no start is specified, end specifies the
-                    // range start relative to the end of the file.
-                    let mut length: i64 =
-                        end_str.parse().map_err(|_| ParseRangeErr(()))?;
-
-                    if length > size_sig {
-                        length = size_sig;
-                    }
-
-                    Ok(Some(HttpRange {
-                        start: (size_sig - length) as u64,
-                        length: length as u64,
-                    }))
-                } else {
-                    let start: i64 = start_str.parse().map_err(|_| ParseRangeErr(()))?;
-
-                    if start < 0 {
-                        return Err(ParseRangeErr(()));
-                    }
-                    if start >= size_sig {
-                        no_overlap = true;
-                        return Ok(None);
-                    }
-
-                    let length = if end_str.is_empty() {
-                        // If no end is specified, range extends to end of the file.
-                        size_sig - start
-                    } else {
-                        let mut end: i64 =
-                            end_str.parse().map_err(|_| ParseRangeErr(()))?;
-
-                        if start > end {
-                            return Err(ParseRangeErr(()));
-                        }
-
-                        if end >= size_sig {
-                            end = size_sig - 1;
-                        }
-
-                        end - start + 1
-                    };
-
-                    Ok(Some(HttpRange {
-                        start: start as u64,
-                        length: length as u64,
-                    }))
-                }
-            })
-            .collect::<Result<_, _>>()?;
-
-        let ranges: Vec<HttpRange> = all_ranges.into_iter().filter_map(|x| x).collect();
-
-        if no_overlap && ranges.is_empty() {
-            return Err(ParseRangeErr(()));
-        }
-
-        Ok(ranges)
     }
 }
 

actix-files/src/service.rs

@@ -1,11 +1,7 @@
-use std::{
+use std::{fmt, io, path::PathBuf, rc::Rc};
-    fmt, io,
-    path::PathBuf,
-    rc::Rc,
-    task::{Context, Poll},
-};
 
 use actix_service::Service;
+use actix_utils::future::ok;
 use actix_web::{
     dev::{ServiceRequest, ServiceResponse},
     error::Error,
@@ -13,11 +9,11 @@ use actix_web::{
     http::{header, Method},
     HttpResponse,
 };
-use futures_util::future::{ok, Either, LocalBoxFuture, Ready};
+use futures_core::future::LocalBoxFuture;
 
 use crate::{
-    named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride,
+    named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride, NamedFile,
-    NamedFile, PathBufWrap,
+    PathBufWrap,
 };
 
 /// Assembled file serving service.
@@ -34,19 +30,18 @@ pub struct FilesService {
     pub(crate) hidden_files: bool,
 }
 
-type FilesServiceFuture = Either<
-    Ready<Result<ServiceResponse, Error>>,
-    LocalBoxFuture<'static, Result<ServiceResponse, Error>>,
->;
-
 impl FilesService {
-    fn handle_err(&mut self, e: io::Error, req: ServiceRequest) -> FilesServiceFuture {
+    fn handle_err(
-        log::debug!("Failed to handle {}: {}", req.path(), e);
+        &self,
+        err: io::Error,
+        req: ServiceRequest,
+    ) -> LocalBoxFuture<'static, Result<ServiceResponse, Error>> {
+        log::debug!("error handling {}: {}", req.path(), err);
 
-        if let Some(ref mut default) = self.default {
+        if let Some(ref default) = self.default {
-            Either::Right(default.call(req))
+            Box::pin(default.call(req))
         } else {
-            Either::Left(ok(req.error_response(e)))
+            Box::pin(ok(req.error_response(err)))
         }
     }
 }
@@ -60,13 +55,11 @@ impl fmt::Debug for FilesService {
 impl Service<ServiceRequest> for FilesService {
     type Response = ServiceResponse;
     type Error = Error;
-    type Future = FilesServiceFuture;
+    type Future = LocalBoxFuture<'static, Result<ServiceResponse, Error>>;
 
-    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+    actix_service::always_ready!();
-        Poll::Ready(Ok(()))
-    }
 
-    fn call(&mut self, req: ServiceRequest) -> Self::Future {
+    fn call(&self, req: ServiceRequest) -> Self::Future {
         let is_method_valid = if let Some(guard) = &self.guards {
             // execute user defined guards
             (**guard).check(req.head())
@@ -76,9 +69,9 @@ impl Service<ServiceRequest> for FilesService {
         };
 
         if !is_method_valid {
-            return Either::Left(ok(req.into_response(
+            return Box::pin(ok(req.into_response(
                 actix_web::HttpResponse::MethodNotAllowed()
-                    .header(header::CONTENT_TYPE, "text/plain")
+                    .insert_header(header::ContentType(mime::TEXT_PLAIN_UTF_8))
                     .body("Request did not meet this resource's requirements."),
             )));
         }
@@ -86,82 +79,79 @@ impl Service<ServiceRequest> for FilesService {
         let real_path =
             match PathBufWrap::parse_path(req.match_info().path(), self.hidden_files) {
                 Ok(item) => item,
-                Err(e) => return Either::Left(ok(req.error_response(e))),
+                Err(e) => return Box::pin(ok(req.error_response(e))),
             };
 
         // full file path
-        let path = match self.directory.join(&real_path).canonicalize() {
+        let path = self.directory.join(&real_path);
-            Ok(path) => path,
+        if let Err(err) = path.canonicalize() {
-            Err(e) => return self.handle_err(e, req),
+            return Box::pin(self.handle_err(err, req));
-        };
+        }
 
         if path.is_dir() {
-            if let Some(ref redir_index) = self.index {
+            if self.redirect_to_slash
-                if self.redirect_to_slash && !req.path().ends_with('/') {
+                && !req.path().ends_with('/')
-                    let redirect_to = format!("{}/", req.path());
+                && (self.index.is_some() || self.show_index)
+            {
+                let redirect_to = format!("{}/", req.path());
 
-                    return Either::Left(ok(req.into_response(
+                return Box::pin(ok(req.into_response(
-                        HttpResponse::Found()
+                    HttpResponse::Found()
-                            .header(header::LOCATION, redirect_to)
+                        .insert_header((header::LOCATION, redirect_to))
-                            .body("")
+                        .finish(),
-                            .into_body(),
+                )));
-                    )));
+            }
+
+            let serve_named_file = |req: ServiceRequest, mut named_file: NamedFile| {
+                if let Some(ref mime_override) = self.mime_override {
+                    let new_disposition = mime_override(&named_file.content_type.type_());
+                    named_file.content_disposition.disposition = new_disposition;
                 }
+                named_file.flags = self.file_flags;
 
-                let path = path.join(redir_index);
+                let (req, _) = req.into_parts();
+                let res = named_file.into_response(&req);
+                Box::pin(ok(ServiceResponse::new(req, res)))
+            };
 
-                match NamedFile::open(path) {
+            let show_index = |req: ServiceRequest| {
-                    Ok(mut named_file) => {
+                let dir = Directory::new(self.directory.clone(), path.clone());
-                        if let Some(ref mime_override) = self.mime_override {
-                            let new_disposition =
-                                mime_override(&named_file.content_type.type_());
-                            named_file.content_disposition.disposition = new_disposition;
-                        }
-                        named_file.flags = self.file_flags;
-
-                        let (req, _) = req.into_parts();
-                        Either::Left(ok(match named_file.into_response(&req) {
-                            Ok(item) => ServiceResponse::new(req, item),
-                            Err(e) => ServiceResponse::from_err(e, req),
-                        }))
-                    }
-                    Err(e) => self.handle_err(e, req),
-                }
-            } else if self.show_index {
-                let dir = Directory::new(self.directory.clone(), path);
 
                 let (req, _) = req.into_parts();
                 let x = (self.renderer)(&dir, &req);
 
-                match x {
+                Box::pin(match x {
-                    Ok(resp) => Either::Left(ok(resp)),
+                    Ok(resp) => ok(resp),
-                    Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
+                    Err(err) => ok(ServiceResponse::from_err(err, req)),
-                }
+                })
-            } else {
+            };
-                Either::Left(ok(ServiceResponse::from_err(
+
+            match self.index {
+                Some(ref index) => match NamedFile::open(path.join(index)) {
+                    Ok(named_file) => serve_named_file(req, named_file),
+                    Err(_) if self.show_index => show_index(req),
+                    Err(err) => self.handle_err(err, req),
+                },
+                None if self.show_index => show_index(req),
+                _ => Box::pin(ok(ServiceResponse::from_err(
                     FilesError::IsDirectory,
                     req.into_parts().0,
-                )))
+                ))),
             }
         } else {
             match NamedFile::open(path) {
                 Ok(mut named_file) => {
                     if let Some(ref mime_override) = self.mime_override {
-                        let new_disposition =
+                        let new_disposition = mime_override(&named_file.content_type.type_());
-                            mime_override(&named_file.content_type.type_());
                         named_file.content_disposition.disposition = new_disposition;
                     }
                     named_file.flags = self.file_flags;
 
                     let (req, _) = req.into_parts();
-                    match named_file.into_response(&req) {
+                    let res = named_file.into_response(&req);
-                        Ok(item) => {
+                    Box::pin(ok(ServiceResponse::new(req, res)))
-                            Either::Left(ok(ServiceResponse::new(req.clone(), item)))
-                        }
-                        Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
-                    }
                 }
-                Err(e) => self.handle_err(e, req),
+                Err(err) => self.handle_err(err, req),
             }
         }
     }

actix-files/tests/encoding.rs

@@ -11,11 +11,10 @@ use actix_web::{
 #[actix_rt::test]
 async fn test_utf8_file_contents() {
     // use default ISO-8859-1 encoding
-    let mut srv =
+    let srv = test::init_service(App::new().service(Files::new("/", "./tests"))).await;
-        test::init_service(App::new().service(Files::new("/", "./tests"))).await;
 
     let req = TestRequest::with_uri("/utf8.txt").to_request();
-    let res = test::call_service(&mut srv, req).await;
+    let res = test::call_service(&srv, req).await;
 
     assert_eq!(res.status(), StatusCode::OK);
     assert_eq!(
@@ -24,13 +23,12 @@ async fn test_utf8_file_contents() {
     );
 
     // prefer UTF-8 encoding
-    let mut srv = test::init_service(
+    let srv =
-        App::new().service(Files::new("/", "./tests").prefer_utf8(true)),
+        test::init_service(App::new().service(Files::new("/", "./tests").prefer_utf8(true)))
-    )
+            .await;
-    .await;
 
     let req = TestRequest::with_uri("/utf8.txt").to_request();
-    let res = test::call_service(&mut srv, req).await;
+    let res = test::call_service(&srv, req).await;
 
     assert_eq!(res.status(), StatusCode::OK);
     assert_eq!(

actix-files/tests/fixtures/guards/first/index.txt

@@ -0,0 +1 @@
+first

actix-files/tests/fixtures/guards/second/index.txt

@@ -0,0 +1 @@
+second

actix-files/tests/guard.rs

@@ -0,0 +1,36 @@
+use actix_files::Files;
+use actix_web::{
+    guard::Host,
+    http::StatusCode,
+    test::{self, TestRequest},
+    App,
+};
+use bytes::Bytes;
+
+#[actix_rt::test]
+async fn test_guard_filter() {
+    let srv = test::init_service(
+        App::new()
+            .service(Files::new("/", "./tests/fixtures/guards/first").guard(Host("first.com")))
+            .service(
+                Files::new("/", "./tests/fixtures/guards/second").guard(Host("second.com")),
+            ),
+    )
+    .await;
+
+    let req = TestRequest::with_uri("/index.txt")
+        .append_header(("Host", "first.com"))
+        .to_request();
+    let res = test::call_service(&srv, req).await;
+
+    assert_eq!(res.status(), StatusCode::OK);
+    assert_eq!(test::read_body(res).await, Bytes::from("first"));
+
+    let req = TestRequest::with_uri("/index.txt")
+        .append_header(("Host", "second.com"))
+        .to_request();
+    let res = test::call_service(&srv, req).await;
+
+    assert_eq!(res.status(), StatusCode::OK);
+    assert_eq!(test::read_body(res).await, Bytes::from("second"));
+}

actix-files/tests/symlink-test.png

@@ -0,0 +1 @@
+test.png

actix-files/tests/test.js

@@ -0,0 +1 @@
+// this file is empty.

actix-http-test/CHANGES.md

@@ -3,6 +3,20 @@
 ## Unreleased - 2021-xx-xx
 
 
+## 3.0.0-beta.4 - 2021-04-02
+* Added `TestServer::client_headers` method. [#2097]
+
+[#2097]: https://github.com/actix/actix-web/pull/2097
+
+
+## 3.0.0-beta.3 - 2021-03-09
+* No notable changes.
+
+
+## 3.0.0-beta.2 - 2021-02-10
+* No notable changes.
+
+
 ## 3.0.0-beta.1 - 2021-01-07
 * Update `bytes` to `1.0`. [#1813]
 

actix-http-test/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-http-test"
-version = "3.0.0-beta.1"
+version = "3.0.0-beta.4"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Various helpers for Actix applications to use during testing"
 readme = "README.md"
@@ -26,30 +26,30 @@ path = "src/lib.rs"
 default = []
 
 # openssl
-openssl = ["open-ssl", "awc/openssl"]
+openssl = ["tls-openssl", "awc/openssl"]
 
 [dependencies]
-actix-service = "2.0.0-beta.2"
+actix-service = "2.0.0"
-actix-codec = "0.4.0-beta.1"
+actix-codec = "0.4.0"
-actix-tls = "3.0.0-beta.2"
+actix-tls = "3.0.0-beta.5"
-actix-utils = "3.0.0-beta.1"
+actix-utils = "3.0.0"
-actix-rt = "2.0.0-beta.1"
+actix-rt = "2.2"
-actix-server = "2.0.0-beta.2"
+actix-server = "2.0.0-beta.3"
-awc = "3.0.0-beta.1"
+awc = { version = "3.0.0-beta.6", default-features = false }
 
 base64 = "0.13"
 bytes = "1"
 futures-core = { version = "0.3.7", default-features = false }
 http = "0.2.2"
 log = "0.4"
-socket2 = "0.3"
+socket2 = "0.4"
 serde = "1.0"
 serde_json = "1.0"
 slab = "0.4"
 serde_urlencoded = "0.7"
-time = { version = "0.2.7", default-features = false, features = ["std"] }
+time = { version = "0.2.23", default-features = false, features = ["std"] }
-open-ssl = { version = "0.10", package = "openssl", optional = true }
+tls-openssl = { version = "0.10.9", package = "openssl", optional = true }
 
 [dev-dependencies]
-actix-web = "4.0.0-beta.1"
+actix-web = { version = "4.0.0-beta.7", default-features = false, features = ["cookies"] }
-actix-http = "3.0.0-beta.1"
+actix-http = "3.0.0-beta.7"

actix-http-test/README.md

@@ -3,9 +3,9 @@
 > Various helpers for Actix applications to use during testing.
 
 [![crates.io](https://img.shields.io/crates/v/actix-http-test?label=latest)](https://crates.io/crates/actix-http-test)
-[![Documentation](https://docs.rs/actix-http-test/badge.svg?version=2.1.0)](https://docs.rs/actix-http-test/2.1.0)
+[![Documentation](https://docs.rs/actix-http-test/badge.svg?version=3.0.0-beta.4)](https://docs.rs/actix-http-test/3.0.0-beta.4)
-![Apache 2.0 or MIT licensed](https://img.shields.io/crates/l/actix-http-test)
+![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http-test)
-[![Dependency Status](https://deps.rs/crate/actix-http-test/2.1.0/status.svg)](https://deps.rs/crate/actix-http-test/2.1.0)
+[![Dependency Status](https://deps.rs/crate/actix-http-test/3.0.0-beta.4/status.svg)](https://deps.rs/crate/actix-http-test/3.0.0-beta.4)
 [![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
 
 ## Documentation & Resources

actix-http-test/src/lib.rs

@@ -4,13 +4,18 @@
 #![doc(html_logo_url = "https://actix.rs/img/logo.png")]
 #![doc(html_favicon_url = "https://actix.rs/favicon.ico")]
 
+#[cfg(feature = "openssl")]
+extern crate tls_openssl as openssl;
+
 use std::sync::mpsc;
 use std::{net, thread, time};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_rt::{net::TcpStream, System};
 use actix_server::{Server, ServiceFactory};
-use awc::{error::PayloadError, ws, Client, ClientRequest, ClientResponse, Connector};
+use awc::{
+    error::PayloadError, http::HeaderMap, ws, Client, ClientRequest, ClientResponse, Connector,
+};
 use bytes::Bytes;
 use futures_core::stream::Stream;
 use http::Method;
@@ -23,7 +28,7 @@ use socket2::{Domain, Protocol, Socket, Type};
 ///
 /// # Examples
 ///
-/// ```rust
+/// ```
 /// use actix_http::HttpService;
 /// use actix_http_test::TestServer;
 /// use actix_web::{web, App, HttpResponse, Error};
@@ -60,7 +65,7 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
 
     // run server in separate thread
     thread::spawn(move || {
-        let sys = System::new("actix-test-server");
+        let sys = System::new();
         let local_addr = tcp.local_addr().unwrap();
 
         let srv = Server::build()
@@ -69,7 +74,7 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
             .disable_signals();
 
         sys.block_on(async {
-            srv.start();
+            srv.run();
             tx.send((System::current(), local_addr)).unwrap();
         });
 
@@ -82,7 +87,7 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
         let connector = {
             #[cfg(feature = "openssl")]
             {
-                use open_ssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
+                use openssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
 
                 let mut builder = SslConnector::builder(SslMethod::tls()).unwrap();
                 builder.set_verify(SslVerifyMode::NONE);
@@ -93,20 +98,17 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
                     .conn_lifetime(time::Duration::from_secs(0))
                     .timeout(time::Duration::from_millis(30000))
                     .ssl(builder.build())
-                    .finish()
             }
             #[cfg(not(feature = "openssl"))]
             {
                 Connector::new()
                     .conn_lifetime(time::Duration::from_secs(0))
                     .timeout(time::Duration::from_millis(30000))
-                    .finish()
             }
         };
 
         Client::builder().connector(connector).finish()
     };
-    actix_tls::connect::start_default_resolver().await.unwrap();
 
     TestServer {
         addr,
@@ -115,17 +117,6 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
     }
 }
 
-/// Get first available unused address
-pub fn unused_addr() -> net::SocketAddr {
-    let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
-    let socket =
-        Socket::new(Domain::ipv4(), Type::stream(), Some(Protocol::tcp())).unwrap();
-    socket.bind(&addr.into()).unwrap();
-    socket.set_reuse_address(true).unwrap();
-    let tcp = socket.into_tcp_listener();
-    tcp.local_addr().unwrap()
-}
-
 /// Test server controller
 pub struct TestServer {
     addr: net::SocketAddr,
@@ -148,7 +139,7 @@ impl TestServer {
         }
     }
 
-    /// Construct test https server url
+    /// Construct test HTTPS server URL.
     pub fn surl(&self, uri: &str) -> String {
         if uri.starts_with('/') {
             format!("https://localhost:{}{}", self.addr.port(), uri)
@@ -162,7 +153,7 @@ impl TestServer {
         self.client.get(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `GET` request
+    /// Create HTTPS `GET` request
     pub fn sget<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.get(self.surl(path.as_ref()).as_str())
     }
@@ -172,7 +163,7 @@ impl TestServer {
         self.client.post(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `POST` request
+    /// Create HTTPS `POST` request
     pub fn spost<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.post(self.surl(path.as_ref()).as_str())
     }
@@ -182,7 +173,7 @@ impl TestServer {
         self.client.head(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `HEAD` request
+    /// Create HTTPS `HEAD` request
     pub fn shead<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.head(self.surl(path.as_ref()).as_str())
     }
@@ -192,7 +183,7 @@ impl TestServer {
         self.client.put(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `PUT` request
+    /// Create HTTPS `PUT` request
     pub fn sput<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.put(self.surl(path.as_ref()).as_str())
     }
@@ -202,7 +193,7 @@ impl TestServer {
         self.client.patch(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `PATCH` request
+    /// Create HTTPS `PATCH` request
     pub fn spatch<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.patch(self.surl(path.as_ref()).as_str())
     }
@@ -212,7 +203,7 @@ impl TestServer {
         self.client.delete(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `DELETE` request
+    /// Create HTTPS `DELETE` request
     pub fn sdelete<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.delete(self.surl(path.as_ref()).as_str())
     }
@@ -222,12 +213,12 @@ impl TestServer {
         self.client.options(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `OPTIONS` request
+    /// Create HTTPS `OPTIONS` request
     pub fn soptions<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.options(self.surl(path.as_ref()).as_str())
     }
 
-    /// Connect to test http server
+    /// Connect to test HTTP server
     pub fn request<S: AsRef<str>>(&self, method: Method, path: S) -> ClientRequest {
         self.client.request(method, path.as_ref())
     }
@@ -242,26 +233,32 @@ impl TestServer {
         response.body().limit(10_485_760).await
     }
 
-    /// Connect to websocket server at a given path
+    /// Connect to WebSocket server at a given path.
     pub async fn ws_at(
         &mut self,
         path: &str,
-    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError>
+    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
-    {
         let url = self.url(path);
         let connect = self.client.ws(url).connect();
         connect.await.map(|(_, framed)| framed)
     }
 
-    /// Connect to a websocket server
+    /// Connect to a WebSocket server.
     pub async fn ws(
         &mut self,
-    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError>
+    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
-    {
         self.ws_at("/").await
     }
 
-    /// Stop http server
+    /// Get default HeaderMap of Client.
+    ///
+    /// Returns Some(&mut HeaderMap) when Client object is unique
+    /// (No other clone of client exists at the same time).
+    pub fn client_headers(&mut self) -> Option<&mut HeaderMap> {
+        self.client.headers()
+    }
+
+    /// Stop HTTP server
     fn stop(&mut self) {
         self.system.stop();
     }
@@ -272,3 +269,13 @@ impl Drop for TestServer {
         self.stop()
     }
 }
+
+/// Get a localhost socket address with random, unused port.
+pub fn unused_addr() -> net::SocketAddr {
+    let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
+    let socket = Socket::new(Domain::IPV4, Type::STREAM, Some(Protocol::TCP)).unwrap();
+    socket.bind(&addr.into()).unwrap();
+    socket.set_reuse_address(true).unwrap();
+    let tcp = net::TcpListener::from(socket);
+    tcp.local_addr().unwrap()
+}

actix-http/CHANGES.md

@@ -1,6 +1,177 @@
 # Changes
 
 ## Unreleased - 2021-xx-xx
+### Changed
+* Change compression algorithm features flags. [#2250]
+
+[#2250]: https://github.com/actix/actix-web/pull/2250
+
+
+## 3.0.0-beta.7 - 2021-06-17
+### Added
+* Alias `body::Body` as `body::AnyBody`. [#2215]
+* `BoxAnyBody`: a boxed message body with boxed errors. [#2183]
+* Re-export `http` crate's `Error` type as `error::HttpError`. [#2171]
+* Re-export `StatusCode`, `Method`, `Version` and `Uri` at the crate root. [#2171]
+* Re-export `ContentEncoding` and `ConnectionType` at the crate root. [#2171]
+* `Response::into_body` that consumes response and returns body type. [#2201]
+* `impl Default` for `Response`. [#2201]
+* Add zstd support for `ContentEncoding`. [#2244]
+
+### Changed
+* The `MessageBody` trait now has an associated `Error` type. [#2183]
+* All error trait bounds in server service builders have changed from `Into<Error>` to `Into<Response<AnyBody>>`. [#2253]
+* All error trait bounds in message body and stream impls changed from `Into<Error>` to `Into<Box<dyn std::error::Error>>`. [#2253]
+* Places in `Response` where `ResponseBody<B>` was received or returned now simply use `B`. [#2201]
+* `header` mod is now public. [#2171]
+* `uri` mod is now public. [#2171]
+* Update `language-tags` to `0.3`.
+* Reduce the level from `error` to `debug` for the log line that is emitted when a `500 Internal Server Error` is built using `HttpResponse::from_error`. [#2201]
+* `ResponseBuilder::message_body` now returns a `Result`. [#2201]
+* Remove `Unpin` bound on `ResponseBuilder::streaming`. [#2253]
+* `HttpServer::{listen_rustls(), bind_rustls()}` now honor the ALPN protocols in the configuation parameter. [#2226]
+
+### Removed
+* Stop re-exporting `http` crate's `HeaderMap` types in addition to ours. [#2171]
+* Down-casting for `MessageBody` types. [#2183]
+* `error::Result` alias. [#2201]
+* Error field from `Response` and `Response::error`. [#2205]
+* `impl Future` for `Response`. [#2201]
+* `Response::take_body` and old `Response::into_body` method that casted body type. [#2201]
+* `InternalError` and all the error types it constructed. [#2215]
+* Conversion (`impl Into`) of `Response<Body>` and `ResponseBuilder` to `Error`. [#2215]
+
+[#2171]: https://github.com/actix/actix-web/pull/2171
+[#2183]: https://github.com/actix/actix-web/pull/2183
+[#2196]: https://github.com/actix/actix-web/pull/2196
+[#2201]: https://github.com/actix/actix-web/pull/2201
+[#2205]: https://github.com/actix/actix-web/pull/2205
+[#2215]: https://github.com/actix/actix-web/pull/2215
+[#2253]: https://github.com/actix/actix-web/pull/2253
+[#2244]: https://github.com/actix/actix-web/pull/2244
+
+
+
+## 3.0.0-beta.6 - 2021-04-17
+### Added
+* `impl<T: MessageBody> MessageBody for Pin<Box<T>>`. [#2152]
+* `Response::{ok, bad_request, not_found, internal_server_error}`. [#2159]
+* Helper `body::to_bytes` for async collecting message body into Bytes. [#2158]
+
+### Changes
+* The type parameter of `Response` no longer has a default. [#2152]
+* The `Message` variant of `body::Body` is now `Pin<Box<dyn MessageBody>>`. [#2152]
+* `BodyStream` and `SizedStream` are no longer restricted to Unpin types. [#2152]
+* Error enum types are marked `#[non_exhaustive]`. [#2161]
+
+### Removed
+* `cookies` feature flag. [#2065]
+* Top-level `cookies` mod (re-export). [#2065]
+* `HttpMessage` trait loses the `cookies` and `cookie` methods. [#2065]
+* `impl ResponseError for CookieParseError`. [#2065]
+* Deprecated methods on `ResponseBuilder`: `if_true`, `if_some`. [#2148]
+* `ResponseBuilder::json`. [#2148]
+* `ResponseBuilder::{set_header, header}`. [#2148]
+* `impl From<serde_json::Value> for Body`. [#2148]
+* `Response::build_from`. [#2159]
+* Most of the status code builders on `Response`. [#2159]
+
+[#2065]: https://github.com/actix/actix-web/pull/2065
+[#2148]: https://github.com/actix/actix-web/pull/2148
+[#2152]: https://github.com/actix/actix-web/pull/2152
+[#2159]: https://github.com/actix/actix-web/pull/2159
+[#2158]: https://github.com/actix/actix-web/pull/2158
+[#2161]: https://github.com/actix/actix-web/pull/2161
+
+
+## 3.0.0-beta.5 - 2021-04-02
+### Added
+* `client::Connector::handshake_timeout` method for customizing TLS connection handshake timeout. [#2081]
+* `client::ConnectorService` as `client::Connector::finish` method's return type [#2081]
+* `client::ConnectionIo` trait alias [#2081]
+
+### Changed
+* `client::Connector` type now only have one generic type for `actix_service::Service`. [#2063]
+
+### Removed
+* Common typed HTTP headers were moved to actix-web. [2094]
+* `ResponseError` impl for `actix_utils::timeout::TimeoutError`. [#2127]
+
+[#2063]: https://github.com/actix/actix-web/pull/2063
+[#2081]: https://github.com/actix/actix-web/pull/2081
+[#2094]: https://github.com/actix/actix-web/pull/2094
+[#2127]: https://github.com/actix/actix-web/pull/2127
+
+
+## 3.0.0-beta.4 - 2021-03-08
+### Changed
+* Feature `cookies` is now optional and disabled by default. [#1981]
+* `ws::hash_key` now returns array. [#2035]
+* `ResponseBuilder::json` now takes `impl Serialize`. [#2052]
+
+### Removed
+* Re-export of `futures_channel::oneshot::Canceled` is removed from `error` mod. [#1994]
+* `ResponseError` impl for `futures_channel::oneshot::Canceled` is removed. [#1994]
+
+[#1981]: https://github.com/actix/actix-web/pull/1981
+[#1994]: https://github.com/actix/actix-web/pull/1994
+[#2035]: https://github.com/actix/actix-web/pull/2035
+[#2052]: https://github.com/actix/actix-web/pull/2052
+
+
+## 3.0.0-beta.3 - 2021-02-10
+* No notable changes.
+
+
+## 3.0.0-beta.2 - 2021-02-10
+### Added
+* `IntoHeaderPair` trait that allows using typed and untyped headers in the same methods. [#1869]
+* `ResponseBuilder::insert_header` method which allows using typed headers. [#1869]
+* `ResponseBuilder::append_header` method which allows using typed headers. [#1869]
+* `TestRequest::insert_header` method which allows using typed headers. [#1869]
+* `ContentEncoding` implements all necessary header traits. [#1912]
+* `HeaderMap::len_keys` has the behavior of the old `len` method. [#1964]
+* `HeaderMap::drain` as an efficient draining iterator. [#1964]
+* Implement `IntoIterator` for owned `HeaderMap`. [#1964]
+* `trust-dns` optional feature to enable `trust-dns-resolver` as client dns resolver. [#1969]
+
+### Changed
+* `ResponseBuilder::content_type` now takes an `impl IntoHeaderValue` to support using typed
+  `mime` types. [#1894]
+* Renamed `IntoHeaderValue::{try_into => try_into_value}` to avoid ambiguity with std
+  `TryInto` trait. [#1894]
+* `Extensions::insert` returns Option of replaced item. [#1904]
+* Remove `HttpResponseBuilder::json2()`. [#1903]
+* Enable `HttpResponseBuilder::json()` to receive data by value and reference. [#1903]
+* `client::error::ConnectError` Resolver variant contains `Box<dyn std::error::Error>` type. [#1905]
+* `client::ConnectorConfig` default timeout changed to 5 seconds. [#1905]
+* Simplify `BlockingError` type to a unit struct. It's now only triggered when blocking thread pool
+  is dead. [#1957]
+* `HeaderMap::len` now returns number of values instead of number of keys. [#1964]
+* `HeaderMap::insert` now returns iterator of removed values. [#1964]
+* `HeaderMap::remove` now returns iterator of removed values. [#1964]
+
+### Removed
+* `ResponseBuilder::set`; use `ResponseBuilder::insert_header`. [#1869]
+* `ResponseBuilder::set_header`; use `ResponseBuilder::insert_header`. [#1869]
+* `ResponseBuilder::header`; use `ResponseBuilder::append_header`. [#1869]
+* `TestRequest::with_hdr`; use `TestRequest::default().insert_header()`. [#1869]
+* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
+* `actors` optional feature. [#1969]
+* `ResponseError` impl for `actix::MailboxError`. [#1969]
+
+### Documentation
+* Vastly improve docs and add examples for `HeaderMap`. [#1964]
+
+[#1869]: https://github.com/actix/actix-web/pull/1869
+[#1894]: https://github.com/actix/actix-web/pull/1894
+[#1903]: https://github.com/actix/actix-web/pull/1903
+[#1904]: https://github.com/actix/actix-web/pull/1904
+[#1905]: https://github.com/actix/actix-web/pull/1905
+[#1912]: https://github.com/actix/actix-web/pull/1912
+[#1957]: https://github.com/actix/actix-web/pull/1957
+[#1964]: https://github.com/actix/actix-web/pull/1964
+[#1969]: https://github.com/actix/actix-web/pull/1969
 
 
 ## 3.0.0-beta.1 - 2021-01-07
@@ -22,10 +193,14 @@
 * Remove `ConnectError::SslHandshakeError` and re-export of `HandshakeError`.
   due to the removal of this type from `tokio-openssl` crate. openssl handshake 
   error would return as `ConnectError::SslError`. [#1813]
+* Remove `actix-threadpool` dependency. Use `actix_rt::task::spawn_blocking`.
+  Due to this change `actix_threadpool::BlockingError` type is moved into 
+  `actix_http::error` module. [#1878]
 
 [#1813]: https://github.com/actix/actix-web/pull/1813
 [#1857]: https://github.com/actix/actix-web/pull/1857
 [#1864]: https://github.com/actix/actix-web/pull/1864
+[#1878]: https://github.com/actix/actix-web/pull/1878
 
 
 ## 2.2.0 - 2020-11-25
@@ -72,15 +247,14 @@
 * Update actix-connect and actix-tls dependencies.
 
 
-## [2.0.0-beta.3] - 2020-08-14
+## 2.0.0-beta.3 - 2020-08-14
-
 ### Fixed
 * Memory leak of `client::pool::ConnectorPoolSupport`. [#1626]
 
 [#1626]: https://github.com/actix/actix-web/pull/1626
 
 
-## [2.0.0-beta.2] - 2020-07-21
+## 2.0.0-beta.2 - 2020-07-21
 ### Fixed
 * Potential UB in h1 decoder using uninitialized memory. [#1614]
 
@@ -91,10 +265,8 @@
 [#1615]: https://github.com/actix/actix-web/pull/1615
 
 
-## [2.0.0-beta.1] - 2020-07-11
+## 2.0.0-beta.1 - 2020-07-11
-
 ### Changed
-
 * Migrate cookie handling to `cookie` crate. [#1558]
 * Update `sha-1` to 0.9. [#1586]
 * Fix leak in client pool. [#1580]
@@ -104,33 +276,30 @@
 [#1586]: https://github.com/actix/actix-web/pull/1586
 [#1580]: https://github.com/actix/actix-web/pull/1580
 
-## [2.0.0-alpha.4] - 2020-05-21
 
+## 2.0.0-alpha.4 - 2020-05-21
 ### Changed
-
 * Bump minimum supported Rust version to 1.40
-* content_length function is removed, and you can set Content-Length by calling no_chunking function [#1439]
+* content_length function is removed, and you can set Content-Length by calling
+  no_chunking function [#1439]
 * `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
   `u64` instead of a `usize`.
 * Update `base64` dependency to 0.12
 
 ### Fixed
-
 * Support parsing of `SameSite=None` [#1503]
 
 [#1439]: https://github.com/actix/actix-web/pull/1439
 [#1503]: https://github.com/actix/actix-web/pull/1503
 
-## [2.0.0-alpha.3] - 2020-05-08
 
+## 2.0.0-alpha.3 - 2020-05-08
 ### Fixed
-
 * Correct spelling of ConnectError::Unresolved [#1487]
 * Fix a mistake in the encoding of websocket continuation messages wherein
   Item::FirstText and Item::FirstBinary are each encoded as the other.
 
 ### Changed
-
 * Implement `std::error::Error` for our custom errors [#1422]
 * Remove `failure` support for `ResponseError` since that crate
   will be deprecated in the near future.
@@ -138,338 +307,247 @@
 [#1422]: https://github.com/actix/actix-web/pull/1422
 [#1487]: https://github.com/actix/actix-web/pull/1487
 
-## [2.0.0-alpha.2] - 2020-03-07
 
+## 2.0.0-alpha.2 - 2020-03-07
 ### Changed
-
 * Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
-
+* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB
-* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB respectively
+  respectively to improve download speed for awc when downloading large objects. [#1394]
-  to improve download speed for awc when downloading large objects. [#1394]
+* client::Connector accepts initial_window_size and initial_connection_window_size
-
+  HTTP2 configuration. [#1394]
-* client::Connector accepts initial_window_size and initial_connection_window_size HTTP2 configuration. [#1394]
-
 * client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
 
 [#1394]: https://github.com/actix/actix-web/pull/1394
 [#1395]: https://github.com/actix/actix-web/pull/1395
 
-## [2.0.0-alpha.1] - 2020-02-27
 
+## 2.0.0-alpha.1 - 2020-02-27
 ### Changed
-
 * Update the `time` dependency to 0.2.7.
 * Moved actors messages support from actix crate, enabled with feature `actors`.
-* Breaking change: trait MessageBody requires Unpin and accepting Pin<&mut Self> instead of &mut self in the poll_next().
+* Breaking change: trait MessageBody requires Unpin and accepting `Pin<&mut Self>` instead of
+  `&mut self` in the poll_next().
 * MessageBody is not implemented for &'static [u8] anymore.
 
 ### Fixed
-
 * Allow `SameSite=None` cookies to be sent in a response.
 
-## [1.0.1] - 2019-12-20
 
+## 1.0.1 - 2019-12-20
 ### Fixed
-
 * Poll upgrade service's readiness from HTTP service handlers
-
 * Replace brotli with brotli2 #1224
 
-## [1.0.0] - 2019-12-13
 
+## 1.0.0 - 2019-12-13
 ### Added
-
 * Add websockets continuation frame support
 
 ### Changed
-
 * Replace `flate2-xxx` features with `compress`
 
-## [1.0.0-alpha.5] - 2019-12-09
 
+## 1.0.0-alpha.5 - 2019-12-09
 ### Fixed
-
 * Check `Upgrade` service readiness before calling it
-
+* Fix buffer remaining capacity calculation
-* Fix buffer remaining capacity calcualtion
 
 ### Changed
-
 * Websockets: Ping and Pong should have binary data #1049
 
-## [1.0.0-alpha.4] - 2019-12-08
 
+## 1.0.0-alpha.4 - 2019-12-08
 ### Added
-
 * Add impl ResponseBuilder for Error
 
 ### Changed
-
 * Use rust based brotli compression library
 
-## [1.0.0-alpha.3] - 2019-12-07
+## 1.0.0-alpha.3 - 2019-12-07
-
 ### Changed
-
 * Migrate to tokio 0.2
-
 * Migrate to `std::future`
 
 
-## [0.2.11] - 2019-11-06
+## 0.2.11 - 2019-11-06
-
 ### Added
-
 * Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
-
+* Add an additional `filename*` param in the `Content-Disposition` header of
-* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
+  `actix_files::NamedFile` to be more compatible. (#1151)
-
 * Allow to use `std::convert::Infallible` as `actix_http::error::Error`
 
 ### Fixed
+* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain;
+  charset=utf-8` header [#1118]
 
-* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain; charset=utf-8` header #1118
+[#1878]: https://github.com/actix/actix-web/pull/1878
 
 
-## [0.2.10] - 2019-09-11
+## 0.2.10 - 2019-09-11
-
 ### Added
-
+* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests
-* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests with `RequestHead`
+  with `RequestHead`
 
 ### Fixed
-
 * h2 will use error response #1080
-
 * on_connect result isn't added to request extensions for http2 requests #1009
 
 
-## [0.2.9] - 2019-08-13
+## 0.2.9 - 2019-08-13
-
 ### Changed
-
 * Dropped the `byteorder`-dependency in favor of `stdlib`-implementation
-
 * Update percent-encoding to 2.1
-
 * Update serde_urlencoded to 0.6.1
 
 ### Fixed
-
 * Fixed a panic in the HTTP2 handshake in client HTTP requests (#1031)
 
 
-## [0.2.8] - 2019-08-01
+## 0.2.8 - 2019-08-01
-
 ### Added
-
 * Add `rustls` support
-
 * Add `Clone` impl for `HeaderMap`
 
 ### Fixed
-
 * awc client panic #1016
-
+* Invalid response with compression middleware enabled, but compression-related features
-* Invalid response with compression middleware enabled, but compression-related features disabled #997
+  disabled #997
 
 
-## [0.2.7] - 2019-07-18
+## 0.2.7 - 2019-07-18
-
 ### Added
-
 * Add support for downcasting response errors #986
 
 
-## [0.2.6] - 2019-07-17
+## 0.2.6 - 2019-07-17
-
 ### Changed
-
 * Replace `ClonableService` with local copy
-
 * Upgrade `rand` dependency version to 0.7
 
 
-## [0.2.5] - 2019-06-28
+## 0.2.5 - 2019-06-28
-
 ### Added
-
 * Add `on-connect` callback, `HttpServiceBuilder::on_connect()` #946
 
 ### Changed
-
 * Use `encoding_rs` crate instead of unmaintained `encoding` crate
-
 * Add `Copy` and `Clone` impls for `ws::Codec`
 
 
-## [0.2.4] - 2019-06-16
+## 0.2.4 - 2019-06-16
-
 ### Fixed
-
 * Do not compress NoContent (204) responses #918
 
 
-## [0.2.3] - 2019-06-02
+## 0.2.3 - 2019-06-02
-
 ### Added
-
 * Debug impl for ResponseBuilder
-
 * From SizedStream and BodyStream for Body
 
 ### Changed
-
 * SizedStream uses u64
 
 
-## [0.2.2] - 2019-05-29
+## 0.2.2 - 2019-05-29
-
 ### Fixed
-
 * Parse incoming stream before closing stream on disconnect #868
 
 
-## [0.2.1] - 2019-05-25
+## 0.2.1 - 2019-05-25
-
 ### Fixed
-
 * Handle socket read disconnect
 
 
-## [0.2.0] - 2019-05-12
+## 0.2.0 - 2019-05-12
-
 ### Changed
-
 * Update actix-service to 0.4
-
 * Expect and upgrade services accept `ServerConfig` config.
 
 ### Deleted
-
 * `OneRequest` service
 
 
-## [0.1.5] - 2019-05-04
+## 0.1.5 - 2019-05-04
-
 ### Fixed
-
 * Clean up response extensions in response pool #817
 
 
-## [0.1.4] - 2019-04-24
+## 0.1.4 - 2019-04-24
-
 ### Added
-
 * Allow to render h1 request headers in `Camel-Case`
 
 ### Fixed
-
 * Read until eof for http/1.0 responses #771
 
 
-## [0.1.3] - 2019-04-23
+## 0.1.3 - 2019-04-23
-
 ### Fixed
-
 * Fix http client pool management
-
 * Fix http client wait queue management #794
 
 
-## [0.1.2] - 2019-04-23
+## 0.1.2 - 2019-04-23
-
 ### Fixed
-
 * Fix BorrowMutError panic in client connector #793
 
 
-## [0.1.1] - 2019-04-19
+## 0.1.1 - 2019-04-19
-
 ### Changed
-
 * Cookie::max_age() accepts value in seconds
-
 * Cookie::max_age_time() accepts value in time::Duration
-
 * Allow to specify server address for client connector
 
 
-## [0.1.0] - 2019-04-16
+## 0.1.0 - 2019-04-16
-
 ### Added
-
 * Expose peer addr via `Request::peer_addr()` and `RequestHead::peer_addr`
 
 ### Changed
-
 * `actix_http::encoding` always available
-
 * use trust-dns-resolver 0.11.0
 
 
-## [0.1.0-alpha.5] - 2019-04-12
+## 0.1.0-alpha.5 - 2019-04-12
-
 ### Added
-
 * Allow to use custom service for upgrade requests
-
 * Added `h1::SendResponse` future.
 
 ### Changed
-
 * MessageBody::length() renamed to MessageBody::size() for consistency
-
 * ws handshake verification functions take RequestHead instead of Request
 
 
-## [0.1.0-alpha.4] - 2019-04-08
+## 0.1.0-alpha.4 - 2019-04-08
-
 ### Added
-
 * Allow to use custom `Expect` handler
-
 * Add minimal `std::error::Error` impl for `Error`
 
 ### Changed
-
 * Export IntoHeaderValue
-
 * Render error and return as response body
-
+* Use thread pool for response body compression
-* Use thread pool for response body comression
 
 ### Deleted
-
 * Removed PayloadBuffer
 
 
-## [0.1.0-alpha.3] - 2019-04-02
+## 0.1.0-alpha.3 - 2019-04-02
-
 ### Added
-
 * Warn when an unsealed private cookie isn't valid UTF-8
 
 ### Fixed
-
 * Rust 1.31.0 compatibility
-
 * Preallocate read buffer for h1 codec
-
 * Detect socket disconnection during protocol selection
 
 
-## [0.1.0-alpha.2] - 2019-03-29
+## 0.1.0-alpha.2 - 2019-03-29
-
 ### Added
-
 * Added ws::Message::Nop, no-op websockets message
 
 ### Changed
-
+* Do not use thread pool for decompression if chunk size is smaller than 2048.
-* Do not use thread pool for decomression if chunk size is smaller than 2048.
 
 
-## [0.1.0-alpha.1] - 2019-03-28
+## 0.1.0-alpha.1 - 2019-03-28
-
 * Initial impl

actix-http/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-http"
-version = "3.0.0-beta.1"
+version = "3.0.0-beta.7"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "HTTP primitives for the Actix ecosystem"
 readme = "README.md"
@@ -15,7 +15,8 @@ license = "MIT OR Apache-2.0"
 edition = "2018"
 
 [package.metadata.docs.rs]
-features = ["openssl", "rustls", "compress", "secure-cookies", "actors"]
+# features that docs.rs will build with
+features = ["openssl", "rustls", "compress-brotli", "compress-gzip", "compress-zstd"]
 
 [lib]
 name = "actix_http"
@@ -30,70 +31,78 @@ openssl = ["actix-tls/openssl"]
 # rustls support
 rustls = ["actix-tls/rustls"]
 
-# enable compressison support
+# enable compression support
-compress = ["flate2", "brotli2"]
+compress-brotli = ["brotli2", "__compress"]
+compress-gzip = ["flate2", "__compress"]
+compress-zstd = ["zstd", "__compress"]
 
-# support for secure cookies
+# trust-dns as client dns resolver
-secure-cookies = ["cookie/secure"]
+trust-dns = ["trust-dns-resolver"]
 
-# support for actix Actor messages
+# Internal (PRIVATE!) features used to aid testing and cheking feature status.
-actors = ["actix"]
+# Don't rely on these whatsoever. They may disappear at anytime.
+__compress = []
 
 [dependencies]
-actix-service = "2.0.0-beta.2"
+actix-service = "2.0.0"
-actix-codec = "0.4.0-beta.1"
+actix-codec = "0.4.0"
-actix-utils = "3.0.0-beta.1"
+actix-utils = "3.0.0"
-actix-rt = "2.0.0-beta.1"
+actix-rt = "2.2"
-actix-threadpool = "0.3.1"
+actix-tls = { version = "3.0.0-beta.5", features = ["accept", "connect"] }
-actix-tls = "3.0.0-beta.2"
-actix = { version = "0.11.0-beta.1", optional = true }
 
+ahash = "0.7"
 base64 = "0.13"
 bitflags = "1.2"
 bytes = "1"
 bytestring = "1"
-cookie = { version = "0.14.1", features = ["percent-encode"] }
-copyless = "0.1.4"
 derive_more = "0.99.5"
-either = "1.5.3"
 encoding_rs = "0.8"
-futures-channel = { version = "0.3.7", default-features = false }
+futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
-futures-core = { version = "0.3.7", default-features = false }
+futures-util = { version = "0.3.7", default-features = false, features = ["alloc", "sink"] }
-futures-util = { version = "0.3.7", default-features = false, features = ["sink"] }
+h2 = "0.3.1"
-fxhash = "0.2.1"
-h2 = "0.3.0"
 http = "0.2.2"
 httparse = "1.3"
-indexmap = "1.3"
 itoa = "0.4"
-lazy_static = "1.4"
+language-tags = "0.3"
-language-tags = "0.2"
+local-channel = "0.1"
+once_cell = "1.5"
 log = "0.4"
 mime = "0.3"
 percent-encoding = "2.1"
 pin-project = "1.0.0"
+pin-project-lite = "0.2"
 rand = "0.8"
 regex = "1.3"
 serde = "1.0"
-serde_json = "1.0"
 sha-1 = "0.9"
-slab = "0.4"
+smallvec = "1.6"
-serde_urlencoded = "0.7"
+time = { version = "0.2.23", default-features = false, features = ["std"] }
-time = { version = "0.2.7", default-features = false, features = ["std"] }
+tokio = { version = "1.2", features = ["sync"] }
 
 # compression
 brotli2 = { version="0.3.2", optional = true }
 flate2 = { version = "1.0.13", optional = true }
+zstd = { version = "0.7", optional = true }
+
+trust-dns-resolver = { version = "0.20.0", optional = true }
 
 [dev-dependencies]
-actix-server = "2.0.0-beta.2"
+actix-server = "2.0.0-beta.3"
-actix-http-test = { version = "3.0.0-beta.1", features = ["openssl"] }
+actix-http-test = { version = "3.0.0-beta.4", features = ["openssl"] }
-actix-tls = { version = "3.0.0-beta.2", features = ["openssl"] }
+actix-tls = { version = "3.0.0-beta.5", features = ["openssl"] }
-criterion = "0.3"
+async-stream = "0.3"
-env_logger = "0.7"
+criterion = { version = "0.3", features = ["html_reports"] }
-serde_derive = "1.0"
+env_logger = "0.8"
-open-ssl = { version="0.10", package = "openssl" }
+rcgen = "0.8"
-rust-tls = { version="0.19", package = "rustls" }
+serde = { version = "1.0", features = ["derive"] }
+serde_json = "1.0"
+tls-openssl = { version = "0.10", package = "openssl" }
+tls-rustls = { version = "0.19", package = "rustls" }
+webpki = { version = "0.21.0" }
+
+[[example]]
+name = "ws"
+required-features = ["rustls"]
 
 [[bench]]
 name = "write-camel-case"

actix-http/README.md

@@ -3,10 +3,13 @@
 > HTTP primitives for the Actix ecosystem.
 
 [![crates.io](https://img.shields.io/crates/v/actix-http?label=latest)](https://crates.io/crates/actix-http)
-[![Documentation](https://docs.rs/actix-http/badge.svg?version=2.2.0)](https://docs.rs/actix-http/2.2.0)
+[![Documentation](https://docs.rs/actix-http/badge.svg?version=3.0.0-beta.7)](https://docs.rs/actix-http/3.0.0-beta.7)
-![Apache 2.0 or MIT licensed](https://img.shields.io/crates/l/actix-http)
+[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
-[![Dependency Status](https://deps.rs/crate/actix-http/2.2.0/status.svg)](https://deps.rs/crate/actix-http/2.2.0)
+![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http.svg)
-[![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+<br />
+[![dependency status](https://deps.rs/crate/actix-http/3.0.0-beta.7/status.svg)](https://deps.rs/crate/actix-http/3.0.0-beta.7)
+[![Download](https://img.shields.io/crates/d/actix-http.svg)](https://crates.io/crates/actix-http)
+[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
 
 ## Documentation & Resources
 

actix-http/examples/echo.rs

@@ -1,19 +1,17 @@
-use std::{env, io};
+use std::io;
 
-use actix_http::{Error, HttpService, Request, Response};
+use actix_http::{http::StatusCode, Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures_util::StreamExt;
+use futures_util::StreamExt as _;
 use http::header::HeaderValue;
-use log::info;
 
 #[actix_rt::main]
 async fn main() -> io::Result<()> {
-    env::set_var("RUST_LOG", "echo=info");
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
-    env_logger::init();
 
     Server::build()
-        .bind("echo", "127.0.0.1:8080", || {
+        .bind("echo", ("127.0.0.1", 8080), || {
             HttpService::build()
                 .client_timeout(1000)
                 .client_disconnect(1000)
@@ -23,10 +21,14 @@ async fn main() -> io::Result<()> {
                         body.extend_from_slice(&item?);
                     }
 
-                    info!("request body: {:?}", body);
+                    log::info!("request body: {:?}", body);
+
                     Ok::<_, Error>(
-                        Response::Ok()
+                        Response::build(StatusCode::OK)
-                            .header("x-head", HeaderValue::from_static("dummy value!"))
+                            .insert_header((
+                                "x-head",
+                                HeaderValue::from_static("dummy value!"),
+                            ))
                             .body(body),
                     )
                 })

actix-http/examples/echo2.rs

@@ -1,31 +1,30 @@
-use std::{env, io};
+use std::io;
 
-use actix_http::http::HeaderValue;
+use actix_http::{body::Body, http::HeaderValue, http::StatusCode};
 use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures_util::StreamExt;
+use futures_util::StreamExt as _;
-use log::info;
 
-async fn handle_request(mut req: Request) -> Result<Response, Error> {
+async fn handle_request(mut req: Request) -> Result<Response<Body>, Error> {
     let mut body = BytesMut::new();
     while let Some(item) = req.payload().next().await {
         body.extend_from_slice(&item?)
     }
 
-    info!("request body: {:?}", body);
+    log::info!("request body: {:?}", body);
-    Ok(Response::Ok()
+
-        .header("x-head", HeaderValue::from_static("dummy value!"))
+    Ok(Response::build(StatusCode::OK)
+        .insert_header(("x-head", HeaderValue::from_static("dummy value!")))
         .body(body))
 }
 
 #[actix_rt::main]
 async fn main() -> io::Result<()> {
-    env::set_var("RUST_LOG", "echo=info");
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
-    env_logger::init();
 
     Server::build()
-        .bind("echo", "127.0.0.1:8080", || {
+        .bind("echo", ("127.0.0.1", 8080), || {
             HttpService::build().finish(handle_request).tcp()
         })?
         .run()

actix-http/examples/hello-world.rs

@@ -1,26 +1,28 @@
-use std::{env, io};
+use std::{convert::Infallible, io};
 
-use actix_http::{HttpService, Response};
+use actix_http::{http::StatusCode, HttpService, Response};
 use actix_server::Server;
-use futures_util::future;
 use http::header::HeaderValue;
-use log::info;
 
 #[actix_rt::main]
 async fn main() -> io::Result<()> {
-    env::set_var("RUST_LOG", "hello_world=info");
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
-    env_logger::init();
 
     Server::build()
-        .bind("hello-world", "127.0.0.1:8080", || {
+        .bind("hello-world", ("127.0.0.1", 8080), || {
             HttpService::build()
                 .client_timeout(1000)
                 .client_disconnect(1000)
-                .finish(|_req| {
+                .finish(|req| async move {
-                    info!("{:?}", _req);
+                    log::info!("{:?}", req);
-                    let mut res = Response::Ok();
+
-                    res.header("x-head", HeaderValue::from_static("dummy value!"));
+                    let mut res = Response::build(StatusCode::OK);
-                    future::ok::<_, ()>(res.body("Hello world!"))
+                    res.insert_header((
+                        "x-head",
+                        HeaderValue::from_static("dummy value!"),
+                    ));
+
+                    Ok::<_, Infallible>(res.body("Hello world!"))
                 })
                 .tcp()
         })?

actix-http/examples/streaming-error.rs

@@ -0,0 +1,40 @@
+//! Example showing response body (chunked) stream erroring.
+//!
+//! Test using `nc` or `curl`.
+//! ```sh
+//! $ curl -vN 127.0.0.1:8080
+//! $ echo 'GET / HTTP/1.1\n\n' | nc 127.0.0.1 8080
+//! ```
+
+use std::{convert::Infallible, io, time::Duration};
+
+use actix_http::{body::BodyStream, HttpService, Response};
+use actix_server::Server;
+use async_stream::stream;
+use bytes::Bytes;
+
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
+
+    Server::build()
+        .bind("streaming-error", ("127.0.0.1", 8080), || {
+            HttpService::build()
+                .finish(|req| async move {
+                    log::info!("{:?}", req);
+                    let res = Response::ok();
+
+                    Ok::<_, Infallible>(res.set_body(BodyStream::new(stream! {
+                        yield Ok(Bytes::from("123"));
+                        yield Ok(Bytes::from("456"));
+
+                        actix_rt::time::sleep(Duration::from_millis(1000)).await;
+
+                        yield Err(io::Error::new(io::ErrorKind::Other, ""));
+                    })))
+                })
+                .tcp()
+        })?
+        .run()
+        .await
+}

actix-http/examples/ws.rs

@@ -0,0 +1,106 @@
+//! Sets up a WebSocket server over TCP and TLS.
+//! Sends a heartbeat message every 4 seconds but does not respond to any incoming frames.
+
+extern crate tls_rustls as rustls;
+
+use std::{
+    io,
+    pin::Pin,
+    task::{Context, Poll},
+    time::Duration,
+};
+
+use actix_codec::Encoder;
+use actix_http::{body::BodyStream, error::Error, ws, HttpService, Request, Response};
+use actix_rt::time::{interval, Interval};
+use actix_server::Server;
+use bytes::{Bytes, BytesMut};
+use bytestring::ByteString;
+use futures_core::{ready, Stream};
+
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
+
+    Server::build()
+        .bind("tcp", ("127.0.0.1", 8080), || {
+            HttpService::build().h1(handler).tcp()
+        })?
+        .bind("tls", ("127.0.0.1", 8443), || {
+            HttpService::build().finish(handler).rustls(tls_config())
+        })?
+        .run()
+        .await
+}
+
+async fn handler(req: Request) -> Result<Response<BodyStream<Heartbeat>>, Error> {
+    log::info!("handshaking");
+    let mut res = ws::handshake(req.head())?;
+
+    // handshake will always fail under HTTP/2
+
+    log::info!("responding");
+    Ok(res.message_body(BodyStream::new(Heartbeat::new(ws::Codec::new())))?)
+}
+
+struct Heartbeat {
+    codec: ws::Codec,
+    interval: Interval,
+}
+
+impl Heartbeat {
+    fn new(codec: ws::Codec) -> Self {
+        Self {
+            codec,
+            interval: interval(Duration::from_secs(4)),
+        }
+    }
+}
+
+impl Stream for Heartbeat {
+    type Item = Result<Bytes, Error>;
+
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        log::trace!("poll");
+
+        ready!(self.as_mut().interval.poll_tick(cx));
+
+        let mut buffer = BytesMut::new();
+
+        self.as_mut()
+            .codec
+            .encode(
+                ws::Message::Text(ByteString::from_static("hello world")),
+                &mut buffer,
+            )
+            .unwrap();
+
+        Poll::Ready(Some(Ok(buffer.freeze())))
+    }
+}
+
+fn tls_config() -> rustls::ServerConfig {
+    use std::io::BufReader;
+
+    use rustls::{
+        internal::pemfile::{certs, pkcs8_private_keys},
+        NoClientAuth, ServerConfig,
+    };
+
+    let cert = rcgen::generate_simple_self_signed(vec!["localhost".to_owned()]).unwrap();
+    let cert_file = cert.serialize_pem().unwrap();
+    let key_file = cert.serialize_private_key_pem();
+
+    let mut config = ServerConfig::new(NoClientAuth::new());
+    let cert_file = &mut BufReader::new(cert_file.as_bytes());
+    let key_file = &mut BufReader::new(key_file.as_bytes());
+
+    let cert_chain = certs(cert_file).unwrap();
+    let mut keys = pkcs8_private_keys(key_file).unwrap();
+    config.set_single_cert(cert_chain, keys.remove(0)).unwrap();
+
+    config
+}

actix-http/src/body.rs

@@ -1,710 +0,0 @@
-use std::pin::Pin;
-use std::task::{Context, Poll};
-use std::{fmt, mem};
-
-use bytes::{Bytes, BytesMut};
-use futures_core::{ready, Stream};
-use pin_project::pin_project;
-
-use crate::error::Error;
-
-#[derive(Debug, PartialEq, Copy, Clone)]
-/// Body size hint
-pub enum BodySize {
-    None,
-    Empty,
-    Sized(u64),
-    Stream,
-}
-
-impl BodySize {
-    pub fn is_eof(&self) -> bool {
-        matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
-    }
-}
-
-/// Type that provides this trait can be streamed to a peer.
-pub trait MessageBody {
-    fn size(&self) -> BodySize;
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>>;
-
-    downcast_get_type_id!();
-}
-
-downcast!(MessageBody);
-
-impl MessageBody for () {
-    fn size(&self) -> BodySize {
-        BodySize::Empty
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        Poll::Ready(None)
-    }
-}
-
-impl<T: MessageBody + Unpin> MessageBody for Box<T> {
-    fn size(&self) -> BodySize {
-        self.as_ref().size()
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        Pin::new(self.get_mut().as_mut()).poll_next(cx)
-    }
-}
-
-#[pin_project(project = ResponseBodyProj)]
-pub enum ResponseBody<B> {
-    Body(#[pin] B),
-    Other(Body),
-}
-
-impl ResponseBody<Body> {
-    pub fn into_body<B>(self) -> ResponseBody<B> {
-        match self {
-            ResponseBody::Body(b) => ResponseBody::Other(b),
-            ResponseBody::Other(b) => ResponseBody::Other(b),
-        }
-    }
-}
-
-impl<B> ResponseBody<B> {
-    pub fn take_body(&mut self) -> ResponseBody<B> {
-        std::mem::replace(self, ResponseBody::Other(Body::None))
-    }
-}
-
-impl<B: MessageBody> ResponseBody<B> {
-    pub fn as_ref(&self) -> Option<&B> {
-        if let ResponseBody::Body(ref b) = self {
-            Some(b)
-        } else {
-            None
-        }
-    }
-}
-
-impl<B: MessageBody> MessageBody for ResponseBody<B> {
-    fn size(&self) -> BodySize {
-        match self {
-            ResponseBody::Body(ref body) => body.size(),
-            ResponseBody::Other(ref body) => body.size(),
-        }
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        match self.project() {
-            ResponseBodyProj::Body(body) => body.poll_next(cx),
-            ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
-        }
-    }
-}
-
-impl<B: MessageBody> Stream for ResponseBody<B> {
-    type Item = Result<Bytes, Error>;
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Self::Item>> {
-        match self.project() {
-            ResponseBodyProj::Body(body) => body.poll_next(cx),
-            ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
-        }
-    }
-}
-
-/// Represents various types of http message body.
-pub enum Body {
-    /// Empty response. `Content-Length` header is not set.
-    None,
-    /// Zero sized response body. `Content-Length` header is set to `0`.
-    Empty,
-    /// Specific response body.
-    Bytes(Bytes),
-    /// Generic message body.
-    Message(Box<dyn MessageBody + Unpin>),
-}
-
-impl Body {
-    /// Create body from slice (copy)
-    pub fn from_slice(s: &[u8]) -> Body {
-        Body::Bytes(Bytes::copy_from_slice(s))
-    }
-
-    /// Create body from generic message body.
-    pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
-        Body::Message(Box::new(body))
-    }
-}
-
-impl MessageBody for Body {
-    fn size(&self) -> BodySize {
-        match self {
-            Body::None => BodySize::None,
-            Body::Empty => BodySize::Empty,
-            Body::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
-            Body::Message(ref body) => body.size(),
-        }
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        match self.get_mut() {
-            Body::None => Poll::Ready(None),
-            Body::Empty => Poll::Ready(None),
-            Body::Bytes(ref mut bin) => {
-                let len = bin.len();
-                if len == 0 {
-                    Poll::Ready(None)
-                } else {
-                    Poll::Ready(Some(Ok(mem::take(bin))))
-                }
-            }
-            Body::Message(body) => Pin::new(&mut **body).poll_next(cx),
-        }
-    }
-}
-
-impl PartialEq for Body {
-    fn eq(&self, other: &Body) -> bool {
-        match *self {
-            Body::None => matches!(*other, Body::None),
-            Body::Empty => matches!(*other, Body::Empty),
-            Body::Bytes(ref b) => match *other {
-                Body::Bytes(ref b2) => b == b2,
-                _ => false,
-            },
-            Body::Message(_) => false,
-        }
-    }
-}
-
-impl fmt::Debug for Body {
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        match *self {
-            Body::None => write!(f, "Body::None"),
-            Body::Empty => write!(f, "Body::Empty"),
-            Body::Bytes(ref b) => write!(f, "Body::Bytes({:?})", b),
-            Body::Message(_) => write!(f, "Body::Message(_)"),
-        }
-    }
-}
-
-impl From<&'static str> for Body {
-    fn from(s: &'static str) -> Body {
-        Body::Bytes(Bytes::from_static(s.as_ref()))
-    }
-}
-
-impl From<&'static [u8]> for Body {
-    fn from(s: &'static [u8]) -> Body {
-        Body::Bytes(Bytes::from_static(s))
-    }
-}
-
-impl From<Vec<u8>> for Body {
-    fn from(vec: Vec<u8>) -> Body {
-        Body::Bytes(Bytes::from(vec))
-    }
-}
-
-impl From<String> for Body {
-    fn from(s: String) -> Body {
-        s.into_bytes().into()
-    }
-}
-
-impl<'a> From<&'a String> for Body {
-    fn from(s: &'a String) -> Body {
-        Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
-    }
-}
-
-impl From<Bytes> for Body {
-    fn from(s: Bytes) -> Body {
-        Body::Bytes(s)
-    }
-}
-
-impl From<BytesMut> for Body {
-    fn from(s: BytesMut) -> Body {
-        Body::Bytes(s.freeze())
-    }
-}
-
-impl From<serde_json::Value> for Body {
-    fn from(v: serde_json::Value) -> Body {
-        Body::Bytes(v.to_string().into())
-    }
-}
-
-impl<S> From<SizedStream<S>> for Body
-where
-    S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
-{
-    fn from(s: SizedStream<S>) -> Body {
-        Body::from_message(s)
-    }
-}
-
-impl<S, E> From<BodyStream<S>> for Body
-where
-    S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
-    E: Into<Error> + 'static,
-{
-    fn from(s: BodyStream<S>) -> Body {
-        Body::from_message(s)
-    }
-}
-
-impl MessageBody for Bytes {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
-        }
-    }
-}
-
-impl MessageBody for BytesMut {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
-        }
-    }
-}
-
-impl MessageBody for &'static str {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(Bytes::from_static(
-                mem::take(self.get_mut()).as_ref(),
-            ))))
-        }
-    }
-}
-
-impl MessageBody for Vec<u8> {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
-        }
-    }
-}
-
-impl MessageBody for String {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(Bytes::from(
-                mem::take(self.get_mut()).into_bytes(),
-            ))))
-        }
-    }
-}
-
-/// Type represent streaming body.
-/// Response does not contain `content-length` header and appropriate transfer encoding is used.
-pub struct BodyStream<S: Unpin> {
-    stream: S,
-}
-
-impl<S, E> BodyStream<S>
-where
-    S: Stream<Item = Result<Bytes, E>> + Unpin,
-    E: Into<Error>,
-{
-    pub fn new(stream: S) -> Self {
-        BodyStream { stream }
-    }
-}
-
-impl<S, E> MessageBody for BodyStream<S>
-where
-    S: Stream<Item = Result<Bytes, E>> + Unpin,
-    E: Into<Error>,
-{
-    fn size(&self) -> BodySize {
-        BodySize::Stream
-    }
-
-    /// Attempts to pull out the next value of the underlying [`Stream`].
-    ///
-    /// Empty values are skipped to prevent [`BodyStream`]'s transmission being
-    /// ended on a zero-length chunk, but rather proceed until the underlying
-    /// [`Stream`] ends.
-    fn poll_next(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        loop {
-            let stream = &mut self.as_mut().stream;
-            return Poll::Ready(match ready!(Pin::new(stream).poll_next(cx)) {
-                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
-                opt => opt.map(|res| res.map_err(Into::into)),
-            });
-        }
-    }
-}
-
-/// Type represent streaming body. This body implementation should be used
-/// if total size of stream is known. Data get sent as is without using transfer encoding.
-pub struct SizedStream<S: Unpin> {
-    size: u64,
-    stream: S,
-}
-
-impl<S> SizedStream<S>
-where
-    S: Stream<Item = Result<Bytes, Error>> + Unpin,
-{
-    pub fn new(size: u64, stream: S) -> Self {
-        SizedStream { size, stream }
-    }
-}
-
-impl<S> MessageBody for SizedStream<S>
-where
-    S: Stream<Item = Result<Bytes, Error>> + Unpin,
-{
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.size as u64)
-    }
-
-    /// Attempts to pull out the next value of the underlying [`Stream`].
-    ///
-    /// Empty values are skipped to prevent [`SizedStream`]'s transmission being
-    /// ended on a zero-length chunk, but rather proceed until the underlying
-    /// [`Stream`] ends.
-    fn poll_next(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        loop {
-            let stream = &mut self.as_mut().stream;
-            return Poll::Ready(match ready!(Pin::new(stream).poll_next(cx)) {
-                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
-                val => val,
-            });
-        }
-    }
-}
-
-#[cfg(test)]
-mod tests {
-    use super::*;
-    use futures_util::future::poll_fn;
-    use futures_util::pin_mut;
-    use futures_util::stream;
-
-    impl Body {
-        pub(crate) fn get_ref(&self) -> &[u8] {
-            match *self {
-                Body::Bytes(ref bin) => &bin,
-                _ => panic!(),
-            }
-        }
-    }
-
-    impl ResponseBody<Body> {
-        pub(crate) fn get_ref(&self) -> &[u8] {
-            match *self {
-                ResponseBody::Body(ref b) => b.get_ref(),
-                ResponseBody::Other(ref b) => b.get_ref(),
-            }
-        }
-    }
-
-    #[actix_rt::test]
-    async fn test_static_str() {
-        assert_eq!(Body::from("").size(), BodySize::Sized(0));
-        assert_eq!(Body::from("test").size(), BodySize::Sized(4));
-        assert_eq!(Body::from("test").get_ref(), b"test");
-
-        assert_eq!("test".size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
-                .await
-                .unwrap()
-                .ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_static_bytes() {
-        assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
-        assert_eq!(
-            Body::from_slice(b"test".as_ref()).size(),
-            BodySize::Sized(4)
-        );
-        assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
-        let sb = Bytes::from(&b"test"[..]);
-        pin_mut!(sb);
-
-        assert_eq!(sb.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_vec() {
-        assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
-        let test_vec = Vec::from("test");
-        pin_mut!(test_vec);
-
-        assert_eq!(test_vec.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| test_vec.as_mut().poll_next(cx))
-                .await
-                .unwrap()
-                .ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_bytes() {
-        let b = Bytes::from("test");
-        assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(b.clone()).get_ref(), b"test");
-        pin_mut!(b);
-
-        assert_eq!(b.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_bytes_mut() {
-        let b = BytesMut::from("test");
-        assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(b.clone()).get_ref(), b"test");
-        pin_mut!(b);
-
-        assert_eq!(b.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_string() {
-        let b = "test".to_owned();
-        assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(b.clone()).get_ref(), b"test");
-        assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(&b).get_ref(), b"test");
-        pin_mut!(b);
-
-        assert_eq!(b.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_unit() {
-        assert_eq!(().size(), BodySize::Empty);
-        assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
-            .await
-            .is_none());
-    }
-
-    #[actix_rt::test]
-    async fn test_box() {
-        let val = Box::new(());
-        pin_mut!(val);
-        assert_eq!(val.size(), BodySize::Empty);
-        assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
-    }
-
-    #[actix_rt::test]
-    async fn test_body_eq() {
-        assert!(
-            Body::Bytes(Bytes::from_static(b"1"))
-                == Body::Bytes(Bytes::from_static(b"1"))
-        );
-        assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
-    }
-
-    #[actix_rt::test]
-    async fn test_body_debug() {
-        assert!(format!("{:?}", Body::None).contains("Body::None"));
-        assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
-        assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
-    }
-
-    #[actix_rt::test]
-    async fn test_serde_json() {
-        use serde_json::json;
-        assert_eq!(
-            Body::from(serde_json::Value::String("test".into())).size(),
-            BodySize::Sized(6)
-        );
-        assert_eq!(
-            Body::from(json!({"test-key":"test-value"})).size(),
-            BodySize::Sized(25)
-        );
-    }
-
-    mod body_stream {
-        use super::*;
-        //use futures::task::noop_waker;
-        //use futures::stream::once;
-
-        #[actix_rt::test]
-        async fn skips_empty_chunks() {
-            let body = BodyStream::new(stream::iter(
-                ["1", "", "2"]
-                    .iter()
-                    .map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
-            ));
-            pin_mut!(body);
-
-            assert_eq!(
-                poll_fn(|cx| body.as_mut().poll_next(cx))
-                    .await
-                    .unwrap()
-                    .ok(),
-                Some(Bytes::from("1")),
-            );
-            assert_eq!(
-                poll_fn(|cx| body.as_mut().poll_next(cx))
-                    .await
-                    .unwrap()
-                    .ok(),
-                Some(Bytes::from("2")),
-            );
-        }
-
-        /* Now it does not compile as it should
-        #[actix_rt::test]
-        async fn move_pinned_pointer() {
-            let (sender, receiver) = futures::channel::oneshot::channel();
-            let mut body_stream = Ok(BodyStream::new(once(async {
-                let x = Box::new(0i32);
-                let y = &x;
-                receiver.await.unwrap();
-                let _z = **y;
-                Ok::<_, ()>(Bytes::new())
-            })));
-
-            let waker = noop_waker();
-            let mut context = Context::from_waker(&waker);
-            pin_mut!(body_stream);
-
-            let _ = body_stream.as_mut().unwrap().poll_next(&mut context);
-            sender.send(()).unwrap();
-            let _ = std::mem::replace(&mut body_stream, Err([0; 32])).unwrap().poll_next(&mut context);
-        }*/
-    }
-
-    mod sized_stream {
-        use super::*;
-
-        #[actix_rt::test]
-        async fn skips_empty_chunks() {
-            let body = SizedStream::new(
-                2,
-                stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
-            );
-            pin_mut!(body);
-            assert_eq!(
-                poll_fn(|cx| body.as_mut().poll_next(cx))
-                    .await
-                    .unwrap()
-                    .ok(),
-                Some(Bytes::from("1")),
-            );
-            assert_eq!(
-                poll_fn(|cx| body.as_mut().poll_next(cx))
-                    .await
-                    .unwrap()
-                    .ok(),
-                Some(Bytes::from("2")),
-            );
-        }
-    }
-
-    #[actix_rt::test]
-    async fn test_body_casting() {
-        let mut body = String::from("hello cast");
-        let resp_body: &mut dyn MessageBody = &mut body;
-        let body = resp_body.downcast_ref::<String>().unwrap();
-        assert_eq!(body, "hello cast");
-        let body = &mut resp_body.downcast_mut::<String>().unwrap();
-        body.push('!');
-        let body = resp_body.downcast_ref::<String>().unwrap();
-        assert_eq!(body, "hello cast!");
-        let not_body = resp_body.downcast_ref::<()>();
-        assert!(not_body.is_none());
-    }
-}

actix-http/src/body/body.rs

@@ -0,0 +1,233 @@
+use std::{
+    borrow::Cow,
+    error::Error as StdError,
+    fmt, mem,
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use bytes::{Bytes, BytesMut};
+use futures_core::{ready, Stream};
+
+use crate::error::Error;
+
+use super::{BodySize, BodyStream, MessageBody, MessageBodyMapErr, SizedStream};
+
+pub type Body = AnyBody;
+
+/// Represents various types of HTTP message body.
+pub enum AnyBody {
+    /// Empty response. `Content-Length` header is not set.
+    None,
+
+    /// Zero sized response body. `Content-Length` header is set to `0`.
+    Empty,
+
+    /// Specific response body.
+    Bytes(Bytes),
+
+    /// Generic message body.
+    Message(BoxAnyBody),
+}
+
+impl AnyBody {
+    /// Create body from slice (copy)
+    pub fn from_slice(s: &[u8]) -> Self {
+        Self::Bytes(Bytes::copy_from_slice(s))
+    }
+
+    /// Create body from generic message body.
+    pub fn from_message<B>(body: B) -> Self
+    where
+        B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError + 'static>>,
+    {
+        Self::Message(BoxAnyBody::from_body(body))
+    }
+}
+
+impl MessageBody for AnyBody {
+    type Error = Error;
+
+    fn size(&self) -> BodySize {
+        match self {
+            AnyBody::None => BodySize::None,
+            AnyBody::Empty => BodySize::Empty,
+            AnyBody::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
+            AnyBody::Message(ref body) => body.size(),
+        }
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        match self.get_mut() {
+            AnyBody::None => Poll::Ready(None),
+            AnyBody::Empty => Poll::Ready(None),
+            AnyBody::Bytes(ref mut bin) => {
+                let len = bin.len();
+                if len == 0 {
+                    Poll::Ready(None)
+                } else {
+                    Poll::Ready(Some(Ok(mem::take(bin))))
+                }
+            }
+
+            // TODO: MSRV 1.51: poll_map_err
+            AnyBody::Message(body) => match ready!(body.as_pin_mut().poll_next(cx)) {
+                Some(Err(err)) => {
+                    Poll::Ready(Some(Err(Error::new_body().with_cause(err))))
+                }
+                Some(Ok(val)) => Poll::Ready(Some(Ok(val))),
+                None => Poll::Ready(None),
+            },
+        }
+    }
+}
+
+impl PartialEq for AnyBody {
+    fn eq(&self, other: &Body) -> bool {
+        match *self {
+            AnyBody::None => matches!(*other, AnyBody::None),
+            AnyBody::Empty => matches!(*other, AnyBody::Empty),
+            AnyBody::Bytes(ref b) => match *other {
+                AnyBody::Bytes(ref b2) => b == b2,
+                _ => false,
+            },
+            AnyBody::Message(_) => false,
+        }
+    }
+}
+
+impl fmt::Debug for AnyBody {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        match *self {
+            AnyBody::None => write!(f, "AnyBody::None"),
+            AnyBody::Empty => write!(f, "AnyBody::Empty"),
+            AnyBody::Bytes(ref b) => write!(f, "AnyBody::Bytes({:?})", b),
+            AnyBody::Message(_) => write!(f, "AnyBody::Message(_)"),
+        }
+    }
+}
+
+impl From<&'static str> for AnyBody {
+    fn from(s: &'static str) -> Body {
+        AnyBody::Bytes(Bytes::from_static(s.as_ref()))
+    }
+}
+
+impl From<&'static [u8]> for AnyBody {
+    fn from(s: &'static [u8]) -> Body {
+        AnyBody::Bytes(Bytes::from_static(s))
+    }
+}
+
+impl From<Vec<u8>> for AnyBody {
+    fn from(vec: Vec<u8>) -> Body {
+        AnyBody::Bytes(Bytes::from(vec))
+    }
+}
+
+impl From<String> for AnyBody {
+    fn from(s: String) -> Body {
+        s.into_bytes().into()
+    }
+}
+
+impl From<&'_ String> for AnyBody {
+    fn from(s: &String) -> Body {
+        AnyBody::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
+    }
+}
+
+impl From<Cow<'_, str>> for AnyBody {
+    fn from(s: Cow<'_, str>) -> Body {
+        match s {
+            Cow::Owned(s) => AnyBody::from(s),
+            Cow::Borrowed(s) => {
+                AnyBody::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(s)))
+            }
+        }
+    }
+}
+
+impl From<Bytes> for AnyBody {
+    fn from(s: Bytes) -> Body {
+        AnyBody::Bytes(s)
+    }
+}
+
+impl From<BytesMut> for AnyBody {
+    fn from(s: BytesMut) -> Body {
+        AnyBody::Bytes(s.freeze())
+    }
+}
+
+impl<S, E> From<SizedStream<S>> for AnyBody
+where
+    S: Stream<Item = Result<Bytes, E>> + 'static,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    fn from(s: SizedStream<S>) -> Body {
+        AnyBody::from_message(s)
+    }
+}
+
+impl<S, E> From<BodyStream<S>> for AnyBody
+where
+    S: Stream<Item = Result<Bytes, E>> + 'static,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    fn from(s: BodyStream<S>) -> Body {
+        AnyBody::from_message(s)
+    }
+}
+
+/// A boxed message body with boxed errors.
+pub struct BoxAnyBody(Pin<Box<dyn MessageBody<Error = Box<dyn StdError + 'static>>>>);
+
+impl BoxAnyBody {
+    /// Boxes a `MessageBody` and any errors it generates.
+    pub fn from_body<B>(body: B) -> Self
+    where
+        B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError + 'static>>,
+    {
+        let body = MessageBodyMapErr::new(body, Into::into);
+        Self(Box::pin(body))
+    }
+
+    /// Returns a mutable pinned reference to the inner message body type.
+    pub fn as_pin_mut(
+        &mut self,
+    ) -> Pin<&mut (dyn MessageBody<Error = Box<dyn StdError + 'static>>)> {
+        self.0.as_mut()
+    }
+}
+
+impl fmt::Debug for BoxAnyBody {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        f.write_str("BoxAnyBody(dyn MessageBody)")
+    }
+}
+
+impl MessageBody for BoxAnyBody {
+    type Error = Error;
+
+    fn size(&self) -> BodySize {
+        self.0.size()
+    }
+
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        // TODO: MSRV 1.51: poll_map_err
+        match ready!(self.0.as_mut().poll_next(cx)) {
+            Some(Err(err)) => Poll::Ready(Some(Err(Error::new_body().with_cause(err)))),
+            Some(Ok(val)) => Poll::Ready(Some(Ok(val))),
+            None => Poll::Ready(None),
+        }
+    }
+}

actix-http/src/body/body_stream.rs

@@ -0,0 +1,171 @@
+use std::{
+    error::Error as StdError,
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use bytes::Bytes;
+use futures_core::{ready, Stream};
+use pin_project_lite::pin_project;
+
+use super::{BodySize, MessageBody};
+
+pin_project! {
+    /// Streaming response wrapper.
+    ///
+    /// Response does not contain `Content-Length` header and appropriate transfer encoding is used.
+    pub struct BodyStream<S> {
+        #[pin]
+        stream: S,
+    }
+}
+
+impl<S, E> BodyStream<S>
+where
+    S: Stream<Item = Result<Bytes, E>>,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    pub fn new(stream: S) -> Self {
+        BodyStream { stream }
+    }
+}
+
+impl<S, E> MessageBody for BodyStream<S>
+where
+    S: Stream<Item = Result<Bytes, E>>,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    type Error = E;
+
+    fn size(&self) -> BodySize {
+        BodySize::Stream
+    }
+
+    /// Attempts to pull out the next value of the underlying [`Stream`].
+    ///
+    /// Empty values are skipped to prevent [`BodyStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        loop {
+            let stream = self.as_mut().project().stream;
+
+            let chunk = match ready!(stream.poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                opt => opt,
+            };
+
+            return Poll::Ready(chunk);
+        }
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use std::{convert::Infallible, time::Duration};
+
+    use actix_rt::{
+        pin,
+        time::{sleep, Sleep},
+    };
+    use actix_utils::future::poll_fn;
+    use derive_more::{Display, Error};
+    use futures_core::ready;
+    use futures_util::{stream, FutureExt as _};
+
+    use super::*;
+    use crate::body::to_bytes;
+
+    #[actix_rt::test]
+    async fn skips_empty_chunks() {
+        let body = BodyStream::new(stream::iter(
+            ["1", "", "2"]
+                .iter()
+                .map(|&v| Ok::<_, Infallible>(Bytes::from(v))),
+        ));
+        pin!(body);
+
+        assert_eq!(
+            poll_fn(|cx| body.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("1")),
+        );
+        assert_eq!(
+            poll_fn(|cx| body.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("2")),
+        );
+    }
+
+    #[actix_rt::test]
+    async fn read_to_bytes() {
+        let body = BodyStream::new(stream::iter(
+            ["1", "", "2"]
+                .iter()
+                .map(|&v| Ok::<_, Infallible>(Bytes::from(v))),
+        ));
+
+        assert_eq!(to_bytes(body).await.ok(), Some(Bytes::from("12")));
+    }
+    #[derive(Debug, Display, Error)]
+    #[display(fmt = "stream error")]
+    struct StreamErr;
+
+    #[actix_rt::test]
+    async fn stream_immediate_error() {
+        let body = BodyStream::new(stream::once(async { Err(StreamErr) }));
+        assert!(matches!(to_bytes(body).await, Err(StreamErr)));
+    }
+
+    #[actix_rt::test]
+    async fn stream_delayed_error() {
+        let body =
+            BodyStream::new(stream::iter(vec![Ok(Bytes::from("1")), Err(StreamErr)]));
+        assert!(matches!(to_bytes(body).await, Err(StreamErr)));
+
+        #[pin_project::pin_project(project = TimeDelayStreamProj)]
+        #[derive(Debug)]
+        enum TimeDelayStream {
+            Start,
+            Sleep(Pin<Box<Sleep>>),
+            Done,
+        }
+
+        impl Stream for TimeDelayStream {
+            type Item = Result<Bytes, StreamErr>;
+
+            fn poll_next(
+                mut self: Pin<&mut Self>,
+                cx: &mut Context<'_>,
+            ) -> Poll<Option<Self::Item>> {
+                match self.as_mut().get_mut() {
+                    TimeDelayStream::Start => {
+                        let sleep = sleep(Duration::from_millis(1));
+                        self.as_mut().set(TimeDelayStream::Sleep(Box::pin(sleep)));
+                        cx.waker().wake_by_ref();
+                        Poll::Pending
+                    }
+
+                    TimeDelayStream::Sleep(ref mut delay) => {
+                        ready!(delay.poll_unpin(cx));
+                        self.set(TimeDelayStream::Done);
+                        cx.waker().wake_by_ref();
+                        Poll::Pending
+                    }
+
+                    TimeDelayStream::Done => Poll::Ready(Some(Err(StreamErr))),
+                }
+            }
+        }
+
+        let body = BodyStream::new(TimeDelayStream::Start);
+        assert!(matches!(to_bytes(body).await, Err(StreamErr)));
+    }
+}

actix-http/src/body/message_body.rs

@@ -0,0 +1,232 @@
+//! [`MessageBody`] trait and foreign implementations.
+
+use std::{
+    convert::Infallible,
+    mem,
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use bytes::{Bytes, BytesMut};
+use futures_core::ready;
+use pin_project_lite::pin_project;
+
+use crate::error::Error;
+
+use super::BodySize;
+
+/// An interface for response bodies.
+pub trait MessageBody {
+    type Error;
+
+    /// Body size hint.
+    fn size(&self) -> BodySize;
+
+    /// Attempt to pull out the next chunk of body bytes.
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>>;
+}
+
+impl MessageBody for () {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Empty
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        Poll::Ready(None)
+    }
+}
+
+impl<B> MessageBody for Box<B>
+where
+    B: MessageBody + Unpin,
+    B::Error: Into<Error>,
+{
+    type Error = B::Error;
+
+    fn size(&self) -> BodySize {
+        self.as_ref().size()
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        Pin::new(self.get_mut().as_mut()).poll_next(cx)
+    }
+}
+
+impl<B> MessageBody for Pin<Box<B>>
+where
+    B: MessageBody,
+    B::Error: Into<Error>,
+{
+    type Error = B::Error;
+
+    fn size(&self) -> BodySize {
+        self.as_ref().size()
+    }
+
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        self.as_mut().poll_next(cx)
+    }
+}
+
+impl MessageBody for Bytes {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
+        }
+    }
+}
+
+impl MessageBody for BytesMut {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
+        }
+    }
+}
+
+impl MessageBody for &'static str {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(Bytes::from_static(
+                mem::take(self.get_mut()).as_ref(),
+            ))))
+        }
+    }
+}
+
+impl MessageBody for Vec<u8> {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
+        }
+    }
+}
+
+impl MessageBody for String {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(Bytes::from(
+                mem::take(self.get_mut()).into_bytes(),
+            ))))
+        }
+    }
+}
+
+pin_project! {
+    pub(crate) struct MessageBodyMapErr<B, F> {
+        #[pin]
+        body: B,
+        mapper: Option<F>,
+    }
+}
+
+impl<B, F, E> MessageBodyMapErr<B, F>
+where
+    B: MessageBody,
+    F: FnOnce(B::Error) -> E,
+{
+    pub(crate) fn new(body: B, mapper: F) -> Self {
+        Self {
+            body,
+            mapper: Some(mapper),
+        }
+    }
+}
+
+impl<B, F, E> MessageBody for MessageBodyMapErr<B, F>
+where
+    B: MessageBody,
+    F: FnOnce(B::Error) -> E,
+{
+    type Error = E;
+
+    fn size(&self) -> BodySize {
+        self.body.size()
+    }
+
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        let this = self.as_mut().project();
+
+        match ready!(this.body.poll_next(cx)) {
+            Some(Err(err)) => {
+                let f = self.as_mut().project().mapper.take().unwrap();
+                let mapped_err = (f)(err);
+                Poll::Ready(Some(Err(mapped_err)))
+            }
+            Some(Ok(val)) => Poll::Ready(Some(Ok(val))),
+            None => Poll::Ready(None),
+        }
+    }
+}

actix-http/src/body/mod.rs

@@ -0,0 +1,263 @@
+//! Traits and structures to aid consuming and writing HTTP payloads.
+
+use std::task::Poll;
+
+use actix_rt::pin;
+use actix_utils::future::poll_fn;
+use bytes::{Bytes, BytesMut};
+use futures_core::ready;
+
+#[allow(clippy::module_inception)]
+mod body;
+mod body_stream;
+mod message_body;
+mod response_body;
+mod size;
+mod sized_stream;
+
+pub use self::body::{AnyBody, Body, BoxAnyBody};
+pub use self::body_stream::BodyStream;
+pub use self::message_body::MessageBody;
+pub(crate) use self::message_body::MessageBodyMapErr;
+pub use self::response_body::ResponseBody;
+pub use self::size::BodySize;
+pub use self::sized_stream::SizedStream;
+
+/// Collects the body produced by a `MessageBody` implementation into `Bytes`.
+///
+/// Any errors produced by the body stream are returned immediately.
+///
+/// # Examples
+/// ```
+/// use actix_http::body::{Body, to_bytes};
+/// use bytes::Bytes;
+///
+/// # async fn test_to_bytes() {
+/// let body = Body::Empty;
+/// let bytes = to_bytes(body).await.unwrap();
+/// assert!(bytes.is_empty());
+///
+/// let body = Body::Bytes(Bytes::from_static(b"123"));
+/// let bytes = to_bytes(body).await.unwrap();
+/// assert_eq!(bytes, b"123"[..]);
+/// # }
+/// ```
+pub async fn to_bytes<B: MessageBody>(body: B) -> Result<Bytes, B::Error> {
+    let cap = match body.size() {
+        BodySize::None | BodySize::Empty | BodySize::Sized(0) => return Ok(Bytes::new()),
+        BodySize::Sized(size) => size as usize,
+        BodySize::Stream => 32_768,
+    };
+
+    let mut buf = BytesMut::with_capacity(cap);
+
+    pin!(body);
+
+    poll_fn(|cx| loop {
+        let body = body.as_mut();
+
+        match ready!(body.poll_next(cx)) {
+            Some(Ok(bytes)) => buf.extend_from_slice(&*bytes),
+            None => return Poll::Ready(Ok(())),
+            Some(Err(err)) => return Poll::Ready(Err(err)),
+        }
+    })
+    .await?;
+
+    Ok(buf.freeze())
+}
+
+#[cfg(test)]
+mod tests {
+    use std::pin::Pin;
+
+    use actix_rt::pin;
+    use actix_utils::future::poll_fn;
+    use bytes::{Bytes, BytesMut};
+
+    use super::*;
+
+    impl Body {
+        pub(crate) fn get_ref(&self) -> &[u8] {
+            match *self {
+                Body::Bytes(ref bin) => &bin,
+                _ => panic!(),
+            }
+        }
+    }
+
+    #[actix_rt::test]
+    async fn test_static_str() {
+        assert_eq!(Body::from("").size(), BodySize::Sized(0));
+        assert_eq!(Body::from("test").size(), BodySize::Sized(4));
+        assert_eq!(Body::from("test").get_ref(), b"test");
+
+        assert_eq!("test".size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_static_bytes() {
+        assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
+        assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
+        assert_eq!(
+            Body::from_slice(b"test".as_ref()).size(),
+            BodySize::Sized(4)
+        );
+        assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
+        let sb = Bytes::from(&b"test"[..]);
+        pin!(sb);
+
+        assert_eq!(sb.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_vec() {
+        assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
+        assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
+        let test_vec = Vec::from("test");
+        pin!(test_vec);
+
+        assert_eq!(test_vec.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| test_vec.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_bytes() {
+        let b = Bytes::from("test");
+        assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
+        assert_eq!(Body::from(b.clone()).get_ref(), b"test");
+        pin!(b);
+
+        assert_eq!(b.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_bytes_mut() {
+        let b = BytesMut::from("test");
+        assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
+        assert_eq!(Body::from(b.clone()).get_ref(), b"test");
+        pin!(b);
+
+        assert_eq!(b.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_string() {
+        let b = "test".to_owned();
+        assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
+        assert_eq!(Body::from(b.clone()).get_ref(), b"test");
+        assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
+        assert_eq!(Body::from(&b).get_ref(), b"test");
+        pin!(b);
+
+        assert_eq!(b.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_unit() {
+        assert_eq!(().size(), BodySize::Empty);
+        assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
+            .await
+            .is_none());
+    }
+
+    #[actix_rt::test]
+    async fn test_box_and_pin() {
+        let val = Box::new(());
+        pin!(val);
+        assert_eq!(val.size(), BodySize::Empty);
+        assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
+
+        let mut val = Box::pin(());
+        assert_eq!(val.size(), BodySize::Empty);
+        assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
+    }
+
+    #[actix_rt::test]
+    async fn test_body_eq() {
+        assert!(
+            Body::Bytes(Bytes::from_static(b"1"))
+                == Body::Bytes(Bytes::from_static(b"1"))
+        );
+        assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
+    }
+
+    #[actix_rt::test]
+    async fn test_body_debug() {
+        assert!(format!("{:?}", Body::None).contains("Body::None"));
+        assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
+        assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
+    }
+
+    #[actix_rt::test]
+    async fn test_serde_json() {
+        use serde_json::{json, Value};
+        assert_eq!(
+            Body::from(serde_json::to_vec(&Value::String("test".to_owned())).unwrap())
+                .size(),
+            BodySize::Sized(6)
+        );
+        assert_eq!(
+            Body::from(serde_json::to_vec(&json!({"test-key":"test-value"})).unwrap())
+                .size(),
+            BodySize::Sized(25)
+        );
+    }
+
+    // down-casting used to be done with a method on MessageBody trait
+    // test is kept to demonstrate equivalence of Any trait
+    #[actix_rt::test]
+    async fn test_body_casting() {
+        let mut body = String::from("hello cast");
+        // let mut resp_body: &mut dyn MessageBody<Error = Error> = &mut body;
+        let resp_body: &mut dyn std::any::Any = &mut body;
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast");
+        let body = &mut resp_body.downcast_mut::<String>().unwrap();
+        body.push('!');
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast!");
+        let not_body = resp_body.downcast_ref::<()>();
+        assert!(not_body.is_none());
+    }
+
+    #[actix_rt::test]
+    async fn test_to_bytes() {
+        let body = Body::Empty;
+        let bytes = to_bytes(body).await.unwrap();
+        assert!(bytes.is_empty());
+
+        let body = Body::Bytes(Bytes::from_static(b"123"));
+        let bytes = to_bytes(body).await.unwrap();
+        assert_eq!(bytes, b"123"[..]);
+    }
+}

actix-http/src/body/response_body.rs

@@ -0,0 +1,89 @@
+use std::{
+    mem,
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use bytes::Bytes;
+use futures_core::{ready, Stream};
+use pin_project::pin_project;
+
+use crate::error::Error;
+
+use super::{Body, BodySize, MessageBody};
+
+#[pin_project(project = ResponseBodyProj)]
+pub enum ResponseBody<B> {
+    Body(#[pin] B),
+    Other(Body),
+}
+
+impl ResponseBody<Body> {
+    pub fn into_body<B>(self) -> ResponseBody<B> {
+        match self {
+            ResponseBody::Body(b) => ResponseBody::Other(b),
+            ResponseBody::Other(b) => ResponseBody::Other(b),
+        }
+    }
+}
+
+impl<B> ResponseBody<B> {
+    pub fn take_body(&mut self) -> ResponseBody<B> {
+        mem::replace(self, ResponseBody::Other(Body::None))
+    }
+}
+
+impl<B: MessageBody> ResponseBody<B> {
+    pub fn as_ref(&self) -> Option<&B> {
+        if let ResponseBody::Body(ref b) = self {
+            Some(b)
+        } else {
+            None
+        }
+    }
+}
+
+impl<B> MessageBody for ResponseBody<B>
+where
+    B: MessageBody,
+    B::Error: Into<Error>,
+{
+    type Error = Error;
+
+    fn size(&self) -> BodySize {
+        match self {
+            ResponseBody::Body(ref body) => body.size(),
+            ResponseBody::Other(ref body) => body.size(),
+        }
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        Stream::poll_next(self, cx)
+    }
+}
+
+impl<B> Stream for ResponseBody<B>
+where
+    B: MessageBody,
+    B::Error: Into<Error>,
+{
+    type Item = Result<Bytes, Error>;
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        match self.project() {
+            // TODO: MSRV 1.51: poll_map_err
+            ResponseBodyProj::Body(body) => match ready!(body.poll_next(cx)) {
+                Some(Err(err)) => Poll::Ready(Some(Err(err.into()))),
+                Some(Ok(val)) => Poll::Ready(Some(Ok(val))),
+                None => Poll::Ready(None),
+            },
+            ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
+        }
+    }
+}

actix-http/src/body/size.rs

@@ -0,0 +1,40 @@
+/// Body size hint.
+#[derive(Debug, Clone, Copy, PartialEq)]
+pub enum BodySize {
+    /// Absence of body can be assumed from method or status code.
+    ///
+    /// Will skip writing Content-Length header.
+    None,
+
+    /// Zero size body.
+    ///
+    /// Will write `Content-Length: 0` header.
+    Empty,
+
+    /// Known size body.
+    ///
+    /// Will write `Content-Length: N` header. `Sized(0)` is treated the same as `Empty`.
+    Sized(u64),
+
+    /// Unknown size body.
+    ///
+    /// Will not write Content-Length header. Can be used with chunked Transfer-Encoding.
+    Stream,
+}
+
+impl BodySize {
+    /// Returns true if size hint indicates no or empty body.
+    ///
+    /// ```
+    /// # use actix_http::body::BodySize;
+    /// assert!(BodySize::None.is_eof());
+    /// assert!(BodySize::Empty.is_eof());
+    /// assert!(BodySize::Sized(0).is_eof());
+    ///
+    /// assert!(!BodySize::Sized(64).is_eof());
+    /// assert!(!BodySize::Stream.is_eof());
+    /// ```
+    pub fn is_eof(&self) -> bool {
+        matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
+    }
+}

actix-http/src/body/sized_stream.rs

@@ -0,0 +1,122 @@
+use std::{
+    error::Error as StdError,
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use bytes::Bytes;
+use futures_core::{ready, Stream};
+use pin_project_lite::pin_project;
+
+use super::{BodySize, MessageBody};
+
+pin_project! {
+    /// Known sized streaming response wrapper.
+    ///
+    /// This body implementation should be used if total size of stream is known. Data is sent as-is
+    /// without using chunked transfer encoding.
+    pub struct SizedStream<S> {
+        size: u64,
+        #[pin]
+        stream: S,
+    }
+}
+
+impl<S, E> SizedStream<S>
+where
+    S: Stream<Item = Result<Bytes, E>>,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    pub fn new(size: u64, stream: S) -> Self {
+        SizedStream { size, stream }
+    }
+}
+
+impl<S, E> MessageBody for SizedStream<S>
+where
+    S: Stream<Item = Result<Bytes, E>>,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    type Error = E;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.size as u64)
+    }
+
+    /// Attempts to pull out the next value of the underlying [`Stream`].
+    ///
+    /// Empty values are skipped to prevent [`SizedStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        loop {
+            let stream = self.as_mut().project().stream;
+
+            let chunk = match ready!(stream.poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                val => val,
+            };
+
+            return Poll::Ready(chunk);
+        }
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use std::convert::Infallible;
+
+    use actix_rt::pin;
+    use actix_utils::future::poll_fn;
+    use futures_util::stream;
+
+    use super::*;
+    use crate::body::to_bytes;
+
+    #[actix_rt::test]
+    async fn skips_empty_chunks() {
+        let body = SizedStream::new(
+            2,
+            stream::iter(
+                ["1", "", "2"]
+                    .iter()
+                    .map(|&v| Ok::<_, Infallible>(Bytes::from(v))),
+            ),
+        );
+
+        pin!(body);
+
+        assert_eq!(
+            poll_fn(|cx| body.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("1")),
+        );
+
+        assert_eq!(
+            poll_fn(|cx| body.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("2")),
+        );
+    }
+
+    #[actix_rt::test]
+    async fn read_to_bytes() {
+        let body = SizedStream::new(
+            2,
+            stream::iter(
+                ["1", "", "2"]
+                    .iter()
+                    .map(|&v| Ok::<_, Infallible>(Bytes::from(v))),
+            ),
+        );
+
+        assert_eq!(to_bytes(body).await.ok(), Some(Bytes::from("12")));
+    }
+}

actix-http/src/builder.rs

@@ -1,19 +1,16 @@
-use std::marker::PhantomData;
+use std::{error::Error as StdError, fmt, marker::PhantomData, net, rc::Rc};
-use std::rc::Rc;
-use std::{fmt, net};
 
 use actix_codec::Framed;
 use actix_service::{IntoServiceFactory, Service, ServiceFactory};
 
-use crate::body::MessageBody;
+use crate::{
-use crate::config::{KeepAlive, ServiceConfig};
+    body::{AnyBody, MessageBody},
-use crate::error::Error;
+    config::{KeepAlive, ServiceConfig},
-use crate::h1::{Codec, ExpectHandler, H1Service, UpgradeHandler};
+    h1::{self, ExpectHandler, H1Service, UpgradeHandler},
-use crate::h2::H2Service;
+    h2::H2Service,
-use crate::request::Request;
+    service::HttpService,
-use crate::response::Response;
+    ConnectCallback, Extensions, Request, Response,
-use crate::service::HttpService;
+};
-use crate::{ConnectCallback, Extensions};
 
 /// A HTTP service builder
 ///
@@ -34,7 +31,7 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler> {
 impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::InitError: fmt::Debug,
     <S::Service as Service<Request>>::Future: 'static,
 {
@@ -57,17 +54,15 @@ where
 impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::InitError: fmt::Debug,
     <S::Service as Service<Request>>::Future: 'static,
     X: ServiceFactory<Request, Config = (), Response = Request>,
-    X::Error: Into<Error>,
+    X::Error: Into<Response<AnyBody>>,
     X::InitError: fmt::Debug,
-    <X::Service as Service<Request>>::Future: 'static,
+    U: ServiceFactory<(Request, Framed<T, h1::Codec>), Config = (), Response = ()>,
-    U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
-    <U::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
 {
     /// Set server keep-alive setting.
     ///
@@ -125,9 +120,8 @@ where
     where
         F: IntoServiceFactory<X1, Request>,
         X1: ServiceFactory<Request, Config = (), Response = Request>,
-        X1::Error: Into<Error>,
+        X1::Error: Into<Response<AnyBody>>,
         X1::InitError: fmt::Debug,
-        <X1::Service as Service<Request>>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
@@ -148,11 +142,10 @@ where
     /// and this service get called with original request and framed object.
     pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
     where
-        F: IntoServiceFactory<U1, (Request, Framed<T, Codec>)>,
+        F: IntoServiceFactory<U1, (Request, Framed<T, h1::Codec>)>,
-        U1: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
+        U1: ServiceFactory<(Request, Framed<T, h1::Codec>), Config = (), Response = ()>,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
-        <U1::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
@@ -185,7 +178,7 @@ where
     where
         B: MessageBody,
         F: IntoServiceFactory<S, Request>,
-        S::Error: Into<Error>,
+        S::Error: Into<Response<AnyBody>>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
     {
@@ -206,12 +199,13 @@ where
     /// Finish service configuration and create a HTTP service for HTTP/2 protocol.
     pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
     where
-        B: MessageBody + 'static,
         F: IntoServiceFactory<S, Request>,
-        S::Error: Into<Error> + 'static,
+        S::Error: Into<Response<AnyBody>> + 'static,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>> + 'static,
-        <S::Service as Service<Request>>::Future: 'static,
+
+        B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError>>,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,
@@ -228,12 +222,13 @@ where
     /// Finish service configuration and create `HttpService` instance.
     pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
     where
-        B: MessageBody + 'static,
         F: IntoServiceFactory<S, Request>,
-        S::Error: Into<Error> + 'static,
+        S::Error: Into<Response<AnyBody>> + 'static,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>> + 'static,
-        <S::Service as Service<Request>>::Future: 'static,
+
+        B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError>>,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,

actix-http/src/client/config.rs

@@ -1,31 +1,35 @@
+use std::net::IpAddr;
 use std::time::Duration;
 
-// These values are taken from hyper/src/proto/h2/client.rs
+const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2MB
-const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2mb
+const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1MB
-const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1mb
 
 /// Connector configuration
 #[derive(Clone)]
 pub(crate) struct ConnectorConfig {
     pub(crate) timeout: Duration,
+    pub(crate) handshake_timeout: Duration,
     pub(crate) conn_lifetime: Duration,
     pub(crate) conn_keep_alive: Duration,
     pub(crate) disconnect_timeout: Option<Duration>,
     pub(crate) limit: usize,
     pub(crate) conn_window_size: u32,
     pub(crate) stream_window_size: u32,
+    pub(crate) local_address: Option<IpAddr>,
 }
 
 impl Default for ConnectorConfig {
     fn default() -> Self {
         Self {
-            timeout: Duration::from_secs(1),
+            timeout: Duration::from_secs(5),
+            handshake_timeout: Duration::from_secs(5),
             conn_lifetime: Duration::from_secs(75),
             conn_keep_alive: Duration::from_secs(15),
             disconnect_timeout: Some(Duration::from_millis(3000)),
             limit: 100,
             conn_window_size: DEFAULT_H2_CONN_WINDOW,
             stream_window_size: DEFAULT_H2_STREAM_WINDOW,
+            local_address: None,
         }
     }
 }

actix-http/src/client/connection.rs

@@ -1,257 +1,365 @@
-use std::future::Future;
+use std::{
-use std::pin::Pin;
+    io,
-use std::task::{Context, Poll};
+    ops::{Deref, DerefMut},
-use std::{fmt, io, time};
+    pin::Pin,
+    task::{Context, Poll},
+    time,
+};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
+use actix_rt::task::JoinHandle;
 use bytes::Bytes;
-use futures_util::future::{err, Either, FutureExt, LocalBoxFuture, Ready};
+use futures_core::future::LocalBoxFuture;
 use h2::client::SendRequest;
-use pin_project::pin_project;
 
-use crate::body::MessageBody;
 use crate::h1::ClientCodec;
 use crate::message::{RequestHeadType, ResponseHead};
 use crate::payload::Payload;
+use crate::{body::MessageBody, Error};
 
 use super::error::SendRequestError;
-use super::pool::{Acquired, Protocol};
+use super::pool::Acquired;
 use super::{h1proto, h2proto};
 
-pub(crate) enum ConnectionType<Io> {
+/// Trait alias for types impl [tokio::io::AsyncRead] and [tokio::io::AsyncWrite].
-    H1(Io),
+pub trait ConnectionIo: AsyncRead + AsyncWrite + Unpin + 'static {}
-    H2(SendRequest<Bytes>),
-}
 
-pub trait Connection {
+impl<T: AsyncRead + AsyncWrite + Unpin + 'static> ConnectionIo for T {}
-    type Io: AsyncRead + AsyncWrite + Unpin;
-    type Future: Future<Output = Result<(ResponseHead, Payload), SendRequestError>>;
 
-    fn protocol(&self) -> Protocol;
-
-    /// Send request and body
-    fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
-        self,
-        head: H,
-        body: B,
-    ) -> Self::Future;
-
-    type TunnelFuture: Future<
-        Output = Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
-    >;
-
-    /// Send request, returns Response and Framed
-    fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture;
-}
-
-pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
-    /// Close connection
-    fn close(self: Pin<&mut Self>);
-
-    /// Release connection to the connection pool
-    fn release(self: Pin<&mut Self>);
-}
-
-#[doc(hidden)]
 /// HTTP client connection
-pub struct IoConnection<T> {
+pub struct H1Connection<Io: ConnectionIo> {
-    io: Option<ConnectionType<T>>,
+    io: Option<Io>,
     created: time::Instant,
-    pool: Option<Acquired<T>>,
+    acquired: Acquired<Io>,
 }
 
-impl<T> fmt::Debug for IoConnection<T>
+impl<Io: ConnectionIo> H1Connection<Io> {
-where
+    /// close or release the connection to pool based on flag input
-    T: fmt::Debug,
+    pub(super) fn on_release(&mut self, keep_alive: bool) {
-{
+        if keep_alive {
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+            self.release();
-        match self.io {
+        } else {
-            Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
+            self.close();
-            Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
-            None => write!(f, "Connection(Empty)"),
         }
     }
+
+    /// Close connection
+    fn close(&mut self) {
+        let io = self.io.take().unwrap();
+        self.acquired.close(ConnectionInnerType::H1(io));
+    }
+
+    /// Release this connection to the connection pool
+    fn release(&mut self) {
+        let io = self.io.take().unwrap();
+        self.acquired
+            .release(ConnectionInnerType::H1(io), self.created);
+    }
+
+    fn io_pin_mut(self: Pin<&mut Self>) -> Pin<&mut Io> {
+        Pin::new(self.get_mut().io.as_mut().unwrap())
+    }
 }
 
-impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
+impl<Io: ConnectionIo> AsyncRead for H1Connection<Io> {
-    pub(crate) fn new(
+    fn poll_read(
-        io: ConnectionType<T>,
+        self: Pin<&mut Self>,
-        created: time::Instant,
+        cx: &mut Context<'_>,
-        pool: Option<Acquired<T>>,
+        buf: &mut ReadBuf<'_>,
+    ) -> Poll<io::Result<()>> {
+        self.io_pin_mut().poll_read(cx, buf)
+    }
+}
+
+impl<Io: ConnectionIo> AsyncWrite for H1Connection<Io> {
+    fn poll_write(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &[u8],
+    ) -> Poll<io::Result<usize>> {
+        self.io_pin_mut().poll_write(cx, buf)
+    }
+
+    fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
+        self.io_pin_mut().poll_flush(cx)
+    }
+
+    fn poll_shutdown(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Result<(), io::Error>> {
+        self.io_pin_mut().poll_shutdown(cx)
+    }
+
+    fn poll_write_vectored(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        bufs: &[io::IoSlice<'_>],
+    ) -> Poll<io::Result<usize>> {
+        self.io_pin_mut().poll_write_vectored(cx, bufs)
+    }
+
+    fn is_write_vectored(&self) -> bool {
+        self.io.as_ref().unwrap().is_write_vectored()
+    }
+}
+
+/// HTTP2 client connection
+pub struct H2Connection<Io: ConnectionIo> {
+    io: Option<H2ConnectionInner>,
+    created: time::Instant,
+    acquired: Acquired<Io>,
+}
+
+impl<Io: ConnectionIo> Deref for H2Connection<Io> {
+    type Target = SendRequest<Bytes>;
+
+    fn deref(&self) -> &Self::Target {
+        &self.io.as_ref().unwrap().sender
+    }
+}
+
+impl<Io: ConnectionIo> DerefMut for H2Connection<Io> {
+    fn deref_mut(&mut self) -> &mut Self::Target {
+        &mut self.io.as_mut().unwrap().sender
+    }
+}
+
+impl<Io: ConnectionIo> H2Connection<Io> {
+    /// close or release the connection to pool based on flag input
+    pub(super) fn on_release(&mut self, close: bool) {
+        if close {
+            self.close();
+        } else {
+            self.release();
+        }
+    }
+
+    /// Close connection
+    fn close(&mut self) {
+        let io = self.io.take().unwrap();
+        self.acquired.close(ConnectionInnerType::H2(io));
+    }
+
+    /// Release this connection to the connection pool
+    fn release(&mut self) {
+        let io = self.io.take().unwrap();
+        self.acquired
+            .release(ConnectionInnerType::H2(io), self.created);
+    }
+}
+
+/// `H2ConnectionInner` has two parts: `SendRequest` and `Connection`.
+///
+/// `Connection` is spawned as an async task on runtime and `H2ConnectionInner` holds a handle
+/// for this task. Therefore, it can wake up and quit the task when SendRequest is dropped.
+pub(super) struct H2ConnectionInner {
+    handle: JoinHandle<()>,
+    sender: SendRequest<Bytes>,
+}
+
+impl H2ConnectionInner {
+    pub(super) fn new<Io: ConnectionIo>(
+        sender: SendRequest<Bytes>,
+        connection: h2::client::Connection<Io>,
     ) -> Self {
-        IoConnection {
+        let handle = actix_rt::spawn(async move {
-            pool,
+            let _ = connection.await;
-            created,
+        });
-            io: Some(io),
-        }
-    }
 
-    pub(crate) fn into_inner(self) -> (ConnectionType<T>, time::Instant) {
+        Self { handle, sender }
-        (self.io.unwrap(), self.created)
     }
 }
 
-impl<T> Connection for IoConnection<T>
+/// Cancel spawned connection task on drop.
-where
+impl Drop for H2ConnectionInner {
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
+    fn drop(&mut self) {
-{
+        if self
-    type Io = T;
+            .sender
-    type Future =
+            .send_request(http::Request::new(()), true)
-        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
+            .is_err()
-
+        {
-    fn protocol(&self) -> Protocol {
+            self.handle.abort();
-        match self.io {
-            Some(ConnectionType::H1(_)) => Protocol::Http1,
-            Some(ConnectionType::H2(_)) => Protocol::Http2,
-            None => Protocol::Http1,
-        }
-    }
-
-    fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
-        mut self,
-        head: H,
-        body: B,
-    ) -> Self::Future {
-        match self.io.take().unwrap() {
-            ConnectionType::H1(io) => {
-                h1proto::send_request(io, head.into(), body, self.created, self.pool)
-                    .boxed_local()
-            }
-            ConnectionType::H2(io) => {
-                h2proto::send_request(io, head.into(), body, self.created, self.pool)
-                    .boxed_local()
-            }
-        }
-    }
-
-    type TunnelFuture = Either<
-        LocalBoxFuture<
-            'static,
-            Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
-        >,
-        Ready<Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>>,
-    >;
-
-    /// Send request, returns Response and Framed
-    fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
-        match self.io.take().unwrap() {
-            ConnectionType::H1(io) => {
-                Either::Left(h1proto::open_tunnel(io, head.into()).boxed_local())
-            }
-            ConnectionType::H2(io) => {
-                if let Some(mut pool) = self.pool.take() {
-                    pool.release(IoConnection::new(
-                        ConnectionType::H2(io),
-                        self.created,
-                        None,
-                    ));
-                }
-                Either::Right(err(SendRequestError::TunnelNotSupported))
-            }
         }
     }
 }
 
 #[allow(dead_code)]
-pub(crate) enum EitherConnection<A, B> {
+/// Unified connection type cover Http1 Plain/Tls and Http2 protocols
-    A(IoConnection<A>),
+pub enum Connection<A, B = Box<dyn ConnectionIo>>
-    B(IoConnection<B>),
+where
+    A: ConnectionIo,
+    B: ConnectionIo,
+{
+    Tcp(ConnectionType<A>),
+    Tls(ConnectionType<B>),
 }
 
-impl<A, B> Connection for EitherConnection<A, B>
+/// Unified connection type cover Http1/2 protocols
-where
+pub enum ConnectionType<Io: ConnectionIo> {
-    A: AsyncRead + AsyncWrite + Unpin + 'static,
+    H1(H1Connection<Io>),
-    B: AsyncRead + AsyncWrite + Unpin + 'static,
+    H2(H2Connection<Io>),
-{
+}
-    type Io = EitherIo<A, B>;
-    type Future =
-        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
 
-    fn protocol(&self) -> Protocol {
+/// Helper type for storing connection types in pool.
-        match self {
+pub(super) enum ConnectionInnerType<Io> {
-            EitherConnection::A(con) => con.protocol(),
+    H1(Io),
-            EitherConnection::B(con) => con.protocol(),
+    H2(H2ConnectionInner),
+}
+
+impl<Io: ConnectionIo> ConnectionType<Io> {
+    pub(super) fn from_pool(
+        inner: ConnectionInnerType<Io>,
+        created: time::Instant,
+        acquired: Acquired<Io>,
+    ) -> Self {
+        match inner {
+            ConnectionInnerType::H1(io) => Self::from_h1(io, created, acquired),
+            ConnectionInnerType::H2(io) => Self::from_h2(io, created, acquired),
         }
     }
 
-    fn send_request<RB: MessageBody + 'static, H: Into<RequestHeadType>>(
+    pub(super) fn from_h1(
+        io: Io,
+        created: time::Instant,
+        acquired: Acquired<Io>,
+    ) -> Self {
+        Self::H1(H1Connection {
+            io: Some(io),
+            created,
+            acquired,
+        })
+    }
+
+    pub(super) fn from_h2(
+        io: H2ConnectionInner,
+        created: time::Instant,
+        acquired: Acquired<Io>,
+    ) -> Self {
+        Self::H2(H2Connection {
+            io: Some(io),
+            created,
+            acquired,
+        })
+    }
+}
+
+impl<A, B> Connection<A, B>
+where
+    A: ConnectionIo,
+    B: ConnectionIo,
+{
+    /// Send a request through connection.
+    pub fn send_request<RB, H>(
         self,
         head: H,
         body: RB,
-    ) -> Self::Future {
+    ) -> LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>
-        match self {
+    where
-            EitherConnection::A(con) => con.send_request(head, body),
+        H: Into<RequestHeadType> + 'static,
-            EitherConnection::B(con) => con.send_request(head, body),
+        RB: MessageBody + 'static,
-        }
+        RB::Error: Into<Error>,
+    {
+        Box::pin(async move {
+            match self {
+                Connection::Tcp(ConnectionType::H1(conn)) => {
+                    h1proto::send_request(conn, head.into(), body).await
+                }
+                Connection::Tls(ConnectionType::H1(conn)) => {
+                    h1proto::send_request(conn, head.into(), body).await
+                }
+                Connection::Tls(ConnectionType::H2(conn)) => {
+                    h2proto::send_request(conn, head.into(), body).await
+                }
+                _ => unreachable!(
+                    "Plain Tcp connection can be used only in Http1 protocol"
+                ),
+            }
+        })
     }
 
-    type TunnelFuture = LocalBoxFuture<
+    /// Send request, returns Response and Framed tunnel.
+    pub fn open_tunnel<H: Into<RequestHeadType> + 'static>(
+        self,
+        head: H,
+    ) -> LocalBoxFuture<
         'static,
-        Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
+        Result<(ResponseHead, Framed<Connection<A, B>, ClientCodec>), SendRequestError>,
-    >;
+    > {
-
+        Box::pin(async move {
-    /// Send request, returns Response and Framed
+            match self {
-    fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
+                Connection::Tcp(ConnectionType::H1(ref _conn)) => {
-        match self {
+                    let (head, framed) = h1proto::open_tunnel(self, head.into()).await?;
-            EitherConnection::A(con) => con
+                    Ok((head, framed))
-                .open_tunnel(head)
+                }
-                .map(|res| {
+                Connection::Tls(ConnectionType::H1(ref _conn)) => {
-                    res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::A)))
+                    let (head, framed) = h1proto::open_tunnel(self, head.into()).await?;
-                })
+                    Ok((head, framed))
-                .boxed_local(),
+                }
-            EitherConnection::B(con) => con
+                Connection::Tls(ConnectionType::H2(mut conn)) => {
-                .open_tunnel(head)
+                    conn.release();
-                .map(|res| {
+                    Err(SendRequestError::TunnelNotSupported)
-                    res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::B)))
+                }
-                })
+                Connection::Tcp(ConnectionType::H2(_)) => {
-                .boxed_local(),
+                    unreachable!(
-        }
+                        "Plain Tcp connection can be used only in Http1 protocol"
+                    )
+                }
+            }
+        })
     }
 }
 
-#[pin_project(project = EitherIoProj)]
+impl<A, B> AsyncRead for Connection<A, B>
-pub enum EitherIo<A, B> {
-    A(#[pin] A),
-    B(#[pin] B),
-}
-
-impl<A, B> AsyncRead for EitherIo<A, B>
 where
-    A: AsyncRead,
+    A: ConnectionIo,
-    B: AsyncRead,
+    B: ConnectionIo,
 {
     fn poll_read(
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
         buf: &mut ReadBuf<'_>,
     ) -> Poll<io::Result<()>> {
-        match self.project() {
+        match self.get_mut() {
-            EitherIoProj::A(val) => val.poll_read(cx, buf),
+            Connection::Tcp(ConnectionType::H1(conn)) => {
-            EitherIoProj::B(val) => val.poll_read(cx, buf),
+                Pin::new(conn).poll_read(cx, buf)
+            }
+            Connection::Tls(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_read(cx, buf)
+            }
+            _ => unreachable!("H2Connection can not impl AsyncRead trait"),
         }
     }
 }
 
-impl<A, B> AsyncWrite for EitherIo<A, B>
+const H2_UNREACHABLE_WRITE: &str = "H2Connection can not impl AsyncWrite trait";
+
+impl<A, B> AsyncWrite for Connection<A, B>
 where
-    A: AsyncWrite,
+    A: ConnectionIo,
-    B: AsyncWrite,
+    B: ConnectionIo,
 {
     fn poll_write(
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
         buf: &[u8],
     ) -> Poll<io::Result<usize>> {
-        match self.project() {
+        match self.get_mut() {
-            EitherIoProj::A(val) => val.poll_write(cx, buf),
+            Connection::Tcp(ConnectionType::H1(conn)) => {
-            EitherIoProj::B(val) => val.poll_write(cx, buf),
+                Pin::new(conn).poll_write(cx, buf)
+            }
+            Connection::Tls(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_write(cx, buf)
+            }
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
         }
     }
 
     fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
-        match self.project() {
+        match self.get_mut() {
-            EitherIoProj::A(val) => val.poll_flush(cx),
+            Connection::Tcp(ConnectionType::H1(conn)) => Pin::new(conn).poll_flush(cx),
-            EitherIoProj::B(val) => val.poll_flush(cx),
+            Connection::Tls(ConnectionType::H1(conn)) => Pin::new(conn).poll_flush(cx),
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
         }
     }
 
@@ -259,9 +367,109 @@ where
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
     ) -> Poll<io::Result<()>> {
-        match self.project() {
+        match self.get_mut() {
-            EitherIoProj::A(val) => val.poll_shutdown(cx),
+            Connection::Tcp(ConnectionType::H1(conn)) => {
-            EitherIoProj::B(val) => val.poll_shutdown(cx),
+                Pin::new(conn).poll_shutdown(cx)
+            }
+            Connection::Tls(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_shutdown(cx)
+            }
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
+        }
+    }
+
+    fn poll_write_vectored(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        bufs: &[io::IoSlice<'_>],
+    ) -> Poll<io::Result<usize>> {
+        match self.get_mut() {
+            Connection::Tcp(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_write_vectored(cx, bufs)
+            }
+            Connection::Tls(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_write_vectored(cx, bufs)
+            }
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
+        }
+    }
+
+    fn is_write_vectored(&self) -> bool {
+        match *self {
+            Connection::Tcp(ConnectionType::H1(ref conn)) => conn.is_write_vectored(),
+            Connection::Tls(ConnectionType::H1(ref conn)) => conn.is_write_vectored(),
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
         }
     }
 }
+
+#[cfg(test)]
+mod test {
+    use std::{
+        future::Future,
+        net,
+        pin::Pin,
+        task::{Context, Poll},
+        time::{Duration, Instant},
+    };
+
+    use actix_rt::{
+        net::TcpStream,
+        time::{interval, Interval},
+    };
+
+    use super::*;
+
+    #[actix_rt::test]
+    async fn test_h2_connection_drop() {
+        let addr = "127.0.0.1:0".parse::<net::SocketAddr>().unwrap();
+        let listener = net::TcpListener::bind(addr).unwrap();
+        let local = listener.local_addr().unwrap();
+
+        std::thread::spawn(move || while listener.accept().is_ok() {});
+
+        let tcp = TcpStream::connect(local).await.unwrap();
+        let (sender, connection) = h2::client::handshake(tcp).await.unwrap();
+        let conn = H2ConnectionInner::new(sender.clone(), connection);
+
+        assert!(sender.clone().ready().await.is_ok());
+        assert!(h2::client::SendRequest::clone(&conn.sender)
+            .ready()
+            .await
+            .is_ok());
+
+        drop(conn);
+
+        struct DropCheck {
+            sender: h2::client::SendRequest<Bytes>,
+            interval: Interval,
+            start_from: Instant,
+        }
+
+        impl Future for DropCheck {
+            type Output = ();
+
+            fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+                let this = self.get_mut();
+                match futures_core::ready!(this.sender.poll_ready(cx)) {
+                    Ok(()) => {
+                        if this.start_from.elapsed() > Duration::from_secs(10) {
+                            panic!("connection should be gone and can not be ready");
+                        } else {
+                            let _ = this.interval.poll_tick(cx);
+                            Poll::Pending
+                        }
+                    }
+                    Err(_) => Poll::Ready(()),
+                }
+            }
+        }
+
+        DropCheck {
+            sender,
+            interval: interval(Duration::from_millis(100)),
+            start_from: Instant::now(),
+        }
+        .await;
+    }
+}

actix-http/src/client/connector.rs

@@ -1,45 +1,53 @@
-use std::fmt;
+use std::{
-use std::marker::PhantomData;
+    fmt,
-use std::time::Duration;
+    future::Future,
-
+    net::IpAddr,
-use actix_codec::{AsyncRead, AsyncWrite};
+    pin::Pin,
-use actix_rt::net::TcpStream;
+    rc::Rc,
-use actix_service::{apply_fn, Service, ServiceExt};
+    task::{Context, Poll},
-use actix_tls::connect::{
+    time::Duration,
-    default_connector, Connect as TcpConnect, Connection as TcpConnection,
 };
-use actix_utils::timeout::{TimeoutError, TimeoutService};
+
+use actix_rt::{
+    net::{ActixStream, TcpStream},
+    time::{sleep, Sleep},
+};
+use actix_service::Service;
+use actix_tls::connect::{
+    new_connector, Connect as TcpConnect, ConnectError as TcpConnectError,
+    Connection as TcpConnection, Resolver,
+};
+use futures_core::{future::LocalBoxFuture, ready};
 use http::Uri;
+use pin_project::pin_project;
 
 use super::config::ConnectorConfig;
-use super::connection::Connection;
+use super::connection::{Connection, ConnectionIo};
 use super::error::ConnectError;
-use super::pool::{ConnectionPool, Protocol};
+use super::pool::ConnectionPool;
 use super::Connect;
+use super::Protocol;
 
 #[cfg(feature = "openssl")]
 use actix_tls::connect::ssl::openssl::SslConnector as OpensslConnector;
-
 #[cfg(feature = "rustls")]
 use actix_tls::connect::ssl::rustls::ClientConfig;
-#[cfg(feature = "rustls")]
-use std::sync::Arc;
 
-#[cfg(any(feature = "openssl", feature = "rustls"))]
 enum SslConnector {
+    #[allow(dead_code)]
+    None,
     #[cfg(feature = "openssl")]
     Openssl(OpensslConnector),
     #[cfg(feature = "rustls")]
-    Rustls(Arc<ClientConfig>),
+    Rustls(std::sync::Arc<ClientConfig>),
 }
-#[cfg(not(any(feature = "openssl", feature = "rustls")))]
-type SslConnector = ();
 
-/// Manages http client network connectivity
+/// Manages HTTP client network connectivity.
+///
 /// The `Connector` type uses a builder-like combinator pattern for service
 /// construction that finishes by calling the `.finish()` method.
 ///
-/// ```rust,ignore
+/// ```ignore
 /// use std::time::Duration;
 /// use actix_http::client::Connector;
 ///
@@ -47,18 +55,14 @@ type SslConnector = ();
 ///      .timeout(Duration::from_secs(5))
 ///      .finish();
 /// ```
-pub struct Connector<T, U> {
+pub struct Connector<T> {
     connector: T,
     config: ConnectorConfig,
     #[allow(dead_code)]
     ssl: SslConnector,
-    _phantom: PhantomData<U>,
 }
 
-trait Io: AsyncRead + AsyncWrite + Unpin {}
+impl Connector<()> {
-impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
-
-impl Connector<(), ()> {
     #[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
     pub fn new() -> Connector<
         impl Service<
@@ -66,13 +70,11 @@ impl Connector<(), ()> {
                 Response = TcpConnection<Uri, TcpStream>,
                 Error = actix_tls::connect::ConnectError,
             > + Clone,
-        TcpStream,
     > {
         Connector {
             ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
-            connector: default_connector(),
+            connector: new_connector(resolver::resolver()),
             config: ConnectorConfig::default(),
-            _phantom: PhantomData,
         }
     }
 
@@ -100,54 +102,69 @@ impl Connector<(), ()> {
     fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
         let mut config = ClientConfig::new();
         config.set_protocols(&protocols);
-        config
+        config.root_store.add_server_trust_anchors(
-            .root_store
+            &actix_tls::connect::ssl::rustls::TLS_SERVER_ROOTS,
-            .add_server_trust_anchors(&actix_tls::accept::rustls::TLS_SERVER_ROOTS);
+        );
-        SslConnector::Rustls(Arc::new(config))
+        SslConnector::Rustls(std::sync::Arc::new(config))
     }
 
     // ssl turned off, provides empty ssl connector
     #[cfg(not(any(feature = "openssl", feature = "rustls")))]
-    fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
+    fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {
+        SslConnector::None
+    }
 }
 
-impl<T, U> Connector<T, U> {
+impl<S> Connector<S> {
     /// Use custom connector.
-    pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
+    pub fn connector<S1, Io1>(self, connector: S1) -> Connector<S1>
     where
-        U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
+        Io1: ActixStream + fmt::Debug + 'static,
-        T1: Service<
+        S1: Service<
                 TcpConnect<Uri>,
-                Response = TcpConnection<Uri, U1>,
+                Response = TcpConnection<Uri, Io1>,
-                Error = actix_tls::connect::ConnectError,
+                Error = TcpConnectError,
             > + Clone,
     {
         Connector {
             connector,
             config: self.config,
             ssl: self.ssl,
-            _phantom: PhantomData,
         }
     }
 }
 
-impl<T, U> Connector<T, U>
+impl<S, Io> Connector<S>
 where
-    U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
+    // Note:
-    T: Service<
+    // Input Io type is bound to ActixStream trait but internally in client module they
+    // are bound to ConnectionIo trait alias. And latter is the trait exposed to public
+    // in the form of Box<dyn ConnectionIo> type.
+    //
+    // This remap is to hide ActixStream's trait methods. They are not meant to be called
+    // from user code.
+    Io: ActixStream + fmt::Debug + 'static,
+    S: Service<
             TcpConnect<Uri>,
-            Response = TcpConnection<Uri, U>,
+            Response = TcpConnection<Uri, Io>,
-            Error = actix_tls::connect::ConnectError,
+            Error = TcpConnectError,
         > + Clone
         + 'static,
 {
-    /// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
+    /// Tcp connection timeout, i.e. max time to connect to remote host including dns name
-    /// Set to 1 second by default.
+    /// resolution. Set to 5 second by default.
     pub fn timeout(mut self, timeout: Duration) -> Self {
         self.config.timeout = timeout;
         self
     }
 
+    /// Tls handshake timeout, i.e. max time to do tls handshake with remote host after tcp
+    /// connection established. Set to 5 second by default.
+    pub fn handshake_timeout(mut self, timeout: Duration) -> Self {
+        self.config.handshake_timeout = timeout;
+        self
+    }
+
     #[cfg(feature = "openssl")]
     /// Use custom `SslConnector` instance.
     pub fn ssl(mut self, connector: OpensslConnector) -> Self {
@@ -156,13 +173,15 @@ where
     }
 
     #[cfg(feature = "rustls")]
-    pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
+    /// Use custom `SslConnector` instance.
+    pub fn rustls(mut self, connector: std::sync::Arc<ClientConfig>) -> Self {
         self.ssl = SslConnector::Rustls(connector);
         self
     }
 
-    /// Maximum supported http major version
+    /// Maximum supported HTTP major version.
-    /// Supported versions http/1.1, http/2
+    ///
+    /// Supported versions are HTTP/1.1 and HTTP/2.
     pub fn max_http_version(mut self, val: http::Version) -> Self {
         let versions = match val {
             http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
@@ -236,299 +255,512 @@ where
         self
     }
 
+    /// Set local IP Address the connector would use for establishing connection.
+    pub fn local_address(mut self, addr: IpAddr) -> Self {
+        self.config.local_address = Some(addr);
+        self
+    }
+
     /// Finish configuration process and create connector service.
     /// The Connector builder always concludes by calling `finish()` last in
     /// its combinator chain.
-    pub fn finish(
+    pub fn finish(self) -> ConnectorService<S, Io> {
-        self,
+        let local_address = self.config.local_address;
-    ) -> impl Service<Connect, Response = impl Connection, Error = ConnectError> + Clone
+        let timeout = self.config.timeout;
-    {
-        #[cfg(not(any(feature = "openssl", feature = "rustls")))]
-        {
-            let connector = TimeoutService::new(
-                self.config.timeout,
-                apply_fn(self.connector, |msg: Connect, srv| {
-                    srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
-                })
-                .map_err(ConnectError::from)
-                .map(|stream| (stream.into_parts().0, Protocol::Http1)),
-            )
-            .map_err(|e| match e {
-                TimeoutError::Service(e) => e,
-                TimeoutError::Timeout => ConnectError::Timeout,
-            });
 
-            connect_impl::InnerConnector {
+        let tcp_service_inner =
-                tcp_pool: ConnectionPool::new(
+            TcpConnectorInnerService::new(self.connector, timeout, local_address);
-                    connector,
+
-                    self.config.no_disconnect_timeout(),
+        #[allow(clippy::redundant_clone)]
-                ),
+        let tcp_service = TcpConnectorService {
-            }
+            service: tcp_service_inner.clone(),
-        }
+        };
-        #[cfg(any(feature = "openssl", feature = "rustls"))]
+
-        {
+        let tls_service = match self.ssl {
-            const H2: &[u8] = b"h2";
+            SslConnector::None => None,
-            use actix_service::{boxed::service, pipeline};
             #[cfg(feature = "openssl")]
-            use actix_tls::connect::ssl::openssl::OpensslConnector;
+            SslConnector::Openssl(tls) => {
-            #[cfg(feature = "rustls")]
+                const H2: &[u8] = b"h2";
-            use actix_tls::connect::ssl::rustls::{RustlsConnector, Session};
 
-            let ssl_service = TimeoutService::new(
+                use actix_tls::connect::ssl::openssl::{OpensslConnector, SslStream};
-                self.config.timeout,
-                pipeline(
-                    apply_fn(self.connector.clone(), |msg: Connect, srv| {
-                        srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
-                    })
-                    .map_err(ConnectError::from),
-                )
-                .and_then(match self.ssl {
-                    #[cfg(feature = "openssl")]
-                    SslConnector::Openssl(ssl) => service(
-                        OpensslConnector::service(ssl)
-                            .map(|stream| {
-                                let sock = stream.into_parts().0;
-                                let h2 = sock
-                                    .ssl()
-                                    .selected_alpn_protocol()
-                                    .map(|protos| protos.windows(2).any(|w| w == H2))
-                                    .unwrap_or(false);
-                                if h2 {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
-                                } else {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
-                                }
-                            })
-                            .map_err(ConnectError::from),
-                    ),
-                    #[cfg(feature = "rustls")]
-                    SslConnector::Rustls(ssl) => service(
-                        RustlsConnector::service(ssl)
-                            .map_err(ConnectError::from)
-                            .map(|stream| {
-                                let sock = stream.into_parts().0;
-                                let h2 = sock
-                                    .get_ref()
-                                    .1
-                                    .get_alpn_protocol()
-                                    .map(|protos| protos.windows(2).any(|w| w == H2))
-                                    .unwrap_or(false);
-                                if h2 {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
-                                } else {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
-                                }
-                            }),
-                    ),
-                }),
-            )
-            .map_err(|e| match e {
-                TimeoutError::Service(e) => e,
-                TimeoutError::Timeout => ConnectError::Timeout,
-            });
 
-            let tcp_service = TimeoutService::new(
+                impl<Io: ConnectionIo> IntoConnectionIo for TcpConnection<Uri, SslStream<Io>> {
-                self.config.timeout,
+                    fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol) {
-                apply_fn(self.connector, |msg: Connect, srv| {
+                        let sock = self.into_parts().0;
-                    srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
+                        let h2 = sock
-                })
+                            .ssl()
-                .map_err(ConnectError::from)
+                            .selected_alpn_protocol()
-                .map(|stream| (stream.into_parts().0, Protocol::Http1)),
+                            .map(|protos| protos.windows(2).any(|w| w == H2))
-            )
+                            .unwrap_or(false);
-            .map_err(|e| match e {
+                        if h2 {
-                TimeoutError::Service(e) => e,
+                            (Box::new(sock), Protocol::Http2)
-                TimeoutError::Timeout => ConnectError::Timeout,
+                        } else {
-            });
+                            (Box::new(sock), Protocol::Http1)
-
+                        }
-            connect_impl::InnerConnector {
+                    }
-                tcp_pool: ConnectionPool::new(
-                    tcp_service,
-                    self.config.no_disconnect_timeout(),
-                ),
-                ssl_pool: ConnectionPool::new(ssl_service, self.config),
-            }
-        }
-    }
-}
-
-#[cfg(not(any(feature = "openssl", feature = "rustls")))]
-mod connect_impl {
-    use std::task::{Context, Poll};
-
-    use futures_util::future::{err, Either, Ready};
-
-    use super::*;
-    use crate::client::connection::IoConnection;
-
-    pub(crate) struct InnerConnector<T, Io>
-    where
-        Io: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
-    {
-        pub(crate) tcp_pool: ConnectionPool<T, Io>,
-    }
-
-    impl<T, Io> Clone for InnerConnector<T, Io>
-    where
-        Io: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
-    {
-        fn clone(&self) -> Self {
-            InnerConnector {
-                tcp_pool: self.tcp_pool.clone(),
-            }
-        }
-    }
-
-    impl<T, Io> Service<Connect> for InnerConnector<T, Io>
-    where
-        Io: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
-    {
-        type Response = IoConnection<Io>;
-        type Error = ConnectError;
-        type Future = Either<
-            <ConnectionPool<T, Io> as Service<Connect>>::Future,
-            Ready<Result<IoConnection<Io>, ConnectError>>,
-        >;
-
-        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-            self.tcp_pool.poll_ready(cx)
-        }
-
-        fn call(&mut self, req: Connect) -> Self::Future {
-            match req.uri.scheme_str() {
-                Some("https") | Some("wss") => {
-                    Either::Right(err(ConnectError::SslIsNotSupported))
                 }
-                _ => Either::Left(self.tcp_pool.call(req)),
+
+                let handshake_timeout = self.config.handshake_timeout;
+
+                let tls_service = TlsConnectorService {
+                    tcp_service: tcp_service_inner,
+                    tls_service: OpensslConnector::service(tls),
+                    timeout: handshake_timeout,
+                };
+
+                Some(actix_service::boxed::rc_service(tls_service))
+            }
+            #[cfg(feature = "rustls")]
+            SslConnector::Rustls(tls) => {
+                const H2: &[u8] = b"h2";
+
+                use actix_tls::connect::ssl::rustls::{
+                    RustlsConnector, Session, TlsStream,
+                };
+
+                impl<Io: ConnectionIo> IntoConnectionIo for TcpConnection<Uri, TlsStream<Io>> {
+                    fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol) {
+                        let sock = self.into_parts().0;
+                        let h2 = sock
+                            .get_ref()
+                            .1
+                            .get_alpn_protocol()
+                            .map(|protos| protos.windows(2).any(|w| w == H2))
+                            .unwrap_or(false);
+                        if h2 {
+                            (Box::new(sock), Protocol::Http2)
+                        } else {
+                            (Box::new(sock), Protocol::Http1)
+                        }
+                    }
+                }
+
+                let handshake_timeout = self.config.handshake_timeout;
+
+                let tls_service = TlsConnectorService {
+                    tcp_service: tcp_service_inner,
+                    tls_service: RustlsConnector::service(tls),
+                    timeout: handshake_timeout,
+                };
+
+                Some(actix_service::boxed::rc_service(tls_service))
+            }
+        };
+
+        let tcp_config = self.config.no_disconnect_timeout();
+
+        let tcp_pool = ConnectionPool::new(tcp_service, tcp_config);
+
+        let tls_config = self.config;
+        let tls_pool = tls_service
+            .map(move |tls_service| ConnectionPool::new(tls_service, tls_config));
+
+        ConnectorServicePriv { tcp_pool, tls_pool }
+    }
+}
+
+/// tcp service for map `TcpConnection<Uri, Io>` type to `(Io, Protocol)`
+#[derive(Clone)]
+pub struct TcpConnectorService<S: Clone> {
+    service: S,
+}
+
+impl<S, Io> Service<Connect> for TcpConnectorService<S>
+where
+    S: Service<Connect, Response = TcpConnection<Uri, Io>, Error = ConnectError>
+        + Clone
+        + 'static,
+{
+    type Response = (Io, Protocol);
+    type Error = ConnectError;
+    type Future = TcpConnectorFuture<S::Future>;
+
+    actix_service::forward_ready!(service);
+
+    fn call(&self, req: Connect) -> Self::Future {
+        TcpConnectorFuture {
+            fut: self.service.call(req),
+        }
+    }
+}
+
+#[pin_project]
+pub struct TcpConnectorFuture<Fut> {
+    #[pin]
+    fut: Fut,
+}
+
+impl<Fut, Io> Future for TcpConnectorFuture<Fut>
+where
+    Fut: Future<Output = Result<TcpConnection<Uri, Io>, ConnectError>>,
+{
+    type Output = Result<(Io, Protocol), ConnectError>;
+
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        self.project()
+            .fut
+            .poll(cx)
+            .map_ok(|res| (res.into_parts().0, Protocol::Http1))
+    }
+}
+
+/// service for establish tcp connection and do client tls handshake.
+/// operation is canceled when timeout limit reached.
+struct TlsConnectorService<S, St> {
+    /// tcp connection is canceled on `TcpConnectorInnerService`'s timeout setting.
+    tcp_service: S,
+    /// tls connection is canceled on `TlsConnectorService`'s timeout setting.
+    tls_service: St,
+    timeout: Duration,
+}
+
+impl<S, St, Io> Service<Connect> for TlsConnectorService<S, St>
+where
+    S: Service<Connect, Response = TcpConnection<Uri, Io>, Error = ConnectError>
+        + Clone
+        + 'static,
+    St: Service<TcpConnection<Uri, Io>, Error = std::io::Error> + Clone + 'static,
+    Io: ConnectionIo,
+    St::Response: IntoConnectionIo,
+{
+    type Response = (Box<dyn ConnectionIo>, Protocol);
+    type Error = ConnectError;
+    type Future = TlsConnectorFuture<St, S::Future, St::Future>;
+
+    fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        ready!(self.tcp_service.poll_ready(cx))?;
+        ready!(self.tls_service.poll_ready(cx))?;
+        Poll::Ready(Ok(()))
+    }
+
+    fn call(&self, req: Connect) -> Self::Future {
+        let fut = self.tcp_service.call(req);
+        let tls_service = self.tls_service.clone();
+        let timeout = self.timeout;
+
+        TlsConnectorFuture::TcpConnect {
+            fut,
+            tls_service: Some(tls_service),
+            timeout,
+        }
+    }
+}
+
+#[pin_project(project = TlsConnectorProj)]
+#[allow(clippy::large_enum_variant)]
+enum TlsConnectorFuture<S, Fut1, Fut2> {
+    TcpConnect {
+        #[pin]
+        fut: Fut1,
+        tls_service: Option<S>,
+        timeout: Duration,
+    },
+    TlsConnect {
+        #[pin]
+        fut: Fut2,
+        #[pin]
+        timeout: Sleep,
+    },
+}
+
+/// helper trait for generic over different TlsStream types between tls crates.
+trait IntoConnectionIo {
+    fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol);
+}
+
+impl<S, Io, Fut1, Fut2, Res> Future for TlsConnectorFuture<S, Fut1, Fut2>
+where
+    S: Service<
+        TcpConnection<Uri, Io>,
+        Response = Res,
+        Error = std::io::Error,
+        Future = Fut2,
+    >,
+    S::Response: IntoConnectionIo,
+    Fut1: Future<Output = Result<TcpConnection<Uri, Io>, ConnectError>>,
+    Fut2: Future<Output = Result<S::Response, S::Error>>,
+    Io: ConnectionIo,
+{
+    type Output = Result<(Box<dyn ConnectionIo>, Protocol), ConnectError>;
+
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        match self.as_mut().project() {
+            TlsConnectorProj::TcpConnect {
+                fut,
+                tls_service,
+                timeout,
+            } => {
+                let res = ready!(fut.poll(cx))?;
+                let fut = tls_service
+                    .take()
+                    .expect("TlsConnectorFuture polled after complete")
+                    .call(res);
+                let timeout = sleep(*timeout);
+                self.set(TlsConnectorFuture::TlsConnect { fut, timeout });
+                self.poll(cx)
+            }
+            TlsConnectorProj::TlsConnect { fut, timeout } => match fut.poll(cx)? {
+                Poll::Ready(res) => Poll::Ready(Ok(res.into_connection_io())),
+                Poll::Pending => timeout.poll(cx).map(|_| Err(ConnectError::Timeout)),
+            },
+        }
+    }
+}
+
+/// service for establish tcp connection.
+/// operation is canceled when timeout limit reached.
+#[derive(Clone)]
+pub struct TcpConnectorInnerService<S: Clone> {
+    service: S,
+    timeout: Duration,
+    local_address: Option<std::net::IpAddr>,
+}
+
+impl<S: Clone> TcpConnectorInnerService<S> {
+    fn new(
+        service: S,
+        timeout: Duration,
+        local_address: Option<std::net::IpAddr>,
+    ) -> Self {
+        Self {
+            service,
+            timeout,
+            local_address,
+        }
+    }
+}
+
+impl<S, Io> Service<Connect> for TcpConnectorInnerService<S>
+where
+    S: Service<
+            TcpConnect<Uri>,
+            Response = TcpConnection<Uri, Io>,
+            Error = TcpConnectError,
+        > + Clone
+        + 'static,
+{
+    type Response = S::Response;
+    type Error = ConnectError;
+    type Future = TcpConnectorInnerFuture<S::Future>;
+
+    actix_service::forward_ready!(service);
+
+    fn call(&self, req: Connect) -> Self::Future {
+        let mut req = TcpConnect::new(req.uri).set_addr(req.addr);
+
+        if let Some(local_addr) = self.local_address {
+            req = req.set_local_addr(local_addr);
+        }
+
+        TcpConnectorInnerFuture {
+            fut: self.service.call(req),
+            timeout: sleep(self.timeout),
+        }
+    }
+}
+
+#[pin_project]
+pub struct TcpConnectorInnerFuture<Fut> {
+    #[pin]
+    fut: Fut,
+    #[pin]
+    timeout: Sleep,
+}
+
+impl<Fut, Io> Future for TcpConnectorInnerFuture<Fut>
+where
+    Fut: Future<Output = Result<TcpConnection<Uri, Io>, TcpConnectError>>,
+{
+    type Output = Result<TcpConnection<Uri, Io>, ConnectError>;
+
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let this = self.project();
+        match this.fut.poll(cx) {
+            Poll::Ready(res) => Poll::Ready(res.map_err(ConnectError::from)),
+            Poll::Pending => this.timeout.poll(cx).map(|_| Err(ConnectError::Timeout)),
+        }
+    }
+}
+
+/// Connector service for pooled Plain/Tls Tcp connections.
+pub type ConnectorService<S, Io> = ConnectorServicePriv<
+    TcpConnectorService<TcpConnectorInnerService<S>>,
+    Rc<
+        dyn Service<
+            Connect,
+            Response = (Box<dyn ConnectionIo>, Protocol),
+            Error = ConnectError,
+            Future = LocalBoxFuture<
+                'static,
+                Result<(Box<dyn ConnectionIo>, Protocol), ConnectError>,
+            >,
+        >,
+    >,
+    Io,
+    Box<dyn ConnectionIo>,
+>;
+
+pub struct ConnectorServicePriv<S1, S2, Io1, Io2>
+where
+    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>,
+    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>,
+    Io1: ConnectionIo,
+    Io2: ConnectionIo,
+{
+    tcp_pool: ConnectionPool<S1, Io1>,
+    tls_pool: Option<ConnectionPool<S2, Io2>>,
+}
+
+impl<S1, S2, Io1, Io2> Service<Connect> for ConnectorServicePriv<S1, S2, Io1, Io2>
+where
+    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
+        + Clone
+        + 'static,
+    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
+        + Clone
+        + 'static,
+    Io1: ConnectionIo,
+    Io2: ConnectionIo,
+{
+    type Response = Connection<Io1, Io2>;
+    type Error = ConnectError;
+    type Future = ConnectorServiceFuture<S1, S2, Io1, Io2>;
+
+    fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        ready!(self.tcp_pool.poll_ready(cx))?;
+        if let Some(ref tls_pool) = self.tls_pool {
+            ready!(tls_pool.poll_ready(cx))?;
+        }
+        Poll::Ready(Ok(()))
+    }
+
+    fn call(&self, req: Connect) -> Self::Future {
+        match req.uri.scheme_str() {
+            Some("https") | Some("wss") => match self.tls_pool {
+                None => ConnectorServiceFuture::SslIsNotSupported,
+                Some(ref pool) => ConnectorServiceFuture::Tls(pool.call(req)),
+            },
+            _ => ConnectorServiceFuture::Tcp(self.tcp_pool.call(req)),
+        }
+    }
+}
+
+#[pin_project(project = ConnectorServiceProj)]
+pub enum ConnectorServiceFuture<S1, S2, Io1, Io2>
+where
+    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
+        + Clone
+        + 'static,
+    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
+        + Clone
+        + 'static,
+    Io1: ConnectionIo,
+    Io2: ConnectionIo,
+{
+    Tcp(#[pin] <ConnectionPool<S1, Io1> as Service<Connect>>::Future),
+    Tls(#[pin] <ConnectionPool<S2, Io2> as Service<Connect>>::Future),
+    SslIsNotSupported,
+}
+
+impl<S1, S2, Io1, Io2> Future for ConnectorServiceFuture<S1, S2, Io1, Io2>
+where
+    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
+        + Clone
+        + 'static,
+    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
+        + Clone
+        + 'static,
+    Io1: ConnectionIo,
+    Io2: ConnectionIo,
+{
+    type Output = Result<Connection<Io1, Io2>, ConnectError>;
+
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        match self.project() {
+            ConnectorServiceProj::Tcp(fut) => fut.poll(cx).map_ok(Connection::Tcp),
+            ConnectorServiceProj::Tls(fut) => fut.poll(cx).map_ok(Connection::Tls),
+            ConnectorServiceProj::SslIsNotSupported => {
+                Poll::Ready(Err(ConnectError::SslIsNotSupported))
             }
         }
     }
 }
 
-#[cfg(any(feature = "openssl", feature = "rustls"))]
+#[cfg(not(feature = "trust-dns"))]
-mod connect_impl {
+mod resolver {
-    use std::future::Future;
+    use super::*;
-    use std::marker::PhantomData;
-    use std::pin::Pin;
-    use std::task::{Context, Poll};
 
-    use futures_core::ready;
+    pub(super) fn resolver() -> Resolver {
-    use futures_util::future::Either;
+        Resolver::Default
+    }
+}
+
+#[cfg(feature = "trust-dns")]
+mod resolver {
+    use std::{cell::RefCell, net::SocketAddr};
+
+    use actix_tls::connect::Resolve;
+    use futures_core::future::LocalBoxFuture;
+    use trust_dns_resolver::{
+        config::{ResolverConfig, ResolverOpts},
+        system_conf::read_system_conf,
+        TokioAsyncResolver,
+    };
 
     use super::*;
-    use crate::client::connection::EitherConnection;
 
-    pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
+    pub(super) fn resolver() -> Resolver {
-    where
+        // new type for impl Resolve trait for TokioAsyncResolver.
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        struct TrustDnsResolver(TokioAsyncResolver);
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-        T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>,
-        T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>,
-    {
-        pub(crate) tcp_pool: ConnectionPool<T1, Io1>,
-        pub(crate) ssl_pool: ConnectionPool<T2, Io2>,
-    }
 
-    impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
+        impl Resolve for TrustDnsResolver {
-    where
+            fn lookup<'a>(
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+                &'a self,
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+                host: &'a str,
-        T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
+                port: u16,
-        T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
+            ) -> LocalBoxFuture<'a, Result<Vec<SocketAddr>, Box<dyn std::error::Error>>>
-    {
+            {
-        fn clone(&self) -> Self {
+                Box::pin(async move {
-            InnerConnector {
+                    let res = self
-                tcp_pool: self.tcp_pool.clone(),
+                        .0
-                ssl_pool: self.ssl_pool.clone(),
+                        .lookup_ip(host)
+                        .await?
+                        .iter()
+                        .map(|ip| SocketAddr::new(ip, port))
+                        .collect();
+                    Ok(res)
+                })
             }
         }
-    }
 
-    impl<T1, T2, Io1, Io2> Service<Connect> for InnerConnector<T1, T2, Io1, Io2>
+        // dns struct is cached in thread local.
-    where
+        // so new client constructor can reuse the existing dns resolver.
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        thread_local! {
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+            static TRUST_DNS_RESOLVER: RefCell<Option<Resolver>> = RefCell::new(None);
-        T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
-        T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
-    {
-        type Response = EitherConnection<Io1, Io2>;
-        type Error = ConnectError;
-        type Future = Either<
-            InnerConnectorResponseA<T1, Io1, Io2>,
-            InnerConnectorResponseB<T2, Io1, Io2>,
-        >;
-
-        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-            self.tcp_pool.poll_ready(cx)
         }
 
-        fn call(&mut self, req: Connect) -> Self::Future {
+        // get from thread local or construct a new trust-dns resolver.
-            match req.uri.scheme_str() {
+        TRUST_DNS_RESOLVER.with(|local| {
-                Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
+            let resolver = local.borrow().as_ref().map(Clone::clone);
-                    fut: self.ssl_pool.call(req),
+            match resolver {
-                    _phantom: PhantomData,
+                Some(resolver) => resolver,
-                }),
+                None => {
-                _ => Either::Left(InnerConnectorResponseA {
+                    let (cfg, opts) = match read_system_conf() {
-                    fut: self.tcp_pool.call(req),
+                        Ok((cfg, opts)) => (cfg, opts),
-                    _phantom: PhantomData,
+                        Err(e) => {
-                }),
+                            log::error!("TRust-DNS can not load system config: {}", e);
+                            (ResolverConfig::default(), ResolverOpts::default())
+                        }
+                    };
+
+                    let resolver = TokioAsyncResolver::tokio(cfg, opts).unwrap();
+
+                    // box trust dns resolver and put it in thread local.
+                    let resolver = Resolver::new_custom(TrustDnsResolver(resolver));
+                    *local.borrow_mut() = Some(resolver.clone());
+                    resolver
+                }
             }
-        }
+        })
-    }
-
-    #[pin_project::pin_project]
-    pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
-    where
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
-    {
-        #[pin]
-        fut: <ConnectionPool<T, Io1> as Service<Connect>>::Future,
-        _phantom: PhantomData<Io2>,
-    }
-
-    impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
-    where
-        T: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-    {
-        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
-
-        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-            Poll::Ready(
-                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
-                    .map(EitherConnection::A),
-            )
-        }
-    }
-
-    #[pin_project::pin_project]
-    pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
-    where
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
-    {
-        #[pin]
-        fut: <ConnectionPool<T, Io2> as Service<Connect>>::Future,
-        _phantom: PhantomData<Io1>,
-    }
-
-    impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
-    where
-        T: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-    {
-        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
-
-        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-            Poll::Ready(
-                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
-                    .map(EitherConnection::B),
-            )
-        }
     }
 }

actix-http/src/client/error.rs

@@ -1,16 +1,16 @@
-use std::io;
+use std::{error::Error as StdError, fmt, io};
 
-use actix_tls::connect::resolver::ResolveError;
 use derive_more::{Display, From};
 
 #[cfg(feature = "openssl")]
 use actix_tls::accept::openssl::SslError;
 
-use crate::error::{Error, ParseError, ResponseError};
+use crate::error::{Error, ParseError};
-use crate::http::{Error as HttpError, StatusCode};
+use crate::http::Error as HttpError;
 
 /// A set of errors that can occur while connecting to an HTTP host
 #[derive(Debug, Display, From)]
+#[non_exhaustive]
 pub enum ConnectError {
     /// SSL feature is not enabled
     #[display(fmt = "SSL is not supported")]
@@ -23,10 +23,10 @@ pub enum ConnectError {
 
     /// Failed to resolve the hostname
     #[display(fmt = "Failed resolving hostname: {}", _0)]
-    Resolver(ResolveError),
+    Resolver(Box<dyn std::error::Error>),
 
     /// No dns records
-    #[display(fmt = "No dns records found for the input")]
+    #[display(fmt = "No DNS records found for the input")]
     NoRecords,
 
     /// Http2 error
@@ -65,14 +65,18 @@ impl From<actix_tls::connect::ConnectError> for ConnectError {
 }
 
 #[derive(Debug, Display, From)]
+#[non_exhaustive]
 pub enum InvalidUrl {
-    #[display(fmt = "Missing url scheme")]
+    #[display(fmt = "Missing URL scheme")]
     MissingScheme,
-    #[display(fmt = "Unknown url scheme")]
+
+    #[display(fmt = "Unknown URL scheme")]
     UnknownScheme,
+
     #[display(fmt = "Missing host name")]
     MissingHost,
-    #[display(fmt = "Url parse error: {}", _0)]
+
+    #[display(fmt = "URL parse error: {}", _0)]
     HttpError(http::Error),
 }
 
@@ -80,66 +84,73 @@ impl std::error::Error for InvalidUrl {}
 
 /// A set of errors that can occur during request sending and response reading
 #[derive(Debug, Display, From)]
+#[non_exhaustive]
 pub enum SendRequestError {
     /// Invalid URL
     #[display(fmt = "Invalid URL: {}", _0)]
     Url(InvalidUrl),
+
     /// Failed to connect to host
     #[display(fmt = "Failed to connect to host: {}", _0)]
     Connect(ConnectError),
+
     /// Error sending request
     Send(io::Error),
+
     /// Error parsing response
     Response(ParseError),
+
     /// Http error
     #[display(fmt = "{}", _0)]
     Http(HttpError),
+
     /// Http2 error
     #[display(fmt = "{}", _0)]
     H2(h2::Error),
+
     /// Response took too long
     #[display(fmt = "Timeout while waiting for response")]
     Timeout,
-    /// Tunnels are not supported for http2 connection
+
+    /// Tunnels are not supported for HTTP/2 connection
     #[display(fmt = "Tunnels are not supported for http2 connection")]
     TunnelNotSupported,
+
     /// Error sending request body
     Body(Error),
+
+    /// Other errors that can occur after submitting a request.
+    #[display(fmt = "{:?}: {}", _1, _0)]
+    Custom(Box<dyn StdError>, Box<dyn fmt::Debug>),
 }
 
 impl std::error::Error for SendRequestError {}
 
-/// Convert `SendRequestError` to a server `Response`
-impl ResponseError for SendRequestError {
-    fn status_code(&self) -> StatusCode {
-        match *self {
-            SendRequestError::Connect(ConnectError::Timeout) => {
-                StatusCode::GATEWAY_TIMEOUT
-            }
-            SendRequestError::Connect(_) => StatusCode::BAD_REQUEST,
-            _ => StatusCode::INTERNAL_SERVER_ERROR,
-        }
-    }
-}
-
 /// A set of errors that can occur during freezing a request
 #[derive(Debug, Display, From)]
+#[non_exhaustive]
 pub enum FreezeRequestError {
     /// Invalid URL
     #[display(fmt = "Invalid URL: {}", _0)]
     Url(InvalidUrl),
-    /// Http error
+
+    /// HTTP error
     #[display(fmt = "{}", _0)]
     Http(HttpError),
+
+    /// Other errors that can occur after submitting a request.
+    #[display(fmt = "{:?}: {}", _1, _0)]
+    Custom(Box<dyn StdError>, Box<dyn fmt::Debug>),
 }
 
 impl std::error::Error for FreezeRequestError {}
 
 impl From<FreezeRequestError> for SendRequestError {
-    fn from(e: FreezeRequestError) -> Self {
+    fn from(err: FreezeRequestError) -> Self {
-        match e {
+        match err {
-            FreezeRequestError::Url(e) => e.into(),
+            FreezeRequestError::Url(err) => err.into(),
-            FreezeRequestError::Http(e) => e.into(),
+            FreezeRequestError::Http(err) => err.into(),
+            FreezeRequestError::Custom(err, msg) => SendRequestError::Custom(err, msg),
         }
     }
 }

actix-http/src/client/h1proto.rs

@@ -1,37 +1,38 @@
-use std::io::Write;
+use std::{
-use std::pin::Pin;
+    io::Write,
-use std::task::{Context, Poll};
+    pin::Pin,
-use std::{io, time};
+    task::{Context, Poll},
+};
 
-use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
+use actix_codec::Framed;
+use actix_utils::future::poll_fn;
 use bytes::buf::BufMut;
 use bytes::{Bytes, BytesMut};
-use futures_core::Stream;
+use futures_core::{ready, Stream};
-use futures_util::future::poll_fn;
+use futures_util::SinkExt as _;
-use futures_util::{pin_mut, SinkExt, StreamExt};
 
-use crate::error::PayloadError;
 use crate::h1;
-use crate::header::HeaderMap;
+use crate::http::{
-use crate::http::header::{IntoHeaderValue, HOST};
+    header::{HeaderMap, IntoHeaderValue, EXPECT, HOST},
+    StatusCode,
+};
 use crate::message::{RequestHeadType, ResponseHead};
-use crate::payload::{Payload, PayloadStream};
+use crate::payload::Payload;
+use crate::{error::PayloadError, Error};
 
-use super::connection::{ConnectionLifetime, ConnectionType, IoConnection};
+use super::connection::{ConnectionIo, H1Connection};
 use super::error::{ConnectError, SendRequestError};
-use super::pool::Acquired;
 use crate::body::{BodySize, MessageBody};
 
-pub(crate) async fn send_request<T, B>(
+pub(crate) async fn send_request<Io, B>(
-    io: T,
+    io: H1Connection<Io>,
     mut head: RequestHeadType,
     body: B,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
 ) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
+    Io: ConnectionIo,
     B: MessageBody,
+    B::Error: Into<Error>,
 {
     // set request host header
     if !head.as_ref().headers.contains_key(HOST)
@@ -40,19 +41,19 @@ where
         if let Some(host) = head.as_ref().uri.host() {
             let mut wrt = BytesMut::with_capacity(host.len() + 5).writer();
 
-            let _ = match head.as_ref().uri.port_u16() {
+            match head.as_ref().uri.port_u16() {
-                None | Some(80) | Some(443) => write!(wrt, "{}", host),
+                None | Some(80) | Some(443) => write!(wrt, "{}", host)?,
-                Some(port) => write!(wrt, "{}:{}", host, port),
+                Some(port) => write!(wrt, "{}:{}", host, port)?,
             };
 
-            match wrt.get_mut().split().freeze().try_into() {
+            match wrt.get_mut().split().freeze().try_into_value() {
                 Ok(value) => match head {
                     RequestHeadType::Owned(ref mut head) => {
-                        head.headers.insert(HOST, value)
+                        head.headers.insert(HOST, value);
                     }
                     RequestHeadType::Rc(_, ref mut extra_headers) => {
                         let headers = extra_headers.get_or_insert(HeaderMap::new());
-                        headers.insert(HOST, value)
+                        headers.insert(HOST, value);
                     }
                 },
                 Err(e) => log::error!("Can not set HOST header {}", e),
@@ -60,82 +61,112 @@ where
         }
     }
 
-    let io = H1Connection {
+    // create Framed and prepare sending request
-        created,
+    let mut framed = Framed::new(io, h1::ClientCodec::default());
-        pool,
-        io: Some(io),
-    };
 
-    // create Framed and send request
+    // Check EXPECT header and enable expect handle flag accordingly.
-    let mut framed_inner = Framed::new(io, h1::ClientCodec::default());
+    //
-    framed_inner.send((head, body.size()).into()).await?;
+    // RFC: https://tools.ietf.org/html/rfc7231#section-5.1.1
+    let is_expect = if head.as_ref().headers.contains_key(EXPECT) {
+        match body.size() {
+            BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
+                let keep_alive = framed.codec_ref().keepalive();
+                framed.io_mut().on_release(keep_alive);
 
-    // send request body
+                // TODO: use a new variant or a new type better describing error violate
-    match body.size() {
+                // `Requirements for clients` session of above RFC
-        BodySize::None | BodySize::Empty | BodySize::Sized(0) => {}
+                return Err(SendRequestError::Connect(ConnectError::Disconnected));
-        _ => send_body(body, Pin::new(&mut framed_inner)).await?,
+            }
-    };
+            _ => true,
-
+        }
-    // read response and init read body
-    let res = Pin::new(&mut framed_inner).into_future().await;
-    let (head, framed) = if let (Some(result), framed) = res {
-        let item = result.map_err(SendRequestError::from)?;
-        (item, framed)
     } else {
-        return Err(SendRequestError::from(ConnectError::Disconnected));
+        false
     };
 
-    match framed.codec_ref().message_type() {
+    framed.send((head, body.size()).into()).await?;
+
+    let mut pin_framed = Pin::new(&mut framed);
+
+    // special handle for EXPECT request.
+    let (do_send, mut res_head) = if is_expect {
+        let head = poll_fn(|cx| pin_framed.as_mut().poll_next(cx))
+            .await
+            .ok_or(ConnectError::Disconnected)??;
+
+        // return response head in case status code is not continue
+        // and current head would be used as final response head.
+        (head.status == StatusCode::CONTINUE, Some(head))
+    } else {
+        (true, None)
+    };
+
+    if do_send {
+        // send request body
+        match body.size() {
+            BodySize::None | BodySize::Empty | BodySize::Sized(0) => {}
+            _ => send_body(body, pin_framed.as_mut()).await?,
+        };
+
+        // read response and init read body
+        let head = poll_fn(|cx| pin_framed.as_mut().poll_next(cx))
+            .await
+            .ok_or(ConnectError::Disconnected)??;
+
+        res_head = Some(head);
+    }
+
+    let head = res_head.unwrap();
+
+    match pin_framed.codec_ref().message_type() {
         h1::MessageType::None => {
-            let force_close = !framed.codec_ref().keepalive();
+            let keep_alive = pin_framed.codec_ref().keepalive();
-            release_connection(framed, force_close);
+            pin_framed.io_mut().on_release(keep_alive);
+
             Ok((head, Payload::None))
         }
-        _ => {
+        _ => Ok((head, Payload::Stream(Box::pin(PlStream::new(framed))))),
-            let pl: PayloadStream = PlStream::new(framed_inner).boxed_local();
-            Ok((head, pl.into()))
-        }
     }
 }
 
-pub(crate) async fn open_tunnel<T>(
+pub(crate) async fn open_tunnel<Io>(
-    io: T,
+    io: Io,
     head: RequestHeadType,
-) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
+) -> Result<(ResponseHead, Framed<Io, h1::ClientCodec>), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
+    Io: ConnectionIo,
 {
-    // create Framed and send request
+    // create Framed and send request.
     let mut framed = Framed::new(io, h1::ClientCodec::default());
     framed.send((head, BodySize::None).into()).await?;
 
-    // read response
+    // read response head.
-    if let (Some(result), framed) = framed.into_future().await {
+    let head = poll_fn(|cx| Pin::new(&mut framed).poll_next(cx))
-        let head = result.map_err(SendRequestError::from)?;
+        .await
-        Ok((head, framed))
+        .ok_or(ConnectError::Disconnected)??;
-    } else {
+
-        Err(SendRequestError::from(ConnectError::Disconnected))
+    Ok((head, framed))
-    }
 }
 
 /// send request body to the peer
-pub(crate) async fn send_body<T, B>(
+pub(crate) async fn send_body<Io, B>(
     body: B,
-    mut framed: Pin<&mut Framed<T, h1::ClientCodec>>,
+    mut framed: Pin<&mut Framed<Io, h1::ClientCodec>>,
 ) -> Result<(), SendRequestError>
 where
-    T: ConnectionLifetime + Unpin,
+    Io: ConnectionIo,
     B: MessageBody,
+    B::Error: Into<Error>,
 {
-    pin_mut!(body);
+    actix_rt::pin!(body);
 
     let mut eof = false;
     while !eof {
         while !eof && !framed.as_ref().is_write_buf_full() {
             match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
-                Some(result) => {
+                Some(Ok(chunk)) => {
-                    framed.as_mut().write(h1::Message::Chunk(Some(result?)))?;
+                    framed.as_mut().write(h1::Message::Chunk(Some(chunk)))?;
                 }
+                Some(Err(err)) => return Err(err.into().into()),
                 None => {
                     eof = true;
                     framed.as_mut().write(h1::Message::Chunk(None))?;
@@ -159,101 +190,25 @@ where
         }
     }
 
-    SinkExt::flush(Pin::into_inner(framed)).await?;
+    framed.get_mut().flush().await?;
     Ok(())
 }
 
-#[doc(hidden)]
-/// HTTP client connection
-pub struct H1Connection<T> {
-    /// T should be `Unpin`
-    io: Option<T>,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
-}
-
-impl<T> ConnectionLifetime for H1Connection<T>
-where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    /// Close connection
-    fn close(mut self: Pin<&mut Self>) {
-        if let Some(mut pool) = self.pool.take() {
-            if let Some(io) = self.io.take() {
-                pool.close(IoConnection::new(
-                    ConnectionType::H1(io),
-                    self.created,
-                    None,
-                ));
-            }
-        }
-    }
-
-    /// Release this connection to the connection pool
-    fn release(mut self: Pin<&mut Self>) {
-        if let Some(mut pool) = self.pool.take() {
-            if let Some(io) = self.io.take() {
-                pool.release(IoConnection::new(
-                    ConnectionType::H1(io),
-                    self.created,
-                    None,
-                ));
-            }
-        }
-    }
-}
-
-impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
-    fn poll_read(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &mut ReadBuf<'_>,
-    ) -> Poll<io::Result<()>> {
-        Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
-    }
-}
-
-impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
-    fn poll_write(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &[u8],
-    ) -> Poll<io::Result<usize>> {
-        Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
-    }
-
-    fn poll_flush(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<io::Result<()>> {
-        Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
-    }
-
-    fn poll_shutdown(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Result<(), io::Error>> {
-        Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
-    }
-}
-
 #[pin_project::pin_project]
-pub(crate) struct PlStream<Io> {
+pub(crate) struct PlStream<Io: ConnectionIo> {
     #[pin]
-    framed: Option<Framed<Io, h1::ClientPayloadCodec>>,
+    framed: Framed<H1Connection<Io>, h1::ClientPayloadCodec>,
 }
 
-impl<Io: ConnectionLifetime> PlStream<Io> {
+impl<Io: ConnectionIo> PlStream<Io> {
-    fn new(framed: Framed<Io, h1::ClientCodec>) -> Self {
+    fn new(framed: Framed<H1Connection<Io>, h1::ClientCodec>) -> Self {
         let framed = framed.into_map_codec(|codec| codec.into_payload_codec());
 
-        PlStream {
+        PlStream { framed }
-            framed: Some(framed),
-        }
     }
 }
 
-impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
+impl<Io: ConnectionIo> Stream for PlStream<Io> {
     type Item = Result<Bytes, PayloadError>;
 
     fn poll_next(
@@ -262,30 +217,14 @@ impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
     ) -> Poll<Option<Self::Item>> {
         let mut this = self.project();
 
-        match this.framed.as_mut().as_pin_mut().unwrap().next_item(cx)? {
+        match ready!(this.framed.as_mut().next_item(cx)?) {
-            Poll::Pending => Poll::Pending,
+            Some(Some(chunk)) => Poll::Ready(Some(Ok(chunk))),
-            Poll::Ready(Some(chunk)) => {
+            Some(None) => {
-                if let Some(chunk) = chunk {
+                let keep_alive = this.framed.codec_ref().keepalive();
-                    Poll::Ready(Some(Ok(chunk)))
+                this.framed.io_mut().on_release(keep_alive);
-                } else {
+                Poll::Ready(None)
-                    let framed = this.framed.as_mut().as_pin_mut().unwrap();
-                    let force_close = !framed.codec_ref().keepalive();
-                    release_connection(framed, force_close);
-                    Poll::Ready(None)
-                }
             }
-            Poll::Ready(None) => Poll::Ready(None),
+            None => Poll::Ready(None),
         }
     }
 }
-
-fn release_connection<T, U>(framed: Pin<&mut Framed<T, U>>, force_close: bool)
-where
-    T: ConnectionLifetime,
-{
-    if !force_close && framed.is_read_buf_empty() && framed.is_write_buf_empty() {
-        framed.io_pin().release()
-    } else {
-        framed.io_pin().close()
-    }
-}

actix-http/src/client/h2proto.rs

@@ -1,11 +1,7 @@
-use std::convert::TryFrom;
 use std::future::Future;
-use std::time;
 
-use actix_codec::{AsyncRead, AsyncWrite};
+use actix_utils::future::poll_fn;
 use bytes::Bytes;
-use futures_util::future::poll_fn;
-use futures_util::pin_mut;
 use h2::{
     client::{Builder, Connection, SendRequest},
     SendStream,
@@ -13,28 +9,32 @@ use h2::{
 use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING};
 use http::{request::Request, Method, Version};
 
-use crate::body::{BodySize, MessageBody};
+use crate::{
-use crate::header::HeaderMap;
+    body::{BodySize, MessageBody},
-use crate::message::{RequestHeadType, ResponseHead};
+    header::HeaderMap,
-use crate::payload::Payload;
+    message::{RequestHeadType, ResponseHead},
+    payload::Payload,
+    Error,
+};
 
-use super::config::ConnectorConfig;
+use super::{
-use super::connection::{ConnectionType, IoConnection};
+    config::ConnectorConfig,
-use super::error::SendRequestError;
+    connection::{ConnectionIo, H2Connection},
-use super::pool::Acquired;
+    error::SendRequestError,
+};
 
-pub(crate) async fn send_request<T, B>(
+pub(crate) async fn send_request<Io, B>(
-    mut io: SendRequest<Bytes>,
+    mut io: H2Connection<Io>,
     head: RequestHeadType,
     body: B,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
 ) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
+    Io: ConnectionIo,
     B: MessageBody,
+    B::Error: Into<Error>,
 {
     trace!("Sending client request: {:?} {:?}", head, body.size());
+
     let head_req = head.as_ref().method == Method::HEAD;
     let length = body.size();
     let eof = matches!(
@@ -60,10 +60,14 @@ where
         BodySize::Empty => req
             .headers_mut()
             .insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
-        BodySize::Sized(len) => req.headers_mut().insert(
+        BodySize::Sized(len) => {
-            CONTENT_LENGTH,
+            let mut buf = itoa::Buffer::new();
-            HeaderValue::try_from(format!("{}", len)).unwrap(),
+
-        ),
+            req.headers_mut().insert(
+                CONTENT_LENGTH,
+                HeaderValue::from_str(buf.format(len)).unwrap(),
+            )
+        }
     };
 
     // Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
@@ -86,7 +90,10 @@ where
     // copy headers
     for (key, value) in headers {
         match *key {
-            CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
+            // TODO: consider skipping other headers according to:
+            //       https://tools.ietf.org/html/rfc7540#section-8.1.2.2
+            // omit HTTP/1.x only headers
+            CONNECTION | TRANSFER_ENCODING => continue,
             CONTENT_LENGTH if skip_len => continue,
             // DATE => has_date = true,
             _ => {}
@@ -96,13 +103,13 @@ where
 
     let res = poll_fn(|cx| io.poll_ready(cx)).await;
     if let Err(e) = res {
-        release(io, pool, created, e.is_io());
+        io.on_release(e.is_io());
         return Err(SendRequestError::from(e));
     }
 
     let resp = match io.send_request(req, eof) {
         Ok((fut, send)) => {
-            release(io, pool, created, false);
+            io.on_release(false);
 
             if !eof {
                 send_body(body, send).await?;
@@ -110,7 +117,7 @@ where
             fut.await.map_err(SendRequestError::from)?
         }
         Err(e) => {
-            release(io, pool, created, e.is_io());
+            io.on_release(e.is_io());
             return Err(e.into());
         }
     };
@@ -124,12 +131,16 @@ where
     Ok((head, payload))
 }
 
-async fn send_body<B: MessageBody>(
+async fn send_body<B>(
     body: B,
     mut send: SendStream<Bytes>,
-) -> Result<(), SendRequestError> {
+) -> Result<(), SendRequestError>
+where
+    B: MessageBody,
+    B::Error: Into<Error>,
+{
     let mut buf = None;
-    pin_mut!(body);
+    actix_rt::pin!(body);
     loop {
         if buf.is_none() {
             match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
@@ -137,7 +148,7 @@ async fn send_body<B: MessageBody>(
                     send.reserve_capacity(b.len());
                     buf = Some(b);
                 }
-                Some(Err(e)) => return Err(e.into()),
+                Some(Err(e)) => return Err(e.into().into()),
                 None => {
                     if let Err(e) = send.send_data(Bytes::new(), true) {
                         return Err(e.into());
@@ -171,28 +182,10 @@ async fn send_body<B: MessageBody>(
     }
 }
 
-// release SendRequest object
+pub(crate) fn handshake<Io: ConnectionIo>(
-fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
-    io: SendRequest<Bytes>,
-    pool: Option<Acquired<T>>,
-    created: time::Instant,
-    close: bool,
-) {
-    if let Some(mut pool) = pool {
-        if close {
-            pool.close(IoConnection::new(ConnectionType::H2(io), created, None));
-        } else {
-            pool.release(IoConnection::new(ConnectionType::H2(io), created, None));
-        }
-    }
-}
-
-pub(crate) fn handshake<Io>(
     io: Io,
     config: &ConnectorConfig,
 ) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     let mut builder = Builder::new();
     builder

actix-http/src/client/mod.rs

@@ -1,4 +1,5 @@
-//! Http client api
+//! HTTP client.
+
 use http::Uri;
 
 mod config;
@@ -9,10 +10,14 @@ mod h1proto;
 mod h2proto;
 mod pool;
 
-pub use self::connection::Connection;
+pub use actix_tls::connect::{
-pub use self::connector::Connector;
+    Connect as TcpConnect, ConnectError as TcpConnectError, Connection as TcpConnection,
+};
+
+pub use self::connection::{Connection, ConnectionIo};
+pub use self::connector::{Connector, ConnectorService};
 pub use self::error::{ConnectError, FreezeRequestError, InvalidUrl, SendRequestError};
-pub use self::pool::Protocol;
+pub use crate::Protocol;
 
 #[derive(Clone)]
 pub struct Connect {

actix-http/src/config.rs

@@ -4,12 +4,14 @@ use std::rc::Rc;
 use std::time::Duration;
 use std::{fmt, net};
 
-use actix_rt::time::{sleep, sleep_until, Instant, Sleep};
+use actix_rt::{
+    task::JoinHandle,
+    time::{interval, sleep_until, Instant, Sleep},
+};
 use bytes::BytesMut;
-use futures_util::{future, FutureExt};
 use time::OffsetDateTime;
 
-// "Sun, 06 Nov 1994 08:49:37 GMT".len()
+/// "Sun, 06 Nov 1994 08:49:37 GMT".len()
 const DATE_VALUE_LENGTH: usize = 29;
 
 #[derive(Debug, PartialEq, Clone, Copy)]
@@ -49,7 +51,7 @@ struct Inner {
     ka_enabled: bool,
     secure: bool,
     local_addr: Option<std::net::SocketAddr>,
-    timer: DateService,
+    date_service: DateService,
 }
 
 impl Clone for ServiceConfig {
@@ -91,42 +93,40 @@ impl ServiceConfig {
             client_disconnect,
             secure,
             local_addr,
-            timer: DateService::new(),
+            date_service: DateService::new(),
         }))
     }
 
+    /// Returns true if connection is secure (HTTPS)
     #[inline]
-    /// Returns true if connection is secure(https)
     pub fn secure(&self) -> bool {
         self.0.secure
     }
 
-    #[inline]
     /// Returns the local address that this server is bound to.
+    #[inline]
     pub fn local_addr(&self) -> Option<net::SocketAddr> {
         self.0.local_addr
     }
 
-    #[inline]
     /// Keep alive duration if configured.
+    #[inline]
     pub fn keep_alive(&self) -> Option<Duration> {
         self.0.keep_alive
     }
 
-    #[inline]
     /// Return state of connection keep-alive functionality
+    #[inline]
     pub fn keep_alive_enabled(&self) -> bool {
         self.0.ka_enabled
     }
 
-    #[inline]
     /// Client timeout for first request.
+    #[inline]
     pub fn client_timer(&self) -> Option<Sleep> {
         let delay_time = self.0.client_timeout;
         if delay_time != 0 {
-            Some(sleep_until(
+            Some(sleep_until(self.now() + Duration::from_millis(delay_time)))
-                self.0.timer.now() + Duration::from_millis(delay_time),
-            ))
         } else {
             None
         }
@@ -136,7 +136,7 @@ impl ServiceConfig {
     pub fn client_timer_expire(&self) -> Option<Instant> {
         let delay = self.0.client_timeout;
         if delay != 0 {
-            Some(self.0.timer.now() + Duration::from_millis(delay))
+            Some(self.now() + Duration::from_millis(delay))
         } else {
             None
         }
@@ -146,7 +146,7 @@ impl ServiceConfig {
     pub fn client_disconnect_timer(&self) -> Option<Instant> {
         let delay = self.0.client_disconnect;
         if delay != 0 {
-            Some(self.0.timer.now() + Duration::from_millis(delay))
+            Some(self.now() + Duration::from_millis(delay))
         } else {
             None
         }
@@ -155,25 +155,17 @@ impl ServiceConfig {
     #[inline]
     /// Return keep-alive timer delay is configured.
     pub fn keep_alive_timer(&self) -> Option<Sleep> {
-        if let Some(ka) = self.0.keep_alive {
+        self.keep_alive().map(|ka| sleep_until(self.now() + ka))
-            Some(sleep_until(self.0.timer.now() + ka))
-        } else {
-            None
-        }
     }
 
     /// Keep-alive expire time
     pub fn keep_alive_expire(&self) -> Option<Instant> {
-        if let Some(ka) = self.0.keep_alive {
+        self.keep_alive().map(|ka| self.now() + ka)
-            Some(self.0.timer.now() + ka)
-        } else {
-            None
-        }
     }
 
     #[inline]
     pub(crate) fn now(&self) -> Instant {
-        self.0.timer.now()
+        self.0.date_service.now()
     }
 
     #[doc(hidden)]
@@ -181,7 +173,7 @@ impl ServiceConfig {
         let mut buf: [u8; 39] = [0; 39];
         buf[..6].copy_from_slice(b"date: ");
         self.0
-            .timer
+            .date_service
             .set_date(|date| buf[6..35].copy_from_slice(&date.bytes));
         buf[35..].copy_from_slice(b"\r\n\r\n");
         dst.extend_from_slice(&buf);
@@ -189,7 +181,7 @@ impl ServiceConfig {
 
     pub(crate) fn set_date_header(&self, dst: &mut BytesMut) {
         self.0
-            .timer
+            .date_service
             .set_date(|date| dst.extend_from_slice(&date.bytes));
     }
 }
@@ -230,57 +222,103 @@ impl fmt::Write for Date {
     }
 }
 
-#[derive(Clone)]
+/// Service for update Date and Instant periodically at 500 millis interval.
-struct DateService(Rc<DateServiceInner>);
+struct DateService {
-
+    current: Rc<Cell<(Date, Instant)>>,
-struct DateServiceInner {
+    handle: JoinHandle<()>,
-    current: Cell<Option<(Date, Instant)>>,
 }
 
-impl DateServiceInner {
+impl Drop for DateService {
-    fn new() -> Self {
+    fn drop(&mut self) {
-        DateServiceInner {
+        // stop the timer update async task on drop.
-            current: Cell::new(None),
+        self.handle.abort();
-        }
-    }
-
-    fn reset(&self) {
-        self.current.take();
-    }
-
-    fn update(&self) {
-        let now = Instant::now();
-        let date = Date::new();
-        self.current.set(Some((date, now)));
     }
 }
 
 impl DateService {
     fn new() -> Self {
-        DateService(Rc::new(DateServiceInner::new()))
+        // shared date and timer for DateService and update async task.
-    }
+        let current = Rc::new(Cell::new((Date::new(), Instant::now())));
+        let current_clone = Rc::clone(&current);
+        // spawn an async task sleep for 500 milli and update current date/timer in a loop.
+        // handle is used to stop the task on DateService drop.
+        let handle = actix_rt::spawn(async move {
+            #[cfg(test)]
+            let _notify = notify_on_drop::NotifyOnDrop::new();
 
-    fn check_date(&self) {
+            let mut interval = interval(Duration::from_millis(500));
-        if self.0.current.get().is_none() {
+            loop {
-            self.0.update();
+                let now = interval.tick().await;
+                let date = Date::new();
+                current_clone.set((date, now));
+            }
+        });
 
-            // periodic date update
+        DateService { current, handle }
-            let s = self.clone();
-            actix_rt::spawn(sleep(Duration::from_millis(500)).then(move |_| {
-                s.0.reset();
-                future::ready(())
-            }));
-        }
     }
 
     fn now(&self) -> Instant {
-        self.check_date();
+        self.current.get().1
-        self.0.current.get().unwrap().1
     }
 
     fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
-        self.check_date();
+        f(&self.current.get().0);
-        f(&self.0.current.get().unwrap().0);
+    }
+}
+
+// TODO: move to a util module for testing all spawn handle drop style tasks.
+#[cfg(test)]
+/// Test Module for checking the drop state of certain async tasks that are spawned
+/// with `actix_rt::spawn`
+///
+/// The target task must explicitly generate `NotifyOnDrop` when spawn the task
+mod notify_on_drop {
+    use std::cell::RefCell;
+
+    thread_local! {
+        static NOTIFY_DROPPED: RefCell<Option<bool>> = RefCell::new(None);
+    }
+
+    /// Check if the spawned task is dropped.
+    ///
+    /// # Panic:
+    ///
+    /// When there was no `NotifyOnDrop` instance on current thread
+    pub(crate) fn is_dropped() -> bool {
+        NOTIFY_DROPPED.with(|bool| {
+            bool.borrow()
+                .expect("No NotifyOnDrop existed on current thread")
+        })
+    }
+
+    pub(crate) struct NotifyOnDrop;
+
+    impl NotifyOnDrop {
+        /// # Panic:
+        ///
+        /// When construct multiple instances on any given thread.
+        pub(crate) fn new() -> Self {
+            NOTIFY_DROPPED.with(|bool| {
+                let mut bool = bool.borrow_mut();
+                if bool.is_some() {
+                    panic!("NotifyOnDrop existed on current thread");
+                } else {
+                    *bool = Some(false);
+                }
+            });
+
+            NotifyOnDrop
+        }
+    }
+
+    impl Drop for NotifyOnDrop {
+        fn drop(&mut self) {
+            NOTIFY_DROPPED.with(|bool| {
+                if let Some(b) = bool.borrow_mut().as_mut() {
+                    *b = true;
+                }
+            });
+        }
     }
 }
 
@@ -288,14 +326,53 @@ impl DateService {
 mod tests {
     use super::*;
 
-    // Test modifying the date from within the closure
+    use actix_rt::task::yield_now;
-    // passed to `set_date`
+
-    #[test]
+    #[actix_rt::test]
-    fn test_evil_date() {
+    async fn test_date_service_update() {
-        let service = DateService::new();
+        let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
-        // Make sure that `check_date` doesn't try to spawn a task
+
-        service.0.update();
+        yield_now().await;
-        service.set_date(|_| service.0.reset());
+
+        let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
+        settings.set_date(&mut buf1);
+        let now1 = settings.now();
+
+        sleep_until(Instant::now() + Duration::from_secs(2)).await;
+        yield_now().await;
+
+        let now2 = settings.now();
+        let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
+        settings.set_date(&mut buf2);
+
+        assert_ne!(now1, now2);
+
+        assert_ne!(buf1, buf2);
+
+        drop(settings);
+        assert!(notify_on_drop::is_dropped());
+    }
+
+    #[actix_rt::test]
+    async fn test_date_service_drop() {
+        let service = Rc::new(DateService::new());
+
+        // yield so date service have a chance to register the spawned timer update task.
+        yield_now().await;
+
+        let clone1 = service.clone();
+        let clone2 = service.clone();
+        let clone3 = service.clone();
+
+        drop(clone1);
+        assert_eq!(false, notify_on_drop::is_dropped());
+        drop(clone2);
+        assert_eq!(false, notify_on_drop::is_dropped());
+        drop(clone3);
+        assert_eq!(false, notify_on_drop::is_dropped());
+
+        drop(service);
+        assert!(notify_on_drop::is_dropped());
     }
 
     #[test]

actix-http/src/encoding/decoder.rs

@@ -1,25 +1,38 @@
-use std::future::Future;
+//! Stream decoders.
-use std::io::{self, Write};
-use std::pin::Pin;
-use std::task::{Context, Poll};
 
-use actix_threadpool::{run, CpuFuture};
+use std::{
-use brotli2::write::BrotliDecoder;
+    future::Future,
+    io::{self, Write as _},
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use actix_rt::task::{spawn_blocking, JoinHandle};
 use bytes::Bytes;
-use flate2::write::{GzDecoder, ZlibDecoder};
 use futures_core::{ready, Stream};
 
-use super::Writer;
+#[cfg(feature = "compress-brotli")]
-use crate::error::PayloadError;
+use brotli2::write::BrotliDecoder;
-use crate::http::header::{ContentEncoding, HeaderMap, CONTENT_ENCODING};
 
-const INPLACE: usize = 2049;
+#[cfg(feature = "compress-gzip")]
+use flate2::write::{GzDecoder, ZlibDecoder};
+
+#[cfg(feature = "compress-zstd")]
+use zstd::stream::write::Decoder as ZstdDecoder;
+
+use crate::{
+    encoding::Writer,
+    error::{BlockingError, PayloadError},
+    http::header::{ContentEncoding, HeaderMap, CONTENT_ENCODING},
+};
+
+const MAX_CHUNK_SIZE_DECODE_IN_PLACE: usize = 2049;
 
 pub struct Decoder<S> {
     decoder: Option<ContentDecoder>,
     stream: S,
     eof: bool,
-    fut: Option<CpuFuture<(Option<Bytes>, ContentDecoder), io::Error>>,
+    fut: Option<JoinHandle<Result<(Option<Bytes>, ContentDecoder), io::Error>>>,
 }
 
 impl<S> Decoder<S>
@@ -30,17 +43,28 @@ where
     #[inline]
     pub fn new(stream: S, encoding: ContentEncoding) -> Decoder<S> {
         let decoder = match encoding {
+            #[cfg(feature = "compress-brotli")]
             ContentEncoding::Br => Some(ContentDecoder::Br(Box::new(
                 BrotliDecoder::new(Writer::new()),
             ))),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoding::Deflate => Some(ContentDecoder::Deflate(Box::new(
                 ZlibDecoder::new(Writer::new()),
             ))),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoding::Gzip => Some(ContentDecoder::Gzip(Box::new(
                 GzDecoder::new(Writer::new()),
             ))),
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoding::Zstd => Some(ContentDecoder::Zstd(Box::new(
+                ZstdDecoder::new(Writer::new()).expect(
+                    "Failed to create zstd decoder. This is a bug. \
+                         Please report it to the actix-web repository.",
+                ),
+            ))),
             _ => None,
         };
+
         Decoder {
             decoder,
             stream,
@@ -53,15 +77,11 @@ where
     #[inline]
     pub fn from_headers(stream: S, headers: &HeaderMap) -> Decoder<S> {
         // check content-encoding
-        let encoding = if let Some(enc) = headers.get(&CONTENT_ENCODING) {
+        let encoding = headers
-            if let Ok(enc) = enc.to_str() {
+            .get(&CONTENT_ENCODING)
-                ContentEncoding::from(enc)
+            .and_then(|val| val.to_str().ok())
-            } else {
+            .map(ContentEncoding::from)
-                ContentEncoding::Identity
+            .unwrap_or(ContentEncoding::Identity);
-            }
-        } else {
-            ContentEncoding::Identity
-        };
 
         Self::new(stream, encoding)
     }
@@ -79,12 +99,12 @@ where
     ) -> Poll<Option<Self::Item>> {
         loop {
             if let Some(ref mut fut) = self.fut {
-                let (chunk, decoder) = match ready!(Pin::new(fut).poll(cx)) {
+                let (chunk, decoder) =
-                    Ok(item) => item,
+                    ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
-                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
+
-                };
                 self.decoder = Some(decoder);
                 self.fut.take();
+
                 if let Some(chunk) = chunk {
                     return Poll::Ready(Some(Ok(chunk)));
                 }
@@ -94,29 +114,34 @@ where
                 return Poll::Ready(None);
             }
 
-            match Pin::new(&mut self.stream).poll_next(cx) {
+            match ready!(Pin::new(&mut self.stream).poll_next(cx)) {
-                Poll::Ready(Some(Err(err))) => return Poll::Ready(Some(Err(err))),
+                Some(Err(err)) => return Poll::Ready(Some(Err(err))),
-                Poll::Ready(Some(Ok(chunk))) => {
+
+                Some(Ok(chunk)) => {
                     if let Some(mut decoder) = self.decoder.take() {
-                        if chunk.len() < INPLACE {
+                        if chunk.len() < MAX_CHUNK_SIZE_DECODE_IN_PLACE {
                             let chunk = decoder.feed_data(chunk)?;
                             self.decoder = Some(decoder);
+
                             if let Some(chunk) = chunk {
                                 return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
-                            self.fut = Some(run(move || {
+                            self.fut = Some(spawn_blocking(move || {
                                 let chunk = decoder.feed_data(chunk)?;
                                 Ok((chunk, decoder))
                             }));
                         }
+
                         continue;
                     } else {
                         return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Poll::Ready(None) => {
+
+                None => {
                     self.eof = true;
+
                     return if let Some(mut decoder) = self.decoder.take() {
                         match decoder.feed_eof() {
                             Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
@@ -127,25 +152,32 @@ where
                         Poll::Ready(None)
                     };
                 }
-                Poll::Pending => break,
             }
         }
-        Poll::Pending
     }
 }
 
 enum ContentDecoder {
+    #[cfg(feature = "compress-gzip")]
     Deflate(Box<ZlibDecoder<Writer>>),
+    #[cfg(feature = "compress-gzip")]
     Gzip(Box<GzDecoder<Writer>>),
+    #[cfg(feature = "compress-brotli")]
     Br(Box<BrotliDecoder<Writer>>),
+    // We need explicit 'static lifetime here because ZstdDecoder need lifetime
+    // argument, and we use `spawn_blocking` in `Decoder::poll_next` that require `FnOnce() -> R + Send + 'static`
+    #[cfg(feature = "compress-zstd")]
+    Zstd(Box<ZstdDecoder<'static, Writer>>),
 }
 
 impl ContentDecoder {
     fn feed_eof(&mut self) -> io::Result<Option<Bytes>> {
         match self {
+            #[cfg(feature = "compress-brotli")]
             ContentDecoder::Br(ref mut decoder) => match decoder.flush() {
                 Ok(()) => {
                     let b = decoder.get_mut().take();
+
                     if !b.is_empty() {
                         Ok(Some(b))
                     } else {
@@ -154,7 +186,23 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
+
+            #[cfg(feature = "compress-gzip")]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.try_finish() {
+                Ok(_) => {
+                    let b = decoder.get_mut().take();
+
+                    if !b.is_empty() {
+                        Ok(Some(b))
+                    } else {
+                        Ok(None)
+                    }
+                }
+                Err(e) => Err(e),
+            },
+
+            #[cfg(feature = "compress-gzip")]
+            ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
                     if !b.is_empty() {
@@ -165,7 +213,9 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
+
+            #[cfg(feature = "compress-zstd")]
+            ContentDecoder::Zstd(ref mut decoder) => match decoder.flush() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
                     if !b.is_empty() {
@@ -181,10 +231,12 @@ impl ContentDecoder {
 
     fn feed_data(&mut self, data: Bytes) -> io::Result<Option<Bytes>> {
         match self {
+            #[cfg(feature = "compress-brotli")]
             ContentDecoder::Br(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
                     let b = decoder.get_mut().take();
+
                     if !b.is_empty() {
                         Ok(Some(b))
                     } else {
@@ -193,9 +245,27 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
+
+            #[cfg(feature = "compress-gzip")]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
+                    let b = decoder.get_mut().take();
+
+                    if !b.is_empty() {
+                        Ok(Some(b))
+                    } else {
+                        Ok(None)
+                    }
+                }
+                Err(e) => Err(e),
+            },
+
+            #[cfg(feature = "compress-gzip")]
+            ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
+                Ok(_) => {
+                    decoder.flush()?;
+
                     let b = decoder.get_mut().take();
                     if !b.is_empty() {
                         Ok(Some(b))
@@ -205,9 +275,12 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
+
+            #[cfg(feature = "compress-zstd")]
+            ContentDecoder::Zstd(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
+
                     let b = decoder.get_mut().take();
                     if !b.is_empty() {
                         Ok(Some(b))

actix-http/src/encoding/encoder.rs

@@ -1,24 +1,41 @@
-//! Stream encoder
+//! Stream encoders.
-use std::future::Future;
-use std::io::{self, Write};
-use std::pin::Pin;
-use std::task::{Context, Poll};
 
-use actix_threadpool::{run, CpuFuture};
+use std::{
-use brotli2::write::BrotliEncoder;
+    error::Error as StdError,
+    future::Future,
+    io::{self, Write as _},
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use actix_rt::task::{spawn_blocking, JoinHandle};
 use bytes::Bytes;
-use flate2::write::{GzEncoder, ZlibEncoder};
+use derive_more::Display;
 use futures_core::ready;
 use pin_project::pin_project;
 
-use crate::body::{Body, BodySize, MessageBody, ResponseBody};
+#[cfg(feature = "compress-brotli")]
-use crate::http::header::{ContentEncoding, CONTENT_ENCODING};
+use brotli2::write::BrotliEncoder;
-use crate::http::{HeaderValue, StatusCode};
+
-use crate::{Error, ResponseHead};
+#[cfg(feature = "compress-gzip")]
+use flate2::write::{GzEncoder, ZlibEncoder};
+
+#[cfg(feature = "compress-zstd")]
+use zstd::stream::write::Encoder as ZstdEncoder;
+
+use crate::{
+    body::{Body, BodySize, BoxAnyBody, MessageBody, ResponseBody},
+    http::{
+        header::{ContentEncoding, CONTENT_ENCODING},
+        HeaderValue, StatusCode,
+    },
+    Error, ResponseHead,
+};
 
 use super::Writer;
+use crate::error::BlockingError;
 
-const INPLACE: usize = 1024;
+const MAX_CHUNK_SIZE_ENCODE_IN_PLACE: usize = 1024;
 
 #[pin_project]
 pub struct Encoder<B> {
@@ -26,7 +43,7 @@ pub struct Encoder<B> {
     #[pin]
     body: EncoderBody<B>,
     encoder: Option<ContentEncoder>,
-    fut: Option<CpuFuture<ContentEncoder, io::Error>>,
+    fut: Option<JoinHandle<Result<ContentEncoder, io::Error>>>,
 }
 
 impl<B: MessageBody> Encoder<B> {
@@ -70,6 +87,7 @@ impl<B: MessageBody> Encoder<B> {
                 });
             }
         }
+
         ResponseBody::Body(Encoder {
             body,
             eof: false,
@@ -83,10 +101,16 @@ impl<B: MessageBody> Encoder<B> {
 enum EncoderBody<B> {
     Bytes(Bytes),
     Stream(#[pin] B),
-    BoxedStream(Box<dyn MessageBody + Unpin>),
+    BoxedStream(BoxAnyBody),
 }
 
-impl<B: MessageBody> MessageBody for EncoderBody<B> {
+impl<B> MessageBody for EncoderBody<B>
+where
+    B: MessageBody,
+    B::Error: Into<Error>,
+{
+    type Error = EncoderError<B::Error>;
+
     fn size(&self) -> BodySize {
         match self {
             EncoderBody::Bytes(ref b) => b.size(),
@@ -98,7 +122,7 @@ impl<B: MessageBody> MessageBody for EncoderBody<B> {
     fn poll_next(
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
         match self.project() {
             EncoderBodyProj::Bytes(b) => {
                 if b.is_empty() {
@@ -107,15 +131,30 @@ impl<B: MessageBody> MessageBody for EncoderBody<B> {
                     Poll::Ready(Some(Ok(std::mem::take(b))))
                 }
             }
-            EncoderBodyProj::Stream(b) => b.poll_next(cx),
+            // TODO: MSRV 1.51: poll_map_err
+            EncoderBodyProj::Stream(b) => match ready!(b.poll_next(cx)) {
+                Some(Err(err)) => Poll::Ready(Some(Err(EncoderError::Body(err)))),
+                Some(Ok(val)) => Poll::Ready(Some(Ok(val))),
+                None => Poll::Ready(None),
+            },
             EncoderBodyProj::BoxedStream(ref mut b) => {
-                Pin::new(b.as_mut()).poll_next(cx)
+                match ready!(b.as_pin_mut().poll_next(cx)) {
+                    Some(Err(err)) => Poll::Ready(Some(Err(EncoderError::Boxed(err)))),
+                    Some(Ok(val)) => Poll::Ready(Some(Ok(val))),
+                    None => Poll::Ready(None),
+                }
             }
         }
     }
 }
 
-impl<B: MessageBody> MessageBody for Encoder<B> {
+impl<B> MessageBody for Encoder<B>
+where
+    B: MessageBody,
+    B::Error: Into<Error>,
+{
+    type Error = EncoderError<B::Error>;
+
     fn size(&self) -> BodySize {
         if self.encoder.is_none() {
             self.body.size()
@@ -127,7 +166,7 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
     fn poll_next(
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
         let mut this = self.project();
         loop {
             if *this.eof {
@@ -135,32 +174,36 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
             }
 
             if let Some(ref mut fut) = this.fut {
-                let mut encoder = match ready!(Pin::new(fut).poll(cx)) {
+                let mut encoder = ready!(Pin::new(fut).poll(cx))
-                    Ok(item) => item,
+                    .map_err(|_| EncoderError::Blocking(BlockingError))?
-                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
+                    .map_err(EncoderError::Io)?;
-                };
+
                 let chunk = encoder.take();
                 *this.encoder = Some(encoder);
                 this.fut.take();
+
                 if !chunk.is_empty() {
                     return Poll::Ready(Some(Ok(chunk)));
                 }
             }
 
-            let result = this.body.as_mut().poll_next(cx);
+            let result = ready!(this.body.as_mut().poll_next(cx));
 
             match result {
-                Poll::Ready(Some(Ok(chunk))) => {
+                Some(Err(err)) => return Poll::Ready(Some(Err(err))),
+
+                Some(Ok(chunk)) => {
                     if let Some(mut encoder) = this.encoder.take() {
-                        if chunk.len() < INPLACE {
+                        if chunk.len() < MAX_CHUNK_SIZE_ENCODE_IN_PLACE {
-                            encoder.write(&chunk)?;
+                            encoder.write(&chunk).map_err(EncoderError::Io)?;
                             let chunk = encoder.take();
                             *this.encoder = Some(encoder);
+
                             if !chunk.is_empty() {
                                 return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
-                            *this.fut = Some(run(move || {
+                            *this.fut = Some(spawn_blocking(move || {
                                 encoder.write(&chunk)?;
                                 Ok(encoder)
                             }));
@@ -169,9 +212,10 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
                         return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Poll::Ready(None) => {
+
+                None => {
                     if let Some(encoder) = this.encoder.take() {
-                        let chunk = encoder.finish()?;
+                        let chunk = encoder.finish().map_err(EncoderError::Io)?;
                         if chunk.is_empty() {
                             return Poll::Ready(None);
                         } else {
@@ -182,7 +226,6 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
                         return Poll::Ready(None);
                     }
                 }
-                val => return val,
             }
         }
     }
@@ -196,25 +239,40 @@ fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) {
 }
 
 enum ContentEncoder {
+    #[cfg(feature = "compress-gzip")]
     Deflate(ZlibEncoder<Writer>),
+    #[cfg(feature = "compress-gzip")]
     Gzip(GzEncoder<Writer>),
+    #[cfg(feature = "compress-brotli")]
     Br(BrotliEncoder<Writer>),
+    // We need explicit 'static lifetime here because ZstdEncoder need lifetime
+    // argument, and we use `spawn_blocking` in `Encoder::poll_next` that require `FnOnce() -> R + Send + 'static`
+    #[cfg(feature = "compress-zstd")]
+    Zstd(ZstdEncoder<'static, Writer>),
 }
 
 impl ContentEncoder {
     fn encoder(encoding: ContentEncoding) -> Option<Self> {
         match encoding {
+            #[cfg(feature = "compress-gzip")]
             ContentEncoding::Deflate => Some(ContentEncoder::Deflate(ZlibEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoding::Gzip => Some(ContentEncoder::Gzip(GzEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
+            #[cfg(feature = "compress-brotli")]
             ContentEncoding::Br => {
                 Some(ContentEncoder::Br(BrotliEncoder::new(Writer::new(), 3)))
             }
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoding::Zstd => {
+                let encoder = ZstdEncoder::new(Writer::new(), 3).ok()?;
+                Some(ContentEncoder::Zstd(encoder))
+            }
             _ => None,
         }
     }
@@ -222,31 +280,45 @@ impl ContentEncoder {
     #[inline]
     pub(crate) fn take(&mut self) -> Bytes {
         match *self {
+            #[cfg(feature = "compress-brotli")]
             ContentEncoder::Br(ref mut encoder) => encoder.get_mut().take(),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Deflate(ref mut encoder) => encoder.get_mut().take(),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Gzip(ref mut encoder) => encoder.get_mut().take(),
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoder::Zstd(ref mut encoder) => encoder.get_mut().take(),
         }
     }
 
     fn finish(self) -> Result<Bytes, io::Error> {
         match self {
+            #[cfg(feature = "compress-brotli")]
             ContentEncoder::Br(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Gzip(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Deflate(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoder::Zstd(encoder) => match encoder.finish() {
+                Ok(writer) => Ok(writer.buf.freeze()),
+                Err(err) => Err(err),
+            },
         }
     }
 
     fn write(&mut self, data: &[u8]) -> Result<(), io::Error> {
         match *self {
+            #[cfg(feature = "compress-brotli")]
             ContentEncoder::Br(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -254,6 +326,7 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Gzip(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -261,6 +334,7 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Deflate(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -268,6 +342,47 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoder::Zstd(ref mut encoder) => match encoder.write_all(data) {
+                Ok(_) => Ok(()),
+                Err(err) => {
+                    trace!("Error decoding ztsd encoding: {}", err);
+                    Err(err)
+                }
+            },
         }
     }
 }
+
+#[derive(Debug, Display)]
+#[non_exhaustive]
+pub enum EncoderError<E> {
+    #[display(fmt = "body")]
+    Body(E),
+
+    #[display(fmt = "boxed")]
+    Boxed(Box<dyn StdError>),
+
+    #[display(fmt = "blocking")]
+    Blocking(BlockingError),
+
+    #[display(fmt = "io")]
+    Io(io::Error),
+}
+
+impl<E: StdError + 'static> StdError for EncoderError<E> {
+    fn source(&self) -> Option<&(dyn StdError + 'static)> {
+        match self {
+            EncoderError::Body(err) => Some(err),
+            EncoderError::Boxed(err) => Some(&**err),
+            EncoderError::Blocking(err) => Some(err),
+            EncoderError::Io(err) => Some(err),
+        }
+    }
+}
+
+impl<E: StdError + 'static> From<EncoderError<E>> for crate::Error {
+    fn from(err: EncoderError<E>) -> Self {
+        crate::Error::new_encoder().with_cause(err)
+    }
+}

actix-http/src/encoding/mod.rs

@@ -1,4 +1,5 @@
-//! Content-Encoding support
+//! Content-Encoding support.
+
 use std::io;
 
 use bytes::{Bytes, BytesMut};

actix-http/src/extensions.rs

@@ -1,62 +1,119 @@
-use std::any::{Any, TypeId};
+use std::{
-use std::{fmt, mem};
+    any::{Any, TypeId},
+    fmt, mem,
+};
 
-use fxhash::FxHashMap;
+use ahash::AHashMap;
 
-/// A type map of request extensions.
+/// A type map for request extensions.
+///
+/// All entries into this map must be owned types (or static references).
 #[derive(Default)]
 pub struct Extensions {
     /// Use FxHasher with a std HashMap with for faster
     /// lookups on the small `TypeId` (u64 equivalent) keys.
-    map: FxHashMap<TypeId, Box<dyn Any>>,
+    map: AHashMap<TypeId, Box<dyn Any>>,
 }
 
 impl Extensions {
-    /// Create an empty `Extensions`.
+    /// Creates an empty `Extensions`.
     #[inline]
     pub fn new() -> Extensions {
         Extensions {
-            map: FxHashMap::default(),
+            map: AHashMap::default(),
         }
     }
 
-    /// Insert a type into this `Extensions`.
+    /// Insert an item into the map.
     ///
-    /// If a extension of this type already existed, it will
+    /// If an item of this type was already stored, it will be replaced and returned.
-    /// be returned.
+    ///
-    pub fn insert<T: 'static>(&mut self, val: T) {
+    /// ```
-        self.map.insert(TypeId::of::<T>(), Box::new(val));
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    /// assert_eq!(map.insert(""), None);
+    /// assert_eq!(map.insert(1u32), None);
+    /// assert_eq!(map.insert(2u32), Some(1u32));
+    /// assert_eq!(*map.get::<u32>().unwrap(), 2u32);
+    /// ```
+    pub fn insert<T: 'static>(&mut self, val: T) -> Option<T> {
+        self.map
+            .insert(TypeId::of::<T>(), Box::new(val))
+            .and_then(downcast_owned)
     }
 
-    /// Check if container contains entry
+    /// Check if map contains an item of a given type.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    /// assert!(!map.contains::<u32>());
+    ///
+    /// assert_eq!(map.insert(1u32), None);
+    /// assert!(map.contains::<u32>());
+    /// ```
     pub fn contains<T: 'static>(&self) -> bool {
         self.map.contains_key(&TypeId::of::<T>())
     }
 
-    /// Get a reference to a type previously inserted on this `Extensions`.
+    /// Get a reference to an item of a given type.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    /// map.insert(1u32);
+    /// assert_eq!(map.get::<u32>(), Some(&1u32));
+    /// ```
     pub fn get<T: 'static>(&self) -> Option<&T> {
         self.map
             .get(&TypeId::of::<T>())
             .and_then(|boxed| boxed.downcast_ref())
     }
 
-    /// Get a mutable reference to a type previously inserted on this `Extensions`.
+    /// Get a mutable reference to an item of a given type.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    /// map.insert(1u32);
+    /// assert_eq!(map.get_mut::<u32>(), Some(&mut 1u32));
+    /// ```
     pub fn get_mut<T: 'static>(&mut self) -> Option<&mut T> {
         self.map
             .get_mut(&TypeId::of::<T>())
             .and_then(|boxed| boxed.downcast_mut())
     }
 
-    /// Remove a type from this `Extensions`.
+    /// Remove an item from the map of a given type.
     ///
-    /// If a extension of this type existed, it will be returned.
+    /// If an item of this type was already stored, it will be returned.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    ///
+    /// map.insert(1u32);
+    /// assert_eq!(map.get::<u32>(), Some(&1u32));
+    ///
+    /// assert_eq!(map.remove::<u32>(), Some(1u32));
+    /// assert!(!map.contains::<u32>());
+    /// ```
     pub fn remove<T: 'static>(&mut self) -> Option<T> {
-        self.map
+        self.map.remove(&TypeId::of::<T>()).and_then(downcast_owned)
-            .remove(&TypeId::of::<T>())
-            .and_then(|boxed| boxed.downcast().ok().map(|boxed| *boxed))
     }
 
     /// Clear the `Extensions` of all inserted extensions.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    ///
+    /// map.insert(1u32);
+    /// assert!(map.contains::<u32>());
+    ///
+    /// map.clear();
+    /// assert!(!map.contains::<u32>());
+    /// ```
     #[inline]
     pub fn clear(&mut self) {
         self.map.clear();
@@ -79,6 +136,10 @@ impl fmt::Debug for Extensions {
     }
 }
 
+fn downcast_owned<T: 'static>(boxed: Box<dyn Any>) -> Option<T> {
+    boxed.downcast().ok().map(|boxed| *boxed)
+}
+
 #[cfg(test)]
 mod tests {
     use super::*;

actix-http/src/h1/client.rs

@@ -223,15 +223,3 @@ impl Encoder<Message<(RequestHeadType, BodySize)>> for ClientCodec {
         Ok(())
     }
 }
-
-pub struct Writer<'a>(pub &'a mut BytesMut);
-
-impl<'a> io::Write for Writer<'a> {
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.0.extend_from_slice(buf);
-        Ok(buf.len())
-    }
-    fn flush(&mut self) -> io::Result<()> {
-        Ok(())
-    }
-}

actix-http/src/h1/codec.rs

@@ -199,10 +199,10 @@ mod tests {
     use http::Method;
 
     use super::*;
-    use crate::httpmessage::HttpMessage;
+    use crate::HttpMessage;
 
-    #[test]
+    #[actix_rt::test]
-    fn test_http_request_chunked_payload_and_next_message() {
+    async fn test_http_request_chunked_payload_and_next_message() {
         let mut codec = Codec::default();
 
         let mut buf = BytesMut::from(

actix-http/src/h1/decoder.rs

@@ -14,7 +14,7 @@ use crate::header::HeaderMap;
 use crate::message::{ConnectionType, ResponseHead};
 use crate::request::Request;
 
-const MAX_BUFFER_SIZE: usize = 131_072;
+pub(crate) const MAX_BUFFER_SIZE: usize = 131_072;
 const MAX_HEADERS: usize = 96;
 
 /// Incoming message decoder
@@ -203,7 +203,15 @@ impl MessageType for Request {
 
                     (len, method, uri, version, req.headers.len())
                 }
-                httparse::Status::Partial => return Ok(None),
+                httparse::Status::Partial => {
+                    return if src.len() >= MAX_BUFFER_SIZE {
+                        trace!("MAX_BUFFER_SIZE unprocessed data reached, closing");
+                        Err(ParseError::TooLarge)
+                    } else {
+                        // Return None to notify more read are needed for parsing request
+                        Ok(None)
+                    };
+                }
             }
         };
 
@@ -216,15 +224,12 @@ impl MessageType for Request {
         let decoder = match length {
             PayloadLength::Payload(pl) => pl,
             PayloadLength::UpgradeWebSocket => {
-                // upgrade(websocket)
+                // upgrade (WebSocket)
                 PayloadType::Stream(PayloadDecoder::eof())
             }
             PayloadLength::None => {
                 if method == Method::CONNECT {
                     PayloadType::Stream(PayloadDecoder::eof())
-                } else if src.len() >= MAX_BUFFER_SIZE {
-                    trace!("MAX_BUFFER_SIZE unprocessed data reached, closing");
-                    return Err(ParseError::TooLarge);
                 } else {
                     PayloadType::None
                 }
@@ -273,7 +278,14 @@ impl MessageType for ResponseHead {
 
                     (len, version, status, res.headers.len())
                 }
-                httparse::Status::Partial => return Ok(None),
+                httparse::Status::Partial => {
+                    return if src.len() >= MAX_BUFFER_SIZE {
+                        error!("MAX_BUFFER_SIZE unprocessed data reached, closing");
+                        Err(ParseError::TooLarge)
+                    } else {
+                        Ok(None)
+                    }
+                }
             }
         };
 
@@ -289,9 +301,6 @@ impl MessageType for ResponseHead {
         } else if status == StatusCode::SWITCHING_PROTOCOLS {
             // switching protocol or connect
             PayloadType::Stream(PayloadDecoder::eof())
-        } else if src.len() >= MAX_BUFFER_SIZE {
-            error!("MAX_BUFFER_SIZE unprocessed data reached, closing");
-            return Err(ParseError::TooLarge);
         } else {
             // for HTTP/1.0 read to eof and close connection
             if msg.version == Version::HTTP_10 {
@@ -643,7 +652,7 @@ mod tests {
     use super::*;
     use crate::error::ParseError;
     use crate::http::header::{HeaderName, SET_COOKIE};
-    use crate::httpmessage::HttpMessage;
+    use crate::HttpMessage;
 
     impl PayloadType {
         fn unwrap(self) -> PayloadDecoder {
@@ -821,8 +830,8 @@ mod tests {
             .get_all(SET_COOKIE)
             .map(|v| v.to_str().unwrap().to_owned())
             .collect();
-        assert_eq!(val[1], "c1=cookie1");
+        assert_eq!(val[0], "c1=cookie1");
-        assert_eq!(val[0], "c2=cookie2");
+        assert_eq!(val[1], "c2=cookie2");
     }
 
     #[test]
@@ -1204,8 +1213,9 @@ mod tests {
     #[test]
     fn test_parse_chunked_payload_chunk_extension() {
         let mut buf = BytesMut::from(
-            &"GET /test HTTP/1.1\r\n\
+            "GET /test HTTP/1.1\r\n\
-              transfer-encoding: chunked\r\n\r\n"[..],
+            transfer-encoding: chunked\r\n\
+            \r\n",
         );
 
         let mut reader = MessageDecoder::<Request>::default();
@@ -1224,7 +1234,7 @@ mod tests {
 
     #[test]
     fn test_response_http10_read_until_eof() {
-        let mut buf = BytesMut::from(&"HTTP/1.0 200 Ok\r\n\r\ntest data"[..]);
+        let mut buf = BytesMut::from("HTTP/1.0 200 Ok\r\n\r\ntest data");
 
         let mut reader = MessageDecoder::<ResponseHead>::default();
         let (_msg, pl) = reader.decode(&mut buf).unwrap().unwrap();

actix-http/src/h1/encoder.rs

@@ -6,14 +6,15 @@ use std::{cmp, io};
 
 use bytes::{BufMut, BytesMut};
 
-use crate::body::BodySize;
+use crate::{
-use crate::config::ServiceConfig;
+    body::BodySize,
-use crate::header::map;
+    config::ServiceConfig,
-use crate::helpers;
+    header::{map::Value, HeaderMap, HeaderName},
-use crate::http::header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
+    header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING},
-use crate::http::{HeaderMap, StatusCode, Version};
+    helpers,
-use crate::message::{ConnectionType, RequestHeadType};
+    message::{ConnectionType, RequestHeadType},
-use crate::response::Response;
+    Response, StatusCode, Version,
+};
 
 const AVERAGE_HEADER_SIZE: usize = 30;
 
@@ -121,21 +122,11 @@ pub(crate) trait MessageType: Sized {
             _ => {}
         }
 
-        // merging headers from head and extra headers. HeaderMap::new() does not allocate.
-        let empty_headers = HeaderMap::new();
-        let extra_headers = self.extra_headers().unwrap_or(&empty_headers);
-        let headers = self
-            .headers()
-            .inner
-            .iter()
-            .filter(|(name, _)| !extra_headers.contains_key(*name))
-            .chain(extra_headers.inner.iter());
-
         // write headers
 
         let mut has_date = false;
 
-        let mut buf = dst.chunk_mut().as_mut_ptr() as *mut u8;
+        let mut buf = dst.chunk_mut().as_mut_ptr();
         let mut remaining = dst.capacity() - dst.len();
 
         // tracks bytes written since last buffer resize
@@ -143,10 +134,10 @@ pub(crate) trait MessageType: Sized {
         // container's knowledge, this is used to sync the containers cursor after data is written
         let mut pos = 0;
 
-        for (key, value) in headers {
+        self.write_headers(|key, value| {
             match *key {
-                CONNECTION => continue,
+                CONNECTION => return,
-                TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => continue,
+                TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => return,
                 DATE => has_date = true,
                 _ => {}
             }
@@ -154,106 +145,56 @@ pub(crate) trait MessageType: Sized {
             let k = key.as_str().as_bytes();
             let k_len = k.len();
 
-            match value {
+            // TODO: drain?
-                map::Value::One(ref val) => {
+            for val in value.iter() {
-                    let v = val.as_ref();
+                let v = val.as_ref();
-                    let v_len = v.len();
+                let v_len = v.len();
 
-                    // key length + value length + colon + space + \r\n
+                // key length + value length + colon + space + \r\n
-                    let len = k_len + v_len + 4;
+                let len = k_len + v_len + 4;
 
-                    if len > remaining {
+                if len > remaining {
-                        // not enough room in buffer for this header; reserve more space
+                    // SAFETY: all the bytes written up to position "pos" are initialized
-
+                    // the written byte count and pointer advancement are kept in sync
-                        // SAFETY: all the bytes written up to position "pos" are initialized
-                        // the written byte count and pointer advancement are kept in sync
-                        unsafe {
-                            dst.advance_mut(pos);
-                        }
-
-                        pos = 0;
-                        dst.reserve(len * 2);
-                        remaining = dst.capacity() - dst.len();
-
-                        // re-assign buf raw pointer since it's possible that the buffer was
-                        // reallocated and/or resized
-                        buf = dst.chunk_mut().as_mut_ptr() as *mut u8;
-                    }
-
-                    // SAFETY: on each write, it is enough to ensure that the advancement of the
-                    // cursor matches the number of bytes written
                     unsafe {
-                        // use upper Camel-Case
+                        dst.advance_mut(pos);
-                        if camel_case {
-                            write_camel_case(k, from_raw_parts_mut(buf, k_len))
-                        } else {
-                            write_data(k, buf, k_len)
-                        }
-
-                        buf = buf.add(k_len);
-
-                        write_data(b": ", buf, 2);
-                        buf = buf.add(2);
-
-                        write_data(v, buf, v_len);
-                        buf = buf.add(v_len);
-
-                        write_data(b"\r\n", buf, 2);
-                        buf = buf.add(2);
                     }
 
-                    pos += len;
+                    pos = 0;
-                    remaining -= len;
+                    dst.reserve(len * 2);
+                    remaining = dst.capacity() - dst.len();
+
+                    // re-assign buf raw pointer since it's possible that the buffer was
+                    // reallocated and/or resized
+                    buf = dst.chunk_mut().as_mut_ptr();
                 }
 
-                map::Value::Multi(ref vec) => {
+                // SAFETY: on each write, it is enough to ensure that the advancement of
-                    for val in vec {
+                // the cursor matches the number of bytes written
-                        let v = val.as_ref();
+                unsafe {
-                        let v_len = v.len();
+                    if camel_case {
-                        let len = k_len + v_len + 4;
+                        // use Camel-Case headers
-
+                        write_camel_case(k, from_raw_parts_mut(buf, k_len));
-                        if len > remaining {
+                    } else {
-                            // SAFETY: all the bytes written up to position "pos" are initialized
+                        write_data(k, buf, k_len);
-                            // the written byte count and pointer advancement are kept in sync
-                            unsafe {
-                                dst.advance_mut(pos);
-                            }
-                            pos = 0;
-                            dst.reserve(len * 2);
-                            remaining = dst.capacity() - dst.len();
-
-                            // re-assign buf raw pointer since it's possible that the buffer was
-                            // reallocated and/or resized
-                            buf = dst.chunk_mut().as_mut_ptr() as *mut u8;
-                        }
-
-                        // SAFETY: on each write, it is enough to ensure that the advancement of
-                        // the cursor matches the number of bytes written
-                        unsafe {
-                            if camel_case {
-                                write_camel_case(k, from_raw_parts_mut(buf, k_len));
-                            } else {
-                                write_data(k, buf, k_len);
-                            }
-
-                            buf = buf.add(k_len);
-
-                            write_data(b": ", buf, 2);
-                            buf = buf.add(2);
-
-                            write_data(v, buf, v_len);
-                            buf = buf.add(v_len);
-
-                            write_data(b"\r\n", buf, 2);
-                            buf = buf.add(2);
-                        };
-
-                        pos += len;
-                        remaining -= len;
                     }
-                }
+
+                    buf = buf.add(k_len);
+
+                    write_data(b": ", buf, 2);
+                    buf = buf.add(2);
+
+                    write_data(v, buf, v_len);
+                    buf = buf.add(v_len);
+
+                    write_data(b"\r\n", buf, 2);
+                    buf = buf.add(2);
+                };
+
+                pos += len;
+                remaining -= len;
             }
-        }
+        });
 
         // final cursor synchronization with the bytes container
         //
@@ -273,6 +214,24 @@ pub(crate) trait MessageType: Sized {
 
         Ok(())
     }
+
+    fn write_headers<F>(&mut self, mut f: F)
+    where
+        F: FnMut(&HeaderName, &Value),
+    {
+        match self.extra_headers() {
+            Some(headers) => {
+                // merging headers from head and extra headers.
+                self.headers()
+                    .inner
+                    .iter()
+                    .filter(|(name, _)| !headers.contains_key(*name))
+                    .chain(headers.inner.iter())
+                    .for_each(|(k, v)| f(k, v))
+            }
+            None => self.headers().inner.iter().for_each(|(k, v)| f(k, v)),
+        }
+    }
 }
 
 impl MessageType for Response<()> {
@@ -329,7 +288,7 @@ impl MessageType for RequestHeadType {
         let head = self.as_ref();
         dst.reserve(256 + head.headers.len() * AVERAGE_HEADER_SIZE);
         write!(
-            Writer(dst),
+            helpers::MutWriter(dst),
             "{} {} {}",
             head.method,
             head.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
@@ -462,7 +421,7 @@ impl TransferEncoding {
                     *eof = true;
                     buf.extend_from_slice(b"0\r\n\r\n");
                 } else {
-                    writeln!(Writer(buf), "{:X}\r", msg.len())
+                    writeln!(helpers::MutWriter(buf), "{:X}\r", msg.len())
                         .map_err(|e| io::Error::new(io::ErrorKind::Other, e))?;
 
                     buf.reserve(msg.len() + 2);
@@ -512,18 +471,6 @@ impl TransferEncoding {
     }
 }
 
-struct Writer<'a>(pub &'a mut BytesMut);
-
-impl<'a> io::Write for Writer<'a> {
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.0.extend_from_slice(buf);
-        Ok(buf.len())
-    }
-    fn flush(&mut self) -> io::Result<()> {
-        Ok(())
-    }
-}
-
 /// # Safety
 /// Callers must ensure that the given length matches given value length.
 unsafe fn write_data(value: &[u8], buf: *mut u8, len: usize) {
@@ -583,8 +530,8 @@ mod tests {
         );
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_camel_case() {
+    async fn test_camel_case() {
         let mut bytes = BytesMut::with_capacity(2048);
         let mut head = RequestHead::default();
         head.set_camel_case_headers(true);
@@ -603,7 +550,6 @@ mod tests {
         );
         let data =
             String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
-        eprintln!("{}", &data);
 
         assert!(data.contains("Content-Length: 0\r\n"));
         assert!(data.contains("Connection: close\r\n"));
@@ -647,8 +593,8 @@ mod tests {
         assert!(data.contains("date: date\r\n"));
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_extra_headers() {
+    async fn test_extra_headers() {
         let mut bytes = BytesMut::with_capacity(2048);
 
         let mut head = RequestHead::default();
@@ -681,16 +627,14 @@ mod tests {
         assert!(data.contains("date: date\r\n"));
     }
 
-    #[test]
+    #[actix_rt::test]
-    fn test_no_content_length() {
+    async fn test_no_content_length() {
         let mut bytes = BytesMut::with_capacity(2048);
 
-        let mut res: Response<()> =
+        let mut res = Response::with_body(StatusCode::SWITCHING_PROTOCOLS, ());
-            Response::new(StatusCode::SWITCHING_PROTOCOLS).into_body::<()>();
+        res.headers_mut().insert(DATE, HeaderValue::from_static(""));
         res.headers_mut()
-            .insert(DATE, HeaderValue::from_static(&""));
+            .insert(CONTENT_LENGTH, HeaderValue::from_static("0"));
-        res.headers_mut()
-            .insert(CONTENT_LENGTH, HeaderValue::from_static(&"0"));
 
         let _ = res.encode_headers(
             &mut bytes,

actix-http/src/h1/expect.rs

@@ -1,7 +1,5 @@
-use std::task::{Context, Poll};
-
 use actix_service::{Service, ServiceFactory};
-use futures_util::future::{ready, Ready};
+use actix_utils::future::{ready, Ready};
 
 use crate::error::Error;
 use crate::request::Request;
@@ -26,11 +24,9 @@ impl Service<Request> for ExpectHandler {
     type Error = Error;
     type Future = Ready<Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+    actix_service::always_ready!();
-        Poll::Ready(Ok(()))
-    }
 
-    fn call(&mut self, req: Request) -> Self::Future {
+    fn call(&self, req: Request) -> Self::Future {
         ready(Ok(req))
         // TODO: add some way to trigger error
         // Err(error::ErrorExpectationFailed("test"))

actix-http/src/h1/mod.rs

@@ -1,4 +1,4 @@
-//! HTTP/1 implementation
+//! HTTP/1 protocol implementation.
 use bytes::{Bytes, BytesMut};
 
 mod client;

actix-http/src/h1/payload.rs

@@ -3,9 +3,8 @@ use std::cell::RefCell;
 use std::collections::VecDeque;
 use std::pin::Pin;
 use std::rc::{Rc, Weak};
-use std::task::{Context, Poll};
+use std::task::{Context, Poll, Waker};
 
-use actix_utils::task::LocalWaker;
 use bytes::Bytes;
 use futures_core::Stream;
 
@@ -134,7 +133,7 @@ impl PayloadSender {
             if shared.borrow().need_read {
                 PayloadStatus::Read
             } else {
-                shared.borrow_mut().io_task.register(cx.waker());
+                shared.borrow_mut().register_io(cx);
                 PayloadStatus::Pause
             }
         } else {
@@ -150,8 +149,8 @@ struct Inner {
     err: Option<PayloadError>,
     need_read: bool,
     items: VecDeque<Bytes>,
-    task: LocalWaker,
+    task: Option<Waker>,
-    io_task: LocalWaker,
+    io_task: Option<Waker>,
 }
 
 impl Inner {
@@ -162,8 +161,48 @@ impl Inner {
             err: None,
             items: VecDeque::new(),
             need_read: true,
-            task: LocalWaker::new(),
+            task: None,
-            io_task: LocalWaker::new(),
+            io_task: None,
+        }
+    }
+
+    /// Wake up future waiting for payload data to be available.
+    fn wake(&mut self) {
+        if let Some(waker) = self.task.take() {
+            waker.wake();
+        }
+    }
+
+    /// Wake up future feeding data to Payload.
+    fn wake_io(&mut self) {
+        if let Some(waker) = self.io_task.take() {
+            waker.wake();
+        }
+    }
+
+    /// Register future waiting data from payload.
+    /// Waker would be used in `Inner::wake`
+    fn register(&mut self, cx: &mut Context<'_>) {
+        if self
+            .task
+            .as_ref()
+            .map(|w| !cx.waker().will_wake(w))
+            .unwrap_or(true)
+        {
+            self.task = Some(cx.waker().clone());
+        }
+    }
+
+    // Register future feeding data to payload.
+    /// Waker would be used in `Inner::wake_io`
+    fn register_io(&mut self, cx: &mut Context<'_>) {
+        if self
+            .io_task
+            .as_ref()
+            .map(|w| !cx.waker().will_wake(w))
+            .unwrap_or(true)
+        {
+            self.io_task = Some(cx.waker().clone());
         }
     }
 
@@ -182,7 +221,7 @@ impl Inner {
         self.len += data.len();
         self.items.push_back(data);
         self.need_read = self.len < MAX_BUFFER_SIZE;
-        self.task.wake();
+        self.wake();
     }
 
     #[cfg(test)]
@@ -199,9 +238,9 @@ impl Inner {
             self.need_read = self.len < MAX_BUFFER_SIZE;
 
             if self.need_read && !self.eof {
-                self.task.register(cx.waker());
+                self.register(cx);
             }
-            self.io_task.wake();
+            self.wake_io();
             Poll::Ready(Some(Ok(data)))
         } else if let Some(err) = self.err.take() {
             Poll::Ready(Some(Err(err)))
@@ -209,8 +248,8 @@ impl Inner {
             Poll::Ready(None)
         } else {
             self.need_read = true;
-            self.task.register(cx.waker());
+            self.register(cx);
-            self.io_task.wake();
+            self.wake_io();
             Poll::Pending
         }
     }
@@ -224,7 +263,7 @@ impl Inner {
 #[cfg(test)]
 mod tests {
     use super::*;
-    use futures_util::future::poll_fn;
+    use actix_utils::future::poll_fn;
 
     #[actix_rt::test]
     async fn test_unread_data() {

actix-http/src/h1/service.rs

@@ -1,28 +1,29 @@
-use std::cell::RefCell;
+use std::{
-use std::future::Future;
+    error::Error as StdError,
-use std::marker::PhantomData;
+    fmt,
-use std::pin::Pin;
+    marker::PhantomData,
-use std::rc::Rc;
+    net,
-use std::task::{Context, Poll};
+    rc::Rc,
-use std::{fmt, net};
+    task::{Context, Poll},
+};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_rt::net::TcpStream;
-use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
+use actix_service::{
-use futures_core::ready;
+    fn_service, IntoServiceFactory, Service, ServiceFactory, ServiceFactoryExt as _,
-use futures_util::future::ready;
+};
+use actix_utils::future::ready;
+use futures_core::future::LocalBoxFuture;
 
-use crate::body::MessageBody;
+use crate::{
-use crate::config::ServiceConfig;
+    body::{AnyBody, MessageBody},
-use crate::error::{DispatchError, Error};
+    config::ServiceConfig,
-use crate::request::Request;
+    error::DispatchError,
-use crate::response::Response;
+    service::HttpServiceHandler,
-use crate::service::HttpFlow;
+    ConnectCallback, OnConnectData, Request, Response,
-use crate::{ConnectCallback, OnConnectData};
+};
 
-use super::codec::Codec;
+use super::{codec::Codec, dispatcher::Dispatcher, ExpectHandler, UpgradeHandler};
-use super::dispatcher::Dispatcher;
-use super::{ExpectHandler, UpgradeHandler};
 
 /// `ServiceFactory` implementation for HTTP1 transport
 pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler> {
@@ -37,7 +38,7 @@ pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler> {
 impl<T, S, B> H1Service<T, S, B>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error>,
+    S::Error: Into<Response<AnyBody>>,
     S::InitError: fmt::Debug,
     S::Response: Into<Response<B>>,
     B: MessageBody,
@@ -61,15 +62,22 @@ where
 impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error>,
+    S::Future: 'static,
+    S::Error: Into<Response<AnyBody>>,
     S::InitError: fmt::Debug,
     S::Response: Into<Response<B>>,
+
     B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
+
     X: ServiceFactory<Request, Config = (), Response = Request>,
-    X::Error: Into<Error>,
+    X::Future: 'static,
+    X::Error: Into<Response<AnyBody>>,
     X::InitError: fmt::Debug,
+
     U: ServiceFactory<(Request, Framed<TcpStream, Codec>), Config = (), Response = ()>,
-    U::Error: fmt::Display + Into<Error>,
+    U::Future: 'static,
+    U::Error: fmt::Display + Into<Response<AnyBody>>,
     U::InitError: fmt::Debug,
 {
     /// Create simple tcp stream service
@@ -82,7 +90,7 @@ where
         Error = DispatchError,
         InitError = (),
     > {
-        pipeline_factory(|io: TcpStream| {
+        fn_service(|io: TcpStream| {
             let peer_addr = io.peer_addr().ok();
             ready(Ok((io, peer_addr)))
         })
@@ -95,25 +103,34 @@ mod openssl {
     use super::*;
 
     use actix_service::ServiceFactoryExt;
-    use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, SslStream};
+    use actix_tls::accept::{
-    use actix_tls::accept::TlsError;
+        openssl::{Acceptor, SslAcceptor, SslError, TlsStream},
+        TlsError,
+    };
 
-    impl<S, B, X, U> H1Service<SslStream<TcpStream>, S, B, X, U>
+    impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
     where
         S: ServiceFactory<Request, Config = ()>,
-        S::Error: Into<Error>,
+        S::Future: 'static,
+        S::Error: Into<Response<AnyBody>>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
+
         B: MessageBody,
+        B::Error: Into<Box<dyn StdError>>,
+
         X: ServiceFactory<Request, Config = (), Response = Request>,
-        X::Error: Into<Error>,
+        X::Future: 'static,
+        X::Error: Into<Response<AnyBody>>,
         X::InitError: fmt::Debug,
+
         U: ServiceFactory<
-            (Request, Framed<SslStream<TcpStream>, Codec>),
+            (Request, Framed<TlsStream<TcpStream>, Codec>),
             Config = (),
             Response = (),
         >,
-        U::Error: fmt::Display + Into<Error>,
+        U::Future: 'static,
+        U::Error: fmt::Display + Into<Response<AnyBody>>,
         U::InitError: fmt::Debug,
     {
         /// Create openssl based service
@@ -127,16 +144,14 @@ mod openssl {
             Error = TlsError<SslError, DispatchError>,
             InitError = (),
         > {
-            pipeline_factory(
+            Acceptor::new(acceptor)
-                Acceptor::new(acceptor)
+                .map_err(TlsError::Tls)
-                    .map_err(TlsError::Tls)
+                .map_init_err(|_| panic!())
-                    .map_init_err(|_| panic!()),
+                .and_then(|io: TlsStream<TcpStream>| {
-            )
+                    let peer_addr = io.get_ref().peer_addr().ok();
-            .and_then(|io: SslStream<TcpStream>| {
+                    ready(Ok((io, peer_addr)))
-                let peer_addr = io.get_ref().peer_addr().ok();
+                })
-                ready(Ok((io, peer_addr)))
+                .and_then(self.map_err(TlsError::Service))
-            })
-            .and_then(self.map_err(TlsError::Service))
         }
     }
 }
@@ -144,27 +159,38 @@ mod openssl {
 #[cfg(feature = "rustls")]
 mod rustls {
     use super::*;
+
+    use std::io;
+
     use actix_service::ServiceFactoryExt;
-    use actix_tls::accept::rustls::{Acceptor, ServerConfig, TlsStream};
+    use actix_tls::accept::{
-    use actix_tls::accept::TlsError;
+        rustls::{Acceptor, ServerConfig, TlsStream},
-    use std::{fmt, io};
+        TlsError,
+    };
 
     impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
     where
         S: ServiceFactory<Request, Config = ()>,
-        S::Error: Into<Error>,
+        S::Future: 'static,
+        S::Error: Into<Response<AnyBody>>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
+
         B: MessageBody,
+        B::Error: Into<Box<dyn StdError>>,
+
         X: ServiceFactory<Request, Config = (), Response = Request>,
-        X::Error: Into<Error>,
+        X::Future: 'static,
+        X::Error: Into<Response<AnyBody>>,
         X::InitError: fmt::Debug,
+
         U: ServiceFactory<
             (Request, Framed<TlsStream<TcpStream>, Codec>),
             Config = (),
             Response = (),
         >,
-        U::Error: fmt::Display + Into<Error>,
+        U::Future: 'static,
+        U::Error: fmt::Display + Into<Response<AnyBody>>,
         U::InitError: fmt::Debug,
     {
         /// Create rustls based service
@@ -178,16 +204,14 @@ mod rustls {
             Error = TlsError<io::Error, DispatchError>,
             InitError = (),
         > {
-            pipeline_factory(
+            Acceptor::new(config)
-                Acceptor::new(config)
+                .map_err(TlsError::Tls)
-                    .map_err(TlsError::Tls)
+                .map_init_err(|_| panic!())
-                    .map_init_err(|_| panic!()),
+                .and_then(|io: TlsStream<TcpStream>| {
-            )
+                    let peer_addr = io.get_ref().0.peer_addr().ok();
-            .and_then(|io: TlsStream<TcpStream>| {
+                    ready(Ok((io, peer_addr)))
-                let peer_addr = io.get_ref().0.peer_addr().ok();
+                })
-                ready(Ok((io, peer_addr)))
+                .and_then(self.map_err(TlsError::Service))
-            })
-            .and_then(self.map_err(TlsError::Service))
         }
     }
 }
@@ -195,7 +219,7 @@ mod rustls {
 impl<T, S, B, X, U> H1Service<T, S, B, X, U>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error>,
+    S::Error: Into<Response<AnyBody>>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
     B: MessageBody,
@@ -203,7 +227,7 @@ where
     pub fn expect<X1>(self, expect: X1) -> H1Service<T, S, B, X1, U>
     where
         X1: ServiceFactory<Request, Response = Request>,
-        X1::Error: Into<Error>,
+        X1::Error: Into<Response<AnyBody>>,
         X1::InitError: fmt::Debug,
     {
         H1Service {
@@ -242,17 +266,25 @@ where
 impl<T, S, B, X, U> ServiceFactory<(T, Option<net::SocketAddr>)>
     for H1Service<T, S, B, X, U>
 where
-    T: AsyncRead + AsyncWrite + Unpin,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
+
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error>,
+    S::Future: 'static,
+    S::Error: Into<Response<AnyBody>>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
+
     B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
+
     X: ServiceFactory<Request, Config = (), Response = Request>,
-    X::Error: Into<Error>,
+    X::Future: 'static,
+    X::Error: Into<Response<AnyBody>>,
     X::InitError: fmt::Debug,
+
     U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
-    U::Error: fmt::Display + Into<Error>,
+    U::Future: 'static,
+    U::Error: fmt::Display + Into<Response<AnyBody>>,
     U::InitError: fmt::Debug,
 {
     type Response = ();
@@ -260,207 +292,78 @@ where
     type Config = ();
     type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
     type InitError = ();
-    type Future = H1ServiceResponse<T, S, B, X, U>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
-        H1ServiceResponse {
+        let service = self.srv.new_service(());
-            fut: self.srv.new_service(()),
+        let expect = self.expect.new_service(());
-            fut_ex: Some(self.expect.new_service(())),
+        let upgrade = self.upgrade.as_ref().map(|s| s.new_service(()));
-            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
+        let on_connect_ext = self.on_connect_ext.clone();
-            expect: None,
+        let cfg = self.cfg.clone();
-            upgrade: None,
-            on_connect_ext: self.on_connect_ext.clone(),
-            cfg: Some(self.cfg.clone()),
-            _phantom: PhantomData,
-        }
-    }
-}
 
-#[doc(hidden)]
+        Box::pin(async move {
-#[pin_project::pin_project]
+            let expect = expect
-pub struct H1ServiceResponse<T, S, B, X, U>
+                .await
-where
+                .map_err(|e| log::error!("Init http expect service error: {:?}", e))?;
-    S: ServiceFactory<Request>,
-    S::Error: Into<Error>,
-    S::InitError: fmt::Debug,
-    X: ServiceFactory<Request, Response = Request>,
-    X::Error: Into<Error>,
-    X::InitError: fmt::Debug,
-    U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
-    U::InitError: fmt::Debug,
-{
-    #[pin]
-    fut: S::Future,
-    #[pin]
-    fut_ex: Option<X::Future>,
-    #[pin]
-    fut_upg: Option<U::Future>,
-    expect: Option<X::Service>,
-    upgrade: Option<U::Service>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    cfg: Option<ServiceConfig>,
-    _phantom: PhantomData<B>,
-}
 
-impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
+            let upgrade = match upgrade {
-where
+                Some(upgrade) => {
-    T: AsyncRead + AsyncWrite + Unpin,
+                    let upgrade = upgrade.await.map_err(|e| {
-    S: ServiceFactory<Request>,
+                        log::error!("Init http upgrade service error: {:?}", e)
-    S::Error: Into<Error>,
+                    })?;
-    S::Response: Into<Response<B>>,
+                    Some(upgrade)
-    S::InitError: fmt::Debug,
+                }
-    B: MessageBody,
+                None => None,
-    X: ServiceFactory<Request, Response = Request>,
+            };
-    X::Error: Into<Error>,
-    X::InitError: fmt::Debug,
-    U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
-    U::InitError: fmt::Debug,
-{
-    type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
 
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+            let service = service
-        let mut this = self.as_mut().project();
+                .await
+                .map_err(|e| log::error!("Init http service error: {:?}", e))?;
 
-        if let Some(fut) = this.fut_ex.as_pin_mut() {
+            Ok(H1ServiceHandler::new(
-            let expect = ready!(fut
+                cfg,
-                .poll(cx)
-                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
-            this = self.as_mut().project();
-            *this.expect = Some(expect);
-            this.fut_ex.set(None);
-        }
-
-        if let Some(fut) = this.fut_upg.as_pin_mut() {
-            let upgrade = ready!(fut
-                .poll(cx)
-                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
-            this = self.as_mut().project();
-            *this.upgrade = Some(upgrade);
-            this.fut_upg.set(None);
-        }
-
-        let result = ready!(this
-            .fut
-            .poll(cx)
-            .map_err(|e| log::error!("Init http service error: {:?}", e)));
-
-        Poll::Ready(result.map(|service| {
-            let this = self.as_mut().project();
-
-            H1ServiceHandler::new(
-                this.cfg.take().unwrap(),
                 service,
-                this.expect.take().unwrap(),
+                expect,
-                this.upgrade.take(),
+                upgrade,
-                this.on_connect_ext.clone(),
+                on_connect_ext,
-            )
+            ))
-        }))
+        })
     }
 }
 
 /// `Service` implementation for HTTP/1 transport
-pub struct H1ServiceHandler<T, S, B, X, U>
+pub type H1ServiceHandler<T, S, B, X, U> = HttpServiceHandler<T, S, B, X, U>;
-where
-    S: Service<Request>,
-    X: Service<Request>,
-    U: Service<(Request, Framed<T, Codec>)>,
-{
-    flow: Rc<RefCell<HttpFlow<S, X, U>>>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    cfg: ServiceConfig,
-    _phantom: PhantomData<B>,
-}
-
-impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
-where
-    S: Service<Request>,
-    S::Error: Into<Error>,
-    S::Response: Into<Response<B>>,
-    B: MessageBody,
-    X: Service<Request, Response = Request>,
-    X::Error: Into<Error>,
-    U: Service<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
-{
-    fn new(
-        cfg: ServiceConfig,
-        service: S,
-        expect: X,
-        upgrade: Option<U>,
-        on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    ) -> H1ServiceHandler<T, S, B, X, U> {
-        H1ServiceHandler {
-            flow: HttpFlow::new(service, expect, upgrade),
-            cfg,
-            on_connect_ext,
-            _phantom: PhantomData,
-        }
-    }
-}
 
 impl<T, S, B, X, U> Service<(T, Option<net::SocketAddr>)>
-    for H1ServiceHandler<T, S, B, X, U>
+    for HttpServiceHandler<T, S, B, X, U>
 where
     T: AsyncRead + AsyncWrite + Unpin,
+
     S: Service<Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Response<AnyBody>>,
     S::Response: Into<Response<B>>,
+
     B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
+
     X: Service<Request, Response = Request>,
-    X::Error: Into<Error>,
+    X::Error: Into<Response<AnyBody>>,
+
     U: Service<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display + Into<Error>,
+    U::Error: fmt::Display + Into<Response<AnyBody>>,
 {
     type Response = ();
     type Error = DispatchError;
     type Future = Dispatcher<T, S, B, X, U>;
 
-    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+    fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        let mut flow = self.flow.borrow_mut();
+        self._poll_ready(cx).map_err(|e| {
-        let ready = flow
+            log::error!("HTTP/1 service readiness error: {:?}", e);
-            .expect
+            DispatchError::Service(e)
-            .poll_ready(cx)
+        })
-            .map_err(|e| {
-                let e = e.into();
-                log::error!("Http service readiness error: {:?}", e);
-                DispatchError::Service(e)
-            })?
-            .is_ready();
-
-        let ready = flow
-            .service
-            .poll_ready(cx)
-            .map_err(|e| {
-                let e = e.into();
-                log::error!("Http service readiness error: {:?}", e);
-                DispatchError::Service(e)
-            })?
-            .is_ready()
-            && ready;
-
-        let ready = if let Some(ref mut upg) = flow.upgrade {
-            upg.poll_ready(cx)
-                .map_err(|e| {
-                    let e = e.into();
-                    log::error!("Http service readiness error: {:?}", e);
-                    DispatchError::Service(e)
-                })?
-                .is_ready()
-                && ready
-        } else {
-            ready
-        };
-
-        if ready {
-            Poll::Ready(Ok(()))
-        } else {
-            Poll::Pending
-        }
     }
 
-    fn call(&mut self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
+    fn call(&self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
         let on_connect_data =
             OnConnectData::from_io(&io, self.on_connect_ext.as_deref());
 

actix-http/src/h1/upgrade.rs

@@ -1,8 +1,6 @@
-use std::task::{Context, Poll};
-
 use actix_codec::Framed;
 use actix_service::{Service, ServiceFactory};
-use futures_util::future::{ready, Ready};
+use futures_core::future::LocalBoxFuture;
 
 use crate::error::Error;
 use crate::h1::Codec;
@@ -16,7 +14,7 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
     type Config = ();
     type Service = UpgradeHandler;
     type InitError = Error;
-    type Future = Ready<Result<Self::Service, Self::InitError>>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
         unimplemented!()
@@ -26,13 +24,11 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
 impl<T> Service<(Request, Framed<T, Codec>)> for UpgradeHandler {
     type Response = ();
     type Error = Error;
-    type Future = Ready<Result<Self::Response, Self::Error>>;
+    type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+    actix_service::always_ready!();
-        Poll::Ready(Ok(()))
-    }
 
-    fn call(&mut self, _: (Request, Framed<T, Codec>)) -> Self::Future {
+    fn call(&self, _: (Request, Framed<T, Codec>)) -> Self::Future {
-        ready(Ok(()))
+        unimplemented!()
     }
 }

actix-http/src/h1/utils.rs

@@ -4,7 +4,7 @@ use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 
-use crate::body::{BodySize, MessageBody, ResponseBody};
+use crate::body::{BodySize, MessageBody};
 use crate::error::Error;
 use crate::h1::{Codec, Message};
 use crate::response::Response;
@@ -14,7 +14,7 @@ use crate::response::Response;
 pub struct SendResponse<T, B> {
     res: Option<Message<(Response<()>, BodySize)>>,
     #[pin]
-    body: Option<ResponseBody<B>>,
+    body: Option<B>,
     #[pin]
     framed: Option<Framed<T, Codec>>,
 }
@@ -22,6 +22,7 @@ pub struct SendResponse<T, B> {
 impl<T, B> SendResponse<T, B>
 where
     B: MessageBody,
+    B::Error: Into<Error>,
 {
     pub fn new(framed: Framed<T, Codec>, response: Response<B>) -> Self {
         let (res, body) = response.into_parts();
@@ -38,6 +39,7 @@ impl<T, B> Future for SendResponse<T, B>
 where
     T: AsyncRead + AsyncWrite + Unpin,
     B: MessageBody + Unpin,
+    B::Error: Into<Error>,
 {
     type Output = Result<Framed<T, Codec>, Error>;
 
@@ -60,7 +62,18 @@ where
                         .unwrap()
                         .is_write_buf_full()
                 {
-                    match this.body.as_mut().as_pin_mut().unwrap().poll_next(cx)? {
+                    let next =
+                        // TODO: MSRV 1.51: poll_map_err
+                        match this.body.as_mut().as_pin_mut().unwrap().poll_next(cx) {
+                            Poll::Ready(Some(Ok(item))) => Poll::Ready(Some(item)),
+                            Poll::Ready(Some(Err(err))) => {
+                                return Poll::Ready(Err(err.into()))
+                            }
+                            Poll::Ready(None) => Poll::Ready(None),
+                            Poll::Pending => Poll::Pending,
+                        };
+
+                    match next {
                         Poll::Ready(item) => {
                             // body is done when item is None
                             body_done = item.is_none();
@@ -68,7 +81,9 @@ where
                                 let _ = this.body.take();
                             }
                             let framed = this.framed.as_mut().as_pin_mut().unwrap();
-                            framed.write(Message::Chunk(item))?;
+                            framed.write(Message::Chunk(item)).map_err(|err| {
+                                Error::new_send_response().with_cause(err)
+                            })?;
                         }
                         Poll::Pending => body_ready = false,
                     }
@@ -79,7 +94,10 @@ where
 
             // flush write buffer
             if !framed.is_write_buf_empty() {
-                match framed.flush(cx)? {
+                match framed
+                    .flush(cx)
+                    .map_err(|err| Error::new_send_response().with_cause(err))?
+                {
                     Poll::Ready(_) => {
                         if body_ready {
                             continue;
@@ -93,7 +111,9 @@ where
 
             // send response
             if let Some(res) = this.res.take() {
-                framed.write(res)?;
+                framed
+                    .write(res)
+                    .map_err(|err| Error::new_send_response().with_cause(err))?;
                 continue;
             }
 

actix-http/src/h2/dispatcher.rs

@@ -1,92 +1,59 @@
-use std::cell::RefCell;
+use std::{
-use std::future::Future;
+    cmp,
-use std::marker::PhantomData;
+    error::Error as StdError,
-use std::net;
+    future::Future,
-use std::pin::Pin;
+    marker::PhantomData,
-use std::rc::Rc;
+    net,
-use std::task::{Context, Poll};
+    pin::Pin,
-use std::{cmp, convert::TryFrom};
+    rc::Rc,
+    task::{Context, Poll},
+};
 
 use actix_codec::{AsyncRead, AsyncWrite};
-use actix_rt::time::{Instant, Sleep};
 use actix_service::Service;
+use actix_utils::future::poll_fn;
 use bytes::{Bytes, BytesMut};
 use futures_core::ready;
 use h2::server::{Connection, SendResponse};
-use h2::SendStream;
 use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
 use log::{error, trace};
+use pin_project_lite::pin_project;
 
-use crate::body::{BodySize, MessageBody, ResponseBody};
+use crate::{
-use crate::config::ServiceConfig;
+    body::{AnyBody, BodySize, MessageBody},
-use crate::error::{DispatchError, Error};
+    config::ServiceConfig,
-use crate::message::ResponseHead;
+    service::HttpFlow,
-use crate::payload::Payload;
+    OnConnectData, Payload, Request, Response, ResponseHead,
-use crate::request::Request;
+};
-use crate::response::Response;
-use crate::service::HttpFlow;
-use crate::OnConnectData;
 
 const CHUNK_SIZE: usize = 16_384;
 
-/// Dispatcher for HTTP/2 protocol.
+pin_project! {
-#[pin_project::pin_project]
+    /// Dispatcher for HTTP/2 protocol.
-pub struct Dispatcher<T, S, B, X, U>
+    pub struct Dispatcher<T, S, B, X, U> {
-where
+        flow: Rc<HttpFlow<S, X, U>>,
-    T: AsyncRead + AsyncWrite + Unpin,
+        connection: Connection<T, Bytes>,
-    S: Service<Request>,
+        on_connect_data: OnConnectData,
-    B: MessageBody,
+        config: ServiceConfig,
-{
+        peer_addr: Option<net::SocketAddr>,
-    flow: Rc<RefCell<HttpFlow<S, X, U>>>,
+        _phantom: PhantomData<B>,
-    connection: Connection<T, Bytes>,
+    }
-    on_connect_data: OnConnectData,
+}
-    config: ServiceConfig,
+
-    peer_addr: Option<net::SocketAddr>,
+impl<T, S, B, X, U> Dispatcher<T, S, B, X, U> {
-    ka_expire: Instant,
+    pub(crate) fn new(
-    ka_timer: Option<Sleep>,
+        flow: Rc<HttpFlow<S, X, U>>,
-    _phantom: PhantomData<B>,
-}
-
-impl<T, S, B, X, U> Dispatcher<T, S, B, X, U>
-where
-    T: AsyncRead + AsyncWrite + Unpin,
-    S: Service<Request>,
-    S::Error: Into<Error>,
-    S::Response: Into<Response<B>>,
-    B: MessageBody,
-{
-    pub(crate) fn new(
-        services: Rc<RefCell<HttpFlow<S, X, U>>>,
         connection: Connection<T, Bytes>,
         on_connect_data: OnConnectData,
         config: ServiceConfig,
-        timeout: Option<Sleep>,
         peer_addr: Option<net::SocketAddr>,
     ) -> Self {
-        // let keepalive = config.keep_alive_enabled();
+        Self {
-        // let flags = if keepalive {
+            flow,
-        // Flags::KEEPALIVE | Flags::KEEPALIVE_ENABLED
-        // } else {
-        //     Flags::empty()
-        // };
-
-        // keep-alive timer
-        let (ka_expire, ka_timer) = if let Some(delay) = timeout {
-            (delay.deadline(), Some(delay))
-        } else if let Some(delay) = config.keep_alive_timer() {
-            (delay.deadline(), Some(delay))
-        } else {
-            (config.now(), None)
-        };
-
-        Dispatcher {
-            flow: services,
             config,
             peer_addr,
             connection,
             on_connect_data,
-            ka_expire,
-            ka_timer,
             _phantom: PhantomData,
         }
     }
@@ -95,277 +62,208 @@ where
 impl<T, S, B, X, U> Future for Dispatcher<T, S, B, X, U>
 where
     T: AsyncRead + AsyncWrite + Unpin,
+
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>>,
     S::Future: 'static,
-    S::Response: Into<Response<B>> + 'static,
+    S::Response: Into<Response<B>>,
-    B: MessageBody + 'static,
+
+    B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
 {
-    type Output = Result<(), DispatchError>;
+    type Output = Result<(), crate::error::DispatchError>;
 
     #[inline]
     fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
         let this = self.get_mut();
 
-        loop {
+        while let Some((req, tx)) =
-            match ready!(Pin::new(&mut this.connection).poll_accept(cx)) {
+            ready!(Pin::new(&mut this.connection).poll_accept(cx)?)
-                None => return Poll::Ready(Ok(())),
+        {
+            let (parts, body) = req.into_parts();
+            let pl = crate::h2::Payload::new(body);
+            let pl = Payload::<crate::payload::PayloadStream>::H2(pl);
+            let mut req = Request::with_payload(pl);
 
-                Some(Err(err)) => return Poll::Ready(Err(err.into())),
+            let head = req.head_mut();
+            head.uri = parts.uri;
+            head.method = parts.method;
+            head.version = parts.version;
+            head.headers = parts.headers.into();
+            head.peer_addr = this.peer_addr;
 
-                Some(Ok((req, res))) => {
+            // merge on_connect_ext data into request extensions
-                    // update keep-alive expire
+            this.on_connect_data.merge_into(&mut req);
-                    if this.ka_timer.is_some() {
+
-                        if let Some(expire) = this.config.keep_alive_expire() {
+            let fut = this.flow.service.call(req);
-                            this.ka_expire = expire;
+            let config = this.config.clone();
+
+            // multiplex request handling with spawn task
+            actix_rt::spawn(async move {
+                // resolve service call and send response.
+                let res = match fut.await {
+                    Ok(res) => handle_response(res.into(), tx, config).await,
+                    Err(err) => {
+                        let res: Response<AnyBody> = err.into();
+                        handle_response(res, tx, config).await
+                    }
+                };
+
+                // log error.
+                if let Err(err) = res {
+                    match err {
+                        DispatchError::SendResponse(err) => {
+                            trace!("Error sending HTTP/2 response: {:?}", err)
+                        }
+                        DispatchError::SendData(err) => warn!("{:?}", err),
+                        DispatchError::ResponseBody(err) => {
+                            error!("Response payload stream error: {:?}", err)
                         }
                     }
+                }
+            });
+        }
 
-                    let (parts, body) = req.into_parts();
+        Poll::Ready(Ok(()))
-                    let pl = crate::h2::Payload::new(body);
+    }
-                    let pl = Payload::<crate::payload::PayloadStream>::H2(pl);
+}
-                    let mut req = Request::with_payload(pl);
 
-                    let head = &mut req.head_mut();
+enum DispatchError {
-                    head.uri = parts.uri;
+    SendResponse(h2::Error),
-                    head.method = parts.method;
+    SendData(h2::Error),
-                    head.version = parts.version;
+    ResponseBody(Box<dyn StdError>),
-                    head.headers = parts.headers.into();
+}
-                    head.peer_addr = this.peer_addr;
 
-                    // merge on_connect_ext data into request extensions
+async fn handle_response<B>(
-                    this.on_connect_data.merge_into(&mut req);
+    res: Response<B>,
+    mut tx: SendResponse<Bytes>,
+    config: ServiceConfig,
+) -> Result<(), DispatchError>
+where
+    B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
+{
+    let (res, body) = res.replace_body(());
 
-                    let svc = ServiceResponse::<S::Future, S::Response, S::Error, B> {
+    // prepare response.
-                        state: ServiceResponseState::ServiceCall(
+    let mut size = body.size();
-                            this.flow.borrow_mut().service.call(req),
+    let res = prepare_response(config, res.head(), &mut size);
-                            Some(res),
+    let eof = size.is_eof();
-                        ),
-                        config: this.config.clone(),
-                        buffer: None,
-                        _phantom: PhantomData,
-                    };
 
-                    actix_rt::spawn(svc);
+    // send response head and return on eof.
+    let mut stream = tx
+        .send_response(res, eof)
+        .map_err(DispatchError::SendResponse)?;
+
+    if eof {
+        return Ok(());
+    }
+
+    // poll response body and send chunks to client.
+    actix_rt::pin!(body);
+
+    while let Some(res) = poll_fn(|cx| body.as_mut().poll_next(cx)).await {
+        let mut chunk = res.map_err(|err| DispatchError::ResponseBody(err.into()))?;
+
+        'send: loop {
+            // reserve enough space and wait for stream ready.
+            stream.reserve_capacity(cmp::min(chunk.len(), CHUNK_SIZE));
+
+            match poll_fn(|cx| stream.poll_capacity(cx)).await {
+                // No capacity left. drop body and return.
+                None => return Ok(()),
+                Some(res) => {
+                    // Split chuck to writeable size and send to client.
+                    let cap = res.map_err(DispatchError::SendData)?;
+
+                    let len = chunk.len();
+                    let bytes = chunk.split_to(cmp::min(cap, len));
+
+                    stream
+                        .send_data(bytes, false)
+                        .map_err(DispatchError::SendData)?;
+
+                    // Current chuck completely sent. break send loop and poll next one.
+                    if chunk.is_empty() {
+                        break 'send;
+                    }
                 }
             }
         }
     }
+
+    // response body streaming finished. send end of stream and return.
+    stream
+        .send_data(Bytes::new(), true)
+        .map_err(DispatchError::SendData)?;
+
+    Ok(())
 }
 
-#[pin_project::pin_project]
+fn prepare_response(
-struct ServiceResponse<F, I, E, B> {
-    #[pin]
-    state: ServiceResponseState<F, B>,
     config: ServiceConfig,
-    buffer: Option<Bytes>,
+    head: &ResponseHead,
-    _phantom: PhantomData<(I, E)>,
+    size: &mut BodySize,
-}
+) -> http::Response<()> {
+    let mut has_date = false;
+    let mut skip_len = size != &BodySize::Stream;
 
-#[pin_project::pin_project(project = ServiceResponseStateProj)]
+    let mut res = http::Response::new(());
-enum ServiceResponseState<F, B> {
+    *res.status_mut() = head.status;
-    ServiceCall(#[pin] F, Option<SendResponse<Bytes>>),
+    *res.version_mut() = http::Version::HTTP_2;
-    SendPayload(SendStream<Bytes>, #[pin] ResponseBody<B>),
-}
 
-impl<F, I, E, B> ServiceResponse<F, I, E, B>
+    // Content length
-where
+    match head.status {
-    F: Future<Output = Result<I, E>>,
+        http::StatusCode::NO_CONTENT
-    E: Into<Error>,
+        | http::StatusCode::CONTINUE
-    I: Into<Response<B>>,
+        | http::StatusCode::PROCESSING => *size = BodySize::None,
-    B: MessageBody,
+        http::StatusCode::SWITCHING_PROTOCOLS => {
-{
+            skip_len = true;
-    fn prepare_response(
+            *size = BodySize::Stream;
-        &self,
+        }
-        head: &ResponseHead,
+        _ => {}
-        size: &mut BodySize,
+    }
-    ) -> http::Response<()> {
-        let mut has_date = false;
-        let mut skip_len = size != &BodySize::Stream;
 
-        let mut res = http::Response::new(());
+    let _ = match size {
-        *res.status_mut() = head.status;
+        BodySize::None | BodySize::Stream => None,
-        *res.version_mut() = http::Version::HTTP_2;
+        BodySize::Empty => res
+            .headers_mut()
+            .insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
+        BodySize::Sized(len) => {
+            let mut buf = itoa::Buffer::new();
 
-        // Content length
+            res.headers_mut().insert(
-        match head.status {
+                CONTENT_LENGTH,
-            http::StatusCode::NO_CONTENT
+                HeaderValue::from_str(buf.format(*len)).unwrap(),
-            | http::StatusCode::CONTINUE
+            )
-            | http::StatusCode::PROCESSING => *size = BodySize::None,
+        }
-            http::StatusCode::SWITCHING_PROTOCOLS => {
+    };
-                skip_len = true;
+
-                *size = BodySize::Stream;
+    // copy headers
-            }
+    for (key, value) in head.headers.iter() {
+        match *key {
+            // TODO: consider skipping other headers according to:
+            //       https://tools.ietf.org/html/rfc7540#section-8.1.2.2
+            // omit HTTP/1.x only headers
+            CONNECTION | TRANSFER_ENCODING => continue,
+            CONTENT_LENGTH if skip_len => continue,
+            DATE => has_date = true,
             _ => {}
         }
 
-        let _ = match size {
+        res.headers_mut().append(key, value.clone());
-            BodySize::None | BodySize::Stream => None,
-            BodySize::Empty => res
-                .headers_mut()
-                .insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
-            BodySize::Sized(len) => res.headers_mut().insert(
-                CONTENT_LENGTH,
-                HeaderValue::try_from(format!("{}", len)).unwrap(),
-            ),
-        };
-
-        // copy headers
-        for (key, value) in head.headers.iter() {
-            match *key {
-                // omit HTTP/1 only headers
-                CONNECTION | TRANSFER_ENCODING => continue,
-                CONTENT_LENGTH if skip_len => continue,
-                DATE => has_date = true,
-                _ => {}
-            }
-
-            res.headers_mut().append(key, value.clone());
-        }
-
-        // set date header
-        if !has_date {
-            let mut bytes = BytesMut::with_capacity(29);
-            self.config.set_date_header(&mut bytes);
-            res.headers_mut().insert(
-                DATE,
-                // SAFETY: serialized date-times are known ASCII strings
-                unsafe { HeaderValue::from_maybe_shared_unchecked(bytes.freeze()) },
-            );
-        }
-
-        res
     }
-}
 
-impl<F, I, E, B> Future for ServiceResponse<F, I, E, B>
+    // set date header
-where
+    if !has_date {
-    F: Future<Output = Result<I, E>>,
+        let mut bytes = BytesMut::with_capacity(29);
-    E: Into<Error>,
+        config.set_date_header(&mut bytes);
-    I: Into<Response<B>>,
+        res.headers_mut().insert(
-    B: MessageBody,
+            DATE,
-{
+            // SAFETY: serialized date-times are known ASCII strings
-    type Output = ();
+            unsafe { HeaderValue::from_maybe_shared_unchecked(bytes.freeze()) },
-
+        );
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let mut this = self.as_mut().project();
-
-        match this.state.project() {
-            ServiceResponseStateProj::ServiceCall(call, send) => {
-                match ready!(call.poll(cx)) {
-                    Ok(res) => {
-                        let (res, body) = res.into().replace_body(());
-
-                        let mut send = send.take().unwrap();
-                        let mut size = body.size();
-                        let h2_res =
-                            self.as_mut().prepare_response(res.head(), &mut size);
-                        this = self.as_mut().project();
-
-                        let stream = match send.send_response(h2_res, size.is_eof()) {
-                            Err(e) => {
-                                trace!("Error sending HTTP/2 response: {:?}", e);
-                                return Poll::Ready(());
-                            }
-                            Ok(stream) => stream,
-                        };
-
-                        if size.is_eof() {
-                            Poll::Ready(())
-                        } else {
-                            this.state
-                                .set(ServiceResponseState::SendPayload(stream, body));
-                            self.poll(cx)
-                        }
-                    }
-
-                    Err(e) => {
-                        let res: Response = e.into().into();
-                        let (res, body) = res.replace_body(());
-
-                        let mut send = send.take().unwrap();
-                        let mut size = body.size();
-                        let h2_res =
-                            self.as_mut().prepare_response(res.head(), &mut size);
-                        this = self.as_mut().project();
-
-                        let stream = match send.send_response(h2_res, size.is_eof()) {
-                            Err(e) => {
-                                trace!("Error sending HTTP/2 response: {:?}", e);
-                                return Poll::Ready(());
-                            }
-                            Ok(stream) => stream,
-                        };
-
-                        if size.is_eof() {
-                            Poll::Ready(())
-                        } else {
-                            this.state.set(ServiceResponseState::SendPayload(
-                                stream,
-                                body.into_body(),
-                            ));
-                            self.poll(cx)
-                        }
-                    }
-                }
-            }
-
-            ServiceResponseStateProj::SendPayload(ref mut stream, ref mut body) => {
-                loop {
-                    loop {
-                        match this.buffer {
-                            Some(ref mut buffer) => {
-                                match ready!(stream.poll_capacity(cx)) {
-                                    None => return Poll::Ready(()),
-
-                                    Some(Ok(cap)) => {
-                                        let len = buffer.len();
-                                        let bytes = buffer.split_to(cmp::min(cap, len));
-
-                                        if let Err(e) = stream.send_data(bytes, false) {
-                                            warn!("{:?}", e);
-                                            return Poll::Ready(());
-                                        } else if !buffer.is_empty() {
-                                            let cap = cmp::min(buffer.len(), CHUNK_SIZE);
-                                            stream.reserve_capacity(cap);
-                                        } else {
-                                            this.buffer.take();
-                                        }
-                                    }
-
-                                    Some(Err(e)) => {
-                                        warn!("{:?}", e);
-                                        return Poll::Ready(());
-                                    }
-                                }
-                            }
-
-                            None => match ready!(body.as_mut().poll_next(cx)) {
-                                None => {
-                                    if let Err(e) = stream.send_data(Bytes::new(), true)
-                                    {
-                                        warn!("{:?}", e);
-                                    }
-                                    return Poll::Ready(());
-                                }
-
-                                Some(Ok(chunk)) => {
-                                    stream.reserve_capacity(cmp::min(
-                                        chunk.len(),
-                                        CHUNK_SIZE,
-                                    ));
-                                    *this.buffer = Some(chunk);
-                                }
-
-                                Some(Err(e)) => {
-                                    error!("Response payload stream error: {:?}", e);
-                                    return Poll::Ready(());
-                                }
-                            },
-                        }
-                    }
-                }
-            }
-        }
     }
+
+    res
 }

actix-http/src/h2/mod.rs

@@ -1,4 +1,4 @@
-//! HTTP/2 implementation.
+//! HTTP/2 protocol.
 
 use std::{
     pin::Pin,

actix-http/src/h2/service.rs

@@ -1,29 +1,32 @@
-use std::cell::RefCell;
+use std::{
-use std::future::Future;
+    error::Error as StdError,
-use std::marker::PhantomData;
+    future::Future,
-use std::pin::Pin;
+    marker::PhantomData,
-use std::task::{Context, Poll};
+    net,
-use std::{net, rc::Rc};
+    pin::Pin,
+    rc::Rc,
+    task::{Context, Poll},
+};
 
 use actix_codec::{AsyncRead, AsyncWrite};
 use actix_rt::net::TcpStream;
 use actix_service::{
-    fn_factory, fn_service, pipeline_factory, IntoServiceFactory, Service,
+    fn_factory, fn_service, IntoServiceFactory, Service, ServiceFactory,
-    ServiceFactory,
+    ServiceFactoryExt as _,
 };
+use actix_utils::future::ready;
 use bytes::Bytes;
-use futures_core::ready;
+use futures_core::{future::LocalBoxFuture, ready};
-use futures_util::future::ok;
+use h2::server::{handshake as h2_handshake, Handshake as H2Handshake};
-use h2::server::{self, Handshake};
 use log::error;
 
-use crate::body::MessageBody;
+use crate::{
-use crate::config::ServiceConfig;
+    body::{AnyBody, MessageBody},
-use crate::error::{DispatchError, Error};
+    config::ServiceConfig,
-use crate::request::Request;
+    error::DispatchError,
-use crate::response::Response;
+    service::HttpFlow,
-use crate::service::HttpFlow;
+    ConnectCallback, OnConnectData, Request, Response,
-use crate::{ConnectCallback, OnConnectData};
+};
 
 use super::dispatcher::Dispatcher;
 
@@ -38,10 +41,12 @@ pub struct H2Service<T, S, B> {
 impl<T, S, B> H2Service<T, S, B>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
+
     B: MessageBody + 'static,
+    B::Error: Into<Box<dyn StdError>>,
 {
     /// Create new `H2Service` instance with config.
     pub(crate) fn with_config<F: IntoServiceFactory<S, Request>>(
@@ -66,10 +71,13 @@ where
 impl<S, B> H2Service<TcpStream, S, B>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Future: 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
+
     B: MessageBody + 'static,
+    B::Error: Into<Box<dyn StdError>>,
 {
     /// Create plain TCP based service
     pub fn tcp(
@@ -81,12 +89,12 @@ where
         Error = DispatchError,
         InitError = S::InitError,
     > {
-        pipeline_factory(fn_factory(|| async {
+        fn_factory(|| {
-            Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
+            ready(Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
                 let peer_addr = io.peer_addr().ok();
-                ok::<_, DispatchError>((io, peer_addr))
+                ready(Ok::<_, DispatchError>((io, peer_addr)))
-            }))
+            })))
-        }))
+        })
         .and_then(self)
     }
 }
@@ -94,18 +102,21 @@ where
 #[cfg(feature = "openssl")]
 mod openssl {
     use actix_service::{fn_factory, fn_service, ServiceFactoryExt};
-    use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, SslStream};
+    use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, TlsStream};
     use actix_tls::accept::TlsError;
 
     use super::*;
 
-    impl<S, B> H2Service<SslStream<TcpStream>, S, B>
+    impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
     where
         S: ServiceFactory<Request, Config = ()>,
-        S::Error: Into<Error> + 'static,
+        S::Future: 'static,
+        S::Error: Into<Response<AnyBody>> + 'static,
         S::Response: Into<Response<B>> + 'static,
         <S::Service as Service<Request>>::Future: 'static,
+
         B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError>>,
     {
         /// Create OpenSSL based service
         pub fn openssl(
@@ -118,18 +129,18 @@ mod openssl {
             Error = TlsError<SslError, DispatchError>,
             InitError = S::InitError,
         > {
-            pipeline_factory(
+            Acceptor::new(acceptor)
-                Acceptor::new(acceptor)
+                .map_err(TlsError::Tls)
-                    .map_err(TlsError::Tls)
+                .map_init_err(|_| panic!())
-                    .map_init_err(|_| panic!()),
+                .and_then(fn_factory(|| {
-            )
+                    ready(Ok::<_, S::InitError>(fn_service(
-            .and_then(fn_factory(|| {
+                        |io: TlsStream<TcpStream>| {
-                ok::<_, S::InitError>(fn_service(|io: SslStream<TcpStream>| {
+                            let peer_addr = io.get_ref().peer_addr().ok();
-                    let peer_addr = io.get_ref().peer_addr().ok();
+                            ready(Ok((io, peer_addr)))
-                    ok((io, peer_addr))
+                        },
+                    )))
                 }))
-            }))
+                .and_then(self.map_err(TlsError::Service))
-            .and_then(self.map_err(TlsError::Service))
         }
     }
 }
@@ -145,10 +156,13 @@ mod rustls {
     impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
     where
         S: ServiceFactory<Request, Config = ()>,
-        S::Error: Into<Error> + 'static,
+        S::Future: 'static,
+        S::Error: Into<Response<AnyBody>> + 'static,
         S::Response: Into<Response<B>> + 'static,
         <S::Service as Service<Request>>::Future: 'static,
+
         B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError>>,
     {
         /// Create Rustls based service
         pub fn rustls(
@@ -161,95 +175,64 @@ mod rustls {
             Error = TlsError<io::Error, DispatchError>,
             InitError = S::InitError,
         > {
-            let protos = vec!["h2".to_string().into()];
+            let mut protos = vec![b"h2".to_vec()];
+            protos.extend_from_slice(&config.alpn_protocols);
             config.set_protocols(&protos);
 
-            pipeline_factory(
+            Acceptor::new(config)
-                Acceptor::new(config)
+                .map_err(TlsError::Tls)
-                    .map_err(TlsError::Tls)
+                .map_init_err(|_| panic!())
-                    .map_init_err(|_| panic!()),
+                .and_then(fn_factory(|| {
-            )
+                    ready(Ok::<_, S::InitError>(fn_service(
-            .and_then(fn_factory(|| {
+                        |io: TlsStream<TcpStream>| {
-                ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
+                            let peer_addr = io.get_ref().0.peer_addr().ok();
-                    let peer_addr = io.get_ref().0.peer_addr().ok();
+                            ready(Ok((io, peer_addr)))
-                    ok((io, peer_addr))
+                        },
+                    )))
                 }))
-            }))
+                .and_then(self.map_err(TlsError::Service))
-            .and_then(self.map_err(TlsError::Service))
         }
     }
 }
 
 impl<T, S, B> ServiceFactory<(T, Option<net::SocketAddr>)> for H2Service<T, S, B>
 where
-    T: AsyncRead + AsyncWrite + Unpin,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
+
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Future: 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
+
     B: MessageBody + 'static,
+    B::Error: Into<Box<dyn StdError>>,
 {
     type Response = ();
     type Error = DispatchError;
     type Config = ();
     type Service = H2ServiceHandler<T, S::Service, B>;
     type InitError = S::InitError;
-    type Future = H2ServiceResponse<T, S, B>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
-        H2ServiceResponse {
+        let service = self.srv.new_service(());
-            fut: self.srv.new_service(()),
+        let cfg = self.cfg.clone();
-            cfg: Some(self.cfg.clone()),
+        let on_connect_ext = self.on_connect_ext.clone();
-            on_connect_ext: self.on_connect_ext.clone(),
-            _phantom: PhantomData,
-        }
-    }
-}
 
-#[doc(hidden)]
+        Box::pin(async move {
-#[pin_project::pin_project]
+            let service = service.await?;
-pub struct H2ServiceResponse<T, S, B>
+            Ok(H2ServiceHandler::new(cfg, on_connect_ext, service))
-where
-    S: ServiceFactory<Request>,
-{
-    #[pin]
-    fut: S::Future,
-    cfg: Option<ServiceConfig>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    _phantom: PhantomData<B>,
-}
-
-impl<T, S, B> Future for H2ServiceResponse<T, S, B>
-where
-    T: AsyncRead + AsyncWrite + Unpin,
-    S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
-    S::Response: Into<Response<B>> + 'static,
-    <S::Service as Service<Request>>::Future: 'static,
-    B: MessageBody + 'static,
-{
-    type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
-
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let this = self.as_mut().project();
-
-        this.fut.poll(cx).map_ok(|service| {
-            let this = self.as_mut().project();
-            H2ServiceHandler::new(
-                this.cfg.take().unwrap(),
-                this.on_connect_ext.clone(),
-                service,
-            )
         })
     }
 }
 
-/// `Service` implementation for http/2 transport
+/// `Service` implementation for HTTP/2 transport
 pub struct H2ServiceHandler<T, S, B>
 where
     S: Service<Request>,
 {
-    flow: Rc<RefCell<HttpFlow<S, (), ()>>>,
+    flow: Rc<HttpFlow<S, (), ()>>,
     cfg: ServiceConfig,
     on_connect_ext: Option<Rc<ConnectCallback<T>>>,
     _phantom: PhantomData<B>,
@@ -258,7 +241,7 @@ where
 impl<T, S, B> H2ServiceHandler<T, S, B>
 where
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Future: 'static,
     S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
@@ -281,24 +264,25 @@ impl<T, S, B> Service<(T, Option<net::SocketAddr>)> for H2ServiceHandler<T, S, B
 where
     T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Future: 'static,
     S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
+    B::Error: Into<Box<dyn StdError>>,
 {
     type Response = ();
     type Error = DispatchError;
     type Future = H2ServiceHandlerResponse<T, S, B>;
 
-    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+    fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        self.flow.borrow_mut().service.poll_ready(cx).map_err(|e| {
+        self.flow.service.poll_ready(cx).map_err(|e| {
             let e = e.into();
             error!("Service readiness error: {:?}", e);
             DispatchError::Service(e)
         })
     }
 
-    fn call(&mut self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
+    fn call(&self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
         let on_connect_data =
             OnConnectData::from_io(&io, self.on_connect_ext.as_deref());
 
@@ -308,7 +292,7 @@ where
                 Some(self.cfg.clone()),
                 addr,
                 on_connect_data,
-                server::handshake(io),
+                h2_handshake(io),
             ),
         }
     }
@@ -321,11 +305,11 @@ where
 {
     Incoming(Dispatcher<T, S, B, (), ()>),
     Handshake(
-        Option<Rc<RefCell<HttpFlow<S, (), ()>>>>,
+        Option<Rc<HttpFlow<S, (), ()>>>,
         Option<ServiceConfig>,
         Option<net::SocketAddr>,
         OnConnectData,
-        Handshake<T, Bytes>,
+        H2Handshake<T, Bytes>,
     ),
 }
 
@@ -333,7 +317,7 @@ pub struct H2ServiceHandlerResponse<T, S, B>
 where
     T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Future: 'static,
     S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
@@ -345,10 +329,11 @@ impl<T, S, B> Future for H2ServiceHandlerResponse<T, S, B>
 where
     T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Future: 'static,
     S::Response: Into<Response<B>> + 'static,
     B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
 {
     type Output = Result<(), DispatchError>;
 
@@ -369,7 +354,6 @@ where
                         conn,
                         on_connect_data,
                         config.take().unwrap(),
-                        None,
                         *peer_addr,
                     ));
                     self.poll(cx)

actix-http/src/header/as_name.rs

@@ -0,0 +1,50 @@
+//! Helper trait for types that can be effectively borrowed as a [HeaderValue].
+//!
+//! [HeaderValue]: crate::http::HeaderValue
+
+use std::{borrow::Cow, str::FromStr};
+
+use http::header::{HeaderName, InvalidHeaderName};
+
+pub trait AsHeaderName: Sealed {}
+
+pub struct Seal;
+
+pub trait Sealed {
+    fn try_as_name(&self, seal: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName>;
+}
+
+impl Sealed for HeaderName {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        Ok(Cow::Borrowed(self))
+    }
+}
+impl AsHeaderName for HeaderName {}
+
+impl Sealed for &HeaderName {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        Ok(Cow::Borrowed(*self))
+    }
+}
+impl AsHeaderName for &HeaderName {}
+
+impl Sealed for &str {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        HeaderName::from_str(self).map(Cow::Owned)
+    }
+}
+impl AsHeaderName for &str {}
+
+impl Sealed for String {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        HeaderName::from_str(self).map(Cow::Owned)
+    }
+}
+impl AsHeaderName for String {}
+
+impl Sealed for &String {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        HeaderName::from_str(self).map(Cow::Owned)
+    }
+}
+impl AsHeaderName for &String {}

actix-http/src/header/common/content_language.rs

@@ -1,65 +0,0 @@
-use crate::header::{QualityItem, CONTENT_LANGUAGE};
-use language_tags::LanguageTag;
-
-header! {
-    /// `Content-Language` header, defined in
-    /// [RFC7231](https://tools.ietf.org/html/rfc7231#section-3.1.3.2)
-    ///
-    /// The `Content-Language` header field describes the natural language(s)
-    /// of the intended audience for the representation.  Note that this
-    /// might not be equivalent to all the languages used within the
-    /// representation.
-    ///
-    /// # ABNF
-    ///
-    /// ```text
-    /// Content-Language = 1#language-tag
-    /// ```
-    ///
-    /// # Example values
-    ///
-    /// * `da`
-    /// * `mi, en`
-    ///
-    /// # Examples
-    ///
-    /// ```rust
-    /// # extern crate actix_http;
-    /// # #[macro_use] extern crate language_tags;
-    /// use actix_http::Response;
-    /// # use actix_http::http::header::{ContentLanguage, qitem};
-    /// #
-    /// # fn main() {
-    /// let mut builder = Response::Ok();
-    /// builder.set(
-    ///     ContentLanguage(vec![
-    ///         qitem(langtag!(en)),
-    ///     ])
-    /// );
-    /// # }
-    /// ```
-    ///
-    /// ```rust
-    /// # extern crate actix_http;
-    /// # #[macro_use] extern crate language_tags;
-    /// use actix_http::Response;
-    /// # use actix_http::http::header::{ContentLanguage, qitem};
-    /// #
-    /// # fn main() {
-    ///
-    /// let mut builder = Response::Ok();
-    /// builder.set(
-    ///     ContentLanguage(vec![
-    ///         qitem(langtag!(da)),
-    ///         qitem(langtag!(en;;;GB)),
-    ///     ])
-    /// );
-    /// # }
-    /// ```
-    (ContentLanguage, CONTENT_LANGUAGE) => (QualityItem<LanguageTag>)+
-
-    test_content_language {
-        test_header!(test1, vec![b"da"]);
-        test_header!(test2, vec![b"mi, en"]);
-    }
-}

actix-http/src/header/into_pair.rs

@@ -0,0 +1,117 @@
+use std::convert::TryFrom;
+
+use http::{
+    header::{HeaderName, InvalidHeaderName, InvalidHeaderValue},
+    Error as HttpError, HeaderValue,
+};
+
+use super::{Header, IntoHeaderValue};
+
+/// Transforms structures into header K/V pairs for inserting into `HeaderMap`s.
+pub trait IntoHeaderPair: Sized {
+    type Error: Into<HttpError>;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error>;
+}
+
+#[derive(Debug)]
+pub enum InvalidHeaderPart {
+    Name(InvalidHeaderName),
+    Value(InvalidHeaderValue),
+}
+
+impl From<InvalidHeaderPart> for HttpError {
+    fn from(part_err: InvalidHeaderPart) -> Self {
+        match part_err {
+            InvalidHeaderPart::Name(err) => err.into(),
+            InvalidHeaderPart::Value(err) => err.into(),
+        }
+    }
+}
+
+impl<V> IntoHeaderPair for (HeaderName, V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        let value = value
+            .try_into_value()
+            .map_err(|err| InvalidHeaderPart::Value(err.into()))?;
+        Ok((name, value))
+    }
+}
+
+impl<V> IntoHeaderPair for (&HeaderName, V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        let value = value
+            .try_into_value()
+            .map_err(|err| InvalidHeaderPart::Value(err.into()))?;
+        Ok((name.clone(), value))
+    }
+}
+
+impl<V> IntoHeaderPair for (&[u8], V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        let name = HeaderName::try_from(name).map_err(InvalidHeaderPart::Name)?;
+        let value = value
+            .try_into_value()
+            .map_err(|err| InvalidHeaderPart::Value(err.into()))?;
+        Ok((name, value))
+    }
+}
+
+impl<V> IntoHeaderPair for (&str, V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        let name = HeaderName::try_from(name).map_err(InvalidHeaderPart::Name)?;
+        let value = value
+            .try_into_value()
+            .map_err(|err| InvalidHeaderPart::Value(err.into()))?;
+        Ok((name, value))
+    }
+}
+
+impl<V> IntoHeaderPair for (String, V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        (name.as_str(), value).try_into_header_pair()
+    }
+}
+
+impl<T: Header> IntoHeaderPair for T {
+    type Error = <T as IntoHeaderValue>::Error;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        Ok((T::name(), self.try_into_value()?))
+    }
+}

actix-http/src/header/into_value.rs

@@ -0,0 +1,131 @@
+use std::convert::TryFrom;
+
+use bytes::Bytes;
+use http::{header::InvalidHeaderValue, Error as HttpError, HeaderValue};
+use mime::Mime;
+
+/// A trait for any object that can be Converted to a `HeaderValue`
+pub trait IntoHeaderValue: Sized {
+    /// The type returned in the event of a conversion error.
+    type Error: Into<HttpError>;
+
+    /// Try to convert value to a HeaderValue.
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error>;
+}
+
+impl IntoHeaderValue for HeaderValue {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        Ok(self)
+    }
+}
+
+impl IntoHeaderValue for &HeaderValue {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        Ok(self.clone())
+    }
+}
+
+impl IntoHeaderValue for &str {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        self.parse()
+    }
+}
+
+impl IntoHeaderValue for &[u8] {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::from_bytes(self)
+    }
+}
+
+impl IntoHeaderValue for Bytes {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::from_maybe_shared(self)
+    }
+}
+
+impl IntoHeaderValue for Vec<u8> {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self)
+    }
+}
+
+impl IntoHeaderValue for String {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self)
+    }
+}
+
+impl IntoHeaderValue for usize {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for i64 {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for u64 {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for i32 {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for u32 {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for Mime {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::from_str(self.as_ref())
+    }
+}

actix-http/src/header/mod.rs

@@ -1,35 +1,58 @@
-//! Various http headers
+//! Pre-defined `HeaderName`s, traits for parsing and conversion, and other header utility methods.
-// This is mostly copy of [hyper](https://github.com/hyperium/hyper/tree/master/src/header)
 
-use std::convert::TryFrom;
-use std::{fmt, str::FromStr};
-
-use bytes::{Bytes, BytesMut};
-use http::Error as HttpError;
-use mime::Mime;
 use percent_encoding::{AsciiSet, CONTROLS};
 
-pub use http::header::*;
+// re-export from http except header map related items
+pub use http::header::{
+    HeaderName, HeaderValue, InvalidHeaderName, InvalidHeaderValue, ToStrError,
+};
+
+// re-export const header names
+pub use http::header::{
+    ACCEPT, ACCEPT_CHARSET, ACCEPT_ENCODING, ACCEPT_LANGUAGE, ACCEPT_RANGES,
+    ACCESS_CONTROL_ALLOW_CREDENTIALS, ACCESS_CONTROL_ALLOW_HEADERS,
+    ACCESS_CONTROL_ALLOW_METHODS, ACCESS_CONTROL_ALLOW_ORIGIN,
+    ACCESS_CONTROL_EXPOSE_HEADERS, ACCESS_CONTROL_MAX_AGE,
+    ACCESS_CONTROL_REQUEST_HEADERS, ACCESS_CONTROL_REQUEST_METHOD, AGE, ALLOW, ALT_SVC,
+    AUTHORIZATION, CACHE_CONTROL, CONNECTION, CONTENT_DISPOSITION, CONTENT_ENCODING,
+    CONTENT_LANGUAGE, CONTENT_LENGTH, CONTENT_LOCATION, CONTENT_RANGE,
+    CONTENT_SECURITY_POLICY, CONTENT_SECURITY_POLICY_REPORT_ONLY, CONTENT_TYPE, COOKIE,
+    DATE, DNT, ETAG, EXPECT, EXPIRES, FORWARDED, FROM, HOST, IF_MATCH,
+    IF_MODIFIED_SINCE, IF_NONE_MATCH, IF_RANGE, IF_UNMODIFIED_SINCE, LAST_MODIFIED,
+    LINK, LOCATION, MAX_FORWARDS, ORIGIN, PRAGMA, PROXY_AUTHENTICATE,
+    PROXY_AUTHORIZATION, PUBLIC_KEY_PINS, PUBLIC_KEY_PINS_REPORT_ONLY, RANGE, REFERER,
+    REFERRER_POLICY, REFRESH, RETRY_AFTER, SEC_WEBSOCKET_ACCEPT,
+    SEC_WEBSOCKET_EXTENSIONS, SEC_WEBSOCKET_KEY, SEC_WEBSOCKET_PROTOCOL,
+    SEC_WEBSOCKET_VERSION, SERVER, SET_COOKIE, STRICT_TRANSPORT_SECURITY, TE, TRAILER,
+    TRANSFER_ENCODING, UPGRADE, UPGRADE_INSECURE_REQUESTS, USER_AGENT, VARY, VIA,
+    WARNING, WWW_AUTHENTICATE, X_CONTENT_TYPE_OPTIONS, X_DNS_PREFETCH_CONTROL,
+    X_FRAME_OPTIONS, X_XSS_PROTECTION,
+};
 
 use crate::error::ParseError;
-use crate::httpmessage::HttpMessage;
+use crate::HttpMessage;
+
+mod as_name;
+mod into_pair;
+mod into_value;
+mod utils;
 
-mod common;
 pub(crate) mod map;
 mod shared;
-pub use self::common::*;
+
 #[doc(hidden)]
 pub use self::shared::*;
 
+pub use self::as_name::AsHeaderName;
+pub use self::into_pair::IntoHeaderPair;
+pub use self::into_value::IntoHeaderValue;
 #[doc(hidden)]
 pub use self::map::GetAll;
 pub use self::map::HeaderMap;
+pub use self::utils::*;
 
-/// A trait for any object that will represent a header field and value.
+/// A trait for any object that already represents a valid header field and value.
-pub trait Header
+pub trait Header: IntoHeaderValue {
-where
-    Self: IntoHeaderValue,
-{
     /// Returns the name of the header field
     fn name() -> HeaderName;
 
@@ -37,358 +60,15 @@ where
     fn parse<T: HttpMessage>(msg: &T) -> Result<Self, ParseError>;
 }
 
-/// A trait for any object that can be Converted to a `HeaderValue`
+/// Convert `http::HeaderMap` to our `HeaderMap`.
-pub trait IntoHeaderValue: Sized {
-    /// The type returned in the event of a conversion error.
-    type Error: Into<HttpError>;
-
-    /// Try to convert value to a Header value.
-    fn try_into(self) -> Result<HeaderValue, Self::Error>;
-}
-
-impl IntoHeaderValue for HeaderValue {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        Ok(self)
-    }
-}
-
-impl<'a> IntoHeaderValue for &'a str {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        self.parse()
-    }
-}
-
-impl<'a> IntoHeaderValue for &'a [u8] {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::from_bytes(self)
-    }
-}
-
-impl IntoHeaderValue for Bytes {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::from_maybe_shared(self)
-    }
-}
-
-impl IntoHeaderValue for Vec<u8> {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::try_from(self)
-    }
-}
-
-impl IntoHeaderValue for String {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::try_from(self)
-    }
-}
-
-impl IntoHeaderValue for usize {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        let s = format!("{}", self);
-        HeaderValue::try_from(s)
-    }
-}
-
-impl IntoHeaderValue for u64 {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        let s = format!("{}", self);
-        HeaderValue::try_from(s)
-    }
-}
-
-impl IntoHeaderValue for Mime {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::try_from(format!("{}", self))
-    }
-}
-
-/// Represents supported types of content encodings
-#[derive(Copy, Clone, PartialEq, Debug)]
-pub enum ContentEncoding {
-    /// Automatically select encoding based on encoding negotiation
-    Auto,
-    /// A format using the Brotli algorithm
-    Br,
-    /// A format using the zlib structure with deflate algorithm
-    Deflate,
-    /// Gzip algorithm
-    Gzip,
-    /// Indicates the identity function (i.e. no compression, nor modification)
-    Identity,
-}
-
-impl ContentEncoding {
-    #[inline]
-    /// Is the content compressed?
-    pub fn is_compression(self) -> bool {
-        matches!(self, ContentEncoding::Identity | ContentEncoding::Auto)
-    }
-
-    #[inline]
-    /// Convert content encoding to string
-    pub fn as_str(self) -> &'static str {
-        match self {
-            ContentEncoding::Br => "br",
-            ContentEncoding::Gzip => "gzip",
-            ContentEncoding::Deflate => "deflate",
-            ContentEncoding::Identity | ContentEncoding::Auto => "identity",
-        }
-    }
-
-    #[inline]
-    /// default quality value
-    pub fn quality(self) -> f64 {
-        match self {
-            ContentEncoding::Br => 1.1,
-            ContentEncoding::Gzip => 1.0,
-            ContentEncoding::Deflate => 0.9,
-            ContentEncoding::Identity | ContentEncoding::Auto => 0.1,
-        }
-    }
-}
-
-impl<'a> From<&'a str> for ContentEncoding {
-    fn from(s: &'a str) -> ContentEncoding {
-        let s = s.trim();
-
-        if s.eq_ignore_ascii_case("br") {
-            ContentEncoding::Br
-        } else if s.eq_ignore_ascii_case("gzip") {
-            ContentEncoding::Gzip
-        } else if s.eq_ignore_ascii_case("deflate") {
-            ContentEncoding::Deflate
-        } else {
-            ContentEncoding::Identity
-        }
-    }
-}
-
-#[doc(hidden)]
-pub(crate) struct Writer {
-    buf: BytesMut,
-}
-
-impl Writer {
-    fn new() -> Writer {
-        Writer {
-            buf: BytesMut::new(),
-        }
-    }
-    fn take(&mut self) -> Bytes {
-        self.buf.split().freeze()
-    }
-}
-
-impl fmt::Write for Writer {
-    #[inline]
-    fn write_str(&mut self, s: &str) -> fmt::Result {
-        self.buf.extend_from_slice(s.as_bytes());
-        Ok(())
-    }
-
-    #[inline]
-    fn write_fmt(&mut self, args: fmt::Arguments<'_>) -> fmt::Result {
-        fmt::write(self, args)
-    }
-}
-
-#[inline]
-#[doc(hidden)]
-/// Reads a comma-delimited raw header into a Vec.
-pub fn from_comma_delimited<'a, I: Iterator<Item = &'a HeaderValue> + 'a, T: FromStr>(
-    all: I,
-) -> Result<Vec<T>, ParseError> {
-    let mut result = Vec::new();
-    for h in all {
-        let s = h.to_str().map_err(|_| ParseError::Header)?;
-        result.extend(
-            s.split(',')
-                .filter_map(|x| match x.trim() {
-                    "" => None,
-                    y => Some(y),
-                })
-                .filter_map(|x| x.trim().parse().ok()),
-        )
-    }
-    Ok(result)
-}
-
-#[inline]
-#[doc(hidden)]
-/// Reads a single string when parsing a header.
-pub fn from_one_raw_str<T: FromStr>(val: Option<&HeaderValue>) -> Result<T, ParseError> {
-    if let Some(line) = val {
-        let line = line.to_str().map_err(|_| ParseError::Header)?;
-        if !line.is_empty() {
-            return T::from_str(line).or(Err(ParseError::Header));
-        }
-    }
-    Err(ParseError::Header)
-}
-
-#[inline]
-#[doc(hidden)]
-/// Format an array into a comma-delimited string.
-pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter<'_>, parts: &[T]) -> fmt::Result
-where
-    T: fmt::Display,
-{
-    let mut iter = parts.iter();
-    if let Some(part) = iter.next() {
-        fmt::Display::fmt(part, f)?;
-    }
-    for part in iter {
-        f.write_str(", ")?;
-        fmt::Display::fmt(part, f)?;
-    }
-    Ok(())
-}
-
-// From hyper v0.11.27 src/header/parsing.rs
-
-/// The value part of an extended parameter consisting of three parts:
-/// the REQUIRED character set name (`charset`), the OPTIONAL language information (`language_tag`),
-/// and a character sequence representing the actual value (`value`), separated by single quote
-/// characters. It is defined in [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
-#[derive(Clone, Debug, PartialEq)]
-pub struct ExtendedValue {
-    /// The character set that is used to encode the `value` to a string.
-    pub charset: Charset,
-    /// The human language details of the `value`, if available.
-    pub language_tag: Option<LanguageTag>,
-    /// The parameter value, as expressed in octets.
-    pub value: Vec<u8>,
-}
-
-/// Parses extended header parameter values (`ext-value`), as defined in
-/// [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
-///
-/// Extended values are denoted by parameter names that end with `*`.
-///
-/// ## ABNF
-///
-/// ```text
-/// ext-value     = charset  "'" [ language ] "'" value-chars
-///               ; like RFC 2231's <extended-initial-value>
-///               ; (see [RFC2231], Section 7)
-///
-/// charset       = "UTF-8" / "ISO-8859-1" / mime-charset
-///
-/// mime-charset  = 1*mime-charsetc
-/// mime-charsetc = ALPHA / DIGIT
-///               / "!" / "#" / "$" / "%" / "&"
-///               / "+" / "-" / "^" / "_" / "`"
-///               / "{" / "}" / "~"
-///               ; as <mime-charset> in Section 2.3 of [RFC2978]
-///               ; except that the single quote is not included
-///               ; SHOULD be registered in the IANA charset registry
-///
-/// language      = <Language-Tag, defined in [RFC5646], Section 2.1>
-///
-/// value-chars   = *( pct-encoded / attr-char )
-///
-/// pct-encoded   = "%" HEXDIG HEXDIG
-///               ; see [RFC3986], Section 2.1
-///
-/// attr-char     = ALPHA / DIGIT
-///               / "!" / "#" / "$" / "&" / "+" / "-" / "."
-///               / "^" / "_" / "`" / "|" / "~"
-///               ; token except ( "*" / "'" / "%" )
-/// ```
-pub fn parse_extended_value(
-    val: &str,
-) -> Result<ExtendedValue, crate::error::ParseError> {
-    // Break into three pieces separated by the single-quote character
-    let mut parts = val.splitn(3, '\'');
-
-    // Interpret the first piece as a Charset
-    let charset: Charset = match parts.next() {
-        None => return Err(crate::error::ParseError::Header),
-        Some(n) => FromStr::from_str(n).map_err(|_| crate::error::ParseError::Header)?,
-    };
-
-    // Interpret the second piece as a language tag
-    let language_tag: Option<LanguageTag> = match parts.next() {
-        None => return Err(crate::error::ParseError::Header),
-        Some("") => None,
-        Some(s) => match s.parse() {
-            Ok(lt) => Some(lt),
-            Err(_) => return Err(crate::error::ParseError::Header),
-        },
-    };
-
-    // Interpret the third piece as a sequence of value characters
-    let value: Vec<u8> = match parts.next() {
-        None => return Err(crate::error::ParseError::Header),
-        Some(v) => percent_encoding::percent_decode(v.as_bytes()).collect(),
-    };
-
-    Ok(ExtendedValue {
-        value,
-        charset,
-        language_tag,
-    })
-}
-
-impl fmt::Display for ExtendedValue {
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        let encoded_value =
-            percent_encoding::percent_encode(&self.value[..], HTTP_VALUE);
-        if let Some(ref lang) = self.language_tag {
-            write!(f, "{}'{}'{}", self.charset, lang, encoded_value)
-        } else {
-            write!(f, "{}''{}", self.charset, encoded_value)
-        }
-    }
-}
-
-/// Percent encode a sequence of bytes with a character set defined in
-/// <https://tools.ietf.org/html/rfc5987#section-3.2>
-pub fn http_percent_encode(f: &mut fmt::Formatter<'_>, bytes: &[u8]) -> fmt::Result {
-    let encoded = percent_encoding::percent_encode(bytes, HTTP_VALUE);
-    fmt::Display::fmt(&encoded, f)
-}
-
-/// Convert http::HeaderMap to a HeaderMap
 impl From<http::HeaderMap> for HeaderMap {
-    fn from(map: http::HeaderMap) -> HeaderMap {
+    fn from(mut map: http::HeaderMap) -> HeaderMap {
-        let mut new_map = HeaderMap::with_capacity(map.capacity());
+        HeaderMap::from_drain(map.drain())
-        for (h, v) in map.iter() {
-            new_map.append(h.clone(), v.clone());
-        }
-        new_map
     }
 }
 
-// This encode set is used for HTTP header values and is defined at
+/// This encode set is used for HTTP header values and is defined at
-// https://tools.ietf.org/html/rfc5987#section-3.2
+/// https://tools.ietf.org/html/rfc5987#section-3.2.
 pub(crate) const HTTP_VALUE: &AsciiSet = &CONTROLS
     .add(b' ')
     .add(b'"')
@@ -410,91 +90,3 @@ pub(crate) const HTTP_VALUE: &AsciiSet = &CONTROLS
     .add(b']')
     .add(b'{')
     .add(b'}');
-
-#[cfg(test)]
-mod tests {
-    use super::shared::Charset;
-    use super::{parse_extended_value, ExtendedValue};
-    use language_tags::LanguageTag;
-
-    #[test]
-    fn test_parse_extended_value_with_encoding_and_language_tag() {
-        let expected_language_tag = "en".parse::<LanguageTag>().unwrap();
-        // RFC 5987, Section 3.2.2
-        // Extended notation, using the Unicode character U+00A3 (POUND SIGN)
-        let result = parse_extended_value("iso-8859-1'en'%A3%20rates");
-        assert!(result.is_ok());
-        let extended_value = result.unwrap();
-        assert_eq!(Charset::Iso_8859_1, extended_value.charset);
-        assert!(extended_value.language_tag.is_some());
-        assert_eq!(expected_language_tag, extended_value.language_tag.unwrap());
-        assert_eq!(
-            vec![163, b' ', b'r', b'a', b't', b'e', b's'],
-            extended_value.value
-        );
-    }
-
-    #[test]
-    fn test_parse_extended_value_with_encoding() {
-        // RFC 5987, Section 3.2.2
-        // Extended notation, using the Unicode characters U+00A3 (POUND SIGN)
-        // and U+20AC (EURO SIGN)
-        let result = parse_extended_value("UTF-8''%c2%a3%20and%20%e2%82%ac%20rates");
-        assert!(result.is_ok());
-        let extended_value = result.unwrap();
-        assert_eq!(Charset::Ext("UTF-8".to_string()), extended_value.charset);
-        assert!(extended_value.language_tag.is_none());
-        assert_eq!(
-            vec![
-                194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
-                b't', b'e', b's',
-            ],
-            extended_value.value
-        );
-    }
-
-    #[test]
-    fn test_parse_extended_value_missing_language_tag_and_encoding() {
-        // From: https://greenbytes.de/tech/tc2231/#attwithfn2231quot2
-        let result = parse_extended_value("foo%20bar.html");
-        assert!(result.is_err());
-    }
-
-    #[test]
-    fn test_parse_extended_value_partially_formatted() {
-        let result = parse_extended_value("UTF-8'missing third part");
-        assert!(result.is_err());
-    }
-
-    #[test]
-    fn test_parse_extended_value_partially_formatted_blank() {
-        let result = parse_extended_value("blank second part'");
-        assert!(result.is_err());
-    }
-
-    #[test]
-    fn test_fmt_extended_value_with_encoding_and_language_tag() {
-        let extended_value = ExtendedValue {
-            charset: Charset::Iso_8859_1,
-            language_tag: Some("en".parse().expect("Could not parse language tag")),
-            value: vec![163, b' ', b'r', b'a', b't', b'e', b's'],
-        };
-        assert_eq!("ISO-8859-1'en'%A3%20rates", format!("{}", extended_value));
-    }
-
-    #[test]
-    fn test_fmt_extended_value_with_encoding() {
-        let extended_value = ExtendedValue {
-            charset: Charset::Ext("UTF-8".to_string()),
-            language_tag: None,
-            value: vec![
-                194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
-                b't', b'e', b's',
-            ],
-        };
-        assert_eq!(
-            "UTF-8''%C2%A3%20and%20%E2%82%AC%20rates",
-            format!("{}", extended_value)
-        );
-    }
-}

actix-http/src/header/shared/charset.rs

@@ -104,7 +104,7 @@ impl Display for Charset {
 impl FromStr for Charset {
     type Err = crate::Error;
 
-    fn from_str(s: &str) -> crate::Result<Charset> {
+    fn from_str(s: &str) -> Result<Charset, crate::Error> {
         Ok(match s.to_ascii_uppercase().as_ref() {
             "US-ASCII" => Us_Ascii,
             "ISO-8859-1" => Iso_8859_1,

actix-http/src/header/shared/content_encoding.rs

@@ -0,0 +1,113 @@
+use std::{convert::Infallible, str::FromStr};
+
+use http::header::InvalidHeaderValue;
+
+use crate::{
+    error::ParseError,
+    header::{self, from_one_raw_str, Header, HeaderName, HeaderValue, IntoHeaderValue},
+    HttpMessage,
+};
+
+/// Represents a supported content encoding.
+#[derive(Copy, Clone, PartialEq, Debug)]
+pub enum ContentEncoding {
+    /// Automatically select encoding based on encoding negotiation.
+    Auto,
+
+    /// A format using the Brotli algorithm.
+    Br,
+
+    /// A format using the zlib structure with deflate algorithm.
+    Deflate,
+
+    /// Gzip algorithm.
+    Gzip,
+
+    // Zstd algorithm.
+    Zstd,
+
+    /// Indicates the identity function (i.e. no compression, nor modification).
+    Identity,
+}
+
+impl ContentEncoding {
+    /// Is the content compressed?
+    #[inline]
+    pub fn is_compression(self) -> bool {
+        matches!(self, ContentEncoding::Identity | ContentEncoding::Auto)
+    }
+
+    /// Convert content encoding to string
+    #[inline]
+    pub fn as_str(self) -> &'static str {
+        match self {
+            ContentEncoding::Br => "br",
+            ContentEncoding::Gzip => "gzip",
+            ContentEncoding::Deflate => "deflate",
+            ContentEncoding::Zstd => "zstd",
+            ContentEncoding::Identity | ContentEncoding::Auto => "identity",
+        }
+    }
+
+    /// Default Q-factor (quality) value.
+    #[inline]
+    pub fn quality(self) -> f64 {
+        match self {
+            ContentEncoding::Br => 1.1,
+            ContentEncoding::Gzip => 1.0,
+            ContentEncoding::Deflate => 0.9,
+            ContentEncoding::Identity | ContentEncoding::Auto => 0.1,
+            ContentEncoding::Zstd => 0.0,
+        }
+    }
+}
+
+impl Default for ContentEncoding {
+    fn default() -> Self {
+        Self::Identity
+    }
+}
+
+impl FromStr for ContentEncoding {
+    type Err = Infallible;
+
+    fn from_str(val: &str) -> Result<Self, Self::Err> {
+        Ok(Self::from(val))
+    }
+}
+
+impl From<&str> for ContentEncoding {
+    fn from(val: &str) -> ContentEncoding {
+        let val = val.trim();
+
+        if val.eq_ignore_ascii_case("br") {
+            ContentEncoding::Br
+        } else if val.eq_ignore_ascii_case("gzip") {
+            ContentEncoding::Gzip
+        } else if val.eq_ignore_ascii_case("deflate") {
+            ContentEncoding::Deflate
+        } else if val.eq_ignore_ascii_case("zstd") {
+            ContentEncoding::Zstd
+        } else {
+            ContentEncoding::default()
+        }
+    }
+}
+
+impl IntoHeaderValue for ContentEncoding {
+    type Error = InvalidHeaderValue;
+
+    fn try_into_value(self) -> Result<http::HeaderValue, Self::Error> {
+        Ok(HeaderValue::from_static(self.as_str()))
+    }
+}
+
+impl Header for ContentEncoding {
+    fn name() -> HeaderName {
+        header::CONTENT_ENCODING
+    }
+
+    fn parse<T: HttpMessage>(msg: &T) -> Result<Self, ParseError> {
+        from_one_raw_str(msg.headers().get(Self::name()))
+    }
+}

actix-http/src/header/shared/extended.rs

@@ -0,0 +1,193 @@
+use std::{fmt, str::FromStr};
+
+use language_tags::LanguageTag;
+
+use crate::header::{Charset, HTTP_VALUE};
+
+// From hyper v0.11.27 src/header/parsing.rs
+
+/// The value part of an extended parameter consisting of three parts:
+/// - The REQUIRED character set name (`charset`).
+/// - The OPTIONAL language information (`language_tag`).
+/// - A character sequence representing the actual value (`value`), separated by single quotes.
+///
+/// It is defined in [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
+#[derive(Clone, Debug, PartialEq)]
+pub struct ExtendedValue {
+    /// The character set that is used to encode the `value` to a string.
+    pub charset: Charset,
+
+    /// The human language details of the `value`, if available.
+    pub language_tag: Option<LanguageTag>,
+
+    /// The parameter value, as expressed in octets.
+    pub value: Vec<u8>,
+}
+
+/// Parses extended header parameter values (`ext-value`), as defined in
+/// [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
+///
+/// Extended values are denoted by parameter names that end with `*`.
+///
+/// ## ABNF
+///
+/// ```text
+/// ext-value     = charset  "'" [ language ] "'" value-chars
+///               ; like RFC 2231's <extended-initial-value>
+///               ; (see [RFC2231], Section 7)
+///
+/// charset       = "UTF-8" / "ISO-8859-1" / mime-charset
+///
+/// mime-charset  = 1*mime-charsetc
+/// mime-charsetc = ALPHA / DIGIT
+///               / "!" / "#" / "$" / "%" / "&"
+///               / "+" / "-" / "^" / "_" / "`"
+///               / "{" / "}" / "~"
+///               ; as <mime-charset> in Section 2.3 of [RFC2978]
+///               ; except that the single quote is not included
+///               ; SHOULD be registered in the IANA charset registry
+///
+/// language      = <Language-Tag, defined in [RFC5646], Section 2.1>
+///
+/// value-chars   = *( pct-encoded / attr-char )
+///
+/// pct-encoded   = "%" HEXDIG HEXDIG
+///               ; see [RFC3986], Section 2.1
+///
+/// attr-char     = ALPHA / DIGIT
+///               / "!" / "#" / "$" / "&" / "+" / "-" / "."
+///               / "^" / "_" / "`" / "|" / "~"
+///               ; token except ( "*" / "'" / "%" )
+/// ```
+pub fn parse_extended_value(
+    val: &str,
+) -> Result<ExtendedValue, crate::error::ParseError> {
+    // Break into three pieces separated by the single-quote character
+    let mut parts = val.splitn(3, '\'');
+
+    // Interpret the first piece as a Charset
+    let charset: Charset = match parts.next() {
+        None => return Err(crate::error::ParseError::Header),
+        Some(n) => FromStr::from_str(n).map_err(|_| crate::error::ParseError::Header)?,
+    };
+
+    // Interpret the second piece as a language tag
+    let language_tag: Option<LanguageTag> = match parts.next() {
+        None => return Err(crate::error::ParseError::Header),
+        Some("") => None,
+        Some(s) => match s.parse() {
+            Ok(lt) => Some(lt),
+            Err(_) => return Err(crate::error::ParseError::Header),
+        },
+    };
+
+    // Interpret the third piece as a sequence of value characters
+    let value: Vec<u8> = match parts.next() {
+        None => return Err(crate::error::ParseError::Header),
+        Some(v) => percent_encoding::percent_decode(v.as_bytes()).collect(),
+    };
+
+    Ok(ExtendedValue {
+        charset,
+        language_tag,
+        value,
+    })
+}
+
+impl fmt::Display for ExtendedValue {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        let encoded_value =
+            percent_encoding::percent_encode(&self.value[..], HTTP_VALUE);
+        if let Some(ref lang) = self.language_tag {
+            write!(f, "{}'{}'{}", self.charset, lang, encoded_value)
+        } else {
+            write!(f, "{}''{}", self.charset, encoded_value)
+        }
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use super::*;
+
+    #[test]
+    fn test_parse_extended_value_with_encoding_and_language_tag() {
+        let expected_language_tag = "en".parse::<LanguageTag>().unwrap();
+        // RFC 5987, Section 3.2.2
+        // Extended notation, using the Unicode character U+00A3 (POUND SIGN)
+        let result = parse_extended_value("iso-8859-1'en'%A3%20rates");
+        assert!(result.is_ok());
+        let extended_value = result.unwrap();
+        assert_eq!(Charset::Iso_8859_1, extended_value.charset);
+        assert!(extended_value.language_tag.is_some());
+        assert_eq!(expected_language_tag, extended_value.language_tag.unwrap());
+        assert_eq!(
+            vec![163, b' ', b'r', b'a', b't', b'e', b's'],
+            extended_value.value
+        );
+    }
+
+    #[test]
+    fn test_parse_extended_value_with_encoding() {
+        // RFC 5987, Section 3.2.2
+        // Extended notation, using the Unicode characters U+00A3 (POUND SIGN)
+        // and U+20AC (EURO SIGN)
+        let result = parse_extended_value("UTF-8''%c2%a3%20and%20%e2%82%ac%20rates");
+        assert!(result.is_ok());
+        let extended_value = result.unwrap();
+        assert_eq!(Charset::Ext("UTF-8".to_string()), extended_value.charset);
+        assert!(extended_value.language_tag.is_none());
+        assert_eq!(
+            vec![
+                194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
+                b't', b'e', b's',
+            ],
+            extended_value.value
+        );
+    }
+
+    #[test]
+    fn test_parse_extended_value_missing_language_tag_and_encoding() {
+        // From: https://greenbytes.de/tech/tc2231/#attwithfn2231quot2
+        let result = parse_extended_value("foo%20bar.html");
+        assert!(result.is_err());
+    }
+
+    #[test]
+    fn test_parse_extended_value_partially_formatted() {
+        let result = parse_extended_value("UTF-8'missing third part");
+        assert!(result.is_err());
+    }
+
+    #[test]
+    fn test_parse_extended_value_partially_formatted_blank() {
+        let result = parse_extended_value("blank second part'");
+        assert!(result.is_err());
+    }
+
+    #[test]
+    fn test_fmt_extended_value_with_encoding_and_language_tag() {
+        let extended_value = ExtendedValue {
+            charset: Charset::Iso_8859_1,
+            language_tag: Some("en".parse().expect("Could not parse language tag")),
+            value: vec![163, b' ', b'r', b'a', b't', b'e', b's'],
+        };
+        assert_eq!("ISO-8859-1'en'%A3%20rates", format!("{}", extended_value));
+    }
+
+    #[test]
+    fn test_fmt_extended_value_with_encoding() {
+        let extended_value = ExtendedValue {
+            charset: Charset::Ext("UTF-8".to_string()),
+            language_tag: None,
+            value: vec![
+                194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
+                b't', b'e', b's',
+            ],
+        };
+        assert_eq!(
+            "UTF-8''%C2%A3%20and%20%E2%82%AC%20rates",
+            format!("{}", extended_value)
+        );
+    }
+}

actix-http/src/header/shared/httpdate.rs

@@ -1,18 +1,20 @@
-use std::fmt::{self, Display};
+use std::{
-use std::io::Write;
+    fmt,
-use std::str::FromStr;
+    io::Write,
-use std::time::{SystemTime, UNIX_EPOCH};
+    str::FromStr,
+    time::{SystemTime, UNIX_EPOCH},
+};
 
 use bytes::buf::BufMut;
 use bytes::BytesMut;
 use http::header::{HeaderValue, InvalidHeaderValue};
-use time::{offset, OffsetDateTime, PrimitiveDateTime};
+use time::{OffsetDateTime, PrimitiveDateTime, UtcOffset};
 
 use crate::error::ParseError;
 use crate::header::IntoHeaderValue;
 use crate::time_parser;
 
-/// A timestamp with HTTP formatting and parsing
+/// A timestamp with HTTP formatting and parsing.
 #[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord)]
 pub struct HttpDate(OffsetDateTime);
 
@@ -27,18 +29,12 @@ impl FromStr for HttpDate {
     }
 }
 
-impl Display for HttpDate {
+impl fmt::Display for HttpDate {
     fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt::Display::fmt(&self.0.format("%a, %d %b %Y %H:%M:%S GMT"), f)
     }
 }
 
-impl From<OffsetDateTime> for HttpDate {
-    fn from(dt: OffsetDateTime) -> HttpDate {
-        HttpDate(dt)
-    }
-}
-
 impl From<SystemTime> for HttpDate {
     fn from(sys: SystemTime) -> HttpDate {
         HttpDate(PrimitiveDateTime::from(sys).assume_utc())
@@ -48,13 +44,13 @@ impl From<SystemTime> for HttpDate {
 impl IntoHeaderValue for HttpDate {
     type Error = InvalidHeaderValue;
 
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
         let mut wrt = BytesMut::with_capacity(29).writer();
         write!(
             wrt,
             "{}",
             self.0
-                .to_offset(offset!(UTC))
+                .to_offset(UtcOffset::UTC)
                 .format("%a, %d %b %Y %H:%M:%S GMT")
         )
         .unwrap();

actix-http/src/header/shared/mod.rs

@@ -1,14 +1,14 @@
-//! Copied for `hyper::header::shared`;
+//! Originally taken from `hyper::header::shared`.
+
+mod charset;
+mod content_encoding;
+mod extended;
+mod httpdate;
+mod quality_item;
 
 pub use self::charset::Charset;
-pub use self::encoding::Encoding;
+pub use self::content_encoding::ContentEncoding;
-pub use self::entity::EntityTag;
+pub use self::extended::{parse_extended_value, ExtendedValue};
 pub use self::httpdate::HttpDate;
 pub use self::quality_item::{q, qitem, Quality, QualityItem};
 pub use language_tags::LanguageTag;
-
-mod charset;
-mod encoding;
-mod entity;
-mod httpdate;
-mod quality_item;

actix-http/src/header/shared/quality_item.rs

@@ -193,21 +193,69 @@ where
 
 #[cfg(test)]
 mod tests {
-    use super::super::encoding::*;
     use super::*;
 
+    // copy of encoding from actix-web headers
+    #[derive(Clone, PartialEq, Debug)]
+    pub enum Encoding {
+        Chunked,
+        Brotli,
+        Gzip,
+        Deflate,
+        Compress,
+        Identity,
+        Trailers,
+        EncodingExt(String),
+    }
+
+    impl fmt::Display for Encoding {
+        fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+            use Encoding::*;
+            f.write_str(match *self {
+                Chunked => "chunked",
+                Brotli => "br",
+                Gzip => "gzip",
+                Deflate => "deflate",
+                Compress => "compress",
+                Identity => "identity",
+                Trailers => "trailers",
+                EncodingExt(ref s) => s.as_ref(),
+            })
+        }
+    }
+
+    impl str::FromStr for Encoding {
+        type Err = crate::error::ParseError;
+        fn from_str(s: &str) -> Result<Encoding, crate::error::ParseError> {
+            use Encoding::*;
+            match s {
+                "chunked" => Ok(Chunked),
+                "br" => Ok(Brotli),
+                "deflate" => Ok(Deflate),
+                "gzip" => Ok(Gzip),
+                "compress" => Ok(Compress),
+                "identity" => Ok(Identity),
+                "trailers" => Ok(Trailers),
+                _ => Ok(EncodingExt(s.to_owned())),
+            }
+        }
+    }
+
     #[test]
     fn test_quality_item_fmt_q_1() {
+        use Encoding::*;
         let x = qitem(Chunked);
         assert_eq!(format!("{}", x), "chunked");
     }
     #[test]
     fn test_quality_item_fmt_q_0001() {
+        use Encoding::*;
         let x = QualityItem::new(Chunked, Quality(1));
         assert_eq!(format!("{}", x), "chunked; q=0.001");
     }
     #[test]
     fn test_quality_item_fmt_q_05() {
+        use Encoding::*;
         // Custom value
         let x = QualityItem {
             item: EncodingExt("identity".to_owned()),
@@ -218,6 +266,7 @@ mod tests {
 
     #[test]
     fn test_quality_item_fmt_q_0() {
+        use Encoding::*;
         // Custom value
         let x = QualityItem {
             item: EncodingExt("identity".to_owned()),
@@ -228,6 +277,7 @@ mod tests {
 
     #[test]
     fn test_quality_item_from_str1() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "chunked".parse();
         assert_eq!(
             x.unwrap(),
@@ -237,8 +287,10 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str2() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "chunked; q=1".parse();
         assert_eq!(
             x.unwrap(),
@@ -248,8 +300,10 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str3() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.5".parse();
         assert_eq!(
             x.unwrap(),
@@ -259,8 +313,10 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str4() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.273".parse();
         assert_eq!(
             x.unwrap(),
@@ -270,16 +326,19 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str5() {
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.2739999".parse();
         assert!(x.is_err());
     }
+
     #[test]
     fn test_quality_item_from_str6() {
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=2".parse();
         assert!(x.is_err());
     }
+
     #[test]
     fn test_quality_item_ordering() {
         let x: QualityItem<Encoding> = "gzip; q=0.5".parse().ok().unwrap();

actix-http/src/header/utils.rs

@@ -0,0 +1,62 @@
+use std::{fmt, str::FromStr};
+
+use super::HeaderValue;
+use crate::{error::ParseError, header::HTTP_VALUE};
+
+/// Reads a comma-delimited raw header into a Vec.
+#[inline]
+pub fn from_comma_delimited<'a, I, T>(all: I) -> Result<Vec<T>, ParseError>
+where
+    I: Iterator<Item = &'a HeaderValue> + 'a,
+    T: FromStr,
+{
+    let mut result = Vec::new();
+    for h in all {
+        let s = h.to_str().map_err(|_| ParseError::Header)?;
+        result.extend(
+            s.split(',')
+                .filter_map(|x| match x.trim() {
+                    "" => None,
+                    y => Some(y),
+                })
+                .filter_map(|x| x.trim().parse().ok()),
+        )
+    }
+    Ok(result)
+}
+
+/// Reads a single string when parsing a header.
+#[inline]
+pub fn from_one_raw_str<T: FromStr>(val: Option<&HeaderValue>) -> Result<T, ParseError> {
+    if let Some(line) = val {
+        let line = line.to_str().map_err(|_| ParseError::Header)?;
+        if !line.is_empty() {
+            return T::from_str(line).or(Err(ParseError::Header));
+        }
+    }
+    Err(ParseError::Header)
+}
+
+/// Format an array into a comma-delimited string.
+#[inline]
+pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter<'_>, parts: &[T]) -> fmt::Result
+where
+    T: fmt::Display,
+{
+    let mut iter = parts.iter();
+    if let Some(part) = iter.next() {
+        fmt::Display::fmt(part, f)?;
+    }
+    for part in iter {
+        f.write_str(", ")?;
+        fmt::Display::fmt(part, f)?;
+    }
+    Ok(())
+}
+
+/// Percent encode a sequence of bytes with a character set defined in
+/// <https://tools.ietf.org/html/rfc5987#section-3.2>
+pub fn http_percent_encode(f: &mut fmt::Formatter<'_>, bytes: &[u8]) -> fmt::Result {
+    let encoded = percent_encoding::percent_encode(bytes, HTTP_VALUE);
+    fmt::Display::fmt(&encoded, f)
+}

actix-http/src/helpers.rs

@@ -1,15 +1,15 @@
 use std::io;
 
-use bytes::{BufMut, BytesMut};
+use bytes::BufMut;
 use http::Version;
 
 const DIGITS_START: u8 = b'0';
 
-pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
+pub(crate) fn write_status_line<B: BufMut>(version: Version, n: u16, buf: &mut B) {
     match version {
-        Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
+        Version::HTTP_11 => buf.put_slice(b"HTTP/1.1 "),
-        Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
+        Version::HTTP_10 => buf.put_slice(b"HTTP/1.0 "),
-        Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
+        Version::HTTP_09 => buf.put_slice(b"HTTP/0.9 "),
         _ => {
             // other HTTP version handlers do not use this method
         }
@@ -19,33 +19,44 @@ pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut)
     let d10 = ((n / 10) % 10) as u8;
     let d1 = (n % 10) as u8;
 
-    bytes.put_u8(DIGITS_START + d100);
+    buf.put_u8(DIGITS_START + d100);
-    bytes.put_u8(DIGITS_START + d10);
+    buf.put_u8(DIGITS_START + d10);
-    bytes.put_u8(DIGITS_START + d1);
+    buf.put_u8(DIGITS_START + d1);
 
     // trailing space before reason
-    bytes.put_u8(b' ');
+    buf.put_u8(b' ');
 }
 
-/// NOTE: bytes object has to contain enough space
+/// Write out content length header.
-pub fn write_content_length(n: u64, bytes: &mut BytesMut) {
+///
+/// Buffer must to contain enough space or be implicitly extendable.
+pub fn write_content_length<B: BufMut>(n: u64, buf: &mut B) {
     if n == 0 {
-        bytes.put_slice(b"\r\ncontent-length: 0\r\n");
+        buf.put_slice(b"\r\ncontent-length: 0\r\n");
         return;
     }
 
-    let mut buf = itoa::Buffer::new();
+    let mut buffer = itoa::Buffer::new();
 
-    bytes.put_slice(b"\r\ncontent-length: ");
+    buf.put_slice(b"\r\ncontent-length: ");
-    bytes.put_slice(buf.format(n).as_bytes());
+    buf.put_slice(buffer.format(n).as_bytes());
-    bytes.put_slice(b"\r\n");
+    buf.put_slice(b"\r\n");
 }
 
-pub(crate) struct Writer<'a>(pub &'a mut BytesMut);
+/// An `io::Write`r that only requires mutable reference and assumes that there is space available
+/// in the buffer for every write operation or that it can be extended implicitly (like
+/// `bytes::BytesMut`, for example).
+///
+/// This is slightly faster (~10%) than `bytes::buf::Writer` in such cases because it does not
+/// perform a remaining length check before writing.
+pub(crate) struct MutWriter<'a, B>(pub(crate) &'a mut B);
 
-impl<'a> io::Write for Writer<'a> {
+impl<'a, B> io::Write for MutWriter<'a, B>
+where
+    B: BufMut,
+{
     fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.0.extend_from_slice(buf);
+        self.0.put_slice(buf);
         Ok(buf.len())
     }
 
@@ -58,6 +69,8 @@ impl<'a> io::Write for Writer<'a> {
 mod tests {
     use std::str::from_utf8;
 
+    use bytes::BytesMut;
+
     use super::*;
 
     #[test]

actix-http/src/http_message.rs

@@ -1,19 +1,20 @@
-use std::cell::{Ref, RefMut};
+use std::{
-use std::str;
+    cell::{Ref, RefMut},
+    str,
+};
 
 use encoding_rs::{Encoding, UTF_8};
 use http::header;
 use mime::Mime;
 
-use crate::cookie::Cookie;
+use crate::{
-use crate::error::{ContentTypeError, CookieParseError, ParseError};
+    error::{ContentTypeError, ParseError},
-use crate::extensions::Extensions;
+    header::{Header, HeaderMap},
-use crate::header::{Header, HeaderMap};
+    payload::Payload,
-use crate::payload::Payload;
+    Extensions,
+};
 
-struct Cookies(Vec<Cookie<'static>>);
+/// Trait that implements general purpose operations on HTTP messages.
-
-/// Trait that implements general purpose operations on http messages
 pub trait HttpMessage: Sized {
     /// Type of message payload stream
     type Stream;
@@ -30,8 +31,8 @@ pub trait HttpMessage: Sized {
     /// Mutable reference to a the request's extensions container
     fn extensions_mut(&self) -> RefMut<'_, Extensions>;
 
+    /// Get a header.
     #[doc(hidden)]
-    /// Get a header
     fn get_header<H: Header>(&self) -> Option<H>
     where
         Self: Sized,
@@ -43,8 +44,8 @@ pub trait HttpMessage: Sized {
         }
     }
 
-    /// Read the request content type. If request does not contain
+    /// Read the request content type. If request did not contain a *Content-Type* header, an empty
-    /// *Content-Type* header, empty str get returned.
+    /// string is returned.
     fn content_type(&self) -> &str {
         if let Some(content_type) = self.headers().get(header::CONTENT_TYPE) {
             if let Ok(content_type) = content_type.to_str() {
@@ -90,7 +91,7 @@ pub trait HttpMessage: Sized {
         Ok(None)
     }
 
-    /// Check if request has chunked transfer encoding
+    /// Check if request has chunked transfer encoding.
     fn chunked(&self) -> Result<bool, ParseError> {
         if let Some(encodings) = self.headers().get(header::TRANSFER_ENCODING) {
             if let Ok(s) = encodings.to_str() {
@@ -102,39 +103,6 @@ pub trait HttpMessage: Sized {
             Ok(false)
         }
     }
-
-    /// Load request cookies.
-    #[inline]
-    fn cookies(&self) -> Result<Ref<'_, Vec<Cookie<'static>>>, CookieParseError> {
-        if self.extensions().get::<Cookies>().is_none() {
-            let mut cookies = Vec::new();
-            for hdr in self.headers().get_all(header::COOKIE) {
-                let s =
-                    str::from_utf8(hdr.as_bytes()).map_err(CookieParseError::from)?;
-                for cookie_str in s.split(';').map(|s| s.trim()) {
-                    if !cookie_str.is_empty() {
-                        cookies.push(Cookie::parse_encoded(cookie_str)?.into_owned());
-                    }
-                }
-            }
-            self.extensions_mut().insert(Cookies(cookies));
-        }
-        Ok(Ref::map(self.extensions(), |ext| {
-            &ext.get::<Cookies>().unwrap().0
-        }))
-    }
-
-    /// Return request cookie.
-    fn cookie(&self, name: &str) -> Option<Cookie<'static>> {
-        if let Ok(cookies) = self.cookies() {
-            for cookie in cookies.iter() {
-                if cookie.name() == name {
-                    return Some(cookie.to_owned());
-                }
-            }
-        }
-        None
-    }
 }
 
 impl<'a, T> HttpMessage for &'a mut T
@@ -173,11 +141,13 @@ mod tests {
 
     #[test]
     fn test_content_type() {
-        let req = TestRequest::with_header("content-type", "text/plain").finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "text/plain"))
+            .finish();
         assert_eq!(req.content_type(), "text/plain");
-        let req =
+        let req = TestRequest::default()
-            TestRequest::with_header("content-type", "application/json; charset=utf=8")
+            .insert_header(("content-type", "application/json; charset=utf=8"))
-                .finish();
+            .finish();
         assert_eq!(req.content_type(), "application/json");
         let req = TestRequest::default().finish();
         assert_eq!(req.content_type(), "");
@@ -185,13 +155,15 @@ mod tests {
 
     #[test]
     fn test_mime_type() {
-        let req = TestRequest::with_header("content-type", "application/json").finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "application/json"))
+            .finish();
         assert_eq!(req.mime_type().unwrap(), Some(mime::APPLICATION_JSON));
         let req = TestRequest::default().finish();
         assert_eq!(req.mime_type().unwrap(), None);
-        let req =
+        let req = TestRequest::default()
-            TestRequest::with_header("content-type", "application/json; charset=utf-8")
+            .insert_header(("content-type", "application/json; charset=utf-8"))
-                .finish();
+            .finish();
         let mt = req.mime_type().unwrap().unwrap();
         assert_eq!(mt.get_param(mime::CHARSET), Some(mime::UTF_8));
         assert_eq!(mt.type_(), mime::APPLICATION);
@@ -200,11 +172,9 @@ mod tests {
 
     #[test]
     fn test_mime_type_error() {
-        let req = TestRequest::with_header(
+        let req = TestRequest::default()
-            "content-type",
+            .insert_header(("content-type", "applicationadfadsfasdflknadsfklnadsfjson"))
-            "applicationadfadsfasdflknadsfklnadsfjson",
+            .finish();
-        )
-        .finish();
         assert_eq!(Err(ContentTypeError::ParseError), req.mime_type());
     }
 
@@ -213,27 +183,27 @@ mod tests {
         let req = TestRequest::default().finish();
         assert_eq!(UTF_8.name(), req.encoding().unwrap().name());
 
-        let req = TestRequest::with_header("content-type", "application/json").finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "application/json"))
+            .finish();
         assert_eq!(UTF_8.name(), req.encoding().unwrap().name());
 
-        let req = TestRequest::with_header(
+        let req = TestRequest::default()
-            "content-type",
+            .insert_header(("content-type", "application/json; charset=ISO-8859-2"))
-            "application/json; charset=ISO-8859-2",
+            .finish();
-        )
-        .finish();
         assert_eq!(ISO_8859_2, req.encoding().unwrap());
     }
 
     #[test]
     fn test_encoding_error() {
-        let req = TestRequest::with_header("content-type", "applicatjson").finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "applicatjson"))
+            .finish();
         assert_eq!(Some(ContentTypeError::ParseError), req.encoding().err());
 
-        let req = TestRequest::with_header(
+        let req = TestRequest::default()
-            "content-type",
+            .insert_header(("content-type", "application/json; charset=kkkttktk"))
-            "application/json; charset=kkkttktk",
+            .finish();
-        )
-        .finish();
         assert_eq!(
             Some(ContentTypeError::UnknownEncoding),
             req.encoding().err()
@@ -245,15 +215,16 @@ mod tests {
         let req = TestRequest::default().finish();
         assert!(!req.chunked().unwrap());
 
-        let req =
+        let req = TestRequest::default()
-            TestRequest::with_header(header::TRANSFER_ENCODING, "chunked").finish();
+            .insert_header((header::TRANSFER_ENCODING, "chunked"))
+            .finish();
         assert!(req.chunked().unwrap());
 
         let req = TestRequest::default()
-            .header(
+            .insert_header((
                 header::TRANSFER_ENCODING,
                 Bytes::from_static(b"some va\xadscc\xacas0xsdasdlue"),
-            )
+            ))
             .finish();
         assert!(req.chunked().is_err());
     }

actix-http/src/lib.rs

@@ -1,6 +1,20 @@
 //! HTTP primitives for the Actix ecosystem.
+//!
+//! ## Crate Features
+//! | Feature             | Functionality                               |
+//! | ------------------- | ------------------------------------------- |
+//! | `openssl`           | TLS support via [OpenSSL].                  |
+//! | `rustls`            | TLS support via [rustls].                   |
+//! | `compress-brotli`   | Payload compression support: Brotli.        |
+//! | `compress-gzip`     | Payload compression support: Deflate, Gzip. |
+//! | `compress-zstd`     | Payload compression support: Zstd.          |
+//! | `trust-dns`         | Use [trust-dns] as the client DNS resolver. |
+//!
+//! [OpenSSL]: https://crates.io/crates/openssl
+//! [rustls]: https://crates.io/crates/rustls
+//! [trust-dns]: https://crates.io/crates/trust-dns
 
-#![deny(rust_2018_idioms)]
+#![deny(rust_2018_idioms, nonstandard_style)]
 #![allow(
     clippy::type_complexity,
     clippy::too_many_arguments,
@@ -20,21 +34,21 @@ pub mod body;
 mod builder;
 pub mod client;
 mod config;
-#[cfg(feature = "compress")]
+
+#[cfg(feature = "__compress")]
 pub mod encoding;
 mod extensions;
-mod header;
+pub mod header;
 mod helpers;
-mod httpcodes;
+mod http_message;
-pub mod httpmessage;
 mod message;
 mod payload;
 mod request;
 mod response;
+mod response_builder;
 mod service;
 mod time_parser;
 
-pub use cookie;
 pub mod error;
 pub mod h1;
 pub mod h2;
@@ -43,17 +57,24 @@ pub mod ws;
 
 pub use self::builder::HttpServiceBuilder;
 pub use self::config::{KeepAlive, ServiceConfig};
-pub use self::error::{Error, ResponseError, Result};
+pub use self::error::Error;
 pub use self::extensions::Extensions;
-pub use self::httpmessage::HttpMessage;
+pub use self::header::ContentEncoding;
+pub use self::http_message::HttpMessage;
+pub use self::message::ConnectionType;
 pub use self::message::{Message, RequestHead, RequestHeadType, ResponseHead};
 pub use self::payload::{Payload, PayloadStream};
 pub use self::request::Request;
-pub use self::response::{Response, ResponseBuilder};
+pub use self::response::Response;
+pub use self::response_builder::ResponseBuilder;
 pub use self::service::HttpService;
 
+pub use ::http::{uri, uri::Uri};
+pub use ::http::{Method, StatusCode, Version};
+
+// TODO: deprecate this mish-mash of random items
 pub mod http {
-    //! Various HTTP related types
+    //! Various HTTP related types.
 
     // re-exports
     pub use http::header::{HeaderName, HeaderValue};
@@ -61,10 +82,9 @@ pub mod http {
     pub use http::{uri, Error, Uri};
     pub use http::{Method, StatusCode, Version};
 
-    pub use crate::cookie::{Cookie, CookieBuilder};
     pub use crate::header::HeaderMap;
 
-    /// Various http headers
+    /// A collection of HTTP headers and helpers.
     pub mod header {
         pub use crate::header::*;
     }

actix-http/src/macros.rs

@@ -1,4 +1,5 @@
 #[macro_export]
+#[doc(hidden)]
 macro_rules! downcast_get_type_id {
     () => {
         /// A helper method to get the type ID of the type
@@ -14,8 +15,15 @@ macro_rules! downcast_get_type_id {
         /// making it impossible for safe code to construct outside of
         /// this module. This ensures that safe code cannot violate
         /// type-safety by implementing this method.
+        ///
+        /// We also take `PrivateHelper` as a parameter, to ensure that
+        /// safe code cannot obtain a `PrivateHelper` instance by
+        /// delegating to an existing implementation of `__private_get_type_id__`
         #[doc(hidden)]
-        fn __private_get_type_id__(&self) -> (std::any::TypeId, PrivateHelper)
+        fn __private_get_type_id__(
+            &self,
+            _: PrivateHelper,
+        ) -> (std::any::TypeId, PrivateHelper)
         where
             Self: 'static,
         {
@@ -25,6 +33,7 @@ macro_rules! downcast_get_type_id {
 }
 
 //Generate implementation for dyn $name
+#[doc(hidden)]
 #[macro_export]
 macro_rules! downcast {
     ($name:ident) => {
@@ -37,7 +46,9 @@ macro_rules! downcast {
         impl dyn $name + 'static {
             /// Downcasts generic body to a specific type.
             pub fn downcast_ref<T: $name + 'static>(&self) -> Option<&T> {
-                if self.__private_get_type_id__().0 == std::any::TypeId::of::<T>() {
+                if self.__private_get_type_id__(PrivateHelper(())).0
+                    == std::any::TypeId::of::<T>()
+                {
                     // SAFETY: external crates cannot override the default
                     // implementation of `__private_get_type_id__`, since
                     // it requires returning a private type. We can therefore
@@ -51,7 +62,9 @@ macro_rules! downcast {
 
             /// Downcasts a generic body to a mutable specific type.
             pub fn downcast_mut<T: $name + 'static>(&mut self) -> Option<&mut T> {
-                if self.__private_get_type_id__().0 == std::any::TypeId::of::<T>() {
+                if self.__private_get_type_id__(PrivateHelper(())).0
+                    == std::any::TypeId::of::<T>()
+                {
                     // SAFETY: external crates cannot override the default
                     // implementation of `__private_get_type_id__`, since
                     // it requires returning a private type. We can therefore
@@ -70,6 +83,7 @@ macro_rules! downcast {
 
 #[cfg(test)]
 mod tests {
+    #![allow(clippy::upper_case_acronyms)]
 
     trait MB {
         downcast_get_type_id!();

actix-http/src/message.rs

@@ -1,21 +1,25 @@
-use std::cell::{Ref, RefCell, RefMut};
+use std::{
-use std::net;
+    cell::{Ref, RefCell, RefMut},
-use std::rc::Rc;
+    net,
+    rc::Rc,
+};
 
 use bitflags::bitflags;
-use copyless::BoxHelper;
 
-use crate::extensions::Extensions;
+use crate::{
-use crate::header::HeaderMap;
+    header::{self, HeaderMap},
-use crate::http::{header, Method, StatusCode, Uri, Version};
+    Extensions, Method, StatusCode, Uri, Version,
+};
 
 /// Represents various types of connection
 #[derive(Copy, Clone, PartialEq, Debug)]
 pub enum ConnectionType {
     /// Close connection after response
     Close,
+
     /// Keep connection alive after response
     KeepAlive,
+
     /// Connection is upgraded to different type
     Upgrade,
 }
@@ -35,7 +39,9 @@ bitflags! {
 pub trait Head: Default + 'static {
     fn clear(&mut self);
 
-    fn pool() -> &'static MessagePool<Self>;
+    fn with_pool<F, R>(f: F) -> R
+    where
+        F: FnOnce(&MessagePool<Self>) -> R;
 }
 
 #[derive(Debug)]
@@ -70,8 +76,11 @@ impl Head for RequestHead {
         self.extensions.get_mut().clear();
     }
 
-    fn pool() -> &'static MessagePool<Self> {
+    fn with_pool<F, R>(f: F) -> R
-        REQUEST_POOL.with(|p| *p)
+    where
+        F: FnOnce(&MessagePool<Self>) -> R,
+    {
+        REQUEST_POOL.with(|p| f(p))
     }
 }
 
@@ -284,14 +293,14 @@ impl ResponseHead {
         }
     }
 
-    #[inline]
     /// Check if keep-alive is enabled
+    #[inline]
     pub fn keep_alive(&self) -> bool {
         self.connection_type() == ConnectionType::KeepAlive
     }
 
-    #[inline]
     /// Check upgrade status of this message
+    #[inline]
     pub fn upgrade(&self) -> bool {
         self.connection_type() == ConnectionType::Upgrade
     }
@@ -339,21 +348,15 @@ impl ResponseHead {
 }
 
 pub struct Message<T: Head> {
+    /// Rc here should not be cloned by anyone.
+    /// It's used to reuse allocation of T and no shared ownership is allowed.
     head: Rc<T>,
 }
 
 impl<T: Head> Message<T> {
     /// Get new message from the pool of objects
     pub fn new() -> Self {
-        T::pool().get_message()
+        T::with_pool(|p| p.get_message())
-    }
-}
-
-impl<T: Head> Clone for Message<T> {
-    fn clone(&self) -> Self {
-        Message {
-            head: self.head.clone(),
-        }
     }
 }
 
@@ -373,9 +376,7 @@ impl<T: Head> std::ops::DerefMut for Message<T> {
 
 impl<T: Head> Drop for Message<T> {
     fn drop(&mut self) {
-        if Rc::strong_count(&self.head) == 1 {
+        T::with_pool(|p| p.release(self.head.clone()))
-            T::pool().release(self.head.clone());
-        }
     }
 }
 
@@ -388,12 +389,6 @@ impl BoxedResponseHead {
     pub fn new(status: StatusCode) -> Self {
         RESPONSE_POOL.with(|p| p.get_message(status))
     }
-
-    pub(crate) fn take(&mut self) -> Self {
-        BoxedResponseHead {
-            head: self.head.take(),
-        }
-    }
 }
 
 impl std::ops::Deref for BoxedResponseHead {
@@ -427,18 +422,17 @@ pub struct MessagePool<T: Head>(RefCell<Vec<Rc<T>>>);
 /// Request's objects pool
 pub struct BoxedResponsePool(RefCell<Vec<Box<ResponseHead>>>);
 
-thread_local!(static REQUEST_POOL: &'static MessagePool<RequestHead> = MessagePool::<RequestHead>::create());
+thread_local!(static REQUEST_POOL: MessagePool<RequestHead> = MessagePool::<RequestHead>::create());
-thread_local!(static RESPONSE_POOL: &'static BoxedResponsePool = BoxedResponsePool::create());
+thread_local!(static RESPONSE_POOL: BoxedResponsePool = BoxedResponsePool::create());
 
 impl<T: Head> MessagePool<T> {
-    fn create() -> &'static MessagePool<T> {
+    fn create() -> MessagePool<T> {
-        let pool = MessagePool(RefCell::new(Vec::with_capacity(128)));
+        MessagePool(RefCell::new(Vec::with_capacity(128)))
-        Box::leak(Box::new(pool))
     }
 
     /// Get message from the pool
     #[inline]
-    fn get_message(&'static self) -> Message<T> {
+    fn get_message(&self) -> Message<T> {
         if let Some(mut msg) = self.0.borrow_mut().pop() {
             // Message is put in pool only when it's the last copy.
             // which means it's guaranteed to be unique when popped out.
@@ -464,14 +458,13 @@ impl<T: Head> MessagePool<T> {
 }
 
 impl BoxedResponsePool {
-    fn create() -> &'static BoxedResponsePool {
+    fn create() -> BoxedResponsePool {
-        let pool = BoxedResponsePool(RefCell::new(Vec::with_capacity(128)));
+        BoxedResponsePool(RefCell::new(Vec::with_capacity(128)))
-        Box::leak(Box::new(pool))
     }
 
     /// Get message from the pool
     #[inline]
-    fn get_message(&'static self, status: StatusCode) -> BoxedResponseHead {
+    fn get_message(&self, status: StatusCode) -> BoxedResponseHead {
         if let Some(mut head) = self.0.borrow_mut().pop() {
             head.reason = None;
             head.status = status;
@@ -480,17 +473,17 @@ impl BoxedResponsePool {
             BoxedResponseHead { head: Some(head) }
         } else {
             BoxedResponseHead {
-                head: Some(Box::alloc().init(ResponseHead::new(status))),
+                head: Some(Box::new(ResponseHead::new(status))),
             }
         }
     }
 
     #[inline]
     /// Release request instance
-    fn release(&self, msg: Box<ResponseHead>) {
+    fn release(&self, mut msg: Box<ResponseHead>) {
         let v = &mut self.0.borrow_mut();
         if v.len() < 128 {
-            msg.extensions.borrow_mut().clear();
+            msg.extensions.get_mut().clear();
             v.push(msg);
         }
     }