prepare awc release 3.0.0-beta.4

Co-authored-by: Rob Ede <robjtede@icloud.com>

.cargo/config.toml

@@ -0,0 +1,3 @@
+[alias]
+chk = "hack check --workspace --all-features --tests --examples"
+lint = "hack --clean-per-run clippy --workspace --tests --examples"

.github/workflows/ci.yml

@@ -23,9 +23,27 @@ jobs:
     name: ${{ matrix.target.name }} / ${{ matrix.version }}
     runs-on: ${{ matrix.target.os }}
 
+    env:
+      VCPKGRS_DYNAMIC: 1
+
     steps:
       - uses: actions/checkout@v2
 
+      # install OpenSSL on Windows
+      - name: Set vcpkg root
+        if: matrix.target.triple == 'x86_64-pc-windows-msvc'
+        run: echo "VCPKG_ROOT=$env:VCPKG_INSTALLATION_ROOT" | Out-File -FilePath $env:GITHUB_ENV -Append
+      - name: Install OpenSSL
+        if: matrix.target.triple == 'x86_64-pc-windows-msvc'
+        run: vcpkg install openssl:x64-windows
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-${{ matrix.target.triple }}
+          profile: minimal
+          override: true
+
       - name: Install ${{ matrix.version }}
         uses: actions-rs/toolchain@v1
         with:
@@ -50,7 +68,13 @@ jobs:
         uses: actions-rs/cargo@v1
         with:
           command: hack
-          args: --clean-per-run check --workspace --no-default-features --tests
+          args: check --workspace --no-default-features
+
+      - name: check minimal + tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: hack
+          args: check --workspace --no-default-features --tests --examples
 
       - name: check full
         uses: actions-rs/cargo@v1

CHANGES.md

@@ -3,6 +3,31 @@
 ## Unreleased - 2021-xx-xx
 
 
+## 4.0.0-beta.5 - 2021-04-02
+### Added
+* `Header` extractor for extracting common HTTP headers in handlers. [#2094]
+* Added `TestServer::client_headers` method. [#2097]
+
+### Fixed
+* Double ampersand in Logger format is escaped correctly. [#2067]
+
+### Changed
+* `CustomResponder` would return error as `HttpResponse` when `CustomResponder::with_header` failed
+  instead of skipping. (Only the first error is kept when multiple error occur) [#2093]
+
+### Removed
+* The `client` mod was removed. Clients should now use `awc` directly.
+  [871ca5e4](https://github.com/actix/actix-web/commit/871ca5e4ae2bdc22d1ea02701c2992fa8d04aed7)
+* Integration testing was moved to new `actix-test` crate. Namely these items from the `test`
+  module: `TestServer`, `TestServerConfig`, `start`, `start_with`, and `unused_addr`. [#2112]
+
+[#2067]: https://github.com/actix/actix-web/pull/2067
+[#2093]: https://github.com/actix/actix-web/pull/2093
+[#2094]: https://github.com/actix/actix-web/pull/2094
+[#2097]: https://github.com/actix/actix-web/pull/2097
+[#2112]: https://github.com/actix/actix-web/pull/2112
+
+
 ## 4.0.0-beta.4 - 2021-03-09
 ### Changed
 * Feature `cookies` is now optional and enabled by default. [#1981]

Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-web"
-version = "4.0.0-beta.4"
+version = "4.0.0-beta.5"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust"
 readme = "README.md"
@@ -36,25 +36,26 @@ members = [
   "actix-web-actors",
   "actix-web-codegen",
   "actix-http-test",
+  "actix-test",
 ]
 
 [features]
 default = ["compress", "cookies"]
 
 # content-encoding support
-compress = ["actix-http/compress", "awc/compress"]
+compress = ["actix-http/compress"]
 
 # support for cookies
-cookies = ["actix-http/cookies", "awc/cookies"]
+cookies = ["actix-http/cookies"]
 
 # secure cookies feature
 secure-cookies = ["actix-http/secure-cookies"]
 
 # openssl
-openssl = ["tls-openssl", "actix-tls/accept", "actix-tls/openssl", "awc/openssl"]
+openssl = ["actix-http/openssl", "actix-tls/accept", "actix-tls/openssl"]
 
 # rustls
-rustls = ["tls-rustls", "actix-tls/accept", "actix-tls/rustls", "awc/rustls"]
+rustls = ["actix-http/rustls", "actix-tls/accept", "actix-tls/rustls"]
 
 [[example]]
 name = "basic"
@@ -72,23 +73,18 @@ required-features = ["compress", "cookies"]
 name = "on_connect"
 required-features = []
 
-[[example]]
-name = "client"
-required-features = ["rustls"]
-
 [dependencies]
 actix-codec = "0.4.0-beta.1"
 actix-macros = "0.2.0"
 actix-router = "0.2.7"
-actix-rt = "2.1"
+actix-rt = "2.2"
 actix-server = "2.0.0-beta.3"
 actix-service = "2.0.0-beta.4"
-actix-utils = "3.0.0-beta.2"
+actix-utils = "3.0.0-beta.4"
-actix-tls = { version = "3.0.0-beta.4", default-features = false, optional = true }
+actix-tls = { version = "3.0.0-beta.5", default-features = false, optional = true }
 
 actix-web-codegen = "0.5.0-beta.2"
-actix-http = "3.0.0-beta.4"
+actix-http = "3.0.0-beta.5"
-awc = { version = "3.0.0-beta.3", default-features = false }
 
 ahash = "0.7"
 bytes = "1"
@@ -97,6 +93,8 @@ either = "1.5.3"
 encoding_rs = "0.8"
 futures-core = { version = "0.3.7", default-features = false }
 futures-util = { version = "0.3.7", default-features = false }
+language-tags = "0.2"
+once_cell = "1.5"
 log = "0.4"
 mime = "0.3"
 pin-project = "1.0.0"
@@ -105,19 +103,14 @@ serde = { version = "1.0", features = ["derive"] }
 serde_json = "1.0"
 serde_urlencoded = "0.7"
 smallvec = "1.6"
-socket2 = "0.3.16"
+socket2 = "0.4.0"
 time = { version = "0.2.23", default-features = false, features = ["std"] }
-tls-openssl = { package = "openssl", version = "0.10.9", optional = true }
-tls-rustls = { package = "rustls", version = "0.19.0", optional = true }
 url = "2.1"
 
-[target.'cfg(windows)'.dependencies.tls-openssl]
-version = "0.10.9"
-package = "openssl"
-features = ["vendored"]
-optional = true
-
 [dev-dependencies]
+actix-test = { version = "0.0.1", features = ["openssl", "rustls"] }
+awc = { version = "3.0.0-beta.4", features = ["openssl"] }
+
 brotli2 = "0.3.2"
 criterion = "0.3"
 env_logger = "0.8"
@@ -125,6 +118,8 @@ flate2 = "1.0.13"
 rand = "0.8"
 rcgen = "0.8"
 serde_derive = "1.0"
+tls-openssl = { package = "openssl", version = "0.10.9" }
+tls-rustls = { package = "rustls", version = "0.19.0" }
 
 [profile.release]
 lto = true
@@ -132,13 +127,14 @@ opt-level = 3
 codegen-units = 1
 
 [patch.crates-io]
-actix-web = { path = "." }
+actix-files = { path = "actix-files" }
 actix-http = { path = "actix-http" }
 actix-http-test = { path = "actix-http-test" }
+actix-multipart = { path = "actix-multipart" }
+actix-test = { path = "actix-test" }
+actix-web = { path = "." }
 actix-web-actors = { path = "actix-web-actors" }
 actix-web-codegen = { path = "actix-web-codegen" }
-actix-multipart = { path = "actix-multipart" }
-actix-files = { path = "actix-files" }
 awc = { path = "awc" }
 
 [[bench]]

README.md

@@ -6,10 +6,10 @@
   <p>
 
 [![crates.io](https://img.shields.io/crates/v/actix-web?label=latest)](https://crates.io/crates/actix-web)
-[![Documentation](https://docs.rs/actix-web/badge.svg?version=4.0.0-beta.4)](https://docs.rs/actix-web/4.0.0-beta.4)
+[![Documentation](https://docs.rs/actix-web/badge.svg?version=4.0.0-beta.5)](https://docs.rs/actix-web/4.0.0-beta.5)
 [![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
 ![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-web.svg)
-[![Dependency Status](https://deps.rs/crate/actix-web/4.0.0-beta.4/status.svg)](https://deps.rs/crate/actix-web/4.0.0-beta.4)
+[![Dependency Status](https://deps.rs/crate/actix-web/4.0.0-beta.5/status.svg)](https://deps.rs/crate/actix-web/4.0.0-beta.5)
 <br />
 [![build status](https://github.com/actix/actix-web/workflows/CI%20%28Linux%29/badge.svg?branch=master&event=push)](https://github.com/actix/actix-web/actions)
 [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) 

actix-files/Cargo.toml

@@ -17,14 +17,14 @@ name = "actix_files"
 path = "src/lib.rs"
 
 [dependencies]
-actix-web = { version = "4.0.0-beta.4", default-features = false }
+actix-web = { version = "4.0.0-beta.5", default-features = false }
 actix-service = "2.0.0-beta.4"
+actix-utils = "3.0.0-beta.4"
 
 askama_escape = "0.10"
 bitflags = "1"
 bytes = "1"
-futures-core = { version = "0.3.7", default-features = false }
+futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
-futures-util = { version = "0.3.7", default-features = false }
 http-range = "0.1.4"
 derive_more = "0.99.5"
 log = "0.4"
@@ -33,5 +33,6 @@ mime_guess = "2.0.1"
 percent-encoding = "2.1"
 
 [dev-dependencies]
-actix-rt = "2.1"
+actix-rt = "2.2"
-actix-web = "4.0.0-beta.4"
+actix-web = "4.0.0-beta.5"
+actix-test = "0.0.1"

actix-files/src/files.rs

@@ -1,6 +1,7 @@
 use std::{cell::RefCell, fmt, io, path::PathBuf, rc::Rc};
 
 use actix_service::{boxed, IntoServiceFactory, ServiceFactory, ServiceFactoryExt};
+use actix_utils::future::ok;
 use actix_web::{
     dev::{AppService, HttpServiceFactory, ResourceDef, ServiceRequest, ServiceResponse},
     error::Error,
@@ -8,7 +9,7 @@ use actix_web::{
     http::header::DispositionType,
     HttpRequest,
 };
-use futures_util::future::{ok, FutureExt, LocalBoxFuture};
+use futures_core::future::LocalBoxFuture;
 
 use crate::{
     directory_listing, named, Directory, DirectoryRenderer, FilesService, HttpNewService,
@@ -19,7 +20,7 @@ use crate::{
 ///
 /// `Files` service must be registered with `App::service()` method.
 ///
-/// ```rust
+/// ```
 /// use actix_web::App;
 /// use actix_files::Files;
 ///
@@ -263,18 +264,18 @@ impl ServiceFactory<ServiceRequest> for Files {
         };
 
         if let Some(ref default) = *self.default.borrow() {
-            default
+            let fut = default.new_service(());
-                .new_service(())
+            Box::pin(async {
-                .map(move |result| match result {
+                match fut.await {
                     Ok(default) => {
                         srv.default = Some(default);
                         Ok(srv)
                     }
                     Err(_) => Err(()),
-                })
+                }
-                .boxed_local()
+            })
         } else {
-            ok(srv).boxed_local()
+            Box::pin(ok(srv))
         }
     }
 }

actix-files/src/lib.rs

@@ -3,7 +3,7 @@
 //! Provides a non-blocking service for serving static files from disk.
 //!
 //! # Example
-//! ```rust
+//! ```
 //! use actix_web::App;
 //! use actix_files::Files;
 //!
@@ -65,6 +65,7 @@ mod tests {
     };
 
     use actix_service::ServiceFactory;
+    use actix_utils::future::ok;
     use actix_web::{
         guard,
         http::{
@@ -76,7 +77,6 @@ mod tests {
         web::{self, Bytes},
         App, HttpResponse, Responder,
     };
-    use futures_util::future::ok;
 
     use super::*;
 
@@ -413,7 +413,7 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_content_range_headers() {
-        let srv = test::start(|| App::new().service(Files::new("/", ".")));
+        let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
 
         // Valid range header
         let response = srv
@@ -438,7 +438,7 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_content_length_headers() {
-        let srv = test::start(|| App::new().service(Files::new("/", ".")));
+        let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
 
         // Valid range header
         let response = srv
@@ -477,7 +477,7 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_head_content_length_headers() {
-        let srv = test::start(|| App::new().service(Files::new("/", ".")));
+        let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
 
         let response = srv.head("/tests/test.binary").send().await.unwrap();
 

actix-files/src/named.rs

@@ -60,7 +60,7 @@ impl NamedFile {
     ///
     /// # Examples
     ///
-    /// ```rust
+    /// ```
     /// use actix_files::NamedFile;
     /// use std::io::{self, Write};
     /// use std::env;
@@ -137,7 +137,7 @@ impl NamedFile {
     ///
     /// # Examples
     ///
-    /// ```rust
+    /// ```
     /// use actix_files::NamedFile;
     ///
     /// let file = NamedFile::open("foo.txt");
@@ -156,7 +156,7 @@ impl NamedFile {
     ///
     /// # Examples
     ///
-    /// ```rust
+    /// ```
     /// # use std::io;
     /// use actix_files::NamedFile;
     ///

actix-files/src/path_buf.rs

@@ -3,8 +3,8 @@ use std::{
     str::FromStr,
 };
 
+use actix_utils::future::{ready, Ready};
 use actix_web::{dev::Payload, FromRequest, HttpRequest};
-use futures_util::future::{ready, Ready};
 
 use crate::error::UriSegmentError;
 

actix-files/src/service.rs

@@ -1,6 +1,7 @@
-use std::{fmt, io, path::PathBuf, rc::Rc, task::Poll};
+use std::{fmt, io, path::PathBuf, rc::Rc};
 
 use actix_service::Service;
+use actix_utils::future::ok;
 use actix_web::{
     dev::{ServiceRequest, ServiceResponse},
     error::Error,
@@ -8,7 +9,7 @@ use actix_web::{
     http::{header, Method},
     HttpResponse,
 };
-use futures_util::future::{ok, Either, LocalBoxFuture, Ready};
+use futures_core::future::LocalBoxFuture;
 
 use crate::{
     named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride, NamedFile,
@@ -29,19 +30,18 @@ pub struct FilesService {
     pub(crate) hidden_files: bool,
 }
 
-type FilesServiceFuture = Either<
-    Ready<Result<ServiceResponse, Error>>,
-    LocalBoxFuture<'static, Result<ServiceResponse, Error>>,
->;
-
 impl FilesService {
-    fn handle_err(&self, e: io::Error, req: ServiceRequest) -> FilesServiceFuture {
+    fn handle_err(
-        log::debug!("Failed to handle {}: {}", req.path(), e);
+        &self,
+        err: io::Error,
+        req: ServiceRequest,
+    ) -> LocalBoxFuture<'static, Result<ServiceResponse, Error>> {
+        log::debug!("error handling {}: {}", req.path(), err);
 
         if let Some(ref default) = self.default {
-            Either::Right(default.call(req))
+            Box::pin(default.call(req))
         } else {
-            Either::Left(ok(req.error_response(e)))
+            Box::pin(ok(req.error_response(err)))
         }
     }
 }
@@ -55,7 +55,7 @@ impl fmt::Debug for FilesService {
 impl Service<ServiceRequest> for FilesService {
     type Response = ServiceResponse;
     type Error = Error;
-    type Future = FilesServiceFuture;
+    type Future = LocalBoxFuture<'static, Result<ServiceResponse, Error>>;
 
     actix_service::always_ready!();
 
@@ -69,7 +69,7 @@ impl Service<ServiceRequest> for FilesService {
         };
 
         if !is_method_valid {
-            return Either::Left(ok(req.into_response(
+            return Box::pin(ok(req.into_response(
                 actix_web::HttpResponse::MethodNotAllowed()
                     .insert_header(header::ContentType(mime::TEXT_PLAIN_UTF_8))
                     .body("Request did not meet this resource's requirements."),
@@ -79,13 +79,13 @@ impl Service<ServiceRequest> for FilesService {
         let real_path =
             match PathBufWrap::parse_path(req.match_info().path(), self.hidden_files) {
                 Ok(item) => item,
-                Err(e) => return Either::Left(ok(req.error_response(e))),
+                Err(e) => return Box::pin(ok(req.error_response(e))),
             };
 
         // full file path
         let path = match self.directory.join(&real_path).canonicalize() {
             Ok(path) => path,
-            Err(e) => return self.handle_err(e, req),
+            Err(err) => return Box::pin(self.handle_err(err, req)),
         };
 
         if path.is_dir() {
@@ -93,7 +93,7 @@ impl Service<ServiceRequest> for FilesService {
                 if self.redirect_to_slash && !req.path().ends_with('/') {
                     let redirect_to = format!("{}/", req.path());
 
-                    return Either::Left(ok(req.into_response(
+                    return Box::pin(ok(req.into_response(
                         HttpResponse::Found()
                             .insert_header((header::LOCATION, redirect_to))
                             .body("")
@@ -114,9 +114,9 @@ impl Service<ServiceRequest> for FilesService {
 
                         let (req, _) = req.into_parts();
                         let res = named_file.into_response(&req);
-                        Either::Left(ok(ServiceResponse::new(req, res)))
+                        Box::pin(ok(ServiceResponse::new(req, res)))
                     }
-                    Err(e) => self.handle_err(e, req),
+                    Err(err) => self.handle_err(err, req),
                 }
             } else if self.show_index {
                 let dir = Directory::new(self.directory.clone(), path);
@@ -124,12 +124,12 @@ impl Service<ServiceRequest> for FilesService {
                 let (req, _) = req.into_parts();
                 let x = (self.renderer)(&dir, &req);
 
-                match x {
+                Box::pin(match x {
-                    Ok(resp) => Either::Left(ok(resp)),
+                    Ok(resp) => ok(resp),
-                    Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
+                    Err(err) => ok(ServiceResponse::from_err(err, req)),
-                }
+                })
             } else {
-                Either::Left(ok(ServiceResponse::from_err(
+                Box::pin(ok(ServiceResponse::from_err(
                     FilesError::IsDirectory,
                     req.into_parts().0,
                 )))
@@ -145,9 +145,9 @@ impl Service<ServiceRequest> for FilesService {
 
                     let (req, _) = req.into_parts();
                     let res = named_file.into_response(&req);
-                    Either::Left(ok(ServiceResponse::new(req, res)))
+                    Box::pin(ok(ServiceResponse::new(req, res)))
                 }
-                Err(e) => self.handle_err(e, req),
+                Err(err) => self.handle_err(err, req),
             }
         }
     }

actix-http-test/CHANGES.md

@@ -1,7 +1,8 @@
 # Changes
 
 ## Unreleased - 2021-xx-xx
-
+### Added
+* Added `TestServer::client_headers` method. [#2097]
 
 ## 3.0.0-beta.3 - 2021-03-09
 * No notable changes.

actix-http-test/Cargo.toml

@@ -31,18 +31,18 @@ openssl = ["tls-openssl", "awc/openssl"]
 [dependencies]
 actix-service = "2.0.0-beta.4"
 actix-codec = "0.4.0-beta.1"
-actix-tls = "3.0.0-beta.4"
+actix-tls = "3.0.0-beta.5"
-actix-utils = "3.0.0-beta.2"
+actix-utils = "3.0.0-beta.4"
-actix-rt = "2.1"
+actix-rt = "2.2"
 actix-server = "2.0.0-beta.3"
-awc = { version = "3.0.0-beta.3", default-features = false }
+awc = { version = "3.0.0-beta.4", default-features = false }
 
 base64 = "0.13"
 bytes = "1"
 futures-core = { version = "0.3.7", default-features = false }
 http = "0.2.2"
 log = "0.4"
-socket2 = "0.3"
+socket2 = "0.4"
 serde = "1.0"
 serde_json = "1.0"
 slab = "0.4"
@@ -50,12 +50,6 @@ serde_urlencoded = "0.7"
 time = { version = "0.2.23", default-features = false, features = ["std"] }
 tls-openssl = { version = "0.10.9", package = "openssl", optional = true }
 
-[target.'cfg(windows)'.dependencies.tls-openssl]
-version = "0.10.9"
-package = "openssl"
-features = ["vendored"]
-optional = true
-
 [dev-dependencies]
-actix-web = { version = "4.0.0-beta.4", default-features = false, features = ["cookies"] }
+actix-web = { version = "4.0.0-beta.5", default-features = false, features = ["cookies"] }
-actix-http = "3.0.0-beta.4"
+actix-http = "3.0.0-beta.5"

actix-http-test/src/lib.rs

@@ -13,7 +13,9 @@ use std::{net, thread, time};
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_rt::{net::TcpStream, System};
 use actix_server::{Server, ServiceFactory};
-use awc::{error::PayloadError, ws, Client, ClientRequest, ClientResponse, Connector};
+use awc::{
+    error::PayloadError, http::HeaderMap, ws, Client, ClientRequest, ClientResponse, Connector,
+};
 use bytes::Bytes;
 use futures_core::stream::Stream;
 use http::Method;
@@ -26,7 +28,7 @@ use socket2::{Domain, Protocol, Socket, Type};
 ///
 /// # Examples
 ///
-/// ```rust
+/// ```
 /// use actix_http::HttpService;
 /// use actix_http_test::TestServer;
 /// use actix_web::{web, App, HttpResponse, Error};
@@ -115,16 +117,6 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
     }
 }
 
-/// Get first available unused address
-pub fn unused_addr() -> net::SocketAddr {
-    let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
-    let socket = Socket::new(Domain::ipv4(), Type::stream(), Some(Protocol::tcp())).unwrap();
-    socket.bind(&addr.into()).unwrap();
-    socket.set_reuse_address(true).unwrap();
-    let tcp = socket.into_tcp_listener();
-    tcp.local_addr().unwrap()
-}
-
 /// Test server controller
 pub struct TestServer {
     addr: net::SocketAddr,
@@ -258,6 +250,14 @@ impl TestServer {
         self.ws_at("/").await
     }
 
+    /// Get default HeaderMap of Client.
+    ///
+    /// Returns Some(&mut HeaderMap) when Client object is unique
+    /// (No other clone of client exists at the same time).
+    pub fn client_headers(&mut self) -> Option<&mut HeaderMap> {
+        self.client.headers()
+    }
+
     /// Stop HTTP server
     fn stop(&mut self) {
         self.system.stop();
@@ -269,3 +269,13 @@ impl Drop for TestServer {
         self.stop()
     }
 }
+
+/// Get a localhost socket address with random, unused port.
+pub fn unused_addr() -> net::SocketAddr {
+    let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
+    let socket = Socket::new(Domain::IPV4, Type::STREAM, Some(Protocol::TCP)).unwrap();
+    socket.bind(&addr.into()).unwrap();
+    socket.set_reuse_address(true).unwrap();
+    let tcp = net::TcpListener::from(socket);
+    tcp.local_addr().unwrap()
+}

actix-http/CHANGES.md

@@ -3,6 +3,25 @@
 ## Unreleased - 2021-xx-xx
 
 
+## 3.0.0-beta.5 - 2021-04-02
+### Added
+* `client::Connector::handshake_timeout` method for customizing TLS connection handshake timeout. [#2081]
+* `client::ConnectorService` as `client::Connector::finish` method's return type [#2081]
+* `client::ConnectionIo` trait alias [#2081]
+
+### Changed
+* `client::Connector` type now only have one generic type for `actix_service::Service`. [#2063]
+
+### Removed
+* Common typed HTTP headers were moved to actix-web. [2094]
+* `ResponseError` impl for `actix_utils::timeout::TimeoutError`. [#2127]
+
+[#2063]: https://github.com/actix/actix-web/pull/2063
+[#2081]: https://github.com/actix/actix-web/pull/2081
+[#2094]: https://github.com/actix/actix-web/pull/2094
+[#2127]: https://github.com/actix/actix-web/pull/2127
+
+
 ## 3.0.0-beta.4 - 2021-03-08
 ### Changed
 * Feature `cookies` is now optional and disabled by default. [#1981]

actix-http/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-http"
-version = "3.0.0-beta.4"
+version = "3.0.0-beta.5"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "HTTP primitives for the Actix ecosystem"
 readme = "README.md"
@@ -46,16 +46,15 @@ trust-dns = ["trust-dns-resolver"]
 [dependencies]
 actix-service = "2.0.0-beta.4"
 actix-codec = "0.4.0-beta.1"
-actix-utils = "3.0.0-beta.2"
+actix-utils = "3.0.0-beta.4"
-actix-rt = "2.1"
+actix-rt = "2.2"
-actix-tls = "3.0.0-beta.4"
+actix-tls = { version = "3.0.0-beta.5", features = ["accept", "connect"] }
 
 ahash = "0.7"
 base64 = "0.13"
 bitflags = "1.2"
 bytes = "1"
 bytestring = "1"
-cfg-if = "1"
 cookie = { version = "0.14.1", features = ["percent-encode"], optional = true }
 derive_more = "0.99.5"
 encoding_rs = "0.8"
@@ -66,11 +65,13 @@ http = "0.2.2"
 httparse = "1.3"
 itoa = "0.4"
 language-tags = "0.2"
+local-channel = "0.1"
 once_cell = "1.5"
 log = "0.4"
 mime = "0.3"
 percent-encoding = "2.1"
 pin-project = "1.0.0"
+pin-project-lite = "0.2"
 rand = "0.8"
 regex = "1.3"
 serde = "1.0"
@@ -90,7 +91,7 @@ trust-dns-resolver = { version = "0.20.0", optional = true }
 [dev-dependencies]
 actix-server = "2.0.0-beta.3"
 actix-http-test = { version = "3.0.0-beta.3", features = ["openssl"] }
-actix-tls = { version = "3.0.0-beta.4", features = ["openssl"] }
+actix-tls = { version = "3.0.0-beta.5", features = ["openssl"] }
 criterion = "0.3"
 env_logger = "0.8"
 rcgen = "0.8"
@@ -98,11 +99,6 @@ serde_derive = "1.0"
 tls-openssl = { version = "0.10", package = "openssl" }
 tls-rustls = { version = "0.19", package = "rustls" }
 
-[target.'cfg(windows)'.dev-dependencies.tls-openssl]
-version = "0.10.9"
-package = "openssl"
-features = ["vendored"]
-
 [[example]]
 name = "ws"
 required-features = ["rustls"]

actix-http/README.md

@@ -3,11 +3,11 @@
 > HTTP primitives for the Actix ecosystem.
 
 [![crates.io](https://img.shields.io/crates/v/actix-http?label=latest)](https://crates.io/crates/actix-http)
-[![Documentation](https://docs.rs/actix-http/badge.svg?version=3.0.0-beta.4)](https://docs.rs/actix-http/3.0.0-beta.4)
+[![Documentation](https://docs.rs/actix-http/badge.svg?version=3.0.0-beta.5)](https://docs.rs/actix-http/3.0.0-beta.5)
 [![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
 ![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http.svg)
 <br />
-[![dependency status](https://deps.rs/crate/actix-http/3.0.0-beta.4/status.svg)](https://deps.rs/crate/actix-http/3.0.0-beta.4)
+[![dependency status](https://deps.rs/crate/actix-http/3.0.0-beta.5/status.svg)](https://deps.rs/crate/actix-http/3.0.0-beta.5)
 [![Download](https://img.shields.io/crates/d/actix-http.svg)](https://crates.io/crates/actix-http)
 [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
 

actix-http/examples/echo.rs

@@ -3,7 +3,7 @@ use std::{env, io};
 use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures_util::StreamExt;
+use futures_util::StreamExt as _;
 use http::header::HeaderValue;
 use log::info;
 

actix-http/examples/echo2.rs

@@ -4,7 +4,7 @@ use actix_http::http::HeaderValue;
 use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures_util::StreamExt;
+use futures_util::StreamExt as _;
 use log::info;
 
 async fn handle_request(mut req: Request) -> Result<Response, Error> {

actix-http/examples/hello-world.rs

@@ -2,7 +2,7 @@ use std::{env, io};
 
 use actix_http::{HttpService, Response};
 use actix_server::Server;
-use futures_util::future;
+use actix_utils::future;
 use http::header::HeaderValue;
 use log::info;
 

actix-http/src/body/mod.rs

@@ -20,8 +20,9 @@ mod tests {
     use std::pin::Pin;
 
     use actix_rt::pin;
+    use actix_utils::future::poll_fn;
     use bytes::{Bytes, BytesMut};
-    use futures_util::{future::poll_fn, stream};
+    use futures_util::stream;
 
     use super::*;
 

actix-http/src/builder.rs

@@ -63,11 +63,9 @@ where
     X: ServiceFactory<Request, Config = (), Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    <X::Service as Service<Request>>::Future: 'static,
     U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
-    <U::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
 {
     /// Set server keep-alive setting.
     ///
@@ -127,7 +125,6 @@ where
         X1: ServiceFactory<Request, Config = (), Response = Request>,
         X1::Error: Into<Error>,
         X1::InitError: fmt::Debug,
-        <X1::Service as Service<Request>>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
@@ -152,7 +149,6 @@ where
         U1: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
-        <U1::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
@@ -211,7 +207,6 @@ where
         S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>> + 'static,
-        <S::Service as Service<Request>>::Future: 'static,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,
@@ -233,7 +228,6 @@ where
         S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>> + 'static,
-        <S::Service as Service<Request>>::Future: 'static,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,

actix-http/src/client/config.rs

@@ -8,6 +8,7 @@ const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1MB
 #[derive(Clone)]
 pub(crate) struct ConnectorConfig {
     pub(crate) timeout: Duration,
+    pub(crate) handshake_timeout: Duration,
     pub(crate) conn_lifetime: Duration,
     pub(crate) conn_keep_alive: Duration,
     pub(crate) disconnect_timeout: Option<Duration>,
@@ -21,6 +22,7 @@ impl Default for ConnectorConfig {
     fn default() -> Self {
         Self {
             timeout: Duration::from_secs(5),
+            handshake_timeout: Duration::from_secs(5),
             conn_lifetime: Duration::from_secs(75),
             conn_keep_alive: Duration::from_secs(15),
             disconnect_timeout: Some(Duration::from_millis(3000)),

actix-http/src/client/connection.rs

@@ -1,14 +1,16 @@
-use std::ops::{Deref, DerefMut};
+use std::{
-use std::pin::Pin;
+    io,
-use std::task::{Context, Poll};
+    ops::{Deref, DerefMut},
-use std::{fmt, io, time};
+    pin::Pin,
+    task::{Context, Poll},
+    time,
+};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
 use actix_rt::task::JoinHandle;
 use bytes::Bytes;
 use futures_core::future::LocalBoxFuture;
 use h2::client::SendRequest;
-use pin_project::pin_project;
 
 use crate::body::MessageBody;
 use crate::h1::ClientCodec;
@@ -19,28 +21,148 @@ use super::error::SendRequestError;
 use super::pool::Acquired;
 use super::{h1proto, h2proto};
 
-pub(crate) enum ConnectionType<Io> {
+/// Trait alias for types impl [tokio::io::AsyncRead] and [tokio::io::AsyncWrite].
-    H1(Io),
+pub trait ConnectionIo: AsyncRead + AsyncWrite + Unpin + 'static {}
-    H2(H2Connection),
+
+impl<T: AsyncRead + AsyncWrite + Unpin + 'static> ConnectionIo for T {}
+
+/// HTTP client connection
+pub struct H1Connection<Io: ConnectionIo> {
+    io: Option<Io>,
+    created: time::Instant,
+    acquired: Acquired<Io>,
 }
 
-/// `H2Connection` has two parts: `SendRequest` and `Connection`.
+impl<Io: ConnectionIo> H1Connection<Io> {
+    /// close or release the connection to pool based on flag input
+    pub(super) fn on_release(&mut self, keep_alive: bool) {
+        if keep_alive {
+            self.release();
+        } else {
+            self.close();
+        }
+    }
+
+    /// Close connection
+    fn close(&mut self) {
+        let io = self.io.take().unwrap();
+        self.acquired.close(ConnectionInnerType::H1(io));
+    }
+
+    /// Release this connection to the connection pool
+    fn release(&mut self) {
+        let io = self.io.take().unwrap();
+        self.acquired
+            .release(ConnectionInnerType::H1(io), self.created);
+    }
+
+    fn io_pin_mut(self: Pin<&mut Self>) -> Pin<&mut Io> {
+        Pin::new(self.get_mut().io.as_mut().unwrap())
+    }
+}
+
+impl<Io: ConnectionIo> AsyncRead for H1Connection<Io> {
+    fn poll_read(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &mut ReadBuf<'_>,
+    ) -> Poll<io::Result<()>> {
+        self.io_pin_mut().poll_read(cx, buf)
+    }
+}
+
+impl<Io: ConnectionIo> AsyncWrite for H1Connection<Io> {
+    fn poll_write(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &[u8],
+    ) -> Poll<io::Result<usize>> {
+        self.io_pin_mut().poll_write(cx, buf)
+    }
+
+    fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
+        self.io_pin_mut().poll_flush(cx)
+    }
+
+    fn poll_shutdown(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Result<(), io::Error>> {
+        self.io_pin_mut().poll_shutdown(cx)
+    }
+
+    fn poll_write_vectored(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        bufs: &[io::IoSlice<'_>],
+    ) -> Poll<io::Result<usize>> {
+        self.io_pin_mut().poll_write_vectored(cx, bufs)
+    }
+
+    fn is_write_vectored(&self) -> bool {
+        self.io.as_ref().unwrap().is_write_vectored()
+    }
+}
+
+/// HTTP2 client connection
+pub struct H2Connection<Io: ConnectionIo> {
+    io: Option<H2ConnectionInner>,
+    created: time::Instant,
+    acquired: Acquired<Io>,
+}
+
+impl<Io: ConnectionIo> Deref for H2Connection<Io> {
+    type Target = SendRequest<Bytes>;
+
+    fn deref(&self) -> &Self::Target {
+        &self.io.as_ref().unwrap().sender
+    }
+}
+
+impl<Io: ConnectionIo> DerefMut for H2Connection<Io> {
+    fn deref_mut(&mut self) -> &mut Self::Target {
+        &mut self.io.as_mut().unwrap().sender
+    }
+}
+
+impl<Io: ConnectionIo> H2Connection<Io> {
+    /// close or release the connection to pool based on flag input
+    pub(super) fn on_release(&mut self, close: bool) {
+        if close {
+            self.close();
+        } else {
+            self.release();
+        }
+    }
+
+    /// Close connection
+    fn close(&mut self) {
+        let io = self.io.take().unwrap();
+        self.acquired.close(ConnectionInnerType::H2(io));
+    }
+
+    /// Release this connection to the connection pool
+    fn release(&mut self) {
+        let io = self.io.take().unwrap();
+        self.acquired
+            .release(ConnectionInnerType::H2(io), self.created);
+    }
+}
+
+/// `H2ConnectionInner` has two parts: `SendRequest` and `Connection`.
 ///
-/// `Connection` is spawned as an async task on runtime and `H2Connection` holds a handle for
+/// `Connection` is spawned as an async task on runtime and `H2ConnectionInner` holds a handle
-/// this task. Therefore, it can wake up and quit the task when SendRequest is dropped.
+/// for this task. Therefore, it can wake up and quit the task when SendRequest is dropped.
-pub(crate) struct H2Connection {
+pub(super) struct H2ConnectionInner {
     handle: JoinHandle<()>,
     sender: SendRequest<Bytes>,
 }
 
-impl H2Connection {
+impl H2ConnectionInner {
-    pub(crate) fn new<Io>(
+    pub(super) fn new<Io: ConnectionIo>(
         sender: SendRequest<Bytes>,
         connection: h2::client::Connection<Io>,
-    ) -> Self
+    ) -> Self {
-    where
-        Io: AsyncRead + AsyncWrite + Unpin + 'static,
-    {
         let handle = actix_rt::spawn(async move {
             let _ = connection.await;
         });
@@ -49,161 +171,86 @@ impl H2Connection {
     }
 }
 
-// cancel spawned connection task on drop.
+/// Cancel spawned connection task on drop.
-impl Drop for H2Connection {
+impl Drop for H2ConnectionInner {
     fn drop(&mut self) {
-        self.handle.abort();
+        if self
-    }
+            .sender
-}
+            .send_request(http::Request::new(()), true)
-
+            .is_err()
-// only expose sender type to public.
+        {
-impl Deref for H2Connection {
+            self.handle.abort();
-    type Target = SendRequest<Bytes>;
-
-    fn deref(&self) -> &Self::Target {
-        &self.sender
-    }
-}
-
-impl DerefMut for H2Connection {
-    fn deref_mut(&mut self) -> &mut Self::Target {
-        &mut self.sender
-    }
-}
-
-pub trait Connection {
-    type Io: AsyncRead + AsyncWrite + Unpin;
-
-    /// Send request and body
-    fn send_request<B, H>(
-        self,
-        head: H,
-        body: B,
-    ) -> LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>
-    where
-        B: MessageBody + 'static,
-        H: Into<RequestHeadType> + 'static;
-
-    /// Send request, returns Response and Framed
-    fn open_tunnel<H: Into<RequestHeadType> + 'static>(
-        self,
-        head: H,
-    ) -> LocalBoxFuture<
-        'static,
-        Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
-    >;
-}
-
-pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
-    /// Close connection
-    fn close(self: Pin<&mut Self>);
-
-    /// Release connection to the connection pool
-    fn release(self: Pin<&mut Self>);
-}
-
-#[doc(hidden)]
-/// HTTP client connection
-pub struct IoConnection<T>
-where
-    T: AsyncWrite + Unpin + 'static,
-{
-    io: Option<ConnectionType<T>>,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
-}
-
-impl<T> fmt::Debug for IoConnection<T>
-where
-    T: AsyncWrite + Unpin + fmt::Debug + 'static,
-{
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        match self.io {
-            Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
-            Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
-            None => write!(f, "Connection(Empty)"),
-        }
-    }
-}
-
-impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
-    pub(crate) fn new(
-        io: ConnectionType<T>,
-        created: time::Instant,
-        pool: Option<Acquired<T>>,
-    ) -> Self {
-        IoConnection {
-            pool,
-            created,
-            io: Some(io),
-        }
-    }
-
-    pub(crate) fn into_inner(self) -> (ConnectionType<T>, time::Instant) {
-        (self.io.unwrap(), self.created)
-    }
-
-    #[cfg(test)]
-    pub(crate) fn into_parts(self) -> (ConnectionType<T>, time::Instant, Acquired<T>) {
-        (self.io.unwrap(), self.created, self.pool.unwrap())
-    }
-
-    async fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
-        mut self,
-        head: H,
-        body: B,
-    ) -> Result<(ResponseHead, Payload), SendRequestError> {
-        match self.io.take().unwrap() {
-            ConnectionType::H1(io) => {
-                h1proto::send_request(io, head.into(), body, self.created, self.pool)
-                    .await
-            }
-            ConnectionType::H2(io) => {
-                h2proto::send_request(io, head.into(), body, self.created, self.pool)
-                    .await
-            }
-        }
-    }
-
-    /// Send request, returns Response and Framed
-    async fn open_tunnel<H: Into<RequestHeadType>>(
-        mut self,
-        head: H,
-    ) -> Result<(ResponseHead, Framed<T, ClientCodec>), SendRequestError> {
-        match self.io.take().unwrap() {
-            ConnectionType::H1(io) => h1proto::open_tunnel(io, head.into()).await,
-            ConnectionType::H2(io) => {
-                if let Some(mut pool) = self.pool.take() {
-                    pool.release(IoConnection::new(
-                        ConnectionType::H2(io),
-                        self.created,
-                        None,
-                    ));
-                }
-                Err(SendRequestError::TunnelNotSupported)
-            }
         }
     }
 }
 
 #[allow(dead_code)]
-pub(crate) enum EitherIoConnection<A, B>
+/// Unified connection type cover Http1 Plain/Tls and Http2 protocols
+pub enum Connection<A, B = Box<dyn ConnectionIo>>
 where
-    A: AsyncRead + AsyncWrite + Unpin + 'static,
+    A: ConnectionIo,
-    B: AsyncRead + AsyncWrite + Unpin + 'static,
+    B: ConnectionIo,
 {
-    A(IoConnection<A>),
+    Tcp(ConnectionType<A>),
-    B(IoConnection<B>),
+    Tls(ConnectionType<B>),
 }
 
-impl<A, B> Connection for EitherIoConnection<A, B>
+/// Unified connection type cover Http1/2 protocols
-where
+pub enum ConnectionType<Io: ConnectionIo> {
-    A: AsyncRead + AsyncWrite + Unpin + 'static,
+    H1(H1Connection<Io>),
-    B: AsyncRead + AsyncWrite + Unpin + 'static,
+    H2(H2Connection<Io>),
-{
+}
-    type Io = EitherIo<A, B>;
 
-    fn send_request<RB, H>(
+/// Helper type for storing connection types in pool.
+pub(super) enum ConnectionInnerType<Io> {
+    H1(Io),
+    H2(H2ConnectionInner),
+}
+
+impl<Io: ConnectionIo> ConnectionType<Io> {
+    pub(super) fn from_pool(
+        inner: ConnectionInnerType<Io>,
+        created: time::Instant,
+        acquired: Acquired<Io>,
+    ) -> Self {
+        match inner {
+            ConnectionInnerType::H1(io) => Self::from_h1(io, created, acquired),
+            ConnectionInnerType::H2(io) => Self::from_h2(io, created, acquired),
+        }
+    }
+
+    pub(super) fn from_h1(
+        io: Io,
+        created: time::Instant,
+        acquired: Acquired<Io>,
+    ) -> Self {
+        Self::H1(H1Connection {
+            io: Some(io),
+            created,
+            acquired,
+        })
+    }
+
+    pub(super) fn from_h2(
+        io: H2ConnectionInner,
+        created: time::Instant,
+        acquired: Acquired<Io>,
+    ) -> Self {
+        Self::H2(H2Connection {
+            io: Some(io),
+            created,
+            acquired,
+        })
+    }
+}
+
+impl<A, B> Connection<A, B>
+where
+    A: ConnectionIo,
+    B: ConnectionIo,
+{
+    /// Send a request through connection.
+    pub fn send_request<RB, H>(
         self,
         head: H,
         body: RB,
@@ -212,76 +259,106 @@ where
         RB: MessageBody + 'static,
         H: Into<RequestHeadType> + 'static,
     {
-        match self {
+        Box::pin(async move {
-            EitherIoConnection::A(con) => Box::pin(con.send_request(head, body)),
+            match self {
-            EitherIoConnection::B(con) => Box::pin(con.send_request(head, body)),
+                Connection::Tcp(ConnectionType::H1(conn)) => {
-        }
+                    h1proto::send_request(conn, head.into(), body).await
+                }
+                Connection::Tls(ConnectionType::H1(conn)) => {
+                    h1proto::send_request(conn, head.into(), body).await
+                }
+                Connection::Tls(ConnectionType::H2(conn)) => {
+                    h2proto::send_request(conn, head.into(), body).await
+                }
+                _ => unreachable!(
+                    "Plain Tcp connection can be used only in Http1 protocol"
+                ),
+            }
+        })
     }
 
-    /// Send request, returns Response and Framed
+    /// Send request, returns Response and Framed tunnel.
-    fn open_tunnel<H: Into<RequestHeadType> + 'static>(
+    pub fn open_tunnel<H: Into<RequestHeadType> + 'static>(
         self,
         head: H,
     ) -> LocalBoxFuture<
         'static,
-        Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
+        Result<(ResponseHead, Framed<Connection<A, B>, ClientCodec>), SendRequestError>,
     > {
-        match self {
+        Box::pin(async move {
-            EitherIoConnection::A(con) => Box::pin(async {
+            match self {
-                let (head, framed) = con.open_tunnel(head).await?;
+                Connection::Tcp(ConnectionType::H1(ref _conn)) => {
-                Ok((head, framed.into_map_io(EitherIo::A)))
+                    let (head, framed) = h1proto::open_tunnel(self, head.into()).await?;
-            }),
+                    Ok((head, framed))
-            EitherIoConnection::B(con) => Box::pin(async {
+                }
-                let (head, framed) = con.open_tunnel(head).await?;
+                Connection::Tls(ConnectionType::H1(ref _conn)) => {
-                Ok((head, framed.into_map_io(EitherIo::B)))
+                    let (head, framed) = h1proto::open_tunnel(self, head.into()).await?;
-            }),
+                    Ok((head, framed))
-        }
+                }
+                Connection::Tls(ConnectionType::H2(mut conn)) => {
+                    conn.release();
+                    Err(SendRequestError::TunnelNotSupported)
+                }
+                Connection::Tcp(ConnectionType::H2(_)) => {
+                    unreachable!(
+                        "Plain Tcp connection can be used only in Http1 protocol"
+                    )
+                }
+            }
+        })
     }
 }
 
-#[pin_project(project = EitherIoProj)]
+impl<A, B> AsyncRead for Connection<A, B>
-pub enum EitherIo<A, B> {
-    A(#[pin] A),
-    B(#[pin] B),
-}
-
-impl<A, B> AsyncRead for EitherIo<A, B>
 where
-    A: AsyncRead,
+    A: ConnectionIo,
-    B: AsyncRead,
+    B: ConnectionIo,
 {
     fn poll_read(
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
         buf: &mut ReadBuf<'_>,
     ) -> Poll<io::Result<()>> {
-        match self.project() {
+        match self.get_mut() {
-            EitherIoProj::A(val) => val.poll_read(cx, buf),
+            Connection::Tcp(ConnectionType::H1(conn)) => {
-            EitherIoProj::B(val) => val.poll_read(cx, buf),
+                Pin::new(conn).poll_read(cx, buf)
+            }
+            Connection::Tls(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_read(cx, buf)
+            }
+            _ => unreachable!("H2Connection can not impl AsyncRead trait"),
         }
     }
 }
 
-impl<A, B> AsyncWrite for EitherIo<A, B>
+const H2_UNREACHABLE_WRITE: &str = "H2Connection can not impl AsyncWrite trait";
+
+impl<A, B> AsyncWrite for Connection<A, B>
 where
-    A: AsyncWrite,
+    A: ConnectionIo,
-    B: AsyncWrite,
+    B: ConnectionIo,
 {
     fn poll_write(
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
         buf: &[u8],
     ) -> Poll<io::Result<usize>> {
-        match self.project() {
+        match self.get_mut() {
-            EitherIoProj::A(val) => val.poll_write(cx, buf),
+            Connection::Tcp(ConnectionType::H1(conn)) => {
-            EitherIoProj::B(val) => val.poll_write(cx, buf),
+                Pin::new(conn).poll_write(cx, buf)
+            }
+            Connection::Tls(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_write(cx, buf)
+            }
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
         }
     }
 
     fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
-        match self.project() {
+        match self.get_mut() {
-            EitherIoProj::A(val) => val.poll_flush(cx),
+            Connection::Tcp(ConnectionType::H1(conn)) => Pin::new(conn).poll_flush(cx),
-            EitherIoProj::B(val) => val.poll_flush(cx),
+            Connection::Tls(ConnectionType::H1(conn)) => Pin::new(conn).poll_flush(cx),
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
         }
     }
 
@@ -289,18 +366,56 @@ where
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
     ) -> Poll<io::Result<()>> {
-        match self.project() {
+        match self.get_mut() {
-            EitherIoProj::A(val) => val.poll_shutdown(cx),
+            Connection::Tcp(ConnectionType::H1(conn)) => {
-            EitherIoProj::B(val) => val.poll_shutdown(cx),
+                Pin::new(conn).poll_shutdown(cx)
+            }
+            Connection::Tls(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_shutdown(cx)
+            }
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
+        }
+    }
+
+    fn poll_write_vectored(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        bufs: &[io::IoSlice<'_>],
+    ) -> Poll<io::Result<usize>> {
+        match self.get_mut() {
+            Connection::Tcp(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_write_vectored(cx, bufs)
+            }
+            Connection::Tls(ConnectionType::H1(conn)) => {
+                Pin::new(conn).poll_write_vectored(cx, bufs)
+            }
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
+        }
+    }
+
+    fn is_write_vectored(&self) -> bool {
+        match *self {
+            Connection::Tcp(ConnectionType::H1(ref conn)) => conn.is_write_vectored(),
+            Connection::Tls(ConnectionType::H1(ref conn)) => conn.is_write_vectored(),
+            _ => unreachable!(H2_UNREACHABLE_WRITE),
         }
     }
 }
 
 #[cfg(test)]
 mod test {
-    use std::net;
+    use std::{
+        future::Future,
+        net,
+        pin::Pin,
+        task::{Context, Poll},
+        time::{Duration, Instant},
+    };
 
-    use actix_rt::net::TcpStream;
+    use actix_rt::{
+        net::TcpStream,
+        time::{interval, Interval},
+    };
 
     use super::*;
 
@@ -314,16 +429,46 @@ mod test {
 
         let tcp = TcpStream::connect(local).await.unwrap();
         let (sender, connection) = h2::client::handshake(tcp).await.unwrap();
-        let conn = H2Connection::new(sender.clone(), connection);
+        let conn = H2ConnectionInner::new(sender.clone(), connection);
 
         assert!(sender.clone().ready().await.is_ok());
-        assert!(h2::client::SendRequest::clone(&*conn).ready().await.is_ok());
+        assert!(h2::client::SendRequest::clone(&conn.sender)
+            .ready()
+            .await
+            .is_ok());
 
         drop(conn);
 
-        match sender.ready().await {
+        struct DropCheck {
-            Ok(_) => panic!("connection should be gone and can not be ready"),
+            sender: h2::client::SendRequest<Bytes>,
-            Err(e) => assert!(e.is_io()),
+            interval: Interval,
-        };
+            start_from: Instant,
+        }
+
+        impl Future for DropCheck {
+            type Output = ();
+
+            fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+                let this = self.get_mut();
+                match futures_core::ready!(this.sender.poll_ready(cx)) {
+                    Ok(()) => {
+                        if this.start_from.elapsed() > Duration::from_secs(10) {
+                            panic!("connection should be gone and can not be ready");
+                        } else {
+                            let _ = this.interval.poll_tick(cx);
+                            Poll::Pending
+                        }
+                    }
+                    Err(_) => Poll::Ready(()),
+                }
+            }
+        }
+
+        DropCheck {
+            sender,
+            interval: interval(Duration::from_millis(100)),
+            start_from: Instant::now(),
+        }
+        .await;
     }
 }

actix-http/src/client/connector.rs

@@ -1,51 +1,53 @@
 use std::{
     fmt,
     future::Future,
-    marker::PhantomData,
     net::IpAddr,
     pin::Pin,
+    rc::Rc,
     task::{Context, Poll},
     time::Duration,
 };
 
-use actix_codec::{AsyncRead, AsyncWrite};
+use actix_rt::{
-use actix_rt::net::TcpStream;
+    net::{ActixStream, TcpStream},
-use actix_service::{apply_fn, Service, ServiceExt};
+    time::{sleep, Sleep},
-use actix_tls::connect::{
-    new_connector, Connect as TcpConnect, Connection as TcpConnection, Resolver,
 };
-use actix_utils::timeout::{TimeoutError, TimeoutService};
+use actix_service::Service;
+use actix_tls::connect::{
+    new_connector, Connect as TcpConnect, ConnectError as TcpConnectError,
+    Connection as TcpConnection, Resolver,
+};
+use futures_core::{future::LocalBoxFuture, ready};
 use http::Uri;
+use pin_project::pin_project;
 
 use super::config::ConnectorConfig;
-use super::connection::{Connection, EitherIoConnection};
+use super::connection::{Connection, ConnectionIo};
 use super::error::ConnectError;
-use super::pool::{ConnectionPool, Protocol};
+use super::pool::ConnectionPool;
 use super::Connect;
+use super::Protocol;
 
 #[cfg(feature = "openssl")]
 use actix_tls::connect::ssl::openssl::SslConnector as OpensslConnector;
 #[cfg(feature = "rustls")]
 use actix_tls::connect::ssl::rustls::ClientConfig;
-#[cfg(feature = "rustls")]
-use std::sync::Arc;
 
-#[cfg(any(feature = "openssl", feature = "rustls"))]
 enum SslConnector {
+    #[allow(dead_code)]
+    None,
     #[cfg(feature = "openssl")]
     Openssl(OpensslConnector),
     #[cfg(feature = "rustls")]
-    Rustls(Arc<ClientConfig>),
+    Rustls(std::sync::Arc<ClientConfig>),
 }
-#[cfg(not(any(feature = "openssl", feature = "rustls")))]
-type SslConnector = ();
 
 /// Manages HTTP client network connectivity.
 ///
 /// The `Connector` type uses a builder-like combinator pattern for service
 /// construction that finishes by calling the `.finish()` method.
 ///
-/// ```rust,ignore
+/// ```ignore
 /// use std::time::Duration;
 /// use actix_http::client::Connector;
 ///
@@ -53,18 +55,14 @@ type SslConnector = ();
 ///      .timeout(Duration::from_secs(5))
 ///      .finish();
 /// ```
-pub struct Connector<T, U> {
+pub struct Connector<T> {
     connector: T,
     config: ConnectorConfig,
     #[allow(dead_code)]
     ssl: SslConnector,
-    _phantom: PhantomData<U>,
 }
 
-pub trait Io: AsyncRead + AsyncWrite + Unpin {}
+impl Connector<()> {
-impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
-
-impl Connector<(), ()> {
     #[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
     pub fn new() -> Connector<
         impl Service<
@@ -72,13 +70,11 @@ impl Connector<(), ()> {
                 Response = TcpConnection<Uri, TcpStream>,
                 Error = actix_tls::connect::ConnectError,
             > + Clone,
-        TcpStream,
     > {
         Connector {
             ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
             connector: new_connector(resolver::resolver()),
             config: ConnectorConfig::default(),
-            _phantom: PhantomData,
         }
     }
 
@@ -109,51 +105,66 @@ impl Connector<(), ()> {
         config.root_store.add_server_trust_anchors(
             &actix_tls::connect::ssl::rustls::TLS_SERVER_ROOTS,
         );
-        SslConnector::Rustls(Arc::new(config))
+        SslConnector::Rustls(std::sync::Arc::new(config))
     }
 
     // ssl turned off, provides empty ssl connector
     #[cfg(not(any(feature = "openssl", feature = "rustls")))]
-    fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
+    fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {
+        SslConnector::None
+    }
 }
 
-impl<T, U> Connector<T, U> {
+impl<S> Connector<S> {
     /// Use custom connector.
-    pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
+    pub fn connector<S1, Io1>(self, connector: S1) -> Connector<S1>
     where
-        U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
+        Io1: ActixStream + fmt::Debug + 'static,
-        T1: Service<
+        S1: Service<
                 TcpConnect<Uri>,
-                Response = TcpConnection<Uri, U1>,
+                Response = TcpConnection<Uri, Io1>,
-                Error = actix_tls::connect::ConnectError,
+                Error = TcpConnectError,
             > + Clone,
     {
         Connector {
             connector,
             config: self.config,
             ssl: self.ssl,
-            _phantom: PhantomData,
         }
     }
 }
 
-impl<T, U> Connector<T, U>
+impl<S, Io> Connector<S>
 where
-    U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
+    // Note:
-    T: Service<
+    // Input Io type is bound to ActixStream trait but internally in client module they
+    // are bound to ConnectionIo trait alias. And latter is the trait exposed to public
+    // in the form of Box<dyn ConnectionIo> type.
+    //
+    // This remap is to hide ActixStream's trait methods. They are not meant to be called
+    // from user code.
+    Io: ActixStream + fmt::Debug + 'static,
+    S: Service<
             TcpConnect<Uri>,
-            Response = TcpConnection<Uri, U>,
+            Response = TcpConnection<Uri, Io>,
-            Error = actix_tls::connect::ConnectError,
+            Error = TcpConnectError,
         > + Clone
         + 'static,
 {
-    /// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
+    /// Tcp connection timeout, i.e. max time to connect to remote host including dns name
-    /// Set to 1 second by default.
+    /// resolution. Set to 5 second by default.
     pub fn timeout(mut self, timeout: Duration) -> Self {
         self.config.timeout = timeout;
         self
     }
 
+    /// Tls handshake timeout, i.e. max time to do tls handshake with remote host after tcp
+    /// connection established. Set to 5 second by default.
+    pub fn handshake_timeout(mut self, timeout: Duration) -> Self {
+        self.config.handshake_timeout = timeout;
+        self
+    }
+
     #[cfg(feature = "openssl")]
     /// Use custom `SslConnector` instance.
     pub fn ssl(mut self, connector: OpensslConnector) -> Self {
@@ -162,7 +173,8 @@ where
     }
 
     #[cfg(feature = "rustls")]
-    pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
+    /// Use custom `SslConnector` instance.
+    pub fn rustls(mut self, connector: std::sync::Arc<ClientConfig>) -> Self {
         self.ssl = SslConnector::Rustls(connector);
         self
     }
@@ -252,214 +264,422 @@ where
     /// Finish configuration process and create connector service.
     /// The Connector builder always concludes by calling `finish()` last in
     /// its combinator chain.
-    pub fn finish(
+    pub fn finish(self) -> ConnectorService<S, Io> {
-        self,
-    ) -> impl Service<Connect, Response = impl Connection, Error = ConnectError> + Clone
-    {
         let local_address = self.config.local_address;
         let timeout = self.config.timeout;
 
-        let tcp_service = TimeoutService::new(
+        let tcp_service_inner =
-            timeout,
+            TcpConnectorInnerService::new(self.connector, timeout, local_address);
-            apply_fn(self.connector.clone(), move |msg: Connect, srv| {
-                let mut req = TcpConnect::new(msg.uri).set_addr(msg.addr);
 
-                if let Some(local_addr) = local_address {
+        #[allow(clippy::redundant_clone)]
-                    req = req.set_local_addr(local_addr);
+        let tcp_service = TcpConnectorService {
+            service: tcp_service_inner.clone(),
+        };
+
+        let tls_service = match self.ssl {
+            SslConnector::None => None,
+            #[cfg(feature = "openssl")]
+            SslConnector::Openssl(tls) => {
+                const H2: &[u8] = b"h2";
+
+                use actix_tls::connect::ssl::openssl::{OpensslConnector, SslStream};
+
+                impl<Io: ConnectionIo> IntoConnectionIo for TcpConnection<Uri, SslStream<Io>> {
+                    fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol) {
+                        let sock = self.into_parts().0;
+                        let h2 = sock
+                            .ssl()
+                            .selected_alpn_protocol()
+                            .map(|protos| protos.windows(2).any(|w| w == H2))
+                            .unwrap_or(false);
+                        if h2 {
+                            (Box::new(sock), Protocol::Http2)
+                        } else {
+                            (Box::new(sock), Protocol::Http1)
+                        }
+                    }
                 }
 
-                srv.call(req)
+                let handshake_timeout = self.config.handshake_timeout;
-            })
-            .map_err(ConnectError::from)
-            .map(|stream| (stream.into_parts().0, Protocol::Http1)),
-        )
-        .map_err(|e| match e {
-            TimeoutError::Service(e) => e,
-            TimeoutError::Timeout => ConnectError::Timeout,
-        });
 
-        #[cfg(not(any(feature = "openssl", feature = "rustls")))]
+                let tls_service = TlsConnectorService {
-        {
+                    tcp_service: tcp_service_inner,
-            // A dummy service for annotate tls pool's type signature.
+                    tls_service: OpensslConnector::service(tls),
-            pub type DummyService = Box<
+                    timeout: handshake_timeout,
-                dyn Service<
+                };
-                    Connect,
-                    Response = (Box<dyn Io>, Protocol),
-                    Error = ConnectError,
-                    Future = futures_core::future::LocalBoxFuture<
-                        'static,
-                        Result<(Box<dyn Io>, Protocol), ConnectError>,
-                    >,
-                >,
-            >;
 
-            InnerConnector::<_, DummyService, _, Box<dyn Io>> {
+                Some(actix_service::boxed::rc_service(tls_service))
-                tcp_pool: ConnectionPool::new(
-                    tcp_service,
-                    self.config.no_disconnect_timeout(),
-                ),
-                tls_pool: None,
             }
-        }
-
-        #[cfg(any(feature = "openssl", feature = "rustls"))]
-        {
-            const H2: &[u8] = b"h2";
-            use actix_service::{boxed::service, pipeline};
-            #[cfg(feature = "openssl")]
-            use actix_tls::connect::ssl::openssl::OpensslConnector;
             #[cfg(feature = "rustls")]
-            use actix_tls::connect::ssl::rustls::{RustlsConnector, Session};
+            SslConnector::Rustls(tls) => {
+                const H2: &[u8] = b"h2";
 
-            let ssl_service = TimeoutService::new(
+                use actix_tls::connect::ssl::rustls::{
-                timeout,
+                    RustlsConnector, Session, TlsStream,
-                pipeline(
+                };
-                    apply_fn(self.connector.clone(), move |msg: Connect, srv| {
-                        let mut req = TcpConnect::new(msg.uri).set_addr(msg.addr);
 
-                        if let Some(local_addr) = local_address {
+                impl<Io: ConnectionIo> IntoConnectionIo for TcpConnection<Uri, TlsStream<Io>> {
-                            req = req.set_local_addr(local_addr);
+                    fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol) {
+                        let sock = self.into_parts().0;
+                        let h2 = sock
+                            .get_ref()
+                            .1
+                            .get_alpn_protocol()
+                            .map(|protos| protos.windows(2).any(|w| w == H2))
+                            .unwrap_or(false);
+                        if h2 {
+                            (Box::new(sock), Protocol::Http2)
+                        } else {
+                            (Box::new(sock), Protocol::Http1)
                         }
+                    }
+                }
 
-                        srv.call(req)
+                let handshake_timeout = self.config.handshake_timeout;
-                    })
-                    .map_err(ConnectError::from),
-                )
-                .and_then(match self.ssl {
-                    #[cfg(feature = "openssl")]
-                    SslConnector::Openssl(ssl) => service(
-                        OpensslConnector::service(ssl)
-                            .map(|stream| {
-                                let sock = stream.into_parts().0;
-                                let h2 = sock
-                                    .ssl()
-                                    .selected_alpn_protocol()
-                                    .map(|protos| protos.windows(2).any(|w| w == H2))
-                                    .unwrap_or(false);
-                                if h2 {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
-                                } else {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
-                                }
-                            })
-                            .map_err(ConnectError::from),
-                    ),
-                    #[cfg(feature = "rustls")]
-                    SslConnector::Rustls(ssl) => service(
-                        RustlsConnector::service(ssl)
-                            .map_err(ConnectError::from)
-                            .map(|stream| {
-                                let sock = stream.into_parts().0;
-                                let h2 = sock
-                                    .get_ref()
-                                    .1
-                                    .get_alpn_protocol()
-                                    .map(|protos| protos.windows(2).any(|w| w == H2))
-                                    .unwrap_or(false);
-                                if h2 {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
-                                } else {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
-                                }
-                            }),
-                    ),
-                }),
-            )
-            .map_err(|e| match e {
-                TimeoutError::Service(e) => e,
-                TimeoutError::Timeout => ConnectError::Timeout,
-            });
 
-            InnerConnector {
+                let tls_service = TlsConnectorService {
-                tcp_pool: ConnectionPool::new(
+                    tcp_service: tcp_service_inner,
-                    tcp_service,
+                    tls_service: RustlsConnector::service(tls),
-                    self.config.no_disconnect_timeout(),
+                    timeout: handshake_timeout,
-                ),
+                };
-                tls_pool: Some(ConnectionPool::new(ssl_service, self.config)),
+
+                Some(actix_service::boxed::rc_service(tls_service))
             }
+        };
+
+        let tcp_config = self.config.no_disconnect_timeout();
+
+        let tcp_pool = ConnectionPool::new(tcp_service, tcp_config);
+
+        let tls_config = self.config;
+        let tls_pool = tls_service
+            .map(move |tls_service| ConnectionPool::new(tls_service, tls_config));
+
+        ConnectorServicePriv { tcp_pool, tls_pool }
+    }
+}
+
+/// tcp service for map `TcpConnection<Uri, Io>` type to `(Io, Protocol)`
+#[derive(Clone)]
+pub struct TcpConnectorService<S: Clone> {
+    service: S,
+}
+
+impl<S, Io> Service<Connect> for TcpConnectorService<S>
+where
+    S: Service<Connect, Response = TcpConnection<Uri, Io>, Error = ConnectError>
+        + Clone
+        + 'static,
+{
+    type Response = (Io, Protocol);
+    type Error = ConnectError;
+    type Future = TcpConnectorFuture<S::Future>;
+
+    actix_service::forward_ready!(service);
+
+    fn call(&self, req: Connect) -> Self::Future {
+        TcpConnectorFuture {
+            fut: self.service.call(req),
         }
     }
 }
 
-struct InnerConnector<S1, S2, Io1, Io2>
+#[pin_project]
+pub struct TcpConnectorFuture<Fut> {
+    #[pin]
+    fut: Fut,
+}
+
+impl<Fut, Io> Future for TcpConnectorFuture<Fut>
 where
-    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
+    Fut: Future<Output = Result<TcpConnection<Uri, Io>, ConnectError>>,
-    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
+{
-    Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+    type Output = Result<(Io, Protocol), ConnectError>;
-    Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        self.project()
+            .fut
+            .poll(cx)
+            .map_ok(|res| (res.into_parts().0, Protocol::Http1))
+    }
+}
+
+/// service for establish tcp connection and do client tls handshake.
+/// operation is canceled when timeout limit reached.
+struct TlsConnectorService<S, St> {
+    /// tcp connection is canceled on `TcpConnectorInnerService`'s timeout setting.
+    tcp_service: S,
+    /// tls connection is canceled on `TlsConnectorService`'s timeout setting.
+    tls_service: St,
+    timeout: Duration,
+}
+
+impl<S, St, Io> Service<Connect> for TlsConnectorService<S, St>
+where
+    S: Service<Connect, Response = TcpConnection<Uri, Io>, Error = ConnectError>
+        + Clone
+        + 'static,
+    St: Service<TcpConnection<Uri, Io>, Error = std::io::Error> + Clone + 'static,
+    Io: ConnectionIo,
+    St::Response: IntoConnectionIo,
+{
+    type Response = (Box<dyn ConnectionIo>, Protocol);
+    type Error = ConnectError;
+    type Future = TlsConnectorFuture<St, S::Future, St::Future>;
+
+    fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        ready!(self.tcp_service.poll_ready(cx))?;
+        ready!(self.tls_service.poll_ready(cx))?;
+        Poll::Ready(Ok(()))
+    }
+
+    fn call(&self, req: Connect) -> Self::Future {
+        let fut = self.tcp_service.call(req);
+        let tls_service = self.tls_service.clone();
+        let timeout = self.timeout;
+
+        TlsConnectorFuture::TcpConnect {
+            fut,
+            tls_service: Some(tls_service),
+            timeout,
+        }
+    }
+}
+
+#[pin_project(project = TlsConnectorProj)]
+#[allow(clippy::large_enum_variant)]
+enum TlsConnectorFuture<S, Fut1, Fut2> {
+    TcpConnect {
+        #[pin]
+        fut: Fut1,
+        tls_service: Option<S>,
+        timeout: Duration,
+    },
+    TlsConnect {
+        #[pin]
+        fut: Fut2,
+        #[pin]
+        timeout: Sleep,
+    },
+}
+
+/// helper trait for generic over different TlsStream types between tls crates.
+trait IntoConnectionIo {
+    fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol);
+}
+
+impl<S, Io, Fut1, Fut2, Res> Future for TlsConnectorFuture<S, Fut1, Fut2>
+where
+    S: Service<
+        TcpConnection<Uri, Io>,
+        Response = Res,
+        Error = std::io::Error,
+        Future = Fut2,
+    >,
+    S::Response: IntoConnectionIo,
+    Fut1: Future<Output = Result<TcpConnection<Uri, Io>, ConnectError>>,
+    Fut2: Future<Output = Result<S::Response, S::Error>>,
+    Io: ConnectionIo,
+{
+    type Output = Result<(Box<dyn ConnectionIo>, Protocol), ConnectError>;
+
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        match self.as_mut().project() {
+            TlsConnectorProj::TcpConnect {
+                fut,
+                tls_service,
+                timeout,
+            } => {
+                let res = ready!(fut.poll(cx))?;
+                let fut = tls_service
+                    .take()
+                    .expect("TlsConnectorFuture polled after complete")
+                    .call(res);
+                let timeout = sleep(*timeout);
+                self.set(TlsConnectorFuture::TlsConnect { fut, timeout });
+                self.poll(cx)
+            }
+            TlsConnectorProj::TlsConnect { fut, timeout } => match fut.poll(cx)? {
+                Poll::Ready(res) => Poll::Ready(Ok(res.into_connection_io())),
+                Poll::Pending => timeout.poll(cx).map(|_| Err(ConnectError::Timeout)),
+            },
+        }
+    }
+}
+
+/// service for establish tcp connection.
+/// operation is canceled when timeout limit reached.
+#[derive(Clone)]
+pub struct TcpConnectorInnerService<S: Clone> {
+    service: S,
+    timeout: Duration,
+    local_address: Option<std::net::IpAddr>,
+}
+
+impl<S: Clone> TcpConnectorInnerService<S> {
+    fn new(
+        service: S,
+        timeout: Duration,
+        local_address: Option<std::net::IpAddr>,
+    ) -> Self {
+        Self {
+            service,
+            timeout,
+            local_address,
+        }
+    }
+}
+
+impl<S, Io> Service<Connect> for TcpConnectorInnerService<S>
+where
+    S: Service<
+            TcpConnect<Uri>,
+            Response = TcpConnection<Uri, Io>,
+            Error = TcpConnectError,
+        > + Clone
+        + 'static,
+{
+    type Response = S::Response;
+    type Error = ConnectError;
+    type Future = TcpConnectorInnerFuture<S::Future>;
+
+    actix_service::forward_ready!(service);
+
+    fn call(&self, req: Connect) -> Self::Future {
+        let mut req = TcpConnect::new(req.uri).set_addr(req.addr);
+
+        if let Some(local_addr) = self.local_address {
+            req = req.set_local_addr(local_addr);
+        }
+
+        TcpConnectorInnerFuture {
+            fut: self.service.call(req),
+            timeout: sleep(self.timeout),
+        }
+    }
+}
+
+#[pin_project]
+pub struct TcpConnectorInnerFuture<Fut> {
+    #[pin]
+    fut: Fut,
+    #[pin]
+    timeout: Sleep,
+}
+
+impl<Fut, Io> Future for TcpConnectorInnerFuture<Fut>
+where
+    Fut: Future<Output = Result<TcpConnection<Uri, Io>, TcpConnectError>>,
+{
+    type Output = Result<TcpConnection<Uri, Io>, ConnectError>;
+
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let this = self.project();
+        match this.fut.poll(cx) {
+            Poll::Ready(res) => Poll::Ready(res.map_err(ConnectError::from)),
+            Poll::Pending => this.timeout.poll(cx).map(|_| Err(ConnectError::Timeout)),
+        }
+    }
+}
+
+/// Connector service for pooled Plain/Tls Tcp connections.
+pub type ConnectorService<S, Io> = ConnectorServicePriv<
+    TcpConnectorService<TcpConnectorInnerService<S>>,
+    Rc<
+        dyn Service<
+            Connect,
+            Response = (Box<dyn ConnectionIo>, Protocol),
+            Error = ConnectError,
+            Future = LocalBoxFuture<
+                'static,
+                Result<(Box<dyn ConnectionIo>, Protocol), ConnectError>,
+            >,
+        >,
+    >,
+    Io,
+    Box<dyn ConnectionIo>,
+>;
+
+pub struct ConnectorServicePriv<S1, S2, Io1, Io2>
+where
+    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>,
+    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>,
+    Io1: ConnectionIo,
+    Io2: ConnectionIo,
 {
     tcp_pool: ConnectionPool<S1, Io1>,
     tls_pool: Option<ConnectionPool<S2, Io2>>,
 }
 
-impl<S1, S2, Io1, Io2> Clone for InnerConnector<S1, S2, Io1, Io2>
+impl<S1, S2, Io1, Io2> Service<Connect> for ConnectorServicePriv<S1, S2, Io1, Io2>
 where
-    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
+    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
-    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
+        + Clone
-    Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        + 'static,
-    Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
+        + Clone
+        + 'static,
+    Io1: ConnectionIo,
+    Io2: ConnectionIo,
 {
-    fn clone(&self) -> Self {
+    type Response = Connection<Io1, Io2>;
-        InnerConnector {
-            tcp_pool: self.tcp_pool.clone(),
-            tls_pool: self.tls_pool.as_ref().cloned(),
-        }
-    }
-}
-
-impl<S1, S2, Io1, Io2> Service<Connect> for InnerConnector<S1, S2, Io1, Io2>
-where
-    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
-    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
-    Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-    Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    type Response = EitherIoConnection<Io1, Io2>;
     type Error = ConnectError;
-    type Future = InnerConnectorResponse<S1, S2, Io1, Io2>;
+    type Future = ConnectorServiceFuture<S1, S2, Io1, Io2>;
 
     fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        self.tcp_pool.poll_ready(cx)
+        ready!(self.tcp_pool.poll_ready(cx))?;
+        if let Some(ref tls_pool) = self.tls_pool {
+            ready!(tls_pool.poll_ready(cx))?;
+        }
+        Poll::Ready(Ok(()))
     }
 
     fn call(&self, req: Connect) -> Self::Future {
         match req.uri.scheme_str() {
             Some("https") | Some("wss") => match self.tls_pool {
-                None => InnerConnectorResponse::SslIsNotSupported,
+                None => ConnectorServiceFuture::SslIsNotSupported,
-                Some(ref pool) => InnerConnectorResponse::Io2(pool.call(req)),
+                Some(ref pool) => ConnectorServiceFuture::Tls(pool.call(req)),
             },
-            _ => InnerConnectorResponse::Io1(self.tcp_pool.call(req)),
+            _ => ConnectorServiceFuture::Tcp(self.tcp_pool.call(req)),
         }
     }
 }
 
-#[pin_project::pin_project(project = InnerConnectorProj)]
+#[pin_project(project = ConnectorServiceProj)]
-enum InnerConnectorResponse<S1, S2, Io1, Io2>
+pub enum ConnectorServiceFuture<S1, S2, Io1, Io2>
 where
-    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
+    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
-    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
+        + Clone
-    Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        + 'static,
-    Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
+        + Clone
+        + 'static,
+    Io1: ConnectionIo,
+    Io2: ConnectionIo,
 {
-    Io1(#[pin] <ConnectionPool<S1, Io1> as Service<Connect>>::Future),
+    Tcp(#[pin] <ConnectionPool<S1, Io1> as Service<Connect>>::Future),
-    Io2(#[pin] <ConnectionPool<S2, Io2> as Service<Connect>>::Future),
+    Tls(#[pin] <ConnectionPool<S2, Io2> as Service<Connect>>::Future),
     SslIsNotSupported,
 }
 
-impl<S1, S2, Io1, Io2> Future for InnerConnectorResponse<S1, S2, Io1, Io2>
+impl<S1, S2, Io1, Io2> Future for ConnectorServiceFuture<S1, S2, Io1, Io2>
 where
-    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
+    S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
-    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
+        + Clone
-    Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        + 'static,
-    Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+    S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
+        + Clone
+        + 'static,
+    Io1: ConnectionIo,
+    Io2: ConnectionIo,
 {
-    type Output = Result<EitherIoConnection<Io1, Io2>, ConnectError>;
+    type Output = Result<Connection<Io1, Io2>, ConnectError>;
 
     fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
         match self.project() {
-            InnerConnectorProj::Io1(fut) => fut.poll(cx).map_ok(EitherIoConnection::A),
+            ConnectorServiceProj::Tcp(fut) => fut.poll(cx).map_ok(Connection::Tcp),
-            InnerConnectorProj::Io2(fut) => fut.poll(cx).map_ok(EitherIoConnection::B),
+            ConnectorServiceProj::Tls(fut) => fut.poll(cx).map_ok(Connection::Tls),
-            InnerConnectorProj::SslIsNotSupported => {
+            ConnectorServiceProj::SslIsNotSupported => {
                 Poll::Ready(Err(ConnectError::SslIsNotSupported))
             }
         }

actix-http/src/client/h1proto.rs

@@ -1,38 +1,36 @@
-use std::io::Write;
+use std::{
-use std::pin::Pin;
+    io::Write,
-use std::task::{Context, Poll};
+    pin::Pin,
-use std::{io, time};
+    task::{Context, Poll},
+};
 
-use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
+use actix_codec::Framed;
+use actix_utils::future::poll_fn;
 use bytes::buf::BufMut;
 use bytes::{Bytes, BytesMut};
-use futures_core::Stream;
+use futures_core::{ready, Stream};
-use futures_util::{future::poll_fn, SinkExt, StreamExt};
+use futures_util::SinkExt as _;
 
 use crate::error::PayloadError;
 use crate::h1;
-use crate::header::HeaderMap;
 use crate::http::{
-    header::{IntoHeaderValue, EXPECT, HOST},
+    header::{HeaderMap, IntoHeaderValue, EXPECT, HOST},
     StatusCode,
 };
 use crate::message::{RequestHeadType, ResponseHead};
-use crate::payload::{Payload, PayloadStream};
+use crate::payload::Payload;
 
-use super::connection::{ConnectionLifetime, ConnectionType, IoConnection};
+use super::connection::{ConnectionIo, H1Connection};
 use super::error::{ConnectError, SendRequestError};
-use super::pool::Acquired;
 use crate::body::{BodySize, MessageBody};
 
-pub(crate) async fn send_request<T, B>(
+pub(crate) async fn send_request<Io, B>(
-    io: T,
+    io: H1Connection<Io>,
     mut head: RequestHeadType,
     body: B,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
 ) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
+    Io: ConnectionIo,
     B: MessageBody,
 {
     // set request host header
@@ -42,9 +40,9 @@ where
         if let Some(host) = head.as_ref().uri.host() {
             let mut wrt = BytesMut::with_capacity(host.len() + 5).writer();
 
-            let _ = match head.as_ref().uri.port_u16() {
+            match head.as_ref().uri.port_u16() {
-                None | Some(80) | Some(443) => write!(wrt, "{}", host),
+                None | Some(80) | Some(443) => write!(wrt, "{}", host)?,
-                Some(port) => write!(wrt, "{}:{}", host, port),
+                Some(port) => write!(wrt, "{}:{}", host, port)?,
             };
 
             match wrt.get_mut().split().freeze().try_into_value() {
@@ -62,12 +60,6 @@ where
         }
     }
 
-    let io = H1Connection {
-        created,
-        pool,
-        io: Some(io),
-    };
-
     // create Framed and prepare sending request
     let mut framed = Framed::new(io, h1::ClientCodec::default());
 
@@ -77,10 +69,8 @@ where
     let is_expect = if head.as_ref().headers.contains_key(EXPECT) {
         match body.size() {
             BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
-                let pin_framed = Pin::new(&mut framed);
+                let keep_alive = framed.codec_ref().keepalive();
-
+                framed.io_mut().on_release(keep_alive);
-                let force_close = !pin_framed.codec_ref().keepalive();
-                release_connection(pin_framed, force_close);
 
                 // TODO: use a new variant or a new type better describing error violate
                 // `Requirements for clients` session of above RFC
@@ -128,44 +118,41 @@ where
 
     match pin_framed.codec_ref().message_type() {
         h1::MessageType::None => {
-            let force_close = !pin_framed.codec_ref().keepalive();
+            let keep_alive = pin_framed.codec_ref().keepalive();
-            release_connection(pin_framed, force_close);
+            pin_framed.io_mut().on_release(keep_alive);
+
             Ok((head, Payload::None))
         }
-        _ => {
+        _ => Ok((head, Payload::Stream(Box::pin(PlStream::new(framed))))),
-            let pl: PayloadStream = Box::pin(PlStream::new(framed));
-            Ok((head, pl.into()))
-        }
     }
 }
 
-pub(crate) async fn open_tunnel<T>(
+pub(crate) async fn open_tunnel<Io>(
-    io: T,
+    io: Io,
     head: RequestHeadType,
-) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
+) -> Result<(ResponseHead, Framed<Io, h1::ClientCodec>), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
+    Io: ConnectionIo,
 {
-    // create Framed and send request
+    // create Framed and send request.
     let mut framed = Framed::new(io, h1::ClientCodec::default());
     framed.send((head, BodySize::None).into()).await?;
 
-    // read response
+    // read response head.
-    if let (Some(result), framed) = framed.into_future().await {
+    let head = poll_fn(|cx| Pin::new(&mut framed).poll_next(cx))
-        let head = result.map_err(SendRequestError::from)?;
+        .await
-        Ok((head, framed))
+        .ok_or(ConnectError::Disconnected)??;
-    } else {
+
-        Err(SendRequestError::from(ConnectError::Disconnected))
+    Ok((head, framed))
-    }
 }
 
 /// send request body to the peer
-pub(crate) async fn send_body<T, B>(
+pub(crate) async fn send_body<Io, B>(
     body: B,
-    mut framed: Pin<&mut Framed<T, h1::ClientCodec>>,
+    mut framed: Pin<&mut Framed<Io, h1::ClientCodec>>,
 ) -> Result<(), SendRequestError>
 where
-    T: ConnectionLifetime + Unpin,
+    Io: ConnectionIo,
     B: MessageBody,
 {
     actix_rt::pin!(body);
@@ -200,104 +187,25 @@ where
         }
     }
 
-    SinkExt::flush(Pin::into_inner(framed)).await?;
+    framed.get_mut().flush().await?;
     Ok(())
 }
 
-#[doc(hidden)]
-/// HTTP client connection
-pub struct H1Connection<T>
-where
-    T: AsyncWrite + Unpin + 'static,
-{
-    /// T should be `Unpin`
-    io: Option<T>,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
-}
-
-impl<T> ConnectionLifetime for H1Connection<T>
-where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    /// Close connection
-    fn close(mut self: Pin<&mut Self>) {
-        if let Some(mut pool) = self.pool.take() {
-            if let Some(io) = self.io.take() {
-                pool.close(IoConnection::new(
-                    ConnectionType::H1(io),
-                    self.created,
-                    None,
-                ));
-            }
-        }
-    }
-
-    /// Release this connection to the connection pool
-    fn release(mut self: Pin<&mut Self>) {
-        if let Some(mut pool) = self.pool.take() {
-            if let Some(io) = self.io.take() {
-                pool.release(IoConnection::new(
-                    ConnectionType::H1(io),
-                    self.created,
-                    None,
-                ));
-            }
-        }
-    }
-}
-
-impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
-    fn poll_read(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &mut ReadBuf<'_>,
-    ) -> Poll<io::Result<()>> {
-        Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
-    }
-}
-
-impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
-    fn poll_write(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &[u8],
-    ) -> Poll<io::Result<usize>> {
-        Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
-    }
-
-    fn poll_flush(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<io::Result<()>> {
-        Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
-    }
-
-    fn poll_shutdown(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Result<(), io::Error>> {
-        Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
-    }
-}
-
 #[pin_project::pin_project]
-pub(crate) struct PlStream<Io> {
+pub(crate) struct PlStream<Io: ConnectionIo> {
     #[pin]
-    framed: Option<Framed<Io, h1::ClientPayloadCodec>>,
+    framed: Framed<H1Connection<Io>, h1::ClientPayloadCodec>,
 }
 
-impl<Io: ConnectionLifetime> PlStream<Io> {
+impl<Io: ConnectionIo> PlStream<Io> {
-    fn new(framed: Framed<Io, h1::ClientCodec>) -> Self {
+    fn new(framed: Framed<H1Connection<Io>, h1::ClientCodec>) -> Self {
         let framed = framed.into_map_codec(|codec| codec.into_payload_codec());
 
-        PlStream {
+        PlStream { framed }
-            framed: Some(framed),
-        }
     }
 }
 
-impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
+impl<Io: ConnectionIo> Stream for PlStream<Io> {
     type Item = Result<Bytes, PayloadError>;
 
     fn poll_next(
@@ -306,30 +214,14 @@ impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
     ) -> Poll<Option<Self::Item>> {
         let mut this = self.project();
 
-        match this.framed.as_mut().as_pin_mut().unwrap().next_item(cx)? {
+        match ready!(this.framed.as_mut().next_item(cx)?) {
-            Poll::Pending => Poll::Pending,
+            Some(Some(chunk)) => Poll::Ready(Some(Ok(chunk))),
-            Poll::Ready(Some(chunk)) => {
+            Some(None) => {
-                if let Some(chunk) = chunk {
+                let keep_alive = this.framed.codec_ref().keepalive();
-                    Poll::Ready(Some(Ok(chunk)))
+                this.framed.io_mut().on_release(keep_alive);
-                } else {
+                Poll::Ready(None)
-                    let framed = this.framed.as_mut().as_pin_mut().unwrap();
-                    let force_close = !framed.codec_ref().keepalive();
-                    release_connection(framed, force_close);
-                    Poll::Ready(None)
-                }
             }
-            Poll::Ready(None) => Poll::Ready(None),
+            None => Poll::Ready(None),
         }
     }
 }
-
-fn release_connection<T, U>(framed: Pin<&mut Framed<T, U>>, force_close: bool)
-where
-    T: ConnectionLifetime,
-{
-    if !force_close && framed.is_read_buf_empty() && framed.is_write_buf_empty() {
-        framed.io_pin().release()
-    } else {
-        framed.io_pin().close()
-    }
-}

actix-http/src/client/h2proto.rs

@@ -1,9 +1,7 @@
 use std::future::Future;
-use std::time;
 
-use actix_codec::{AsyncRead, AsyncWrite};
+use actix_utils::future::poll_fn;
 use bytes::Bytes;
-use futures_util::future::poll_fn;
 use h2::{
     client::{Builder, Connection, SendRequest},
     SendStream,
@@ -17,20 +15,16 @@ use crate::message::{RequestHeadType, ResponseHead};
 use crate::payload::Payload;
 
 use super::config::ConnectorConfig;
-use super::connection::{ConnectionType, IoConnection};
+use super::connection::{ConnectionIo, H2Connection};
 use super::error::SendRequestError;
-use super::pool::Acquired;
-use crate::client::connection::H2Connection;
 
-pub(crate) async fn send_request<T, B>(
+pub(crate) async fn send_request<Io, B>(
-    mut io: H2Connection,
+    mut io: H2Connection<Io>,
     head: RequestHeadType,
     body: B,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
 ) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
+    Io: ConnectionIo,
     B: MessageBody,
 {
     trace!("Sending client request: {:?} {:?}", head, body.size());
@@ -103,13 +97,13 @@ where
 
     let res = poll_fn(|cx| io.poll_ready(cx)).await;
     if let Err(e) = res {
-        release(io, pool, created, e.is_io());
+        io.on_release(e.is_io());
         return Err(SendRequestError::from(e));
     }
 
     let resp = match io.send_request(req, eof) {
         Ok((fut, send)) => {
-            release(io, pool, created, false);
+            io.on_release(false);
 
             if !eof {
                 send_body(body, send).await?;
@@ -117,7 +111,7 @@ where
             fut.await.map_err(SendRequestError::from)?
         }
         Err(e) => {
-            release(io, pool, created, e.is_io());
+            io.on_release(e.is_io());
             return Err(e.into());
         }
     };
@@ -178,28 +172,10 @@ async fn send_body<B: MessageBody>(
     }
 }
 
-/// release SendRequest object
+pub(crate) fn handshake<Io: ConnectionIo>(
-fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
-    io: H2Connection,
-    pool: Option<Acquired<T>>,
-    created: time::Instant,
-    close: bool,
-) {
-    if let Some(mut pool) = pool {
-        if close {
-            pool.close(IoConnection::new(ConnectionType::H2(io), created, None));
-        } else {
-            pool.release(IoConnection::new(ConnectionType::H2(io), created, None));
-        }
-    }
-}
-
-pub(crate) fn handshake<Io>(
     io: Io,
     config: &ConnectorConfig,
 ) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     let mut builder = Builder::new();
     builder

actix-http/src/client/mod.rs

@@ -14,10 +14,10 @@ pub use actix_tls::connect::{
     Connect as TcpConnect, ConnectError as TcpConnectError, Connection as TcpConnection,
 };
 
-pub use self::connection::Connection;
+pub use self::connection::{Connection, ConnectionIo};
-pub use self::connector::Connector;
+pub use self::connector::{Connector, ConnectorService};
 pub use self::error::{ConnectError, FreezeRequestError, InvalidUrl, SendRequestError};
-pub use self::pool::Protocol;
+pub use crate::Protocol;
 
 #[derive(Clone)]
 pub struct Connect {

actix-http/src/client/pool.rs

@@ -1,40 +1,38 @@
 //! Client connection pooling keyed on the authority part of the connection URI.
 
-use std::collections::VecDeque;
+use std::{
-use std::future::Future;
+    cell::RefCell,
-use std::ops::Deref;
+    collections::VecDeque,
-use std::pin::Pin;
+    future::Future,
-use std::rc::Rc;
+    io,
-use std::sync::Arc;
+    ops::Deref,
-use std::task::{Context, Poll};
+    pin::Pin,
-use std::time::{Duration, Instant};
+    rc::Rc,
-use std::{cell::RefCell, io};
+    sync::Arc,
+    task::{Context, Poll},
+    time::{Duration, Instant},
+};
 
-use actix_codec::{AsyncRead, AsyncWrite};
+use actix_codec::{AsyncRead, AsyncWrite, ReadBuf};
 use actix_rt::time::{sleep, Sleep};
 use actix_service::Service;
 use ahash::AHashMap;
 use futures_core::future::LocalBoxFuture;
 use http::uri::Authority;
 use pin_project::pin_project;
-use tokio::io::ReadBuf;
 use tokio::sync::{OwnedSemaphorePermit, Semaphore};
 
 use super::config::ConnectorConfig;
-use super::connection::{ConnectionType, H2Connection, IoConnection};
+use super::connection::{
+    ConnectionInnerType, ConnectionIo, ConnectionType, H2ConnectionInner,
+};
 use super::error::ConnectError;
 use super::h2proto::handshake;
 use super::Connect;
-
+use super::Protocol;
-#[derive(Clone, Copy, PartialEq)]
-/// Protocol version
-pub enum Protocol {
-    Http1,
-    Http2,
-}
 
 #[derive(Hash, Eq, PartialEq, Clone, Debug)]
-pub(crate) struct Key {
+pub struct Key {
     authority: Authority,
 }
 
@@ -44,17 +42,18 @@ impl From<Authority> for Key {
     }
 }
 
+#[doc(hidden)]
 /// Connections pool for reuse Io type for certain [`http::uri::Authority`] as key.
-pub(crate) struct ConnectionPool<S, Io>
+pub struct ConnectionPool<S, Io>
 where
     Io: AsyncWrite + Unpin + 'static,
 {
-    connector: Rc<S>,
+    connector: S,
     inner: ConnectionPoolInner<Io>,
 }
 
 /// wrapper type for check the ref count of Rc.
-struct ConnectionPoolInner<Io>(Rc<ConnectionPoolInnerPriv<Io>>)
+pub struct ConnectionPoolInner<Io>(Rc<ConnectionPoolInnerPriv<Io>>)
 where
     Io: AsyncWrite + Unpin + 'static;
 
@@ -62,10 +61,21 @@ impl<Io> ConnectionPoolInner<Io>
 where
     Io: AsyncWrite + Unpin + 'static,
 {
+    fn new(config: ConnectorConfig) -> Self {
+        let permits = Arc::new(Semaphore::new(config.limit));
+        let available = RefCell::new(AHashMap::default());
+
+        Self(Rc::new(ConnectionPoolInnerPriv {
+            config,
+            available,
+            permits,
+        }))
+    }
+
     /// spawn a async for graceful shutdown h1 Io type with a timeout.
-    fn close(&self, conn: ConnectionType<Io>) {
+    fn close(&self, conn: ConnectionInnerType<Io>) {
         if let Some(timeout) = self.config.disconnect_timeout {
-            if let ConnectionType::H1(io) = conn {
+            if let ConnectionInnerType::H1(io) = conn {
                 actix_rt::spawn(CloseConnection::new(io, timeout));
             }
         }
@@ -110,7 +120,7 @@ where
     }
 }
 
-struct ConnectionPoolInnerPriv<Io>
+pub struct ConnectionPoolInnerPriv<Io>
 where
     Io: AsyncWrite + Unpin + 'static,
 {
@@ -134,40 +144,22 @@ where
     /// Any requests beyond limit would be wait in fifo order and get notified in async manner
     /// by [`tokio::sync::Semaphore`]
     pub(crate) fn new(connector: S, config: ConnectorConfig) -> Self {
-        let permits = Arc::new(Semaphore::new(config.limit));
+        let inner = ConnectionPoolInner::new(config);
-        let available = RefCell::new(AHashMap::default());
-        let connector = Rc::new(connector);
-
-        let inner = ConnectionPoolInner(Rc::new(ConnectionPoolInnerPriv {
-            config,
-            available,
-            permits,
-        }));
 
         Self { connector, inner }
     }
 }
 
-impl<S, Io> Clone for ConnectionPool<S, Io>
-where
-    Io: AsyncWrite + Unpin + 'static,
-{
-    fn clone(&self) -> Self {
-        Self {
-            connector: self.connector.clone(),
-            inner: self.inner.clone(),
-        }
-    }
-}
-
 impl<S, Io> Service<Connect> for ConnectionPool<S, Io>
 where
-    S: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
+    S: Service<Connect, Response = (Io, Protocol), Error = ConnectError>
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+        + Clone
+        + 'static,
+    Io: ConnectionIo,
 {
-    type Response = IoConnection<Io>;
+    type Response = ConnectionType<Io>;
     type Error = ConnectError;
-    type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
+    type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
 
     actix_service::forward_ready!(connector);
 
@@ -211,7 +203,7 @@ where
                             inner.close(c.conn);
                         } else {
                             // check if the connection is still usable
-                            if let ConnectionType::H1(ref mut io) = c.conn {
+                            if let ConnectionInnerType::H1(ref mut io) = c.conn {
                                 let check = ConnectionCheckFuture { io };
                                 match check.await {
                                     ConnectionState::Tainted => {
@@ -235,28 +227,26 @@ where
 
             // construct acquired. It's used to put Io type back to pool/ close the Io type.
             // permit is carried with the whole lifecycle of Acquired.
-            let acquired = Some(Acquired { key, inner, permit });
+            let acquired = Acquired { key, inner, permit };
 
             // match the connection and spawn new one if did not get anything.
             match conn {
-                Some(conn) => Ok(IoConnection::new(conn.conn, conn.created, acquired)),
+                Some(conn) => {
+                    Ok(ConnectionType::from_pool(conn.conn, conn.created, acquired))
+                }
                 None => {
                     let (io, proto) = connector.call(req).await?;
 
+                    // TODO: remove when http3 is added in support.
+                    assert!(proto != Protocol::Http3);
+
                     if proto == Protocol::Http1 {
-                        Ok(IoConnection::new(
+                        Ok(ConnectionType::from_h1(io, Instant::now(), acquired))
-                            ConnectionType::H1(io),
-                            Instant::now(),
-                            acquired,
-                        ))
                     } else {
-                        let config = &acquired.as_ref().unwrap().inner.config;
+                        let config = &acquired.inner.config;
                         let (sender, connection) = handshake(io, config).await?;
-                        Ok(IoConnection::new(
+                        let inner = H2ConnectionInner::new(sender, connection);
-                            ConnectionType::H2(H2Connection::new(sender, connection)),
+                        Ok(ConnectionType::from_h2(inner, Instant::now(), acquired))
-                            Instant::now(),
-                            acquired,
-                        ))
                     }
                 }
             }
@@ -307,7 +297,7 @@ where
 }
 
 struct PooledConnection<Io> {
-    conn: ConnectionType<Io>,
+    conn: ConnectionInnerType<Io>,
     used: Instant,
     created: Instant,
 }
@@ -347,28 +337,26 @@ where
     }
 }
 
-pub(crate) struct Acquired<Io>
+pub struct Acquired<Io>
 where
     Io: AsyncWrite + Unpin + 'static,
 {
+    /// authority key for identify connection.
     key: Key,
+    /// handle to connection pool.
     inner: ConnectionPoolInner<Io>,
+    /// permit for limit concurrent in-flight connection for a Client object.
     permit: OwnedSemaphorePermit,
 }
 
-impl<Io> Acquired<Io>
+impl<Io: ConnectionIo> Acquired<Io> {
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
     /// Close the IO.
-    pub(crate) fn close(&mut self, conn: IoConnection<Io>) {
+    pub(super) fn close(&self, conn: ConnectionInnerType<Io>) {
-        let (conn, _) = conn.into_inner();
         self.inner.close(conn);
     }
 
     /// Release IO back into pool.
-    pub(crate) fn release(&mut self, conn: IoConnection<Io>) {
+    pub(super) fn release(&self, conn: ConnectionInnerType<Io>, created: Instant) {
-        let (io, created) = conn.into_inner();
         let Acquired { key, inner, .. } = self;
 
         inner
@@ -377,12 +365,12 @@ where
             .entry(key.clone())
             .or_insert_with(VecDeque::new)
             .push_back(PooledConnection {
-                conn: io,
+                conn,
                 created,
                 used: Instant::now(),
             });
 
-        let _ = &mut self.permit;
+        let _ = &self.permit;
     }
 }
 
@@ -393,7 +381,7 @@ mod test {
     use http::Uri;
 
     use super::*;
-    use crate::client::connection::IoConnection;
+    use crate::client::connection::ConnectionType;
 
     /// A stream type that always returns pending on async read.
     ///
@@ -440,6 +428,7 @@ mod test {
         }
     }
 
+    #[derive(Clone)]
     struct TestPoolConnector {
         generated: Rc<Cell<usize>>,
     }
@@ -458,12 +447,14 @@ mod test {
         }
     }
 
-    fn release<T>(conn: IoConnection<T>)
+    fn release<T>(conn: ConnectionType<T>)
     where
         T: AsyncRead + AsyncWrite + Unpin + 'static,
     {
-        let (conn, created, mut acquired) = conn.into_parts();
+        match conn {
-        acquired.release(IoConnection::new(conn, created, None));
+            ConnectionType::H1(mut conn) => conn.on_release(true),
+            ConnectionType::H2(mut conn) => conn.on_release(false),
+        }
     }
 
     #[actix_rt::test]

actix-http/src/config.rs

@@ -126,9 +126,7 @@ impl ServiceConfig {
     pub fn client_timer(&self) -> Option<Sleep> {
         let delay_time = self.0.client_timeout;
         if delay_time != 0 {
-            Some(sleep_until(
+            Some(sleep_until(self.now() + Duration::from_millis(delay_time)))
-                self.0.date_service.now() + Duration::from_millis(delay_time),
-            ))
         } else {
             None
         }
@@ -138,7 +136,7 @@ impl ServiceConfig {
     pub fn client_timer_expire(&self) -> Option<Instant> {
         let delay = self.0.client_timeout;
         if delay != 0 {
-            Some(self.0.date_service.now() + Duration::from_millis(delay))
+            Some(self.now() + Duration::from_millis(delay))
         } else {
             None
         }
@@ -148,7 +146,7 @@ impl ServiceConfig {
     pub fn client_disconnect_timer(&self) -> Option<Instant> {
         let delay = self.0.client_disconnect;
         if delay != 0 {
-            Some(self.0.date_service.now() + Duration::from_millis(delay))
+            Some(self.now() + Duration::from_millis(delay))
         } else {
             None
         }
@@ -157,20 +155,12 @@ impl ServiceConfig {
     #[inline]
     /// Return keep-alive timer delay is configured.
     pub fn keep_alive_timer(&self) -> Option<Sleep> {
-        if let Some(ka) = self.0.keep_alive {
+        self.keep_alive().map(|ka| sleep_until(self.now() + ka))
-            Some(sleep_until(self.0.date_service.now() + ka))
-        } else {
-            None
-        }
     }
 
     /// Keep-alive expire time
     pub fn keep_alive_expire(&self) -> Option<Instant> {
-        if let Some(ka) = self.0.keep_alive {
+        self.keep_alive().map(|ka| self.now() + ka)
-            Some(self.0.date_service.now() + ka)
-        } else {
-            None
-        }
     }
 
     #[inline]

actix-http/src/error.rs

@@ -6,9 +6,6 @@ use std::str::Utf8Error;
 use std::string::FromUtf8Error;
 use std::{fmt, io, result};
 
-use actix_codec::{Decoder, Encoder};
-use actix_utils::dispatcher::DispatcherError as FramedDispatcherError;
-use actix_utils::timeout::TimeoutError;
 use bytes::BytesMut;
 use derive_more::{Display, From};
 use http::uri::InvalidUri;
@@ -54,7 +51,7 @@ impl Error {
 
     /// Similar to `as_response_error` but downcasts.
     pub fn as_error<T: ResponseError + 'static>(&self) -> Option<&T> {
-        ResponseError::downcast_ref(self.cause.as_ref())
+        <dyn ResponseError>::downcast_ref(self.cause.as_ref())
     }
 }
 
@@ -148,19 +145,6 @@ impl From<ResponseBuilder> for Error {
     }
 }
 
-/// Inspects the underlying enum and returns an appropriate status code.
-///
-/// If the variant is [`TimeoutError::Service`], the error code of the service is returned.
-/// Otherwise, [`StatusCode::GATEWAY_TIMEOUT`] is returned.
-impl<E: ResponseError> ResponseError for TimeoutError<E> {
-    fn status_code(&self) -> StatusCode {
-        match self {
-            TimeoutError::Service(e) => e.status_code(),
-            TimeoutError::Timeout => StatusCode::GATEWAY_TIMEOUT,
-        }
-    }
-}
-
 #[derive(Debug, Display)]
 #[display(fmt = "UnknownError")]
 struct UnitError;
@@ -469,21 +453,13 @@ impl ResponseError for ContentTypeError {
     }
 }
 
-impl<E, U: Encoder<I> + Decoder, I> ResponseError for FramedDispatcherError<E, U, I>
-where
-    E: fmt::Debug + fmt::Display,
-    <U as Encoder<I>>::Error: fmt::Debug,
-    <U as Decoder>::Error: fmt::Debug,
-{
-}
-
 /// Helper type that can wrap any error and generate custom response.
 ///
 /// In following example any `io::Error` will be converted into "BAD REQUEST"
 /// response as opposite to *INTERNAL SERVER ERROR* which is defined by
 /// default.
 ///
-/// ```rust
+/// ```
 /// # use std::io;
 /// # use actix_http::*;
 ///

actix-http/src/h1/dispatcher.rs

@@ -662,7 +662,7 @@ where
                     // got timeout during shutdown, drop connection
                     if this.flags.contains(Flags::SHUTDOWN) {
                         return Err(DispatchError::DisconnectTimeout);
-                    // exceed deadline. check for any outstanding tasks
+                        // exceed deadline. check for any outstanding tasks
                     } else if timer.deadline() >= *this.ka_expire {
                         // have no task at hand.
                         if this.state.is_empty() && this.write_buf.is_empty() {
@@ -695,15 +695,15 @@ where
                                 this.flags.insert(Flags::STARTED | Flags::SHUTDOWN);
                                 this.state.set(State::None);
                             }
-                        // still have unfinished task. try to reset and register keep-alive.
+                            // still have unfinished task. try to reset and register keep-alive.
                         } else if let Some(deadline) =
                             this.codec.config().keep_alive_expire()
                         {
                             timer.as_mut().reset(deadline);
                             let _ = timer.poll(cx);
                         }
-                    // timer resolved but still have not met the keep-alive expire deadline.
+                        // timer resolved but still have not met the keep-alive expire deadline.
-                    // reset and register for later wakeup.
+                        // reset and register for later wakeup.
                     } else {
                         timer.as_mut().reset(*this.ka_expire);
                         let _ = timer.poll(cx);
@@ -951,14 +951,16 @@ mod tests {
     use std::str;
 
     use actix_service::fn_service;
-    use futures_util::future::{lazy, ready};
+    use actix_utils::future::{ready, Ready};
+    use futures_util::future::lazy;
 
     use super::*;
-    use crate::test::TestBuffer;
-    use crate::{error::Error, KeepAlive};
     use crate::{
+        error::Error,
         h1::{ExpectHandler, UpgradeHandler},
-        test::TestSeqBuffer,
+        http::Method,
+        test::{TestBuffer, TestSeqBuffer},
+        HttpMessage, KeepAlive,
     };
 
     fn find_slice(haystack: &[u8], needle: &[u8], from: usize) -> Option<usize> {
@@ -1282,14 +1284,30 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_upgrade() {
+        struct TestUpgrade;
+
+        impl<T> Service<(Request, Framed<T, Codec>)> for TestUpgrade {
+            type Response = ();
+            type Error = Error;
+            type Future = Ready<Result<Self::Response, Self::Error>>;
+
+            actix_service::always_ready!();
+
+            fn call(&self, (req, _framed): (Request, Framed<T, Codec>)) -> Self::Future {
+                assert_eq!(req.method(), Method::GET);
+                assert!(req.upgrade());
+                assert_eq!(req.headers().get("upgrade").unwrap(), "websocket");
+                ready(Ok(()))
+            }
+        }
+
         lazy(|cx| {
             let mut buf = TestSeqBuffer::empty();
             let cfg = ServiceConfig::new(KeepAlive::Disabled, 0, 0, false, None);
 
-            let services =
+            let services = HttpFlow::new(ok_service(), ExpectHandler, Some(TestUpgrade));
-                HttpFlow::new(ok_service(), ExpectHandler, Some(UpgradeHandler));
 
-            let h1 = Dispatcher::<_, _, _, _, UpgradeHandler>::new(
+            let h1 = Dispatcher::<_, _, _, _, TestUpgrade>::new(
                 buf.clone(),
                 cfg,
                 services,

actix-http/src/h1/expect.rs

@@ -1,7 +1,5 @@
-use std::task::Poll;
-
 use actix_service::{Service, ServiceFactory};
-use futures_util::future::{ready, Ready};
+use actix_utils::future::{ready, Ready};
 
 use crate::error::Error;
 use crate::request::Request;

actix-http/src/h1/payload.rs

@@ -263,7 +263,7 @@ impl Inner {
 #[cfg(test)]
 mod tests {
     use super::*;
-    use futures_util::future::poll_fn;
+    use actix_utils::future::poll_fn;
 
     #[actix_rt::test]
     async fn test_unread_data() {

actix-http/src/h1/service.rs

@@ -1,6 +1,4 @@
-use std::future::Future;
 use std::marker::PhantomData;
-use std::pin::Pin;
 use std::rc::Rc;
 use std::task::{Context, Poll};
 use std::{fmt, net};
@@ -8,15 +6,15 @@ use std::{fmt, net};
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_rt::net::TcpStream;
 use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
-use futures_core::ready;
+use actix_utils::future::ready;
-use futures_util::future::ready;
+use futures_core::future::LocalBoxFuture;
 
 use crate::body::MessageBody;
 use crate::config::ServiceConfig;
 use crate::error::{DispatchError, Error};
 use crate::request::Request;
 use crate::response::Response;
-use crate::service::HttpFlow;
+use crate::service::HttpServiceHandler;
 use crate::{ConnectCallback, OnConnectData};
 
 use super::codec::Codec;
@@ -60,14 +58,17 @@ where
 impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
 where
     S: ServiceFactory<Request, Config = ()>,
+    S::Future: 'static,
     S::Error: Into<Error>,
     S::InitError: fmt::Debug,
     S::Response: Into<Response<B>>,
     B: MessageBody,
     X: ServiceFactory<Request, Config = (), Response = Request>,
+    X::Future: 'static,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
     U: ServiceFactory<(Request, Framed<TcpStream, Codec>), Config = (), Response = ()>,
+    U::Future: 'static,
     U::Error: fmt::Display + Into<Error>,
     U::InitError: fmt::Debug,
 {
@@ -94,17 +95,21 @@ mod openssl {
     use super::*;
 
     use actix_service::ServiceFactoryExt;
-    use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, TlsStream};
+    use actix_tls::accept::{
-    use actix_tls::accept::TlsError;
+        openssl::{Acceptor, SslAcceptor, SslError, TlsStream},
+        TlsError,
+    };
 
     impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
     where
         S: ServiceFactory<Request, Config = ()>,
+        S::Future: 'static,
         S::Error: Into<Error>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
         B: MessageBody,
         X: ServiceFactory<Request, Config = (), Response = Request>,
+        X::Future: 'static,
         X::Error: Into<Error>,
         X::InitError: fmt::Debug,
         U: ServiceFactory<
@@ -112,6 +117,7 @@ mod openssl {
             Config = (),
             Response = (),
         >,
+        U::Future: 'static,
         U::Error: fmt::Display + Into<Error>,
         U::InitError: fmt::Debug,
     {
@@ -143,19 +149,25 @@ mod openssl {
 #[cfg(feature = "rustls")]
 mod rustls {
     use super::*;
+
+    use std::io;
+
     use actix_service::ServiceFactoryExt;
-    use actix_tls::accept::rustls::{Acceptor, ServerConfig, TlsStream};
+    use actix_tls::accept::{
-    use actix_tls::accept::TlsError;
+        rustls::{Acceptor, ServerConfig, TlsStream},
-    use std::{fmt, io};
+        TlsError,
+    };
 
     impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
     where
         S: ServiceFactory<Request, Config = ()>,
+        S::Future: 'static,
         S::Error: Into<Error>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
         B: MessageBody,
         X: ServiceFactory<Request, Config = (), Response = Request>,
+        X::Future: 'static,
         X::Error: Into<Error>,
         X::InitError: fmt::Debug,
         U: ServiceFactory<
@@ -163,6 +175,7 @@ mod rustls {
             Config = (),
             Response = (),
         >,
+        U::Future: 'static,
         U::Error: fmt::Display + Into<Error>,
         U::InitError: fmt::Debug,
     {
@@ -241,16 +254,19 @@ where
 impl<T, S, B, X, U> ServiceFactory<(T, Option<net::SocketAddr>)>
     for H1Service<T, S, B, X, U>
 where
-    T: AsyncRead + AsyncWrite + Unpin,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     S: ServiceFactory<Request, Config = ()>,
+    S::Future: 'static,
     S::Error: Into<Error>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
     B: MessageBody,
     X: ServiceFactory<Request, Config = (), Response = Request>,
+    X::Future: 'static,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
     U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
+    U::Future: 'static,
     U::Error: fmt::Display + Into<Error>,
     U::InitError: fmt::Debug,
 {
@@ -259,148 +275,50 @@ where
     type Config = ();
     type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
     type InitError = ();
-    type Future = H1ServiceResponse<T, S, B, X, U>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
-        H1ServiceResponse {
+        let service = self.srv.new_service(());
-            fut: self.srv.new_service(()),
+        let expect = self.expect.new_service(());
-            fut_ex: Some(self.expect.new_service(())),
+        let upgrade = self.upgrade.as_ref().map(|s| s.new_service(()));
-            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
+        let on_connect_ext = self.on_connect_ext.clone();
-            expect: None,
+        let cfg = self.cfg.clone();
-            upgrade: None,
-            on_connect_ext: self.on_connect_ext.clone(),
-            cfg: Some(self.cfg.clone()),
-            _phantom: PhantomData,
-        }
-    }
-}
 
-#[doc(hidden)]
+        Box::pin(async move {
-#[pin_project::pin_project]
+            let expect = expect
-pub struct H1ServiceResponse<T, S, B, X, U>
+                .await
-where
+                .map_err(|e| log::error!("Init http expect service error: {:?}", e))?;
-    S: ServiceFactory<Request>,
-    S::Error: Into<Error>,
-    S::InitError: fmt::Debug,
-    X: ServiceFactory<Request, Response = Request>,
-    X::Error: Into<Error>,
-    X::InitError: fmt::Debug,
-    U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
-    U::InitError: fmt::Debug,
-{
-    #[pin]
-    fut: S::Future,
-    #[pin]
-    fut_ex: Option<X::Future>,
-    #[pin]
-    fut_upg: Option<U::Future>,
-    expect: Option<X::Service>,
-    upgrade: Option<U::Service>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    cfg: Option<ServiceConfig>,
-    _phantom: PhantomData<B>,
-}
 
-impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
+            let upgrade = match upgrade {
-where
+                Some(upgrade) => {
-    T: AsyncRead + AsyncWrite + Unpin,
+                    let upgrade = upgrade.await.map_err(|e| {
-    S: ServiceFactory<Request>,
+                        log::error!("Init http upgrade service error: {:?}", e)
-    S::Error: Into<Error>,
+                    })?;
-    S::Response: Into<Response<B>>,
+                    Some(upgrade)
-    S::InitError: fmt::Debug,
+                }
-    B: MessageBody,
+                None => None,
-    X: ServiceFactory<Request, Response = Request>,
+            };
-    X::Error: Into<Error>,
-    X::InitError: fmt::Debug,
-    U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
-    U::InitError: fmt::Debug,
-{
-    type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
 
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+            let service = service
-        let mut this = self.as_mut().project();
+                .await
+                .map_err(|e| log::error!("Init http service error: {:?}", e))?;
 
-        if let Some(fut) = this.fut_ex.as_pin_mut() {
+            Ok(H1ServiceHandler::new(
-            let expect = ready!(fut
+                cfg,
-                .poll(cx)
-                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
-            this = self.as_mut().project();
-            *this.expect = Some(expect);
-            this.fut_ex.set(None);
-        }
-
-        if let Some(fut) = this.fut_upg.as_pin_mut() {
-            let upgrade = ready!(fut
-                .poll(cx)
-                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
-            this = self.as_mut().project();
-            *this.upgrade = Some(upgrade);
-            this.fut_upg.set(None);
-        }
-
-        let result = ready!(this
-            .fut
-            .poll(cx)
-            .map_err(|e| log::error!("Init http service error: {:?}", e)));
-
-        Poll::Ready(result.map(|service| {
-            let this = self.as_mut().project();
-
-            H1ServiceHandler::new(
-                this.cfg.take().unwrap(),
                 service,
-                this.expect.take().unwrap(),
+                expect,
-                this.upgrade.take(),
+                upgrade,
-                this.on_connect_ext.clone(),
+                on_connect_ext,
-            )
+            ))
-        }))
+        })
     }
 }
 
 /// `Service` implementation for HTTP/1 transport
-pub struct H1ServiceHandler<T, S, B, X, U>
+pub type H1ServiceHandler<T, S, B, X, U> = HttpServiceHandler<T, S, B, X, U>;
-where
-    S: Service<Request>,
-    X: Service<Request>,
-    U: Service<(Request, Framed<T, Codec>)>,
-{
-    flow: Rc<HttpFlow<S, X, U>>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    cfg: ServiceConfig,
-    _phantom: PhantomData<B>,
-}
-
-impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
-where
-    S: Service<Request>,
-    S::Error: Into<Error>,
-    S::Response: Into<Response<B>>,
-    B: MessageBody,
-    X: Service<Request, Response = Request>,
-    X::Error: Into<Error>,
-    U: Service<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
-{
-    fn new(
-        cfg: ServiceConfig,
-        service: S,
-        expect: X,
-        upgrade: Option<U>,
-        on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    ) -> H1ServiceHandler<T, S, B, X, U> {
-        H1ServiceHandler {
-            flow: HttpFlow::new(service, expect, upgrade),
-            cfg,
-            on_connect_ext,
-            _phantom: PhantomData,
-        }
-    }
-}
 
 impl<T, S, B, X, U> Service<(T, Option<net::SocketAddr>)>
-    for H1ServiceHandler<T, S, B, X, U>
+    for HttpServiceHandler<T, S, B, X, U>
 where
     T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request>,
@@ -417,47 +335,10 @@ where
     type Future = Dispatcher<T, S, B, X, U>;
 
     fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        let ready = self
+        self._poll_ready(cx).map_err(|e| {
-            .flow
+            log::error!("HTTP/1 service readiness error: {:?}", e);
-            .expect
+            DispatchError::Service(e)
-            .poll_ready(cx)
+        })
-            .map_err(|e| {
-                let e = e.into();
-                log::error!("Http service readiness error: {:?}", e);
-                DispatchError::Service(e)
-            })?
-            .is_ready();
-
-        let ready = self
-            .flow
-            .service
-            .poll_ready(cx)
-            .map_err(|e| {
-                let e = e.into();
-                log::error!("Http service readiness error: {:?}", e);
-                DispatchError::Service(e)
-            })?
-            .is_ready()
-            && ready;
-
-        let ready = if let Some(ref upg) = self.flow.upgrade {
-            upg.poll_ready(cx)
-                .map_err(|e| {
-                    let e = e.into();
-                    log::error!("Http service readiness error: {:?}", e);
-                    DispatchError::Service(e)
-                })?
-                .is_ready()
-                && ready
-        } else {
-            ready
-        };
-
-        if ready {
-            Poll::Ready(Ok(()))
-        } else {
-            Poll::Pending
-        }
     }
 
     fn call(&self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {

actix-http/src/h1/upgrade.rs

@@ -1,8 +1,6 @@
-use std::task::Poll;
-
 use actix_codec::Framed;
 use actix_service::{Service, ServiceFactory};
-use futures_util::future::{ready, Ready};
+use futures_core::future::LocalBoxFuture;
 
 use crate::error::Error;
 use crate::h1::Codec;
@@ -16,7 +14,7 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
     type Config = ();
     type Service = UpgradeHandler;
     type InitError = Error;
-    type Future = Ready<Result<Self::Service, Self::InitError>>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
         unimplemented!()
@@ -26,11 +24,11 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
 impl<T> Service<(Request, Framed<T, Codec>)> for UpgradeHandler {
     type Response = ();
     type Error = Error;
-    type Future = Ready<Result<Self::Response, Self::Error>>;
+    type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
 
     actix_service::always_ready!();
 
     fn call(&self, _: (Request, Framed<T, Codec>)) -> Self::Future {
-        ready(Ok(()))
+        unimplemented!()
     }
 }

actix-http/src/h2/dispatcher.rs

@@ -5,8 +5,10 @@ use actix_codec::{AsyncRead, AsyncWrite};
 use actix_service::Service;
 use bytes::{Bytes, BytesMut};
 use futures_core::ready;
-use h2::server::{Connection, SendResponse};
+use h2::{
-use h2::SendStream;
+    server::{Connection, SendResponse},
+    SendStream,
+};
 use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
 use log::{error, trace};
 

actix-http/src/h2/service.rs

@@ -10,10 +10,10 @@ use actix_service::{
     fn_factory, fn_service, pipeline_factory, IntoServiceFactory, Service,
     ServiceFactory,
 };
+use actix_utils::future::ready;
 use bytes::Bytes;
-use futures_core::ready;
+use futures_core::{future::LocalBoxFuture, ready};
-use futures_util::future::ok;
+use h2::server::{handshake, Handshake};
-use h2::server::{self, Handshake};
 use log::error;
 
 use crate::body::MessageBody;
@@ -65,6 +65,7 @@ where
 impl<S, B> H2Service<TcpStream, S, B>
 where
     S: ServiceFactory<Request, Config = ()>,
+    S::Future: 'static,
     S::Error: Into<Error> + 'static,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
@@ -80,11 +81,11 @@ where
         Error = DispatchError,
         InitError = S::InitError,
     > {
-        pipeline_factory(fn_factory(|| async {
+        pipeline_factory(fn_factory(|| {
-            Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
+            ready(Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
                 let peer_addr = io.peer_addr().ok();
-                ok::<_, DispatchError>((io, peer_addr))
+                ready(Ok::<_, DispatchError>((io, peer_addr)))
-            }))
+            })))
         }))
         .and_then(self)
     }
@@ -101,6 +102,7 @@ mod openssl {
     impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
     where
         S: ServiceFactory<Request, Config = ()>,
+        S::Future: 'static,
         S::Error: Into<Error> + 'static,
         S::Response: Into<Response<B>> + 'static,
         <S::Service as Service<Request>>::Future: 'static,
@@ -123,10 +125,12 @@ mod openssl {
                     .map_init_err(|_| panic!()),
             )
             .and_then(fn_factory(|| {
-                ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
+                ready(Ok::<_, S::InitError>(fn_service(
-                    let peer_addr = io.get_ref().peer_addr().ok();
+                    |io: TlsStream<TcpStream>| {
-                    ok((io, peer_addr))
+                        let peer_addr = io.get_ref().peer_addr().ok();
-                }))
+                        ready(Ok((io, peer_addr)))
+                    },
+                )))
             }))
             .and_then(self.map_err(TlsError::Service))
         }
@@ -144,6 +148,7 @@ mod rustls {
     impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
     where
         S: ServiceFactory<Request, Config = ()>,
+        S::Future: 'static,
         S::Error: Into<Error> + 'static,
         S::Response: Into<Response<B>> + 'static,
         <S::Service as Service<Request>>::Future: 'static,
@@ -169,10 +174,12 @@ mod rustls {
                     .map_init_err(|_| panic!()),
             )
             .and_then(fn_factory(|| {
-                ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
+                ready(Ok::<_, S::InitError>(fn_service(
-                    let peer_addr = io.get_ref().0.peer_addr().ok();
+                    |io: TlsStream<TcpStream>| {
-                    ok((io, peer_addr))
+                        let peer_addr = io.get_ref().0.peer_addr().ok();
-                }))
+                        ready(Ok((io, peer_addr)))
+                    },
+                )))
             }))
             .and_then(self.map_err(TlsError::Service))
         }
@@ -181,8 +188,9 @@ mod rustls {
 
 impl<T, S, B> ServiceFactory<(T, Option<net::SocketAddr>)> for H2Service<T, S, B>
 where
-    T: AsyncRead + AsyncWrite + Unpin,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     S: ServiceFactory<Request, Config = ()>,
+    S::Future: 'static,
     S::Error: Into<Error> + 'static,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
@@ -193,52 +201,16 @@ where
     type Config = ();
     type Service = H2ServiceHandler<T, S::Service, B>;
     type InitError = S::InitError;
-    type Future = H2ServiceResponse<T, S, B>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
-        H2ServiceResponse {
+        let service = self.srv.new_service(());
-            fut: self.srv.new_service(()),
+        let cfg = self.cfg.clone();
-            cfg: Some(self.cfg.clone()),
+        let on_connect_ext = self.on_connect_ext.clone();
-            on_connect_ext: self.on_connect_ext.clone(),
-            _phantom: PhantomData,
-        }
-    }
-}
 
-#[doc(hidden)]
+        Box::pin(async move {
-#[pin_project::pin_project]
+            let service = service.await?;
-pub struct H2ServiceResponse<T, S, B>
+            Ok(H2ServiceHandler::new(cfg, on_connect_ext, service))
-where
-    S: ServiceFactory<Request>,
-{
-    #[pin]
-    fut: S::Future,
-    cfg: Option<ServiceConfig>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    _phantom: PhantomData<B>,
-}
-
-impl<T, S, B> Future for H2ServiceResponse<T, S, B>
-where
-    T: AsyncRead + AsyncWrite + Unpin,
-    S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
-    S::Response: Into<Response<B>> + 'static,
-    <S::Service as Service<Request>>::Future: 'static,
-    B: MessageBody + 'static,
-{
-    type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
-
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let this = self.as_mut().project();
-
-        this.fut.poll(cx).map_ok(|service| {
-            let this = self.as_mut().project();
-            H2ServiceHandler::new(
-                this.cfg.take().unwrap(),
-                this.on_connect_ext.clone(),
-                service,
-            )
         })
     }
 }
@@ -307,7 +279,7 @@ where
                 Some(self.cfg.clone()),
                 addr,
                 on_connect_data,
-                server::handshake(io),
+                handshake(io),
             ),
         }
     }

actix-http/src/header/mod.rs

@@ -1,9 +1,6 @@
 //! Typed HTTP headers, pre-defined `HeaderName`s, traits for parsing and conversion, and other
 //! header utility methods.
 
-use std::fmt;
-
-use bytes::{Bytes, BytesMut};
 use percent_encoding::{AsciiSet, CONTROLS};
 
 pub use http::header::*;
@@ -16,11 +13,9 @@ mod into_pair;
 mod into_value;
 mod utils;
 
-mod common;
 pub(crate) mod map;
 mod shared;
 
-pub use self::common::*;
 #[doc(hidden)]
 pub use self::shared::*;
 
@@ -41,34 +36,6 @@ pub trait Header: IntoHeaderValue {
     fn parse<T: HttpMessage>(msg: &T) -> Result<Self, ParseError>;
 }
 
-#[derive(Debug, Default)]
-pub(crate) struct Writer {
-    buf: BytesMut,
-}
-
-impl Writer {
-    fn new() -> Writer {
-        Writer::default()
-    }
-
-    fn take(&mut self) -> Bytes {
-        self.buf.split().freeze()
-    }
-}
-
-impl fmt::Write for Writer {
-    #[inline]
-    fn write_str(&mut self, s: &str) -> fmt::Result {
-        self.buf.extend_from_slice(s.as_bytes());
-        Ok(())
-    }
-
-    #[inline]
-    fn write_fmt(&mut self, args: fmt::Arguments<'_>) -> fmt::Result {
-        fmt::write(self, args)
-    }
-}
-
 /// Convert `http::HeaderMap` to our `HeaderMap`.
 impl From<http::HeaderMap> for HeaderMap {
     fn from(mut map: http::HeaderMap) -> HeaderMap {

actix-http/src/header/shared/extended.rs

@@ -88,9 +88,9 @@ pub fn parse_extended_value(
     };
 
     Ok(ExtendedValue {
-        value,
         charset,
         language_tag,
+        value,
     })
 }
 

actix-http/src/header/shared/httpdate.rs

@@ -1,18 +1,20 @@
-use std::fmt::{self, Display};
+use std::{
-use std::io::Write;
+    fmt,
-use std::str::FromStr;
+    io::Write,
-use std::time::{SystemTime, UNIX_EPOCH};
+    str::FromStr,
+    time::{SystemTime, UNIX_EPOCH},
+};
 
 use bytes::buf::BufMut;
 use bytes::BytesMut;
 use http::header::{HeaderValue, InvalidHeaderValue};
-use time::{offset, OffsetDateTime, PrimitiveDateTime};
+use time::{OffsetDateTime, PrimitiveDateTime, UtcOffset};
 
 use crate::error::ParseError;
 use crate::header::IntoHeaderValue;
 use crate::time_parser;
 
-/// A timestamp with HTTP formatting and parsing
+/// A timestamp with HTTP formatting and parsing.
 #[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord)]
 pub struct HttpDate(OffsetDateTime);
 
@@ -27,18 +29,12 @@ impl FromStr for HttpDate {
     }
 }
 
-impl Display for HttpDate {
+impl fmt::Display for HttpDate {
     fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt::Display::fmt(&self.0.format("%a, %d %b %Y %H:%M:%S GMT"), f)
     }
 }
 
-impl From<OffsetDateTime> for HttpDate {
-    fn from(dt: OffsetDateTime) -> HttpDate {
-        HttpDate(dt)
-    }
-}
-
 impl From<SystemTime> for HttpDate {
     fn from(sys: SystemTime) -> HttpDate {
         HttpDate(PrimitiveDateTime::from(sys).assume_utc())
@@ -54,7 +50,7 @@ impl IntoHeaderValue for HttpDate {
             wrt,
             "{}",
             self.0
-                .to_offset(offset!(UTC))
+                .to_offset(UtcOffset::UTC)
                 .format("%a, %d %b %Y %H:%M:%S GMT")
         )
         .unwrap();

actix-http/src/header/shared/mod.rs

@@ -1,15 +1,13 @@
 //! Originally taken from `hyper::header::shared`.
 
 mod charset;
-mod encoding;
+mod content_encoding;
-mod entity;
 mod extended;
 mod httpdate;
 mod quality_item;
 
 pub use self::charset::Charset;
-pub use self::encoding::Encoding;
+pub use self::content_encoding::ContentEncoding;
-pub use self::entity::EntityTag;
 pub use self::extended::{parse_extended_value, ExtendedValue};
 pub use self::httpdate::HttpDate;
 pub use self::quality_item::{q, qitem, Quality, QualityItem};

actix-http/src/header/shared/quality_item.rs

@@ -193,21 +193,69 @@ where
 
 #[cfg(test)]
 mod tests {
-    use super::super::encoding::*;
     use super::*;
 
+    // copy of encoding from actix-web headers
+    #[derive(Clone, PartialEq, Debug)]
+    pub enum Encoding {
+        Chunked,
+        Brotli,
+        Gzip,
+        Deflate,
+        Compress,
+        Identity,
+        Trailers,
+        EncodingExt(String),
+    }
+
+    impl fmt::Display for Encoding {
+        fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+            use Encoding::*;
+            f.write_str(match *self {
+                Chunked => "chunked",
+                Brotli => "br",
+                Gzip => "gzip",
+                Deflate => "deflate",
+                Compress => "compress",
+                Identity => "identity",
+                Trailers => "trailers",
+                EncodingExt(ref s) => s.as_ref(),
+            })
+        }
+    }
+
+    impl str::FromStr for Encoding {
+        type Err = crate::error::ParseError;
+        fn from_str(s: &str) -> Result<Encoding, crate::error::ParseError> {
+            use Encoding::*;
+            match s {
+                "chunked" => Ok(Chunked),
+                "br" => Ok(Brotli),
+                "deflate" => Ok(Deflate),
+                "gzip" => Ok(Gzip),
+                "compress" => Ok(Compress),
+                "identity" => Ok(Identity),
+                "trailers" => Ok(Trailers),
+                _ => Ok(EncodingExt(s.to_owned())),
+            }
+        }
+    }
+
     #[test]
     fn test_quality_item_fmt_q_1() {
+        use Encoding::*;
         let x = qitem(Chunked);
         assert_eq!(format!("{}", x), "chunked");
     }
     #[test]
     fn test_quality_item_fmt_q_0001() {
+        use Encoding::*;
         let x = QualityItem::new(Chunked, Quality(1));
         assert_eq!(format!("{}", x), "chunked; q=0.001");
     }
     #[test]
     fn test_quality_item_fmt_q_05() {
+        use Encoding::*;
         // Custom value
         let x = QualityItem {
             item: EncodingExt("identity".to_owned()),
@@ -218,6 +266,7 @@ mod tests {
 
     #[test]
     fn test_quality_item_fmt_q_0() {
+        use Encoding::*;
         // Custom value
         let x = QualityItem {
             item: EncodingExt("identity".to_owned()),
@@ -228,6 +277,7 @@ mod tests {
 
     #[test]
     fn test_quality_item_from_str1() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "chunked".parse();
         assert_eq!(
             x.unwrap(),
@@ -237,8 +287,10 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str2() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "chunked; q=1".parse();
         assert_eq!(
             x.unwrap(),
@@ -248,8 +300,10 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str3() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.5".parse();
         assert_eq!(
             x.unwrap(),
@@ -259,8 +313,10 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str4() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.273".parse();
         assert_eq!(
             x.unwrap(),
@@ -270,16 +326,19 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str5() {
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.2739999".parse();
         assert!(x.is_err());
     }
+
     #[test]
     fn test_quality_item_from_str6() {
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=2".parse();
         assert!(x.is_err());
     }
+
     #[test]
     fn test_quality_item_ordering() {
         let x: QualityItem<Encoding> = "gzip; q=0.5".parse().ok().unwrap();

actix-http/src/header/utils.rs

@@ -1,7 +1,6 @@
 use std::{fmt, str::FromStr};
 
-use http::HeaderValue;
+use super::HeaderValue;
-
 use crate::{error::ParseError, header::HTTP_VALUE};
 
 /// Reads a comma-delimited raw header into a Vec.

actix-http/src/helpers.rs

@@ -1,15 +1,15 @@
 use std::io;
 
-use bytes::{BufMut, BytesMut};
+use bytes::BufMut;
 use http::Version;
 
 const DIGITS_START: u8 = b'0';
 
-pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
+pub(crate) fn write_status_line<B: BufMut>(version: Version, n: u16, buf: &mut B) {
     match version {
-        Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
+        Version::HTTP_11 => buf.put_slice(b"HTTP/1.1 "),
-        Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
+        Version::HTTP_10 => buf.put_slice(b"HTTP/1.0 "),
-        Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
+        Version::HTTP_09 => buf.put_slice(b"HTTP/0.9 "),
         _ => {
             // other HTTP version handlers do not use this method
         }
@@ -19,33 +19,36 @@ pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut)
     let d10 = ((n / 10) % 10) as u8;
     let d1 = (n % 10) as u8;
 
-    bytes.put_u8(DIGITS_START + d100);
+    buf.put_u8(DIGITS_START + d100);
-    bytes.put_u8(DIGITS_START + d10);
+    buf.put_u8(DIGITS_START + d10);
-    bytes.put_u8(DIGITS_START + d1);
+    buf.put_u8(DIGITS_START + d1);
 
     // trailing space before reason
-    bytes.put_u8(b' ');
+    buf.put_u8(b' ');
 }
 
 /// NOTE: bytes object has to contain enough space
-pub fn write_content_length(n: u64, bytes: &mut BytesMut) {
+pub fn write_content_length<B: BufMut>(n: u64, buf: &mut B) {
     if n == 0 {
-        bytes.put_slice(b"\r\ncontent-length: 0\r\n");
+        buf.put_slice(b"\r\ncontent-length: 0\r\n");
         return;
     }
 
-    let mut buf = itoa::Buffer::new();
+    let mut buffer = itoa::Buffer::new();
 
-    bytes.put_slice(b"\r\ncontent-length: ");
+    buf.put_slice(b"\r\ncontent-length: ");
-    bytes.put_slice(buf.format(n).as_bytes());
+    buf.put_slice(buffer.format(n).as_bytes());
-    bytes.put_slice(b"\r\n");
+    buf.put_slice(b"\r\n");
 }
 
-pub(crate) struct Writer<'a>(pub &'a mut BytesMut);
+pub(crate) struct Writer<'a, B>(pub &'a mut B);
 
-impl<'a> io::Write for Writer<'a> {
+impl<'a, B> io::Write for Writer<'a, B>
+where
+    B: BufMut,
+{
     fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.0.extend_from_slice(buf);
+        self.0.put_slice(buf);
         Ok(buf.len())
     }
 
@@ -58,6 +61,8 @@ impl<'a> io::Write for Writer<'a> {
 mod tests {
     use std::str::from_utf8;
 
+    use bytes::BytesMut;
+
     use super::*;
 
     #[test]

actix-http/src/response.rs

@@ -357,12 +357,12 @@ impl ResponseBuilder {
 
     /// Insert a header, replacing any that were set with an equivalent field name.
     ///
-    /// ```rust
+    /// ```
     /// # use actix_http::Response;
-    /// use actix_http::http::header::ContentType;
+    /// use actix_http::http::header;
     ///
     /// Response::Ok()
-    ///     .insert_header(ContentType(mime::APPLICATION_JSON))
+    ///     .insert_header((header::CONTENT_TYPE, mime::APPLICATION_JSON))
     ///     .insert_header(("X-TEST", "value"))
     ///     .finish();
     /// ```
@@ -384,12 +384,12 @@ impl ResponseBuilder {
 
     /// Append a header, keeping any that were set with an equivalent field name.
     ///
-    /// ```rust
+    /// ```
     /// # use actix_http::Response;
-    /// use actix_http::http::header::ContentType;
+    /// use actix_http::http::header;
     ///
     /// Response::Ok()
-    ///     .append_header(ContentType(mime::APPLICATION_JSON))
+    ///     .append_header((header::CONTENT_TYPE, mime::APPLICATION_JSON))
     ///     .append_header(("X-TEST", "value1"))
     ///     .append_header(("X-TEST", "value2"))
     ///     .finish();
@@ -525,7 +525,7 @@ impl ResponseBuilder {
 
     /// Set a cookie
     ///
-    /// ```rust
+    /// ```
     /// use actix_http::{http, Request, Response};
     ///
     /// fn index(req: Request) -> Response {
@@ -555,7 +555,7 @@ impl ResponseBuilder {
 
     /// Remove cookie
     ///
-    /// ```rust
+    /// ```
     /// use actix_http::{http, Request, Response, HttpMessage};
     ///
     /// fn index(req: Request) -> Response {
@@ -682,7 +682,7 @@ impl ResponseBuilder {
                 };
 
                 if !contains {
-                    self.insert_header(header::ContentType(mime::APPLICATION_JSON));
+                    self.insert_header((header::CONTENT_TYPE, mime::APPLICATION_JSON));
                 }
 
                 self.body(Body::from(body))
@@ -1133,7 +1133,7 @@ mod tests {
     #[test]
     fn response_builder_header_insert_typed() {
         let mut res = Response::Ok();
-        res.insert_header(header::ContentType(mime::APPLICATION_OCTET_STREAM));
+        res.insert_header((header::CONTENT_TYPE, mime::APPLICATION_OCTET_STREAM));
         let res = res.finish();
 
         assert_eq!(
@@ -1158,8 +1158,8 @@ mod tests {
     #[test]
     fn response_builder_header_append_typed() {
         let mut res = Response::Ok();
-        res.append_header(header::ContentType(mime::APPLICATION_OCTET_STREAM));
+        res.append_header((header::CONTENT_TYPE, mime::APPLICATION_OCTET_STREAM));
-        res.append_header(header::ContentType(mime::APPLICATION_JSON));
+        res.append_header((header::CONTENT_TYPE, mime::APPLICATION_JSON));
         let res = res.finish();
 
         let headers: Vec<_> = res.headers().get_all("Content-Type").cloned().collect();

actix-http/src/service.rs

@@ -1,14 +1,19 @@
-use std::marker::PhantomData;
+use std::{
-use std::pin::Pin;
+    fmt,
-use std::task::{Context, Poll};
+    future::Future,
-use std::{fmt, net, rc::Rc};
+    marker::PhantomData,
+    net,
+    pin::Pin,
+    rc::Rc,
+    task::{Context, Poll},
+};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_rt::net::TcpStream;
 use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
 use bytes::Bytes;
-use futures_core::{ready, Future};
+use futures_core::{future::LocalBoxFuture, ready};
-use h2::server::{self, Handshake};
+use h2::server::{handshake, Handshake};
 use pin_project::pin_project;
 
 use crate::body::MessageBody;
@@ -102,7 +107,6 @@ where
         X1: ServiceFactory<Request, Config = (), Response = Request>,
         X1::Error: Into<Error>,
         X1::InitError: fmt::Debug,
-        <X1::Service as Service<Request>>::Future: 'static,
     {
         HttpService {
             expect,
@@ -123,7 +127,6 @@ where
         U1: ServiceFactory<(Request, Framed<T, h1::Codec>), Config = (), Response = ()>,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
-        <U1::Service as Service<(Request, Framed<T, h1::Codec>)>>::Future: 'static,
     {
         HttpService {
             upgrade,
@@ -145,23 +148,27 @@ where
 impl<S, B, X, U> HttpService<TcpStream, S, B, X, U>
 where
     S: ServiceFactory<Request, Config = ()>,
+    S::Future: 'static,
     S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
+
     B: MessageBody + 'static,
+
     X: ServiceFactory<Request, Config = (), Response = Request>,
+    X::Future: 'static,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    <X::Service as Service<Request>>::Future: 'static,
+
     U: ServiceFactory<
         (Request, Framed<TcpStream, h1::Codec>),
         Config = (),
         Response = (),
     >,
+    U::Future: 'static,
     U::Error: fmt::Display + Into<Error>,
     U::InitError: fmt::Debug,
-    <U::Service as Service<(Request, Framed<TcpStream, h1::Codec>)>>::Future: 'static,
 {
     /// Create simple tcp stream service
     pub fn tcp(
@@ -183,31 +190,36 @@ where
 
 #[cfg(feature = "openssl")]
 mod openssl {
-    use super::*;
     use actix_service::ServiceFactoryExt;
     use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, TlsStream};
     use actix_tls::accept::TlsError;
 
+    use super::*;
+
     impl<S, B, X, U> HttpService<TlsStream<TcpStream>, S, B, X, U>
     where
         S: ServiceFactory<Request, Config = ()>,
+        S::Future: 'static,
         S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>> + 'static,
         <S::Service as Service<Request>>::Future: 'static,
+
         B: MessageBody + 'static,
+
         X: ServiceFactory<Request, Config = (), Response = Request>,
+        X::Future: 'static,
         X::Error: Into<Error>,
         X::InitError: fmt::Debug,
-        <X::Service as Service<Request>>::Future: 'static,
+
         U: ServiceFactory<
             (Request, Framed<TlsStream<TcpStream>, h1::Codec>),
             Config = (),
             Response = (),
         >,
+        U::Future: 'static,
         U::Error: fmt::Display + Into<Error>,
         U::InitError: fmt::Debug,
-        <U::Service as Service<(Request, Framed<TlsStream<TcpStream>, h1::Codec>)>>::Future: 'static,
     {
         /// Create openssl based service
         pub fn openssl(
@@ -256,25 +268,29 @@ mod rustls {
     impl<S, B, X, U> HttpService<TlsStream<TcpStream>, S, B, X, U>
     where
         S: ServiceFactory<Request, Config = ()>,
+        S::Future: 'static,
         S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>> + 'static,
         <S::Service as Service<Request>>::Future: 'static,
+
         B: MessageBody + 'static,
+
         X: ServiceFactory<Request, Config = (), Response = Request>,
+        X::Future: 'static,
         X::Error: Into<Error>,
         X::InitError: fmt::Debug,
-        <X::Service as Service<Request>>::Future: 'static,
+
         U: ServiceFactory<
             (Request, Framed<TlsStream<TcpStream>, h1::Codec>),
             Config = (),
             Response = (),
         >,
+        U::Future: 'static,
         U::Error: fmt::Display + Into<Error>,
         U::InitError: fmt::Debug,
-        <U::Service as Service<(Request, Framed<TlsStream<TcpStream>, h1::Codec>)>>::Future: 'static,
     {
-        /// Create openssl based service
+        /// Create rustls based service
         pub fn rustls(
             self,
             mut config: ServerConfig,
@@ -314,137 +330,121 @@ mod rustls {
 impl<T, S, B, X, U> ServiceFactory<(T, Protocol, Option<net::SocketAddr>)>
     for HttpService<T, S, B, X, U>
 where
-    T: AsyncRead + AsyncWrite + Unpin,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
+
     S: ServiceFactory<Request, Config = ()>,
+    S::Future: 'static,
     S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
+
     B: MessageBody + 'static,
+
     X: ServiceFactory<Request, Config = (), Response = Request>,
+    X::Future: 'static,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    <X::Service as Service<Request>>::Future: 'static,
+
     U: ServiceFactory<(Request, Framed<T, h1::Codec>), Config = (), Response = ()>,
+    U::Future: 'static,
     U::Error: fmt::Display + Into<Error>,
     U::InitError: fmt::Debug,
-    <U::Service as Service<(Request, Framed<T, h1::Codec>)>>::Future: 'static,
 {
     type Response = ();
     type Error = DispatchError;
     type Config = ();
     type Service = HttpServiceHandler<T, S::Service, B, X::Service, U::Service>;
     type InitError = ();
-    type Future = HttpServiceResponse<T, S, B, X, U>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
-        HttpServiceResponse {
+        let service = self.srv.new_service(());
-            fut: self.srv.new_service(()),
+        let expect = self.expect.new_service(());
-            fut_ex: Some(self.expect.new_service(())),
+        let upgrade = self.upgrade.as_ref().map(|s| s.new_service(()));
-            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
+        let on_connect_ext = self.on_connect_ext.clone();
-            expect: None,
+        let cfg = self.cfg.clone();
-            upgrade: None,
-            on_connect_ext: self.on_connect_ext.clone(),
-            cfg: self.cfg.clone(),
-            _phantom: PhantomData,
-        }
-    }
-}
 
-#[doc(hidden)]
+        Box::pin(async move {
-#[pin_project]
+            let expect = expect
-pub struct HttpServiceResponse<T, S, B, X, U>
+                .await
-where
+                .map_err(|e| log::error!("Init http expect service error: {:?}", e))?;
-    S: ServiceFactory<Request>,
-    X: ServiceFactory<Request>,
-    U: ServiceFactory<(Request, Framed<T, h1::Codec>)>,
-{
-    #[pin]
-    fut: S::Future,
-    #[pin]
-    fut_ex: Option<X::Future>,
-    #[pin]
-    fut_upg: Option<U::Future>,
-    expect: Option<X::Service>,
-    upgrade: Option<U::Service>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    cfg: ServiceConfig,
-    _phantom: PhantomData<B>,
-}
 
-impl<T, S, B, X, U> Future for HttpServiceResponse<T, S, B, X, U>
+            let upgrade = match upgrade {
-where
+                Some(upgrade) => {
-    T: AsyncRead + AsyncWrite + Unpin,
+                    let upgrade = upgrade.await.map_err(|e| {
-    S: ServiceFactory<Request>,
+                        log::error!("Init http upgrade service error: {:?}", e)
-    S::Error: Into<Error> + 'static,
+                    })?;
-    S::InitError: fmt::Debug,
+                    Some(upgrade)
-    S::Response: Into<Response<B>> + 'static,
+                }
-    <S::Service as Service<Request>>::Future: 'static,
+                None => None,
-    B: MessageBody + 'static,
+            };
-    X: ServiceFactory<Request, Response = Request>,
-    X::Error: Into<Error>,
-    X::InitError: fmt::Debug,
-    <X::Service as Service<Request>>::Future: 'static,
-    U: ServiceFactory<(Request, Framed<T, h1::Codec>), Response = ()>,
-    U::Error: fmt::Display,
-    U::InitError: fmt::Debug,
-    <U::Service as Service<(Request, Framed<T, h1::Codec>)>>::Future: 'static,
-{
-    type Output =
-        Result<HttpServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
 
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+            let service = service
-        let mut this = self.as_mut().project();
+                .await
+                .map_err(|e| log::error!("Init http service error: {:?}", e))?;
 
-        if let Some(fut) = this.fut_ex.as_pin_mut() {
+            Ok(HttpServiceHandler::new(
-            let expect = ready!(fut
+                cfg,
-                .poll(cx)
-                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
-            this = self.as_mut().project();
-            *this.expect = Some(expect);
-            this.fut_ex.set(None);
-        }
-
-        if let Some(fut) = this.fut_upg.as_pin_mut() {
-            let upgrade = ready!(fut
-                .poll(cx)
-                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
-            this = self.as_mut().project();
-            *this.upgrade = Some(upgrade);
-            this.fut_upg.set(None);
-        }
-
-        let result = ready!(this
-            .fut
-            .poll(cx)
-            .map_err(|e| log::error!("Init http service error: {:?}", e)));
-
-        Poll::Ready(result.map(|service| {
-            let this = self.as_mut().project();
-            HttpServiceHandler::new(
-                this.cfg.clone(),
                 service,
-                this.expect.take().unwrap(),
+                expect,
-                this.upgrade.take(),
+                upgrade,
-                this.on_connect_ext.clone(),
+                on_connect_ext,
-            )
+            ))
-        }))
+        })
     }
 }
 
-/// `Service` implementation for HTTP transport
+/// `Service` implementation for HTTP/1 and HTTP/2 transport
 pub struct HttpServiceHandler<T, S, B, X, U>
 where
     S: Service<Request>,
     X: Service<Request>,
     U: Service<(Request, Framed<T, h1::Codec>)>,
 {
-    flow: Rc<HttpFlow<S, X, U>>,
+    pub(super) flow: Rc<HttpFlow<S, X, U>>,
-    cfg: ServiceConfig,
+    pub(super) cfg: ServiceConfig,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
+    pub(super) on_connect_ext: Option<Rc<ConnectCallback<T>>>,
     _phantom: PhantomData<B>,
 }
 
+impl<T, S, B, X, U> HttpServiceHandler<T, S, B, X, U>
+where
+    S: Service<Request>,
+    S::Error: Into<Error>,
+    X: Service<Request>,
+    X::Error: Into<Error>,
+    U: Service<(Request, Framed<T, h1::Codec>)>,
+    U::Error: Into<Error>,
+{
+    pub(super) fn new(
+        cfg: ServiceConfig,
+        service: S,
+        expect: X,
+        upgrade: Option<U>,
+        on_connect_ext: Option<Rc<ConnectCallback<T>>>,
+    ) -> HttpServiceHandler<T, S, B, X, U> {
+        HttpServiceHandler {
+            cfg,
+            on_connect_ext,
+            flow: HttpFlow::new(service, expect, upgrade),
+            _phantom: PhantomData,
+        }
+    }
+
+    pub(super) fn _poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Error>> {
+        ready!(self.flow.expect.poll_ready(cx).map_err(Into::into))?;
+
+        ready!(self.flow.service.poll_ready(cx).map_err(Into::into))?;
+
+        if let Some(ref upg) = self.flow.upgrade {
+            ready!(upg.poll_ready(cx).map_err(Into::into))?;
+        };
+
+        Poll::Ready(Ok(()))
+    }
+}
+
 /// A collection of services that describe an HTTP request flow.
 pub(super) struct HttpFlow<S, X, U> {
     pub(super) service: S,
@@ -462,34 +462,6 @@ impl<S, X, U> HttpFlow<S, X, U> {
     }
 }
 
-impl<T, S, B, X, U> HttpServiceHandler<T, S, B, X, U>
-where
-    S: Service<Request>,
-    S::Error: Into<Error> + 'static,
-    S::Future: 'static,
-    S::Response: Into<Response<B>> + 'static,
-    B: MessageBody + 'static,
-    X: Service<Request, Response = Request>,
-    X::Error: Into<Error>,
-    U: Service<(Request, Framed<T, h1::Codec>), Response = ()>,
-    U::Error: fmt::Display,
-{
-    fn new(
-        cfg: ServiceConfig,
-        service: S,
-        expect: X,
-        upgrade: Option<U>,
-        on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    ) -> HttpServiceHandler<T, S, B, X, U> {
-        HttpServiceHandler {
-            cfg,
-            on_connect_ext,
-            flow: HttpFlow::new(service, expect, upgrade),
-            _phantom: PhantomData,
-        }
-    }
-}
-
 impl<T, S, B, X, U> Service<(T, Protocol, Option<net::SocketAddr>)>
     for HttpServiceHandler<T, S, B, X, U>
 where
@@ -509,47 +481,10 @@ where
     type Future = HttpServiceHandlerResponse<T, S, B, X, U>;
 
     fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        let ready = self
+        self._poll_ready(cx).map_err(|e| {
-            .flow
+            log::error!("HTTP service readiness error: {:?}", e);
-            .expect
+            DispatchError::Service(e)
-            .poll_ready(cx)
+        })
-            .map_err(|e| {
-                let e = e.into();
-                log::error!("Http service readiness error: {:?}", e);
-                DispatchError::Service(e)
-            })?
-            .is_ready();
-
-        let ready = self
-            .flow
-            .service
-            .poll_ready(cx)
-            .map_err(|e| {
-                let e = e.into();
-                log::error!("Http service readiness error: {:?}", e);
-                DispatchError::Service(e)
-            })?
-            .is_ready()
-            && ready;
-
-        let ready = if let Some(ref upg) = self.flow.upgrade {
-            upg.poll_ready(cx)
-                .map_err(|e| {
-                    let e = e.into();
-                    log::error!("Http service readiness error: {:?}", e);
-                    DispatchError::Service(e)
-                })?
-                .is_ready()
-                && ready
-        } else {
-            ready
-        };
-
-        if ready {
-            Poll::Ready(Ok(()))
-        } else {
-            Poll::Pending
-        }
     }
 
     fn call(
@@ -562,7 +497,7 @@ where
         match proto {
             Protocol::Http2 => HttpServiceHandlerResponse {
                 state: State::H2Handshake(Some((
-                    server::handshake(io),
+                    handshake(io),
                     self.cfg.clone(),
                     self.flow.clone(),
                     on_connect_data,

actix-http/src/test.rs

@@ -26,7 +26,7 @@ use crate::{
 
 /// Test `Request` builder
 ///
-/// ```rust,ignore
+/// ```ignore
 /// # use http::{header, StatusCode};
 /// # use actix_web::*;
 /// use actix_web::test::TestRequest;

actix-http/src/time_parser.rs

@@ -1,7 +1,7 @@
 use time::{Date, OffsetDateTime, PrimitiveDateTime};
 
 /// Attempt to parse a `time` string as one of either RFC 1123, RFC 850, or asctime.
-pub fn parse_http_date(time: &str) -> Option<PrimitiveDateTime> {
+pub(crate) fn parse_http_date(time: &str) -> Option<PrimitiveDateTime> {
     try_parse_rfc_1123(time)
         .or_else(|| try_parse_rfc_850(time))
         .or_else(|| try_parse_asctime(time))

actix-http/src/ws/dispatcher.rs

@@ -4,7 +4,6 @@ use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_service::{IntoService, Service};
-use actix_utils::dispatcher::{Dispatcher as InnerDispatcher, DispatcherError};
 
 use super::{Codec, Frame, Message};
 
@@ -15,7 +14,7 @@ where
     T: AsyncRead + AsyncWrite,
 {
     #[pin]
-    inner: InnerDispatcher<S, T, Codec, Message>,
+    inner: inner::Dispatcher<S, T, Codec, Message>,
 }
 
 impl<S, T> Dispatcher<S, T>
@@ -27,13 +26,13 @@ where
 {
     pub fn new<F: IntoService<S, Frame>>(io: T, service: F) -> Self {
         Dispatcher {
-            inner: InnerDispatcher::new(Framed::new(io, Codec::new()), service),
+            inner: inner::Dispatcher::new(Framed::new(io, Codec::new()), service),
         }
     }
 
     pub fn with<F: IntoService<S, Frame>>(framed: Framed<T, Codec>, service: F) -> Self {
         Dispatcher {
-            inner: InnerDispatcher::new(framed, service),
+            inner: inner::Dispatcher::new(framed, service),
         }
     }
 }
@@ -45,9 +44,393 @@ where
     S::Future: 'static,
     S::Error: 'static,
 {
-    type Output = Result<(), DispatcherError<S::Error, Codec, Message>>;
+    type Output = Result<(), inner::DispatcherError<S::Error, Codec, Message>>;
 
     fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
         self.project().inner.poll(cx)
     }
 }
+
+/// Framed dispatcher service and related utilities.
+mod inner {
+    // allow dead code since this mod was ripped from actix-utils
+    #![allow(dead_code)]
+
+    use core::{
+        fmt,
+        future::Future,
+        mem,
+        pin::Pin,
+        task::{Context, Poll},
+    };
+
+    use actix_service::{IntoService, Service};
+    use futures_core::stream::Stream;
+    use local_channel::mpsc;
+    use log::debug;
+    use pin_project_lite::pin_project;
+
+    use actix_codec::{AsyncRead, AsyncWrite, Decoder, Encoder, Framed};
+
+    use crate::ResponseError;
+
+    /// Framed transport errors
+    pub enum DispatcherError<E, U, I>
+    where
+        U: Encoder<I> + Decoder,
+    {
+        /// Inner service error.
+        Service(E),
+
+        /// Frame encoding error.
+        Encoder(<U as Encoder<I>>::Error),
+
+        /// Frame decoding error.
+        Decoder(<U as Decoder>::Error),
+    }
+
+    impl<E, U, I> From<E> for DispatcherError<E, U, I>
+    where
+        U: Encoder<I> + Decoder,
+    {
+        fn from(err: E) -> Self {
+            DispatcherError::Service(err)
+        }
+    }
+
+    impl<E, U, I> fmt::Debug for DispatcherError<E, U, I>
+    where
+        E: fmt::Debug,
+        U: Encoder<I> + Decoder,
+        <U as Encoder<I>>::Error: fmt::Debug,
+        <U as Decoder>::Error: fmt::Debug,
+    {
+        fn fmt(&self, fmt: &mut fmt::Formatter<'_>) -> fmt::Result {
+            match *self {
+                DispatcherError::Service(ref e) => {
+                    write!(fmt, "DispatcherError::Service({:?})", e)
+                }
+                DispatcherError::Encoder(ref e) => {
+                    write!(fmt, "DispatcherError::Encoder({:?})", e)
+                }
+                DispatcherError::Decoder(ref e) => {
+                    write!(fmt, "DispatcherError::Decoder({:?})", e)
+                }
+            }
+        }
+    }
+
+    impl<E, U, I> fmt::Display for DispatcherError<E, U, I>
+    where
+        E: fmt::Display,
+        U: Encoder<I> + Decoder,
+        <U as Encoder<I>>::Error: fmt::Debug,
+        <U as Decoder>::Error: fmt::Debug,
+    {
+        fn fmt(&self, fmt: &mut fmt::Formatter<'_>) -> fmt::Result {
+            match *self {
+                DispatcherError::Service(ref e) => write!(fmt, "{}", e),
+                DispatcherError::Encoder(ref e) => write!(fmt, "{:?}", e),
+                DispatcherError::Decoder(ref e) => write!(fmt, "{:?}", e),
+            }
+        }
+    }
+
+    impl<E, U, I> ResponseError for DispatcherError<E, U, I>
+    where
+        E: fmt::Debug + fmt::Display,
+        U: Encoder<I> + Decoder,
+        <U as Encoder<I>>::Error: fmt::Debug,
+        <U as Decoder>::Error: fmt::Debug,
+    {
+    }
+
+    /// Message type wrapper for signalling end of message stream.
+    pub enum Message<T> {
+        /// Message item.
+        Item(T),
+
+        /// Signal from service to flush all messages and stop processing.
+        Close,
+    }
+
+    pin_project! {
+        /// A future that reads frames from a [`Framed`] object and passes them to a [`Service`].
+        pub struct Dispatcher<S, T, U, I>
+        where
+            S: Service<<U as Decoder>::Item, Response = I>,
+            S::Error: 'static,
+            S::Future: 'static,
+            T: AsyncRead,
+            T: AsyncWrite,
+            U: Encoder<I>,
+            U: Decoder,
+            I: 'static,
+            <U as Encoder<I>>::Error: fmt::Debug,
+        {
+            service: S,
+            state: State<S, U, I>,
+            #[pin]
+            framed: Framed<T, U>,
+            rx: mpsc::Receiver<Result<Message<I>, S::Error>>,
+            tx: mpsc::Sender<Result<Message<I>, S::Error>>,
+        }
+    }
+
+    enum State<S, U, I>
+    where
+        S: Service<<U as Decoder>::Item>,
+        U: Encoder<I> + Decoder,
+    {
+        Processing,
+        Error(DispatcherError<S::Error, U, I>),
+        FramedError(DispatcherError<S::Error, U, I>),
+        FlushAndStop,
+        Stopping,
+    }
+
+    impl<S, U, I> State<S, U, I>
+    where
+        S: Service<<U as Decoder>::Item>,
+        U: Encoder<I> + Decoder,
+    {
+        fn take_error(&mut self) -> DispatcherError<S::Error, U, I> {
+            match mem::replace(self, State::Processing) {
+                State::Error(err) => err,
+                _ => panic!(),
+            }
+        }
+
+        fn take_framed_error(&mut self) -> DispatcherError<S::Error, U, I> {
+            match mem::replace(self, State::Processing) {
+                State::FramedError(err) => err,
+                _ => panic!(),
+            }
+        }
+    }
+
+    impl<S, T, U, I> Dispatcher<S, T, U, I>
+    where
+        S: Service<<U as Decoder>::Item, Response = I>,
+        S::Error: 'static,
+        S::Future: 'static,
+        T: AsyncRead + AsyncWrite,
+        U: Decoder + Encoder<I>,
+        I: 'static,
+        <U as Decoder>::Error: fmt::Debug,
+        <U as Encoder<I>>::Error: fmt::Debug,
+    {
+        /// Create new `Dispatcher`.
+        pub fn new<F>(framed: Framed<T, U>, service: F) -> Self
+        where
+            F: IntoService<S, <U as Decoder>::Item>,
+        {
+            let (tx, rx) = mpsc::channel();
+            Dispatcher {
+                framed,
+                rx,
+                tx,
+                service: service.into_service(),
+                state: State::Processing,
+            }
+        }
+
+        /// Construct new `Dispatcher` instance with customer `mpsc::Receiver`
+        pub fn with_rx<F>(
+            framed: Framed<T, U>,
+            service: F,
+            rx: mpsc::Receiver<Result<Message<I>, S::Error>>,
+        ) -> Self
+        where
+            F: IntoService<S, <U as Decoder>::Item>,
+        {
+            let tx = rx.sender();
+            Dispatcher {
+                framed,
+                rx,
+                tx,
+                service: service.into_service(),
+                state: State::Processing,
+            }
+        }
+
+        /// Get sender handle.
+        pub fn tx(&self) -> mpsc::Sender<Result<Message<I>, S::Error>> {
+            self.tx.clone()
+        }
+
+        /// Get reference to a service wrapped by `Dispatcher` instance.
+        pub fn service(&self) -> &S {
+            &self.service
+        }
+
+        /// Get mutable reference to a service wrapped by `Dispatcher` instance.
+        pub fn service_mut(&mut self) -> &mut S {
+            &mut self.service
+        }
+
+        /// Get reference to a framed instance wrapped by `Dispatcher` instance.
+        pub fn framed(&self) -> &Framed<T, U> {
+            &self.framed
+        }
+
+        /// Get mutable reference to a framed instance wrapped by `Dispatcher` instance.
+        pub fn framed_mut(&mut self) -> &mut Framed<T, U> {
+            &mut self.framed
+        }
+
+        /// Read from framed object.
+        fn poll_read(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> bool
+        where
+            S: Service<<U as Decoder>::Item, Response = I>,
+            S::Error: 'static,
+            S::Future: 'static,
+            T: AsyncRead + AsyncWrite,
+            U: Decoder + Encoder<I>,
+            I: 'static,
+            <U as Encoder<I>>::Error: fmt::Debug,
+        {
+            loop {
+                let this = self.as_mut().project();
+                match this.service.poll_ready(cx) {
+                    Poll::Ready(Ok(_)) => {
+                        let item = match this.framed.next_item(cx) {
+                            Poll::Ready(Some(Ok(el))) => el,
+                            Poll::Ready(Some(Err(err))) => {
+                                *this.state =
+                                    State::FramedError(DispatcherError::Decoder(err));
+                                return true;
+                            }
+                            Poll::Pending => return false,
+                            Poll::Ready(None) => {
+                                *this.state = State::Stopping;
+                                return true;
+                            }
+                        };
+
+                        let tx = this.tx.clone();
+                        let fut = this.service.call(item);
+                        actix_rt::spawn(async move {
+                            let item = fut.await;
+                            let _ = tx.send(item.map(Message::Item));
+                        });
+                    }
+                    Poll::Pending => return false,
+                    Poll::Ready(Err(err)) => {
+                        *this.state = State::Error(DispatcherError::Service(err));
+                        return true;
+                    }
+                }
+            }
+        }
+
+        /// Write to framed object.
+        fn poll_write(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> bool
+        where
+            S: Service<<U as Decoder>::Item, Response = I>,
+            S::Error: 'static,
+            S::Future: 'static,
+            T: AsyncRead + AsyncWrite,
+            U: Decoder + Encoder<I>,
+            I: 'static,
+            <U as Encoder<I>>::Error: fmt::Debug,
+        {
+            loop {
+                let mut this = self.as_mut().project();
+                while !this.framed.is_write_buf_full() {
+                    match Pin::new(&mut this.rx).poll_next(cx) {
+                        Poll::Ready(Some(Ok(Message::Item(msg)))) => {
+                            if let Err(err) = this.framed.as_mut().write(msg) {
+                                *this.state =
+                                    State::FramedError(DispatcherError::Encoder(err));
+                                return true;
+                            }
+                        }
+                        Poll::Ready(Some(Ok(Message::Close))) => {
+                            *this.state = State::FlushAndStop;
+                            return true;
+                        }
+                        Poll::Ready(Some(Err(err))) => {
+                            *this.state = State::Error(DispatcherError::Service(err));
+                            return true;
+                        }
+                        Poll::Ready(None) | Poll::Pending => break,
+                    }
+                }
+
+                if !this.framed.is_write_buf_empty() {
+                    match this.framed.flush(cx) {
+                        Poll::Pending => break,
+                        Poll::Ready(Ok(_)) => {}
+                        Poll::Ready(Err(err)) => {
+                            debug!("Error sending data: {:?}", err);
+                            *this.state =
+                                State::FramedError(DispatcherError::Encoder(err));
+                            return true;
+                        }
+                    }
+                } else {
+                    break;
+                }
+            }
+
+            false
+        }
+    }
+
+    impl<S, T, U, I> Future for Dispatcher<S, T, U, I>
+    where
+        S: Service<<U as Decoder>::Item, Response = I>,
+        S::Error: 'static,
+        S::Future: 'static,
+        T: AsyncRead + AsyncWrite,
+        U: Decoder + Encoder<I>,
+        I: 'static,
+        <U as Encoder<I>>::Error: fmt::Debug,
+        <U as Decoder>::Error: fmt::Debug,
+    {
+        type Output = Result<(), DispatcherError<S::Error, U, I>>;
+
+        fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+            loop {
+                let this = self.as_mut().project();
+
+                return match this.state {
+                    State::Processing => {
+                        if self.as_mut().poll_read(cx) || self.as_mut().poll_write(cx) {
+                            continue;
+                        } else {
+                            Poll::Pending
+                        }
+                    }
+                    State::Error(_) => {
+                        // flush write buffer
+                        if !this.framed.is_write_buf_empty()
+                            && this.framed.flush(cx).is_pending()
+                        {
+                            return Poll::Pending;
+                        }
+                        Poll::Ready(Err(this.state.take_error()))
+                    }
+                    State::FlushAndStop => {
+                        if !this.framed.is_write_buf_empty() {
+                            this.framed.flush(cx).map(|res| {
+                                if let Err(err) = res {
+                                    debug!("Error sending data: {:?}", err);
+                                }
+
+                                Ok(())
+                            })
+                        } else {
+                            Poll::Ready(Ok(()))
+                        }
+                    }
+                    State::FramedError(_) => {
+                        Poll::Ready(Err(this.state.take_framed_error()))
+                    }
+                    State::Stopping => Poll::Ready(Ok(())),
+                };
+            }
+        }
+    }
+}

actix-http/tests/test_client.rs

@@ -3,11 +3,9 @@ use actix_http::{
 };
 use actix_http_test::test_server;
 use actix_service::ServiceFactoryExt;
+use actix_utils::future;
 use bytes::Bytes;
-use futures_util::{
+use futures_util::StreamExt as _;
-    future::{self, ok},
-    StreamExt,
-};
 
 const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
                    Hello World Hello World Hello World Hello World Hello World \
@@ -63,7 +61,7 @@ async fn test_h1_v2() {
 async fn test_connection_close() {
     let srv = test_server(move || {
         HttpService::build()
-            .finish(|_| ok::<_, ()>(Response::Ok().body(STR)))
+            .finish(|_| future::ok::<_, ()>(Response::Ok().body(STR)))
             .tcp()
             .map(|_| ())
     })
@@ -79,9 +77,9 @@ async fn test_with_query_parameter() {
         HttpService::build()
             .finish(|req: Request| {
                 if req.uri().query().unwrap().contains("qp=") {
-                    ok::<_, ()>(Response::Ok().finish())
+                    future::ok::<_, ()>(Response::Ok().finish())
                 } else {
-                    ok::<_, ()>(Response::BadRequest().finish())
+                    future::ok::<_, ()>(Response::BadRequest().finish())
                 }
             })
             .tcp()

actix-http/tests/test_openssl.rs

@@ -11,9 +11,10 @@ use actix_http::HttpMessage;
 use actix_http::{body, Error, HttpService, Request, Response};
 use actix_http_test::test_server;
 use actix_service::{fn_service, ServiceFactoryExt};
+use actix_utils::future::{err, ok, ready};
 use bytes::{Bytes, BytesMut};
-use futures_util::future::{err, ok, ready};
+use futures_core::Stream;
-use futures_util::stream::{once, Stream, StreamExt};
+use futures_util::stream::{once, StreamExt as _};
 use openssl::{
     pkey::PKey,
     ssl::{SslAcceptor, SslMethod},

actix-http/tests/test_rustls.rs

@@ -8,10 +8,11 @@ use actix_http::http::{Method, StatusCode, Version};
 use actix_http::{body, error, Error, HttpService, Request, Response};
 use actix_http_test::test_server;
 use actix_service::{fn_factory_with_config, fn_service};
+use actix_utils::future::{err, ok};
 
 use bytes::{Bytes, BytesMut};
-use futures_util::future::{self, err, ok};
+use futures_core::Stream;
-use futures_util::stream::{once, Stream, StreamExt};
+use futures_util::stream::{once, StreamExt as _};
 use rustls::{
     internal::pemfile::{certs, pkcs8_private_keys},
     NoClientAuth, ServerConfig as RustlsServerConfig,
@@ -50,7 +51,7 @@ fn tls_config() -> RustlsServerConfig {
 async fn test_h1() -> io::Result<()> {
     let srv = test_server(move || {
         HttpService::build()
-            .h1(|_| future::ok::<_, Error>(Response::Ok().finish()))
+            .h1(|_| ok::<_, Error>(Response::Ok().finish()))
             .rustls(tls_config())
     })
     .await;
@@ -64,7 +65,7 @@ async fn test_h1() -> io::Result<()> {
 async fn test_h2() -> io::Result<()> {
     let srv = test_server(move || {
         HttpService::build()
-            .h2(|_| future::ok::<_, Error>(Response::Ok().finish()))
+            .h2(|_| ok::<_, Error>(Response::Ok().finish()))
             .rustls(tls_config())
     })
     .await;
@@ -81,7 +82,7 @@ async fn test_h1_1() -> io::Result<()> {
             .h1(|req: Request| {
                 assert!(req.peer_addr().is_some());
                 assert_eq!(req.version(), Version::HTTP_11);
-                future::ok::<_, Error>(Response::Ok().finish())
+                ok::<_, Error>(Response::Ok().finish())
             })
             .rustls(tls_config())
     })
@@ -99,7 +100,7 @@ async fn test_h2_1() -> io::Result<()> {
             .finish(|req: Request| {
                 assert!(req.peer_addr().is_some());
                 assert_eq!(req.version(), Version::HTTP_2);
-                future::ok::<_, Error>(Response::Ok().finish())
+                ok::<_, Error>(Response::Ok().finish())
             })
             .rustls(tls_config())
     })
@@ -143,7 +144,7 @@ async fn test_h2_content_length() {
                     StatusCode::OK,
                     StatusCode::NOT_FOUND,
                 ];
-                future::ok::<_, ()>(Response::new(statuses[indx]))
+                ok::<_, ()>(Response::new(statuses[indx]))
             })
             .rustls(tls_config())
     })
@@ -212,7 +213,7 @@ async fn test_h2_headers() {
                         TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST ",
                 ));
             }
-            future::ok::<_, ()>(config.body(data.clone()))
+            ok::<_, ()>(config.body(data.clone()))
         })
             .rustls(tls_config())
     }).await;
@@ -251,7 +252,7 @@ const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
 async fn test_h2_body2() {
     let mut srv = test_server(move || {
         HttpService::build()
-            .h2(|_| future::ok::<_, ()>(Response::Ok().body(STR)))
+            .h2(|_| ok::<_, ()>(Response::Ok().body(STR)))
             .rustls(tls_config())
     })
     .await;

actix-http/tests/test_server.rs

@@ -5,9 +5,10 @@ use std::{net, thread};
 use actix_http_test::test_server;
 use actix_rt::time::sleep;
 use actix_service::fn_service;
+use actix_utils::future::{err, ok, ready};
 use bytes::Bytes;
-use futures_util::future::{self, err, ok, ready, FutureExt};
+use futures_util::stream::{once, StreamExt as _};
-use futures_util::stream::{once, StreamExt};
+use futures_util::FutureExt as _;
 use regex::Regex;
 
 use actix_http::HttpMessage;
@@ -24,7 +25,7 @@ async fn test_h1() {
             .client_disconnect(1000)
             .h1(|req: Request| {
                 assert!(req.peer_addr().is_some());
-                future::ok::<_, ()>(Response::Ok().finish())
+                ok::<_, ()>(Response::Ok().finish())
             })
             .tcp()
     })
@@ -44,7 +45,7 @@ async fn test_h1_2() {
             .finish(|req: Request| {
                 assert!(req.peer_addr().is_some());
                 assert_eq!(req.version(), http::Version::HTTP_11);
-                future::ok::<_, ()>(Response::Ok().finish())
+                ok::<_, ()>(Response::Ok().finish())
             })
             .tcp()
     })
@@ -65,7 +66,7 @@ async fn test_expect_continue() {
                     err(error::ErrorPreconditionFailed("error"))
                 }
             }))
-            .finish(|_| future::ok::<_, ()>(Response::Ok().finish()))
+            .finish(|_| ok::<_, ()>(Response::Ok().finish()))
             .tcp()
     })
     .await;
@@ -96,7 +97,7 @@ async fn test_expect_continue_h1() {
                     }
                 })
             }))
-            .h1(fn_service(|_| future::ok::<_, ()>(Response::Ok().finish())))
+            .h1(fn_service(|_| ok::<_, ()>(Response::Ok().finish())))
             .tcp()
     })
     .await;
@@ -175,7 +176,7 @@ async fn test_slow_request() {
     let srv = test_server(|| {
         HttpService::build()
             .client_timeout(100)
-            .finish(|_| future::ok::<_, ()>(Response::Ok().finish()))
+            .finish(|_| ok::<_, ()>(Response::Ok().finish()))
             .tcp()
     })
     .await;
@@ -191,7 +192,7 @@ async fn test_slow_request() {
 async fn test_http1_malformed_request() {
     let srv = test_server(|| {
         HttpService::build()
-            .h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
+            .h1(|_| ok::<_, ()>(Response::Ok().finish()))
             .tcp()
     })
     .await;
@@ -207,7 +208,7 @@ async fn test_http1_malformed_request() {
 async fn test_http1_keepalive() {
     let srv = test_server(|| {
         HttpService::build()
-            .h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
+            .h1(|_| ok::<_, ()>(Response::Ok().finish()))
             .tcp()
     })
     .await;
@@ -229,7 +230,7 @@ async fn test_http1_keepalive_timeout() {
     let srv = test_server(|| {
         HttpService::build()
             .keep_alive(1)
-            .h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
+            .h1(|_| ok::<_, ()>(Response::Ok().finish()))
             .tcp()
     })
     .await;
@@ -250,7 +251,7 @@ async fn test_http1_keepalive_timeout() {
 async fn test_http1_keepalive_close() {
     let srv = test_server(|| {
         HttpService::build()
-            .h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
+            .h1(|_| ok::<_, ()>(Response::Ok().finish()))
             .tcp()
     })
     .await;
@@ -271,7 +272,7 @@ async fn test_http1_keepalive_close() {
 async fn test_http10_keepalive_default_close() {
     let srv = test_server(|| {
         HttpService::build()
-            .h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
+            .h1(|_| ok::<_, ()>(Response::Ok().finish()))
             .tcp()
     })
     .await;
@@ -291,7 +292,7 @@ async fn test_http10_keepalive_default_close() {
 async fn test_http10_keepalive() {
     let srv = test_server(|| {
         HttpService::build()
-            .h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
+            .h1(|_| ok::<_, ()>(Response::Ok().finish()))
             .tcp()
     })
     .await;
@@ -319,7 +320,7 @@ async fn test_http1_keepalive_disabled() {
     let srv = test_server(|| {
         HttpService::build()
             .keep_alive(KeepAlive::Disabled)
-            .h1(|_| future::ok::<_, ()>(Response::Ok().finish()))
+            .h1(|_| ok::<_, ()>(Response::Ok().finish()))
             .tcp()
     })
     .await;
@@ -354,7 +355,7 @@ async fn test_content_length() {
                     StatusCode::OK,
                     StatusCode::NOT_FOUND,
                 ];
-                future::ok::<_, ()>(Response::new(statuses[indx]))
+                ok::<_, ()>(Response::new(statuses[indx]))
             })
             .tcp()
     })
@@ -409,7 +410,7 @@ async fn test_h1_headers() {
                         TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST TEST ",
                 ));
             }
-            future::ok::<_, ()>(builder.body(data.clone()))
+            ok::<_, ()>(builder.body(data.clone()))
         }).tcp()
     }).await;
 
@@ -645,7 +646,7 @@ async fn test_h1_response_http_error_handling() {
 async fn test_h1_service_error() {
     let mut srv = test_server(|| {
         HttpService::build()
-            .h1(|_| future::err::<Response, Error>(error::ErrorBadRequest("error")))
+            .h1(|_| err::<Response, _>(error::ErrorBadRequest("error")))
             .tcp()
     })
     .await;
@@ -667,7 +668,7 @@ async fn test_h1_on_connect() {
             })
             .h1(|req: Request| {
                 assert!(req.extensions().contains::<isize>());
-                future::ok::<_, ()>(Response::Ok().finish())
+                ok::<_, ()>(Response::Ok().finish())
             })
             .tcp()
     })

actix-http/tests/test_ws.rs

@@ -3,16 +3,17 @@ use std::future::Future;
 use std::marker::PhantomData;
 use std::pin::Pin;
 use std::sync::{Arc, Mutex};
+use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_http::{body, h1, ws, Error, HttpService, Request, Response};
 use actix_http_test::test_server;
 use actix_service::{fn_factory, Service};
-use actix_utils::dispatcher::Dispatcher;
+use actix_utils::future;
 use bytes::Bytes;
-use futures_util::future;
+use futures_util::{SinkExt as _, StreamExt as _};
-use futures_util::task::{Context, Poll};
+
-use futures_util::{SinkExt, StreamExt};
+use crate::ws::Dispatcher;
 
 struct WsService<T>(Arc<Mutex<(PhantomData<T>, Cell<bool>)>>);
 
@@ -58,7 +59,7 @@ where
                 .await
                 .unwrap();
 
-            Dispatcher::new(framed.replace_codec(ws::Codec::new()), service)
+            Dispatcher::with(framed.replace_codec(ws::Codec::new()), service)
                 .await
                 .map_err(|_| panic!())
         };

actix-multipart/Cargo.toml

@@ -16,19 +16,21 @@ name = "actix_multipart"
 path = "src/lib.rs"
 
 [dependencies]
-actix-web = { version = "4.0.0-beta.4", default-features = false }
+actix-web = { version = "4.0.0-beta.5", default-features = false }
-actix-utils = "3.0.0-beta.2"
+actix-utils = "3.0.0-beta.4"
 
 bytes = "1"
 derive_more = "0.99.5"
-httparse = "1.3"
+futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
 futures-util = { version = "0.3.7", default-features = false, features = ["alloc"] }
+httparse = "1.3"
+local-waker = "0.1"
 log = "0.4"
 mime = "0.3"
 twoway = "0.2"
 
 [dev-dependencies]
-actix-rt = "2.1"
+actix-rt = "2.2"
-actix-http = "3.0.0-beta.4"
+actix-http = "3.0.0-beta.5"
 tokio = { version = "1", features = ["sync"] }
 tokio-stream = "0.1"

actix-multipart/src/extractor.rs

@@ -1,21 +1,22 @@
 //! Multipart payload support
+
+use actix_utils::future::{ready, Ready};
 use actix_web::{dev::Payload, Error, FromRequest, HttpRequest};
-use futures_util::future::{ok, Ready};
 
 use crate::server::Multipart;
 
-/// Get request's payload as multipart stream
+/// Get request's payload as multipart stream.
 ///
 /// Content-type: multipart/form-data;
 ///
 /// ## Server example
 ///
-/// ```rust
+/// ```
-/// use futures_util::stream::{Stream, StreamExt};
 /// use actix_web::{web, HttpResponse, Error};
-/// use actix_multipart as mp;
+/// use actix_multipart::Multipart;
+/// use futures_util::stream::StreamExt as _;
 ///
-/// async fn index(mut payload: mp::Multipart) -> Result<HttpResponse, Error> {
+/// async fn index(mut payload: Multipart) -> Result<HttpResponse, Error> {
 ///     // iterate over multipart stream
 ///     while let Some(item) = payload.next().await {
 ///            let mut field = item?;
@@ -25,9 +26,9 @@ use crate::server::Multipart;
 ///                println!("-- CHUNK: \n{:?}", std::str::from_utf8(&chunk?));
 ///            }
 ///     }
+///
 ///     Ok(HttpResponse::Ok().into())
 /// }
-/// # fn main() {}
 /// ```
 impl FromRequest for Multipart {
     type Error = Error;
@@ -36,9 +37,9 @@ impl FromRequest for Multipart {
 
     #[inline]
     fn from_request(req: &HttpRequest, payload: &mut Payload) -> Self::Future {
-        ok(match Multipart::boundary(req.headers()) {
+        ready(Ok(match Multipart::boundary(req.headers()) {
             Ok(boundary) => Multipart::from_boundary(boundary, payload.take()),
             Err(err) => Multipart::from_error(err),
-        })
+        }))
     }
 }

actix-multipart/src/server.rs

@@ -1,4 +1,4 @@
-//! Multipart payload support
+//! Multipart response payload support.
 
 use std::cell::{Cell, RefCell, RefMut};
 use std::convert::TryFrom;
@@ -8,12 +8,12 @@ use std::rc::Rc;
 use std::task::{Context, Poll};
 use std::{cmp, fmt};
 
-use bytes::{Bytes, BytesMut};
-use futures_util::stream::{LocalBoxStream, Stream, StreamExt};
-
-use actix_utils::task::LocalWaker;
 use actix_web::error::{ParseError, PayloadError};
 use actix_web::http::header::{self, ContentDisposition, HeaderMap, HeaderName, HeaderValue};
+use bytes::{Bytes, BytesMut};
+use futures_core::stream::{LocalBoxStream, Stream};
+use futures_util::stream::StreamExt as _;
+use local_waker::LocalWaker;
 
 use crate::error::MultipartError;
 

actix-test/CHANGES.md

@@ -0,0 +1,6 @@
+# Changes
+
+## Unreleased - 2021-xx-xx
+* Move integration testing structs from `actix-web`. [#???]
+
+[#???]: https://github.com/actix/actix-web/pull/???

actix-test/Cargo.toml

@@ -0,0 +1,35 @@
+[package]
+name = "actix-test"
+version = "0.0.1"
+authors = ["Rob Ede <robjtede@icloud.com>"]
+edition = "2018"
+description = "Integration testing tools for Actix Web applications"
+license = "MIT OR Apache-2.0"
+
+[features]
+default = []
+
+# rustls
+rustls = ["tls-rustls", "actix-http/rustls"]
+
+# openssl
+openssl = ["tls-openssl", "actix-http/openssl"]
+
+[dependencies]
+actix-codec = "0.4.0-beta.1"
+actix-http = { version = "3.0.0-beta.5", features = ["cookies"] }
+actix-http-test = { version = "3.0.0-beta.3", features = [] }
+actix-service = "2.0.0-beta.4"
+actix-utils = "3.0.0-beta.2"
+actix-web = { version = "4.0.0-beta.5", default-features = false, features = ["cookies"] }
+actix-rt = "2.1"
+awc = { version = "3.0.0-beta.4", default-features = false, features = ["cookies"] }
+
+futures-core = { version = "0.3.7", default-features = false, features = ["std"] }
+futures-util = { version = "0.3.7", default-features = false, features = [] }
+log = "0.4"
+serde = { version = "1", features = ["derive"] }
+serde_json = "1"
+serde_urlencoded = "0.7"
+tls-openssl = { package = "openssl", version = "0.10.9", optional = true }
+tls-rustls = { package = "rustls", version = "0.19.0", optional = true }

actix-test/LICENSE-APACHE

@@ -0,0 +1 @@
+../LICENSE-APACHE

actix-test/LICENSE-MIT

@@ -0,0 +1 @@
+../LICENSE-MIT

actix-test/src/lib.rs

@@ -0,0 +1,472 @@
+//! Integration testing tools for Actix Web applications.
+//!
+//! The main integration testing tool is [`TestServer`]. It spawns a real HTTP server on an
+//! unused port and provides methods that use a real HTTP client. Therefore, it is much closer to
+//! real-world cases than using `init_service`, which skips HTTP encoding and decoding.
+//!
+//! # Examples
+//! ```
+//! use actix_web::{get, web, test, App, HttpResponse, Error, Responder};
+//!
+//! #[get("/")]
+//! async fn my_handler() -> Result<impl Responder, Error> {
+//!     Ok(HttpResponse::Ok())
+//! }
+//!
+//! #[actix_rt::test]
+//! async fn test_example() {
+//!     let srv = actix_test::start(||
+//!         App::new().service(my_handler)
+//!     );
+//!
+//!     let req = srv.get("/");
+//!     let res = req.send().await.unwrap();
+//!
+//!     assert!(res.status().is_success());
+//! }
+//! ```
+
+#[cfg(feature = "openssl")]
+extern crate tls_openssl as openssl;
+#[cfg(feature = "rustls")]
+extern crate tls_rustls as rustls;
+
+use std::{fmt, net, sync::mpsc, thread, time};
+
+use actix_codec::{AsyncRead, AsyncWrite, Framed};
+pub use actix_http::test::TestBuffer;
+use actix_http::{
+    http::{HeaderMap, Method},
+    ws, HttpService, Request,
+};
+use actix_service::{map_config, IntoServiceFactory, ServiceFactory};
+use actix_web::{
+    dev::{AppConfig, MessageBody, Server, Service},
+    rt, web, Error, HttpResponse,
+};
+use awc::{error::PayloadError, Client, ClientRequest, ClientResponse, Connector};
+use futures_core::Stream;
+
+pub use actix_http_test::unused_addr;
+pub use actix_web::test::{
+    call_service, default_service, init_service, load_stream, ok_service, read_body,
+    read_body_json, read_response, read_response_json, TestRequest,
+};
+
+/// Start default [`TestServer`].
+///
+/// # Examples
+/// ```
+/// use actix_web::{get, web, test, App, HttpResponse, Error, Responder};
+///
+/// #[get("/")]
+/// async fn my_handler() -> Result<impl Responder, Error> {
+///     Ok(HttpResponse::Ok())
+/// }
+///
+/// #[actix_rt::test]
+/// async fn test_example() {
+///     let srv = actix_test::start(||
+///         App::new().service(my_handler)
+///     );
+///
+///     let req = srv.get("/");
+///     let res = req.send().await.unwrap();
+///
+///     assert!(res.status().is_success());
+/// }
+/// ```
+pub fn start<F, I, S, B>(factory: F) -> TestServer
+where
+    F: Fn() -> I + Send + Clone + 'static,
+    I: IntoServiceFactory<S, Request>,
+    S: ServiceFactory<Request, Config = AppConfig> + 'static,
+    S::Error: Into<Error> + 'static,
+    S::InitError: fmt::Debug,
+    S::Response: Into<HttpResponse<B>> + 'static,
+    <S::Service as Service<Request>>::Future: 'static,
+    B: MessageBody + 'static,
+{
+    start_with(TestServerConfig::default(), factory)
+}
+
+/// Start test server with custom configuration
+///
+/// Check [`TestServerConfig`] docs for configuration options.
+///
+/// # Examples
+/// ```
+/// use actix_web::{get, web, test, App, HttpResponse, Error, Responder};
+///
+/// #[get("/")]
+/// async fn my_handler() -> Result<impl Responder, Error> {
+///     Ok(HttpResponse::Ok())
+/// }
+///
+/// #[actix_rt::test]
+/// async fn test_example() {
+///     let srv = actix_test::start_with(actix_test::config().h1(), ||
+///         App::new().service(my_handler)
+///     );
+///
+///     let req = srv.get("/");
+///     let res = req.send().await.unwrap();
+///
+///     assert!(res.status().is_success());
+/// }
+/// ```
+pub fn start_with<F, I, S, B>(cfg: TestServerConfig, factory: F) -> TestServer
+where
+    F: Fn() -> I + Send + Clone + 'static,
+    I: IntoServiceFactory<S, Request>,
+    S: ServiceFactory<Request, Config = AppConfig> + 'static,
+    S::Error: Into<Error> + 'static,
+    S::InitError: fmt::Debug,
+    S::Response: Into<HttpResponse<B>> + 'static,
+    <S::Service as Service<Request>>::Future: 'static,
+    B: MessageBody + 'static,
+{
+    let (tx, rx) = mpsc::channel();
+
+    let tls = match cfg.stream {
+        StreamType::Tcp => false,
+        #[cfg(feature = "openssl")]
+        StreamType::Openssl(_) => true,
+        #[cfg(feature = "rustls")]
+        StreamType::Rustls(_) => true,
+    };
+
+    // run server in separate thread
+    thread::spawn(move || {
+        let sys = rt::System::new();
+        let tcp = net::TcpListener::bind("127.0.0.1:0").unwrap();
+        let local_addr = tcp.local_addr().unwrap();
+        let factory = factory.clone();
+        let srv_cfg = cfg.clone();
+        let timeout = cfg.client_timeout;
+        let builder = Server::build().workers(1).disable_signals();
+
+        let srv = match srv_cfg.stream {
+            StreamType::Tcp => match srv_cfg.tp {
+                HttpVer::Http1 => builder.listen("test", tcp, move || {
+                    let app_cfg =
+                        AppConfig::__priv_test_new(false, local_addr.to_string(), local_addr);
+                    HttpService::build()
+                        .client_timeout(timeout)
+                        .h1(map_config(factory(), move |_| app_cfg.clone()))
+                        .tcp()
+                }),
+                HttpVer::Http2 => builder.listen("test", tcp, move || {
+                    let app_cfg =
+                        AppConfig::__priv_test_new(false, local_addr.to_string(), local_addr);
+                    HttpService::build()
+                        .client_timeout(timeout)
+                        .h2(map_config(factory(), move |_| app_cfg.clone()))
+                        .tcp()
+                }),
+                HttpVer::Both => builder.listen("test", tcp, move || {
+                    let app_cfg =
+                        AppConfig::__priv_test_new(false, local_addr.to_string(), local_addr);
+                    HttpService::build()
+                        .client_timeout(timeout)
+                        .finish(map_config(factory(), move |_| app_cfg.clone()))
+                        .tcp()
+                }),
+            },
+            #[cfg(feature = "openssl")]
+            StreamType::Openssl(acceptor) => match cfg.tp {
+                HttpVer::Http1 => builder.listen("test", tcp, move || {
+                    let app_cfg =
+                        AppConfig::__priv_test_new(false, local_addr.to_string(), local_addr);
+                    HttpService::build()
+                        .client_timeout(timeout)
+                        .h1(map_config(factory(), move |_| app_cfg.clone()))
+                        .openssl(acceptor.clone())
+                }),
+                HttpVer::Http2 => builder.listen("test", tcp, move || {
+                    let app_cfg =
+                        AppConfig::__priv_test_new(false, local_addr.to_string(), local_addr);
+                    HttpService::build()
+                        .client_timeout(timeout)
+                        .h2(map_config(factory(), move |_| app_cfg.clone()))
+                        .openssl(acceptor.clone())
+                }),
+                HttpVer::Both => builder.listen("test", tcp, move || {
+                    let app_cfg =
+                        AppConfig::__priv_test_new(false, local_addr.to_string(), local_addr);
+                    HttpService::build()
+                        .client_timeout(timeout)
+                        .finish(map_config(factory(), move |_| app_cfg.clone()))
+                        .openssl(acceptor.clone())
+                }),
+            },
+            #[cfg(feature = "rustls")]
+            StreamType::Rustls(config) => match cfg.tp {
+                HttpVer::Http1 => builder.listen("test", tcp, move || {
+                    let app_cfg =
+                        AppConfig::__priv_test_new(false, local_addr.to_string(), local_addr);
+                    HttpService::build()
+                        .client_timeout(timeout)
+                        .h1(map_config(factory(), move |_| app_cfg.clone()))
+                        .rustls(config.clone())
+                }),
+                HttpVer::Http2 => builder.listen("test", tcp, move || {
+                    let app_cfg =
+                        AppConfig::__priv_test_new(false, local_addr.to_string(), local_addr);
+                    HttpService::build()
+                        .client_timeout(timeout)
+                        .h2(map_config(factory(), move |_| app_cfg.clone()))
+                        .rustls(config.clone())
+                }),
+                HttpVer::Both => builder.listen("test", tcp, move || {
+                    let app_cfg =
+                        AppConfig::__priv_test_new(false, local_addr.to_string(), local_addr);
+                    HttpService::build()
+                        .client_timeout(timeout)
+                        .finish(map_config(factory(), move |_| app_cfg.clone()))
+                        .rustls(config.clone())
+                }),
+            },
+        }
+        .unwrap();
+
+        sys.block_on(async {
+            let srv = srv.run();
+            tx.send((rt::System::current(), srv, local_addr)).unwrap();
+        });
+
+        sys.run()
+    });
+
+    let (system, server, addr) = rx.recv().unwrap();
+
+    let client = {
+        let connector = {
+            #[cfg(feature = "openssl")]
+            {
+                use openssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
+
+                let mut builder = SslConnector::builder(SslMethod::tls()).unwrap();
+                builder.set_verify(SslVerifyMode::NONE);
+                let _ = builder
+                    .set_alpn_protos(b"\x02h2\x08http/1.1")
+                    .map_err(|e| log::error!("Can not set alpn protocol: {:?}", e));
+                Connector::new()
+                    .conn_lifetime(time::Duration::from_secs(0))
+                    .timeout(time::Duration::from_millis(30000))
+                    .ssl(builder.build())
+            }
+            #[cfg(not(feature = "openssl"))]
+            {
+                Connector::new()
+                    .conn_lifetime(time::Duration::from_secs(0))
+                    .timeout(time::Duration::from_millis(30000))
+            }
+        };
+
+        Client::builder().connector(connector).finish()
+    };
+
+    TestServer {
+        addr,
+        client,
+        system,
+        tls,
+        server,
+    }
+}
+
+#[derive(Debug, Clone)]
+enum HttpVer {
+    Http1,
+    Http2,
+    Both,
+}
+
+#[derive(Clone)]
+enum StreamType {
+    Tcp,
+    #[cfg(feature = "openssl")]
+    Openssl(openssl::ssl::SslAcceptor),
+    #[cfg(feature = "rustls")]
+    Rustls(rustls::ServerConfig),
+}
+
+/// Create default test server config.
+pub fn config() -> TestServerConfig {
+    TestServerConfig::default()
+}
+
+#[derive(Clone)]
+pub struct TestServerConfig {
+    tp: HttpVer,
+    stream: StreamType,
+    client_timeout: u64,
+}
+
+impl Default for TestServerConfig {
+    fn default() -> Self {
+        TestServerConfig::new()
+    }
+}
+
+impl TestServerConfig {
+    /// Create default server configuration
+    pub(crate) fn new() -> TestServerConfig {
+        TestServerConfig {
+            tp: HttpVer::Both,
+            stream: StreamType::Tcp,
+            client_timeout: 5000,
+        }
+    }
+
+    /// Accept HTTP/1.1 only.
+    pub fn h1(mut self) -> Self {
+        self.tp = HttpVer::Http1;
+        self
+    }
+
+    /// Accept HTTP/2 only.
+    pub fn h2(mut self) -> Self {
+        self.tp = HttpVer::Http2;
+        self
+    }
+
+    /// Accept secure connections via OpenSSL.
+    #[cfg(feature = "openssl")]
+    pub fn openssl(mut self, acceptor: openssl::ssl::SslAcceptor) -> Self {
+        self.stream = StreamType::Openssl(acceptor);
+        self
+    }
+
+    /// Accept secure connections via Rustls.
+    #[cfg(feature = "rustls")]
+    pub fn rustls(mut self, config: rustls::ServerConfig) -> Self {
+        self.stream = StreamType::Rustls(config);
+        self
+    }
+
+    /// Set client timeout in milliseconds for first request.
+    pub fn client_timeout(mut self, val: u64) -> Self {
+        self.client_timeout = val;
+        self
+    }
+}
+
+/// A basic HTTP server controller that simplifies the process of writing integration tests for
+/// Actix Web applications.
+///
+/// See [`start`] for usage example.
+pub struct TestServer {
+    addr: net::SocketAddr,
+    client: awc::Client,
+    system: rt::System,
+    tls: bool,
+    server: Server,
+}
+
+impl TestServer {
+    /// Construct test server url
+    pub fn addr(&self) -> net::SocketAddr {
+        self.addr
+    }
+
+    /// Construct test server url
+    pub fn url(&self, uri: &str) -> String {
+        let scheme = if self.tls { "https" } else { "http" };
+
+        if uri.starts_with('/') {
+            format!("{}://localhost:{}{}", scheme, self.addr.port(), uri)
+        } else {
+            format!("{}://localhost:{}/{}", scheme, self.addr.port(), uri)
+        }
+    }
+
+    /// Create `GET` request.
+    pub fn get(&self, path: impl AsRef<str>) -> ClientRequest {
+        self.client.get(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create `POST` request.
+    pub fn post(&self, path: impl AsRef<str>) -> ClientRequest {
+        self.client.post(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create `HEAD` request.
+    pub fn head(&self, path: impl AsRef<str>) -> ClientRequest {
+        self.client.head(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create `PUT` request.
+    pub fn put(&self, path: impl AsRef<str>) -> ClientRequest {
+        self.client.put(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create `PATCH` request.
+    pub fn patch(&self, path: impl AsRef<str>) -> ClientRequest {
+        self.client.patch(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create `DELETE` request.
+    pub fn delete(&self, path: impl AsRef<str>) -> ClientRequest {
+        self.client.delete(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create `OPTIONS` request.
+    pub fn options(&self, path: impl AsRef<str>) -> ClientRequest {
+        self.client.options(self.url(path.as_ref()).as_str())
+    }
+
+    /// Connect request with given method and path.
+    pub fn request(&self, method: Method, path: impl AsRef<str>) -> ClientRequest {
+        self.client.request(method, path.as_ref())
+    }
+
+    pub async fn load_body<S>(
+        &mut self,
+        mut response: ClientResponse<S>,
+    ) -> Result<web::Bytes, PayloadError>
+    where
+        S: Stream<Item = Result<web::Bytes, PayloadError>> + Unpin + 'static,
+    {
+        response.body().limit(10_485_760).await
+    }
+
+    /// Connect to WebSocket server at a given path.
+    pub async fn ws_at(
+        &mut self,
+        path: &str,
+    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
+        let url = self.url(path);
+        let connect = self.client.ws(url).connect();
+        connect.await.map(|(_, framed)| framed)
+    }
+
+    /// Connect to a WebSocket server.
+    pub async fn ws(
+        &mut self,
+    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
+        self.ws_at("/").await
+    }
+
+    /// Get default HeaderMap of Client.
+    ///
+    /// Returns Some(&mut HeaderMap) when Client object is unique
+    /// (No other clone of client exists at the same time).
+    pub fn client_headers(&mut self) -> Option<&mut HeaderMap> {
+        self.client.headers()
+    }
+
+    /// Gracefully stop HTTP server.
+    pub async fn stop(self) {
+        self.server.stop(true).await;
+        self.system.stop();
+        rt::time::sleep(time::Duration::from_millis(100)).await;
+    }
+}
+
+impl Drop for TestServer {
+    fn drop(&mut self) {
+        self.system.stop()
+    }
+}

actix-web-actors/Cargo.toml

@@ -18,8 +18,8 @@ path = "src/lib.rs"
 [dependencies]
 actix = { version = "0.11.0-beta.3", default-features = false }
 actix-codec = "0.4.0-beta.1"
-actix-http = "3.0.0-beta.4"
+actix-http = "3.0.0-beta.5"
-actix-web = { version = "4.0.0-beta.4", default-features = false }
+actix-web = { version = "4.0.0-beta.5", default-features = false }
 
 bytes = "1"
 bytestring = "1"
@@ -28,6 +28,9 @@ pin-project = "1.0.0"
 tokio = { version = "1", features = ["sync"] }
 
 [dev-dependencies]
-actix-rt = "2.1"
+actix-rt = "2.2"
+actix-test = "0.0.1"
+
+awc = { version = "3.0.0-beta.4", default-features = false }
 env_logger = "0.8"
 futures-util = { version = "0.3.7", default-features = false }

actix-web-actors/tests/test_ws.rs

@@ -1,8 +1,11 @@
 use actix::prelude::*;
-use actix_web::{test, web, App, HttpRequest};
+use actix_web::{
+    http::{header, StatusCode},
+    web, App, HttpRequest, HttpResponse,
+};
 use actix_web_actors::*;
 use bytes::Bytes;
-use futures_util::{SinkExt, StreamExt};
+use futures_util::{SinkExt as _, StreamExt as _};
 
 struct Ws;
 
@@ -24,7 +27,7 @@ impl StreamHandler<Result<ws::Message, ws::ProtocolError>> for Ws {
 
 #[actix_rt::test]
 async fn test_simple() {
-    let mut srv = test::start(|| {
+    let mut srv = actix_test::start(|| {
         App::new().service(web::resource("/").to(
             |req: HttpRequest, stream: web::Payload| async move { ws::start(Ws, &req, stream) },
         ))
@@ -56,3 +59,51 @@ async fn test_simple() {
     let item = framed.next().await.unwrap().unwrap();
     assert_eq!(item, ws::Frame::Close(Some(ws::CloseCode::Normal.into())));
 }
+
+#[actix_rt::test]
+async fn test_with_credentials() {
+    let mut srv = actix_test::start(|| {
+        App::new().service(web::resource("/").to(
+            |req: HttpRequest, stream: web::Payload| async move {
+                if req.headers().contains_key("Authorization") {
+                    ws::start(Ws, &req, stream)
+                } else {
+                    Ok(HttpResponse::new(StatusCode::UNAUTHORIZED))
+                }
+            },
+        ))
+    });
+
+    // client service without credentials
+    match srv.ws().await {
+        Ok(_) => panic!("WebSocket client without credentials should panic"),
+        Err(awc::error::WsClientError::InvalidResponseStatus(status)) => {
+            assert_eq!(status, StatusCode::UNAUTHORIZED)
+        }
+        Err(e) => panic!("Invalid error from WebSocket client: {}", e),
+    }
+
+    let headers = srv.client_headers().unwrap();
+    headers.insert(
+        header::AUTHORIZATION,
+        header::HeaderValue::from_static("Bearer Something"),
+    );
+
+    // client service with credentials
+    let client = srv.ws();
+
+    let mut framed = client.await.unwrap();
+
+    framed.send(ws::Message::Text("text".into())).await.unwrap();
+
+    let item = framed.next().await.unwrap().unwrap();
+    assert_eq!(item, ws::Frame::Text(Bytes::from_static(b"text")));
+
+    framed
+        .send(ws::Message::Close(Some(ws::CloseCode::Normal.into())))
+        .await
+        .unwrap();
+
+    let item = framed.next().await.unwrap().unwrap();
+    assert_eq!(item, ws::Frame::Close(Some(ws::CloseCode::Normal.into())));
+}

actix-web-codegen/Cargo.toml

@@ -19,8 +19,11 @@ syn = { version = "1", features = ["full", "parsing"] }
 proc-macro2 = "1"
 
 [dev-dependencies]
-actix-rt = "2.1"
+actix-rt = "2.2"
-actix-web = "4.0.0-beta.4"
+actix-test = "0.0.1"
-futures-util = { version = "0.3.7", default-features = false }
+actix-utils = "3.0.0-beta.4"
+actix-web = "4.0.0-beta.5"
+
+futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
 trybuild = "1"
 rustversion = "1"

actix-web-codegen/src/lib.rs

@@ -82,7 +82,7 @@ mod route;
 ///
 /// # Example
 ///
-/// ```rust
+/// ```
 /// # use actix_web::HttpResponse;
 /// # use actix_web_codegen::route;
 /// #[route("/test", method="GET", method="HEAD")]
@@ -127,7 +127,7 @@ code, e.g `my_guard` or `my_module::my_guard`.
 
 # Example
 
-```rust
+```
 # use actix_web::HttpResponse;
 # use actix_web_codegen::"#, stringify!($method), ";
 #[", stringify!($method), r#"("/")]
@@ -162,7 +162,7 @@ method_macro! {
 /// This macro can be applied with `#[actix_web::main]` when used in Actix Web applications.
 ///
 /// # Examples
-/// ```rust
+/// ```
 /// #[actix_web_codegen::main]
 /// async fn main() {
 ///     async { println!("Hello world"); }.await

actix-web-codegen/tests/test_macro.rs

@@ -1,11 +1,12 @@
 use std::future::Future;
 use std::task::{Context, Poll};
 
+use actix_utils::future;
 use actix_web::dev::{Service, ServiceRequest, ServiceResponse, Transform};
 use actix_web::http::header::{HeaderName, HeaderValue};
-use actix_web::{http, test, web::Path, App, Error, HttpResponse, Responder};
+use actix_web::{http, web::Path, App, Error, HttpResponse, Responder};
 use actix_web_codegen::{connect, delete, get, head, options, patch, post, put, route, trace};
-use futures_util::future::{self, LocalBoxFuture};
+use futures_core::future::LocalBoxFuture;
 
 // Make sure that we can name function as 'config'
 #[get("/config")]
@@ -148,7 +149,7 @@ async fn get_wrap(_: Path<String>) -> impl Responder {
 
 #[actix_rt::test]
 async fn test_params() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new()
             .service(get_param_test)
             .service(put_param_test)
@@ -170,7 +171,7 @@ async fn test_params() {
 
 #[actix_rt::test]
 async fn test_body() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new()
             .service(post_test)
             .service(put_test)
@@ -244,7 +245,7 @@ async fn test_body() {
 
 #[actix_rt::test]
 async fn test_auto_async() {
-    let srv = test::start(|| App::new().service(auto_async));
+    let srv = actix_test::start(|| App::new().service(auto_async));
 
     let request = srv.request(http::Method::GET, srv.url("/test"));
     let response = request.send().await.unwrap();
@@ -253,7 +254,7 @@ async fn test_auto_async() {
 
 #[actix_rt::test]
 async fn test_wrap() {
-    let srv = test::start(|| App::new().service(get_wrap));
+    let srv = actix_test::start(|| App::new().service(get_wrap));
 
     let request = srv.request(http::Method::GET, srv.url("/test/wrap"));
     let response = request.send().await.unwrap();

actix-web-codegen/tests/trybuild/docstring-ok.rs

@@ -1,7 +1,7 @@
-use actix_web::{Responder, HttpResponse, App, test};
+use actix_web::{Responder, HttpResponse, App};
 use actix_web_codegen::*;
 
-/// Docstrings shouldn't break anything.
+/// doc comments shouldn't break anything
 #[get("/")]
 async fn index() -> impl Responder {
     HttpResponse::Ok()
@@ -9,7 +9,7 @@ async fn index() -> impl Responder {
 
 #[actix_web::main]
 async fn main() {
-    let srv = test::start(|| App::new().service(index));
+    let srv = actix_test::start(|| App::new().service(index));
 
     let request = srv.get("/");
     let response = request.send().await.unwrap();

actix-web-codegen/tests/trybuild/route-duplicate-method-fail.rs

@@ -7,9 +7,9 @@ async fn index() -> String {
 
 #[actix_web::main]
 async fn main() {
-    use actix_web::{App, test};
+    use actix_web::App;
 
-    let srv = test::start(|| App::new().service(index));
+    let srv = actix_test::start(|| App::new().service(index));
 
     let request = srv.get("/");
     let response = request.send().await.unwrap();

actix-web-codegen/tests/trybuild/route-duplicate-method-fail.stderr

@@ -5,7 +5,7 @@ error: HTTP method defined more than once: `GET`
   |                                   ^^^^^
 
 error[E0425]: cannot find value `index` in this scope
-  --> $DIR/route-duplicate-method-fail.rs:12:49
+  --> $DIR/route-duplicate-method-fail.rs:12:55
    |
-12 |     let srv = test::start(|| App::new().service(index));
+12 |     let srv = actix_test::start(|| App::new().service(index));
-   |                                                 ^^^^^ not found in this scope
+   |                                                       ^^^^^ not found in this scope

actix-web-codegen/tests/trybuild/route-missing-method-fail.rs

@@ -7,9 +7,9 @@ async fn index() -> String {
 
 #[actix_web::main]
 async fn main() {
-    use actix_web::{App, test};
+    use actix_web::App;
     
-    let srv = test::start(|| App::new().service(index));
+    let srv = actix_test::start(|| App::new().service(index));
 
     let request = srv.get("/");
     let response = request.send().await.unwrap();

actix-web-codegen/tests/trybuild/route-missing-method-fail.stderr

@@ -7,7 +7,7 @@ error: The #[route(..)] macro requires at least one `method` attribute
   = note: this error originates in an attribute macro (in Nightly builds, run with -Z macro-backtrace for more info)
 
 error[E0425]: cannot find value `index` in this scope
-  --> $DIR/route-missing-method-fail.rs:12:49
+  --> $DIR/route-missing-method-fail.rs:12:55
    |
-12 |     let srv = test::start(|| App::new().service(index));
+12 |     let srv = actix_test::start(|| App::new().service(index));
-   |                                                 ^^^^^ not found in this scope
+   |                                                       ^^^^^ not found in this scope

actix-web-codegen/tests/trybuild/route-ok.rs

@@ -7,9 +7,9 @@ async fn index() -> String {
 
 #[actix_web::main]
 async fn main() {
-    use actix_web::{App, test};
+    use actix_web::App;
 
-    let srv = test::start(|| App::new().service(index));
+    let srv = actix_test::start(|| App::new().service(index));
 
     let request = srv.get("/");
     let response = request.send().await.unwrap();

actix-web-codegen/tests/trybuild/route-unexpected-method-fail.rs

@@ -7,9 +7,9 @@ async fn index() -> String {
 
 #[actix_web::main]
 async fn main() {
-    use actix_web::{App, test};
+    use actix_web::App;
 
-    let srv = test::start(|| App::new().service(index));
+    let srv = actix_test::start(|| App::new().service(index));
 
     let request = srv.get("/");
     let response = request.send().await.unwrap();

actix-web-codegen/tests/trybuild/route-unexpected-method-fail.stderr

@@ -5,7 +5,7 @@ error: Unexpected HTTP method: `UNEXPECTED`
   |                     ^^^^^^^^^^^^
 
 error[E0425]: cannot find value `index` in this scope
-  --> $DIR/route-unexpected-method-fail.rs:12:49
+  --> $DIR/route-unexpected-method-fail.rs:12:55
    |
-12 |     let srv = test::start(|| App::new().service(index));
+12 |     let srv = actix_test::start(|| App::new().service(index));
-   |                                                 ^^^^^ not found in this scope
+   |                                                       ^^^^^ not found in this scope

actix-web-codegen/tests/trybuild/simple.rs

@@ -1,4 +1,4 @@
-use actix_web::{Responder, HttpResponse, App, test};
+use actix_web::{Responder, HttpResponse, App};
 use actix_web_codegen::*;
 
 #[get("/config")]
@@ -8,7 +8,7 @@ async fn config() -> impl Responder {
 
 #[actix_web::main]
 async fn main() {
-    let srv = test::start(|| App::new().service(config));
+    let srv = actix_test::start(|| App::new().service(config));
 
     let request = srv.get("/config");
     let response = request.send().await.unwrap();

awc/CHANGES.md

@@ -3,6 +3,22 @@
 ## Unreleased - 2021-xx-xx
 
 
+## 3.0.0-beta.4 - 2021-04-02
+### Added
+* Add `Client::headers` to get default mut reference of `HeaderMap` of client object. [#2114]
+
+### Changed
+* `ConnectorService` type is renamed to `BoxConnectorService`. [#2081]
+* Fix http/https encoding when enabling `compress` feature. [#2116]
+* Rename `TestResponse::header` to `append_header`, `set` to `insert_header`. `TestResponse` header
+  methods now take `IntoHeaderPair` tuples. [#2094]
+
+[#2081]: https://github.com/actix/actix-web/pull/2081
+[#2094]: https://github.com/actix/actix-web/pull/2094
+[#2114]: https://github.com/actix/actix-web/pull/2114
+[#2116]: https://github.com/actix/actix-web/pull/2116
+
+
 ## 3.0.0-beta.3 - 2021-03-08
 ### Added
 * `ClientResponse::timeout` for set the timeout of collecting response body. [#1931]

awc/Cargo.toml

@@ -1,7 +1,10 @@
 [package]
 name = "awc"
-version = "3.0.0-beta.3"
+version = "3.0.0-beta.4"
-authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
+authors = [
+    "Nikolay Kim <fafhrd91@gmail.com>",
+    "fakeshadow <24548779@qq.com>",
+]
 description = "Async HTTP and WebSocket client library built on the Actix ecosystem"
 readme = "README.md"
 keywords = ["actix", "http", "framework", "async", "web"]
@@ -46,12 +49,11 @@ trust-dns = ["actix-http/trust-dns"]
 [dependencies]
 actix-codec = "0.4.0-beta.1"
 actix-service = "2.0.0-beta.4"
-actix-http = "3.0.0-beta.4"
+actix-http = "3.0.0-beta.5"
 actix-rt = { version = "2.1", default-features = false }
 
 base64 = "0.13"
 bytes = "1"
-cfg-if = "1.0"
 derive_more = "0.99.5"
 futures-core = { version = "0.3.7", default-features = false }
 itoa = "0.4"
@@ -66,19 +68,14 @@ serde_urlencoded = "0.7"
 tls-openssl = { version = "0.10.9", package = "openssl", optional = true }
 tls-rustls = { version = "0.19.0", package = "rustls", optional = true, features = ["dangerous_configuration"] }
 
-[target.'cfg(windows)'.dependencies.tls-openssl]
-version = "0.10.9"
-package = "openssl"
-features = ["vendored"]
-optional = true
-
 [dev-dependencies]
-actix-web = { version = "4.0.0-beta.4", features = ["openssl"] }
+actix-web = { version = "4.0.0-beta.5", features = ["openssl"] }
-actix-http = { version = "3.0.0-beta.4", features = ["openssl"] }
+actix-http = { version = "3.0.0-beta.5", features = ["openssl"] }
 actix-http-test = { version = "3.0.0-beta.3", features = ["openssl"] }
-actix-utils = "3.0.0-beta.1"
+actix-utils = "3.0.0-beta.4"
 actix-server = "2.0.0-beta.3"
-actix-tls = { version = "3.0.0-beta.4", features = ["openssl", "rustls"] }
+actix-tls = { version = "3.0.0-beta.5", features = ["openssl", "rustls"] }
+actix-test = { version = "0.0.1", features = ["openssl", "rustls"] }
 
 brotli2 = "0.3.2"
 env_logger = "0.8"
@@ -86,3 +83,7 @@ flate2 = "1.0.13"
 futures-util = { version = "0.3.7", default-features = false }
 rcgen = "0.8"
 webpki = "0.21"
+
+[[example]]
+name = "client"
+required-features = ["rustls"]

awc/README.md

@@ -27,7 +27,7 @@ fn main() {
 
         let res = client
             .get("http://www.rust-lang.org")    // <- Create request builder
-            .header("User-Agent", "Actix-web")
+            .insert_header(("User-Agent", "Actix-web"))
             .send()                             // <- Send http request
             .await;
 

awc/src/builder.rs

@@ -4,31 +4,30 @@ use std::net::IpAddr;
 use std::rc::Rc;
 use std::time::Duration;
 
-use actix_codec::{AsyncRead, AsyncWrite};
 use actix_http::{
-    client::{Connector, TcpConnect, TcpConnectError, TcpConnection},
+    client::{Connector, ConnectorService, TcpConnect, TcpConnectError, TcpConnection},
     http::{self, header, Error as HttpError, HeaderMap, HeaderName, Uri},
 };
-use actix_rt::net::TcpStream;
+use actix_rt::net::{ActixStream, TcpStream};
 use actix_service::{boxed, Service};
 
 use crate::connect::DefaultConnector;
 use crate::error::SendRequestError;
 use crate::middleware::{NestTransform, Redirect, Transform};
-use crate::{Client, ClientConfig, ConnectRequest, ConnectResponse, ConnectorService};
+use crate::{Client, ClientConfig, ConnectRequest, ConnectResponse};
 
 /// An HTTP Client builder
 ///
 /// This type can be used to construct an instance of `Client` through a
 /// builder-like pattern.
-pub struct ClientBuilder<S = (), Io = (), M = ()> {
+pub struct ClientBuilder<S = (), M = ()> {
     default_headers: bool,
     max_http_version: Option<http::Version>,
     stream_window_size: Option<u32>,
     conn_window_size: Option<u32>,
     headers: HeaderMap,
     timeout: Option<Duration>,
-    connector: Connector<S, Io>,
+    connector: Connector<S>,
     middleware: M,
     local_address: Option<IpAddr>,
     max_redirects: u8,
@@ -42,7 +41,6 @@ impl ClientBuilder {
                 Response = TcpConnection<Uri, TcpStream>,
                 Error = TcpConnectError,
             > + Clone,
-        TcpStream,
         (),
     > {
         ClientBuilder {
@@ -60,15 +58,15 @@ impl ClientBuilder {
     }
 }
 
-impl<S, Io, M> ClientBuilder<S, Io, M>
+impl<S, Io, M> ClientBuilder<S, M>
 where
     S: Service<TcpConnect<Uri>, Response = TcpConnection<Uri, Io>, Error = TcpConnectError>
         + Clone
         + 'static,
-    Io: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
+    Io: ActixStream + fmt::Debug + 'static,
 {
     /// Use custom connector service.
-    pub fn connector<S1, Io1>(self, connector: Connector<S1, Io1>) -> ClientBuilder<S1, Io1, M>
+    pub fn connector<S1, Io1>(self, connector: Connector<S1>) -> ClientBuilder<S1, M>
     where
         S1: Service<
                 TcpConnect<Uri>,
@@ -76,7 +74,7 @@ where
                 Error = TcpConnectError,
             > + Clone
             + 'static,
-        Io1: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
+        Io1: ActixStream + fmt::Debug + 'static,
     {
         ClientBuilder {
             middleware: self.middleware,
@@ -213,7 +211,7 @@ where
     pub fn wrap<S1, M1>(
         self,
         mw: M1,
-    ) -> ClientBuilder<S, Io, NestTransform<M, M1, S1, ConnectRequest>>
+    ) -> ClientBuilder<S, NestTransform<M, M1, S1, ConnectRequest>>
     where
         M: Transform<S1, ConnectRequest>,
         M1: Transform<M::Transform, ConnectRequest>,
@@ -235,7 +233,7 @@ where
     /// Finish build process and create `Client` instance.
     pub fn finish(self) -> Client
     where
-        M: Transform<ConnectorService, ConnectRequest> + 'static,
+        M: Transform<DefaultConnector<ConnectorService<S, Io>>, ConnectRequest> + 'static,
         M::Transform:
             Service<ConnectRequest, Response = ConnectResponse, Error = SendRequestError>,
     {
@@ -251,7 +249,7 @@ where
 
     fn _finish(self) -> Client
     where
-        M: Transform<ConnectorService, ConnectRequest> + 'static,
+        M: Transform<DefaultConnector<ConnectorService<S, Io>>, ConnectRequest> + 'static,
         M::Transform:
             Service<ConnectRequest, Response = ConnectResponse, Error = SendRequestError>,
     {
@@ -270,16 +268,14 @@ where
             connector = connector.local_address(val);
         }
 
-        let connector = boxed::service(DefaultConnector::new(connector.finish()));
+        let connector = DefaultConnector::new(connector.finish());
-        let connector = boxed::service(self.middleware.new_transform(connector));
+        let connector = boxed::rc_service(self.middleware.new_transform(connector));
 
-        let config = ClientConfig {
+        Client(ClientConfig {
-            headers: self.headers,
+            headers: Rc::new(self.headers),
             timeout: self.timeout,
             connector,
-        };
+        })
-
-        Client(Rc::new(config))
     }
 }
 

awc/src/connect.rs

@@ -1,15 +1,17 @@
 use std::{
-    fmt,
     future::Future,
-    io, net,
+    net,
     pin::Pin,
+    rc::Rc,
     task::{Context, Poll},
 };
 
-use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
+use actix_codec::Framed;
 use actix_http::{
     body::Body,
-    client::{Connect as ClientConnect, ConnectError, Connection, SendRequestError},
+    client::{
+        Connect as ClientConnect, ConnectError, Connection, ConnectionIo, SendRequestError,
+    },
     h1::ClientCodec,
     Payload, RequestHead, RequestHeadType, ResponseHead,
 };
@@ -18,7 +20,7 @@ use futures_core::{future::LocalBoxFuture, ready};
 
 use crate::response::ClientResponse;
 
-pub type ConnectorService = Box<
+pub type BoxConnectorService = Rc<
     dyn Service<
         ConnectRequest,
         Response = ConnectResponse,
@@ -27,6 +29,8 @@ pub type ConnectorService = Box<
     >,
 >;
 
+pub type BoxedSocket = Box<dyn ConnectionIo>;
+
 pub enum ConnectRequest {
     Client(RequestHeadType, Body, Option<net::SocketAddr>),
     Tunnel(RequestHead, Option<net::SocketAddr>),
@@ -57,7 +61,7 @@ impl ConnectResponse {
     }
 }
 
-pub(crate) struct DefaultConnector<S> {
+pub struct DefaultConnector<S> {
     connector: S,
 }
 
@@ -67,15 +71,14 @@ impl<S> DefaultConnector<S> {
     }
 }
 
-impl<S> Service<ConnectRequest> for DefaultConnector<S>
+impl<S, Io> Service<ConnectRequest> for DefaultConnector<S>
 where
-    S: Service<ClientConnect, Error = ConnectError>,
+    S: Service<ClientConnect, Error = ConnectError, Response = Connection<Io>>,
-    S::Response: Connection,
+    Io: ConnectionIo,
-    <S::Response as Connection>::Io: 'static,
 {
     type Response = ConnectResponse;
     type Error = SendRequestError;
-    type Future = ConnectRequestFuture<S::Future, <S::Response as Connection>::Io>;
+    type Future = ConnectRequestFuture<S::Future, Io>;
 
     actix_service::forward_ready!(connector);
 
@@ -101,7 +104,10 @@ where
 
 pin_project_lite::pin_project! {
     #[project = ConnectRequestProj]
-    pub(crate) enum ConnectRequestFuture<Fut, Io> {
+    pub enum ConnectRequestFuture<Fut, Io>
+    where
+        Io: ConnectionIo
+    {
         Connection {
             #[pin]
             fut: Fut,
@@ -113,17 +119,16 @@ pin_project_lite::pin_project! {
         Tunnel {
             fut: LocalBoxFuture<
                 'static,
-                Result<(ResponseHead, Framed<Io, ClientCodec>), SendRequestError>,
+                Result<(ResponseHead, Framed<Connection<Io>, ClientCodec>), SendRequestError>,
             >,
         }
     }
 }
 
-impl<Fut, C, Io> Future for ConnectRequestFuture<Fut, Io>
+impl<Fut, Io> Future for ConnectRequestFuture<Fut, Io>
 where
-    Fut: Future<Output = Result<C, ConnectError>>,
+    Fut: Future<Output = Result<Connection<Io>, ConnectError>>,
-    C: Connection<Io = Io>,
+    Io: ConnectionIo,
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     type Output = Result<ConnectResponse, SendRequestError>;
 
@@ -138,14 +143,14 @@ where
                         let fut = ConnectRequestFuture::Client {
                             fut: connection.send_request(head, body),
                         };
-                        self.as_mut().set(fut);
+                        self.set(fut);
                     }
                     ConnectRequest::Tunnel(head, ..) => {
                         // send request
                         let fut = ConnectRequestFuture::Tunnel {
                             fut: connection.open_tunnel(RequestHeadType::from(head)),
                         };
-                        self.as_mut().set(fut);
+                        self.set(fut);
                     }
                 }
                 self.poll(cx)
@@ -158,65 +163,9 @@ where
             }
             ConnectRequestProj::Tunnel { fut } => {
                 let (head, framed) = ready!(fut.as_mut().poll(cx))?;
-                let framed = framed.into_map_io(|io| BoxedSocket(Box::new(Socket(io))));
+                let framed = framed.into_map_io(|io| Box::new(io) as _);
                 Poll::Ready(Ok(ConnectResponse::Tunnel(head, framed)))
             }
         }
     }
 }
-
-trait AsyncSocket {
-    fn as_read(&self) -> &(dyn AsyncRead + Unpin);
-    fn as_read_mut(&mut self) -> &mut (dyn AsyncRead + Unpin);
-    fn as_write(&mut self) -> &mut (dyn AsyncWrite + Unpin);
-}
-
-struct Socket<T: AsyncRead + AsyncWrite + Unpin>(T);
-
-impl<T: AsyncRead + AsyncWrite + Unpin> AsyncSocket for Socket<T> {
-    fn as_read(&self) -> &(dyn AsyncRead + Unpin) {
-        &self.0
-    }
-    fn as_read_mut(&mut self) -> &mut (dyn AsyncRead + Unpin) {
-        &mut self.0
-    }
-    fn as_write(&mut self) -> &mut (dyn AsyncWrite + Unpin) {
-        &mut self.0
-    }
-}
-
-pub struct BoxedSocket(Box<dyn AsyncSocket>);
-
-impl fmt::Debug for BoxedSocket {
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        write!(f, "BoxedSocket")
-    }
-}
-
-impl AsyncRead for BoxedSocket {
-    fn poll_read(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &mut ReadBuf<'_>,
-    ) -> Poll<io::Result<()>> {
-        Pin::new(self.get_mut().0.as_read_mut()).poll_read(cx, buf)
-    }
-}
-
-impl AsyncWrite for BoxedSocket {
-    fn poll_write(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &[u8],
-    ) -> Poll<io::Result<usize>> {
-        Pin::new(self.get_mut().0.as_write()).poll_write(cx, buf)
-    }
-
-    fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
-        Pin::new(self.get_mut().0.as_write()).poll_flush(cx)
-    }
-
-    fn poll_shutdown(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
-        Pin::new(self.get_mut().0.as_write()).poll_shutdown(cx)
-    }
-}

awc/src/frozen.rs

@@ -23,7 +23,7 @@ pub struct FrozenClientRequest {
     pub(crate) addr: Option<net::SocketAddr>,
     pub(crate) response_decompress: bool,
     pub(crate) timeout: Option<Duration>,
-    pub(crate) config: Rc<ClientConfig>,
+    pub(crate) config: ClientConfig,
 }
 
 impl FrozenClientRequest {
@@ -51,7 +51,7 @@ impl FrozenClientRequest {
             self.addr,
             self.response_decompress,
             self.timeout,
-            self.config.as_ref(),
+            &self.config,
             body,
         )
     }
@@ -62,7 +62,7 @@ impl FrozenClientRequest {
             self.addr,
             self.response_decompress,
             self.timeout,
-            self.config.as_ref(),
+            &self.config,
             value,
         )
     }
@@ -73,7 +73,7 @@ impl FrozenClientRequest {
             self.addr,
             self.response_decompress,
             self.timeout,
-            self.config.as_ref(),
+            &self.config,
             value,
         )
     }
@@ -88,7 +88,7 @@ impl FrozenClientRequest {
             self.addr,
             self.response_decompress,
             self.timeout,
-            self.config.as_ref(),
+            &self.config,
             stream,
         )
     }
@@ -99,7 +99,7 @@ impl FrozenClientRequest {
             self.addr,
             self.response_decompress,
             self.timeout,
-            self.config.as_ref(),
+            &self.config,
         )
     }
 
@@ -168,7 +168,7 @@ impl FrozenSendBuilder {
             self.req.addr,
             self.req.response_decompress,
             self.req.timeout,
-            self.req.config.as_ref(),
+            &self.req.config,
             body,
         )
     }
@@ -183,7 +183,7 @@ impl FrozenSendBuilder {
             self.req.addr,
             self.req.response_decompress,
             self.req.timeout,
-            self.req.config.as_ref(),
+            &self.req.config,
             value,
         )
     }
@@ -198,7 +198,7 @@ impl FrozenSendBuilder {
             self.req.addr,
             self.req.response_decompress,
             self.req.timeout,
-            self.req.config.as_ref(),
+            &self.req.config,
             value,
         )
     }
@@ -217,7 +217,7 @@ impl FrozenSendBuilder {
             self.req.addr,
             self.req.response_decompress,
             self.req.timeout,
-            self.req.config.as_ref(),
+            &self.req.config,
             stream,
         )
     }
@@ -232,7 +232,7 @@ impl FrozenSendBuilder {
             self.req.addr,
             self.req.response_decompress,
             self.req.timeout,
-            self.req.config.as_ref(),
+            &self.req.config,
         )
     }
 }

awc/src/lib.rs

@@ -121,7 +121,7 @@ pub mod test;
 pub mod ws;
 
 pub use self::builder::ClientBuilder;
-pub use self::connect::{BoxedSocket, ConnectRequest, ConnectResponse, ConnectorService};
+pub use self::connect::{BoxConnectorService, BoxedSocket, ConnectRequest, ConnectResponse};
 pub use self::frozen::{FrozenClientRequest, FrozenSendBuilder};
 pub use self::request::ClientRequest;
 pub use self::response::{ClientResponse, JsonBody, MessageBody};
@@ -131,7 +131,7 @@ pub use self::sender::SendClientRequest;
 ///
 /// ## Examples
 ///
-/// ```rust
+/// ```
 /// use awc::Client;
 ///
 /// #[actix_rt::main]
@@ -147,11 +147,12 @@ pub use self::sender::SendClientRequest;
 /// }
 /// ```
 #[derive(Clone)]
-pub struct Client(Rc<ClientConfig>);
+pub struct Client(ClientConfig);
 
+#[derive(Clone)]
 pub(crate) struct ClientConfig {
-    pub(crate) connector: ConnectorService,
+    pub(crate) connector: BoxConnectorService,
-    pub(crate) headers: HeaderMap,
+    pub(crate) headers: Rc<HeaderMap>,
     pub(crate) timeout: Option<Duration>,
 }
 
@@ -175,7 +176,6 @@ impl Client {
                 Response = TcpConnection<Uri, TcpStream>,
                 Error = TcpConnectError,
             > + Clone,
-        TcpStream,
     > {
         ClientBuilder::new()
     }
@@ -286,4 +286,12 @@ impl Client {
         }
         req
     }
+
+    /// Get default HeaderMap of Client.
+    ///
+    /// Returns Some(&mut HeaderMap) when Client object is unique
+    /// (No other clone of client exists at the same time).
+    pub fn headers(&mut self) -> Option<&mut HeaderMap> {
+        Rc::get_mut(&mut self.0.headers)
+    }
 }

awc/src/middleware/redirect.rs

@@ -189,7 +189,7 @@ where
                             // remove body
                             .call(ConnectRequest::Client(head, Body::None, addr));
 
-                        self.as_mut().set(RedirectServiceFuture::Client {
+                        self.set(RedirectServiceFuture::Client {
                             fut,
                             max_redirect_times,
                             uri: Some(uri),
@@ -236,7 +236,7 @@ where
                             .unwrap()
                             .call(ConnectRequest::Client(head, body_new, addr));
 
-                        self.as_mut().set(RedirectServiceFuture::Client {
+                        self.set(RedirectServiceFuture::Client {
                             fut,
                             max_redirect_times,
                             uri: Some(uri),
@@ -283,10 +283,9 @@ fn rebuild_uri(res: &ClientResponse, org_uri: Uri) -> Result<Uri, SendRequestErr
 
 #[cfg(test)]
 mod tests {
-    use actix_web::{test::start, web, App, Error, HttpResponse};
+    use actix_web::{web, App, Error, HttpResponse};
 
     use super::*;
-
     use crate::ClientBuilder;
 
     #[actix_rt::test]
@@ -296,7 +295,7 @@ mod tests {
             .wrap(Redirect::new().max_redirect_times(10))
             .finish();
 
-        let srv = start(|| {
+        let srv = actix_test::start(|| {
             App::new()
                 .service(web::resource("/test").route(web::to(|| async {
                     Ok::<_, Error>(HttpResponse::BadRequest())
@@ -323,7 +322,7 @@ mod tests {
             .connector(crate::Connector::new())
             .finish();
 
-        let srv = start(|| {
+        let srv = actix_test::start(|| {
             App::new()
                 .service(web::resource("/").route(web::to(|| async {
                     Ok::<_, Error>(

awc/src/request.rs

@@ -21,22 +21,17 @@ use crate::frozen::FrozenClientRequest;
 use crate::sender::{PrepForSendingError, RequestSender, SendClientRequest};
 use crate::ClientConfig;
 
-cfg_if::cfg_if! {
+#[cfg(feature = "compress")]
-    if #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))] {
+const HTTPS_ENCODING: &str = "br, gzip, deflate";
-        const HTTPS_ENCODING: &str = "br, gzip, deflate";
+#[cfg(not(feature = "compress"))]
-    } else if #[cfg(feature = "compress")] {
+const HTTPS_ENCODING: &str = "br";
-        const HTTPS_ENCODING: &str = "br";
-    } else {
-        const HTTPS_ENCODING: &str = "identity";
-    }
-}
 
 /// An HTTP Client request builder
 ///
 /// This type can be used to construct an instance of `ClientRequest` through a
 /// builder-like pattern.
 ///
-/// ```rust
+/// ```
 /// #[actix_rt::main]
 /// async fn main() {
 ///    let response = awc::Client::new()
@@ -57,7 +52,7 @@ pub struct ClientRequest {
     addr: Option<net::SocketAddr>,
     response_decompress: bool,
     timeout: Option<Duration>,
-    config: Rc<ClientConfig>,
+    config: ClientConfig,
 
     #[cfg(feature = "cookies")]
     cookies: Option<CookieJar>,
@@ -65,7 +60,7 @@ pub struct ClientRequest {
 
 impl ClientRequest {
     /// Create new client request builder.
-    pub(crate) fn new<U>(method: Method, uri: U, config: Rc<ClientConfig>) -> Self
+    pub(crate) fn new<U>(method: Method, uri: U, config: ClientConfig) -> Self
     where
         Uri: TryFrom<U>,
         <Uri as TryFrom<U>>::Error: Into<HttpError>,
@@ -190,16 +185,16 @@ impl ClientRequest {
 
     /// Append a header, keeping any that were set with an equivalent field name.
     ///
-    /// ```rust
+    /// ```
     /// # #[actix_rt::main]
     /// # async fn main() {
     /// # use awc::Client;
-    /// use awc::http::header::ContentType;
+    /// use awc::http::header::CONTENT_TYPE;
     ///
     /// Client::new()
     ///     .get("http://www.rust-lang.org")
     ///     .insert_header(("X-TEST", "value"))
-    ///     .insert_header(ContentType(mime::APPLICATION_JSON));
+    ///     .insert_header((CONTENT_TYPE, mime::APPLICATION_JSON));
     /// # }
     /// ```
     pub fn append_header<H>(mut self, header: H) -> Self
@@ -271,7 +266,7 @@ impl ClientRequest {
 
     /// Set a cookie
     ///
-    /// ```rust
+    /// ```
     /// #[actix_rt::main]
     /// async fn main() {
     ///     let resp = awc::Client::new().get("https://www.rust-lang.org")
@@ -398,7 +393,7 @@ impl ClientRequest {
             slf.addr,
             slf.response_decompress,
             slf.timeout,
-            slf.config.as_ref(),
+            &slf.config,
             body,
         )
     }
@@ -414,7 +409,7 @@ impl ClientRequest {
             slf.addr,
             slf.response_decompress,
             slf.timeout,
-            slf.config.as_ref(),
+            &slf.config,
             value,
         )
     }
@@ -432,7 +427,7 @@ impl ClientRequest {
             slf.addr,
             slf.response_decompress,
             slf.timeout,
-            slf.config.as_ref(),
+            &slf.config,
             value,
         )
     }
@@ -452,7 +447,7 @@ impl ClientRequest {
             slf.addr,
             slf.response_decompress,
             slf.timeout,
-            slf.config.as_ref(),
+            &slf.config,
             stream,
         )
     }
@@ -468,7 +463,7 @@ impl ClientRequest {
             slf.addr,
             slf.response_decompress,
             slf.timeout,
-            slf.config.as_ref(),
+            &slf.config,
         )
     }
 
@@ -521,11 +516,11 @@ impl ClientRequest {
                 .unwrap_or(true);
 
             if https {
-                slf = slf.insert_header_if_none((header::ACCEPT_ENCODING, HTTPS_ENCODING))
+                slf = slf.insert_header_if_none((header::ACCEPT_ENCODING, HTTPS_ENCODING));
             } else {
-                #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
+                #[cfg(feature = "compress")]
                 {
-                    slf = slf.insert_header_if_none((header::ACCEPT_ENCODING, "gzip, deflate"))
+                    slf = slf.insert_header_if_none((header::ACCEPT_ENCODING, "gzip, deflate"));
                 }
             };
         }
@@ -553,6 +548,8 @@ impl fmt::Debug for ClientRequest {
 mod tests {
     use std::time::SystemTime;
 
+    use actix_http::http::header::HttpDate;
+
     use super::*;
     use crate::Client;
 
@@ -569,7 +566,7 @@ mod tests {
         let req = Client::new()
             .put("/")
             .version(Version::HTTP_2)
-            .insert_header(header::Date(SystemTime::now().into()))
+            .insert_header((header::DATE, HttpDate::from(SystemTime::now())))
             .content_type("plain/text")
             .append_header((header::SERVER, "awc"));
 

awc/src/response.rs

@@ -228,12 +228,13 @@ impl<S> fmt::Debug for ClientResponse<S> {
     }
 }
 
+const DEFAULT_BODY_LIMIT: usize = 2 * 1024 * 1024;
+
 /// Future that resolves to a complete HTTP message body.
 pub struct MessageBody<S> {
     length: Option<usize>,
-    err: Option<PayloadError>,
     timeout: ResponseTimeout,
-    fut: Option<ReadBody<S>>,
+    body: Result<ReadBody<S>, Option<PayloadError>>,
 }
 
 impl<S> MessageBody<S>
@@ -242,41 +243,38 @@ where
 {
     /// Create `MessageBody` for request.
     pub fn new(res: &mut ClientResponse<S>) -> MessageBody<S> {
-        let mut len = None;
+        let length = match res.headers().get(&header::CONTENT_LENGTH) {
-        if let Some(l) = res.headers().get(&header::CONTENT_LENGTH) {
+            Some(value) => {
-            if let Ok(s) = l.to_str() {
+                let len = value.to_str().ok().and_then(|s| s.parse::<usize>().ok());
-                if let Ok(l) = s.parse::<usize>() {
+
-                    len = Some(l)
+                match len {
-                } else {
+                    None => return Self::err(PayloadError::UnknownLength),
-                    return Self::err(PayloadError::UnknownLength);
+                    len => len,
                 }
-            } else {
-                return Self::err(PayloadError::UnknownLength);
             }
-        }
+            None => None,
+        };
 
         MessageBody {
-            length: len,
+            length,
-            err: None,
             timeout: std::mem::take(&mut res.timeout),
-            fut: Some(ReadBody::new(res.take_payload(), 262_144)),
+            body: Ok(ReadBody::new(res.take_payload(), DEFAULT_BODY_LIMIT)),
         }
     }
 
-    /// Change max size of payload. By default max size is 256kB
+    /// Change max size of payload. By default max size is 2048kB
     pub fn limit(mut self, limit: usize) -> Self {
-        if let Some(ref mut fut) = self.fut {
+        if let Ok(ref mut body) = self.body {
-            fut.limit = limit;
+            body.limit = limit;
         }
         self
     }
 
     fn err(e: PayloadError) -> Self {
         MessageBody {
-            fut: None,
-            err: Some(e),
             length: None,
             timeout: ResponseTimeout::default(),
+            body: Err(Some(e)),
         }
     }
 }
@@ -290,19 +288,20 @@ where
     fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
         let this = self.get_mut();
 
-        if let Some(err) = this.err.take() {
+        match this.body {
-            return Poll::Ready(Err(err));
+            Err(ref mut err) => Poll::Ready(Err(err.take().unwrap())),
-        }
+            Ok(ref mut body) => {
+                if let Some(len) = this.length.take() {
+                    if len > body.limit {
+                        return Poll::Ready(Err(PayloadError::Overflow));
+                    }
+                }
 
-        if let Some(len) = this.length.take() {
+                this.timeout.poll_timeout(cx)?;
-            if len > this.fut.as_ref().unwrap().limit {
+
-                return Poll::Ready(Err(PayloadError::Overflow));
+                Pin::new(body).poll(cx)
             }
         }
-
-        this.timeout.poll_timeout(cx)?;
-
-        Pin::new(&mut this.fut.as_mut().unwrap()).poll(cx)
     }
 }
 
@@ -415,7 +414,7 @@ impl<S> ReadBody<S> {
     fn new(stream: Payload<S>, limit: usize) -> Self {
         Self {
             stream,
-            buf: BytesMut::with_capacity(std::cmp::min(limit, 32768)),
+            buf: BytesMut::new(),
             limit,
         }
     }
@@ -430,20 +429,14 @@ where
     fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
         let this = self.get_mut();
 
-        loop {
+        while let Some(chunk) = ready!(Pin::new(&mut this.stream).poll_next(cx)?) {
-            return match Pin::new(&mut this.stream).poll_next(cx)? {
+            if (this.buf.len() + chunk.len()) > this.limit {
-                Poll::Ready(Some(chunk)) => {
+                return Poll::Ready(Err(PayloadError::Overflow));
-                    if (this.buf.len() + chunk.len()) > this.limit {
+            }
-                        Poll::Ready(Err(PayloadError::Overflow))
+            this.buf.extend_from_slice(&chunk);
-                    } else {
-                        this.buf.extend_from_slice(&chunk);
-                        continue;
-                    }
-                }
-                Poll::Ready(None) => Poll::Ready(Ok(this.buf.split().freeze())),
-                Poll::Pending => Poll::Pending,
-            };
         }
+
+        Poll::Ready(Ok(this.buf.split().freeze()))
     }
 }
 
@@ -456,13 +449,13 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_body() {
-        let mut req = TestResponse::with_header(header::CONTENT_LENGTH, "xxxx").finish();
+        let mut req = TestResponse::with_header((header::CONTENT_LENGTH, "xxxx")).finish();
         match req.body().await.err().unwrap() {
             PayloadError::UnknownLength => {}
             _ => unreachable!("error"),
         }
 
-        let mut req = TestResponse::with_header(header::CONTENT_LENGTH, "1000000").finish();
+        let mut req = TestResponse::with_header((header::CONTENT_LENGTH, "10000000")).finish();
         match req.body().await.err().unwrap() {
             PayloadError::Overflow => {}
             _ => unreachable!("error"),
@@ -504,23 +497,23 @@ mod tests {
         assert!(json_eq(json.err().unwrap(), JsonPayloadError::ContentType));
 
         let mut req = TestResponse::default()
-            .header(
+            .insert_header((
                 header::CONTENT_TYPE,
                 header::HeaderValue::from_static("application/text"),
-            )
+            ))
             .finish();
         let json = JsonBody::<_, MyObject>::new(&mut req).await;
         assert!(json_eq(json.err().unwrap(), JsonPayloadError::ContentType));
 
         let mut req = TestResponse::default()
-            .header(
+            .insert_header((
                 header::CONTENT_TYPE,
                 header::HeaderValue::from_static("application/json"),
-            )
+            ))
-            .header(
+            .insert_header((
                 header::CONTENT_LENGTH,
                 header::HeaderValue::from_static("10000"),
-            )
+            ))
             .finish();
 
         let json = JsonBody::<_, MyObject>::new(&mut req).limit(100).await;
@@ -530,14 +523,14 @@ mod tests {
         ));
 
         let mut req = TestResponse::default()
-            .header(
+            .insert_header((
                 header::CONTENT_TYPE,
                 header::HeaderValue::from_static("application/json"),
-            )
+            ))
-            .header(
+            .insert_header((
                 header::CONTENT_LENGTH,
                 header::HeaderValue::from_static("16"),
-            )
+            ))
             .set_payload(Bytes::from_static(b"{\"name\": \"test\"}"))
             .finish();
 

awc/src/test.rs

@@ -1,8 +1,6 @@
 //! Test helpers for actix http client to use during testing.
-use std::convert::TryFrom;
+use actix_http::http::header::IntoHeaderPair;
-
+use actix_http::http::{StatusCode, Version};
-use actix_http::http::header::{Header, IntoHeaderValue};
-use actix_http::http::{Error as HttpError, HeaderName, StatusCode, Version};
 #[cfg(feature = "cookies")]
 use actix_http::{
     cookie::{Cookie, CookieJar},
@@ -34,13 +32,11 @@ impl Default for TestResponse {
 
 impl TestResponse {
     /// Create TestResponse and set header
-    pub fn with_header<K, V>(key: K, value: V) -> Self
+    pub fn with_header<H>(header: H) -> Self
     where
-        HeaderName: TryFrom<K>,
+        H: IntoHeaderPair,
-        <HeaderName as TryFrom<K>>::Error: Into<HttpError>,
-        V: IntoHeaderValue,
     {
-        Self::default().header(key, value)
+        Self::default().insert_header(header)
     }
 
     /// Set HTTP version of this response
@@ -49,27 +45,26 @@ impl TestResponse {
         self
     }
 
-    /// Set a header
+    /// Insert a header
-    pub fn set<H: Header>(mut self, hdr: H) -> Self {
+    pub fn insert_header<H>(mut self, header: H) -> Self
-        if let Ok(value) = hdr.try_into_value() {
+    where
-            self.head.headers.append(H::name(), value);
+        H: IntoHeaderPair,
+    {
+        if let Ok((key, value)) = header.try_into_header_pair() {
+            self.head.headers.insert(key, value);
             return self;
         }
         panic!("Can not set header");
     }
 
     /// Append a header
-    pub fn header<K, V>(mut self, key: K, value: V) -> Self
+    pub fn append_header<H>(mut self, header: H) -> Self
     where
-        HeaderName: TryFrom<K>,
+        H: IntoHeaderPair,
-        <HeaderName as TryFrom<K>>::Error: Into<HttpError>,
-        V: IntoHeaderValue,
     {
-        if let Ok(key) = HeaderName::try_from(key) {
+        if let Ok((key, value)) = header.try_into_header_pair() {
-            if let Ok(value) = value.try_into_value() {
+            self.head.headers.append(key, value);
-                self.head.headers.append(key, value);
+            return self;
-                return self;
-            }
         }
         panic!("Can not create header");
     }
@@ -115,6 +110,8 @@ impl TestResponse {
 mod tests {
     use std::time::SystemTime;
 
+    use actix_http::http::header::HttpDate;
+
     use super::*;
     use crate::{cookie, http::header};
 
@@ -122,7 +119,7 @@ mod tests {
     fn test_basics() {
         let res = TestResponse::default()
             .version(Version::HTTP_2)
-            .set(header::Date(SystemTime::now().into()))
+            .insert_header((header::DATE, HttpDate::from(SystemTime::now())))
             .cookie(cookie::Cookie::build("name", "value").finish())
             .finish();
         assert!(res.headers().contains_key(header::SET_COOKIE));

awc/src/ws.rs

@@ -6,7 +6,7 @@
 //!
 //! ```no_run
 //! use awc::{Client, ws};
-//! use futures_util::{sink::SinkExt, stream::StreamExt};
+//! use futures_util::{sink::SinkExt as _, stream::StreamExt as _};
 //!
 //! #[actix_rt::main]
 //! async fn main() {
@@ -28,7 +28,6 @@
 
 use std::convert::TryFrom;
 use std::net::SocketAddr;
-use std::rc::Rc;
 use std::{fmt, str};
 
 use actix_codec::Framed;
@@ -56,7 +55,7 @@ pub struct WebsocketsRequest {
     addr: Option<SocketAddr>,
     max_size: usize,
     server_mode: bool,
-    config: Rc<ClientConfig>,
+    config: ClientConfig,
 
     #[cfg(feature = "cookies")]
     cookies: Option<CookieJar>,
@@ -64,7 +63,7 @@ pub struct WebsocketsRequest {
 
 impl WebsocketsRequest {
     /// Create new WebSocket connection
-    pub(crate) fn new<U>(uri: U, config: Rc<ClientConfig>) -> Self
+    pub(crate) fn new<U>(uri: U, config: ClientConfig) -> Self
     where
         Uri: TryFrom<U>,
         <Uri as TryFrom<U>>::Error: Into<HttpError>,

awc/tests/test_client.rs

@@ -5,12 +5,13 @@ use std::sync::atomic::{AtomicUsize, Ordering};
 use std::sync::Arc;
 use std::time::Duration;
 
+use actix_utils::future::ok;
 use brotli2::write::BrotliEncoder;
 use bytes::Bytes;
 use flate2::read::GzDecoder;
 use flate2::write::GzEncoder;
 use flate2::Compression;
-use futures_util::{future::ok, stream};
+use futures_util::stream;
 use rand::Rng;
 
 use actix_http::{
@@ -23,7 +24,7 @@ use actix_web::{
     dev::{AppConfig, BodyEncoding},
     http::{header, Cookie},
     middleware::Compress,
-    test, web, App, Error, HttpMessage, HttpRequest, HttpResponse,
+    web, App, Error, HttpMessage, HttpRequest, HttpResponse,
 };
 use awc::error::{JsonPayloadError, PayloadError, SendRequestError};
 
@@ -51,7 +52,7 @@ const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
 
 #[actix_rt::test]
 async fn test_simple() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(|| HttpResponse::Ok().body(STR))))
     });
 
@@ -77,7 +78,7 @@ async fn test_simple() {
 
 #[actix_rt::test]
 async fn test_json() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(
             web::resource("/").route(web::to(|_: web::Json<String>| HttpResponse::Ok())),
         )
@@ -93,7 +94,7 @@ async fn test_json() {
 
 #[actix_rt::test]
 async fn test_form() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(
             |_: web::Form<HashMap<String, String>>| HttpResponse::Ok(),
         )))
@@ -112,7 +113,7 @@ async fn test_form() {
 
 #[actix_rt::test]
 async fn test_timeout() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(|| async {
             actix_rt::time::sleep(Duration::from_millis(200)).await;
             Ok::<_, Error>(HttpResponse::Ok().body(STR))
@@ -137,7 +138,7 @@ async fn test_timeout() {
 
 #[actix_rt::test]
 async fn test_timeout_override() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(|| async {
             actix_rt::time::sleep(Duration::from_millis(200)).await;
             Ok::<_, Error>(HttpResponse::Ok().body(STR))
@@ -159,9 +160,9 @@ async fn test_timeout_override() {
 
 #[actix_rt::test]
 async fn test_response_timeout() {
-    use futures_util::stream::{once, StreamExt};
+    use futures_util::stream::{once, StreamExt as _};
 
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(|| async {
             Ok::<_, Error>(
                 HttpResponse::Ok()
@@ -443,7 +444,7 @@ async fn test_connection_wait_queue_force_close() {
 
 #[actix_rt::test]
 async fn test_with_query_parameter() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").to(|req: HttpRequest| {
             if req.query_string().contains("qp") {
                 HttpResponse::Ok()
@@ -463,7 +464,7 @@ async fn test_with_query_parameter() {
 
 #[actix_rt::test]
 async fn test_no_decompress() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new()
             .wrap(Compress::default())
             .service(web::resource("/").route(web::to(|| {
@@ -507,7 +508,7 @@ async fn test_no_decompress() {
 
 #[actix_rt::test]
 async fn test_client_gzip_encoding() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(|| {
             let mut e = GzEncoder::new(Vec::new(), Compression::default());
             e.write_all(STR.as_ref()).unwrap();
@@ -530,7 +531,7 @@ async fn test_client_gzip_encoding() {
 
 #[actix_rt::test]
 async fn test_client_gzip_encoding_large() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(|| {
             let mut e = GzEncoder::new(Vec::new(), Compression::default());
             e.write_all(STR.repeat(10).as_ref()).unwrap();
@@ -559,7 +560,7 @@ async fn test_client_gzip_encoding_large_random() {
         .map(char::from)
         .collect::<String>();
 
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(|data: Bytes| {
             let mut e = GzEncoder::new(Vec::new(), Compression::default());
             e.write_all(&data).unwrap();
@@ -581,7 +582,7 @@ async fn test_client_gzip_encoding_large_random() {
 
 #[actix_rt::test]
 async fn test_client_brotli_encoding() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(|data: Bytes| {
             let mut e = BrotliEncoder::new(Vec::new(), 5);
             e.write_all(&data).unwrap();
@@ -609,7 +610,7 @@ async fn test_client_brotli_encoding_large_random() {
         .map(char::from)
         .collect::<String>();
 
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().service(web::resource("/").route(web::to(|data: Bytes| {
             let mut e = BrotliEncoder::new(Vec::new(), 5);
             e.write_all(&data).unwrap();
@@ -632,7 +633,7 @@ async fn test_client_brotli_encoding_large_random() {
 
 #[actix_rt::test]
 async fn test_client_deflate_encoding() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().default_service(web::to(|body: Bytes| {
             HttpResponse::Ok()
                 .encoding(http::ContentEncoding::Br)
@@ -657,7 +658,7 @@ async fn test_client_deflate_encoding_large_random() {
         .take(70_000)
         .collect::<String>();
 
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().default_service(web::to(|body: Bytes| {
             HttpResponse::Ok()
                 .encoding(http::ContentEncoding::Br)
@@ -676,7 +677,7 @@ async fn test_client_deflate_encoding_large_random() {
 
 #[actix_rt::test]
 async fn test_client_streaming_explicit() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().default_service(web::to(|body: web::Payload| {
             HttpResponse::Ok()
                 .encoding(http::ContentEncoding::Identity)
@@ -697,7 +698,7 @@ async fn test_client_streaming_explicit() {
 
 #[actix_rt::test]
 async fn test_body_streaming_implicit() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().default_service(web::to(|| {
             let body = stream::once(async {
                 Ok::<_, actix_http::Error>(Bytes::from_static(STR.as_bytes()))
@@ -733,7 +734,7 @@ async fn test_client_cookie_handling() {
     let cookie1b = cookie1.clone();
     let cookie2b = cookie2.clone();
 
-    let srv = test::start(move || {
+    let srv = actix_test::start(move || {
         let cookie1 = cookie1b.clone();
         let cookie2 = cookie2b.clone();
 
@@ -789,8 +790,7 @@ async fn test_client_cookie_handling() {
 
 #[actix_rt::test]
 async fn client_unread_response() {
-    let addr = test::unused_addr();
+    let addr = actix_test::unused_addr();
-
     let lst = std::net::TcpListener::bind(addr).unwrap();
 
     std::thread::spawn(move || {
@@ -819,7 +819,7 @@ async fn client_unread_response() {
 
 #[actix_rt::test]
 async fn client_basic_auth() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().route(
             "/",
             web::to(|req: HttpRequest| {
@@ -847,7 +847,7 @@ async fn client_basic_auth() {
 
 #[actix_rt::test]
 async fn client_bearer_auth() {
-    let srv = test::start(|| {
+    let srv = actix_test::start(|| {
         App::new().route(
             "/",
             web::to(|req: HttpRequest| {
@@ -877,7 +877,7 @@ async fn client_bearer_auth() {
 async fn test_local_address() {
     let ip = IpAddr::V4(Ipv4Addr::new(127, 0, 0, 1));
 
-    let srv = test::start(move || {
+    let srv = actix_test::start(move || {
         App::new().service(web::resource("/").route(web::to(
             move |req: HttpRequest| async move {
                 assert_eq!(req.peer_addr().unwrap().ip(), ip);

awc/tests/test_rustls_client.rs

@@ -13,8 +13,8 @@ use std::{
 use actix_http::HttpService;
 use actix_http_test::test_server;
 use actix_service::{map_config, pipeline_factory, ServiceFactoryExt};
+use actix_utils::future::ok;
 use actix_web::{dev::AppConfig, http::Version, web, App, HttpResponse};
-use futures_util::future::ok;
 use rustls::internal::pemfile::{certs, pkcs8_private_keys};
 use rustls::{ClientConfig, NoClientAuth, ServerConfig};
 

awc/tests/test_ssl_client.rs

@@ -8,9 +8,9 @@ use std::sync::Arc;
 use actix_http::HttpService;
 use actix_http_test::test_server;
 use actix_service::{map_config, pipeline_factory, ServiceFactoryExt};
+use actix_utils::future::ok;
 use actix_web::http::Version;
 use actix_web::{dev::AppConfig, web, App, HttpResponse};
-use futures_util::future::ok;
 use openssl::{
     pkey::PKey,
     ssl::{SslAcceptor, SslConnector, SslMethod, SslVerifyMode},

awc/tests/test_ws.rs

@@ -3,9 +3,9 @@ use std::io;
 use actix_codec::Framed;
 use actix_http::{body::BodySize, h1, ws, Error, HttpService, Request, Response};
 use actix_http_test::test_server;
+use actix_utils::future::ok;
 use bytes::Bytes;
-use futures_util::future::ok;
+use futures_util::{SinkExt as _, StreamExt as _};
-use futures_util::{SinkExt, StreamExt};
 
 async fn ws_service(req: ws::Frame) -> Result<ws::Message, io::Error> {
     match req {

benches/responder.rs

@@ -1,12 +1,12 @@
-use std::future::Future;
+use std::{future::Future, time::Instant};
-use std::time::Instant;
 
 use actix_http::Response;
+use actix_utils::future::{ready, Ready};
 use actix_web::http::StatusCode;
 use actix_web::test::TestRequest;
 use actix_web::{error, Error, HttpRequest, HttpResponse, Responder};
 use criterion::{criterion_group, criterion_main, Criterion};
-use futures_util::future::{ready, Either, Ready};
+use futures_util::future::{join_all, Either};
 
 // responder simulate the old responder trait.
 trait FutureResponder {
@@ -79,7 +79,7 @@ fn future_responder(c: &mut Criterion) {
                     .await
             });
 
-            let futs = futures_util::future::join_all(futs);
+            let futs = join_all(futs);
 
             let start = Instant::now();
 

benches/server.rs

@@ -32,7 +32,7 @@ fn bench_async_burst(c: &mut Criterion) {
     let rt = actix_rt::System::new();
 
     let srv = rt.block_on(async {
-        test::start(|| {
+        actix_test::start(|| {
             App::new()
                 .service(web::resource("/").route(web::to(|| HttpResponse::Ok().body(STR))))
         })

benches/service.rs

@@ -9,7 +9,7 @@ use actix_web::test::{init_service, ok_service, TestRequest};
 
 /// Criterion Benchmark for async Service
 /// Should be used from within criterion group:
-/// ```rust,ignore
+/// ```ignore
 /// let mut criterion: ::criterion::Criterion<_> =
 ///     ::criterion::Criterion::default().configure_from_args();
 /// bench_async_service(&mut criterion, ok_service(), "async_service_direct");

codecov.yml

@@ -11,6 +11,5 @@ coverage:
 
 ignore: # ignore code coverage on following paths
   - "**/tests"
-  - "test-server"
   - "**/benches"
   - "**/examples"

docs/graphs/net-only.dot

@@ -1,21 +1,37 @@
 digraph {
+    rankdir=TB
+
     subgraph cluster_net {
-        label="actix/actix-net";
+        label="actix-net"
-        "actix-codec"
+        "actix-codec" "actix-macros" "actix-rt" "actix-server" "actix-service"
-        "actix-macros"
+        "actix-tls" "actix-tracing" "actix-utils" "actix-router"
-        "actix-rt"
+    }
-        "actix-server"
+    
-        "actix-service"
+    subgraph cluster_other {
-        "actix-threadpool"
+        label="other actix owned crates"
-        "actix-tls"
+        { rank=same; "local-channel" "local-waker" "bytestring" }
-        "actix-tracing"
-        "actix-utils"
-        "actix-router"
     }
 
-    "actix-utils" -> { "actix-service" "actix-rt" "actix-codec" }
+    subgraph cluster_tokio {
+        label="tokio"
+        "tokio" "tokio-util"
+    }
+
+    "actix-codec" -> { "tokio" }
+    "actix-codec" -> { "tokio-util" }[color=red]
+    "actix-utils" -> { "local-waker" }
     "actix-tracing" -> { "actix-service" }
     "actix-tls" -> { "actix-service" "actix-codec" "actix-utils" "actix-rt" }
-    "actix-server" -> { "actix-service" "actix-rt" "actix-codec" "actix-utils" }
+    "actix-tls" -> { "tokio-util" }[color="#009900"]
-    "actix-rt" -> { "actix-macros" "actix-threadpool" }
+    "actix-server" -> { "actix-service" "actix-rt" "actix-utils" "tokio" }
+    "actix-rt" -> { "actix-macros" "tokio" }
+    "actix-router" -> { "bytestring" }
+
+    "local-channel" -> { "local-waker" }
+
+    // invisible edges to force nicer layout
+    edge [style=invis]
+    "actix-macros" -> "tokio"
+    "actix-service" -> "bytestring"
+    "actix-macros" -> "bytestring"
 }