1
0
mirror of https://github.com/fafhrd91/actix-web synced 2025-08-17 11:28:07 +02:00

Compare commits

..

35 Commits

Author SHA1 Message Date
Nikolay Kim
1fcf1d4a49 prepare release 2018-06-21 09:47:46 +06:00
Nikolay Kim
4012606910 SendRequest execution fails with the entered unreachable code #329 2018-06-21 09:47:28 +06:00
Nikolay Kim
e975124630 Allow to disable masking for websockets client 2018-06-21 09:38:59 +06:00
Nikolay Kim
6862aa6ee7 prepare release 2018-06-13 05:04:59 -07:00
Nikolay Kim
8a22558f25 http/2 end-of-frame is not set if body is empty bytes #307 2018-06-12 14:47:45 -07:00
Nikolay Kim
b5b9f9656e do not allow stream or actor responses for internal error #301 2018-06-11 19:44:11 -07:00
Nikolay Kim
2fffc55d34 update changelog 2018-06-11 18:53:36 -07:00
Nikolay Kim
7d39f1582e InternalError can trigger memory unsafety #301 2018-06-11 18:52:54 -07:00
Nikolay Kim
75ed053a35 bump version 2018-06-11 12:32:31 -07:00
Nikolay Kim
cfedf5fff4 Merge branch '0.6' of github.com:actix/actix-web into 0.6 2018-06-11 12:32:05 -07:00
Nikolay Kim
be73a36339 use custom resolver 2018-06-11 12:28:43 -07:00
Nikolay Kim
1ad8ba2604 Fix docs.rs build 2018-06-11 12:25:20 -07:00
Armin Ronacher
6848a12095 prepare 0.6.12 release 2018-06-09 01:22:19 +02:00
Nikolay Kim
4797298706 Allow to use custom resolver for ClientConnector 2018-06-08 16:10:47 -07:00
Nikolay Kim
5eaf4cbefd update changelog 2018-06-08 08:42:10 -07:00
Nikolay Kim
7f1844e541 fix doc test 2018-06-07 20:22:50 -07:00
Nikolay Kim
6c7ac7fc22 update changelog 2018-06-07 20:07:58 -07:00
Nikolay Kim
42f9e1034b add Host predicate 2018-06-07 20:05:45 -07:00
Nikolay Kim
e3cd0fdd13 add application filters 2018-06-07 20:05:26 -07:00
Nikolay Kim
40ff550460 update changelog 2018-06-07 20:04:40 -07:00
Armin Ronacher
7119340d44 Added improved failure interoperability with downcasting (#285)
Deprecates Error::cause and introduces failure interoperability functions and downcasting.
2018-06-07 20:03:10 -07:00
Nikolay Kim
e140bc3906 prep release 2018-06-05 09:44:29 -07:00
Nikolay Kim
fdc08d365d metadata for docs.rs 2018-06-05 08:59:30 -07:00
Nikolay Kim
8f1b88e39e update changelog 2018-06-05 08:53:27 -07:00
Nikolay Kim
6a40a0a466 fix multipart boundary parsing #282 2018-06-05 08:52:46 -07:00
Nikolay Kim
89fc6b6ac9 changelog 2018-06-05 07:42:52 -07:00
Nikolay Kim
afa67b838a CORS: Do not validate Origin header on non-OPTION requests #271 2018-06-05 07:41:13 -07:00
Nikolay Kim
f7b7d282bf Middleware::response is not invoked if error result was returned by another Middleware::start #255 2018-06-04 13:57:54 -07:00
Nikolay Kim
09780ea9f3 changelog updates 2018-06-02 15:03:34 -07:00
Nikolay Kim
a7dab950f3 Support chunked encoding for UrlEncoded body #262 2018-06-02 15:02:42 -07:00
Nikolay Kim
ec0737e392 fix doc test 2018-06-02 13:48:37 -07:00
Nikolay Kim
d664993d56 remove debug prints 2018-06-02 11:58:11 -07:00
Nikolay Kim
a9c6c57a67 remove debug print 2018-06-02 11:55:27 -07:00
Nikolay Kim
08e7374eee update changelog 2018-06-02 11:46:53 -07:00
Nikolay Kim
42da1448fb fixed HttpRequest::url_for for a named route with no variables #265 2018-06-02 11:46:02 -07:00
333 changed files with 36333 additions and 53303 deletions

62
.appveyor.yml Normal file
View File

@@ -0,0 +1,62 @@
environment:
global:
PROJECT_NAME: actix
matrix:
# Stable channel
- TARGET: i686-pc-windows-gnu
CHANNEL: 1.24.0
- TARGET: i686-pc-windows-msvc
CHANNEL: 1.24.0
- TARGET: x86_64-pc-windows-gnu
CHANNEL: 1.24.0
- TARGET: x86_64-pc-windows-msvc
CHANNEL: 1.24.0
# Stable channel
- TARGET: i686-pc-windows-gnu
CHANNEL: stable
- TARGET: i686-pc-windows-msvc
CHANNEL: stable
- TARGET: x86_64-pc-windows-gnu
CHANNEL: stable
- TARGET: x86_64-pc-windows-msvc
CHANNEL: stable
# Beta channel
- TARGET: i686-pc-windows-gnu
CHANNEL: beta
- TARGET: i686-pc-windows-msvc
CHANNEL: beta
- TARGET: x86_64-pc-windows-gnu
CHANNEL: beta
- TARGET: x86_64-pc-windows-msvc
CHANNEL: beta
# Nightly channel
- TARGET: i686-pc-windows-gnu
CHANNEL: nightly
- TARGET: i686-pc-windows-msvc
CHANNEL: nightly
- TARGET: x86_64-pc-windows-gnu
CHANNEL: nightly
- TARGET: x86_64-pc-windows-msvc
CHANNEL: nightly
# Install Rust and Cargo
# (Based on from https://github.com/rust-lang/libc/blob/master/appveyor.yml)
install:
- ps: >-
If ($Env:TARGET -eq 'x86_64-pc-windows-gnu') {
$Env:PATH += ';C:\msys64\mingw64\bin'
} ElseIf ($Env:TARGET -eq 'i686-pc-windows-gnu') {
$Env:PATH += ';C:\MinGW\bin'
}
- curl -sSf -o rustup-init.exe https://win.rustup.rs
- rustup-init.exe --default-host %TARGET% --default-toolchain %CHANNEL% -y
- set PATH=%PATH%;C:\Users\appveyor\.cargo\bin
- rustc -Vv
- cargo -V
# 'cargo test' takes care of building for us, so disable Appveyor's build stage.
build: false
# Equivalent to Travis' `script` phase
test_script:
- cargo test --no-default-features --features="flate2-rust"

View File

@@ -1,37 +0,0 @@
---
name: Bug Report
about: Create a bug report.
---
Your issue may already be reported!
Please search on the [Actix Web issue tracker](https://github.com/actix/actix-web/issues) before creating one.
## Expected Behavior
<!--- If you're describing a bug, tell us what should happen -->
<!--- If you're suggesting a change/improvement, tell us how it should work -->
## Current Behavior
<!--- If describing a bug, tell us what happens instead of the expected behavior -->
<!--- If suggesting a change/improvement, explain the difference from current behavior -->
## Possible Solution
<!--- Not obligatory, but suggest a fix/reason for the bug, -->
<!--- or ideas how to implement the addition or change -->
## Steps to Reproduce (for bugs)
<!--- Provide a link to a live example, or an unambiguous set of steps to -->
<!--- reproduce this bug. Include code to reproduce, if relevant -->
1.
2.
3.
4.
## Context
<!--- How has this issue affected you? What are you trying to accomplish? -->
<!--- Providing context helps us come up with a solution that is most useful in the real world -->
## Your Environment
<!--- Include as many relevant details about the environment you experienced the bug in -->
* Rust Version (I.e, output of `rustc -V`):
* Actix Web Version:

View File

@@ -1,15 +0,0 @@
blank_issues_enabled: true
contact_links:
- name: GitHub Discussions
url: https://github.com/actix/actix-web/discussions
about: Actix Web Q&A
- name: Gitter chat (actix-web)
url: https://gitter.im/actix/actix-web
about: Actix Web Q&A
- name: Gitter chat (actix)
url: https://gitter.im/actix/actix
about: Actix (actor framework) Q&A
- name: Actix Discord
url: https://discord.gg/NWpN5mmg3x
about: Actix developer discussion and community chat

View File

@@ -1,27 +0,0 @@
<!-- Thanks for considering contributing actix! -->
<!-- Please fill out the following to get your PR reviewed quicker. -->
## PR Type
<!-- What kind of change does this PR make? -->
<!-- Bug Fix / Feature / Refactor / Code Style / Other -->
PR_TYPE
## PR Checklist
<!-- Check your PR fulfills the following items. ->>
<!-- For draft PRs check the boxes as you complete them. -->
- [ ] Tests for the changes have been added / updated.
- [ ] Documentation comments have been added / updated.
- [ ] A changelog entry has been made for the appropriate packages.
- [ ] Format code with the latest stable rustfmt.
- [ ] (Team) Label with affected crates and semver status.
## Overview
<!-- Describe the current and new behavior. -->
<!-- Emphasize any breaking changes. -->
<!-- If this PR fixes or closes an issue, reference it here. -->
<!-- Closes #000 -->

View File

@@ -1,28 +0,0 @@
name: Benchmark
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches:
- master
jobs:
check_benchmark:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: nightly
profile: minimal
override: true
- name: Check benchmark
uses: actions-rs/cargo@v1
with:
command: bench
args: --bench=server -- --sample-size=15

View File

@@ -1,103 +0,0 @@
name: CI
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches: [master]
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
target:
- { name: Linux, os: ubuntu-latest, triple: x86_64-unknown-linux-gnu }
- { name: macOS, os: macos-latest, triple: x86_64-apple-darwin }
- { name: Windows, os: windows-latest, triple: x86_64-pc-windows-msvc }
version:
- 1.46.0 # MSRV
- stable
- nightly
name: ${{ matrix.target.name }} / ${{ matrix.version }}
runs-on: ${{ matrix.target.os }}
steps:
- uses: actions/checkout@v2
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-${{ matrix.target.triple }}
profile: minimal
override: true
- name: Generate Cargo.lock
uses: actions-rs/cargo@v1
with:
command: generate-lockfile
- name: Cache Dependencies
uses: Swatinem/rust-cache@v1.2.0
- name: Install cargo-hack
uses: actions-rs/cargo@v1
with:
command: install
args: cargo-hack
- name: check minimal
uses: actions-rs/cargo@v1
with:
command: hack
args: --clean-per-run check --workspace --no-default-features --tests
- name: check full
uses: actions-rs/cargo@v1
with:
command: check
args: --workspace --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
with:
command: test
args: -v --workspace --all-features --no-fail-fast -- --nocapture
--skip=test_h2_content_length
--skip=test_reading_deflate_encoding_large_random_rustls
- name: tests (actix-http)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=actix-http --no-default-features --features=rustls -- --nocapture
- name: tests (awc)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=awc --no-default-features --features=rustls -- --nocapture
- name: Generate coverage file
if: >
matrix.target.os == 'ubuntu-latest'
&& matrix.version == 'stable'
&& github.ref == 'refs/heads/master'
run: |
cargo install cargo-tarpaulin --vers "^0.13"
cargo tarpaulin --out Xml --verbose
- name: Upload to Codecov
if: >
matrix.target.os == 'ubuntu-latest'
&& matrix.version == 'stable'
&& github.ref == 'refs/heads/master'
uses: codecov/codecov-action@v1
with:
file: cobertura.xml
- name: Clear the cargo caches
run: |
cargo install cargo-cache --no-default-features --features ci-autoclean
cargo-cache

View File

@@ -1,39 +0,0 @@
name: Lint
on:
pull_request:
types: [opened, synchronize, reopened]
jobs:
fmt:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: stable
components: rustfmt
- name: Check with rustfmt
uses: actions-rs/cargo@v1
with:
command: fmt
args: --all -- --check
clippy:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: stable
components: clippy
override: true
- name: Check with Clippy
uses: actions-rs/clippy-check@v1
with:
token: ${{ secrets.GITHUB_TOKEN }}
args: --workspace --tests --all-features

View File

@@ -1,35 +0,0 @@
name: Upload Documentation
on:
push:
branches: [master]
jobs:
build:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: nightly-x86_64-unknown-linux-gnu
profile: minimal
override: true
- name: Build Docs
uses: actions-rs/cargo@v1
with:
command: doc
args: --workspace --all-features --no-deps
- name: Tweak HTML
run: echo '<meta http-equiv="refresh" content="0;url=actix_web/index.html">' > target/doc/index.html
- name: Deploy to GitHub Pages
uses: JamesIves/github-pages-deploy-action@3.7.1
with:
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
BRANCH: gh-pages
FOLDER: target/doc

4
.gitignore vendored
View File

@@ -9,10 +9,6 @@ guide/build/
*.pid *.pid
*.sock *.sock
*~ *~
.DS_Store
# These are backup files generated by rustfmt # These are backup files generated by rustfmt
**/*.rs.bk **/*.rs.bk
# Configuration directory generated by CLion
.idea

55
.travis.yml Normal file
View File

@@ -0,0 +1,55 @@
language: rust
sudo: false
dist: trusty
cache:
cargo: true
apt: true
matrix:
include:
- rust: 1.24.0
- rust: stable
- rust: beta
- rust: nightly
allow_failures:
- rust: nightly
env:
global:
# - RUSTFLAGS="-C link-dead-code"
- OPENSSL_VERSION=openssl-1.0.2
before_install:
- sudo add-apt-repository -y ppa:0k53d-karl-f830m/openssl
- sudo apt-get update -qq
- sudo apt-get install -qq libssl-dev libelf-dev libdw-dev cmake gcc binutils-dev libiberty-dev
# Add clippy
before_script:
- export PATH=$PATH:~/.cargo/bin
script:
- |
if [[ "$TRAVIS_RUST_VERSION" != "1.24.0" ]]; then
cargo clean
cargo test --features="alpn,tls" -- --nocapture
fi
- |
if [[ "$TRAVIS_RUST_VERSION" == "1.24.0" ]]; then
bash <(curl https://raw.githubusercontent.com/xd009642/tarpaulin/master/travis-install.sh)
USE_SKEPTIC=1 cargo tarpaulin --out Xml --no-count
bash <(curl -s https://codecov.io/bash)
echo "Uploaded code coverage"
fi
# Upload docs
after_success:
- |
if [[ "$TRAVIS_OS_NAME" == "linux" && "$TRAVIS_PULL_REQUEST" = "false" && "$TRAVIS_BRANCH" == "master" && "$TRAVIS_RUST_VERSION" == "stable" ]]; then
cargo doc --features "alpn, tls, session" --no-deps &&
echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html &&
git clone https://github.com/davisp/ghp-import.git &&
./ghp-import/ghp_import.py -n -p -f -m "Documentation upload" -r https://"$GH_TOKEN"@github.com/"$TRAVIS_REPO_SLUG.git" target/doc &&
echo "Uploaded documentation"
fi

View File

@@ -1,682 +1,456 @@
# Changes # Changes
## Unreleased - 2021-xx-xx ## [0.6.14] - 2018-06-21
### Changed
* Feature `cookies` is now optional and enabled by default. [#1981]
* `JsonBody::new` returns a default limit of 32kB to be consistent with `JsonConfig` and the
default behaviour of the `web::Json<T>` extractor. [#2010]
[#1981]: https://github.com/actix/actix-web/pull/1981
[#2010]: https://github.com/actix/actix-web/pull/2010
## 4.0.0-beta.3 - 2021-02-10
* Update `actix-web-codegen` to `0.5.0-beta.1`.
## 4.0.0-beta.2 - 2021-02-10
### Added
* The method `Either<web::Json<T>, web::Form<T>>::into_inner()` which returns the inner type for
whichever variant was created. Also works for `Either<web::Form<T>, web::Json<T>>`. [#1894]
* Add `services!` macro for helping register multiple services to `App`. [#1933]
* Enable registering a vec of services of the same type to `App` [#1933]
### Changed
* Rework `Responder` trait to be sync and returns `Response`/`HttpResponse` directly.
Making it simpler and more performant. [#1891]
* `ServiceRequest::into_parts` and `ServiceRequest::from_parts` can no longer fail. [#1893]
* `ServiceRequest::from_request` can no longer fail. [#1893]
* Our `Either` type now uses `Left`/`Right` variants (instead of `A`/`B`) [#1894]
* `test::{call_service, read_response, read_response_json, send_request}` take `&Service`
in argument [#1905]
* `App::wrap_fn`, `Resource::wrap_fn` and `Scope::wrap_fn` provide `&Service` in closure
argument. [#1905]
* `web::block` no longer requires the output is a Result. [#1957]
### Fixed
* Multiple calls to `App::data` with the same type now keeps the latest call's data. [#1906]
### Removed
* Public field of `web::Path` has been made private. [#1894]
* Public field of `web::Query` has been made private. [#1894]
* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
* `AppService::set_service_data`; for custom HTTP service factories adding application data, use the
layered data model by calling `ServiceRequest::add_data_container` when handling
requests instead. [#1906]
[#1891]: https://github.com/actix/actix-web/pull/1891
[#1893]: https://github.com/actix/actix-web/pull/1893
[#1894]: https://github.com/actix/actix-web/pull/1894
[#1869]: https://github.com/actix/actix-web/pull/1869
[#1905]: https://github.com/actix/actix-web/pull/1905
[#1906]: https://github.com/actix/actix-web/pull/1906
[#1933]: https://github.com/actix/actix-web/pull/1933
[#1957]: https://github.com/actix/actix-web/pull/1957
## 4.0.0-beta.1 - 2021-01-07
### Added
* `Compat` middleware enabling generic response body/error type of middlewares like `Logger` and
`Compress` to be used in `middleware::Condition` and `Resource`, `Scope` services. [#1865]
### Changed
* Update `actix-*` dependencies to tokio `1.0` based versions. [#1813]
* Bumped `rand` to `0.8`.
* Update `rust-tls` to `0.19`. [#1813]
* Rename `Handler` to `HandlerService` and rename `Factory` to `Handler`. [#1852]
* The default `TrailingSlash` is now `Trim`, in line with existing documentation. See migration
guide for implications. [#1875]
* Rename `DefaultHeaders::{content_type => add_content_type}`. [#1875]
* MSRV is now 1.46.0.
### Fixed
* Added the underlying parse error to `test::read_body_json`'s panic message. [#1812]
### Removed
* Public modules `middleware::{normalize, err_handlers}`. All necessary middleware structs are now
exposed directly by the `middleware` module.
* Remove `actix-threadpool` as dependency. `actix_threadpool::BlockingError` error type can be imported
from `actix_web::error` module. [#1878]
[#1812]: https://github.com/actix/actix-web/pull/1812
[#1813]: https://github.com/actix/actix-web/pull/1813
[#1852]: https://github.com/actix/actix-web/pull/1852
[#1865]: https://github.com/actix/actix-web/pull/1865
[#1875]: https://github.com/actix/actix-web/pull/1875
[#1878]: https://github.com/actix/actix-web/pull/1878
## 3.3.2 - 2020-12-01
### Fixed
* Removed an occasional `unwrap` on `None` panic in `NormalizePathNormalization`. [#1762]
* Fix `match_pattern()` returning `None` for scope with empty path resource. [#1798]
* Increase minimum `socket2` version. [#1803]
[#1762]: https://github.com/actix/actix-web/pull/1762
[#1798]: https://github.com/actix/actix-web/pull/1798
[#1803]: https://github.com/actix/actix-web/pull/1803
## 3.3.1 - 2020-11-29
* Ensure `actix-http` dependency uses same `serde_urlencoded`.
## 3.3.0 - 2020-11-25
### Added
* Add `Either<A, B>` extractor helper. [#1788]
### Changed
* Upgrade `serde_urlencoded` to `0.7`. [#1773]
[#1773]: https://github.com/actix/actix-web/pull/1773
[#1788]: https://github.com/actix/actix-web/pull/1788
## 3.2.0 - 2020-10-30
### Added
* Implement `exclude_regex` for Logger middleware. [#1723]
* Add request-local data extractor `web::ReqData`. [#1748]
* Add ability to register closure for request middleware logging. [#1749]
* Add `app_data` to `ServiceConfig`. [#1757]
* Expose `on_connect` for access to the connection stream before request is handled. [#1754]
### Changed
* Updated actix-web-codegen dependency for access to new `#[route(...)]` multi-method macro.
* Print non-configured `Data<T>` type when attempting extraction. [#1743]
* Re-export bytes::Buf{Mut} in web module. [#1750]
* Upgrade `pin-project` to `1.0`.
[#1723]: https://github.com/actix/actix-web/pull/1723
[#1743]: https://github.com/actix/actix-web/pull/1743
[#1748]: https://github.com/actix/actix-web/pull/1748
[#1750]: https://github.com/actix/actix-web/pull/1750
[#1754]: https://github.com/actix/actix-web/pull/1754
[#1749]: https://github.com/actix/actix-web/pull/1749
## 3.1.0 - 2020-09-29
### Changed
* Add `TrailingSlash::MergeOnly` behaviour to `NormalizePath`, which allows `NormalizePath`
to retain any trailing slashes. [#1695]
* Remove bound `std::marker::Sized` from `web::Data` to support storing `Arc<dyn Trait>`
via `web::Data::from` [#1710]
### Fixed
* `ResourceMap` debug printing is no longer infinitely recursive. [#1708]
[#1695]: https://github.com/actix/actix-web/pull/1695
[#1708]: https://github.com/actix/actix-web/pull/1708
[#1710]: https://github.com/actix/actix-web/pull/1710
## 3.0.2 - 2020-09-15
### Fixed
* `NormalizePath` when used with `TrailingSlash::Trim` no longer trims the root path "/". [#1678]
[#1678]: https://github.com/actix/actix-web/pull/1678
## 3.0.1 - 2020-09-13
### Changed
* `middleware::normalize::TrailingSlash` enum is now accessible. [#1673]
[#1673]: https://github.com/actix/actix-web/pull/1673
## 3.0.0 - 2020-09-11
* No significant changes from `3.0.0-beta.4`.
## 3.0.0-beta.4 - 2020-09-09
### Added
* `middleware::NormalizePath` now has configurable behavior for either always having a trailing
slash, or as the new addition, always trimming trailing slashes. [#1639]
### Changed
* Update actix-codec and actix-utils dependencies. [#1634]
* `FormConfig` and `JsonConfig` configurations are now also considered when set
using `App::data`. [#1641]
* `HttpServer::maxconn` is renamed to the more expressive `HttpServer::max_connections`. [#1655]
* `HttpServer::maxconnrate` is renamed to the more expressive
`HttpServer::max_connection_rate`. [#1655]
[#1639]: https://github.com/actix/actix-web/pull/1639
[#1641]: https://github.com/actix/actix-web/pull/1641
[#1634]: https://github.com/actix/actix-web/pull/1634
[#1655]: https://github.com/actix/actix-web/pull/1655
## 3.0.0-beta.3 - 2020-08-17
### Changed
* Update `rustls` to 0.18
## 3.0.0-beta.2 - 2020-08-17
### Changed
* `PayloadConfig` is now also considered in `Bytes` and `String` extractors when set
using `App::data`. [#1610]
* `web::Path` now has a public representation: `web::Path(pub T)` that enables
destructuring. [#1594]
* `ServiceRequest::app_data` allows retrieval of non-Data data without splitting into parts to
access `HttpRequest` which already allows this. [#1618]
* Re-export all error types from `awc`. [#1621]
* MSRV is now 1.42.0.
### Fixed
* Memory leak of app data in pooled requests. [#1609]
[#1594]: https://github.com/actix/actix-web/pull/1594
[#1609]: https://github.com/actix/actix-web/pull/1609
[#1610]: https://github.com/actix/actix-web/pull/1610
[#1618]: https://github.com/actix/actix-web/pull/1618
[#1621]: https://github.com/actix/actix-web/pull/1621
## 3.0.0-beta.1 - 2020-07-13
### Added
* Re-export `actix_rt::main` as `actix_web::main`.
* `HttpRequest::match_pattern` and `ServiceRequest::match_pattern` for extracting the matched
resource pattern.
* `HttpRequest::match_name` and `ServiceRequest::match_name` for extracting matched resource name.
### Changed
* Fix actix_http::h1::dispatcher so it returns when HW_BUFFER_SIZE is reached. Should reduce peak memory consumption during large uploads. [#1550]
* Migrate cookie handling to `cookie` crate. Actix-web no longer requires `ring` dependency.
* MSRV is now 1.41.1
### Fixed
* `NormalizePath` improved consistency when path needs slashes added _and_ removed.
## 3.0.0-alpha.3 - 2020-05-21
### Added
* Add option to create `Data<T>` from `Arc<T>` [#1509]
### Changed
* Resources and Scopes can now access non-overridden data types set on App (or containing scopes) when setting their own data. [#1486]
* Fix audit issue logging by default peer address [#1485]
* Bump minimum supported Rust version to 1.40
* Replace deprecated `net2` crate with `socket2`
[#1485]: https://github.com/actix/actix-web/pull/1485
[#1509]: https://github.com/actix/actix-web/pull/1509
## [3.0.0-alpha.2] - 2020-05-08
### Changed
* `{Resource,Scope}::default_service(f)` handlers now support app data extraction. [#1452]
* Implement `std::error::Error` for our custom errors [#1422]
* NormalizePath middleware now appends trailing / so that routes of form /example/ respond to /example requests. [#1433]
* Remove the `failure` feature and support.
[#1422]: https://github.com/actix/actix-web/pull/1422
[#1433]: https://github.com/actix/actix-web/pull/1433
[#1452]: https://github.com/actix/actix-web/pull/1452
[#1486]: https://github.com/actix/actix-web/pull/1486
## [3.0.0-alpha.1] - 2020-03-11
### Added ### Added
* Add helper function for creating routes with `TRACE` method guard `web::trace()` * Allow to disable masking for websockets client
* Add convenience functions `test::read_body_json()` and `test::TestRequest::send_request()` for testing.
### Changed
* Use `sha-1` crate instead of unmaintained `sha1` crate
* Skip empty chunks when returning response from a `Stream` [#1308]
* Update the `time` dependency to 0.2.7
* Update `actix-tls` dependency to 2.0.0-alpha.1
* Update `rustls` dependency to 0.17
[#1308]: https://github.com/actix/actix-web/pull/1308
## [2.0.0] - 2019-12-25
### Changed
* Rename `HttpServer::start()` to `HttpServer::run()`
* Allow to gracefully stop test server via `TestServer::stop()`
* Allow to specify multi-patterns for resources
## [2.0.0-rc] - 2019-12-20
### Changed
* Move `BodyEncoding` to `dev` module #1220
* Allow to set `peer_addr` for TestRequest #1074
* Make web::Data deref to Arc<T> #1214
* Rename `App::register_data()` to `App::app_data()`
* `HttpRequest::app_data<T>()` returns `Option<&T>` instead of `Option<&Data<T>>`
### Fixed ### Fixed
* Fix `AppConfig::secure()` is always false. #1202 * SendRequest execution fails with the "internal error: entered unreachable code" #329
## [2.0.0-alpha.6] - 2019-12-15 ## [0.6.13] - 2018-06-13
### Fixed ### Fixed
* Fixed compilation with default features off * http/2 end-of-frame is not set if body is empty bytes #307
## [2.0.0-alpha.5] - 2019-12-13 * InternalError can trigger memory unsafety #301
* Fix docs.rs build
## [0.6.12] - 2018-06-08
### Added ### Added
* Add test server, `test::start()` and `test::start_with()` * Add `Host` filter #287
## [2.0.0-alpha.4] - 2019-12-08 * Allow to filter applications
### Deleted * Improved failure interoperability with downcasting #285
* Delete HttpServer::run(), it is not useful with async/await * Allow to use custom resolver for `ClientConnector`
## [2.0.0-alpha.3] - 2019-12-07
### Changed
* Migrate to tokio 0.2
## [2.0.0-alpha.1] - 2019-11-22 ### Deprecated
### Changed * `Error::cause()` and introduces failure interoperability functions and downcasting.
* Migrated to `std::future`
* Remove implementation of `Responder` for `()`. (#1167)
## [1.0.9] - 2019-11-14 ## [0.6.11] - 2018-06-05
### Added
* Add `Payload::into_inner` method and make stored `def::Payload` public. (#1110)
### Changed
* Support `Host` guards when the `Host` header is unset (e.g. HTTP/2 requests) (#1129)
## [1.0.8] - 2019-09-25
### Added
* Add `Scope::register_data` and `Resource::register_data` methods, parallel to
`App::register_data`.
* Add `middleware::Condition` that conditionally enables another middleware
* Allow to re-construct `ServiceRequest` from `HttpRequest` and `Payload`
* Add `HttpServer::listen_uds` for ability to listen on UDS FD rather than path,
which is useful for example with systemd.
### Changed
* Make UrlEncodedError::Overflow more informative
* Use actix-testing for testing utils
## [1.0.7] - 2019-08-29
### Fixed ### Fixed
* Request Extensions leak #1062 * Support chunked encoding for UrlEncoded body #262
* `HttpRequest::url_for()` for a named route with no variables segments #265
* `Middleware::response()` is not invoked if error result was returned by another `Middleware::start()` #255
* CORS: Do not validate Origin header on non-OPTION requests #271
* Fix multipart upload "Incomplete" error #282
## [1.0.6] - 2019-08-28 ## [0.6.10] - 2018-05-24
### Added ### Added
* Re-implement Host predicate (#989) * Allow to use path without traling slashes for scope registration #241
* Form implements Responder, returning a `application/x-www-form-urlencoded` response * Allow to set encoding for exact NamedFile #239
* Add `into_inner` to `Data`
* Add `test::TestRequest::set_form()` convenience method to automatically serialize data and set
the header in test requests.
### Changed
* `Query` payload made `pub`. Allows user to pattern-match the payload.
* Enable `rust-tls` feature for client #1045
* Update serde_urlencoded to 0.6.1
* Update url to 2.1
## [1.0.5] - 2019-07-18
### Added
* Unix domain sockets (HttpServer::bind_uds) #92
* Actix now logs errors resulting in "internal server error" responses always, with the `error`
logging level
### Fixed ### Fixed
* Restored logging of errors through the `Logger` middleware * `TestServer::post()` actually sends `GET` request #240
## [1.0.4] - 2019-07-17 ## 0.6.9 (2018-05-22)
### Added * Drop connection if request's payload is not fully consumed #236
* Add `Responder` impl for `(T, StatusCode) where T: Responder` * Fix streaming response with body compression
* Allow to access app's resource map via
`ServiceRequest::resource_map()` and `HttpRequest::resource_map()` methods.
### Changed ## 0.6.8 (2018-05-20)
* Upgrade `rand` dependency version to 0.7 * Fix scope resource path extractor #234
* Re-use tcp listener on pause/resume
## [1.0.3] - 2019-06-28
### Added ## 0.6.7 (2018-05-17)
* Support asynchronous data factories #850 * Fix compilation with --no-default-features
### Changed
* Use `encoding_rs` crate instead of unmaintained `encoding` crate ## 0.6.6 (2018-05-17)
* Panic during middleware execution #226
## [1.0.2] - 2019-06-17 * Add support for listen_tls/listen_ssl #224
### Changed * Implement extractor for `Session`
* Move cors middleware to `actix-cors` crate. * Ranges header support for NamedFile #60
* Move identity middleware to `actix-identity` crate.
## 0.6.5 (2018-05-15)
## [1.0.1] - 2019-06-17 * Fix error handling during request decoding #222
### Added
* Add support for PathConfig #903 ## 0.6.4 (2018-05-11)
* Add `middleware::identity::RequestIdentity` trait to `get_identity` from `HttpMessage`. * Fix segfault in ServerSettings::get_response_builder()
### Changed
* Move cors middleware to `actix-cors` crate. ## 0.6.3 (2018-05-10)
* Move identity middleware to `actix-identity` crate. * Add `Router::with_async()` method for async handler registration.
* Disable default feature `secure-cookies`. * Added error response functions for 501,502,503,504
* Allow to test an app that uses async actors #897 * Fix client request timeout handling
* Re-apply patch from #637 #894
### Fixed ## 0.6.2 (2018-05-09)
* HttpRequest::url_for is broken with nested scopes #915 * WsWriter trait is optional.
## [1.0.0] - 2019-06-05 ## 0.6.1 (2018-05-08)
### Added * Fix http/2 payload streaming #215
* Add `Scope::configure()` method. * Fix connector's default `keep-alive` and `lifetime` settings #212
* Add `ServiceRequest::set_payload()` method. * Send `ErrorNotFound` instead of `ErrorBadRequest` when path extractor fails #214
* Add `test::TestRequest::set_json()` convenience method to automatically * Allow to exclude certain endpoints from logging #211
serialize data and set header in test requests.
* Add macros for head, options, trace, connect and patch http methods
### Changed ## 0.6.0 (2018-05-08)
* Drop an unnecessary `Option<_>` indirection around `ServerBuilder` from `HttpServer`. #863 * Add route scopes #202
### Fixed * Allow to use ssl and non-ssl connections at the same time #206
* Fix Logger request time format, and use rfc3339. #867 * Websocket CloseCode Empty/Status is ambiguous #193
* Clear http requests pool on app service drop #860 * Add Content-Disposition to NamedFile #204
* Allow to access Error's backtrace object
## [1.0.0-rc] - 2019-05-18 * Allow to override files listing renderer for `StaticFiles` #203
### Added * Various extractor usability improvements #207
* Add `Query<T>::from_query()` to extract parameters from a query string. #846
* `QueryConfig`, similar to `JsonConfig` for customizing error handling of query extractors.
### Changed ## 0.5.6 (2018-04-24)
* `JsonConfig` is now `Send + Sync`, this implies that `error_handler` must be `Send + Sync` too. * Make flate2 crate optional #200
### Fixed
* Codegen with parameters in the path only resolves the first registered endpoint #841 ## 0.5.5 (2018-04-24)
* Fix panic when Websocket is closed with no error code #191
## [1.0.0-beta.4] - 2019-05-12 * Allow to use rust backend for flate2 crate #199
### Added ## 0.5.4 (2018-04-19)
* Allow to set/override app data on scope level * Add identity service middleware
### Changed * Middleware response() is not invoked if there was an error in async handler #187
* `App::configure` take an `FnOnce` instead of `Fn` * Use Display formatting for InternalError Display implementation #188
* Upgrade actix-net crates
## [1.0.0-beta.3] - 2019-05-04 ## 0.5.3 (2018-04-18)
### Added * Impossible to quote slashes in path parameters #182
* Add helper function for executing futures `test::block_fn()`
### Changed ## 0.5.2 (2018-04-16)
* Extractor configuration could be registered with `App::data()` * Allow to configure StaticFiles's CpuPool, via static method or env variable
or with `Resource::data()` #775
* Route data is unified with app data, `Route::data()` moved to resource * Add support for custom handling of Json extractor errors #181
level to `Resource::data()`
* CORS handling without headers #702 * Fix StaticFiles does not support percent encoded paths #177
* Allow constructing `Data` instances to avoid double `Arc` for `Send + Sync` types. * Fix Client Request with custom Body Stream halting on certain size requests #176
### Fixed
* Fix `NormalizePath` middleware impl #806 ## 0.5.1 (2018-04-12)
### Deleted * Client connector provides stats, `ClientConnector::stats()`
* `App::data_factory()` is deleted. * Fix end-of-stream handling in parse_payload #173
* Fix StaticFiles generate a lot of threads #174
## [1.0.0-beta.2] - 2019-04-24
### Added ## 0.5.0 (2018-04-10)
* Add raw services support via `web::service()` * Type-safe path/query/form parameter handling, using serde #70
* Add helper functions for reading response body `test::read_body()` * HttpResponse builder's methods `.body()`, `.finish()`, `.json()`
return `HttpResponse` instead of `Result`
* Add support for `remainder match` (i.e "/path/{tail}*") * Use more ergonomic `actix_web::Error` instead of `http::Error` for `ClientRequestBuilder::body()`
* Extend `Responder` trait, allow to override status code and headers. * Added `signed` and `private` `CookieSessionBackend`s
* Store visit and login timestamp in the identity cookie #502 * Added `HttpRequest::resource()`, returns current matched resource
### Changed * Added `ErrorHandlers` middleware
* `.to_async()` handler can return `Responder` type #792 * Fix router cannot parse Non-ASCII characters in URL #137
### Fixed * Fix client connection pooling
* Fix async web::Data factory handling * Fix long client urls #129
* Fix panic on invalid URL characters #130
## [1.0.0-beta.1] - 2019-04-20 * Fix logger request duration calculation #152
### Added * Fix prefix and static file serving #168
* Add helper functions for reading test response body,
`test::read_response()` and test::read_response_json()`
* Add `.peer_addr()` #744 ## 0.4.10 (2018-03-20)
* Add `NormalizePath` middleware * Use `Error` instead of `InternalError` for `error::ErrorXXXX` methods
### Changed * Allow to set client request timeout
* Rename `RouterConfig` to `ServiceConfig` * Allow to set client websocket handshake timeout
* Rename `test::call_success` to `test::call_service` * Refactor `TestServer` configuration
* Removed `ServiceRequest::from_parts()` as it is unsafe to create from parts. * Fix server websockets big payloads support
* `CookieIdentityPolicy::max_age()` accepts value in seconds * Fix http/2 date header generation
### Fixed
* Fixed `TestRequest::app_data()` ## 0.4.9 (2018-03-16)
* Allow to disable http/2 support
## [1.0.0-alpha.6] - 2019-04-14 * Wake payload reading task when data is available
### Changed * Fix server keep-alive handling
* Allow using any service as default service. * Send Query Parameters in client requests #120
* Remove generic type for request payload, always use default. * Move brotli encoding to a feature
* Removed `Decompress` middleware. Bytes, String, Json, Form extractors * Add option of default handler for `StaticFiles` handler #57
automatically decompress payload.
* Make extractor config type explicit. Add `FromRequest::Config` associated type. * Add basic client connection pooling
## [1.0.0-alpha.5] - 2019-04-12 ## 0.4.8 (2018-03-12)
### Added * Allow to set read buffer capacity for server request
* Added async io `TestBuffer` for testing. * Handle WouldBlock error for socket accept call
### Deleted
* Removed native-tls support ## 0.4.7 (2018-03-11)
* Fix panic on unknown content encoding
## [1.0.0-alpha.4] - 2019-04-08 * Fix connection get closed too early
### Added * Fix streaming response handling for http/2
* `App::configure()` allow to offload app configuration to different methods * Better sleep on error support
* Added `URLPath` option for logger
* Added `ServiceRequest::app_data()`, returns `Data<T>` ## 0.4.6 (2018-03-10)
* Added `ServiceFromRequest::app_data()`, returns `Data<T>` * Fix client cookie handling
### Changed * Fix json content type detection
* `FromRequest` trait refactoring * Fix CORS middleware #117
* Move multipart support to actix-multipart crate * Optimize websockets stream support
### Fixed
* Fix body propagation in Response::from_error. #760 ## 0.4.5 (2018-03-07)
* Fix compression #103 and #104
## [1.0.0-alpha.3] - 2019-04-02 * Fix client cookie handling #111
### Changed * Non-blocking processing of a `NamedFile`
* Renamed `TestRequest::to_service()` to `TestRequest::to_srv_request()` * Enable compression support for `NamedFile`
* Renamed `TestRequest::to_response()` to `TestRequest::to_srv_response()` * Better support for `NamedFile` type
* Removed `Deref` impls * Add `ResponseError` impl for `SendRequestError`. This improves ergonomics of the client.
### Removed * Add native-tls support for client
* Removed unused `actix_web::web::md()` * Allow client connection timeout to be set #108
* Allow to use std::net::TcpListener for HttpServer
## [1.0.0-alpha.2] - 2019-03-29 * Handle panics in worker threads
### Added
* Rustls support ## 0.4.4 (2018-03-04)
### Changed * Allow to use Arc<Vec<u8>> as response/request body
* Use forked cookie * Fix handling of requests with an encoded body with a length > 8192 #93
* Multipart::Field renamed to MultipartField ## 0.4.3 (2018-03-03)
## [1.0.0-alpha.1] - 2019-03-28 * Fix request body read bug
### Changed * Fix segmentation fault #79
* Complete architecture re-design. * Set reuse address before bind #90
* Return 405 response if no matching route found within resource #538
## 0.4.2 (2018-03-02)
* Better naming for websockets implementation
* Add `Pattern::with_prefix()`, make it more usable outside of actix
* Add csrf middleware for filter for cross-site request forgery #89
* Fix disconnect on idle connections
## 0.4.1 (2018-03-01)
* Rename `Route::p()` to `Route::filter()`
* Better naming for http codes
* Fix payload parse in situation when socket data is not ready.
* Fix Session mutable borrow lifetime #87
## 0.4.0 (2018-02-28)
* Actix 0.5 compatibility
* Fix request json/urlencoded loaders
* Simplify HttpServer type definition
* Added HttpRequest::encoding() method
* Added HttpRequest::mime_type() method
* Added HttpRequest::uri_mut(), allows to modify request uri
* Added StaticFiles::index_file()
* Added http client
* Added websocket client
* Added TestServer::ws(), test websockets client
* Added TestServer http client support
* Allow to override content encoding on application level
## 0.3.3 (2018-01-25)
* Stop processing any events after context stop
* Re-enable write back-pressure for h1 connections
* Refactor HttpServer::start_ssl() method
* Upgrade openssl to 0.10
## 0.3.2 (2018-01-21)
* Fix HEAD requests handling
* Log request processing errors
* Always enable content encoding if encoding explicitly selected
* Allow multiple Applications on a single server with different state #49
* CORS middleware: allowed_headers is defaulting to None #50
## 0.3.1 (2018-01-13)
* Fix directory entry path #47
* Do not enable chunked encoding for HTTP/1.0
* Allow explicitly disable chunked encoding
## 0.3.0 (2018-01-12)
* HTTP/2 Support
* Refactor streaming responses
* Refactor error handling
* Asynchronous middlewares
* Refactor logger middleware
* Content compression/decompression (br, gzip, deflate)
* Server multi-threading
* Gracefull shutdown support
## 0.2.1 (2017-11-03)
* Allow to start tls server with `HttpServer::serve_tls`
* Export `Frame` enum
* Add conversion impl from `HttpResponse` and `BinaryBody` to a `Frame`
## 0.2.0 (2017-10-30)
* Do not use `http::Uri` as it can not parse some valid paths
* Refactor response `Body`
* Refactor `RouteRecognizer` usability
* Refactor `HttpContext::write`
* Refactor `Payload` stream
* Re-use `BinaryBody` for `Frame::Payload`
* Stop http actor on `write_eof`
* Fix disconnection handling.
## 0.1.0 (2017-10-23)
* First release

View File

@@ -34,13 +34,10 @@ This Code of Conduct applies both within project spaces and in public spaces whe
## Enforcement ## Enforcement
Instances of abusive, harassing, or otherwise unacceptable behavior may be reported by contacting the project team at robjtede@icloud.com ([@robjtede]) or huyuumi@neet.club ([@JohnTitor]). The project team will review and investigate all complaints, and will respond in a way that it deems appropriate to the circumstances. The project team is obligated to maintain confidentiality with regard to the reporter of an incident. Further details of specific enforcement policies may be posted separately. Instances of abusive, harassing, or otherwise unacceptable behavior may be reported by contacting the project team at fafhrd91@gmail.com. The project team will review and investigate all complaints, and will respond in a way that it deems appropriate to the circumstances. The project team is obligated to maintain confidentiality with regard to the reporter of an incident. Further details of specific enforcement policies may be posted separately.
Project maintainers who do not follow or enforce the Code of Conduct in good faith may face temporary or permanent repercussions as determined by other members of the project's leadership. Project maintainers who do not follow or enforce the Code of Conduct in good faith may face temporary or permanent repercussions as determined by other members of the project's leadership.
[@robjtede]: https://github.com/robjtede
[@JohnTitor]: https://github.com/JohnTitor
## Attribution ## Attribution
This Code of Conduct is adapted from the [Contributor Covenant][homepage], version 1.4, available at [http://contributor-covenant.org/version/1/4][version] This Code of Conduct is adapted from the [Contributor Covenant][homepage], version 1.4, available at [http://contributor-covenant.org/version/1/4][version]

View File

@@ -1,154 +1,119 @@
[package] [package]
name = "actix-web" name = "actix-web"
version = "4.0.0-beta.3" version = "0.6.14"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"] authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust" description = "Actix web is a simple, pragmatic and extremely fast web framework for Rust."
readme = "README.md" readme = "README.md"
keywords = ["actix", "http", "web", "framework", "async"] keywords = ["http", "web", "framework", "async", "futures"]
homepage = "https://actix.rs" homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git" repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-web/" documentation = "https://docs.rs/actix-web/"
categories = ["network-programming", "asynchronous", categories = ["network-programming", "asynchronous",
"web-programming::http-server", "web-programming::http-server",
"web-programming::http-client",
"web-programming::websocket"] "web-programming::websocket"]
license = "MIT OR Apache-2.0" license = "MIT/Apache-2.0"
edition = "2018" exclude = [".gitignore", ".travis.yml", ".cargo/config", "appveyor.yml"]
build = "build.rs"
[package.metadata.docs.rs]
# features that docs.rs will build with
features = ["openssl", "rustls", "compress", "secure-cookies"]
[badges] [badges]
travis-ci = { repository = "actix/actix-web", branch = "master" } travis-ci = { repository = "actix/actix-web", branch = "master" }
appveyor = { repository = "fafhrd91/actix-web-hdy9d" }
codecov = { repository = "actix/actix-web", branch = "master", service = "github" } codecov = { repository = "actix/actix-web", branch = "master", service = "github" }
[lib] [lib]
name = "actix_web" name = "actix_web"
path = "src/lib.rs" path = "src/lib.rs"
[workspace]
members = [
".",
"awc",
"actix-http",
"actix-files",
"actix-multipart",
"actix-web-actors",
"actix-web-codegen",
"actix-http-test",
]
[features] [features]
default = ["compress", "cookies"] default = ["session", "brotli", "flate2-c"]
# content-encoding support # tls
compress = ["actix-http/compress", "awc/compress"] tls = ["native-tls", "tokio-tls"]
# support for cookies
cookies = ["actix-http/cookies", "awc/cookies"]
# secure cookies feature
secure-cookies = ["actix-http/secure-cookies"]
# openssl # openssl
openssl = ["tls-openssl", "actix-tls/accept", "actix-tls/openssl", "awc/openssl"] alpn = ["openssl", "tokio-openssl"]
# rustls # sessions feature, session require "ring" crate and c compiler
rustls = ["tls-rustls", "actix-tls/accept", "actix-tls/rustls", "awc/rustls"] session = ["cookie/secure"]
[[example]] # brotli encoding, requires c compiler
name = "basic" brotli = ["brotli2"]
required-features = ["compress"]
[[example]] # miniz-sys backend for flate2 crate
name = "uds" flate2-c = ["flate2/miniz-sys"]
required-features = ["compress"]
[[test]] # rust backend for flate2 crate
name = "test_server" flate2-rust = ["flate2/rust_backend"]
required-features = ["compress", "cookies"]
[[example]] [package.metadata.docs.rs]
name = "on_connect" features = ["tls", "alpn", "session", "brotli", "flate2-c"]
required-features = []
[[example]]
name = "client"
required-features = ["rustls"]
[dependencies] [dependencies]
actix-codec = "0.4.0-beta.1" actix = "^0.5.8"
actix-macros = "0.2.0"
actix-router = "0.2.7"
actix-rt = "2.1"
actix-server = "2.0.0-beta.3"
actix-service = "2.0.0-beta.4"
actix-utils = "3.0.0-beta.2"
actix-tls = { version = "3.0.0-beta.4", default-features = false, optional = true }
actix-web-codegen = "0.5.0-beta.1" base64 = "0.9"
actix-http = "3.0.0-beta.4" bitflags = "1.0"
awc = { version = "3.0.0-beta.3", default-features = false } failure = "0.1.1"
h2 = "0.1"
ahash = "0.7" http = "^0.1.5"
bytes = "1" httparse = "1.2"
derive_more = "0.99.5" http-range = "0.1"
either = "1.5.3" libc = "0.2"
encoding_rs = "0.8"
futures-core = { version = "0.3.7", default-features = false }
futures-util = { version = "0.3.7", default-features = false }
log = "0.4" log = "0.4"
mime = "0.3" mime = "0.3"
pin-project = "1.0.0" mime_guess = "2.0.0-alpha"
regex = "1.4" num_cpus = "1.0"
serde = { version = "1.0", features = ["derive"] } percent-encoding = "1.0"
rand = "0.4"
regex = "1.0"
serde = "1.0"
serde_json = "1.0" serde_json = "1.0"
serde_urlencoded = "0.7" serde_urlencoded = "0.5"
smallvec = "1.6" sha1 = "0.6"
socket2 = "0.3.16" smallvec = "0.6"
time = { version = "0.2.23", default-features = false, features = ["std"] } time = "0.1"
tls-openssl = { package = "openssl", version = "0.10.9", optional = true } encoding = "0.2"
tls-rustls = { package = "rustls", version = "0.19.0", optional = true } language-tags = "0.2"
url = "2.1" lazy_static = "1.0"
url = { version="1.7", features=["query_encoding"] }
cookie = { version="0.10", features=["percent-encode"] }
brotli2 = { version="^0.3.2", optional = true }
flate2 = { version="1.0", optional = true, default-features = false }
[target.'cfg(windows)'.dependencies.tls-openssl] # io
version = "0.10.9" mio = "^0.6.13"
package = "openssl" net2 = "0.2"
features = ["vendored"] bytes = "0.4"
optional = true byteorder = "1"
futures = "0.1"
futures-cpupool = "0.1"
slab = "0.4"
tokio-io = "0.1"
tokio-core = "0.1"
# native-tls
native-tls = { version="0.1", optional = true }
tokio-tls = { version="0.1", optional = true }
# openssl
openssl = { version="0.10", optional = true }
tokio-openssl = { version="0.2", optional = true }
[dev-dependencies] [dev-dependencies]
brotli2 = "0.3.2" env_logger = "0.5"
criterion = "0.3"
env_logger = "0.8"
flate2 = "1.0.13"
rand = "0.8"
rcgen = "0.8"
serde_derive = "1.0" serde_derive = "1.0"
[build-dependencies]
version_check = "0.1"
[profile.release] [profile.release]
lto = true lto = true
opt-level = 3 opt-level = 3
codegen-units = 1 codegen-units = 1
[patch.crates-io] [workspace]
actix-web = { path = "." } members = [
actix-http = { path = "actix-http" } "./",
actix-http-test = { path = "actix-http-test" } "tools/wsload/",
actix-web-actors = { path = "actix-web-actors" } ]
actix-web-codegen = { path = "actix-web-codegen" }
actix-multipart = { path = "actix-multipart" }
actix-files = { path = "actix-files" }
awc = { path = "awc" }
[[bench]]
name = "server"
harness = false
[[bench]]
name = "service"
harness = false
[[bench]]
name = "responder"
harness = false

View File

@@ -186,7 +186,7 @@
same "printed page" as the copyright notice for easier same "printed page" as the copyright notice for easier
identification within third-party archives. identification within third-party archives.
Copyright 2017-NOW Actix Team Copyright 2017-NOW Nikolay Kim
Licensed under the Apache License, Version 2.0 (the "License"); Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License. you may not use this file except in compliance with the License.

View File

@@ -1,4 +1,4 @@
Copyright (c) 2017 Actix Team Copyright (c) 2017 Nikolay Kim
Permission is hereby granted, free of charge, to any Permission is hereby granted, free of charge, to any
person obtaining a copy of this software and associated person obtaining a copy of this software and associated

View File

@@ -1,584 +1,4 @@
## Unreleased ## Migration from 0.5 to 0.6
* The default `NormalizePath` behavior now strips trailing slashes by default. This was
previously documented to be the case in v3 but the behavior now matches. The effect is that
routes defined with trailing slashes will become inaccessible when
using `NormalizePath::default()`.
Before: `#[get("/test/")`
After: `#[get("/test")`
Alternatively, explicitly require trailing slashes: `NormalizePath::new(TrailingSlash::Always)`.
## 3.0.0
* The return type for `ServiceRequest::app_data::<T>()` was changed from returning a `Data<T>` to
simply a `T`. To access a `Data<T>` use `ServiceRequest::app_data::<Data<T>>()`.
* Cookie handling has been offloaded to the `cookie` crate:
* `USERINFO_ENCODE_SET` is no longer exposed. Percent-encoding is still supported; check docs.
* Some types now require lifetime parameters.
* The time crate was updated to `v0.2`, a major breaking change to the time crate, which affects
any `actix-web` method previously expecting a time v0.1 input.
* Setting a cookie's SameSite property, explicitly, to `SameSite::None` will now
result in `SameSite=None` being sent with the response Set-Cookie header.
To create a cookie without a SameSite attribute, remove any calls setting same_site.
* actix-http support for Actors messages was moved to actix-http crate and is enabled
with feature `actors`
* content_length function is removed from actix-http.
You can set Content-Length by normally setting the response body or calling no_chunking function.
* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
`u64` instead of a `usize`.
* Code that was using `path.<index>` to access a `web::Path<(A, B, C)>`s elements now needs to use
destructuring or `.into_inner()`. For example:
```rust
// Previously:
async fn some_route(path: web::Path<(String, String)>) -> String {
format!("Hello, {} {}", path.0, path.1)
}
// Now (this also worked before):
async fn some_route(path: web::Path<(String, String)>) -> String {
let (first_name, last_name) = path.into_inner();
format!("Hello, {} {}", first_name, last_name)
}
// Or (this wasn't previously supported):
async fn some_route(web::Path((first_name, last_name)): web::Path<(String, String)>) -> String {
format!("Hello, {} {}", first_name, last_name)
}
```
* `middleware::NormalizePath` can now also be configured to trim trailing slashes instead of always keeping one.
It will need `middleware::normalize::TrailingSlash` when being constructed with `NormalizePath::new(...)`,
or for an easier migration you can replace `wrap(middleware::NormalizePath)` with `wrap(middleware::NormalizePath::new(TrailingSlash::MergeOnly))`.
* `HttpServer::maxconn` is renamed to the more expressive `HttpServer::max_connections`.
* `HttpServer::maxconnrate` is renamed to the more expressive `HttpServer::max_connection_rate`.
## 2.0.0
* `HttpServer::start()` renamed to `HttpServer::run()`. It also possible to
`.await` on `run` method result, in that case it awaits server exit.
* `App::register_data()` renamed to `App::app_data()` and accepts any type `T: 'static`.
Stored data is available via `HttpRequest::app_data()` method at runtime.
* Extractor configuration must be registered with `App::app_data()` instead of `App::data()`
* Sync handlers has been removed. `.to_async()` method has been renamed to `.to()`
replace `fn` with `async fn` to convert sync handler to async
* `actix_http_test::TestServer` moved to `actix_web::test` module. To start
test server use `test::start()` or `test_start_with_config()` methods
* `ResponseError` trait has been reafctored. `ResponseError::error_response()` renders
http response.
* Feature `rust-tls` renamed to `rustls`
instead of
```rust
actix-web = { version = "2.0.0", features = ["rust-tls"] }
```
use
```rust
actix-web = { version = "2.0.0", features = ["rustls"] }
```
* Feature `ssl` renamed to `openssl`
instead of
```rust
actix-web = { version = "2.0.0", features = ["ssl"] }
```
use
```rust
actix-web = { version = "2.0.0", features = ["openssl"] }
```
* `Cors` builder now requires that you call `.finish()` to construct the middleware
## 1.0.1
* Cors middleware has been moved to `actix-cors` crate
instead of
```rust
use actix_web::middleware::cors::Cors;
```
use
```rust
use actix_cors::Cors;
```
* Identity middleware has been moved to `actix-identity` crate
instead of
```rust
use actix_web::middleware::identity::{Identity, CookieIdentityPolicy, IdentityService};
```
use
```rust
use actix_identity::{Identity, CookieIdentityPolicy, IdentityService};
```
## 1.0.0
* Extractor configuration. In version 1.0 this is handled with the new `Data` mechanism for both setting and retrieving the configuration
instead of
```rust
#[derive(Default)]
struct ExtractorConfig {
config: String,
}
impl FromRequest for YourExtractor {
type Config = ExtractorConfig;
type Result = Result<YourExtractor, Error>;
fn from_request(req: &HttpRequest, cfg: &Self::Config) -> Self::Result {
println!("use the config: {:?}", cfg.config);
...
}
}
App::new().resource("/route_with_config", |r| {
r.post().with_config(handler_fn, |cfg| {
cfg.0.config = "test".to_string();
})
})
```
use the HttpRequest to get the configuration like any other `Data` with `req.app_data::<C>()` and set it with the `data()` method on the `resource`
```rust
#[derive(Default)]
struct ExtractorConfig {
config: String,
}
impl FromRequest for YourExtractor {
type Error = Error;
type Future = Result<Self, Self::Error>;
type Config = ExtractorConfig;
fn from_request(req: &HttpRequest, payload: &mut Payload) -> Self::Future {
let cfg = req.app_data::<ExtractorConfig>();
println!("config data?: {:?}", cfg.unwrap().role);
...
}
}
App::new().service(
resource("/route_with_config")
.data(ExtractorConfig {
config: "test".to_string(),
})
.route(post().to(handler_fn)),
)
```
* Resource registration. 1.0 version uses generalized resource
registration via `.service()` method.
instead of
```rust
App.new().resource("/welcome", |r| r.f(welcome))
```
use App's or Scope's `.service()` method. `.service()` method accepts
object that implements `HttpServiceFactory` trait. By default
actix-web provides `Resource` and `Scope` services.
```rust
App.new().service(
web::resource("/welcome")
.route(web::get().to(welcome))
.route(web::post().to(post_handler))
```
* Scope registration.
instead of
```rust
let app = App::new().scope("/{project_id}", |scope| {
scope
.resource("/path1", |r| r.f(|_| HttpResponse::Ok()))
.resource("/path2", |r| r.f(|_| HttpResponse::Ok()))
.resource("/path3", |r| r.f(|_| HttpResponse::MethodNotAllowed()))
});
```
use `.service()` for registration and `web::scope()` as scope object factory.
```rust
let app = App::new().service(
web::scope("/{project_id}")
.service(web::resource("/path1").to(|| HttpResponse::Ok()))
.service(web::resource("/path2").to(|| HttpResponse::Ok()))
.service(web::resource("/path3").to(|| HttpResponse::MethodNotAllowed()))
);
```
* `.with()`, `.with_async()` registration methods have been renamed to `.to()` and `.to_async()`.
instead of
```rust
App.new().resource("/welcome", |r| r.with(welcome))
```
use `.to()` or `.to_async()` methods
```rust
App.new().service(web::resource("/welcome").to(welcome))
```
* Passing arguments to handler with extractors, multiple arguments are allowed
instead of
```rust
fn welcome((body, req): (Bytes, HttpRequest)) -> ... {
...
}
```
use multiple arguments
```rust
fn welcome(body: Bytes, req: HttpRequest) -> ... {
...
}
```
* `.f()`, `.a()` and `.h()` handler registration methods have been removed.
Use `.to()` for handlers and `.to_async()` for async handlers. Handler function
must use extractors.
instead of
```rust
App.new().resource("/welcome", |r| r.f(welcome))
```
use App's `to()` or `to_async()` methods
```rust
App.new().service(web::resource("/welcome").to(welcome))
```
* `HttpRequest` does not provide access to request's payload stream.
instead of
```rust
fn index(req: &HttpRequest) -> Box<Future<Item=HttpResponse, Error=Error>> {
req
.payload()
.from_err()
.fold((), |_, chunk| {
...
})
.map(|_| HttpResponse::Ok().finish())
.responder()
}
```
use `Payload` extractor
```rust
fn index(stream: web::Payload) -> impl Future<Item=HttpResponse, Error=Error> {
stream
.from_err()
.fold((), |_, chunk| {
...
})
.map(|_| HttpResponse::Ok().finish())
}
```
* `State` is now `Data`. You register Data during the App initialization process
and then access it from handlers either using a Data extractor or using
HttpRequest's api.
instead of
```rust
App.with_state(T)
```
use App's `data` method
```rust
App.new()
.data(T)
```
and either use the Data extractor within your handler
```rust
use actix_web::web::Data;
fn endpoint_handler(Data<T>)){
...
}
```
.. or access your Data element from the HttpRequest
```rust
fn endpoint_handler(req: HttpRequest) {
let data: Option<Data<T>> = req.app_data::<T>();
}
```
* AsyncResponder is removed, use `.to_async()` registration method and `impl Future<>` as result type.
instead of
```rust
use actix_web::AsyncResponder;
fn endpoint_handler(...) -> impl Future<Item=HttpResponse, Error=Error>{
...
.responder()
}
```
.. simply omit AsyncResponder and the corresponding responder() finish method
* Middleware
instead of
```rust
let app = App::new()
.middleware(middleware::Logger::default())
```
use `.wrap()` method
```rust
let app = App::new()
.wrap(middleware::Logger::default())
.route("/index.html", web::get().to(index));
```
* `HttpRequest::body()`, `HttpRequest::urlencoded()`, `HttpRequest::json()`, `HttpRequest::multipart()`
method have been removed. Use `Bytes`, `String`, `Form`, `Json`, `Multipart` extractors instead.
instead of
```rust
fn index(req: &HttpRequest) -> Responder {
req.body()
.and_then(|body| {
...
})
}
```
use
```rust
fn index(body: Bytes) -> Responder {
...
}
```
* `actix_web::server` module has been removed. To start http server use `actix_web::HttpServer` type
* StaticFiles and NamedFile have been moved to a separate crate.
instead of `use actix_web::fs::StaticFile`
use `use actix_files::Files`
instead of `use actix_web::fs::Namedfile`
use `use actix_files::NamedFile`
* Multipart has been moved to a separate crate.
instead of `use actix_web::multipart::Multipart`
use `use actix_multipart::Multipart`
* Response compression is not enabled by default.
To enable, use `Compress` middleware, `App::new().wrap(Compress::default())`.
* Session middleware moved to actix-session crate
* Actors support have been moved to `actix-web-actors` crate
* Custom Error
Instead of error_response method alone, ResponseError now provides two methods: error_response and render_response respectively. Where, error_response creates the error response and render_response returns the error response to the caller.
Simplest migration from 0.7 to 1.0 shall include below method to the custom implementation of ResponseError:
```rust
fn render_response(&self) -> HttpResponse {
self.error_response()
}
```
## 0.7.15
* The `' '` character is not percent decoded anymore before matching routes. If you need to use it in
your routes, you should use `%20`.
instead of
```rust
fn main() {
let app = App::new().resource("/my index", |r| {
r.method(http::Method::GET)
.with(index);
});
}
```
use
```rust
fn main() {
let app = App::new().resource("/my%20index", |r| {
r.method(http::Method::GET)
.with(index);
});
}
```
* If you used `AsyncResult::async` you need to replace it with `AsyncResult::future`
## 0.7.4
* `Route::with_config()`/`Route::with_async_config()` always passes configuration objects as tuple
even for handler with one parameter.
## 0.7
* `HttpRequest` does not implement `Stream` anymore. If you need to read request payload
use `HttpMessage::payload()` method.
instead of
```rust
fn index(req: HttpRequest) -> impl Responder {
req
.from_err()
.fold(...)
....
}
```
use `.payload()`
```rust
fn index(req: HttpRequest) -> impl Responder {
req
.payload() // <- get request payload stream
.from_err()
.fold(...)
....
}
```
* [Middleware](https://actix.rs/actix-web/actix_web/middleware/trait.Middleware.html)
trait uses `&HttpRequest` instead of `&mut HttpRequest`.
* Removed `Route::with2()` and `Route::with3()` use tuple of extractors instead.
instead of
```rust
fn index(query: Query<..>, info: Json<MyStruct) -> impl Responder {}
```
use tuple of extractors and use `.with()` for registration:
```rust
fn index((query, json): (Query<..>, Json<MyStruct)) -> impl Responder {}
```
* `Handler::handle()` uses `&self` instead of `&mut self`
* `Handler::handle()` accepts reference to `HttpRequest<_>` instead of value
* Removed deprecated `HttpServer::threads()`, use
[HttpServer::workers()](https://actix.rs/actix-web/actix_web/server/struct.HttpServer.html#method.workers) instead.
* Renamed `client::ClientConnectorError::Connector` to
`client::ClientConnectorError::Resolver`
* `Route::with()` does not return `ExtractorConfig`, to configure
extractor use `Route::with_config()`
instead of
```rust
fn main() {
let app = App::new().resource("/index.html", |r| {
r.method(http::Method::GET)
.with(index)
.limit(4096); // <- limit size of the payload
});
}
```
use
```rust
fn main() {
let app = App::new().resource("/index.html", |r| {
r.method(http::Method::GET)
.with_config(index, |cfg| { // <- register handler
cfg.limit(4096); // <- limit size of the payload
})
});
}
```
* `Route::with_async()` does not return `ExtractorConfig`, to configure
extractor use `Route::with_async_config()`
## 0.6
* `Path<T>` extractor return `ErrorNotFound` on failure instead of `ErrorBadRequest` * `Path<T>` extractor return `ErrorNotFound` on failure instead of `ErrorBadRequest`
@@ -593,12 +13,12 @@
* `HttpRequest::extensions()` returns read only reference to the request's Extension * `HttpRequest::extensions()` returns read only reference to the request's Extension
`HttpRequest::extensions_mut()` returns mutable reference. `HttpRequest::extensions_mut()` returns mutable reference.
* Instead of * Instead of
`use actix_web::middleware::{ `use actix_web::middleware::{
CookieSessionBackend, CookieSessionError, RequestSession, CookieSessionBackend, CookieSessionError, RequestSession,
Session, SessionBackend, SessionImpl, SessionStorage};` Session, SessionBackend, SessionImpl, SessionStorage};`
use `actix_web::middleware::session` use `actix_web::middleware::session`
`use actix_web::middleware::session{CookieSessionBackend, CookieSessionError, `use actix_web::middleware::session{CookieSessionBackend, CookieSessionError,
@@ -630,7 +50,7 @@
you need to use `use actix_web::ws::WsWriter` you need to use `use actix_web::ws::WsWriter`
## 0.5 ## Migration from 0.4 to 0.5
* `HttpResponseBuilder::body()`, `.finish()`, `.json()` * `HttpResponseBuilder::body()`, `.finish()`, `.json()`
methods return `HttpResponse` instead of `Result<HttpResponse>` methods return `HttpResponse` instead of `Result<HttpResponse>`

14
Makefile Normal file
View File

@@ -0,0 +1,14 @@
.PHONY: default build test doc book clean
CARGO_FLAGS := --features "$(FEATURES) alpn"
default: test
build:
cargo build $(CARGO_FLAGS)
test: build clippy
cargo test $(CARGO_FLAGS)
doc: build
cargo doc --no-deps $(CARGO_FLAGS)

122
README.md
View File

@@ -1,109 +1,89 @@
<div align="center"> # Actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![Build status](https://ci.appveyor.com/api/projects/status/kkdb4yce7qhm5w85/branch/master?svg=true)](https://ci.appveyor.com/project/fafhrd91/actix-web-hdy9d/branch/master) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
<h1>Actix Web</h1>
<p>
<strong>Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust</strong>
</p>
<p>
[![crates.io](https://img.shields.io/crates/v/actix-web?label=latest)](https://crates.io/crates/actix-web) Actix web is a simple, pragmatic and extremely fast web framework for Rust.
[![Documentation](https://docs.rs/actix-web/badge.svg?version=4.0.0-beta.2)](https://docs.rs/actix-web/4.0.0-beta.2)
[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-web.svg)
[![Dependency Status](https://deps.rs/crate/actix-web/4.0.0-beta.2/status.svg)](https://deps.rs/crate/actix-web/4.0.0-beta.2)
<br />
[![build status](https://github.com/actix/actix-web/workflows/CI%20%28Linux%29/badge.svg?branch=master&event=push)](https://github.com/actix/actix-web/actions)
[![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web)
![downloads](https://img.shields.io/crates/d/actix-web.svg)
[![Chat on Discord](https://img.shields.io/discord/771444961383153695?label=chat&logo=discord)](https://discord.gg/NWpN5mmg3x)
</p> * Supported *HTTP/1.x* and [*HTTP/2.0*](https://actix.rs/docs/http2/) protocols
</div>
## Features
* Supports *HTTP/1.x* and *HTTP/2*
* Streaming and pipelining * Streaming and pipelining
* Keep-alive and slow requests handling * Keep-alive and slow requests handling
* Client/server [WebSockets](https://actix.rs/docs/websockets/) support * Client/server [WebSockets](https://actix.rs/docs/websockets/) support
* Transparent content compression/decompression (br, gzip, deflate) * Transparent content compression/decompression (br, gzip, deflate)
* Powerful [request routing](https://actix.rs/docs/url-dispatch/) * Configurable [request routing](https://actix.rs/docs/url-dispatch/)
* Graceful server shutdown
* Multipart streams * Multipart streams
* Static assets * Static assets
* SSL support using OpenSSL or Rustls * SSL support with OpenSSL or `native-tls`
* Middlewares ([Logger, Session, CORS, etc](https://actix.rs/docs/middleware/)) * Middlewares ([Logger](https://actix.rs/book/actix-web/sec-9-middlewares.html#logging),
* Includes an async [HTTP client](https://docs.rs/actix-web/latest/actix_web/client/index.html) [Session](https://actix.rs/book/actix-web/sec-9-middlewares.html#user-sessions),
* Runs on stable Rust 1.46+ [Redis sessions](https://github.com/actix/actix-redis),
[DefaultHeaders](https://actix.rs/book/actix-web/sec-9-middlewares.html#default-headers),
[CORS](https://actix.rs/actix-web/actix_web/middleware/cors/index.html),
[CSRF](https://actix.rs/actix-web/actix_web/middleware/csrf/index.html))
* Includes an asynchronous [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
* Built on top of [Actix actor framework](https://github.com/actix/actix)
## Documentation ## Documentation & community resources
* [Website & User Guide](https://actix.rs) * [User Guide](https://actix.rs/docs/)
* [Examples Repository](https://github.com/actix/examples) * [API Documentation (Development)](https://actix.rs/actix-web/actix_web/)
* [API Documentation](https://docs.rs/actix-web) * [API Documentation (Releases)](https://docs.rs/actix-web/)
* [API Documentation (master branch)](https://actix.rs/actix-web/actix_web) * [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-web](https://crates.io/crates/actix-web)
* Minimum supported Rust version: 1.24 or later
## Example ## Example
Dependencies:
```toml
[dependencies]
actix-web = "3"
```
Code:
```rust ```rust
use actix_web::{get, web, App, HttpServer, Responder}; extern crate actix_web;
use actix_web::{http, server, App, Path, Responder};
#[get("/{id}/{name}/index.html")] fn index(info: Path<(u32, String)>) -> impl Responder {
async fn index(web::Path((id, name)): web::Path<(u32, String)>) -> impl Responder { format!("Hello {}! id:{}", info.1, info.0)
format!("Hello {}! id:{}", name, id)
} }
#[actix_web::main] fn main() {
async fn main() -> std::io::Result<()> { server::new(
HttpServer::new(|| App::new().service(index)) || App::new()
.bind("127.0.0.1:8080")? .route("/{id}/{name}/index.html", http::Method::GET, index))
.run() .bind("127.0.0.1:8080").unwrap()
.await .run();
} }
``` ```
### More examples ### More examples
* [Basic Setup](https://github.com/actix/examples/tree/master/basics/basics/) * [Basics](https://github.com/actix/examples/tree/master/basics/)
* [Application State](https://github.com/actix/examples/tree/master/basics/state/) * [Stateful](https://github.com/actix/examples/tree/master/state/)
* [JSON Handling](https://github.com/actix/examples/tree/master/json/json/) * [Protobuf support](https://github.com/actix/examples/tree/master/protobuf/)
* [Multipart Streams](https://github.com/actix/examples/tree/master/forms/multipart/) * [Multipart streams](https://github.com/actix/examples/tree/master/multipart/)
* [Diesel Integration](https://github.com/actix/examples/tree/master/database_interactions/diesel/) * [Simple websocket](https://github.com/actix/examples/tree/master/websocket/)
* [r2d2 Integration](https://github.com/actix/examples/tree/master/database_interactions/r2d2/) * [Tera](https://github.com/actix/examples/tree/master/template_tera/) /
* [Simple WebSocket](https://github.com/actix/examples/tree/master/websockets/websocket/) [Askama](https://github.com/actix/examples/tree/master/template_askama/) templates
* [Tera Templates](https://github.com/actix/examples/tree/master/template_engines/tera/) * [Diesel integration](https://github.com/actix/examples/tree/master/diesel/)
* [Askama Templates](https://github.com/actix/examples/tree/master/template_engines/askama/) * [r2d2](https://github.com/actix/examples/tree/master/r2d2/)
* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/security/rustls/) * [SSL / HTTP/2.0](https://github.com/actix/examples/tree/master/tls/)
* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/security/openssl/) * [Tcp/Websocket chat](https://github.com/actix/examples/tree/master/websocket-chat/)
* [WebSocket Chat](https://github.com/actix/examples/tree/master/websockets/chat/) * [Json](https://github.com/actix/examples/tree/master/json/)
You may consider checking out You may consider checking out
[this directory](https://github.com/actix/examples/tree/master/) for more examples. [this directory](https://github.com/actix/examples/tree/master/) for more examples.
## Benchmarks ## Benchmarks
One of the fastest web frameworks available according to the * [TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r15&hw=ph&test=plaintext)
[TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r19).
* Some basic benchmarks could be found in this [repository](https://github.com/fafhrd91/benchmarks).
## License ## License
This project is licensed under either of This project is licensed under either of
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or * Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
[http://www.apache.org/licenses/LICENSE-2.0]) * MIT license ([LICENSE-MIT](LICENSE-MIT) or [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
* MIT license ([LICENSE-MIT](LICENSE-MIT) or
[http://opensource.org/licenses/MIT])
at your option. at your option.
## Code of Conduct ## Code of Conduct
Contribution to the actix-web repo is organized under the terms of the Contributor Covenant. Contribution to the actix-web crate is organized under the terms of the
The Actix team promises to intervene to uphold that code of conduct. Contributor Covenant, the maintainer of actix-web, @fafhrd91, promises to
intervene to uphold that code of conduct.

View File

@@ -1,123 +0,0 @@
# Changes
## Unreleased - 2021-xx-xx
## 0.6.0-beta.2 - 2021-02-10
* Fix If-Modified-Since and If-Unmodified-Since to not compare using sub-second timestamps. [#1887]
* Replace `v_htmlescape` with `askama_escape`. [#1953]
[#1887]: https://github.com/actix/actix-web/pull/1887
[#1953]: https://github.com/actix/actix-web/pull/1953
## 0.6.0-beta.1 - 2021-01-07
* `HttpRange::parse` now has its own error type.
* Update `bytes` to `1.0`. [#1813]
[#1813]: https://github.com/actix/actix-web/pull/1813
## 0.5.0 - 2020-12-26
* Optionally support hidden files/directories. [#1811]
[#1811]: https://github.com/actix/actix-web/pull/1811
## 0.4.1 - 2020-11-24
* Clarify order of parameters in `Files::new` and improve docs.
## 0.4.0 - 2020-10-06
* Add `Files::prefer_utf8` option that adds UTF-8 charset on certain response types. [#1714]
[#1714]: https://github.com/actix/actix-web/pull/1714
## 0.3.0 - 2020-09-11
* No significant changes from 0.3.0-beta.1.
## 0.3.0-beta.1 - 2020-07-15
* Update `v_htmlescape` to 0.10
* Update `actix-web` and `actix-http` dependencies to beta.1
## 0.3.0-alpha.1 - 2020-05-23
* Update `actix-web` and `actix-http` dependencies to alpha
* Fix some typos in the docs
* Bump minimum supported Rust version to 1.40
* Support sending Content-Length when Content-Range is specified [#1384]
[#1384]: https://github.com/actix/actix-web/pull/1384
## 0.2.1 - 2019-12-22
* Use the same format for file URLs regardless of platforms
## 0.2.0 - 2019-12-20
* Fix BodyEncoding trait import #1220
## 0.2.0-alpha.1 - 2019-12-07
* Migrate to `std::future`
## 0.1.7 - 2019-11-06
* Add an additional `filename*` param in the `Content-Disposition` header of
`actix_files::NamedFile` to be more compatible. (#1151)
## 0.1.6 - 2019-10-14
* Add option to redirect to a slash-ended path `Files` #1132
## 0.1.5 - 2019-10-08
* Bump up `mime_guess` crate version to 2.0.1
* Bump up `percent-encoding` crate version to 2.1
* Allow user defined request guards for `Files` #1113
## 0.1.4 - 2019-07-20
* Allow to disable `Content-Disposition` header #686
## 0.1.3 - 2019-06-28
* Do not set `Content-Length` header, let actix-http set it #930
## 0.1.2 - 2019-06-13
* Content-Length is 0 for NamedFile HEAD request #914
* Fix ring dependency from actix-web default features for #741
## 0.1.1 - 2019-06-01
* Static files are incorrectly served as both chunked and with length #812
## 0.1.0 - 2019-05-25
* NamedFile last-modified check always fails due to nano-seconds in file modified date #820
## 0.1.0-beta.4 - 2019-05-12
* Update actix-web to beta.4
## 0.1.0-beta.1 - 2019-04-20
* Update actix-web to beta.1
## 0.1.0-alpha.6 - 2019-04-14
* Update actix-web to alpha6
## 0.1.0-alpha.4 - 2019-04-08
* Update actix-web to alpha4
## 0.1.0-alpha.2 - 2019-04-02
* Add default handler support
## 0.1.0-alpha.1 - 2019-03-28
* Initial impl

View File

@@ -1,37 +0,0 @@
[package]
name = "actix-files"
version = "0.6.0-beta.2"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Static file serving for Actix Web"
readme = "README.md"
keywords = ["actix", "http", "async", "futures"]
homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-files/"
categories = ["asynchronous", "web-programming::http-server"]
license = "MIT OR Apache-2.0"
edition = "2018"
[lib]
name = "actix_files"
path = "src/lib.rs"
[dependencies]
actix-web = { version = "4.0.0-beta.3", default-features = false }
actix-service = "2.0.0-beta.4"
askama_escape = "0.10"
bitflags = "1"
bytes = "1"
futures-core = { version = "0.3.7", default-features = false }
futures-util = { version = "0.3.7", default-features = false }
http-range = "0.1.4"
derive_more = "0.99.5"
log = "0.4"
mime = "0.3"
mime_guess = "2.0.1"
percent-encoding = "2.1"
[dev-dependencies]
actix-rt = "2.1"
actix-web = "4.0.0-beta.3"

View File

@@ -1 +0,0 @@
../LICENSE-APACHE

View File

@@ -1 +0,0 @@
../LICENSE-MIT

View File

@@ -1,19 +0,0 @@
# actix-files
> Static file serving for Actix Web
[![crates.io](https://img.shields.io/crates/v/actix-files?label=latest)](https://crates.io/crates/actix-files)
[![Documentation](https://docs.rs/actix-files/badge.svg?version=0.5.0)](https://docs.rs/actix-files/0.5.0)
[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
![License](https://img.shields.io/crates/l/actix-files.svg)
<br />
[![dependency status](https://deps.rs/crate/actix-files/0.5.0/status.svg)](https://deps.rs/crate/actix-files/0.5.0)
[![Download](https://img.shields.io/crates/d/actix-files.svg)](https://crates.io/crates/actix-files)
[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & Resources
- [API Documentation](https://docs.rs/actix-files/)
- [Example Project](https://github.com/actix/examples/tree/master/basics/static_index)
- [Chat on Gitter](https://gitter.im/actix/actix-web)
- Minimum supported Rust version: 1.46 or later

View File

@@ -1,98 +0,0 @@
use std::{
cmp, fmt,
fs::File,
future::Future,
io::{self, Read, Seek},
pin::Pin,
task::{Context, Poll},
};
use actix_web::{
error::{BlockingError, Error},
rt::task::{spawn_blocking, JoinHandle},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
#[doc(hidden)]
/// A helper created from a `std::fs::File` which reads the file
/// chunk-by-chunk on a `ThreadPool`.
pub struct ChunkedReadFile {
size: u64,
offset: u64,
state: ChunkedReadFileState,
counter: u64,
}
enum ChunkedReadFileState {
File(Option<File>),
Future(JoinHandle<Result<(File, Bytes), io::Error>>),
}
impl ChunkedReadFile {
pub(crate) fn new(size: u64, offset: u64, file: File) -> Self {
Self {
size,
offset,
state: ChunkedReadFileState::File(Some(file)),
counter: 0,
}
}
}
impl fmt::Debug for ChunkedReadFile {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.write_str("ChunkedReadFile")
}
}
impl Stream for ChunkedReadFile {
type Item = Result<Bytes, Error>;
fn poll_next(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Option<Self::Item>> {
let this = self.as_mut().get_mut();
match this.state {
ChunkedReadFileState::File(ref mut file) => {
let size = this.size;
let offset = this.offset;
let counter = this.counter;
if size == counter {
Poll::Ready(None)
} else {
let mut file = file
.take()
.expect("ChunkedReadFile polled after completion");
let fut = spawn_blocking(move || {
let max_bytes = cmp::min(size.saturating_sub(counter), 65_536) as usize;
let mut buf = Vec::with_capacity(max_bytes);
file.seek(io::SeekFrom::Start(offset))?;
let n_bytes =
file.by_ref().take(max_bytes as u64).read_to_end(&mut buf)?;
if n_bytes == 0 {
return Err(io::ErrorKind::UnexpectedEof.into());
}
Ok((file, Bytes::from(buf)))
});
this.state = ChunkedReadFileState::Future(fut);
self.poll_next(cx)
}
}
ChunkedReadFileState::Future(ref mut fut) => {
let (file, bytes) =
ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
this.state = ChunkedReadFileState::File(Some(file));
this.offset += bytes.len() as u64;
this.counter += bytes.len() as u64;
Poll::Ready(Some(Ok(bytes)))
}
}
}
}

View File

@@ -1,112 +0,0 @@
use std::{fmt::Write, fs::DirEntry, io, path::Path, path::PathBuf};
use actix_web::{dev::ServiceResponse, HttpRequest, HttpResponse};
use askama_escape::{escape as escape_html_entity, Html};
use percent_encoding::{utf8_percent_encode, CONTROLS};
/// A directory; responds with the generated directory listing.
#[derive(Debug)]
pub struct Directory {
/// Base directory.
pub base: PathBuf,
/// Path of subdirectory to generate listing for.
pub path: PathBuf,
}
impl Directory {
/// Create a new directory
pub fn new(base: PathBuf, path: PathBuf) -> Directory {
Directory { base, path }
}
/// Is this entry visible from this directory?
pub fn is_visible(&self, entry: &io::Result<DirEntry>) -> bool {
if let Ok(ref entry) = *entry {
if let Some(name) = entry.file_name().to_str() {
if name.starts_with('.') {
return false;
}
}
if let Ok(ref md) = entry.metadata() {
let ft = md.file_type();
return ft.is_dir() || ft.is_file() || ft.is_symlink();
}
}
false
}
}
pub(crate) type DirectoryRenderer =
dyn Fn(&Directory, &HttpRequest) -> Result<ServiceResponse, io::Error>;
// show file url as relative to static path
macro_rules! encode_file_url {
($path:ident) => {
utf8_percent_encode(&$path, CONTROLS)
};
}
// " -- &quot; & -- &amp; ' -- &#x27; < -- &lt; > -- &gt; / -- &#x2f;
macro_rules! encode_file_name {
($entry:ident) => {
escape_html_entity(&$entry.file_name().to_string_lossy(), Html)
};
}
pub(crate) fn directory_listing(
dir: &Directory,
req: &HttpRequest,
) -> Result<ServiceResponse, io::Error> {
let index_of = format!("Index of {}", req.path());
let mut body = String::new();
let base = Path::new(req.path());
for entry in dir.path.read_dir()? {
if dir.is_visible(&entry) {
let entry = entry.unwrap();
let p = match entry.path().strip_prefix(&dir.path) {
Ok(p) if cfg!(windows) => base.join(p).to_string_lossy().replace("\\", "/"),
Ok(p) => base.join(p).to_string_lossy().into_owned(),
Err(_) => continue,
};
// if file is a directory, add '/' to the end of the name
if let Ok(metadata) = entry.metadata() {
if metadata.is_dir() {
let _ = write!(
body,
"<li><a href=\"{}\">{}/</a></li>",
encode_file_url!(p),
encode_file_name!(entry),
);
} else {
let _ = write!(
body,
"<li><a href=\"{}\">{}</a></li>",
encode_file_url!(p),
encode_file_name!(entry),
);
}
} else {
continue;
}
}
}
let html = format!(
"<html>\
<head><title>{}</title></head>\
<body><h1>{}</h1>\
<ul>\
{}\
</ul></body>\n</html>",
index_of, index_of, body
);
Ok(ServiceResponse::new(
req.clone(),
HttpResponse::Ok()
.content_type("text/html; charset=utf-8")
.body(html),
))
}

View File

@@ -1,52 +0,0 @@
use mime::Mime;
/// Transforms MIME `text/*` types into their UTF-8 equivalent, if supported.
///
/// MIME types that are converted
/// - application/javascript
/// - text/html
/// - text/css
/// - text/plain
/// - text/csv
/// - text/tab-separated-values
pub(crate) fn equiv_utf8_text(ct: Mime) -> Mime {
// use (roughly) order of file-type popularity for a web server
if ct == mime::APPLICATION_JAVASCRIPT {
return mime::APPLICATION_JAVASCRIPT_UTF_8;
}
if ct == mime::TEXT_HTML {
return mime::TEXT_HTML_UTF_8;
}
if ct == mime::TEXT_CSS {
return mime::TEXT_CSS_UTF_8;
}
if ct == mime::TEXT_PLAIN {
return mime::TEXT_PLAIN_UTF_8;
}
if ct == mime::TEXT_CSV {
return mime::TEXT_CSV_UTF_8;
}
if ct == mime::TEXT_TAB_SEPARATED_VALUES {
return mime::TEXT_TAB_SEPARATED_VALUES_UTF_8;
}
ct
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_equiv_utf8_text() {
assert_eq!(equiv_utf8_text(mime::TEXT_PLAIN), mime::TEXT_PLAIN_UTF_8);
assert_eq!(equiv_utf8_text(mime::TEXT_XML), mime::TEXT_XML);
assert_eq!(equiv_utf8_text(mime::IMAGE_PNG), mime::IMAGE_PNG);
}
}

View File

@@ -1,42 +0,0 @@
use actix_web::{http::StatusCode, HttpResponse, ResponseError};
use derive_more::Display;
/// Errors which can occur when serving static files.
#[derive(Display, Debug, PartialEq)]
pub enum FilesError {
/// Path is not a directory
#[allow(dead_code)]
#[display(fmt = "Path is not a directory. Unable to serve static files")]
IsNotDirectory,
/// Cannot render directory
#[display(fmt = "Unable to render directory without index file")]
IsDirectory,
}
/// Return `NotFound` for `FilesError`
impl ResponseError for FilesError {
fn error_response(&self) -> HttpResponse {
HttpResponse::new(StatusCode::NOT_FOUND)
}
}
#[derive(Display, Debug, PartialEq)]
pub enum UriSegmentError {
/// The segment started with the wrapped invalid character.
#[display(fmt = "The segment started with the wrapped invalid character")]
BadStart(char),
/// The segment contained the wrapped invalid character.
#[display(fmt = "The segment contained the wrapped invalid character")]
BadChar(char),
/// The segment ended with the wrapped invalid character.
#[display(fmt = "The segment ended with the wrapped invalid character")]
BadEnd(char),
}
/// Return `BadRequest` for `UriSegmentError`
impl ResponseError for UriSegmentError {
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}

View File

@@ -1,280 +0,0 @@
use std::{cell::RefCell, fmt, io, path::PathBuf, rc::Rc};
use actix_service::{boxed, IntoServiceFactory, ServiceFactory, ServiceFactoryExt};
use actix_web::{
dev::{AppService, HttpServiceFactory, ResourceDef, ServiceRequest, ServiceResponse},
error::Error,
guard::Guard,
http::header::DispositionType,
HttpRequest,
};
use futures_util::future::{ok, FutureExt, LocalBoxFuture};
use crate::{
directory_listing, named, Directory, DirectoryRenderer, FilesService, HttpNewService,
MimeOverride,
};
/// Static files handling service.
///
/// `Files` service must be registered with `App::service()` method.
///
/// ```rust
/// use actix_web::App;
/// use actix_files::Files;
///
/// let app = App::new()
/// .service(Files::new("/static", "."));
/// ```
pub struct Files {
path: String,
directory: PathBuf,
index: Option<String>,
show_index: bool,
redirect_to_slash: bool,
default: Rc<RefCell<Option<Rc<HttpNewService>>>>,
renderer: Rc<DirectoryRenderer>,
mime_override: Option<Rc<MimeOverride>>,
file_flags: named::Flags,
guards: Option<Rc<dyn Guard>>,
hidden_files: bool,
}
impl fmt::Debug for Files {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.write_str("Files")
}
}
impl Clone for Files {
fn clone(&self) -> Self {
Self {
directory: self.directory.clone(),
index: self.index.clone(),
show_index: self.show_index,
redirect_to_slash: self.redirect_to_slash,
default: self.default.clone(),
renderer: self.renderer.clone(),
file_flags: self.file_flags,
path: self.path.clone(),
mime_override: self.mime_override.clone(),
guards: self.guards.clone(),
hidden_files: self.hidden_files,
}
}
}
impl Files {
/// Create new `Files` instance for a specified base directory.
///
/// # Argument Order
/// The first argument (`mount_path`) is the root URL at which the static files are served.
/// For example, `/assets` will serve files at `example.com/assets/...`.
///
/// The second argument (`serve_from`) is the location on disk at which files are loaded.
/// This can be a relative path. For example, `./` would serve files from the current
/// working directory.
///
/// # Implementation Notes
/// If the mount path is set as the root path `/`, services registered after this one will
/// be inaccessible. Register more specific handlers and services first.
///
/// `Files` uses a threadpool for blocking filesystem operations. By default, the pool uses a
/// max number of threads equal to `512 * HttpServer::worker`. Real time thread count are
/// adjusted with work load. More threads would spawn when need and threads goes idle for a
/// period of time would be de-spawned.
pub fn new<T: Into<PathBuf>>(mount_path: &str, serve_from: T) -> Files {
let orig_dir = serve_from.into();
let dir = match orig_dir.canonicalize() {
Ok(canon_dir) => canon_dir,
Err(_) => {
log::error!("Specified path is not a directory: {:?}", orig_dir);
PathBuf::new()
}
};
Files {
path: mount_path.to_owned(),
directory: dir,
index: None,
show_index: false,
redirect_to_slash: false,
default: Rc::new(RefCell::new(None)),
renderer: Rc::new(directory_listing),
mime_override: None,
file_flags: named::Flags::default(),
guards: None,
hidden_files: false,
}
}
/// Show files listing for directories.
///
/// By default show files listing is disabled.
pub fn show_files_listing(mut self) -> Self {
self.show_index = true;
self
}
/// Redirects to a slash-ended path when browsing a directory.
///
/// By default never redirect.
pub fn redirect_to_slash_directory(mut self) -> Self {
self.redirect_to_slash = true;
self
}
/// Set custom directory renderer
pub fn files_listing_renderer<F>(mut self, f: F) -> Self
where
for<'r, 's> F:
Fn(&'r Directory, &'s HttpRequest) -> Result<ServiceResponse, io::Error> + 'static,
{
self.renderer = Rc::new(f);
self
}
/// Specifies mime override callback
pub fn mime_override<F>(mut self, f: F) -> Self
where
F: Fn(&mime::Name<'_>) -> DispositionType + 'static,
{
self.mime_override = Some(Rc::new(f));
self
}
/// Set index file
///
/// Shows specific index file for directory "/" instead of
/// showing files listing.
pub fn index_file<T: Into<String>>(mut self, index: T) -> Self {
self.index = Some(index.into());
self
}
/// Specifies whether to use ETag or not.
///
/// Default is true.
#[inline]
pub fn use_etag(mut self, value: bool) -> Self {
self.file_flags.set(named::Flags::ETAG, value);
self
}
/// Specifies whether to use Last-Modified or not.
///
/// Default is true.
#[inline]
pub fn use_last_modified(mut self, value: bool) -> Self {
self.file_flags.set(named::Flags::LAST_MD, value);
self
}
/// Specifies whether text responses should signal a UTF-8 encoding.
///
/// Default is false (but will default to true in a future version).
#[inline]
pub fn prefer_utf8(mut self, value: bool) -> Self {
self.file_flags.set(named::Flags::PREFER_UTF8, value);
self
}
/// Specifies custom guards to use for directory listings and files.
///
/// Default behaviour allows GET and HEAD.
#[inline]
pub fn use_guards<G: Guard + 'static>(mut self, guards: G) -> Self {
self.guards = Some(Rc::new(guards));
self
}
/// Disable `Content-Disposition` header.
///
/// By default Content-Disposition` header is enabled.
#[inline]
pub fn disable_content_disposition(mut self) -> Self {
self.file_flags.remove(named::Flags::CONTENT_DISPOSITION);
self
}
/// Sets default handler which is used when no matched file could be found.
pub fn default_handler<F, U>(mut self, f: F) -> Self
where
F: IntoServiceFactory<U, ServiceRequest>,
U: ServiceFactory<
ServiceRequest,
Config = (),
Response = ServiceResponse,
Error = Error,
> + 'static,
{
// create and configure default resource
self.default = Rc::new(RefCell::new(Some(Rc::new(boxed::factory(
f.into_factory().map_init_err(|_| ()),
)))));
self
}
/// Enables serving hidden files and directories, allowing a leading dots in url fragments.
#[inline]
pub fn use_hidden_files(mut self) -> Self {
self.hidden_files = true;
self
}
}
impl HttpServiceFactory for Files {
fn register(self, config: &mut AppService) {
if self.default.borrow().is_none() {
*self.default.borrow_mut() = Some(config.default_service());
}
let rdef = if config.is_root() {
ResourceDef::root_prefix(&self.path)
} else {
ResourceDef::prefix(&self.path)
};
config.register_service(rdef, None, self, None)
}
}
impl ServiceFactory<ServiceRequest> for Files {
type Response = ServiceResponse;
type Error = Error;
type Config = ();
type Service = FilesService;
type InitError = ();
type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: ()) -> Self::Future {
let mut srv = FilesService {
directory: self.directory.clone(),
index: self.index.clone(),
show_index: self.show_index,
redirect_to_slash: self.redirect_to_slash,
default: None,
renderer: self.renderer.clone(),
mime_override: self.mime_override.clone(),
file_flags: self.file_flags,
guards: self.guards.clone(),
hidden_files: self.hidden_files,
};
if let Some(ref default) = *self.default.borrow() {
default
.new_service(())
.map(move |result| match result {
Ok(default) => {
srv.default = Some(default);
Ok(srv)
}
Err(_) => Err(()),
})
.boxed_local()
} else {
ok(srv).boxed_local()
}
}
}

View File

@@ -1,757 +0,0 @@
//! Static file serving for Actix Web.
//!
//! Provides a non-blocking service for serving static files from disk.
//!
//! # Example
//! ```rust
//! use actix_web::App;
//! use actix_files::Files;
//!
//! let app = App::new()
//! .service(Files::new("/static", ".").prefer_utf8(true));
//! ```
#![deny(rust_2018_idioms)]
#![warn(missing_docs, missing_debug_implementations)]
use actix_service::boxed::{BoxService, BoxServiceFactory};
use actix_web::{
dev::{ServiceRequest, ServiceResponse},
error::Error,
http::header::DispositionType,
};
use mime_guess::from_ext;
mod chunked;
mod directory;
mod encoding;
mod error;
mod files;
mod named;
mod path_buf;
mod range;
mod service;
pub use crate::chunked::ChunkedReadFile;
pub use crate::directory::Directory;
pub use crate::files::Files;
pub use crate::named::NamedFile;
pub use crate::range::HttpRange;
pub use crate::service::FilesService;
use self::directory::{directory_listing, DirectoryRenderer};
use self::error::FilesError;
use self::path_buf::PathBufWrap;
type HttpService = BoxService<ServiceRequest, ServiceResponse, Error>;
type HttpNewService = BoxServiceFactory<(), ServiceRequest, ServiceResponse, Error, ()>;
/// Return the MIME type associated with a filename extension (case-insensitive).
/// If `ext` is empty or no associated type for the extension was found, returns
/// the type `application/octet-stream`.
#[inline]
pub fn file_extension_to_mime(ext: &str) -> mime::Mime {
from_ext(ext).first_or_octet_stream()
}
type MimeOverride = dyn Fn(&mime::Name<'_>) -> DispositionType;
#[cfg(test)]
mod tests {
use std::{
fs::{self, File},
ops::Add,
time::{Duration, SystemTime},
};
use actix_service::ServiceFactory;
use actix_web::{
guard,
http::{
header::{self, ContentDisposition, DispositionParam, DispositionType},
Method, StatusCode,
},
middleware::Compress,
test::{self, TestRequest},
web::{self, Bytes},
App, HttpResponse, Responder,
};
use futures_util::future::ok;
use super::*;
#[actix_rt::test]
async fn test_file_extension_to_mime() {
let m = file_extension_to_mime("");
assert_eq!(m, mime::APPLICATION_OCTET_STREAM);
let m = file_extension_to_mime("jpg");
assert_eq!(m, mime::IMAGE_JPEG);
let m = file_extension_to_mime("invalid extension!!");
assert_eq!(m, mime::APPLICATION_OCTET_STREAM);
let m = file_extension_to_mime("");
assert_eq!(m, mime::APPLICATION_OCTET_STREAM);
}
#[actix_rt::test]
async fn test_if_modified_since_without_if_none_match() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since = header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
let req = TestRequest::default()
.insert_header((header::IF_MODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(resp.status(), StatusCode::NOT_MODIFIED);
}
#[actix_rt::test]
async fn test_if_modified_since_without_if_none_match_same() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since = file.last_modified().unwrap();
let req = TestRequest::default()
.insert_header((header::IF_MODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(resp.status(), StatusCode::NOT_MODIFIED);
}
#[actix_rt::test]
async fn test_if_modified_since_with_if_none_match() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since = header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
let req = TestRequest::default()
.insert_header((header::IF_NONE_MATCH, "miss_etag"))
.insert_header((header::IF_MODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_ne!(resp.status(), StatusCode::NOT_MODIFIED);
}
#[actix_rt::test]
async fn test_if_unmodified_since() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since = file.last_modified().unwrap();
let req = TestRequest::default()
.insert_header((header::IF_UNMODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(resp.status(), StatusCode::OK);
}
#[actix_rt::test]
async fn test_if_unmodified_since_failed() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since = header::HttpDate::from(SystemTime::UNIX_EPOCH);
let req = TestRequest::default()
.insert_header((header::IF_UNMODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(resp.status(), StatusCode::PRECONDITION_FAILED);
}
#[actix_rt::test]
async fn test_named_file_text() {
assert!(NamedFile::open("test--").is_err());
let mut file = NamedFile::open("Cargo.toml").unwrap();
{
file.file();
let _f: &File = &file;
}
{
let _f: &mut File = &mut file;
}
let req = TestRequest::default().to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"text/x-toml"
);
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"inline; filename=\"Cargo.toml\""
);
}
#[actix_rt::test]
async fn test_named_file_content_disposition() {
assert!(NamedFile::open("test--").is_err());
let mut file = NamedFile::open("Cargo.toml").unwrap();
{
file.file();
let _f: &File = &file;
}
{
let _f: &mut File = &mut file;
}
let req = TestRequest::default().to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"inline; filename=\"Cargo.toml\""
);
let file = NamedFile::open("Cargo.toml")
.unwrap()
.disable_content_disposition();
let req = TestRequest::default().to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert!(resp.headers().get(header::CONTENT_DISPOSITION).is_none());
}
#[actix_rt::test]
async fn test_named_file_non_ascii_file_name() {
let mut file =
NamedFile::from_file(File::open("Cargo.toml").unwrap(), "貨物.toml").unwrap();
{
file.file();
let _f: &File = &file;
}
{
let _f: &mut File = &mut file;
}
let req = TestRequest::default().to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"text/x-toml"
);
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"inline; filename=\"貨物.toml\"; filename*=UTF-8''%E8%B2%A8%E7%89%A9.toml"
);
}
#[actix_rt::test]
async fn test_named_file_set_content_type() {
let mut file = NamedFile::open("Cargo.toml")
.unwrap()
.set_content_type(mime::TEXT_XML);
{
file.file();
let _f: &File = &file;
}
{
let _f: &mut File = &mut file;
}
let req = TestRequest::default().to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"text/xml"
);
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"inline; filename=\"Cargo.toml\""
);
}
#[actix_rt::test]
async fn test_named_file_image() {
let mut file = NamedFile::open("tests/test.png").unwrap();
{
file.file();
let _f: &File = &file;
}
{
let _f: &mut File = &mut file;
}
let req = TestRequest::default().to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"image/png"
);
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"inline; filename=\"test.png\""
);
}
#[actix_rt::test]
async fn test_named_file_image_attachment() {
let cd = ContentDisposition {
disposition: DispositionType::Attachment,
parameters: vec![DispositionParam::Filename(String::from("test.png"))],
};
let mut file = NamedFile::open("tests/test.png")
.unwrap()
.set_content_disposition(cd);
{
file.file();
let _f: &File = &file;
}
{
let _f: &mut File = &mut file;
}
let req = TestRequest::default().to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"image/png"
);
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"attachment; filename=\"test.png\""
);
}
#[actix_rt::test]
async fn test_named_file_binary() {
let mut file = NamedFile::open("tests/test.binary").unwrap();
{
file.file();
let _f: &File = &file;
}
{
let _f: &mut File = &mut file;
}
let req = TestRequest::default().to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"application/octet-stream"
);
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"attachment; filename=\"test.binary\""
);
}
#[actix_rt::test]
async fn test_named_file_status_code_text() {
let mut file = NamedFile::open("Cargo.toml")
.unwrap()
.set_status_code(StatusCode::NOT_FOUND);
{
file.file();
let _f: &File = &file;
}
{
let _f: &mut File = &mut file;
}
let req = TestRequest::default().to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"text/x-toml"
);
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"inline; filename=\"Cargo.toml\""
);
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
}
#[actix_rt::test]
async fn test_mime_override() {
fn all_attachment(_: &mime::Name<'_>) -> DispositionType {
DispositionType::Attachment
}
let srv = test::init_service(
App::new().service(
Files::new("/", ".")
.mime_override(all_attachment)
.index_file("Cargo.toml"),
),
)
.await;
let request = TestRequest::get().uri("/").to_request();
let response = test::call_service(&srv, request).await;
assert_eq!(response.status(), StatusCode::OK);
let content_disposition = response
.headers()
.get(header::CONTENT_DISPOSITION)
.expect("To have CONTENT_DISPOSITION");
let content_disposition = content_disposition
.to_str()
.expect("Convert CONTENT_DISPOSITION to str");
assert_eq!(content_disposition, "attachment; filename=\"Cargo.toml\"");
}
#[actix_rt::test]
async fn test_named_file_ranges_status_code() {
let srv = test::init_service(
App::new().service(Files::new("/test", ".").index_file("Cargo.toml")),
)
.await;
// Valid range header
let request = TestRequest::get()
.uri("/t%65st/Cargo.toml")
.insert_header((header::RANGE, "bytes=10-20"))
.to_request();
let response = test::call_service(&srv, request).await;
assert_eq!(response.status(), StatusCode::PARTIAL_CONTENT);
// Invalid range header
let request = TestRequest::get()
.uri("/t%65st/Cargo.toml")
.insert_header((header::RANGE, "bytes=1-0"))
.to_request();
let response = test::call_service(&srv, request).await;
assert_eq!(response.status(), StatusCode::RANGE_NOT_SATISFIABLE);
}
#[actix_rt::test]
async fn test_named_file_content_range_headers() {
let srv = test::start(|| App::new().service(Files::new("/", ".")));
// Valid range header
let response = srv
.get("/tests/test.binary")
.insert_header((header::RANGE, "bytes=10-20"))
.send()
.await
.unwrap();
let content_range = response.headers().get(header::CONTENT_RANGE).unwrap();
assert_eq!(content_range.to_str().unwrap(), "bytes 10-20/100");
// Invalid range header
let response = srv
.get("/tests/test.binary")
.insert_header((header::RANGE, "bytes=10-5"))
.send()
.await
.unwrap();
let content_range = response.headers().get(header::CONTENT_RANGE).unwrap();
assert_eq!(content_range.to_str().unwrap(), "bytes */100");
}
#[actix_rt::test]
async fn test_named_file_content_length_headers() {
let srv = test::start(|| App::new().service(Files::new("/", ".")));
// Valid range header
let response = srv
.get("/tests/test.binary")
.insert_header((header::RANGE, "bytes=10-20"))
.send()
.await
.unwrap();
let content_length = response.headers().get(header::CONTENT_LENGTH).unwrap();
assert_eq!(content_length.to_str().unwrap(), "11");
// Valid range header, starting from 0
let response = srv
.get("/tests/test.binary")
.insert_header((header::RANGE, "bytes=0-20"))
.send()
.await
.unwrap();
let content_length = response.headers().get(header::CONTENT_LENGTH).unwrap();
assert_eq!(content_length.to_str().unwrap(), "21");
// Without range header
let mut response = srv.get("/tests/test.binary").send().await.unwrap();
let content_length = response.headers().get(header::CONTENT_LENGTH).unwrap();
assert_eq!(content_length.to_str().unwrap(), "100");
// Should be no transfer-encoding
let transfer_encoding = response.headers().get(header::TRANSFER_ENCODING);
assert!(transfer_encoding.is_none());
// Check file contents
let bytes = response.body().await.unwrap();
let data = web::Bytes::from(fs::read("tests/test.binary").unwrap());
assert_eq!(bytes, data);
}
#[actix_rt::test]
async fn test_head_content_length_headers() {
let srv = test::start(|| App::new().service(Files::new("/", ".")));
let response = srv.head("/tests/test.binary").send().await.unwrap();
let content_length = response
.headers()
.get(header::CONTENT_LENGTH)
.unwrap()
.to_str()
.unwrap();
assert_eq!(content_length, "100");
}
#[actix_rt::test]
async fn test_static_files_with_spaces() {
let srv = test::init_service(
App::new().service(Files::new("/", ".").index_file("Cargo.toml")),
)
.await;
let request = TestRequest::get()
.uri("/tests/test%20space.binary")
.to_request();
let response = test::call_service(&srv, request).await;
assert_eq!(response.status(), StatusCode::OK);
let bytes = test::read_body(response).await;
let data = web::Bytes::from(fs::read("tests/test space.binary").unwrap());
assert_eq!(bytes, data);
}
#[actix_rt::test]
async fn test_files_not_allowed() {
let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
let req = TestRequest::default()
.uri("/Cargo.toml")
.method(Method::POST)
.to_request();
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::METHOD_NOT_ALLOWED);
let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
let req = TestRequest::default()
.method(Method::PUT)
.uri("/Cargo.toml")
.to_request();
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::METHOD_NOT_ALLOWED);
}
#[actix_rt::test]
async fn test_files_guards() {
let srv = test::init_service(
App::new().service(Files::new("/", ".").use_guards(guard::Post())),
)
.await;
let req = TestRequest::default()
.uri("/Cargo.toml")
.method(Method::POST)
.to_request();
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::OK);
}
#[actix_rt::test]
async fn test_named_file_content_encoding() {
let srv = test::init_service(App::new().wrap(Compress::default()).service(
web::resource("/").to(|| async {
NamedFile::open("Cargo.toml")
.unwrap()
.set_content_encoding(header::ContentEncoding::Identity)
}),
))
.await;
let request = TestRequest::get()
.uri("/")
.insert_header((header::ACCEPT_ENCODING, "gzip"))
.to_request();
let res = test::call_service(&srv, request).await;
assert_eq!(res.status(), StatusCode::OK);
assert!(!res.headers().contains_key(header::CONTENT_ENCODING));
}
#[actix_rt::test]
async fn test_named_file_content_encoding_gzip() {
let srv = test::init_service(App::new().wrap(Compress::default()).service(
web::resource("/").to(|| async {
NamedFile::open("Cargo.toml")
.unwrap()
.set_content_encoding(header::ContentEncoding::Gzip)
}),
))
.await;
let request = TestRequest::get()
.uri("/")
.insert_header((header::ACCEPT_ENCODING, "gzip"))
.to_request();
let res = test::call_service(&srv, request).await;
assert_eq!(res.status(), StatusCode::OK);
assert_eq!(
res.headers()
.get(header::CONTENT_ENCODING)
.unwrap()
.to_str()
.unwrap(),
"gzip"
);
}
#[actix_rt::test]
async fn test_named_file_allowed_method() {
let req = TestRequest::default().method(Method::GET).to_http_request();
let file = NamedFile::open("Cargo.toml").unwrap();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(resp.status(), StatusCode::OK);
}
#[actix_rt::test]
async fn test_static_files() {
let srv =
test::init_service(App::new().service(Files::new("/", ".").show_files_listing()))
.await;
let req = TestRequest::with_uri("/missing").to_request();
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
let req = TestRequest::default().to_request();
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
let srv =
test::init_service(App::new().service(Files::new("/", ".").show_files_listing()))
.await;
let req = TestRequest::with_uri("/tests").to_request();
let resp = test::call_service(&srv, req).await;
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"text/html; charset=utf-8"
);
let bytes = test::read_body(resp).await;
assert!(format!("{:?}", bytes).contains("/tests/test.png"));
}
#[actix_rt::test]
async fn test_redirect_to_slash_directory() {
// should not redirect if no index
let srv = test::init_service(
App::new().service(Files::new("/", ".").redirect_to_slash_directory()),
)
.await;
let req = TestRequest::with_uri("/tests").to_request();
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
// should redirect if index present
let srv = test::init_service(
App::new().service(
Files::new("/", ".")
.index_file("test.png")
.redirect_to_slash_directory(),
),
)
.await;
let req = TestRequest::with_uri("/tests").to_request();
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::FOUND);
// should not redirect if the path is wrong
let req = TestRequest::with_uri("/not_existing").to_request();
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
}
#[actix_rt::test]
async fn test_static_files_bad_directory() {
let service = Files::new("/", "./missing").new_service(()).await.unwrap();
let req = TestRequest::with_uri("/").to_srv_request();
let resp = test::call_service(&service, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
}
#[actix_rt::test]
async fn test_default_handler_file_missing() {
let st = Files::new("/", ".")
.default_handler(|req: ServiceRequest| {
ok(req.into_response(HttpResponse::Ok().body("default content")))
})
.new_service(())
.await
.unwrap();
let req = TestRequest::with_uri("/missing").to_srv_request();
let resp = test::call_service(&st, req).await;
assert_eq!(resp.status(), StatusCode::OK);
let bytes = test::read_body(resp).await;
assert_eq!(bytes, web::Bytes::from_static(b"default content"));
}
#[actix_rt::test]
async fn test_serve_index_nested() {
let service = Files::new(".", ".")
.index_file("lib.rs")
.new_service(())
.await
.unwrap();
let req = TestRequest::default().uri("/src").to_srv_request();
let resp = test::call_service(&service, req).await;
assert_eq!(resp.status(), StatusCode::OK);
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"text/x-rust"
);
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"inline; filename=\"lib.rs\""
);
}
#[actix_rt::test]
async fn integration_serve_index() {
let srv = test::init_service(
App::new().service(Files::new("test", ".").index_file("Cargo.toml")),
)
.await;
let req = TestRequest::get().uri("/test").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
let bytes = test::read_body(res).await;
let data = Bytes::from(fs::read("Cargo.toml").unwrap());
assert_eq!(bytes, data);
let req = TestRequest::get().uri("/test/").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
let bytes = test::read_body(res).await;
let data = Bytes::from(fs::read("Cargo.toml").unwrap());
assert_eq!(bytes, data);
// nonexistent index file
let req = TestRequest::get().uri("/test/unknown").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::NOT_FOUND);
let req = TestRequest::get().uri("/test/unknown/").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::NOT_FOUND);
}
#[actix_rt::test]
async fn integration_percent_encoded() {
let srv = test::init_service(
App::new().service(Files::new("test", ".").index_file("Cargo.toml")),
)
.await;
let req = TestRequest::get().uri("/test/%43argo.toml").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
}
}

View File

@@ -1,482 +0,0 @@
use std::fs::{File, Metadata};
use std::io;
use std::ops::{Deref, DerefMut};
use std::path::{Path, PathBuf};
use std::time::{SystemTime, UNIX_EPOCH};
#[cfg(unix)]
use std::os::unix::fs::MetadataExt;
use actix_web::{
dev::{BodyEncoding, SizedStream},
http::{
header::{
self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
},
ContentEncoding, StatusCode,
},
HttpMessage, HttpRequest, HttpResponse, Responder,
};
use bitflags::bitflags;
use mime_guess::from_path;
use crate::ChunkedReadFile;
use crate::{encoding::equiv_utf8_text, range::HttpRange};
bitflags! {
pub(crate) struct Flags: u8 {
const ETAG = 0b0000_0001;
const LAST_MD = 0b0000_0010;
const CONTENT_DISPOSITION = 0b0000_0100;
const PREFER_UTF8 = 0b0000_1000;
}
}
impl Default for Flags {
fn default() -> Self {
Flags::from_bits_truncate(0b0000_0111)
}
}
/// A file with an associated name.
#[derive(Debug)]
pub struct NamedFile {
path: PathBuf,
file: File,
modified: Option<SystemTime>,
pub(crate) md: Metadata,
pub(crate) flags: Flags,
pub(crate) status_code: StatusCode,
pub(crate) content_type: mime::Mime,
pub(crate) content_disposition: header::ContentDisposition,
pub(crate) encoding: Option<ContentEncoding>,
}
impl NamedFile {
/// Creates an instance from a previously opened file.
///
/// The given `path` need not exist and is only used to determine the `ContentType` and
/// `ContentDisposition` headers.
///
/// # Examples
///
/// ```rust
/// use actix_files::NamedFile;
/// use std::io::{self, Write};
/// use std::env;
/// use std::fs::File;
///
/// fn main() -> io::Result<()> {
/// let mut file = File::create("foo.txt")?;
/// file.write_all(b"Hello, world!")?;
/// let named_file = NamedFile::from_file(file, "bar.txt")?;
/// # std::fs::remove_file("foo.txt");
/// Ok(())
/// }
/// ```
pub fn from_file<P: AsRef<Path>>(file: File, path: P) -> io::Result<NamedFile> {
let path = path.as_ref().to_path_buf();
// Get the name of the file and use it to construct default Content-Type
// and Content-Disposition values
let (content_type, content_disposition) = {
let filename = match path.file_name() {
Some(name) => name.to_string_lossy(),
None => {
return Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Provided path has no filename",
));
}
};
let ct = from_path(&path).first_or_octet_stream();
let disposition = match ct.type_() {
mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
_ => DispositionType::Attachment,
};
let mut parameters =
vec![DispositionParam::Filename(String::from(filename.as_ref()))];
if !filename.is_ascii() {
parameters.push(DispositionParam::FilenameExt(ExtendedValue {
charset: Charset::Ext(String::from("UTF-8")),
language_tag: None,
value: filename.into_owned().into_bytes(),
}))
}
let cd = ContentDisposition {
disposition,
parameters,
};
(ct, cd)
};
let md = file.metadata()?;
let modified = md.modified().ok();
let encoding = None;
Ok(NamedFile {
path,
file,
content_type,
content_disposition,
md,
modified,
encoding,
status_code: StatusCode::OK,
flags: Flags::default(),
})
}
/// Attempts to open a file in read-only mode.
///
/// # Examples
///
/// ```rust
/// use actix_files::NamedFile;
///
/// let file = NamedFile::open("foo.txt");
/// ```
pub fn open<P: AsRef<Path>>(path: P) -> io::Result<NamedFile> {
Self::from_file(File::open(&path)?, path)
}
/// Returns reference to the underlying `File` object.
#[inline]
pub fn file(&self) -> &File {
&self.file
}
/// Retrieve the path of this file.
///
/// # Examples
///
/// ```rust
/// # use std::io;
/// use actix_files::NamedFile;
///
/// # fn path() -> io::Result<()> {
/// let file = NamedFile::open("test.txt")?;
/// assert_eq!(file.path().as_os_str(), "foo.txt");
/// # Ok(())
/// # }
/// ```
#[inline]
pub fn path(&self) -> &Path {
self.path.as_path()
}
/// Set response **Status Code**
pub fn set_status_code(mut self, status: StatusCode) -> Self {
self.status_code = status;
self
}
/// Set the MIME Content-Type for serving this file. By default
/// the Content-Type is inferred from the filename extension.
#[inline]
pub fn set_content_type(mut self, mime_type: mime::Mime) -> Self {
self.content_type = mime_type;
self
}
/// Set the Content-Disposition for serving this file. This allows
/// changing the inline/attachment disposition as well as the filename
/// sent to the peer. By default the disposition is `inline` for text,
/// image, and video content types, and `attachment` otherwise, and
/// the filename is taken from the path provided in the `open` method
/// after converting it to UTF-8 using.
/// [`std::ffi::OsStr::to_string_lossy`]
#[inline]
pub fn set_content_disposition(mut self, cd: header::ContentDisposition) -> Self {
self.content_disposition = cd;
self.flags.insert(Flags::CONTENT_DISPOSITION);
self
}
/// Disable `Content-Disposition` header.
///
/// By default Content-Disposition` header is enabled.
#[inline]
pub fn disable_content_disposition(mut self) -> Self {
self.flags.remove(Flags::CONTENT_DISPOSITION);
self
}
/// Set content encoding for serving this file
#[inline]
pub fn set_content_encoding(mut self, enc: ContentEncoding) -> Self {
self.encoding = Some(enc);
self
}
/// Specifies whether to use ETag or not.
///
/// Default is true.
#[inline]
pub fn use_etag(mut self, value: bool) -> Self {
self.flags.set(Flags::ETAG, value);
self
}
/// Specifies whether to use Last-Modified or not.
///
/// Default is true.
#[inline]
pub fn use_last_modified(mut self, value: bool) -> Self {
self.flags.set(Flags::LAST_MD, value);
self
}
/// Specifies whether text responses should signal a UTF-8 encoding.
///
/// Default is false (but will default to true in a future version).
#[inline]
pub fn prefer_utf8(mut self, value: bool) -> Self {
self.flags.set(Flags::PREFER_UTF8, value);
self
}
pub(crate) fn etag(&self) -> Option<header::EntityTag> {
// This etag format is similar to Apache's.
self.modified.as_ref().map(|mtime| {
let ino = {
#[cfg(unix)]
{
self.md.ino()
}
#[cfg(not(unix))]
{
0
}
};
let dur = mtime
.duration_since(UNIX_EPOCH)
.expect("modification time must be after epoch");
header::EntityTag::strong(format!(
"{:x}:{:x}:{:x}:{:x}",
ino,
self.md.len(),
dur.as_secs(),
dur.subsec_nanos()
))
})
}
pub(crate) fn last_modified(&self) -> Option<header::HttpDate> {
self.modified.map(|mtime| mtime.into())
}
/// Creates an `HttpResponse` with file as a streaming body.
pub fn into_response(self, req: &HttpRequest) -> HttpResponse {
if self.status_code != StatusCode::OK {
let mut res = HttpResponse::build(self.status_code);
if self.flags.contains(Flags::PREFER_UTF8) {
let ct = equiv_utf8_text(self.content_type.clone());
res.insert_header((header::CONTENT_TYPE, ct.to_string()));
} else {
res.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
}
if self.flags.contains(Flags::CONTENT_DISPOSITION) {
res.insert_header((
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
));
}
if let Some(current_encoding) = self.encoding {
res.encoding(current_encoding);
}
let reader = ChunkedReadFile::new(self.md.len(), 0, self.file);
return res.streaming(reader);
}
let etag = if self.flags.contains(Flags::ETAG) {
self.etag()
} else {
None
};
let last_modified = if self.flags.contains(Flags::LAST_MD) {
self.last_modified()
} else {
None
};
// check preconditions
let precondition_failed = if !any_match(etag.as_ref(), req) {
true
} else if let (Some(ref m), Some(header::IfUnmodifiedSince(ref since))) =
(last_modified, req.get_header())
{
let t1: SystemTime = m.clone().into();
let t2: SystemTime = since.clone().into();
match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
(Ok(t1), Ok(t2)) => t1.as_secs() > t2.as_secs(),
_ => false,
}
} else {
false
};
// check last modified
let not_modified = if !none_match(etag.as_ref(), req) {
true
} else if req.headers().contains_key(header::IF_NONE_MATCH) {
false
} else if let (Some(ref m), Some(header::IfModifiedSince(ref since))) =
(last_modified, req.get_header())
{
let t1: SystemTime = m.clone().into();
let t2: SystemTime = since.clone().into();
match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
(Ok(t1), Ok(t2)) => t1.as_secs() <= t2.as_secs(),
_ => false,
}
} else {
false
};
let mut resp = HttpResponse::build(self.status_code);
if self.flags.contains(Flags::PREFER_UTF8) {
let ct = equiv_utf8_text(self.content_type.clone());
resp.insert_header((header::CONTENT_TYPE, ct.to_string()));
} else {
resp.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
}
if self.flags.contains(Flags::CONTENT_DISPOSITION) {
resp.insert_header((
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
));
}
// default compressing
if let Some(current_encoding) = self.encoding {
resp.encoding(current_encoding);
}
if let Some(lm) = last_modified {
resp.insert_header((header::LAST_MODIFIED, lm.to_string()));
}
if let Some(etag) = etag {
resp.insert_header((header::ETAG, etag.to_string()));
}
resp.insert_header((header::ACCEPT_RANGES, "bytes"));
let mut length = self.md.len();
let mut offset = 0;
// check for range header
if let Some(ranges) = req.headers().get(header::RANGE) {
if let Ok(ranges_header) = ranges.to_str() {
if let Ok(ranges) = HttpRange::parse(ranges_header, length) {
length = ranges[0].length;
offset = ranges[0].start;
resp.encoding(ContentEncoding::Identity);
resp.insert_header((
header::CONTENT_RANGE,
format!("bytes {}-{}/{}", offset, offset + length - 1, self.md.len()),
));
} else {
resp.insert_header((header::CONTENT_RANGE, format!("bytes */{}", length)));
return resp.status(StatusCode::RANGE_NOT_SATISFIABLE).finish();
};
} else {
return resp.status(StatusCode::BAD_REQUEST).finish();
};
};
if precondition_failed {
return resp.status(StatusCode::PRECONDITION_FAILED).finish();
} else if not_modified {
return resp.status(StatusCode::NOT_MODIFIED).finish();
}
let reader = ChunkedReadFile::new(length, offset, self.file);
if offset != 0 || length != self.md.len() {
resp.status(StatusCode::PARTIAL_CONTENT);
}
resp.body(SizedStream::new(length, reader))
}
}
impl Deref for NamedFile {
type Target = File;
fn deref(&self) -> &File {
&self.file
}
}
impl DerefMut for NamedFile {
fn deref_mut(&mut self) -> &mut File {
&mut self.file
}
}
/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfMatch>() {
None | Some(header::IfMatch::Any) => true,
Some(header::IfMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.strong_eq(some_etag) {
return true;
}
}
}
false
}
}
}
/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfNoneMatch>() {
Some(header::IfNoneMatch::Any) => false,
Some(header::IfNoneMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.weak_eq(some_etag) {
return false;
}
}
}
true
}
None => true,
}
}
impl Responder for NamedFile {
fn respond_to(self, req: &HttpRequest) -> HttpResponse {
self.into_response(req)
}
}

View File

@@ -1,119 +0,0 @@
use std::{
path::{Path, PathBuf},
str::FromStr,
};
use actix_web::{dev::Payload, FromRequest, HttpRequest};
use futures_util::future::{ready, Ready};
use crate::error::UriSegmentError;
#[derive(Debug)]
pub(crate) struct PathBufWrap(PathBuf);
impl FromStr for PathBufWrap {
type Err = UriSegmentError;
fn from_str(path: &str) -> Result<Self, Self::Err> {
Self::parse_path(path, false)
}
}
impl PathBufWrap {
/// Parse a path, giving the choice of allowing hidden files to be considered valid segments.
pub fn parse_path(path: &str, hidden_files: bool) -> Result<Self, UriSegmentError> {
let mut buf = PathBuf::new();
for segment in path.split('/') {
if segment == ".." {
buf.pop();
} else if !hidden_files && segment.starts_with('.') {
return Err(UriSegmentError::BadStart('.'));
} else if segment.starts_with('*') {
return Err(UriSegmentError::BadStart('*'));
} else if segment.ends_with(':') {
return Err(UriSegmentError::BadEnd(':'));
} else if segment.ends_with('>') {
return Err(UriSegmentError::BadEnd('>'));
} else if segment.ends_with('<') {
return Err(UriSegmentError::BadEnd('<'));
} else if segment.is_empty() {
continue;
} else if cfg!(windows) && segment.contains('\\') {
return Err(UriSegmentError::BadChar('\\'));
} else {
buf.push(segment)
}
}
Ok(PathBufWrap(buf))
}
}
impl AsRef<Path> for PathBufWrap {
fn as_ref(&self) -> &Path {
self.0.as_ref()
}
}
impl FromRequest for PathBufWrap {
type Error = UriSegmentError;
type Future = Ready<Result<Self, Self::Error>>;
type Config = ();
fn from_request(req: &HttpRequest, _: &mut Payload) -> Self::Future {
ready(req.match_info().path().parse())
}
}
#[cfg(test)]
mod tests {
use std::iter::FromIterator;
use super::*;
#[test]
fn test_path_buf() {
assert_eq!(
PathBufWrap::from_str("/test/.tt").map(|t| t.0),
Err(UriSegmentError::BadStart('.'))
);
assert_eq!(
PathBufWrap::from_str("/test/*tt").map(|t| t.0),
Err(UriSegmentError::BadStart('*'))
);
assert_eq!(
PathBufWrap::from_str("/test/tt:").map(|t| t.0),
Err(UriSegmentError::BadEnd(':'))
);
assert_eq!(
PathBufWrap::from_str("/test/tt<").map(|t| t.0),
Err(UriSegmentError::BadEnd('<'))
);
assert_eq!(
PathBufWrap::from_str("/test/tt>").map(|t| t.0),
Err(UriSegmentError::BadEnd('>'))
);
assert_eq!(
PathBufWrap::from_str("/seg1/seg2/").unwrap().0,
PathBuf::from_iter(vec!["seg1", "seg2"])
);
assert_eq!(
PathBufWrap::from_str("/seg1/../seg2/").unwrap().0,
PathBuf::from_iter(vec!["seg2"])
);
}
#[test]
fn test_parse_path() {
assert_eq!(
PathBufWrap::parse_path("/test/.tt", false).map(|t| t.0),
Err(UriSegmentError::BadStart('.'))
);
assert_eq!(
PathBufWrap::parse_path("/test/.tt", true).unwrap().0,
PathBuf::from_iter(vec!["test", ".tt"])
);
}
}

View File

@@ -1,310 +0,0 @@
use derive_more::{Display, Error};
/// HTTP Range header representation.
#[derive(Debug, Clone, Copy)]
pub struct HttpRange {
/// Start of range.
pub start: u64,
/// Length of range.
pub length: u64,
}
#[derive(Debug, Clone, Display, Error)]
#[display(fmt = "Parse HTTP Range failed")]
pub struct ParseRangeErr(#[error(not(source))] ());
impl HttpRange {
/// Parses Range HTTP header string as per RFC 2616.
///
/// `header` is HTTP Range header (e.g. `bytes=bytes=0-9`).
/// `size` is full size of response (file).
pub fn parse(header: &str, size: u64) -> Result<Vec<HttpRange>, ParseRangeErr> {
match http_range::HttpRange::parse(header, size) {
Ok(ranges) => Ok(ranges
.iter()
.map(|range| HttpRange {
start: range.start,
length: range.length,
})
.collect()),
Err(_) => Err(ParseRangeErr(())),
}
}
}
#[cfg(test)]
mod tests {
use super::*;
struct T(&'static str, u64, Vec<HttpRange>);
#[test]
fn test_parse() {
let tests = vec![
T("", 0, vec![]),
T("", 1000, vec![]),
T("foo", 0, vec![]),
T("bytes=", 0, vec![]),
T("bytes=7", 10, vec![]),
T("bytes= 7 ", 10, vec![]),
T("bytes=1-", 0, vec![]),
T("bytes=5-4", 10, vec![]),
T("bytes=0-2,5-4", 10, vec![]),
T("bytes=2-5,4-3", 10, vec![]),
T("bytes=--5,4--3", 10, vec![]),
T("bytes=A-", 10, vec![]),
T("bytes=A- ", 10, vec![]),
T("bytes=A-Z", 10, vec![]),
T("bytes= -Z", 10, vec![]),
T("bytes=5-Z", 10, vec![]),
T("bytes=Ran-dom, garbage", 10, vec![]),
T("bytes=0x01-0x02", 10, vec![]),
T("bytes= ", 10, vec![]),
T("bytes= , , , ", 10, vec![]),
T(
"bytes=0-9",
10,
vec![HttpRange {
start: 0,
length: 10,
}],
),
T(
"bytes=0-",
10,
vec![HttpRange {
start: 0,
length: 10,
}],
),
T(
"bytes=5-",
10,
vec![HttpRange {
start: 5,
length: 5,
}],
),
T(
"bytes=0-20",
10,
vec![HttpRange {
start: 0,
length: 10,
}],
),
T(
"bytes=15-,0-5",
10,
vec![HttpRange {
start: 0,
length: 6,
}],
),
T(
"bytes=1-2,5-",
10,
vec![
HttpRange {
start: 1,
length: 2,
},
HttpRange {
start: 5,
length: 5,
},
],
),
T(
"bytes=-2 , 7-",
11,
vec![
HttpRange {
start: 9,
length: 2,
},
HttpRange {
start: 7,
length: 4,
},
],
),
T(
"bytes=0-0 ,2-2, 7-",
11,
vec![
HttpRange {
start: 0,
length: 1,
},
HttpRange {
start: 2,
length: 1,
},
HttpRange {
start: 7,
length: 4,
},
],
),
T(
"bytes=-5",
10,
vec![HttpRange {
start: 5,
length: 5,
}],
),
T(
"bytes=-15",
10,
vec![HttpRange {
start: 0,
length: 10,
}],
),
T(
"bytes=0-499",
10000,
vec![HttpRange {
start: 0,
length: 500,
}],
),
T(
"bytes=500-999",
10000,
vec![HttpRange {
start: 500,
length: 500,
}],
),
T(
"bytes=-500",
10000,
vec![HttpRange {
start: 9500,
length: 500,
}],
),
T(
"bytes=9500-",
10000,
vec![HttpRange {
start: 9500,
length: 500,
}],
),
T(
"bytes=0-0,-1",
10000,
vec![
HttpRange {
start: 0,
length: 1,
},
HttpRange {
start: 9999,
length: 1,
},
],
),
T(
"bytes=500-600,601-999",
10000,
vec![
HttpRange {
start: 500,
length: 101,
},
HttpRange {
start: 601,
length: 399,
},
],
),
T(
"bytes=500-700,601-999",
10000,
vec![
HttpRange {
start: 500,
length: 201,
},
HttpRange {
start: 601,
length: 399,
},
],
),
// Match Apache laxity:
T(
"bytes= 1 -2 , 4- 5, 7 - 8 , ,,",
11,
vec![
HttpRange {
start: 1,
length: 2,
},
HttpRange {
start: 4,
length: 2,
},
HttpRange {
start: 7,
length: 2,
},
],
),
];
for t in tests {
let header = t.0;
let size = t.1;
let expected = t.2;
let res = HttpRange::parse(header, size);
if res.is_err() {
if expected.is_empty() {
continue;
} else {
panic!(
"parse({}, {}) returned error {:?}",
header,
size,
res.unwrap_err()
);
}
}
let got = res.unwrap();
if got.len() != expected.len() {
panic!(
"len(parseRange({}, {})) = {}, want {}",
header,
size,
got.len(),
expected.len()
);
}
for i in 0..expected.len() {
if got[i].start != expected[i].start {
panic!(
"parseRange({}, {})[{}].start = {}, want {}",
header, size, i, got[i].start, expected[i].start
)
}
if got[i].length != expected[i].length {
panic!(
"parseRange({}, {})[{}].length = {}, want {}",
header, size, i, got[i].length, expected[i].length
)
}
}
}
}
}

View File

@@ -1,154 +0,0 @@
use std::{fmt, io, path::PathBuf, rc::Rc, task::Poll};
use actix_service::Service;
use actix_web::{
dev::{ServiceRequest, ServiceResponse},
error::Error,
guard::Guard,
http::{header, Method},
HttpResponse,
};
use futures_util::future::{ok, Either, LocalBoxFuture, Ready};
use crate::{
named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride, NamedFile,
PathBufWrap,
};
/// Assembled file serving service.
pub struct FilesService {
pub(crate) directory: PathBuf,
pub(crate) index: Option<String>,
pub(crate) show_index: bool,
pub(crate) redirect_to_slash: bool,
pub(crate) default: Option<HttpService>,
pub(crate) renderer: Rc<DirectoryRenderer>,
pub(crate) mime_override: Option<Rc<MimeOverride>>,
pub(crate) file_flags: named::Flags,
pub(crate) guards: Option<Rc<dyn Guard>>,
pub(crate) hidden_files: bool,
}
type FilesServiceFuture = Either<
Ready<Result<ServiceResponse, Error>>,
LocalBoxFuture<'static, Result<ServiceResponse, Error>>,
>;
impl FilesService {
fn handle_err(&self, e: io::Error, req: ServiceRequest) -> FilesServiceFuture {
log::debug!("Failed to handle {}: {}", req.path(), e);
if let Some(ref default) = self.default {
Either::Right(default.call(req))
} else {
Either::Left(ok(req.error_response(e)))
}
}
}
impl fmt::Debug for FilesService {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.write_str("FilesService")
}
}
impl Service<ServiceRequest> for FilesService {
type Response = ServiceResponse;
type Error = Error;
type Future = FilesServiceFuture;
actix_service::always_ready!();
fn call(&self, req: ServiceRequest) -> Self::Future {
let is_method_valid = if let Some(guard) = &self.guards {
// execute user defined guards
(**guard).check(req.head())
} else {
// default behavior
matches!(*req.method(), Method::HEAD | Method::GET)
};
if !is_method_valid {
return Either::Left(ok(req.into_response(
actix_web::HttpResponse::MethodNotAllowed()
.insert_header(header::ContentType(mime::TEXT_PLAIN_UTF_8))
.body("Request did not meet this resource's requirements."),
)));
}
let real_path =
match PathBufWrap::parse_path(req.match_info().path(), self.hidden_files) {
Ok(item) => item,
Err(e) => return Either::Left(ok(req.error_response(e))),
};
// full file path
let path = match self.directory.join(&real_path).canonicalize() {
Ok(path) => path,
Err(e) => return self.handle_err(e, req),
};
if path.is_dir() {
if let Some(ref redir_index) = self.index {
if self.redirect_to_slash && !req.path().ends_with('/') {
let redirect_to = format!("{}/", req.path());
return Either::Left(ok(req.into_response(
HttpResponse::Found()
.insert_header((header::LOCATION, redirect_to))
.body("")
.into_body(),
)));
}
let path = path.join(redir_index);
match NamedFile::open(path) {
Ok(mut named_file) => {
if let Some(ref mime_override) = self.mime_override {
let new_disposition =
mime_override(&named_file.content_type.type_());
named_file.content_disposition.disposition = new_disposition;
}
named_file.flags = self.file_flags;
let (req, _) = req.into_parts();
let res = named_file.into_response(&req);
Either::Left(ok(ServiceResponse::new(req, res)))
}
Err(e) => self.handle_err(e, req),
}
} else if self.show_index {
let dir = Directory::new(self.directory.clone(), path);
let (req, _) = req.into_parts();
let x = (self.renderer)(&dir, &req);
match x {
Ok(resp) => Either::Left(ok(resp)),
Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
}
} else {
Either::Left(ok(ServiceResponse::from_err(
FilesError::IsDirectory,
req.into_parts().0,
)))
}
} else {
match NamedFile::open(path) {
Ok(mut named_file) => {
if let Some(ref mime_override) = self.mime_override {
let new_disposition = mime_override(&named_file.content_type.type_());
named_file.content_disposition.disposition = new_disposition;
}
named_file.flags = self.file_flags;
let (req, _) = req.into_parts();
let res = named_file.into_response(&req);
Either::Left(ok(ServiceResponse::new(req, res)))
}
Err(e) => self.handle_err(e, req),
}
}
}
}

View File

@@ -1,38 +0,0 @@
use actix_files::Files;
use actix_web::{
http::{
header::{self, HeaderValue},
StatusCode,
},
test::{self, TestRequest},
App,
};
#[actix_rt::test]
async fn test_utf8_file_contents() {
// use default ISO-8859-1 encoding
let srv = test::init_service(App::new().service(Files::new("/", "./tests"))).await;
let req = TestRequest::with_uri("/utf8.txt").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
assert_eq!(
res.headers().get(header::CONTENT_TYPE),
Some(&HeaderValue::from_static("text/plain")),
);
// prefer UTF-8 encoding
let srv =
test::init_service(App::new().service(Files::new("/", "./tests").prefer_utf8(true)))
.await;
let req = TestRequest::with_uri("/utf8.txt").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
assert_eq!(
res.headers().get(header::CONTENT_TYPE),
Some(&HeaderValue::from_static("text/plain; charset=utf-8")),
);
}

View File

@@ -1 +0,0 @@
<EFBFBD>TǑɂV<EFBFBD>2<EFBFBD>vI<EFBFBD><EFBFBD><EFBFBD>\<5C><52><CB99><EFBFBD>e<EFBFBD><04>vD<76>:藽<>RV<03>Yp<59><70>;<3B><>G<><47>p!2<7F>C<EFBFBD>.<2E> <0C><><EFBFBD><EFBFBD>pA !<21>ߦ<EFBFBD>x j+Uc<55><63><EFBFBD>X<13>c%<17>;<3B>"y<10><>AI

View File

@@ -1,3 +0,0 @@
中文内容显示正确。
English is OK.

View File

@@ -1,90 +0,0 @@
# Changes
## Unreleased - 2021-xx-xx
## 3.0.0-beta.2 - 2021-02-10
* No notable changes.
## 3.0.0-beta.1 - 2021-01-07
* Update `bytes` to `1.0`. [#1813]
[#1813]: https://github.com/actix/actix-web/pull/1813
## 2.1.0 - 2020-11-25
* Add ability to set address for `TestServer`. [#1645]
* Upgrade `base64` to `0.13`.
* Upgrade `serde_urlencoded` to `0.7`. [#1773]
[#1773]: https://github.com/actix/actix-web/pull/1773
[#1645]: https://github.com/actix/actix-web/pull/1645
## 2.0.0 - 2020-09-11
* Update actix-codec and actix-utils dependencies.
## 2.0.0-alpha.1 - 2020-05-23
* Update the `time` dependency to 0.2.7
* Update `actix-connect` dependency to 2.0.0-alpha.2
* Make `test_server` `async` fn.
* Bump minimum supported Rust version to 1.40
* Replace deprecated `net2` crate with `socket2`
* Update `base64` dependency to 0.12
* Update `env_logger` dependency to 0.7
## 1.0.0 - 2019-12-13
* Replaced `TestServer::start()` with `test_server()`
## 1.0.0-alpha.3 - 2019-12-07
* Migrate to `std::future`
## 0.2.5 - 2019-09-17
* Update serde_urlencoded to "0.6.1"
* Increase TestServerRuntime timeouts from 500ms to 3000ms
* Do not override current `System`
## 0.2.4 - 2019-07-18
* Update actix-server to 0.6
## 0.2.3 - 2019-07-16
* Add `delete`, `options`, `patch` methods to `TestServerRunner`
## 0.2.2 - 2019-06-16
* Add .put() and .sput() methods
## 0.2.1 - 2019-06-05
* Add license files
## 0.2.0 - 2019-05-12
* Update awc and actix-http deps
## 0.1.1 - 2019-04-24
* Always make new connection for http client
## 0.1.0 - 2019-04-16
* No changes
## 0.1.0-alpha.3 - 2019-04-02
* Request functions accept path #743
## 0.1.0-alpha.2 - 2019-03-29
* Added TestServerRuntime::load_body() method
* Update actix-http and awc libraries
## 0.1.0-alpha.1 - 2019-03-28
* Initial impl

View File

@@ -1,61 +0,0 @@
[package]
name = "actix-http-test"
version = "3.0.0-beta.2"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Various helpers for Actix applications to use during testing"
readme = "README.md"
keywords = ["http", "web", "framework", "async", "futures"]
homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-http-test/"
categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT OR Apache-2.0"
exclude = [".gitignore", ".cargo/config"]
edition = "2018"
[package.metadata.docs.rs]
features = []
[lib]
name = "actix_http_test"
path = "src/lib.rs"
[features]
default = []
# openssl
openssl = ["tls-openssl", "awc/openssl"]
[dependencies]
actix-service = "2.0.0-beta.4"
actix-codec = "0.4.0-beta.1"
actix-tls = "3.0.0-beta.4"
actix-utils = "3.0.0-beta.2"
actix-rt = "2.1"
actix-server = "2.0.0-beta.3"
awc = { version = "3.0.0-beta.3", default-features = false }
base64 = "0.13"
bytes = "1"
futures-core = { version = "0.3.7", default-features = false }
http = "0.2.2"
log = "0.4"
socket2 = "0.3"
serde = "1.0"
serde_json = "1.0"
slab = "0.4"
serde_urlencoded = "0.7"
time = { version = "0.2.23", default-features = false, features = ["std"] }
tls-openssl = { version = "0.10.9", package = "openssl", optional = true }
[target.'cfg(windows)'.dependencies.tls-openssl]
version = "0.10.9"
package = "openssl"
features = ["vendored"]
optional = true
[dev-dependencies]
actix-web = { version = "4.0.0-beta.3", default-features = false, features = ["cookies"] }
actix-http = "3.0.0-beta.4"

View File

@@ -1 +0,0 @@
../LICENSE-APACHE

View File

@@ -1 +0,0 @@
../LICENSE-MIT

View File

@@ -1,15 +0,0 @@
# actix-http-test
> Various helpers for Actix applications to use during testing.
[![crates.io](https://img.shields.io/crates/v/actix-http-test?label=latest)](https://crates.io/crates/actix-http-test)
[![Documentation](https://docs.rs/actix-http-test/badge.svg?version=2.1.0)](https://docs.rs/actix-http-test/2.1.0)
![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http-test)
[![Dependency Status](https://deps.rs/crate/actix-http-test/2.1.0/status.svg)](https://deps.rs/crate/actix-http-test/2.1.0)
[![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & Resources
- [API Documentation](https://docs.rs/actix-http-test)
- [Chat on Gitter](https://gitter.im/actix/actix-web)
- Minimum Supported Rust Version (MSRV): 1.46.0

View File

@@ -1,271 +0,0 @@
//! Various helpers for Actix applications to use during testing.
#![deny(rust_2018_idioms)]
#![doc(html_logo_url = "https://actix.rs/img/logo.png")]
#![doc(html_favicon_url = "https://actix.rs/favicon.ico")]
#[cfg(feature = "openssl")]
extern crate tls_openssl as openssl;
use std::sync::mpsc;
use std::{net, thread, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_rt::{net::TcpStream, System};
use actix_server::{Server, ServiceFactory};
use awc::{error::PayloadError, ws, Client, ClientRequest, ClientResponse, Connector};
use bytes::Bytes;
use futures_core::stream::Stream;
use http::Method;
use socket2::{Domain, Protocol, Socket, Type};
/// Start test server
///
/// `TestServer` is very simple test server that simplify process of writing
/// integration tests cases for actix web applications.
///
/// # Examples
///
/// ```rust
/// use actix_http::HttpService;
/// use actix_http_test::TestServer;
/// use actix_web::{web, App, HttpResponse, Error};
///
/// async fn my_handler() -> Result<HttpResponse, Error> {
/// Ok(HttpResponse::Ok().into())
/// }
///
/// #[actix_rt::test]
/// async fn test_example() {
/// let mut srv = TestServer::start(
/// || HttpService::new(
/// App::new().service(
/// web::resource("/").to(my_handler))
/// )
/// );
///
/// let req = srv.get("/");
/// let response = req.send().await.unwrap();
/// assert!(response.status().is_success());
/// }
/// ```
pub async fn test_server<F: ServiceFactory<TcpStream>>(factory: F) -> TestServer {
let tcp = net::TcpListener::bind("127.0.0.1:0").unwrap();
test_server_with_addr(tcp, factory).await
}
/// Start [`test server`](test_server()) on a concrete Address
pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
tcp: net::TcpListener,
factory: F,
) -> TestServer {
let (tx, rx) = mpsc::channel();
// run server in separate thread
thread::spawn(move || {
let sys = System::new();
let local_addr = tcp.local_addr().unwrap();
let srv = Server::build()
.listen("test", tcp, factory)?
.workers(1)
.disable_signals();
sys.block_on(async {
srv.run();
tx.send((System::current(), local_addr)).unwrap();
});
sys.run()
});
let (system, addr) = rx.recv().unwrap();
let client = {
let connector = {
#[cfg(feature = "openssl")]
{
use openssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
let mut builder = SslConnector::builder(SslMethod::tls()).unwrap();
builder.set_verify(SslVerifyMode::NONE);
let _ = builder
.set_alpn_protos(b"\x02h2\x08http/1.1")
.map_err(|e| log::error!("Can not set alpn protocol: {:?}", e));
Connector::new()
.conn_lifetime(time::Duration::from_secs(0))
.timeout(time::Duration::from_millis(30000))
.ssl(builder.build())
}
#[cfg(not(feature = "openssl"))]
{
Connector::new()
.conn_lifetime(time::Duration::from_secs(0))
.timeout(time::Duration::from_millis(30000))
}
};
Client::builder().connector(connector).finish()
};
TestServer {
addr,
client,
system,
}
}
/// Get first available unused address
pub fn unused_addr() -> net::SocketAddr {
let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
let socket = Socket::new(Domain::ipv4(), Type::stream(), Some(Protocol::tcp())).unwrap();
socket.bind(&addr.into()).unwrap();
socket.set_reuse_address(true).unwrap();
let tcp = socket.into_tcp_listener();
tcp.local_addr().unwrap()
}
/// Test server controller
pub struct TestServer {
addr: net::SocketAddr,
client: Client,
system: System,
}
impl TestServer {
/// Construct test server url
pub fn addr(&self) -> net::SocketAddr {
self.addr
}
/// Construct test server url
pub fn url(&self, uri: &str) -> String {
if uri.starts_with('/') {
format!("http://localhost:{}{}", self.addr.port(), uri)
} else {
format!("http://localhost:{}/{}", self.addr.port(), uri)
}
}
/// Construct test HTTPS server URL.
pub fn surl(&self, uri: &str) -> String {
if uri.starts_with('/') {
format!("https://localhost:{}{}", self.addr.port(), uri)
} else {
format!("https://localhost:{}/{}", self.addr.port(), uri)
}
}
/// Create `GET` request
pub fn get<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.get(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `GET` request
pub fn sget<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.get(self.surl(path.as_ref()).as_str())
}
/// Create `POST` request
pub fn post<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.post(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `POST` request
pub fn spost<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.post(self.surl(path.as_ref()).as_str())
}
/// Create `HEAD` request
pub fn head<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.head(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `HEAD` request
pub fn shead<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.head(self.surl(path.as_ref()).as_str())
}
/// Create `PUT` request
pub fn put<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.put(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `PUT` request
pub fn sput<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.put(self.surl(path.as_ref()).as_str())
}
/// Create `PATCH` request
pub fn patch<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.patch(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `PATCH` request
pub fn spatch<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.patch(self.surl(path.as_ref()).as_str())
}
/// Create `DELETE` request
pub fn delete<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.delete(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `DELETE` request
pub fn sdelete<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.delete(self.surl(path.as_ref()).as_str())
}
/// Create `OPTIONS` request
pub fn options<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.options(self.url(path.as_ref()).as_str())
}
/// Create HTTPS `OPTIONS` request
pub fn soptions<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.options(self.surl(path.as_ref()).as_str())
}
/// Connect to test HTTP server
pub fn request<S: AsRef<str>>(&self, method: Method, path: S) -> ClientRequest {
self.client.request(method, path.as_ref())
}
pub async fn load_body<S>(
&mut self,
mut response: ClientResponse<S>,
) -> Result<Bytes, PayloadError>
where
S: Stream<Item = Result<Bytes, PayloadError>> + Unpin + 'static,
{
response.body().limit(10_485_760).await
}
/// Connect to WebSocket server at a given path.
pub async fn ws_at(
&mut self,
path: &str,
) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
let url = self.url(path);
let connect = self.client.ws(url).connect();
connect.await.map(|(_, framed)| framed)
}
/// Connect to a WebSocket server.
pub async fn ws(
&mut self,
) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
self.ws_at("/").await
}
/// Stop HTTP server
fn stop(&mut self) {
self.system.stop();
}
}
impl Drop for TestServer {
fn drop(&mut self) {
self.stop()
}
}

View File

@@ -1,453 +0,0 @@
# Changes
## Unreleased - 2021-xx-xx
## 3.0.0-beta.4 - 2021-03-08
### Changed
* Feature `cookies` is now optional and disabled by default. [#1981]
* `ws::hash_key` now returns array. [#2035]
* `ResponseBuilder::json` now takes `impl Serialize`. [#2052]
### Removed
* Re-export of `futures_channel::oneshot::Canceled` is removed from `error` mod. [#1994]
* `ResponseError` impl for `futures_channel::oneshot::Canceled` is removed. [#1994]
[#1981]: https://github.com/actix/actix-web/pull/1981
[#1994]: https://github.com/actix/actix-web/pull/1994
[#2035]: https://github.com/actix/actix-web/pull/2035
[#2052]: https://github.com/actix/actix-web/pull/2052
## 3.0.0-beta.3 - 2021-02-10
* No notable changes.
## 3.0.0-beta.2 - 2021-02-10
### Added
* `IntoHeaderPair` trait that allows using typed and untyped headers in the same methods. [#1869]
* `ResponseBuilder::insert_header` method which allows using typed headers. [#1869]
* `ResponseBuilder::append_header` method which allows using typed headers. [#1869]
* `TestRequest::insert_header` method which allows using typed headers. [#1869]
* `ContentEncoding` implements all necessary header traits. [#1912]
* `HeaderMap::len_keys` has the behavior of the old `len` method. [#1964]
* `HeaderMap::drain` as an efficient draining iterator. [#1964]
* Implement `IntoIterator` for owned `HeaderMap`. [#1964]
* `trust-dns` optional feature to enable `trust-dns-resolver` as client dns resolver. [#1969]
### Changed
* `ResponseBuilder::content_type` now takes an `impl IntoHeaderValue` to support using typed
`mime` types. [#1894]
* Renamed `IntoHeaderValue::{try_into => try_into_value}` to avoid ambiguity with std
`TryInto` trait. [#1894]
* `Extensions::insert` returns Option of replaced item. [#1904]
* Remove `HttpResponseBuilder::json2()`. [#1903]
* Enable `HttpResponseBuilder::json()` to receive data by value and reference. [#1903]
* `client::error::ConnectError` Resolver variant contains `Box<dyn std::error::Error>` type. [#1905]
* `client::ConnectorConfig` default timeout changed to 5 seconds. [#1905]
* Simplify `BlockingError` type to a unit struct. It's now only triggered when blocking thread pool
is dead. [#1957]
* `HeaderMap::len` now returns number of values instead of number of keys. [#1964]
* `HeaderMap::insert` now returns iterator of removed values. [#1964]
* `HeaderMap::remove` now returns iterator of removed values. [#1964]
### Removed
* `ResponseBuilder::set`; use `ResponseBuilder::insert_header`. [#1869]
* `ResponseBuilder::set_header`; use `ResponseBuilder::insert_header`. [#1869]
* `ResponseBuilder::header`; use `ResponseBuilder::append_header`. [#1869]
* `TestRequest::with_hdr`; use `TestRequest::default().insert_header()`. [#1869]
* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
* `actors` optional feature. [#1969]
* `ResponseError` impl for `actix::MailboxError`. [#1969]
### Documentation
* Vastly improve docs and add examples for `HeaderMap`. [#1964]
[#1869]: https://github.com/actix/actix-web/pull/1869
[#1894]: https://github.com/actix/actix-web/pull/1894
[#1903]: https://github.com/actix/actix-web/pull/1903
[#1904]: https://github.com/actix/actix-web/pull/1904
[#1905]: https://github.com/actix/actix-web/pull/1905
[#1912]: https://github.com/actix/actix-web/pull/1912
[#1957]: https://github.com/actix/actix-web/pull/1957
[#1964]: https://github.com/actix/actix-web/pull/1964
[#1969]: https://github.com/actix/actix-web/pull/1969
## 3.0.0-beta.1 - 2021-01-07
### Added
* Add `Http3` to `Protocol` enum for future compatibility and also mark `#[non_exhaustive]`.
### Changed
* Update `actix-*` dependencies to tokio `1.0` based versions. [#1813]
* Bumped `rand` to `0.8`.
* Update `bytes` to `1.0`. [#1813]
* Update `h2` to `0.3`. [#1813]
* The `ws::Message::Text` enum variant now contains a `bytestring::ByteString`. [#1864]
### Removed
* Deprecated `on_connect` methods have been removed. Prefer the new
`on_connect_ext` technique. [#1857]
* Remove `ResponseError` impl for `actix::actors::resolver::ResolverError`
due to deprecate of resolver actor. [#1813]
* Remove `ConnectError::SslHandshakeError` and re-export of `HandshakeError`.
due to the removal of this type from `tokio-openssl` crate. openssl handshake
error would return as `ConnectError::SslError`. [#1813]
* Remove `actix-threadpool` dependency. Use `actix_rt::task::spawn_blocking`.
Due to this change `actix_threadpool::BlockingError` type is moved into
`actix_http::error` module. [#1878]
[#1813]: https://github.com/actix/actix-web/pull/1813
[#1857]: https://github.com/actix/actix-web/pull/1857
[#1864]: https://github.com/actix/actix-web/pull/1864
[#1878]: https://github.com/actix/actix-web/pull/1878
## 2.2.0 - 2020-11-25
### Added
* HttpResponse builders for 1xx status codes. [#1768]
* `Accept::mime_precedence` and `Accept::mime_preference`. [#1793]
* `TryFrom<u16>` and `TryFrom<f32>` for `http::header::Quality`. [#1797]
### Fixed
* Started dropping `transfer-encoding: chunked` and `Content-Length` for 1XX and 204 responses. [#1767]
### Changed
* Upgrade `serde_urlencoded` to `0.7`. [#1773]
[#1773]: https://github.com/actix/actix-web/pull/1773
[#1767]: https://github.com/actix/actix-web/pull/1767
[#1768]: https://github.com/actix/actix-web/pull/1768
[#1793]: https://github.com/actix/actix-web/pull/1793
[#1797]: https://github.com/actix/actix-web/pull/1797
## 2.1.0 - 2020-10-30
### Added
* Added more flexible `on_connect_ext` methods for on-connect handling. [#1754]
### Changed
* Upgrade `base64` to `0.13`. [#1744]
* Upgrade `pin-project` to `1.0`. [#1733]
* Deprecate `ResponseBuilder::{if_some, if_true}`. [#1760]
[#1760]: https://github.com/actix/actix-web/pull/1760
[#1754]: https://github.com/actix/actix-web/pull/1754
[#1733]: https://github.com/actix/actix-web/pull/1733
[#1744]: https://github.com/actix/actix-web/pull/1744
## 2.0.0 - 2020-09-11
* No significant changes from `2.0.0-beta.4`.
## 2.0.0-beta.4 - 2020-09-09
### Changed
* Update actix-codec and actix-utils dependencies.
* Update actix-connect and actix-tls dependencies.
## 2.0.0-beta.3 - 2020-08-14
### Fixed
* Memory leak of `client::pool::ConnectorPoolSupport`. [#1626]
[#1626]: https://github.com/actix/actix-web/pull/1626
## 2.0.0-beta.2 - 2020-07-21
### Fixed
* Potential UB in h1 decoder using uninitialized memory. [#1614]
### Changed
* Fix illegal chunked encoding. [#1615]
[#1614]: https://github.com/actix/actix-web/pull/1614
[#1615]: https://github.com/actix/actix-web/pull/1615
## 2.0.0-beta.1 - 2020-07-11
### Changed
* Migrate cookie handling to `cookie` crate. [#1558]
* Update `sha-1` to 0.9. [#1586]
* Fix leak in client pool. [#1580]
* MSRV is now 1.41.1.
[#1558]: https://github.com/actix/actix-web/pull/1558
[#1586]: https://github.com/actix/actix-web/pull/1586
[#1580]: https://github.com/actix/actix-web/pull/1580
## 2.0.0-alpha.4 - 2020-05-21
### Changed
* Bump minimum supported Rust version to 1.40
* content_length function is removed, and you can set Content-Length by calling
no_chunking function [#1439]
* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
`u64` instead of a `usize`.
* Update `base64` dependency to 0.12
### Fixed
* Support parsing of `SameSite=None` [#1503]
[#1439]: https://github.com/actix/actix-web/pull/1439
[#1503]: https://github.com/actix/actix-web/pull/1503
## 2.0.0-alpha.3 - 2020-05-08
### Fixed
* Correct spelling of ConnectError::Unresolved [#1487]
* Fix a mistake in the encoding of websocket continuation messages wherein
Item::FirstText and Item::FirstBinary are each encoded as the other.
### Changed
* Implement `std::error::Error` for our custom errors [#1422]
* Remove `failure` support for `ResponseError` since that crate
will be deprecated in the near future.
[#1422]: https://github.com/actix/actix-web/pull/1422
[#1487]: https://github.com/actix/actix-web/pull/1487
## 2.0.0-alpha.2 - 2020-03-07
### Changed
* Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB
respectively to improve download speed for awc when downloading large objects. [#1394]
* client::Connector accepts initial_window_size and initial_connection_window_size
HTTP2 configuration. [#1394]
* client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
[#1394]: https://github.com/actix/actix-web/pull/1394
[#1395]: https://github.com/actix/actix-web/pull/1395
## 2.0.0-alpha.1 - 2020-02-27
### Changed
* Update the `time` dependency to 0.2.7.
* Moved actors messages support from actix crate, enabled with feature `actors`.
* Breaking change: trait MessageBody requires Unpin and accepting `Pin<&mut Self>` instead of
`&mut self` in the poll_next().
* MessageBody is not implemented for &'static [u8] anymore.
### Fixed
* Allow `SameSite=None` cookies to be sent in a response.
## 1.0.1 - 2019-12-20
### Fixed
* Poll upgrade service's readiness from HTTP service handlers
* Replace brotli with brotli2 #1224
## 1.0.0 - 2019-12-13
### Added
* Add websockets continuation frame support
### Changed
* Replace `flate2-xxx` features with `compress`
## 1.0.0-alpha.5 - 2019-12-09
### Fixed
* Check `Upgrade` service readiness before calling it
* Fix buffer remaining capacity calculation
### Changed
* Websockets: Ping and Pong should have binary data #1049
## 1.0.0-alpha.4 - 2019-12-08
### Added
* Add impl ResponseBuilder for Error
### Changed
* Use rust based brotli compression library
## 1.0.0-alpha.3 - 2019-12-07
### Changed
* Migrate to tokio 0.2
* Migrate to `std::future`
## 0.2.11 - 2019-11-06
### Added
* Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
* Add an additional `filename*` param in the `Content-Disposition` header of
`actix_files::NamedFile` to be more compatible. (#1151)
* Allow to use `std::convert::Infallible` as `actix_http::error::Error`
### Fixed
* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain;
charset=utf-8` header [#1118]
[#1878]: https://github.com/actix/actix-web/pull/1878
## 0.2.10 - 2019-09-11
### Added
* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests
with `RequestHead`
### Fixed
* h2 will use error response #1080
* on_connect result isn't added to request extensions for http2 requests #1009
## 0.2.9 - 2019-08-13
### Changed
* Dropped the `byteorder`-dependency in favor of `stdlib`-implementation
* Update percent-encoding to 2.1
* Update serde_urlencoded to 0.6.1
### Fixed
* Fixed a panic in the HTTP2 handshake in client HTTP requests (#1031)
## 0.2.8 - 2019-08-01
### Added
* Add `rustls` support
* Add `Clone` impl for `HeaderMap`
### Fixed
* awc client panic #1016
* Invalid response with compression middleware enabled, but compression-related features
disabled #997
## 0.2.7 - 2019-07-18
### Added
* Add support for downcasting response errors #986
## 0.2.6 - 2019-07-17
### Changed
* Replace `ClonableService` with local copy
* Upgrade `rand` dependency version to 0.7
## 0.2.5 - 2019-06-28
### Added
* Add `on-connect` callback, `HttpServiceBuilder::on_connect()` #946
### Changed
* Use `encoding_rs` crate instead of unmaintained `encoding` crate
* Add `Copy` and `Clone` impls for `ws::Codec`
## 0.2.4 - 2019-06-16
### Fixed
* Do not compress NoContent (204) responses #918
## 0.2.3 - 2019-06-02
### Added
* Debug impl for ResponseBuilder
* From SizedStream and BodyStream for Body
### Changed
* SizedStream uses u64
## 0.2.2 - 2019-05-29
### Fixed
* Parse incoming stream before closing stream on disconnect #868
## 0.2.1 - 2019-05-25
### Fixed
* Handle socket read disconnect
## 0.2.0 - 2019-05-12
### Changed
* Update actix-service to 0.4
* Expect and upgrade services accept `ServerConfig` config.
### Deleted
* `OneRequest` service
## 0.1.5 - 2019-05-04
### Fixed
* Clean up response extensions in response pool #817
## 0.1.4 - 2019-04-24
### Added
* Allow to render h1 request headers in `Camel-Case`
### Fixed
* Read until eof for http/1.0 responses #771
## 0.1.3 - 2019-04-23
### Fixed
* Fix http client pool management
* Fix http client wait queue management #794
## 0.1.2 - 2019-04-23
### Fixed
* Fix BorrowMutError panic in client connector #793
## 0.1.1 - 2019-04-19
### Changed
* Cookie::max_age() accepts value in seconds
* Cookie::max_age_time() accepts value in time::Duration
* Allow to specify server address for client connector
## 0.1.0 - 2019-04-16
### Added
* Expose peer addr via `Request::peer_addr()` and `RequestHead::peer_addr`
### Changed
* `actix_http::encoding` always available
* use trust-dns-resolver 0.11.0
## 0.1.0-alpha.5 - 2019-04-12
### Added
* Allow to use custom service for upgrade requests
* Added `h1::SendResponse` future.
### Changed
* MessageBody::length() renamed to MessageBody::size() for consistency
* ws handshake verification functions take RequestHead instead of Request
## 0.1.0-alpha.4 - 2019-04-08
### Added
* Allow to use custom `Expect` handler
* Add minimal `std::error::Error` impl for `Error`
### Changed
* Export IntoHeaderValue
* Render error and return as response body
* Use thread pool for response body compression
### Deleted
* Removed PayloadBuffer
## 0.1.0-alpha.3 - 2019-04-02
### Added
* Warn when an unsealed private cookie isn't valid UTF-8
### Fixed
* Rust 1.31.0 compatibility
* Preallocate read buffer for h1 codec
* Detect socket disconnection during protocol selection
## 0.1.0-alpha.2 - 2019-03-29
### Added
* Added ws::Message::Nop, no-op websockets message
### Changed
* Do not use thread pool for decompression if chunk size is smaller than 2048.
## 0.1.0-alpha.1 - 2019-03-28
* Initial impl

View File

@@ -1,120 +0,0 @@
[package]
name = "actix-http"
version = "3.0.0-beta.4"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "HTTP primitives for the Actix ecosystem"
readme = "README.md"
keywords = ["actix", "http", "framework", "async", "futures"]
homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-http/"
categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT OR Apache-2.0"
edition = "2018"
[package.metadata.docs.rs]
# features that docs.rs will build with
features = ["openssl", "rustls", "compress", "cookies", "secure-cookies"]
[lib]
name = "actix_http"
path = "src/lib.rs"
[features]
default = []
# openssl
openssl = ["actix-tls/openssl"]
# rustls support
rustls = ["actix-tls/rustls"]
# enable compression support
compress = ["flate2", "brotli2"]
# support for cookies
cookies = ["cookie"]
# support for secure cookies
secure-cookies = ["cookies", "cookie/secure"]
# trust-dns as client dns resolver
trust-dns = ["trust-dns-resolver"]
[dependencies]
actix-service = "2.0.0-beta.4"
actix-codec = "0.4.0-beta.1"
actix-utils = "3.0.0-beta.2"
actix-rt = "2.1"
actix-tls = "3.0.0-beta.4"
ahash = "0.7"
base64 = "0.13"
bitflags = "1.2"
bytes = "1"
bytestring = "1"
cfg-if = "1"
cookie = { version = "0.14.1", features = ["percent-encode"], optional = true }
derive_more = "0.99.5"
encoding_rs = "0.8"
futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
futures-util = { version = "0.3.7", default-features = false, features = ["alloc", "sink"] }
h2 = "0.3.1"
http = "0.2.2"
httparse = "1.3"
itoa = "0.4"
language-tags = "0.2"
once_cell = "1.5"
log = "0.4"
mime = "0.3"
percent-encoding = "2.1"
pin-project = "1.0.0"
rand = "0.8"
regex = "1.3"
serde = "1.0"
serde_json = "1.0"
serde_urlencoded = "0.7"
sha-1 = "0.9"
smallvec = "1.6"
time = { version = "0.2.23", default-features = false, features = ["std"] }
tokio = { version = "1.2", features = ["sync"] }
# compression
brotli2 = { version="0.3.2", optional = true }
flate2 = { version = "1.0.13", optional = true }
trust-dns-resolver = { version = "0.20.0", optional = true }
[dev-dependencies]
actix-server = "2.0.0-beta.3"
actix-http-test = { version = "3.0.0-beta.2", features = ["openssl"] }
actix-tls = { version = "3.0.0-beta.4", features = ["openssl"] }
criterion = "0.3"
env_logger = "0.8"
rcgen = "0.8"
serde_derive = "1.0"
tls-openssl = { version = "0.10", package = "openssl" }
tls-rustls = { version = "0.19", package = "rustls" }
[target.'cfg(windows)'.dev-dependencies.tls-openssl]
version = "0.10.9"
package = "openssl"
features = ["vendored"]
[[example]]
name = "ws"
required-features = ["rustls"]
[[bench]]
name = "write-camel-case"
harness = false
[[bench]]
name = "status-line"
harness = false
[[bench]]
name = "uninit-headers"
harness = false

View File

@@ -1 +0,0 @@
../LICENSE-APACHE

View File

@@ -1 +0,0 @@
../LICENSE-MIT

View File

@@ -1,67 +0,0 @@
# actix-http
> HTTP primitives for the Actix ecosystem.
[![crates.io](https://img.shields.io/crates/v/actix-http?label=latest)](https://crates.io/crates/actix-http)
[![Documentation](https://docs.rs/actix-http/badge.svg?version=3.0.0-beta.4)](https://docs.rs/actix-http/3.0.0-beta.4)
[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http.svg)
<br />
[![dependency status](https://deps.rs/crate/actix-http/3.0.0-beta.4/status.svg)](https://deps.rs/crate/actix-http/3.0.0-beta.4)
[![Download](https://img.shields.io/crates/d/actix-http.svg)](https://crates.io/crates/actix-http)
[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & Resources
- [API Documentation](https://docs.rs/actix-http)
- [Chat on Gitter](https://gitter.im/actix/actix-web)
- Minimum Supported Rust Version (MSRV): 1.46.0
## Example
```rust
use std::{env, io};
use actix_http::{HttpService, Response};
use actix_server::Server;
use futures_util::future;
use http::header::HeaderValue;
use log::info;
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "hello_world=info");
env_logger::init();
Server::build()
.bind("hello-world", "127.0.0.1:8080", || {
HttpService::build()
.client_timeout(1000)
.client_disconnect(1000)
.finish(|_req| {
info!("{:?}", _req);
let mut res = Response::Ok();
res.header("x-head", HeaderValue::from_static("dummy value!"));
future::ok::<_, ()>(res.body("Hello world!"))
})
.tcp()
})?
.run()
.await
}
```
## License
This project is licensed under either of
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
* MIT license ([LICENSE-MIT](LICENSE-MIT) or [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
at your option.
## Code of Conduct
Contribution to the actix-http crate is organized under the terms of the
Contributor Covenant, the maintainer of actix-http, @fafhrd91, promises to
intervene to uphold that code of conduct.

View File

@@ -1,222 +0,0 @@
use criterion::{criterion_group, criterion_main, BenchmarkId, Criterion};
use bytes::BytesMut;
use http::Version;
const CODES: &[u16] = &[201, 303, 404, 515];
fn bench_write_status_line_11(c: &mut Criterion) {
let mut group = c.benchmark_group("write_status_line v1.1");
let version = Version::HTTP_11;
for i in CODES.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_naive::write_status_line(version, i, &mut b);
})
});
}
group.finish();
}
fn bench_write_status_line_10(c: &mut Criterion) {
let mut group = c.benchmark_group("write_status_line v1.0");
let version = Version::HTTP_10;
for i in CODES.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_naive::write_status_line(version, i, &mut b);
})
});
}
group.finish();
}
fn bench_write_status_line_09(c: &mut Criterion) {
let mut group = c.benchmark_group("write_status_line v0.9");
let version = Version::HTTP_09;
for i in CODES.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_naive::write_status_line(version, i, &mut b);
})
});
}
group.finish();
}
criterion_group!(
benches,
bench_write_status_line_11,
bench_write_status_line_10,
bench_write_status_line_09
);
criterion_main!(benches);
mod _naive {
use bytes::{BufMut, BytesMut};
use http::Version;
pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
match version {
Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
_ => {
// other HTTP version handlers do not use this method
}
}
bytes.put_slice(n.to_string().as_bytes());
}
}
mod _new {
use bytes::{BufMut, BytesMut};
use http::Version;
const DIGITS_START: u8 = b'0';
pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
match version {
Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
_ => {
// other HTTP version handlers do not use this method
}
}
let d100 = (n / 100) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
bytes.put_u8(b' ');
}
}
mod _original {
use std::ptr;
use bytes::{BufMut, BytesMut};
use http::Version;
const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
2021222324252627282930313233343536373839\
4041424344454647484950515253545556575859\
6061626364656667686970717273747576777879\
8081828384858687888990919293949596979899";
pub(crate) const STATUS_LINE_BUF_SIZE: usize = 13;
pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesMut) {
let mut buf: [u8; STATUS_LINE_BUF_SIZE] = *b"HTTP/1.1 ";
match version {
Version::HTTP_2 => buf[5] = b'2',
Version::HTTP_10 => buf[7] = b'0',
Version::HTTP_09 => {
buf[5] = b'0';
buf[7] = b'9';
}
_ => {}
}
let mut curr: isize = 12;
let buf_ptr = buf.as_mut_ptr();
let lut_ptr = DEC_DIGITS_LUT.as_ptr();
let four = n > 999;
// decode 2 more chars, if > 2 chars
let d1 = (n % 100) << 1;
n /= 100;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(
lut_ptr.offset(d1 as isize),
buf_ptr.offset(curr),
2,
);
}
// decode last 1 or 2 chars
if n < 10 {
curr -= 1;
unsafe {
*buf_ptr.offset(curr) = (n as u8) + b'0';
}
} else {
let d1 = n << 1;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(
lut_ptr.offset(d1 as isize),
buf_ptr.offset(curr),
2,
);
}
}
bytes.put_slice(&buf);
if four {
bytes.put_u8(b' ');
}
}
}

View File

@@ -1,137 +0,0 @@
use criterion::{criterion_group, criterion_main, Criterion};
use bytes::BytesMut;
// A Miri run detects UB, seen on this playground:
// https://play.rust-lang.org/?version=stable&mode=debug&edition=2018&gist=f5d9aa166aa48df8dca05fce2b6c3915
fn bench_header_parsing(c: &mut Criterion) {
c.bench_function("Original (Unsound) [short]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ_SHORT);
_original::parse_headers(&mut buf);
})
});
c.bench_function("New (safe) [short]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ_SHORT);
_new::parse_headers(&mut buf);
})
});
c.bench_function("Original (Unsound) [realistic]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ);
_original::parse_headers(&mut buf);
})
});
c.bench_function("New (safe) [realistic]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ);
_new::parse_headers(&mut buf);
})
});
}
criterion_group!(benches, bench_header_parsing);
criterion_main!(benches);
const MAX_HEADERS: usize = 96;
const EMPTY_HEADER_ARRAY: [httparse::Header<'static>; MAX_HEADERS] =
[httparse::EMPTY_HEADER; MAX_HEADERS];
#[derive(Clone, Copy)]
struct HeaderIndex {
name: (usize, usize),
value: (usize, usize),
}
const EMPTY_HEADER_INDEX: HeaderIndex = HeaderIndex {
name: (0, 0),
value: (0, 0),
};
const EMPTY_HEADER_INDEX_ARRAY: [HeaderIndex; MAX_HEADERS] =
[EMPTY_HEADER_INDEX; MAX_HEADERS];
impl HeaderIndex {
fn record(
bytes: &[u8],
headers: &[httparse::Header<'_>],
indices: &mut [HeaderIndex],
) {
let bytes_ptr = bytes.as_ptr() as usize;
for (header, indices) in headers.iter().zip(indices.iter_mut()) {
let name_start = header.name.as_ptr() as usize - bytes_ptr;
let name_end = name_start + header.name.len();
indices.name = (name_start, name_end);
let value_start = header.value.as_ptr() as usize - bytes_ptr;
let value_end = value_start + header.value.len();
indices.value = (value_start, value_end);
}
}
}
// test cases taken from:
// https://github.com/seanmonstar/httparse/blob/master/benches/parse.rs
const REQ_SHORT: &'static [u8] = b"\
GET / HTTP/1.0\r\n\
Host: example.com\r\n\
Cookie: session=60; user_id=1\r\n\r\n";
const REQ: &'static [u8] = b"\
GET /wp-content/uploads/2010/03/hello-kitty-darth-vader-pink.jpg HTTP/1.1\r\n\
Host: www.kittyhell.com\r\n\
User-Agent: Mozilla/5.0 (Macintosh; U; Intel Mac OS X 10.6; ja-JP-mac; rv:1.9.2.3) Gecko/20100401 Firefox/3.6.3 Pathtraq/0.9\r\n\
Accept: text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8\r\n\
Accept-Language: ja,en-us;q=0.7,en;q=0.3\r\n\
Accept-Encoding: gzip,deflate\r\n\
Accept-Charset: Shift_JIS,utf-8;q=0.7,*;q=0.7\r\n\
Keep-Alive: 115\r\n\
Connection: keep-alive\r\n\
Cookie: wp_ozh_wsa_visits=2; wp_ozh_wsa_visit_lasttime=xxxxxxxxxx; __utma=xxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.x; __utmz=xxxxxxxxx.xxxxxxxxxx.x.x.utmccn=(referral)|utmcsr=reader.livedoor.com|utmcct=/reader/|utmcmd=referral|padding=under256\r\n\r\n";
mod _new {
use super::*;
pub fn parse_headers(src: &mut BytesMut) -> usize {
let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
let mut req = httparse::Request::new(&mut parsed);
match req.parse(src).unwrap() {
httparse::Status::Complete(_len) => {
HeaderIndex::record(src, req.headers, &mut headers);
req.headers.len()
}
_ => unreachable!(),
}
}
}
mod _original {
use super::*;
use std::mem::MaybeUninit;
pub fn parse_headers(src: &mut BytesMut) -> usize {
let mut headers: [HeaderIndex; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut req = httparse::Request::new(&mut parsed);
match req.parse(src).unwrap() {
httparse::Status::Complete(_len) => {
HeaderIndex::record(src, req.headers, &mut headers);
req.headers.len()
}
_ => unreachable!(),
}
}
}

View File

@@ -1,89 +0,0 @@
use criterion::{black_box, criterion_group, criterion_main, BenchmarkId, Criterion};
fn bench_write_camel_case(c: &mut Criterion) {
let mut group = c.benchmark_group("write_camel_case");
let names = ["connection", "Transfer-Encoding", "transfer-encoding"];
for &i in &names {
let bts = i.as_bytes();
group.bench_with_input(BenchmarkId::new("Original", i), bts, |b, bts| {
b.iter(|| {
let mut buf = black_box([0; 24]);
_original::write_camel_case(black_box(bts), &mut buf)
});
});
group.bench_with_input(BenchmarkId::new("New", i), bts, |b, bts| {
b.iter(|| {
let mut buf = black_box([0; 24]);
_new::write_camel_case(black_box(bts), &mut buf)
});
});
}
group.finish();
}
criterion_group!(benches, bench_write_camel_case);
criterion_main!(benches);
mod _new {
pub fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
// first copy entire (potentially wrong) slice to output
buffer[..value.len()].copy_from_slice(value);
let mut iter = value.iter();
// first character should be uppercase
if let Some(c @ b'a'..=b'z') = iter.next() {
buffer[0] = c & 0b1101_1111;
}
// track 1 ahead of the current position since that's the location being assigned to
let mut index = 2;
// remaining characters after hyphens should also be uppercase
while let Some(&c) = iter.next() {
if c == b'-' {
// advance iter by one and uppercase if needed
if let Some(c @ b'a'..=b'z') = iter.next() {
buffer[index] = c & 0b1101_1111;
}
}
index += 1;
}
}
}
mod _original {
pub fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
let mut index = 0;
let key = value;
let mut key_iter = key.iter();
if let Some(c) = key_iter.next() {
if *c >= b'a' && *c <= b'z' {
buffer[index] = *c ^ b' ';
index += 1;
}
} else {
return;
}
while let Some(c) = key_iter.next() {
buffer[index] = *c;
index += 1;
if *c == b'-' {
if let Some(c) = key_iter.next() {
if *c >= b'a' && *c <= b'z' {
buffer[index] = *c ^ b' ';
index += 1;
}
}
}
}
}
}

View File

@@ -1,40 +0,0 @@
use std::{env, io};
use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures_util::StreamExt;
use http::header::HeaderValue;
use log::info;
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "echo=info");
env_logger::init();
Server::build()
.bind("echo", "127.0.0.1:8080", || {
HttpService::build()
.client_timeout(1000)
.client_disconnect(1000)
.finish(|mut req: Request| async move {
let mut body = BytesMut::new();
while let Some(item) = req.payload().next().await {
body.extend_from_slice(&item?);
}
info!("request body: {:?}", body);
Ok::<_, Error>(
Response::Ok()
.insert_header((
"x-head",
HeaderValue::from_static("dummy value!"),
))
.body(body),
)
})
.tcp()
})?
.run()
.await
}

View File

@@ -1,33 +0,0 @@
use std::{env, io};
use actix_http::http::HeaderValue;
use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures_util::StreamExt;
use log::info;
async fn handle_request(mut req: Request) -> Result<Response, Error> {
let mut body = BytesMut::new();
while let Some(item) = req.payload().next().await {
body.extend_from_slice(&item?)
}
info!("request body: {:?}", body);
Ok(Response::Ok()
.insert_header(("x-head", HeaderValue::from_static("dummy value!")))
.body(body))
}
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "echo=info");
env_logger::init();
Server::build()
.bind("echo", "127.0.0.1:8080", || {
HttpService::build().finish(handle_request).tcp()
})?
.run()
.await
}

View File

@@ -1,32 +0,0 @@
use std::{env, io};
use actix_http::{HttpService, Response};
use actix_server::Server;
use futures_util::future;
use http::header::HeaderValue;
use log::info;
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "hello_world=info");
env_logger::init();
Server::build()
.bind("hello-world", "127.0.0.1:8080", || {
HttpService::build()
.client_timeout(1000)
.client_disconnect(1000)
.finish(|_req| {
info!("{:?}", _req);
let mut res = Response::Ok();
res.insert_header((
"x-head",
HeaderValue::from_static("dummy value!"),
));
future::ok::<_, ()>(res.body("Hello world!"))
})
.tcp()
})?
.run()
.await
}

View File

@@ -1,107 +0,0 @@
//! Sets up a WebSocket server over TCP and TLS.
//! Sends a heartbeat message every 4 seconds but does not respond to any incoming frames.
extern crate tls_rustls as rustls;
use std::{
env, io,
pin::Pin,
task::{Context, Poll},
time::Duration,
};
use actix_codec::Encoder;
use actix_http::{error::Error, ws, HttpService, Request, Response};
use actix_rt::time::{interval, Interval};
use actix_server::Server;
use bytes::{Bytes, BytesMut};
use bytestring::ByteString;
use futures_core::{ready, Stream};
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "actix=info,h2_ws=info");
env_logger::init();
Server::build()
.bind("tcp", ("127.0.0.1", 8080), || {
HttpService::build().h1(handler).tcp()
})?
.bind("tls", ("127.0.0.1", 8443), || {
HttpService::build().finish(handler).rustls(tls_config())
})?
.run()
.await
}
async fn handler(req: Request) -> Result<Response, Error> {
log::info!("handshaking");
let mut res = ws::handshake(req.head())?;
// handshake will always fail under HTTP/2
log::info!("responding");
Ok(res.streaming(Heartbeat::new(ws::Codec::new())))
}
struct Heartbeat {
codec: ws::Codec,
interval: Interval,
}
impl Heartbeat {
fn new(codec: ws::Codec) -> Self {
Self {
codec,
interval: interval(Duration::from_secs(4)),
}
}
}
impl Stream for Heartbeat {
type Item = Result<Bytes, Error>;
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
log::trace!("poll");
ready!(self.as_mut().interval.poll_tick(cx));
let mut buffer = BytesMut::new();
self.as_mut()
.codec
.encode(
ws::Message::Text(ByteString::from_static("hello world")),
&mut buffer,
)
.unwrap();
Poll::Ready(Some(Ok(buffer.freeze())))
}
}
fn tls_config() -> rustls::ServerConfig {
use std::io::BufReader;
use rustls::{
internal::pemfile::{certs, pkcs8_private_keys},
NoClientAuth, ServerConfig,
};
let cert = rcgen::generate_simple_self_signed(vec!["localhost".to_owned()]).unwrap();
let cert_file = cert.serialize_pem().unwrap();
let key_file = cert.serialize_private_key_pem();
let mut config = ServerConfig::new(NoClientAuth::new());
let cert_file = &mut BufReader::new(cert_file.as_bytes());
let key_file = &mut BufReader::new(key_file.as_bytes());
let cert_chain = certs(cert_file).unwrap();
let mut keys = pkcs8_private_keys(key_file).unwrap();
config.set_single_cert(cert_chain, keys.remove(0)).unwrap();
config
}

View File

@@ -1,5 +0,0 @@
max_width = 89
reorder_imports = true
#wrap_comments = true
#fn_args_density = "Compressed"
#use_small_heuristics = false

View File

@@ -1,158 +0,0 @@
use std::{
fmt, mem,
pin::Pin,
task::{Context, Poll},
};
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use crate::error::Error;
use super::{BodySize, BodyStream, MessageBody, SizedStream};
/// Represents various types of HTTP message body.
pub enum Body {
/// Empty response. `Content-Length` header is not set.
None,
/// Zero sized response body. `Content-Length` header is set to `0`.
Empty,
/// Specific response body.
Bytes(Bytes),
/// Generic message body.
Message(Box<dyn MessageBody + Unpin>),
}
impl Body {
/// Create body from slice (copy)
pub fn from_slice(s: &[u8]) -> Body {
Body::Bytes(Bytes::copy_from_slice(s))
}
/// Create body from generic message body.
pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
Body::Message(Box::new(body))
}
}
impl MessageBody for Body {
fn size(&self) -> BodySize {
match self {
Body::None => BodySize::None,
Body::Empty => BodySize::Empty,
Body::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
Body::Message(ref body) => body.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.get_mut() {
Body::None => Poll::Ready(None),
Body::Empty => Poll::Ready(None),
Body::Bytes(ref mut bin) => {
let len = bin.len();
if len == 0 {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(bin))))
}
}
Body::Message(body) => Pin::new(&mut **body).poll_next(cx),
}
}
}
impl PartialEq for Body {
fn eq(&self, other: &Body) -> bool {
match *self {
Body::None => matches!(*other, Body::None),
Body::Empty => matches!(*other, Body::Empty),
Body::Bytes(ref b) => match *other {
Body::Bytes(ref b2) => b == b2,
_ => false,
},
Body::Message(_) => false,
}
}
}
impl fmt::Debug for Body {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
Body::None => write!(f, "Body::None"),
Body::Empty => write!(f, "Body::Empty"),
Body::Bytes(ref b) => write!(f, "Body::Bytes({:?})", b),
Body::Message(_) => write!(f, "Body::Message(_)"),
}
}
}
impl From<&'static str> for Body {
fn from(s: &'static str) -> Body {
Body::Bytes(Bytes::from_static(s.as_ref()))
}
}
impl From<&'static [u8]> for Body {
fn from(s: &'static [u8]) -> Body {
Body::Bytes(Bytes::from_static(s))
}
}
impl From<Vec<u8>> for Body {
fn from(vec: Vec<u8>) -> Body {
Body::Bytes(Bytes::from(vec))
}
}
impl From<String> for Body {
fn from(s: String) -> Body {
s.into_bytes().into()
}
}
impl<'a> From<&'a String> for Body {
fn from(s: &'a String) -> Body {
Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
}
}
impl From<Bytes> for Body {
fn from(s: Bytes) -> Body {
Body::Bytes(s)
}
}
impl From<BytesMut> for Body {
fn from(s: BytesMut) -> Body {
Body::Bytes(s.freeze())
}
}
impl From<serde_json::Value> for Body {
fn from(v: serde_json::Value) -> Body {
Body::Bytes(v.to_string().into())
}
}
impl<S> From<SizedStream<S>> for Body
where
S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
{
fn from(s: SizedStream<S>) -> Body {
Body::from_message(s)
}
}
impl<S, E> From<BodyStream<S>> for Body
where
S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
E: Into<Error> + 'static,
{
fn from(s: BodyStream<S>) -> Body {
Body::from_message(s)
}
}

View File

@@ -1,59 +0,0 @@
use std::{
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
use crate::error::Error;
use super::{BodySize, MessageBody};
/// Streaming response wrapper.
///
/// Response does not contain `Content-Length` header and appropriate transfer encoding is used.
pub struct BodyStream<S: Unpin> {
stream: S,
}
impl<S, E> BodyStream<S>
where
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
pub fn new(stream: S) -> Self {
BodyStream { stream }
}
}
impl<S, E> MessageBody for BodyStream<S>
where
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
fn size(&self) -> BodySize {
BodySize::Stream
}
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`BodyStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
loop {
let stream = &mut self.as_mut().stream;
let chunk = match ready!(Pin::new(stream).poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
opt => opt.map(|res| res.map_err(Into::into)),
};
return Poll::Ready(chunk);
}
}
}

View File

@@ -1,142 +0,0 @@
//! [`MessageBody`] trait and foreign implementations.
use std::{
mem,
pin::Pin,
task::{Context, Poll},
};
use bytes::{Bytes, BytesMut};
use crate::error::Error;
use super::BodySize;
/// Type that implement this trait can be streamed to a peer.
pub trait MessageBody {
fn size(&self) -> BodySize;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>>;
downcast_get_type_id!();
}
downcast!(MessageBody);
impl MessageBody for () {
fn size(&self) -> BodySize {
BodySize::Empty
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Poll::Ready(None)
}
}
impl<T: MessageBody + Unpin> MessageBody for Box<T> {
fn size(&self) -> BodySize {
self.as_ref().size()
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Pin::new(self.get_mut().as_mut()).poll_next(cx)
}
}
impl MessageBody for Bytes {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
}
}
}
impl MessageBody for BytesMut {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
}
}
}
impl MessageBody for &'static str {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from_static(
mem::take(self.get_mut()).as_ref(),
))))
}
}
}
impl MessageBody for Vec<u8> {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
}
}
}
impl MessageBody for String {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from(
mem::take(self.get_mut()).into_bytes(),
))))
}
}
}

View File

@@ -1,252 +0,0 @@
//! Traits and structures to aid consuming and writing HTTP payloads.
#[allow(clippy::module_inception)]
mod body;
mod body_stream;
mod message_body;
mod response_body;
mod size;
mod sized_stream;
pub use self::body::Body;
pub use self::body_stream::BodyStream;
pub use self::message_body::MessageBody;
pub use self::response_body::ResponseBody;
pub use self::size::BodySize;
pub use self::sized_stream::SizedStream;
#[cfg(test)]
mod tests {
use std::pin::Pin;
use actix_rt::pin;
use bytes::{Bytes, BytesMut};
use futures_util::{future::poll_fn, stream};
use super::*;
impl Body {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
Body::Bytes(ref bin) => &bin,
_ => panic!(),
}
}
}
impl ResponseBody<Body> {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
ResponseBody::Body(ref b) => b.get_ref(),
ResponseBody::Other(ref b) => b.get_ref(),
}
}
}
#[actix_rt::test]
async fn test_static_str() {
assert_eq!(Body::from("").size(), BodySize::Sized(0));
assert_eq!(Body::from("test").size(), BodySize::Sized(4));
assert_eq!(Body::from("test").get_ref(), b"test");
assert_eq!("test".size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_static_bytes() {
assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
assert_eq!(
Body::from_slice(b"test".as_ref()).size(),
BodySize::Sized(4)
);
assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
let sb = Bytes::from(&b"test"[..]);
pin!(sb);
assert_eq!(sb.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_vec() {
assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
let test_vec = Vec::from("test");
pin!(test_vec);
assert_eq!(test_vec.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| test_vec.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_bytes() {
let b = Bytes::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_bytes_mut() {
let b = BytesMut::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_string() {
let b = "test".to_owned();
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
assert_eq!(Body::from(&b).get_ref(), b"test");
pin!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_unit() {
assert_eq!(().size(), BodySize::Empty);
assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
.await
.is_none());
}
#[actix_rt::test]
async fn test_box() {
let val = Box::new(());
pin!(val);
assert_eq!(val.size(), BodySize::Empty);
assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
}
#[actix_rt::test]
async fn test_body_eq() {
assert!(
Body::Bytes(Bytes::from_static(b"1"))
== Body::Bytes(Bytes::from_static(b"1"))
);
assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
}
#[actix_rt::test]
async fn test_body_debug() {
assert!(format!("{:?}", Body::None).contains("Body::None"));
assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
}
#[actix_rt::test]
async fn test_serde_json() {
use serde_json::json;
assert_eq!(
Body::from(serde_json::Value::String("test".into())).size(),
BodySize::Sized(6)
);
assert_eq!(
Body::from(json!({"test-key":"test-value"})).size(),
BodySize::Sized(25)
);
}
#[actix_rt::test]
async fn body_stream_skips_empty_chunks() {
let body = BodyStream::new(stream::iter(
["1", "", "2"]
.iter()
.map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
));
pin!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
mod sized_stream {
use super::*;
#[actix_rt::test]
async fn skips_empty_chunks() {
let body = SizedStream::new(
2,
stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
);
pin!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
}
#[actix_rt::test]
async fn test_body_casting() {
let mut body = String::from("hello cast");
let resp_body: &mut dyn MessageBody = &mut body;
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast");
let body = &mut resp_body.downcast_mut::<String>().unwrap();
body.push('!');
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast!");
let not_body = resp_body.downcast_ref::<()>();
assert!(not_body.is_none());
}
}

View File

@@ -1,77 +0,0 @@
use std::{
mem,
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::Stream;
use pin_project::pin_project;
use crate::error::Error;
use super::{Body, BodySize, MessageBody};
#[pin_project(project = ResponseBodyProj)]
pub enum ResponseBody<B> {
Body(#[pin] B),
Other(Body),
}
impl ResponseBody<Body> {
pub fn into_body<B>(self) -> ResponseBody<B> {
match self {
ResponseBody::Body(b) => ResponseBody::Other(b),
ResponseBody::Other(b) => ResponseBody::Other(b),
}
}
}
impl<B> ResponseBody<B> {
pub fn take_body(&mut self) -> ResponseBody<B> {
mem::replace(self, ResponseBody::Other(Body::None))
}
}
impl<B: MessageBody> ResponseBody<B> {
pub fn as_ref(&self) -> Option<&B> {
if let ResponseBody::Body(ref b) = self {
Some(b)
} else {
None
}
}
}
impl<B: MessageBody> MessageBody for ResponseBody<B> {
fn size(&self) -> BodySize {
match self {
ResponseBody::Body(ref body) => body.size(),
ResponseBody::Other(ref body) => body.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
}
}
}
impl<B: MessageBody> Stream for ResponseBody<B> {
type Item = Result<Bytes, Error>;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
}
}
}

View File

@@ -1,40 +0,0 @@
/// Body size hint.
#[derive(Debug, Clone, Copy, PartialEq)]
pub enum BodySize {
/// Absence of body can be assumed from method or status code.
///
/// Will skip writing Content-Length header.
None,
/// Zero size body.
///
/// Will write `Content-Length: 0` header.
Empty,
/// Known size body.
///
/// Will write `Content-Length: N` header. `Sized(0)` is treated the same as `Empty`.
Sized(u64),
/// Unknown size body.
///
/// Will not write Content-Length header. Can be used with chunked Transfer-Encoding.
Stream,
}
impl BodySize {
/// Returns true if size hint indicates no or empty body.
///
/// ```
/// # use actix_http::body::BodySize;
/// assert!(BodySize::None.is_eof());
/// assert!(BodySize::Empty.is_eof());
/// assert!(BodySize::Sized(0).is_eof());
///
/// assert!(!BodySize::Sized(64).is_eof());
/// assert!(!BodySize::Stream.is_eof());
/// ```
pub fn is_eof(&self) -> bool {
matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
}
}

View File

@@ -1,59 +0,0 @@
use std::{
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
use crate::error::Error;
use super::{BodySize, MessageBody};
/// Known sized streaming response wrapper.
///
/// This body implementation should be used if total size of stream is known. Data get sent as is
/// without using transfer encoding.
pub struct SizedStream<S: Unpin> {
size: u64,
stream: S,
}
impl<S> SizedStream<S>
where
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
pub fn new(size: u64, stream: S) -> Self {
SizedStream { size, stream }
}
}
impl<S> MessageBody for SizedStream<S>
where
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
fn size(&self) -> BodySize {
BodySize::Sized(self.size as u64)
}
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`SizedStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
loop {
let stream = &mut self.as_mut().stream;
let chunk = match ready!(Pin::new(stream).poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
val => val,
};
return Poll::Ready(chunk);
}
}
}

View File

@@ -1,251 +0,0 @@
use std::marker::PhantomData;
use std::rc::Rc;
use std::{fmt, net};
use actix_codec::Framed;
use actix_service::{IntoServiceFactory, Service, ServiceFactory};
use crate::body::MessageBody;
use crate::config::{KeepAlive, ServiceConfig};
use crate::error::Error;
use crate::h1::{Codec, ExpectHandler, H1Service, UpgradeHandler};
use crate::h2::H2Service;
use crate::request::Request;
use crate::response::Response;
use crate::service::HttpService;
use crate::{ConnectCallback, Extensions};
/// A HTTP service builder
///
/// This type can be used to construct an instance of [`HttpService`] through a
/// builder-like pattern.
pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler> {
keep_alive: KeepAlive,
client_timeout: u64,
client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
expect: X,
upgrade: Option<U>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
_phantom: PhantomData<S>,
}
impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
<S::Service as Service<Request>>::Future: 'static,
{
/// Create instance of `ServiceConfigBuilder`
pub fn new() -> Self {
HttpServiceBuilder {
keep_alive: KeepAlive::Timeout(5),
client_timeout: 5000,
client_disconnect: 0,
secure: false,
local_addr: None,
expect: ExpectHandler,
upgrade: None,
on_connect_ext: None,
_phantom: PhantomData,
}
}
}
impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
<S::Service as Service<Request>>::Future: 'static,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service<Request>>::Future: 'static,
U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
{
/// Set server keep-alive setting.
///
/// By default keep alive is set to a 5 seconds.
pub fn keep_alive<W: Into<KeepAlive>>(mut self, val: W) -> Self {
self.keep_alive = val.into();
self
}
/// Set connection secure state
pub fn secure(mut self) -> Self {
self.secure = true;
self
}
/// Set the local address that this service is bound to.
pub fn local_addr(mut self, addr: net::SocketAddr) -> Self {
self.local_addr = Some(addr);
self
}
/// Set server client timeout in milliseconds for first request.
///
/// Defines a timeout for reading client request header. If a client does not transmit
/// the entire set headers within this time, the request is terminated with
/// the 408 (Request Time-out) error.
///
/// To disable timeout set value to 0.
///
/// By default client timeout is set to 5000 milliseconds.
pub fn client_timeout(mut self, val: u64) -> Self {
self.client_timeout = val;
self
}
/// Set server connection disconnect timeout in milliseconds.
///
/// Defines a timeout for disconnect connection. If a disconnect procedure does not complete
/// within this time, the request get dropped. This timeout affects secure connections.
///
/// To disable timeout set value to 0.
///
/// By default disconnect timeout is set to 0.
pub fn client_disconnect(mut self, val: u64) -> Self {
self.client_disconnect = val;
self
}
/// Provide service for `EXPECT: 100-Continue` support.
///
/// Service get called with request that contains `EXPECT` header.
/// Service must return request in case of success, in that case
/// request will be forwarded to main service.
pub fn expect<F, X1>(self, expect: F) -> HttpServiceBuilder<T, S, X1, U>
where
F: IntoServiceFactory<X1, Request>,
X1: ServiceFactory<Request, Config = (), Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
<X1::Service as Service<Request>>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect,
secure: self.secure,
local_addr: self.local_addr,
expect: expect.into_factory(),
upgrade: self.upgrade,
on_connect_ext: self.on_connect_ext,
_phantom: PhantomData,
}
}
/// Provide service for custom `Connection: UPGRADE` support.
///
/// If service is provided then normal requests handling get halted
/// and this service get called with original request and framed object.
pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
where
F: IntoServiceFactory<U1, (Request, Framed<T, Codec>)>,
U1: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
<U1::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect,
secure: self.secure,
local_addr: self.local_addr,
expect: self.expect,
upgrade: Some(upgrade.into_factory()),
on_connect_ext: self.on_connect_ext,
_phantom: PhantomData,
}
}
/// Sets the callback to be run on connection establishment.
///
/// Has mutable access to a data container that will be merged into request extensions.
/// This enables transport layer data (like client certificates) to be accessed in middleware
/// and handlers.
pub fn on_connect_ext<F>(mut self, f: F) -> Self
where
F: Fn(&T, &mut Extensions) + 'static,
{
self.on_connect_ext = Some(Rc::new(f));
self
}
/// Finish service configuration and create a HTTP Service for HTTP/1 protocol.
pub fn h1<F, B>(self, service: F) -> H1Service<T, S, B, X, U>
where
B: MessageBody,
F: IntoServiceFactory<S, Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
{
let cfg = ServiceConfig::new(
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
H1Service::with_config(cfg, service.into_factory())
.expect(self.expect)
.upgrade(self.upgrade)
.on_connect_ext(self.on_connect_ext)
}
/// Finish service configuration and create a HTTP service for HTTP/2 protocol.
pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
where
B: MessageBody + 'static,
F: IntoServiceFactory<S, Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
H2Service::with_config(cfg, service.into_factory())
.on_connect_ext(self.on_connect_ext)
}
/// Finish service configuration and create `HttpService` instance.
pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
where
B: MessageBody + 'static,
F: IntoServiceFactory<S, Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
HttpService::with_config(cfg, service.into_factory())
.expect(self.expect)
.upgrade(self.upgrade)
.on_connect_ext(self.on_connect_ext)
}
}

View File

@@ -1,41 +0,0 @@
use std::net::IpAddr;
use std::time::Duration;
const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2MB
const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1MB
/// Connector configuration
#[derive(Clone)]
pub(crate) struct ConnectorConfig {
pub(crate) timeout: Duration,
pub(crate) conn_lifetime: Duration,
pub(crate) conn_keep_alive: Duration,
pub(crate) disconnect_timeout: Option<Duration>,
pub(crate) limit: usize,
pub(crate) conn_window_size: u32,
pub(crate) stream_window_size: u32,
pub(crate) local_address: Option<IpAddr>,
}
impl Default for ConnectorConfig {
fn default() -> Self {
Self {
timeout: Duration::from_secs(5),
conn_lifetime: Duration::from_secs(75),
conn_keep_alive: Duration::from_secs(15),
disconnect_timeout: Some(Duration::from_millis(3000)),
limit: 100,
conn_window_size: DEFAULT_H2_CONN_WINDOW,
stream_window_size: DEFAULT_H2_STREAM_WINDOW,
local_address: None,
}
}
}
impl ConnectorConfig {
pub(crate) fn no_disconnect_timeout(&self) -> Self {
let mut res = self.clone();
res.disconnect_timeout = None;
res
}
}

View File

@@ -1,329 +0,0 @@
use std::ops::{Deref, DerefMut};
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, io, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
use actix_rt::task::JoinHandle;
use bytes::Bytes;
use futures_core::future::LocalBoxFuture;
use h2::client::SendRequest;
use pin_project::pin_project;
use crate::body::MessageBody;
use crate::h1::ClientCodec;
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::Payload;
use super::error::SendRequestError;
use super::pool::Acquired;
use super::{h1proto, h2proto};
pub(crate) enum ConnectionType<Io> {
H1(Io),
H2(H2Connection),
}
/// `H2Connection` has two parts: `SendRequest` and `Connection`.
///
/// `Connection` is spawned as an async task on runtime and `H2Connection` holds a handle for
/// this task. Therefore, it can wake up and quit the task when SendRequest is dropped.
pub(crate) struct H2Connection {
handle: JoinHandle<()>,
sender: SendRequest<Bytes>,
}
impl H2Connection {
pub(crate) fn new<Io>(
sender: SendRequest<Bytes>,
connection: h2::client::Connection<Io>,
) -> Self
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
let handle = actix_rt::spawn(async move {
let _ = connection.await;
});
Self { handle, sender }
}
}
// cancel spawned connection task on drop.
impl Drop for H2Connection {
fn drop(&mut self) {
self.handle.abort();
}
}
// only expose sender type to public.
impl Deref for H2Connection {
type Target = SendRequest<Bytes>;
fn deref(&self) -> &Self::Target {
&self.sender
}
}
impl DerefMut for H2Connection {
fn deref_mut(&mut self) -> &mut Self::Target {
&mut self.sender
}
}
pub trait Connection {
type Io: AsyncRead + AsyncWrite + Unpin;
/// Send request and body
fn send_request<B, H>(
self,
head: H,
body: B,
) -> LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>
where
B: MessageBody + 'static,
H: Into<RequestHeadType> + 'static;
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType> + 'static>(
self,
head: H,
) -> LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>;
}
pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
/// Close connection
fn close(self: Pin<&mut Self>);
/// Release connection to the connection pool
fn release(self: Pin<&mut Self>);
}
#[doc(hidden)]
/// HTTP client connection
pub struct IoConnection<T>
where
T: AsyncWrite + Unpin + 'static,
{
io: Option<ConnectionType<T>>,
created: time::Instant,
pool: Option<Acquired<T>>,
}
impl<T> fmt::Debug for IoConnection<T>
where
T: AsyncWrite + Unpin + fmt::Debug + 'static,
{
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match self.io {
Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
None => write!(f, "Connection(Empty)"),
}
}
}
impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
pub(crate) fn new(
io: ConnectionType<T>,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> Self {
IoConnection {
pool,
created,
io: Some(io),
}
}
pub(crate) fn into_inner(self) -> (ConnectionType<T>, time::Instant) {
(self.io.unwrap(), self.created)
}
#[cfg(test)]
pub(crate) fn into_parts(self) -> (ConnectionType<T>, time::Instant, Acquired<T>) {
(self.io.unwrap(), self.created, self.pool.unwrap())
}
async fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
mut self,
head: H,
body: B,
) -> Result<(ResponseHead, Payload), SendRequestError> {
match self.io.take().unwrap() {
ConnectionType::H1(io) => {
h1proto::send_request(io, head.into(), body, self.created, self.pool)
.await
}
ConnectionType::H2(io) => {
h2proto::send_request(io, head.into(), body, self.created, self.pool)
.await
}
}
}
/// Send request, returns Response and Framed
async fn open_tunnel<H: Into<RequestHeadType>>(
mut self,
head: H,
) -> Result<(ResponseHead, Framed<T, ClientCodec>), SendRequestError> {
match self.io.take().unwrap() {
ConnectionType::H1(io) => h1proto::open_tunnel(io, head.into()).await,
ConnectionType::H2(io) => {
if let Some(mut pool) = self.pool.take() {
pool.release(IoConnection::new(
ConnectionType::H2(io),
self.created,
None,
));
}
Err(SendRequestError::TunnelNotSupported)
}
}
}
}
#[allow(dead_code)]
pub(crate) enum EitherIoConnection<A, B>
where
A: AsyncRead + AsyncWrite + Unpin + 'static,
B: AsyncRead + AsyncWrite + Unpin + 'static,
{
A(IoConnection<A>),
B(IoConnection<B>),
}
impl<A, B> Connection for EitherIoConnection<A, B>
where
A: AsyncRead + AsyncWrite + Unpin + 'static,
B: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Io = EitherIo<A, B>;
fn send_request<RB, H>(
self,
head: H,
body: RB,
) -> LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>
where
RB: MessageBody + 'static,
H: Into<RequestHeadType> + 'static,
{
match self {
EitherIoConnection::A(con) => Box::pin(con.send_request(head, body)),
EitherIoConnection::B(con) => Box::pin(con.send_request(head, body)),
}
}
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType> + 'static>(
self,
head: H,
) -> LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
> {
match self {
EitherIoConnection::A(con) => Box::pin(async {
let (head, framed) = con.open_tunnel(head).await?;
Ok((head, framed.into_map_io(EitherIo::A)))
}),
EitherIoConnection::B(con) => Box::pin(async {
let (head, framed) = con.open_tunnel(head).await?;
Ok((head, framed.into_map_io(EitherIo::B)))
}),
}
}
}
#[pin_project(project = EitherIoProj)]
pub enum EitherIo<A, B> {
A(#[pin] A),
B(#[pin] B),
}
impl<A, B> AsyncRead for EitherIo<A, B>
where
A: AsyncRead,
B: AsyncRead,
{
fn poll_read(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut ReadBuf<'_>,
) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_read(cx, buf),
EitherIoProj::B(val) => val.poll_read(cx, buf),
}
}
}
impl<A, B> AsyncWrite for EitherIo<A, B>
where
A: AsyncWrite,
B: AsyncWrite,
{
fn poll_write(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
match self.project() {
EitherIoProj::A(val) => val.poll_write(cx, buf),
EitherIoProj::B(val) => val.poll_write(cx, buf),
}
}
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_flush(cx),
EitherIoProj::B(val) => val.poll_flush(cx),
}
}
fn poll_shutdown(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_shutdown(cx),
EitherIoProj::B(val) => val.poll_shutdown(cx),
}
}
}
#[cfg(test)]
mod test {
use std::net;
use actix_rt::net::TcpStream;
use super::*;
#[actix_rt::test]
async fn test_h2_connection_drop() {
let addr = "127.0.0.1:0".parse::<net::SocketAddr>().unwrap();
let listener = net::TcpListener::bind(addr).unwrap();
let local = listener.local_addr().unwrap();
std::thread::spawn(move || while listener.accept().is_ok() {});
let tcp = TcpStream::connect(local).await.unwrap();
let (sender, connection) = h2::client::handshake(tcp).await.unwrap();
let conn = H2Connection::new(sender.clone(), connection);
assert!(sender.clone().ready().await.is_ok());
assert!(h2::client::SendRequest::clone(&*conn).ready().await.is_ok());
drop(conn);
match sender.ready().await {
Ok(_) => panic!("connection should be gone and can not be ready"),
Err(e) => assert!(e.is_io()),
};
}
}

View File

@@ -1,546 +0,0 @@
use std::{
fmt,
future::Future,
marker::PhantomData,
net::IpAddr,
pin::Pin,
task::{Context, Poll},
time::Duration,
};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::net::TcpStream;
use actix_service::{apply_fn, Service, ServiceExt};
use actix_tls::connect::{
new_connector, Connect as TcpConnect, Connection as TcpConnection, Resolver,
};
use actix_utils::timeout::{TimeoutError, TimeoutService};
use http::Uri;
use super::config::ConnectorConfig;
use super::connection::{Connection, EitherIoConnection};
use super::error::ConnectError;
use super::pool::{ConnectionPool, Protocol};
use super::Connect;
#[cfg(feature = "openssl")]
use actix_tls::connect::ssl::openssl::SslConnector as OpensslConnector;
#[cfg(feature = "rustls")]
use actix_tls::connect::ssl::rustls::ClientConfig;
#[cfg(feature = "rustls")]
use std::sync::Arc;
#[cfg(any(feature = "openssl", feature = "rustls"))]
enum SslConnector {
#[cfg(feature = "openssl")]
Openssl(OpensslConnector),
#[cfg(feature = "rustls")]
Rustls(Arc<ClientConfig>),
}
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
type SslConnector = ();
/// Manages HTTP client network connectivity.
///
/// The `Connector` type uses a builder-like combinator pattern for service
/// construction that finishes by calling the `.finish()` method.
///
/// ```rust,ignore
/// use std::time::Duration;
/// use actix_http::client::Connector;
///
/// let connector = Connector::new()
/// .timeout(Duration::from_secs(5))
/// .finish();
/// ```
pub struct Connector<T, U> {
connector: T,
config: ConnectorConfig,
#[allow(dead_code)]
ssl: SslConnector,
_phantom: PhantomData<U>,
}
pub trait Io: AsyncRead + AsyncWrite + Unpin {}
impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
impl Connector<(), ()> {
#[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
pub fn new() -> Connector<
impl Service<
TcpConnect<Uri>,
Response = TcpConnection<Uri, TcpStream>,
Error = actix_tls::connect::ConnectError,
> + Clone,
TcpStream,
> {
Connector {
ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
connector: new_connector(resolver::resolver()),
config: ConnectorConfig::default(),
_phantom: PhantomData,
}
}
// Build Ssl connector with openssl, based on supplied alpn protocols
#[cfg(feature = "openssl")]
fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
use actix_tls::connect::ssl::openssl::SslMethod;
use bytes::{BufMut, BytesMut};
let mut alpn = BytesMut::with_capacity(20);
for proto in protocols.iter() {
alpn.put_u8(proto.len() as u8);
alpn.put(proto.as_slice());
}
let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
let _ = ssl
.set_alpn_protos(&alpn)
.map_err(|e| error!("Can not set alpn protocol: {:?}", e));
SslConnector::Openssl(ssl.build())
}
// Build Ssl connector with rustls, based on supplied alpn protocols
#[cfg(all(not(feature = "openssl"), feature = "rustls"))]
fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
let mut config = ClientConfig::new();
config.set_protocols(&protocols);
config.root_store.add_server_trust_anchors(
&actix_tls::connect::ssl::rustls::TLS_SERVER_ROOTS,
);
SslConnector::Rustls(Arc::new(config))
}
// ssl turned off, provides empty ssl connector
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
}
impl<T, U> Connector<T, U> {
/// Use custom connector.
pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
where
U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
T1: Service<
TcpConnect<Uri>,
Response = TcpConnection<Uri, U1>,
Error = actix_tls::connect::ConnectError,
> + Clone,
{
Connector {
connector,
config: self.config,
ssl: self.ssl,
_phantom: PhantomData,
}
}
}
impl<T, U> Connector<T, U>
where
U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
T: Service<
TcpConnect<Uri>,
Response = TcpConnection<Uri, U>,
Error = actix_tls::connect::ConnectError,
> + Clone
+ 'static,
{
/// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
/// Set to 1 second by default.
pub fn timeout(mut self, timeout: Duration) -> Self {
self.config.timeout = timeout;
self
}
#[cfg(feature = "openssl")]
/// Use custom `SslConnector` instance.
pub fn ssl(mut self, connector: OpensslConnector) -> Self {
self.ssl = SslConnector::Openssl(connector);
self
}
#[cfg(feature = "rustls")]
pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
self.ssl = SslConnector::Rustls(connector);
self
}
/// Maximum supported HTTP major version.
///
/// Supported versions are HTTP/1.1 and HTTP/2.
pub fn max_http_version(mut self, val: http::Version) -> Self {
let versions = match val {
http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
http::Version::HTTP_2 => vec![b"h2".to_vec(), b"http/1.1".to_vec()],
_ => {
unimplemented!("actix-http:client: supported versions http/1.1, http/2")
}
};
self.ssl = Connector::build_ssl(versions);
self
}
/// Indicates the initial window size (in octets) for
/// HTTP2 stream-level flow control for received data.
///
/// The default value is 65,535 and is good for APIs, but not for big objects.
pub fn initial_window_size(mut self, size: u32) -> Self {
self.config.stream_window_size = size;
self
}
/// Indicates the initial window size (in octets) for
/// HTTP2 connection-level flow control for received data.
///
/// The default value is 65,535 and is good for APIs, but not for big objects.
pub fn initial_connection_window_size(mut self, size: u32) -> Self {
self.config.conn_window_size = size;
self
}
/// Set total number of simultaneous connections per type of scheme.
///
/// If limit is 0, the connector has no limit.
/// The default limit size is 100.
pub fn limit(mut self, limit: usize) -> Self {
self.config.limit = limit;
self
}
/// Set keep-alive period for opened connection.
///
/// Keep-alive period is the period between connection usage. If
/// the delay between repeated usages of the same connection
/// exceeds this period, the connection is closed.
/// Default keep-alive period is 15 seconds.
pub fn conn_keep_alive(mut self, dur: Duration) -> Self {
self.config.conn_keep_alive = dur;
self
}
/// Set max lifetime period for connection.
///
/// Connection lifetime is max lifetime of any opened connection
/// until it is closed regardless of keep-alive period.
/// Default lifetime period is 75 seconds.
pub fn conn_lifetime(mut self, dur: Duration) -> Self {
self.config.conn_lifetime = dur;
self
}
/// Set server connection disconnect timeout in milliseconds.
///
/// Defines a timeout for disconnect connection. If a disconnect procedure does not complete
/// within this time, the socket get dropped. This timeout affects only secure connections.
///
/// To disable timeout set value to 0.
///
/// By default disconnect timeout is set to 3000 milliseconds.
pub fn disconnect_timeout(mut self, dur: Duration) -> Self {
self.config.disconnect_timeout = Some(dur);
self
}
/// Set local IP Address the connector would use for establishing connection.
pub fn local_address(mut self, addr: IpAddr) -> Self {
self.config.local_address = Some(addr);
self
}
/// Finish configuration process and create connector service.
/// The Connector builder always concludes by calling `finish()` last in
/// its combinator chain.
pub fn finish(
self,
) -> impl Service<Connect, Response = impl Connection, Error = ConnectError> + Clone
{
let local_address = self.config.local_address;
let timeout = self.config.timeout;
let tcp_service = TimeoutService::new(
timeout,
apply_fn(self.connector.clone(), move |msg: Connect, srv| {
let mut req = TcpConnect::new(msg.uri).set_addr(msg.addr);
if let Some(local_addr) = local_address {
req = req.set_local_addr(local_addr);
}
srv.call(req)
})
.map_err(ConnectError::from)
.map(|stream| (stream.into_parts().0, Protocol::Http1)),
)
.map_err(|e| match e {
TimeoutError::Service(e) => e,
TimeoutError::Timeout => ConnectError::Timeout,
});
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
{
// A dummy service for annotate tls pool's type signature.
pub type DummyService = Box<
dyn Service<
Connect,
Response = (Box<dyn Io>, Protocol),
Error = ConnectError,
Future = futures_core::future::LocalBoxFuture<
'static,
Result<(Box<dyn Io>, Protocol), ConnectError>,
>,
>,
>;
InnerConnector::<_, DummyService, _, Box<dyn Io>> {
tcp_pool: ConnectionPool::new(
tcp_service,
self.config.no_disconnect_timeout(),
),
tls_pool: None,
}
}
#[cfg(any(feature = "openssl", feature = "rustls"))]
{
const H2: &[u8] = b"h2";
use actix_service::{boxed::service, pipeline};
#[cfg(feature = "openssl")]
use actix_tls::connect::ssl::openssl::OpensslConnector;
#[cfg(feature = "rustls")]
use actix_tls::connect::ssl::rustls::{RustlsConnector, Session};
let ssl_service = TimeoutService::new(
timeout,
pipeline(
apply_fn(self.connector.clone(), move |msg: Connect, srv| {
let mut req = TcpConnect::new(msg.uri).set_addr(msg.addr);
if let Some(local_addr) = local_address {
req = req.set_local_addr(local_addr);
}
srv.call(req)
})
.map_err(ConnectError::from),
)
.and_then(match self.ssl {
#[cfg(feature = "openssl")]
SslConnector::Openssl(ssl) => service(
OpensslConnector::service(ssl)
.map(|stream| {
let sock = stream.into_parts().0;
let h2 = sock
.ssl()
.selected_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
.unwrap_or(false);
if h2 {
(Box::new(sock) as Box<dyn Io>, Protocol::Http2)
} else {
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
}
})
.map_err(ConnectError::from),
),
#[cfg(feature = "rustls")]
SslConnector::Rustls(ssl) => service(
RustlsConnector::service(ssl)
.map_err(ConnectError::from)
.map(|stream| {
let sock = stream.into_parts().0;
let h2 = sock
.get_ref()
.1
.get_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
.unwrap_or(false);
if h2 {
(Box::new(sock) as Box<dyn Io>, Protocol::Http2)
} else {
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
}
}),
),
}),
)
.map_err(|e| match e {
TimeoutError::Service(e) => e,
TimeoutError::Timeout => ConnectError::Timeout,
});
InnerConnector {
tcp_pool: ConnectionPool::new(
tcp_service,
self.config.no_disconnect_timeout(),
),
tls_pool: Some(ConnectionPool::new(ssl_service, self.config)),
}
}
}
}
struct InnerConnector<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
tcp_pool: ConnectionPool<S1, Io1>,
tls_pool: Option<ConnectionPool<S2, Io2>>,
}
impl<S1, S2, Io1, Io2> Clone for InnerConnector<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn clone(&self) -> Self {
InnerConnector {
tcp_pool: self.tcp_pool.clone(),
tls_pool: self.tls_pool.as_ref().cloned(),
}
}
}
impl<S1, S2, Io1, Io2> Service<Connect> for InnerConnector<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Response = EitherIoConnection<Io1, Io2>;
type Error = ConnectError;
type Future = InnerConnectorResponse<S1, S2, Io1, Io2>;
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready(cx)
}
fn call(&self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => match self.tls_pool {
None => InnerConnectorResponse::SslIsNotSupported,
Some(ref pool) => InnerConnectorResponse::Io2(pool.call(req)),
},
_ => InnerConnectorResponse::Io1(self.tcp_pool.call(req)),
}
}
}
#[pin_project::pin_project(project = InnerConnectorProj)]
enum InnerConnectorResponse<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
Io1(#[pin] <ConnectionPool<S1, Io1> as Service<Connect>>::Future),
Io2(#[pin] <ConnectionPool<S2, Io2> as Service<Connect>>::Future),
SslIsNotSupported,
}
impl<S1, S2, Io1, Io2> Future for InnerConnectorResponse<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Output = Result<EitherIoConnection<Io1, Io2>, ConnectError>;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
match self.project() {
InnerConnectorProj::Io1(fut) => fut.poll(cx).map_ok(EitherIoConnection::A),
InnerConnectorProj::Io2(fut) => fut.poll(cx).map_ok(EitherIoConnection::B),
InnerConnectorProj::SslIsNotSupported => {
Poll::Ready(Err(ConnectError::SslIsNotSupported))
}
}
}
}
#[cfg(not(feature = "trust-dns"))]
mod resolver {
use super::*;
pub(super) fn resolver() -> Resolver {
Resolver::Default
}
}
#[cfg(feature = "trust-dns")]
mod resolver {
use std::{cell::RefCell, net::SocketAddr};
use actix_tls::connect::Resolve;
use futures_core::future::LocalBoxFuture;
use trust_dns_resolver::{
config::{ResolverConfig, ResolverOpts},
system_conf::read_system_conf,
TokioAsyncResolver,
};
use super::*;
pub(super) fn resolver() -> Resolver {
// new type for impl Resolve trait for TokioAsyncResolver.
struct TrustDnsResolver(TokioAsyncResolver);
impl Resolve for TrustDnsResolver {
fn lookup<'a>(
&'a self,
host: &'a str,
port: u16,
) -> LocalBoxFuture<'a, Result<Vec<SocketAddr>, Box<dyn std::error::Error>>>
{
Box::pin(async move {
let res = self
.0
.lookup_ip(host)
.await?
.iter()
.map(|ip| SocketAddr::new(ip, port))
.collect();
Ok(res)
})
}
}
// dns struct is cached in thread local.
// so new client constructor can reuse the existing dns resolver.
thread_local! {
static TRUST_DNS_RESOLVER: RefCell<Option<Resolver>> = RefCell::new(None);
}
// get from thread local or construct a new trust-dns resolver.
TRUST_DNS_RESOLVER.with(|local| {
let resolver = local.borrow().as_ref().map(Clone::clone);
match resolver {
Some(resolver) => resolver,
None => {
let (cfg, opts) = match read_system_conf() {
Ok((cfg, opts)) => (cfg, opts),
Err(e) => {
log::error!("TRust-DNS can not load system config: {}", e);
(ResolverConfig::default(), ResolverOpts::default())
}
};
let resolver = TokioAsyncResolver::tokio(cfg, opts).unwrap();
// box trust dns resolver and put it in thread local.
let resolver = Resolver::new_custom(TrustDnsResolver(resolver));
*local.borrow_mut() = Some(resolver.clone());
resolver
}
}
})
}
}

View File

@@ -1,156 +0,0 @@
use std::io;
use derive_more::{Display, From};
#[cfg(feature = "openssl")]
use actix_tls::accept::openssl::SslError;
use crate::error::{Error, ParseError, ResponseError};
use crate::http::{Error as HttpError, StatusCode};
/// A set of errors that can occur while connecting to an HTTP host
#[derive(Debug, Display, From)]
pub enum ConnectError {
/// SSL feature is not enabled
#[display(fmt = "SSL is not supported")]
SslIsNotSupported,
/// SSL error
#[cfg(feature = "openssl")]
#[display(fmt = "{}", _0)]
SslError(SslError),
/// Failed to resolve the hostname
#[display(fmt = "Failed resolving hostname: {}", _0)]
Resolver(Box<dyn std::error::Error>),
/// No dns records
#[display(fmt = "No DNS records found for the input")]
NoRecords,
/// Http2 error
#[display(fmt = "{}", _0)]
H2(h2::Error),
/// Connecting took too long
#[display(fmt = "Timeout while establishing connection")]
Timeout,
/// Connector has been disconnected
#[display(fmt = "Internal error: connector has been disconnected")]
Disconnected,
/// Unresolved host name
#[display(fmt = "Connector received `Connect` method with unresolved host")]
Unresolved,
/// Connection io error
#[display(fmt = "{}", _0)]
Io(io::Error),
}
impl std::error::Error for ConnectError {}
impl From<actix_tls::connect::ConnectError> for ConnectError {
fn from(err: actix_tls::connect::ConnectError) -> ConnectError {
match err {
actix_tls::connect::ConnectError::Resolver(e) => ConnectError::Resolver(e),
actix_tls::connect::ConnectError::NoRecords => ConnectError::NoRecords,
actix_tls::connect::ConnectError::InvalidInput => panic!(),
actix_tls::connect::ConnectError::Unresolved => ConnectError::Unresolved,
actix_tls::connect::ConnectError::Io(e) => ConnectError::Io(e),
}
}
}
#[derive(Debug, Display, From)]
pub enum InvalidUrl {
#[display(fmt = "Missing URL scheme")]
MissingScheme,
#[display(fmt = "Unknown URL scheme")]
UnknownScheme,
#[display(fmt = "Missing host name")]
MissingHost,
#[display(fmt = "URL parse error: {}", _0)]
HttpError(http::Error),
}
impl std::error::Error for InvalidUrl {}
/// A set of errors that can occur during request sending and response reading
#[derive(Debug, Display, From)]
pub enum SendRequestError {
/// Invalid URL
#[display(fmt = "Invalid URL: {}", _0)]
Url(InvalidUrl),
/// Failed to connect to host
#[display(fmt = "Failed to connect to host: {}", _0)]
Connect(ConnectError),
/// Error sending request
Send(io::Error),
/// Error parsing response
Response(ParseError),
/// Http error
#[display(fmt = "{}", _0)]
Http(HttpError),
/// Http2 error
#[display(fmt = "{}", _0)]
H2(h2::Error),
/// Response took too long
#[display(fmt = "Timeout while waiting for response")]
Timeout,
/// Tunnels are not supported for HTTP/2 connection
#[display(fmt = "Tunnels are not supported for http2 connection")]
TunnelNotSupported,
/// Error sending request body
Body(Error),
}
impl std::error::Error for SendRequestError {}
/// Convert `SendRequestError` to a server `Response`
impl ResponseError for SendRequestError {
fn status_code(&self) -> StatusCode {
match *self {
SendRequestError::Connect(ConnectError::Timeout) => {
StatusCode::GATEWAY_TIMEOUT
}
SendRequestError::Connect(_) => StatusCode::BAD_REQUEST,
_ => StatusCode::INTERNAL_SERVER_ERROR,
}
}
}
/// A set of errors that can occur during freezing a request
#[derive(Debug, Display, From)]
pub enum FreezeRequestError {
/// Invalid URL
#[display(fmt = "Invalid URL: {}", _0)]
Url(InvalidUrl),
/// HTTP error
#[display(fmt = "{}", _0)]
Http(HttpError),
}
impl std::error::Error for FreezeRequestError {}
impl From<FreezeRequestError> for SendRequestError {
fn from(e: FreezeRequestError) -> Self {
match e {
FreezeRequestError::Url(e) => e.into(),
FreezeRequestError::Http(e) => e.into(),
}
}
}

View File

@@ -1,335 +0,0 @@
use std::io::Write;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{io, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
use bytes::buf::BufMut;
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use futures_util::{future::poll_fn, SinkExt, StreamExt};
use crate::error::PayloadError;
use crate::h1;
use crate::header::HeaderMap;
use crate::http::{
header::{IntoHeaderValue, EXPECT, HOST},
StatusCode,
};
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::{Payload, PayloadStream};
use super::connection::{ConnectionLifetime, ConnectionType, IoConnection};
use super::error::{ConnectError, SendRequestError};
use super::pool::Acquired;
use crate::body::{BodySize, MessageBody};
pub(crate) async fn send_request<T, B>(
io: T,
mut head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> Result<(ResponseHead, Payload), SendRequestError>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
B: MessageBody,
{
// set request host header
if !head.as_ref().headers.contains_key(HOST)
&& !head.extra_headers().iter().any(|h| h.contains_key(HOST))
{
if let Some(host) = head.as_ref().uri.host() {
let mut wrt = BytesMut::with_capacity(host.len() + 5).writer();
let _ = match head.as_ref().uri.port_u16() {
None | Some(80) | Some(443) => write!(wrt, "{}", host),
Some(port) => write!(wrt, "{}:{}", host, port),
};
match wrt.get_mut().split().freeze().try_into_value() {
Ok(value) => match head {
RequestHeadType::Owned(ref mut head) => {
head.headers.insert(HOST, value);
}
RequestHeadType::Rc(_, ref mut extra_headers) => {
let headers = extra_headers.get_or_insert(HeaderMap::new());
headers.insert(HOST, value);
}
},
Err(e) => log::error!("Can not set HOST header {}", e),
}
}
}
let io = H1Connection {
created,
pool,
io: Some(io),
};
// create Framed and prepare sending request
let mut framed = Framed::new(io, h1::ClientCodec::default());
// Check EXPECT header and enable expect handle flag accordingly.
//
// RFC: https://tools.ietf.org/html/rfc7231#section-5.1.1
let is_expect = if head.as_ref().headers.contains_key(EXPECT) {
match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
let pin_framed = Pin::new(&mut framed);
let force_close = !pin_framed.codec_ref().keepalive();
release_connection(pin_framed, force_close);
// TODO: use a new variant or a new type better describing error violate
// `Requirements for clients` session of above RFC
return Err(SendRequestError::Connect(ConnectError::Disconnected));
}
_ => true,
}
} else {
false
};
framed.send((head, body.size()).into()).await?;
let mut pin_framed = Pin::new(&mut framed);
// special handle for EXPECT request.
let (do_send, mut res_head) = if is_expect {
let head = poll_fn(|cx| pin_framed.as_mut().poll_next(cx))
.await
.ok_or(ConnectError::Disconnected)??;
// return response head in case status code is not continue
// and current head would be used as final response head.
(head.status == StatusCode::CONTINUE, Some(head))
} else {
(true, None)
};
if do_send {
// send request body
match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {}
_ => send_body(body, pin_framed.as_mut()).await?,
};
// read response and init read body
let head = poll_fn(|cx| pin_framed.as_mut().poll_next(cx))
.await
.ok_or(ConnectError::Disconnected)??;
res_head = Some(head);
}
let head = res_head.unwrap();
match pin_framed.codec_ref().message_type() {
h1::MessageType::None => {
let force_close = !pin_framed.codec_ref().keepalive();
release_connection(pin_framed, force_close);
Ok((head, Payload::None))
}
_ => {
let pl: PayloadStream = Box::pin(PlStream::new(framed));
Ok((head, pl.into()))
}
}
}
pub(crate) async fn open_tunnel<T>(
io: T,
head: RequestHeadType,
) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
// create Framed and send request
let mut framed = Framed::new(io, h1::ClientCodec::default());
framed.send((head, BodySize::None).into()).await?;
// read response
if let (Some(result), framed) = framed.into_future().await {
let head = result.map_err(SendRequestError::from)?;
Ok((head, framed))
} else {
Err(SendRequestError::from(ConnectError::Disconnected))
}
}
/// send request body to the peer
pub(crate) async fn send_body<T, B>(
body: B,
mut framed: Pin<&mut Framed<T, h1::ClientCodec>>,
) -> Result<(), SendRequestError>
where
T: ConnectionLifetime + Unpin,
B: MessageBody,
{
actix_rt::pin!(body);
let mut eof = false;
while !eof {
while !eof && !framed.as_ref().is_write_buf_full() {
match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
Some(result) => {
framed.as_mut().write(h1::Message::Chunk(Some(result?)))?;
}
None => {
eof = true;
framed.as_mut().write(h1::Message::Chunk(None))?;
}
}
}
if !framed.as_ref().is_write_buf_empty() {
poll_fn(|cx| match framed.as_mut().flush(cx) {
Poll::Ready(Ok(_)) => Poll::Ready(Ok(())),
Poll::Ready(Err(err)) => Poll::Ready(Err(err)),
Poll::Pending => {
if !framed.as_ref().is_write_buf_full() {
Poll::Ready(Ok(()))
} else {
Poll::Pending
}
}
})
.await?;
}
}
SinkExt::flush(Pin::into_inner(framed)).await?;
Ok(())
}
#[doc(hidden)]
/// HTTP client connection
pub struct H1Connection<T>
where
T: AsyncWrite + Unpin + 'static,
{
/// T should be `Unpin`
io: Option<T>,
created: time::Instant,
pool: Option<Acquired<T>>,
}
impl<T> ConnectionLifetime for H1Connection<T>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
/// Close connection
fn close(mut self: Pin<&mut Self>) {
if let Some(mut pool) = self.pool.take() {
if let Some(io) = self.io.take() {
pool.close(IoConnection::new(
ConnectionType::H1(io),
self.created,
None,
));
}
}
}
/// Release this connection to the connection pool
fn release(mut self: Pin<&mut Self>) {
if let Some(mut pool) = self.pool.take() {
if let Some(io) = self.io.take() {
pool.release(IoConnection::new(
ConnectionType::H1(io),
self.created,
None,
));
}
}
}
}
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
fn poll_read(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut ReadBuf<'_>,
) -> Poll<io::Result<()>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
}
}
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
fn poll_write(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
}
fn poll_flush(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
}
fn poll_shutdown(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Result<(), io::Error>> {
Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
}
}
#[pin_project::pin_project]
pub(crate) struct PlStream<Io> {
#[pin]
framed: Option<Framed<Io, h1::ClientPayloadCodec>>,
}
impl<Io: ConnectionLifetime> PlStream<Io> {
fn new(framed: Framed<Io, h1::ClientCodec>) -> Self {
let framed = framed.into_map_codec(|codec| codec.into_payload_codec());
PlStream {
framed: Some(framed),
}
}
}
impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
type Item = Result<Bytes, PayloadError>;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
let mut this = self.project();
match this.framed.as_mut().as_pin_mut().unwrap().next_item(cx)? {
Poll::Pending => Poll::Pending,
Poll::Ready(Some(chunk)) => {
if let Some(chunk) = chunk {
Poll::Ready(Some(Ok(chunk)))
} else {
let framed = this.framed.as_mut().as_pin_mut().unwrap();
let force_close = !framed.codec_ref().keepalive();
release_connection(framed, force_close);
Poll::Ready(None)
}
}
Poll::Ready(None) => Poll::Ready(None),
}
}
}
fn release_connection<T, U>(framed: Pin<&mut Framed<T, U>>, force_close: bool)
where
T: ConnectionLifetime,
{
if !force_close && framed.is_read_buf_empty() && framed.is_write_buf_empty() {
framed.io_pin().release()
} else {
framed.io_pin().close()
}
}

View File

@@ -1,210 +0,0 @@
use std::future::Future;
use std::time;
use actix_codec::{AsyncRead, AsyncWrite};
use bytes::Bytes;
use futures_util::future::poll_fn;
use h2::{
client::{Builder, Connection, SendRequest},
SendStream,
};
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING};
use http::{request::Request, Method, Version};
use crate::body::{BodySize, MessageBody};
use crate::header::HeaderMap;
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::Payload;
use super::config::ConnectorConfig;
use super::connection::{ConnectionType, IoConnection};
use super::error::SendRequestError;
use super::pool::Acquired;
use crate::client::connection::H2Connection;
pub(crate) async fn send_request<T, B>(
mut io: H2Connection,
head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> Result<(ResponseHead, Payload), SendRequestError>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
B: MessageBody,
{
trace!("Sending client request: {:?} {:?}", head, body.size());
let head_req = head.as_ref().method == Method::HEAD;
let length = body.size();
let eof = matches!(
length,
BodySize::None | BodySize::Empty | BodySize::Sized(0)
);
let mut req = Request::new(());
*req.uri_mut() = head.as_ref().uri.clone();
*req.method_mut() = head.as_ref().method.clone();
*req.version_mut() = Version::HTTP_2;
let mut skip_len = true;
// let mut has_date = false;
// Content length
let _ = match length {
BodySize::None => None,
BodySize::Stream => {
skip_len = false;
None
}
BodySize::Empty => req
.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
BodySize::Sized(len) => {
let mut buf = itoa::Buffer::new();
req.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::from_str(buf.format(len)).unwrap(),
)
}
};
// Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
let (head, extra_headers) = match head {
RequestHeadType::Owned(head) => (RequestHeadType::Owned(head), HeaderMap::new()),
RequestHeadType::Rc(head, extra_headers) => (
RequestHeadType::Rc(head, None),
extra_headers.unwrap_or_else(HeaderMap::new),
),
};
// merging headers from head and extra headers.
let headers = head
.as_ref()
.headers
.iter()
.filter(|(name, _)| !extra_headers.contains_key(*name))
.chain(extra_headers.iter());
// copy headers
for (key, value) in headers {
match *key {
// TODO: consider skipping other headers according to:
// https://tools.ietf.org/html/rfc7540#section-8.1.2.2
// omit HTTP/1.x only headers
CONNECTION | TRANSFER_ENCODING => continue,
CONTENT_LENGTH if skip_len => continue,
// DATE => has_date = true,
_ => {}
}
req.headers_mut().append(key, value.clone());
}
let res = poll_fn(|cx| io.poll_ready(cx)).await;
if let Err(e) = res {
release(io, pool, created, e.is_io());
return Err(SendRequestError::from(e));
}
let resp = match io.send_request(req, eof) {
Ok((fut, send)) => {
release(io, pool, created, false);
if !eof {
send_body(body, send).await?;
}
fut.await.map_err(SendRequestError::from)?
}
Err(e) => {
release(io, pool, created, e.is_io());
return Err(e.into());
}
};
let (parts, body) = resp.into_parts();
let payload = if head_req { Payload::None } else { body.into() };
let mut head = ResponseHead::new(parts.status);
head.version = parts.version;
head.headers = parts.headers.into();
Ok((head, payload))
}
async fn send_body<B: MessageBody>(
body: B,
mut send: SendStream<Bytes>,
) -> Result<(), SendRequestError> {
let mut buf = None;
actix_rt::pin!(body);
loop {
if buf.is_none() {
match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
Some(Ok(b)) => {
send.reserve_capacity(b.len());
buf = Some(b);
}
Some(Err(e)) => return Err(e.into()),
None => {
if let Err(e) = send.send_data(Bytes::new(), true) {
return Err(e.into());
}
send.reserve_capacity(0);
return Ok(());
}
}
}
match poll_fn(|cx| send.poll_capacity(cx)).await {
None => return Ok(()),
Some(Ok(cap)) => {
let b = buf.as_mut().unwrap();
let len = b.len();
let bytes = b.split_to(std::cmp::min(cap, len));
if let Err(e) = send.send_data(bytes, false) {
return Err(e.into());
} else {
if !b.is_empty() {
send.reserve_capacity(b.len());
} else {
buf = None;
}
continue;
}
}
Some(Err(e)) => return Err(e.into()),
}
}
}
/// release SendRequest object
fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
io: H2Connection,
pool: Option<Acquired<T>>,
created: time::Instant,
close: bool,
) {
if let Some(mut pool) = pool {
if close {
pool.close(IoConnection::new(ConnectionType::H2(io), created, None));
} else {
pool.release(IoConnection::new(ConnectionType::H2(io), created, None));
}
}
}
pub(crate) fn handshake<Io>(
io: Io,
config: &ConnectorConfig,
) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
let mut builder = Builder::new();
builder
.initial_window_size(config.stream_window_size)
.initial_connection_window_size(config.conn_window_size)
.enable_push(false);
builder.handshake(io)
}

View File

@@ -1,26 +0,0 @@
//! HTTP client.
use http::Uri;
mod config;
mod connection;
mod connector;
mod error;
mod h1proto;
mod h2proto;
mod pool;
pub use actix_tls::connect::{
Connect as TcpConnect, ConnectError as TcpConnectError, Connection as TcpConnection,
};
pub use self::connection::Connection;
pub use self::connector::Connector;
pub use self::error::{ConnectError, FreezeRequestError, InvalidUrl, SendRequestError};
pub use self::pool::Protocol;
#[derive(Clone)]
pub struct Connect {
pub uri: Uri,
pub addr: Option<std::net::SocketAddr>,
}

View File

@@ -1,678 +0,0 @@
//! Client connection pooling keyed on the authority part of the connection URI.
use std::collections::VecDeque;
use std::future::Future;
use std::ops::Deref;
use std::pin::Pin;
use std::rc::Rc;
use std::sync::Arc;
use std::task::{Context, Poll};
use std::time::{Duration, Instant};
use std::{cell::RefCell, io};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::time::{sleep, Sleep};
use actix_service::Service;
use ahash::AHashMap;
use futures_core::future::LocalBoxFuture;
use http::uri::Authority;
use pin_project::pin_project;
use tokio::io::ReadBuf;
use tokio::sync::{OwnedSemaphorePermit, Semaphore};
use super::config::ConnectorConfig;
use super::connection::{ConnectionType, H2Connection, IoConnection};
use super::error::ConnectError;
use super::h2proto::handshake;
use super::Connect;
#[derive(Clone, Copy, PartialEq)]
/// Protocol version
pub enum Protocol {
Http1,
Http2,
}
#[derive(Hash, Eq, PartialEq, Clone, Debug)]
pub(crate) struct Key {
authority: Authority,
}
impl From<Authority> for Key {
fn from(authority: Authority) -> Key {
Key { authority }
}
}
/// Connections pool for reuse Io type for certain [`http::uri::Authority`] as key.
pub(crate) struct ConnectionPool<S, Io>
where
Io: AsyncWrite + Unpin + 'static,
{
connector: Rc<S>,
inner: ConnectionPoolInner<Io>,
}
/// wrapper type for check the ref count of Rc.
struct ConnectionPoolInner<Io>(Rc<ConnectionPoolInnerPriv<Io>>)
where
Io: AsyncWrite + Unpin + 'static;
impl<Io> ConnectionPoolInner<Io>
where
Io: AsyncWrite + Unpin + 'static,
{
/// spawn a async for graceful shutdown h1 Io type with a timeout.
fn close(&self, conn: ConnectionType<Io>) {
if let Some(timeout) = self.config.disconnect_timeout {
if let ConnectionType::H1(io) = conn {
actix_rt::spawn(CloseConnection::new(io, timeout));
}
}
}
}
impl<Io> Clone for ConnectionPoolInner<Io>
where
Io: AsyncWrite + Unpin + 'static,
{
fn clone(&self) -> Self {
Self(Rc::clone(&self.0))
}
}
impl<Io> Deref for ConnectionPoolInner<Io>
where
Io: AsyncWrite + Unpin + 'static,
{
type Target = ConnectionPoolInnerPriv<Io>;
fn deref(&self) -> &Self::Target {
&*self.0
}
}
impl<Io> Drop for ConnectionPoolInner<Io>
where
Io: AsyncWrite + Unpin + 'static,
{
fn drop(&mut self) {
// When strong count is one it means the pool is dropped
// remove and drop all Io types.
if Rc::strong_count(&self.0) == 1 {
self.permits.close();
std::mem::take(&mut *self.available.borrow_mut())
.into_iter()
.for_each(|(_, conns)| {
conns.into_iter().for_each(|pooled| self.close(pooled.conn))
});
}
}
}
struct ConnectionPoolInnerPriv<Io>
where
Io: AsyncWrite + Unpin + 'static,
{
config: ConnectorConfig,
available: RefCell<AHashMap<Key, VecDeque<PooledConnection<Io>>>>,
permits: Arc<Semaphore>,
}
impl<S, Io> ConnectionPool<S, Io>
where
Io: AsyncWrite + Unpin + 'static,
{
/// Construct a new connection pool.
///
/// [`super::config::ConnectorConfig`]'s `limit` is used as the max permits allowed for
/// in-flight connections.
///
/// The pool can only have equal to `limit` amount of requests spawning/using Io type
/// concurrently.
///
/// Any requests beyond limit would be wait in fifo order and get notified in async manner
/// by [`tokio::sync::Semaphore`]
pub(crate) fn new(connector: S, config: ConnectorConfig) -> Self {
let permits = Arc::new(Semaphore::new(config.limit));
let available = RefCell::new(AHashMap::default());
let connector = Rc::new(connector);
let inner = ConnectionPoolInner(Rc::new(ConnectionPoolInnerPriv {
config,
available,
permits,
}));
Self { connector, inner }
}
}
impl<S, Io> Clone for ConnectionPool<S, Io>
where
Io: AsyncWrite + Unpin + 'static,
{
fn clone(&self) -> Self {
Self {
connector: self.connector.clone(),
inner: self.inner.clone(),
}
}
}
impl<S, Io> Service<Connect> for ConnectionPool<S, Io>
where
S: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Response = IoConnection<Io>;
type Error = ConnectError;
type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
actix_service::forward_ready!(connector);
fn call(&self, req: Connect) -> Self::Future {
let connector = self.connector.clone();
let inner = self.inner.clone();
Box::pin(async move {
let key = if let Some(authority) = req.uri.authority() {
authority.clone().into()
} else {
return Err(ConnectError::Unresolved);
};
// acquire an owned permit and carry it with connection
let permit = inner.permits.clone().acquire_owned().await.map_err(|_| {
ConnectError::Io(io::Error::new(
io::ErrorKind::Other,
"failed to acquire semaphore on client connection pool",
))
})?;
let conn = {
let mut conn = None;
// check if there is idle connection for given key.
let mut map = inner.available.borrow_mut();
if let Some(conns) = map.get_mut(&key) {
let now = Instant::now();
while let Some(mut c) = conns.pop_front() {
let config = &inner.config;
let idle_dur = now - c.used;
let age = now - c.created;
let conn_ineligible = idle_dur > config.conn_keep_alive
|| age > config.conn_lifetime;
if conn_ineligible {
// drop connections that are too old
inner.close(c.conn);
} else {
// check if the connection is still usable
if let ConnectionType::H1(ref mut io) = c.conn {
let check = ConnectionCheckFuture { io };
match check.await {
ConnectionState::Tainted => {
inner.close(c.conn);
continue;
}
ConnectionState::Skip => continue,
ConnectionState::Live => conn = Some(c),
}
} else {
conn = Some(c);
}
break;
}
}
};
conn
};
// construct acquired. It's used to put Io type back to pool/ close the Io type.
// permit is carried with the whole lifecycle of Acquired.
let acquired = Some(Acquired { key, inner, permit });
// match the connection and spawn new one if did not get anything.
match conn {
Some(conn) => Ok(IoConnection::new(conn.conn, conn.created, acquired)),
None => {
let (io, proto) = connector.call(req).await?;
if proto == Protocol::Http1 {
Ok(IoConnection::new(
ConnectionType::H1(io),
Instant::now(),
acquired,
))
} else {
let config = &acquired.as_ref().unwrap().inner.config;
let (sender, connection) = handshake(io, config).await?;
Ok(IoConnection::new(
ConnectionType::H2(H2Connection::new(sender, connection)),
Instant::now(),
acquired,
))
}
}
}
})
}
}
/// Type for check the connection and determine if it's usable.
struct ConnectionCheckFuture<'a, Io> {
io: &'a mut Io,
}
enum ConnectionState {
/// IO is pending and a new request would wake it.
Live,
/// IO unexpectedly has unread data and should be dropped.
Tainted,
/// IO should be skipped but not dropped.
Skip,
}
impl<Io> Future for ConnectionCheckFuture<'_, Io>
where
Io: AsyncRead + Unpin,
{
type Output = ConnectionState;
// this future is only used to get access to Context.
// It should never return Poll::Pending.
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.get_mut();
let mut buf = [0; 2];
let mut read_buf = ReadBuf::new(&mut buf);
let state = match Pin::new(&mut this.io).poll_read(cx, &mut read_buf) {
Poll::Ready(Ok(())) if !read_buf.filled().is_empty() => {
ConnectionState::Tainted
}
Poll::Pending => ConnectionState::Live,
_ => ConnectionState::Skip,
};
Poll::Ready(state)
}
}
struct PooledConnection<Io> {
conn: ConnectionType<Io>,
used: Instant,
created: Instant,
}
#[pin_project]
struct CloseConnection<Io> {
io: Io,
#[pin]
timeout: Sleep,
}
impl<Io> CloseConnection<Io>
where
Io: AsyncWrite + Unpin,
{
fn new(io: Io, timeout: Duration) -> Self {
CloseConnection {
io,
timeout: sleep(timeout),
}
}
}
impl<Io> Future for CloseConnection<Io>
where
Io: AsyncWrite + Unpin,
{
type Output = ();
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<()> {
let this = self.project();
match this.timeout.poll(cx) {
Poll::Ready(_) => Poll::Ready(()),
Poll::Pending => Pin::new(this.io).poll_shutdown(cx).map(|_| ()),
}
}
}
pub(crate) struct Acquired<Io>
where
Io: AsyncWrite + Unpin + 'static,
{
key: Key,
inner: ConnectionPoolInner<Io>,
permit: OwnedSemaphorePermit,
}
impl<Io> Acquired<Io>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
/// Close the IO.
pub(crate) fn close(&mut self, conn: IoConnection<Io>) {
let (conn, _) = conn.into_inner();
self.inner.close(conn);
}
/// Release IO back into pool.
pub(crate) fn release(&mut self, conn: IoConnection<Io>) {
let (io, created) = conn.into_inner();
let Acquired { key, inner, .. } = self;
inner
.available
.borrow_mut()
.entry(key.clone())
.or_insert_with(VecDeque::new)
.push_back(PooledConnection {
conn: io,
created,
used: Instant::now(),
});
let _ = &mut self.permit;
}
}
#[cfg(test)]
mod test {
use std::{cell::Cell, io};
use http::Uri;
use super::*;
use crate::client::connection::IoConnection;
/// A stream type that always returns pending on async read.
///
/// Mocks an idle TCP stream that is ready to be used for client connections.
struct TestStream(Rc<Cell<usize>>);
impl Drop for TestStream {
fn drop(&mut self) {
self.0.set(self.0.get() - 1);
}
}
impl AsyncRead for TestStream {
fn poll_read(
self: Pin<&mut Self>,
_: &mut Context<'_>,
_: &mut ReadBuf<'_>,
) -> Poll<io::Result<()>> {
Poll::Pending
}
}
impl AsyncWrite for TestStream {
fn poll_write(
self: Pin<&mut Self>,
_: &mut Context<'_>,
_: &[u8],
) -> Poll<io::Result<usize>> {
unimplemented!()
}
fn poll_flush(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<io::Result<()>> {
unimplemented!()
}
fn poll_shutdown(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<io::Result<()>> {
Poll::Ready(Ok(()))
}
}
struct TestPoolConnector {
generated: Rc<Cell<usize>>,
}
impl Service<Connect> for TestPoolConnector {
type Response = (TestStream, Protocol);
type Error = ConnectError;
type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
actix_service::always_ready!();
fn call(&self, _: Connect) -> Self::Future {
self.generated.set(self.generated.get() + 1);
let generated = self.generated.clone();
Box::pin(async { Ok((TestStream(generated), Protocol::Http1)) })
}
}
fn release<T>(conn: IoConnection<T>)
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
let (conn, created, mut acquired) = conn.into_parts();
acquired.release(IoConnection::new(conn, created, None));
}
#[actix_rt::test]
async fn test_pool_limit() {
let connector = TestPoolConnector {
generated: Rc::new(Cell::new(0)),
};
let config = ConnectorConfig {
limit: 1,
..Default::default()
};
let pool = super::ConnectionPool::new(connector, config);
let req = Connect {
uri: Uri::from_static("http://localhost"),
addr: None,
};
let conn = pool.call(req.clone()).await.unwrap();
let waiting = Rc::new(Cell::new(true));
let waiting_clone = waiting.clone();
actix_rt::spawn(async move {
actix_rt::time::sleep(Duration::from_millis(100)).await;
waiting_clone.set(false);
drop(conn);
});
assert!(waiting.get());
let now = Instant::now();
let conn = pool.call(req).await.unwrap();
release(conn);
assert!(!waiting.get());
assert!(now.elapsed() >= Duration::from_millis(100));
}
#[actix_rt::test]
async fn test_pool_keep_alive() {
let generated = Rc::new(Cell::new(0));
let generated_clone = generated.clone();
let connector = TestPoolConnector { generated };
let config = ConnectorConfig {
conn_keep_alive: Duration::from_secs(1),
..Default::default()
};
let pool = super::ConnectionPool::new(connector, config);
let req = Connect {
uri: Uri::from_static("http://localhost"),
addr: None,
};
let conn = pool.call(req.clone()).await.unwrap();
assert_eq!(1, generated_clone.get());
release(conn);
let conn = pool.call(req.clone()).await.unwrap();
assert_eq!(1, generated_clone.get());
release(conn);
actix_rt::time::sleep(Duration::from_millis(1500)).await;
actix_rt::task::yield_now().await;
let conn = pool.call(req).await.unwrap();
// Note: spawned recycle connection is not ran yet.
// This is tokio current thread runtime specific behavior.
assert_eq!(2, generated_clone.get());
// yield task so the old connection is properly dropped.
actix_rt::task::yield_now().await;
assert_eq!(1, generated_clone.get());
release(conn);
}
#[actix_rt::test]
async fn test_pool_lifetime() {
let generated = Rc::new(Cell::new(0));
let generated_clone = generated.clone();
let connector = TestPoolConnector { generated };
let config = ConnectorConfig {
conn_lifetime: Duration::from_secs(1),
..Default::default()
};
let pool = super::ConnectionPool::new(connector, config);
let req = Connect {
uri: Uri::from_static("http://localhost"),
addr: None,
};
let conn = pool.call(req.clone()).await.unwrap();
assert_eq!(1, generated_clone.get());
release(conn);
let conn = pool.call(req.clone()).await.unwrap();
assert_eq!(1, generated_clone.get());
release(conn);
actix_rt::time::sleep(Duration::from_millis(1500)).await;
actix_rt::task::yield_now().await;
let conn = pool.call(req).await.unwrap();
// Note: spawned recycle connection is not ran yet.
// This is tokio current thread runtime specific behavior.
assert_eq!(2, generated_clone.get());
// yield task so the old connection is properly dropped.
actix_rt::task::yield_now().await;
assert_eq!(1, generated_clone.get());
release(conn);
}
#[actix_rt::test]
async fn test_pool_authority_key() {
let generated = Rc::new(Cell::new(0));
let generated_clone = generated.clone();
let connector = TestPoolConnector { generated };
let config = ConnectorConfig::default();
let pool = super::ConnectionPool::new(connector, config);
let req = Connect {
uri: Uri::from_static("https://crates.io"),
addr: None,
};
let conn = pool.call(req.clone()).await.unwrap();
assert_eq!(1, generated_clone.get());
release(conn);
let conn = pool.call(req).await.unwrap();
assert_eq!(1, generated_clone.get());
release(conn);
let req = Connect {
uri: Uri::from_static("https://google.com"),
addr: None,
};
let conn = pool.call(req.clone()).await.unwrap();
assert_eq!(2, generated_clone.get());
release(conn);
let conn = pool.call(req).await.unwrap();
assert_eq!(2, generated_clone.get());
release(conn);
}
#[actix_rt::test]
async fn test_pool_drop() {
let generated = Rc::new(Cell::new(0));
let generated_clone = generated.clone();
let connector = TestPoolConnector { generated };
let config = ConnectorConfig::default();
let pool = Rc::new(super::ConnectionPool::new(connector, config));
let req = Connect {
uri: Uri::from_static("https://crates.io"),
addr: None,
};
let conn = pool.call(req.clone()).await.unwrap();
assert_eq!(1, generated_clone.get());
release(conn);
let req = Connect {
uri: Uri::from_static("https://google.com"),
addr: None,
};
let conn = pool.call(req.clone()).await.unwrap();
assert_eq!(2, generated_clone.get());
release(conn);
let clone1 = pool.clone();
let clone2 = clone1.clone();
drop(clone2);
for _ in 0..2 {
actix_rt::task::yield_now().await;
}
assert_eq!(2, generated_clone.get());
drop(clone1);
for _ in 0..2 {
actix_rt::task::yield_now().await;
}
assert_eq!(2, generated_clone.get());
drop(pool);
for _ in 0..2 {
actix_rt::task::yield_now().await;
}
assert_eq!(0, generated_clone.get());
}
}

View File

@@ -1,402 +0,0 @@
use std::cell::Cell;
use std::fmt::Write;
use std::rc::Rc;
use std::time::Duration;
use std::{fmt, net};
use actix_rt::{
task::JoinHandle,
time::{interval, sleep_until, Instant, Sleep},
};
use bytes::BytesMut;
use time::OffsetDateTime;
/// "Sun, 06 Nov 1994 08:49:37 GMT".len()
const DATE_VALUE_LENGTH: usize = 29;
#[derive(Debug, PartialEq, Clone, Copy)]
/// Server keep-alive setting
pub enum KeepAlive {
/// Keep alive in seconds
Timeout(usize),
/// Rely on OS to shutdown tcp connection
Os,
/// Disabled
Disabled,
}
impl From<usize> for KeepAlive {
fn from(keepalive: usize) -> Self {
KeepAlive::Timeout(keepalive)
}
}
impl From<Option<usize>> for KeepAlive {
fn from(keepalive: Option<usize>) -> Self {
if let Some(keepalive) = keepalive {
KeepAlive::Timeout(keepalive)
} else {
KeepAlive::Disabled
}
}
}
/// Http service configuration
pub struct ServiceConfig(Rc<Inner>);
struct Inner {
keep_alive: Option<Duration>,
client_timeout: u64,
client_disconnect: u64,
ka_enabled: bool,
secure: bool,
local_addr: Option<std::net::SocketAddr>,
date_service: DateService,
}
impl Clone for ServiceConfig {
fn clone(&self) -> Self {
ServiceConfig(self.0.clone())
}
}
impl Default for ServiceConfig {
fn default() -> Self {
Self::new(KeepAlive::Timeout(5), 0, 0, false, None)
}
}
impl ServiceConfig {
/// Create instance of `ServiceConfig`
pub fn new(
keep_alive: KeepAlive,
client_timeout: u64,
client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
) -> ServiceConfig {
let (keep_alive, ka_enabled) = match keep_alive {
KeepAlive::Timeout(val) => (val as u64, true),
KeepAlive::Os => (0, true),
KeepAlive::Disabled => (0, false),
};
let keep_alive = if ka_enabled && keep_alive > 0 {
Some(Duration::from_secs(keep_alive))
} else {
None
};
ServiceConfig(Rc::new(Inner {
keep_alive,
ka_enabled,
client_timeout,
client_disconnect,
secure,
local_addr,
date_service: DateService::new(),
}))
}
/// Returns true if connection is secure (HTTPS)
#[inline]
pub fn secure(&self) -> bool {
self.0.secure
}
/// Returns the local address that this server is bound to.
#[inline]
pub fn local_addr(&self) -> Option<net::SocketAddr> {
self.0.local_addr
}
/// Keep alive duration if configured.
#[inline]
pub fn keep_alive(&self) -> Option<Duration> {
self.0.keep_alive
}
/// Return state of connection keep-alive functionality
#[inline]
pub fn keep_alive_enabled(&self) -> bool {
self.0.ka_enabled
}
/// Client timeout for first request.
#[inline]
pub fn client_timer(&self) -> Option<Sleep> {
let delay_time = self.0.client_timeout;
if delay_time != 0 {
Some(sleep_until(
self.0.date_service.now() + Duration::from_millis(delay_time),
))
} else {
None
}
}
/// Client timeout for first request.
pub fn client_timer_expire(&self) -> Option<Instant> {
let delay = self.0.client_timeout;
if delay != 0 {
Some(self.0.date_service.now() + Duration::from_millis(delay))
} else {
None
}
}
/// Client disconnect timer
pub fn client_disconnect_timer(&self) -> Option<Instant> {
let delay = self.0.client_disconnect;
if delay != 0 {
Some(self.0.date_service.now() + Duration::from_millis(delay))
} else {
None
}
}
#[inline]
/// Return keep-alive timer delay is configured.
pub fn keep_alive_timer(&self) -> Option<Sleep> {
if let Some(ka) = self.0.keep_alive {
Some(sleep_until(self.0.date_service.now() + ka))
} else {
None
}
}
/// Keep-alive expire time
pub fn keep_alive_expire(&self) -> Option<Instant> {
if let Some(ka) = self.0.keep_alive {
Some(self.0.date_service.now() + ka)
} else {
None
}
}
#[inline]
pub(crate) fn now(&self) -> Instant {
self.0.date_service.now()
}
#[doc(hidden)]
pub fn set_date(&self, dst: &mut BytesMut) {
let mut buf: [u8; 39] = [0; 39];
buf[..6].copy_from_slice(b"date: ");
self.0
.date_service
.set_date(|date| buf[6..35].copy_from_slice(&date.bytes));
buf[35..].copy_from_slice(b"\r\n\r\n");
dst.extend_from_slice(&buf);
}
pub(crate) fn set_date_header(&self, dst: &mut BytesMut) {
self.0
.date_service
.set_date(|date| dst.extend_from_slice(&date.bytes));
}
}
#[derive(Copy, Clone)]
struct Date {
bytes: [u8; DATE_VALUE_LENGTH],
pos: usize,
}
impl Date {
fn new() -> Date {
let mut date = Date {
bytes: [0; DATE_VALUE_LENGTH],
pos: 0,
};
date.update();
date
}
fn update(&mut self) {
self.pos = 0;
write!(
self,
"{}",
OffsetDateTime::now_utc().format("%a, %d %b %Y %H:%M:%S GMT")
)
.unwrap();
}
}
impl fmt::Write for Date {
fn write_str(&mut self, s: &str) -> fmt::Result {
let len = s.len();
self.bytes[self.pos..self.pos + len].copy_from_slice(s.as_bytes());
self.pos += len;
Ok(())
}
}
/// Service for update Date and Instant periodically at 500 millis interval.
struct DateService {
current: Rc<Cell<(Date, Instant)>>,
handle: JoinHandle<()>,
}
impl Drop for DateService {
fn drop(&mut self) {
// stop the timer update async task on drop.
self.handle.abort();
}
}
impl DateService {
fn new() -> Self {
// shared date and timer for DateService and update async task.
let current = Rc::new(Cell::new((Date::new(), Instant::now())));
let current_clone = Rc::clone(&current);
// spawn an async task sleep for 500 milli and update current date/timer in a loop.
// handle is used to stop the task on DateService drop.
let handle = actix_rt::spawn(async move {
#[cfg(test)]
let _notify = notify_on_drop::NotifyOnDrop::new();
let mut interval = interval(Duration::from_millis(500));
loop {
let now = interval.tick().await;
let date = Date::new();
current_clone.set((date, now));
}
});
DateService { current, handle }
}
fn now(&self) -> Instant {
self.current.get().1
}
fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
f(&self.current.get().0);
}
}
// TODO: move to a util module for testing all spawn handle drop style tasks.
#[cfg(test)]
/// Test Module for checking the drop state of certain async tasks that are spawned
/// with `actix_rt::spawn`
///
/// The target task must explicitly generate `NotifyOnDrop` when spawn the task
mod notify_on_drop {
use std::cell::RefCell;
thread_local! {
static NOTIFY_DROPPED: RefCell<Option<bool>> = RefCell::new(None);
}
/// Check if the spawned task is dropped.
///
/// # Panic:
///
/// When there was no `NotifyOnDrop` instance on current thread
pub(crate) fn is_dropped() -> bool {
NOTIFY_DROPPED.with(|bool| {
bool.borrow()
.expect("No NotifyOnDrop existed on current thread")
})
}
pub(crate) struct NotifyOnDrop;
impl NotifyOnDrop {
/// # Panic:
///
/// When construct multiple instances on any given thread.
pub(crate) fn new() -> Self {
NOTIFY_DROPPED.with(|bool| {
let mut bool = bool.borrow_mut();
if bool.is_some() {
panic!("NotifyOnDrop existed on current thread");
} else {
*bool = Some(false);
}
});
NotifyOnDrop
}
}
impl Drop for NotifyOnDrop {
fn drop(&mut self) {
NOTIFY_DROPPED.with(|bool| {
if let Some(b) = bool.borrow_mut().as_mut() {
*b = true;
}
});
}
}
}
#[cfg(test)]
mod tests {
use super::*;
use actix_rt::task::yield_now;
#[actix_rt::test]
async fn test_date_service_update() {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
yield_now().await;
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1);
let now1 = settings.now();
sleep_until(Instant::now() + Duration::from_secs(2)).await;
yield_now().await;
let now2 = settings.now();
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2);
assert_ne!(now1, now2);
assert_ne!(buf1, buf2);
drop(settings);
assert!(notify_on_drop::is_dropped());
}
#[actix_rt::test]
async fn test_date_service_drop() {
let service = Rc::new(DateService::new());
// yield so date service have a chance to register the spawned timer update task.
yield_now().await;
let clone1 = service.clone();
let clone2 = service.clone();
let clone3 = service.clone();
drop(clone1);
assert_eq!(false, notify_on_drop::is_dropped());
drop(clone2);
assert_eq!(false, notify_on_drop::is_dropped());
drop(clone3);
assert_eq!(false, notify_on_drop::is_dropped());
drop(service);
assert!(notify_on_drop::is_dropped());
}
#[test]
fn test_date_len() {
assert_eq!(DATE_VALUE_LENGTH, "Sun, 06 Nov 1994 08:49:37 GMT".len());
}
#[actix_rt::test]
async fn test_date() {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1);
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2);
assert_eq!(buf1, buf2);
}
}

View File

@@ -1,237 +0,0 @@
//! Stream decoders.
use std::{
future::Future,
io::{self, Write as _},
pin::Pin,
task::{Context, Poll},
};
use actix_rt::task::{spawn_blocking, JoinHandle};
use brotli2::write::BrotliDecoder;
use bytes::Bytes;
use flate2::write::{GzDecoder, ZlibDecoder};
use futures_core::{ready, Stream};
use crate::{
encoding::Writer,
error::{BlockingError, PayloadError},
http::header::{ContentEncoding, HeaderMap, CONTENT_ENCODING},
};
const MAX_CHUNK_SIZE_DECODE_IN_PLACE: usize = 2049;
pub struct Decoder<S> {
decoder: Option<ContentDecoder>,
stream: S,
eof: bool,
fut: Option<JoinHandle<Result<(Option<Bytes>, ContentDecoder), io::Error>>>,
}
impl<S> Decoder<S>
where
S: Stream<Item = Result<Bytes, PayloadError>>,
{
/// Construct a decoder.
#[inline]
pub fn new(stream: S, encoding: ContentEncoding) -> Decoder<S> {
let decoder = match encoding {
ContentEncoding::Br => Some(ContentDecoder::Br(Box::new(
BrotliDecoder::new(Writer::new()),
))),
ContentEncoding::Deflate => Some(ContentDecoder::Deflate(Box::new(
ZlibDecoder::new(Writer::new()),
))),
ContentEncoding::Gzip => Some(ContentDecoder::Gzip(Box::new(
GzDecoder::new(Writer::new()),
))),
_ => None,
};
Decoder {
decoder,
stream,
fut: None,
eof: false,
}
}
/// Construct decoder based on headers.
#[inline]
pub fn from_headers(stream: S, headers: &HeaderMap) -> Decoder<S> {
// check content-encoding
let encoding = headers
.get(&CONTENT_ENCODING)
.and_then(|val| val.to_str().ok())
.map(ContentEncoding::from)
.unwrap_or(ContentEncoding::Identity);
Self::new(stream, encoding)
}
}
impl<S> Stream for Decoder<S>
where
S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
{
type Item = Result<Bytes, PayloadError>;
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
loop {
if let Some(ref mut fut) = self.fut {
let (chunk, decoder) =
ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
self.decoder = Some(decoder);
self.fut.take();
if let Some(chunk) = chunk {
return Poll::Ready(Some(Ok(chunk)));
}
}
if self.eof {
return Poll::Ready(None);
}
match ready!(Pin::new(&mut self.stream).poll_next(cx)) {
Some(Err(err)) => return Poll::Ready(Some(Err(err))),
Some(Ok(chunk)) => {
if let Some(mut decoder) = self.decoder.take() {
if chunk.len() < MAX_CHUNK_SIZE_DECODE_IN_PLACE {
let chunk = decoder.feed_data(chunk)?;
self.decoder = Some(decoder);
if let Some(chunk) = chunk {
return Poll::Ready(Some(Ok(chunk)));
}
} else {
self.fut = Some(spawn_blocking(move || {
let chunk = decoder.feed_data(chunk)?;
Ok((chunk, decoder))
}));
}
continue;
} else {
return Poll::Ready(Some(Ok(chunk)));
}
}
None => {
self.eof = true;
return if let Some(mut decoder) = self.decoder.take() {
match decoder.feed_eof() {
Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
Ok(None) => Poll::Ready(None),
Err(err) => Poll::Ready(Some(Err(err.into()))),
}
} else {
Poll::Ready(None)
};
}
}
}
}
}
enum ContentDecoder {
Deflate(Box<ZlibDecoder<Writer>>),
Gzip(Box<GzDecoder<Writer>>),
Br(Box<BrotliDecoder<Writer>>),
}
impl ContentDecoder {
fn feed_eof(&mut self) -> io::Result<Option<Bytes>> {
match self {
ContentDecoder::Br(ref mut decoder) => match decoder.flush() {
Ok(()) => {
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
Ok(None)
}
}
Err(e) => Err(e),
},
ContentDecoder::Gzip(ref mut decoder) => match decoder.try_finish() {
Ok(_) => {
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
Ok(None)
}
}
Err(e) => Err(e),
},
ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
Ok(_) => {
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
Ok(None)
}
}
Err(e) => Err(e),
},
}
}
fn feed_data(&mut self, data: Bytes) -> io::Result<Option<Bytes>> {
match self {
ContentDecoder::Br(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
Ok(None)
}
}
Err(e) => Err(e),
},
ContentDecoder::Gzip(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
Ok(None)
}
}
Err(e) => Err(e),
},
ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
Ok(None)
}
}
Err(e) => Err(e),
},
}
}
}

View File

@@ -1,285 +0,0 @@
//! Stream encoders.
use std::{
future::Future,
io::{self, Write as _},
pin::Pin,
task::{Context, Poll},
};
use actix_rt::task::{spawn_blocking, JoinHandle};
use brotli2::write::BrotliEncoder;
use bytes::Bytes;
use flate2::write::{GzEncoder, ZlibEncoder};
use futures_core::ready;
use pin_project::pin_project;
use crate::{
body::{Body, BodySize, MessageBody, ResponseBody},
http::{
header::{ContentEncoding, CONTENT_ENCODING},
HeaderValue, StatusCode,
},
Error, ResponseHead,
};
use super::Writer;
use crate::error::BlockingError;
const MAX_CHUNK_SIZE_ENCODE_IN_PLACE: usize = 1024;
#[pin_project]
pub struct Encoder<B> {
eof: bool,
#[pin]
body: EncoderBody<B>,
encoder: Option<ContentEncoder>,
fut: Option<JoinHandle<Result<ContentEncoder, io::Error>>>,
}
impl<B: MessageBody> Encoder<B> {
pub fn response(
encoding: ContentEncoding,
head: &mut ResponseHead,
body: ResponseBody<B>,
) -> ResponseBody<Encoder<B>> {
let can_encode = !(head.headers().contains_key(&CONTENT_ENCODING)
|| head.status == StatusCode::SWITCHING_PROTOCOLS
|| head.status == StatusCode::NO_CONTENT
|| encoding == ContentEncoding::Identity
|| encoding == ContentEncoding::Auto);
let body = match body {
ResponseBody::Other(b) => match b {
Body::None => return ResponseBody::Other(Body::None),
Body::Empty => return ResponseBody::Other(Body::Empty),
Body::Bytes(buf) => {
if can_encode {
EncoderBody::Bytes(buf)
} else {
return ResponseBody::Other(Body::Bytes(buf));
}
}
Body::Message(stream) => EncoderBody::BoxedStream(stream),
},
ResponseBody::Body(stream) => EncoderBody::Stream(stream),
};
if can_encode {
// Modify response body only if encoder is not None
if let Some(enc) = ContentEncoder::encoder(encoding) {
update_head(encoding, head);
head.no_chunking(false);
return ResponseBody::Body(Encoder {
body,
eof: false,
fut: None,
encoder: Some(enc),
});
}
}
ResponseBody::Body(Encoder {
body,
eof: false,
fut: None,
encoder: None,
})
}
}
#[pin_project(project = EncoderBodyProj)]
enum EncoderBody<B> {
Bytes(Bytes),
Stream(#[pin] B),
BoxedStream(Box<dyn MessageBody + Unpin>),
}
impl<B: MessageBody> MessageBody for EncoderBody<B> {
fn size(&self) -> BodySize {
match self {
EncoderBody::Bytes(ref b) => b.size(),
EncoderBody::Stream(ref b) => b.size(),
EncoderBody::BoxedStream(ref b) => b.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.project() {
EncoderBodyProj::Bytes(b) => {
if b.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(std::mem::take(b))))
}
}
EncoderBodyProj::Stream(b) => b.poll_next(cx),
EncoderBodyProj::BoxedStream(ref mut b) => {
Pin::new(b.as_mut()).poll_next(cx)
}
}
}
}
impl<B: MessageBody> MessageBody for Encoder<B> {
fn size(&self) -> BodySize {
if self.encoder.is_none() {
self.body.size()
} else {
BodySize::Stream
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
let mut this = self.project();
loop {
if *this.eof {
return Poll::Ready(None);
}
if let Some(ref mut fut) = this.fut {
let mut encoder =
ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
let chunk = encoder.take();
*this.encoder = Some(encoder);
this.fut.take();
if !chunk.is_empty() {
return Poll::Ready(Some(Ok(chunk)));
}
}
let result = ready!(this.body.as_mut().poll_next(cx));
match result {
Some(Err(err)) => return Poll::Ready(Some(Err(err))),
Some(Ok(chunk)) => {
if let Some(mut encoder) = this.encoder.take() {
if chunk.len() < MAX_CHUNK_SIZE_ENCODE_IN_PLACE {
encoder.write(&chunk)?;
let chunk = encoder.take();
*this.encoder = Some(encoder);
if !chunk.is_empty() {
return Poll::Ready(Some(Ok(chunk)));
}
} else {
*this.fut = Some(spawn_blocking(move || {
encoder.write(&chunk)?;
Ok(encoder)
}));
}
} else {
return Poll::Ready(Some(Ok(chunk)));
}
}
None => {
if let Some(encoder) = this.encoder.take() {
let chunk = encoder.finish()?;
if chunk.is_empty() {
return Poll::Ready(None);
} else {
*this.eof = true;
return Poll::Ready(Some(Ok(chunk)));
}
} else {
return Poll::Ready(None);
}
}
}
}
}
}
fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) {
head.headers_mut().insert(
CONTENT_ENCODING,
HeaderValue::from_static(encoding.as_str()),
);
}
enum ContentEncoder {
Deflate(ZlibEncoder<Writer>),
Gzip(GzEncoder<Writer>),
Br(BrotliEncoder<Writer>),
}
impl ContentEncoder {
fn encoder(encoding: ContentEncoding) -> Option<Self> {
match encoding {
ContentEncoding::Deflate => Some(ContentEncoder::Deflate(ZlibEncoder::new(
Writer::new(),
flate2::Compression::fast(),
))),
ContentEncoding::Gzip => Some(ContentEncoder::Gzip(GzEncoder::new(
Writer::new(),
flate2::Compression::fast(),
))),
ContentEncoding::Br => {
Some(ContentEncoder::Br(BrotliEncoder::new(Writer::new(), 3)))
}
_ => None,
}
}
#[inline]
pub(crate) fn take(&mut self) -> Bytes {
match *self {
ContentEncoder::Br(ref mut encoder) => encoder.get_mut().take(),
ContentEncoder::Deflate(ref mut encoder) => encoder.get_mut().take(),
ContentEncoder::Gzip(ref mut encoder) => encoder.get_mut().take(),
}
}
fn finish(self) -> Result<Bytes, io::Error> {
match self {
ContentEncoder::Br(encoder) => match encoder.finish() {
Ok(writer) => Ok(writer.buf.freeze()),
Err(err) => Err(err),
},
ContentEncoder::Gzip(encoder) => match encoder.finish() {
Ok(writer) => Ok(writer.buf.freeze()),
Err(err) => Err(err),
},
ContentEncoder::Deflate(encoder) => match encoder.finish() {
Ok(writer) => Ok(writer.buf.freeze()),
Err(err) => Err(err),
},
}
}
fn write(&mut self, data: &[u8]) -> Result<(), io::Error> {
match *self {
ContentEncoder::Br(ref mut encoder) => match encoder.write_all(data) {
Ok(_) => Ok(()),
Err(err) => {
trace!("Error decoding br encoding: {}", err);
Err(err)
}
},
ContentEncoder::Gzip(ref mut encoder) => match encoder.write_all(data) {
Ok(_) => Ok(()),
Err(err) => {
trace!("Error decoding gzip encoding: {}", err);
Err(err)
}
},
ContentEncoder::Deflate(ref mut encoder) => match encoder.write_all(data) {
Ok(_) => Ok(()),
Err(err) => {
trace!("Error decoding deflate encoding: {}", err);
Err(err)
}
},
}
}
}

View File

@@ -1,38 +0,0 @@
//! Content-Encoding support.
use std::io;
use bytes::{Bytes, BytesMut};
mod decoder;
mod encoder;
pub use self::decoder::Decoder;
pub use self::encoder::Encoder;
pub(self) struct Writer {
buf: BytesMut,
}
impl Writer {
fn new() -> Writer {
Writer {
buf: BytesMut::with_capacity(8192),
}
}
fn take(&mut self) -> Bytes {
self.buf.split().freeze()
}
}
impl io::Write for Writer {
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
self.buf.extend_from_slice(buf);
Ok(buf.len())
}
fn flush(&mut self) -> io::Result<()> {
Ok(())
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -1,305 +0,0 @@
use std::{
any::{Any, TypeId},
fmt, mem,
};
use ahash::AHashMap;
/// A type map for request extensions.
///
/// All entries into this map must be owned types (or static references).
#[derive(Default)]
pub struct Extensions {
/// Use FxHasher with a std HashMap with for faster
/// lookups on the small `TypeId` (u64 equivalent) keys.
map: AHashMap<TypeId, Box<dyn Any>>,
}
impl Extensions {
/// Creates an empty `Extensions`.
#[inline]
pub fn new() -> Extensions {
Extensions {
map: AHashMap::default(),
}
}
/// Insert an item into the map.
///
/// If an item of this type was already stored, it will be replaced and returned.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
/// assert_eq!(map.insert(""), None);
/// assert_eq!(map.insert(1u32), None);
/// assert_eq!(map.insert(2u32), Some(1u32));
/// assert_eq!(*map.get::<u32>().unwrap(), 2u32);
/// ```
pub fn insert<T: 'static>(&mut self, val: T) -> Option<T> {
self.map
.insert(TypeId::of::<T>(), Box::new(val))
.and_then(downcast_owned)
}
/// Check if map contains an item of a given type.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
/// assert!(!map.contains::<u32>());
///
/// assert_eq!(map.insert(1u32), None);
/// assert!(map.contains::<u32>());
/// ```
pub fn contains<T: 'static>(&self) -> bool {
self.map.contains_key(&TypeId::of::<T>())
}
/// Get a reference to an item of a given type.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
/// map.insert(1u32);
/// assert_eq!(map.get::<u32>(), Some(&1u32));
/// ```
pub fn get<T: 'static>(&self) -> Option<&T> {
self.map
.get(&TypeId::of::<T>())
.and_then(|boxed| boxed.downcast_ref())
}
/// Get a mutable reference to an item of a given type.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
/// map.insert(1u32);
/// assert_eq!(map.get_mut::<u32>(), Some(&mut 1u32));
/// ```
pub fn get_mut<T: 'static>(&mut self) -> Option<&mut T> {
self.map
.get_mut(&TypeId::of::<T>())
.and_then(|boxed| boxed.downcast_mut())
}
/// Remove an item from the map of a given type.
///
/// If an item of this type was already stored, it will be returned.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
///
/// map.insert(1u32);
/// assert_eq!(map.get::<u32>(), Some(&1u32));
///
/// assert_eq!(map.remove::<u32>(), Some(1u32));
/// assert!(!map.contains::<u32>());
/// ```
pub fn remove<T: 'static>(&mut self) -> Option<T> {
self.map.remove(&TypeId::of::<T>()).and_then(downcast_owned)
}
/// Clear the `Extensions` of all inserted extensions.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
///
/// map.insert(1u32);
/// assert!(map.contains::<u32>());
///
/// map.clear();
/// assert!(!map.contains::<u32>());
/// ```
#[inline]
pub fn clear(&mut self) {
self.map.clear();
}
/// Extends self with the items from another `Extensions`.
pub fn extend(&mut self, other: Extensions) {
self.map.extend(other.map);
}
/// Sets (or overrides) items from `other` into this map.
pub(crate) fn drain_from(&mut self, other: &mut Self) {
self.map.extend(mem::take(&mut other.map));
}
}
impl fmt::Debug for Extensions {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.debug_struct("Extensions").finish()
}
}
fn downcast_owned<T: 'static>(boxed: Box<dyn Any>) -> Option<T> {
boxed.downcast().ok().map(|boxed| *boxed)
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_remove() {
let mut map = Extensions::new();
map.insert::<i8>(123);
assert!(map.get::<i8>().is_some());
map.remove::<i8>();
assert!(map.get::<i8>().is_none());
}
#[test]
fn test_clear() {
let mut map = Extensions::new();
map.insert::<i8>(8);
map.insert::<i16>(16);
map.insert::<i32>(32);
assert!(map.contains::<i8>());
assert!(map.contains::<i16>());
assert!(map.contains::<i32>());
map.clear();
assert!(!map.contains::<i8>());
assert!(!map.contains::<i16>());
assert!(!map.contains::<i32>());
map.insert::<i8>(10);
assert_eq!(*map.get::<i8>().unwrap(), 10);
}
#[test]
fn test_integers() {
let mut map = Extensions::new();
map.insert::<i8>(8);
map.insert::<i16>(16);
map.insert::<i32>(32);
map.insert::<i64>(64);
map.insert::<i128>(128);
map.insert::<u8>(8);
map.insert::<u16>(16);
map.insert::<u32>(32);
map.insert::<u64>(64);
map.insert::<u128>(128);
assert!(map.get::<i8>().is_some());
assert!(map.get::<i16>().is_some());
assert!(map.get::<i32>().is_some());
assert!(map.get::<i64>().is_some());
assert!(map.get::<i128>().is_some());
assert!(map.get::<u8>().is_some());
assert!(map.get::<u16>().is_some());
assert!(map.get::<u32>().is_some());
assert!(map.get::<u64>().is_some());
assert!(map.get::<u128>().is_some());
}
#[test]
fn test_composition() {
struct Magi<T>(pub T);
struct Madoka {
pub god: bool,
}
struct Homura {
pub attempts: usize,
}
struct Mami {
pub guns: usize,
}
let mut map = Extensions::new();
map.insert(Magi(Madoka { god: false }));
map.insert(Magi(Homura { attempts: 0 }));
map.insert(Magi(Mami { guns: 999 }));
assert!(!map.get::<Magi<Madoka>>().unwrap().0.god);
assert_eq!(0, map.get::<Magi<Homura>>().unwrap().0.attempts);
assert_eq!(999, map.get::<Magi<Mami>>().unwrap().0.guns);
}
#[test]
fn test_extensions() {
#[derive(Debug, PartialEq)]
struct MyType(i32);
let mut extensions = Extensions::new();
extensions.insert(5i32);
extensions.insert(MyType(10));
assert_eq!(extensions.get(), Some(&5i32));
assert_eq!(extensions.get_mut(), Some(&mut 5i32));
assert_eq!(extensions.remove::<i32>(), Some(5i32));
assert!(extensions.get::<i32>().is_none());
assert_eq!(extensions.get::<bool>(), None);
assert_eq!(extensions.get(), Some(&MyType(10)));
}
#[test]
fn test_extend() {
#[derive(Debug, PartialEq)]
struct MyType(i32);
let mut extensions = Extensions::new();
extensions.insert(5i32);
extensions.insert(MyType(10));
let mut other = Extensions::new();
other.insert(15i32);
other.insert(20u8);
extensions.extend(other);
assert_eq!(extensions.get(), Some(&15i32));
assert_eq!(extensions.get_mut(), Some(&mut 15i32));
assert_eq!(extensions.remove::<i32>(), Some(15i32));
assert!(extensions.get::<i32>().is_none());
assert_eq!(extensions.get::<bool>(), None);
assert_eq!(extensions.get(), Some(&MyType(10)));
assert_eq!(extensions.get(), Some(&20u8));
assert_eq!(extensions.get_mut(), Some(&mut 20u8));
}
#[test]
fn test_drain_from() {
let mut ext = Extensions::new();
ext.insert(2isize);
let mut more_ext = Extensions::new();
more_ext.insert(5isize);
more_ext.insert(5usize);
assert_eq!(ext.get::<isize>(), Some(&2isize));
assert_eq!(ext.get::<usize>(), None);
assert_eq!(more_ext.get::<isize>(), Some(&5isize));
assert_eq!(more_ext.get::<usize>(), Some(&5usize));
ext.drain_from(&mut more_ext);
assert_eq!(ext.get::<isize>(), Some(&5isize));
assert_eq!(ext.get::<usize>(), Some(&5usize));
assert_eq!(more_ext.get::<isize>(), None);
assert_eq!(more_ext.get::<usize>(), None);
}
}

View File

@@ -1,225 +0,0 @@
use std::io;
use actix_codec::{Decoder, Encoder};
use bitflags::bitflags;
use bytes::{Bytes, BytesMut};
use http::{Method, Version};
use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
use super::{decoder, encoder, reserve_readbuf};
use super::{Message, MessageType};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::error::{ParseError, PayloadError};
use crate::message::{ConnectionType, RequestHeadType, ResponseHead};
bitflags! {
struct Flags: u8 {
const HEAD = 0b0000_0001;
const KEEPALIVE_ENABLED = 0b0000_1000;
const STREAM = 0b0001_0000;
}
}
/// HTTP/1 Codec
pub struct ClientCodec {
inner: ClientCodecInner,
}
/// HTTP/1 Payload Codec
pub struct ClientPayloadCodec {
inner: ClientCodecInner,
}
struct ClientCodecInner {
config: ServiceConfig,
decoder: decoder::MessageDecoder<ResponseHead>,
payload: Option<PayloadDecoder>,
version: Version,
ctype: ConnectionType,
// encoder part
flags: Flags,
encoder: encoder::MessageEncoder<RequestHeadType>,
}
impl Default for ClientCodec {
fn default() -> Self {
ClientCodec::new(ServiceConfig::default())
}
}
impl ClientCodec {
/// Create HTTP/1 codec.
///
/// `keepalive_enabled` how response `connection` header get generated.
pub fn new(config: ServiceConfig) -> Self {
let flags = if config.keep_alive_enabled() {
Flags::KEEPALIVE_ENABLED
} else {
Flags::empty()
};
ClientCodec {
inner: ClientCodecInner {
config,
decoder: decoder::MessageDecoder::default(),
payload: None,
version: Version::HTTP_11,
ctype: ConnectionType::Close,
flags,
encoder: encoder::MessageEncoder::default(),
},
}
}
/// Check if request is upgrade
pub fn upgrade(&self) -> bool {
self.inner.ctype == ConnectionType::Upgrade
}
/// Check if last response is keep-alive
pub fn keepalive(&self) -> bool {
self.inner.ctype == ConnectionType::KeepAlive
}
/// Check last request's message type
pub fn message_type(&self) -> MessageType {
if self.inner.flags.contains(Flags::STREAM) {
MessageType::Stream
} else if self.inner.payload.is_none() {
MessageType::None
} else {
MessageType::Payload
}
}
/// Convert message codec to a payload codec
pub fn into_payload_codec(self) -> ClientPayloadCodec {
ClientPayloadCodec { inner: self.inner }
}
}
impl ClientPayloadCodec {
/// Check if last response is keep-alive
pub fn keepalive(&self) -> bool {
self.inner.ctype == ConnectionType::KeepAlive
}
/// Transform payload codec to a message codec
pub fn into_message_codec(self) -> ClientCodec {
ClientCodec { inner: self.inner }
}
}
impl Decoder for ClientCodec {
type Item = ResponseHead;
type Error = ParseError;
fn decode(&mut self, src: &mut BytesMut) -> Result<Option<Self::Item>, Self::Error> {
debug_assert!(!self.inner.payload.is_some(), "Payload decoder is set");
if let Some((req, payload)) = self.inner.decoder.decode(src)? {
if let Some(ctype) = req.ctype() {
// do not use peer's keep-alive
self.inner.ctype = if ctype == ConnectionType::KeepAlive {
self.inner.ctype
} else {
ctype
};
}
if !self.inner.flags.contains(Flags::HEAD) {
match payload {
PayloadType::None => self.inner.payload = None,
PayloadType::Payload(pl) => self.inner.payload = Some(pl),
PayloadType::Stream(pl) => {
self.inner.payload = Some(pl);
self.inner.flags.insert(Flags::STREAM);
}
}
} else {
self.inner.payload = None;
}
reserve_readbuf(src);
Ok(Some(req))
} else {
Ok(None)
}
}
}
impl Decoder for ClientPayloadCodec {
type Item = Option<Bytes>;
type Error = PayloadError;
fn decode(&mut self, src: &mut BytesMut) -> Result<Option<Self::Item>, Self::Error> {
debug_assert!(
self.inner.payload.is_some(),
"Payload decoder is not specified"
);
Ok(match self.inner.payload.as_mut().unwrap().decode(src)? {
Some(PayloadItem::Chunk(chunk)) => {
reserve_readbuf(src);
Some(Some(chunk))
}
Some(PayloadItem::Eof) => {
self.inner.payload.take();
Some(None)
}
None => None,
})
}
}
impl Encoder<Message<(RequestHeadType, BodySize)>> for ClientCodec {
type Error = io::Error;
fn encode(
&mut self,
item: Message<(RequestHeadType, BodySize)>,
dst: &mut BytesMut,
) -> Result<(), Self::Error> {
match item {
Message::Item((mut head, length)) => {
let inner = &mut self.inner;
inner.version = head.as_ref().version;
inner
.flags
.set(Flags::HEAD, head.as_ref().method == Method::HEAD);
// connection status
inner.ctype = match head.as_ref().connection_type() {
ConnectionType::KeepAlive => {
if inner.flags.contains(Flags::KEEPALIVE_ENABLED) {
ConnectionType::KeepAlive
} else {
ConnectionType::Close
}
}
ConnectionType::Upgrade => ConnectionType::Upgrade,
ConnectionType::Close => ConnectionType::Close,
};
inner.encoder.encode(
dst,
&mut head,
false,
false,
inner.version,
length,
inner.ctype,
&inner.config,
)?;
}
Message::Chunk(Some(bytes)) => {
self.inner.encoder.encode_chunk(bytes.as_ref(), dst)?;
}
Message::Chunk(None) => {
self.inner.encoder.encode_eof(dst)?;
}
}
Ok(())
}
}

View File

@@ -1,240 +0,0 @@
use std::{fmt, io};
use actix_codec::{Decoder, Encoder};
use bitflags::bitflags;
use bytes::BytesMut;
use http::{Method, Version};
use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
use super::{decoder, encoder};
use super::{Message, MessageType};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::error::ParseError;
use crate::message::ConnectionType;
use crate::request::Request;
use crate::response::Response;
bitflags! {
struct Flags: u8 {
const HEAD = 0b0000_0001;
const KEEPALIVE_ENABLED = 0b0000_0010;
const STREAM = 0b0000_0100;
}
}
/// HTTP/1 Codec
pub struct Codec {
config: ServiceConfig,
decoder: decoder::MessageDecoder<Request>,
payload: Option<PayloadDecoder>,
version: Version,
ctype: ConnectionType,
// encoder part
flags: Flags,
encoder: encoder::MessageEncoder<Response<()>>,
}
impl Default for Codec {
fn default() -> Self {
Codec::new(ServiceConfig::default())
}
}
impl fmt::Debug for Codec {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "h1::Codec({:?})", self.flags)
}
}
impl Codec {
/// Create HTTP/1 codec.
///
/// `keepalive_enabled` how response `connection` header get generated.
pub fn new(config: ServiceConfig) -> Self {
let flags = if config.keep_alive_enabled() {
Flags::KEEPALIVE_ENABLED
} else {
Flags::empty()
};
Codec {
config,
flags,
decoder: decoder::MessageDecoder::default(),
payload: None,
version: Version::HTTP_11,
ctype: ConnectionType::Close,
encoder: encoder::MessageEncoder::default(),
}
}
/// Check if request is upgrade.
#[inline]
pub fn upgrade(&self) -> bool {
self.ctype == ConnectionType::Upgrade
}
/// Check if last response is keep-alive.
#[inline]
pub fn keepalive(&self) -> bool {
self.ctype == ConnectionType::KeepAlive
}
/// Check if keep-alive enabled on server level.
#[inline]
pub fn keepalive_enabled(&self) -> bool {
self.flags.contains(Flags::KEEPALIVE_ENABLED)
}
/// Check last request's message type.
#[inline]
pub fn message_type(&self) -> MessageType {
if self.flags.contains(Flags::STREAM) {
MessageType::Stream
} else if self.payload.is_none() {
MessageType::None
} else {
MessageType::Payload
}
}
#[inline]
pub fn config(&self) -> &ServiceConfig {
&self.config
}
}
impl Decoder for Codec {
type Item = Message<Request>;
type Error = ParseError;
fn decode(&mut self, src: &mut BytesMut) -> Result<Option<Self::Item>, Self::Error> {
if let Some(ref mut payload) = self.payload {
Ok(match payload.decode(src)? {
Some(PayloadItem::Chunk(chunk)) => Some(Message::Chunk(Some(chunk))),
Some(PayloadItem::Eof) => {
self.payload.take();
Some(Message::Chunk(None))
}
None => None,
})
} else if let Some((req, payload)) = self.decoder.decode(src)? {
let head = req.head();
self.flags.set(Flags::HEAD, head.method == Method::HEAD);
self.version = head.version;
self.ctype = head.connection_type();
if self.ctype == ConnectionType::KeepAlive
&& !self.flags.contains(Flags::KEEPALIVE_ENABLED)
{
self.ctype = ConnectionType::Close
}
match payload {
PayloadType::None => self.payload = None,
PayloadType::Payload(pl) => self.payload = Some(pl),
PayloadType::Stream(pl) => {
self.payload = Some(pl);
self.flags.insert(Flags::STREAM);
}
}
Ok(Some(Message::Item(req)))
} else {
Ok(None)
}
}
}
impl Encoder<Message<(Response<()>, BodySize)>> for Codec {
type Error = io::Error;
fn encode(
&mut self,
item: Message<(Response<()>, BodySize)>,
dst: &mut BytesMut,
) -> Result<(), Self::Error> {
match item {
Message::Item((mut res, length)) => {
// set response version
res.head_mut().version = self.version;
// connection status
self.ctype = if let Some(ct) = res.head().ctype() {
if ct == ConnectionType::KeepAlive {
self.ctype
} else {
ct
}
} else {
self.ctype
};
// encode message
self.encoder.encode(
dst,
&mut res,
self.flags.contains(Flags::HEAD),
self.flags.contains(Flags::STREAM),
self.version,
length,
self.ctype,
&self.config,
)?;
// self.headers_size = (dst.len() - len) as u32;
}
Message::Chunk(Some(bytes)) => {
self.encoder.encode_chunk(bytes.as_ref(), dst)?;
}
Message::Chunk(None) => {
self.encoder.encode_eof(dst)?;
}
}
Ok(())
}
}
#[cfg(test)]
mod tests {
use bytes::BytesMut;
use http::Method;
use super::*;
use crate::HttpMessage;
#[actix_rt::test]
async fn test_http_request_chunked_payload_and_next_message() {
let mut codec = Codec::default();
let mut buf = BytesMut::from(
"GET /test HTTP/1.1\r\n\
transfer-encoding: chunked\r\n\r\n",
);
let item = codec.decode(&mut buf).unwrap().unwrap();
let req = item.message();
assert_eq!(req.method(), Method::GET);
assert!(req.chunked().unwrap());
buf.extend(
b"4\r\ndata\r\n4\r\nline\r\n0\r\n\r\n\
POST /test2 HTTP/1.1\r\n\
transfer-encoding: chunked\r\n\r\n"
.iter(),
);
let msg = codec.decode(&mut buf).unwrap().unwrap();
assert_eq!(msg.chunk().as_ref(), b"data");
let msg = codec.decode(&mut buf).unwrap().unwrap();
assert_eq!(msg.chunk().as_ref(), b"line");
let msg = codec.decode(&mut buf).unwrap().unwrap();
assert!(msg.eof());
// decode next message
let item = codec.decode(&mut buf).unwrap().unwrap();
let req = item.message();
assert_eq!(*req.method(), Method::POST);
assert!(req.chunked().unwrap());
}
}

File diff suppressed because it is too large Load Diff

File diff suppressed because it is too large Load Diff

View File

@@ -1,651 +0,0 @@
use std::io::Write;
use std::marker::PhantomData;
use std::ptr::copy_nonoverlapping;
use std::slice::from_raw_parts_mut;
use std::{cmp, io};
use bytes::{BufMut, BytesMut};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::header::{map::Value, HeaderName};
use crate::helpers;
use crate::http::header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use crate::http::{HeaderMap, StatusCode, Version};
use crate::message::{ConnectionType, RequestHeadType};
use crate::response::Response;
const AVERAGE_HEADER_SIZE: usize = 30;
#[derive(Debug)]
pub(crate) struct MessageEncoder<T: MessageType> {
pub length: BodySize,
pub te: TransferEncoding,
_phantom: PhantomData<T>,
}
impl<T: MessageType> Default for MessageEncoder<T> {
fn default() -> Self {
MessageEncoder {
length: BodySize::None,
te: TransferEncoding::empty(),
_phantom: PhantomData,
}
}
}
pub(crate) trait MessageType: Sized {
fn status(&self) -> Option<StatusCode>;
fn headers(&self) -> &HeaderMap;
fn extra_headers(&self) -> Option<&HeaderMap>;
fn camel_case(&self) -> bool {
false
}
fn chunked(&self) -> bool;
fn encode_status(&mut self, dst: &mut BytesMut) -> io::Result<()>;
fn encode_headers(
&mut self,
dst: &mut BytesMut,
version: Version,
mut length: BodySize,
ctype: ConnectionType,
config: &ServiceConfig,
) -> io::Result<()> {
let chunked = self.chunked();
let mut skip_len = length != BodySize::Stream;
let camel_case = self.camel_case();
// Content length
if let Some(status) = self.status() {
match status {
StatusCode::CONTINUE
| StatusCode::SWITCHING_PROTOCOLS
| StatusCode::PROCESSING
| StatusCode::NO_CONTENT => {
// skip content-length and transfer-encoding headers
// See https://tools.ietf.org/html/rfc7230#section-3.3.1
// and https://tools.ietf.org/html/rfc7230#section-3.3.2
skip_len = true;
length = BodySize::None
}
_ => {}
}
}
match length {
BodySize::Stream => {
if chunked {
if camel_case {
dst.put_slice(b"\r\nTransfer-Encoding: chunked\r\n")
} else {
dst.put_slice(b"\r\ntransfer-encoding: chunked\r\n")
}
} else {
skip_len = false;
dst.put_slice(b"\r\n");
}
}
BodySize::Empty => {
if camel_case {
dst.put_slice(b"\r\nContent-Length: 0\r\n");
} else {
dst.put_slice(b"\r\ncontent-length: 0\r\n");
}
}
BodySize::Sized(len) => helpers::write_content_length(len, dst),
BodySize::None => dst.put_slice(b"\r\n"),
}
// Connection
match ctype {
ConnectionType::Upgrade => dst.put_slice(b"connection: upgrade\r\n"),
ConnectionType::KeepAlive if version < Version::HTTP_11 => {
if camel_case {
dst.put_slice(b"Connection: keep-alive\r\n")
} else {
dst.put_slice(b"connection: keep-alive\r\n")
}
}
ConnectionType::Close if version >= Version::HTTP_11 => {
if camel_case {
dst.put_slice(b"Connection: close\r\n")
} else {
dst.put_slice(b"connection: close\r\n")
}
}
_ => {}
}
// write headers
let mut has_date = false;
let mut buf = dst.chunk_mut().as_mut_ptr();
let mut remaining = dst.capacity() - dst.len();
// tracks bytes written since last buffer resize
// since buf is a raw pointer to a bytes container storage but is written to without the
// container's knowledge, this is used to sync the containers cursor after data is written
let mut pos = 0;
self.write_headers(|key, value| {
match *key {
CONNECTION => return,
TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => return,
DATE => has_date = true,
_ => {}
}
let k = key.as_str().as_bytes();
let k_len = k.len();
// TODO: drain?
for val in value.iter() {
let v = val.as_ref();
let v_len = v.len();
// key length + value length + colon + space + \r\n
let len = k_len + v_len + 4;
if len > remaining {
// SAFETY: all the bytes written up to position "pos" are initialized
// the written byte count and pointer advancement are kept in sync
unsafe {
dst.advance_mut(pos);
}
pos = 0;
dst.reserve(len * 2);
remaining = dst.capacity() - dst.len();
// re-assign buf raw pointer since it's possible that the buffer was
// reallocated and/or resized
buf = dst.chunk_mut().as_mut_ptr();
}
// SAFETY: on each write, it is enough to ensure that the advancement of
// the cursor matches the number of bytes written
unsafe {
if camel_case {
// use Camel-Case headers
write_camel_case(k, from_raw_parts_mut(buf, k_len));
} else {
write_data(k, buf, k_len);
}
buf = buf.add(k_len);
write_data(b": ", buf, 2);
buf = buf.add(2);
write_data(v, buf, v_len);
buf = buf.add(v_len);
write_data(b"\r\n", buf, 2);
buf = buf.add(2);
};
pos += len;
remaining -= len;
}
});
// final cursor synchronization with the bytes container
//
// SAFETY: all the bytes written up to position "pos" are initialized
// the written byte count and pointer advancement are kept in sync
unsafe {
dst.advance_mut(pos);
}
// optimized date header, set_date writes \r\n
if !has_date {
config.set_date(dst);
} else {
// msg eof
dst.extend_from_slice(b"\r\n");
}
Ok(())
}
fn write_headers<F>(&mut self, mut f: F)
where
F: FnMut(&HeaderName, &Value),
{
match self.extra_headers() {
Some(headers) => {
// merging headers from head and extra headers.
self.headers()
.inner
.iter()
.filter(|(name, _)| !headers.contains_key(*name))
.chain(headers.inner.iter())
.for_each(|(k, v)| f(k, v))
}
None => self.headers().inner.iter().for_each(|(k, v)| f(k, v)),
}
}
}
impl MessageType for Response<()> {
fn status(&self) -> Option<StatusCode> {
Some(self.head().status)
}
fn chunked(&self) -> bool {
self.head().chunked()
}
fn headers(&self) -> &HeaderMap {
&self.head().headers
}
fn extra_headers(&self) -> Option<&HeaderMap> {
None
}
fn encode_status(&mut self, dst: &mut BytesMut) -> io::Result<()> {
let head = self.head();
let reason = head.reason().as_bytes();
dst.reserve(256 + head.headers.len() * AVERAGE_HEADER_SIZE + reason.len());
// status line
helpers::write_status_line(head.version, head.status.as_u16(), dst);
dst.put_slice(reason);
Ok(())
}
}
impl MessageType for RequestHeadType {
fn status(&self) -> Option<StatusCode> {
None
}
fn chunked(&self) -> bool {
self.as_ref().chunked()
}
fn camel_case(&self) -> bool {
self.as_ref().camel_case_headers()
}
fn headers(&self) -> &HeaderMap {
self.as_ref().headers()
}
fn extra_headers(&self) -> Option<&HeaderMap> {
self.extra_headers()
}
fn encode_status(&mut self, dst: &mut BytesMut) -> io::Result<()> {
let head = self.as_ref();
dst.reserve(256 + head.headers.len() * AVERAGE_HEADER_SIZE);
write!(
helpers::Writer(dst),
"{} {} {}",
head.method,
head.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
match head.version {
Version::HTTP_09 => "HTTP/0.9",
Version::HTTP_10 => "HTTP/1.0",
Version::HTTP_11 => "HTTP/1.1",
Version::HTTP_2 => "HTTP/2.0",
Version::HTTP_3 => "HTTP/3.0",
_ =>
return Err(io::Error::new(
io::ErrorKind::Other,
"unsupported version"
)),
}
)
.map_err(|e| io::Error::new(io::ErrorKind::Other, e))
}
}
impl<T: MessageType> MessageEncoder<T> {
/// Encode message
pub fn encode_chunk(&mut self, msg: &[u8], buf: &mut BytesMut) -> io::Result<bool> {
self.te.encode(msg, buf)
}
/// Encode eof
pub fn encode_eof(&mut self, buf: &mut BytesMut) -> io::Result<()> {
self.te.encode_eof(buf)
}
pub fn encode(
&mut self,
dst: &mut BytesMut,
message: &mut T,
head: bool,
stream: bool,
version: Version,
length: BodySize,
ctype: ConnectionType,
config: &ServiceConfig,
) -> io::Result<()> {
// transfer encoding
if !head {
self.te = match length {
BodySize::Empty => TransferEncoding::empty(),
BodySize::Sized(len) => TransferEncoding::length(len),
BodySize::Stream => {
if message.chunked() && !stream {
TransferEncoding::chunked()
} else {
TransferEncoding::eof()
}
}
BodySize::None => TransferEncoding::empty(),
};
} else {
self.te = TransferEncoding::empty();
}
message.encode_status(dst)?;
message.encode_headers(dst, version, length, ctype, config)
}
}
/// Encoders to handle different Transfer-Encodings.
#[derive(Debug)]
pub(crate) struct TransferEncoding {
kind: TransferEncodingKind,
}
#[derive(Debug, PartialEq, Clone)]
enum TransferEncodingKind {
/// An Encoder for when Transfer-Encoding includes `chunked`.
Chunked(bool),
/// An Encoder for when Content-Length is set.
///
/// Enforces that the body is not longer than the Content-Length header.
Length(u64),
/// An Encoder for when Content-Length is not known.
///
/// Application decides when to stop writing.
Eof,
}
impl TransferEncoding {
#[inline]
pub fn empty() -> TransferEncoding {
TransferEncoding {
kind: TransferEncodingKind::Length(0),
}
}
#[inline]
pub fn eof() -> TransferEncoding {
TransferEncoding {
kind: TransferEncodingKind::Eof,
}
}
#[inline]
pub fn chunked() -> TransferEncoding {
TransferEncoding {
kind: TransferEncodingKind::Chunked(false),
}
}
#[inline]
pub fn length(len: u64) -> TransferEncoding {
TransferEncoding {
kind: TransferEncodingKind::Length(len),
}
}
/// Encode message. Return `EOF` state of encoder
#[inline]
pub fn encode(&mut self, msg: &[u8], buf: &mut BytesMut) -> io::Result<bool> {
match self.kind {
TransferEncodingKind::Eof => {
let eof = msg.is_empty();
buf.extend_from_slice(msg);
Ok(eof)
}
TransferEncodingKind::Chunked(ref mut eof) => {
if *eof {
return Ok(true);
}
if msg.is_empty() {
*eof = true;
buf.extend_from_slice(b"0\r\n\r\n");
} else {
writeln!(helpers::Writer(buf), "{:X}\r", msg.len())
.map_err(|e| io::Error::new(io::ErrorKind::Other, e))?;
buf.reserve(msg.len() + 2);
buf.extend_from_slice(msg);
buf.extend_from_slice(b"\r\n");
}
Ok(*eof)
}
TransferEncodingKind::Length(ref mut remaining) => {
if *remaining > 0 {
if msg.is_empty() {
return Ok(*remaining == 0);
}
let len = cmp::min(*remaining, msg.len() as u64);
buf.extend_from_slice(&msg[..len as usize]);
*remaining -= len as u64;
Ok(*remaining == 0)
} else {
Ok(true)
}
}
}
}
/// Encode eof. Return `EOF` state of encoder
#[inline]
pub fn encode_eof(&mut self, buf: &mut BytesMut) -> io::Result<()> {
match self.kind {
TransferEncodingKind::Eof => Ok(()),
TransferEncodingKind::Length(rem) => {
if rem != 0 {
Err(io::Error::new(io::ErrorKind::UnexpectedEof, ""))
} else {
Ok(())
}
}
TransferEncodingKind::Chunked(ref mut eof) => {
if !*eof {
*eof = true;
buf.extend_from_slice(b"0\r\n\r\n");
}
Ok(())
}
}
}
}
/// # Safety
/// Callers must ensure that the given length matches given value length.
unsafe fn write_data(value: &[u8], buf: *mut u8, len: usize) {
debug_assert_eq!(value.len(), len);
copy_nonoverlapping(value.as_ptr(), buf, len);
}
fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
// first copy entire (potentially wrong) slice to output
buffer[..value.len()].copy_from_slice(value);
let mut iter = value.iter();
// first character should be uppercase
if let Some(c @ b'a'..=b'z') = iter.next() {
buffer[0] = c & 0b1101_1111;
}
// track 1 ahead of the current position since that's the location being assigned to
let mut index = 2;
// remaining characters after hyphens should also be uppercase
while let Some(&c) = iter.next() {
if c == b'-' {
// advance iter by one and uppercase if needed
if let Some(c @ b'a'..=b'z') = iter.next() {
buffer[index] = c & 0b1101_1111;
}
}
index += 1;
}
}
#[cfg(test)]
mod tests {
use std::rc::Rc;
use bytes::Bytes;
use http::header::AUTHORIZATION;
use super::*;
use crate::http::header::{HeaderValue, CONTENT_TYPE};
use crate::RequestHead;
#[test]
fn test_chunked_te() {
let mut bytes = BytesMut::new();
let mut enc = TransferEncoding::chunked();
{
assert!(!enc.encode(b"test", &mut bytes).ok().unwrap());
assert!(enc.encode(b"", &mut bytes).ok().unwrap());
}
assert_eq!(
bytes.split().freeze(),
Bytes::from_static(b"4\r\ntest\r\n0\r\n\r\n")
);
}
#[actix_rt::test]
async fn test_camel_case() {
let mut bytes = BytesMut::with_capacity(2048);
let mut head = RequestHead::default();
head.set_camel_case_headers(true);
head.headers.insert(DATE, HeaderValue::from_static("date"));
head.headers
.insert(CONTENT_TYPE, HeaderValue::from_static("plain/text"));
let mut head = RequestHeadType::Owned(head);
let _ = head.encode_headers(
&mut bytes,
Version::HTTP_11,
BodySize::Empty,
ConnectionType::Close,
&ServiceConfig::default(),
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("Content-Length: 0\r\n"));
assert!(data.contains("Connection: close\r\n"));
assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let _ = head.encode_headers(
&mut bytes,
Version::HTTP_11,
BodySize::Stream,
ConnectionType::KeepAlive,
&ServiceConfig::default(),
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("Transfer-Encoding: chunked\r\n"));
assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let mut head = RequestHead::default();
head.set_camel_case_headers(false);
head.headers.insert(DATE, HeaderValue::from_static("date"));
head.headers
.insert(CONTENT_TYPE, HeaderValue::from_static("plain/text"));
head.headers
.append(CONTENT_TYPE, HeaderValue::from_static("xml"));
let mut head = RequestHeadType::Owned(head);
let _ = head.encode_headers(
&mut bytes,
Version::HTTP_11,
BodySize::Stream,
ConnectionType::KeepAlive,
&ServiceConfig::default(),
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("transfer-encoding: chunked\r\n"));
assert!(data.contains("content-type: xml\r\n"));
assert!(data.contains("content-type: plain/text\r\n"));
assert!(data.contains("date: date\r\n"));
}
#[actix_rt::test]
async fn test_extra_headers() {
let mut bytes = BytesMut::with_capacity(2048);
let mut head = RequestHead::default();
head.headers.insert(
AUTHORIZATION,
HeaderValue::from_static("some authorization"),
);
let mut extra_headers = HeaderMap::new();
extra_headers.insert(
AUTHORIZATION,
HeaderValue::from_static("another authorization"),
);
extra_headers.insert(DATE, HeaderValue::from_static("date"));
let mut head = RequestHeadType::Rc(Rc::new(head), Some(extra_headers));
let _ = head.encode_headers(
&mut bytes,
Version::HTTP_11,
BodySize::Empty,
ConnectionType::Close,
&ServiceConfig::default(),
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("content-length: 0\r\n"));
assert!(data.contains("connection: close\r\n"));
assert!(data.contains("authorization: another authorization\r\n"));
assert!(data.contains("date: date\r\n"));
}
#[actix_rt::test]
async fn test_no_content_length() {
let mut bytes = BytesMut::with_capacity(2048);
let mut res: Response<()> =
Response::new(StatusCode::SWITCHING_PROTOCOLS).into_body::<()>();
res.headers_mut().insert(DATE, HeaderValue::from_static(""));
res.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static("0"));
let _ = res.encode_headers(
&mut bytes,
Version::HTTP_11,
BodySize::Stream,
ConnectionType::Upgrade,
&ServiceConfig::default(),
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(!data.contains("content-length: 0\r\n"));
assert!(!data.contains("transfer-encoding: chunked\r\n"));
}
}

View File

@@ -1,36 +0,0 @@
use std::task::Poll;
use actix_service::{Service, ServiceFactory};
use futures_util::future::{ready, Ready};
use crate::error::Error;
use crate::request::Request;
pub struct ExpectHandler;
impl ServiceFactory<Request> for ExpectHandler {
type Response = Request;
type Error = Error;
type Config = ();
type Service = ExpectHandler;
type InitError = Error;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: Self::Config) -> Self::Future {
ready(Ok(ExpectHandler))
}
}
impl Service<Request> for ExpectHandler {
type Response = Request;
type Error = Error;
type Future = Ready<Result<Self::Response, Self::Error>>;
actix_service::always_ready!();
fn call(&self, req: Request) -> Self::Future {
ready(Ok(req))
// TODO: add some way to trigger error
// Err(error::ErrorExpectationFailed("test"))
}
}

View File

@@ -1,85 +0,0 @@
//! HTTP/1 protocol implementation.
use bytes::{Bytes, BytesMut};
mod client;
mod codec;
mod decoder;
mod dispatcher;
mod encoder;
mod expect;
mod payload;
mod service;
mod upgrade;
mod utils;
pub use self::client::{ClientCodec, ClientPayloadCodec};
pub use self::codec::Codec;
pub use self::dispatcher::Dispatcher;
pub use self::expect::ExpectHandler;
pub use self::payload::Payload;
pub use self::service::{H1Service, H1ServiceHandler};
pub use self::upgrade::UpgradeHandler;
pub use self::utils::SendResponse;
#[derive(Debug)]
/// Codec message
pub enum Message<T> {
/// Http message
Item(T),
/// Payload chunk
Chunk(Option<Bytes>),
}
impl<T> From<T> for Message<T> {
fn from(item: T) -> Self {
Message::Item(item)
}
}
/// Incoming request type
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
pub enum MessageType {
None,
Payload,
Stream,
}
const LW: usize = 2 * 1024;
const HW: usize = 32 * 1024;
pub(crate) fn reserve_readbuf(src: &mut BytesMut) {
let cap = src.capacity();
if cap < LW {
src.reserve(HW - cap);
}
}
#[cfg(test)]
mod tests {
use super::*;
use crate::request::Request;
impl Message<Request> {
pub fn message(self) -> Request {
match self {
Message::Item(req) => req,
_ => panic!("error"),
}
}
pub fn chunk(self) -> Bytes {
match self {
Message::Chunk(Some(data)) => data,
_ => panic!("error"),
}
}
pub fn eof(self) -> bool {
match self {
Message::Chunk(None) => true,
Message::Chunk(Some(_)) => false,
_ => panic!("error"),
}
}
}
}

View File

@@ -1,281 +0,0 @@
//! Payload stream
use std::cell::RefCell;
use std::collections::VecDeque;
use std::pin::Pin;
use std::rc::{Rc, Weak};
use std::task::{Context, Poll, Waker};
use bytes::Bytes;
use futures_core::Stream;
use crate::error::PayloadError;
/// max buffer size 32k
pub(crate) const MAX_BUFFER_SIZE: usize = 32_768;
#[derive(Debug, PartialEq)]
pub enum PayloadStatus {
Read,
Pause,
Dropped,
}
/// Buffered stream of bytes chunks
///
/// Payload stores chunks in a vector. First chunk can be received with
/// `.readany()` method. Payload stream is not thread safe. Payload does not
/// notify current task when new data is available.
///
/// Payload stream can be used as `Response` body stream.
#[derive(Debug)]
pub struct Payload {
inner: Rc<RefCell<Inner>>,
}
impl Payload {
/// Create payload stream.
///
/// This method construct two objects responsible for bytes stream
/// generation.
///
/// * `PayloadSender` - *Sender* side of the stream
///
/// * `Payload` - *Receiver* side of the stream
pub fn create(eof: bool) -> (PayloadSender, Payload) {
let shared = Rc::new(RefCell::new(Inner::new(eof)));
(
PayloadSender {
inner: Rc::downgrade(&shared),
},
Payload { inner: shared },
)
}
/// Create empty payload
#[doc(hidden)]
pub fn empty() -> Payload {
Payload {
inner: Rc::new(RefCell::new(Inner::new(true))),
}
}
/// Length of the data in this payload
#[cfg(test)]
pub fn len(&self) -> usize {
self.inner.borrow().len()
}
/// Is payload empty
#[cfg(test)]
pub fn is_empty(&self) -> bool {
self.inner.borrow().len() == 0
}
/// Put unused data back to payload
#[inline]
pub fn unread_data(&mut self, data: Bytes) {
self.inner.borrow_mut().unread_data(data);
}
#[inline]
pub fn readany(
&mut self,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
self.inner.borrow_mut().readany(cx)
}
}
impl Stream for Payload {
type Item = Result<Bytes, PayloadError>;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
self.inner.borrow_mut().readany(cx)
}
}
/// Sender part of the payload stream
pub struct PayloadSender {
inner: Weak<RefCell<Inner>>,
}
impl PayloadSender {
#[inline]
pub fn set_error(&mut self, err: PayloadError) {
if let Some(shared) = self.inner.upgrade() {
shared.borrow_mut().set_error(err)
}
}
#[inline]
pub fn feed_eof(&mut self) {
if let Some(shared) = self.inner.upgrade() {
shared.borrow_mut().feed_eof()
}
}
#[inline]
pub fn feed_data(&mut self, data: Bytes) {
if let Some(shared) = self.inner.upgrade() {
shared.borrow_mut().feed_data(data)
}
}
#[inline]
pub fn need_read(&self, cx: &mut Context<'_>) -> PayloadStatus {
// we check need_read only if Payload (other side) is alive,
// otherwise always return true (consume payload)
if let Some(shared) = self.inner.upgrade() {
if shared.borrow().need_read {
PayloadStatus::Read
} else {
shared.borrow_mut().register_io(cx);
PayloadStatus::Pause
}
} else {
PayloadStatus::Dropped
}
}
}
#[derive(Debug)]
struct Inner {
len: usize,
eof: bool,
err: Option<PayloadError>,
need_read: bool,
items: VecDeque<Bytes>,
task: Option<Waker>,
io_task: Option<Waker>,
}
impl Inner {
fn new(eof: bool) -> Self {
Inner {
eof,
len: 0,
err: None,
items: VecDeque::new(),
need_read: true,
task: None,
io_task: None,
}
}
/// Wake up future waiting for payload data to be available.
fn wake(&mut self) {
if let Some(waker) = self.task.take() {
waker.wake();
}
}
/// Wake up future feeding data to Payload.
fn wake_io(&mut self) {
if let Some(waker) = self.io_task.take() {
waker.wake();
}
}
/// Register future waiting data from payload.
/// Waker would be used in `Inner::wake`
fn register(&mut self, cx: &mut Context<'_>) {
if self
.task
.as_ref()
.map(|w| !cx.waker().will_wake(w))
.unwrap_or(true)
{
self.task = Some(cx.waker().clone());
}
}
// Register future feeding data to payload.
/// Waker would be used in `Inner::wake_io`
fn register_io(&mut self, cx: &mut Context<'_>) {
if self
.io_task
.as_ref()
.map(|w| !cx.waker().will_wake(w))
.unwrap_or(true)
{
self.io_task = Some(cx.waker().clone());
}
}
#[inline]
fn set_error(&mut self, err: PayloadError) {
self.err = Some(err);
}
#[inline]
fn feed_eof(&mut self) {
self.eof = true;
}
#[inline]
fn feed_data(&mut self, data: Bytes) {
self.len += data.len();
self.items.push_back(data);
self.need_read = self.len < MAX_BUFFER_SIZE;
self.wake();
}
#[cfg(test)]
fn len(&self) -> usize {
self.len
}
fn readany(
&mut self,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
if let Some(data) = self.items.pop_front() {
self.len -= data.len();
self.need_read = self.len < MAX_BUFFER_SIZE;
if self.need_read && !self.eof {
self.register(cx);
}
self.wake_io();
Poll::Ready(Some(Ok(data)))
} else if let Some(err) = self.err.take() {
Poll::Ready(Some(Err(err)))
} else if self.eof {
Poll::Ready(None)
} else {
self.need_read = true;
self.register(cx);
self.wake_io();
Poll::Pending
}
}
fn unread_data(&mut self, data: Bytes) {
self.len += data.len();
self.items.push_front(data);
}
}
#[cfg(test)]
mod tests {
use super::*;
use futures_util::future::poll_fn;
#[actix_rt::test]
async fn test_unread_data() {
let (_, mut payload) = Payload::create(false);
payload.unread_data(Bytes::from("data"));
assert!(!payload.is_empty());
assert_eq!(payload.len(), 4);
assert_eq!(
Bytes::from("data"),
poll_fn(|cx| payload.readany(cx)).await.unwrap().unwrap()
);
}
}

View File

@@ -1,475 +0,0 @@
use std::future::Future;
use std::marker::PhantomData;
use std::pin::Pin;
use std::rc::Rc;
use std::task::{Context, Poll};
use std::{fmt, net};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_rt::net::TcpStream;
use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
use futures_core::ready;
use futures_util::future::ready;
use crate::body::MessageBody;
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error};
use crate::request::Request;
use crate::response::Response;
use crate::service::HttpFlow;
use crate::{ConnectCallback, OnConnectData};
use super::codec::Codec;
use super::dispatcher::Dispatcher;
use super::{ExpectHandler, UpgradeHandler};
/// `ServiceFactory` implementation for HTTP1 transport
pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler> {
srv: S,
cfg: ServiceConfig,
expect: X,
upgrade: Option<U>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
_phantom: PhantomData<B>,
}
impl<T, S, B> H1Service<T, S, B>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
{
/// Create new `HttpService` instance with config.
pub(crate) fn with_config<F: IntoServiceFactory<S, Request>>(
cfg: ServiceConfig,
service: F,
) -> Self {
H1Service {
cfg,
srv: service.into_factory(),
expect: ExpectHandler,
upgrade: None,
on_connect_ext: None,
_phantom: PhantomData,
}
}
}
impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<(Request, Framed<TcpStream, Codec>), Config = (), Response = ()>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
/// Create simple tcp stream service
pub fn tcp(
self,
) -> impl ServiceFactory<
TcpStream,
Config = (),
Response = (),
Error = DispatchError,
InitError = (),
> {
pipeline_factory(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ready(Ok((io, peer_addr)))
})
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use super::*;
use actix_service::ServiceFactoryExt;
use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, TlsStream};
use actix_tls::accept::TlsError;
impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
(Request, Framed<TlsStream<TcpStream>, Codec>),
Config = (),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
/// Create openssl based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
TcpStream,
Config = (),
Response = (),
Error = TlsError<SslError, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(TlsError::Tls)
.map_init_err(|_| panic!()),
)
.and_then(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ready(Ok((io, peer_addr)))
})
.and_then(self.map_err(TlsError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_service::ServiceFactoryExt;
use actix_tls::accept::rustls::{Acceptor, ServerConfig, TlsStream};
use actix_tls::accept::TlsError;
use std::{fmt, io};
impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
(Request, Framed<TlsStream<TcpStream>, Codec>),
Config = (),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
/// Create rustls based service
pub fn rustls(
self,
config: ServerConfig,
) -> impl ServiceFactory<
TcpStream,
Config = (),
Response = (),
Error = TlsError<io::Error, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(config)
.map_err(TlsError::Tls)
.map_init_err(|_| panic!()),
)
.and_then(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ready(Ok((io, peer_addr)))
})
.and_then(self.map_err(TlsError::Service))
}
}
}
impl<T, S, B, X, U> H1Service<T, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
{
pub fn expect<X1>(self, expect: X1) -> H1Service<T, S, B, X1, U>
where
X1: ServiceFactory<Request, Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
{
H1Service {
expect,
cfg: self.cfg,
srv: self.srv,
upgrade: self.upgrade,
on_connect_ext: self.on_connect_ext,
_phantom: PhantomData,
}
}
pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, S, B, X, U1>
where
U1: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
{
H1Service {
upgrade,
cfg: self.cfg,
srv: self.srv,
expect: self.expect,
on_connect_ext: self.on_connect_ext,
_phantom: PhantomData,
}
}
/// Set on connect callback.
pub(crate) fn on_connect_ext(mut self, f: Option<Rc<ConnectCallback<T>>>) -> Self {
self.on_connect_ext = f;
self
}
}
impl<T, S, B, X, U> ServiceFactory<(T, Option<net::SocketAddr>)>
for H1Service<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
type Response = ();
type Error = DispatchError;
type Config = ();
type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
type InitError = ();
type Future = H1ServiceResponse<T, S, B, X, U>;
fn new_service(&self, _: ()) -> Self::Future {
H1ServiceResponse {
fut: self.srv.new_service(()),
fut_ex: Some(self.expect.new_service(())),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
expect: None,
upgrade: None,
on_connect_ext: self.on_connect_ext.clone(),
cfg: Some(self.cfg.clone()),
_phantom: PhantomData,
}
}
}
#[doc(hidden)]
#[pin_project::pin_project]
pub struct H1ServiceResponse<T, S, B, X, U>
where
S: ServiceFactory<Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
X: ServiceFactory<Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
#[pin]
fut: S::Future,
#[pin]
fut_ex: Option<X::Future>,
#[pin]
fut_upg: Option<U::Future>,
expect: Option<X::Service>,
upgrade: Option<U::Service>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
cfg: Option<ServiceConfig>,
_phantom: PhantomData<B>,
}
impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
X: ServiceFactory<Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
if let Some(fut) = this.fut_ex.as_pin_mut() {
let expect = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.expect = Some(expect);
this.fut_ex.set(None);
}
if let Some(fut) = this.fut_upg.as_pin_mut() {
let upgrade = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.upgrade = Some(upgrade);
this.fut_upg.set(None);
}
let result = ready!(this
.fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)));
Poll::Ready(result.map(|service| {
let this = self.as_mut().project();
H1ServiceHandler::new(
this.cfg.take().unwrap(),
service,
this.expect.take().unwrap(),
this.upgrade.take(),
this.on_connect_ext.clone(),
)
}))
}
}
/// `Service` implementation for HTTP/1 transport
pub struct H1ServiceHandler<T, S, B, X, U>
where
S: Service<Request>,
X: Service<Request>,
U: Service<(Request, Framed<T, Codec>)>,
{
flow: Rc<HttpFlow<S, X, U>>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
cfg: ServiceConfig,
_phantom: PhantomData<B>,
}
impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
where
S: Service<Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
B: MessageBody,
X: Service<Request, Response = Request>,
X::Error: Into<Error>,
U: Service<(Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
{
fn new(
cfg: ServiceConfig,
service: S,
expect: X,
upgrade: Option<U>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
) -> H1ServiceHandler<T, S, B, X, U> {
H1ServiceHandler {
flow: HttpFlow::new(service, expect, upgrade),
cfg,
on_connect_ext,
_phantom: PhantomData,
}
}
}
impl<T, S, B, X, U> Service<(T, Option<net::SocketAddr>)>
for H1ServiceHandler<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
B: MessageBody,
X: Service<Request, Response = Request>,
X::Error: Into<Error>,
U: Service<(Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display + Into<Error>,
{
type Response = ();
type Error = DispatchError;
type Future = Dispatcher<T, S, B, X, U>;
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
let ready = self
.flow
.expect
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready();
let ready = self
.flow
.service
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready()
&& ready;
let ready = if let Some(ref upg) = self.flow.upgrade {
upg.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready()
&& ready
} else {
ready
};
if ready {
Poll::Ready(Ok(()))
} else {
Poll::Pending
}
}
fn call(&self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
let on_connect_data =
OnConnectData::from_io(&io, self.on_connect_ext.as_deref());
Dispatcher::new(
io,
self.cfg.clone(),
self.flow.clone(),
on_connect_data,
addr,
)
}
}

View File

@@ -1,36 +0,0 @@
use std::task::Poll;
use actix_codec::Framed;
use actix_service::{Service, ServiceFactory};
use futures_util::future::{ready, Ready};
use crate::error::Error;
use crate::h1::Codec;
use crate::request::Request;
pub struct UpgradeHandler;
impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
type Response = ();
type Error = Error;
type Config = ();
type Service = UpgradeHandler;
type InitError = Error;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: ()) -> Self::Future {
unimplemented!()
}
}
impl<T> Service<(Request, Framed<T, Codec>)> for UpgradeHandler {
type Response = ();
type Error = Error;
type Future = Ready<Result<Self::Response, Self::Error>>;
actix_service::always_ready!();
fn call(&self, _: (Request, Framed<T, Codec>)) -> Self::Future {
ready(Ok(()))
}
}

View File

@@ -1,115 +0,0 @@
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use crate::body::{BodySize, MessageBody, ResponseBody};
use crate::error::Error;
use crate::h1::{Codec, Message};
use crate::response::Response;
/// Send HTTP/1 response
#[pin_project::pin_project]
pub struct SendResponse<T, B> {
res: Option<Message<(Response<()>, BodySize)>>,
#[pin]
body: Option<ResponseBody<B>>,
#[pin]
framed: Option<Framed<T, Codec>>,
}
impl<T, B> SendResponse<T, B>
where
B: MessageBody,
{
pub fn new(framed: Framed<T, Codec>, response: Response<B>) -> Self {
let (res, body) = response.into_parts();
SendResponse {
res: Some((res, body.size()).into()),
body: Some(body),
framed: Some(framed),
}
}
}
impl<T, B> Future for SendResponse<T, B>
where
T: AsyncRead + AsyncWrite + Unpin,
B: MessageBody + Unpin,
{
type Output = Result<Framed<T, Codec>, Error>;
// TODO: rethink if we need loops in polls
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
let mut body_done = this.body.is_none();
loop {
let mut body_ready = !body_done;
// send body
if this.res.is_none() && body_ready {
while body_ready
&& !body_done
&& !this
.framed
.as_ref()
.as_pin_ref()
.unwrap()
.is_write_buf_full()
{
match this.body.as_mut().as_pin_mut().unwrap().poll_next(cx)? {
Poll::Ready(item) => {
// body is done when item is None
body_done = item.is_none();
if body_done {
let _ = this.body.take();
}
let framed = this.framed.as_mut().as_pin_mut().unwrap();
framed.write(Message::Chunk(item))?;
}
Poll::Pending => body_ready = false,
}
}
}
let framed = this.framed.as_mut().as_pin_mut().unwrap();
// flush write buffer
if !framed.is_write_buf_empty() {
match framed.flush(cx)? {
Poll::Ready(_) => {
if body_ready {
continue;
} else {
return Poll::Pending;
}
}
Poll::Pending => return Poll::Pending,
}
}
// send response
if let Some(res) = this.res.take() {
framed.write(res)?;
continue;
}
if !body_done {
if body_ready {
continue;
} else {
return Poll::Pending;
}
} else {
break;
}
}
let framed = this.framed.take().unwrap();
Poll::Ready(Ok(framed))
}
}

View File

@@ -1,335 +0,0 @@
use std::task::{Context, Poll};
use std::{cmp, future::Future, marker::PhantomData, net, pin::Pin, rc::Rc};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_service::Service;
use bytes::{Bytes, BytesMut};
use futures_core::ready;
use h2::server::{Connection, SendResponse};
use h2::SendStream;
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use log::{error, trace};
use crate::body::{BodySize, MessageBody, ResponseBody};
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error};
use crate::message::ResponseHead;
use crate::payload::Payload;
use crate::request::Request;
use crate::response::Response;
use crate::service::HttpFlow;
use crate::OnConnectData;
const CHUNK_SIZE: usize = 16_384;
/// Dispatcher for HTTP/2 protocol.
#[pin_project::pin_project]
pub struct Dispatcher<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request>,
B: MessageBody,
{
flow: Rc<HttpFlow<S, X, U>>,
connection: Connection<T, Bytes>,
on_connect_data: OnConnectData,
config: ServiceConfig,
peer_addr: Option<net::SocketAddr>,
_phantom: PhantomData<B>,
}
impl<T, S, B, X, U> Dispatcher<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
B: MessageBody,
{
pub(crate) fn new(
flow: Rc<HttpFlow<S, X, U>>,
connection: Connection<T, Bytes>,
on_connect_data: OnConnectData,
config: ServiceConfig,
peer_addr: Option<net::SocketAddr>,
) -> Self {
Dispatcher {
flow,
config,
peer_addr,
connection,
on_connect_data,
_phantom: PhantomData,
}
}
}
impl<T, S, B, X, U> Future for Dispatcher<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
type Output = Result<(), DispatchError>;
#[inline]
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.get_mut();
loop {
match ready!(Pin::new(&mut this.connection).poll_accept(cx)) {
None => return Poll::Ready(Ok(())),
Some(Err(err)) => return Poll::Ready(Err(err.into())),
Some(Ok((req, res))) => {
let (parts, body) = req.into_parts();
let pl = crate::h2::Payload::new(body);
let pl = Payload::<crate::payload::PayloadStream>::H2(pl);
let mut req = Request::with_payload(pl);
let head = req.head_mut();
head.uri = parts.uri;
head.method = parts.method;
head.version = parts.version;
head.headers = parts.headers.into();
head.peer_addr = this.peer_addr;
// merge on_connect_ext data into request extensions
this.on_connect_data.merge_into(&mut req);
let svc = ServiceResponse {
state: ServiceResponseState::ServiceCall(
this.flow.service.call(req),
Some(res),
),
config: this.config.clone(),
buffer: None,
_phantom: PhantomData,
};
actix_rt::spawn(svc);
}
}
}
}
}
#[pin_project::pin_project]
struct ServiceResponse<F, I, E, B> {
#[pin]
state: ServiceResponseState<F, B>,
config: ServiceConfig,
buffer: Option<Bytes>,
_phantom: PhantomData<(I, E)>,
}
#[pin_project::pin_project(project = ServiceResponseStateProj)]
enum ServiceResponseState<F, B> {
ServiceCall(#[pin] F, Option<SendResponse<Bytes>>),
SendPayload(SendStream<Bytes>, #[pin] ResponseBody<B>),
}
impl<F, I, E, B> ServiceResponse<F, I, E, B>
where
F: Future<Output = Result<I, E>>,
E: Into<Error>,
I: Into<Response<B>>,
B: MessageBody,
{
fn prepare_response(
&self,
head: &ResponseHead,
size: &mut BodySize,
) -> http::Response<()> {
let mut has_date = false;
let mut skip_len = size != &BodySize::Stream;
let mut res = http::Response::new(());
*res.status_mut() = head.status;
*res.version_mut() = http::Version::HTTP_2;
// Content length
match head.status {
http::StatusCode::NO_CONTENT
| http::StatusCode::CONTINUE
| http::StatusCode::PROCESSING => *size = BodySize::None,
http::StatusCode::SWITCHING_PROTOCOLS => {
skip_len = true;
*size = BodySize::Stream;
}
_ => {}
}
let _ = match size {
BodySize::None | BodySize::Stream => None,
BodySize::Empty => res
.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
BodySize::Sized(len) => {
let mut buf = itoa::Buffer::new();
res.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::from_str(buf.format(*len)).unwrap(),
)
}
};
// copy headers
for (key, value) in head.headers.iter() {
match *key {
// TODO: consider skipping other headers according to:
// https://tools.ietf.org/html/rfc7540#section-8.1.2.2
// omit HTTP/1.x only headers
CONNECTION | TRANSFER_ENCODING => continue,
CONTENT_LENGTH if skip_len => continue,
DATE => has_date = true,
_ => {}
}
res.headers_mut().append(key, value.clone());
}
// set date header
if !has_date {
let mut bytes = BytesMut::with_capacity(29);
self.config.set_date_header(&mut bytes);
res.headers_mut().insert(
DATE,
// SAFETY: serialized date-times are known ASCII strings
unsafe { HeaderValue::from_maybe_shared_unchecked(bytes.freeze()) },
);
}
res
}
}
impl<F, I, E, B> Future for ServiceResponse<F, I, E, B>
where
F: Future<Output = Result<I, E>>,
E: Into<Error>,
I: Into<Response<B>>,
B: MessageBody,
{
type Output = ();
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
match this.state.project() {
ServiceResponseStateProj::ServiceCall(call, send) => {
match ready!(call.poll(cx)) {
Ok(res) => {
let (res, body) = res.into().replace_body(());
let mut send = send.take().unwrap();
let mut size = body.size();
let h2_res =
self.as_mut().prepare_response(res.head(), &mut size);
this = self.as_mut().project();
let stream = match send.send_response(h2_res, size.is_eof()) {
Err(e) => {
trace!("Error sending HTTP/2 response: {:?}", e);
return Poll::Ready(());
}
Ok(stream) => stream,
};
if size.is_eof() {
Poll::Ready(())
} else {
this.state
.set(ServiceResponseState::SendPayload(stream, body));
self.poll(cx)
}
}
Err(e) => {
let res: Response = e.into().into();
let (res, body) = res.replace_body(());
let mut send = send.take().unwrap();
let mut size = body.size();
let h2_res =
self.as_mut().prepare_response(res.head(), &mut size);
this = self.as_mut().project();
let stream = match send.send_response(h2_res, size.is_eof()) {
Err(e) => {
trace!("Error sending HTTP/2 response: {:?}", e);
return Poll::Ready(());
}
Ok(stream) => stream,
};
if size.is_eof() {
Poll::Ready(())
} else {
this.state.set(ServiceResponseState::SendPayload(
stream,
body.into_body(),
));
self.poll(cx)
}
}
}
}
ServiceResponseStateProj::SendPayload(ref mut stream, ref mut body) => {
loop {
match this.buffer {
Some(ref mut buffer) => match ready!(stream.poll_capacity(cx)) {
None => return Poll::Ready(()),
Some(Ok(cap)) => {
let len = buffer.len();
let bytes = buffer.split_to(cmp::min(cap, len));
if let Err(e) = stream.send_data(bytes, false) {
warn!("{:?}", e);
return Poll::Ready(());
} else if !buffer.is_empty() {
let cap = cmp::min(buffer.len(), CHUNK_SIZE);
stream.reserve_capacity(cap);
} else {
this.buffer.take();
}
}
Some(Err(e)) => {
warn!("{:?}", e);
return Poll::Ready(());
}
},
None => match ready!(body.as_mut().poll_next(cx)) {
None => {
if let Err(e) = stream.send_data(Bytes::new(), true) {
warn!("{:?}", e);
}
return Poll::Ready(());
}
Some(Ok(chunk)) => {
stream
.reserve_capacity(cmp::min(chunk.len(), CHUNK_SIZE));
*this.buffer = Some(chunk);
}
Some(Err(e)) => {
error!("Response payload stream error: {:?}", e);
return Poll::Ready(());
}
},
}
}
}
}
}
}

View File

@@ -1,52 +0,0 @@
//! HTTP/2 protocol.
use std::{
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
use h2::RecvStream;
mod dispatcher;
mod service;
pub use self::dispatcher::Dispatcher;
pub use self::service::H2Service;
use crate::error::PayloadError;
/// HTTP/2 peer stream.
pub struct Payload {
stream: RecvStream,
}
impl Payload {
pub(crate) fn new(stream: RecvStream) -> Self {
Self { stream }
}
}
impl Stream for Payload {
type Item = Result<Bytes, PayloadError>;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
let this = self.get_mut();
match ready!(Pin::new(&mut this.stream).poll_data(cx)) {
Some(Ok(chunk)) => {
let len = chunk.len();
match this.stream.flow_control().release_capacity(len) {
Ok(()) => Poll::Ready(Some(Ok(chunk))),
Err(err) => Poll::Ready(Some(Err(err.into()))),
}
}
Some(Err(err)) => Poll::Ready(Some(Err(err.into()))),
None => Poll::Ready(None),
}
}
}

View File

@@ -1,382 +0,0 @@
use std::future::Future;
use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{net, rc::Rc};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::net::TcpStream;
use actix_service::{
fn_factory, fn_service, pipeline_factory, IntoServiceFactory, Service,
ServiceFactory,
};
use bytes::Bytes;
use futures_core::ready;
use futures_util::future::ok;
use h2::server::{self, Handshake};
use log::error;
use crate::body::MessageBody;
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error};
use crate::request::Request;
use crate::response::Response;
use crate::service::HttpFlow;
use crate::{ConnectCallback, OnConnectData};
use super::dispatcher::Dispatcher;
/// `ServiceFactory` implementation for HTTP/2 transport
pub struct H2Service<T, S, B> {
srv: S,
cfg: ServiceConfig,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
_phantom: PhantomData<(T, B)>,
}
impl<T, S, B> H2Service<T, S, B>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
{
/// Create new `H2Service` instance with config.
pub(crate) fn with_config<F: IntoServiceFactory<S, Request>>(
cfg: ServiceConfig,
service: F,
) -> Self {
H2Service {
cfg,
on_connect_ext: None,
srv: service.into_factory(),
_phantom: PhantomData,
}
}
/// Set on connect callback.
pub(crate) fn on_connect_ext(mut self, f: Option<Rc<ConnectCallback<T>>>) -> Self {
self.on_connect_ext = f;
self
}
}
impl<S, B> H2Service<TcpStream, S, B>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
{
/// Create plain TCP based service
pub fn tcp(
self,
) -> impl ServiceFactory<
TcpStream,
Config = (),
Response = (),
Error = DispatchError,
InitError = S::InitError,
> {
pipeline_factory(fn_factory(|| async {
Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok::<_, DispatchError>((io, peer_addr))
}))
}))
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use actix_service::{fn_factory, fn_service, ServiceFactoryExt};
use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, TlsStream};
use actix_tls::accept::TlsError;
use super::*;
impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
{
/// Create OpenSSL based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
TcpStream,
Config = (),
Response = (),
Error = TlsError<SslError, DispatchError>,
InitError = S::InitError,
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(TlsError::Tls)
.map_init_err(|_| panic!()),
)
.and_then(fn_factory(|| {
ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, peer_addr))
}))
}))
.and_then(self.map_err(TlsError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_service::ServiceFactoryExt;
use actix_tls::accept::rustls::{Acceptor, ServerConfig, TlsStream};
use actix_tls::accept::TlsError;
use std::io;
impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
where
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
{
/// Create Rustls based service
pub fn rustls(
self,
mut config: ServerConfig,
) -> impl ServiceFactory<
TcpStream,
Config = (),
Response = (),
Error = TlsError<io::Error, DispatchError>,
InitError = S::InitError,
> {
let protos = vec!["h2".to_string().into()];
config.set_protocols(&protos);
pipeline_factory(
Acceptor::new(config)
.map_err(TlsError::Tls)
.map_init_err(|_| panic!()),
)
.and_then(fn_factory(|| {
ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, peer_addr))
}))
}))
.and_then(self.map_err(TlsError::Service))
}
}
}
impl<T, S, B> ServiceFactory<(T, Option<net::SocketAddr>)> for H2Service<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
{
type Response = ();
type Error = DispatchError;
type Config = ();
type Service = H2ServiceHandler<T, S::Service, B>;
type InitError = S::InitError;
type Future = H2ServiceResponse<T, S, B>;
fn new_service(&self, _: ()) -> Self::Future {
H2ServiceResponse {
fut: self.srv.new_service(()),
cfg: Some(self.cfg.clone()),
on_connect_ext: self.on_connect_ext.clone(),
_phantom: PhantomData,
}
}
}
#[doc(hidden)]
#[pin_project::pin_project]
pub struct H2ServiceResponse<T, S, B>
where
S: ServiceFactory<Request>,
{
#[pin]
fut: S::Future,
cfg: Option<ServiceConfig>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
_phantom: PhantomData<B>,
}
impl<T, S, B> Future for H2ServiceResponse<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
{
type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.as_mut().project();
this.fut.poll(cx).map_ok(|service| {
let this = self.as_mut().project();
H2ServiceHandler::new(
this.cfg.take().unwrap(),
this.on_connect_ext.clone(),
service,
)
})
}
}
/// `Service` implementation for HTTP/2 transport
pub struct H2ServiceHandler<T, S, B>
where
S: Service<Request>,
{
flow: Rc<HttpFlow<S, (), ()>>,
cfg: ServiceConfig,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
_phantom: PhantomData<B>,
}
impl<T, S, B> H2ServiceHandler<T, S, B>
where
S: Service<Request>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
fn new(
cfg: ServiceConfig,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
service: S,
) -> H2ServiceHandler<T, S, B> {
H2ServiceHandler {
flow: HttpFlow::new(service, (), None),
cfg,
on_connect_ext,
_phantom: PhantomData,
}
}
}
impl<T, S, B> Service<(T, Option<net::SocketAddr>)> for H2ServiceHandler<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
type Response = ();
type Error = DispatchError;
type Future = H2ServiceHandlerResponse<T, S, B>;
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.flow.service.poll_ready(cx).map_err(|e| {
let e = e.into();
error!("Service readiness error: {:?}", e);
DispatchError::Service(e)
})
}
fn call(&self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
let on_connect_data =
OnConnectData::from_io(&io, self.on_connect_ext.as_deref());
H2ServiceHandlerResponse {
state: State::Handshake(
Some(self.flow.clone()),
Some(self.cfg.clone()),
addr,
on_connect_data,
server::handshake(io),
),
}
}
}
enum State<T, S: Service<Request>, B: MessageBody>
where
T: AsyncRead + AsyncWrite + Unpin,
S::Future: 'static,
{
Incoming(Dispatcher<T, S, B, (), ()>),
Handshake(
Option<Rc<HttpFlow<S, (), ()>>>,
Option<ServiceConfig>,
Option<net::SocketAddr>,
OnConnectData,
Handshake<T, Bytes>,
),
}
pub struct H2ServiceHandlerResponse<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
state: State<T, S, B>,
}
impl<T, S, B> Future for H2ServiceHandlerResponse<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>> + 'static,
B: MessageBody,
{
type Output = Result<(), DispatchError>;
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
match self.state {
State::Incoming(ref mut disp) => Pin::new(disp).poll(cx),
State::Handshake(
ref mut srv,
ref mut config,
ref peer_addr,
ref mut on_connect_data,
ref mut handshake,
) => match ready!(Pin::new(handshake).poll(cx)) {
Ok(conn) => {
let on_connect_data = std::mem::take(on_connect_data);
self.state = State::Incoming(Dispatcher::new(
srv.take().unwrap(),
conn,
on_connect_data,
config.take().unwrap(),
*peer_addr,
));
self.poll(cx)
}
Err(err) => {
trace!("H2 handshake error: {}", err);
Poll::Ready(Err(err.into()))
}
},
}
}
}

View File

@@ -1,48 +0,0 @@
//! Helper trait for types that can be effectively borrowed as a [HeaderValue].
//!
//! [HeaderValue]: crate::http::HeaderValue
use std::{borrow::Cow, str::FromStr};
use http::header::{HeaderName, InvalidHeaderName};
pub trait AsHeaderName: Sealed {}
pub trait Sealed {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName>;
}
impl Sealed for HeaderName {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
Ok(Cow::Borrowed(self))
}
}
impl AsHeaderName for HeaderName {}
impl Sealed for &HeaderName {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
Ok(Cow::Borrowed(*self))
}
}
impl AsHeaderName for &HeaderName {}
impl Sealed for &str {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
HeaderName::from_str(self).map(Cow::Owned)
}
}
impl AsHeaderName for &str {}
impl Sealed for String {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
HeaderName::from_str(self).map(Cow::Owned)
}
}
impl AsHeaderName for String {}
impl Sealed for &String {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
HeaderName::from_str(self).map(Cow::Owned)
}
}
impl AsHeaderName for &String {}

View File

@@ -1,272 +0,0 @@
use std::cmp::Ordering;
use mime::Mime;
use crate::header::{qitem, QualityItem};
use crate::http::header;
header! {
/// `Accept` header, defined in [RFC7231](http://tools.ietf.org/html/rfc7231#section-5.3.2)
///
/// The `Accept` header field can be used by user agents to specify
/// response media types that are acceptable. Accept header fields can
/// be used to indicate that the request is specifically limited to a
/// small set of desired types, as in the case of a request for an
/// in-line image
///
/// # ABNF
///
/// ```text
/// Accept = #( media-range [ accept-params ] )
///
/// media-range = ( "*/*"
/// / ( type "/" "*" )
/// / ( type "/" subtype )
/// ) *( OWS ";" OWS parameter )
/// accept-params = weight *( accept-ext )
/// accept-ext = OWS ";" OWS token [ "=" ( token / quoted-string ) ]
/// ```
///
/// # Example values
/// * `audio/*; q=0.2, audio/basic`
/// * `text/plain; q=0.5, text/html, text/x-dvi; q=0.8, text/x-c`
///
/// # Examples
/// ```
/// use actix_http::Response;
/// use actix_http::http::header::{Accept, qitem};
///
/// let mut builder = Response::Ok();
/// builder.insert_header(
/// Accept(vec![
/// qitem(mime::TEXT_HTML),
/// ])
/// );
/// ```
///
/// ```
/// use actix_http::Response;
/// use actix_http::http::header::{Accept, qitem};
///
/// let mut builder = Response::Ok();
/// builder.insert_header(
/// Accept(vec![
/// qitem(mime::APPLICATION_JSON),
/// ])
/// );
/// ```
///
/// ```
/// use actix_http::Response;
/// use actix_http::http::header::{Accept, QualityItem, q, qitem};
///
/// let mut builder = Response::Ok();
/// builder.insert_header(
/// Accept(vec![
/// qitem(mime::TEXT_HTML),
/// qitem("application/xhtml+xml".parse().unwrap()),
/// QualityItem::new(
/// mime::TEXT_XML,
/// q(900)
/// ),
/// qitem("image/webp".parse().unwrap()),
/// QualityItem::new(
/// mime::STAR_STAR,
/// q(800)
/// ),
/// ])
/// );
/// ```
(Accept, header::ACCEPT) => (QualityItem<Mime>)+
test_accept {
// Tests from the RFC
test_header!(
test1,
vec![b"audio/*; q=0.2, audio/basic"],
Some(Accept(vec![
QualityItem::new("audio/*".parse().unwrap(), q(200)),
qitem("audio/basic".parse().unwrap()),
])));
test_header!(
test2,
vec![b"text/plain; q=0.5, text/html, text/x-dvi; q=0.8, text/x-c"],
Some(Accept(vec![
QualityItem::new(mime::TEXT_PLAIN, q(500)),
qitem(mime::TEXT_HTML),
QualityItem::new(
"text/x-dvi".parse().unwrap(),
q(800)),
qitem("text/x-c".parse().unwrap()),
])));
// Custom tests
test_header!(
test3,
vec![b"text/plain; charset=utf-8"],
Some(Accept(vec![
qitem(mime::TEXT_PLAIN_UTF_8),
])));
test_header!(
test4,
vec![b"text/plain; charset=utf-8; q=0.5"],
Some(Accept(vec![
QualityItem::new(mime::TEXT_PLAIN_UTF_8,
q(500)),
])));
#[test]
fn test_fuzzing1() {
use crate::test::TestRequest;
let req = TestRequest::default().insert_header((crate::header::ACCEPT, "chunk#;e")).finish();
let header = Accept::parse(&req);
assert!(header.is_ok());
}
}
}
impl Accept {
/// Construct `Accept: */*`.
pub fn star() -> Accept {
Accept(vec![qitem(mime::STAR_STAR)])
}
/// Construct `Accept: application/json`.
pub fn json() -> Accept {
Accept(vec![qitem(mime::APPLICATION_JSON)])
}
/// Construct `Accept: text/*`.
pub fn text() -> Accept {
Accept(vec![qitem(mime::TEXT_STAR)])
}
/// Construct `Accept: image/*`.
pub fn image() -> Accept {
Accept(vec![qitem(mime::IMAGE_STAR)])
}
/// Construct `Accept: text/html`.
pub fn html() -> Accept {
Accept(vec![qitem(mime::TEXT_HTML)])
}
/// Returns a sorted list of mime types from highest to lowest preference, accounting for
/// [q-factor weighting] and specificity.
///
/// [q-factor weighting]: https://tools.ietf.org/html/rfc7231#section-5.3.2
pub fn mime_precedence(&self) -> Vec<Mime> {
let mut types = self.0.clone();
// use stable sort so items with equal q-factor and specificity retain listed order
types.sort_by(|a, b| {
// sort by q-factor descending
b.quality.cmp(&a.quality).then_with(|| {
// use specificity rules on mime types with
// same q-factor (eg. text/html > text/* > */*)
// subtypes are not comparable if main type is star, so return
match (a.item.type_(), b.item.type_()) {
(mime::STAR, mime::STAR) => return Ordering::Equal,
// a is sorted after b
(mime::STAR, _) => return Ordering::Greater,
// a is sorted before b
(_, mime::STAR) => return Ordering::Less,
_ => {}
}
// in both these match expressions, the returned ordering appears
// inverted because sort is high-to-low ("descending") precedence
match (a.item.subtype(), b.item.subtype()) {
(mime::STAR, mime::STAR) => Ordering::Equal,
// a is sorted after b
(mime::STAR, _) => Ordering::Greater,
// a is sorted before b
(_, mime::STAR) => Ordering::Less,
_ => Ordering::Equal,
}
})
});
types.into_iter().map(|qitem| qitem.item).collect()
}
/// Extracts the most preferable mime type, accounting for [q-factor weighting].
///
/// If no q-factors are provided, the first mime type is chosen. Note that items without
/// q-factors are given the maximum preference value.
///
/// Returns `None` if contained list is empty.
///
/// [q-factor weighting]: https://tools.ietf.org/html/rfc7231#section-5.3.2
pub fn mime_preference(&self) -> Option<Mime> {
let types = self.mime_precedence();
types.first().cloned()
}
}
#[cfg(test)]
mod tests {
use super::*;
use crate::header::q;
#[test]
fn test_mime_precedence() {
let test = Accept(vec![]);
assert!(test.mime_precedence().is_empty());
let test = Accept(vec![qitem(mime::APPLICATION_JSON)]);
assert_eq!(test.mime_precedence(), vec!(mime::APPLICATION_JSON));
let test = Accept(vec![
qitem(mime::TEXT_HTML),
"application/xhtml+xml".parse().unwrap(),
QualityItem::new("application/xml".parse().unwrap(), q(0.9)),
QualityItem::new(mime::STAR_STAR, q(0.8)),
]);
assert_eq!(
test.mime_precedence(),
vec![
mime::TEXT_HTML,
"application/xhtml+xml".parse().unwrap(),
"application/xml".parse().unwrap(),
mime::STAR_STAR,
]
);
let test = Accept(vec![
qitem(mime::STAR_STAR),
qitem(mime::IMAGE_STAR),
qitem(mime::IMAGE_PNG),
]);
assert_eq!(
test.mime_precedence(),
vec![mime::IMAGE_PNG, mime::IMAGE_STAR, mime::STAR_STAR]
);
}
#[test]
fn test_mime_preference() {
let test = Accept(vec![
qitem(mime::TEXT_HTML),
"application/xhtml+xml".parse().unwrap(),
QualityItem::new("application/xml".parse().unwrap(), q(0.9)),
QualityItem::new(mime::STAR_STAR, q(0.8)),
]);
assert_eq!(test.mime_preference(), Some(mime::TEXT_HTML));
let test = Accept(vec![
QualityItem::new("video/*".parse().unwrap(), q(0.8)),
qitem(mime::IMAGE_PNG),
QualityItem::new(mime::STAR_STAR, q(0.5)),
qitem(mime::IMAGE_SVG),
QualityItem::new(mime::IMAGE_STAR, q(0.8)),
]);
assert_eq!(test.mime_preference(), Some(mime::IMAGE_PNG));
}
}

View File

@@ -1,985 +0,0 @@
//! # References
//!
//! "The Content-Disposition Header Field" https://www.ietf.org/rfc/rfc2183.txt
//! "The Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)" https://www.ietf.org/rfc/rfc6266.txt
//! "Returning Values from Forms: multipart/form-data" https://www.ietf.org/rfc/rfc7578.txt
//! Browser conformance tests at: http://greenbytes.de/tech/tc2231/
//! IANA assignment: http://www.iana.org/assignments/cont-disp/cont-disp.xhtml
use once_cell::sync::Lazy;
use regex::Regex;
use std::fmt::{self, Write};
use crate::header::{self, ExtendedValue, Header, IntoHeaderValue, Writer};
/// Split at the index of the first `needle` if it exists or at the end.
fn split_once(haystack: &str, needle: char) -> (&str, &str) {
haystack.find(needle).map_or_else(
|| (haystack, ""),
|sc| {
let (first, last) = haystack.split_at(sc);
(first, last.split_at(1).1)
},
)
}
/// Split at the index of the first `needle` if it exists or at the end, trim the right of the
/// first part and the left of the last part.
fn split_once_and_trim(haystack: &str, needle: char) -> (&str, &str) {
let (first, last) = split_once(haystack, needle);
(first.trim_end(), last.trim_start())
}
/// The implied disposition of the content of the HTTP body.
#[derive(Clone, Debug, PartialEq)]
pub enum DispositionType {
/// Inline implies default processing
Inline,
/// Attachment implies that the recipient should prompt the user to save the response locally,
/// rather than process it normally (as per its media type).
Attachment,
/// Used in *multipart/form-data* as defined in
/// [RFC7578](https://tools.ietf.org/html/rfc7578) to carry the field name and the file name.
FormData,
/// Extension type. Should be handled by recipients the same way as Attachment
Ext(String),
}
impl<'a> From<&'a str> for DispositionType {
fn from(origin: &'a str) -> DispositionType {
if origin.eq_ignore_ascii_case("inline") {
DispositionType::Inline
} else if origin.eq_ignore_ascii_case("attachment") {
DispositionType::Attachment
} else if origin.eq_ignore_ascii_case("form-data") {
DispositionType::FormData
} else {
DispositionType::Ext(origin.to_owned())
}
}
}
/// Parameter in [`ContentDisposition`].
///
/// # Examples
/// ```
/// use actix_http::http::header::DispositionParam;
///
/// let param = DispositionParam::Filename(String::from("sample.txt"));
/// assert!(param.is_filename());
/// assert_eq!(param.as_filename().unwrap(), "sample.txt");
/// ```
#[derive(Clone, Debug, PartialEq)]
#[allow(clippy::large_enum_variant)]
pub enum DispositionParam {
/// For [`DispositionType::FormData`] (i.e. *multipart/form-data*), the name of an field from
/// the form.
Name(String),
/// A plain file name.
///
/// It is [not supposed](https://tools.ietf.org/html/rfc6266#appendix-D) to contain any
/// non-ASCII characters when used in a *Content-Disposition* HTTP response header, where
/// [`FilenameExt`](DispositionParam::FilenameExt) with charset UTF-8 may be used instead
/// in case there are Unicode characters in file names.
Filename(String),
/// An extended file name. It must not exist for `ContentType::Formdata` according to
/// [RFC7578 Section 4.2](https://tools.ietf.org/html/rfc7578#section-4.2).
FilenameExt(ExtendedValue),
/// An unrecognized regular parameter as defined in
/// [RFC5987](https://tools.ietf.org/html/rfc5987) as *reg-parameter*, in
/// [RFC6266](https://tools.ietf.org/html/rfc6266) as *token "=" value*. Recipients should
/// ignore unrecognizable parameters.
Unknown(String, String),
/// An unrecognized extended parameter as defined in
/// [RFC5987](https://tools.ietf.org/html/rfc5987) as *ext-parameter*, in
/// [RFC6266](https://tools.ietf.org/html/rfc6266) as *ext-token "=" ext-value*. The single
/// trailing asterisk is not included. Recipients should ignore unrecognizable parameters.
UnknownExt(String, ExtendedValue),
}
impl DispositionParam {
/// Returns `true` if the parameter is [`Name`](DispositionParam::Name).
#[inline]
pub fn is_name(&self) -> bool {
self.as_name().is_some()
}
/// Returns `true` if the parameter is [`Filename`](DispositionParam::Filename).
#[inline]
pub fn is_filename(&self) -> bool {
self.as_filename().is_some()
}
/// Returns `true` if the parameter is [`FilenameExt`](DispositionParam::FilenameExt).
#[inline]
pub fn is_filename_ext(&self) -> bool {
self.as_filename_ext().is_some()
}
/// Returns `true` if the parameter is [`Unknown`](DispositionParam::Unknown) and the `name`
#[inline]
/// matches.
pub fn is_unknown<T: AsRef<str>>(&self, name: T) -> bool {
self.as_unknown(name).is_some()
}
/// Returns `true` if the parameter is [`UnknownExt`](DispositionParam::UnknownExt) and the
/// `name` matches.
#[inline]
pub fn is_unknown_ext<T: AsRef<str>>(&self, name: T) -> bool {
self.as_unknown_ext(name).is_some()
}
/// Returns the name if applicable.
#[inline]
pub fn as_name(&self) -> Option<&str> {
match self {
DispositionParam::Name(ref name) => Some(name.as_str()),
_ => None,
}
}
/// Returns the filename if applicable.
#[inline]
pub fn as_filename(&self) -> Option<&str> {
match self {
DispositionParam::Filename(ref filename) => Some(filename.as_str()),
_ => None,
}
}
/// Returns the filename* if applicable.
#[inline]
pub fn as_filename_ext(&self) -> Option<&ExtendedValue> {
match self {
DispositionParam::FilenameExt(ref value) => Some(value),
_ => None,
}
}
/// Returns the value of the unrecognized regular parameter if it is
/// [`Unknown`](DispositionParam::Unknown) and the `name` matches.
#[inline]
pub fn as_unknown<T: AsRef<str>>(&self, name: T) -> Option<&str> {
match self {
DispositionParam::Unknown(ref ext_name, ref value)
if ext_name.eq_ignore_ascii_case(name.as_ref()) =>
{
Some(value.as_str())
}
_ => None,
}
}
/// Returns the value of the unrecognized extended parameter if it is
/// [`Unknown`](DispositionParam::Unknown) and the `name` matches.
#[inline]
pub fn as_unknown_ext<T: AsRef<str>>(&self, name: T) -> Option<&ExtendedValue> {
match self {
DispositionParam::UnknownExt(ref ext_name, ref value)
if ext_name.eq_ignore_ascii_case(name.as_ref()) =>
{
Some(value)
}
_ => None,
}
}
}
/// A *Content-Disposition* header. It is compatible to be used either as
/// [a response header for the main body](https://mdn.io/Content-Disposition#As_a_response_header_for_the_main_body)
/// as (re)defined in [RFC6266](https://tools.ietf.org/html/rfc6266), or as
/// [a header for a multipart body](https://mdn.io/Content-Disposition#As_a_header_for_a_multipart_body)
/// as (re)defined in [RFC7587](https://tools.ietf.org/html/rfc7578).
///
/// In a regular HTTP response, the *Content-Disposition* response header is a header indicating if
/// the content is expected to be displayed *inline* in the browser, that is, as a Web page or as
/// part of a Web page, or as an attachment, that is downloaded and saved locally, and also can be
/// used to attach additional metadata, such as the filename to use when saving the response payload
/// locally.
///
/// In a *multipart/form-data* body, the HTTP *Content-Disposition* general header is a header that
/// can be used on the subpart of a multipart body to give information about the field it applies to.
/// The subpart is delimited by the boundary defined in the *Content-Type* header. Used on the body
/// itself, *Content-Disposition* has no effect.
///
/// # ABNF
/// ```text
/// content-disposition = "Content-Disposition" ":"
/// disposition-type *( ";" disposition-parm )
///
/// disposition-type = "inline" | "attachment" | disp-ext-type
/// ; case-insensitive
///
/// disp-ext-type = token
///
/// disposition-parm = filename-parm | disp-ext-parm
///
/// filename-parm = "filename" "=" value
/// | "filename*" "=" ext-value
///
/// disp-ext-parm = token "=" value
/// | ext-token "=" ext-value
///
/// ext-token = <the characters in token, followed by "*">
/// ```
///
/// # Note
///
/// filename is [not supposed](https://tools.ietf.org/html/rfc6266#appendix-D) to contain any
/// non-ASCII characters when used in a *Content-Disposition* HTTP response header, where
/// filename* with charset UTF-8 may be used instead in case there are Unicode characters in file
/// names.
/// filename is [acceptable](https://tools.ietf.org/html/rfc7578#section-4.2) to be UTF-8 encoded
/// directly in a *Content-Disposition* header for *multipart/form-data*, though.
///
/// filename* [must not](https://tools.ietf.org/html/rfc7578#section-4.2) be used within
/// *multipart/form-data*.
///
/// # Example
///
/// ```
/// use actix_http::http::header::{
/// Charset, ContentDisposition, DispositionParam, DispositionType,
/// ExtendedValue,
/// };
///
/// let cd1 = ContentDisposition {
/// disposition: DispositionType::Attachment,
/// parameters: vec![DispositionParam::FilenameExt(ExtendedValue {
/// charset: Charset::Iso_8859_1, // The character set for the bytes of the filename
/// language_tag: None, // The optional language tag (see `language-tag` crate)
/// value: b"\xa9 Copyright 1989.txt".to_vec(), // the actual bytes of the filename
/// })],
/// };
/// assert!(cd1.is_attachment());
/// assert!(cd1.get_filename_ext().is_some());
///
/// let cd2 = ContentDisposition {
/// disposition: DispositionType::FormData,
/// parameters: vec![
/// DispositionParam::Name(String::from("file")),
/// DispositionParam::Filename(String::from("bill.odt")),
/// ],
/// };
/// assert_eq!(cd2.get_name(), Some("file")); // field name
/// assert_eq!(cd2.get_filename(), Some("bill.odt"));
///
/// // HTTP response header with Unicode characters in file names
/// let cd3 = ContentDisposition {
/// disposition: DispositionType::Attachment,
/// parameters: vec![
/// DispositionParam::FilenameExt(ExtendedValue {
/// charset: Charset::Ext(String::from("UTF-8")),
/// language_tag: None,
/// value: String::from("\u{1f600}.svg").into_bytes(),
/// }),
/// // fallback for better compatibility
/// DispositionParam::Filename(String::from("Grinning-Face-Emoji.svg"))
/// ],
/// };
/// assert_eq!(cd3.get_filename_ext().map(|ev| ev.value.as_ref()),
/// Some("\u{1f600}.svg".as_bytes()));
/// ```
///
/// # Security Note
///
/// If "filename" parameter is supplied, do not use the file name blindly, check and possibly
/// change to match local file system conventions if applicable, and do not use directory path
/// information that may be present. See [RFC2183](https://tools.ietf.org/html/rfc2183#section-2.3).
#[derive(Clone, Debug, PartialEq)]
pub struct ContentDisposition {
/// The disposition type
pub disposition: DispositionType,
/// Disposition parameters
pub parameters: Vec<DispositionParam>,
}
impl ContentDisposition {
/// Parse a raw Content-Disposition header value.
pub fn from_raw(hv: &header::HeaderValue) -> Result<Self, crate::error::ParseError> {
// `header::from_one_raw_str` invokes `hv.to_str` which assumes `hv` contains only visible
// ASCII characters. So `hv.as_bytes` is necessary here.
let hv = String::from_utf8(hv.as_bytes().to_vec())
.map_err(|_| crate::error::ParseError::Header)?;
let (disp_type, mut left) = split_once_and_trim(hv.as_str().trim(), ';');
if disp_type.is_empty() {
return Err(crate::error::ParseError::Header);
}
let mut cd = ContentDisposition {
disposition: disp_type.into(),
parameters: Vec::new(),
};
while !left.is_empty() {
let (param_name, new_left) = split_once_and_trim(left, '=');
if param_name.is_empty() || param_name == "*" || new_left.is_empty() {
return Err(crate::error::ParseError::Header);
}
left = new_left;
if let Some(param_name) = param_name.strip_suffix('*') {
// extended parameters
let (ext_value, new_left) = split_once_and_trim(left, ';');
left = new_left;
let ext_value = header::parse_extended_value(ext_value)?;
let param = if param_name.eq_ignore_ascii_case("filename") {
DispositionParam::FilenameExt(ext_value)
} else {
DispositionParam::UnknownExt(param_name.to_owned(), ext_value)
};
cd.parameters.push(param);
} else {
// regular parameters
let value = if left.starts_with('\"') {
// quoted-string: defined in RFC6266 -> RFC2616 Section 3.6
let mut escaping = false;
let mut quoted_string = vec![];
let mut end = None;
// search for closing quote
for (i, &c) in left.as_bytes().iter().skip(1).enumerate() {
if escaping {
escaping = false;
quoted_string.push(c);
} else if c == 0x5c {
// backslash
escaping = true;
} else if c == 0x22 {
// double quote
end = Some(i + 1); // cuz skipped 1 for the leading quote
break;
} else {
quoted_string.push(c);
}
}
left = &left[end.ok_or(crate::error::ParseError::Header)? + 1..];
left = split_once(left, ';').1.trim_start();
// In fact, it should not be Err if the above code is correct.
String::from_utf8(quoted_string)
.map_err(|_| crate::error::ParseError::Header)?
} else {
// token: won't contains semicolon according to RFC 2616 Section 2.2
let (token, new_left) = split_once_and_trim(left, ';');
left = new_left;
if token.is_empty() {
// quoted-string can be empty, but token cannot be empty
return Err(crate::error::ParseError::Header);
}
token.to_owned()
};
let param = if param_name.eq_ignore_ascii_case("name") {
DispositionParam::Name(value)
} else if param_name.eq_ignore_ascii_case("filename") {
// See also comments in test_from_raw_unnecessary_percent_decode.
DispositionParam::Filename(value)
} else {
DispositionParam::Unknown(param_name.to_owned(), value)
};
cd.parameters.push(param);
}
}
Ok(cd)
}
/// Returns `true` if it is [`Inline`](DispositionType::Inline).
pub fn is_inline(&self) -> bool {
matches!(self.disposition, DispositionType::Inline)
}
/// Returns `true` if it is [`Attachment`](DispositionType::Attachment).
pub fn is_attachment(&self) -> bool {
matches!(self.disposition, DispositionType::Attachment)
}
/// Returns `true` if it is [`FormData`](DispositionType::FormData).
pub fn is_form_data(&self) -> bool {
matches!(self.disposition, DispositionType::FormData)
}
/// Returns `true` if it is [`Ext`](DispositionType::Ext) and the `disp_type` matches.
pub fn is_ext<T: AsRef<str>>(&self, disp_type: T) -> bool {
match self.disposition {
DispositionType::Ext(ref t)
if t.eq_ignore_ascii_case(disp_type.as_ref()) =>
{
true
}
_ => false,
}
}
/// Return the value of *name* if exists.
pub fn get_name(&self) -> Option<&str> {
self.parameters.iter().filter_map(|p| p.as_name()).next()
}
/// Return the value of *filename* if exists.
pub fn get_filename(&self) -> Option<&str> {
self.parameters
.iter()
.filter_map(|p| p.as_filename())
.next()
}
/// Return the value of *filename\** if exists.
pub fn get_filename_ext(&self) -> Option<&ExtendedValue> {
self.parameters
.iter()
.filter_map(|p| p.as_filename_ext())
.next()
}
/// Return the value of the parameter which the `name` matches.
pub fn get_unknown<T: AsRef<str>>(&self, name: T) -> Option<&str> {
let name = name.as_ref();
self.parameters
.iter()
.filter_map(|p| p.as_unknown(name))
.next()
}
/// Return the value of the extended parameter which the `name` matches.
pub fn get_unknown_ext<T: AsRef<str>>(&self, name: T) -> Option<&ExtendedValue> {
let name = name.as_ref();
self.parameters
.iter()
.filter_map(|p| p.as_unknown_ext(name))
.next()
}
}
impl IntoHeaderValue for ContentDisposition {
type Error = header::InvalidHeaderValue;
fn try_into_value(self) -> Result<header::HeaderValue, Self::Error> {
let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self);
header::HeaderValue::from_maybe_shared(writer.take())
}
}
impl Header for ContentDisposition {
fn name() -> header::HeaderName {
header::CONTENT_DISPOSITION
}
fn parse<T: crate::HttpMessage>(msg: &T) -> Result<Self, crate::error::ParseError> {
if let Some(h) = msg.headers().get(&Self::name()) {
Self::from_raw(&h)
} else {
Err(crate::error::ParseError::Header)
}
}
}
impl fmt::Display for DispositionType {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match self {
DispositionType::Inline => write!(f, "inline"),
DispositionType::Attachment => write!(f, "attachment"),
DispositionType::FormData => write!(f, "form-data"),
DispositionType::Ext(ref s) => write!(f, "{}", s),
}
}
}
impl fmt::Display for DispositionParam {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
// All ASCII control characters (0-30, 127) including horizontal tab, double quote, and
// backslash should be escaped in quoted-string (i.e. "foobar").
// Ref: RFC6266 S4.1 -> RFC2616 S3.6
// filename-parm = "filename" "=" value
// value = token | quoted-string
// quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
// qdtext = <any TEXT except <">>
// quoted-pair = "\" CHAR
// TEXT = <any OCTET except CTLs,
// but including LWS>
// LWS = [CRLF] 1*( SP | HT )
// OCTET = <any 8-bit sequence of data>
// CHAR = <any US-ASCII character (octets 0 - 127)>
// CTL = <any US-ASCII control character
// (octets 0 - 31) and DEL (127)>
//
// Ref: RFC7578 S4.2 -> RFC2183 S2 -> RFC2045 S5.1
// parameter := attribute "=" value
// attribute := token
// ; Matching of attributes
// ; is ALWAYS case-insensitive.
// value := token / quoted-string
// token := 1*<any (US-ASCII) CHAR except SPACE, CTLs,
// or tspecials>
// tspecials := "(" / ")" / "<" / ">" / "@" /
// "," / ";" / ":" / "\" / <">
// "/" / "[" / "]" / "?" / "="
// ; Must be in quoted-string,
// ; to use within parameter values
//
//
// See also comments in test_from_raw_unnecessary_percent_decode.
static RE: Lazy<Regex> = Lazy::new(|| Regex::new("[\x00-\x08\x10-\x1F\x7F\"\\\\]").unwrap());
match self {
DispositionParam::Name(ref value) => write!(f, "name={}", value),
DispositionParam::Filename(ref value) => {
write!(f, "filename=\"{}\"", RE.replace_all(value, "\\$0").as_ref())
}
DispositionParam::Unknown(ref name, ref value) => write!(
f,
"{}=\"{}\"",
name,
&RE.replace_all(value, "\\$0").as_ref()
),
DispositionParam::FilenameExt(ref ext_value) => {
write!(f, "filename*={}", ext_value)
}
DispositionParam::UnknownExt(ref name, ref ext_value) => {
write!(f, "{}*={}", name, ext_value)
}
}
}
}
impl fmt::Display for ContentDisposition {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "{}", self.disposition)?;
self.parameters
.iter()
.try_for_each(|param| write!(f, "; {}", param))
}
}
#[cfg(test)]
mod tests {
use super::{ContentDisposition, DispositionParam, DispositionType};
use crate::header::shared::Charset;
use crate::header::{ExtendedValue, HeaderValue};
#[test]
fn test_from_raw_basic() {
assert!(ContentDisposition::from_raw(&HeaderValue::from_static("")).is_err());
let a = HeaderValue::from_static(
"form-data; dummy=3; name=upload; filename=\"sample.png\"",
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![
DispositionParam::Unknown("dummy".to_owned(), "3".to_owned()),
DispositionParam::Name("upload".to_owned()),
DispositionParam::Filename("sample.png".to_owned()),
],
};
assert_eq!(a, b);
let a = HeaderValue::from_static("attachment; filename=\"image.jpg\"");
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::Attachment,
parameters: vec![DispositionParam::Filename("image.jpg".to_owned())],
};
assert_eq!(a, b);
let a = HeaderValue::from_static("inline; filename=image.jpg");
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::Inline,
parameters: vec![DispositionParam::Filename("image.jpg".to_owned())],
};
assert_eq!(a, b);
let a = HeaderValue::from_static(
"attachment; creation-date=\"Wed, 12 Feb 1997 16:29:51 -0500\"",
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::Attachment,
parameters: vec![DispositionParam::Unknown(
String::from("creation-date"),
"Wed, 12 Feb 1997 16:29:51 -0500".to_owned(),
)],
};
assert_eq!(a, b);
}
#[test]
fn test_from_raw_extended() {
let a = HeaderValue::from_static(
"attachment; filename*=UTF-8''%c2%a3%20and%20%e2%82%ac%20rates",
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::Attachment,
parameters: vec![DispositionParam::FilenameExt(ExtendedValue {
charset: Charset::Ext(String::from("UTF-8")),
language_tag: None,
value: vec![
0xc2, 0xa3, 0x20, b'a', b'n', b'd', 0x20, 0xe2, 0x82, 0xac, 0x20,
b'r', b'a', b't', b'e', b's',
],
})],
};
assert_eq!(a, b);
let a = HeaderValue::from_static(
"attachment; filename*=UTF-8''%c2%a3%20and%20%e2%82%ac%20rates",
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::Attachment,
parameters: vec![DispositionParam::FilenameExt(ExtendedValue {
charset: Charset::Ext(String::from("UTF-8")),
language_tag: None,
value: vec![
0xc2, 0xa3, 0x20, b'a', b'n', b'd', 0x20, 0xe2, 0x82, 0xac, 0x20,
b'r', b'a', b't', b'e', b's',
],
})],
};
assert_eq!(a, b);
}
#[test]
fn test_from_raw_extra_whitespace() {
let a = HeaderValue::from_static(
"form-data ; du-mmy= 3 ; name =upload ; filename = \"sample.png\" ; ",
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![
DispositionParam::Unknown("du-mmy".to_owned(), "3".to_owned()),
DispositionParam::Name("upload".to_owned()),
DispositionParam::Filename("sample.png".to_owned()),
],
};
assert_eq!(a, b);
}
#[test]
fn test_from_raw_unordered() {
let a = HeaderValue::from_static(
"form-data; dummy=3; filename=\"sample.png\" ; name=upload;",
// Actually, a trailing semicolon is not compliant. But it is fine to accept.
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![
DispositionParam::Unknown("dummy".to_owned(), "3".to_owned()),
DispositionParam::Filename("sample.png".to_owned()),
DispositionParam::Name("upload".to_owned()),
],
};
assert_eq!(a, b);
let a = HeaderValue::from_str(
"attachment; filename*=iso-8859-1''foo-%E4.html; filename=\"foo-ä.html\"",
)
.unwrap();
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::Attachment,
parameters: vec![
DispositionParam::FilenameExt(ExtendedValue {
charset: Charset::Iso_8859_1,
language_tag: None,
value: b"foo-\xe4.html".to_vec(),
}),
DispositionParam::Filename("foo-ä.html".to_owned()),
],
};
assert_eq!(a, b);
}
#[test]
fn test_from_raw_only_disp() {
let a = ContentDisposition::from_raw(&HeaderValue::from_static("attachment"))
.unwrap();
let b = ContentDisposition {
disposition: DispositionType::Attachment,
parameters: vec![],
};
assert_eq!(a, b);
let a =
ContentDisposition::from_raw(&HeaderValue::from_static("inline ;")).unwrap();
let b = ContentDisposition {
disposition: DispositionType::Inline,
parameters: vec![],
};
assert_eq!(a, b);
let a = ContentDisposition::from_raw(&HeaderValue::from_static(
"unknown-disp-param",
))
.unwrap();
let b = ContentDisposition {
disposition: DispositionType::Ext(String::from("unknown-disp-param")),
parameters: vec![],
};
assert_eq!(a, b);
}
#[test]
fn from_raw_with_mixed_case() {
let a = HeaderValue::from_str(
"InLInE; fIlenAME*=iso-8859-1''foo-%E4.html; filEName=\"foo-ä.html\"",
)
.unwrap();
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::Inline,
parameters: vec![
DispositionParam::FilenameExt(ExtendedValue {
charset: Charset::Iso_8859_1,
language_tag: None,
value: b"foo-\xe4.html".to_vec(),
}),
DispositionParam::Filename("foo-ä.html".to_owned()),
],
};
assert_eq!(a, b);
}
#[test]
fn from_raw_with_unicode() {
/* RFC7578 Section 4.2:
Some commonly deployed systems use multipart/form-data with file names directly encoded
including octets outside the US-ASCII range. The encoding used for the file names is
typically UTF-8, although HTML forms will use the charset associated with the form.
Mainstream browsers like Firefox (gecko) and Chrome use UTF-8 directly as above.
(And now, only UTF-8 is handled by this implementation.)
*/
let a = HeaderValue::from_str("form-data; name=upload; filename=\"文件.webp\"")
.unwrap();
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![
DispositionParam::Name(String::from("upload")),
DispositionParam::Filename(String::from("文件.webp")),
],
};
assert_eq!(a, b);
let a = HeaderValue::from_str(
"form-data; name=upload; filename=\"余固知謇謇之為患兮,忍而不能舍也.pptx\"",
)
.unwrap();
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![
DispositionParam::Name(String::from("upload")),
DispositionParam::Filename(String::from(
"余固知謇謇之為患兮,忍而不能舍也.pptx",
)),
],
};
assert_eq!(a, b);
}
#[test]
fn test_from_raw_escape() {
let a = HeaderValue::from_static(
"form-data; dummy=3; name=upload; filename=\"s\\amp\\\"le.png\"",
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![
DispositionParam::Unknown("dummy".to_owned(), "3".to_owned()),
DispositionParam::Name("upload".to_owned()),
DispositionParam::Filename(
['s', 'a', 'm', 'p', '\"', 'l', 'e', '.', 'p', 'n', 'g']
.iter()
.collect(),
),
],
};
assert_eq!(a, b);
}
#[test]
fn test_from_raw_semicolon() {
let a =
HeaderValue::from_static("form-data; filename=\"A semicolon here;.pdf\"");
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![DispositionParam::Filename(String::from(
"A semicolon here;.pdf",
))],
};
assert_eq!(a, b);
}
#[test]
fn test_from_raw_unnecessary_percent_decode() {
// In fact, RFC7578 (multipart/form-data) Section 2 and 4.2 suggests that filename with
// non-ASCII characters MAY be percent-encoded.
// On the contrary, RFC6266 or other RFCs related to Content-Disposition response header
// do not mention such percent-encoding.
// So, it appears to be undecidable whether to percent-decode or not without
// knowing the usage scenario (multipart/form-data v.s. HTTP response header) and
// inevitable to unnecessarily percent-decode filename with %XX in the former scenario.
// Fortunately, it seems that almost all mainstream browsers just send UTF-8 encoded file
// names in quoted-string format (tested on Edge, IE11, Chrome and Firefox) without
// percent-encoding. So we do not bother to attempt to percent-decode.
let a = HeaderValue::from_static(
"form-data; name=photo; filename=\"%74%65%73%74%2e%70%6e%67\"",
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![
DispositionParam::Name("photo".to_owned()),
DispositionParam::Filename(String::from("%74%65%73%74%2e%70%6e%67")),
],
};
assert_eq!(a, b);
let a = HeaderValue::from_static(
"form-data; name=photo; filename=\"%74%65%73%74.png\"",
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![
DispositionParam::Name("photo".to_owned()),
DispositionParam::Filename(String::from("%74%65%73%74.png")),
],
};
assert_eq!(a, b);
}
#[test]
fn test_from_raw_param_value_missing() {
let a = HeaderValue::from_static("form-data; name=upload ; filename=");
assert!(ContentDisposition::from_raw(&a).is_err());
let a = HeaderValue::from_static("attachment; dummy=; filename=invoice.pdf");
assert!(ContentDisposition::from_raw(&a).is_err());
let a = HeaderValue::from_static("inline; filename= ");
assert!(ContentDisposition::from_raw(&a).is_err());
let a = HeaderValue::from_static("inline; filename=\"\"");
assert!(ContentDisposition::from_raw(&a)
.expect("parse cd")
.get_filename()
.expect("filename")
.is_empty());
}
#[test]
fn test_from_raw_param_name_missing() {
let a = HeaderValue::from_static("inline; =\"test.txt\"");
assert!(ContentDisposition::from_raw(&a).is_err());
let a = HeaderValue::from_static("inline; =diary.odt");
assert!(ContentDisposition::from_raw(&a).is_err());
let a = HeaderValue::from_static("inline; =");
assert!(ContentDisposition::from_raw(&a).is_err());
}
#[test]
fn test_display_extended() {
let as_string =
"attachment; filename*=UTF-8'en'%C2%A3%20and%20%E2%82%AC%20rates";
let a = HeaderValue::from_static(as_string);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let display_rendered = format!("{}", a);
assert_eq!(as_string, display_rendered);
let a = HeaderValue::from_static("attachment; filename=colourful.csv");
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let display_rendered = format!("{}", a);
assert_eq!(
"attachment; filename=\"colourful.csv\"".to_owned(),
display_rendered
);
}
#[test]
fn test_display_quote() {
let as_string = "form-data; name=upload; filename=\"Quote\\\"here.png\"";
as_string
.find(['\\', '\"'].iter().collect::<String>().as_str())
.unwrap(); // ensure `\"` is there
let a = HeaderValue::from_static(as_string);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let display_rendered = format!("{}", a);
assert_eq!(as_string, display_rendered);
}
#[test]
fn test_display_space_tab() {
let as_string = "form-data; name=upload; filename=\"Space here.png\"";
let a = HeaderValue::from_static(as_string);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let display_rendered = format!("{}", a);
assert_eq!(as_string, display_rendered);
let a: ContentDisposition = ContentDisposition {
disposition: DispositionType::Inline,
parameters: vec![DispositionParam::Filename(String::from("Tab\there.png"))],
};
let display_rendered = format!("{}", a);
assert_eq!("inline; filename=\"Tab\x09here.png\"", display_rendered);
}
#[test]
fn test_display_control_characters() {
/* let a = "attachment; filename=\"carriage\rreturn.png\"";
let a = HeaderValue::from_static(a);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let display_rendered = format!("{}", a);
assert_eq!(
"attachment; filename=\"carriage\\\rreturn.png\"",
display_rendered
);*/
// No way to create a HeaderValue containing a carriage return.
let a: ContentDisposition = ContentDisposition {
disposition: DispositionType::Inline,
parameters: vec![DispositionParam::Filename(String::from("bell\x07.png"))],
};
let display_rendered = format!("{}", a);
assert_eq!("inline; filename=\"bell\\\x07.png\"", display_rendered);
}
#[test]
fn test_param_methods() {
let param = DispositionParam::Filename(String::from("sample.txt"));
assert!(param.is_filename());
assert_eq!(param.as_filename().unwrap(), "sample.txt");
let param = DispositionParam::Unknown(String::from("foo"), String::from("bar"));
assert!(param.is_unknown("foo"));
assert_eq!(param.as_unknown("fOo"), Some("bar"));
}
#[test]
fn test_disposition_methods() {
let cd = ContentDisposition {
disposition: DispositionType::FormData,
parameters: vec![
DispositionParam::Unknown("dummy".to_owned(), "3".to_owned()),
DispositionParam::Name("upload".to_owned()),
DispositionParam::Filename("sample.png".to_owned()),
],
};
assert_eq!(cd.get_name(), Some("upload"));
assert_eq!(cd.get_unknown("dummy"), Some("3"));
assert_eq!(cd.get_filename(), Some("sample.png"));
assert_eq!(cd.get_unknown_ext("dummy"), None);
assert_eq!(cd.get_unknown("duMMy"), Some("3"));
}
}

View File

@@ -1,106 +0,0 @@
use std::{convert::Infallible, str::FromStr};
use http::header::InvalidHeaderValue;
use crate::{
error::ParseError,
header::{self, from_one_raw_str, Header, HeaderName, HeaderValue, IntoHeaderValue},
HttpMessage,
};
/// Represents a supported content encoding.
#[derive(Copy, Clone, PartialEq, Debug)]
pub enum ContentEncoding {
/// Automatically select encoding based on encoding negotiation.
Auto,
/// A format using the Brotli algorithm.
Br,
/// A format using the zlib structure with deflate algorithm.
Deflate,
/// Gzip algorithm.
Gzip,
/// Indicates the identity function (i.e. no compression, nor modification).
Identity,
}
impl ContentEncoding {
/// Is the content compressed?
#[inline]
pub fn is_compression(self) -> bool {
matches!(self, ContentEncoding::Identity | ContentEncoding::Auto)
}
/// Convert content encoding to string
#[inline]
pub fn as_str(self) -> &'static str {
match self {
ContentEncoding::Br => "br",
ContentEncoding::Gzip => "gzip",
ContentEncoding::Deflate => "deflate",
ContentEncoding::Identity | ContentEncoding::Auto => "identity",
}
}
/// Default Q-factor (quality) value.
#[inline]
pub fn quality(self) -> f64 {
match self {
ContentEncoding::Br => 1.1,
ContentEncoding::Gzip => 1.0,
ContentEncoding::Deflate => 0.9,
ContentEncoding::Identity | ContentEncoding::Auto => 0.1,
}
}
}
impl Default for ContentEncoding {
fn default() -> Self {
Self::Identity
}
}
impl FromStr for ContentEncoding {
type Err = Infallible;
fn from_str(val: &str) -> Result<Self, Self::Err> {
Ok(Self::from(val))
}
}
impl From<&str> for ContentEncoding {
fn from(val: &str) -> ContentEncoding {
let val = val.trim();
if val.eq_ignore_ascii_case("br") {
ContentEncoding::Br
} else if val.eq_ignore_ascii_case("gzip") {
ContentEncoding::Gzip
} else if val.eq_ignore_ascii_case("deflate") {
ContentEncoding::Deflate
} else {
ContentEncoding::default()
}
}
}
impl IntoHeaderValue for ContentEncoding {
type Error = InvalidHeaderValue;
fn try_into_value(self) -> Result<http::HeaderValue, Self::Error> {
Ok(HeaderValue::from_static(self.as_str()))
}
}
impl Header for ContentEncoding {
fn name() -> HeaderName {
header::CONTENT_ENCODING
}
fn parse<T: HttpMessage>(msg: &T) -> Result<Self, ParseError> {
from_one_raw_str(msg.headers().get(Self::name()))
}
}

View File

@@ -1,117 +0,0 @@
use std::convert::TryFrom;
use http::{
header::{HeaderName, InvalidHeaderName, InvalidHeaderValue},
Error as HttpError, HeaderValue,
};
use super::{Header, IntoHeaderValue};
/// Transforms structures into header K/V pairs for inserting into `HeaderMap`s.
pub trait IntoHeaderPair: Sized {
type Error: Into<HttpError>;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error>;
}
#[derive(Debug)]
pub enum InvalidHeaderPart {
Name(InvalidHeaderName),
Value(InvalidHeaderValue),
}
impl From<InvalidHeaderPart> for HttpError {
fn from(part_err: InvalidHeaderPart) -> Self {
match part_err {
InvalidHeaderPart::Name(err) => err.into(),
InvalidHeaderPart::Value(err) => err.into(),
}
}
}
impl<V> IntoHeaderPair for (HeaderName, V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
let value = value
.try_into_value()
.map_err(|err| InvalidHeaderPart::Value(err.into()))?;
Ok((name, value))
}
}
impl<V> IntoHeaderPair for (&HeaderName, V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
let value = value
.try_into_value()
.map_err(|err| InvalidHeaderPart::Value(err.into()))?;
Ok((name.clone(), value))
}
}
impl<V> IntoHeaderPair for (&[u8], V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
let name = HeaderName::try_from(name).map_err(InvalidHeaderPart::Name)?;
let value = value
.try_into_value()
.map_err(|err| InvalidHeaderPart::Value(err.into()))?;
Ok((name, value))
}
}
impl<V> IntoHeaderPair for (&str, V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
let name = HeaderName::try_from(name).map_err(InvalidHeaderPart::Name)?;
let value = value
.try_into_value()
.map_err(|err| InvalidHeaderPart::Value(err.into()))?;
Ok((name, value))
}
}
impl<V> IntoHeaderPair for (String, V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
(name.as_str(), value).try_into_header_pair()
}
}
impl<T: Header> IntoHeaderPair for T {
type Error = <T as IntoHeaderValue>::Error;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
Ok((T::name(), self.try_into_value()?))
}
}

View File

@@ -1,131 +0,0 @@
use std::convert::TryFrom;
use bytes::Bytes;
use http::{header::InvalidHeaderValue, Error as HttpError, HeaderValue};
use mime::Mime;
/// A trait for any object that can be Converted to a `HeaderValue`
pub trait IntoHeaderValue: Sized {
/// The type returned in the event of a conversion error.
type Error: Into<HttpError>;
/// Try to convert value to a HeaderValue.
fn try_into_value(self) -> Result<HeaderValue, Self::Error>;
}
impl IntoHeaderValue for HeaderValue {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
Ok(self)
}
}
impl IntoHeaderValue for &HeaderValue {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
Ok(self.clone())
}
}
impl IntoHeaderValue for &str {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
self.parse()
}
}
impl IntoHeaderValue for &[u8] {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_bytes(self)
}
}
impl IntoHeaderValue for Bytes {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_maybe_shared(self)
}
}
impl IntoHeaderValue for Vec<u8> {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self)
}
}
impl IntoHeaderValue for String {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self)
}
}
impl IntoHeaderValue for usize {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for i64 {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for u64 {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for i32 {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for u32 {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for Mime {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_str(self.as_ref())
}
}

View File

@@ -1,953 +0,0 @@
//! A multi-value [`HeaderMap`] and its iterators.
use std::{borrow::Cow, collections::hash_map, ops};
use ahash::AHashMap;
use http::header::{HeaderName, HeaderValue};
use smallvec::{smallvec, SmallVec};
use crate::header::AsHeaderName;
/// A multi-map of HTTP headers.
///
/// `HeaderMap` is a "multi-map" of [`HeaderName`] to one or more [`HeaderValue`]s.
///
/// # Examples
/// ```
/// use actix_http::http::{header, HeaderMap, HeaderValue};
///
/// let mut map = HeaderMap::new();
///
/// map.insert(header::CONTENT_TYPE, HeaderValue::from_static("text/plain"));
/// map.insert(header::ORIGIN, HeaderValue::from_static("example.com"));
///
/// assert!(map.contains_key(header::CONTENT_TYPE));
/// assert!(map.contains_key(header::ORIGIN));
///
/// let mut removed = map.remove(header::ORIGIN);
/// assert_eq!(removed.next().unwrap(), "example.com");
///
/// assert!(!map.contains_key(header::ORIGIN));
/// ```
#[derive(Debug, Clone, Default)]
pub struct HeaderMap {
pub(crate) inner: AHashMap<HeaderName, Value>,
}
/// A bespoke non-empty list for HeaderMap values.
#[derive(Debug, Clone)]
pub(crate) struct Value {
inner: SmallVec<[HeaderValue; 4]>,
}
impl Value {
fn one(val: HeaderValue) -> Self {
Self {
inner: smallvec![val],
}
}
fn first(&self) -> &HeaderValue {
&self.inner[0]
}
fn first_mut(&mut self) -> &mut HeaderValue {
&mut self.inner[0]
}
fn append(&mut self, new_val: HeaderValue) {
self.inner.push(new_val)
}
}
impl ops::Deref for Value {
type Target = SmallVec<[HeaderValue; 4]>;
fn deref(&self) -> &Self::Target {
&self.inner
}
}
impl HeaderMap {
/// Create an empty `HeaderMap`.
///
/// The map will be created without any capacity; this function will not allocate.
///
/// # Examples
/// ```
/// # use actix_http::http::HeaderMap;
/// let map = HeaderMap::new();
///
/// assert!(map.is_empty());
/// assert_eq!(0, map.capacity());
/// ```
pub fn new() -> Self {
HeaderMap::default()
}
/// Create an empty `HeaderMap` with the specified capacity.
///
/// The map will be able to hold at least `capacity` elements without needing to reallocate.
/// If `capacity` is 0, the map will be created without allocating.
///
/// # Examples
/// ```
/// # use actix_http::http::HeaderMap;
/// let map = HeaderMap::with_capacity(16);
///
/// assert!(map.is_empty());
/// assert!(map.capacity() >= 16);
/// ```
pub fn with_capacity(capacity: usize) -> Self {
HeaderMap {
inner: AHashMap::with_capacity(capacity),
}
}
/// Create new `HeaderMap` from a `http::HeaderMap`-like drain.
pub(crate) fn from_drain<I>(mut drain: I) -> Self
where
I: Iterator<Item = (Option<HeaderName>, HeaderValue)>,
{
let (first_name, first_value) = match drain.next() {
None => return HeaderMap::new(),
Some((name, val)) => {
let name = name.expect("drained first item had no name");
(name, val)
}
};
let (lb, ub) = drain.size_hint();
let capacity = ub.unwrap_or(lb);
let mut map = HeaderMap::with_capacity(capacity);
map.append(first_name.clone(), first_value);
let (map, _) =
drain.fold((map, first_name), |(mut map, prev_name), (name, value)| {
let name = name.unwrap_or(prev_name);
map.append(name.clone(), value);
(map, name)
});
map
}
/// Returns the number of values stored in the map.
///
/// See also: [`len_keys`](Self::len_keys).
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
/// assert_eq!(map.len(), 0);
///
/// map.insert(header::ACCEPT, HeaderValue::from_static("text/plain"));
/// map.insert(header::SET_COOKIE, HeaderValue::from_static("one=1"));
/// assert_eq!(map.len(), 2);
///
/// map.append(header::SET_COOKIE, HeaderValue::from_static("two=2"));
/// assert_eq!(map.len(), 3);
/// ```
pub fn len(&self) -> usize {
self.inner
.iter()
.fold(0, |acc, (_, values)| acc + values.len())
}
/// Returns the number of _keys_ stored in the map.
///
/// The number of values stored will be at least this number. See also: [`Self::len`].
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
/// assert_eq!(map.len_keys(), 0);
///
/// map.insert(header::ACCEPT, HeaderValue::from_static("text/plain"));
/// map.insert(header::SET_COOKIE, HeaderValue::from_static("one=1"));
/// assert_eq!(map.len_keys(), 2);
///
/// map.append(header::SET_COOKIE, HeaderValue::from_static("two=2"));
/// assert_eq!(map.len_keys(), 2);
/// ```
pub fn len_keys(&self) -> usize {
self.inner.len()
}
/// Returns true if the map contains no elements.
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
/// assert!(map.is_empty());
///
/// map.insert(header::ACCEPT, HeaderValue::from_static("text/plain"));
/// assert!(!map.is_empty());
/// ```
pub fn is_empty(&self) -> bool {
self.inner.len() == 0
}
/// Clears the map, removing all name-value pairs.
///
/// Keeps the allocated memory for reuse.
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// map.insert(header::ACCEPT, HeaderValue::from_static("text/plain"));
/// map.insert(header::SET_COOKIE, HeaderValue::from_static("one=1"));
/// assert_eq!(map.len(), 2);
///
/// map.clear();
/// assert!(map.is_empty());
/// ```
pub fn clear(&mut self) {
self.inner.clear();
}
fn get_value(&self, key: impl AsHeaderName) -> Option<&Value> {
match key.try_as_name().ok()? {
Cow::Borrowed(name) => self.inner.get(name),
Cow::Owned(name) => self.inner.get(&name),
}
}
/// Returns a reference to the _first_ value associated with a header name.
///
/// Returns `None` if there is no value associated with the key.
///
/// Even when multiple values are associated with the key, the "first" one is returned but is
/// not guaranteed to be chosen with any particular order; though, the returned item will be
/// consistent for each call to `get` if the map has not changed.
///
/// See also: [`get_all`](Self::get_all).
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// map.insert(header::SET_COOKIE, HeaderValue::from_static("one=1"));
///
/// let cookie = map.get(header::SET_COOKIE).unwrap();
/// assert_eq!(cookie, "one=1");
///
/// map.append(header::SET_COOKIE, HeaderValue::from_static("two=2"));
/// assert_eq!(map.get(header::SET_COOKIE).unwrap(), "one=1");
///
/// assert_eq!(map.get(header::SET_COOKIE), map.get("set-cookie"));
/// assert_eq!(map.get(header::SET_COOKIE), map.get("Set-Cookie"));
///
/// assert!(map.get(header::HOST).is_none());
/// assert!(map.get("INVALID HEADER NAME").is_none());
/// ```
pub fn get(&self, key: impl AsHeaderName) -> Option<&HeaderValue> {
self.get_value(key).map(|val| val.first())
}
/// Returns a mutable reference to the _first_ value associated a header name.
///
/// Returns `None` if there is no value associated with the key.
///
/// Even when multiple values are associated with the key, the "first" one is returned but is
/// not guaranteed to be chosen with any particular order; though, the returned item will be
/// consistent for each call to `get_mut` if the map has not changed.
///
/// See also: [`get_all`](Self::get_all).
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// map.insert(header::SET_COOKIE, HeaderValue::from_static("one=1"));
///
/// let mut cookie = map.get_mut(header::SET_COOKIE).unwrap();
/// assert_eq!(cookie, "one=1");
///
/// *cookie = HeaderValue::from_static("three=3");
/// assert_eq!(map.get(header::SET_COOKIE).unwrap(), "three=3");
///
/// assert!(map.get(header::HOST).is_none());
/// assert!(map.get("INVALID HEADER NAME").is_none());
/// ```
pub fn get_mut(&mut self, key: impl AsHeaderName) -> Option<&mut HeaderValue> {
match key.try_as_name().ok()? {
Cow::Borrowed(name) => self.inner.get_mut(name).map(|v| v.first_mut()),
Cow::Owned(name) => self.inner.get_mut(&name).map(|v| v.first_mut()),
}
}
/// Returns an iterator over all values associated with a header name.
///
/// The returned iterator does not incur any allocations and will yield no items if there are no
/// values associated with the key. Iteration order is **not** guaranteed to be the same as
/// insertion order.
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// let mut none_iter = map.get_all(header::ORIGIN);
/// assert!(none_iter.next().is_none());
///
/// map.insert(header::SET_COOKIE, HeaderValue::from_static("one=1"));
/// map.append(header::SET_COOKIE, HeaderValue::from_static("two=2"));
///
/// let mut set_cookies_iter = map.get_all(header::SET_COOKIE);
/// assert_eq!(set_cookies_iter.next().unwrap(), "one=1");
/// assert_eq!(set_cookies_iter.next().unwrap(), "two=2");
/// assert!(set_cookies_iter.next().is_none());
/// ```
pub fn get_all(&self, key: impl AsHeaderName) -> GetAll<'_> {
GetAll::new(self.get_value(key))
}
// TODO: get_all_mut ?
/// Returns `true` if the map contains a value for the specified key.
///
/// Invalid header names will simply return false.
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
/// assert!(!map.contains_key(header::ACCEPT));
///
/// map.insert(header::ACCEPT, HeaderValue::from_static("text/plain"));
/// assert!(map.contains_key(header::ACCEPT));
/// ```
pub fn contains_key(&self, key: impl AsHeaderName) -> bool {
match key.try_as_name() {
Ok(Cow::Borrowed(name)) => self.inner.contains_key(name),
Ok(Cow::Owned(name)) => self.inner.contains_key(&name),
Err(_) => false,
}
}
/// Inserts a name-value pair into the map.
///
/// If the map already contained this key, the new value is associated with the key and all
/// previous values are removed and returned as a `Removed` iterator. The key is not updated;
/// this matters for types that can be `==` without being identical.
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// map.insert(header::ACCEPT, HeaderValue::from_static("text/plain"));
/// assert!(map.contains_key(header::ACCEPT));
/// assert_eq!(map.len(), 1);
///
/// let mut removed = map.insert(header::ACCEPT, HeaderValue::from_static("text/csv"));
/// assert_eq!(removed.next().unwrap(), "text/plain");
/// assert!(removed.next().is_none());
///
/// assert_eq!(map.len(), 1);
/// ```
pub fn insert(&mut self, key: HeaderName, val: HeaderValue) -> Removed {
let value = self.inner.insert(key, Value::one(val));
Removed::new(value)
}
/// Inserts a name-value pair into the map.
///
/// If the map already contained this key, the new value is added to the list of values
/// currently associated with the key. The key is not updated; this matters for types that can
/// be `==` without being identical.
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// map.append(header::HOST, HeaderValue::from_static("example.com"));
/// assert_eq!(map.len(), 1);
///
/// map.append(header::ACCEPT, HeaderValue::from_static("text/csv"));
/// assert_eq!(map.len(), 2);
///
/// map.append(header::ACCEPT, HeaderValue::from_static("text/html"));
/// assert_eq!(map.len(), 3);
/// ```
pub fn append(&mut self, key: HeaderName, value: HeaderValue) {
match self.inner.entry(key) {
hash_map::Entry::Occupied(mut entry) => {
entry.get_mut().append(value);
}
hash_map::Entry::Vacant(entry) => {
entry.insert(Value::one(value));
}
};
}
/// Removes all headers for a particular header name from the map.
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// map.append(header::SET_COOKIE, HeaderValue::from_static("one=1"));
/// map.append(header::SET_COOKIE, HeaderValue::from_static("one=2"));
///
/// assert_eq!(map.len(), 2);
///
/// let mut removed = map.remove(header::SET_COOKIE);
/// assert_eq!(removed.next().unwrap(), "one=1");
/// assert_eq!(removed.next().unwrap(), "one=2");
/// assert!(removed.next().is_none());
///
/// assert!(map.is_empty());
pub fn remove(&mut self, key: impl AsHeaderName) -> Removed {
let value = match key.try_as_name() {
Ok(Cow::Borrowed(name)) => self.inner.remove(name),
Ok(Cow::Owned(name)) => self.inner.remove(&name),
Err(_) => None,
};
Removed::new(value)
}
/// Returns the number of single-value headers the map can hold without needing to reallocate.
///
/// Since this is a multi-value map, the actual capacity is much larger when considering
/// each header name can be associated with an arbitrary number of values. The effect is that
/// the size of `len` may be greater than `capacity` since it counts all the values.
/// Conversely, [`len_keys`](Self::len_keys) will never be larger than capacity.
///
/// # Examples
/// ```
/// # use actix_http::http::HeaderMap;
/// let map = HeaderMap::with_capacity(16);
///
/// assert!(map.is_empty());
/// assert!(map.capacity() >= 16);
/// ```
pub fn capacity(&self) -> usize {
self.inner.capacity()
}
/// Reserves capacity for at least `additional` more headers to be inserted in the map.
///
/// The header map may reserve more space to avoid frequent reallocations. Additional capacity
/// only considers single-value headers.
///
/// # Panics
/// Panics if the new allocation size overflows usize.
///
/// # Examples
/// ```
/// # use actix_http::http::HeaderMap;
/// let mut map = HeaderMap::with_capacity(2);
/// assert!(map.capacity() >= 2);
///
/// map.reserve(100);
/// assert!(map.capacity() >= 102);
///
/// assert!(map.is_empty());
/// ```
pub fn reserve(&mut self, additional: usize) {
self.inner.reserve(additional)
}
/// An iterator over all name-value pairs.
///
/// Names will be yielded for each associated value. So, if a key has 3 associated values, it
/// will be yielded 3 times. The iteration order should be considered arbitrary.
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// let mut iter = map.iter();
/// assert!(iter.next().is_none());
///
/// map.append(header::HOST, HeaderValue::from_static("duck.com"));
/// map.append(header::SET_COOKIE, HeaderValue::from_static("one=1"));
/// map.append(header::SET_COOKIE, HeaderValue::from_static("two=2"));
///
/// let mut iter = map.iter();
/// assert!(iter.next().is_some());
/// assert!(iter.next().is_some());
/// assert!(iter.next().is_some());
/// assert!(iter.next().is_none());
///
/// let pairs = map.iter().collect::<Vec<_>>();
/// assert!(pairs.contains(&(&header::HOST, &HeaderValue::from_static("duck.com"))));
/// assert!(pairs.contains(&(&header::SET_COOKIE, &HeaderValue::from_static("one=1"))));
/// assert!(pairs.contains(&(&header::SET_COOKIE, &HeaderValue::from_static("two=2"))));
/// ```
pub fn iter(&self) -> Iter<'_> {
Iter::new(self.inner.iter())
}
/// An iterator over all contained header names.
///
/// Each name will only be yielded once even if it has multiple associated values. The iteration
/// order should be considered arbitrary.
///
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// let mut iter = map.keys();
/// assert!(iter.next().is_none());
///
/// map.append(header::HOST, HeaderValue::from_static("duck.com"));
/// map.append(header::SET_COOKIE, HeaderValue::from_static("one=1"));
/// map.append(header::SET_COOKIE, HeaderValue::from_static("two=2"));
///
/// let keys = map.keys().cloned().collect::<Vec<_>>();
/// assert_eq!(keys.len(), 2);
/// assert!(keys.contains(&header::HOST));
/// assert!(keys.contains(&header::SET_COOKIE));
/// ```
pub fn keys(&self) -> Keys<'_> {
Keys(self.inner.keys())
}
/// Clears the map, returning all name-value sets as an iterator.
///
/// Header names will only be yielded for the first value in each set. All items that are
/// yielded without a name and after an item with a name are associated with that same name.
/// The first item will always contain a name.
///
/// Keeps the allocated memory for reuse.
/// # Examples
/// ```
/// # use actix_http::http::{header, HeaderMap, HeaderValue};
/// let mut map = HeaderMap::new();
///
/// let mut iter = map.drain();
/// assert!(iter.next().is_none());
/// drop(iter);
///
/// map.append(header::SET_COOKIE, HeaderValue::from_static("one=1"));
/// map.append(header::SET_COOKIE, HeaderValue::from_static("two=2"));
///
/// let mut iter = map.drain();
/// assert_eq!(iter.next().unwrap(), (Some(header::SET_COOKIE), HeaderValue::from_static("one=1")));
/// assert_eq!(iter.next().unwrap(), (None, HeaderValue::from_static("two=2")));
/// drop(iter);
///
/// assert!(map.is_empty());
/// ```
pub fn drain(&mut self) -> Drain<'_> {
Drain::new(self.inner.drain())
}
}
/// Note that this implementation will clone a [HeaderName] for each value.
impl IntoIterator for HeaderMap {
type Item = (HeaderName, HeaderValue);
type IntoIter = IntoIter;
#[inline]
fn into_iter(self) -> Self::IntoIter {
IntoIter::new(self.inner.into_iter())
}
}
impl<'a> IntoIterator for &'a HeaderMap {
type Item = (&'a HeaderName, &'a HeaderValue);
type IntoIter = Iter<'a>;
#[inline]
fn into_iter(self) -> Self::IntoIter {
Iter::new(self.inner.iter())
}
}
/// Iterator for all values with the same header name.
///
/// See [`HeaderMap::get_all`].
#[derive(Debug)]
pub struct GetAll<'a> {
idx: usize,
value: Option<&'a Value>,
}
impl<'a> GetAll<'a> {
fn new(value: Option<&'a Value>) -> Self {
Self { idx: 0, value }
}
}
impl<'a> Iterator for GetAll<'a> {
type Item = &'a HeaderValue;
fn next(&mut self) -> Option<Self::Item> {
let val = self.value?;
match val.get(self.idx) {
Some(val) => {
self.idx += 1;
Some(val)
}
None => {
// current index is none; remove value to fast-path future next calls
self.value = None;
None
}
}
}
fn size_hint(&self) -> (usize, Option<usize>) {
match self.value {
Some(val) => (val.len(), Some(val.len())),
None => (0, Some(0)),
}
}
}
/// Iterator for owned [`HeaderValue`]s with the same associated [`HeaderName`] returned from methods
/// on [`HeaderMap`] that remove or replace items.
#[derive(Debug)]
pub struct Removed {
inner: Option<smallvec::IntoIter<[HeaderValue; 4]>>,
}
impl<'a> Removed {
fn new(value: Option<Value>) -> Self {
let inner = value.map(|value| value.inner.into_iter());
Self { inner }
}
}
impl Iterator for Removed {
type Item = HeaderValue;
#[inline]
fn next(&mut self) -> Option<Self::Item> {
self.inner.as_mut()?.next()
}
#[inline]
fn size_hint(&self) -> (usize, Option<usize>) {
match self.inner {
Some(ref iter) => iter.size_hint(),
None => (0, None),
}
}
}
/// Iterator over all [`HeaderName`]s in the map.
#[derive(Debug)]
pub struct Keys<'a>(hash_map::Keys<'a, HeaderName, Value>);
impl<'a> Iterator for Keys<'a> {
type Item = &'a HeaderName;
#[inline]
fn next(&mut self) -> Option<Self::Item> {
self.0.next()
}
#[inline]
fn size_hint(&self) -> (usize, Option<usize>) {
self.0.size_hint()
}
}
#[derive(Debug)]
pub struct Iter<'a> {
inner: hash_map::Iter<'a, HeaderName, Value>,
multi_inner: Option<(&'a HeaderName, &'a SmallVec<[HeaderValue; 4]>)>,
multi_idx: usize,
}
impl<'a> Iter<'a> {
fn new(iter: hash_map::Iter<'a, HeaderName, Value>) -> Self {
Self {
inner: iter,
multi_idx: 0,
multi_inner: None,
}
}
}
impl<'a> Iterator for Iter<'a> {
type Item = (&'a HeaderName, &'a HeaderValue);
fn next(&mut self) -> Option<Self::Item> {
// handle in-progress multi value lists first
if let Some((ref name, ref mut vals)) = self.multi_inner {
match vals.get(self.multi_idx) {
Some(val) => {
self.multi_idx += 1;
return Some((name, val));
}
None => {
// no more items in value list; reset state
self.multi_idx = 0;
self.multi_inner = None;
}
}
}
let (name, value) = self.inner.next()?;
// set up new inner iter and recurse into it
self.multi_inner = Some((name, &value.inner));
self.next()
}
#[inline]
fn size_hint(&self) -> (usize, Option<usize>) {
// take inner lower bound
// make no attempt at an upper bound
(self.inner.size_hint().0, None)
}
}
/// Iterator over drained name-value pairs.
///
/// Iterator items are `(Option<HeaderName>, HeaderValue)` to avoid cloning.
#[derive(Debug)]
pub struct Drain<'a> {
inner: hash_map::Drain<'a, HeaderName, Value>,
multi_inner: Option<(Option<HeaderName>, SmallVec<[HeaderValue; 4]>)>,
multi_idx: usize,
}
impl<'a> Drain<'a> {
fn new(iter: hash_map::Drain<'a, HeaderName, Value>) -> Self {
Self {
inner: iter,
multi_inner: None,
multi_idx: 0,
}
}
}
impl<'a> Iterator for Drain<'a> {
type Item = (Option<HeaderName>, HeaderValue);
fn next(&mut self) -> Option<Self::Item> {
// handle in-progress multi value iterators first
if let Some((ref mut name, ref mut vals)) = self.multi_inner {
if !vals.is_empty() {
// OPTIMIZE: array removals
return Some((name.take(), vals.remove(0)));
} else {
// no more items in value iterator; reset state
self.multi_inner = None;
self.multi_idx = 0;
}
}
let (name, value) = self.inner.next()?;
// set up new inner iter and recurse into it
self.multi_inner = Some((Some(name), value.inner));
self.next()
}
#[inline]
fn size_hint(&self) -> (usize, Option<usize>) {
// take inner lower bound
// make no attempt at an upper bound
(self.inner.size_hint().0, None)
}
}
/// Iterator over owned name-value pairs.
///
/// Implementation necessarily clones header names for each value.
#[derive(Debug)]
pub struct IntoIter {
inner: hash_map::IntoIter<HeaderName, Value>,
multi_inner: Option<(HeaderName, smallvec::IntoIter<[HeaderValue; 4]>)>,
}
impl IntoIter {
fn new(inner: hash_map::IntoIter<HeaderName, Value>) -> Self {
Self {
inner,
multi_inner: None,
}
}
}
impl Iterator for IntoIter {
type Item = (HeaderName, HeaderValue);
fn next(&mut self) -> Option<Self::Item> {
// handle in-progress multi value iterators first
if let Some((ref name, ref mut vals)) = self.multi_inner {
match vals.next() {
Some(val) => {
return Some((name.clone(), val));
}
None => {
// no more items in value iterator; reset state
self.multi_inner = None;
}
}
}
let (name, value) = self.inner.next()?;
// set up new inner iter and recurse into it
self.multi_inner = Some((name, value.inner.into_iter()));
self.next()
}
#[inline]
fn size_hint(&self) -> (usize, Option<usize>) {
// take inner lower bound
// make no attempt at an upper bound
(self.inner.size_hint().0, None)
}
}
#[cfg(test)]
mod tests {
use http::header;
use super::*;
#[test]
fn create() {
let map = HeaderMap::new();
assert_eq!(map.len(), 0);
assert_eq!(map.capacity(), 0);
let map = HeaderMap::with_capacity(16);
assert_eq!(map.len(), 0);
assert!(map.capacity() >= 16);
}
#[test]
fn insert() {
let mut map = HeaderMap::new();
map.insert(header::LOCATION, HeaderValue::from_static("/test"));
assert_eq!(map.len(), 1);
}
#[test]
fn contains() {
let mut map = HeaderMap::new();
assert!(!map.contains_key(header::LOCATION));
map.insert(header::LOCATION, HeaderValue::from_static("/test"));
assert!(map.contains_key(header::LOCATION));
assert!(map.contains_key("Location"));
assert!(map.contains_key("Location".to_owned()));
assert!(map.contains_key("location"));
}
#[test]
fn entries_iter() {
let mut map = HeaderMap::new();
map.append(header::HOST, HeaderValue::from_static("duck.com"));
map.append(header::COOKIE, HeaderValue::from_static("one=1"));
map.append(header::COOKIE, HeaderValue::from_static("two=2"));
let mut iter = map.iter();
assert!(iter.next().is_some());
assert!(iter.next().is_some());
assert!(iter.next().is_some());
assert!(iter.next().is_none());
let pairs = map.iter().collect::<Vec<_>>();
assert!(pairs.contains(&(&header::HOST, &HeaderValue::from_static("duck.com"))));
assert!(pairs.contains(&(&header::COOKIE, &HeaderValue::from_static("one=1"))));
assert!(pairs.contains(&(&header::COOKIE, &HeaderValue::from_static("two=2"))));
}
#[test]
fn drain_iter() {
let mut map = HeaderMap::new();
map.append(header::COOKIE, HeaderValue::from_static("one=1"));
map.append(header::COOKIE, HeaderValue::from_static("two=2"));
let mut vals = vec![];
let mut iter = map.drain();
let (name, val) = iter.next().unwrap();
assert_eq!(name, Some(header::COOKIE));
vals.push(val);
let (name, val) = iter.next().unwrap();
assert!(name.is_none());
vals.push(val);
assert!(vals.contains(&HeaderValue::from_static("one=1")));
assert!(vals.contains(&HeaderValue::from_static("two=2")));
assert!(iter.next().is_none());
drop(iter);
assert!(map.is_empty());
}
#[test]
fn entries_into_iter() {
let mut map = HeaderMap::new();
map.append(header::HOST, HeaderValue::from_static("duck.com"));
map.append(header::COOKIE, HeaderValue::from_static("one=1"));
map.append(header::COOKIE, HeaderValue::from_static("two=2"));
let mut iter = map.into_iter();
assert!(iter.next().is_some());
assert!(iter.next().is_some());
assert!(iter.next().is_some());
assert!(iter.next().is_none());
}
#[test]
fn iter_and_into_iter_same_order() {
let mut map = HeaderMap::new();
map.append(header::HOST, HeaderValue::from_static("duck.com"));
map.append(header::COOKIE, HeaderValue::from_static("one=1"));
map.append(header::COOKIE, HeaderValue::from_static("two=2"));
let mut iter = map.iter();
let mut into_iter = map.clone().into_iter();
assert_eq!(iter.next().map(owned_pair), into_iter.next());
assert_eq!(iter.next().map(owned_pair), into_iter.next());
assert_eq!(iter.next().map(owned_pair), into_iter.next());
assert_eq!(iter.next().map(owned_pair), into_iter.next());
}
#[test]
fn get_all_and_remove_same_order() {
let mut map = HeaderMap::new();
map.append(header::COOKIE, HeaderValue::from_static("one=1"));
map.append(header::COOKIE, HeaderValue::from_static("two=2"));
let mut vals = map.get_all(header::COOKIE);
let mut removed = map.clone().remove(header::COOKIE);
assert_eq!(vals.next(), removed.next().as_ref());
assert_eq!(vals.next(), removed.next().as_ref());
assert_eq!(vals.next(), removed.next().as_ref());
}
fn owned_pair<'a>(
(name, val): (&'a HeaderName, &'a HeaderValue),
) -> (HeaderName, HeaderValue) {
(name.clone(), val.clone())
}
}

View File

@@ -1,101 +0,0 @@
//! Typed HTTP headers, pre-defined `HeaderName`s, traits for parsing and conversion, and other
//! header utility methods.
use std::fmt;
use bytes::{Bytes, BytesMut};
use percent_encoding::{AsciiSet, CONTROLS};
pub use http::header::*;
use crate::error::ParseError;
use crate::HttpMessage;
mod as_name;
mod into_pair;
mod into_value;
mod utils;
mod common;
pub(crate) mod map;
mod shared;
pub use self::common::*;
#[doc(hidden)]
pub use self::shared::*;
pub use self::as_name::AsHeaderName;
pub use self::into_pair::IntoHeaderPair;
pub use self::into_value::IntoHeaderValue;
#[doc(hidden)]
pub use self::map::GetAll;
pub use self::map::HeaderMap;
pub use self::utils::*;
/// A trait for any object that already represents a valid header field and value.
pub trait Header: IntoHeaderValue {
/// Returns the name of the header field
fn name() -> HeaderName;
/// Parse a header
fn parse<T: HttpMessage>(msg: &T) -> Result<Self, ParseError>;
}
#[derive(Debug, Default)]
pub(crate) struct Writer {
buf: BytesMut,
}
impl Writer {
fn new() -> Writer {
Writer::default()
}
fn take(&mut self) -> Bytes {
self.buf.split().freeze()
}
}
impl fmt::Write for Writer {
#[inline]
fn write_str(&mut self, s: &str) -> fmt::Result {
self.buf.extend_from_slice(s.as_bytes());
Ok(())
}
#[inline]
fn write_fmt(&mut self, args: fmt::Arguments<'_>) -> fmt::Result {
fmt::write(self, args)
}
}
/// Convert `http::HeaderMap` to our `HeaderMap`.
impl From<http::HeaderMap> for HeaderMap {
fn from(mut map: http::HeaderMap) -> HeaderMap {
HeaderMap::from_drain(map.drain())
}
}
/// This encode set is used for HTTP header values and is defined at
/// https://tools.ietf.org/html/rfc5987#section-3.2.
pub(crate) const HTTP_VALUE: &AsciiSet = &CONTROLS
.add(b' ')
.add(b'"')
.add(b'%')
.add(b'\'')
.add(b'(')
.add(b')')
.add(b'*')
.add(b',')
.add(b'/')
.add(b':')
.add(b';')
.add(b'<')
.add(b'-')
.add(b'>')
.add(b'?')
.add(b'[')
.add(b'\\')
.add(b']')
.add(b'{')
.add(b'}');

View File

@@ -1,193 +0,0 @@
use std::{fmt, str::FromStr};
use language_tags::LanguageTag;
use crate::header::{Charset, HTTP_VALUE};
// From hyper v0.11.27 src/header/parsing.rs
/// The value part of an extended parameter consisting of three parts:
/// - The REQUIRED character set name (`charset`).
/// - The OPTIONAL language information (`language_tag`).
/// - A character sequence representing the actual value (`value`), separated by single quotes.
///
/// It is defined in [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
#[derive(Clone, Debug, PartialEq)]
pub struct ExtendedValue {
/// The character set that is used to encode the `value` to a string.
pub charset: Charset,
/// The human language details of the `value`, if available.
pub language_tag: Option<LanguageTag>,
/// The parameter value, as expressed in octets.
pub value: Vec<u8>,
}
/// Parses extended header parameter values (`ext-value`), as defined in
/// [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
///
/// Extended values are denoted by parameter names that end with `*`.
///
/// ## ABNF
///
/// ```text
/// ext-value = charset "'" [ language ] "'" value-chars
/// ; like RFC 2231's <extended-initial-value>
/// ; (see [RFC2231], Section 7)
///
/// charset = "UTF-8" / "ISO-8859-1" / mime-charset
///
/// mime-charset = 1*mime-charsetc
/// mime-charsetc = ALPHA / DIGIT
/// / "!" / "#" / "$" / "%" / "&"
/// / "+" / "-" / "^" / "_" / "`"
/// / "{" / "}" / "~"
/// ; as <mime-charset> in Section 2.3 of [RFC2978]
/// ; except that the single quote is not included
/// ; SHOULD be registered in the IANA charset registry
///
/// language = <Language-Tag, defined in [RFC5646], Section 2.1>
///
/// value-chars = *( pct-encoded / attr-char )
///
/// pct-encoded = "%" HEXDIG HEXDIG
/// ; see [RFC3986], Section 2.1
///
/// attr-char = ALPHA / DIGIT
/// / "!" / "#" / "$" / "&" / "+" / "-" / "."
/// / "^" / "_" / "`" / "|" / "~"
/// ; token except ( "*" / "'" / "%" )
/// ```
pub fn parse_extended_value(
val: &str,
) -> Result<ExtendedValue, crate::error::ParseError> {
// Break into three pieces separated by the single-quote character
let mut parts = val.splitn(3, '\'');
// Interpret the first piece as a Charset
let charset: Charset = match parts.next() {
None => return Err(crate::error::ParseError::Header),
Some(n) => FromStr::from_str(n).map_err(|_| crate::error::ParseError::Header)?,
};
// Interpret the second piece as a language tag
let language_tag: Option<LanguageTag> = match parts.next() {
None => return Err(crate::error::ParseError::Header),
Some("") => None,
Some(s) => match s.parse() {
Ok(lt) => Some(lt),
Err(_) => return Err(crate::error::ParseError::Header),
},
};
// Interpret the third piece as a sequence of value characters
let value: Vec<u8> = match parts.next() {
None => return Err(crate::error::ParseError::Header),
Some(v) => percent_encoding::percent_decode(v.as_bytes()).collect(),
};
Ok(ExtendedValue {
value,
charset,
language_tag,
})
}
impl fmt::Display for ExtendedValue {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
let encoded_value =
percent_encoding::percent_encode(&self.value[..], HTTP_VALUE);
if let Some(ref lang) = self.language_tag {
write!(f, "{}'{}'{}", self.charset, lang, encoded_value)
} else {
write!(f, "{}''{}", self.charset, encoded_value)
}
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_parse_extended_value_with_encoding_and_language_tag() {
let expected_language_tag = "en".parse::<LanguageTag>().unwrap();
// RFC 5987, Section 3.2.2
// Extended notation, using the Unicode character U+00A3 (POUND SIGN)
let result = parse_extended_value("iso-8859-1'en'%A3%20rates");
assert!(result.is_ok());
let extended_value = result.unwrap();
assert_eq!(Charset::Iso_8859_1, extended_value.charset);
assert!(extended_value.language_tag.is_some());
assert_eq!(expected_language_tag, extended_value.language_tag.unwrap());
assert_eq!(
vec![163, b' ', b'r', b'a', b't', b'e', b's'],
extended_value.value
);
}
#[test]
fn test_parse_extended_value_with_encoding() {
// RFC 5987, Section 3.2.2
// Extended notation, using the Unicode characters U+00A3 (POUND SIGN)
// and U+20AC (EURO SIGN)
let result = parse_extended_value("UTF-8''%c2%a3%20and%20%e2%82%ac%20rates");
assert!(result.is_ok());
let extended_value = result.unwrap();
assert_eq!(Charset::Ext("UTF-8".to_string()), extended_value.charset);
assert!(extended_value.language_tag.is_none());
assert_eq!(
vec![
194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
b't', b'e', b's',
],
extended_value.value
);
}
#[test]
fn test_parse_extended_value_missing_language_tag_and_encoding() {
// From: https://greenbytes.de/tech/tc2231/#attwithfn2231quot2
let result = parse_extended_value("foo%20bar.html");
assert!(result.is_err());
}
#[test]
fn test_parse_extended_value_partially_formatted() {
let result = parse_extended_value("UTF-8'missing third part");
assert!(result.is_err());
}
#[test]
fn test_parse_extended_value_partially_formatted_blank() {
let result = parse_extended_value("blank second part'");
assert!(result.is_err());
}
#[test]
fn test_fmt_extended_value_with_encoding_and_language_tag() {
let extended_value = ExtendedValue {
charset: Charset::Iso_8859_1,
language_tag: Some("en".parse().expect("Could not parse language tag")),
value: vec![163, b' ', b'r', b'a', b't', b'e', b's'],
};
assert_eq!("ISO-8859-1'en'%A3%20rates", format!("{}", extended_value));
}
#[test]
fn test_fmt_extended_value_with_encoding() {
let extended_value = ExtendedValue {
charset: Charset::Ext("UTF-8".to_string()),
language_tag: None,
value: vec![
194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
b't', b'e', b's',
],
};
assert_eq!(
"UTF-8''%C2%A3%20and%20%E2%82%AC%20rates",
format!("{}", extended_value)
);
}
}

Some files were not shown because too many files have changed in this diff Show More