1
0
mirror of https://github.com/fafhrd91/actix-web synced 2025-07-07 19:23:58 +02:00

Compare commits

..

2 Commits

Author SHA1 Message Date
1d45639bed prepare actix-multipart release 2019-12-07 20:02:46 +06:00
6a672c9097 actix-multipart: Fix multipart boundary reading (#1189)
* actix-multipart: Fix multipart boundary reading

If we're not ready to read the first line after the multipart field
(which should be a "\r\n" line) then return NotReady instead of Ready(None)
so that we will get called again to read that line.

Without this I was getting MultipartError::Boundary from read_boundary()
because it got the "\r\n" line instead of the boundary.

* actix-multipart: Test handling of NotReady

Use a stream that reports NoReady and does partial reads in the test_stream
test. This works now, but failed before the previous commit.
2019-12-07 19:58:38 +06:00
310 changed files with 27507 additions and 27852 deletions

41
.appveyor.yml Normal file
View File

@ -0,0 +1,41 @@
environment:
global:
PROJECT_NAME: actix-web
matrix:
# Stable channel
- TARGET: i686-pc-windows-msvc
CHANNEL: stable
- TARGET: x86_64-pc-windows-gnu
CHANNEL: stable
- TARGET: x86_64-pc-windows-msvc
CHANNEL: stable
# Nightly channel
- TARGET: i686-pc-windows-msvc
CHANNEL: nightly
- TARGET: x86_64-pc-windows-gnu
CHANNEL: nightly
- TARGET: x86_64-pc-windows-msvc
CHANNEL: nightly
# Install Rust and Cargo
# (Based on from https://github.com/rust-lang/libc/blob/master/appveyor.yml)
install:
- ps: >-
If ($Env:TARGET -eq 'x86_64-pc-windows-gnu') {
$Env:PATH += ';C:\msys64\mingw64\bin'
} ElseIf ($Env:TARGET -eq 'i686-pc-windows-gnu') {
$Env:PATH += ';C:\MinGW\bin'
}
- curl -sSf -o rustup-init.exe https://win.rustup.rs
- rustup-init.exe --default-host %TARGET% --default-toolchain %CHANNEL% -y
- set PATH=%PATH%;C:\Users\appveyor\.cargo\bin
- rustc -Vv
- cargo -V
# 'cargo test' takes care of building for us, so disable Appveyor's build stage.
build: false
# Equivalent to Travis' `script` phase
test_script:
- cargo clean
- cargo test --no-default-features --features="flate2-rust"

View File

@ -1,37 +0,0 @@
---
name: Bug Report
about: Create a bug report.
---
Your issue may already be reported!
Please search on the [Actix Web issue tracker](https://github.com/actix/actix-web/issues) before creating one.
## Expected Behavior
<!--- If you're describing a bug, tell us what should happen -->
<!--- If you're suggesting a change/improvement, tell us how it should work -->
## Current Behavior
<!--- If describing a bug, tell us what happens instead of the expected behavior -->
<!--- If suggesting a change/improvement, explain the difference from current behavior -->
## Possible Solution
<!--- Not obligatory, but suggest a fix/reason for the bug, -->
<!--- or ideas how to implement the addition or change -->
## Steps to Reproduce (for bugs)
<!--- Provide a link to a live example, or an unambiguous set of steps to -->
<!--- reproduce this bug. Include code to reproduce, if relevant -->
1.
2.
3.
4.
## Context
<!--- How has this issue affected you? What are you trying to accomplish? -->
<!--- Providing context helps us come up with a solution that is most useful in the real world -->
## Your Environment
<!--- Include as many relevant details about the environment you experienced the bug in -->
* Rust Version (I.e, output of `rustc -V`):
* Actix Web Version:

View File

@ -1,15 +0,0 @@
blank_issues_enabled: true
contact_links:
- name: GitHub Discussions
url: https://github.com/actix/actix-web/discussions
about: Actix Web Q&A
- name: Gitter chat (actix-web)
url: https://gitter.im/actix/actix-web
about: Actix Web Q&A
- name: Gitter chat (actix)
url: https://gitter.im/actix/actix
about: Actix (actor framework) Q&A
- name: Actix Discord
url: https://discord.gg/NWpN5mmg3x
about: Actix developer discussion and community chat

View File

@ -1,27 +0,0 @@
<!-- Thanks for considering contributing actix! -->
<!-- Please fill out the following to get your PR reviewed quicker. -->
## PR Type
<!-- What kind of change does this PR make? -->
<!-- Bug Fix / Feature / Refactor / Code Style / Other -->
PR_TYPE
## PR Checklist
<!-- Check your PR fulfills the following items. ->>
<!-- For draft PRs check the boxes as you complete them. -->
- [ ] Tests for the changes have been added / updated.
- [ ] Documentation comments have been added / updated.
- [ ] A changelog entry has been made for the appropriate packages.
- [ ] Format code with the latest stable rustfmt.
- [ ] (Team) Label with affected crates and semver status.
## Overview
<!-- Describe the current and new behavior. -->
<!-- Emphasize any breaking changes. -->
<!-- If this PR fixes or closes an issue, reference it here. -->
<!-- Closes #000 -->

View File

@ -1,28 +0,0 @@
name: Benchmark
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches:
- master
jobs:
check_benchmark:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: nightly
profile: minimal
override: true
- name: Check benchmark
uses: actions-rs/cargo@v1
with:
command: bench
args: --bench=server -- --sample-size=15

View File

@ -1,103 +0,0 @@
name: CI
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches: [master]
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
target:
- { name: Linux, os: ubuntu-latest, triple: x86_64-unknown-linux-gnu }
- { name: macOS, os: macos-latest, triple: x86_64-apple-darwin }
- { name: Windows, os: windows-latest, triple: x86_64-pc-windows-msvc }
version:
- 1.46.0 # MSRV
- stable
- nightly
name: ${{ matrix.target.name }} / ${{ matrix.version }}
runs-on: ${{ matrix.target.os }}
steps:
- uses: actions/checkout@v2
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-${{ matrix.target.triple }}
profile: minimal
override: true
- name: Generate Cargo.lock
uses: actions-rs/cargo@v1
with:
command: generate-lockfile
- name: Cache Dependencies
uses: Swatinem/rust-cache@v1.2.0
- name: Install cargo-hack
uses: actions-rs/cargo@v1
with:
command: install
args: cargo-hack
- name: check minimal
uses: actions-rs/cargo@v1
with:
command: hack
args: --clean-per-run check --workspace --no-default-features --tests
- name: check full
uses: actions-rs/cargo@v1
with:
command: check
args: --workspace --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
with:
command: test
args: -v --workspace --all-features --no-fail-fast -- --nocapture
--skip=test_h2_content_length
--skip=test_reading_deflate_encoding_large_random_rustls
- name: tests (actix-http)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=actix-http --no-default-features --features=rustls -- --nocapture
- name: tests (awc)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=awc --no-default-features --features=rustls -- --nocapture
- name: Generate coverage file
if: >
matrix.target.os == 'ubuntu-latest'
&& matrix.version == 'stable'
&& github.ref == 'refs/heads/master'
run: |
cargo install cargo-tarpaulin --vers "^0.13"
cargo tarpaulin --out Xml --verbose
- name: Upload to Codecov
if: >
matrix.target.os == 'ubuntu-latest'
&& matrix.version == 'stable'
&& github.ref == 'refs/heads/master'
uses: codecov/codecov-action@v1
with:
file: cobertura.xml
- name: Clear the cargo caches
run: |
cargo install cargo-cache --no-default-features --features ci-autoclean
cargo-cache

View File

@ -1,39 +0,0 @@
name: Lint
on:
pull_request:
types: [opened, synchronize, reopened]
jobs:
fmt:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: stable
components: rustfmt
- name: Check with rustfmt
uses: actions-rs/cargo@v1
with:
command: fmt
args: --all -- --check
clippy:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: stable
components: clippy
override: true
- name: Check with Clippy
uses: actions-rs/clippy-check@v1
with:
token: ${{ secrets.GITHUB_TOKEN }}
args: --workspace --tests --all-features

View File

@ -1,35 +0,0 @@
name: Upload Documentation
on:
push:
branches: [master]
jobs:
build:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: nightly-x86_64-unknown-linux-gnu
profile: minimal
override: true
- name: Build Docs
uses: actions-rs/cargo@v1
with:
command: doc
args: --workspace --all-features --no-deps
- name: Tweak HTML
run: echo '<meta http-equiv="refresh" content="0;url=actix_web/index.html">' > target/doc/index.html
- name: Deploy to GitHub Pages
uses: JamesIves/github-pages-deploy-action@3.7.1
with:
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
BRANCH: gh-pages
FOLDER: target/doc

4
.gitignore vendored
View File

@ -9,10 +9,6 @@ guide/build/
*.pid
*.sock
*~
.DS_Store
# These are backup files generated by rustfmt
**/*.rs.bk
# Configuration directory generated by CLion
.idea

58
.travis.yml Normal file
View File

@ -0,0 +1,58 @@
language: rust
sudo: required
dist: trusty
cache:
# cargo: true
apt: true
matrix:
include:
- rust: stable
- rust: beta
- rust: nightly-2019-08-10
allow_failures:
- rust: nightly-2019-08-10
env:
global:
# - RUSTFLAGS="-C link-dead-code"
- OPENSSL_VERSION=openssl-1.0.2
before_install:
- sudo add-apt-repository -y ppa:0k53d-karl-f830m/openssl
- sudo apt-get update -qq
- sudo apt-get install -y openssl libssl-dev libelf-dev libdw-dev cmake gcc binutils-dev libiberty-dev
before_cache: |
if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-08-10" ]]; then
RUSTFLAGS="--cfg procmacro2_semver_exempt" cargo install --version 0.6.11 cargo-tarpaulin
fi
# Add clippy
before_script:
- export PATH=$PATH:~/.cargo/bin
script:
- cargo update
- cargo check --all --no-default-features
- cargo test --all-features --all -- --nocapture
- cd actix-http; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd ..
- cd awc; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd ..
# Upload docs
after_success:
- |
if [[ "$TRAVIS_OS_NAME" == "linux" && "$TRAVIS_PULL_REQUEST" = "false" && "$TRAVIS_BRANCH" == "master" && "$TRAVIS_RUST_VERSION" == "stable" ]]; then
cargo doc --no-deps --all-features &&
echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html &&
git clone https://github.com/davisp/ghp-import.git &&
./ghp-import/ghp_import.py -n -p -f -m "Documentation upload" -r https://"$GH_TOKEN"@github.com/"$TRAVIS_REPO_SLUG.git" target/doc &&
echo "Uploaded documentation"
fi
- |
if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-08-10" ]]; then
taskset -c 0 cargo tarpaulin --out Xml --all --all-features
bash <(curl -s https://codecov.io/bash)
echo "Uploaded code coverage"
fi

View File

@ -1,342 +1,5 @@
# Changes
## Unreleased - 2021-xx-xx
## 4.0.0-beta.4 - 2021-03-09
### Changed
* Feature `cookies` is now optional and enabled by default. [#1981]
* `JsonBody::new` returns a default limit of 32kB to be consistent with `JsonConfig` and the default
behaviour of the `web::Json<T>` extractor. [#2010]
[#1981]: https://github.com/actix/actix-web/pull/1981
[#2010]: https://github.com/actix/actix-web/pull/2010
## 4.0.0-beta.3 - 2021-02-10
* Update `actix-web-codegen` to `0.5.0-beta.1`.
## 4.0.0-beta.2 - 2021-02-10
### Added
* The method `Either<web::Json<T>, web::Form<T>>::into_inner()` which returns the inner type for
whichever variant was created. Also works for `Either<web::Form<T>, web::Json<T>>`. [#1894]
* Add `services!` macro for helping register multiple services to `App`. [#1933]
* Enable registering a vec of services of the same type to `App` [#1933]
### Changed
* Rework `Responder` trait to be sync and returns `Response`/`HttpResponse` directly.
Making it simpler and more performant. [#1891]
* `ServiceRequest::into_parts` and `ServiceRequest::from_parts` can no longer fail. [#1893]
* `ServiceRequest::from_request` can no longer fail. [#1893]
* Our `Either` type now uses `Left`/`Right` variants (instead of `A`/`B`) [#1894]
* `test::{call_service, read_response, read_response_json, send_request}` take `&Service`
in argument [#1905]
* `App::wrap_fn`, `Resource::wrap_fn` and `Scope::wrap_fn` provide `&Service` in closure
argument. [#1905]
* `web::block` no longer requires the output is a Result. [#1957]
### Fixed
* Multiple calls to `App::data` with the same type now keeps the latest call's data. [#1906]
### Removed
* Public field of `web::Path` has been made private. [#1894]
* Public field of `web::Query` has been made private. [#1894]
* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
* `AppService::set_service_data`; for custom HTTP service factories adding application data, use the
layered data model by calling `ServiceRequest::add_data_container` when handling
requests instead. [#1906]
[#1891]: https://github.com/actix/actix-web/pull/1891
[#1893]: https://github.com/actix/actix-web/pull/1893
[#1894]: https://github.com/actix/actix-web/pull/1894
[#1869]: https://github.com/actix/actix-web/pull/1869
[#1905]: https://github.com/actix/actix-web/pull/1905
[#1906]: https://github.com/actix/actix-web/pull/1906
[#1933]: https://github.com/actix/actix-web/pull/1933
[#1957]: https://github.com/actix/actix-web/pull/1957
## 4.0.0-beta.1 - 2021-01-07
### Added
* `Compat` middleware enabling generic response body/error type of middlewares like `Logger` and
`Compress` to be used in `middleware::Condition` and `Resource`, `Scope` services. [#1865]
### Changed
* Update `actix-*` dependencies to tokio `1.0` based versions. [#1813]
* Bumped `rand` to `0.8`.
* Update `rust-tls` to `0.19`. [#1813]
* Rename `Handler` to `HandlerService` and rename `Factory` to `Handler`. [#1852]
* The default `TrailingSlash` is now `Trim`, in line with existing documentation. See migration
guide for implications. [#1875]
* Rename `DefaultHeaders::{content_type => add_content_type}`. [#1875]
* MSRV is now 1.46.0.
### Fixed
* Added the underlying parse error to `test::read_body_json`'s panic message. [#1812]
### Removed
* Public modules `middleware::{normalize, err_handlers}`. All necessary middleware structs are now
exposed directly by the `middleware` module.
* Remove `actix-threadpool` as dependency. `actix_threadpool::BlockingError` error type can be imported
from `actix_web::error` module. [#1878]
[#1812]: https://github.com/actix/actix-web/pull/1812
[#1813]: https://github.com/actix/actix-web/pull/1813
[#1852]: https://github.com/actix/actix-web/pull/1852
[#1865]: https://github.com/actix/actix-web/pull/1865
[#1875]: https://github.com/actix/actix-web/pull/1875
[#1878]: https://github.com/actix/actix-web/pull/1878
## 3.3.2 - 2020-12-01
### Fixed
* Removed an occasional `unwrap` on `None` panic in `NormalizePathNormalization`. [#1762]
* Fix `match_pattern()` returning `None` for scope with empty path resource. [#1798]
* Increase minimum `socket2` version. [#1803]
[#1762]: https://github.com/actix/actix-web/pull/1762
[#1798]: https://github.com/actix/actix-web/pull/1798
[#1803]: https://github.com/actix/actix-web/pull/1803
## 3.3.1 - 2020-11-29
* Ensure `actix-http` dependency uses same `serde_urlencoded`.
## 3.3.0 - 2020-11-25
### Added
* Add `Either<A, B>` extractor helper. [#1788]
### Changed
* Upgrade `serde_urlencoded` to `0.7`. [#1773]
[#1773]: https://github.com/actix/actix-web/pull/1773
[#1788]: https://github.com/actix/actix-web/pull/1788
## 3.2.0 - 2020-10-30
### Added
* Implement `exclude_regex` for Logger middleware. [#1723]
* Add request-local data extractor `web::ReqData`. [#1748]
* Add ability to register closure for request middleware logging. [#1749]
* Add `app_data` to `ServiceConfig`. [#1757]
* Expose `on_connect` for access to the connection stream before request is handled. [#1754]
### Changed
* Updated actix-web-codegen dependency for access to new `#[route(...)]` multi-method macro.
* Print non-configured `Data<T>` type when attempting extraction. [#1743]
* Re-export bytes::Buf{Mut} in web module. [#1750]
* Upgrade `pin-project` to `1.0`.
[#1723]: https://github.com/actix/actix-web/pull/1723
[#1743]: https://github.com/actix/actix-web/pull/1743
[#1748]: https://github.com/actix/actix-web/pull/1748
[#1750]: https://github.com/actix/actix-web/pull/1750
[#1754]: https://github.com/actix/actix-web/pull/1754
[#1749]: https://github.com/actix/actix-web/pull/1749
## 3.1.0 - 2020-09-29
### Changed
* Add `TrailingSlash::MergeOnly` behaviour to `NormalizePath`, which allows `NormalizePath`
to retain any trailing slashes. [#1695]
* Remove bound `std::marker::Sized` from `web::Data` to support storing `Arc<dyn Trait>`
via `web::Data::from` [#1710]
### Fixed
* `ResourceMap` debug printing is no longer infinitely recursive. [#1708]
[#1695]: https://github.com/actix/actix-web/pull/1695
[#1708]: https://github.com/actix/actix-web/pull/1708
[#1710]: https://github.com/actix/actix-web/pull/1710
## 3.0.2 - 2020-09-15
### Fixed
* `NormalizePath` when used with `TrailingSlash::Trim` no longer trims the root path "/". [#1678]
[#1678]: https://github.com/actix/actix-web/pull/1678
## 3.0.1 - 2020-09-13
### Changed
* `middleware::normalize::TrailingSlash` enum is now accessible. [#1673]
[#1673]: https://github.com/actix/actix-web/pull/1673
## 3.0.0 - 2020-09-11
* No significant changes from `3.0.0-beta.4`.
## 3.0.0-beta.4 - 2020-09-09
### Added
* `middleware::NormalizePath` now has configurable behavior for either always having a trailing
slash, or as the new addition, always trimming trailing slashes. [#1639]
### Changed
* Update actix-codec and actix-utils dependencies. [#1634]
* `FormConfig` and `JsonConfig` configurations are now also considered when set
using `App::data`. [#1641]
* `HttpServer::maxconn` is renamed to the more expressive `HttpServer::max_connections`. [#1655]
* `HttpServer::maxconnrate` is renamed to the more expressive
`HttpServer::max_connection_rate`. [#1655]
[#1639]: https://github.com/actix/actix-web/pull/1639
[#1641]: https://github.com/actix/actix-web/pull/1641
[#1634]: https://github.com/actix/actix-web/pull/1634
[#1655]: https://github.com/actix/actix-web/pull/1655
## 3.0.0-beta.3 - 2020-08-17
### Changed
* Update `rustls` to 0.18
## 3.0.0-beta.2 - 2020-08-17
### Changed
* `PayloadConfig` is now also considered in `Bytes` and `String` extractors when set
using `App::data`. [#1610]
* `web::Path` now has a public representation: `web::Path(pub T)` that enables
destructuring. [#1594]
* `ServiceRequest::app_data` allows retrieval of non-Data data without splitting into parts to
access `HttpRequest` which already allows this. [#1618]
* Re-export all error types from `awc`. [#1621]
* MSRV is now 1.42.0.
### Fixed
* Memory leak of app data in pooled requests. [#1609]
[#1594]: https://github.com/actix/actix-web/pull/1594
[#1609]: https://github.com/actix/actix-web/pull/1609
[#1610]: https://github.com/actix/actix-web/pull/1610
[#1618]: https://github.com/actix/actix-web/pull/1618
[#1621]: https://github.com/actix/actix-web/pull/1621
## 3.0.0-beta.1 - 2020-07-13
### Added
* Re-export `actix_rt::main` as `actix_web::main`.
* `HttpRequest::match_pattern` and `ServiceRequest::match_pattern` for extracting the matched
resource pattern.
* `HttpRequest::match_name` and `ServiceRequest::match_name` for extracting matched resource name.
### Changed
* Fix actix_http::h1::dispatcher so it returns when HW_BUFFER_SIZE is reached. Should reduce peak memory consumption during large uploads. [#1550]
* Migrate cookie handling to `cookie` crate. Actix-web no longer requires `ring` dependency.
* MSRV is now 1.41.1
### Fixed
* `NormalizePath` improved consistency when path needs slashes added _and_ removed.
## 3.0.0-alpha.3 - 2020-05-21
### Added
* Add option to create `Data<T>` from `Arc<T>` [#1509]
### Changed
* Resources and Scopes can now access non-overridden data types set on App (or containing scopes) when setting their own data. [#1486]
* Fix audit issue logging by default peer address [#1485]
* Bump minimum supported Rust version to 1.40
* Replace deprecated `net2` crate with `socket2`
[#1485]: https://github.com/actix/actix-web/pull/1485
[#1509]: https://github.com/actix/actix-web/pull/1509
## [3.0.0-alpha.2] - 2020-05-08
### Changed
* `{Resource,Scope}::default_service(f)` handlers now support app data extraction. [#1452]
* Implement `std::error::Error` for our custom errors [#1422]
* NormalizePath middleware now appends trailing / so that routes of form /example/ respond to /example requests. [#1433]
* Remove the `failure` feature and support.
[#1422]: https://github.com/actix/actix-web/pull/1422
[#1433]: https://github.com/actix/actix-web/pull/1433
[#1452]: https://github.com/actix/actix-web/pull/1452
[#1486]: https://github.com/actix/actix-web/pull/1486
## [3.0.0-alpha.1] - 2020-03-11
### Added
* Add helper function for creating routes with `TRACE` method guard `web::trace()`
* Add convenience functions `test::read_body_json()` and `test::TestRequest::send_request()` for testing.
### Changed
* Use `sha-1` crate instead of unmaintained `sha1` crate
* Skip empty chunks when returning response from a `Stream` [#1308]
* Update the `time` dependency to 0.2.7
* Update `actix-tls` dependency to 2.0.0-alpha.1
* Update `rustls` dependency to 0.17
[#1308]: https://github.com/actix/actix-web/pull/1308
## [2.0.0] - 2019-12-25
### Changed
* Rename `HttpServer::start()` to `HttpServer::run()`
* Allow to gracefully stop test server via `TestServer::stop()`
* Allow to specify multi-patterns for resources
## [2.0.0-rc] - 2019-12-20
### Changed
* Move `BodyEncoding` to `dev` module #1220
* Allow to set `peer_addr` for TestRequest #1074
* Make web::Data deref to Arc<T> #1214
* Rename `App::register_data()` to `App::app_data()`
* `HttpRequest::app_data<T>()` returns `Option<&T>` instead of `Option<&Data<T>>`
### Fixed
* Fix `AppConfig::secure()` is always false. #1202
## [2.0.0-alpha.6] - 2019-12-15
### Fixed
* Fixed compilation with default features off
## [2.0.0-alpha.5] - 2019-12-13
### Added
* Add test server, `test::start()` and `test::start_with()`
## [2.0.0-alpha.4] - 2019-12-08
### Deleted
* Delete HttpServer::run(), it is not useful with async/await
## [2.0.0-alpha.3] - 2019-12-07
### Changed
* Migrate to tokio 0.2
## [2.0.0-alpha.1] - 2019-11-22
### Changed
* Migrated to `std::future`
* Remove implementation of `Responder` for `()`. (#1167)
## [1.0.9] - 2019-11-14
### Added
@ -364,7 +27,7 @@
### Changed
* Make UrlEncodedError::Overflow more informative
* Make UrlEncodedError::Overflow more informativve
* Use actix-testing for testing utils
@ -382,7 +45,7 @@
* Re-implement Host predicate (#989)
* Form implements Responder, returning a `application/x-www-form-urlencoded` response
* Form immplements Responder, returning a `application/x-www-form-urlencoded` response
* Add `into_inner` to `Data`
@ -499,7 +162,7 @@
## [1.0.0-rc] - 2019-05-18
### Added
### Add
* Add `Query<T>::from_query()` to extract parameters from a query string. #846
* `QueryConfig`, similar to `JsonConfig` for customizing error handling of query extractors.
@ -515,7 +178,7 @@
## [1.0.0-beta.4] - 2019-05-12
### Added
### Add
* Allow to set/override app data on scope level
@ -541,7 +204,7 @@
* CORS handling without headers #702
* Allow constructing `Data` instances to avoid double `Arc` for `Send + Sync` types.
* Allow to construct `Data` instances to avoid double `Arc` for `Send + Sync` types.
### Fixed
@ -605,7 +268,7 @@
### Changed
* Allow using any service as default service.
* Allow to use any service as default service.
* Remove generic type for request payload, always use default.
@ -668,13 +331,13 @@
### Added
* Rustls support
* rustls support
### Changed
* Use forked cookie
* use forked cookie
* Multipart::Field renamed to MultipartField
* multipart::Field renamed to MultipartField
## [1.0.0-alpha.1] - 2019-03-28

View File

@ -34,13 +34,10 @@ This Code of Conduct applies both within project spaces and in public spaces whe
## Enforcement
Instances of abusive, harassing, or otherwise unacceptable behavior may be reported by contacting the project team at robjtede@icloud.com ([@robjtede]) or huyuumi@neet.club ([@JohnTitor]). The project team will review and investigate all complaints, and will respond in a way that it deems appropriate to the circumstances. The project team is obligated to maintain confidentiality with regard to the reporter of an incident. Further details of specific enforcement policies may be posted separately.
Instances of abusive, harassing, or otherwise unacceptable behavior may be reported by contacting the project team at fafhrd91@gmail.com. The project team will review and investigate all complaints, and will respond in a way that it deems appropriate to the circumstances. The project team is obligated to maintain confidentiality with regard to the reporter of an incident. Further details of specific enforcement policies may be posted separately.
Project maintainers who do not follow or enforce the Code of Conduct in good faith may face temporary or permanent repercussions as determined by other members of the project's leadership.
[@robjtede]: https://github.com/robjtede
[@JohnTitor]: https://github.com/JohnTitor
## Attribution
This Code of Conduct is adapted from the [Contributor Covenant][homepage], version 1.4, available at [http://contributor-covenant.org/version/1/4][version]

View File

@ -1,8 +1,8 @@
[package]
name = "actix-web"
version = "4.0.0-beta.4"
version = "1.0.9"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust"
description = "Actix web is a simple, pragmatic and extremely fast web framework for Rust."
readme = "README.md"
keywords = ["actix", "http", "web", "framework", "async"]
homepage = "https://actix.rs"
@ -11,12 +11,12 @@ documentation = "https://docs.rs/actix-web/"
categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT OR Apache-2.0"
license = "MIT/Apache-2.0"
exclude = [".gitignore", ".travis.yml", ".cargo/config", "appveyor.yml"]
edition = "2018"
[package.metadata.docs.rs]
# features that docs.rs will build with
features = ["openssl", "rustls", "compress", "secure-cookies"]
features = ["ssl", "brotli", "flate2-zlib", "secure-cookies", "client", "rust-tls", "uds"]
[badges]
travis-ci = { repository = "actix/actix-web", branch = "master" }
@ -31,100 +31,90 @@ members = [
".",
"awc",
"actix-http",
"actix-cors",
"actix-files",
"actix-framed",
"actix-session",
"actix-identity",
"actix-multipart",
"actix-web-actors",
"actix-web-codegen",
"actix-http-test",
"test-server",
]
[features]
default = ["compress", "cookies"]
default = ["brotli", "flate2-zlib", "client", "fail"]
# content-encoding support
compress = ["actix-http/compress", "awc/compress"]
# http client
client = ["awc"]
# support for cookies
cookies = ["actix-http/cookies", "awc/cookies"]
# brotli encoding, requires c compiler
brotli = ["actix-http/brotli"]
# secure cookies feature
# miniz-sys backend for flate2 crate
flate2-zlib = ["actix-http/flate2-zlib"]
# rust backend for flate2 crate
flate2-rust = ["actix-http/flate2-rust"]
# sessions feature, session require "ring" crate and c compiler
secure-cookies = ["actix-http/secure-cookies"]
fail = ["actix-http/fail"]
# openssl
openssl = ["tls-openssl", "actix-tls/accept", "actix-tls/openssl", "awc/openssl"]
ssl = ["openssl", "actix-server/ssl", "awc/ssl"]
# rustls
rustls = ["tls-rustls", "actix-tls/accept", "actix-tls/rustls", "awc/rustls"]
rust-tls = ["rustls", "actix-server/rust-tls", "awc/rust-tls"]
[[example]]
name = "basic"
required-features = ["compress"]
[[example]]
name = "uds"
required-features = ["compress"]
[[test]]
name = "test_server"
required-features = ["compress", "cookies"]
[[example]]
name = "on_connect"
required-features = []
[[example]]
name = "client"
required-features = ["rustls"]
# unix domain sockets support
uds = ["actix-server/uds"]
[dependencies]
actix-codec = "0.4.0-beta.1"
actix-macros = "0.2.0"
actix-router = "0.2.7"
actix-rt = "2.1"
actix-server = "2.0.0-beta.3"
actix-service = "2.0.0-beta.4"
actix-utils = "3.0.0-beta.2"
actix-tls = { version = "3.0.0-beta.4", default-features = false, optional = true }
actix-codec = "0.1.2"
actix-service = "0.4.1"
actix-utils = "0.4.4"
actix-router = "0.1.5"
actix-rt = "0.2.4"
actix-web-codegen = "0.1.2"
actix-http = "0.2.11"
actix-server = "0.6.1"
actix-server-config = "0.1.2"
actix-testing = "0.1.0"
actix-threadpool = "0.1.1"
awc = { version = "0.2.7", optional = true }
actix-web-codegen = "0.5.0-beta.2"
actix-http = "3.0.0-beta.4"
awc = { version = "3.0.0-beta.3", default-features = false }
ahash = "0.7"
bytes = "1"
derive_more = "0.99.5"
either = "1.5.3"
bytes = "0.4"
derive_more = "0.15.0"
encoding_rs = "0.8"
futures-core = { version = "0.3.7", default-features = false }
futures-util = { version = "0.3.7", default-features = false }
futures = "0.1.25"
hashbrown = "0.6.3"
log = "0.4"
mime = "0.3"
pin-project = "1.0.0"
regex = "1.4"
serde = { version = "1.0", features = ["derive"] }
net2 = "0.2.33"
parking_lot = "0.9"
regex = "1.0"
serde = { version = "1.0", features=["derive"] }
serde_json = "1.0"
serde_urlencoded = "0.7"
smallvec = "1.6"
socket2 = "0.3.16"
time = { version = "0.2.23", default-features = false, features = ["std"] }
tls-openssl = { package = "openssl", version = "0.10.9", optional = true }
tls-rustls = { package = "rustls", version = "0.19.0", optional = true }
serde_urlencoded = "0.6.1"
time = "0.1.42"
url = "2.1"
[target.'cfg(windows)'.dependencies.tls-openssl]
version = "0.10.9"
package = "openssl"
features = ["vendored"]
optional = true
# ssl support
openssl = { version="0.10", optional = true }
rustls = { version = "0.15", optional = true }
[dev-dependencies]
brotli2 = "0.3.2"
criterion = "0.3"
env_logger = "0.8"
flate2 = "1.0.13"
rand = "0.8"
rcgen = "0.8"
actix = "0.8.3"
actix-connect = "0.2.2"
actix-http-test = "0.2.4"
rand = "0.7"
env_logger = "0.6"
serde_derive = "1.0"
tokio-timer = "0.2.8"
brotli2 = "0.3.2"
flate2 = "1.0.2"
[profile.release]
lto = true
@ -134,21 +124,10 @@ codegen-units = 1
[patch.crates-io]
actix-web = { path = "." }
actix-http = { path = "actix-http" }
actix-http-test = { path = "actix-http-test" }
actix-web-actors = { path = "actix-web-actors" }
actix-http-test = { path = "test-server" }
actix-web-codegen = { path = "actix-web-codegen" }
actix-multipart = { path = "actix-multipart" }
actix-web-actors = { path = "actix-web-actors" }
actix-session = { path = "actix-session" }
actix-files = { path = "actix-files" }
actix-multipart = { path = "actix-multipart" }
awc = { path = "awc" }
[[bench]]
name = "server"
harness = false
[[bench]]
name = "service"
harness = false
[[bench]]
name = "responder"
harness = false

View File

@ -186,7 +186,7 @@
same "printed page" as the copyright notice for easier
identification within third-party archives.
Copyright 2017-NOW Actix Team
Copyright 2017-NOW Nikolay Kim
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.

View File

@ -1,4 +1,4 @@
Copyright (c) 2017 Actix Team
Copyright (c) 2017 Nikolay Kim
Permission is hereby granted, free of charge, to any
person obtaining a copy of this software and associated

View File

@ -1,118 +1,3 @@
## Unreleased
* The default `NormalizePath` behavior now strips trailing slashes by default. This was
previously documented to be the case in v3 but the behavior now matches. The effect is that
routes defined with trailing slashes will become inaccessible when
using `NormalizePath::default()`.
Before: `#[get("/test/")`
After: `#[get("/test")`
Alternatively, explicitly require trailing slashes: `NormalizePath::new(TrailingSlash::Always)`.
## 3.0.0
* The return type for `ServiceRequest::app_data::<T>()` was changed from returning a `Data<T>` to
simply a `T`. To access a `Data<T>` use `ServiceRequest::app_data::<Data<T>>()`.
* Cookie handling has been offloaded to the `cookie` crate:
* `USERINFO_ENCODE_SET` is no longer exposed. Percent-encoding is still supported; check docs.
* Some types now require lifetime parameters.
* The time crate was updated to `v0.2`, a major breaking change to the time crate, which affects
any `actix-web` method previously expecting a time v0.1 input.
* Setting a cookie's SameSite property, explicitly, to `SameSite::None` will now
result in `SameSite=None` being sent with the response Set-Cookie header.
To create a cookie without a SameSite attribute, remove any calls setting same_site.
* actix-http support for Actors messages was moved to actix-http crate and is enabled
with feature `actors`
* content_length function is removed from actix-http.
You can set Content-Length by normally setting the response body or calling no_chunking function.
* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
`u64` instead of a `usize`.
* Code that was using `path.<index>` to access a `web::Path<(A, B, C)>`s elements now needs to use
destructuring or `.into_inner()`. For example:
```rust
// Previously:
async fn some_route(path: web::Path<(String, String)>) -> String {
format!("Hello, {} {}", path.0, path.1)
}
// Now (this also worked before):
async fn some_route(path: web::Path<(String, String)>) -> String {
let (first_name, last_name) = path.into_inner();
format!("Hello, {} {}", first_name, last_name)
}
// Or (this wasn't previously supported):
async fn some_route(web::Path((first_name, last_name)): web::Path<(String, String)>) -> String {
format!("Hello, {} {}", first_name, last_name)
}
```
* `middleware::NormalizePath` can now also be configured to trim trailing slashes instead of always keeping one.
It will need `middleware::normalize::TrailingSlash` when being constructed with `NormalizePath::new(...)`,
or for an easier migration you can replace `wrap(middleware::NormalizePath)` with `wrap(middleware::NormalizePath::new(TrailingSlash::MergeOnly))`.
* `HttpServer::maxconn` is renamed to the more expressive `HttpServer::max_connections`.
* `HttpServer::maxconnrate` is renamed to the more expressive `HttpServer::max_connection_rate`.
## 2.0.0
* `HttpServer::start()` renamed to `HttpServer::run()`. It also possible to
`.await` on `run` method result, in that case it awaits server exit.
* `App::register_data()` renamed to `App::app_data()` and accepts any type `T: 'static`.
Stored data is available via `HttpRequest::app_data()` method at runtime.
* Extractor configuration must be registered with `App::app_data()` instead of `App::data()`
* Sync handlers has been removed. `.to_async()` method has been renamed to `.to()`
replace `fn` with `async fn` to convert sync handler to async
* `actix_http_test::TestServer` moved to `actix_web::test` module. To start
test server use `test::start()` or `test_start_with_config()` methods
* `ResponseError` trait has been reafctored. `ResponseError::error_response()` renders
http response.
* Feature `rust-tls` renamed to `rustls`
instead of
```rust
actix-web = { version = "2.0.0", features = ["rust-tls"] }
```
use
```rust
actix-web = { version = "2.0.0", features = ["rustls"] }
```
* Feature `ssl` renamed to `openssl`
instead of
```rust
actix-web = { version = "2.0.0", features = ["ssl"] }
```
use
```rust
actix-web = { version = "2.0.0", features = ["openssl"] }
```
* `Cors` builder now requires that you call `.finish()` to construct the middleware
## 1.0.1
* Cors middleware has been moved to `actix-cors` crate
@ -149,52 +34,52 @@
* Extractor configuration. In version 1.0 this is handled with the new `Data` mechanism for both setting and retrieving the configuration
instead of
```rust
#[derive(Default)]
struct ExtractorConfig {
config: String,
}
impl FromRequest for YourExtractor {
type Config = ExtractorConfig;
type Result = Result<YourExtractor, Error>;
fn from_request(req: &HttpRequest, cfg: &Self::Config) -> Self::Result {
println!("use the config: {:?}", cfg.config);
...
}
}
App::new().resource("/route_with_config", |r| {
r.post().with_config(handler_fn, |cfg| {
cfg.0.config = "test".to_string();
})
})
```
use the HttpRequest to get the configuration like any other `Data` with `req.app_data::<C>()` and set it with the `data()` method on the `resource`
```rust
#[derive(Default)]
struct ExtractorConfig {
config: String,
}
impl FromRequest for YourExtractor {
type Error = Error;
type Future = Result<Self, Self::Error>;
type Config = ExtractorConfig;
fn from_request(req: &HttpRequest, payload: &mut Payload) -> Self::Future {
let cfg = req.app_data::<ExtractorConfig>();
println!("config data?: {:?}", cfg.unwrap().role);
...
}
}
App::new().service(
resource("/route_with_config")
.data(ExtractorConfig {
@ -203,7 +88,7 @@
.route(post().to(handler_fn)),
)
```
* Resource registration. 1.0 version uses generalized resource
registration via `.service()` method.
@ -419,7 +304,7 @@
* `actix_web::server` module has been removed. To start http server use `actix_web::HttpServer` type
* StaticFiles and NamedFile have been moved to a separate crate.
* StaticFiles and NamedFile has been move to separate create.
instead of `use actix_web::fs::StaticFile`
@ -429,7 +314,7 @@
use `use actix_files::NamedFile`
* Multipart has been moved to a separate crate.
* Multipart has been move to separate create.
instead of `use actix_web::multipart::Multipart`
@ -494,9 +379,9 @@
* `HttpRequest` does not implement `Stream` anymore. If you need to read request payload
use `HttpMessage::payload()` method.
instead of
```rust
fn index(req: HttpRequest) -> impl Responder {
req
@ -522,8 +407,8 @@
trait uses `&HttpRequest` instead of `&mut HttpRequest`.
* Removed `Route::with2()` and `Route::with3()` use tuple of extractors instead.
instead of
instead of
```rust
fn index(query: Query<..>, info: Json<MyStruct) -> impl Responder {}
@ -539,7 +424,7 @@
* `Handler::handle()` accepts reference to `HttpRequest<_>` instead of value
* Removed deprecated `HttpServer::threads()`, use
* Removed deprecated `HttpServer::threads()`, use
[HttpServer::workers()](https://actix.rs/actix-web/actix_web/server/struct.HttpServer.html#method.workers) instead.
* Renamed `client::ClientConnectorError::Connector` to
@ -548,7 +433,7 @@
* `Route::with()` does not return `ExtractorConfig`, to configure
extractor use `Route::with_config()`
instead of
instead of
```rust
fn main() {
@ -559,11 +444,11 @@
});
}
```
use
use
```rust
fn main() {
let app = App::new().resource("/index.html", |r| {
r.method(http::Method::GET)
@ -593,12 +478,12 @@
* `HttpRequest::extensions()` returns read only reference to the request's Extension
`HttpRequest::extensions_mut()` returns mutable reference.
* Instead of
* Instead of
`use actix_web::middleware::{
CookieSessionBackend, CookieSessionError, RequestSession,
Session, SessionBackend, SessionImpl, SessionStorage};`
use `actix_web::middleware::session`
`use actix_web::middleware::session{CookieSessionBackend, CookieSessionError,

106
README.md
View File

@ -1,109 +1,79 @@
<div align="center">
<h1>Actix Web</h1>
<p>
<strong>Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust</strong>
</p>
<p>
# Actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
[![crates.io](https://img.shields.io/crates/v/actix-web?label=latest)](https://crates.io/crates/actix-web)
[![Documentation](https://docs.rs/actix-web/badge.svg?version=4.0.0-beta.4)](https://docs.rs/actix-web/4.0.0-beta.4)
[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-web.svg)
[![Dependency Status](https://deps.rs/crate/actix-web/4.0.0-beta.4/status.svg)](https://deps.rs/crate/actix-web/4.0.0-beta.4)
<br />
[![build status](https://github.com/actix/actix-web/workflows/CI%20%28Linux%29/badge.svg?branch=master&event=push)](https://github.com/actix/actix-web/actions)
[![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web)
![downloads](https://img.shields.io/crates/d/actix-web.svg)
[![Chat on Discord](https://img.shields.io/discord/771444961383153695?label=chat&logo=discord)](https://discord.gg/NWpN5mmg3x)
Actix web is a simple, pragmatic and extremely fast web framework for Rust.
</p>
</div>
## Features
* Supports *HTTP/1.x* and *HTTP/2*
* Supported *HTTP/1.x* and *HTTP/2.0* protocols
* Streaming and pipelining
* Keep-alive and slow requests handling
* Client/server [WebSockets](https://actix.rs/docs/websockets/) support
* Transparent content compression/decompression (br, gzip, deflate)
* Powerful [request routing](https://actix.rs/docs/url-dispatch/)
* Configurable [request routing](https://actix.rs/docs/url-dispatch/)
* Multipart streams
* Static assets
* SSL support using OpenSSL or Rustls
* SSL support with OpenSSL or Rustls
* Middlewares ([Logger, Session, CORS, etc](https://actix.rs/docs/middleware/))
* Includes an async [HTTP client](https://docs.rs/actix-web/latest/actix_web/client/index.html)
* Runs on stable Rust 1.46+
* Includes an asynchronous [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
* Supports [Actix actor framework](https://github.com/actix/actix)
## Documentation
## Documentation & community resources
* [Website & User Guide](https://actix.rs)
* [Examples Repository](https://github.com/actix/examples)
* [API Documentation](https://docs.rs/actix-web)
* [API Documentation (master branch)](https://actix.rs/actix-web/actix_web)
* [User Guide](https://actix.rs/docs/)
* [API Documentation (1.0)](https://docs.rs/actix-web/)
* [API Documentation (0.7)](https://docs.rs/actix-web/0.7.19/actix_web/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-web](https://crates.io/crates/actix-web)
* Minimum supported Rust version: 1.36 or later
## Example
Dependencies:
```toml
[dependencies]
actix-web = "3"
```
Code:
```rust
use actix_web::{get, web, App, HttpServer, Responder};
use actix_web::{web, App, HttpServer, Responder};
#[get("/{id}/{name}/index.html")]
async fn index(web::Path((id, name)): web::Path<(u32, String)>) -> impl Responder {
format!("Hello {}! id:{}", name, id)
fn index(info: web::Path<(u32, String)>) -> impl Responder {
format!("Hello {}! id:{}", info.1, info.0)
}
#[actix_web::main]
async fn main() -> std::io::Result<()> {
HttpServer::new(|| App::new().service(index))
fn main() -> std::io::Result<()> {
HttpServer::new(
|| App::new().service(
web::resource("/{id}/{name}/index.html").to(index)))
.bind("127.0.0.1:8080")?
.run()
.await
}
```
### More examples
* [Basic Setup](https://github.com/actix/examples/tree/master/basics/basics/)
* [Application State](https://github.com/actix/examples/tree/master/basics/state/)
* [JSON Handling](https://github.com/actix/examples/tree/master/json/json/)
* [Multipart Streams](https://github.com/actix/examples/tree/master/forms/multipart/)
* [Diesel Integration](https://github.com/actix/examples/tree/master/database_interactions/diesel/)
* [r2d2 Integration](https://github.com/actix/examples/tree/master/database_interactions/r2d2/)
* [Simple WebSocket](https://github.com/actix/examples/tree/master/websockets/websocket/)
* [Tera Templates](https://github.com/actix/examples/tree/master/template_engines/tera/)
* [Askama Templates](https://github.com/actix/examples/tree/master/template_engines/askama/)
* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/security/rustls/)
* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/security/openssl/)
* [WebSocket Chat](https://github.com/actix/examples/tree/master/websockets/chat/)
* [Basics](https://github.com/actix/examples/tree/master/basics/)
* [Stateful](https://github.com/actix/examples/tree/master/state/)
* [Multipart streams](https://github.com/actix/examples/tree/master/multipart/)
* [Simple websocket](https://github.com/actix/examples/tree/master/websocket/)
* [Tera](https://github.com/actix/examples/tree/master/template_tera/) /
[Askama](https://github.com/actix/examples/tree/master/template_askama/) templates
* [Diesel integration](https://github.com/actix/examples/tree/master/diesel/)
* [r2d2](https://github.com/actix/examples/tree/master/r2d2/)
* [SSL / HTTP/2.0](https://github.com/actix/examples/tree/master/tls/)
* [Tcp/Websocket chat](https://github.com/actix/examples/tree/master/websocket-chat/)
* [Json](https://github.com/actix/examples/tree/master/json/)
You may consider checking out
[this directory](https://github.com/actix/examples/tree/master/) for more examples.
## Benchmarks
One of the fastest web frameworks available according to the
[TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r19).
* [TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r18)
## License
This project is licensed under either of
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or
[http://www.apache.org/licenses/LICENSE-2.0])
* MIT license ([LICENSE-MIT](LICENSE-MIT) or
[http://opensource.org/licenses/MIT])
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
* MIT license ([LICENSE-MIT](LICENSE-MIT) or [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
at your option.
## Code of Conduct
Contribution to the actix-web repo is organized under the terms of the Contributor Covenant.
The Actix team promises to intervene to uphold that code of conduct.
Contribution to the actix-web crate is organized under the terms of the
Contributor Covenant, the maintainer of actix-web, @fafhrd91, promises to
intervene to uphold that code of conduct.

9
actix-cors/CHANGES.md Normal file
View File

@ -0,0 +1,9 @@
# Changes
## [0.1.1] - unreleased
* Bump `derive_more` crate version to 0.15.0
## [0.1.0] - 2019-06-15
* Move cors middleware to separate crate

23
actix-cors/Cargo.toml Normal file
View File

@ -0,0 +1,23 @@
[package]
name = "actix-cors"
version = "0.1.0"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Cross-origin resource sharing (CORS) for Actix applications."
readme = "README.md"
keywords = ["web", "framework"]
homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-cors/"
license = "MIT/Apache-2.0"
edition = "2018"
#workspace = ".."
[lib]
name = "actix_cors"
path = "src/lib.rs"
[dependencies]
actix-web = "1.0.0"
actix-service = "0.4.0"
derive_more = "0.15.0"
futures = "0.1.25"

9
actix-cors/README.md Normal file
View File

@ -0,0 +1,9 @@
# Cors Middleware for actix web framework [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-cors)](https://crates.io/crates/actix-cors) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & community resources
* [User Guide](https://actix.rs/docs/)
* [API Documentation](https://docs.rs/actix-cors/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-cors](https://crates.io/crates/actix-cors)
* Minimum supported Rust version: 1.34 or later

1175
actix-cors/src/lib.rs Normal file

File diff suppressed because it is too large Load Diff

View File

@ -1,127 +1,64 @@
# Changes
## Unreleased - 2021-xx-xx
## [0.1.7] - 2019-11-06
* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
## 0.6.0-beta.3 - 2021-03-09
* No notable changes.
## [0.1.6] - 2019-10-14
## 0.6.0-beta.2 - 2021-02-10
* Fix If-Modified-Since and If-Unmodified-Since to not compare using sub-second timestamps. [#1887]
* Replace `v_htmlescape` with `askama_escape`. [#1953]
[#1887]: https://github.com/actix/actix-web/pull/1887
[#1953]: https://github.com/actix/actix-web/pull/1953
## 0.6.0-beta.1 - 2021-01-07
* `HttpRange::parse` now has its own error type.
* Update `bytes` to `1.0`. [#1813]
[#1813]: https://github.com/actix/actix-web/pull/1813
## 0.5.0 - 2020-12-26
* Optionally support hidden files/directories. [#1811]
[#1811]: https://github.com/actix/actix-web/pull/1811
## 0.4.1 - 2020-11-24
* Clarify order of parameters in `Files::new` and improve docs.
## 0.4.0 - 2020-10-06
* Add `Files::prefer_utf8` option that adds UTF-8 charset on certain response types. [#1714]
[#1714]: https://github.com/actix/actix-web/pull/1714
## 0.3.0 - 2020-09-11
* No significant changes from 0.3.0-beta.1.
## 0.3.0-beta.1 - 2020-07-15
* Update `v_htmlescape` to 0.10
* Update `actix-web` and `actix-http` dependencies to beta.1
## 0.3.0-alpha.1 - 2020-05-23
* Update `actix-web` and `actix-http` dependencies to alpha
* Fix some typos in the docs
* Bump minimum supported Rust version to 1.40
* Support sending Content-Length when Content-Range is specified [#1384]
[#1384]: https://github.com/actix/actix-web/pull/1384
## 0.2.1 - 2019-12-22
* Use the same format for file URLs regardless of platforms
## 0.2.0 - 2019-12-20
* Fix BodyEncoding trait import #1220
## 0.2.0-alpha.1 - 2019-12-07
* Migrate to `std::future`
## 0.1.7 - 2019-11-06
* Add an additional `filename*` param in the `Content-Disposition` header of
`actix_files::NamedFile` to be more compatible. (#1151)
## 0.1.6 - 2019-10-14
* Add option to redirect to a slash-ended path `Files` #1132
## [0.1.5] - 2019-10-08
## 0.1.5 - 2019-10-08
* Bump up `mime_guess` crate version to 2.0.1
* Bump up `percent-encoding` crate version to 2.1
* Allow user defined request guards for `Files` #1113
## [0.1.4] - 2019-07-20
## 0.1.4 - 2019-07-20
* Allow to disable `Content-Disposition` header #686
## [0.1.3] - 2019-06-28
## 0.1.3 - 2019-06-28
* Do not set `Content-Length` header, let actix-http set it #930
## [0.1.2] - 2019-06-13
## 0.1.2 - 2019-06-13
* Content-Length is 0 for NamedFile HEAD request #914
* Fix ring dependency from actix-web default features for #741
## [0.1.1] - 2019-06-01
## 0.1.1 - 2019-06-01
* Static files are incorrectly served as both chunked and with length #812
## [0.1.0] - 2019-05-25
## 0.1.0 - 2019-05-25
* NamedFile last-modified check always fails due to nano-seconds in file modified date #820
* NamedFile last-modified check always fails due to nano-seconds
in file modified date #820
## [0.1.0-beta.4] - 2019-05-12
## 0.1.0-beta.4 - 2019-05-12
* Update actix-web to beta.4
## [0.1.0-beta.1] - 2019-04-20
## 0.1.0-beta.1 - 2019-04-20
* Update actix-web to beta.1
## [0.1.0-alpha.6] - 2019-04-14
## 0.1.0-alpha.6 - 2019-04-14
* Update actix-web to alpha6
## [0.1.0-alpha.4] - 2019-04-08
## 0.1.0-alpha.4 - 2019-04-08
* Update actix-web to alpha4
## [0.1.0-alpha.2] - 2019-04-02
## 0.1.0-alpha.2 - 2019-04-02
* Add default handler support
## [0.1.0-alpha.1] - 2019-03-28
## 0.1.0-alpha.1 - 2019-03-28
* Initial impl

View File

@ -1,37 +1,35 @@
[package]
name = "actix-files"
version = "0.6.0-beta.3"
version = "0.1.7"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Static file serving for Actix Web"
description = "Static files support for actix web."
readme = "README.md"
keywords = ["actix", "http", "async", "futures"]
homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-files/"
categories = ["asynchronous", "web-programming::http-server"]
license = "MIT OR Apache-2.0"
license = "MIT/Apache-2.0"
edition = "2018"
workspace = ".."
[lib]
name = "actix_files"
path = "src/lib.rs"
[dependencies]
actix-web = { version = "4.0.0-beta.4", default-features = false }
actix-service = "2.0.0-beta.4"
askama_escape = "0.10"
actix-web = { version = "1.0.8", default-features = false }
actix-http = "0.2.11"
actix-service = "0.4.1"
bitflags = "1"
bytes = "1"
futures-core = { version = "0.3.7", default-features = false }
futures-util = { version = "0.3.7", default-features = false }
http-range = "0.1.4"
derive_more = "0.99.5"
bytes = "0.4"
futures = "0.1.25"
derive_more = "0.15.0"
log = "0.4"
mime = "0.3"
mime_guess = "2.0.1"
percent-encoding = "2.1"
v_htmlescape = "0.4"
[dev-dependencies]
actix-rt = "2.1"
actix-web = "4.0.0-beta.4"
actix-web = { version = "1.0.8", features=["ssl"] }

View File

@ -1,19 +1,9 @@
# actix-files
# Static files support for actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-files)](https://crates.io/crates/actix-files) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
> Static file serving for Actix Web
## Documentation & community resources
[![crates.io](https://img.shields.io/crates/v/actix-files?label=latest)](https://crates.io/crates/actix-files)
[![Documentation](https://docs.rs/actix-files/badge.svg?version=0.6.0-beta.3)](https://docs.rs/actix-files/0.6.0-beta.3)
[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
![License](https://img.shields.io/crates/l/actix-files.svg)
<br />
[![dependency status](https://deps.rs/crate/actix-files/0.6.0-beta.3/status.svg)](https://deps.rs/crate/actix-files/0.6.0-beta.3)
[![Download](https://img.shields.io/crates/d/actix-files.svg)](https://crates.io/crates/actix-files)
[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & Resources
- [API Documentation](https://docs.rs/actix-files/)
- [Example Project](https://github.com/actix/examples/tree/master/basics/static_index)
- [Chat on Gitter](https://gitter.im/actix/actix-web)
- Minimum supported Rust version: 1.46 or later
* [User Guide](https://actix.rs/docs/)
* [API Documentation](https://docs.rs/actix-files/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-files](https://crates.io/crates/actix-files)
* Minimum supported Rust version: 1.33 or later

View File

@ -1,98 +0,0 @@
use std::{
cmp, fmt,
fs::File,
future::Future,
io::{self, Read, Seek},
pin::Pin,
task::{Context, Poll},
};
use actix_web::{
error::{BlockingError, Error},
rt::task::{spawn_blocking, JoinHandle},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
#[doc(hidden)]
/// A helper created from a `std::fs::File` which reads the file
/// chunk-by-chunk on a `ThreadPool`.
pub struct ChunkedReadFile {
size: u64,
offset: u64,
state: ChunkedReadFileState,
counter: u64,
}
enum ChunkedReadFileState {
File(Option<File>),
Future(JoinHandle<Result<(File, Bytes), io::Error>>),
}
impl ChunkedReadFile {
pub(crate) fn new(size: u64, offset: u64, file: File) -> Self {
Self {
size,
offset,
state: ChunkedReadFileState::File(Some(file)),
counter: 0,
}
}
}
impl fmt::Debug for ChunkedReadFile {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.write_str("ChunkedReadFile")
}
}
impl Stream for ChunkedReadFile {
type Item = Result<Bytes, Error>;
fn poll_next(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Option<Self::Item>> {
let this = self.as_mut().get_mut();
match this.state {
ChunkedReadFileState::File(ref mut file) => {
let size = this.size;
let offset = this.offset;
let counter = this.counter;
if size == counter {
Poll::Ready(None)
} else {
let mut file = file
.take()
.expect("ChunkedReadFile polled after completion");
let fut = spawn_blocking(move || {
let max_bytes = cmp::min(size.saturating_sub(counter), 65_536) as usize;
let mut buf = Vec::with_capacity(max_bytes);
file.seek(io::SeekFrom::Start(offset))?;
let n_bytes =
file.by_ref().take(max_bytes as u64).read_to_end(&mut buf)?;
if n_bytes == 0 {
return Err(io::ErrorKind::UnexpectedEof.into());
}
Ok((file, Bytes::from(buf)))
});
this.state = ChunkedReadFileState::Future(fut);
self.poll_next(cx)
}
}
ChunkedReadFileState::Future(ref mut fut) => {
let (file, bytes) =
ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
this.state = ChunkedReadFileState::File(Some(file));
this.offset += bytes.len() as u64;
this.counter += bytes.len() as u64;
Poll::Ready(Some(Ok(bytes)))
}
}
}
}

View File

@ -1,112 +0,0 @@
use std::{fmt::Write, fs::DirEntry, io, path::Path, path::PathBuf};
use actix_web::{dev::ServiceResponse, HttpRequest, HttpResponse};
use askama_escape::{escape as escape_html_entity, Html};
use percent_encoding::{utf8_percent_encode, CONTROLS};
/// A directory; responds with the generated directory listing.
#[derive(Debug)]
pub struct Directory {
/// Base directory.
pub base: PathBuf,
/// Path of subdirectory to generate listing for.
pub path: PathBuf,
}
impl Directory {
/// Create a new directory
pub fn new(base: PathBuf, path: PathBuf) -> Directory {
Directory { base, path }
}
/// Is this entry visible from this directory?
pub fn is_visible(&self, entry: &io::Result<DirEntry>) -> bool {
if let Ok(ref entry) = *entry {
if let Some(name) = entry.file_name().to_str() {
if name.starts_with('.') {
return false;
}
}
if let Ok(ref md) = entry.metadata() {
let ft = md.file_type();
return ft.is_dir() || ft.is_file() || ft.is_symlink();
}
}
false
}
}
pub(crate) type DirectoryRenderer =
dyn Fn(&Directory, &HttpRequest) -> Result<ServiceResponse, io::Error>;
// show file url as relative to static path
macro_rules! encode_file_url {
($path:ident) => {
utf8_percent_encode(&$path, CONTROLS)
};
}
// " -- &quot; & -- &amp; ' -- &#x27; < -- &lt; > -- &gt; / -- &#x2f;
macro_rules! encode_file_name {
($entry:ident) => {
escape_html_entity(&$entry.file_name().to_string_lossy(), Html)
};
}
pub(crate) fn directory_listing(
dir: &Directory,
req: &HttpRequest,
) -> Result<ServiceResponse, io::Error> {
let index_of = format!("Index of {}", req.path());
let mut body = String::new();
let base = Path::new(req.path());
for entry in dir.path.read_dir()? {
if dir.is_visible(&entry) {
let entry = entry.unwrap();
let p = match entry.path().strip_prefix(&dir.path) {
Ok(p) if cfg!(windows) => base.join(p).to_string_lossy().replace("\\", "/"),
Ok(p) => base.join(p).to_string_lossy().into_owned(),
Err(_) => continue,
};
// if file is a directory, add '/' to the end of the name
if let Ok(metadata) = entry.metadata() {
if metadata.is_dir() {
let _ = write!(
body,
"<li><a href=\"{}\">{}/</a></li>",
encode_file_url!(p),
encode_file_name!(entry),
);
} else {
let _ = write!(
body,
"<li><a href=\"{}\">{}</a></li>",
encode_file_url!(p),
encode_file_name!(entry),
);
}
} else {
continue;
}
}
}
let html = format!(
"<html>\
<head><title>{}</title></head>\
<body><h1>{}</h1>\
<ul>\
{}\
</ul></body>\n</html>",
index_of, index_of, body
);
Ok(ServiceResponse::new(
req.clone(),
HttpResponse::Ok()
.content_type("text/html; charset=utf-8")
.body(html),
))
}

View File

@ -1,52 +0,0 @@
use mime::Mime;
/// Transforms MIME `text/*` types into their UTF-8 equivalent, if supported.
///
/// MIME types that are converted
/// - application/javascript
/// - text/html
/// - text/css
/// - text/plain
/// - text/csv
/// - text/tab-separated-values
pub(crate) fn equiv_utf8_text(ct: Mime) -> Mime {
// use (roughly) order of file-type popularity for a web server
if ct == mime::APPLICATION_JAVASCRIPT {
return mime::APPLICATION_JAVASCRIPT_UTF_8;
}
if ct == mime::TEXT_HTML {
return mime::TEXT_HTML_UTF_8;
}
if ct == mime::TEXT_CSS {
return mime::TEXT_CSS_UTF_8;
}
if ct == mime::TEXT_PLAIN {
return mime::TEXT_PLAIN_UTF_8;
}
if ct == mime::TEXT_CSV {
return mime::TEXT_CSV_UTF_8;
}
if ct == mime::TEXT_TAB_SEPARATED_VALUES {
return mime::TEXT_TAB_SEPARATED_VALUES_UTF_8;
}
ct
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_equiv_utf8_text() {
assert_eq!(equiv_utf8_text(mime::TEXT_PLAIN), mime::TEXT_PLAIN_UTF_8);
assert_eq!(equiv_utf8_text(mime::TEXT_XML), mime::TEXT_XML);
assert_eq!(equiv_utf8_text(mime::IMAGE_PNG), mime::IMAGE_PNG);
}
}

View File

@ -5,7 +5,6 @@ use derive_more::Display;
#[derive(Display, Debug, PartialEq)]
pub enum FilesError {
/// Path is not a directory
#[allow(dead_code)]
#[display(fmt = "Path is not a directory. Unable to serve static files")]
IsNotDirectory,
@ -36,7 +35,7 @@ pub enum UriSegmentError {
/// Return `BadRequest` for `UriSegmentError`
impl ResponseError for UriSegmentError {
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
fn error_response(&self) -> HttpResponse {
HttpResponse::new(StatusCode::BAD_REQUEST)
}
}

View File

@ -1,280 +0,0 @@
use std::{cell::RefCell, fmt, io, path::PathBuf, rc::Rc};
use actix_service::{boxed, IntoServiceFactory, ServiceFactory, ServiceFactoryExt};
use actix_web::{
dev::{AppService, HttpServiceFactory, ResourceDef, ServiceRequest, ServiceResponse},
error::Error,
guard::Guard,
http::header::DispositionType,
HttpRequest,
};
use futures_util::future::{ok, FutureExt, LocalBoxFuture};
use crate::{
directory_listing, named, Directory, DirectoryRenderer, FilesService, HttpNewService,
MimeOverride,
};
/// Static files handling service.
///
/// `Files` service must be registered with `App::service()` method.
///
/// ```rust
/// use actix_web::App;
/// use actix_files::Files;
///
/// let app = App::new()
/// .service(Files::new("/static", "."));
/// ```
pub struct Files {
path: String,
directory: PathBuf,
index: Option<String>,
show_index: bool,
redirect_to_slash: bool,
default: Rc<RefCell<Option<Rc<HttpNewService>>>>,
renderer: Rc<DirectoryRenderer>,
mime_override: Option<Rc<MimeOverride>>,
file_flags: named::Flags,
guards: Option<Rc<dyn Guard>>,
hidden_files: bool,
}
impl fmt::Debug for Files {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.write_str("Files")
}
}
impl Clone for Files {
fn clone(&self) -> Self {
Self {
directory: self.directory.clone(),
index: self.index.clone(),
show_index: self.show_index,
redirect_to_slash: self.redirect_to_slash,
default: self.default.clone(),
renderer: self.renderer.clone(),
file_flags: self.file_flags,
path: self.path.clone(),
mime_override: self.mime_override.clone(),
guards: self.guards.clone(),
hidden_files: self.hidden_files,
}
}
}
impl Files {
/// Create new `Files` instance for a specified base directory.
///
/// # Argument Order
/// The first argument (`mount_path`) is the root URL at which the static files are served.
/// For example, `/assets` will serve files at `example.com/assets/...`.
///
/// The second argument (`serve_from`) is the location on disk at which files are loaded.
/// This can be a relative path. For example, `./` would serve files from the current
/// working directory.
///
/// # Implementation Notes
/// If the mount path is set as the root path `/`, services registered after this one will
/// be inaccessible. Register more specific handlers and services first.
///
/// `Files` uses a threadpool for blocking filesystem operations. By default, the pool uses a
/// max number of threads equal to `512 * HttpServer::worker`. Real time thread count are
/// adjusted with work load. More threads would spawn when need and threads goes idle for a
/// period of time would be de-spawned.
pub fn new<T: Into<PathBuf>>(mount_path: &str, serve_from: T) -> Files {
let orig_dir = serve_from.into();
let dir = match orig_dir.canonicalize() {
Ok(canon_dir) => canon_dir,
Err(_) => {
log::error!("Specified path is not a directory: {:?}", orig_dir);
PathBuf::new()
}
};
Files {
path: mount_path.to_owned(),
directory: dir,
index: None,
show_index: false,
redirect_to_slash: false,
default: Rc::new(RefCell::new(None)),
renderer: Rc::new(directory_listing),
mime_override: None,
file_flags: named::Flags::default(),
guards: None,
hidden_files: false,
}
}
/// Show files listing for directories.
///
/// By default show files listing is disabled.
pub fn show_files_listing(mut self) -> Self {
self.show_index = true;
self
}
/// Redirects to a slash-ended path when browsing a directory.
///
/// By default never redirect.
pub fn redirect_to_slash_directory(mut self) -> Self {
self.redirect_to_slash = true;
self
}
/// Set custom directory renderer
pub fn files_listing_renderer<F>(mut self, f: F) -> Self
where
for<'r, 's> F:
Fn(&'r Directory, &'s HttpRequest) -> Result<ServiceResponse, io::Error> + 'static,
{
self.renderer = Rc::new(f);
self
}
/// Specifies mime override callback
pub fn mime_override<F>(mut self, f: F) -> Self
where
F: Fn(&mime::Name<'_>) -> DispositionType + 'static,
{
self.mime_override = Some(Rc::new(f));
self
}
/// Set index file
///
/// Shows specific index file for directory "/" instead of
/// showing files listing.
pub fn index_file<T: Into<String>>(mut self, index: T) -> Self {
self.index = Some(index.into());
self
}
/// Specifies whether to use ETag or not.
///
/// Default is true.
#[inline]
pub fn use_etag(mut self, value: bool) -> Self {
self.file_flags.set(named::Flags::ETAG, value);
self
}
/// Specifies whether to use Last-Modified or not.
///
/// Default is true.
#[inline]
pub fn use_last_modified(mut self, value: bool) -> Self {
self.file_flags.set(named::Flags::LAST_MD, value);
self
}
/// Specifies whether text responses should signal a UTF-8 encoding.
///
/// Default is false (but will default to true in a future version).
#[inline]
pub fn prefer_utf8(mut self, value: bool) -> Self {
self.file_flags.set(named::Flags::PREFER_UTF8, value);
self
}
/// Specifies custom guards to use for directory listings and files.
///
/// Default behaviour allows GET and HEAD.
#[inline]
pub fn use_guards<G: Guard + 'static>(mut self, guards: G) -> Self {
self.guards = Some(Rc::new(guards));
self
}
/// Disable `Content-Disposition` header.
///
/// By default Content-Disposition` header is enabled.
#[inline]
pub fn disable_content_disposition(mut self) -> Self {
self.file_flags.remove(named::Flags::CONTENT_DISPOSITION);
self
}
/// Sets default handler which is used when no matched file could be found.
pub fn default_handler<F, U>(mut self, f: F) -> Self
where
F: IntoServiceFactory<U, ServiceRequest>,
U: ServiceFactory<
ServiceRequest,
Config = (),
Response = ServiceResponse,
Error = Error,
> + 'static,
{
// create and configure default resource
self.default = Rc::new(RefCell::new(Some(Rc::new(boxed::factory(
f.into_factory().map_init_err(|_| ()),
)))));
self
}
/// Enables serving hidden files and directories, allowing a leading dots in url fragments.
#[inline]
pub fn use_hidden_files(mut self) -> Self {
self.hidden_files = true;
self
}
}
impl HttpServiceFactory for Files {
fn register(self, config: &mut AppService) {
if self.default.borrow().is_none() {
*self.default.borrow_mut() = Some(config.default_service());
}
let rdef = if config.is_root() {
ResourceDef::root_prefix(&self.path)
} else {
ResourceDef::prefix(&self.path)
};
config.register_service(rdef, None, self, None)
}
}
impl ServiceFactory<ServiceRequest> for Files {
type Response = ServiceResponse;
type Error = Error;
type Config = ();
type Service = FilesService;
type InitError = ();
type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: ()) -> Self::Future {
let mut srv = FilesService {
directory: self.directory.clone(),
index: self.index.clone(),
show_index: self.show_index,
redirect_to_slash: self.redirect_to_slash,
default: None,
renderer: self.renderer.clone(),
mime_override: self.mime_override.clone(),
file_flags: self.file_flags,
guards: self.guards.clone(),
hidden_files: self.hidden_files,
};
if let Some(ref default) = *self.default.borrow() {
default
.new_service(())
.map(move |result| match result {
Ok(default) => {
srv.default = Some(default);
Ok(srv)
}
Err(_) => Err(()),
})
.boxed_local()
} else {
ok(srv).boxed_local()
}
}
}

File diff suppressed because it is too large Load Diff

View File

@ -7,34 +7,32 @@ use std::time::{SystemTime, UNIX_EPOCH};
#[cfg(unix)]
use std::os::unix::fs::MetadataExt;
use actix_web::{
dev::{BodyEncoding, SizedStream},
http::{
header::{
self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
},
ContentEncoding, StatusCode,
},
HttpMessage, HttpRequest, HttpResponse, Responder,
};
use bitflags::bitflags;
use mime;
use mime_guess::from_path;
use actix_http::body::SizedStream;
use actix_web::http::header::{
self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
};
use actix_web::http::{ContentEncoding, StatusCode};
use actix_web::middleware::BodyEncoding;
use actix_web::{Error, HttpMessage, HttpRequest, HttpResponse, Responder};
use crate::range::HttpRange;
use crate::ChunkedReadFile;
use crate::{encoding::equiv_utf8_text, range::HttpRange};
bitflags! {
pub(crate) struct Flags: u8 {
const ETAG = 0b0000_0001;
const LAST_MD = 0b0000_0010;
const ETAG = 0b0000_0001;
const LAST_MD = 0b0000_0010;
const CONTENT_DISPOSITION = 0b0000_0100;
const PREFER_UTF8 = 0b0000_1000;
}
}
impl Default for Flags {
fn default() -> Self {
Flags::from_bits_truncate(0b0000_0111)
Flags::all()
}
}
@ -91,15 +89,12 @@ impl NamedFile {
};
let ct = from_path(&path).first_or_octet_stream();
let disposition = match ct.type_() {
let disposition_type = match ct.type_() {
mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
_ => DispositionType::Attachment,
};
let mut parameters =
vec![DispositionParam::Filename(String::from(filename.as_ref()))];
if !filename.is_ascii() {
parameters.push(DispositionParam::FilenameExt(ExtendedValue {
charset: Charset::Ext(String::from("UTF-8")),
@ -107,19 +102,16 @@ impl NamedFile {
value: filename.into_owned().into_bytes(),
}))
}
let cd = ContentDisposition {
disposition,
parameters,
disposition: disposition_type,
parameters: parameters,
};
(ct, cd)
};
let md = file.metadata()?;
let modified = md.modified().ok();
let encoding = None;
Ok(NamedFile {
path,
file,
@ -191,7 +183,7 @@ impl NamedFile {
/// image, and video content types, and `attachment` otherwise, and
/// the filename is taken from the path provided in the `open` method
/// after converting it to UTF-8 using.
/// [`std::ffi::OsStr::to_string_lossy`]
/// [to_string_lossy](https://doc.rust-lang.org/std/ffi/struct.OsStr.html#method.to_string_lossy).
#[inline]
pub fn set_content_disposition(mut self, cd: header::ContentDisposition) -> Self {
self.content_disposition = cd;
@ -215,33 +207,24 @@ impl NamedFile {
self
}
/// Specifies whether to use ETag or not.
///
/// Default is true.
#[inline]
///Specifies whether to use ETag or not.
///
///Default is true.
pub fn use_etag(mut self, value: bool) -> Self {
self.flags.set(Flags::ETAG, value);
self
}
/// Specifies whether to use Last-Modified or not.
///
/// Default is true.
#[inline]
///Specifies whether to use Last-Modified or not.
///
///Default is true.
pub fn use_last_modified(mut self, value: bool) -> Self {
self.flags.set(Flags::LAST_MD, value);
self
}
/// Specifies whether text responses should signal a UTF-8 encoding.
///
/// Default is false (but will default to true in a future version).
#[inline]
pub fn prefer_utf8(mut self, value: bool) -> Self {
self.flags.set(Flags::PREFER_UTF8, value);
self
}
pub(crate) fn etag(&self) -> Option<header::EntityTag> {
// This etag format is similar to Apache's.
self.modified.as_ref().map(|mtime| {
@ -259,7 +242,6 @@ impl NamedFile {
let dur = mtime
.duration_since(UNIX_EPOCH)
.expect("modification time must be after epoch");
header::EntityTag::strong(format!(
"{:x}:{:x}:{:x}:{:x}",
ino,
@ -273,152 +255,6 @@ impl NamedFile {
pub(crate) fn last_modified(&self) -> Option<header::HttpDate> {
self.modified.map(|mtime| mtime.into())
}
/// Creates an `HttpResponse` with file as a streaming body.
pub fn into_response(self, req: &HttpRequest) -> HttpResponse {
if self.status_code != StatusCode::OK {
let mut res = HttpResponse::build(self.status_code);
if self.flags.contains(Flags::PREFER_UTF8) {
let ct = equiv_utf8_text(self.content_type.clone());
res.insert_header((header::CONTENT_TYPE, ct.to_string()));
} else {
res.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
}
if self.flags.contains(Flags::CONTENT_DISPOSITION) {
res.insert_header((
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
));
}
if let Some(current_encoding) = self.encoding {
res.encoding(current_encoding);
}
let reader = ChunkedReadFile::new(self.md.len(), 0, self.file);
return res.streaming(reader);
}
let etag = if self.flags.contains(Flags::ETAG) {
self.etag()
} else {
None
};
let last_modified = if self.flags.contains(Flags::LAST_MD) {
self.last_modified()
} else {
None
};
// check preconditions
let precondition_failed = if !any_match(etag.as_ref(), req) {
true
} else if let (Some(ref m), Some(header::IfUnmodifiedSince(ref since))) =
(last_modified, req.get_header())
{
let t1: SystemTime = m.clone().into();
let t2: SystemTime = since.clone().into();
match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
(Ok(t1), Ok(t2)) => t1.as_secs() > t2.as_secs(),
_ => false,
}
} else {
false
};
// check last modified
let not_modified = if !none_match(etag.as_ref(), req) {
true
} else if req.headers().contains_key(header::IF_NONE_MATCH) {
false
} else if let (Some(ref m), Some(header::IfModifiedSince(ref since))) =
(last_modified, req.get_header())
{
let t1: SystemTime = m.clone().into();
let t2: SystemTime = since.clone().into();
match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
(Ok(t1), Ok(t2)) => t1.as_secs() <= t2.as_secs(),
_ => false,
}
} else {
false
};
let mut resp = HttpResponse::build(self.status_code);
if self.flags.contains(Flags::PREFER_UTF8) {
let ct = equiv_utf8_text(self.content_type.clone());
resp.insert_header((header::CONTENT_TYPE, ct.to_string()));
} else {
resp.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
}
if self.flags.contains(Flags::CONTENT_DISPOSITION) {
resp.insert_header((
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
));
}
// default compressing
if let Some(current_encoding) = self.encoding {
resp.encoding(current_encoding);
}
if let Some(lm) = last_modified {
resp.insert_header((header::LAST_MODIFIED, lm.to_string()));
}
if let Some(etag) = etag {
resp.insert_header((header::ETAG, etag.to_string()));
}
resp.insert_header((header::ACCEPT_RANGES, "bytes"));
let mut length = self.md.len();
let mut offset = 0;
// check for range header
if let Some(ranges) = req.headers().get(header::RANGE) {
if let Ok(ranges_header) = ranges.to_str() {
if let Ok(ranges) = HttpRange::parse(ranges_header, length) {
length = ranges[0].length;
offset = ranges[0].start;
resp.encoding(ContentEncoding::Identity);
resp.insert_header((
header::CONTENT_RANGE,
format!("bytes {}-{}/{}", offset, offset + length - 1, self.md.len()),
));
} else {
resp.insert_header((header::CONTENT_RANGE, format!("bytes */{}", length)));
return resp.status(StatusCode::RANGE_NOT_SATISFIABLE).finish();
};
} else {
return resp.status(StatusCode::BAD_REQUEST).finish();
};
};
if precondition_failed {
return resp.status(StatusCode::PRECONDITION_FAILED).finish();
} else if not_modified {
return resp.status(StatusCode::NOT_MODIFIED).finish();
}
let reader = ChunkedReadFile::new(length, offset, self.file);
if offset != 0 || length != self.md.len() {
resp.status(StatusCode::PARTIAL_CONTENT);
}
resp.body(SizedStream::new(length, reader))
}
}
impl Deref for NamedFile {
@ -439,7 +275,6 @@ impl DerefMut for NamedFile {
fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfMatch>() {
None | Some(header::IfMatch::Any) => true,
Some(header::IfMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
@ -448,7 +283,6 @@ fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
}
}
}
false
}
}
@ -458,7 +292,6 @@ fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfNoneMatch>() {
Some(header::IfNoneMatch::Any) => false,
Some(header::IfNoneMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
@ -467,16 +300,150 @@ fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
}
}
}
true
}
None => true,
}
}
impl Responder for NamedFile {
fn respond_to(self, req: &HttpRequest) -> HttpResponse {
self.into_response(req)
type Error = Error;
type Future = Result<HttpResponse, Error>;
fn respond_to(self, req: &HttpRequest) -> Self::Future {
if self.status_code != StatusCode::OK {
let mut resp = HttpResponse::build(self.status_code);
resp.set(header::ContentType(self.content_type.clone()))
.if_true(self.flags.contains(Flags::CONTENT_DISPOSITION), |res| {
res.header(
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
);
});
if let Some(current_encoding) = self.encoding {
resp.encoding(current_encoding);
}
let reader = ChunkedReadFile {
size: self.md.len(),
offset: 0,
file: Some(self.file),
fut: None,
counter: 0,
};
return Ok(resp.streaming(reader));
}
let etag = if self.flags.contains(Flags::ETAG) {
self.etag()
} else {
None
};
let last_modified = if self.flags.contains(Flags::LAST_MD) {
self.last_modified()
} else {
None
};
// check preconditions
let precondition_failed = if !any_match(etag.as_ref(), req) {
true
} else if let (Some(ref m), Some(header::IfUnmodifiedSince(ref since))) =
(last_modified, req.get_header())
{
let t1: SystemTime = m.clone().into();
let t2: SystemTime = since.clone().into();
match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
(Ok(t1), Ok(t2)) => t1 > t2,
_ => false,
}
} else {
false
};
// check last modified
let not_modified = if !none_match(etag.as_ref(), req) {
true
} else if req.headers().contains_key(&header::IF_NONE_MATCH) {
false
} else if let (Some(ref m), Some(header::IfModifiedSince(ref since))) =
(last_modified, req.get_header())
{
let t1: SystemTime = m.clone().into();
let t2: SystemTime = since.clone().into();
match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
(Ok(t1), Ok(t2)) => t1 <= t2,
_ => false,
}
} else {
false
};
let mut resp = HttpResponse::build(self.status_code);
resp.set(header::ContentType(self.content_type.clone()))
.if_true(self.flags.contains(Flags::CONTENT_DISPOSITION), |res| {
res.header(
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
);
});
// default compressing
if let Some(current_encoding) = self.encoding {
resp.encoding(current_encoding);
}
resp.if_some(last_modified, |lm, resp| {
resp.set(header::LastModified(lm));
})
.if_some(etag, |etag, resp| {
resp.set(header::ETag(etag));
});
resp.header(header::ACCEPT_RANGES, "bytes");
let mut length = self.md.len();
let mut offset = 0;
// check for range header
if let Some(ranges) = req.headers().get(&header::RANGE) {
if let Ok(rangesheader) = ranges.to_str() {
if let Ok(rangesvec) = HttpRange::parse(rangesheader, length) {
length = rangesvec[0].length;
offset = rangesvec[0].start;
resp.encoding(ContentEncoding::Identity);
resp.header(
header::CONTENT_RANGE,
format!(
"bytes {}-{}/{}",
offset,
offset + length - 1,
self.md.len()
),
);
} else {
resp.header(header::CONTENT_RANGE, format!("bytes */{}", length));
return Ok(resp.status(StatusCode::RANGE_NOT_SATISFIABLE).finish());
};
} else {
return Ok(resp.status(StatusCode::BAD_REQUEST).finish());
};
};
if precondition_failed {
return Ok(resp.status(StatusCode::PRECONDITION_FAILED).finish());
} else if not_modified {
return Ok(resp.status(StatusCode::NOT_MODIFIED).finish());
}
let reader = ChunkedReadFile {
offset,
size: length,
file: Some(self.file),
fut: None,
counter: 0,
};
if offset != 0 || length != self.md.len() {
return Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader));
};
Ok(resp.body(SizedStream::new(length, reader)))
}
}

View File

@ -1,119 +0,0 @@
use std::{
path::{Path, PathBuf},
str::FromStr,
};
use actix_web::{dev::Payload, FromRequest, HttpRequest};
use futures_util::future::{ready, Ready};
use crate::error::UriSegmentError;
#[derive(Debug)]
pub(crate) struct PathBufWrap(PathBuf);
impl FromStr for PathBufWrap {
type Err = UriSegmentError;
fn from_str(path: &str) -> Result<Self, Self::Err> {
Self::parse_path(path, false)
}
}
impl PathBufWrap {
/// Parse a path, giving the choice of allowing hidden files to be considered valid segments.
pub fn parse_path(path: &str, hidden_files: bool) -> Result<Self, UriSegmentError> {
let mut buf = PathBuf::new();
for segment in path.split('/') {
if segment == ".." {
buf.pop();
} else if !hidden_files && segment.starts_with('.') {
return Err(UriSegmentError::BadStart('.'));
} else if segment.starts_with('*') {
return Err(UriSegmentError::BadStart('*'));
} else if segment.ends_with(':') {
return Err(UriSegmentError::BadEnd(':'));
} else if segment.ends_with('>') {
return Err(UriSegmentError::BadEnd('>'));
} else if segment.ends_with('<') {
return Err(UriSegmentError::BadEnd('<'));
} else if segment.is_empty() {
continue;
} else if cfg!(windows) && segment.contains('\\') {
return Err(UriSegmentError::BadChar('\\'));
} else {
buf.push(segment)
}
}
Ok(PathBufWrap(buf))
}
}
impl AsRef<Path> for PathBufWrap {
fn as_ref(&self) -> &Path {
self.0.as_ref()
}
}
impl FromRequest for PathBufWrap {
type Error = UriSegmentError;
type Future = Ready<Result<Self, Self::Error>>;
type Config = ();
fn from_request(req: &HttpRequest, _: &mut Payload) -> Self::Future {
ready(req.match_info().path().parse())
}
}
#[cfg(test)]
mod tests {
use std::iter::FromIterator;
use super::*;
#[test]
fn test_path_buf() {
assert_eq!(
PathBufWrap::from_str("/test/.tt").map(|t| t.0),
Err(UriSegmentError::BadStart('.'))
);
assert_eq!(
PathBufWrap::from_str("/test/*tt").map(|t| t.0),
Err(UriSegmentError::BadStart('*'))
);
assert_eq!(
PathBufWrap::from_str("/test/tt:").map(|t| t.0),
Err(UriSegmentError::BadEnd(':'))
);
assert_eq!(
PathBufWrap::from_str("/test/tt<").map(|t| t.0),
Err(UriSegmentError::BadEnd('<'))
);
assert_eq!(
PathBufWrap::from_str("/test/tt>").map(|t| t.0),
Err(UriSegmentError::BadEnd('>'))
);
assert_eq!(
PathBufWrap::from_str("/seg1/seg2/").unwrap().0,
PathBuf::from_iter(vec!["seg1", "seg2"])
);
assert_eq!(
PathBufWrap::from_str("/seg1/../seg2/").unwrap().0,
PathBuf::from_iter(vec!["seg2"])
);
}
#[test]
fn test_parse_path() {
assert_eq!(
PathBufWrap::parse_path("/test/.tt", false).map(|t| t.0),
Err(UriSegmentError::BadStart('.'))
);
assert_eq!(
PathBufWrap::parse_path("/test/.tt", true).unwrap().0,
PathBuf::from_iter(vec!["test", ".tt"])
);
}
}

View File

@ -1,35 +1,95 @@
use derive_more::{Display, Error};
/// HTTP Range header representation.
#[derive(Debug, Clone, Copy)]
pub struct HttpRange {
/// Start of range.
pub start: u64,
/// Length of range.
pub length: u64,
}
#[derive(Debug, Clone, Display, Error)]
#[display(fmt = "Parse HTTP Range failed")]
pub struct ParseRangeErr(#[error(not(source))] ());
static PREFIX: &str = "bytes=";
const PREFIX_LEN: usize = 6;
impl HttpRange {
/// Parses Range HTTP header string as per RFC 2616.
///
/// `header` is HTTP Range header (e.g. `bytes=bytes=0-9`).
/// `size` is full size of response (file).
pub fn parse(header: &str, size: u64) -> Result<Vec<HttpRange>, ParseRangeErr> {
match http_range::HttpRange::parse(header, size) {
Ok(ranges) => Ok(ranges
.iter()
.map(|range| HttpRange {
start: range.start,
length: range.length,
})
.collect()),
Err(_) => Err(ParseRangeErr(())),
pub fn parse(header: &str, size: u64) -> Result<Vec<HttpRange>, ()> {
if header.is_empty() {
return Ok(Vec::new());
}
if !header.starts_with(PREFIX) {
return Err(());
}
let size_sig = size as i64;
let mut no_overlap = false;
let all_ranges: Vec<Option<HttpRange>> = header[PREFIX_LEN..]
.split(',')
.map(|x| x.trim())
.filter(|x| !x.is_empty())
.map(|ra| {
let mut start_end_iter = ra.split('-');
let start_str = start_end_iter.next().ok_or(())?.trim();
let end_str = start_end_iter.next().ok_or(())?.trim();
if start_str.is_empty() {
// If no start is specified, end specifies the
// range start relative to the end of the file.
let mut length: i64 = end_str.parse().map_err(|_| ())?;
if length > size_sig {
length = size_sig;
}
Ok(Some(HttpRange {
start: (size_sig - length) as u64,
length: length as u64,
}))
} else {
let start: i64 = start_str.parse().map_err(|_| ())?;
if start < 0 {
return Err(());
}
if start >= size_sig {
no_overlap = true;
return Ok(None);
}
let length = if end_str.is_empty() {
// If no end is specified, range extends to end of the file.
size_sig - start
} else {
let mut end: i64 = end_str.parse().map_err(|_| ())?;
if start > end {
return Err(());
}
if end >= size_sig {
end = size_sig - 1;
}
end - start + 1
};
Ok(Some(HttpRange {
start: start as u64,
length: length as u64,
}))
}
})
.collect::<Result<_, _>>()?;
let ranges: Vec<HttpRange> = all_ranges.into_iter().filter_map(|x| x).collect();
if no_overlap && ranges.is_empty() {
return Err(());
}
Ok(ranges)
}
}
@ -270,7 +330,8 @@ mod tests {
if expected.is_empty() {
continue;
} else {
panic!(
assert!(
false,
"parse({}, {}) returned error {:?}",
header,
size,
@ -282,24 +343,28 @@ mod tests {
let got = res.unwrap();
if got.len() != expected.len() {
panic!(
assert!(
false,
"len(parseRange({}, {})) = {}, want {}",
header,
size,
got.len(),
expected.len()
);
continue;
}
for i in 0..expected.len() {
if got[i].start != expected[i].start {
panic!(
assert!(
false,
"parseRange({}, {})[{}].start = {}, want {}",
header, size, i, got[i].start, expected[i].start
)
}
if got[i].length != expected[i].length {
panic!(
assert!(
false,
"parseRange({}, {})[{}].length = {}, want {}",
header, size, i, got[i].length, expected[i].length
)

View File

@ -1,154 +0,0 @@
use std::{fmt, io, path::PathBuf, rc::Rc, task::Poll};
use actix_service::Service;
use actix_web::{
dev::{ServiceRequest, ServiceResponse},
error::Error,
guard::Guard,
http::{header, Method},
HttpResponse,
};
use futures_util::future::{ok, Either, LocalBoxFuture, Ready};
use crate::{
named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride, NamedFile,
PathBufWrap,
};
/// Assembled file serving service.
pub struct FilesService {
pub(crate) directory: PathBuf,
pub(crate) index: Option<String>,
pub(crate) show_index: bool,
pub(crate) redirect_to_slash: bool,
pub(crate) default: Option<HttpService>,
pub(crate) renderer: Rc<DirectoryRenderer>,
pub(crate) mime_override: Option<Rc<MimeOverride>>,
pub(crate) file_flags: named::Flags,
pub(crate) guards: Option<Rc<dyn Guard>>,
pub(crate) hidden_files: bool,
}
type FilesServiceFuture = Either<
Ready<Result<ServiceResponse, Error>>,
LocalBoxFuture<'static, Result<ServiceResponse, Error>>,
>;
impl FilesService {
fn handle_err(&self, e: io::Error, req: ServiceRequest) -> FilesServiceFuture {
log::debug!("Failed to handle {}: {}", req.path(), e);
if let Some(ref default) = self.default {
Either::Right(default.call(req))
} else {
Either::Left(ok(req.error_response(e)))
}
}
}
impl fmt::Debug for FilesService {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.write_str("FilesService")
}
}
impl Service<ServiceRequest> for FilesService {
type Response = ServiceResponse;
type Error = Error;
type Future = FilesServiceFuture;
actix_service::always_ready!();
fn call(&self, req: ServiceRequest) -> Self::Future {
let is_method_valid = if let Some(guard) = &self.guards {
// execute user defined guards
(**guard).check(req.head())
} else {
// default behavior
matches!(*req.method(), Method::HEAD | Method::GET)
};
if !is_method_valid {
return Either::Left(ok(req.into_response(
actix_web::HttpResponse::MethodNotAllowed()
.insert_header(header::ContentType(mime::TEXT_PLAIN_UTF_8))
.body("Request did not meet this resource's requirements."),
)));
}
let real_path =
match PathBufWrap::parse_path(req.match_info().path(), self.hidden_files) {
Ok(item) => item,
Err(e) => return Either::Left(ok(req.error_response(e))),
};
// full file path
let path = match self.directory.join(&real_path).canonicalize() {
Ok(path) => path,
Err(e) => return self.handle_err(e, req),
};
if path.is_dir() {
if let Some(ref redir_index) = self.index {
if self.redirect_to_slash && !req.path().ends_with('/') {
let redirect_to = format!("{}/", req.path());
return Either::Left(ok(req.into_response(
HttpResponse::Found()
.insert_header((header::LOCATION, redirect_to))
.body("")
.into_body(),
)));
}
let path = path.join(redir_index);
match NamedFile::open(path) {
Ok(mut named_file) => {
if let Some(ref mime_override) = self.mime_override {
let new_disposition =
mime_override(&named_file.content_type.type_());
named_file.content_disposition.disposition = new_disposition;
}
named_file.flags = self.file_flags;
let (req, _) = req.into_parts();
let res = named_file.into_response(&req);
Either::Left(ok(ServiceResponse::new(req, res)))
}
Err(e) => self.handle_err(e, req),
}
} else if self.show_index {
let dir = Directory::new(self.directory.clone(), path);
let (req, _) = req.into_parts();
let x = (self.renderer)(&dir, &req);
match x {
Ok(resp) => Either::Left(ok(resp)),
Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
}
} else {
Either::Left(ok(ServiceResponse::from_err(
FilesError::IsDirectory,
req.into_parts().0,
)))
}
} else {
match NamedFile::open(path) {
Ok(mut named_file) => {
if let Some(ref mime_override) = self.mime_override {
let new_disposition = mime_override(&named_file.content_type.type_());
named_file.content_disposition.disposition = new_disposition;
}
named_file.flags = self.file_flags;
let (req, _) = req.into_parts();
let res = named_file.into_response(&req);
Either::Left(ok(ServiceResponse::new(req, res)))
}
Err(e) => self.handle_err(e, req),
}
}
}
}

View File

@ -1,38 +0,0 @@
use actix_files::Files;
use actix_web::{
http::{
header::{self, HeaderValue},
StatusCode,
},
test::{self, TestRequest},
App,
};
#[actix_rt::test]
async fn test_utf8_file_contents() {
// use default ISO-8859-1 encoding
let srv = test::init_service(App::new().service(Files::new("/", "./tests"))).await;
let req = TestRequest::with_uri("/utf8.txt").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
assert_eq!(
res.headers().get(header::CONTENT_TYPE),
Some(&HeaderValue::from_static("text/plain")),
);
// prefer UTF-8 encoding
let srv =
test::init_service(App::new().service(Files::new("/", "./tests").prefer_utf8(true)))
.await;
let req = TestRequest::with_uri("/utf8.txt").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
assert_eq!(
res.headers().get(header::CONTENT_TYPE),
Some(&HeaderValue::from_static("text/plain; charset=utf-8")),
);
}

View File

@ -1,3 +0,0 @@
中文内容显示正确。
English is OK.

38
actix-framed/Cargo.toml Normal file
View File

@ -0,0 +1,38 @@
[package]
name = "actix-framed"
version = "0.2.1"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix framed app server"
readme = "README.md"
keywords = ["http", "web", "framework", "async", "futures"]
homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-framed/"
categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT/Apache-2.0"
edition = "2018"
workspace =".."
[lib]
name = "actix_framed"
path = "src/lib.rs"
[dependencies]
actix-codec = "0.1.2"
actix-service = "0.4.1"
actix-router = "0.1.2"
actix-rt = "0.2.2"
actix-http = "0.2.7"
actix-server-config = "0.1.2"
bytes = "0.4"
futures = "0.1.25"
log = "0.4"
[dev-dependencies]
actix-server = { version = "0.6.0", features=["ssl"] }
actix-connect = { version = "0.2.0", features=["ssl"] }
actix-http-test = { version = "0.2.4", features=["ssl"] }
actix-utils = "0.4.4"

201
actix-framed/LICENSE-APACHE Normal file
View File

@ -0,0 +1,201 @@
Apache License
Version 2.0, January 2004
http://www.apache.org/licenses/
TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
1. Definitions.
"License" shall mean the terms and conditions for use, reproduction,
and distribution as defined by Sections 1 through 9 of this document.
"Licensor" shall mean the copyright owner or entity authorized by
the copyright owner that is granting the License.
"Legal Entity" shall mean the union of the acting entity and all
other entities that control, are controlled by, or are under common
control with that entity. For the purposes of this definition,
"control" means (i) the power, direct or indirect, to cause the
direction or management of such entity, whether by contract or
otherwise, or (ii) ownership of fifty percent (50%) or more of the
outstanding shares, or (iii) beneficial ownership of such entity.
"You" (or "Your") shall mean an individual or Legal Entity
exercising permissions granted by this License.
"Source" form shall mean the preferred form for making modifications,
including but not limited to software source code, documentation
source, and configuration files.
"Object" form shall mean any form resulting from mechanical
transformation or translation of a Source form, including but
not limited to compiled object code, generated documentation,
and conversions to other media types.
"Work" shall mean the work of authorship, whether in Source or
Object form, made available under the License, as indicated by a
copyright notice that is included in or attached to the work
(an example is provided in the Appendix below).
"Derivative Works" shall mean any work, whether in Source or Object
form, that is based on (or derived from) the Work and for which the
editorial revisions, annotations, elaborations, or other modifications
represent, as a whole, an original work of authorship. For the purposes
of this License, Derivative Works shall not include works that remain
separable from, or merely link (or bind by name) to the interfaces of,
the Work and Derivative Works thereof.
"Contribution" shall mean any work of authorship, including
the original version of the Work and any modifications or additions
to that Work or Derivative Works thereof, that is intentionally
submitted to Licensor for inclusion in the Work by the copyright owner
or by an individual or Legal Entity authorized to submit on behalf of
the copyright owner. For the purposes of this definition, "submitted"
means any form of electronic, verbal, or written communication sent
to the Licensor or its representatives, including but not limited to
communication on electronic mailing lists, source code control systems,
and issue tracking systems that are managed by, or on behalf of, the
Licensor for the purpose of discussing and improving the Work, but
excluding communication that is conspicuously marked or otherwise
designated in writing by the copyright owner as "Not a Contribution."
"Contributor" shall mean Licensor and any individual or Legal Entity
on behalf of whom a Contribution has been received by Licensor and
subsequently incorporated within the Work.
2. Grant of Copyright License. Subject to the terms and conditions of
this License, each Contributor hereby grants to You a perpetual,
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
copyright license to reproduce, prepare Derivative Works of,
publicly display, publicly perform, sublicense, and distribute the
Work and such Derivative Works in Source or Object form.
3. Grant of Patent License. Subject to the terms and conditions of
this License, each Contributor hereby grants to You a perpetual,
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
(except as stated in this section) patent license to make, have made,
use, offer to sell, sell, import, and otherwise transfer the Work,
where such license applies only to those patent claims licensable
by such Contributor that are necessarily infringed by their
Contribution(s) alone or by combination of their Contribution(s)
with the Work to which such Contribution(s) was submitted. If You
institute patent litigation against any entity (including a
cross-claim or counterclaim in a lawsuit) alleging that the Work
or a Contribution incorporated within the Work constitutes direct
or contributory patent infringement, then any patent licenses
granted to You under this License for that Work shall terminate
as of the date such litigation is filed.
4. Redistribution. You may reproduce and distribute copies of the
Work or Derivative Works thereof in any medium, with or without
modifications, and in Source or Object form, provided that You
meet the following conditions:
(a) You must give any other recipients of the Work or
Derivative Works a copy of this License; and
(b) You must cause any modified files to carry prominent notices
stating that You changed the files; and
(c) You must retain, in the Source form of any Derivative Works
that You distribute, all copyright, patent, trademark, and
attribution notices from the Source form of the Work,
excluding those notices that do not pertain to any part of
the Derivative Works; and
(d) If the Work includes a "NOTICE" text file as part of its
distribution, then any Derivative Works that You distribute must
include a readable copy of the attribution notices contained
within such NOTICE file, excluding those notices that do not
pertain to any part of the Derivative Works, in at least one
of the following places: within a NOTICE text file distributed
as part of the Derivative Works; within the Source form or
documentation, if provided along with the Derivative Works; or,
within a display generated by the Derivative Works, if and
wherever such third-party notices normally appear. The contents
of the NOTICE file are for informational purposes only and
do not modify the License. You may add Your own attribution
notices within Derivative Works that You distribute, alongside
or as an addendum to the NOTICE text from the Work, provided
that such additional attribution notices cannot be construed
as modifying the License.
You may add Your own copyright statement to Your modifications and
may provide additional or different license terms and conditions
for use, reproduction, or distribution of Your modifications, or
for any such Derivative Works as a whole, provided Your use,
reproduction, and distribution of the Work otherwise complies with
the conditions stated in this License.
5. Submission of Contributions. Unless You explicitly state otherwise,
any Contribution intentionally submitted for inclusion in the Work
by You to the Licensor shall be under the terms and conditions of
this License, without any additional terms or conditions.
Notwithstanding the above, nothing herein shall supersede or modify
the terms of any separate license agreement you may have executed
with Licensor regarding such Contributions.
6. Trademarks. This License does not grant permission to use the trade
names, trademarks, service marks, or product names of the Licensor,
except as required for reasonable and customary use in describing the
origin of the Work and reproducing the content of the NOTICE file.
7. Disclaimer of Warranty. Unless required by applicable law or
agreed to in writing, Licensor provides the Work (and each
Contributor provides its Contributions) on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
implied, including, without limitation, any warranties or conditions
of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
PARTICULAR PURPOSE. You are solely responsible for determining the
appropriateness of using or redistributing the Work and assume any
risks associated with Your exercise of permissions under this License.
8. Limitation of Liability. In no event and under no legal theory,
whether in tort (including negligence), contract, or otherwise,
unless required by applicable law (such as deliberate and grossly
negligent acts) or agreed to in writing, shall any Contributor be
liable to You for damages, including any direct, indirect, special,
incidental, or consequential damages of any character arising as a
result of this License or out of the use or inability to use the
Work (including but not limited to damages for loss of goodwill,
work stoppage, computer failure or malfunction, or any and all
other commercial damages or losses), even if such Contributor
has been advised of the possibility of such damages.
9. Accepting Warranty or Additional Liability. While redistributing
the Work or Derivative Works thereof, You may choose to offer,
and charge a fee for, acceptance of support, warranty, indemnity,
or other liability obligations and/or rights consistent with this
License. However, in accepting such obligations, You may act only
on Your own behalf and on Your sole responsibility, not on behalf
of any other Contributor, and only if You agree to indemnify,
defend, and hold each Contributor harmless for any liability
incurred by, or claims asserted against, such Contributor by reason
of your accepting any such warranty or additional liability.
END OF TERMS AND CONDITIONS
APPENDIX: How to apply the Apache License to your work.
To apply the Apache License to your work, attach the following
boilerplate notice, with the fields enclosed by brackets "{}"
replaced with your own identifying information. (Don't include
the brackets!) The text should be enclosed in the appropriate
comment syntax for the file format. We also recommend that a
file or class name and description of purpose be included on the
same "printed page" as the copyright notice for easier
identification within third-party archives.
Copyright 2017-NOW Nikolay Kim
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.

25
actix-framed/LICENSE-MIT Normal file
View File

@ -0,0 +1,25 @@
Copyright (c) 2017 Nikolay Kim
Permission is hereby granted, free of charge, to any
person obtaining a copy of this software and associated
documentation files (the "Software"), to deal in the
Software without restriction, including without
limitation the rights to use, copy, modify, merge,
publish, distribute, sublicense, and/or sell copies of
the Software, and to permit persons to whom the Software
is furnished to do so, subject to the following
conditions:
The above copyright notice and this permission notice
shall be included in all copies or substantial portions
of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF
ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED
TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A
PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT
SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR
IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
DEALINGS IN THE SOFTWARE.

8
actix-framed/README.md Normal file
View File

@ -0,0 +1,8 @@
# Framed app for actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-framed)](https://crates.io/crates/actix-framed) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & community resources
* [API Documentation](https://docs.rs/actix-framed/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-framed](https://crates.io/crates/actix-framed)
* Minimum supported Rust version: 1.33 or later

20
actix-framed/changes.md Normal file
View File

@ -0,0 +1,20 @@
# Changes
## [0.2.1] - 2019-07-20
* Remove unneeded actix-utils dependency
## [0.2.0] - 2019-05-12
* Update dependencies
## [0.1.0] - 2019-04-16
* Update tests
## [0.1.0-alpha.1] - 2019-04-12
* Initial release

217
actix-framed/src/app.rs Normal file
View File

@ -0,0 +1,217 @@
use std::rc::Rc;
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_http::h1::{Codec, SendResponse};
use actix_http::{Error, Request, Response};
use actix_router::{Path, Router, Url};
use actix_server_config::ServerConfig;
use actix_service::{IntoNewService, NewService, Service};
use futures::{Async, Future, Poll};
use crate::helpers::{BoxedHttpNewService, BoxedHttpService, HttpNewService};
use crate::request::FramedRequest;
use crate::state::State;
type BoxedResponse = Box<dyn Future<Item = (), Error = Error>>;
pub trait HttpServiceFactory {
type Factory: NewService;
fn path(&self) -> &str;
fn create(self) -> Self::Factory;
}
/// Application builder
pub struct FramedApp<T, S = ()> {
state: State<S>,
services: Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>,
}
impl<T: 'static> FramedApp<T, ()> {
pub fn new() -> Self {
FramedApp {
state: State::new(()),
services: Vec::new(),
}
}
}
impl<T: 'static, S: 'static> FramedApp<T, S> {
pub fn with(state: S) -> FramedApp<T, S> {
FramedApp {
services: Vec::new(),
state: State::new(state),
}
}
pub fn service<U>(mut self, factory: U) -> Self
where
U: HttpServiceFactory,
U::Factory: NewService<
Config = (),
Request = FramedRequest<T, S>,
Response = (),
Error = Error,
InitError = (),
> + 'static,
<U::Factory as NewService>::Future: 'static,
<U::Factory as NewService>::Service: Service<
Request = FramedRequest<T, S>,
Response = (),
Error = Error,
Future = Box<dyn Future<Item = (), Error = Error>>,
>,
{
let path = factory.path().to_string();
self.services
.push((path, Box::new(HttpNewService::new(factory.create()))));
self
}
}
impl<T, S> IntoNewService<FramedAppFactory<T, S>> for FramedApp<T, S>
where
T: AsyncRead + AsyncWrite + 'static,
S: 'static,
{
fn into_new_service(self) -> FramedAppFactory<T, S> {
FramedAppFactory {
state: self.state,
services: Rc::new(self.services),
}
}
}
#[derive(Clone)]
pub struct FramedAppFactory<T, S> {
state: State<S>,
services: Rc<Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>>,
}
impl<T, S> NewService for FramedAppFactory<T, S>
where
T: AsyncRead + AsyncWrite + 'static,
S: 'static,
{
type Config = ServerConfig;
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type InitError = ();
type Service = FramedAppService<T, S>;
type Future = CreateService<T, S>;
fn new_service(&self, _: &ServerConfig) -> Self::Future {
CreateService {
fut: self
.services
.iter()
.map(|(path, service)| {
CreateServiceItem::Future(
Some(path.clone()),
service.new_service(&()),
)
})
.collect(),
state: self.state.clone(),
}
}
}
#[doc(hidden)]
pub struct CreateService<T, S> {
fut: Vec<CreateServiceItem<T, S>>,
state: State<S>,
}
enum CreateServiceItem<T, S> {
Future(
Option<String>,
Box<dyn Future<Item = BoxedHttpService<FramedRequest<T, S>>, Error = ()>>,
),
Service(String, BoxedHttpService<FramedRequest<T, S>>),
}
impl<S: 'static, T: 'static> Future for CreateService<T, S>
where
T: AsyncRead + AsyncWrite,
{
type Item = FramedAppService<T, S>;
type Error = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let mut done = true;
// poll http services
for item in &mut self.fut {
let res = match item {
CreateServiceItem::Future(ref mut path, ref mut fut) => {
match fut.poll()? {
Async::Ready(service) => Some((path.take().unwrap(), service)),
Async::NotReady => {
done = false;
None
}
}
}
CreateServiceItem::Service(_, _) => continue,
};
if let Some((path, service)) = res {
*item = CreateServiceItem::Service(path, service);
}
}
if done {
let router = self
.fut
.drain(..)
.fold(Router::build(), |mut router, item| {
match item {
CreateServiceItem::Service(path, service) => {
router.path(&path, service);
}
CreateServiceItem::Future(_, _) => unreachable!(),
}
router
});
Ok(Async::Ready(FramedAppService {
router: router.finish(),
state: self.state.clone(),
}))
} else {
Ok(Async::NotReady)
}
}
}
pub struct FramedAppService<T, S> {
state: State<S>,
router: Router<BoxedHttpService<FramedRequest<T, S>>>,
}
impl<S: 'static, T: 'static> Service for FramedAppService<T, S>
where
T: AsyncRead + AsyncWrite,
{
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type Future = BoxedResponse;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
}
fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
let mut path = Path::new(Url::new(req.uri().clone()));
if let Some((srv, _info)) = self.router.recognize_mut(&mut path) {
return srv.call(FramedRequest::new(req, framed, path, self.state.clone()));
}
Box::new(
SendResponse::new(framed, Response::NotFound().finish()).then(|_| Ok(())),
)
}
}

View File

@ -0,0 +1,90 @@
use actix_http::Error;
use actix_service::{NewService, Service};
use futures::{Future, Poll};
pub(crate) type BoxedHttpService<Req> = Box<
dyn Service<
Request = Req,
Response = (),
Error = Error,
Future = Box<dyn Future<Item = (), Error = Error>>,
>,
>;
pub(crate) type BoxedHttpNewService<Req> = Box<
dyn NewService<
Config = (),
Request = Req,
Response = (),
Error = Error,
InitError = (),
Service = BoxedHttpService<Req>,
Future = Box<dyn Future<Item = BoxedHttpService<Req>, Error = ()>>,
>,
>;
pub(crate) struct HttpNewService<T: NewService>(T);
impl<T> HttpNewService<T>
where
T: NewService<Response = (), Error = Error>,
T::Response: 'static,
T::Future: 'static,
T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static,
<T::Service as Service>::Future: 'static,
{
pub fn new(service: T) -> Self {
HttpNewService(service)
}
}
impl<T> NewService for HttpNewService<T>
where
T: NewService<Config = (), Response = (), Error = Error>,
T::Request: 'static,
T::Future: 'static,
T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static,
<T::Service as Service>::Future: 'static,
{
type Config = ();
type Request = T::Request;
type Response = ();
type Error = Error;
type InitError = ();
type Service = BoxedHttpService<T::Request>;
type Future = Box<dyn Future<Item = Self::Service, Error = ()>>;
fn new_service(&self, _: &()) -> Self::Future {
Box::new(self.0.new_service(&()).map_err(|_| ()).and_then(|service| {
let service: BoxedHttpService<_> = Box::new(HttpServiceWrapper { service });
Ok(service)
}))
}
}
struct HttpServiceWrapper<T: Service> {
service: T,
}
impl<T> Service for HttpServiceWrapper<T>
where
T: Service<
Response = (),
Future = Box<dyn Future<Item = (), Error = Error>>,
Error = Error,
>,
T::Request: 'static,
{
type Request = T::Request;
type Response = ();
type Error = Error;
type Future = Box<dyn Future<Item = (), Error = Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.service.poll_ready()
}
fn call(&mut self, req: Self::Request) -> Self::Future {
self.service.call(req)
}
}

17
actix-framed/src/lib.rs Normal file
View File

@ -0,0 +1,17 @@
#![allow(clippy::type_complexity, clippy::new_without_default, dead_code)]
mod app;
mod helpers;
mod request;
mod route;
mod service;
mod state;
pub mod test;
// re-export for convinience
pub use actix_http::{http, Error, HttpMessage, Response, ResponseError};
pub use self::app::{FramedApp, FramedAppService};
pub use self::request::FramedRequest;
pub use self::route::FramedRoute;
pub use self::service::{SendError, VerifyWebSockets};
pub use self::state::State;

170
actix-framed/src/request.rs Normal file
View File

@ -0,0 +1,170 @@
use std::cell::{Ref, RefMut};
use actix_codec::Framed;
use actix_http::http::{HeaderMap, Method, Uri, Version};
use actix_http::{h1::Codec, Extensions, Request, RequestHead};
use actix_router::{Path, Url};
use crate::state::State;
pub struct FramedRequest<Io, S = ()> {
req: Request,
framed: Framed<Io, Codec>,
state: State<S>,
pub(crate) path: Path<Url>,
}
impl<Io, S> FramedRequest<Io, S> {
pub fn new(
req: Request,
framed: Framed<Io, Codec>,
path: Path<Url>,
state: State<S>,
) -> Self {
Self {
req,
framed,
state,
path,
}
}
}
impl<Io, S> FramedRequest<Io, S> {
/// Split request into a parts
pub fn into_parts(self) -> (Request, Framed<Io, Codec>, State<S>) {
(self.req, self.framed, self.state)
}
/// This method returns reference to the request head
#[inline]
pub fn head(&self) -> &RequestHead {
self.req.head()
}
/// This method returns muttable reference to the request head.
/// panics if multiple references of http request exists.
#[inline]
pub fn head_mut(&mut self) -> &mut RequestHead {
self.req.head_mut()
}
/// Shared application state
#[inline]
pub fn state(&self) -> &S {
self.state.get_ref()
}
/// Request's uri.
#[inline]
pub fn uri(&self) -> &Uri {
&self.head().uri
}
/// Read the Request method.
#[inline]
pub fn method(&self) -> &Method {
&self.head().method
}
/// Read the Request Version.
#[inline]
pub fn version(&self) -> Version {
self.head().version
}
#[inline]
/// Returns request's headers.
pub fn headers(&self) -> &HeaderMap {
&self.head().headers
}
/// The target path of this Request.
#[inline]
pub fn path(&self) -> &str {
self.head().uri.path()
}
/// The query string in the URL.
///
/// E.g., id=10
#[inline]
pub fn query_string(&self) -> &str {
if let Some(query) = self.uri().query().as_ref() {
query
} else {
""
}
}
/// Get a reference to the Path parameters.
///
/// Params is a container for url parameters.
/// A variable segment is specified in the form `{identifier}`,
/// where the identifier can be used later in a request handler to
/// access the matched value for that segment.
#[inline]
pub fn match_info(&self) -> &Path<Url> {
&self.path
}
/// Request extensions
#[inline]
pub fn extensions(&self) -> Ref<Extensions> {
self.head().extensions()
}
/// Mutable reference to a the request's extensions
#[inline]
pub fn extensions_mut(&self) -> RefMut<Extensions> {
self.head().extensions_mut()
}
}
#[cfg(test)]
mod tests {
use actix_http::http::{HeaderName, HeaderValue, HttpTryFrom};
use actix_http::test::{TestBuffer, TestRequest};
use super::*;
#[test]
fn test_reqest() {
let buf = TestBuffer::empty();
let framed = Framed::new(buf, Codec::default());
let req = TestRequest::with_uri("/index.html?q=1")
.header("content-type", "test")
.finish();
let path = Path::new(Url::new(req.uri().clone()));
let mut freq = FramedRequest::new(req, framed, path, State::new(10u8));
assert_eq!(*freq.state(), 10);
assert_eq!(freq.version(), Version::HTTP_11);
assert_eq!(freq.method(), Method::GET);
assert_eq!(freq.path(), "/index.html");
assert_eq!(freq.query_string(), "q=1");
assert_eq!(
freq.headers()
.get("content-type")
.unwrap()
.to_str()
.unwrap(),
"test"
);
freq.head_mut().headers.insert(
HeaderName::try_from("x-hdr").unwrap(),
HeaderValue::from_static("test"),
);
assert_eq!(
freq.headers().get("x-hdr").unwrap().to_str().unwrap(),
"test"
);
freq.extensions_mut().insert(100usize);
assert_eq!(*freq.extensions().get::<usize>().unwrap(), 100usize);
let (_, _, state) = freq.into_parts();
assert_eq!(*state, 10);
}
}

157
actix-framed/src/route.rs Normal file
View File

@ -0,0 +1,157 @@
use std::fmt;
use std::marker::PhantomData;
use actix_codec::{AsyncRead, AsyncWrite};
use actix_http::{http::Method, Error};
use actix_service::{NewService, Service};
use futures::future::{ok, FutureResult};
use futures::{Async, Future, IntoFuture, Poll};
use log::error;
use crate::app::HttpServiceFactory;
use crate::request::FramedRequest;
/// Resource route definition
///
/// Route uses builder-like pattern for configuration.
/// If handler is not explicitly set, default *404 Not Found* handler is used.
pub struct FramedRoute<Io, S, F = (), R = ()> {
handler: F,
pattern: String,
methods: Vec<Method>,
state: PhantomData<(Io, S, R)>,
}
impl<Io, S> FramedRoute<Io, S> {
pub fn new(pattern: &str) -> Self {
FramedRoute {
handler: (),
pattern: pattern.to_string(),
methods: Vec::new(),
state: PhantomData,
}
}
pub fn get(path: &str) -> FramedRoute<Io, S> {
FramedRoute::new(path).method(Method::GET)
}
pub fn post(path: &str) -> FramedRoute<Io, S> {
FramedRoute::new(path).method(Method::POST)
}
pub fn put(path: &str) -> FramedRoute<Io, S> {
FramedRoute::new(path).method(Method::PUT)
}
pub fn delete(path: &str) -> FramedRoute<Io, S> {
FramedRoute::new(path).method(Method::DELETE)
}
pub fn method(mut self, method: Method) -> Self {
self.methods.push(method);
self
}
pub fn to<F, R>(self, handler: F) -> FramedRoute<Io, S, F, R>
where
F: FnMut(FramedRequest<Io, S>) -> R,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Debug,
{
FramedRoute {
handler,
pattern: self.pattern,
methods: self.methods,
state: PhantomData,
}
}
}
impl<Io, S, F, R> HttpServiceFactory for FramedRoute<Io, S, F, R>
where
Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Display,
{
type Factory = FramedRouteFactory<Io, S, F, R>;
fn path(&self) -> &str {
&self.pattern
}
fn create(self) -> Self::Factory {
FramedRouteFactory {
handler: self.handler,
methods: self.methods,
_t: PhantomData,
}
}
}
pub struct FramedRouteFactory<Io, S, F, R> {
handler: F,
methods: Vec<Method>,
_t: PhantomData<(Io, S, R)>,
}
impl<Io, S, F, R> NewService for FramedRouteFactory<Io, S, F, R>
where
Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Display,
{
type Config = ();
type Request = FramedRequest<Io, S>;
type Response = ();
type Error = Error;
type InitError = ();
type Service = FramedRouteService<Io, S, F, R>;
type Future = FutureResult<Self::Service, Self::InitError>;
fn new_service(&self, _: &()) -> Self::Future {
ok(FramedRouteService {
handler: self.handler.clone(),
methods: self.methods.clone(),
_t: PhantomData,
})
}
}
pub struct FramedRouteService<Io, S, F, R> {
handler: F,
methods: Vec<Method>,
_t: PhantomData<(Io, S, R)>,
}
impl<Io, S, F, R> Service for FramedRouteService<Io, S, F, R>
where
Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Display,
{
type Request = FramedRequest<Io, S>;
type Response = ();
type Error = Error;
type Future = Box<dyn Future<Item = (), Error = Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
}
fn call(&mut self, req: FramedRequest<Io, S>) -> Self::Future {
Box::new((self.handler)(req).into_future().then(|res| {
if let Err(e) = res {
error!("Error in request handler: {}", e);
}
Ok(())
}))
}
}

149
actix-framed/src/service.rs Normal file
View File

@ -0,0 +1,149 @@
use std::marker::PhantomData;
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_http::body::BodySize;
use actix_http::error::ResponseError;
use actix_http::h1::{Codec, Message};
use actix_http::ws::{verify_handshake, HandshakeError};
use actix_http::{Request, Response};
use actix_service::{NewService, Service};
use futures::future::{ok, Either, FutureResult};
use futures::{Async, Future, IntoFuture, Poll, Sink};
/// Service that verifies incoming request if it is valid websocket
/// upgrade request. In case of error returns `HandshakeError`
pub struct VerifyWebSockets<T, C> {
_t: PhantomData<(T, C)>,
}
impl<T, C> Default for VerifyWebSockets<T, C> {
fn default() -> Self {
VerifyWebSockets { _t: PhantomData }
}
}
impl<T, C> NewService for VerifyWebSockets<T, C> {
type Config = C;
type Request = (Request, Framed<T, Codec>);
type Response = (Request, Framed<T, Codec>);
type Error = (HandshakeError, Framed<T, Codec>);
type InitError = ();
type Service = VerifyWebSockets<T, C>;
type Future = FutureResult<Self::Service, Self::InitError>;
fn new_service(&self, _: &C) -> Self::Future {
ok(VerifyWebSockets { _t: PhantomData })
}
}
impl<T, C> Service for VerifyWebSockets<T, C> {
type Request = (Request, Framed<T, Codec>);
type Response = (Request, Framed<T, Codec>);
type Error = (HandshakeError, Framed<T, Codec>);
type Future = FutureResult<Self::Response, Self::Error>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
}
fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
match verify_handshake(req.head()) {
Err(e) => Err((e, framed)).into_future(),
Ok(_) => Ok((req, framed)).into_future(),
}
}
}
/// Send http/1 error response
pub struct SendError<T, R, E, C>(PhantomData<(T, R, E, C)>);
impl<T, R, E, C> Default for SendError<T, R, E, C>
where
T: AsyncRead + AsyncWrite,
E: ResponseError,
{
fn default() -> Self {
SendError(PhantomData)
}
}
impl<T, R, E, C> NewService for SendError<T, R, E, C>
where
T: AsyncRead + AsyncWrite + 'static,
R: 'static,
E: ResponseError + 'static,
{
type Config = C;
type Request = Result<R, (E, Framed<T, Codec>)>;
type Response = R;
type Error = (E, Framed<T, Codec>);
type InitError = ();
type Service = SendError<T, R, E, C>;
type Future = FutureResult<Self::Service, Self::InitError>;
fn new_service(&self, _: &C) -> Self::Future {
ok(SendError(PhantomData))
}
}
impl<T, R, E, C> Service for SendError<T, R, E, C>
where
T: AsyncRead + AsyncWrite + 'static,
R: 'static,
E: ResponseError + 'static,
{
type Request = Result<R, (E, Framed<T, Codec>)>;
type Response = R;
type Error = (E, Framed<T, Codec>);
type Future = Either<FutureResult<R, (E, Framed<T, Codec>)>, SendErrorFut<T, R, E>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
}
fn call(&mut self, req: Result<R, (E, Framed<T, Codec>)>) -> Self::Future {
match req {
Ok(r) => Either::A(ok(r)),
Err((e, framed)) => {
let res = e.error_response().drop_body();
Either::B(SendErrorFut {
framed: Some(framed),
res: Some((res, BodySize::Empty).into()),
err: Some(e),
_t: PhantomData,
})
}
}
}
}
pub struct SendErrorFut<T, R, E> {
res: Option<Message<(Response<()>, BodySize)>>,
framed: Option<Framed<T, Codec>>,
err: Option<E>,
_t: PhantomData<R>,
}
impl<T, R, E> Future for SendErrorFut<T, R, E>
where
E: ResponseError,
T: AsyncRead + AsyncWrite,
{
type Item = R;
type Error = (E, Framed<T, Codec>);
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
if let Some(res) = self.res.take() {
if self.framed.as_mut().unwrap().force_send(res).is_err() {
return Err((self.err.take().unwrap(), self.framed.take().unwrap()));
}
}
match self.framed.as_mut().unwrap().poll_complete() {
Ok(Async::Ready(_)) => {
Err((self.err.take().unwrap(), self.framed.take().unwrap()))
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(_) => Err((self.err.take().unwrap(), self.framed.take().unwrap())),
}
}
}

29
actix-framed/src/state.rs Normal file
View File

@ -0,0 +1,29 @@
use std::ops::Deref;
use std::sync::Arc;
/// Application state
pub struct State<S>(Arc<S>);
impl<S> State<S> {
pub fn new(state: S) -> State<S> {
State(Arc::new(state))
}
pub fn get_ref(&self) -> &S {
self.0.as_ref()
}
}
impl<S> Deref for State<S> {
type Target = S;
fn deref(&self) -> &S {
self.0.as_ref()
}
}
impl<S> Clone for State<S> {
fn clone(&self) -> State<S> {
State(self.0.clone())
}
}

153
actix-framed/src/test.rs Normal file
View File

@ -0,0 +1,153 @@
//! Various helpers for Actix applications to use during testing.
use actix_codec::Framed;
use actix_http::h1::Codec;
use actix_http::http::header::{Header, HeaderName, IntoHeaderValue};
use actix_http::http::{HttpTryFrom, Method, Uri, Version};
use actix_http::test::{TestBuffer, TestRequest as HttpTestRequest};
use actix_router::{Path, Url};
use actix_rt::Runtime;
use futures::IntoFuture;
use crate::{FramedRequest, State};
/// Test `Request` builder.
pub struct TestRequest<S = ()> {
req: HttpTestRequest,
path: Path<Url>,
state: State<S>,
}
impl Default for TestRequest<()> {
fn default() -> TestRequest {
TestRequest {
req: HttpTestRequest::default(),
path: Path::new(Url::new(Uri::default())),
state: State::new(()),
}
}
}
impl TestRequest<()> {
/// Create TestRequest and set request uri
pub fn with_uri(path: &str) -> Self {
Self::get().uri(path)
}
/// Create TestRequest and set header
pub fn with_hdr<H: Header>(hdr: H) -> Self {
Self::default().set(hdr)
}
/// Create TestRequest and set header
pub fn with_header<K, V>(key: K, value: V) -> Self
where
HeaderName: HttpTryFrom<K>,
V: IntoHeaderValue,
{
Self::default().header(key, value)
}
/// Create TestRequest and set method to `Method::GET`
pub fn get() -> Self {
Self::default().method(Method::GET)
}
/// Create TestRequest and set method to `Method::POST`
pub fn post() -> Self {
Self::default().method(Method::POST)
}
}
impl<S> TestRequest<S> {
/// Create TestRequest and set request uri
pub fn with_state(state: S) -> TestRequest<S> {
let req = TestRequest::get();
TestRequest {
state: State::new(state),
req: req.req,
path: req.path,
}
}
/// Set HTTP version of this request
pub fn version(mut self, ver: Version) -> Self {
self.req.version(ver);
self
}
/// Set HTTP method of this request
pub fn method(mut self, meth: Method) -> Self {
self.req.method(meth);
self
}
/// Set HTTP Uri of this request
pub fn uri(mut self, path: &str) -> Self {
self.req.uri(path);
self
}
/// Set a header
pub fn set<H: Header>(mut self, hdr: H) -> Self {
self.req.set(hdr);
self
}
/// Set a header
pub fn header<K, V>(mut self, key: K, value: V) -> Self
where
HeaderName: HttpTryFrom<K>,
V: IntoHeaderValue,
{
self.req.header(key, value);
self
}
/// Set request path pattern parameter
pub fn param(mut self, name: &'static str, value: &'static str) -> Self {
self.path.add_static(name, value);
self
}
/// Complete request creation and generate `Request` instance
pub fn finish(mut self) -> FramedRequest<TestBuffer, S> {
let req = self.req.finish();
self.path.get_mut().update(req.uri());
let framed = Framed::new(TestBuffer::empty(), Codec::default());
FramedRequest::new(req, framed, self.path, self.state)
}
/// This method generates `FramedRequest` instance and executes async handler
pub fn run<F, R, I, E>(self, f: F) -> Result<I, E>
where
F: FnOnce(FramedRequest<TestBuffer, S>) -> R,
R: IntoFuture<Item = I, Error = E>,
{
let mut rt = Runtime::new().unwrap();
rt.block_on(f(self.finish()).into_future())
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test() {
let req = TestRequest::with_uri("/index.html")
.header("x-test", "test")
.param("test", "123")
.finish();
assert_eq!(*req.state(), ());
assert_eq!(req.version(), Version::HTTP_11);
assert_eq!(req.method(), Method::GET);
assert_eq!(req.path(), "/index.html");
assert_eq!(req.query_string(), "");
assert_eq!(
req.headers().get("x-test").unwrap().to_str().unwrap(),
"test"
);
assert_eq!(&req.match_info()["test"], "123");
}
}

View File

@ -0,0 +1,141 @@
use actix_codec::{AsyncRead, AsyncWrite};
use actix_http::{body, http::StatusCode, ws, Error, HttpService, Response};
use actix_http_test::TestServer;
use actix_service::{IntoNewService, NewService};
use actix_utils::framed::FramedTransport;
use bytes::{Bytes, BytesMut};
use futures::future::{self, ok};
use futures::{Future, Sink, Stream};
use actix_framed::{FramedApp, FramedRequest, FramedRoute, SendError, VerifyWebSockets};
fn ws_service<T: AsyncRead + AsyncWrite>(
req: FramedRequest<T>,
) -> impl Future<Item = (), Error = Error> {
let (req, framed, _) = req.into_parts();
let res = ws::handshake(req.head()).unwrap().message_body(());
framed
.send((res, body::BodySize::None).into())
.map_err(|_| panic!())
.and_then(|framed| {
FramedTransport::new(framed.into_framed(ws::Codec::new()), service)
.map_err(|_| panic!())
})
}
fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> {
let msg = match msg {
ws::Frame::Ping(msg) => ws::Message::Pong(msg),
ws::Frame::Text(text) => {
ws::Message::Text(String::from_utf8_lossy(&text.unwrap()).to_string())
}
ws::Frame::Binary(bin) => ws::Message::Binary(bin.unwrap().freeze()),
ws::Frame::Close(reason) => ws::Message::Close(reason),
_ => panic!(),
};
ok(msg)
}
#[test]
fn test_simple() {
let mut srv = TestServer::new(|| {
HttpService::build()
.upgrade(
FramedApp::new().service(FramedRoute::get("/index.html").to(ws_service)),
)
.finish(|_| future::ok::<_, Error>(Response::NotFound()))
});
assert!(srv.ws_at("/test").is_err());
// client service
let framed = srv.ws_at("/index.html").unwrap();
let framed = srv
.block_on(framed.send(ws::Message::Text("text".to_string())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
let framed = srv
.block_on(framed.send(ws::Message::Binary("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(
item,
Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
);
let framed = srv
.block_on(framed.send(ws::Message::Ping("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
let framed = srv
.block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
.unwrap();
let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(
item,
Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
);
}
#[test]
fn test_service() {
let mut srv = TestServer::new(|| {
actix_http::h1::OneRequest::new().map_err(|_| ()).and_then(
VerifyWebSockets::default()
.then(SendError::default())
.map_err(|_| ())
.and_then(
FramedApp::new()
.service(FramedRoute::get("/index.html").to(ws_service))
.into_new_service()
.map_err(|_| ()),
),
)
});
// non ws request
let res = srv.block_on(srv.get("/index.html").send()).unwrap();
assert_eq!(res.status(), StatusCode::BAD_REQUEST);
// not found
assert!(srv.ws_at("/test").is_err());
// client service
let framed = srv.ws_at("/index.html").unwrap();
let framed = srv
.block_on(framed.send(ws::Message::Text("text".to_string())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
let framed = srv
.block_on(framed.send(ws::Message::Binary("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(
item,
Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
);
let framed = srv
.block_on(framed.send(ws::Message::Ping("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
let framed = srv
.block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
.unwrap();
let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(
item,
Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
);
}

View File

@ -1,94 +0,0 @@
# Changes
## Unreleased - 2021-xx-xx
## 3.0.0-beta.3 - 2021-03-09
* No notable changes.
## 3.0.0-beta.2 - 2021-02-10
* No notable changes.
## 3.0.0-beta.1 - 2021-01-07
* Update `bytes` to `1.0`. [#1813]
[#1813]: https://github.com/actix/actix-web/pull/1813
## 2.1.0 - 2020-11-25
* Add ability to set address for `TestServer`. [#1645]
* Upgrade `base64` to `0.13`.
* Upgrade `serde_urlencoded` to `0.7`. [#1773]
[#1773]: https://github.com/actix/actix-web/pull/1773
[#1645]: https://github.com/actix/actix-web/pull/1645
## 2.0.0 - 2020-09-11
* Update actix-codec and actix-utils dependencies.
## 2.0.0-alpha.1 - 2020-05-23
* Update the `time` dependency to 0.2.7
* Update `actix-connect` dependency to 2.0.0-alpha.2
* Make `test_server` `async` fn.
* Bump minimum supported Rust version to 1.40
* Replace deprecated `net2` crate with `socket2`
* Update `base64` dependency to 0.12
* Update `env_logger` dependency to 0.7
## 1.0.0 - 2019-12-13
* Replaced `TestServer::start()` with `test_server()`
## 1.0.0-alpha.3 - 2019-12-07
* Migrate to `std::future`
## 0.2.5 - 2019-09-17
* Update serde_urlencoded to "0.6.1"
* Increase TestServerRuntime timeouts from 500ms to 3000ms
* Do not override current `System`
## 0.2.4 - 2019-07-18
* Update actix-server to 0.6
## 0.2.3 - 2019-07-16
* Add `delete`, `options`, `patch` methods to `TestServerRunner`
## 0.2.2 - 2019-06-16
* Add .put() and .sput() methods
## 0.2.1 - 2019-06-05
* Add license files
## 0.2.0 - 2019-05-12
* Update awc and actix-http deps
## 0.1.1 - 2019-04-24
* Always make new connection for http client
## 0.1.0 - 2019-04-16
* No changes
## 0.1.0-alpha.3 - 2019-04-02
* Request functions accept path #743
## 0.1.0-alpha.2 - 2019-03-29
* Added TestServerRuntime::load_body() method
* Update actix-http and awc libraries
## 0.1.0-alpha.1 - 2019-03-28
* Initial impl

View File

@ -1,61 +0,0 @@
[package]
name = "actix-http-test"
version = "3.0.0-beta.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Various helpers for Actix applications to use during testing"
readme = "README.md"
keywords = ["http", "web", "framework", "async", "futures"]
homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-http-test/"
categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT OR Apache-2.0"
exclude = [".gitignore", ".cargo/config"]
edition = "2018"
[package.metadata.docs.rs]
features = []
[lib]
name = "actix_http_test"
path = "src/lib.rs"
[features]
default = []
# openssl
openssl = ["tls-openssl", "awc/openssl"]
[dependencies]
actix-service = "2.0.0-beta.4"
actix-codec = "0.4.0-beta.1"
actix-tls = "3.0.0-beta.4"
actix-utils = "3.0.0-beta.2"
actix-rt = "2.1"
actix-server = "2.0.0-beta.3"
awc = { version = "3.0.0-beta.3", default-features = false }
base64 = "0.13"
bytes = "1"
futures-core = { version = "0.3.7", default-features = false }
http = "0.2.2"
log = "0.4"
socket2 = "0.3"
serde = "1.0"
serde_json = "1.0"
slab = "0.4"
serde_urlencoded = "0.7"
time = { version = "0.2.23", default-features = false, features = ["std"] }
tls-openssl = { version = "0.10.9", package = "openssl", optional = true }
[target.'cfg(windows)'.dependencies.tls-openssl]
version = "0.10.9"
package = "openssl"
features = ["vendored"]
optional = true
[dev-dependencies]
actix-web = { version = "4.0.0-beta.4", default-features = false, features = ["cookies"] }
actix-http = "3.0.0-beta.4"

View File

@ -1,15 +0,0 @@
# actix-http-test
> Various helpers for Actix applications to use during testing.
[![crates.io](https://img.shields.io/crates/v/actix-http-test?label=latest)](https://crates.io/crates/actix-http-test)
[![Documentation](https://docs.rs/actix-http-test/badge.svg?version=3.0.0-beta.3)](https://docs.rs/actix-http-test/3.0.0-beta.3)
![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http-test)
[![Dependency Status](https://deps.rs/crate/actix-http-test/3.0.0-beta.3/status.svg)](https://deps.rs/crate/actix-http-test/3.0.0-beta.3)
[![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & Resources
- [API Documentation](https://docs.rs/actix-http-test)
- [Chat on Gitter](https://gitter.im/actix/actix-web)
- Minimum Supported Rust Version (MSRV): 1.46.0

View File

@ -1,271 +0,0 @@
//! Various helpers for Actix applications to use during testing.
#![deny(rust_2018_idioms)]
#![doc(html_logo_url = "https://actix.rs/img/logo.png")]
#![doc(html_favicon_url = "https://actix.rs/favicon.ico")]
#[cfg(feature = "openssl")]
extern crate tls_openssl as openssl;
use std::sync::mpsc;
use std::{net, thread, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_rt::{net::TcpStream, System};
use actix_server::{Server, ServiceFactory};
use awc::{error::PayloadError, ws, Client, ClientRequest, ClientResponse, Connector};
use bytes::Bytes;
use futures_core::stream::Stream;
use http::Method;
use socket2::{Domain, Protocol, Socket, Type};
/// Start test server
///
/// `TestServer` is very simple test server that simplify process of writing
/// integration tests cases for actix web applications.
///
/// # Examples
///
/// ```rust
/// use actix_http::HttpService;
/// use actix_http_test::TestServer;
/// use actix_web::{web, App, HttpResponse, Error};
///
/// async fn my_handler() -> Result<HttpResponse, Error> {
/// Ok(HttpResponse::Ok().into())
/// }
///
/// #[actix_rt::test]
/// async fn test_example() {
/// let mut srv = TestServer::start(
/// || HttpService::new(
/// App::new().service(
/// web::resource("/").to(my_handler))
/// )
/// );
///
/// let req = srv.get("/");
/// let response = req.send().await.unwrap();
/// assert!(response.status().is_success());
/// }
/// ```
pub async fn test_server<F: ServiceFactory<TcpStream>>(factory: F) -> TestServer {
let tcp = net::TcpListener::bind("127.0.0.1:0").unwrap();
test_server_with_addr(tcp, factory).await
}
/// Start [`test server`](test_server()) on a concrete Address
pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
tcp: net::TcpListener,
factory: F,
) -> TestServer {
let (tx, rx) = mpsc::channel();
// run server in separate thread
thread::spawn(move || {
let sys = System::new();
let local_addr = tcp.local_addr().unwrap();
let srv = Server::build()
.listen("test", tcp, factory)?
.workers(1)
.disable_signals();
sys.block_on(async {
srv.run();
tx.send((System::current(), local_addr)).unwrap();
});
sys.run()
});
let (system, addr) = rx.recv().unwrap();
let client = {
let connector = {
#[cfg(feature = "openssl")]
{
use openssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
let mut builder = SslConnector::builder(SslMethod::tls()).unwrap();
builder.set_verify(SslVerifyMode::NONE);
let _ = builder
.set_alpn_protos(b"\x02h2\x08http/1.1")
.map_err(|e| log::error!("Can not set alpn protocol: {:?}", e));
Connector::new()
.conn_lifetime(time::Duration::from_secs(0))
.timeout(time::Duration::from_millis(30000))
.ssl(builder.build())
}
#[cfg(not(feature = "openssl"))]
{
Connector::new()
.conn_lifetime(time::Duration::from_secs(0))
.timeout(time::Duration::from_millis(30000))
}
};
Client::builder().connector(connector).finish()
};
TestServer {
addr,
client,
system,
}
}
/// Get first available unused address
pub fn unused_addr() -> net::SocketAddr {
let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
let socket = Socket::new(Domain::ipv4(), Type::stream(), Some(Protocol::tcp())).unwrap();
socket.bind(&addr.into()).unwrap();
socket.set_reuse_address(true).unwrap();
let tcp = socket.into_tcp_listener();
tcp.local_addr().unwrap()
}
/// Test server controller
pub struct TestServer {
addr: net::SocketAddr,
client: Client,
system: System,
}
impl TestServer {
/// Construct test server url
pub fn addr(&self) -> net::SocketAddr {
self.addr
}
/// Construct test server url
pub fn url(&self, uri: &str) -> String {
if uri.starts_with('/') {
format!("http://localhost:{}{}", self.addr.port(), uri)
} else {
format!("http://localhost:{}/{}", self.addr.port(), uri)
}
}
/// Construct test HTTPS server URL.
pub fn surl(&self, uri: &str) -> String {
if uri.starts_with('/') {
format!("https://localhost:{}{}", self.addr.port(), uri)
} else {
format!("https://localhost:{}/{}", self.addr.port(), uri)
}
}
/// Create `GET` request
pub fn get<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.get(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `GET` request
pub fn sget<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.get(self.surl(path.as_ref()).as_str())
}
/// Create `POST` request
pub fn post<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.post(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `POST` request
pub fn spost<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.post(self.surl(path.as_ref()).as_str())
}
/// Create `HEAD` request
pub fn head<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.head(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `HEAD` request
pub fn shead<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.head(self.surl(path.as_ref()).as_str())
}
/// Create `PUT` request
pub fn put<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.put(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `PUT` request
pub fn sput<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.put(self.surl(path.as_ref()).as_str())
}
/// Create `PATCH` request
pub fn patch<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.patch(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `PATCH` request
pub fn spatch<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.patch(self.surl(path.as_ref()).as_str())
}
/// Create `DELETE` request
pub fn delete<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.delete(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `DELETE` request
pub fn sdelete<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.delete(self.surl(path.as_ref()).as_str())
}
/// Create `OPTIONS` request
pub fn options<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.options(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `OPTIONS` request
pub fn soptions<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.options(self.surl(path.as_ref()).as_str())
}
/// Connect to test HTTP server
pub fn request<S: AsRef<str>>(&self, method: Method, path: S) -> ClientRequest {
self.client.request(method, path.as_ref())
}
pub async fn load_body<S>(
&mut self,
mut response: ClientResponse<S>,
) -> Result<Bytes, PayloadError>
where
S: Stream<Item = Result<Bytes, PayloadError>> + Unpin + 'static,
{
response.body().limit(10_485_760).await
}
/// Connect to WebSocket server at a given path.
pub async fn ws_at(
&mut self,
path: &str,
) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
let url = self.url(path);
let connect = self.client.ws(url).connect();
connect.await.map(|(_, framed)| framed)
}
/// Connect to a WebSocket server.
pub async fn ws(
&mut self,
) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
self.ws_at("/").await
}
/// Stop HTTP server
fn stop(&mut self) {
self.system.stop();
}
}
impl Drop for TestServer {
fn drop(&mut self) {
self.stop()
}
}

41
actix-http/.appveyor.yml Normal file
View File

@ -0,0 +1,41 @@
environment:
global:
PROJECT_NAME: actix-http
matrix:
# Stable channel
- TARGET: i686-pc-windows-msvc
CHANNEL: stable
- TARGET: x86_64-pc-windows-gnu
CHANNEL: stable
- TARGET: x86_64-pc-windows-msvc
CHANNEL: stable
# Nightly channel
- TARGET: i686-pc-windows-msvc
CHANNEL: nightly
- TARGET: x86_64-pc-windows-gnu
CHANNEL: nightly
- TARGET: x86_64-pc-windows-msvc
CHANNEL: nightly
# Install Rust and Cargo
# (Based on from https://github.com/rust-lang/libc/blob/master/appveyor.yml)
install:
- ps: >-
If ($Env:TARGET -eq 'x86_64-pc-windows-gnu') {
$Env:PATH += ';C:\msys64\mingw64\bin'
} ElseIf ($Env:TARGET -eq 'i686-pc-windows-gnu') {
$Env:PATH += ';C:\MinGW\bin'
}
- curl -sSf -o rustup-init.exe https://win.rustup.rs
- rustup-init.exe --default-host %TARGET% --default-toolchain %CHANNEL% -y
- set PATH=%PATH%;C:\Users\appveyor\.cargo\bin
- rustc -Vv
- cargo -V
# 'cargo test' takes care of building for us, so disable Appveyor's build stage.
build: false
# Equivalent to Travis' `script` phase
test_script:
- cargo clean
- cargo test

View File

@ -1,453 +1,259 @@
# Changes
## Unreleased - 2021-xx-xx
## [0.2.11] - 2019-11-06
## 3.0.0-beta.4 - 2021-03-08
### Changed
* Feature `cookies` is now optional and disabled by default. [#1981]
* `ws::hash_key` now returns array. [#2035]
* `ResponseBuilder::json` now takes `impl Serialize`. [#2052]
### Removed
* Re-export of `futures_channel::oneshot::Canceled` is removed from `error` mod. [#1994]
* `ResponseError` impl for `futures_channel::oneshot::Canceled` is removed. [#1994]
[#1981]: https://github.com/actix/actix-web/pull/1981
[#1994]: https://github.com/actix/actix-web/pull/1994
[#2035]: https://github.com/actix/actix-web/pull/2035
[#2052]: https://github.com/actix/actix-web/pull/2052
## 3.0.0-beta.3 - 2021-02-10
* No notable changes.
## 3.0.0-beta.2 - 2021-02-10
### Added
* `IntoHeaderPair` trait that allows using typed and untyped headers in the same methods. [#1869]
* `ResponseBuilder::insert_header` method which allows using typed headers. [#1869]
* `ResponseBuilder::append_header` method which allows using typed headers. [#1869]
* `TestRequest::insert_header` method which allows using typed headers. [#1869]
* `ContentEncoding` implements all necessary header traits. [#1912]
* `HeaderMap::len_keys` has the behavior of the old `len` method. [#1964]
* `HeaderMap::drain` as an efficient draining iterator. [#1964]
* Implement `IntoIterator` for owned `HeaderMap`. [#1964]
* `trust-dns` optional feature to enable `trust-dns-resolver` as client dns resolver. [#1969]
### Changed
* `ResponseBuilder::content_type` now takes an `impl IntoHeaderValue` to support using typed
`mime` types. [#1894]
* Renamed `IntoHeaderValue::{try_into => try_into_value}` to avoid ambiguity with std
`TryInto` trait. [#1894]
* `Extensions::insert` returns Option of replaced item. [#1904]
* Remove `HttpResponseBuilder::json2()`. [#1903]
* Enable `HttpResponseBuilder::json()` to receive data by value and reference. [#1903]
* `client::error::ConnectError` Resolver variant contains `Box<dyn std::error::Error>` type. [#1905]
* `client::ConnectorConfig` default timeout changed to 5 seconds. [#1905]
* Simplify `BlockingError` type to a unit struct. It's now only triggered when blocking thread pool
is dead. [#1957]
* `HeaderMap::len` now returns number of values instead of number of keys. [#1964]
* `HeaderMap::insert` now returns iterator of removed values. [#1964]
* `HeaderMap::remove` now returns iterator of removed values. [#1964]
### Removed
* `ResponseBuilder::set`; use `ResponseBuilder::insert_header`. [#1869]
* `ResponseBuilder::set_header`; use `ResponseBuilder::insert_header`. [#1869]
* `ResponseBuilder::header`; use `ResponseBuilder::append_header`. [#1869]
* `TestRequest::with_hdr`; use `TestRequest::default().insert_header()`. [#1869]
* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
* `actors` optional feature. [#1969]
* `ResponseError` impl for `actix::MailboxError`. [#1969]
### Documentation
* Vastly improve docs and add examples for `HeaderMap`. [#1964]
[#1869]: https://github.com/actix/actix-web/pull/1869
[#1894]: https://github.com/actix/actix-web/pull/1894
[#1903]: https://github.com/actix/actix-web/pull/1903
[#1904]: https://github.com/actix/actix-web/pull/1904
[#1905]: https://github.com/actix/actix-web/pull/1905
[#1912]: https://github.com/actix/actix-web/pull/1912
[#1957]: https://github.com/actix/actix-web/pull/1957
[#1964]: https://github.com/actix/actix-web/pull/1964
[#1969]: https://github.com/actix/actix-web/pull/1969
## 3.0.0-beta.1 - 2021-01-07
### Added
* Add `Http3` to `Protocol` enum for future compatibility and also mark `#[non_exhaustive]`.
### Changed
* Update `actix-*` dependencies to tokio `1.0` based versions. [#1813]
* Bumped `rand` to `0.8`.
* Update `bytes` to `1.0`. [#1813]
* Update `h2` to `0.3`. [#1813]
* The `ws::Message::Text` enum variant now contains a `bytestring::ByteString`. [#1864]
### Removed
* Deprecated `on_connect` methods have been removed. Prefer the new
`on_connect_ext` technique. [#1857]
* Remove `ResponseError` impl for `actix::actors::resolver::ResolverError`
due to deprecate of resolver actor. [#1813]
* Remove `ConnectError::SslHandshakeError` and re-export of `HandshakeError`.
due to the removal of this type from `tokio-openssl` crate. openssl handshake
error would return as `ConnectError::SslError`. [#1813]
* Remove `actix-threadpool` dependency. Use `actix_rt::task::spawn_blocking`.
Due to this change `actix_threadpool::BlockingError` type is moved into
`actix_http::error` module. [#1878]
[#1813]: https://github.com/actix/actix-web/pull/1813
[#1857]: https://github.com/actix/actix-web/pull/1857
[#1864]: https://github.com/actix/actix-web/pull/1864
[#1878]: https://github.com/actix/actix-web/pull/1878
## 2.2.0 - 2020-11-25
### Added
* HttpResponse builders for 1xx status codes. [#1768]
* `Accept::mime_precedence` and `Accept::mime_preference`. [#1793]
* `TryFrom<u16>` and `TryFrom<f32>` for `http::header::Quality`. [#1797]
### Fixed
* Started dropping `transfer-encoding: chunked` and `Content-Length` for 1XX and 204 responses. [#1767]
### Changed
* Upgrade `serde_urlencoded` to `0.7`. [#1773]
[#1773]: https://github.com/actix/actix-web/pull/1773
[#1767]: https://github.com/actix/actix-web/pull/1767
[#1768]: https://github.com/actix/actix-web/pull/1768
[#1793]: https://github.com/actix/actix-web/pull/1793
[#1797]: https://github.com/actix/actix-web/pull/1797
## 2.1.0 - 2020-10-30
### Added
* Added more flexible `on_connect_ext` methods for on-connect handling. [#1754]
### Changed
* Upgrade `base64` to `0.13`. [#1744]
* Upgrade `pin-project` to `1.0`. [#1733]
* Deprecate `ResponseBuilder::{if_some, if_true}`. [#1760]
[#1760]: https://github.com/actix/actix-web/pull/1760
[#1754]: https://github.com/actix/actix-web/pull/1754
[#1733]: https://github.com/actix/actix-web/pull/1733
[#1744]: https://github.com/actix/actix-web/pull/1744
## 2.0.0 - 2020-09-11
* No significant changes from `2.0.0-beta.4`.
## 2.0.0-beta.4 - 2020-09-09
### Changed
* Update actix-codec and actix-utils dependencies.
* Update actix-connect and actix-tls dependencies.
## 2.0.0-beta.3 - 2020-08-14
### Fixed
* Memory leak of `client::pool::ConnectorPoolSupport`. [#1626]
[#1626]: https://github.com/actix/actix-web/pull/1626
## 2.0.0-beta.2 - 2020-07-21
### Fixed
* Potential UB in h1 decoder using uninitialized memory. [#1614]
### Changed
* Fix illegal chunked encoding. [#1615]
[#1614]: https://github.com/actix/actix-web/pull/1614
[#1615]: https://github.com/actix/actix-web/pull/1615
## 2.0.0-beta.1 - 2020-07-11
### Changed
* Migrate cookie handling to `cookie` crate. [#1558]
* Update `sha-1` to 0.9. [#1586]
* Fix leak in client pool. [#1580]
* MSRV is now 1.41.1.
[#1558]: https://github.com/actix/actix-web/pull/1558
[#1586]: https://github.com/actix/actix-web/pull/1586
[#1580]: https://github.com/actix/actix-web/pull/1580
## 2.0.0-alpha.4 - 2020-05-21
### Changed
* Bump minimum supported Rust version to 1.40
* content_length function is removed, and you can set Content-Length by calling
no_chunking function [#1439]
* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
`u64` instead of a `usize`.
* Update `base64` dependency to 0.12
### Fixed
* Support parsing of `SameSite=None` [#1503]
[#1439]: https://github.com/actix/actix-web/pull/1439
[#1503]: https://github.com/actix/actix-web/pull/1503
## 2.0.0-alpha.3 - 2020-05-08
### Fixed
* Correct spelling of ConnectError::Unresolved [#1487]
* Fix a mistake in the encoding of websocket continuation messages wherein
Item::FirstText and Item::FirstBinary are each encoded as the other.
### Changed
* Implement `std::error::Error` for our custom errors [#1422]
* Remove `failure` support for `ResponseError` since that crate
will be deprecated in the near future.
[#1422]: https://github.com/actix/actix-web/pull/1422
[#1487]: https://github.com/actix/actix-web/pull/1487
## 2.0.0-alpha.2 - 2020-03-07
### Changed
* Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB
respectively to improve download speed for awc when downloading large objects. [#1394]
* client::Connector accepts initial_window_size and initial_connection_window_size
HTTP2 configuration. [#1394]
* client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
[#1394]: https://github.com/actix/actix-web/pull/1394
[#1395]: https://github.com/actix/actix-web/pull/1395
## 2.0.0-alpha.1 - 2020-02-27
### Changed
* Update the `time` dependency to 0.2.7.
* Moved actors messages support from actix crate, enabled with feature `actors`.
* Breaking change: trait MessageBody requires Unpin and accepting `Pin<&mut Self>` instead of
`&mut self` in the poll_next().
* MessageBody is not implemented for &'static [u8] anymore.
### Fixed
* Allow `SameSite=None` cookies to be sent in a response.
## 1.0.1 - 2019-12-20
### Fixed
* Poll upgrade service's readiness from HTTP service handlers
* Replace brotli with brotli2 #1224
## 1.0.0 - 2019-12-13
### Added
* Add websockets continuation frame support
### Changed
* Replace `flate2-xxx` features with `compress`
## 1.0.0-alpha.5 - 2019-12-09
### Fixed
* Check `Upgrade` service readiness before calling it
* Fix buffer remaining capacity calculation
### Changed
* Websockets: Ping and Pong should have binary data #1049
## 1.0.0-alpha.4 - 2019-12-08
### Added
* Add impl ResponseBuilder for Error
### Changed
* Use rust based brotli compression library
## 1.0.0-alpha.3 - 2019-12-07
### Changed
* Migrate to tokio 0.2
* Migrate to `std::future`
## 0.2.11 - 2019-11-06
### Added
* Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
* Add an additional `filename*` param in the `Content-Disposition` header of
`actix_files::NamedFile` to be more compatible. (#1151)
* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
* Allow to use `std::convert::Infallible` as `actix_http::error::Error`
### Fixed
* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain;
charset=utf-8` header [#1118]
[#1878]: https://github.com/actix/actix-web/pull/1878
* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain; charset=utf-8` header #1118
## 0.2.10 - 2019-09-11
## [0.2.10] - 2019-09-11
### Added
* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests
with `RequestHead`
* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests with `RequestHead`
### Fixed
* h2 will use error response #1080
* on_connect result isn't added to request extensions for http2 requests #1009
## 0.2.9 - 2019-08-13
## [0.2.9] - 2019-08-13
### Changed
* Dropped the `byteorder`-dependency in favor of `stdlib`-implementation
* Update percent-encoding to 2.1
* Update serde_urlencoded to 0.6.1
### Fixed
* Fixed a panic in the HTTP2 handshake in client HTTP requests (#1031)
## 0.2.8 - 2019-08-01
## [0.2.8] - 2019-08-01
### Added
* Add `rustls` support
* Add `Clone` impl for `HeaderMap`
### Fixed
* awc client panic #1016
* Invalid response with compression middleware enabled, but compression-related features
disabled #997
* Invalid response with compression middleware enabled, but compression-related features disabled #997
## 0.2.7 - 2019-07-18
## [0.2.7] - 2019-07-18
### Added
* Add support for downcasting response errors #986
## 0.2.6 - 2019-07-17
## [0.2.6] - 2019-07-17
### Changed
* Replace `ClonableService` with local copy
* Upgrade `rand` dependency version to 0.7
## 0.2.5 - 2019-06-28
## [0.2.5] - 2019-06-28
### Added
* Add `on-connect` callback, `HttpServiceBuilder::on_connect()` #946
### Changed
* Use `encoding_rs` crate instead of unmaintained `encoding` crate
* Add `Copy` and `Clone` impls for `ws::Codec`
## 0.2.4 - 2019-06-16
## [0.2.4] - 2019-06-16
### Fixed
* Do not compress NoContent (204) responses #918
## 0.2.3 - 2019-06-02
## [0.2.3] - 2019-06-02
### Added
* Debug impl for ResponseBuilder
* From SizedStream and BodyStream for Body
### Changed
* SizedStream uses u64
## 0.2.2 - 2019-05-29
## [0.2.2] - 2019-05-29
### Fixed
* Parse incoming stream before closing stream on disconnect #868
## 0.2.1 - 2019-05-25
## [0.2.1] - 2019-05-25
### Fixed
* Handle socket read disconnect
## 0.2.0 - 2019-05-12
## [0.2.0] - 2019-05-12
### Changed
* Update actix-service to 0.4
* Expect and upgrade services accept `ServerConfig` config.
### Deleted
* `OneRequest` service
## 0.1.5 - 2019-05-04
## [0.1.5] - 2019-05-04
### Fixed
* Clean up response extensions in response pool #817
## 0.1.4 - 2019-04-24
## [0.1.4] - 2019-04-24
### Added
* Allow to render h1 request headers in `Camel-Case`
### Fixed
* Read until eof for http/1.0 responses #771
## 0.1.3 - 2019-04-23
## [0.1.3] - 2019-04-23
### Fixed
* Fix http client pool management
* Fix http client wait queue management #794
## 0.1.2 - 2019-04-23
## [0.1.2] - 2019-04-23
### Fixed
* Fix BorrowMutError panic in client connector #793
## 0.1.1 - 2019-04-19
## [0.1.1] - 2019-04-19
### Changed
* Cookie::max_age() accepts value in seconds
* Cookie::max_age_time() accepts value in time::Duration
* Allow to specify server address for client connector
## 0.1.0 - 2019-04-16
## [0.1.0] - 2019-04-16
### Added
* Expose peer addr via `Request::peer_addr()` and `RequestHead::peer_addr`
### Changed
* `actix_http::encoding` always available
* use trust-dns-resolver 0.11.0
## 0.1.0-alpha.5 - 2019-04-12
## [0.1.0-alpha.5] - 2019-04-12
### Added
* Allow to use custom service for upgrade requests
* Added `h1::SendResponse` future.
### Changed
* MessageBody::length() renamed to MessageBody::size() for consistency
* ws handshake verification functions take RequestHead instead of Request
## 0.1.0-alpha.4 - 2019-04-08
## [0.1.0-alpha.4] - 2019-04-08
### Added
* Allow to use custom `Expect` handler
* Add minimal `std::error::Error` impl for `Error`
### Changed
* Export IntoHeaderValue
* Render error and return as response body
* Use thread pool for response body compression
* Use thread pool for response body comression
### Deleted
* Removed PayloadBuffer
## 0.1.0-alpha.3 - 2019-04-02
## [0.1.0-alpha.3] - 2019-04-02
### Added
* Warn when an unsealed private cookie isn't valid UTF-8
### Fixed
* Rust 1.31.0 compatibility
* Preallocate read buffer for h1 codec
* Detect socket disconnection during protocol selection
## 0.1.0-alpha.2 - 2019-03-29
## [0.1.0-alpha.2] - 2019-03-29
### Added
* Added ws::Message::Nop, no-op websockets message
### Changed
* Do not use thread pool for decompression if chunk size is smaller than 2048.
* Do not use thread pool for decomression if chunk size is smaller than 2048.
## 0.1.0-alpha.1 - 2019-03-28
## [0.1.0-alpha.1] - 2019-03-28
* Initial impl

View File

@ -0,0 +1,46 @@
# Contributor Covenant Code of Conduct
## Our Pledge
In the interest of fostering an open and welcoming environment, we as contributors and maintainers pledge to making participation in our project and our community a harassment-free experience for everyone, regardless of age, body size, disability, ethnicity, gender identity and expression, level of experience, nationality, personal appearance, race, religion, or sexual identity and orientation.
## Our Standards
Examples of behavior that contributes to creating a positive environment include:
* Using welcoming and inclusive language
* Being respectful of differing viewpoints and experiences
* Gracefully accepting constructive criticism
* Focusing on what is best for the community
* Showing empathy towards other community members
Examples of unacceptable behavior by participants include:
* The use of sexualized language or imagery and unwelcome sexual attention or advances
* Trolling, insulting/derogatory comments, and personal or political attacks
* Public or private harassment
* Publishing others' private information, such as a physical or electronic address, without explicit permission
* Other conduct which could reasonably be considered inappropriate in a professional setting
## Our Responsibilities
Project maintainers are responsible for clarifying the standards of acceptable behavior and are expected to take appropriate and fair corrective action in response to any instances of unacceptable behavior.
Project maintainers have the right and responsibility to remove, edit, or reject comments, commits, code, wiki edits, issues, and other contributions that are not aligned to this Code of Conduct, or to ban temporarily or permanently any contributor for other behaviors that they deem inappropriate, threatening, offensive, or harmful.
## Scope
This Code of Conduct applies both within project spaces and in public spaces when an individual is representing the project or its community. Examples of representing a project or community include using an official project e-mail address, posting via an official social media account, or acting as an appointed representative at an online or offline event. Representation of a project may be further defined and clarified by project maintainers.
## Enforcement
Instances of abusive, harassing, or otherwise unacceptable behavior may be reported by contacting the project team at fafhrd91@gmail.com. The project team will review and investigate all complaints, and will respond in a way that it deems appropriate to the circumstances. The project team is obligated to maintain confidentiality with regard to the reporter of an incident. Further details of specific enforcement policies may be posted separately.
Project maintainers who do not follow or enforce the Code of Conduct in good faith may face temporary or permanent repercussions as determined by other members of the project's leadership.
## Attribution
This Code of Conduct is adapted from the [Contributor Covenant][homepage], version 1.4, available at [http://contributor-covenant.org/version/1/4][version]
[homepage]: http://contributor-covenant.org
[version]: http://contributor-covenant.org/version/1/4/

View File

@ -1,8 +1,8 @@
[package]
name = "actix-http"
version = "3.0.0-beta.4"
version = "0.2.11"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "HTTP primitives for the Actix ecosystem"
description = "Actix http primitives"
readme = "README.md"
keywords = ["actix", "http", "framework", "async", "futures"]
homepage = "https://actix.rs"
@ -11,12 +11,12 @@ documentation = "https://docs.rs/actix-http/"
categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT OR Apache-2.0"
license = "MIT/Apache-2.0"
edition = "2018"
workspace = ".."
[package.metadata.docs.rs]
# features that docs.rs will build with
features = ["openssl", "rustls", "compress", "cookies", "secure-cookies"]
features = ["ssl", "fail", "brotli", "flate2-zlib", "secure-cookies"]
[lib]
name = "actix_http"
@ -26,95 +26,85 @@ path = "src/lib.rs"
default = []
# openssl
openssl = ["actix-tls/openssl"]
ssl = ["openssl", "actix-connect/ssl"]
# rustls support
rustls = ["actix-tls/rustls"]
rust-tls = ["rustls", "webpki-roots", "actix-connect/rust-tls"]
# enable compression support
compress = ["flate2", "brotli2"]
# brotli encoding, requires c compiler
brotli = ["brotli2"]
# support for cookies
cookies = ["cookie"]
# miniz-sys backend for flate2 crate
flate2-zlib = ["flate2/miniz-sys"]
# rust backend for flate2 crate
flate2-rust = ["flate2/rust_backend"]
# failure integration. actix does not use failure anymore
fail = ["failure"]
# support for secure cookies
secure-cookies = ["cookies", "cookie/secure"]
# trust-dns as client dns resolver
trust-dns = ["trust-dns-resolver"]
secure-cookies = ["ring"]
[dependencies]
actix-service = "2.0.0-beta.4"
actix-codec = "0.4.0-beta.1"
actix-utils = "3.0.0-beta.2"
actix-rt = "2.1"
actix-tls = "3.0.0-beta.4"
actix-service = "0.4.1"
actix-codec = "0.1.2"
actix-connect = "0.2.4"
actix-utils = "0.4.4"
actix-server-config = "0.1.2"
actix-threadpool = "0.1.1"
ahash = "0.7"
base64 = "0.13"
bitflags = "1.2"
bytes = "1"
bytestring = "1"
cfg-if = "1"
cookie = { version = "0.14.1", features = ["percent-encode"], optional = true }
derive_more = "0.99.5"
base64 = "0.10"
bitflags = "1.0"
bytes = "0.4"
copyless = "0.1.4"
derive_more = "0.15.0"
either = "1.5.2"
encoding_rs = "0.8"
futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
futures-util = { version = "0.3.7", default-features = false, features = ["alloc", "sink"] }
h2 = "0.3.1"
http = "0.2.2"
futures = "0.1.25"
hashbrown = "0.6.3"
h2 = "0.1.16"
http = "0.1.17"
httparse = "1.3"
itoa = "0.4"
indexmap = "1.2"
lazy_static = "1.0"
language-tags = "0.2"
once_cell = "1.5"
log = "0.4"
mime = "0.3"
percent-encoding = "2.1"
pin-project = "1.0.0"
rand = "0.8"
regex = "1.3"
rand = "0.7"
regex = "1.0"
serde = "1.0"
serde_json = "1.0"
serde_urlencoded = "0.7"
sha-1 = "0.9"
smallvec = "1.6"
time = { version = "0.2.23", default-features = false, features = ["std"] }
tokio = { version = "1.2", features = ["sync"] }
sha1 = "0.6"
slab = "0.4"
serde_urlencoded = "0.6.1"
time = "0.1.42"
tokio-tcp = "0.1.3"
tokio-timer = "0.2.8"
tokio-current-thread = "0.1"
trust-dns-resolver = { version="0.11.1", default-features = false }
# for secure cookie
ring = { version = "0.14.6", optional = true }
# compression
brotli2 = { version="0.3.2", optional = true }
flate2 = { version = "1.0.13", optional = true }
flate2 = { version="1.0.7", optional = true, default-features = false }
trust-dns-resolver = { version = "0.20.0", optional = true }
# optional deps
failure = { version = "0.1.5", optional = true }
openssl = { version="0.10", optional = true }
rustls = { version = "0.15.2", optional = true }
webpki-roots = { version = "0.16", optional = true }
chrono = "0.4.6"
[dev-dependencies]
actix-server = "2.0.0-beta.3"
actix-http-test = { version = "3.0.0-beta.3", features = ["openssl"] }
actix-tls = { version = "3.0.0-beta.4", features = ["openssl"] }
criterion = "0.3"
env_logger = "0.8"
rcgen = "0.8"
actix-rt = "0.2.2"
actix-server = { version = "0.6.0", features=["ssl", "rust-tls"] }
actix-connect = { version = "0.2.0", features=["ssl"] }
actix-http-test = { version = "0.2.4", features=["ssl"] }
env_logger = "0.6"
serde_derive = "1.0"
tls-openssl = { version = "0.10", package = "openssl" }
tls-rustls = { version = "0.19", package = "rustls" }
[target.'cfg(windows)'.dev-dependencies.tls-openssl]
version = "0.10.9"
package = "openssl"
features = ["vendored"]
[[example]]
name = "ws"
required-features = ["rustls"]
[[bench]]
name = "write-camel-case"
harness = false
[[bench]]
name = "status-line"
harness = false
[[bench]]
name = "uninit-headers"
harness = false
openssl = { version="0.10" }
tokio-tcp = "0.1"

View File

@ -1 +0,0 @@
../LICENSE-APACHE

201
actix-http/LICENSE-APACHE Normal file
View File

@ -0,0 +1,201 @@
Apache License
Version 2.0, January 2004
http://www.apache.org/licenses/
TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
1. Definitions.
"License" shall mean the terms and conditions for use, reproduction,
and distribution as defined by Sections 1 through 9 of this document.
"Licensor" shall mean the copyright owner or entity authorized by
the copyright owner that is granting the License.
"Legal Entity" shall mean the union of the acting entity and all
other entities that control, are controlled by, or are under common
control with that entity. For the purposes of this definition,
"control" means (i) the power, direct or indirect, to cause the
direction or management of such entity, whether by contract or
otherwise, or (ii) ownership of fifty percent (50%) or more of the
outstanding shares, or (iii) beneficial ownership of such entity.
"You" (or "Your") shall mean an individual or Legal Entity
exercising permissions granted by this License.
"Source" form shall mean the preferred form for making modifications,
including but not limited to software source code, documentation
source, and configuration files.
"Object" form shall mean any form resulting from mechanical
transformation or translation of a Source form, including but
not limited to compiled object code, generated documentation,
and conversions to other media types.
"Work" shall mean the work of authorship, whether in Source or
Object form, made available under the License, as indicated by a
copyright notice that is included in or attached to the work
(an example is provided in the Appendix below).
"Derivative Works" shall mean any work, whether in Source or Object
form, that is based on (or derived from) the Work and for which the
editorial revisions, annotations, elaborations, or other modifications
represent, as a whole, an original work of authorship. For the purposes
of this License, Derivative Works shall not include works that remain
separable from, or merely link (or bind by name) to the interfaces of,
the Work and Derivative Works thereof.
"Contribution" shall mean any work of authorship, including
the original version of the Work and any modifications or additions
to that Work or Derivative Works thereof, that is intentionally
submitted to Licensor for inclusion in the Work by the copyright owner
or by an individual or Legal Entity authorized to submit on behalf of
the copyright owner. For the purposes of this definition, "submitted"
means any form of electronic, verbal, or written communication sent
to the Licensor or its representatives, including but not limited to
communication on electronic mailing lists, source code control systems,
and issue tracking systems that are managed by, or on behalf of, the
Licensor for the purpose of discussing and improving the Work, but
excluding communication that is conspicuously marked or otherwise
designated in writing by the copyright owner as "Not a Contribution."
"Contributor" shall mean Licensor and any individual or Legal Entity
on behalf of whom a Contribution has been received by Licensor and
subsequently incorporated within the Work.
2. Grant of Copyright License. Subject to the terms and conditions of
this License, each Contributor hereby grants to You a perpetual,
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
copyright license to reproduce, prepare Derivative Works of,
publicly display, publicly perform, sublicense, and distribute the
Work and such Derivative Works in Source or Object form.
3. Grant of Patent License. Subject to the terms and conditions of
this License, each Contributor hereby grants to You a perpetual,
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
(except as stated in this section) patent license to make, have made,
use, offer to sell, sell, import, and otherwise transfer the Work,
where such license applies only to those patent claims licensable
by such Contributor that are necessarily infringed by their
Contribution(s) alone or by combination of their Contribution(s)
with the Work to which such Contribution(s) was submitted. If You
institute patent litigation against any entity (including a
cross-claim or counterclaim in a lawsuit) alleging that the Work
or a Contribution incorporated within the Work constitutes direct
or contributory patent infringement, then any patent licenses
granted to You under this License for that Work shall terminate
as of the date such litigation is filed.
4. Redistribution. You may reproduce and distribute copies of the
Work or Derivative Works thereof in any medium, with or without
modifications, and in Source or Object form, provided that You
meet the following conditions:
(a) You must give any other recipients of the Work or
Derivative Works a copy of this License; and
(b) You must cause any modified files to carry prominent notices
stating that You changed the files; and
(c) You must retain, in the Source form of any Derivative Works
that You distribute, all copyright, patent, trademark, and
attribution notices from the Source form of the Work,
excluding those notices that do not pertain to any part of
the Derivative Works; and
(d) If the Work includes a "NOTICE" text file as part of its
distribution, then any Derivative Works that You distribute must
include a readable copy of the attribution notices contained
within such NOTICE file, excluding those notices that do not
pertain to any part of the Derivative Works, in at least one
of the following places: within a NOTICE text file distributed
as part of the Derivative Works; within the Source form or
documentation, if provided along with the Derivative Works; or,
within a display generated by the Derivative Works, if and
wherever such third-party notices normally appear. The contents
of the NOTICE file are for informational purposes only and
do not modify the License. You may add Your own attribution
notices within Derivative Works that You distribute, alongside
or as an addendum to the NOTICE text from the Work, provided
that such additional attribution notices cannot be construed
as modifying the License.
You may add Your own copyright statement to Your modifications and
may provide additional or different license terms and conditions
for use, reproduction, or distribution of Your modifications, or
for any such Derivative Works as a whole, provided Your use,
reproduction, and distribution of the Work otherwise complies with
the conditions stated in this License.
5. Submission of Contributions. Unless You explicitly state otherwise,
any Contribution intentionally submitted for inclusion in the Work
by You to the Licensor shall be under the terms and conditions of
this License, without any additional terms or conditions.
Notwithstanding the above, nothing herein shall supersede or modify
the terms of any separate license agreement you may have executed
with Licensor regarding such Contributions.
6. Trademarks. This License does not grant permission to use the trade
names, trademarks, service marks, or product names of the Licensor,
except as required for reasonable and customary use in describing the
origin of the Work and reproducing the content of the NOTICE file.
7. Disclaimer of Warranty. Unless required by applicable law or
agreed to in writing, Licensor provides the Work (and each
Contributor provides its Contributions) on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
implied, including, without limitation, any warranties or conditions
of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
PARTICULAR PURPOSE. You are solely responsible for determining the
appropriateness of using or redistributing the Work and assume any
risks associated with Your exercise of permissions under this License.
8. Limitation of Liability. In no event and under no legal theory,
whether in tort (including negligence), contract, or otherwise,
unless required by applicable law (such as deliberate and grossly
negligent acts) or agreed to in writing, shall any Contributor be
liable to You for damages, including any direct, indirect, special,
incidental, or consequential damages of any character arising as a
result of this License or out of the use or inability to use the
Work (including but not limited to damages for loss of goodwill,
work stoppage, computer failure or malfunction, or any and all
other commercial damages or losses), even if such Contributor
has been advised of the possibility of such damages.
9. Accepting Warranty or Additional Liability. While redistributing
the Work or Derivative Works thereof, You may choose to offer,
and charge a fee for, acceptance of support, warranty, indemnity,
or other liability obligations and/or rights consistent with this
License. However, in accepting such obligations, You may act only
on Your own behalf and on Your sole responsibility, not on behalf
of any other Contributor, and only if You agree to indemnify,
defend, and hold each Contributor harmless for any liability
incurred by, or claims asserted against, such Contributor by reason
of your accepting any such warranty or additional liability.
END OF TERMS AND CONDITIONS
APPENDIX: How to apply the Apache License to your work.
To apply the Apache License to your work, attach the following
boilerplate notice, with the fields enclosed by brackets "{}"
replaced with your own identifying information. (Don't include
the brackets!) The text should be enclosed in the appropriate
comment syntax for the file format. We also recommend that a
file or class name and description of purpose be included on the
same "printed page" as the copyright notice for easier
identification within third-party archives.
Copyright 2017-NOW Nikolay Kim
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.

View File

@ -1 +0,0 @@
../LICENSE-MIT

25
actix-http/LICENSE-MIT Normal file
View File

@ -0,0 +1,25 @@
Copyright (c) 2017 Nikolay Kim
Permission is hereby granted, free of charge, to any
person obtaining a copy of this software and associated
documentation files (the "Software"), to deal in the
Software without restriction, including without
limitation the rights to use, copy, modify, merge,
publish, distribute, sublicense, and/or sell copies of
the Software, and to permit persons to whom the Software
is furnished to do so, subject to the following
conditions:
The above copyright notice and this permission notice
shall be included in all copies or substantial portions
of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF
ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED
TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A
PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT
SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR
IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
DEALINGS IN THE SOFTWARE.

View File

@ -1,53 +1,32 @@
# actix-http
# Actix http [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-http)](https://crates.io/crates/actix-http) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
> HTTP primitives for the Actix ecosystem.
Actix http
[![crates.io](https://img.shields.io/crates/v/actix-http?label=latest)](https://crates.io/crates/actix-http)
[![Documentation](https://docs.rs/actix-http/badge.svg?version=3.0.0-beta.4)](https://docs.rs/actix-http/3.0.0-beta.4)
[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http.svg)
<br />
[![dependency status](https://deps.rs/crate/actix-http/3.0.0-beta.4/status.svg)](https://deps.rs/crate/actix-http/3.0.0-beta.4)
[![Download](https://img.shields.io/crates/d/actix-http.svg)](https://crates.io/crates/actix-http)
[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & community resources
## Documentation & Resources
- [API Documentation](https://docs.rs/actix-http)
- [Chat on Gitter](https://gitter.im/actix/actix-web)
- Minimum Supported Rust Version (MSRV): 1.46.0
* [User Guide](https://actix.rs/docs/)
* [API Documentation](https://docs.rs/actix-http/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-http](https://crates.io/crates/actix-http)
* Minimum supported Rust version: 1.31 or later
## Example
```rust
use std::{env, io};
// see examples/framed_hello.rs for complete list of used crates.
extern crate actix_http;
use actix_http::{h1, Response, ServiceConfig};
use actix_http::{HttpService, Response};
use actix_server::Server;
use futures_util::future;
use http::header::HeaderValue;
use log::info;
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "hello_world=info");
env_logger::init();
Server::build()
.bind("hello-world", "127.0.0.1:8080", || {
HttpService::build()
.client_timeout(1000)
.client_disconnect(1000)
.finish(|_req| {
info!("{:?}", _req);
let mut res = Response::Ok();
res.header("x-head", HeaderValue::from_static("dummy value!"));
future::ok::<_, ()>(res.body("Hello world!"))
})
.tcp()
})?
.run()
.await
fn main() {
Server::new().bind("framed_hello", "127.0.0.1:8080", || {
IntoFramed::new(|| h1::Codec::new(ServiceConfig::default())) // <- create h1 codec
.and_then(TakeItem::new().map_err(|_| ())) // <- read one request
.and_then(|(_req, _framed): (_, Framed<_, _>)| { // <- send response and close conn
SendResponse::send(_framed, Response::Ok().body("Hello world!"))
.map_err(|_| ())
.map(|_| ())
})
}).unwrap().run();
}
```

View File

@ -1,222 +0,0 @@
use criterion::{criterion_group, criterion_main, BenchmarkId, Criterion};
use bytes::BytesMut;
use http::Version;
const CODES: &[u16] = &[201, 303, 404, 515];
fn bench_write_status_line_11(c: &mut Criterion) {
let mut group = c.benchmark_group("write_status_line v1.1");
let version = Version::HTTP_11;
for i in CODES.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_naive::write_status_line(version, i, &mut b);
})
});
}
group.finish();
}
fn bench_write_status_line_10(c: &mut Criterion) {
let mut group = c.benchmark_group("write_status_line v1.0");
let version = Version::HTTP_10;
for i in CODES.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_naive::write_status_line(version, i, &mut b);
})
});
}
group.finish();
}
fn bench_write_status_line_09(c: &mut Criterion) {
let mut group = c.benchmark_group("write_status_line v0.9");
let version = Version::HTTP_09;
for i in CODES.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_naive::write_status_line(version, i, &mut b);
})
});
}
group.finish();
}
criterion_group!(
benches,
bench_write_status_line_11,
bench_write_status_line_10,
bench_write_status_line_09
);
criterion_main!(benches);
mod _naive {
use bytes::{BufMut, BytesMut};
use http::Version;
pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
match version {
Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
_ => {
// other HTTP version handlers do not use this method
}
}
bytes.put_slice(n.to_string().as_bytes());
}
}
mod _new {
use bytes::{BufMut, BytesMut};
use http::Version;
const DIGITS_START: u8 = b'0';
pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
match version {
Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
_ => {
// other HTTP version handlers do not use this method
}
}
let d100 = (n / 100) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
bytes.put_u8(b' ');
}
}
mod _original {
use std::ptr;
use bytes::{BufMut, BytesMut};
use http::Version;
const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
2021222324252627282930313233343536373839\
4041424344454647484950515253545556575859\
6061626364656667686970717273747576777879\
8081828384858687888990919293949596979899";
pub(crate) const STATUS_LINE_BUF_SIZE: usize = 13;
pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesMut) {
let mut buf: [u8; STATUS_LINE_BUF_SIZE] = *b"HTTP/1.1 ";
match version {
Version::HTTP_2 => buf[5] = b'2',
Version::HTTP_10 => buf[7] = b'0',
Version::HTTP_09 => {
buf[5] = b'0';
buf[7] = b'9';
}
_ => {}
}
let mut curr: isize = 12;
let buf_ptr = buf.as_mut_ptr();
let lut_ptr = DEC_DIGITS_LUT.as_ptr();
let four = n > 999;
// decode 2 more chars, if > 2 chars
let d1 = (n % 100) << 1;
n /= 100;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(
lut_ptr.offset(d1 as isize),
buf_ptr.offset(curr),
2,
);
}
// decode last 1 or 2 chars
if n < 10 {
curr -= 1;
unsafe {
*buf_ptr.offset(curr) = (n as u8) + b'0';
}
} else {
let d1 = n << 1;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(
lut_ptr.offset(d1 as isize),
buf_ptr.offset(curr),
2,
);
}
}
bytes.put_slice(&buf);
if four {
bytes.put_u8(b' ');
}
}
}

View File

@ -1,137 +0,0 @@
use criterion::{criterion_group, criterion_main, Criterion};
use bytes::BytesMut;
// A Miri run detects UB, seen on this playground:
// https://play.rust-lang.org/?version=stable&mode=debug&edition=2018&gist=f5d9aa166aa48df8dca05fce2b6c3915
fn bench_header_parsing(c: &mut Criterion) {
c.bench_function("Original (Unsound) [short]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ_SHORT);
_original::parse_headers(&mut buf);
})
});
c.bench_function("New (safe) [short]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ_SHORT);
_new::parse_headers(&mut buf);
})
});
c.bench_function("Original (Unsound) [realistic]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ);
_original::parse_headers(&mut buf);
})
});
c.bench_function("New (safe) [realistic]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ);
_new::parse_headers(&mut buf);
})
});
}
criterion_group!(benches, bench_header_parsing);
criterion_main!(benches);
const MAX_HEADERS: usize = 96;
const EMPTY_HEADER_ARRAY: [httparse::Header<'static>; MAX_HEADERS] =
[httparse::EMPTY_HEADER; MAX_HEADERS];
#[derive(Clone, Copy)]
struct HeaderIndex {
name: (usize, usize),
value: (usize, usize),
}
const EMPTY_HEADER_INDEX: HeaderIndex = HeaderIndex {
name: (0, 0),
value: (0, 0),
};
const EMPTY_HEADER_INDEX_ARRAY: [HeaderIndex; MAX_HEADERS] =
[EMPTY_HEADER_INDEX; MAX_HEADERS];
impl HeaderIndex {
fn record(
bytes: &[u8],
headers: &[httparse::Header<'_>],
indices: &mut [HeaderIndex],
) {
let bytes_ptr = bytes.as_ptr() as usize;
for (header, indices) in headers.iter().zip(indices.iter_mut()) {
let name_start = header.name.as_ptr() as usize - bytes_ptr;
let name_end = name_start + header.name.len();
indices.name = (name_start, name_end);
let value_start = header.value.as_ptr() as usize - bytes_ptr;
let value_end = value_start + header.value.len();
indices.value = (value_start, value_end);
}
}
}
// test cases taken from:
// https://github.com/seanmonstar/httparse/blob/master/benches/parse.rs
const REQ_SHORT: &'static [u8] = b"\
GET / HTTP/1.0\r\n\
Host: example.com\r\n\
Cookie: session=60; user_id=1\r\n\r\n";
const REQ: &'static [u8] = b"\
GET /wp-content/uploads/2010/03/hello-kitty-darth-vader-pink.jpg HTTP/1.1\r\n\
Host: www.kittyhell.com\r\n\
User-Agent: Mozilla/5.0 (Macintosh; U; Intel Mac OS X 10.6; ja-JP-mac; rv:1.9.2.3) Gecko/20100401 Firefox/3.6.3 Pathtraq/0.9\r\n\
Accept: text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8\r\n\
Accept-Language: ja,en-us;q=0.7,en;q=0.3\r\n\
Accept-Encoding: gzip,deflate\r\n\
Accept-Charset: Shift_JIS,utf-8;q=0.7,*;q=0.7\r\n\
Keep-Alive: 115\r\n\
Connection: keep-alive\r\n\
Cookie: wp_ozh_wsa_visits=2; wp_ozh_wsa_visit_lasttime=xxxxxxxxxx; __utma=xxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.x; __utmz=xxxxxxxxx.xxxxxxxxxx.x.x.utmccn=(referral)|utmcsr=reader.livedoor.com|utmcct=/reader/|utmcmd=referral|padding=under256\r\n\r\n";
mod _new {
use super::*;
pub fn parse_headers(src: &mut BytesMut) -> usize {
let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
let mut req = httparse::Request::new(&mut parsed);
match req.parse(src).unwrap() {
httparse::Status::Complete(_len) => {
HeaderIndex::record(src, req.headers, &mut headers);
req.headers.len()
}
_ => unreachable!(),
}
}
}
mod _original {
use super::*;
use std::mem::MaybeUninit;
pub fn parse_headers(src: &mut BytesMut) -> usize {
let mut headers: [HeaderIndex; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut req = httparse::Request::new(&mut parsed);
match req.parse(src).unwrap() {
httparse::Status::Complete(_len) => {
HeaderIndex::record(src, req.headers, &mut headers);
req.headers.len()
}
_ => unreachable!(),
}
}
}

View File

@ -1,89 +0,0 @@
use criterion::{black_box, criterion_group, criterion_main, BenchmarkId, Criterion};
fn bench_write_camel_case(c: &mut Criterion) {
let mut group = c.benchmark_group("write_camel_case");
let names = ["connection", "Transfer-Encoding", "transfer-encoding"];
for &i in &names {
let bts = i.as_bytes();
group.bench_with_input(BenchmarkId::new("Original", i), bts, |b, bts| {
b.iter(|| {
let mut buf = black_box([0; 24]);
_original::write_camel_case(black_box(bts), &mut buf)
});
});
group.bench_with_input(BenchmarkId::new("New", i), bts, |b, bts| {
b.iter(|| {
let mut buf = black_box([0; 24]);
_new::write_camel_case(black_box(bts), &mut buf)
});
});
}
group.finish();
}
criterion_group!(benches, bench_write_camel_case);
criterion_main!(benches);
mod _new {
pub fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
// first copy entire (potentially wrong) slice to output
buffer[..value.len()].copy_from_slice(value);
let mut iter = value.iter();
// first character should be uppercase
if let Some(c @ b'a'..=b'z') = iter.next() {
buffer[0] = c & 0b1101_1111;
}
// track 1 ahead of the current position since that's the location being assigned to
let mut index = 2;
// remaining characters after hyphens should also be uppercase
while let Some(&c) = iter.next() {
if c == b'-' {
// advance iter by one and uppercase if needed
if let Some(c @ b'a'..=b'z') = iter.next() {
buffer[index] = c & 0b1101_1111;
}
}
index += 1;
}
}
}
mod _original {
pub fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
let mut index = 0;
let key = value;
let mut key_iter = key.iter();
if let Some(c) = key_iter.next() {
if *c >= b'a' && *c <= b'z' {
buffer[index] = *c ^ b' ';
index += 1;
}
} else {
return;
}
while let Some(c) = key_iter.next() {
buffer[index] = *c;
index += 1;
if *c == b'-' {
if let Some(c) = key_iter.next() {
if *c >= b'a' && *c <= b'z' {
buffer[index] = *c ^ b' ';
index += 1;
}
}
}
}
}
}

View File

@ -1,14 +1,13 @@
use std::{env, io};
use actix_http::{Error, HttpService, Request, Response};
use actix_http::{error::PayloadError, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures_util::StreamExt;
use futures::{Future, Stream};
use http::header::HeaderValue;
use log::info;
#[actix_rt::main]
async fn main() -> io::Result<()> {
fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "echo=info");
env_logger::init();
@ -17,24 +16,22 @@ async fn main() -> io::Result<()> {
HttpService::build()
.client_timeout(1000)
.client_disconnect(1000)
.finish(|mut req: Request| async move {
let mut body = BytesMut::new();
while let Some(item) = req.payload().next().await {
body.extend_from_slice(&item?);
}
info!("request body: {:?}", body);
Ok::<_, Error>(
Response::Ok()
.insert_header((
.finish(|mut req: Request| {
req.take_payload()
.fold(BytesMut::new(), move |mut body, chunk| {
body.extend_from_slice(&chunk);
Ok::<_, PayloadError>(body)
})
.and_then(|bytes| {
info!("request body: {:?}", bytes);
let mut res = Response::Ok();
res.header(
"x-head",
HeaderValue::from_static("dummy value!"),
))
.body(body),
)
);
Ok(res.body(bytes))
})
})
.tcp()
})?
.run()
.await
}

View File

@ -1,33 +1,34 @@
use std::{env, io};
use actix_http::http::HeaderValue;
use actix_http::{Error, HttpService, Request, Response};
use actix_http::{error::PayloadError, Error, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures_util::StreamExt;
use futures::{Future, Stream};
use log::info;
async fn handle_request(mut req: Request) -> Result<Response, Error> {
let mut body = BytesMut::new();
while let Some(item) = req.payload().next().await {
body.extend_from_slice(&item?)
}
info!("request body: {:?}", body);
Ok(Response::Ok()
.insert_header(("x-head", HeaderValue::from_static("dummy value!")))
.body(body))
fn handle_request(mut req: Request) -> impl Future<Item = Response, Error = Error> {
req.take_payload()
.fold(BytesMut::new(), move |mut body, chunk| {
body.extend_from_slice(&chunk);
Ok::<_, PayloadError>(body)
})
.from_err()
.and_then(|bytes| {
info!("request body: {:?}", bytes);
let mut res = Response::Ok();
res.header("x-head", HeaderValue::from_static("dummy value!"));
Ok(res.body(bytes))
})
}
#[actix_rt::main]
async fn main() -> io::Result<()> {
fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "echo=info");
env_logger::init();
Server::build()
.bind("echo", "127.0.0.1:8080", || {
HttpService::build().finish(handle_request).tcp()
HttpService::build().finish(|_req: Request| handle_request(_req))
})?
.run()
.await
}

View File

@ -2,12 +2,11 @@ use std::{env, io};
use actix_http::{HttpService, Response};
use actix_server::Server;
use futures_util::future;
use futures::future;
use http::header::HeaderValue;
use log::info;
#[actix_rt::main]
async fn main() -> io::Result<()> {
fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "hello_world=info");
env_logger::init();
@ -19,14 +18,9 @@ async fn main() -> io::Result<()> {
.finish(|_req| {
info!("{:?}", _req);
let mut res = Response::Ok();
res.insert_header((
"x-head",
HeaderValue::from_static("dummy value!"),
));
res.header("x-head", HeaderValue::from_static("dummy value!"));
future::ok::<_, ()>(res.body("Hello world!"))
})
.tcp()
})?
.run()
.await
}

View File

@ -1,107 +0,0 @@
//! Sets up a WebSocket server over TCP and TLS.
//! Sends a heartbeat message every 4 seconds but does not respond to any incoming frames.
extern crate tls_rustls as rustls;
use std::{
env, io,
pin::Pin,
task::{Context, Poll},
time::Duration,
};
use actix_codec::Encoder;
use actix_http::{error::Error, ws, HttpService, Request, Response};
use actix_rt::time::{interval, Interval};
use actix_server::Server;
use bytes::{Bytes, BytesMut};
use bytestring::ByteString;
use futures_core::{ready, Stream};
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "actix=info,h2_ws=info");
env_logger::init();
Server::build()
.bind("tcp", ("127.0.0.1", 8080), || {
HttpService::build().h1(handler).tcp()
})?
.bind("tls", ("127.0.0.1", 8443), || {
HttpService::build().finish(handler).rustls(tls_config())
})?
.run()
.await
}
async fn handler(req: Request) -> Result<Response, Error> {
log::info!("handshaking");
let mut res = ws::handshake(req.head())?;
// handshake will always fail under HTTP/2
log::info!("responding");
Ok(res.streaming(Heartbeat::new(ws::Codec::new())))
}
struct Heartbeat {
codec: ws::Codec,
interval: Interval,
}
impl Heartbeat {
fn new(codec: ws::Codec) -> Self {
Self {
codec,
interval: interval(Duration::from_secs(4)),
}
}
}
impl Stream for Heartbeat {
type Item = Result<Bytes, Error>;
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
log::trace!("poll");
ready!(self.as_mut().interval.poll_tick(cx));
let mut buffer = BytesMut::new();
self.as_mut()
.codec
.encode(
ws::Message::Text(ByteString::from_static("hello world")),
&mut buffer,
)
.unwrap();
Poll::Ready(Some(Ok(buffer.freeze())))
}
}
fn tls_config() -> rustls::ServerConfig {
use std::io::BufReader;
use rustls::{
internal::pemfile::{certs, pkcs8_private_keys},
NoClientAuth, ServerConfig,
};
let cert = rcgen::generate_simple_self_signed(vec!["localhost".to_owned()]).unwrap();
let cert_file = cert.serialize_pem().unwrap();
let key_file = cert.serialize_private_key_pem();
let mut config = ServerConfig::new(NoClientAuth::new());
let cert_file = &mut BufReader::new(cert_file.as_bytes());
let key_file = &mut BufReader::new(key_file.as_bytes());
let cert_chain = certs(cert_file).unwrap();
let mut keys = pkcs8_private_keys(key_file).unwrap();
config.set_single_cert(cert_chain, keys.remove(0)).unwrap();
config
}

570
actix-http/src/body.rs Normal file
View File

@ -0,0 +1,570 @@
use std::marker::PhantomData;
use std::{fmt, mem};
use bytes::{Bytes, BytesMut};
use futures::{Async, Poll, Stream};
use crate::error::Error;
#[derive(Debug, PartialEq, Copy, Clone)]
/// Body size hint
pub enum BodySize {
None,
Empty,
Sized(usize),
Sized64(u64),
Stream,
}
impl BodySize {
pub fn is_eof(&self) -> bool {
match self {
BodySize::None
| BodySize::Empty
| BodySize::Sized(0)
| BodySize::Sized64(0) => true,
_ => false,
}
}
}
/// Type that provides this trait can be streamed to a peer.
pub trait MessageBody {
fn size(&self) -> BodySize;
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error>;
}
impl MessageBody for () {
fn size(&self) -> BodySize {
BodySize::Empty
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
Ok(Async::Ready(None))
}
}
impl<T: MessageBody> MessageBody for Box<T> {
fn size(&self) -> BodySize {
self.as_ref().size()
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
self.as_mut().poll_next()
}
}
pub enum ResponseBody<B> {
Body(B),
Other(Body),
}
impl ResponseBody<Body> {
pub fn into_body<B>(self) -> ResponseBody<B> {
match self {
ResponseBody::Body(b) => ResponseBody::Other(b),
ResponseBody::Other(b) => ResponseBody::Other(b),
}
}
}
impl<B> ResponseBody<B> {
pub fn take_body(&mut self) -> ResponseBody<B> {
std::mem::replace(self, ResponseBody::Other(Body::None))
}
}
impl<B: MessageBody> ResponseBody<B> {
pub fn as_ref(&self) -> Option<&B> {
if let ResponseBody::Body(ref b) = self {
Some(b)
} else {
None
}
}
}
impl<B: MessageBody> MessageBody for ResponseBody<B> {
fn size(&self) -> BodySize {
match self {
ResponseBody::Body(ref body) => body.size(),
ResponseBody::Other(ref body) => body.size(),
}
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
match self {
ResponseBody::Body(ref mut body) => body.poll_next(),
ResponseBody::Other(ref mut body) => body.poll_next(),
}
}
}
impl<B: MessageBody> Stream for ResponseBody<B> {
type Item = Bytes;
type Error = Error;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
self.poll_next()
}
}
/// Represents various types of http message body.
pub enum Body {
/// Empty response. `Content-Length` header is not set.
None,
/// Zero sized response body. `Content-Length` header is set to `0`.
Empty,
/// Specific response body.
Bytes(Bytes),
/// Generic message body.
Message(Box<dyn MessageBody>),
}
impl Body {
/// Create body from slice (copy)
pub fn from_slice(s: &[u8]) -> Body {
Body::Bytes(Bytes::from(s))
}
/// Create body from generic message body.
pub fn from_message<B: MessageBody + 'static>(body: B) -> Body {
Body::Message(Box::new(body))
}
}
impl MessageBody for Body {
fn size(&self) -> BodySize {
match self {
Body::None => BodySize::None,
Body::Empty => BodySize::Empty,
Body::Bytes(ref bin) => BodySize::Sized(bin.len()),
Body::Message(ref body) => body.size(),
}
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
match self {
Body::None => Ok(Async::Ready(None)),
Body::Empty => Ok(Async::Ready(None)),
Body::Bytes(ref mut bin) => {
let len = bin.len();
if len == 0 {
Ok(Async::Ready(None))
} else {
Ok(Async::Ready(Some(mem::replace(bin, Bytes::new()))))
}
}
Body::Message(ref mut body) => body.poll_next(),
}
}
}
impl PartialEq for Body {
fn eq(&self, other: &Body) -> bool {
match *self {
Body::None => match *other {
Body::None => true,
_ => false,
},
Body::Empty => match *other {
Body::Empty => true,
_ => false,
},
Body::Bytes(ref b) => match *other {
Body::Bytes(ref b2) => b == b2,
_ => false,
},
Body::Message(_) => false,
}
}
}
impl fmt::Debug for Body {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
match *self {
Body::None => write!(f, "Body::None"),
Body::Empty => write!(f, "Body::Empty"),
Body::Bytes(ref b) => write!(f, "Body::Bytes({:?})", b),
Body::Message(_) => write!(f, "Body::Message(_)"),
}
}
}
impl From<&'static str> for Body {
fn from(s: &'static str) -> Body {
Body::Bytes(Bytes::from_static(s.as_ref()))
}
}
impl From<&'static [u8]> for Body {
fn from(s: &'static [u8]) -> Body {
Body::Bytes(Bytes::from_static(s))
}
}
impl From<Vec<u8>> for Body {
fn from(vec: Vec<u8>) -> Body {
Body::Bytes(Bytes::from(vec))
}
}
impl From<String> for Body {
fn from(s: String) -> Body {
s.into_bytes().into()
}
}
impl<'a> From<&'a String> for Body {
fn from(s: &'a String) -> Body {
Body::Bytes(Bytes::from(AsRef::<[u8]>::as_ref(&s)))
}
}
impl From<Bytes> for Body {
fn from(s: Bytes) -> Body {
Body::Bytes(s)
}
}
impl From<BytesMut> for Body {
fn from(s: BytesMut) -> Body {
Body::Bytes(s.freeze())
}
}
impl From<serde_json::Value> for Body {
fn from(v: serde_json::Value) -> Body {
Body::Bytes(v.to_string().into())
}
}
impl<S> From<SizedStream<S>> for Body
where
S: Stream<Item = Bytes, Error = Error> + 'static,
{
fn from(s: SizedStream<S>) -> Body {
Body::from_message(s)
}
}
impl<S, E> From<BodyStream<S, E>> for Body
where
S: Stream<Item = Bytes, Error = E> + 'static,
E: Into<Error> + 'static,
{
fn from(s: BodyStream<S, E>) -> Body {
Body::from_message(s)
}
}
impl MessageBody for Bytes {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
if self.is_empty() {
Ok(Async::Ready(None))
} else {
Ok(Async::Ready(Some(mem::replace(self, Bytes::new()))))
}
}
}
impl MessageBody for BytesMut {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
if self.is_empty() {
Ok(Async::Ready(None))
} else {
Ok(Async::Ready(Some(
mem::replace(self, BytesMut::new()).freeze(),
)))
}
}
}
impl MessageBody for &'static str {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
if self.is_empty() {
Ok(Async::Ready(None))
} else {
Ok(Async::Ready(Some(Bytes::from_static(
mem::replace(self, "").as_ref(),
))))
}
}
}
impl MessageBody for &'static [u8] {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
if self.is_empty() {
Ok(Async::Ready(None))
} else {
Ok(Async::Ready(Some(Bytes::from_static(mem::replace(
self, b"",
)))))
}
}
}
impl MessageBody for Vec<u8> {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
if self.is_empty() {
Ok(Async::Ready(None))
} else {
Ok(Async::Ready(Some(Bytes::from(mem::replace(
self,
Vec::new(),
)))))
}
}
}
impl MessageBody for String {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
if self.is_empty() {
Ok(Async::Ready(None))
} else {
Ok(Async::Ready(Some(Bytes::from(
mem::replace(self, String::new()).into_bytes(),
))))
}
}
}
/// Type represent streaming body.
/// Response does not contain `content-length` header and appropriate transfer encoding is used.
pub struct BodyStream<S, E> {
stream: S,
_t: PhantomData<E>,
}
impl<S, E> BodyStream<S, E>
where
S: Stream<Item = Bytes, Error = E>,
E: Into<Error>,
{
pub fn new(stream: S) -> Self {
BodyStream {
stream,
_t: PhantomData,
}
}
}
impl<S, E> MessageBody for BodyStream<S, E>
where
S: Stream<Item = Bytes, Error = E>,
E: Into<Error>,
{
fn size(&self) -> BodySize {
BodySize::Stream
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
self.stream.poll().map_err(std::convert::Into::into)
}
}
/// Type represent streaming body. This body implementation should be used
/// if total size of stream is known. Data get sent as is without using transfer encoding.
pub struct SizedStream<S> {
size: u64,
stream: S,
}
impl<S> SizedStream<S>
where
S: Stream<Item = Bytes, Error = Error>,
{
pub fn new(size: u64, stream: S) -> Self {
SizedStream { size, stream }
}
}
impl<S> MessageBody for SizedStream<S>
where
S: Stream<Item = Bytes, Error = Error>,
{
fn size(&self) -> BodySize {
BodySize::Sized64(self.size)
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
self.stream.poll()
}
}
#[cfg(test)]
mod tests {
use super::*;
impl Body {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
Body::Bytes(ref bin) => &bin,
_ => panic!(),
}
}
}
impl ResponseBody<Body> {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
ResponseBody::Body(ref b) => b.get_ref(),
ResponseBody::Other(ref b) => b.get_ref(),
}
}
}
#[test]
fn test_static_str() {
assert_eq!(Body::from("").size(), BodySize::Sized(0));
assert_eq!(Body::from("test").size(), BodySize::Sized(4));
assert_eq!(Body::from("test").get_ref(), b"test");
assert_eq!("test".size(), BodySize::Sized(4));
assert_eq!(
"test".poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
);
}
#[test]
fn test_static_bytes() {
assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
assert_eq!(
Body::from_slice(b"test".as_ref()).size(),
BodySize::Sized(4)
);
assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
assert_eq!((&b"test"[..]).size(), BodySize::Sized(4));
assert_eq!(
(&b"test"[..]).poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
);
}
#[test]
fn test_vec() {
assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
assert_eq!(Vec::from("test").size(), BodySize::Sized(4));
assert_eq!(
Vec::from("test").poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
);
}
#[test]
fn test_bytes() {
let mut b = Bytes::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
b.poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
);
}
#[test]
fn test_bytes_mut() {
let mut b = BytesMut::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
b.poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
);
}
#[test]
fn test_string() {
let mut b = "test".to_owned();
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
assert_eq!(Body::from(&b).get_ref(), b"test");
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
b.poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
);
}
#[test]
fn test_unit() {
assert_eq!(().size(), BodySize::Empty);
assert_eq!(().poll_next().unwrap(), Async::Ready(None));
}
#[test]
fn test_box() {
let mut val = Box::new(());
assert_eq!(val.size(), BodySize::Empty);
assert_eq!(val.poll_next().unwrap(), Async::Ready(None));
}
#[test]
fn test_body_eq() {
assert!(Body::None == Body::None);
assert!(Body::None != Body::Empty);
assert!(Body::Empty == Body::Empty);
assert!(Body::Empty != Body::None);
assert!(
Body::Bytes(Bytes::from_static(b"1"))
== Body::Bytes(Bytes::from_static(b"1"))
);
assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
}
#[test]
fn test_body_debug() {
assert!(format!("{:?}", Body::None).contains("Body::None"));
assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains("1"));
}
#[test]
fn test_serde_json() {
use serde_json::json;
assert_eq!(
Body::from(serde_json::Value::String("test".into())).size(),
BodySize::Sized(6)
);
assert_eq!(
Body::from(json!({"test-key":"test-value"})).size(),
BodySize::Sized(25)
);
}
}

View File

@ -1,158 +0,0 @@
use std::{
fmt, mem,
pin::Pin,
task::{Context, Poll},
};
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use crate::error::Error;
use super::{BodySize, BodyStream, MessageBody, SizedStream};
/// Represents various types of HTTP message body.
pub enum Body {
/// Empty response. `Content-Length` header is not set.
None,
/// Zero sized response body. `Content-Length` header is set to `0`.
Empty,
/// Specific response body.
Bytes(Bytes),
/// Generic message body.
Message(Box<dyn MessageBody + Unpin>),
}
impl Body {
/// Create body from slice (copy)
pub fn from_slice(s: &[u8]) -> Body {
Body::Bytes(Bytes::copy_from_slice(s))
}
/// Create body from generic message body.
pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
Body::Message(Box::new(body))
}
}
impl MessageBody for Body {
fn size(&self) -> BodySize {
match self {
Body::None => BodySize::None,
Body::Empty => BodySize::Empty,
Body::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
Body::Message(ref body) => body.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.get_mut() {
Body::None => Poll::Ready(None),
Body::Empty => Poll::Ready(None),
Body::Bytes(ref mut bin) => {
let len = bin.len();
if len == 0 {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(bin))))
}
}
Body::Message(body) => Pin::new(&mut **body).poll_next(cx),
}
}
}
impl PartialEq for Body {
fn eq(&self, other: &Body) -> bool {
match *self {
Body::None => matches!(*other, Body::None),
Body::Empty => matches!(*other, Body::Empty),
Body::Bytes(ref b) => match *other {
Body::Bytes(ref b2) => b == b2,
_ => false,
},
Body::Message(_) => false,
}
}
}
impl fmt::Debug for Body {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
Body::None => write!(f, "Body::None"),
Body::Empty => write!(f, "Body::Empty"),
Body::Bytes(ref b) => write!(f, "Body::Bytes({:?})", b),
Body::Message(_) => write!(f, "Body::Message(_)"),
}
}
}
impl From<&'static str> for Body {
fn from(s: &'static str) -> Body {
Body::Bytes(Bytes::from_static(s.as_ref()))
}
}
impl From<&'static [u8]> for Body {
fn from(s: &'static [u8]) -> Body {
Body::Bytes(Bytes::from_static(s))
}
}
impl From<Vec<u8>> for Body {
fn from(vec: Vec<u8>) -> Body {
Body::Bytes(Bytes::from(vec))
}
}
impl From<String> for Body {
fn from(s: String) -> Body {
s.into_bytes().into()
}
}
impl<'a> From<&'a String> for Body {
fn from(s: &'a String) -> Body {
Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
}
}
impl From<Bytes> for Body {
fn from(s: Bytes) -> Body {
Body::Bytes(s)
}
}
impl From<BytesMut> for Body {
fn from(s: BytesMut) -> Body {
Body::Bytes(s.freeze())
}
}
impl From<serde_json::Value> for Body {
fn from(v: serde_json::Value) -> Body {
Body::Bytes(v.to_string().into())
}
}
impl<S> From<SizedStream<S>> for Body
where
S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
{
fn from(s: SizedStream<S>) -> Body {
Body::from_message(s)
}
}
impl<S, E> From<BodyStream<S>> for Body
where
S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
E: Into<Error> + 'static,
{
fn from(s: BodyStream<S>) -> Body {
Body::from_message(s)
}
}

View File

@ -1,59 +0,0 @@
use std::{
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
use crate::error::Error;
use super::{BodySize, MessageBody};
/// Streaming response wrapper.
///
/// Response does not contain `Content-Length` header and appropriate transfer encoding is used.
pub struct BodyStream<S: Unpin> {
stream: S,
}
impl<S, E> BodyStream<S>
where
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
pub fn new(stream: S) -> Self {
BodyStream { stream }
}
}
impl<S, E> MessageBody for BodyStream<S>
where
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
fn size(&self) -> BodySize {
BodySize::Stream
}
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`BodyStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
loop {
let stream = &mut self.as_mut().stream;
let chunk = match ready!(Pin::new(stream).poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
opt => opt.map(|res| res.map_err(Into::into)),
};
return Poll::Ready(chunk);
}
}
}

View File

@ -1,142 +0,0 @@
//! [`MessageBody`] trait and foreign implementations.
use std::{
mem,
pin::Pin,
task::{Context, Poll},
};
use bytes::{Bytes, BytesMut};
use crate::error::Error;
use super::BodySize;
/// Type that implement this trait can be streamed to a peer.
pub trait MessageBody {
fn size(&self) -> BodySize;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>>;
downcast_get_type_id!();
}
downcast!(MessageBody);
impl MessageBody for () {
fn size(&self) -> BodySize {
BodySize::Empty
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Poll::Ready(None)
}
}
impl<T: MessageBody + Unpin> MessageBody for Box<T> {
fn size(&self) -> BodySize {
self.as_ref().size()
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Pin::new(self.get_mut().as_mut()).poll_next(cx)
}
}
impl MessageBody for Bytes {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
}
}
}
impl MessageBody for BytesMut {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
}
}
}
impl MessageBody for &'static str {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from_static(
mem::take(self.get_mut()).as_ref(),
))))
}
}
}
impl MessageBody for Vec<u8> {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
}
}
}
impl MessageBody for String {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from(
mem::take(self.get_mut()).into_bytes(),
))))
}
}
}

View File

@ -1,252 +0,0 @@
//! Traits and structures to aid consuming and writing HTTP payloads.
#[allow(clippy::module_inception)]
mod body;
mod body_stream;
mod message_body;
mod response_body;
mod size;
mod sized_stream;
pub use self::body::Body;
pub use self::body_stream::BodyStream;
pub use self::message_body::MessageBody;
pub use self::response_body::ResponseBody;
pub use self::size::BodySize;
pub use self::sized_stream::SizedStream;
#[cfg(test)]
mod tests {
use std::pin::Pin;
use actix_rt::pin;
use bytes::{Bytes, BytesMut};
use futures_util::{future::poll_fn, stream};
use super::*;
impl Body {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
Body::Bytes(ref bin) => &bin,
_ => panic!(),
}
}
}
impl ResponseBody<Body> {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
ResponseBody::Body(ref b) => b.get_ref(),
ResponseBody::Other(ref b) => b.get_ref(),
}
}
}
#[actix_rt::test]
async fn test_static_str() {
assert_eq!(Body::from("").size(), BodySize::Sized(0));
assert_eq!(Body::from("test").size(), BodySize::Sized(4));
assert_eq!(Body::from("test").get_ref(), b"test");
assert_eq!("test".size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_static_bytes() {
assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
assert_eq!(
Body::from_slice(b"test".as_ref()).size(),
BodySize::Sized(4)
);
assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
let sb = Bytes::from(&b"test"[..]);
pin!(sb);
assert_eq!(sb.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_vec() {
assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
let test_vec = Vec::from("test");
pin!(test_vec);
assert_eq!(test_vec.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| test_vec.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_bytes() {
let b = Bytes::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_bytes_mut() {
let b = BytesMut::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_string() {
let b = "test".to_owned();
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
assert_eq!(Body::from(&b).get_ref(), b"test");
pin!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_unit() {
assert_eq!(().size(), BodySize::Empty);
assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
.await
.is_none());
}
#[actix_rt::test]
async fn test_box() {
let val = Box::new(());
pin!(val);
assert_eq!(val.size(), BodySize::Empty);
assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
}
#[actix_rt::test]
async fn test_body_eq() {
assert!(
Body::Bytes(Bytes::from_static(b"1"))
== Body::Bytes(Bytes::from_static(b"1"))
);
assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
}
#[actix_rt::test]
async fn test_body_debug() {
assert!(format!("{:?}", Body::None).contains("Body::None"));
assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
}
#[actix_rt::test]
async fn test_serde_json() {
use serde_json::json;
assert_eq!(
Body::from(serde_json::Value::String("test".into())).size(),
BodySize::Sized(6)
);
assert_eq!(
Body::from(json!({"test-key":"test-value"})).size(),
BodySize::Sized(25)
);
}
#[actix_rt::test]
async fn body_stream_skips_empty_chunks() {
let body = BodyStream::new(stream::iter(
["1", "", "2"]
.iter()
.map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
));
pin!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
mod sized_stream {
use super::*;
#[actix_rt::test]
async fn skips_empty_chunks() {
let body = SizedStream::new(
2,
stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
);
pin!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
}
#[actix_rt::test]
async fn test_body_casting() {
let mut body = String::from("hello cast");
let resp_body: &mut dyn MessageBody = &mut body;
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast");
let body = &mut resp_body.downcast_mut::<String>().unwrap();
body.push('!');
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast!");
let not_body = resp_body.downcast_ref::<()>();
assert!(not_body.is_none());
}
}

View File

@ -1,77 +0,0 @@
use std::{
mem,
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::Stream;
use pin_project::pin_project;
use crate::error::Error;
use super::{Body, BodySize, MessageBody};
#[pin_project(project = ResponseBodyProj)]
pub enum ResponseBody<B> {
Body(#[pin] B),
Other(Body),
}
impl ResponseBody<Body> {
pub fn into_body<B>(self) -> ResponseBody<B> {
match self {
ResponseBody::Body(b) => ResponseBody::Other(b),
ResponseBody::Other(b) => ResponseBody::Other(b),
}
}
}
impl<B> ResponseBody<B> {
pub fn take_body(&mut self) -> ResponseBody<B> {
mem::replace(self, ResponseBody::Other(Body::None))
}
}
impl<B: MessageBody> ResponseBody<B> {
pub fn as_ref(&self) -> Option<&B> {
if let ResponseBody::Body(ref b) = self {
Some(b)
} else {
None
}
}
}
impl<B: MessageBody> MessageBody for ResponseBody<B> {
fn size(&self) -> BodySize {
match self {
ResponseBody::Body(ref body) => body.size(),
ResponseBody::Other(ref body) => body.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
}
}
}
impl<B: MessageBody> Stream for ResponseBody<B> {
type Item = Result<Bytes, Error>;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
}
}
}

View File

@ -1,40 +0,0 @@
/// Body size hint.
#[derive(Debug, Clone, Copy, PartialEq)]
pub enum BodySize {
/// Absence of body can be assumed from method or status code.
///
/// Will skip writing Content-Length header.
None,
/// Zero size body.
///
/// Will write `Content-Length: 0` header.
Empty,
/// Known size body.
///
/// Will write `Content-Length: N` header. `Sized(0)` is treated the same as `Empty`.
Sized(u64),
/// Unknown size body.
///
/// Will not write Content-Length header. Can be used with chunked Transfer-Encoding.
Stream,
}
impl BodySize {
/// Returns true if size hint indicates no or empty body.
///
/// ```
/// # use actix_http::body::BodySize;
/// assert!(BodySize::None.is_eof());
/// assert!(BodySize::Empty.is_eof());
/// assert!(BodySize::Sized(0).is_eof());
///
/// assert!(!BodySize::Sized(64).is_eof());
/// assert!(!BodySize::Stream.is_eof());
/// ```
pub fn is_eof(&self) -> bool {
matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
}
}

View File

@ -1,59 +0,0 @@
use std::{
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
use crate::error::Error;
use super::{BodySize, MessageBody};
/// Known sized streaming response wrapper.
///
/// This body implementation should be used if total size of stream is known. Data get sent as is
/// without using transfer encoding.
pub struct SizedStream<S: Unpin> {
size: u64,
stream: S,
}
impl<S> SizedStream<S>
where
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
pub fn new(size: u64, stream: S) -> Self {
SizedStream { size, stream }
}
}
impl<S> MessageBody for SizedStream<S>
where
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
fn size(&self) -> BodySize {
BodySize::Sized(self.size as u64)
}
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`SizedStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
loop {
let stream = &mut self.as_mut().stream;
let chunk = match ready!(Pin::new(stream).poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
val => val,
};
return Poll::Ready(chunk);
}
}
}

View File

@ -1,42 +1,40 @@
use std::fmt;
use std::marker::PhantomData;
use std::rc::Rc;
use std::{fmt, net};
use actix_codec::Framed;
use actix_service::{IntoServiceFactory, Service, ServiceFactory};
use actix_server_config::ServerConfig as SrvConfig;
use actix_service::{IntoNewService, NewService, Service};
use crate::body::MessageBody;
use crate::config::{KeepAlive, ServiceConfig};
use crate::error::Error;
use crate::h1::{Codec, ExpectHandler, H1Service, UpgradeHandler};
use crate::h2::H2Service;
use crate::helpers::{Data, DataFactory};
use crate::request::Request;
use crate::response::Response;
use crate::service::HttpService;
use crate::{ConnectCallback, Extensions};
/// A HTTP service builder
/// A http service builder
///
/// This type can be used to construct an instance of [`HttpService`] through a
/// This type can be used to construct an instance of `http service` through a
/// builder-like pattern.
pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler> {
pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
keep_alive: KeepAlive,
client_timeout: u64,
client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
expect: X,
upgrade: Option<U>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
_phantom: PhantomData<S>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, S)>,
}
impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler>
impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler<T>>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
<S::Service as Service<Request>>::Future: 'static,
{
/// Create instance of `ServiceConfigBuilder`
pub fn new() -> Self {
@ -44,30 +42,29 @@ where
keep_alive: KeepAlive::Timeout(5),
client_timeout: 5000,
client_disconnect: 0,
secure: false,
local_addr: None,
expect: ExpectHandler,
upgrade: None,
on_connect_ext: None,
_phantom: PhantomData,
on_connect: None,
_t: PhantomData,
}
}
}
impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
<S::Service as Service<Request>>::Future: 'static,
X: ServiceFactory<Request, Config = (), Response = Request>,
X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service<Request>>::Future: 'static,
U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
U: NewService<
Config = SrvConfig,
Request = (Request, Framed<T, Codec>),
Response = (),
>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
{
/// Set server keep-alive setting.
///
@ -77,18 +74,6 @@ where
self
}
/// Set connection secure state
pub fn secure(mut self) -> Self {
self.secure = true;
self
}
/// Set the local address that this service is bound to.
pub fn local_addr(mut self, addr: net::SocketAddr) -> Self {
self.local_addr = Some(addr);
self
}
/// Set server client timeout in milliseconds for first request.
///
/// Defines a timeout for reading client request header. If a client does not transmit
@ -123,22 +108,19 @@ where
/// request will be forwarded to main service.
pub fn expect<F, X1>(self, expect: F) -> HttpServiceBuilder<T, S, X1, U>
where
F: IntoServiceFactory<X1, Request>,
X1: ServiceFactory<Request, Config = (), Response = Request>,
F: IntoNewService<X1>,
X1: NewService<Config = SrvConfig, Request = Request, Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
<X1::Service as Service<Request>>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect,
secure: self.secure,
local_addr: self.local_addr,
expect: expect.into_factory(),
expect: expect.into_new_service(),
upgrade: self.upgrade,
on_connect_ext: self.on_connect_ext,
_phantom: PhantomData,
on_connect: self.on_connect,
_t: PhantomData,
}
}
@ -148,43 +130,44 @@ where
/// and this service get called with original request and framed object.
pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
where
F: IntoServiceFactory<U1, (Request, Framed<T, Codec>)>,
U1: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
F: IntoNewService<U1>,
U1: NewService<
Config = SrvConfig,
Request = (Request, Framed<T, Codec>),
Response = (),
>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
<U1::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect,
secure: self.secure,
local_addr: self.local_addr,
expect: self.expect,
upgrade: Some(upgrade.into_factory()),
on_connect_ext: self.on_connect_ext,
_phantom: PhantomData,
upgrade: Some(upgrade.into_new_service()),
on_connect: self.on_connect,
_t: PhantomData,
}
}
/// Sets the callback to be run on connection establishment.
/// Set on-connect callback.
///
/// Has mutable access to a data container that will be merged into request extensions.
/// This enables transport layer data (like client certificates) to be accessed in middleware
/// and handlers.
pub fn on_connect_ext<F>(mut self, f: F) -> Self
/// It get called once per connection and result of the call
/// get stored to the request's extensions.
pub fn on_connect<F, I>(mut self, f: F) -> Self
where
F: Fn(&T, &mut Extensions) + 'static,
F: Fn(&T) -> I + 'static,
I: Clone + 'static,
{
self.on_connect_ext = Some(Rc::new(f));
self.on_connect = Some(Rc::new(move |io| Box::new(Data(f(io)))));
self
}
/// Finish service configuration and create a HTTP Service for HTTP/1 protocol.
pub fn h1<F, B>(self, service: F) -> H1Service<T, S, B, X, U>
/// Finish service configuration and create *http service* for HTTP/1 protocol.
pub fn h1<F, P, B>(self, service: F) -> H1Service<T, P, S, B, X, U>
where
B: MessageBody,
F: IntoServiceFactory<S, Request>,
B: MessageBody + 'static,
F: IntoNewService<S>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
@ -193,59 +176,50 @@ where
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
H1Service::with_config(cfg, service.into_factory())
H1Service::with_config(cfg, service.into_new_service())
.expect(self.expect)
.upgrade(self.upgrade)
.on_connect_ext(self.on_connect_ext)
.on_connect(self.on_connect)
}
/// Finish service configuration and create a HTTP service for HTTP/2 protocol.
pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
/// Finish service configuration and create *http service* for HTTP/2 protocol.
pub fn h2<F, P, B>(self, service: F) -> H2Service<T, P, S, B>
where
B: MessageBody + 'static,
F: IntoServiceFactory<S, Request>,
S::Error: Into<Error> + 'static,
F: IntoNewService<S>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
S::Response: Into<Response<B>>,
<S::Service as Service>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
H2Service::with_config(cfg, service.into_factory())
.on_connect_ext(self.on_connect_ext)
H2Service::with_config(cfg, service.into_new_service())
.on_connect(self.on_connect)
}
/// Finish service configuration and create `HttpService` instance.
pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
pub fn finish<F, P, B>(self, service: F) -> HttpService<T, P, S, B, X, U>
where
B: MessageBody + 'static,
F: IntoServiceFactory<S, Request>,
S::Error: Into<Error> + 'static,
F: IntoNewService<S>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
S::Response: Into<Response<B>>,
<S::Service as Service>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
HttpService::with_config(cfg, service.into_factory())
HttpService::with_config(cfg, service.into_new_service())
.expect(self.expect)
.upgrade(self.upgrade)
.on_connect_ext(self.on_connect_ext)
.on_connect(self.on_connect)
}
}

View File

@ -1,41 +0,0 @@
use std::net::IpAddr;
use std::time::Duration;
const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2MB
const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1MB
/// Connector configuration
#[derive(Clone)]
pub(crate) struct ConnectorConfig {
pub(crate) timeout: Duration,
pub(crate) conn_lifetime: Duration,
pub(crate) conn_keep_alive: Duration,
pub(crate) disconnect_timeout: Option<Duration>,
pub(crate) limit: usize,
pub(crate) conn_window_size: u32,
pub(crate) stream_window_size: u32,
pub(crate) local_address: Option<IpAddr>,
}
impl Default for ConnectorConfig {
fn default() -> Self {
Self {
timeout: Duration::from_secs(5),
conn_lifetime: Duration::from_secs(75),
conn_keep_alive: Duration::from_secs(15),
disconnect_timeout: Some(Duration::from_millis(3000)),
limit: 100,
conn_window_size: DEFAULT_H2_CONN_WINDOW,
stream_window_size: DEFAULT_H2_STREAM_WINDOW,
local_address: None,
}
}
}
impl ConnectorConfig {
pub(crate) fn no_disconnect_timeout(&self) -> Self {
let mut res = self.clone();
res.disconnect_timeout = None;
res
}
}

View File

@ -1,14 +1,10 @@
use std::ops::{Deref, DerefMut};
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, io, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
use actix_rt::task::JoinHandle;
use bytes::Bytes;
use futures_core::future::LocalBoxFuture;
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use bytes::{Buf, Bytes};
use futures::future::{err, Either, Future, FutureResult};
use futures::Poll;
use h2::client::SendRequest;
use pin_project::pin_project;
use crate::body::MessageBody;
use crate::h1::ClientCodec;
@ -16,98 +12,47 @@ use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::Payload;
use super::error::SendRequestError;
use super::pool::Acquired;
use super::pool::{Acquired, Protocol};
use super::{h1proto, h2proto};
pub(crate) enum ConnectionType<Io> {
H1(Io),
H2(H2Connection),
}
/// `H2Connection` has two parts: `SendRequest` and `Connection`.
///
/// `Connection` is spawned as an async task on runtime and `H2Connection` holds a handle for
/// this task. Therefore, it can wake up and quit the task when SendRequest is dropped.
pub(crate) struct H2Connection {
handle: JoinHandle<()>,
sender: SendRequest<Bytes>,
}
impl H2Connection {
pub(crate) fn new<Io>(
sender: SendRequest<Bytes>,
connection: h2::client::Connection<Io>,
) -> Self
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
let handle = actix_rt::spawn(async move {
let _ = connection.await;
});
Self { handle, sender }
}
}
// cancel spawned connection task on drop.
impl Drop for H2Connection {
fn drop(&mut self) {
self.handle.abort();
}
}
// only expose sender type to public.
impl Deref for H2Connection {
type Target = SendRequest<Bytes>;
fn deref(&self) -> &Self::Target {
&self.sender
}
}
impl DerefMut for H2Connection {
fn deref_mut(&mut self) -> &mut Self::Target {
&mut self.sender
}
H2(SendRequest<Bytes>),
}
pub trait Connection {
type Io: AsyncRead + AsyncWrite + Unpin;
type Io: AsyncRead + AsyncWrite;
type Future: Future<Item = (ResponseHead, Payload), Error = SendRequestError>;
fn protocol(&self) -> Protocol;
/// Send request and body
fn send_request<B, H>(
fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
self,
head: H,
body: B,
) -> LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>
where
B: MessageBody + 'static,
H: Into<RequestHeadType> + 'static;
) -> Self::Future;
type TunnelFuture: Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
Error = SendRequestError,
>;
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType> + 'static>(
self,
head: H,
) -> LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>;
fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture;
}
pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
/// Close connection
fn close(self: Pin<&mut Self>);
fn close(&mut self);
/// Release connection to the connection pool
fn release(self: Pin<&mut Self>);
fn release(&mut self);
}
#[doc(hidden)]
/// HTTP client connection
pub struct IoConnection<T>
where
T: AsyncWrite + Unpin + 'static,
{
pub struct IoConnection<T> {
io: Option<ConnectionType<T>>,
created: time::Instant,
pool: Option<Acquired<T>>,
@ -115,9 +60,9 @@ where
impl<T> fmt::Debug for IoConnection<T>
where
T: AsyncWrite + Unpin + fmt::Debug + 'static,
T: fmt::Debug,
{
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
match self.io {
Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
@ -126,7 +71,7 @@ where
}
}
impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
pub(crate) fn new(
io: ConnectionType<T>,
created: time::Instant,
@ -142,36 +87,63 @@ impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
pub(crate) fn into_inner(self) -> (ConnectionType<T>, time::Instant) {
(self.io.unwrap(), self.created)
}
}
#[cfg(test)]
pub(crate) fn into_parts(self) -> (ConnectionType<T>, time::Instant, Acquired<T>) {
(self.io.unwrap(), self.created, self.pool.unwrap())
}
impl<T> Connection for IoConnection<T>
where
T: AsyncRead + AsyncWrite + 'static,
{
type Io = T;
type Future =
Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
async fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
mut self,
head: H,
body: B,
) -> Result<(ResponseHead, Payload), SendRequestError> {
match self.io.take().unwrap() {
ConnectionType::H1(io) => {
h1proto::send_request(io, head.into(), body, self.created, self.pool)
.await
}
ConnectionType::H2(io) => {
h2proto::send_request(io, head.into(), body, self.created, self.pool)
.await
}
fn protocol(&self) -> Protocol {
match self.io {
Some(ConnectionType::H1(_)) => Protocol::Http1,
Some(ConnectionType::H2(_)) => Protocol::Http2,
None => Protocol::Http1,
}
}
/// Send request, returns Response and Framed
async fn open_tunnel<H: Into<RequestHeadType>>(
fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
mut self,
head: H,
) -> Result<(ResponseHead, Framed<T, ClientCodec>), SendRequestError> {
body: B,
) -> Self::Future {
match self.io.take().unwrap() {
ConnectionType::H1(io) => h1proto::open_tunnel(io, head.into()).await,
ConnectionType::H1(io) => Box::new(h1proto::send_request(
io,
head.into(),
body,
self.created,
self.pool,
)),
ConnectionType::H2(io) => Box::new(h2proto::send_request(
io,
head.into(),
body,
self.created,
self.pool,
)),
}
}
type TunnelFuture = Either<
Box<
dyn Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
Error = SendRequestError,
>,
>,
FutureResult<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>;
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
match self.io.take().unwrap() {
ConnectionType::H1(io) => {
Either::A(Box::new(h1proto::open_tunnel(io, head.into())))
}
ConnectionType::H2(io) => {
if let Some(mut pool) = self.pool.take() {
pool.release(IoConnection::new(
@ -180,69 +152,83 @@ impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
None,
));
}
Err(SendRequestError::TunnelNotSupported)
Either::B(err(SendRequestError::TunnelNotSupported))
}
}
}
}
#[allow(dead_code)]
pub(crate) enum EitherIoConnection<A, B>
where
A: AsyncRead + AsyncWrite + Unpin + 'static,
B: AsyncRead + AsyncWrite + Unpin + 'static,
{
pub(crate) enum EitherConnection<A, B> {
A(IoConnection<A>),
B(IoConnection<B>),
}
impl<A, B> Connection for EitherIoConnection<A, B>
impl<A, B> Connection for EitherConnection<A, B>
where
A: AsyncRead + AsyncWrite + Unpin + 'static,
B: AsyncRead + AsyncWrite + Unpin + 'static,
A: AsyncRead + AsyncWrite + 'static,
B: AsyncRead + AsyncWrite + 'static,
{
type Io = EitherIo<A, B>;
type Future =
Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
fn send_request<RB, H>(
self,
head: H,
body: RB,
) -> LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>
where
RB: MessageBody + 'static,
H: Into<RequestHeadType> + 'static,
{
fn protocol(&self) -> Protocol {
match self {
EitherIoConnection::A(con) => Box::pin(con.send_request(head, body)),
EitherIoConnection::B(con) => Box::pin(con.send_request(head, body)),
EitherConnection::A(con) => con.protocol(),
EitherConnection::B(con) => con.protocol(),
}
}
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType> + 'static>(
fn send_request<RB: MessageBody + 'static, H: Into<RequestHeadType>>(
self,
head: H,
) -> LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
> {
body: RB,
) -> Self::Future {
match self {
EitherIoConnection::A(con) => Box::pin(async {
let (head, framed) = con.open_tunnel(head).await?;
Ok((head, framed.into_map_io(EitherIo::A)))
}),
EitherIoConnection::B(con) => Box::pin(async {
let (head, framed) = con.open_tunnel(head).await?;
Ok((head, framed.into_map_io(EitherIo::B)))
}),
EitherConnection::A(con) => con.send_request(head, body),
EitherConnection::B(con) => con.send_request(head, body),
}
}
type TunnelFuture = Box<
dyn Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
Error = SendRequestError,
>,
>;
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
match self {
EitherConnection::A(con) => Box::new(
con.open_tunnel(head)
.map(|(head, framed)| (head, framed.map_io(EitherIo::A))),
),
EitherConnection::B(con) => Box::new(
con.open_tunnel(head)
.map(|(head, framed)| (head, framed.map_io(EitherIo::B))),
),
}
}
}
#[pin_project(project = EitherIoProj)]
pub enum EitherIo<A, B> {
A(#[pin] A),
B(#[pin] B),
A(A),
B(B),
}
impl<A, B> io::Read for EitherIo<A, B>
where
A: io::Read,
B: io::Read,
{
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
match self {
EitherIo::A(ref mut val) => val.read(buf),
EitherIo::B(ref mut val) => val.read(buf),
}
}
}
impl<A, B> AsyncRead for EitherIo<A, B>
@ -250,14 +236,30 @@ where
A: AsyncRead,
B: AsyncRead,
{
fn poll_read(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut ReadBuf<'_>,
) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_read(cx, buf),
EitherIoProj::B(val) => val.poll_read(cx, buf),
unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool {
match self {
EitherIo::A(ref val) => val.prepare_uninitialized_buffer(buf),
EitherIo::B(ref val) => val.prepare_uninitialized_buffer(buf),
}
}
}
impl<A, B> io::Write for EitherIo<A, B>
where
A: io::Write,
B: io::Write,
{
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
match self {
EitherIo::A(ref mut val) => val.write(buf),
EitherIo::B(ref mut val) => val.write(buf),
}
}
fn flush(&mut self) -> io::Result<()> {
match self {
EitherIo::A(ref mut val) => val.flush(),
EitherIo::B(ref mut val) => val.flush(),
}
}
}
@ -267,63 +269,20 @@ where
A: AsyncWrite,
B: AsyncWrite,
{
fn poll_write(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
match self.project() {
EitherIoProj::A(val) => val.poll_write(cx, buf),
EitherIoProj::B(val) => val.poll_write(cx, buf),
fn shutdown(&mut self) -> Poll<(), io::Error> {
match self {
EitherIo::A(ref mut val) => val.shutdown(),
EitherIo::B(ref mut val) => val.shutdown(),
}
}
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_flush(cx),
EitherIoProj::B(val) => val.poll_flush(cx),
}
}
fn poll_shutdown(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_shutdown(cx),
EitherIoProj::B(val) => val.poll_shutdown(cx),
fn write_buf<U: Buf>(&mut self, buf: &mut U) -> Poll<usize, io::Error>
where
Self: Sized,
{
match self {
EitherIo::A(ref mut val) => val.write_buf(buf),
EitherIo::B(ref mut val) => val.write_buf(buf),
}
}
}
#[cfg(test)]
mod test {
use std::net;
use actix_rt::net::TcpStream;
use super::*;
#[actix_rt::test]
async fn test_h2_connection_drop() {
let addr = "127.0.0.1:0".parse::<net::SocketAddr>().unwrap();
let listener = net::TcpListener::bind(addr).unwrap();
let local = listener.local_addr().unwrap();
std::thread::spawn(move || while listener.accept().is_ok() {});
let tcp = TcpStream::connect(local).await.unwrap();
let (sender, connection) = h2::client::handshake(tcp).await.unwrap();
let conn = H2Connection::new(sender.clone(), connection);
assert!(sender.clone().ready().await.is_ok());
assert!(h2::client::SendRequest::clone(&*conn).ready().await.is_ok());
drop(conn);
match sender.ready().await {
Ok(_) => panic!("connection should be gone and can not be ready"),
Err(e) => assert!(e.is_io()),
};
}
}

View File

@ -1,47 +1,40 @@
use std::{
fmt,
future::Future,
marker::PhantomData,
net::IpAddr,
pin::Pin,
task::{Context, Poll},
time::Duration,
};
use std::fmt;
use std::marker::PhantomData;
use std::time::Duration;
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::net::TcpStream;
use actix_service::{apply_fn, Service, ServiceExt};
use actix_tls::connect::{
new_connector, Connect as TcpConnect, Connection as TcpConnection, Resolver,
use actix_connect::{
default_connector, Connect as TcpConnect, Connection as TcpConnection,
};
use actix_service::{apply_fn, Service, ServiceExt};
use actix_utils::timeout::{TimeoutError, TimeoutService};
use http::Uri;
use tokio_tcp::TcpStream;
use super::config::ConnectorConfig;
use super::connection::{Connection, EitherIoConnection};
use super::connection::Connection;
use super::error::ConnectError;
use super::pool::{ConnectionPool, Protocol};
use super::Connect;
#[cfg(feature = "openssl")]
use actix_tls::connect::ssl::openssl::SslConnector as OpensslConnector;
#[cfg(feature = "rustls")]
use actix_tls::connect::ssl::rustls::ClientConfig;
#[cfg(feature = "rustls")]
#[cfg(feature = "ssl")]
use openssl::ssl::SslConnector as OpensslConnector;
#[cfg(feature = "rust-tls")]
use rustls::ClientConfig;
#[cfg(feature = "rust-tls")]
use std::sync::Arc;
#[cfg(any(feature = "openssl", feature = "rustls"))]
#[cfg(any(feature = "ssl", feature = "rust-tls"))]
enum SslConnector {
#[cfg(feature = "openssl")]
#[cfg(feature = "ssl")]
Openssl(OpensslConnector),
#[cfg(feature = "rustls")]
#[cfg(feature = "rust-tls")]
Rustls(Arc<ClientConfig>),
}
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
type SslConnector = ();
/// Manages HTTP client network connectivity.
///
/// Manages http client network connectivity
/// The `Connector` type uses a builder-like combinator pattern for service
/// construction that finishes by calling the `.finish()` method.
///
@ -55,157 +48,127 @@ type SslConnector = ();
/// ```
pub struct Connector<T, U> {
connector: T,
config: ConnectorConfig,
timeout: Duration,
conn_lifetime: Duration,
conn_keep_alive: Duration,
disconnect_timeout: Duration,
limit: usize,
#[allow(dead_code)]
ssl: SslConnector,
_phantom: PhantomData<U>,
_t: PhantomData<U>,
}
pub trait Io: AsyncRead + AsyncWrite + Unpin {}
impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
trait Io: AsyncRead + AsyncWrite {}
impl<T: AsyncRead + AsyncWrite> Io for T {}
impl Connector<(), ()> {
#[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
#[allow(clippy::new_ret_no_self)]
pub fn new() -> Connector<
impl Service<
TcpConnect<Uri>,
Request = TcpConnect<Uri>,
Response = TcpConnection<Uri, TcpStream>,
Error = actix_tls::connect::ConnectError,
Error = actix_connect::ConnectError,
> + Clone,
TcpStream,
> {
let ssl = {
#[cfg(feature = "ssl")]
{
use openssl::ssl::SslMethod;
let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
let _ = ssl
.set_alpn_protos(b"\x02h2\x08http/1.1")
.map_err(|e| error!("Can not set alpn protocol: {:?}", e));
SslConnector::Openssl(ssl.build())
}
#[cfg(all(not(feature = "ssl"), feature = "rust-tls"))]
{
let protos = vec![b"h2".to_vec(), b"http/1.1".to_vec()];
let mut config = ClientConfig::new();
config.set_protocols(&protos);
config
.root_store
.add_server_trust_anchors(&webpki_roots::TLS_SERVER_ROOTS);
SslConnector::Rustls(Arc::new(config))
}
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
{}
};
Connector {
ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
connector: new_connector(resolver::resolver()),
config: ConnectorConfig::default(),
_phantom: PhantomData,
ssl,
connector: default_connector(),
timeout: Duration::from_secs(1),
conn_lifetime: Duration::from_secs(75),
conn_keep_alive: Duration::from_secs(15),
disconnect_timeout: Duration::from_millis(3000),
limit: 100,
_t: PhantomData,
}
}
// Build Ssl connector with openssl, based on supplied alpn protocols
#[cfg(feature = "openssl")]
fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
use actix_tls::connect::ssl::openssl::SslMethod;
use bytes::{BufMut, BytesMut};
let mut alpn = BytesMut::with_capacity(20);
for proto in protocols.iter() {
alpn.put_u8(proto.len() as u8);
alpn.put(proto.as_slice());
}
let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
let _ = ssl
.set_alpn_protos(&alpn)
.map_err(|e| error!("Can not set alpn protocol: {:?}", e));
SslConnector::Openssl(ssl.build())
}
// Build Ssl connector with rustls, based on supplied alpn protocols
#[cfg(all(not(feature = "openssl"), feature = "rustls"))]
fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
let mut config = ClientConfig::new();
config.set_protocols(&protocols);
config.root_store.add_server_trust_anchors(
&actix_tls::connect::ssl::rustls::TLS_SERVER_ROOTS,
);
SslConnector::Rustls(Arc::new(config))
}
// ssl turned off, provides empty ssl connector
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
}
impl<T, U> Connector<T, U> {
/// Use custom connector.
pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
where
U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
U1: AsyncRead + AsyncWrite + fmt::Debug,
T1: Service<
TcpConnect<Uri>,
Request = TcpConnect<Uri>,
Response = TcpConnection<Uri, U1>,
Error = actix_tls::connect::ConnectError,
Error = actix_connect::ConnectError,
> + Clone,
{
Connector {
connector,
config: self.config,
timeout: self.timeout,
conn_lifetime: self.conn_lifetime,
conn_keep_alive: self.conn_keep_alive,
disconnect_timeout: self.disconnect_timeout,
limit: self.limit,
ssl: self.ssl,
_phantom: PhantomData,
_t: PhantomData,
}
}
}
impl<T, U> Connector<T, U>
where
U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
U: AsyncRead + AsyncWrite + fmt::Debug + 'static,
T: Service<
TcpConnect<Uri>,
Request = TcpConnect<Uri>,
Response = TcpConnection<Uri, U>,
Error = actix_tls::connect::ConnectError,
Error = actix_connect::ConnectError,
> + Clone
+ 'static,
{
/// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
/// Set to 1 second by default.
pub fn timeout(mut self, timeout: Duration) -> Self {
self.config.timeout = timeout;
self.timeout = timeout;
self
}
#[cfg(feature = "openssl")]
#[cfg(feature = "ssl")]
/// Use custom `SslConnector` instance.
pub fn ssl(mut self, connector: OpensslConnector) -> Self {
self.ssl = SslConnector::Openssl(connector);
self
}
#[cfg(feature = "rustls")]
#[cfg(feature = "rust-tls")]
pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
self.ssl = SslConnector::Rustls(connector);
self
}
/// Maximum supported HTTP major version.
///
/// Supported versions are HTTP/1.1 and HTTP/2.
pub fn max_http_version(mut self, val: http::Version) -> Self {
let versions = match val {
http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
http::Version::HTTP_2 => vec![b"h2".to_vec(), b"http/1.1".to_vec()],
_ => {
unimplemented!("actix-http:client: supported versions http/1.1, http/2")
}
};
self.ssl = Connector::build_ssl(versions);
self
}
/// Indicates the initial window size (in octets) for
/// HTTP2 stream-level flow control for received data.
///
/// The default value is 65,535 and is good for APIs, but not for big objects.
pub fn initial_window_size(mut self, size: u32) -> Self {
self.config.stream_window_size = size;
self
}
/// Indicates the initial window size (in octets) for
/// HTTP2 connection-level flow control for received data.
///
/// The default value is 65,535 and is good for APIs, but not for big objects.
pub fn initial_connection_window_size(mut self, size: u32) -> Self {
self.config.conn_window_size = size;
self
}
/// Set total number of simultaneous connections per type of scheme.
///
/// If limit is 0, the connector has no limit.
/// The default limit size is 100.
pub fn limit(mut self, limit: usize) -> Self {
self.config.limit = limit;
self.limit = limit;
self
}
@ -216,7 +179,7 @@ where
/// exceeds this period, the connection is closed.
/// Default keep-alive period is 15 seconds.
pub fn conn_keep_alive(mut self, dur: Duration) -> Self {
self.config.conn_keep_alive = dur;
self.conn_keep_alive = dur;
self
}
@ -226,7 +189,7 @@ where
/// until it is closed regardless of keep-alive period.
/// Default lifetime period is 75 seconds.
pub fn conn_lifetime(mut self, dur: Duration) -> Self {
self.config.conn_lifetime = dur;
self.conn_lifetime = dur;
self
}
@ -239,13 +202,7 @@ where
///
/// By default disconnect timeout is set to 3000 milliseconds.
pub fn disconnect_timeout(mut self, dur: Duration) -> Self {
self.config.disconnect_timeout = Some(dur);
self
}
/// Set local IP Address the connector would use for establishing connection.
pub fn local_address(mut self, addr: IpAddr) -> Self {
self.config.local_address = Some(addr);
self.disconnect_timeout = dur;
self
}
@ -254,84 +211,59 @@ where
/// its combinator chain.
pub fn finish(
self,
) -> impl Service<Connect, Response = impl Connection, Error = ConnectError> + Clone
{
let local_address = self.config.local_address;
let timeout = self.config.timeout;
let tcp_service = TimeoutService::new(
timeout,
apply_fn(self.connector.clone(), move |msg: Connect, srv| {
let mut req = TcpConnect::new(msg.uri).set_addr(msg.addr);
if let Some(local_addr) = local_address {
req = req.set_local_addr(local_addr);
}
srv.call(req)
})
.map_err(ConnectError::from)
.map(|stream| (stream.into_parts().0, Protocol::Http1)),
)
.map_err(|e| match e {
TimeoutError::Service(e) => e,
TimeoutError::Timeout => ConnectError::Timeout,
});
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
) -> impl Service<Request = Connect, Response = impl Connection, Error = ConnectError>
+ Clone {
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
{
// A dummy service for annotate tls pool's type signature.
pub type DummyService = Box<
dyn Service<
Connect,
Response = (Box<dyn Io>, Protocol),
Error = ConnectError,
Future = futures_core::future::LocalBoxFuture<
'static,
Result<(Box<dyn Io>, Protocol), ConnectError>,
>,
>,
>;
let connector = TimeoutService::new(
self.timeout,
apply_fn(self.connector, |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from)
.map(|stream| (stream.into_parts().0, Protocol::Http1)),
)
.map_err(|e| match e {
TimeoutError::Service(e) => e,
TimeoutError::Timeout => ConnectError::Timeout,
});
InnerConnector::<_, DummyService, _, Box<dyn Io>> {
connect_impl::InnerConnector {
tcp_pool: ConnectionPool::new(
tcp_service,
self.config.no_disconnect_timeout(),
connector,
self.conn_lifetime,
self.conn_keep_alive,
None,
self.limit,
),
tls_pool: None,
}
}
#[cfg(any(feature = "openssl", feature = "rustls"))]
#[cfg(any(feature = "ssl", feature = "rust-tls"))]
{
const H2: &[u8] = b"h2";
use actix_service::{boxed::service, pipeline};
#[cfg(feature = "openssl")]
use actix_tls::connect::ssl::openssl::OpensslConnector;
#[cfg(feature = "rustls")]
use actix_tls::connect::ssl::rustls::{RustlsConnector, Session};
#[cfg(feature = "ssl")]
use actix_connect::ssl::OpensslConnector;
#[cfg(feature = "rust-tls")]
use actix_connect::ssl::RustlsConnector;
use actix_service::boxed::service;
#[cfg(feature = "rust-tls")]
use rustls::Session;
let ssl_service = TimeoutService::new(
timeout,
pipeline(
apply_fn(self.connector.clone(), move |msg: Connect, srv| {
let mut req = TcpConnect::new(msg.uri).set_addr(msg.addr);
if let Some(local_addr) = local_address {
req = req.set_local_addr(local_addr);
}
srv.call(req)
})
.map_err(ConnectError::from),
)
self.timeout,
apply_fn(self.connector.clone(), |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from)
.and_then(match self.ssl {
#[cfg(feature = "openssl")]
#[cfg(feature = "ssl")]
SslConnector::Openssl(ssl) => service(
OpensslConnector::service(ssl)
.map_err(ConnectError::from)
.map(|stream| {
let sock = stream.into_parts().0;
let h2 = sock
.get_ref()
.ssl()
.selected_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
@ -341,10 +273,9 @@ where
} else {
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
}
})
.map_err(ConnectError::from),
}),
),
#[cfg(feature = "rustls")]
#[cfg(feature = "rust-tls")]
SslConnector::Rustls(ssl) => service(
RustlsConnector::service(ssl)
.map_err(ConnectError::from)
@ -370,177 +301,240 @@ where
TimeoutError::Timeout => ConnectError::Timeout,
});
InnerConnector {
let tcp_service = TimeoutService::new(
self.timeout,
apply_fn(self.connector.clone(), |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from)
.map(|stream| (stream.into_parts().0, Protocol::Http1)),
)
.map_err(|e| match e {
TimeoutError::Service(e) => e,
TimeoutError::Timeout => ConnectError::Timeout,
});
connect_impl::InnerConnector {
tcp_pool: ConnectionPool::new(
tcp_service,
self.config.no_disconnect_timeout(),
self.conn_lifetime,
self.conn_keep_alive,
None,
self.limit,
),
ssl_pool: ConnectionPool::new(
ssl_service,
self.conn_lifetime,
self.conn_keep_alive,
Some(self.disconnect_timeout),
self.limit,
),
tls_pool: Some(ConnectionPool::new(ssl_service, self.config)),
}
}
}
}
struct InnerConnector<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
tcp_pool: ConnectionPool<S1, Io1>,
tls_pool: Option<ConnectionPool<S2, Io2>>,
}
impl<S1, S2, Io1, Io2> Clone for InnerConnector<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn clone(&self) -> Self {
InnerConnector {
tcp_pool: self.tcp_pool.clone(),
tls_pool: self.tls_pool.as_ref().cloned(),
}
}
}
impl<S1, S2, Io1, Io2> Service<Connect> for InnerConnector<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Response = EitherIoConnection<Io1, Io2>;
type Error = ConnectError;
type Future = InnerConnectorResponse<S1, S2, Io1, Io2>;
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready(cx)
}
fn call(&self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => match self.tls_pool {
None => InnerConnectorResponse::SslIsNotSupported,
Some(ref pool) => InnerConnectorResponse::Io2(pool.call(req)),
},
_ => InnerConnectorResponse::Io1(self.tcp_pool.call(req)),
}
}
}
#[pin_project::pin_project(project = InnerConnectorProj)]
enum InnerConnectorResponse<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
Io1(#[pin] <ConnectionPool<S1, Io1> as Service<Connect>>::Future),
Io2(#[pin] <ConnectionPool<S2, Io2> as Service<Connect>>::Future),
SslIsNotSupported,
}
impl<S1, S2, Io1, Io2> Future for InnerConnectorResponse<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Output = Result<EitherIoConnection<Io1, Io2>, ConnectError>;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
match self.project() {
InnerConnectorProj::Io1(fut) => fut.poll(cx).map_ok(EitherIoConnection::A),
InnerConnectorProj::Io2(fut) => fut.poll(cx).map_ok(EitherIoConnection::B),
InnerConnectorProj::SslIsNotSupported => {
Poll::Ready(Err(ConnectError::SslIsNotSupported))
}
}
}
}
#[cfg(not(feature = "trust-dns"))]
mod resolver {
use super::*;
pub(super) fn resolver() -> Resolver {
Resolver::Default
}
}
#[cfg(feature = "trust-dns")]
mod resolver {
use std::{cell::RefCell, net::SocketAddr};
use actix_tls::connect::Resolve;
use futures_core::future::LocalBoxFuture;
use trust_dns_resolver::{
config::{ResolverConfig, ResolverOpts},
system_conf::read_system_conf,
TokioAsyncResolver,
};
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
mod connect_impl {
use futures::future::{err, Either, FutureResult};
use futures::Poll;
use super::*;
use crate::client::connection::IoConnection;
pub(super) fn resolver() -> Resolver {
// new type for impl Resolve trait for TokioAsyncResolver.
struct TrustDnsResolver(TokioAsyncResolver);
pub(crate) struct InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
pub(crate) tcp_pool: ConnectionPool<T, Io>,
}
impl Resolve for TrustDnsResolver {
fn lookup<'a>(
&'a self,
host: &'a str,
port: u16,
) -> LocalBoxFuture<'a, Result<Vec<SocketAddr>, Box<dyn std::error::Error>>>
{
Box::pin(async move {
let res = self
.0
.lookup_ip(host)
.await?
.iter()
.map(|ip| SocketAddr::new(ip, port))
.collect();
Ok(res)
})
impl<T, Io> Clone for InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
fn clone(&self) -> Self {
InnerConnector {
tcp_pool: self.tcp_pool.clone(),
}
}
}
// dns struct is cached in thread local.
// so new client constructor can reuse the existing dns resolver.
thread_local! {
static TRUST_DNS_RESOLVER: RefCell<Option<Resolver>> = RefCell::new(None);
impl<T, Io> Service for InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
type Request = Connect;
type Response = IoConnection<Io>;
type Error = ConnectError;
type Future = Either<
<ConnectionPool<T, Io> as Service>::Future,
FutureResult<IoConnection<Io>, ConnectError>,
>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.tcp_pool.poll_ready()
}
// get from thread local or construct a new trust-dns resolver.
TRUST_DNS_RESOLVER.with(|local| {
let resolver = local.borrow().as_ref().map(Clone::clone);
match resolver {
Some(resolver) => resolver,
None => {
let (cfg, opts) = match read_system_conf() {
Ok((cfg, opts)) => (cfg, opts),
Err(e) => {
log::error!("TRust-DNS can not load system config: {}", e);
(ResolverConfig::default(), ResolverOpts::default())
}
};
let resolver = TokioAsyncResolver::tokio(cfg, opts).unwrap();
// box trust dns resolver and put it in thread local.
let resolver = Resolver::new_custom(TrustDnsResolver(resolver));
*local.borrow_mut() = Some(resolver.clone());
resolver
fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => {
Either::B(err(ConnectError::SslIsNotSupported))
}
_ => Either::A(self.tcp_pool.call(req)),
}
})
}
}
}
#[cfg(any(feature = "ssl", feature = "rust-tls"))]
mod connect_impl {
use std::marker::PhantomData;
use futures::future::{Either, FutureResult};
use futures::{Async, Future, Poll};
use super::*;
use crate::client::connection::EitherConnection;
pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>,
{
pub(crate) tcp_pool: ConnectionPool<T1, Io1>,
pub(crate) ssl_pool: ConnectionPool<T2, Io2>,
}
impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
fn clone(&self) -> Self {
InnerConnector {
tcp_pool: self.tcp_pool.clone(),
ssl_pool: self.ssl_pool.clone(),
}
}
}
impl<T1, T2, Io1, Io2> Service for InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
type Request = Connect;
type Response = EitherConnection<Io1, Io2>;
type Error = ConnectError;
type Future = Either<
FutureResult<Self::Response, Self::Error>,
Either<
InnerConnectorResponseA<T1, Io1, Io2>,
InnerConnectorResponseB<T2, Io1, Io2>,
>,
>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.tcp_pool.poll_ready()
}
fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => {
Either::B(Either::B(InnerConnectorResponseB {
fut: self.ssl_pool.call(req),
_t: PhantomData,
}))
}
_ => Either::B(Either::A(InnerConnectorResponseA {
fut: self.tcp_pool.call(req),
_t: PhantomData,
})),
}
}
}
pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
fut: <ConnectionPool<T, Io1> as Service>::Future,
_t: PhantomData<Io2>,
}
impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
where
T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
{
type Item = EitherConnection<Io1, Io2>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.fut.poll()? {
Async::NotReady => Ok(Async::NotReady),
Async::Ready(res) => Ok(Async::Ready(EitherConnection::A(res))),
}
}
}
pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
where
Io2: AsyncRead + AsyncWrite + 'static,
T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
fut: <ConnectionPool<T, Io2> as Service>::Future,
_t: PhantomData<Io1>,
}
impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
where
T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
{
type Item = EitherConnection<Io1, Io2>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.fut.poll()? {
Async::NotReady => Ok(Async::NotReady),
Async::Ready(res) => Ok(Async::Ready(EitherConnection::B(res))),
}
}
}
}

View File

@ -1,12 +1,14 @@
use std::io;
use derive_more::{Display, From};
use trust_dns_resolver::error::ResolveError;
#[cfg(feature = "openssl")]
use actix_tls::accept::openssl::SslError;
#[cfg(feature = "ssl")]
use openssl::ssl::{Error as SslError, HandshakeError};
use crate::error::{Error, ParseError, ResponseError};
use crate::http::{Error as HttpError, StatusCode};
use crate::http::Error as HttpError;
use crate::response::Response;
/// A set of errors that can occur while connecting to an HTTP host
#[derive(Debug, Display, From)]
@ -16,16 +18,16 @@ pub enum ConnectError {
SslIsNotSupported,
/// SSL error
#[cfg(feature = "openssl")]
#[cfg(feature = "ssl")]
#[display(fmt = "{}", _0)]
SslError(SslError),
/// Failed to resolve the hostname
#[display(fmt = "Failed resolving hostname: {}", _0)]
Resolver(Box<dyn std::error::Error>),
Resolver(ResolveError),
/// No dns records
#[display(fmt = "No DNS records found for the input")]
#[display(fmt = "No dns records found for the input")]
NoRecords,
/// Http2 error
@ -33,7 +35,7 @@ pub enum ConnectError {
H2(h2::Error),
/// Connecting took too long
#[display(fmt = "Timeout while establishing connection")]
#[display(fmt = "Timeout out while establishing connection")]
Timeout,
/// Connector has been disconnected
@ -42,93 +44,88 @@ pub enum ConnectError {
/// Unresolved host name
#[display(fmt = "Connector received `Connect` method with unresolved host")]
Unresolved,
Unresolverd,
/// Connection io error
#[display(fmt = "{}", _0)]
Io(io::Error),
}
impl std::error::Error for ConnectError {}
impl From<actix_tls::connect::ConnectError> for ConnectError {
fn from(err: actix_tls::connect::ConnectError) -> ConnectError {
impl From<actix_connect::ConnectError> for ConnectError {
fn from(err: actix_connect::ConnectError) -> ConnectError {
match err {
actix_tls::connect::ConnectError::Resolver(e) => ConnectError::Resolver(e),
actix_tls::connect::ConnectError::NoRecords => ConnectError::NoRecords,
actix_tls::connect::ConnectError::InvalidInput => panic!(),
actix_tls::connect::ConnectError::Unresolved => ConnectError::Unresolved,
actix_tls::connect::ConnectError::Io(e) => ConnectError::Io(e),
actix_connect::ConnectError::Resolver(e) => ConnectError::Resolver(e),
actix_connect::ConnectError::NoRecords => ConnectError::NoRecords,
actix_connect::ConnectError::InvalidInput => panic!(),
actix_connect::ConnectError::Unresolverd => ConnectError::Unresolverd,
actix_connect::ConnectError::Io(e) => ConnectError::Io(e),
}
}
}
#[cfg(feature = "ssl")]
impl<T> From<HandshakeError<T>> for ConnectError {
fn from(err: HandshakeError<T>) -> ConnectError {
match err {
HandshakeError::SetupFailure(stack) => SslError::from(stack).into(),
HandshakeError::Failure(stream) => stream.into_error().into(),
HandshakeError::WouldBlock(stream) => stream.into_error().into(),
}
}
}
#[derive(Debug, Display, From)]
pub enum InvalidUrl {
#[display(fmt = "Missing URL scheme")]
#[display(fmt = "Missing url scheme")]
MissingScheme,
#[display(fmt = "Unknown URL scheme")]
#[display(fmt = "Unknown url scheme")]
UnknownScheme,
#[display(fmt = "Missing host name")]
MissingHost,
#[display(fmt = "URL parse error: {}", _0)]
#[display(fmt = "Url parse error: {}", _0)]
HttpError(http::Error),
}
impl std::error::Error for InvalidUrl {}
/// A set of errors that can occur during request sending and response reading
#[derive(Debug, Display, From)]
pub enum SendRequestError {
/// Invalid URL
#[display(fmt = "Invalid URL: {}", _0)]
Url(InvalidUrl),
/// Failed to connect to host
#[display(fmt = "Failed to connect to host: {}", _0)]
Connect(ConnectError),
/// Error sending request
Send(io::Error),
/// Error parsing response
Response(ParseError),
/// Http error
#[display(fmt = "{}", _0)]
Http(HttpError),
/// Http2 error
#[display(fmt = "{}", _0)]
H2(h2::Error),
/// Response took too long
#[display(fmt = "Timeout while waiting for response")]
#[display(fmt = "Timeout out while waiting for response")]
Timeout,
/// Tunnels are not supported for HTTP/2 connection
/// Tunnels are not supported for http2 connection
#[display(fmt = "Tunnels are not supported for http2 connection")]
TunnelNotSupported,
/// Error sending request body
Body(Error),
}
impl std::error::Error for SendRequestError {}
/// Convert `SendRequestError` to a server `Response`
impl ResponseError for SendRequestError {
fn status_code(&self) -> StatusCode {
fn error_response(&self) -> Response {
match *self {
SendRequestError::Connect(ConnectError::Timeout) => {
StatusCode::GATEWAY_TIMEOUT
Response::GatewayTimeout()
}
SendRequestError::Connect(_) => StatusCode::BAD_REQUEST,
_ => StatusCode::INTERNAL_SERVER_ERROR,
SendRequestError::Connect(_) => Response::BadGateway(),
_ => Response::InternalServerError(),
}
.into()
}
}
@ -138,14 +135,11 @@ pub enum FreezeRequestError {
/// Invalid URL
#[display(fmt = "Invalid URL: {}", _0)]
Url(InvalidUrl),
/// HTTP error
/// Http error
#[display(fmt = "{}", _0)]
Http(HttpError),
}
impl std::error::Error for FreezeRequestError {}
impl From<FreezeRequestError> for SendRequestError {
fn from(e: FreezeRequestError) -> Self {
match e {

View File

@ -1,21 +1,15 @@
use std::io::Write;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{io, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
use bytes::buf::BufMut;
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use futures_util::{future::poll_fn, SinkExt, StreamExt};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use bytes::{BufMut, Bytes, BytesMut};
use futures::future::{ok, Either};
use futures::{Async, Future, Poll, Sink, Stream};
use crate::error::PayloadError;
use crate::h1;
use crate::header::HeaderMap;
use crate::http::{
header::{IntoHeaderValue, EXPECT, HOST},
StatusCode,
};
use crate::http::header::{IntoHeaderValue, HOST};
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::{Payload, PayloadStream};
@ -24,15 +18,15 @@ use super::error::{ConnectError, SendRequestError};
use super::pool::Acquired;
use crate::body::{BodySize, MessageBody};
pub(crate) async fn send_request<T, B>(
pub(crate) fn send_request<T, B>(
io: T,
mut head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> Result<(ResponseHead, Payload), SendRequestError>
) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
T: AsyncRead + AsyncWrite + 'static,
B: MessageBody,
{
// set request host header
@ -47,14 +41,14 @@ where
Some(port) => write!(wrt, "{}:{}", host, port),
};
match wrt.get_mut().split().freeze().try_into_value() {
match wrt.get_mut().take().freeze().try_into() {
Ok(value) => match head {
RequestHeadType::Owned(ref mut head) => {
head.headers.insert(HOST, value);
head.headers.insert(HOST, value)
}
RequestHeadType::Rc(_, ref mut extra_headers) => {
let headers = extra_headers.get_or_insert(HeaderMap::new());
headers.insert(HOST, value);
headers.insert(HOST, value)
}
},
Err(e) => log::error!("Can not set HOST header {}", e),
@ -68,160 +62,81 @@ where
io: Some(io),
};
// create Framed and prepare sending request
let mut framed = Framed::new(io, h1::ClientCodec::default());
let len = body.size();
// Check EXPECT header and enable expect handle flag accordingly.
//
// RFC: https://tools.ietf.org/html/rfc7231#section-5.1.1
let is_expect = if head.as_ref().headers.contains_key(EXPECT) {
match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
let pin_framed = Pin::new(&mut framed);
let force_close = !pin_framed.codec_ref().keepalive();
release_connection(pin_framed, force_close);
// TODO: use a new variant or a new type better describing error violate
// `Requirements for clients` session of above RFC
return Err(SendRequestError::Connect(ConnectError::Disconnected));
}
_ => true,
}
} else {
false
};
framed.send((head, body.size()).into()).await?;
let mut pin_framed = Pin::new(&mut framed);
// special handle for EXPECT request.
let (do_send, mut res_head) = if is_expect {
let head = poll_fn(|cx| pin_framed.as_mut().poll_next(cx))
.await
.ok_or(ConnectError::Disconnected)??;
// return response head in case status code is not continue
// and current head would be used as final response head.
(head.status == StatusCode::CONTINUE, Some(head))
} else {
(true, None)
};
if do_send {
// create Framed and send request
Framed::new(io, h1::ClientCodec::default())
.send((head, len).into())
.from_err()
// send request body
match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {}
_ => send_body(body, pin_framed.as_mut()).await?,
};
.and_then(move |framed| match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
Either::A(ok(framed))
}
_ => Either::B(SendBody::new(body, framed)),
})
// read response and init read body
let head = poll_fn(|cx| pin_framed.as_mut().poll_next(cx))
.await
.ok_or(ConnectError::Disconnected)??;
res_head = Some(head);
}
let head = res_head.unwrap();
match pin_framed.codec_ref().message_type() {
h1::MessageType::None => {
let force_close = !pin_framed.codec_ref().keepalive();
release_connection(pin_framed, force_close);
Ok((head, Payload::None))
}
_ => {
let pl: PayloadStream = Box::pin(PlStream::new(framed));
Ok((head, pl.into()))
}
}
.and_then(|framed| {
framed
.into_future()
.map_err(|(e, _)| SendRequestError::from(e))
.and_then(|(item, framed)| {
if let Some(res) = item {
match framed.get_codec().message_type() {
h1::MessageType::None => {
let force_close = !framed.get_codec().keepalive();
release_connection(framed, force_close);
Ok((res, Payload::None))
}
_ => {
let pl: PayloadStream = Box::new(PlStream::new(framed));
Ok((res, pl.into()))
}
}
} else {
Err(ConnectError::Disconnected.into())
}
})
})
}
pub(crate) async fn open_tunnel<T>(
pub(crate) fn open_tunnel<T>(
io: T,
head: RequestHeadType,
) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
) -> impl Future<Item = (ResponseHead, Framed<T, h1::ClientCodec>), Error = SendRequestError>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
T: AsyncRead + AsyncWrite + 'static,
{
// create Framed and send request
let mut framed = Framed::new(io, h1::ClientCodec::default());
framed.send((head, BodySize::None).into()).await?;
// read response
if let (Some(result), framed) = framed.into_future().await {
let head = result.map_err(SendRequestError::from)?;
Ok((head, framed))
} else {
Err(SendRequestError::from(ConnectError::Disconnected))
}
}
/// send request body to the peer
pub(crate) async fn send_body<T, B>(
body: B,
mut framed: Pin<&mut Framed<T, h1::ClientCodec>>,
) -> Result<(), SendRequestError>
where
T: ConnectionLifetime + Unpin,
B: MessageBody,
{
actix_rt::pin!(body);
let mut eof = false;
while !eof {
while !eof && !framed.as_ref().is_write_buf_full() {
match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
Some(result) => {
framed.as_mut().write(h1::Message::Chunk(Some(result?)))?;
}
None => {
eof = true;
framed.as_mut().write(h1::Message::Chunk(None))?;
}
}
}
if !framed.as_ref().is_write_buf_empty() {
poll_fn(|cx| match framed.as_mut().flush(cx) {
Poll::Ready(Ok(_)) => Poll::Ready(Ok(())),
Poll::Ready(Err(err)) => Poll::Ready(Err(err)),
Poll::Pending => {
if !framed.as_ref().is_write_buf_full() {
Poll::Ready(Ok(()))
Framed::new(io, h1::ClientCodec::default())
.send((head, BodySize::None).into())
.from_err()
// read response
.and_then(|framed| {
framed
.into_future()
.map_err(|(e, _)| SendRequestError::from(e))
.and_then(|(head, framed)| {
if let Some(head) = head {
Ok((head, framed))
} else {
Poll::Pending
Err(SendRequestError::from(ConnectError::Disconnected))
}
}
})
.await?;
}
}
SinkExt::flush(Pin::into_inner(framed)).await?;
Ok(())
})
})
}
#[doc(hidden)]
/// HTTP client connection
pub struct H1Connection<T>
where
T: AsyncWrite + Unpin + 'static,
{
/// T should be `Unpin`
pub struct H1Connection<T> {
io: Option<T>,
created: time::Instant,
pool: Option<Acquired<T>>,
}
impl<T> ConnectionLifetime for H1Connection<T>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T> {
/// Close connection
fn close(mut self: Pin<&mut Self>) {
fn close(&mut self) {
if let Some(mut pool) = self.pool.take() {
if let Some(io) = self.io.take() {
pool.close(IoConnection::new(
@ -234,7 +149,7 @@ where
}
/// Release this connection to the connection pool
fn release(mut self: Pin<&mut Self>) {
fn release(&mut self) {
if let Some(mut pool) = self.pool.take() {
if let Some(io) = self.io.take() {
pool.release(IoConnection::new(
@ -247,89 +162,143 @@ where
}
}
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
fn poll_read(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut ReadBuf<'_>,
) -> Poll<io::Result<()>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
impl<T: AsyncRead + AsyncWrite + 'static> io::Read for H1Connection<T> {
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
self.io.as_mut().unwrap().read(buf)
}
}
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
fn poll_write(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
impl<T: AsyncRead + AsyncWrite + 'static> AsyncRead for H1Connection<T> {}
impl<T: AsyncRead + AsyncWrite + 'static> io::Write for H1Connection<T> {
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
self.io.as_mut().unwrap().write(buf)
}
fn poll_flush(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
}
fn poll_shutdown(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Result<(), io::Error>> {
Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
fn flush(&mut self) -> io::Result<()> {
self.io.as_mut().unwrap().flush()
}
}
impl<T: AsyncRead + AsyncWrite + 'static> AsyncWrite for H1Connection<T> {
fn shutdown(&mut self) -> Poll<(), io::Error> {
self.io.as_mut().unwrap().shutdown()
}
}
/// Future responsible for sending request body to the peer
pub(crate) struct SendBody<I, B> {
body: Option<B>,
framed: Option<Framed<I, h1::ClientCodec>>,
flushed: bool,
}
impl<I, B> SendBody<I, B>
where
I: AsyncRead + AsyncWrite + 'static,
B: MessageBody,
{
pub(crate) fn new(body: B, framed: Framed<I, h1::ClientCodec>) -> Self {
SendBody {
body: Some(body),
framed: Some(framed),
flushed: true,
}
}
}
impl<I, B> Future for SendBody<I, B>
where
I: ConnectionLifetime,
B: MessageBody,
{
type Item = Framed<I, h1::ClientCodec>;
type Error = SendRequestError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let mut body_ready = true;
loop {
while body_ready
&& self.body.is_some()
&& !self.framed.as_ref().unwrap().is_write_buf_full()
{
match self.body.as_mut().unwrap().poll_next()? {
Async::Ready(item) => {
// check if body is done
if item.is_none() {
let _ = self.body.take();
}
self.flushed = false;
self.framed
.as_mut()
.unwrap()
.force_send(h1::Message::Chunk(item))?;
break;
}
Async::NotReady => body_ready = false,
}
}
if !self.flushed {
match self.framed.as_mut().unwrap().poll_complete()? {
Async::Ready(_) => {
self.flushed = true;
continue;
}
Async::NotReady => return Ok(Async::NotReady),
}
}
if self.body.is_none() {
return Ok(Async::Ready(self.framed.take().unwrap()));
}
return Ok(Async::NotReady);
}
}
}
#[pin_project::pin_project]
pub(crate) struct PlStream<Io> {
#[pin]
framed: Option<Framed<Io, h1::ClientPayloadCodec>>,
}
impl<Io: ConnectionLifetime> PlStream<Io> {
fn new(framed: Framed<Io, h1::ClientCodec>) -> Self {
let framed = framed.into_map_codec(|codec| codec.into_payload_codec());
PlStream {
framed: Some(framed),
framed: Some(framed.map_codec(|codec| codec.into_payload_codec())),
}
}
}
impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
type Item = Result<Bytes, PayloadError>;
type Item = Bytes;
type Error = PayloadError;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
let mut this = self.project();
match this.framed.as_mut().as_pin_mut().unwrap().next_item(cx)? {
Poll::Pending => Poll::Pending,
Poll::Ready(Some(chunk)) => {
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
match self.framed.as_mut().unwrap().poll()? {
Async::NotReady => Ok(Async::NotReady),
Async::Ready(Some(chunk)) => {
if let Some(chunk) = chunk {
Poll::Ready(Some(Ok(chunk)))
Ok(Async::Ready(Some(chunk)))
} else {
let framed = this.framed.as_mut().as_pin_mut().unwrap();
let force_close = !framed.codec_ref().keepalive();
let framed = self.framed.take().unwrap();
let force_close = !framed.get_codec().keepalive();
release_connection(framed, force_close);
Poll::Ready(None)
Ok(Async::Ready(None))
}
}
Poll::Ready(None) => Poll::Ready(None),
Async::Ready(None) => Ok(Async::Ready(None)),
}
}
}
fn release_connection<T, U>(framed: Pin<&mut Framed<T, U>>, force_close: bool)
fn release_connection<T, U>(framed: Framed<T, U>, force_close: bool)
where
T: ConnectionLifetime,
{
if !force_close && framed.is_read_buf_empty() && framed.is_write_buf_empty() {
framed.io_pin().release()
let mut parts = framed.into_parts();
if !force_close && parts.read_buf.is_empty() && parts.write_buf.is_empty() {
parts.io.release()
} else {
framed.io_pin().close()
parts.io.close()
}
}

View File

@ -1,186 +1,194 @@
use std::future::Future;
use std::time;
use actix_codec::{AsyncRead, AsyncWrite};
use bytes::Bytes;
use futures_util::future::poll_fn;
use h2::{
client::{Builder, Connection, SendRequest},
SendStream,
};
use futures::future::{err, Either};
use futures::{Async, Future, Poll};
use h2::{client::SendRequest, SendStream};
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING};
use http::{request::Request, Method, Version};
use http::{request::Request, HttpTryFrom, Method, Version};
use crate::body::{BodySize, MessageBody};
use crate::header::HeaderMap;
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::Payload;
use super::config::ConnectorConfig;
use super::connection::{ConnectionType, IoConnection};
use super::error::SendRequestError;
use super::pool::Acquired;
use crate::client::connection::H2Connection;
pub(crate) async fn send_request<T, B>(
mut io: H2Connection,
pub(crate) fn send_request<T, B>(
io: SendRequest<Bytes>,
head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> Result<(ResponseHead, Payload), SendRequestError>
) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
T: AsyncRead + AsyncWrite + 'static,
B: MessageBody,
{
trace!("Sending client request: {:?} {:?}", head, body.size());
let head_req = head.as_ref().method == Method::HEAD;
let length = body.size();
let eof = matches!(
length,
BodySize::None | BodySize::Empty | BodySize::Sized(0)
);
let mut req = Request::new(());
*req.uri_mut() = head.as_ref().uri.clone();
*req.method_mut() = head.as_ref().method.clone();
*req.version_mut() = Version::HTTP_2;
let mut skip_len = true;
// let mut has_date = false;
// Content length
let _ = match length {
BodySize::None => None,
BodySize::Stream => {
skip_len = false;
None
}
BodySize::Empty => req
.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
BodySize::Sized(len) => {
let mut buf = itoa::Buffer::new();
req.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::from_str(buf.format(len)).unwrap(),
)
}
let eof = match length {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => true,
_ => false,
};
// Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
let (head, extra_headers) = match head {
RequestHeadType::Owned(head) => (RequestHeadType::Owned(head), HeaderMap::new()),
RequestHeadType::Rc(head, extra_headers) => (
RequestHeadType::Rc(head, None),
extra_headers.unwrap_or_else(HeaderMap::new),
),
};
io.ready()
.map_err(SendRequestError::from)
.and_then(move |mut io| {
let mut req = Request::new(());
*req.uri_mut() = head.as_ref().uri.clone();
*req.method_mut() = head.as_ref().method.clone();
*req.version_mut() = Version::HTTP_2;
// merging headers from head and extra headers.
let headers = head
.as_ref()
.headers
.iter()
.filter(|(name, _)| !extra_headers.contains_key(*name))
.chain(extra_headers.iter());
let mut skip_len = true;
// let mut has_date = false;
// copy headers
for (key, value) in headers {
match *key {
// TODO: consider skipping other headers according to:
// https://tools.ietf.org/html/rfc7540#section-8.1.2.2
// omit HTTP/1.x only headers
CONNECTION | TRANSFER_ENCODING => continue,
CONTENT_LENGTH if skip_len => continue,
// DATE => has_date = true,
_ => {}
}
req.headers_mut().append(key, value.clone());
}
let res = poll_fn(|cx| io.poll_ready(cx)).await;
if let Err(e) = res {
release(io, pool, created, e.is_io());
return Err(SendRequestError::from(e));
}
let resp = match io.send_request(req, eof) {
Ok((fut, send)) => {
release(io, pool, created, false);
if !eof {
send_body(body, send).await?;
}
fut.await.map_err(SendRequestError::from)?
}
Err(e) => {
release(io, pool, created, e.is_io());
return Err(e.into());
}
};
let (parts, body) = resp.into_parts();
let payload = if head_req { Payload::None } else { body.into() };
let mut head = ResponseHead::new(parts.status);
head.version = parts.version;
head.headers = parts.headers.into();
Ok((head, payload))
}
async fn send_body<B: MessageBody>(
body: B,
mut send: SendStream<Bytes>,
) -> Result<(), SendRequestError> {
let mut buf = None;
actix_rt::pin!(body);
loop {
if buf.is_none() {
match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
Some(Ok(b)) => {
send.reserve_capacity(b.len());
buf = Some(b);
// Content length
let _ = match length {
BodySize::None => None,
BodySize::Stream => {
skip_len = false;
None
}
Some(Err(e)) => return Err(e.into()),
None => {
if let Err(e) = send.send_data(Bytes::new(), true) {
return Err(e.into());
}
send.reserve_capacity(0);
return Ok(());
BodySize::Empty => req
.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
BodySize::Sized(len) => req.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::try_from(format!("{}", len)).unwrap(),
),
BodySize::Sized64(len) => req.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::try_from(format!("{}", len)).unwrap(),
),
};
// Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
let (head, extra_headers) = match head {
RequestHeadType::Owned(head) => {
(RequestHeadType::Owned(head), HeaderMap::new())
}
RequestHeadType::Rc(head, extra_headers) => (
RequestHeadType::Rc(head, None),
extra_headers.unwrap_or_else(HeaderMap::new),
),
};
// merging headers from head and extra headers.
let headers = head
.as_ref()
.headers
.iter()
.filter(|(name, _)| !extra_headers.contains_key(*name))
.chain(extra_headers.iter());
// copy headers
for (key, value) in headers {
match *key {
CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
CONTENT_LENGTH if skip_len => continue,
// DATE => has_date = true,
_ => (),
}
req.headers_mut().append(key, value.clone());
}
}
match poll_fn(|cx| send.poll_capacity(cx)).await {
None => return Ok(()),
Some(Ok(cap)) => {
let b = buf.as_mut().unwrap();
let len = b.len();
let bytes = b.split_to(std::cmp::min(cap, len));
match io.send_request(req, eof) {
Ok((res, send)) => {
release(io, pool, created, false);
if let Err(e) = send.send_data(bytes, false) {
return Err(e.into());
} else {
if !b.is_empty() {
send.reserve_capacity(b.len());
if !eof {
Either::A(Either::B(
SendBody {
body,
send,
buf: None,
}
.and_then(move |_| res.map_err(SendRequestError::from)),
))
} else {
buf = None;
Either::B(res.map_err(SendRequestError::from))
}
continue;
}
Err(e) => {
release(io, pool, created, e.is_io());
Either::A(Either::A(err(e.into())))
}
}
Some(Err(e)) => return Err(e.into()),
})
.and_then(move |resp| {
let (parts, body) = resp.into_parts();
let payload = if head_req { Payload::None } else { body.into() };
let mut head = ResponseHead::new(parts.status);
head.version = parts.version;
head.headers = parts.headers.into();
Ok((head, payload))
})
.from_err()
}
struct SendBody<B: MessageBody> {
body: B,
send: SendStream<Bytes>,
buf: Option<Bytes>,
}
impl<B: MessageBody> Future for SendBody<B> {
type Item = ();
type Error = SendRequestError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
loop {
if self.buf.is_none() {
match self.body.poll_next() {
Ok(Async::Ready(Some(buf))) => {
self.send.reserve_capacity(buf.len());
self.buf = Some(buf);
}
Ok(Async::Ready(None)) => {
if let Err(e) = self.send.send_data(Bytes::new(), true) {
return Err(e.into());
}
self.send.reserve_capacity(0);
return Ok(Async::Ready(()));
}
Ok(Async::NotReady) => return Ok(Async::NotReady),
Err(e) => return Err(e.into()),
}
}
match self.send.poll_capacity() {
Ok(Async::NotReady) => return Ok(Async::NotReady),
Ok(Async::Ready(None)) => return Ok(Async::Ready(())),
Ok(Async::Ready(Some(cap))) => {
let mut buf = self.buf.take().unwrap();
let len = buf.len();
let bytes = buf.split_to(std::cmp::min(cap, len));
if let Err(e) = self.send.send_data(bytes, false) {
return Err(e.into());
} else {
if !buf.is_empty() {
self.send.reserve_capacity(buf.len());
self.buf = Some(buf);
}
continue;
}
}
Err(e) => return Err(e.into()),
}
}
}
}
/// release SendRequest object
fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
io: H2Connection,
// release SendRequest object
fn release<T: AsyncRead + AsyncWrite + 'static>(
io: SendRequest<Bytes>,
pool: Option<Acquired<T>>,
created: time::Instant,
close: bool,
@ -193,18 +201,3 @@ fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
}
}
}
pub(crate) fn handshake<Io>(
io: Io,
config: &ConnectorConfig,
) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
let mut builder = Builder::new();
builder
.initial_window_size(config.stream_window_size)
.initial_connection_window_size(config.conn_window_size)
.enable_push(false);
builder.handshake(io)
}

View File

@ -1,8 +1,6 @@
//! HTTP client.
//! Http client api
use http::Uri;
mod config;
mod connection;
mod connector;
mod error;
@ -10,10 +8,6 @@ mod h1proto;
mod h2proto;
mod pool;
pub use actix_tls::connect::{
Connect as TcpConnect, ConnectError as TcpConnectError, Connection as TcpConnection,
};
pub use self::connection::Connection;
pub use self::connector::Connector;
pub use self::error::{ConnectError, FreezeRequestError, InvalidUrl, SendRequestError};

File diff suppressed because it is too large Load Diff

View File

@ -0,0 +1,42 @@
use std::cell::UnsafeCell;
use std::rc::Rc;
use actix_service::Service;
use futures::Poll;
#[doc(hidden)]
/// Service that allows to turn non-clone service to a service with `Clone` impl
pub(crate) struct CloneableService<T>(Rc<UnsafeCell<T>>);
impl<T> CloneableService<T> {
pub(crate) fn new(service: T) -> Self
where
T: Service,
{
Self(Rc::new(UnsafeCell::new(service)))
}
}
impl<T> Clone for CloneableService<T> {
fn clone(&self) -> Self {
Self(self.0.clone())
}
}
impl<T> Service for CloneableService<T>
where
T: Service,
{
type Request = T::Request;
type Response = T::Response;
type Error = T::Error;
type Future = T::Future;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
unsafe { &mut *self.0.as_ref().get() }.poll_ready()
}
fn call(&mut self, req: T::Request) -> Self::Future {
unsafe { &mut *self.0.as_ref().get() }.call(req)
}
}

View File

@ -1,17 +1,15 @@
use std::cell::Cell;
use std::cell::UnsafeCell;
use std::fmt;
use std::fmt::Write;
use std::rc::Rc;
use std::time::Duration;
use std::{fmt, net};
use std::time::{Duration, Instant};
use actix_rt::{
task::JoinHandle,
time::{interval, sleep_until, Instant, Sleep},
};
use bytes::BytesMut;
use time::OffsetDateTime;
use futures::{future, Future};
use time;
use tokio_timer::{sleep, Delay};
/// "Sun, 06 Nov 1994 08:49:37 GMT".len()
// "Sun, 06 Nov 1994 08:49:37 GMT".len()
const DATE_VALUE_LENGTH: usize = 29;
#[derive(Debug, PartialEq, Clone, Copy)]
@ -19,7 +17,7 @@ const DATE_VALUE_LENGTH: usize = 29;
pub enum KeepAlive {
/// Keep alive in seconds
Timeout(usize),
/// Rely on OS to shutdown tcp connection
/// Relay on OS to shutdown tcp connection
Os,
/// Disabled
Disabled,
@ -49,9 +47,7 @@ struct Inner {
client_timeout: u64,
client_disconnect: u64,
ka_enabled: bool,
secure: bool,
local_addr: Option<std::net::SocketAddr>,
date_service: DateService,
timer: DateService,
}
impl Clone for ServiceConfig {
@ -62,7 +58,7 @@ impl Clone for ServiceConfig {
impl Default for ServiceConfig {
fn default() -> Self {
Self::new(KeepAlive::Timeout(5), 0, 0, false, None)
Self::new(KeepAlive::Timeout(5), 0, 0)
}
}
@ -72,8 +68,6 @@ impl ServiceConfig {
keep_alive: KeepAlive,
client_timeout: u64,
client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
) -> ServiceConfig {
let (keep_alive, ka_enabled) = match keep_alive {
KeepAlive::Timeout(val) => (val as u64, true),
@ -91,43 +85,29 @@ impl ServiceConfig {
ka_enabled,
client_timeout,
client_disconnect,
secure,
local_addr,
date_service: DateService::new(),
timer: DateService::new(),
}))
}
/// Returns true if connection is secure (HTTPS)
#[inline]
pub fn secure(&self) -> bool {
self.0.secure
}
/// Returns the local address that this server is bound to.
#[inline]
pub fn local_addr(&self) -> Option<net::SocketAddr> {
self.0.local_addr
}
/// Keep alive duration if configured.
#[inline]
pub fn keep_alive(&self) -> Option<Duration> {
self.0.keep_alive
}
/// Return state of connection keep-alive functionality
#[inline]
/// Return state of connection keep-alive funcitonality
pub fn keep_alive_enabled(&self) -> bool {
self.0.ka_enabled
}
/// Client timeout for first request.
#[inline]
pub fn client_timer(&self) -> Option<Sleep> {
let delay_time = self.0.client_timeout;
if delay_time != 0 {
Some(sleep_until(
self.0.date_service.now() + Duration::from_millis(delay_time),
/// Client timeout for first request.
pub fn client_timer(&self) -> Option<Delay> {
let delay = self.0.client_timeout;
if delay != 0 {
Some(Delay::new(
self.0.timer.now() + Duration::from_millis(delay),
))
} else {
None
@ -138,7 +118,7 @@ impl ServiceConfig {
pub fn client_timer_expire(&self) -> Option<Instant> {
let delay = self.0.client_timeout;
if delay != 0 {
Some(self.0.date_service.now() + Duration::from_millis(delay))
Some(self.0.timer.now() + Duration::from_millis(delay))
} else {
None
}
@ -148,7 +128,7 @@ impl ServiceConfig {
pub fn client_disconnect_timer(&self) -> Option<Instant> {
let delay = self.0.client_disconnect;
if delay != 0 {
Some(self.0.date_service.now() + Duration::from_millis(delay))
Some(self.0.timer.now() + Duration::from_millis(delay))
} else {
None
}
@ -156,9 +136,9 @@ impl ServiceConfig {
#[inline]
/// Return keep-alive timer delay is configured.
pub fn keep_alive_timer(&self) -> Option<Sleep> {
pub fn keep_alive_timer(&self) -> Option<Delay> {
if let Some(ka) = self.0.keep_alive {
Some(sleep_until(self.0.date_service.now() + ka))
Some(Delay::new(self.0.timer.now() + ka))
} else {
None
}
@ -167,7 +147,7 @@ impl ServiceConfig {
/// Keep-alive expire time
pub fn keep_alive_expire(&self) -> Option<Instant> {
if let Some(ka) = self.0.keep_alive {
Some(self.0.date_service.now() + ka)
Some(self.0.timer.now() + ka)
} else {
None
}
@ -175,7 +155,7 @@ impl ServiceConfig {
#[inline]
pub(crate) fn now(&self) -> Instant {
self.0.date_service.now()
self.0.timer.now()
}
#[doc(hidden)]
@ -183,7 +163,7 @@ impl ServiceConfig {
let mut buf: [u8; 39] = [0; 39];
buf[..6].copy_from_slice(b"date: ");
self.0
.date_service
.timer
.set_date(|date| buf[6..35].copy_from_slice(&date.bytes));
buf[35..].copy_from_slice(b"\r\n\r\n");
dst.extend_from_slice(&buf);
@ -191,7 +171,7 @@ impl ServiceConfig {
pub(crate) fn set_date_header(&self, dst: &mut BytesMut) {
self.0
.date_service
.timer
.set_date(|date| dst.extend_from_slice(&date.bytes));
}
}
@ -211,15 +191,9 @@ impl Date {
date.update();
date
}
fn update(&mut self) {
self.pos = 0;
write!(
self,
"{}",
OffsetDateTime::now_utc().format("%a, %d %b %Y %H:%M:%S GMT")
)
.unwrap();
write!(self, "{}", time::at_utc(time::get_time()).rfc822()).unwrap();
}
}
@ -232,171 +206,85 @@ impl fmt::Write for Date {
}
}
/// Service for update Date and Instant periodically at 500 millis interval.
struct DateService {
current: Rc<Cell<(Date, Instant)>>,
handle: JoinHandle<()>,
#[derive(Clone)]
struct DateService(Rc<DateServiceInner>);
struct DateServiceInner {
current: UnsafeCell<Option<(Date, Instant)>>,
}
impl Drop for DateService {
fn drop(&mut self) {
// stop the timer update async task on drop.
self.handle.abort();
impl DateServiceInner {
fn new() -> Self {
DateServiceInner {
current: UnsafeCell::new(None),
}
}
fn reset(&self) {
unsafe { (&mut *self.current.get()).take() };
}
fn update(&self) {
let now = Instant::now();
let date = Date::new();
*(unsafe { &mut *self.current.get() }) = Some((date, now));
}
}
impl DateService {
fn new() -> Self {
// shared date and timer for DateService and update async task.
let current = Rc::new(Cell::new((Date::new(), Instant::now())));
let current_clone = Rc::clone(&current);
// spawn an async task sleep for 500 milli and update current date/timer in a loop.
// handle is used to stop the task on DateService drop.
let handle = actix_rt::spawn(async move {
#[cfg(test)]
let _notify = notify_on_drop::NotifyOnDrop::new();
DateService(Rc::new(DateServiceInner::new()))
}
let mut interval = interval(Duration::from_millis(500));
loop {
let now = interval.tick().await;
let date = Date::new();
current_clone.set((date, now));
}
});
fn check_date(&self) {
if unsafe { (&*self.0.current.get()).is_none() } {
self.0.update();
DateService { current, handle }
// periodic date update
let s = self.clone();
tokio_current_thread::spawn(sleep(Duration::from_millis(500)).then(
move |_| {
s.0.reset();
future::ok(())
},
));
}
}
fn now(&self) -> Instant {
self.current.get().1
self.check_date();
unsafe { (&*self.0.current.get()).as_ref().unwrap().1 }
}
fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
f(&self.current.get().0);
}
}
// TODO: move to a util module for testing all spawn handle drop style tasks.
#[cfg(test)]
/// Test Module for checking the drop state of certain async tasks that are spawned
/// with `actix_rt::spawn`
///
/// The target task must explicitly generate `NotifyOnDrop` when spawn the task
mod notify_on_drop {
use std::cell::RefCell;
thread_local! {
static NOTIFY_DROPPED: RefCell<Option<bool>> = RefCell::new(None);
}
/// Check if the spawned task is dropped.
///
/// # Panic:
///
/// When there was no `NotifyOnDrop` instance on current thread
pub(crate) fn is_dropped() -> bool {
NOTIFY_DROPPED.with(|bool| {
bool.borrow()
.expect("No NotifyOnDrop existed on current thread")
})
}
pub(crate) struct NotifyOnDrop;
impl NotifyOnDrop {
/// # Panic:
///
/// When construct multiple instances on any given thread.
pub(crate) fn new() -> Self {
NOTIFY_DROPPED.with(|bool| {
let mut bool = bool.borrow_mut();
if bool.is_some() {
panic!("NotifyOnDrop existed on current thread");
} else {
*bool = Some(false);
}
});
NotifyOnDrop
}
}
impl Drop for NotifyOnDrop {
fn drop(&mut self) {
NOTIFY_DROPPED.with(|bool| {
if let Some(b) = bool.borrow_mut().as_mut() {
*b = true;
}
});
}
self.check_date();
f(&unsafe { (&*self.0.current.get()).as_ref().unwrap().0 })
}
}
#[cfg(test)]
mod tests {
use super::*;
use actix_rt::task::yield_now;
#[actix_rt::test]
async fn test_date_service_update() {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
yield_now().await;
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1);
let now1 = settings.now();
sleep_until(Instant::now() + Duration::from_secs(2)).await;
yield_now().await;
let now2 = settings.now();
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2);
assert_ne!(now1, now2);
assert_ne!(buf1, buf2);
drop(settings);
assert!(notify_on_drop::is_dropped());
}
#[actix_rt::test]
async fn test_date_service_drop() {
let service = Rc::new(DateService::new());
// yield so date service have a chance to register the spawned timer update task.
yield_now().await;
let clone1 = service.clone();
let clone2 = service.clone();
let clone3 = service.clone();
drop(clone1);
assert_eq!(false, notify_on_drop::is_dropped());
drop(clone2);
assert_eq!(false, notify_on_drop::is_dropped());
drop(clone3);
assert_eq!(false, notify_on_drop::is_dropped());
drop(service);
assert!(notify_on_drop::is_dropped());
}
use actix_rt::System;
use futures::future;
#[test]
fn test_date_len() {
assert_eq!(DATE_VALUE_LENGTH, "Sun, 06 Nov 1994 08:49:37 GMT".len());
}
#[actix_rt::test]
async fn test_date() {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1);
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2);
assert_eq!(buf1, buf2);
#[test]
fn test_date() {
let mut rt = System::new("test");
let _ = rt.block_on(future::lazy(|| {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0);
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1);
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2);
assert_eq!(buf1, buf2);
future::ok::<_, ()>(())
}));
}
}

View File

@ -0,0 +1,260 @@
use std::borrow::Cow;
use chrono::Duration;
use time::Tm;
use super::{Cookie, SameSite};
/// Structure that follows the builder pattern for building `Cookie` structs.
///
/// To construct a cookie:
///
/// 1. Call [`Cookie::build`](struct.Cookie.html#method.build) to start building.
/// 2. Use any of the builder methods to set fields in the cookie.
/// 3. Call [finish](#method.finish) to retrieve the built cookie.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let cookie: Cookie = Cookie::build("name", "value")
/// .domain("www.rust-lang.org")
/// .path("/")
/// .secure(true)
/// .http_only(true)
/// .max_age(84600)
/// .finish();
/// # }
/// ```
#[derive(Debug, Clone)]
pub struct CookieBuilder {
/// The cookie being built.
cookie: Cookie<'static>,
}
impl CookieBuilder {
/// Creates a new `CookieBuilder` instance from the given name and value.
///
/// This method is typically called indirectly via
/// [Cookie::build](struct.Cookie.html#method.build).
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar").finish();
/// assert_eq!(c.name_value(), ("foo", "bar"));
/// ```
pub fn new<N, V>(name: N, value: V) -> CookieBuilder
where
N: Into<Cow<'static, str>>,
V: Into<Cow<'static, str>>,
{
CookieBuilder {
cookie: Cookie::new(name, value),
}
}
/// Sets the `expires` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .expires(time::now())
/// .finish();
///
/// assert!(c.expires().is_some());
/// # }
/// ```
#[inline]
pub fn expires(mut self, when: Tm) -> CookieBuilder {
self.cookie.set_expires(when);
self
}
/// Sets the `max_age` field in seconds in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .max_age(1800)
/// .finish();
///
/// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
/// # }
/// ```
#[inline]
pub fn max_age(self, seconds: i64) -> CookieBuilder {
self.max_age_time(Duration::seconds(seconds))
}
/// Sets the `max_age` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .max_age_time(time::Duration::minutes(30))
/// .finish();
///
/// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
/// # }
/// ```
#[inline]
pub fn max_age_time(mut self, value: Duration) -> CookieBuilder {
self.cookie.set_max_age(value);
self
}
/// Sets the `domain` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .domain("www.rust-lang.org")
/// .finish();
///
/// assert_eq!(c.domain(), Some("www.rust-lang.org"));
/// ```
pub fn domain<D: Into<Cow<'static, str>>>(mut self, value: D) -> CookieBuilder {
self.cookie.set_domain(value);
self
}
/// Sets the `path` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .path("/")
/// .finish();
///
/// assert_eq!(c.path(), Some("/"));
/// ```
pub fn path<P: Into<Cow<'static, str>>>(mut self, path: P) -> CookieBuilder {
self.cookie.set_path(path);
self
}
/// Sets the `secure` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .secure(true)
/// .finish();
///
/// assert_eq!(c.secure(), Some(true));
/// ```
#[inline]
pub fn secure(mut self, value: bool) -> CookieBuilder {
self.cookie.set_secure(value);
self
}
/// Sets the `http_only` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .http_only(true)
/// .finish();
///
/// assert_eq!(c.http_only(), Some(true));
/// ```
#[inline]
pub fn http_only(mut self, value: bool) -> CookieBuilder {
self.cookie.set_http_only(value);
self
}
/// Sets the `same_site` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{Cookie, SameSite};
///
/// let c = Cookie::build("foo", "bar")
/// .same_site(SameSite::Strict)
/// .finish();
///
/// assert_eq!(c.same_site(), Some(SameSite::Strict));
/// ```
#[inline]
pub fn same_site(mut self, value: SameSite) -> CookieBuilder {
self.cookie.set_same_site(value);
self
}
/// Makes the cookie being built 'permanent' by extending its expiration and
/// max age 20 years into the future.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
/// use chrono::Duration;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .permanent()
/// .finish();
///
/// assert_eq!(c.max_age(), Some(Duration::days(365 * 20)));
/// # assert!(c.expires().is_some());
/// # }
/// ```
#[inline]
pub fn permanent(mut self) -> CookieBuilder {
self.cookie.make_permanent();
self
}
/// Finishes building and returns the built `Cookie`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .domain("crates.io")
/// .path("/")
/// .finish();
///
/// assert_eq!(c.name_value(), ("foo", "bar"));
/// assert_eq!(c.domain(), Some("crates.io"));
/// assert_eq!(c.path(), Some("/"));
/// ```
#[inline]
pub fn finish(self) -> Cookie<'static> {
self.cookie
}
}

View File

@ -0,0 +1,71 @@
use std::borrow::Borrow;
use std::hash::{Hash, Hasher};
use std::ops::{Deref, DerefMut};
use super::Cookie;
/// A `DeltaCookie` is a helper structure used in a cookie jar. It wraps a
/// `Cookie` so that it can be hashed and compared purely by name. It further
/// records whether the wrapped cookie is a "removal" cookie, that is, a cookie
/// that when sent to the client removes the named cookie on the client's
/// machine.
#[derive(Clone, Debug)]
pub struct DeltaCookie {
pub cookie: Cookie<'static>,
pub removed: bool,
}
impl DeltaCookie {
/// Create a new `DeltaCookie` that is being added to a jar.
#[inline]
pub fn added(cookie: Cookie<'static>) -> DeltaCookie {
DeltaCookie {
cookie,
removed: false,
}
}
/// Create a new `DeltaCookie` that is being removed from a jar. The
/// `cookie` should be a "removal" cookie.
#[inline]
pub fn removed(cookie: Cookie<'static>) -> DeltaCookie {
DeltaCookie {
cookie,
removed: true,
}
}
}
impl Deref for DeltaCookie {
type Target = Cookie<'static>;
fn deref(&self) -> &Cookie<'static> {
&self.cookie
}
}
impl DerefMut for DeltaCookie {
fn deref_mut(&mut self) -> &mut Cookie<'static> {
&mut self.cookie
}
}
impl PartialEq for DeltaCookie {
fn eq(&self, other: &DeltaCookie) -> bool {
self.name() == other.name()
}
}
impl Eq for DeltaCookie {}
impl Hash for DeltaCookie {
fn hash<H: Hasher>(&self, state: &mut H) {
self.name().hash(state);
}
}
impl Borrow<str> for DeltaCookie {
fn borrow(&self) -> &str {
self.name()
}
}

View File

@ -0,0 +1,98 @@
//! This module contains types that represent cookie properties that are not yet
//! standardized. That is, _draft_ features.
use std::fmt;
/// The `SameSite` cookie attribute.
///
/// A cookie with a `SameSite` attribute is imposed restrictions on when it is
/// sent to the origin server in a cross-site request. If the `SameSite`
/// attribute is "Strict", then the cookie is never sent in cross-site requests.
/// If the `SameSite` attribute is "Lax", the cookie is only sent in cross-site
/// requests with "safe" HTTP methods, i.e, `GET`, `HEAD`, `OPTIONS`, `TRACE`.
/// If the `SameSite` attribute is not present (made explicit via the
/// `SameSite::None` variant), then the cookie will be sent as normal.
///
/// **Note:** This cookie attribute is an HTTP draft! Its meaning and definition
/// are subject to change.
#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
pub enum SameSite {
/// The "Strict" `SameSite` attribute.
Strict,
/// The "Lax" `SameSite` attribute.
Lax,
/// No `SameSite` attribute.
None,
}
impl SameSite {
/// Returns `true` if `self` is `SameSite::Strict` and `false` otherwise.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::SameSite;
///
/// let strict = SameSite::Strict;
/// assert!(strict.is_strict());
/// assert!(!strict.is_lax());
/// assert!(!strict.is_none());
/// ```
#[inline]
pub fn is_strict(self) -> bool {
match self {
SameSite::Strict => true,
SameSite::Lax | SameSite::None => false,
}
}
/// Returns `true` if `self` is `SameSite::Lax` and `false` otherwise.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::SameSite;
///
/// let lax = SameSite::Lax;
/// assert!(lax.is_lax());
/// assert!(!lax.is_strict());
/// assert!(!lax.is_none());
/// ```
#[inline]
pub fn is_lax(self) -> bool {
match self {
SameSite::Lax => true,
SameSite::Strict | SameSite::None => false,
}
}
/// Returns `true` if `self` is `SameSite::None` and `false` otherwise.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::SameSite;
///
/// let none = SameSite::None;
/// assert!(none.is_none());
/// assert!(!none.is_lax());
/// assert!(!none.is_strict());
/// ```
#[inline]
pub fn is_none(self) -> bool {
match self {
SameSite::None => true,
SameSite::Lax | SameSite::Strict => false,
}
}
}
impl fmt::Display for SameSite {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
match *self {
SameSite::Strict => write!(f, "Strict"),
SameSite::Lax => write!(f, "Lax"),
SameSite::None => Ok(()),
}
}
}

View File

@ -0,0 +1,655 @@
use std::collections::HashSet;
use std::mem::replace;
use chrono::Duration;
use super::delta::DeltaCookie;
use super::Cookie;
#[cfg(feature = "secure-cookies")]
use super::secure::{Key, PrivateJar, SignedJar};
/// A collection of cookies that tracks its modifications.
///
/// A `CookieJar` provides storage for any number of cookies. Any changes made
/// to the jar are tracked; the changes can be retrieved via the
/// [delta](#method.delta) method which returns an interator over the changes.
///
/// # Usage
///
/// A jar's life begins via [new](#method.new) and calls to
/// [`add_original`](#method.add_original):
///
/// ```rust
/// use actix_http::cookie::{Cookie, CookieJar};
///
/// let mut jar = CookieJar::new();
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add_original(Cookie::new("second", "another"));
/// ```
///
/// Cookies can be added via [add](#method.add) and removed via
/// [remove](#method.remove). Finally, cookies can be looked up via
/// [get](#method.get):
///
/// ```rust
/// # use actix_http::cookie::{Cookie, CookieJar};
/// let mut jar = CookieJar::new();
/// jar.add(Cookie::new("a", "one"));
/// jar.add(Cookie::new("b", "two"));
///
/// assert_eq!(jar.get("a").map(|c| c.value()), Some("one"));
/// assert_eq!(jar.get("b").map(|c| c.value()), Some("two"));
///
/// jar.remove(Cookie::named("b"));
/// assert!(jar.get("b").is_none());
/// ```
///
/// # Deltas
///
/// A jar keeps track of any modifications made to it over time. The
/// modifications are recorded as cookies. The modifications can be retrieved
/// via [delta](#method.delta). Any new `Cookie` added to a jar via `add`
/// results in the same `Cookie` appearing in the `delta`; cookies added via
/// `add_original` do not count towards the delta. Any _original_ cookie that is
/// removed from a jar results in a "removal" cookie appearing in the delta. A
/// "removal" cookie is a cookie that a server sends so that the cookie is
/// removed from the client's machine.
///
/// Deltas are typically used to create `Set-Cookie` headers corresponding to
/// the changes made to a cookie jar over a period of time.
///
/// ```rust
/// # use actix_http::cookie::{Cookie, CookieJar};
/// let mut jar = CookieJar::new();
///
/// // original cookies don't affect the delta
/// jar.add_original(Cookie::new("original", "value"));
/// assert_eq!(jar.delta().count(), 0);
///
/// // new cookies result in an equivalent `Cookie` in the delta
/// jar.add(Cookie::new("a", "one"));
/// jar.add(Cookie::new("b", "two"));
/// assert_eq!(jar.delta().count(), 2);
///
/// // removing an original cookie adds a "removal" cookie to the delta
/// jar.remove(Cookie::named("original"));
/// assert_eq!(jar.delta().count(), 3);
///
/// // removing a new cookie that was added removes that `Cookie` from the delta
/// jar.remove(Cookie::named("a"));
/// assert_eq!(jar.delta().count(), 2);
/// ```
#[derive(Default, Debug, Clone)]
pub struct CookieJar {
original_cookies: HashSet<DeltaCookie>,
delta_cookies: HashSet<DeltaCookie>,
}
impl CookieJar {
/// Creates an empty cookie jar.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::CookieJar;
///
/// let jar = CookieJar::new();
/// assert_eq!(jar.iter().count(), 0);
/// ```
pub fn new() -> CookieJar {
CookieJar::default()
}
/// Returns a reference to the `Cookie` inside this jar with the name
/// `name`. If no such cookie exists, returns `None`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// assert!(jar.get("name").is_none());
///
/// jar.add(Cookie::new("name", "value"));
/// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
/// ```
pub fn get(&self, name: &str) -> Option<&Cookie<'static>> {
self.delta_cookies
.get(name)
.or_else(|| self.original_cookies.get(name))
.and_then(|c| if !c.removed { Some(&c.cookie) } else { None })
}
/// Adds an "original" `cookie` to this jar. If an original cookie with the
/// same name already exists, it is replaced with `cookie`. Cookies added
/// with `add` take precedence and are not replaced by this method.
///
/// Adding an original cookie does not affect the [delta](#method.delta)
/// computation. This method is intended to be used to seed the cookie jar
/// with cookies received from a client's HTTP message.
///
/// For accurate `delta` computations, this method should not be called
/// after calling `remove`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add_original(Cookie::new("second", "two"));
///
/// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
/// assert_eq!(jar.get("second").map(|c| c.value()), Some("two"));
/// assert_eq!(jar.iter().count(), 2);
/// assert_eq!(jar.delta().count(), 0);
/// ```
pub fn add_original(&mut self, cookie: Cookie<'static>) {
self.original_cookies.replace(DeltaCookie::added(cookie));
}
/// Adds `cookie` to this jar. If a cookie with the same name already
/// exists, it is replaced with `cookie`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// jar.add(Cookie::new("name", "value"));
/// jar.add(Cookie::new("second", "two"));
///
/// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
/// assert_eq!(jar.get("second").map(|c| c.value()), Some("two"));
/// assert_eq!(jar.iter().count(), 2);
/// assert_eq!(jar.delta().count(), 2);
/// ```
pub fn add(&mut self, cookie: Cookie<'static>) {
self.delta_cookies.replace(DeltaCookie::added(cookie));
}
/// Removes `cookie` from this jar. If an _original_ cookie with the same
/// name as `cookie` is present in the jar, a _removal_ cookie will be
/// present in the `delta` computation. To properly generate the removal
/// cookie, `cookie` must contain the same `path` and `domain` as the cookie
/// that was initially set.
///
/// A "removal" cookie is a cookie that has the same name as the original
/// cookie but has an empty value, a max-age of 0, and an expiration date
/// far in the past.
///
/// # Example
///
/// Removing an _original_ cookie results in a _removal_ cookie:
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
/// use chrono::Duration;
///
/// # fn main() {
/// let mut jar = CookieJar::new();
///
/// // Assume this cookie originally had a path of "/" and domain of "a.b".
/// jar.add_original(Cookie::new("name", "value"));
///
/// // If the path and domain were set, they must be provided to `remove`.
/// jar.remove(Cookie::build("name", "").path("/").domain("a.b").finish());
///
/// // The delta will contain the removal cookie.
/// let delta: Vec<_> = jar.delta().collect();
/// assert_eq!(delta.len(), 1);
/// assert_eq!(delta[0].name(), "name");
/// assert_eq!(delta[0].max_age(), Some(Duration::seconds(0)));
/// # }
/// ```
///
/// Removing a new cookie does not result in a _removal_ cookie:
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// jar.add(Cookie::new("name", "value"));
/// assert_eq!(jar.delta().count(), 1);
///
/// jar.remove(Cookie::named("name"));
/// assert_eq!(jar.delta().count(), 0);
/// ```
pub fn remove(&mut self, mut cookie: Cookie<'static>) {
if self.original_cookies.contains(cookie.name()) {
cookie.set_value("");
cookie.set_max_age(Duration::seconds(0));
cookie.set_expires(time::now() - Duration::days(365));
self.delta_cookies.replace(DeltaCookie::removed(cookie));
} else {
self.delta_cookies.remove(cookie.name());
}
}
/// Removes `cookie` from this jar completely. This method differs from
/// `remove` in that no delta cookie is created under any condition. Neither
/// the `delta` nor `iter` methods will return a cookie that is removed
/// using this method.
///
/// # Example
///
/// Removing an _original_ cookie; no _removal_ cookie is generated:
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
/// use chrono::Duration;
///
/// # fn main() {
/// let mut jar = CookieJar::new();
///
/// // Add an original cookie and a new cookie.
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add(Cookie::new("key", "value"));
/// assert_eq!(jar.delta().count(), 1);
/// assert_eq!(jar.iter().count(), 2);
///
/// // Now force remove the original cookie.
/// jar.force_remove(Cookie::new("name", "value"));
/// assert_eq!(jar.delta().count(), 1);
/// assert_eq!(jar.iter().count(), 1);
///
/// // Now force remove the new cookie.
/// jar.force_remove(Cookie::new("key", "value"));
/// assert_eq!(jar.delta().count(), 0);
/// assert_eq!(jar.iter().count(), 0);
/// # }
/// ```
pub fn force_remove<'a>(&mut self, cookie: Cookie<'a>) {
self.original_cookies.remove(cookie.name());
self.delta_cookies.remove(cookie.name());
}
/// Removes all cookies from this cookie jar.
#[deprecated(
since = "0.7.0",
note = "calling this method may not remove \
all cookies since the path and domain are not specified; use \
`remove` instead"
)]
pub fn clear(&mut self) {
self.delta_cookies.clear();
for delta in replace(&mut self.original_cookies, HashSet::new()) {
self.remove(delta.cookie);
}
}
/// Returns an iterator over cookies that represent the changes to this jar
/// over time. These cookies can be rendered directly as `Set-Cookie` header
/// values to affect the changes made to this jar on the client.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add_original(Cookie::new("second", "two"));
///
/// // Add new cookies.
/// jar.add(Cookie::new("new", "third"));
/// jar.add(Cookie::new("another", "fourth"));
/// jar.add(Cookie::new("yac", "fifth"));
///
/// // Remove some cookies.
/// jar.remove(Cookie::named("name"));
/// jar.remove(Cookie::named("another"));
///
/// // Delta contains two new cookies ("new", "yac") and a removal ("name").
/// assert_eq!(jar.delta().count(), 3);
/// ```
pub fn delta(&self) -> Delta {
Delta {
iter: self.delta_cookies.iter(),
}
}
/// Returns an iterator over all of the cookies present in this jar.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
///
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add_original(Cookie::new("second", "two"));
///
/// jar.add(Cookie::new("new", "third"));
/// jar.add(Cookie::new("another", "fourth"));
/// jar.add(Cookie::new("yac", "fifth"));
///
/// jar.remove(Cookie::named("name"));
/// jar.remove(Cookie::named("another"));
///
/// // There are three cookies in the jar: "second", "new", and "yac".
/// # assert_eq!(jar.iter().count(), 3);
/// for cookie in jar.iter() {
/// match cookie.name() {
/// "second" => assert_eq!(cookie.value(), "two"),
/// "new" => assert_eq!(cookie.value(), "third"),
/// "yac" => assert_eq!(cookie.value(), "fifth"),
/// _ => unreachable!("there are only three cookies in the jar")
/// }
/// }
/// ```
pub fn iter(&self) -> Iter {
Iter {
delta_cookies: self
.delta_cookies
.iter()
.chain(self.original_cookies.difference(&self.delta_cookies)),
}
}
/// Returns a `PrivateJar` with `self` as its parent jar using the key `key`
/// to sign/encrypt and verify/decrypt cookies added/retrieved from the
/// child jar.
///
/// Any modifications to the child jar will be reflected on the parent jar,
/// and any retrievals from the child jar will be made from the parent jar.
///
/// This method is only available when the `secure` feature is enabled.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{Cookie, CookieJar, Key};
///
/// // Generate a secure key.
/// let key = Key::generate();
///
/// // Add a private (signed + encrypted) cookie.
/// let mut jar = CookieJar::new();
/// jar.private(&key).add(Cookie::new("private", "text"));
///
/// // The cookie's contents are encrypted.
/// assert_ne!(jar.get("private").unwrap().value(), "text");
///
/// // They can be decrypted and verified through the child jar.
/// assert_eq!(jar.private(&key).get("private").unwrap().value(), "text");
///
/// // A tampered with cookie does not validate but still exists.
/// let mut cookie = jar.get("private").unwrap().clone();
/// jar.add(Cookie::new("private", cookie.value().to_string() + "!"));
/// assert!(jar.private(&key).get("private").is_none());
/// assert!(jar.get("private").is_some());
/// ```
#[cfg(feature = "secure-cookies")]
pub fn private(&mut self, key: &Key) -> PrivateJar {
PrivateJar::new(self, key)
}
/// Returns a `SignedJar` with `self` as its parent jar using the key `key`
/// to sign/verify cookies added/retrieved from the child jar.
///
/// Any modifications to the child jar will be reflected on the parent jar,
/// and any retrievals from the child jar will be made from the parent jar.
///
/// This method is only available when the `secure` feature is enabled.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{Cookie, CookieJar, Key};
///
/// // Generate a secure key.
/// let key = Key::generate();
///
/// // Add a signed cookie.
/// let mut jar = CookieJar::new();
/// jar.signed(&key).add(Cookie::new("signed", "text"));
///
/// // The cookie's contents are signed but still in plaintext.
/// assert_ne!(jar.get("signed").unwrap().value(), "text");
/// assert!(jar.get("signed").unwrap().value().contains("text"));
///
/// // They can be verified through the child jar.
/// assert_eq!(jar.signed(&key).get("signed").unwrap().value(), "text");
///
/// // A tampered with cookie does not validate but still exists.
/// let mut cookie = jar.get("signed").unwrap().clone();
/// jar.add(Cookie::new("signed", cookie.value().to_string() + "!"));
/// assert!(jar.signed(&key).get("signed").is_none());
/// assert!(jar.get("signed").is_some());
/// ```
#[cfg(feature = "secure-cookies")]
pub fn signed(&mut self, key: &Key) -> SignedJar {
SignedJar::new(self, key)
}
}
use std::collections::hash_set::Iter as HashSetIter;
/// Iterator over the changes to a cookie jar.
pub struct Delta<'a> {
iter: HashSetIter<'a, DeltaCookie>,
}
impl<'a> Iterator for Delta<'a> {
type Item = &'a Cookie<'static>;
fn next(&mut self) -> Option<&'a Cookie<'static>> {
self.iter.next().map(|c| &c.cookie)
}
}
use std::collections::hash_map::RandomState;
use std::collections::hash_set::Difference;
use std::iter::Chain;
/// Iterator over all of the cookies in a jar.
pub struct Iter<'a> {
delta_cookies:
Chain<HashSetIter<'a, DeltaCookie>, Difference<'a, DeltaCookie, RandomState>>,
}
impl<'a> Iterator for Iter<'a> {
type Item = &'a Cookie<'static>;
fn next(&mut self) -> Option<&'a Cookie<'static>> {
for cookie in self.delta_cookies.by_ref() {
if !cookie.removed {
return Some(&*cookie);
}
}
None
}
}
#[cfg(test)]
mod test {
#[cfg(feature = "secure-cookies")]
use super::Key;
use super::{Cookie, CookieJar};
#[test]
#[allow(deprecated)]
fn simple() {
let mut c = CookieJar::new();
c.add(Cookie::new("test", ""));
c.add(Cookie::new("test2", ""));
c.remove(Cookie::named("test"));
assert!(c.get("test").is_none());
assert!(c.get("test2").is_some());
c.add(Cookie::new("test3", ""));
c.clear();
assert!(c.get("test").is_none());
assert!(c.get("test2").is_none());
assert!(c.get("test3").is_none());
}
#[test]
fn jar_is_send() {
fn is_send<T: Send>(_: T) -> bool {
true
}
assert!(is_send(CookieJar::new()))
}
#[test]
#[cfg(feature = "secure-cookies")]
fn iter() {
let key = Key::generate();
let mut c = CookieJar::new();
c.add_original(Cookie::new("original", "original"));
c.add(Cookie::new("test", "test"));
c.add(Cookie::new("test2", "test2"));
c.add(Cookie::new("test3", "test3"));
assert_eq!(c.iter().count(), 4);
c.signed(&key).add(Cookie::new("signed", "signed"));
c.private(&key).add(Cookie::new("encrypted", "encrypted"));
assert_eq!(c.iter().count(), 6);
c.remove(Cookie::named("test"));
assert_eq!(c.iter().count(), 5);
c.remove(Cookie::named("signed"));
c.remove(Cookie::named("test2"));
assert_eq!(c.iter().count(), 3);
c.add(Cookie::new("test2", "test2"));
assert_eq!(c.iter().count(), 4);
c.remove(Cookie::named("test2"));
assert_eq!(c.iter().count(), 3);
}
#[test]
#[cfg(feature = "secure-cookies")]
fn delta() {
use chrono::Duration;
use std::collections::HashMap;
let mut c = CookieJar::new();
c.add_original(Cookie::new("original", "original"));
c.add_original(Cookie::new("original1", "original1"));
c.add(Cookie::new("test", "test"));
c.add(Cookie::new("test2", "test2"));
c.add(Cookie::new("test3", "test3"));
c.add(Cookie::new("test4", "test4"));
c.remove(Cookie::named("test"));
c.remove(Cookie::named("original"));
assert_eq!(c.delta().count(), 4);
let names: HashMap<_, _> = c.delta().map(|c| (c.name(), c.max_age())).collect();
assert!(names.get("test2").unwrap().is_none());
assert!(names.get("test3").unwrap().is_none());
assert!(names.get("test4").unwrap().is_none());
assert_eq!(names.get("original").unwrap(), &Some(Duration::seconds(0)));
}
#[test]
fn replace_original() {
let mut jar = CookieJar::new();
jar.add_original(Cookie::new("original_a", "a"));
jar.add_original(Cookie::new("original_b", "b"));
assert_eq!(jar.get("original_a").unwrap().value(), "a");
jar.add(Cookie::new("original_a", "av2"));
assert_eq!(jar.get("original_a").unwrap().value(), "av2");
}
#[test]
fn empty_delta() {
let mut jar = CookieJar::new();
jar.add(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().count(), 0);
jar.add_original(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 0);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().count(), 1);
jar.add(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().count(), 1);
}
#[test]
fn add_remove_add() {
let mut jar = CookieJar::new();
jar.add_original(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 0);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
// The cookie's been deleted. Another original doesn't change that.
jar.add_original(Cookie::new("name", "val"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
jar.add(Cookie::new("name", "val"));
assert_eq!(jar.delta().filter(|c| !c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
}
#[test]
fn replace_remove() {
let mut jar = CookieJar::new();
jar.add_original(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 0);
jar.add(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 1);
assert_eq!(jar.delta().filter(|c| !c.value().is_empty()).count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
}
#[test]
fn remove_with_path() {
let mut jar = CookieJar::new();
jar.add_original(Cookie::build("name", "val").finish());
assert_eq!(jar.iter().count(), 1);
assert_eq!(jar.delta().count(), 0);
assert_eq!(jar.iter().filter(|c| c.path().is_none()).count(), 1);
jar.remove(Cookie::build("name", "").path("/").finish());
assert_eq!(jar.iter().count(), 0);
assert_eq!(jar.delta().count(), 1);
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().filter(|c| c.path() == Some("/")).count(), 1);
}
}

1106
actix-http/src/cookie/mod.rs Normal file

File diff suppressed because it is too large Load Diff

View File

@ -0,0 +1,425 @@
use std::borrow::Cow;
use std::cmp;
use std::convert::From;
use std::error::Error;
use std::fmt;
use std::str::Utf8Error;
use chrono::Duration;
use percent_encoding::percent_decode;
use super::{Cookie, CookieStr, SameSite};
/// Enum corresponding to a parsing error.
#[derive(Debug, PartialEq, Eq, Clone, Copy)]
pub enum ParseError {
/// The cookie did not contain a name/value pair.
MissingPair,
/// The cookie's name was empty.
EmptyName,
/// Decoding the cookie's name or value resulted in invalid UTF-8.
Utf8Error(Utf8Error),
/// It is discouraged to exhaustively match on this enum as its variants may
/// grow without a breaking-change bump in version numbers.
#[doc(hidden)]
__Nonexhasutive,
}
impl ParseError {
/// Returns a description of this error as a string
pub fn as_str(&self) -> &'static str {
match *self {
ParseError::MissingPair => "the cookie is missing a name/value pair",
ParseError::EmptyName => "the cookie's name is empty",
ParseError::Utf8Error(_) => {
"decoding the cookie's name or value resulted in invalid UTF-8"
}
ParseError::__Nonexhasutive => unreachable!("__Nonexhasutive ParseError"),
}
}
}
impl fmt::Display for ParseError {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
write!(f, "{}", self.as_str())
}
}
impl From<Utf8Error> for ParseError {
fn from(error: Utf8Error) -> ParseError {
ParseError::Utf8Error(error)
}
}
impl Error for ParseError {
fn description(&self) -> &str {
self.as_str()
}
}
fn indexes_of(needle: &str, haystack: &str) -> Option<(usize, usize)> {
let haystack_start = haystack.as_ptr() as usize;
let needle_start = needle.as_ptr() as usize;
if needle_start < haystack_start {
return None;
}
if (needle_start + needle.len()) > (haystack_start + haystack.len()) {
return None;
}
let start = needle_start - haystack_start;
let end = start + needle.len();
Some((start, end))
}
fn name_val_decoded(
name: &str,
val: &str,
) -> Result<(CookieStr, CookieStr), ParseError> {
let decoded_name = percent_decode(name.as_bytes()).decode_utf8()?;
let decoded_value = percent_decode(val.as_bytes()).decode_utf8()?;
let name = CookieStr::Concrete(Cow::Owned(decoded_name.into_owned()));
let val = CookieStr::Concrete(Cow::Owned(decoded_value.into_owned()));
Ok((name, val))
}
// This function does the real parsing but _does not_ set the `cookie_string` in
// the returned cookie object. This only exists so that the borrow to `s` is
// returned at the end of the call, allowing the `cookie_string` field to be
// set in the outer `parse` function.
fn parse_inner<'c>(s: &str, decode: bool) -> Result<Cookie<'c>, ParseError> {
let mut attributes = s.split(';');
let key_value = match attributes.next() {
Some(s) => s,
_ => panic!(),
};
// Determine the name = val.
let (name, value) = match key_value.find('=') {
Some(i) => (key_value[..i].trim(), key_value[(i + 1)..].trim()),
None => return Err(ParseError::MissingPair),
};
if name.is_empty() {
return Err(ParseError::EmptyName);
}
// Create a cookie with all of the defaults. We'll fill things in while we
// iterate through the parameters below.
let (name, value) = if decode {
name_val_decoded(name, value)?
} else {
let name_indexes = indexes_of(name, s).expect("name sub");
let value_indexes = indexes_of(value, s).expect("value sub");
let name = CookieStr::Indexed(name_indexes.0, name_indexes.1);
let value = CookieStr::Indexed(value_indexes.0, value_indexes.1);
(name, value)
};
let mut cookie = Cookie {
name,
value,
cookie_string: None,
expires: None,
max_age: None,
domain: None,
path: None,
secure: None,
http_only: None,
same_site: None,
};
for attr in attributes {
let (key, value) = match attr.find('=') {
Some(i) => (attr[..i].trim(), Some(attr[(i + 1)..].trim())),
None => (attr.trim(), None),
};
match (&*key.to_ascii_lowercase(), value) {
("secure", _) => cookie.secure = Some(true),
("httponly", _) => cookie.http_only = Some(true),
("max-age", Some(v)) => {
// See RFC 6265 Section 5.2.2, negative values indicate that the
// earliest possible expiration time should be used, so set the
// max age as 0 seconds.
cookie.max_age = match v.parse() {
Ok(val) if val <= 0 => Some(Duration::zero()),
Ok(val) => {
// Don't panic if the max age seconds is greater than what's supported by
// `Duration`.
let val = cmp::min(val, Duration::max_value().num_seconds());
Some(Duration::seconds(val))
}
Err(_) => continue,
};
}
("domain", Some(mut domain)) if !domain.is_empty() => {
if domain.starts_with('.') {
domain = &domain[1..];
}
let (i, j) = indexes_of(domain, s).expect("domain sub");
cookie.domain = Some(CookieStr::Indexed(i, j));
}
("path", Some(v)) => {
let (i, j) = indexes_of(v, s).expect("path sub");
cookie.path = Some(CookieStr::Indexed(i, j));
}
("samesite", Some(v)) => {
if v.eq_ignore_ascii_case("strict") {
cookie.same_site = Some(SameSite::Strict);
} else if v.eq_ignore_ascii_case("lax") {
cookie.same_site = Some(SameSite::Lax);
} else {
// We do nothing here, for now. When/if the `SameSite`
// attribute becomes standard, the spec says that we should
// ignore this cookie, i.e, fail to parse it, when an
// invalid value is passed in. The draft is at
// http://httpwg.org/http-extensions/draft-ietf-httpbis-cookie-same-site.html.
}
}
("expires", Some(v)) => {
// Try strptime with three date formats according to
// http://tools.ietf.org/html/rfc2616#section-3.3.1. Try
// additional ones as encountered in the real world.
let tm = time::strptime(v, "%a, %d %b %Y %H:%M:%S %Z")
.or_else(|_| time::strptime(v, "%A, %d-%b-%y %H:%M:%S %Z"))
.or_else(|_| time::strptime(v, "%a, %d-%b-%Y %H:%M:%S %Z"))
.or_else(|_| time::strptime(v, "%a %b %d %H:%M:%S %Y"));
if let Ok(time) = tm {
cookie.expires = Some(time)
}
}
_ => {
// We're going to be permissive here. If we have no idea what
// this is, then it's something nonstandard. We're not going to
// store it (because it's not compliant), but we're also not
// going to emit an error.
}
}
}
Ok(cookie)
}
pub fn parse_cookie<'c, S>(cow: S, decode: bool) -> Result<Cookie<'c>, ParseError>
where
S: Into<Cow<'c, str>>,
{
let s = cow.into();
let mut cookie = parse_inner(&s, decode)?;
cookie.cookie_string = Some(s);
Ok(cookie)
}
#[cfg(test)]
mod tests {
use super::{Cookie, SameSite};
use chrono::Duration;
use time::strptime;
macro_rules! assert_eq_parse {
($string:expr, $expected:expr) => {
let cookie = match Cookie::parse($string) {
Ok(cookie) => cookie,
Err(e) => panic!("Failed to parse {:?}: {:?}", $string, e),
};
assert_eq!(cookie, $expected);
};
}
macro_rules! assert_ne_parse {
($string:expr, $expected:expr) => {
let cookie = match Cookie::parse($string) {
Ok(cookie) => cookie,
Err(e) => panic!("Failed to parse {:?}: {:?}", $string, e),
};
assert_ne!(cookie, $expected);
};
}
#[test]
fn parse_same_site() {
let expected = Cookie::build("foo", "bar")
.same_site(SameSite::Lax)
.finish();
assert_eq_parse!("foo=bar; SameSite=Lax", expected);
assert_eq_parse!("foo=bar; SameSite=lax", expected);
assert_eq_parse!("foo=bar; SameSite=LAX", expected);
assert_eq_parse!("foo=bar; samesite=Lax", expected);
assert_eq_parse!("foo=bar; SAMESITE=Lax", expected);
let expected = Cookie::build("foo", "bar")
.same_site(SameSite::Strict)
.finish();
assert_eq_parse!("foo=bar; SameSite=Strict", expected);
assert_eq_parse!("foo=bar; SameSITE=Strict", expected);
assert_eq_parse!("foo=bar; SameSite=strict", expected);
assert_eq_parse!("foo=bar; SameSite=STrICT", expected);
assert_eq_parse!("foo=bar; SameSite=STRICT", expected);
}
#[test]
fn parse() {
assert!(Cookie::parse("bar").is_err());
assert!(Cookie::parse("=bar").is_err());
assert!(Cookie::parse(" =bar").is_err());
assert!(Cookie::parse("foo=").is_ok());
let expected = Cookie::build("foo", "bar=baz").finish();
assert_eq_parse!("foo=bar=baz", expected);
let mut expected = Cookie::build("foo", "bar").finish();
assert_eq_parse!("foo=bar", expected);
assert_eq_parse!("foo = bar", expected);
assert_eq_parse!(" foo=bar ", expected);
assert_eq_parse!(" foo=bar ;Domain=", expected);
assert_eq_parse!(" foo=bar ;Domain= ", expected);
assert_eq_parse!(" foo=bar ;Ignored", expected);
let mut unexpected = Cookie::build("foo", "bar").http_only(false).finish();
assert_ne_parse!(" foo=bar ;HttpOnly", unexpected);
assert_ne_parse!(" foo=bar; httponly", unexpected);
expected.set_http_only(true);
assert_eq_parse!(" foo=bar ;HttpOnly", expected);
assert_eq_parse!(" foo=bar ;httponly", expected);
assert_eq_parse!(" foo=bar ;HTTPONLY=whatever", expected);
assert_eq_parse!(" foo=bar ; sekure; HTTPONLY", expected);
expected.set_secure(true);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure=aaaa", expected);
unexpected.set_http_only(true);
unexpected.set_secure(true);
assert_ne_parse!(" foo=bar ;HttpOnly; skeure", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; =secure", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly;", unexpected);
unexpected.set_secure(false);
assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
expected.set_max_age(Duration::zero());
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=0", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 0 ", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=-1", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = -1 ", expected);
expected.set_max_age(Duration::minutes(1));
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=60", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 60 ", expected);
expected.set_max_age(Duration::seconds(4));
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=4", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 4 ", expected);
unexpected.set_secure(true);
unexpected.set_max_age(Duration::minutes(1));
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=122", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 38 ", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=51", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = -1 ", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 0", unexpected);
expected.set_path("/");
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/", expected);
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/", expected);
expected.set_path("/foo");
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/foo", expected);
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/foo", expected);
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;path=/foo", expected);
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;path = /foo", expected);
unexpected.set_max_age(Duration::seconds(4));
unexpected.set_path("/bar");
assert_ne_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/foo", unexpected);
assert_ne_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/baz", unexpected);
expected.set_domain("www.foo.com");
assert_eq_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=www.foo.com",
expected
);
expected.set_domain("foo.com");
assert_eq_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=foo.com",
expected
);
assert_eq_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=FOO.COM",
expected
);
unexpected.set_path("/foo");
unexpected.set_domain("bar.com");
assert_ne_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=foo.com",
unexpected
);
assert_ne_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=FOO.COM",
unexpected
);
let time_str = "Wed, 21 Oct 2015 07:28:00 GMT";
let expires = strptime(time_str, "%a, %d %b %Y %H:%M:%S %Z").unwrap();
expected.set_expires(expires);
assert_eq_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=foo.com; Expires=Wed, 21 Oct 2015 07:28:00 GMT",
expected
);
unexpected.set_domain("foo.com");
let bad_expires = strptime(time_str, "%a, %d %b %Y %H:%S:%M %Z").unwrap();
expected.set_expires(bad_expires);
assert_ne_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=foo.com; Expires=Wed, 21 Oct 2015 07:28:00 GMT",
unexpected
);
}
#[test]
fn odd_characters() {
let expected = Cookie::new("foo", "b%2Fr");
assert_eq_parse!("foo=b%2Fr", expected);
}
#[test]
fn odd_characters_encoded() {
let expected = Cookie::new("foo", "b/r");
let cookie = match Cookie::parse_encoded("foo=b%2Fr") {
Ok(cookie) => cookie,
Err(e) => panic!("Failed to parse: {:?}", e),
};
assert_eq!(cookie, expected);
}
#[test]
fn do_not_panic_on_large_max_ages() {
let max_seconds = Duration::max_value().num_seconds();
let expected = Cookie::build("foo", "bar").max_age(max_seconds).finish();
assert_eq_parse!(format!(" foo=bar; Max-Age={:?}", max_seconds + 1), expected);
}
}

View File

@ -0,0 +1,180 @@
use ring::digest::{Algorithm, SHA256};
use ring::hkdf::expand;
use ring::hmac::SigningKey;
use ring::rand::{SecureRandom, SystemRandom};
use super::private::KEY_LEN as PRIVATE_KEY_LEN;
use super::signed::KEY_LEN as SIGNED_KEY_LEN;
static HKDF_DIGEST: &Algorithm = &SHA256;
const KEYS_INFO: &str = "COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM";
/// A cryptographic master key for use with `Signed` and/or `Private` jars.
///
/// This structure encapsulates secure, cryptographic keys for use with both
/// [PrivateJar](struct.PrivateJar.html) and [SignedJar](struct.SignedJar.html).
/// It can be derived from a single master key via
/// [from_master](#method.from_master) or generated from a secure random source
/// via [generate](#method.generate). A single instance of `Key` can be used for
/// both a `PrivateJar` and a `SignedJar`.
///
/// This type is only available when the `secure` feature is enabled.
#[derive(Clone)]
pub struct Key {
signing_key: [u8; SIGNED_KEY_LEN],
encryption_key: [u8; PRIVATE_KEY_LEN],
}
impl Key {
/// Derives new signing/encryption keys from a master key.
///
/// The master key must be at least 256-bits (32 bytes). For security, the
/// master key _must_ be cryptographically random. The keys are derived
/// deterministically from the master key.
///
/// # Panics
///
/// Panics if `key` is less than 32 bytes in length.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// # /*
/// let master_key = { /* a cryptographically random key >= 32 bytes */ };
/// # */
/// # let master_key: &Vec<u8> = &(0..32).collect();
///
/// let key = Key::from_master(master_key);
/// ```
pub fn from_master(key: &[u8]) -> Key {
if key.len() < 32 {
panic!(
"bad master key length: expected at least 32 bytes, found {}",
key.len()
);
}
// Expand the user's key into two.
let prk = SigningKey::new(HKDF_DIGEST, key);
let mut both_keys = [0; SIGNED_KEY_LEN + PRIVATE_KEY_LEN];
expand(&prk, KEYS_INFO.as_bytes(), &mut both_keys);
// Copy the keys into their respective arrays.
let mut signing_key = [0; SIGNED_KEY_LEN];
let mut encryption_key = [0; PRIVATE_KEY_LEN];
signing_key.copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
encryption_key.copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
Key {
signing_key,
encryption_key,
}
}
/// Generates signing/encryption keys from a secure, random source. Keys are
/// generated nondeterministically.
///
/// # Panics
///
/// Panics if randomness cannot be retrieved from the operating system. See
/// [try_generate](#method.try_generate) for a non-panicking version.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// let key = Key::generate();
/// ```
pub fn generate() -> Key {
Self::try_generate().expect("failed to generate `Key` from randomness")
}
/// Attempts to generate signing/encryption keys from a secure, random
/// source. Keys are generated nondeterministically. If randomness cannot be
/// retrieved from the underlying operating system, returns `None`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// let key = Key::try_generate();
/// ```
pub fn try_generate() -> Option<Key> {
let mut sign_key = [0; SIGNED_KEY_LEN];
let mut enc_key = [0; PRIVATE_KEY_LEN];
let rng = SystemRandom::new();
if rng.fill(&mut sign_key).is_err() || rng.fill(&mut enc_key).is_err() {
return None;
}
Some(Key {
signing_key: sign_key,
encryption_key: enc_key,
})
}
/// Returns the raw bytes of a key suitable for signing cookies.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// let key = Key::generate();
/// let signing_key = key.signing();
/// ```
pub fn signing(&self) -> &[u8] {
&self.signing_key[..]
}
/// Returns the raw bytes of a key suitable for encrypting cookies.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// let key = Key::generate();
/// let encryption_key = key.encryption();
/// ```
pub fn encryption(&self) -> &[u8] {
&self.encryption_key[..]
}
}
#[cfg(test)]
mod test {
use super::Key;
#[test]
fn deterministic_from_master() {
let master_key: Vec<u8> = (0..32).collect();
let key_a = Key::from_master(&master_key);
let key_b = Key::from_master(&master_key);
assert_eq!(key_a.signing(), key_b.signing());
assert_eq!(key_a.encryption(), key_b.encryption());
assert_ne!(key_a.encryption(), key_a.signing());
let master_key_2: Vec<u8> = (32..64).collect();
let key_2 = Key::from_master(&master_key_2);
assert_ne!(key_2.signing(), key_a.signing());
assert_ne!(key_2.encryption(), key_a.encryption());
}
#[test]
fn non_deterministic_generate() {
let key_a = Key::generate();
let key_b = Key::generate();
assert_ne!(key_a.signing(), key_b.signing());
assert_ne!(key_a.encryption(), key_b.encryption());
}
}

View File

@ -0,0 +1,40 @@
#[cfg(test)]
macro_rules! assert_simple_behaviour {
($clear:expr, $secure:expr) => {{
assert_eq!($clear.iter().count(), 0);
$secure.add(Cookie::new("name", "val"));
assert_eq!($clear.iter().count(), 1);
assert_eq!($secure.get("name").unwrap().value(), "val");
assert_ne!($clear.get("name").unwrap().value(), "val");
$secure.add(Cookie::new("another", "two"));
assert_eq!($clear.iter().count(), 2);
$clear.remove(Cookie::named("another"));
assert_eq!($clear.iter().count(), 1);
$secure.remove(Cookie::named("name"));
assert_eq!($clear.iter().count(), 0);
}};
}
#[cfg(test)]
macro_rules! assert_secure_behaviour {
($clear:expr, $secure:expr) => {{
$secure.add(Cookie::new("secure", "secure"));
assert!($clear.get("secure").unwrap().value() != "secure");
assert!($secure.get("secure").unwrap().value() == "secure");
let mut cookie = $clear.get("secure").unwrap().clone();
let new_val = format!("{}l", cookie.value());
cookie.set_value(new_val);
$clear.add(cookie);
assert!($secure.get("secure").is_none());
let mut cookie = $clear.get("secure").unwrap().clone();
cookie.set_value("foobar");
$clear.add(cookie);
assert!($secure.get("secure").is_none());
}};
}

View File

@ -0,0 +1,10 @@
//! Fork of https://github.com/alexcrichton/cookie-rs
#[macro_use]
mod macros;
mod key;
mod private;
mod signed;
pub use self::key::*;
pub use self::private::*;
pub use self::signed::*;

Some files were not shown because too many files have changed in this diff Show More