1
0
mirror of https://github.com/fafhrd91/actix-web synced 2025-07-18 15:35:43 +02:00

Compare commits

...

376 Commits

Author SHA1 Message Date
Yuki Okushi
a253d7d3ce Merge pull request #1410 from JohnTitor/new-web
Release actix-web 3.0.0-alpha.1
2020-03-12 05:12:54 +09:00
Yuki Okushi
0152cedc5d Update changelog 2020-03-12 03:24:15 +09:00
Yuki Okushi
a6a47b95ee Exclude actix-cors 2020-03-12 03:04:31 +09:00
Yuki Okushi
1b28a5d48b Update actix-web dependency to 3.0.0-alpha.1 2020-03-12 03:03:50 +09:00
Yuki Okushi
c147b94832 Bump up to 3.0.0-alpha.1 2020-03-12 03:03:22 +09:00
Yuki Okushi
95f9a12a5e dev-deps: Update env_logger to 0.7 2020-03-12 02:58:22 +09:00
Yuki Okushi
73eeab0e90 Merge pull request #1391 from JohnTitor/new-awc
Release awc v2.0.0-alpha.1
2020-03-11 21:15:48 +09:00
Yuki Okushi
ce1e996b41 Update release date 2020-03-11 20:42:45 +09:00
Yuki Okushi
e718f65121 Update tests 2020-03-08 16:42:45 +09:00
Yuki Okushi
a9a475d555 Make test_server async fn 2020-03-08 16:42:26 +09:00
Yuki Okushi
b93e1555ec Update actix-connect to 2.0.0-alpha.2 2020-03-08 15:27:40 +09:00
Yuki Okushi
6f33b7ea42 Update awc dependency 2020-03-08 15:27:40 +09:00
Yuki Okushi
294523a32f Bump up to 2.0.0-alpha.1 2020-03-08 15:27:39 +09:00
Yuki Okushi
6b626c7d77 dev-deps: Update env_logger to 0.7 2020-03-08 03:07:53 +09:00
Yuki Okushi
5da9e277a2 Merge pull request #1399 from JohnTitor/new-http
Release actix-http 2.0.0-alpha.2
2020-03-08 01:47:40 +09:00
Yuki Okushi
0d5646a8b6 Run rustfmt 2020-03-08 00:52:39 +09:00
Yuki Okushi
7941594f94 Update actix-http dependency 2020-03-08 00:50:20 +09:00
Yuki Okushi
6f63acaf01 Bump up to 2.0.0-alpha.2 2020-03-08 00:48:45 +09:00
Yuki Okushi
7172885beb Update changelog 2020-03-08 00:43:17 +09:00
Yuki Okushi
cf721c5fff Update README example 2020-03-08 00:43:01 +09:00
Maxim Vorobjov
10e3e72595 Http2 client configuration to improve performance (#1394)
* add defaults for http2 client configuration

* fix spaces

* Add changes text for extended H2 defaults buffers

* client: configurable H2 window sizes and max_http_version

* add H2 window size configuration and max_http_version to awc::ClientBuilder

* add awc::ClientBuilder H2 window sizes and max_http_version

* add test for H2 window size settings

* cleanup comment

* Apply code review fixes

* Code review fix for awc ClientBuilder

* Remove unnecessary comments on code review

* pin quote version to resolve build issue

* max_http_version to accept http::Version

* revert fix for quote broken build
2020-03-07 11:09:31 +09:00
Yuki Okushi
a7d805aab7 Merge pull request #1396 from Aaron1011/fix/reapply-dispatcher
Re-apply commit 2cf7b3ad20
2020-03-05 02:48:20 +09:00
Aaron Hill
e90950fee1 Re-apply commit 2cf7b3ad20
This ended up getting reverted by #1367, which re-introduced an unsound
use of `Pin::new_unchecked`

See my original PR #1374 for the reasoning behind this change.
2020-03-04 11:27:58 -05:00
Yuki Okushi
c8f0672ef7 Merge pull request #1395 from JohnTitor/rustls
Update `rustls` to 0.17
2020-03-04 15:56:27 +09:00
Yuki Okushi
9d661dc4f3 Update changelog 2020-03-04 15:20:14 +09:00
Yuki Okushi
687dc609dd Update rustls to 0.17 2020-03-04 15:11:31 +09:00
Yuki Okushi
b9b52079e0 Update actix-tls to 2.0.0-alpha.1 2020-03-04 15:10:23 +09:00
Yuki Okushi
117d28f7ba Update actix-connect to 2.0.0-alpha.1 2020-03-04 15:09:31 +09:00
Yuki Okushi
795a575fc5 Merge pull request #1386 from JohnTitor/deny-to-warn
Demote lint level to warn
2020-02-28 14:17:11 +09:00
Yuki Okushi
b4d63667df Demote lint level to warn 2020-02-27 22:39:11 +09:00
__JM_Joy__
3dc859af58 Fix missing std::error::Error implement for MultipartError. (#1382)
* Fix missing `std::error::Error` implement for `MultipartError`.

* Update actix-multipart CHANGES.md.
2020-02-27 22:34:06 +09:00
Yuki Okushi
1fa02b5f1c Merge pull request #1385 from JohnTitor/http-2-alpha
Release actix-http 2.0.0-alpha.1
2020-02-27 14:47:32 +09:00
Yuki Okushi
c9fdcc596d Update actix to 0.10.0-alpha.1 2020-02-27 12:46:29 +09:00
Yuki Okushi
6cc83dbb67 Allow clippy lint for compatibility 2020-02-27 12:45:11 +09:00
Yuki Okushi
3b675c9125 Update actix-http to 2.0.0-alpha.1 2020-02-27 12:39:04 +09:00
Yuki Okushi
15a2587887 Bump up to 2.0.0-alpha.1 2020-02-27 12:39:04 +09:00
Yuki Okushi
0173f99726 Update changelog 2020-02-27 12:39:04 +09:00
Yuki Okushi
f27dd19093 Fix Clippy warnings 2020-02-27 12:39:04 +09:00
Yuki Okushi
7ba14fd113 Run rustfmt 2020-02-27 11:10:55 +09:00
Yuki Okushi
903ae47baa dev-deps: Update env_logger to 0.7 2020-02-27 11:08:45 +09:00
Yuki Okushi
95c18dbdf3 Merge pull request #1367 from actix/msg-body
Merge `MessageBody` improvements
2020-02-27 10:42:14 +09:00
Yuki Okushi
d3ccf46e92 Clean-up metadata 2020-02-27 09:53:27 +09:00
Yuki Okushi
cd1765035c Avoid re-definition 2020-02-27 09:42:32 +09:00
Maksym Vorobiov
ea28219d0f reenable actix-http test-ws 2020-02-27 09:42:32 +09:00
Maksym Vorobiov
77058ef779 adopt MessageBody Pin changes to actix-web root 2020-02-27 09:42:32 +09:00
Maksym Vorobiov
e5f2feec45 reenable actix-http from local path 2020-02-27 09:42:32 +09:00
Maksym Vorobiov
0a86907dd2 use mem::replace instead of mem::take rust 1.40+ 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
78749a4b7e rollback actix-http version change 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
de815dd99c Fixed condition for finishing transfer of response 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
e6078bf792 Fix EncoderBody enum to align with Body::Message 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
a84b37199a Add Unpin to Body to get rid of unsafe in MessageBody 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
c05f9475c5 refactor dispatcher to avoid possible UB with DispatcherState Pin 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
69dab0063c Get rid of one more unsafe 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
ec5c779732 unlink MessageBody from Unpin 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
2e2ea7ab80 remove extra whitespaces and Unpins 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
eeebc653fd change actix-http version to alpha 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
835a00599c rollback missed dependencies and CHANGES in crates except actix-http 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
d9c415e540 disable weird poll test until actix-web based on actix-http:2 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
09a391a3ca rollback changes to actix-web, awc and test-server for now 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
62aba424e2 Rollback actix-http-test dependency to show the issue 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
9d04b250f9 This is a squashed commit:
- Convert MessageBody to accept Pin in poll_next

- add CHANGES and increase versions aligned to semver

- update crates to accomodate MessageBody Pin change

- fix tests and dependencies
2020-02-27 09:37:05 +09:00
Maksym Vorobiov
a4148de226 add test crashing with segfault according to #1321 2020-02-27 09:36:30 +09:00
Maxim Vorobjov
48ef4d7a26 Add actix-http support for actix error messages (#1379)
* Moved actix-http for actix from actix crate

* remove resolver feature

* renamed actix feature to actor

* fixed doc attr for actors, add documentation
2020-02-27 09:34:49 +09:00
Aaron Hill
71c4bd1b30 Remove uses of Pin::new_unchecked in h1 Dispatcher (#1374)
This removes the last uses of unsafe `Pin` functions in actix-web.

This PR adds a `Pin<Box<_>>` wrapper to `DispatcherState::Upgrade`,
`State::ExpectCall`, and `State::ServiceCall`.

The previous uses of the futures `State::ExpectCall` and `State::ServiceCall`
were Undefined Behavior - a future was obtained from `self.expect.call`
or `self.service.call`, pinned on the stack, and then immediately
returned from `handle_request`. The only alternative to using `Box::pin`
would be to refactor `handle_request` to write the futures directly into
their final location, or avoid polling them before they are returned.

The previous use of `DispatcherState::Upgrade` doesn't seem to be
unsound. However, having data pinned inside an enum that we
`std::mem::replace` would require some careful `unsafe` code to ensure
that we never call `std::mem::replace` when the active variant contains
pinned data. By using `Box::pin`, we any possibility of future
refactoring accidentally introducing undefined behavior.

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-02-26 08:21:05 +09:00
Yuki Okushi
de1d6ad5cb Merge pull request #1344 from actix/replace-unsafe-content-length-helper
Replace unsafe content length helper
2020-02-25 17:02:22 +09:00
Yuki Okushi
2a72e8d119 Merge branch 'master' into replace-unsafe-content-length-helper 2020-02-25 14:30:04 +09:00
Yuki Okushi
2a8e5fdc73 Merge pull request #1370 from mattgathu/feat/helper-function-for-trace-method
Create helper function for HTTP Trace Method
2020-02-25 14:24:09 +09:00
Yuki Okushi
b213c07799 Merge branch 'master' into feat/helper-function-for-trace-method 2020-02-25 12:36:20 +09:00
Yuki Okushi
3d6b8686ad Merge pull request #1373 from JohnTitor/new-codegen
Release `actix-web-codegen` v0.2.1
2020-02-25 09:32:48 +09:00
Yuki Okushi
a4f87a53da Update CHANGES.md 2020-02-25 08:42:39 +09:00
Yuki Okushi
08f172a0aa Merge branch 'master' into new-codegen 2020-02-25 08:29:31 +09:00
Yuki Okushi
7792eaa16e Merge pull request #1378 from JohnTitor/fix-doc
Fix doc comment
2020-02-25 08:29:14 +09:00
Yuki Okushi
845ce3cf34 Fix doc comment 2020-02-25 07:46:03 +09:00
Yuki Okushi
7daef22e24 Merge branch 'master' into new-codegen 2020-02-25 06:58:49 +09:00
Yuki Okushi
1249262c35 Merge pull request #1372 from JohnTitor/time-0.2.7
Update `time` to 0.2.7
2020-02-25 06:58:33 +09:00
Rob Ede
94da08f506 increase content-length fast path to responses up to 1MB 2020-02-24 20:58:41 +00:00
Matt Gathu
d143c44130 Update the ChangeLog 2020-02-23 09:33:28 +01:00
Matt Gathu
8ec8ccf4fb Create helper function for HTTP Trace Method
Create *route* with `TRACE` method guard.
2020-02-23 09:25:55 +01:00
Yuki Okushi
c8ccc69b93 actix-http: update time to 0.2.7 2020-02-23 07:09:00 +09:00
Yuki Okushi
f9f9fb4c84 actix-http-test: update time to 0.2.7 2020-02-23 07:08:50 +09:00
Yuki Okushi
1b77963aac actix-web: update time to 0.2.7 2020-02-23 07:08:22 +09:00
Yuki Okushi
036ffd43f9 Prepare for new release 2020-02-23 06:40:02 +09:00
Yuki Okushi
bdccccd536 Merge pull request #1368 from mattgathu/add-missing-docs-attr-to-codegen-structs
Add`#[allow(missing_docs)]` attribute to generated structs
2020-02-23 06:26:42 +09:00
Matt Gathu
060c392c67 Add missing_docs attribute to generated structs 2020-02-22 10:32:12 +01:00
Daniel YU
245f96868a impl downcast_ref for MessageBody (#1287)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-02-21 13:31:51 +09:00
Yuki Okushi
b3f1071aaf Merge pull request #1361 from Aaron1011/fix/connector-pool-support
Use #[pin_project] with `ConnectorPoolSupport`
2020-02-21 06:01:26 +09:00
Aaron Hill
e6811e8818 Use #[pin_project] with ConnectorPoolSupport
This removes a use of `Pin::get_unchecked_mut`
2020-02-19 21:42:53 -05:00
Elliot Jackson
809930d36e Add dependencies to docs example (#1343)
* Add dependencies to docs example

* Change codeblock type to toml

* Clarify the need for actix-rt

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-02-20 05:13:10 +09:00
Rob Ede
f266b44cb0 replace unsafe blocks in write_usize helper 2020-02-16 15:20:25 +00:00
Rob Ede
31a3515e90 add safe vs unsafe benchmarks 2020-02-16 14:31:06 +00:00
Rob Ede
82b2786d6b replace unsafe content length implementation 2020-02-16 14:31:05 +00:00
Masayuki Nagamachi
6ab7cfa2be Remove descriptions about undefined uds feature from docs (#1356) 2020-02-16 04:18:31 +09:00
Yuki Okushi
9b3f7248a8 Merge pull request #1354 from actix/JohnTitor-patch-1
Disable coverage for PRs
2020-02-14 08:18:09 +09:00
Yuki Okushi
a1835d6510 Disable coverage for PRs 2020-02-14 07:31:29 +09:00
Yuki Okushi
4484b3f66e Merge pull request #1347 from actix/bye-travis
Use Actions fully
2020-02-12 05:54:32 +09:00
Yuki Okushi
cde3ae5f61 Remove Travis config 2020-02-08 05:36:11 +09:00
Yuki Okushi
7d40b66300 Add some Actions workflows 2020-02-08 04:28:34 +09:00
Yuki Okushi
63730c1f73 Merge pull request #1345 from JohnTitor/fix-warnings
Fix warnings
2020-02-08 04:17:04 +09:00
Yuki Okushi
53ff3ad099 More ignore test causes timeout 2020-02-08 02:20:01 +09:00
Yuki Okushi
6406f56ca2 Fix/suppress warnings 2020-02-08 02:20:01 +09:00
zero-systems
728b944360 Extensions module improvement and tests. (#1297)
* replace get.is_some to contains_key

* Add tests

* remove unnecessary box cast

* fix missing uints

* asserts fix

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-02-07 16:08:25 +09:00
Levi Notik
3851a377df Fix minor grammatical errors (#1341) 2020-02-07 03:00:22 +09:00
Aaron Hill
fe13789345 Use Pin<Box<S>> in BodyStream and SizedStream (#1328)
Fixes #1321

A better fix would be to change `MessageBody` to take a `Pin<&mut
Self>`, rather than a `Pin<&mut Self>`. This will avoid requiring the
use of `Box` for all consumers by allowing the caller to determine how
to pin the `MessageBody` implementation (e.g. via stack pinning).

However, doing so is a breaking change that will affect every user of
`MessageBody`. By pinning the inner stream ourselves, we can fix the
undefined behavior without breaking the API.

I've included @sebzim4500's reproduction case as a new test case.
However, due to the nature of undefined behavior, this could pass (and
not segfault) even if underlying issue were to regress.

Unfortunately, until rust-lang/unsafe-code-guidelines#148 is resolved,
it's not even possible to write a Miri test that will pass when the bug
is fixed.

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-31 09:39:34 +09:00
Aaron Hill
3033f187d2 Enforce safety of downcast_ref at compile time. (#1326)
* Enforce safety of `downcast_ref` at compile time.

The safety of `downcast_ref` requires that `__private_get_type_id__` not
be overriden by callers, since the returned `TypeId` is used to check if
the cast is safe. However, all trait methods in Rust are public, so
users can override `__private_get_type_id__` despite it being
`#[doc(hidden)]`.

This commit makes `__private_get_type_id__` return a type with a private
constructor, ensuring that the only possible implementation is the
default implementation. A more detailed explanation is provided in the
comments added to the file.

Note that the standard library was affected by this type of issue with
the `Error::type_id` function: see https://blog.rust-lang.org/2019/05/14/Rust-1.34.2.html#whats-in-1.34.2-stable

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-30 23:43:35 +09:00
Aaron Hill
276a5a3ee4 Replace UnsafeCell with Cell in DateServiceInner (#1325)
* Replace `UnsafeCell` with `Cell` in `DateServiceInner`

This ensures that it's impossible to cause undefined behavior by
accidentally violating Rust's aliasing rules (e.g. passing a closure to
`set_date` which ends up invoking `reset` or `update` on the inner
`DateServiceInner`).

There might be a tiny amount of overhead from copying the `Option<(Date,
Instant)>` rather than taking a reference, but it shouldn't be
measurable.

Since the wrapped type is `Copy`, a `Cell` can be used, avoiding the
runtime overhead of a `RefCell`.

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-29 21:05:08 +09:00
Andrey Kutejko
664f9a8b2d Long lasting auto-prolonged session (#1292)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-29 10:26:39 +09:00
Yuki Okushi
c73c2dc12c Don't use cache in Windows CI (#1327) 2020-01-29 09:00:04 +09:00
kevinpoitra
e634e64847 Upgrade time to 0.2.5 (#1254)
* Use `OffsetDateTime` instead of `PrimitiveDateTime`

* Parse time strings with `PrimitiveDateTime::parse` instead of `OffsetDateTime::parse`

* Remove unused `time` dependency from actix-multipart

* Fix a few errors with time related tests from the `time` upgrade

* Implement logic to convert a RFC 850 two-digit year into a full length year, and organize time parsing related functions

* Upgrade `time` to 0.2.2

* Correctly parse C's asctime time format using time 0.2's new format patterns

* Update CHANGES.md

* Use `time` without any of its deprecated functions

* Enforce a UTC time offset when converting an `OffsetDateTime` into a Header value

* Use the more readable version of `Duration::seconds(0)`, `Duration::zero()`

* Remove unneeded conversion of time::Duration to std::time::Duration

* Use `OffsetDateTime::as_seconds_f64` instead of manually calculating the amount of seconds from nanoseconds

* Replace a few additional instances of `Duration::seconds(0)` with `Duration::zero()`

* Truncate any nanoseconds from a supplied `Duration` within `Cookie::set_max_age` to ensure two Cookies with the same amount whole seconds equate to one another

* Fix the actix-http:🍪:do_not_panic_on_large_max_ages test

* Convert `Cookie::max_age` and `Cookie::expires` examples to `time` 0.2

Mainly minor  changes. Type inference can be used alongside the new
`time::parse` method, such that the type doesn't need to be specified.
This will be useful if a refactoring takes place that changes the type.
There are also new macros, which are used where possible.

One change that is not immediately obvious, in `HttpDate`, there was an
unnecessary conditional. As the time crate allows for negative durations
(and can perform arithmetic with such), the if/else can be removed
entirely.

Time v0.2.3 also has some bug fixes, which is why I am not using a more
general v0.2 in Cargo.toml.

v0.2.3 has been yanked, as it was backwards imcompatible. This version
reverts the breaking change, while still supporting rustc back to
1.34.0.

* Add missing `time::offset` macro import

* Fix type confusion when using `time::parse` followed by `using_offset`

* Update `time` to 0.2.5

* Update CHANGES.md

Co-authored-by: Jacob Pratt <the.z.cuber@gmail.com>
2020-01-28 20:44:22 +09:00
Kai Ren
cdba30d45f Skip empty chucks for BodyStream and SizedStream (#1308)
* Skip empty chucks for BodyStream and SizedStream when streaming response (#1267)

* Fix tests to fail on previous implementation

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-28 18:28:09 +09:00
Aaron Hill
74dcc7366d Remove several uses of Pin::new_unchecked (#1294)
Most of the relevant struct already had a `#[pin_project]` attribute,
but it wasn't being used.

The remaining uses of `Pin::new_unchecked` all involve going from a
`&mut T` to a `Pin<&mut T>`, without directly observing a `Pin<&mut T>`
first. As such, they cannot be replaced by `pin_project`

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-28 12:35:51 +09:00
Aaron Hill
d137a8635b Replace Pin::new_unchecked with #[pin_project] in tuple_from_req! (#1293)
Using some module trickery, we can generate a tuple struct for each
invocation of the macro. This allows us to use `pin_project` to project
through to the tuple fields, removing the need to use
`Pin::new_unchecked`

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-28 10:45:25 +09:00
Yuki Okushi
a2d4ff157e Update call_service documentation (#1302)
Co-authored-by: Christian Battaglia <christian.d.battaglia@gmail.com>
2020-01-28 08:09:46 +09:00
Andrey Torsunov
71d11644a7 Add ability to name a handler function as 'config' (#1290)
* eliminate handler naming restrictions #1277

* Update actix-web-codegen/CHANGES.md

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-26 07:22:40 +09:00
Maxim Vorobjov
8888520d83 Add benchmark for full stack request lifecycle (#1298)
* add benchmark for full stack request lifecycle

* add direct service benchmarks

* fix newline

* add cloneable service benchmarks

* remove cloneable bench experiments + cargo fmt

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-25 08:05:25 +09:00
Yuki Okushi
cf3577550c Tweak caches (#1319)
* Try to use `cargo-cache`

* Tweak issue template
2020-01-25 02:27:13 +09:00
Maxim Vorobjov
58844874a0 Fixing #1295 convert UnsafeCell to RefCell in CloneableService (#1303)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-24 14:51:38 +09:00
cetra3
78f24dda03 Initial Issue template (#1311)
* Initial Issue template

* First round of changes for the bug report

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-24 07:32:34 +09:00
godofdream
e17b3accb9 Remove codecoverage for tests and examples (#1299)
* Ignore Tests & Examples for CodeCoverage

Ignore Tests & Examples for CodeCoverage
2020-01-24 05:10:02 +09:00
Yuki Okushi
c6fa007e72 Fix vcpkg cache (#1312) 2020-01-23 11:27:34 +09:00
Rob Ede
a3287948d1 allow explicit SameSite=None cookies (#1282)
fixes #1035
2020-01-23 10:08:23 +09:00
Yuki Okushi
2e9ab0625e Tweak actions (#1305)
* Add benchmark action

* Fix Windows build
2020-01-23 06:23:53 +09:00
Yuki Okushi
3a5b62b550 Add dependencies instruction (#1281) 2020-01-16 23:17:17 +09:00
Adam Kewley
412e54ce10 Fixed documentation typo for actix-files (#1278) 2020-01-15 11:09:58 -08:00
Peter Hall
bca41f8d40 Changes to Cors builder (#1266)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-11 04:53:17 +09:00
Jacob Brown
7c974ee668 Update doc comment for HttpRequest::app_data (#1265)
* update doc comment for `HttpRequest::app_data`

* add `no_run` to doc comment

* add `ignore` to doc comment

* Update src/request.rs

Co-Authored-By: Yuki Okushi <huyuumi.dev@gmail.com>

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-11 03:55:20 +09:00
linkmauve
abb462ef85 Replace sha1 dependency with sha-1 (#1258)
* Replace sha1 dependency with sha-1

This other crate is being maintained, and it offers better performances
when using the `asm` feature (especially [on
AArch64](https://github.com/RustCrypto/hashes/pull/97)).

* Update CHANGES.md with the sha-1 migration

* Add a test for hash_key()
2020-01-11 02:34:31 +09:00
Nikolay Kim
e66312b664 add extra constraints 2020-01-10 11:36:59 +06:00
Nikolay Kim
39f4b2b39e Merge branch 'master' of github.com:actix/actix-web 2020-01-10 11:28:58 +06:00
Nikolay Kim
f6ff056b8a Fix panic with already borrowed: BorrowMutError #1263 2020-01-10 11:26:54 +06:00
Yuki Okushi
51ab4fb73d Tweak actions to use cache and not to be stuck on the way (#1264) 2020-01-10 03:30:45 +09:00
linkmauve
f5fd6bc49f Fix actix-http examples (#1259)
Fix actix-http examples
2020-01-07 00:15:04 +09:00
Jeremy Wright
2803fcbe22 Small grammaritical update to lib.rs (#1248) 2020-01-03 08:45:17 +06:00
Nikolay Kim
67793c5d92 add ssl feature migration 2019-12-30 21:22:04 +06:00
Jonathan Brookins
bcb5086c91 Added 2.0.0 rustls feature name change (#1244) 2019-12-30 21:16:04 +06:00
wojciechkepka
7bd2270290 Fix link to example in readme.md (#1236)
* Fix link to example in readme.md

* Add links to openssl and rustls examples

* Rustls should be uppercase
2019-12-26 19:42:07 +09:00
Nikolay Kim
a4ad5e6b69 update timeouts for test server 2019-12-25 20:52:20 +04:00
Nikolay Kim
6db909a3e7 update migration 2019-12-25 20:27:30 +04:00
Nikolay Kim
642ae161c0 prep actix-web release 2019-12-25 20:21:00 +04:00
Nikolay Kim
7b3c99b933 prep actix-framed release 2019-12-25 20:17:22 +04:00
Nikolay Kim
f86ce0390e allow to specify multi pattern for resources 2019-12-25 20:14:44 +04:00
Nikolay Kim
7882f545e5 Allow to gracefully stop test server via TestServer::stop() 2019-12-25 12:10:48 +04:00
Nikolay Kim
1c75e6876b update migration 2019-12-22 17:16:07 +04:00
Nikolay Kim
6a0cd2dced Rename HttpServer::start() to HttpServer::run() 2019-12-22 17:12:22 +04:00
Nikolay Kim
c7f3915779 update actix-service dep 2019-12-22 16:39:25 +04:00
Yuki Okushi
f45db1f909 Enable GitHub Actions and fix file URL behavior (#1232)
* Use GitHub Actions

* Fix unused imports on Windows

* Fix test for Windows

* Stop to run CI for i686-pc-windows-msvc for now

* Use `/` instead of `\` on Windows

* Add entry to changelog

* Prepare actix-files release
2019-12-22 16:43:41 +09:00
Darin
3751a4018e fixed test::init_service api docs (missing await) (#1230) 2019-12-21 08:47:18 +06:00
Nikolay Kim
0cb1b0642f add test server data test 2019-12-20 23:18:59 +06:00
Nikolay Kim
48476362a3 update changes 2019-12-20 17:59:34 +06:00
Nikolay Kim
2b4256baab add links to configs 2019-12-20 17:49:05 +06:00
Nikolay Kim
e5a50f423d Make web::Data deref to Arc<T> #1214 2019-12-20 17:45:35 +06:00
Nikolay Kim
8b8a9a995d bump ver 2019-12-20 17:36:48 +06:00
Nikolay Kim
74fa4060c2 fix awc tests 2019-12-20 17:27:32 +06:00
Nikolay Kim
c877840c07 rename App::register_data to App::app_data and HttpRequest::app_data returns Option<&T> instead of Option<&Data<T>> 2019-12-20 17:13:09 +06:00
Nikolay Kim
20248daeda Allow to set peer_addr for TestRequest #1074 2019-12-20 16:11:51 +06:00
Nikolay Kim
a08d8dab70 AppConfig::secure() is always false. #1202 2019-12-20 16:04:51 +06:00
tglman
fbbb4a86e9 feat: add access to the session also from immutable references (#1225) 2019-12-20 13:59:07 +06:00
Nikolay Kim
1d12ba9d5f Replace brotli with brotli2 #1224 2019-12-20 13:50:07 +06:00
Nikolay Kim
8c54054844 Use .advance() intead of .split_to() 2019-12-19 09:56:14 +06:00
Nikolay Kim
1732ae8c79 fix Bodyencoding trait usage 2019-12-18 09:30:14 +06:00
Rajasekharan Vengalil
3b860ebdc7 Fix poll_ready call for WebSockets upgrade (#1219)
* Fix poll_ready call for WebSockets upgrade

* Poll upgrade service from H1ServiceHandler too
2019-12-17 13:34:25 +06:00
Nikolay Kim
29ac6463e1 Merge branch 'master' of github.com:actix/actix-web 2019-12-16 17:22:49 +06:00
Nikolay Kim
01613f334b Move BodyEncoding to dev module #1220 2019-12-16 17:22:26 +06:00
Andrii Radyk
30dcaf9da0 fix deprecated Error::description (#1218) 2019-12-16 07:43:19 +06:00
Nikolay Kim
b0aa9395da prep actix-web alpha.6 release 2019-12-15 22:51:14 +06:00
Nikolay Kim
a153374b61 migrate actix-web-actors 2019-12-15 22:45:38 +06:00
Nikolay Kim
a791aab418 prep awc release 2019-12-15 13:36:05 +06:00
Nikolay Kim
cb705317b8 compile with default-features off 2019-12-15 13:28:54 +06:00
Nikolay Kim
e8e0f98f96 fix docs.rs features list 2019-12-13 12:41:48 +06:00
Nikolay Kim
c878f66d05 fix docs.rs features list 2019-12-13 12:40:22 +06:00
Nikolay Kim
fac6dec3c9 update deps 2019-12-13 12:36:15 +06:00
Nikolay Kim
232f71b3b5 update changes 2019-12-13 12:18:30 +06:00
Nikolay Kim
8881c13e60 update changes 2019-12-13 12:16:43 +06:00
Nikolay Kim
d006a7b31f update changes 2019-12-13 12:10:45 +06:00
Nikolay Kim
3d64d565d9 fix warnings 2019-12-13 11:46:02 +06:00
Nikolay Kim
c1deaaeb2f cleanup imports 2019-12-13 11:24:57 +06:00
Nikolay Kim
b81417c2fa fix warnings 2019-12-13 10:59:02 +06:00
Nikolay Kim
4937c9f9c2 refactor http-test server 2019-12-12 23:08:38 +06:00
Nikolay Kim
db1d6b7963 refactor test server impl 2019-12-12 22:28:47 +06:00
Nikolay Kim
fa07415721 Replace flate2-xxx features with compress 2019-12-12 15:08:08 +06:00
Nikolay Kim
b4b3350b3e Add websockets continuation frame support 2019-12-12 14:06:54 +06:00
Jonathan Speiser
4a1695f719 fixes missing import in example (#1210) 2019-12-12 07:06:22 +06:00
0x1793d1
1b8d747937 Fix extra line feed (#1209) 2019-12-12 07:05:39 +06:00
Emilio González
a43a005f59 Log path if it is not a directory (#1208) 2019-12-12 07:04:53 +06:00
Alexander Larsson
a612b74aeb actix-multipart: Fix multipart boundary reading (#1205)
* actix-multipart: Fix multipart boundary reading

If we're not ready to read the first line after the multipart field
(which should be a "\r\n" line) then return Pending instead of Ready(None)
so that we will get called again to read that line.

Without this I was getting MultipartError::Boundary from read_boundary()
because it got the "\r\n" line instead of the boundary.

Also tweaks the test_stream test to test partial reads.

This is a forward port of #1189 from 1.0

* actix-multipart: Update changes for boundary fix
2019-12-12 07:03:44 +06:00
Nikolay Kim
131c897099 upgrade to actix-net release 2019-12-11 19:20:20 +06:00
Nikolay Kim
ef3a33b9d6 use std mutext instead of parking_lot 2019-12-10 09:00:51 +06:00
Nikolay Kim
5132257b0d Fix buffer remaining capacity calcualtion 2019-12-09 21:55:22 +06:00
Nikolay Kim
0c1f5f9edc Check Upgrade service readiness before calling it 2019-12-09 17:40:15 +06:00
Sameer Dhar
e4382e4fc1 Fix broken docs (#1204)
Fixed un escaped brackets in lib.rs, and reflowed links to ConnectionInfo in app, config, and server.rs
2019-12-09 10:02:43 +06:00
Nikolay Kim
a3ce371312 ws ping and pong uses bytes #1049 2019-12-09 07:01:22 +06:00
Nikolay Kim
42258ee289 deps 2019-12-08 20:22:39 +06:00
Nikolay Kim
b92eafb839 prepare actix-http release 2019-12-08 20:15:51 +06:00
Nikolay Kim
3b2e78db47 add link to chat 2019-12-08 19:27:06 +06:00
Nikolay Kim
63da1a5560 Merge branch 'master' of github.com:actix/actix-web 2019-12-08 19:26:12 +06:00
Nikolay Kim
1f3ffe38e8 update actix-service dep 2019-12-08 19:25:24 +06:00
krircc
c23b6b3879 Merge pull request #1192 from krircc/master
Add rich project metadata
2019-12-08 16:03:39 +08:00
Yuki Okushi
909c7c8b5b Merge branch 'master' into master 2019-12-08 16:26:35 +09:00
Nikolay Kim
4a8a9ef405 update tests and clippy warnings 2019-12-08 12:31:16 +06:00
Nikolay Kim
6c9f9fff73 clippy warnings 2019-12-08 00:46:51 +06:00
Nikolay Kim
8df33f7a81 remove HttpServer::run() as it is not useful with async/await 2019-12-08 00:06:04 +06:00
Nikolay Kim
7ec5ca88a1 update changes 2019-12-07 22:01:55 +06:00
daxpedda
e5f3d88a4e Switch brotli compressor to rust. (#1197)
* Switch to a rustified version of brotli.

* Some memory optimizations.

* Make brotli not optional anymore.
2019-12-07 21:55:41 +06:00
Nikolay Kim
0ba125444a Add impl ResponseBuilder for Error 2019-12-07 21:41:34 +06:00
Nikolay Kim
6c226e47bd prepare actix-web-actors release 2019-12-07 20:10:36 +06:00
Vlad Frolov
8c3f58db9d Allow comma-separated websocket subprotocols without spaces (#1172)
* Allow comma-separated websocket subprotocols without spaces

* [CHANGES] Added an entry to CHANGES.md
2019-12-07 20:08:06 +06:00
daxpedda
4921243add Fix rustls build. (#1195) 2019-12-07 16:14:09 +06:00
daxpedda
91b3fcf85c Fix dependency features. (#1196) 2019-12-07 16:13:26 +06:00
Nikolay Kim
1729a52f8b prepare alpha.3 release 2019-12-07 13:00:03 +06:00
Nikolay Kim
ed2f3fe80d use actix-net alpha.3 release 2019-12-07 12:28:26 +06:00
Yuki Okushi
f2ba389496 Merge branch 'master' into master 2019-12-06 16:57:42 +09:00
krircc
439f02b6b1 Update README.md 2019-12-06 14:59:11 +08:00
krircc
e32da08a26 Update README.md 2019-12-06 14:34:14 +08:00
krircc
82110e0927 Update README.md 2019-12-06 14:29:10 +08:00
krircc
7b3354a9ad Update README.md 2019-12-06 14:26:23 +08:00
krircc
5243e8baca Update README.md 2019-12-06 14:23:28 +08:00
krircc
98903028c7 Update README.md 2019-12-06 14:22:29 +08:00
Nikolay Kim
7dd676439c update changes for actix-session 2019-12-06 11:24:25 +06:00
tglman
fbead137f0 feat: add access to UserSession from RequestHead (#1164)
* feat: add access to UserSession from RequestHead

* add test case for session from RequestHead and changes entry for the new feature
2019-12-06 11:21:43 +06:00
Nikolay Kim
205a964d8f upgrade to tokio 0.2 2019-12-05 23:35:43 +06:00
Nikolay Kim
b45c6cd66b replace hashbrown with std hashmap 2019-12-04 18:33:43 +06:00
Nikolay Kim
0015a204aa update version 2019-12-03 19:03:53 +06:00
Nikolay Kim
c7ed6d3428 update version 2019-12-03 16:35:31 +06:00
Nikolay Kim
cf30eafb49 update md 2019-12-03 00:49:12 +06:00
Nikolay Kim
14075ebf7f use released versions of actix-net 2019-12-02 23:33:39 +06:00
Nikolay Kim
068f047dd5 update service factory config 2019-12-02 21:37:13 +06:00
Nikolay Kim
f4c01384ec update to latest actix-net 2019-12-02 17:33:11 +06:00
krircc
b7d44d6c4c Merge pull request #1 from actix/master
git pull
2019-12-01 16:56:42 +08:00
Yuki Okushi
33574403b5 Remove rustls from package.metadata.docs.rs (#1182) 2019-11-28 06:25:21 +06:00
Nikolay Kim
dcc6efa3e6 Merge branch 'master' of github.com:actix/actix-web 2019-11-27 21:08:13 +06:00
Nikolay Kim
56b9f11c98 disable rustls 2019-11-27 21:07:49 +06:00
Folyd
f43a706364 Set name for each generated resource 2019-11-26 19:25:28 +06:00
Nikolay Kim
f2b3dc5625 update examples 2019-11-26 17:16:33 +06:00
Nikolay Kim
f73f97353b refactor ResponseError trait 2019-11-26 16:07:39 +06:00
Nikolay Kim
4dc31aac93 use actix_rt::test for test setup 2019-11-26 11:25:50 +06:00
Nikolay Kim
c1c44a7dd6 upgrade derive_more 2019-11-25 17:59:14 +06:00
Jim Blandy
c5907747ad Remove implementation of Responder for (). Fixes #1108.
Rationale:

- In Rust, one can omit a semicolon after a function's final expression to make
  its value the function's return value. It's common for people to include a
  semicolon after the last expression by mistake - common enough that the Rust
  compiler suggests removing the semicolon when there's a type mismatch between
  the function's signature and body. By implementing Responder for (), Actix makes
  this common mistake a silent error in handler functions.

- Functions returning an empty body should return HTTP status 204 ("No Content"),
  so the current Responder impl for (), which returns status 200 ("OK"), is not
  really what one wants anyway.

- It's not much of a burden to ask handlers to explicitly return
  `HttpResponse::Ok()` if that is what they want; all the examples in the
  documentation do this already.
2019-11-23 21:10:02 +06:00
Martell Malone
525c22de15 fix typos from updating to futures 0.3 2019-11-22 13:25:55 +06:00
Nikolay Kim
57981ca04a update tests to async handlers 2019-11-22 11:49:35 +06:00
Nikolay Kim
e668acc596 update travis config 2019-11-22 10:13:32 +06:00
Nikolay Kim
512dd2be63 disable rustls support 2019-11-22 07:01:05 +06:00
Nikolay Kim
8683ba8bb0 rename .to_async() to .to() 2019-11-21 21:36:35 +06:00
Nikolay Kim
0b9e3d381b add test with custom connector 2019-11-21 17:36:18 +06:00
Nikolay Kim
1f0577f8d5 cleanup api doc examples 2019-11-21 16:02:17 +06:00
Nikolay Kim
53c5151692 use response instead of result for asyn c handlers 2019-11-21 16:02:17 +06:00
Nikolay Kim
55698f2524 migrade rest of middlewares 2019-11-21 16:02:17 +06:00
Nikolay Kim
471f82f0e0 migrate actix-multipart 2019-11-21 16:02:17 +06:00
Nikolay Kim
60ada97b3d migrate actix-session 2019-11-21 16:02:17 +06:00
Nikolay Kim
0de101bc4d update actix-web-codegen tests 2019-11-21 16:02:17 +06:00
Nikolay Kim
95e2a0ef2e migrate actix-framed 2019-11-21 16:02:17 +06:00
Nikolay Kim
69cadcdedb migrate actix-files 2019-11-21 16:02:17 +06:00
Nikolay Kim
6ac4ac66b9 migrate actix-cors 2019-11-21 16:02:17 +06:00
Nikolay Kim
3646725cf6 migrate actix-identity 2019-11-21 16:02:17 +06:00
Nikolay Kim
ff62facc0d disable unmigrated crates 2019-11-21 16:02:17 +06:00
Nikolay Kim
b510527a9f update awc tests 2019-11-21 16:02:17 +06:00
Nikolay Kim
3127dd4db6 migrate actix-web to std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
d081e57316 fix h2 client send body 2019-11-21 16:02:17 +06:00
Nikolay Kim
1ffa7d18d3 drop unpin constraint 2019-11-21 16:02:17 +06:00
Nikolay Kim
687884fb94 update test-server tests 2019-11-21 16:02:17 +06:00
Nikolay Kim
5ab29b2e62 migrate awc and test-server to std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
a6a2d2f444 update ssl impls 2019-11-21 16:02:17 +06:00
Nikolay Kim
9e95efcc16 migrate client to std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
8cba1170e6 make actix-http compile with std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
5cb2d500d1 update actix-web-actors 2019-11-14 08:58:24 +06:00
Nikolay Kim
0212c618c6 prepare actix-web release 2019-11-14 08:55:37 +06:00
Feiko Nanninga
88110ed268 Add security note to ConnectionInfo::remote() (#1158) 2019-11-14 08:32:47 +06:00
Nikolay Kim
fba02fdd8c prep awc release 2019-11-06 11:33:25 -08:00
Nikolay Kim
b2934ad8d2 prep actix-file release 2019-11-06 11:25:26 -08:00
Nikolay Kim
f7f410d033 fix test order dep 2019-11-06 11:20:47 -08:00
Nikolay Kim
885ff7396e prepare actox-http release 2019-11-06 10:35:13 -08:00
Erlend Langseth
61b38e8d0d Increase timeouts in test-server (#1153) 2019-11-06 06:09:22 -08:00
Hung-I Wang
edcde67076 Fix escaping/encoding problems in Content-Disposition header (#1151)
* Fix filename encoding in Content-Disposition of acitx_files::NamedFile

* Add more comments on how to use Content-Disposition header properly & Fix some trivial problems

* Improve Content-Disposition filename(*) parameters of actix_files::NamedFile

* Tweak Content-Disposition parse to accept empty param value in quoted-string

* Fix typos in comments in .../content_disposition.rs (pointed out by @JohnTitor)

* Update CHANGES.md

* Update CHANGES.md again
2019-11-06 06:08:37 -08:00
Jonathas Conceição
f0612f7570 awc: Add support for setting query from Serialize type for client request (#1130)
Signed-off-by: Jonathas-Conceicao <jadoliveira@inf.ufpel.edu.br>
2019-10-26 08:27:14 +03:00
Anton Lazarev
ace98e3a1e support Host guards when Host header is unset (#1129) 2019-10-15 05:05:54 +06:00
Nikolay Kim
1ca9d87f0a prep actix-web-codegen release 2019-10-14 21:35:53 +06:00
DanSnow
967f965405 Update syn & quote to 1.0 (#1133)
* chore(actix-web-codegen): Upgrade syn and quote to 1.0

* feat(actix-web-codegen): Generate better error message

* doc(actix-web-codegen): Update CHANGES.md

* fix: Build with stable rust
2019-10-14 21:34:17 +06:00
Nikolay Kim
062e51e8ce prep actix-file release 2019-10-14 21:26:26 +06:00
Roberto Huertas
a48e616def feat(files): add possibility to redirect to slash-ended path (#1134)
When accessing to a folder without a final slash, the index file will be loaded ok, but if it has
references (like a css or an image in an html file) these resources won't be loaded correctly if
they are using relative paths. In order to solve this, this PR adds the possibility to detect
folders without a final slash and make a 302 redirect to mitigate this issue. The behavior is off by
default. We're adding a new method called `redirect_to_slash_directory` which can be used to enable
this behavior.
2019-10-14 21:23:15 +06:00
MaySantucci
effa96f5e4 Removed httpcode 'MovedPermanenty'. (#1128) 2019-10-12 06:45:12 +06:00
Nathan
cc0b4be5b7 Fix typo in response.rs body() comment (#1126)
Fixes https://github.com/actix/actix-web/issues/1125
2019-10-09 19:11:55 +06:00
Nikolay Kim
a464ffc23d prepare actix-files release 2019-10-08 10:13:16 +06:00
Naim A
4de2e8a898 [actix-files] Allow user defined guards for NamedFile (actix#1113) (#1115)
* [actix-files] remove request method checks from NamedFile

* [actix-files] added custom guard checks to FilesService

* [actix-files] modify method check tests (NamedFile -> Files)

* [actix-files] add test for custom guards in Files

* [actix-files] update changelog
2019-10-08 10:09:40 +06:00
Priit Laes
0f09415469 Convert documentation examples to Rust 2018 edition (#1120)
* Convert types::query examples to rust-2018 edition

* Convert types::json examples to rust-2018 edition

* Convert types::path examples to rust-2018 edition

* Convert types::form examples to rust-2018 edition

* Convert rest of the examples to rust-2018 edition.
2019-10-07 11:29:11 +06:00
SuperHacker-liuan
f089cf185b Let ResponseError render w/ 'text/plain; charset=utf-8' header (#1118) (#1119)
* Let ResponseError render w/ 'text/plain; charset=utf-8' header (#1118)

Trait ResponseError originally render Error messages with header
`text/plain` , which causes browsers (i.e. Firefox 70.0) with
Non-English locale unable to render UTF-8 responses with non-English
characters correctly. i.e. emoji.

This fix solved this problem by specifying the charset of `text/plain`
as utf-8, which is the default charset in rust.

Before actix-web consider to support other charsets, this hotfix is
 enough.

Test case:

fn test() -> Result<String, actix_web::Error> {
    Err(actix_web::error::ErrorForbidden("😋test"))
}

* Update actix-http/CHANGES.md for #1118
2019-10-07 10:56:24 +06:00
Koen Hoeijmakers
15d3c1ae81 Update docs of guard.rs (#1116)
* Update guard.rs
2019-10-07 12:05:17 +09:00
Zac Pullar-Strecker
fba31d4e0a Expose ContentDisposition in actix-multipart to fix broken doc link (#1114)
* Expose ContentDisposition in actix-multipart to fix broken doc link

* Revert "Expose ContentDisposition in actix-multipart to fix broken doc link"

This reverts commit e90d71d16c.

* Unhide actix-http::header::common docs

These types are used in other exported documented interfaces and create
broken links if not documented.
See `actix_multipart::Field.content_disposition`
2019-10-02 09:48:25 +06:00
Igor Aleksanov
f81ae37677 Add From<Payload> for crate::dev::Payload (#1110)
* Add From<Payload> for crate::dev::Payload

* Make dev::Payload field of Payload public and add into_inner method

* Add changelog entry
2019-10-01 14:05:38 +06:00
Nikolay Kim
5169d306ae update ConnectionInfo.remote() doc string 2019-09-27 07:03:12 +06:00
Nikolay Kim
4f3e97fff8 prepare actix-web release 2019-09-25 15:39:09 +06:00
Sven-Hendrik Haase
3ff01a9fc4 Add changelog entry for #1101 (#1102) 2019-09-25 15:35:28 +06:00
Nikolay Kim
3d4e45a0e5 prepare release 2019-09-25 15:30:20 +06:00
karlri
c659c33919 Feature uds: Add listen_uds to ServerBuilder (#1085)
Allows using an existing Unix Listener instead of binding to a path.
Useful for when running as a daemon under systemd.

Change-Id: I54a0e78c321d8b7a9ded381083217af590e9a7fa
2019-09-25 15:16:51 +06:00
Sven-Hendrik Haase
959f7754b2 Merge pull request #1101 from actix/add-awc-get-head-methods
Add remaining getter methods from private head field
2019-09-25 10:23:23 +02:00
Sven-Hendrik Haase
23f04c4f38 Add remaining getter methods from private head field 2019-09-25 08:50:45 +02:00
Nikolay Kim
d9af8f66ba Use actix-testing for testing utils 2019-09-25 10:28:41 +06:00
Sarfaraz Nawaz
aa39b8ca6f Add support for serde_json::Value to be passed as argument to ResponseBuilder.body() (#1096)
* Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()

* Update actix-http/CHANGES.md
2019-09-25 09:33:52 +06:00
Jim Blandy
58c7065f08 Implement register_data method on Resource and Scope. (#1094)
* Implement `register_data` method on `Resource` and `Scope`.

* Split Scope::register_data tests out from Scope::data tests.

* CHANGES.md: Mention {Scope,Resource}::register_data.
2019-09-18 06:36:39 +06:00
Nikolay Kim
b3783b403e Merge branch 'master' of github.com:actix/actix-web 2019-09-17 21:46:45 +06:00
Nikolay Kim
e4503046de Do not override current System 2019-09-17 21:45:06 +06:00
Jos van den Oever
32a1c36597 Make UrlencodedError::Overflow more informative (#1089) 2019-09-17 06:58:04 +06:00
nWacky
7c9f9afc46 Add ability to use Infallible as HttpResponse error type (#1093)
* Add `std::convert::Infallible` implementantion for `ResponseError`

* Add from `std::convert::Infallible` to `Error`

* Remove `ResponseError` implementantion for `Infallible`

* Remove useless docs

* Better comment

* Update changelog

* Update actix_http::changelog
2019-09-17 06:57:38 +06:00
Yuki Okushi
c1f99e0775 Remove mem::uninitialized() (#1090) 2019-09-16 07:52:23 +09:00
Nikolay Kim
a32573bb58 Allow to re-construct ServiceRequest from HttpRequest and Payload #1088 2019-09-13 11:56:24 +06:00
Nikolay Kim
e35d930ef9 prepare releases 2019-09-12 21:58:08 +06:00
Nikolay Kim
60b7aebd0a fmt & clippy 2019-09-12 21:52:46 +06:00
Nikolay Kim
45d2fd4299 export frozen request related types; refactor code layout 2019-09-12 10:40:56 +06:00
Nikolay Kim
71f8577713 prepare awc release 2019-09-11 20:13:28 +06:00
Nikolay Kim
043f763c51 prepare actix-http release 2019-09-11 20:07:39 +06:00
Dmitry Pypin
8873e9b39e Added FrozenClientRequest for easier retrying HTTP calls (#1064)
* Initial commit

* Added extra_headers

* Added freeze() method to ClientRequest which produces a 'read-only' copy of a request suitable for retrying the send operation

* Additional methods for FrozenClientRequest

* Fix

* Increased crates versions

* Fixed a unit test. Added one more unit test.

* Added RequestHeaderWrapper

* Small fixes

* Renamed RequestHeadWrapper->RequestHeadType

* Updated CHANGES.md files

* Small fix

* Small changes

* Removed *_extra methods from Connection trait

* Added FrozenSendBuilder

* Added FrozenSendBuilder

* Minor fix

* Replaced impl Future with concrete Future implementation

* Small renaming

* Renamed Send->SendBody
2019-09-10 10:29:32 +06:00
Ronald Chan
5e8f1c338c fix h2 not using error response (#1080)
* fix h2 not using error response

* add fix change log

* fix h2 service error tests
2019-09-09 16:24:57 +06:00
Jeffrey Shen
1d96ae9bc3 actix-multipart: Correctly parse multipart body which does not end in CRLF (#1042)
* Correctly parse multipart body which does not end in CRLF

* Add in an eof guard for extra safety
2019-09-09 13:58:00 +06:00
Eugene Bulkin
8d61fe0925 Ensure that awc::ws::WebsocketsRequest sets the Host header (#1070)
* Ensure that awc::ws::WebsocketsRequest sets the Host header before connecting.

* Make sure to check if headers already have a HOST value before setting

* Update CHANGES.md to reflect WebSocket client update.
2019-09-09 12:27:13 +06:00
κeen
8a9fcddb3c Condition middleware (#1075)
* add condition middleware

* write tests

* update changes

* Update src/middleware/condition.rs

Co-Authored-By: Yuki Okushi <huyuumi.dev@gmail.com>

* Update src/middleware/condition.rs

Co-Authored-By: Yuki Okushi <huyuumi.dev@gmail.com>

* Update src/middleware/condition.rs

Co-Authored-By: Yuki Okushi <huyuumi.dev@gmail.com>

* Update src/middleware/condition.rs

Co-Authored-By: Yuki Okushi <huyuumi.dev@gmail.com>
2019-09-09 12:26:38 +06:00
Nikolay Kim
c9400456f6 update actix-connect ver 2019-09-02 15:20:28 -07:00
Nikolay Kim
63ddd30ee4 on_connect result isnt added to request extensions for http2 requests #1009 2019-09-01 13:15:02 +06:00
Nikolay Kim
bae29897d6 prep actix-web release 2019-08-29 09:36:16 +06:00
Philip Jenvey
616981ecf9 clear extensions before reclaiming HttpRequests in their pool (#1063)
Issue #1062
2019-08-29 09:35:05 +06:00
Nikolay Kim
98bf8ab098 enable rust-tls feature for actix_web::client #1045 2019-08-28 21:40:24 +06:00
Leland Jansen
c193137905 actix_web::test::TestRequest::set_form (#1058) 2019-08-28 21:32:17 +06:00
Erlend Langseth
a07cdd6533 Data::into_inner 2019-08-27 17:25:25 +01:00
Yuki Okushi
61e492e7e3 Prepare actix-multipart 0.1.3 release 2019-08-18 10:39:22 +09:00
Yuki Okushi
23d768a77b Add explicit dyns (#1041)
* Add explicit `dyn`s

* Remove unnecessary lines
2019-08-17 02:45:44 +09:00
Roberto Huertas
87b7162473 chore(readme): fix copy paste error (#1040)
Fix actix-cors README
2019-08-16 09:21:30 +09:00
Nikolay Kim
979c4d44f4 update awc dep 2019-08-13 12:41:26 -07:00
Nikolay Kim
5d248cad89 prep release 2019-08-13 12:28:05 -07:00
Nikolay Kim
b1cb72d088 update url crate 2019-08-13 11:03:24 -07:00
Nikolay Kim
55179d6ab2 update dependencies 2019-08-13 10:48:11 -07:00
Armin Ronacher
192dfff680 prepare actix-http 0.2.9 release 2019-08-13 15:20:29 +02:00
Armin Ronacher
915010e733 Fixes a bug in OpenWaitingConnection where the h2 flow would panic a future (#1031) 2019-08-13 14:55:04 +02:00
Yuki Okushi
dbe4c9ffb5 Replace deprecated methods in actix_files (#1027)
* Bump up mime_guess to 2.0.1

* Replace deprecated methods

* Update CHANGE.md
2019-08-12 05:43:29 +09:00
Yuki Okushi
0ee69671ba Update nightly to 2019-08-10 (#1028) 2019-08-12 04:00:13 +09:00
leizzer
80e1d16ab8 Merge pull request #1023 from lukaslueg/byteorder_removed
Remove byteorder-dependency
2019-08-07 12:28:23 -03:00
Lukas Lueg
b70de5b991 Update CHANGES.md 2019-08-07 16:43:03 +02:00
Lukas Lueg
0b9e692298 Remove byteorder-dependency 2019-08-06 18:32:36 +02:00
Nikolay Kim
cf1a60cb3a prepare awc release 2019-08-01 15:41:14 -07:00
Nikolay Kim
0d15861e23 prepare actix-http release 2019-08-01 15:26:30 -07:00
Marat Safin
cb19ebfe0c add rustls support for actix-http and awc (#998)
* add rustls support for actix-http and awc

* fix features conflict

* remove unnecessary duplication

* test server with rust-tls

* fix

* test rustls

* awc rustls test

* format

* tests

* fix dependencies

* fixes and add changes

* remove test-server and Cargo.toml dev-dependencies changes

* cargo fmt
2019-07-31 13:02:56 -07:00
Nikolay Kim
0d9ea41047 update min rust version 2019-07-31 06:49:46 -07:00
Nikolay Kim
e9b4aa205f Merge branch 'master' of github.com:actix/actix-web 2019-07-30 08:00:57 -07:00
Nikolay Kim
7674f1173c fix awc client panic #1016 2019-07-30 08:00:46 -07:00
Sven-Hendrik Haase
511026cab0 Allow HeaderMap to be cloned (#1014)
* Allow HeaderMap to be cloned

* Add entry to changelog
2019-07-29 08:11:23 +04:00
Sven-Hendrik Haase
81ab37f235 Fix two dyn warnings (#1015) 2019-07-29 08:10:33 +04:00
Cyril Plisko
6f2049ba9b Fix typo 2019-07-25 12:54:59 +01:00
erikdesjardins
52372fcbea actix-files: "Specified path is not a directory" error now includes the path (#1004) 2019-07-23 06:41:58 +06:00
Nikolay Kim
f3751d83f8 Modify response body only if encoder is not None #997 2019-07-22 11:35:00 +06:00
jesskfulwood
b0b462581b update CHANGES.md for Form impl Responder 2019-07-20 14:46:46 +01:00
jesskfulwood
8f48ed2597 impl Responder for Form 2019-07-20 14:46:46 +01:00
Nikolay Kim
c96068e78d bump version 2019-07-20 11:46:21 +06:00
Nikolay Kim
7bca1f7d8d Allow to disable Content-Disposition header #686 2019-07-20 11:43:49 +06:00
Nikolay Kim
3618a84164 update changes 2019-07-20 11:27:21 +06:00
jairinhohw
03ca408e94 add support for specifying protocols on websocket handshake (#835)
* add support for specifying protocols on websocket handshake

* separated the handshake function with and without protocols
changed protocols type from Vec<&str> to [&str]
2019-07-20 11:22:06 +06:00
naerbnic
e53e9c8ba3 Add the start_with_addr() function, to obtain an addr to the target websocket actor (#988) 2019-07-20 11:17:58 +06:00
Nikolay Kim
941241c5f0 Remove unneeded actix-utils dependency 2019-07-20 10:50:36 +06:00
jesskfullwood
f8320fedd8 add note about Query decoding (#992) 2019-07-19 17:37:49 +06:00
jesskfullwood
c808364c07 make Query payload public (#991) 2019-07-19 15:47:44 +06:00
Nikolay Kim
cccd829656 update changes 2019-07-19 11:07:52 +06:00
Anton Lazarev
3650f6d7b8 Re-implement Host predicate (#989)
* update HostGuard implementation

* update/add tests for new HostGuard implementation
2019-07-19 10:28:43 +06:00
Nikolay Kim
6b7df6b242 prep actix-web release 2019-07-18 17:51:51 +06:00
Nikolay Kim
b6ff786ed3 update dependencies 2019-07-18 17:50:10 +06:00
Nikolay Kim
9c3789cbd0 revert DateServiceInner changes 2019-07-18 17:37:41 +06:00
Armin Ronacher
29098f8397 Add support for downcasting response errors (#986)
* Add support for downcasting response errors

* Added test for error casting
2019-07-18 17:25:50 +06:00
Nikolay Kim
fbdda8acb1 Unix domain sockets (HttpServer::bind_uds) #92 2019-07-18 17:24:12 +06:00
Rotem Yaari
d03296237e Log error results in Logger middleware (closes #938) (#984)
* Log error results in Logger middleware (closes #938)

* Log internal server errors with an ERROR log level

* Logger middleware: don't log 500 internal server errors, as Actix now logs them always

* Changelog
2019-07-18 14:31:18 +06:00
Aaron Hill
b36fdc46db Remove several usages of 'unsafe' (#968)
* Replace UnsafeCell in DateServiceInner with Cell

The previous API was extremely dangerous - calling `get_ref()`
followed by `reset()` would trigger instant UB, without requiring
any `unsafe` blocks in the caller.

By making DateInner `Copy`, we can use a normal `Cell` instead
of an `UnsafeCell`. This makes it impossible to cause UB (or even panic)
with the API.

* Split unsafe block HttpServiceHandlerResponse

Also add explanation of the safety of the usage of `unsafe`

* Replace UnsafeCell with RefCell in PayloadRef

This ensures that a mistake in the usage of 'get_mut' will cause
a panic, not undefined behavior.
2019-07-18 04:45:17 +06:00
Nikolay Kim
2a2d7f5768 nightly clippy warnings 2019-07-17 15:53:51 +06:00
Nikolay Kim
4092c7f326 clippy warnings 2019-07-17 15:08:30 +06:00
Nikolay Kim
ef3e1037a8 bump version 2019-07-17 14:18:26 +06:00
Nikolay Kim
baaa7b3fbb Replace ClonableService with local copy 2019-07-17 13:55:44 +06:00
Ravi Shankar
32718b7e31 Expose factory traits and some clippy fixes (#983) 2019-07-17 12:58:42 +06:00
Nikolay Kim
c01611d8b5 prepare actix-web release 2019-07-17 12:07:12 +06:00
Nikolay Kim
7b1dcaffda cleanup deprecation warning for Box<dyn> 2019-07-17 11:44:39 +06:00
Nikolay Kim
c65dbaf88e expose app's ResourceMap via resource_map method 2019-07-17 11:33:05 +06:00
Nikolay Kim
c45728ac01 prep test server release 2019-07-16 10:21:52 +06:00
Andrea Corradi
6f71409355 Add DELETE, PATCH, OPTIONS methods to TestServerRunner (#973) 2019-07-16 10:19:28 +06:00
Nikolay Kim
8d17c8651f update bench link 2019-07-11 14:45:58 +06:00
messense
b1143168e5 Impl Responder for (T, StatusCode) where T: Responder (#954) 2019-07-11 14:42:58 +06:00
Nikolay Kim
69456991f6 update api doc example for client and add panic info for connection_info 2019-07-11 14:40:37 +06:00
204 changed files with 16650 additions and 10417 deletions

37
.github/ISSUE_TEMPLATE/bug_report.md vendored Normal file
View File

@@ -0,0 +1,37 @@
---
name: bug report
about: create a bug report
---
Your issue may already be reported!
Please search on the [Actix Web issue tracker](https://github.com/actix/actix-web/issues) before creating one.
## Expected Behavior
<!--- If you're describing a bug, tell us what should happen -->
<!--- If you're suggesting a change/improvement, tell us how it should work -->
## Current Behavior
<!--- If describing a bug, tell us what happens instead of the expected behavior -->
<!--- If suggesting a change/improvement, explain the difference from current behavior -->
## Possible Solution
<!--- Not obligatory, but suggest a fix/reason for the bug, -->
<!--- or ideas how to implement the addition or change -->
## Steps to Reproduce (for bugs)
<!--- Provide a link to a live example, or an unambiguous set of steps to -->
<!--- reproduce this bug. Include code to reproduce, if relevant -->
1.
2.
3.
4.
## Context
<!--- How has this issue affected you? What are you trying to accomplish? -->
<!--- Providing context helps us come up with a solution that is most useful in the real world -->
## Your Environment
<!--- Include as many relevant details about the environment you experienced the bug in -->
* Rust Version (I.e, output of `rustc -V`):
* Actix Web Version:

47
.github/workflows/bench.yml vendored Normal file
View File

@@ -0,0 +1,47 @@
name: Benchmark (Linux)
on: [push, pull_request]
jobs:
check_benchmark:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@master
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: nightly
profile: minimal
override: true
- name: Generate Cargo.lock
uses: actions-rs/cargo@v1
with:
command: generate-lockfile
- name: Cache cargo registry
uses: actions/cache@v1
with:
path: ~/.cargo/registry
key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-registry-trimmed-${{ hashFiles('**/Cargo.lock') }}
- name: Cache cargo index
uses: actions/cache@v1
with:
path: ~/.cargo/git
key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-index-trimmed-${{ hashFiles('**/Cargo.lock') }}
- name: Cache cargo build
uses: actions/cache@v1
with:
path: target
key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-build-trimmed-${{ hashFiles('**/Cargo.lock') }}
- name: Check benchmark
uses: actions-rs/cargo@v1
with:
command: bench
- name: Clear the cargo caches
run: |
cargo install cargo-cache --no-default-features --features ci-autoclean
cargo-cache

90
.github/workflows/linux.yml vendored Normal file
View File

@@ -0,0 +1,90 @@
name: CI (Linux)
on: [push, pull_request]
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
version:
- 1.39.0 # MSRV
- stable
- nightly
name: ${{ matrix.version }} - x86_64-unknown-linux-gnu
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@master
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-x86_64-unknown-linux-gnu
profile: minimal
override: true
- name: Generate Cargo.lock
uses: actions-rs/cargo@v1
with:
command: generate-lockfile
- name: Cache cargo registry
uses: actions/cache@v1
with:
path: ~/.cargo/registry
key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-registry-trimmed-${{ hashFiles('**/Cargo.lock') }}
- name: Cache cargo index
uses: actions/cache@v1
with:
path: ~/.cargo/git
key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-index-trimmed-${{ hashFiles('**/Cargo.lock') }}
- name: Cache cargo build
uses: actions/cache@v1
with:
path: target
key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-build-trimmed-${{ hashFiles('**/Cargo.lock') }}
- name: check build
uses: actions-rs/cargo@v1
with:
command: check
args: --all --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --all --all-features --no-fail-fast -- --nocapture
- name: tests (actix-http)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=actix-http --no-default-features --features=rustls -- --nocapture
- name: tests (awc)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=awc --no-default-features --features=rustls -- --nocapture
- name: Generate coverage file
if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
run: |
cargo install cargo-tarpaulin
cargo tarpaulin --out Xml
- name: Upload to Codecov
if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
uses: codecov/codecov-action@v1
with:
token: ${{ secrets.CODECOV_TOKEN }}
file: cobertura.xml
- name: Clear the cargo caches
run: |
cargo install cargo-cache --no-default-features --features ci-autoclean
cargo-cache

64
.github/workflows/macos.yml vendored Normal file
View File

@@ -0,0 +1,64 @@
name: CI (macOS)
on: [push, pull_request]
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
version:
- stable
- nightly
name: ${{ matrix.version }} - x86_64-apple-darwin
runs-on: macOS-latest
steps:
- uses: actions/checkout@master
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-x86_64-apple-darwin
profile: minimal
override: true
- name: Generate Cargo.lock
uses: actions-rs/cargo@v1
with:
command: generate-lockfile
- name: Cache cargo registry
uses: actions/cache@v1
with:
path: ~/.cargo/registry
key: ${{ matrix.version }}-x86_64-apple-darwin-cargo-registry-trimmed-${{ hashFiles('**/Cargo.lock') }}
- name: Cache cargo index
uses: actions/cache@v1
with:
path: ~/.cargo/git
key: ${{ matrix.version }}-x86_64-apple-darwin-cargo-index-trimmed-${{ hashFiles('**/Cargo.lock') }}
- name: Cache cargo build
uses: actions/cache@v1
with:
path: target
key: ${{ matrix.version }}-x86_64-apple-darwin-cargo-build-trimmed-${{ hashFiles('**/Cargo.lock') }}
- name: check build
uses: actions-rs/cargo@v1
with:
command: check
args: --all --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
with:
command: test
args: --all --all-features --no-fail-fast -- --nocapture
--skip=test_h2_content_length
--skip=test_reading_deflate_encoding_large_random_rustls
- name: Clear the cargo caches
run: |
cargo install cargo-cache --no-default-features --features ci-autoclean
cargo-cache

35
.github/workflows/upload-doc.yml vendored Normal file
View File

@@ -0,0 +1,35 @@
name: Upload documentation
on:
push:
branches:
- master
jobs:
build:
runs-on: ubuntu-latest
if: github.repository == 'actix/actix-web'
steps:
- uses: actions/checkout@master
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: stable-x86_64-unknown-linux-gnu
profile: minimal
override: true
- name: check build
uses: actions-rs/cargo@v1
with:
command: doc
args: --no-deps --all-features
- name: Tweak HTML
run: echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html
- name: Upload documentation
run: |
git clone https://github.com/davisp/ghp-import.git
./ghp-import/ghp_import.py -n -p -f -m "Documentation upload" -r https://${{ secrets.GITHUB_TOKEN }}@github.com/"${{ github.repository }}.git" target/doc

59
.github/workflows/windows.yml vendored Normal file
View File

@@ -0,0 +1,59 @@
name: CI (Windows)
on: [push, pull_request]
env:
VCPKGRS_DYNAMIC: 1
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
version:
- stable
- nightly
name: ${{ matrix.version }} - x86_64-pc-windows-msvc
runs-on: windows-latest
steps:
- uses: actions/checkout@master
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-x86_64-pc-windows-msvc
profile: minimal
override: true
- name: Install OpenSSL
run: |
vcpkg integrate install
vcpkg install openssl:x64-windows
Copy-Item C:\vcpkg\installed\x64-windows\bin\libcrypto-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libcrypto.dll
Copy-Item C:\vcpkg\installed\x64-windows\bin\libssl-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libssl.dll
Get-ChildItem C:\vcpkg\installed\x64-windows\bin
Get-ChildItem C:\vcpkg\installed\x64-windows\lib
- name: check build
uses: actions-rs/cargo@v1
with:
command: check
args: --all --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
with:
command: test
args: --all --all-features --no-fail-fast -- --nocapture
--skip=test_h2_content_length
--skip=test_reading_deflate_encoding_large_random_rustls
--skip=test_params
--skip=test_simple
--skip=test_expect_continue
--skip=test_http10_keepalive
--skip=test_slow_request
--skip=test_connection_force_close
--skip=test_connection_server_close
--skip=test_connection_wait_queue_force_close

View File

@@ -1,56 +0,0 @@
language: rust
sudo: required
dist: trusty
cache:
# cargo: true
apt: true
matrix:
include:
- rust: stable
- rust: beta
- rust: nightly-2019-04-02
allow_failures:
- rust: nightly-2019-04-02
env:
global:
# - RUSTFLAGS="-C link-dead-code"
- OPENSSL_VERSION=openssl-1.0.2
before_install:
- sudo add-apt-repository -y ppa:0k53d-karl-f830m/openssl
- sudo apt-get update -qq
- sudo apt-get install -y openssl libssl-dev libelf-dev libdw-dev cmake gcc binutils-dev libiberty-dev
before_cache: |
if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-04-02" ]]; then
RUSTFLAGS="--cfg procmacro2_semver_exempt" cargo install --version 0.6.11 cargo-tarpaulin
fi
# Add clippy
before_script:
- export PATH=$PATH:~/.cargo/bin
script:
- cargo update
- cargo check --all --no-default-features
- cargo test --all-features --all -- --nocapture
# Upload docs
after_success:
- |
if [[ "$TRAVIS_OS_NAME" == "linux" && "$TRAVIS_PULL_REQUEST" = "false" && "$TRAVIS_BRANCH" == "master" && "$TRAVIS_RUST_VERSION" == "stable" ]]; then
cargo doc --no-deps --all-features &&
echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html &&
git clone https://github.com/davisp/ghp-import.git &&
./ghp-import/ghp_import.py -n -p -f -m "Documentation upload" -r https://"$GH_TOKEN"@github.com/"$TRAVIS_REPO_SLUG.git" target/doc &&
echo "Uploaded documentation"
fi
- |
if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-04-02" ]]; then
taskset -c 0 cargo tarpaulin --out Xml --all --all-features
bash <(curl -s https://codecov.io/bash)
echo "Uploaded code coverage"
fi

View File

@@ -1,11 +1,175 @@
# Changes
## [1.0.4] - TBD
## [3.0.0-alpha.1] - 2020-03-11
### Added
* Add helper function for creating routes with `TRACE` method guard `web::trace()`
### Changed
* Use `sha-1` crate instead of unmaintained `sha1` crate
* Skip empty chunks when returning response from a `Stream` [#1308]
* Update the `time` dependency to 0.2.7
* Update `actix-tls` dependency to 2.0.0-alpha.1
* Update `rustls` dependency to 0.17
[#1308]: https://github.com/actix/actix-web/pull/1308
## [2.0.0] - 2019-12-25
### Changed
* Rename `HttpServer::start()` to `HttpServer::run()`
* Allow to gracefully stop test server via `TestServer::stop()`
* Allow to specify multi-patterns for resources
## [2.0.0-rc] - 2019-12-20
### Changed
* Move `BodyEncoding` to `dev` module #1220
* Allow to set `peer_addr` for TestRequest #1074
* Make web::Data deref to Arc<T> #1214
* Rename `App::register_data()` to `App::app_data()`
* `HttpRequest::app_data<T>()` returns `Option<&T>` instead of `Option<&Data<T>>`
### Fixed
* Fix `AppConfig::secure()` is always false. #1202
## [2.0.0-alpha.6] - 2019-12-15
### Fixed
* Fixed compilation with default features off
## [2.0.0-alpha.5] - 2019-12-13
### Added
* Add test server, `test::start()` and `test::start_with()`
## [2.0.0-alpha.4] - 2019-12-08
### Deleted
* Delete HttpServer::run(), it is not useful witht async/await
## [2.0.0-alpha.3] - 2019-12-07
### Changed
* Migrate to tokio 0.2
## [2.0.0-alpha.1] - 2019-11-22
### Changed
* Migrated to `std::future`
* Remove implementation of `Responder` for `()`. (#1167)
## [1.0.9] - 2019-11-14
### Added
* Add `Payload::into_inner` method and make stored `def::Payload` public. (#1110)
### Changed
* Support `Host` guards when the `Host` header is unset (e.g. HTTP/2 requests) (#1129)
## [1.0.8] - 2019-09-25
### Added
* Add `Scope::register_data` and `Resource::register_data` methods, parallel to
`App::register_data`.
* Add `middleware::Condition` that conditionally enables another middleware
* Allow to re-construct `ServiceRequest` from `HttpRequest` and `Payload`
* Add `HttpServer::listen_uds` for ability to listen on UDS FD rather than path,
which is useful for example with systemd.
### Changed
* Make UrlEncodedError::Overflow more informativve
* Use actix-testing for testing utils
## [1.0.7] - 2019-08-29
### Fixed
* Request Extensions leak #1062
## [1.0.6] - 2019-08-28
### Added
* Re-implement Host predicate (#989)
* Form immplements Responder, returning a `application/x-www-form-urlencoded` response
* Add `into_inner` to `Data`
* Add `test::TestRequest::set_form()` convenience method to automatically serialize data and set
the header in test requests.
### Changed
* `Query` payload made `pub`. Allows user to pattern-match the payload.
* Enable `rust-tls` feature for client #1045
* Update serde_urlencoded to 0.6.1
* Update url to 2.1
## [1.0.5] - 2019-07-18
### Added
* Unix domain sockets (HttpServer::bind_uds) #92
* Actix now logs errors resulting in "internal server error" responses always, with the `error`
logging level
### Fixed
* Restored logging of errors through the `Logger` middleware
## [1.0.4] - 2019-07-17
### Added
* Add `Responder` impl for `(T, StatusCode) where T: Responder`
* Allow to access app's resource map via
`ServiceRequest::resource_map()` and `HttpRequest::resource_map()` methods.
### Changed
* Upgrade `rand` dependency version to 0.7
## [1.0.3] - 2019-06-28
### Added

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-web"
version = "1.0.3"
version = "3.0.0-alpha.1"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix web is a simple, pragmatic and extremely fast web framework for Rust."
readme = "README.md"
@@ -12,11 +12,10 @@ categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT/Apache-2.0"
exclude = [".gitignore", ".travis.yml", ".cargo/config", "appveyor.yml"]
edition = "2018"
[package.metadata.docs.rs]
features = ["ssl", "brotli", "flate2-zlib", "secure-cookies", "client", "rust-tls"]
features = ["openssl", "rustls", "compress", "secure-cookies"]
[badges]
travis-ci = { repository = "actix/actix-web", branch = "master" }
@@ -31,11 +30,11 @@ members = [
".",
"awc",
"actix-http",
"actix-cors",
# "actix-cors",
"actix-files",
"actix-framed",
"actix-session",
"actix-identity",
# "actix-session",
# "actix-identity",
"actix-multipart",
"actix-web-actors",
"actix-web-codegen",
@@ -43,74 +42,64 @@ members = [
]
[features]
default = ["brotli", "flate2-zlib", "client", "fail"]
default = ["compress", "failure"]
# http client
client = ["awc"]
# brotli encoding, requires c compiler
brotli = ["actix-http/brotli"]
# miniz-sys backend for flate2 crate
flate2-zlib = ["actix-http/flate2-zlib"]
# rust backend for flate2 crate
flate2-rust = ["actix-http/flate2-rust"]
# content-encoding support
compress = ["actix-http/compress", "awc/compress"]
# sessions feature, session require "ring" crate and c compiler
secure-cookies = ["actix-http/secure-cookies"]
fail = ["actix-http/fail"]
failure = ["actix-http/failure"]
# openssl
ssl = ["openssl", "actix-server/ssl", "awc/ssl"]
openssl = ["actix-tls/openssl", "awc/openssl", "open-ssl"]
# rustls
rust-tls = ["rustls", "actix-server/rust-tls"]
rustls = ["actix-tls/rustls", "awc/rustls", "rust-tls"]
[dependencies]
actix-codec = "0.1.2"
actix-service = "0.4.1"
actix-utils = "0.4.2"
actix-router = "0.1.5"
actix-rt = "0.2.3"
actix-web-codegen = "0.1.2"
actix-http = "0.2.5"
actix-server = "0.5.1"
actix-server-config = "0.1.1"
actix-threadpool = "0.1.1"
awc = { version = "0.2.1", optional = true }
actix-codec = "0.2.0"
actix-service = "1.0.2"
actix-utils = "1.0.6"
actix-router = "0.2.4"
actix-rt = "1.0.0"
actix-server = "1.0.0"
actix-testing = "1.0.0"
actix-macros = "0.1.0"
actix-threadpool = "0.3.1"
actix-tls = "2.0.0-alpha.1"
bytes = "0.4"
derive_more = "0.15.0"
actix-web-codegen = "0.2.0"
actix-http = "2.0.0-alpha.2"
awc = { version = "2.0.0-alpha.1", default-features = false }
bytes = "0.5.3"
derive_more = "0.99.2"
encoding_rs = "0.8"
futures = "0.1.25"
hashbrown = "0.5.0"
futures = "0.3.1"
fxhash = "0.2.1"
log = "0.4"
mime = "0.3"
net2 = "0.2.33"
parking_lot = "0.8"
regex = "1.0"
pin-project = "0.4.6"
regex = "1.3"
serde = { version = "1.0", features=["derive"] }
serde_json = "1.0"
serde_urlencoded = "0.5.3"
time = "0.1.42"
url = { version="1.7", features=["query_encoding"] }
# ssl support
openssl = { version="0.10", optional = true }
rustls = { version = "0.15", optional = true }
serde_urlencoded = "0.6.1"
time = { version = "0.2.7", default-features = false, features = ["std"] }
url = "2.1"
open-ssl = { version="0.10", package = "openssl", optional = true }
rust-tls = { version = "0.17.0", package = "rustls", optional = true }
[dev-dependencies]
actix = { version = "0.8.3" }
actix-http = { version = "0.2.5", features=["ssl", "brotli", "flate2-zlib"] }
actix-http-test = { version = "0.2.2", features=["ssl"] }
actix = "0.10.0-alpha.1"
rand = "0.7"
env_logger = "0.6"
env_logger = "0.7"
serde_derive = "1.0"
tokio-timer = "0.2.8"
brotli2 = "0.3.2"
flate2 = "1.0.2"
flate2 = "1.0.13"
criterion = "0.3"
[profile.release]
lto = true
@@ -122,8 +111,17 @@ actix-web = { path = "." }
actix-http = { path = "actix-http" }
actix-http-test = { path = "test-server" }
actix-web-codegen = { path = "actix-web-codegen" }
actix-web-actors = { path = "actix-web-actors" }
actix-cors = { path = "actix-cors" }
actix-identity = { path = "actix-identity" }
actix-session = { path = "actix-session" }
actix-files = { path = "actix-files" }
actix-multipart = { path = "actix-multipart" }
awc = { path = "awc" }
[[bench]]
name = "server"
harness = false
[[bench]]
name = "service"
harness = false

View File

@@ -1,3 +1,59 @@
## Unreleased
* Setting a cookie's SameSite property, explicitly, to `SameSite::None` will now
result in `SameSite=None` being sent with the response Set-Cookie header.
To create a cookie without a SameSite attribute, remove any calls setting same_site.
* actix-http support for Actors messages was moved to actix-http crate and is enabled
with feature `actors`
## 2.0.0
* `HttpServer::start()` renamed to `HttpServer::run()`. It also possible to
`.await` on `run` method result, in that case it awaits server exit.
* `App::register_data()` renamed to `App::app_data()` and accepts any type `T: 'static`.
Stored data is available via `HttpRequest::app_data()` method at runtime.
* Extractor configuration must be registered with `App::app_data()` instead of `App::data()`
* Sync handlers has been removed. `.to_async()` method has been renamed to `.to()`
replace `fn` with `async fn` to convert sync handler to async
* `actix_http_test::TestServer` moved to `actix_web::test` module. To start
test server use `test::start()` or `test_start_with_config()` methods
* `ResponseError` trait has been reafctored. `ResponseError::error_response()` renders
http response.
* Feature `rust-tls` renamed to `rustls`
instead of
```rust
actix-web = { version = "2.0.0", features = ["rust-tls"] }
```
use
```rust
actix-web = { version = "2.0.0", features = ["rustls"] }
```
* Feature `ssl` renamed to `openssl`
instead of
```rust
actix-web = { version = "2.0.0", features = ["ssl"] }
```
use
```rust
actix-web = { version = "2.0.0", features = ["openssl"] }
```
* `Cors` builder now requires that you call `.finish()` to construct the middleware
## 1.0.1
* Cors middleware has been moved to `actix-cors` crate

View File

@@ -1,4 +1,28 @@
# Actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
<div align="center">
<p><h1>Actix web</h1> </p>
<p><strong>Actix web is a small, pragmatic, and extremely fast rust web framework</strong> </p>
<p>
[![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web)
[![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web)
[![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web)
[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
[![Documentation](https://docs.rs/actix-web/badge.svg)](https://docs.rs/actix-web)
[![Download](https://img.shields.io/crates/d/actix-web.svg)](https://crates.io/crates/actix-web)
[![Version](https://img.shields.io/badge/rustc-1.39+-lightgray.svg)](https://blog.rust-lang.org/2019/11/07/Rust-1.39.0.html)
![License](https://img.shields.io/crates/l/actix-web.svg)
</p>
<h3>
<a href="https://actix.rs">Website</a>
<span> | </span>
<a href="https://gitter.im/actix/actix">Chat</a>
<span> | </span>
<a href="https://github.com/actix/examples">Examples</a>
</h3>
</div>
<br>
Actix web is a simple, pragmatic and extremely fast web framework for Rust.
@@ -15,30 +39,32 @@ Actix web is a simple, pragmatic and extremely fast web framework for Rust.
* Includes an asynchronous [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
* Supports [Actix actor framework](https://github.com/actix/actix)
## Documentation & community resources
* [User Guide](https://actix.rs/docs/)
* [API Documentation (1.0)](https://docs.rs/actix-web/)
* [API Documentation (0.7)](https://docs.rs/actix-web/0.7.19/actix_web/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-web](https://crates.io/crates/actix-web)
* Minimum supported Rust version: 1.34 or later
## Example
```rust
use actix_web::{web, App, HttpServer, Responder};
Dependencies:
fn index(info: web::Path<(u32, String)>) -> impl Responder {
```toml
[dependencies]
actix-web = "2"
actix-rt = "1"
```
Code:
```rust
use actix_web::{get, web, App, HttpServer, Responder};
#[get("/{id}/{name}/index.html")]
async fn index(info: web::Path<(u32, String)>) -> impl Responder {
format!("Hello {}! id:{}", info.1, info.0)
}
fn main() -> std::io::Result<()> {
HttpServer::new(
|| App::new().service(
web::resource("/{id}/{name}/index.html").to(index)))
#[actix_rt::main]
async fn main() -> std::io::Result<()> {
HttpServer::new(|| App::new().service(index))
.bind("127.0.0.1:8080")?
.run()
.await
}
```
@@ -49,10 +75,11 @@ fn main() -> std::io::Result<()> {
* [Multipart streams](https://github.com/actix/examples/tree/master/multipart/)
* [Simple websocket](https://github.com/actix/examples/tree/master/websocket/)
* [Tera](https://github.com/actix/examples/tree/master/template_tera/) /
[Askama](https://github.com/actix/examples/tree/master/template_askama/) templates
* [Askama](https://github.com/actix/examples/tree/master/template_askama/) templates
* [Diesel integration](https://github.com/actix/examples/tree/master/diesel/)
* [r2d2](https://github.com/actix/examples/tree/master/r2d2/)
* [SSL / HTTP/2.0](https://github.com/actix/examples/tree/master/tls/)
* [OpenSSL](https://github.com/actix/examples/tree/master/openssl/)
* [Rustls](https://github.com/actix/examples/tree/master/rustls/)
* [Tcp/Websocket chat](https://github.com/actix/examples/tree/master/websocket-chat/)
* [Json](https://github.com/actix/examples/tree/master/json/)
@@ -61,7 +88,7 @@ You may consider checking out
## Benchmarks
* [TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r16&hw=ph&test=plaintext)
* [TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r18)
## License

View File

@@ -1,8 +1,14 @@
# Changes
## [0.1.1] - unreleased
## [0.2.0] - 2019-12-20
* Bump `derive_more` crate version to 0.15.0
* Release
## [0.2.0-alpha.3] - 2019-12-07
* Migrate to actix-web 2.0.0
* Bump `derive_more` crate version to 0.99.0
## [0.1.0] - 2019-06-15

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-cors"
version = "0.1.0"
version = "0.2.0"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Cross-origin resource sharing (CORS) for Actix applications."
readme = "README.md"
@@ -10,14 +10,17 @@ repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-cors/"
license = "MIT/Apache-2.0"
edition = "2018"
#workspace = ".."
workspace = ".."
[lib]
name = "actix_cors"
path = "src/lib.rs"
[dependencies]
actix-web = "1.0.0"
actix-service = "0.4.0"
derive_more = "0.15.0"
futures = "0.1.25"
actix-web = "2.0.0-rc"
actix-service = "1.0.1"
derive_more = "0.99.2"
futures = "0.3.1"
[dev-dependencies]
actix-rt = "1.0.0"

View File

@@ -1,4 +1,4 @@
# Identity service for actix web framework [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-identity)](https://crates.io/crates/actix-identity) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
# Cors Middleware for actix web framework [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-cors)](https://crates.io/crates/actix-cors) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & community resources

View File

@@ -1,3 +1,4 @@
#![allow(clippy::borrow_interior_mutable_const, clippy::type_complexity)]
//! Cross-origin resource sharing (CORS) for Actix applications
//!
//! CORS middleware could be used with application and with resource.
@@ -10,7 +11,7 @@
//! use actix_cors::Cors;
//! use actix_web::{http, web, App, HttpRequest, HttpResponse, HttpServer};
//!
//! fn index(req: HttpRequest) -> &'static str {
//! async fn index(req: HttpRequest) -> &'static str {
//! "Hello world"
//! }
//!
@@ -22,7 +23,8 @@
//! .allowed_methods(vec!["GET", "POST"])
//! .allowed_headers(vec![http::header::AUTHORIZATION, http::header::ACCEPT])
//! .allowed_header(http::header::CONTENT_TYPE)
//! .max_age(3600))
//! .max_age(3600)
//! .finish())
//! .service(
//! web::resource("/index.html")
//! .route(web::get().to(index))
@@ -38,18 +40,19 @@
//!
//! Cors middleware automatically handle *OPTIONS* preflight request.
use std::collections::HashSet;
use std::convert::TryFrom;
use std::iter::FromIterator;
use std::rc::Rc;
use std::task::{Context, Poll};
use actix_service::{IntoTransform, Service, Transform};
use actix_service::{Service, Transform};
use actix_web::dev::{RequestHead, ServiceRequest, ServiceResponse};
use actix_web::error::{Error, ResponseError, Result};
use actix_web::http::header::{self, HeaderName, HeaderValue};
use actix_web::http::{self, HttpTryFrom, Method, StatusCode, Uri};
use actix_web::http::{self, Error as HttpError, Method, StatusCode, Uri};
use actix_web::HttpResponse;
use derive_more::Display;
use futures::future::{ok, Either, Future, FutureResult};
use futures::Poll;
use futures::future::{ok, Either, FutureExt, LocalBoxFuture, Ready};
/// A set of errors that can occur during processing CORS
#[derive(Debug, Display)]
@@ -91,6 +94,10 @@ pub enum CorsError {
}
impl ResponseError for CorsError {
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
fn error_response(&self) -> HttpResponse {
HttpResponse::with_body(StatusCode::BAD_REQUEST, format!("{}", self).into())
}
@@ -162,6 +169,7 @@ impl<T> AllOrSome<T> {
/// .max_age(3600);
/// # }
/// ```
#[derive(Default)]
pub struct Cors {
cors: Option<Inner>,
methods: bool,
@@ -267,7 +275,8 @@ impl Cors {
pub fn allowed_methods<U, M>(mut self, methods: U) -> Cors
where
U: IntoIterator<Item = M>,
Method: HttpTryFrom<M>,
Method: TryFrom<M>,
<Method as TryFrom<M>>::Error: Into<HttpError>,
{
self.methods = true;
if let Some(cors) = cors(&mut self.cors, &self.error) {
@@ -289,7 +298,8 @@ impl Cors {
/// Set an allowed header
pub fn allowed_header<H>(mut self, header: H) -> Cors
where
HeaderName: HttpTryFrom<H>,
HeaderName: TryFrom<H>,
<HeaderName as TryFrom<H>>::Error: Into<HttpError>,
{
if let Some(cors) = cors(&mut self.cors, &self.error) {
match HeaderName::try_from(header) {
@@ -321,7 +331,8 @@ impl Cors {
pub fn allowed_headers<U, H>(mut self, headers: U) -> Cors
where
U: IntoIterator<Item = H>,
HeaderName: HttpTryFrom<H>,
HeaderName: TryFrom<H>,
<HeaderName as TryFrom<H>>::Error: Into<HttpError>,
{
if let Some(cors) = cors(&mut self.cors, &self.error) {
for h in headers {
@@ -355,7 +366,8 @@ impl Cors {
pub fn expose_headers<U, H>(mut self, headers: U) -> Cors
where
U: IntoIterator<Item = H>,
HeaderName: HttpTryFrom<H>,
HeaderName: TryFrom<H>,
<HeaderName as TryFrom<H>>::Error: Into<HttpError>,
{
for h in headers {
match HeaderName::try_from(h) {
@@ -454,25 +466,9 @@ impl Cors {
}
self
}
}
fn cors<'a>(
parts: &'a mut Option<Inner>,
err: &Option<http::Error>,
) -> Option<&'a mut Inner> {
if err.is_some() {
return None;
}
parts.as_mut()
}
impl<S, B> IntoTransform<CorsFactory, S> for Cors
where
S: Service<Request = ServiceRequest, Response = ServiceResponse<B>, Error = Error>,
S::Future: 'static,
B: 'static,
{
fn into_transform(self) -> CorsFactory {
/// Construct cors middleware
pub fn finish(self) -> CorsFactory {
let mut slf = if !self.methods {
self.allowed_methods(vec![
Method::GET,
@@ -519,6 +515,16 @@ where
}
}
fn cors<'a>(
parts: &'a mut Option<Inner>,
err: &Option<http::Error>,
) -> Option<&'a mut Inner> {
if err.is_some() {
return None;
}
parts.as_mut()
}
/// `Middleware` for Cross-origin resource sharing support
///
/// The Cors struct contains the settings for CORS requests to be validated and
@@ -538,7 +544,7 @@ where
type Error = Error;
type InitError = ();
type Transform = CorsMiddleware<S>;
type Future = FutureResult<Self::Transform, Self::InitError>;
type Future = Ready<Result<Self::Transform, Self::InitError>>;
fn new_transform(&self, service: S) -> Self::Future {
ok(CorsMiddleware {
@@ -585,10 +591,10 @@ impl Inner {
}
Err(CorsError::BadOrigin)
} else {
return match self.origins {
match self.origins {
AllOrSome::All => Ok(()),
_ => Err(CorsError::MissingOrigin),
};
}
}
}
@@ -663,7 +669,7 @@ impl Inner {
}
Err(CorsError::BadRequestHeaders)
} else {
return Ok(());
Ok(())
}
}
}
@@ -680,12 +686,12 @@ where
type Response = ServiceResponse<B>;
type Error = Error;
type Future = Either<
FutureResult<Self::Response, Error>,
Either<S::Future, Box<Future<Item = Self::Response, Error = Error>>>,
Ready<Result<Self::Response, Error>>,
LocalBoxFuture<'static, Result<Self::Response, Error>>,
>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.service.poll_ready()
fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.service.poll_ready(cx)
}
fn call(&mut self, req: ServiceRequest) -> Self::Future {
@@ -696,7 +702,7 @@ where
.and_then(|_| self.inner.validate_allowed_method(req.head()))
.and_then(|_| self.inner.validate_allowed_headers(req.head()))
{
return Either::A(ok(req.error_response(e)));
return Either::Left(ok(req.error_response(e)));
}
// allowed headers
@@ -749,22 +755,32 @@ where
.finish()
.into_body();
Either::A(ok(req.into_response(res)))
} else if req.headers().contains_key(&header::ORIGIN) {
Either::Left(ok(req.into_response(res)))
} else {
if req.headers().contains_key(&header::ORIGIN) {
// Only check requests with a origin header.
if let Err(e) = self.inner.validate_origin(req.head()) {
return Either::A(ok(req.error_response(e)));
return Either::Left(ok(req.error_response(e)));
}
}
let inner = self.inner.clone();
let has_origin = req.headers().contains_key(&header::ORIGIN);
let fut = self.service.call(req);
Either::B(Either::B(Box::new(self.service.call(req).and_then(
move |mut res| {
Either::Right(
async move {
let res = fut.await;
if has_origin {
let mut res = res?;
if let Some(origin) =
inner.access_control_allow_origin(res.request().head())
{
res.headers_mut()
.insert(header::ACCESS_CONTROL_ALLOW_ORIGIN, origin.clone());
res.headers_mut().insert(
header::ACCESS_CONTROL_ALLOW_ORIGIN,
origin.clone(),
);
};
if let Some(ref expose) = inner.expose_hdrs {
@@ -780,8 +796,9 @@ where
);
}
if inner.vary_header {
let value =
if let Some(hdr) = res.headers_mut().get(&header::VARY) {
let value = if let Some(hdr) =
res.headers_mut().get(&header::VARY)
{
let mut val: Vec<u8> =
Vec::with_capacity(hdr.as_bytes().len() + 8);
val.extend(hdr.as_bytes());
@@ -793,80 +810,68 @@ where
res.headers_mut().insert(header::VARY, value);
}
Ok(res)
},
))))
} else {
Either::B(Either::A(self.service.call(req)))
res
}
}
.boxed_local(),
)
}
}
}
#[cfg(test)]
mod tests {
use actix_service::{IntoService, Transform};
use actix_web::test::{self, block_on, TestRequest};
use actix_service::{fn_service, Transform};
use actix_web::test::{self, TestRequest};
use super::*;
impl Cors {
fn finish<F, S, B>(self, srv: F) -> CorsMiddleware<S>
where
F: IntoService<S>,
S: Service<
Request = ServiceRequest,
Response = ServiceResponse<B>,
Error = Error,
> + 'static,
S::Future: 'static,
B: 'static,
{
block_on(
IntoTransform::<CorsFactory, S>::into_transform(self)
.new_transform(srv.into_service()),
)
.unwrap()
}
}
#[test]
#[actix_rt::test]
#[should_panic(expected = "Credentials are allowed, but the Origin is set to")]
fn cors_validates_illegal_allow_credentials() {
let _cors = Cors::new()
.supports_credentials()
.send_wildcard()
.finish(test::ok_service());
async fn cors_validates_illegal_allow_credentials() {
let _cors = Cors::new().supports_credentials().send_wildcard().finish();
}
#[test]
fn validate_origin_allows_all_origins() {
let mut cors = Cors::new().finish(test::ok_service());
#[actix_rt::test]
async fn validate_origin_allows_all_origins() {
let mut cors = Cors::new()
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com")
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::OK);
}
#[test]
fn default() {
let mut cors =
block_on(Cors::default().new_transform(test::ok_service())).unwrap();
#[actix_rt::test]
async fn default() {
let mut cors = Cors::default()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com")
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::OK);
}
#[test]
fn test_preflight() {
#[actix_rt::test]
async fn test_preflight() {
let mut cors = Cors::new()
.send_wildcard()
.max_age(3600)
.allowed_methods(vec![Method::GET, Method::OPTIONS, Method::POST])
.allowed_headers(vec![header::AUTHORIZATION, header::ACCEPT])
.allowed_header(header::CONTENT_TYPE)
.finish(test::ok_service());
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS)
@@ -875,7 +880,7 @@ mod tests {
assert!(cors.inner.validate_allowed_method(req.head()).is_err());
assert!(cors.inner.validate_allowed_headers(req.head()).is_err());
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::BAD_REQUEST);
let req = TestRequest::with_header("Origin", "https://www.example.com")
@@ -895,7 +900,7 @@ mod tests {
.method(Method::OPTIONS)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(
&b"*"[..],
resp.headers()
@@ -941,13 +946,13 @@ mod tests {
.method(Method::OPTIONS)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::OK);
}
// #[test]
// #[actix_rt::test]
// #[should_panic(expected = "MissingOrigin")]
// fn test_validate_missing_origin() {
// async fn test_validate_missing_origin() {
// let cors = Cors::build()
// .allowed_origin("https://www.example.com")
// .finish();
@@ -955,12 +960,15 @@ mod tests {
// cors.start(&req).unwrap();
// }
#[test]
#[actix_rt::test]
#[should_panic(expected = "OriginNotAllowed")]
fn test_validate_not_allowed_origin() {
async fn test_validate_not_allowed_origin() {
let cors = Cors::new()
.allowed_origin("https://www.example.com")
.finish(test::ok_service());
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.unknown.com")
.method(Method::GET)
@@ -970,26 +978,34 @@ mod tests {
cors.inner.validate_allowed_headers(req.head()).unwrap();
}
#[test]
fn test_validate_origin() {
#[actix_rt::test]
async fn test_validate_origin() {
let mut cors = Cors::new()
.allowed_origin("https://www.example.com")
.finish(test::ok_service());
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::GET)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(resp.status(), StatusCode::OK);
}
#[test]
fn test_no_origin_response() {
let mut cors = Cors::new().disable_preflight().finish(test::ok_service());
#[actix_rt::test]
async fn test_no_origin_response() {
let mut cors = Cors::new()
.disable_preflight()
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::default().method(Method::GET).to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert!(resp
.headers()
.get(header::ACCESS_CONTROL_ALLOW_ORIGIN)
@@ -998,7 +1014,7 @@ mod tests {
let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(
&b"https://www.example.com"[..],
resp.headers()
@@ -1008,8 +1024,8 @@ mod tests {
);
}
#[test]
fn test_response() {
#[actix_rt::test]
async fn test_response() {
let exposed_headers = vec![header::AUTHORIZATION, header::ACCEPT];
let mut cors = Cors::new()
.send_wildcard()
@@ -1019,13 +1035,16 @@ mod tests {
.allowed_headers(exposed_headers.clone())
.expose_headers(exposed_headers.clone())
.allowed_header(header::CONTENT_TYPE)
.finish(test::ok_service());
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(
&b"*"[..],
resp.headers()
@@ -1063,15 +1082,18 @@ mod tests {
.allowed_headers(exposed_headers.clone())
.expose_headers(exposed_headers.clone())
.allowed_header(header::CONTENT_TYPE)
.finish(|req: ServiceRequest| {
req.into_response(
.finish()
.new_transform(fn_service(|req: ServiceRequest| {
ok(req.into_response(
HttpResponse::Ok().header(header::VARY, "Accept").finish(),
)
});
))
}))
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(
&b"Accept, Origin"[..],
resp.headers().get(header::VARY).unwrap().as_bytes()
@@ -1081,13 +1103,16 @@ mod tests {
.disable_vary_header()
.allowed_origin("https://www.example.com")
.allowed_origin("https://www.google.com")
.finish(test::ok_service());
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://www.example.com")
.method(Method::OPTIONS)
.header(header::ACCESS_CONTROL_REQUEST_METHOD, "POST")
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
let origins_str = resp
.headers()
@@ -1099,19 +1124,22 @@ mod tests {
assert_eq!("https://www.example.com", origins_str);
}
#[test]
fn test_multiple_origins() {
#[actix_rt::test]
async fn test_multiple_origins() {
let mut cors = Cors::new()
.allowed_origin("https://example.com")
.allowed_origin("https://example.org")
.allowed_methods(vec![Method::GET])
.finish(test::ok_service());
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://example.com")
.method(Method::GET)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(
&b"https://example.com"[..],
resp.headers()
@@ -1124,7 +1152,7 @@ mod tests {
.method(Method::GET)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(
&b"https://example.org"[..],
resp.headers()
@@ -1134,20 +1162,23 @@ mod tests {
);
}
#[test]
fn test_multiple_origins_preflight() {
#[actix_rt::test]
async fn test_multiple_origins_preflight() {
let mut cors = Cors::new()
.allowed_origin("https://example.com")
.allowed_origin("https://example.org")
.allowed_methods(vec![Method::GET])
.finish(test::ok_service());
.finish()
.new_transform(test::ok_service())
.await
.unwrap();
let req = TestRequest::with_header("Origin", "https://example.com")
.header(header::ACCESS_CONTROL_REQUEST_METHOD, "GET")
.method(Method::OPTIONS)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(
&b"https://example.com"[..],
resp.headers()
@@ -1161,7 +1192,7 @@ mod tests {
.method(Method::OPTIONS)
.to_srv_request();
let resp = test::call_service(&mut cors, req);
let resp = test::call_service(&mut cors, req).await;
assert_eq!(
&b"https://example.org"[..],
resp.headers()

View File

@@ -1,10 +1,41 @@
# Changes
## [0.2.1] - 2019-12-22
* Use the same format for file URLs regardless of platforms
## [0.2.0] - 2019-12-20
* Fix BodyEncoding trait import #1220
## [0.2.0-alpha.1] - 2019-12-07
* Migrate to `std::future`
## [0.1.7] - 2019-11-06
* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
## [0.1.6] - 2019-10-14
* Add option to redirect to a slash-ended path `Files` #1132
## [0.1.5] - 2019-10-08
* Bump up `mime_guess` crate version to 2.0.1
* Bump up `percent-encoding` crate version to 2.1
* Allow user defined request guards for `Files` #1113
## [0.1.4] - 2019-07-20
* Allow to disable `Content-Disposition` header #686
## [0.1.3] - 2019-06-28
* Do not set `Content-Length` header, let actix-http set it #930
## [0.1.2] - 2019-06-13
* Content-Length is 0 for NamedFile HEAD request #914

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-files"
version = "0.1.3"
version = "0.2.1"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Static files support for actix web."
readme = "README.md"
@@ -18,18 +18,19 @@ name = "actix_files"
path = "src/lib.rs"
[dependencies]
actix-web = { version = "1.0.2", default-features = false }
actix-http = "0.2.4"
actix-service = "0.4.1"
actix-web = { version = "3.0.0-alpha.1", default-features = false }
actix-http = "2.0.0-alpha.2"
actix-service = "1.0.1"
bitflags = "1"
bytes = "0.4"
futures = "0.1.25"
derive_more = "0.15.0"
bytes = "0.5.3"
futures = "0.3.1"
derive_more = "0.99.2"
log = "0.4"
mime = "0.3"
mime_guess = "2.0.0-alpha"
percent-encoding = "1.0"
mime_guess = "2.0.1"
percent-encoding = "2.1"
v_htmlescape = "0.4"
[dev-dependencies]
actix-web = { version = "1.0.2", features=["ssl"] }
actix-rt = "1.0.0"
actix-web = { version = "3.0.0-alpha.1", features=["openssl"] }

View File

@@ -5,6 +5,7 @@ use derive_more::Display;
#[derive(Display, Debug, PartialEq)]
pub enum FilesError {
/// Path is not a directory
#[allow(dead_code)]
#[display(fmt = "Path is not a directory. Unable to serve static files")]
IsNotDirectory,
@@ -35,7 +36,7 @@ pub enum UriSegmentError {
/// Return `BadRequest` for `UriSegmentError`
impl ResponseError for UriSegmentError {
fn error_response(&self) -> HttpResponse {
HttpResponse::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -9,23 +9,25 @@ use std::os::unix::fs::MetadataExt;
use bitflags::bitflags;
use mime;
use mime_guess::guess_mime_type;
use mime_guess::from_path;
use actix_http::body::SizedStream;
use actix_web::dev::BodyEncoding;
use actix_web::http::header::{
self, ContentDisposition, DispositionParam, DispositionType,
self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
};
use actix_web::http::{ContentEncoding, Method, StatusCode};
use actix_web::middleware::BodyEncoding;
use actix_web::http::{ContentEncoding, StatusCode};
use actix_web::{Error, HttpMessage, HttpRequest, HttpResponse, Responder};
use futures::future::{ready, Ready};
use crate::range::HttpRange;
use crate::ChunkedReadFile;
bitflags! {
pub(crate) struct Flags: u32 {
const ETAG = 0b00000001;
const LAST_MD = 0b00000010;
pub(crate) struct Flags: u8 {
const ETAG = 0b0000_0001;
const LAST_MD = 0b0000_0010;
const CONTENT_DISPOSITION = 0b0000_0100;
}
}
@@ -40,13 +42,13 @@ impl Default for Flags {
pub struct NamedFile {
path: PathBuf,
file: File,
modified: Option<SystemTime>,
pub(crate) md: Metadata,
pub(crate) flags: Flags,
pub(crate) status_code: StatusCode,
pub(crate) content_type: mime::Mime,
pub(crate) content_disposition: header::ContentDisposition,
pub(crate) md: Metadata,
modified: Option<SystemTime>,
pub(crate) encoding: Option<ContentEncoding>,
pub(crate) status_code: StatusCode,
pub(crate) flags: Flags,
}
impl NamedFile {
@@ -87,14 +89,23 @@ impl NamedFile {
}
};
let ct = guess_mime_type(&path);
let ct = from_path(&path).first_or_octet_stream();
let disposition_type = match ct.type_() {
mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
_ => DispositionType::Attachment,
};
let mut parameters =
vec![DispositionParam::Filename(String::from(filename.as_ref()))];
if !filename.is_ascii() {
parameters.push(DispositionParam::FilenameExt(ExtendedValue {
charset: Charset::Ext(String::from("UTF-8")),
language_tag: None,
value: filename.into_owned().into_bytes(),
}))
}
let cd = ContentDisposition {
disposition: disposition_type,
parameters: vec![DispositionParam::Filename(filename.into_owned())],
parameters: parameters,
};
(ct, cd)
};
@@ -172,11 +183,21 @@ impl NamedFile {
/// sent to the peer. By default the disposition is `inline` for text,
/// image, and video content types, and `attachment` otherwise, and
/// the filename is taken from the path provided in the `open` method
/// after converting it to UTF-8 using
/// after converting it to UTF-8 using.
/// [to_string_lossy](https://doc.rust-lang.org/std/ffi/struct.OsStr.html#method.to_string_lossy).
#[inline]
pub fn set_content_disposition(mut self, cd: header::ContentDisposition) -> Self {
self.content_disposition = cd;
self.flags.insert(Flags::CONTENT_DISPOSITION);
self
}
/// Disable `Content-Disposition` header.
///
/// By default Content-Disposition` header is enabled.
#[inline]
pub fn disable_content_disposition(mut self) -> Self {
self.flags.remove(Flags::CONTENT_DISPOSITION);
self
}
@@ -235,69 +256,17 @@ impl NamedFile {
pub(crate) fn last_modified(&self) -> Option<header::HttpDate> {
self.modified.map(|mtime| mtime.into())
}
}
impl Deref for NamedFile {
type Target = File;
fn deref(&self) -> &File {
&self.file
}
}
impl DerefMut for NamedFile {
fn deref_mut(&mut self) -> &mut File {
&mut self.file
}
}
/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfMatch>() {
None | Some(header::IfMatch::Any) => true,
Some(header::IfMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.strong_eq(some_etag) {
return true;
}
}
}
false
}
}
}
/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfNoneMatch>() {
Some(header::IfNoneMatch::Any) => false,
Some(header::IfNoneMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.weak_eq(some_etag) {
return false;
}
}
}
true
}
None => true,
}
}
impl Responder for NamedFile {
type Error = Error;
type Future = Result<HttpResponse, Error>;
fn respond_to(self, req: &HttpRequest) -> Self::Future {
pub fn into_response(self, req: &HttpRequest) -> Result<HttpResponse, Error> {
if self.status_code != StatusCode::OK {
let mut resp = HttpResponse::build(self.status_code);
resp.set(header::ContentType(self.content_type.clone()))
.header(
.if_true(self.flags.contains(Flags::CONTENT_DISPOSITION), |res| {
res.header(
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
);
});
if let Some(current_encoding) = self.encoding {
resp.encoding(current_encoding);
}
@@ -311,16 +280,6 @@ impl Responder for NamedFile {
return Ok(resp.streaming(reader));
}
match req.method() {
&Method::HEAD | &Method::GET => (),
_ => {
return Ok(HttpResponse::MethodNotAllowed()
.header(header::CONTENT_TYPE, "text/plain")
.header(header::ALLOW, "GET, HEAD")
.body("This resource only supports GET and HEAD."));
}
}
let etag = if self.flags.contains(Flags::ETAG) {
self.etag()
} else {
@@ -368,10 +327,12 @@ impl Responder for NamedFile {
let mut resp = HttpResponse::build(self.status_code);
resp.set(header::ContentType(self.content_type.clone()))
.header(
.if_true(self.flags.contains(Flags::CONTENT_DISPOSITION), |res| {
res.header(
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
);
});
// default compressing
if let Some(current_encoding) = self.encoding {
resp.encoding(current_encoding);
@@ -428,8 +389,67 @@ impl Responder for NamedFile {
counter: 0,
};
if offset != 0 || length != self.md.len() {
return Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader));
};
Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader))
} else {
Ok(resp.body(SizedStream::new(length, reader)))
}
}
}
impl Deref for NamedFile {
type Target = File;
fn deref(&self) -> &File {
&self.file
}
}
impl DerefMut for NamedFile {
fn deref_mut(&mut self) -> &mut File {
&mut self.file
}
}
/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfMatch>() {
None | Some(header::IfMatch::Any) => true,
Some(header::IfMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.strong_eq(some_etag) {
return true;
}
}
}
false
}
}
}
/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfNoneMatch>() {
Some(header::IfNoneMatch::Any) => false,
Some(header::IfNoneMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.weak_eq(some_etag) {
return false;
}
}
}
true
}
None => true,
}
}
impl Responder for NamedFile {
type Error = Error;
type Future = Ready<Result<HttpResponse, Error>>;
fn respond_to(self, req: &HttpRequest) -> Self::Future {
ready(self.into_response(req))
}
}

View File

@@ -5,7 +5,7 @@ pub struct HttpRange {
pub length: u64,
}
static PREFIX: &'static str = "bytes=";
static PREFIX: &str = "bytes=";
const PREFIX_LEN: usize = 6;
impl HttpRange {

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-framed"
version = "0.2.0"
version = "0.3.0"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix framed app server"
readme = "README.md"
@@ -13,26 +13,25 @@ categories = ["network-programming", "asynchronous",
"web-programming::websocket"]
license = "MIT/Apache-2.0"
edition = "2018"
workspace =".."
[lib]
name = "actix_framed"
path = "src/lib.rs"
[dependencies]
actix-codec = "0.1.2"
actix-service = "0.4.0"
actix-utils = "0.4.0"
actix-router = "0.1.2"
actix-rt = "0.2.2"
actix-http = "0.2.0"
actix-server-config = "0.1.1"
actix-codec = "0.2.0"
actix-service = "1.0.1"
actix-router = "0.2.1"
actix-rt = "1.0.0"
actix-http = "2.0.0-alpha.2"
bytes = "0.4"
futures = "0.1.25"
bytes = "0.5.3"
futures = "0.3.1"
pin-project = "0.4.6"
log = "0.4"
[dev-dependencies]
actix-server = { version = "0.5.0", features=["ssl"] }
actix-connect = { version = "0.2.0", features=["ssl"] }
actix-http-test = { version = "0.2.0", features=["ssl"] }
actix-server = "1.0.0"
actix-connect = { version = "2.0.0-alpha.2", features=["openssl"] }
actix-http-test = { version = "1.0.0", features=["openssl"] }
actix-utils = "1.0.3"

View File

@@ -1,5 +1,14 @@
# Changes
## [0.3.0] - 2019-12-25
* Migrate to actix-http 1.0
## [0.2.1] - 2019-07-20
* Remove unneeded actix-utils dependency
## [0.2.0] - 2019-05-12
* Update dependencies

View File

@@ -1,22 +1,23 @@
use std::future::Future;
use std::pin::Pin;
use std::rc::Rc;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_http::h1::{Codec, SendResponse};
use actix_http::{Error, Request, Response};
use actix_router::{Path, Router, Url};
use actix_server_config::ServerConfig;
use actix_service::{IntoNewService, NewService, Service};
use actix_utils::cloneable::CloneableService;
use futures::{Async, Future, Poll};
use actix_service::{IntoServiceFactory, Service, ServiceFactory};
use futures::future::{ok, FutureExt, LocalBoxFuture};
use crate::helpers::{BoxedHttpNewService, BoxedHttpService, HttpNewService};
use crate::request::FramedRequest;
use crate::state::State;
type BoxedResponse = Box<Future<Item = (), Error = Error>>;
type BoxedResponse = LocalBoxFuture<'static, Result<(), Error>>;
pub trait HttpServiceFactory {
type Factory: NewService;
type Factory: ServiceFactory;
fn path(&self) -> &str;
@@ -49,19 +50,19 @@ impl<T: 'static, S: 'static> FramedApp<T, S> {
pub fn service<U>(mut self, factory: U) -> Self
where
U: HttpServiceFactory,
U::Factory: NewService<
U::Factory: ServiceFactory<
Config = (),
Request = FramedRequest<T, S>,
Response = (),
Error = Error,
InitError = (),
> + 'static,
<U::Factory as NewService>::Future: 'static,
<U::Factory as NewService>::Service: Service<
<U::Factory as ServiceFactory>::Future: 'static,
<U::Factory as ServiceFactory>::Service: Service<
Request = FramedRequest<T, S>,
Response = (),
Error = Error,
Future = Box<Future<Item = (), Error = Error>>,
Future = LocalBoxFuture<'static, Result<(), Error>>,
>,
{
let path = factory.path().to_string();
@@ -71,12 +72,12 @@ impl<T: 'static, S: 'static> FramedApp<T, S> {
}
}
impl<T, S> IntoNewService<FramedAppFactory<T, S>> for FramedApp<T, S>
impl<T, S> IntoServiceFactory<FramedAppFactory<T, S>> for FramedApp<T, S>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
S: 'static,
{
fn into_new_service(self) -> FramedAppFactory<T, S> {
fn into_factory(self) -> FramedAppFactory<T, S> {
FramedAppFactory {
state: self.state,
services: Rc::new(self.services),
@@ -90,20 +91,20 @@ pub struct FramedAppFactory<T, S> {
services: Rc<Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>>,
}
impl<T, S> NewService for FramedAppFactory<T, S>
impl<T, S> ServiceFactory for FramedAppFactory<T, S>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
S: 'static,
{
type Config = ServerConfig;
type Config = ();
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type InitError = ();
type Service = CloneableService<FramedAppService<T, S>>;
type Service = FramedAppService<T, S>;
type Future = CreateService<T, S>;
fn new_service(&self, _: &ServerConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
CreateService {
fut: self
.services
@@ -111,7 +112,7 @@ where
.map(|(path, service)| {
CreateServiceItem::Future(
Some(path.clone()),
service.new_service(&()),
service.new_service(()),
)
})
.collect(),
@@ -129,28 +130,30 @@ pub struct CreateService<T, S> {
enum CreateServiceItem<T, S> {
Future(
Option<String>,
Box<Future<Item = BoxedHttpService<FramedRequest<T, S>>, Error = ()>>,
LocalBoxFuture<'static, Result<BoxedHttpService<FramedRequest<T, S>>, ()>>,
),
Service(String, BoxedHttpService<FramedRequest<T, S>>),
}
impl<S: 'static, T: 'static> Future for CreateService<T, S>
where
T: AsyncRead + AsyncWrite,
T: AsyncRead + AsyncWrite + Unpin,
{
type Item = CloneableService<FramedAppService<T, S>>;
type Error = ();
type Output = Result<FramedAppService<T, S>, ()>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
let mut done = true;
// poll http services
for item in &mut self.fut {
let res = match item {
CreateServiceItem::Future(ref mut path, ref mut fut) => {
match fut.poll()? {
Async::Ready(service) => Some((path.take().unwrap(), service)),
Async::NotReady => {
match Pin::new(fut).poll(cx) {
Poll::Ready(Ok(service)) => {
Some((path.take().unwrap(), service))
}
Poll::Ready(Err(e)) => return Poll::Ready(Err(e)),
Poll::Pending => {
done = false;
None
}
@@ -177,12 +180,12 @@ where
}
router
});
Ok(Async::Ready(CloneableService::new(FramedAppService {
Poll::Ready(Ok(FramedAppService {
router: router.finish(),
state: self.state.clone(),
})))
}))
} else {
Ok(Async::NotReady)
Poll::Pending
}
}
}
@@ -194,15 +197,15 @@ pub struct FramedAppService<T, S> {
impl<S: 'static, T: 'static> Service for FramedAppService<T, S>
where
T: AsyncRead + AsyncWrite,
T: AsyncRead + AsyncWrite + Unpin,
{
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type Future = BoxedResponse;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
@@ -211,8 +214,8 @@ where
if let Some((srv, _info)) = self.router.recognize_mut(&mut path) {
return srv.call(FramedRequest::new(req, framed, path, self.state.clone()));
}
Box::new(
SendResponse::new(framed, Response::NotFound().finish()).then(|_| Ok(())),
)
SendResponse::new(framed, Response::NotFound().finish())
.then(|_| ok(()))
.boxed_local()
}
}

View File

@@ -1,36 +1,38 @@
use std::task::{Context, Poll};
use actix_http::Error;
use actix_service::{NewService, Service};
use futures::{Future, Poll};
use actix_service::{Service, ServiceFactory};
use futures::future::{FutureExt, LocalBoxFuture};
pub(crate) type BoxedHttpService<Req> = Box<
Service<
dyn Service<
Request = Req,
Response = (),
Error = Error,
Future = Box<Future<Item = (), Error = Error>>,
Future = LocalBoxFuture<'static, Result<(), Error>>,
>,
>;
pub(crate) type BoxedHttpNewService<Req> = Box<
NewService<
dyn ServiceFactory<
Config = (),
Request = Req,
Response = (),
Error = Error,
InitError = (),
Service = BoxedHttpService<Req>,
Future = Box<Future<Item = BoxedHttpService<Req>, Error = ()>>,
Future = LocalBoxFuture<'static, Result<BoxedHttpService<Req>, ()>>,
>,
>;
pub(crate) struct HttpNewService<T: NewService>(T);
pub(crate) struct HttpNewService<T: ServiceFactory>(T);
impl<T> HttpNewService<T>
where
T: NewService<Response = (), Error = Error>,
T: ServiceFactory<Response = (), Error = Error>,
T::Response: 'static,
T::Future: 'static,
T::Service: Service<Future = Box<Future<Item = (), Error = Error>>> + 'static,
T::Service: Service<Future = LocalBoxFuture<'static, Result<(), Error>>> + 'static,
<T::Service as Service>::Future: 'static,
{
pub fn new(service: T) -> Self {
@@ -38,12 +40,12 @@ where
}
}
impl<T> NewService for HttpNewService<T>
impl<T> ServiceFactory for HttpNewService<T>
where
T: NewService<Config = (), Response = (), Error = Error>,
T: ServiceFactory<Config = (), Response = (), Error = Error>,
T::Request: 'static,
T::Future: 'static,
T::Service: Service<Future = Box<Future<Item = (), Error = Error>>> + 'static,
T::Service: Service<Future = LocalBoxFuture<'static, Result<(), Error>>> + 'static,
<T::Service as Service>::Future: 'static,
{
type Config = ();
@@ -52,13 +54,19 @@ where
type Error = Error;
type InitError = ();
type Service = BoxedHttpService<T::Request>;
type Future = Box<Future<Item = Self::Service, Error = ()>>;
type Future = LocalBoxFuture<'static, Result<Self::Service, ()>>;
fn new_service(&self, _: &()) -> Self::Future {
Box::new(self.0.new_service(&()).map_err(|_| ()).and_then(|service| {
let service: BoxedHttpService<_> = Box::new(HttpServiceWrapper { service });
Ok(service)
}))
fn new_service(&self, _: ()) -> Self::Future {
let fut = self.0.new_service(());
async move {
fut.await.map_err(|_| ()).map(|service| {
let service: BoxedHttpService<_> =
Box::new(HttpServiceWrapper { service });
service
})
}
.boxed_local()
}
}
@@ -70,7 +78,7 @@ impl<T> Service for HttpServiceWrapper<T>
where
T: Service<
Response = (),
Future = Box<Future<Item = (), Error = Error>>,
Future = LocalBoxFuture<'static, Result<(), Error>>,
Error = Error,
>,
T::Request: 'static,
@@ -78,10 +86,10 @@ where
type Request = T::Request;
type Response = ();
type Error = Error;
type Future = Box<Future<Item = (), Error = Error>>;
type Future = LocalBoxFuture<'static, Result<(), Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.service.poll_ready()
fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
self.service.poll_ready(cx)
}
fn call(&mut self, req: Self::Request) -> Self::Future {

View File

@@ -1,3 +1,4 @@
#![allow(clippy::type_complexity, clippy::new_without_default, dead_code)]
mod app;
mod helpers;
mod request;

View File

@@ -123,7 +123,9 @@ impl<Io, S> FramedRequest<Io, S> {
#[cfg(test)]
mod tests {
use actix_http::http::{HeaderName, HeaderValue, HttpTryFrom};
use std::convert::TryFrom;
use actix_http::http::{HeaderName, HeaderValue};
use actix_http::test::{TestBuffer, TestRequest};
use super::*;

View File

@@ -1,11 +1,12 @@
use std::fmt;
use std::future::Future;
use std::marker::PhantomData;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_http::{http::Method, Error};
use actix_service::{NewService, Service};
use futures::future::{ok, FutureResult};
use futures::{Async, Future, IntoFuture, Poll};
use actix_service::{Service, ServiceFactory};
use futures::future::{ok, FutureExt, LocalBoxFuture, Ready};
use log::error;
use crate::app::HttpServiceFactory;
@@ -15,11 +16,11 @@ use crate::request::FramedRequest;
///
/// Route uses builder-like pattern for configuration.
/// If handler is not explicitly set, default *404 Not Found* handler is used.
pub struct FramedRoute<Io, S, F = (), R = ()> {
pub struct FramedRoute<Io, S, F = (), R = (), E = ()> {
handler: F,
pattern: String,
methods: Vec<Method>,
state: PhantomData<(Io, S, R)>,
state: PhantomData<(Io, S, R, E)>,
}
impl<Io, S> FramedRoute<Io, S> {
@@ -53,12 +54,12 @@ impl<Io, S> FramedRoute<Io, S> {
self
}
pub fn to<F, R>(self, handler: F) -> FramedRoute<Io, S, F, R>
pub fn to<F, R, E>(self, handler: F) -> FramedRoute<Io, S, F, R, E>
where
F: FnMut(FramedRequest<Io, S>) -> R,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Debug,
R: Future<Output = Result<(), E>> + 'static,
E: fmt::Debug,
{
FramedRoute {
handler,
@@ -69,15 +70,14 @@ impl<Io, S> FramedRoute<Io, S> {
}
}
impl<Io, S, F, R> HttpServiceFactory for FramedRoute<Io, S, F, R>
impl<Io, S, F, R, E> HttpServiceFactory for FramedRoute<Io, S, F, R, E>
where
Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Display,
R: Future<Output = Result<(), E>> + 'static,
E: fmt::Display,
{
type Factory = FramedRouteFactory<Io, S, F, R>;
type Factory = FramedRouteFactory<Io, S, F, R, E>;
fn path(&self) -> &str {
&self.pattern
@@ -92,29 +92,28 @@ where
}
}
pub struct FramedRouteFactory<Io, S, F, R> {
pub struct FramedRouteFactory<Io, S, F, R, E> {
handler: F,
methods: Vec<Method>,
_t: PhantomData<(Io, S, R)>,
_t: PhantomData<(Io, S, R, E)>,
}
impl<Io, S, F, R> NewService for FramedRouteFactory<Io, S, F, R>
impl<Io, S, F, R, E> ServiceFactory for FramedRouteFactory<Io, S, F, R, E>
where
Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Display,
R: Future<Output = Result<(), E>> + 'static,
E: fmt::Display,
{
type Config = ();
type Request = FramedRequest<Io, S>;
type Response = ();
type Error = Error;
type InitError = ();
type Service = FramedRouteService<Io, S, F, R>;
type Future = FutureResult<Self::Service, Self::InitError>;
type Service = FramedRouteService<Io, S, F, R, E>;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &()) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
ok(FramedRouteService {
handler: self.handler.clone(),
methods: self.methods.clone(),
@@ -123,35 +122,38 @@ where
}
}
pub struct FramedRouteService<Io, S, F, R> {
pub struct FramedRouteService<Io, S, F, R, E> {
handler: F,
methods: Vec<Method>,
_t: PhantomData<(Io, S, R)>,
_t: PhantomData<(Io, S, R, E)>,
}
impl<Io, S, F, R> Service for FramedRouteService<Io, S, F, R>
impl<Io, S, F, R, E> Service for FramedRouteService<Io, S, F, R, E>
where
Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Display,
R: Future<Output = Result<(), E>> + 'static,
E: fmt::Display,
{
type Request = FramedRequest<Io, S>;
type Response = ();
type Error = Error;
type Future = Box<Future<Item = (), Error = Error>>;
type Future = LocalBoxFuture<'static, Result<(), Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, req: FramedRequest<Io, S>) -> Self::Future {
Box::new((self.handler)(req).into_future().then(|res| {
let fut = (self.handler)(req);
async move {
let res = fut.await;
if let Err(e) = res {
error!("Error in request handler: {}", e);
}
Ok(())
}))
}
.boxed_local()
}
}

View File

@@ -1,4 +1,6 @@
use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_http::body::BodySize;
@@ -6,9 +8,9 @@ use actix_http::error::ResponseError;
use actix_http::h1::{Codec, Message};
use actix_http::ws::{verify_handshake, HandshakeError};
use actix_http::{Request, Response};
use actix_service::{NewService, Service};
use futures::future::{ok, Either, FutureResult};
use futures::{Async, Future, IntoFuture, Poll, Sink};
use actix_service::{Service, ServiceFactory};
use futures::future::{err, ok, Either, Ready};
use futures::Future;
/// Service that verifies incoming request if it is valid websocket
/// upgrade request. In case of error returns `HandshakeError`
@@ -22,16 +24,16 @@ impl<T, C> Default for VerifyWebSockets<T, C> {
}
}
impl<T, C> NewService for VerifyWebSockets<T, C> {
impl<T, C> ServiceFactory for VerifyWebSockets<T, C> {
type Config = C;
type Request = (Request, Framed<T, Codec>);
type Response = (Request, Framed<T, Codec>);
type Error = (HandshakeError, Framed<T, Codec>);
type InitError = ();
type Service = VerifyWebSockets<T, C>;
type Future = FutureResult<Self::Service, Self::InitError>;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &C) -> Self::Future {
fn new_service(&self, _: C) -> Self::Future {
ok(VerifyWebSockets { _t: PhantomData })
}
}
@@ -40,16 +42,16 @@ impl<T, C> Service for VerifyWebSockets<T, C> {
type Request = (Request, Framed<T, Codec>);
type Response = (Request, Framed<T, Codec>);
type Error = (HandshakeError, Framed<T, Codec>);
type Future = FutureResult<Self::Response, Self::Error>;
type Future = Ready<Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
match verify_handshake(req.head()) {
Err(e) => Err((e, framed)).into_future(),
Ok(_) => Ok((req, framed)).into_future(),
Err(e) => err((e, framed)),
Ok(_) => ok((req, framed)),
}
}
}
@@ -67,9 +69,9 @@ where
}
}
impl<T, R, E, C> NewService for SendError<T, R, E, C>
impl<T, R, E, C> ServiceFactory for SendError<T, R, E, C>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
R: 'static,
E: ResponseError + 'static,
{
@@ -79,34 +81,34 @@ where
type Error = (E, Framed<T, Codec>);
type InitError = ();
type Service = SendError<T, R, E, C>;
type Future = FutureResult<Self::Service, Self::InitError>;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &C) -> Self::Future {
fn new_service(&self, _: C) -> Self::Future {
ok(SendError(PhantomData))
}
}
impl<T, R, E, C> Service for SendError<T, R, E, C>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
R: 'static,
E: ResponseError + 'static,
{
type Request = Result<R, (E, Framed<T, Codec>)>;
type Response = R;
type Error = (E, Framed<T, Codec>);
type Future = Either<FutureResult<R, (E, Framed<T, Codec>)>, SendErrorFut<T, R, E>>;
type Future = Either<Ready<Result<R, (E, Framed<T, Codec>)>>, SendErrorFut<T, R, E>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, req: Result<R, (E, Framed<T, Codec>)>) -> Self::Future {
match req {
Ok(r) => Either::A(ok(r)),
Ok(r) => Either::Left(ok(r)),
Err((e, framed)) => {
let res = e.error_response().drop_body();
Either::B(SendErrorFut {
Either::Right(SendErrorFut {
framed: Some(framed),
res: Some((res, BodySize::Empty).into()),
err: Some(e),
@@ -117,6 +119,7 @@ where
}
}
#[pin_project::pin_project]
pub struct SendErrorFut<T, R, E> {
res: Option<Message<(Response<()>, BodySize)>>,
framed: Option<Framed<T, Codec>>,
@@ -127,23 +130,27 @@ pub struct SendErrorFut<T, R, E> {
impl<T, R, E> Future for SendErrorFut<T, R, E>
where
E: ResponseError,
T: AsyncRead + AsyncWrite,
T: AsyncRead + AsyncWrite + Unpin,
{
type Item = R;
type Error = (E, Framed<T, Codec>);
type Output = Result<R, (E, Framed<T, Codec>)>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
if let Some(res) = self.res.take() {
if self.framed.as_mut().unwrap().force_send(res).is_err() {
return Err((self.err.take().unwrap(), self.framed.take().unwrap()));
if self.framed.as_mut().unwrap().write(res).is_err() {
return Poll::Ready(Err((
self.err.take().unwrap(),
self.framed.take().unwrap(),
)));
}
}
match self.framed.as_mut().unwrap().poll_complete() {
Ok(Async::Ready(_)) => {
Err((self.err.take().unwrap(), self.framed.take().unwrap()))
match self.framed.as_mut().unwrap().flush(cx) {
Poll::Ready(Ok(_)) => {
Poll::Ready(Err((self.err.take().unwrap(), self.framed.take().unwrap())))
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(_) => Err((self.err.take().unwrap(), self.framed.take().unwrap())),
Poll::Ready(Err(_)) => {
Poll::Ready(Err((self.err.take().unwrap(), self.framed.take().unwrap())))
}
Poll::Pending => Poll::Pending,
}
}
}

View File

@@ -1,12 +1,13 @@
//! Various helpers for Actix applications to use during testing.
use std::convert::TryFrom;
use std::future::Future;
use actix_codec::Framed;
use actix_http::h1::Codec;
use actix_http::http::header::{Header, HeaderName, IntoHeaderValue};
use actix_http::http::{HttpTryFrom, Method, Uri, Version};
use actix_http::http::{Error as HttpError, Method, Uri, Version};
use actix_http::test::{TestBuffer, TestRequest as HttpTestRequest};
use actix_router::{Path, Url};
use actix_rt::Runtime;
use futures::IntoFuture;
use crate::{FramedRequest, State};
@@ -41,7 +42,8 @@ impl TestRequest<()> {
/// Create TestRequest and set header
pub fn with_header<K, V>(key: K, value: V) -> Self
where
HeaderName: HttpTryFrom<K>,
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue,
{
Self::default().header(key, value)
@@ -96,7 +98,8 @@ impl<S> TestRequest<S> {
/// Set a header
pub fn header<K, V>(mut self, key: K, value: V) -> Self
where
HeaderName: HttpTryFrom<K>,
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue,
{
self.req.header(key, value);
@@ -118,13 +121,12 @@ impl<S> TestRequest<S> {
}
/// This method generates `FramedRequest` instance and executes async handler
pub fn run<F, R, I, E>(self, f: F) -> Result<I, E>
pub async fn run<F, R, I, E>(self, f: F) -> Result<I, E>
where
F: FnOnce(FramedRequest<TestBuffer, S>) -> R,
R: IntoFuture<Item = I, Error = E>,
R: Future<Output = Result<I, E>>,
{
let mut rt = Runtime::new().unwrap();
rt.block_on(f(self.finish()).into_future())
f(self.finish()).await
}
}

View File

@@ -1,141 +1,161 @@
use actix_codec::{AsyncRead, AsyncWrite};
use actix_http::{body, http::StatusCode, ws, Error, HttpService, Response};
use actix_http_test::TestServer;
use actix_service::{IntoNewService, NewService};
use actix_utils::framed::FramedTransport;
use bytes::{Bytes, BytesMut};
use futures::future::{self, ok};
use futures::{Future, Sink, Stream};
use actix_http_test::test_server;
use actix_service::{pipeline_factory, IntoServiceFactory, ServiceFactory};
use actix_utils::framed::Dispatcher;
use bytes::Bytes;
use futures::{future, SinkExt, StreamExt};
use actix_framed::{FramedApp, FramedRequest, FramedRoute, SendError, VerifyWebSockets};
fn ws_service<T: AsyncRead + AsyncWrite>(
async fn ws_service<T: AsyncRead + AsyncWrite>(
req: FramedRequest<T>,
) -> impl Future<Item = (), Error = Error> {
let (req, framed, _) = req.into_parts();
) -> Result<(), Error> {
let (req, mut framed, _) = req.into_parts();
let res = ws::handshake(req.head()).unwrap().message_body(());
framed
.send((res, body::BodySize::None).into())
.map_err(|_| panic!())
.and_then(|framed| {
FramedTransport::new(framed.into_framed(ws::Codec::new()), service)
.map_err(|_| panic!())
})
.await
.unwrap();
Dispatcher::new(framed.into_framed(ws::Codec::new()), service)
.await
.unwrap();
Ok(())
}
fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> {
async fn service(msg: ws::Frame) -> Result<ws::Message, Error> {
let msg = match msg {
ws::Frame::Ping(msg) => ws::Message::Pong(msg),
ws::Frame::Text(text) => {
ws::Message::Text(String::from_utf8_lossy(&text.unwrap()).to_string())
ws::Message::Text(String::from_utf8_lossy(&text).to_string())
}
ws::Frame::Binary(bin) => ws::Message::Binary(bin.unwrap().freeze()),
ws::Frame::Binary(bin) => ws::Message::Binary(bin),
ws::Frame::Close(reason) => ws::Message::Close(reason),
_ => panic!(),
};
ok(msg)
Ok(msg)
}
#[test]
fn test_simple() {
let mut srv = TestServer::new(|| {
#[actix_rt::test]
async fn test_simple() {
let mut srv = test_server(|| {
HttpService::build()
.upgrade(
FramedApp::new().service(FramedRoute::get("/index.html").to(ws_service)),
)
.finish(|_| future::ok::<_, Error>(Response::NotFound()))
});
.tcp()
})
.await;
assert!(srv.ws_at("/test").is_err());
assert!(srv.ws_at("/test").await.is_err());
// client service
let framed = srv.ws_at("/index.html").unwrap();
let framed = srv
.block_on(framed.send(ws::Message::Text("text".to_string())))
let mut framed = srv.ws_at("/index.html").await.unwrap();
framed
.send(ws::Message::Text("text".to_string()))
.await
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
let framed = srv
.block_on(framed.send(ws::Message::Binary("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
let (item, mut framed) = framed.into_future().await;
assert_eq!(
item,
Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
item.unwrap().unwrap(),
ws::Frame::Text(Bytes::from_static(b"text"))
);
let framed = srv
.block_on(framed.send(ws::Message::Ping("text".into())))
framed
.send(ws::Message::Binary("text".into()))
.await
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
let framed = srv
.block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
.unwrap();
let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
let (item, mut framed) = framed.into_future().await;
assert_eq!(
item,
Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
item.unwrap().unwrap(),
ws::Frame::Binary(Bytes::from_static(b"text"))
);
framed.send(ws::Message::Ping("text".into())).await.unwrap();
let (item, mut framed) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Pong("text".to_string().into())
);
framed
.send(ws::Message::Close(Some(ws::CloseCode::Normal.into())))
.await
.unwrap();
let (item, _) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Close(Some(ws::CloseCode::Normal.into()))
);
}
#[test]
fn test_service() {
let mut srv = TestServer::new(|| {
actix_http::h1::OneRequest::new().map_err(|_| ()).and_then(
VerifyWebSockets::default()
#[actix_rt::test]
async fn test_service() {
let mut srv = test_server(|| {
pipeline_factory(actix_http::h1::OneRequest::new().map_err(|_| ())).and_then(
pipeline_factory(
pipeline_factory(VerifyWebSockets::default())
.then(SendError::default())
.map_err(|_| ())
.map_err(|_| ()),
)
.and_then(
FramedApp::new()
.service(FramedRoute::get("/index.html").to(ws_service))
.into_new_service()
.into_factory()
.map_err(|_| ()),
),
)
});
})
.await;
// non ws request
let res = srv.block_on(srv.get("/index.html").send()).unwrap();
let res = srv.get("/index.html").send().await.unwrap();
assert_eq!(res.status(), StatusCode::BAD_REQUEST);
// not found
assert!(srv.ws_at("/test").is_err());
assert!(srv.ws_at("/test").await.is_err());
// client service
let framed = srv.ws_at("/index.html").unwrap();
let framed = srv
.block_on(framed.send(ws::Message::Text("text".to_string())))
let mut framed = srv.ws_at("/index.html").await.unwrap();
framed
.send(ws::Message::Text("text".to_string()))
.await
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
let framed = srv
.block_on(framed.send(ws::Message::Binary("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
let (item, mut framed) = framed.into_future().await;
assert_eq!(
item,
Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
item.unwrap().unwrap(),
ws::Frame::Text(Bytes::from_static(b"text"))
);
let framed = srv
.block_on(framed.send(ws::Message::Ping("text".into())))
framed
.send(ws::Message::Binary("text".into()))
.await
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
let framed = srv
.block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
.unwrap();
let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
let (item, mut framed) = framed.into_future().await;
assert_eq!(
item,
Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
item.unwrap().unwrap(),
ws::Frame::Binary(Bytes::from_static(b"text"))
);
framed.send(ws::Message::Ping("text".into())).await.unwrap();
let (item, mut framed) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Pong("text".to_string().into())
);
framed
.send(ws::Message::Close(Some(ws::CloseCode::Normal.into())))
.await
.unwrap();
let (item, _) = framed.into_future().await;
assert_eq!(
item.unwrap().unwrap(),
ws::Frame::Close(Some(ws::CloseCode::Normal.into()))
);
}

View File

@@ -1,11 +1,157 @@
# Changes
## [0.2.6] - TBD
## [2.0.0-alpha.2] - 2020-03-07
### Changed
* Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB respectively
to improve download speed for awc when downloading large objects. [#1394]
* client::Connector accepts initial_window_size and initial_connection_window_size HTTP2 configuration. [#1394]
* client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
[#1394]: https://github.com/actix/actix-web/pull/1394
[#1395]: https://github.com/actix/actix-web/pull/1395
## [2.0.0-alpha.1] - 2020-02-27
### Changed
* Update the `time` dependency to 0.2.7.
* Moved actors messages support from actix crate, enabled with feature `actors`.
* Breaking change: trait MessageBody requires Unpin and accepting Pin<&mut Self> instead of &mut self in the poll_next().
* MessageBody is not implemented for &'static [u8] anymore.
### Fixed
* Allow `SameSite=None` cookies to be sent in a response.
## [1.0.1] - 2019-12-20
### Fixed
* Poll upgrade service's readiness from HTTP service handlers
* Replace brotli with brotli2 #1224
## [1.0.0] - 2019-12-13
### Added
* Add websockets continuation frame support
### Changed
* Replace `flate2-xxx` features with `compress`
## [1.0.0-alpha.5] - 2019-12-09
### Fixed
* Check `Upgrade` service readiness before calling it
* Fix buffer remaining capacity calcualtion
### Changed
* Websockets: Ping and Pong should have binary data #1049
## [1.0.0-alpha.4] - 2019-12-08
### Added
* Add impl ResponseBuilder for Error
### Changed
* Use rust based brotli compression library
## [1.0.0-alpha.3] - 2019-12-07
### Changed
* Migrate to tokio 0.2
* Migrate to `std::future`
## [0.2.11] - 2019-11-06
### Added
* Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
* Allow to use `std::convert::Infallible` as `actix_http::error::Error`
### Fixed
* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain; charset=utf-8` header #1118
## [0.2.10] - 2019-09-11
### Added
* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests with `RequestHead`
### Fixed
* h2 will use error response #1080
* on_connect result isn't added to request extensions for http2 requests #1009
## [0.2.9] - 2019-08-13
### Changed
* Dropped the `byteorder`-dependency in favor of `stdlib`-implementation
* Update percent-encoding to 2.1
* Update serde_urlencoded to 0.6.1
### Fixed
* Fixed a panic in the HTTP2 handshake in client HTTP requests (#1031)
## [0.2.8] - 2019-08-01
### Added
* Add `rustls` support
* Add `Clone` impl for `HeaderMap`
### Fixed
* awc client panic #1016
* Invalid response with compression middleware enabled, but compression-related features disabled #997
## [0.2.7] - 2019-07-18
### Added
* Add support for downcasting response errors #986
## [0.2.6] - 2019-07-17
### Changed
* Replace `ClonableService` with local copy
* Upgrade `rand` dependency version to 0.7
## [0.2.5] - 2019-06-28
### Added

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-http"
version = "0.2.5"
version = "2.0.0-alpha.2"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix http primitives"
readme = "README.md"
@@ -13,10 +13,9 @@ categories = ["network-programming", "asynchronous",
"web-programming::websocket"]
license = "MIT/Apache-2.0"
edition = "2018"
workspace = ".."
[package.metadata.docs.rs]
features = ["ssl", "fail", "brotli", "flate2-zlib", "secure-cookies"]
features = ["openssl", "rustls", "failure", "compress", "secure-cookies","actors"]
[lib]
name = "actix_http"
@@ -26,81 +25,85 @@ path = "src/lib.rs"
default = []
# openssl
ssl = ["openssl", "actix-connect/ssl"]
openssl = ["actix-tls/openssl", "actix-connect/openssl"]
# brotli encoding, requires c compiler
brotli = ["brotli2"]
# rustls support
rustls = ["actix-tls/rustls", "actix-connect/rustls"]
# miniz-sys backend for flate2 crate
flate2-zlib = ["flate2/miniz-sys"]
# rust backend for flate2 crate
flate2-rust = ["flate2/rust_backend"]
# enable compressison support
compress = ["flate2", "brotli2"]
# failure integration. actix does not use failure anymore
fail = ["failure"]
failure = ["fail-ure"]
# support for secure cookies
secure-cookies = ["ring"]
[dependencies]
actix-service = "0.4.1"
actix-codec = "0.1.2"
actix-connect = "0.2.0"
actix-utils = "0.4.2"
actix-server-config = "0.1.1"
actix-threadpool = "0.1.0"
# support for actix Actor messages
actors = ["actix"]
base64 = "0.10"
bitflags = "1.0"
bytes = "0.4"
byteorder = "1.2"
[dependencies]
actix-service = "1.0.5"
actix-codec = "0.2.0"
actix-connect = "2.0.0-alpha.2"
actix-utils = "1.0.6"
actix-rt = "1.0.0"
actix-threadpool = "0.3.1"
actix-tls = { version = "2.0.0-alpha.1", optional = true }
actix = { version = "0.10.0-alpha.1", optional = true }
base64 = "0.11"
bitflags = "1.2"
bytes = "0.5.3"
copyless = "0.1.4"
derive_more = "0.15.0"
either = "1.5.2"
derive_more = "0.99.2"
either = "1.5.3"
encoding_rs = "0.8"
futures = "0.1.25"
hashbrown = "0.5.0"
h2 = "0.1.16"
http = "0.1.17"
futures-core = "0.3.1"
futures-util = "0.3.1"
futures-channel = "0.3.1"
fxhash = "0.2.1"
h2 = "0.2.1"
http = "0.2.0"
httparse = "1.3"
indexmap = "1.0"
lazy_static = "1.0"
indexmap = "1.3"
lazy_static = "1.4"
language-tags = "0.2"
log = "0.4"
mime = "0.3"
percent-encoding = "1.0"
percent-encoding = "2.1"
pin-project = "0.4.6"
rand = "0.7"
regex = "1.0"
regex = "1.3"
serde = "1.0"
serde_json = "1.0"
sha1 = "0.6"
sha-1 = "0.8"
slab = "0.4"
serde_urlencoded = "0.5.5"
time = "0.1.42"
tokio-tcp = "0.1.3"
tokio-timer = "0.2.8"
tokio-current-thread = "0.1"
trust-dns-resolver = { version="0.11.1", default-features = false }
serde_urlencoded = "0.6.1"
time = { version = "0.2.7", default-features = false, features = ["std"] }
# for secure cookie
ring = { version = "0.14.6", optional = true }
ring = { version = "0.16.9", optional = true }
# compression
brotli2 = { version="0.3.2", optional = true }
flate2 = { version="1.0.7", optional = true, default-features = false }
flate2 = { version = "1.0.13", optional = true }
# optional deps
failure = { version = "0.1.5", optional = true }
openssl = { version="0.10", optional = true }
chrono = "0.4.6"
fail-ure = { version = "0.1.5", package="failure", optional = true }
[dev-dependencies]
actix-rt = "0.2.2"
actix-server = { version = "0.5.0", features=["ssl"] }
actix-connect = { version = "0.2.0", features=["ssl"] }
actix-http-test = { version = "0.2.0", features=["ssl"] }
env_logger = "0.6"
actix-server = "1.0.1"
actix-connect = { version = "2.0.0-alpha.2", features=["openssl"] }
actix-http-test = { version = "1.0.0", features=["openssl"] }
actix-tls = { version = "2.0.0-alpha.1", features=["openssl"] }
criterion = "0.3"
futures = "0.3.1"
env_logger = "0.7"
serde_derive = "1.0"
openssl = { version="0.10" }
tokio-tcp = "0.1"
open-ssl = { version="0.10", package = "openssl" }
rust-tls = { version="0.17", package = "rustls" }
[[bench]]
name = "content-length"
harness = false

View File

@@ -14,19 +14,34 @@ Actix http
```rust
// see examples/framed_hello.rs for complete list of used crates.
extern crate actix_http;
use actix_http::{h1, Response, ServiceConfig};
use std::{env, io};
fn main() {
Server::new().bind("framed_hello", "127.0.0.1:8080", || {
IntoFramed::new(|| h1::Codec::new(ServiceConfig::default())) // <- create h1 codec
.and_then(TakeItem::new().map_err(|_| ())) // <- read one request
.and_then(|(_req, _framed): (_, Framed<_, _>)| { // <- send response and close conn
SendResponse::send(_framed, Response::Ok().body("Hello world!"))
.map_err(|_| ())
.map(|_| ())
use actix_http::{HttpService, Response};
use actix_server::Server;
use futures::future;
use http::header::HeaderValue;
use log::info;
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "hello_world=info");
env_logger::init();
Server::build()
.bind("hello-world", "127.0.0.1:8080", || {
HttpService::build()
.client_timeout(1000)
.client_disconnect(1000)
.finish(|_req| {
info!("{:?}", _req);
let mut res = Response::Ok();
res.header("x-head", HeaderValue::from_static("dummy value!"));
future::ok::<_, ()>(res.body("Hello world!"))
})
}).unwrap().run();
.tcp()
})?
.run()
.await
}
```

View File

@@ -0,0 +1,267 @@
use criterion::{criterion_group, criterion_main, BenchmarkId, Criterion};
use bytes::BytesMut;
// benchmark sending all requests at the same time
fn bench_write_content_length(c: &mut Criterion) {
let mut group = c.benchmark_group("write_content_length");
let sizes = [
0, 1, 11, 83, 101, 653, 1001, 6323, 10001, 56329, 100001, 123456, 98724245,
4294967202,
];
for i in sizes.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_content_length(i, &mut b)
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_content_length(i, &mut b)
})
});
}
group.finish();
}
criterion_group!(benches, bench_write_content_length);
criterion_main!(benches);
mod _new {
use bytes::{BufMut, BytesMut};
const DIGITS_START: u8 = b'0';
/// NOTE: bytes object has to contain enough space
pub fn write_content_length(n: usize, bytes: &mut BytesMut) {
if n == 0 {
bytes.put_slice(b"\r\ncontent-length: 0\r\n");
return;
}
bytes.put_slice(b"\r\ncontent-length: ");
if n < 10 {
bytes.put_u8(DIGITS_START + (n as u8));
} else if n < 100 {
let n = n as u8;
let d10 = n / 10;
let d1 = n % 10;
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 1000 {
let n = n as u16;
let d100 = (n / 100) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 10_000 {
let n = n as u16;
let d1000 = (n / 1000) as u8;
let d100 = ((n / 100) % 10) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d1000);
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 100_000 {
let n = n as u32;
let d10000 = (n / 10000) as u8;
let d1000 = ((n / 1000) % 10) as u8;
let d100 = ((n / 100) % 10) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d10000);
bytes.put_u8(DIGITS_START + d1000);
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 1_000_000 {
let n = n as u32;
let d100000 = (n / 100000) as u8;
let d10000 = ((n / 10000) % 10) as u8;
let d1000 = ((n / 1000) % 10) as u8;
let d100 = ((n / 100) % 10) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100000);
bytes.put_u8(DIGITS_START + d10000);
bytes.put_u8(DIGITS_START + d1000);
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else {
write_usize(n, bytes);
}
bytes.put_slice(b"\r\n");
}
fn write_usize(n: usize, bytes: &mut BytesMut) {
let mut n = n;
// 20 chars is max length of a usize (2^64)
// digits will be added to the buffer from lsd to msd
let mut buf = BytesMut::with_capacity(20);
while n > 9 {
// "pop" the least-significant digit
let lsd = (n % 10) as u8;
// remove the lsd from n
n = n / 10;
buf.put_u8(DIGITS_START + lsd);
}
// put msd to result buffer
bytes.put_u8(DIGITS_START + (n as u8));
// put, in reverse (msd to lsd), remaining digits to buffer
for i in (0..buf.len()).rev() {
bytes.put_u8(buf[i]);
}
}
}
mod _original {
use std::{mem, ptr, slice};
use bytes::{BufMut, BytesMut};
const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
2021222324252627282930313233343536373839\
4041424344454647484950515253545556575859\
6061626364656667686970717273747576777879\
8081828384858687888990919293949596979899";
/// NOTE: bytes object has to contain enough space
pub fn write_content_length(mut n: usize, bytes: &mut BytesMut) {
if n < 10 {
let mut buf: [u8; 21] = [
b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'\r', b'\n',
];
buf[18] = (n as u8) + b'0';
bytes.put_slice(&buf);
} else if n < 100 {
let mut buf: [u8; 22] = [
b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'\r', b'\n',
];
let d1 = n << 1;
unsafe {
ptr::copy_nonoverlapping(
DEC_DIGITS_LUT.as_ptr().add(d1),
buf.as_mut_ptr().offset(18),
2,
);
}
bytes.put_slice(&buf);
} else if n < 1000 {
let mut buf: [u8; 23] = [
b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'0', b'\r',
b'\n',
];
// decode 2 more chars, if > 2 chars
let d1 = (n % 100) << 1;
n /= 100;
unsafe {
ptr::copy_nonoverlapping(
DEC_DIGITS_LUT.as_ptr().add(d1),
buf.as_mut_ptr().offset(19),
2,
)
};
// decode last 1
buf[18] = (n as u8) + b'0';
bytes.put_slice(&buf);
} else {
bytes.put_slice(b"\r\ncontent-length: ");
convert_usize(n, bytes);
}
}
pub(crate) fn convert_usize(mut n: usize, bytes: &mut BytesMut) {
let mut curr: isize = 39;
let mut buf: [u8; 41] = unsafe { mem::MaybeUninit::uninit().assume_init() };
buf[39] = b'\r';
buf[40] = b'\n';
let buf_ptr = buf.as_mut_ptr();
let lut_ptr = DEC_DIGITS_LUT.as_ptr();
// eagerly decode 4 characters at a time
while n >= 10_000 {
let rem = (n % 10_000) as isize;
n /= 10_000;
let d1 = (rem / 100) << 1;
let d2 = (rem % 100) << 1;
curr -= 4;
unsafe {
ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
ptr::copy_nonoverlapping(
lut_ptr.offset(d2),
buf_ptr.offset(curr + 2),
2,
);
}
}
// if we reach here numbers are <= 9999, so at most 4 chars long
let mut n = n as isize; // possibly reduce 64bit math
// decode 2 more chars, if > 2 chars
if n >= 100 {
let d1 = (n % 100) << 1;
n /= 100;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
}
}
// decode last 1 or 2 chars
if n < 10 {
curr -= 1;
unsafe {
*buf_ptr.offset(curr) = (n as u8) + b'0';
}
} else {
let d1 = n << 1;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
}
}
unsafe {
bytes.extend_from_slice(slice::from_raw_parts(
buf_ptr.offset(curr),
41 - curr as usize,
));
}
}
}

View File

@@ -1,13 +1,14 @@
use std::{env, io};
use actix_http::{error::PayloadError, HttpService, Request, Response};
use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures::{Future, Stream};
use futures::StreamExt;
use http::header::HeaderValue;
use log::info;
fn main() -> io::Result<()> {
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "echo=info");
env_logger::init();
@@ -16,22 +17,21 @@ fn main() -> io::Result<()> {
HttpService::build()
.client_timeout(1000)
.client_disconnect(1000)
.finish(|mut req: Request| {
req.take_payload()
.fold(BytesMut::new(), move |mut body, chunk| {
body.extend_from_slice(&chunk);
Ok::<_, PayloadError>(body)
})
.and_then(|bytes| {
info!("request body: {:?}", bytes);
let mut res = Response::Ok();
res.header(
"x-head",
HeaderValue::from_static("dummy value!"),
);
Ok(res.body(bytes))
})
.finish(|mut req: Request| async move {
let mut body = BytesMut::new();
while let Some(item) = req.payload().next().await {
body.extend_from_slice(&item?);
}
info!("request body: {:?}", body);
Ok::<_, Error>(
Response::Ok()
.header("x-head", HeaderValue::from_static("dummy value!"))
.body(body),
)
})
.tcp()
})?
.run()
.await
}

View File

@@ -1,34 +1,33 @@
use std::{env, io};
use actix_http::http::HeaderValue;
use actix_http::{error::PayloadError, Error, HttpService, Request, Response};
use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures::{Future, Stream};
use futures::StreamExt;
use log::info;
fn handle_request(mut req: Request) -> impl Future<Item = Response, Error = Error> {
req.take_payload()
.fold(BytesMut::new(), move |mut body, chunk| {
body.extend_from_slice(&chunk);
Ok::<_, PayloadError>(body)
})
.from_err()
.and_then(|bytes| {
info!("request body: {:?}", bytes);
let mut res = Response::Ok();
res.header("x-head", HeaderValue::from_static("dummy value!"));
Ok(res.body(bytes))
})
async fn handle_request(mut req: Request) -> Result<Response, Error> {
let mut body = BytesMut::new();
while let Some(item) = req.payload().next().await {
body.extend_from_slice(&item?)
}
info!("request body: {:?}", body);
Ok(Response::Ok()
.header("x-head", HeaderValue::from_static("dummy value!"))
.body(body))
}
fn main() -> io::Result<()> {
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "echo=info");
env_logger::init();
Server::build()
.bind("echo", "127.0.0.1:8080", || {
HttpService::build().finish(|_req: Request| handle_request(_req))
HttpService::build().finish(handle_request).tcp()
})?
.run()
.await
}

View File

@@ -6,7 +6,8 @@ use futures::future;
use http::header::HeaderValue;
use log::info;
fn main() -> io::Result<()> {
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "hello_world=info");
env_logger::init();
@@ -21,6 +22,8 @@ fn main() -> io::Result<()> {
res.header("x-head", HeaderValue::from_static("dummy value!"));
future::ok::<_, ()>(res.body("Hello world!"))
})
.tcp()
})?
.run()
.await
}

View File

@@ -1,8 +1,12 @@
use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, mem};
use bytes::{Bytes, BytesMut};
use futures::{Async, Poll, Stream};
use futures_core::Stream;
use futures_util::ready;
use pin_project::{pin_project, project};
use crate::error::Error;
@@ -32,32 +36,46 @@ impl BodySize {
pub trait MessageBody {
fn size(&self) -> BodySize;
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error>;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>>;
downcast_get_type_id!();
}
downcast!(MessageBody);
impl MessageBody for () {
fn size(&self) -> BodySize {
BodySize::Empty
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
Ok(Async::Ready(None))
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Poll::Ready(None)
}
}
impl<T: MessageBody> MessageBody for Box<T> {
impl<T: MessageBody + Unpin> MessageBody for Box<T> {
fn size(&self) -> BodySize {
self.as_ref().size()
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
self.as_mut().poll_next()
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Pin::new(self.get_mut().as_mut()).poll_next(cx)
}
}
#[pin_project]
pub enum ResponseBody<B> {
Body(B),
Other(Body),
Body(#[pin] B),
Other(#[pin] Body),
}
impl ResponseBody<Body> {
@@ -93,23 +111,36 @@ impl<B: MessageBody> MessageBody for ResponseBody<B> {
}
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
match self {
ResponseBody::Body(ref mut body) => body.poll_next(),
ResponseBody::Other(ref mut body) => body.poll_next(),
#[project]
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
#[project]
match self.project() {
ResponseBody::Body(body) => body.poll_next(cx),
ResponseBody::Other(body) => body.poll_next(cx),
}
}
}
impl<B: MessageBody> Stream for ResponseBody<B> {
type Item = Bytes;
type Error = Error;
type Item = Result<Bytes, Error>;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
self.poll_next()
#[project]
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
#[project]
match self.project() {
ResponseBody::Body(body) => body.poll_next(cx),
ResponseBody::Other(body) => body.poll_next(cx),
}
}
}
#[pin_project]
/// Represents various types of http message body.
pub enum Body {
/// Empty response. `Content-Length` header is not set.
@@ -119,17 +150,17 @@ pub enum Body {
/// Specific response body.
Bytes(Bytes),
/// Generic message body.
Message(Box<dyn MessageBody>),
Message(Box<dyn MessageBody + Unpin>),
}
impl Body {
/// Create body from slice (copy)
pub fn from_slice(s: &[u8]) -> Body {
Body::Bytes(Bytes::from(s))
Body::Bytes(Bytes::copy_from_slice(s))
}
/// Create body from generic message body.
pub fn from_message<B: MessageBody + 'static>(body: B) -> Body {
pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
Body::Message(Box::new(body))
}
}
@@ -144,19 +175,24 @@ impl MessageBody for Body {
}
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
match self {
Body::None => Ok(Async::Ready(None)),
Body::Empty => Ok(Async::Ready(None)),
#[project]
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
#[project]
match self.project() {
Body::None => Poll::Ready(None),
Body::Empty => Poll::Ready(None),
Body::Bytes(ref mut bin) => {
let len = bin.len();
if len == 0 {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(mem::replace(bin, Bytes::new()))))
Poll::Ready(Some(Ok(mem::replace(bin, Bytes::new()))))
}
}
Body::Message(ref mut body) => body.poll_next(),
Body::Message(ref mut body) => Pin::new(body.as_mut()).poll_next(cx),
}
}
}
@@ -182,7 +218,7 @@ impl PartialEq for Body {
}
impl fmt::Debug for Body {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
Body::None => write!(f, "Body::None"),
Body::Empty => write!(f, "Body::Empty"),
@@ -218,7 +254,7 @@ impl From<String> for Body {
impl<'a> From<&'a String> for Body {
fn from(s: &'a String) -> Body {
Body::Bytes(Bytes::from(AsRef::<[u8]>::as_ref(&s)))
Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
}
}
@@ -234,9 +270,15 @@ impl From<BytesMut> for Body {
}
}
impl From<serde_json::Value> for Body {
fn from(v: serde_json::Value) -> Body {
Body::Bytes(v.to_string().into())
}
}
impl<S> From<SizedStream<S>> for Body
where
S: Stream<Item = Bytes, Error = Error> + 'static,
S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
{
fn from(s: SizedStream<S>) -> Body {
Body::from_message(s)
@@ -245,7 +287,7 @@ where
impl<S, E> From<BodyStream<S, E>> for Body
where
S: Stream<Item = Bytes, Error = E> + 'static,
S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
E: Into<Error> + 'static,
{
fn from(s: BodyStream<S, E>) -> Body {
@@ -258,11 +300,14 @@ impl MessageBody for Bytes {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(mem::replace(self, Bytes::new()))))
Poll::Ready(Some(Ok(mem::replace(self.get_mut(), Bytes::new()))))
}
}
}
@@ -272,12 +317,15 @@ impl MessageBody for BytesMut {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(
mem::replace(self, BytesMut::new()).freeze(),
Poll::Ready(Some(Ok(
mem::replace(self.get_mut(), BytesMut::new()).freeze()
)))
}
}
@@ -288,44 +336,34 @@ impl MessageBody for &'static str {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(Bytes::from_static(
mem::replace(self, "").as_ref(),
Poll::Ready(Some(Ok(Bytes::from_static(
mem::replace(self.get_mut(), "").as_ref(),
))))
}
}
}
impl MessageBody for &'static [u8] {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
if self.is_empty() {
Ok(Async::Ready(None))
} else {
Ok(Async::Ready(Some(Bytes::from_static(mem::replace(
self, b"",
)))))
}
}
}
impl MessageBody for Vec<u8> {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(Bytes::from(mem::replace(
self,
Poll::Ready(Some(Ok(Bytes::from(mem::replace(
self.get_mut(),
Vec::new(),
)))))
}
@@ -337,12 +375,15 @@ impl MessageBody for String {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(Bytes::from(
mem::replace(self, String::new()).into_bytes(),
Poll::Ready(Some(Ok(Bytes::from(
mem::replace(self.get_mut(), String::new()).into_bytes(),
))))
}
}
@@ -350,14 +391,16 @@ impl MessageBody for String {
/// Type represent streaming body.
/// Response does not contain `content-length` header and appropriate transfer encoding is used.
pub struct BodyStream<S, E> {
#[pin_project]
pub struct BodyStream<S: Unpin, E> {
#[pin]
stream: S,
_t: PhantomData<E>,
}
impl<S, E> BodyStream<S, E>
where
S: Stream<Item = Bytes, Error = E>,
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
pub fn new(stream: S) -> Self {
@@ -370,28 +413,45 @@ where
impl<S, E> MessageBody for BodyStream<S, E>
where
S: Stream<Item = Bytes, Error = E>,
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
fn size(&self) -> BodySize {
BodySize::Stream
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
self.stream.poll().map_err(std::convert::Into::into)
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`BodyStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
let mut stream = self.project().stream;
loop {
let stream = stream.as_mut();
return Poll::Ready(match ready!(stream.poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
opt => opt.map(|res| res.map_err(Into::into)),
});
}
}
}
/// Type represent streaming body. This body implementation should be used
/// if total size of stream is known. Data get sent as is without using transfer encoding.
pub struct SizedStream<S> {
#[pin_project]
pub struct SizedStream<S: Unpin> {
size: u64,
#[pin]
stream: S,
}
impl<S> SizedStream<S>
where
S: Stream<Item = Bytes, Error = Error>,
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
pub fn new(size: u64, stream: S) -> Self {
SizedStream { size, stream }
@@ -400,20 +460,38 @@ where
impl<S> MessageBody for SizedStream<S>
where
S: Stream<Item = Bytes, Error = Error>,
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
fn size(&self) -> BodySize {
BodySize::Sized64(self.size)
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
self.stream.poll()
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`SizedStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
let mut stream: Pin<&mut S> = self.project().stream;
loop {
let stream = stream.as_mut();
return Poll::Ready(match ready!(stream.poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
val => val,
});
}
}
}
#[cfg(test)]
mod tests {
use super::*;
use futures::stream;
use futures_util::future::poll_fn;
use futures_util::pin_mut;
impl Body {
pub(crate) fn get_ref(&self) -> &[u8] {
@@ -433,21 +511,24 @@ mod tests {
}
}
#[test]
fn test_static_str() {
#[actix_rt::test]
async fn test_static_str() {
assert_eq!(Body::from("").size(), BodySize::Sized(0));
assert_eq!(Body::from("test").size(), BodySize::Sized(4));
assert_eq!(Body::from("test").get_ref(), b"test");
assert_eq!("test".size(), BodySize::Sized(4));
assert_eq!(
"test".poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_static_bytes() {
#[actix_rt::test]
async fn test_static_bytes() {
assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
assert_eq!(
@@ -455,82 +536,95 @@ mod tests {
BodySize::Sized(4)
);
assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
let sb = Bytes::from(&b"test"[..]);
pin_mut!(sb);
assert_eq!((&b"test"[..]).size(), BodySize::Sized(4));
assert_eq!(sb.size(), BodySize::Sized(4));
assert_eq!(
(&b"test"[..]).poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_vec() {
#[actix_rt::test]
async fn test_vec() {
assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
let test_vec = Vec::from("test");
pin_mut!(test_vec);
assert_eq!(Vec::from("test").size(), BodySize::Sized(4));
assert_eq!(test_vec.size(), BodySize::Sized(4));
assert_eq!(
Vec::from("test").poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| test_vec.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_bytes() {
let mut b = Bytes::from("test");
#[actix_rt::test]
async fn test_bytes() {
let b = Bytes::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin_mut!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
b.poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_bytes_mut() {
let mut b = BytesMut::from("test");
#[actix_rt::test]
async fn test_bytes_mut() {
let b = BytesMut::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin_mut!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
b.poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_string() {
let mut b = "test".to_owned();
#[actix_rt::test]
async fn test_string() {
let b = "test".to_owned();
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
assert_eq!(Body::from(&b).get_ref(), b"test");
pin_mut!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
b.poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_unit() {
#[actix_rt::test]
async fn test_unit() {
assert_eq!(().size(), BodySize::Empty);
assert_eq!(().poll_next().unwrap(), Async::Ready(None));
assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
.await
.is_none());
}
#[test]
fn test_box() {
let mut val = Box::new(());
#[actix_rt::test]
async fn test_box() {
let val = Box::new(());
pin_mut!(val);
assert_eq!(val.size(), BodySize::Empty);
assert_eq!(val.poll_next().unwrap(), Async::Ready(None));
assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
}
#[test]
fn test_body_eq() {
#[actix_rt::test]
async fn test_body_eq() {
assert!(Body::None == Body::None);
assert!(Body::None != Body::Empty);
assert!(Body::Empty == Body::Empty);
@@ -542,10 +636,116 @@ mod tests {
assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
}
#[test]
fn test_body_debug() {
#[actix_rt::test]
async fn test_body_debug() {
assert!(format!("{:?}", Body::None).contains("Body::None"));
assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains("1"));
}
#[actix_rt::test]
async fn test_serde_json() {
use serde_json::json;
assert_eq!(
Body::from(serde_json::Value::String("test".into())).size(),
BodySize::Sized(6)
);
assert_eq!(
Body::from(json!({"test-key":"test-value"})).size(),
BodySize::Sized(25)
);
}
mod body_stream {
use super::*;
//use futures::task::noop_waker;
//use futures::stream::once;
#[actix_rt::test]
async fn skips_empty_chunks() {
let body = BodyStream::new(stream::iter(
["1", "", "2"]
.iter()
.map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
));
pin_mut!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
/* Now it does not compile as it should
#[actix_rt::test]
async fn move_pinned_pointer() {
let (sender, receiver) = futures::channel::oneshot::channel();
let mut body_stream = Ok(BodyStream::new(once(async {
let x = Box::new(0i32);
let y = &x;
receiver.await.unwrap();
let _z = **y;
Ok::<_, ()>(Bytes::new())
})));
let waker = noop_waker();
let mut context = Context::from_waker(&waker);
pin_mut!(body_stream);
let _ = body_stream.as_mut().unwrap().poll_next(&mut context);
sender.send(()).unwrap();
let _ = std::mem::replace(&mut body_stream, Err([0; 32])).unwrap().poll_next(&mut context);
}*/
}
mod sized_stream {
use super::*;
#[actix_rt::test]
async fn skips_empty_chunks() {
let body = SizedStream::new(
2,
stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
);
pin_mut!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
}
#[actix_rt::test]
async fn test_body_casting() {
let mut body = String::from("hello cast");
let resp_body: &mut dyn MessageBody = &mut body;
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast");
let body = &mut resp_body.downcast_mut::<String>().unwrap();
body.push_str("!");
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast!");
let not_body = resp_body.downcast_ref::<()>();
assert!(not_body.is_none());
}
}

View File

@@ -1,10 +1,9 @@
use std::fmt;
use std::marker::PhantomData;
use std::rc::Rc;
use std::{fmt, net};
use actix_codec::Framed;
use actix_server_config::ServerConfig as SrvConfig;
use actix_service::{IntoNewService, NewService, Service};
use actix_service::{IntoServiceFactory, Service, ServiceFactory};
use crate::body::MessageBody;
use crate::config::{KeepAlive, ServiceConfig};
@@ -24,17 +23,20 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
keep_alive: KeepAlive,
client_timeout: u64,
client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
expect: X,
upgrade: Option<U>,
on_connect: Option<Rc<Fn(&T) -> Box<dyn DataFactory>>>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, S)>,
}
impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler<T>>
where
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
<S::Service as Service>::Future: 'static,
{
/// Create instance of `ServiceConfigBuilder`
pub fn new() -> Self {
@@ -42,6 +44,8 @@ where
keep_alive: KeepAlive::Timeout(5),
client_timeout: 5000,
client_disconnect: 0,
secure: false,
local_addr: None,
expect: ExpectHandler,
upgrade: None,
on_connect: None,
@@ -52,19 +56,18 @@ where
impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
where
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
<S::Service as Service>::Future: 'static,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<
Config = SrvConfig,
Request = (Request, Framed<T, Codec>),
Response = (),
>,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
/// Set server keep-alive setting.
///
@@ -74,6 +77,18 @@ where
self
}
/// Set connection secure state
pub fn secure(mut self) -> Self {
self.secure = true;
self
}
/// Set the local address that this service is bound to.
pub fn local_addr(mut self, addr: net::SocketAddr) -> Self {
self.local_addr = Some(addr);
self
}
/// Set server client timeout in milliseconds for first request.
///
/// Defines a timeout for reading client request header. If a client does not transmit
@@ -108,16 +123,19 @@ where
/// request will be forwarded to main service.
pub fn expect<F, X1>(self, expect: F) -> HttpServiceBuilder<T, S, X1, U>
where
F: IntoNewService<X1>,
X1: NewService<Config = SrvConfig, Request = Request, Response = Request>,
F: IntoServiceFactory<X1>,
X1: ServiceFactory<Config = (), Request = Request, Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
<X1::Service as Service>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect,
expect: expect.into_new_service(),
secure: self.secure,
local_addr: self.local_addr,
expect: expect.into_factory(),
upgrade: self.upgrade,
on_connect: self.on_connect,
_t: PhantomData,
@@ -130,21 +148,24 @@ where
/// and this service get called with original request and framed object.
pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
where
F: IntoNewService<U1>,
U1: NewService<
Config = SrvConfig,
F: IntoServiceFactory<U1>,
U1: ServiceFactory<
Config = (),
Request = (Request, Framed<T, Codec>),
Response = (),
>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
<U1::Service as Service>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect,
secure: self.secure,
local_addr: self.local_addr,
expect: self.expect,
upgrade: Some(upgrade.into_new_service()),
upgrade: Some(upgrade.into_factory()),
on_connect: self.on_connect,
_t: PhantomData,
}
@@ -164,10 +185,10 @@ where
}
/// Finish service configuration and create *http service* for HTTP/1 protocol.
pub fn h1<F, P, B>(self, service: F) -> H1Service<T, P, S, B, X, U>
pub fn h1<F, B>(self, service: F) -> H1Service<T, S, B, X, U>
where
B: MessageBody + 'static,
F: IntoNewService<S>,
B: MessageBody,
F: IntoServiceFactory<S>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
@@ -176,47 +197,53 @@ where
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
H1Service::with_config(cfg, service.into_new_service())
H1Service::with_config(cfg, service.into_factory())
.expect(self.expect)
.upgrade(self.upgrade)
.on_connect(self.on_connect)
}
/// Finish service configuration and create *http service* for HTTP/2 protocol.
pub fn h2<F, P, B>(self, service: F) -> H2Service<T, P, S, B>
pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
where
B: MessageBody + 'static,
F: IntoNewService<S>,
S::Error: Into<Error>,
F: IntoServiceFactory<S>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
H2Service::with_config(cfg, service.into_new_service())
H2Service::with_config(cfg, service.into_factory()).on_connect(self.on_connect)
}
/// Finish service configuration and create `HttpService` instance.
pub fn finish<F, P, B>(self, service: F) -> HttpService<T, P, S, B, X, U>
pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
where
B: MessageBody + 'static,
F: IntoNewService<S>,
S::Error: Into<Error>,
F: IntoServiceFactory<S>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
HttpService::with_config(cfg, service.into_new_service())
HttpService::with_config(cfg, service.into_factory())
.expect(self.expect)
.upgrade(self.upgrade)
.on_connect(self.on_connect)

View File

@@ -0,0 +1,39 @@
use std::time::Duration;
// These values are taken from hyper/src/proto/h2/client.rs
const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2mb
const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1mb
/// Connector configuration
#[derive(Clone)]
pub(crate) struct ConnectorConfig {
pub(crate) timeout: Duration,
pub(crate) conn_lifetime: Duration,
pub(crate) conn_keep_alive: Duration,
pub(crate) disconnect_timeout: Option<Duration>,
pub(crate) limit: usize,
pub(crate) conn_window_size: u32,
pub(crate) stream_window_size: u32,
}
impl Default for ConnectorConfig {
fn default() -> Self {
Self {
timeout: Duration::from_secs(1),
conn_lifetime: Duration::from_secs(75),
conn_keep_alive: Duration::from_secs(15),
disconnect_timeout: Some(Duration::from_millis(3000)),
limit: 100,
conn_window_size: DEFAULT_H2_CONN_WINDOW,
stream_window_size: DEFAULT_H2_STREAM_WINDOW,
}
}
}
impl ConnectorConfig {
pub(crate) fn no_disconnect_timeout(&self) -> Self {
let mut res = self.clone();
res.disconnect_timeout = None;
res
}
}

View File

@@ -1,14 +1,16 @@
use std::{fmt, io, time};
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, io, mem, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use bytes::{Buf, Bytes};
use futures::future::{err, Either, Future, FutureResult};
use futures::Poll;
use futures_util::future::{err, Either, Future, FutureExt, LocalBoxFuture, Ready};
use h2::client::SendRequest;
use pin_project::{pin_project, project};
use crate::body::MessageBody;
use crate::h1::ClientCodec;
use crate::message::{RequestHead, ResponseHead};
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::Payload;
use super::error::SendRequestError;
@@ -21,25 +23,24 @@ pub(crate) enum ConnectionType<Io> {
}
pub trait Connection {
type Io: AsyncRead + AsyncWrite;
type Future: Future<Item = (ResponseHead, Payload), Error = SendRequestError>;
type Io: AsyncRead + AsyncWrite + Unpin;
type Future: Future<Output = Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol;
/// Send request and body
fn send_request<B: MessageBody + 'static>(
fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
self,
head: RequestHead,
head: H,
body: B,
) -> Self::Future;
type TunnelFuture: Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
Error = SendRequestError,
Output = Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>;
/// Send request, returns Response and Framed
fn open_tunnel(self, head: RequestHead) -> Self::TunnelFuture;
fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture;
}
pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
@@ -62,7 +63,7 @@ impl<T> fmt::Debug for IoConnection<T>
where
T: fmt::Debug,
{
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match self.io {
Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
@@ -71,7 +72,7 @@ where
}
}
impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
pub(crate) fn new(
io: ConnectionType<T>,
created: time::Instant,
@@ -91,10 +92,11 @@ impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
impl<T> Connection for IoConnection<T>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Io = T;
type Future = Box<Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
type Future =
LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol {
match self.io {
@@ -104,44 +106,36 @@ where
}
}
fn send_request<B: MessageBody + 'static>(
fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
mut self,
head: RequestHead,
head: H,
body: B,
) -> Self::Future {
match self.io.take().unwrap() {
ConnectionType::H1(io) => Box::new(h1proto::send_request(
io,
head,
body,
self.created,
self.pool,
)),
ConnectionType::H2(io) => Box::new(h2proto::send_request(
io,
head,
body,
self.created,
self.pool,
)),
ConnectionType::H1(io) => {
h1proto::send_request(io, head.into(), body, self.created, self.pool)
.boxed_local()
}
ConnectionType::H2(io) => {
h2proto::send_request(io, head.into(), body, self.created, self.pool)
.boxed_local()
}
}
}
type TunnelFuture = Either<
Box<
Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
Error = SendRequestError,
LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>,
>,
FutureResult<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
Ready<Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>>,
>;
/// Send request, returns Response and Framed
fn open_tunnel(mut self, head: RequestHead) -> Self::TunnelFuture {
fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
match self.io.take().unwrap() {
ConnectionType::H1(io) => {
Either::A(Box::new(h1proto::open_tunnel(io, head)))
Either::Left(h1proto::open_tunnel(io, head.into()).boxed_local())
}
ConnectionType::H2(io) => {
if let Some(mut pool) = self.pool.take() {
@@ -151,7 +145,7 @@ where
None,
));
}
Either::B(err(SendRequestError::TunnelNotSupported))
Either::Right(err(SendRequestError::TunnelNotSupported))
}
}
}
@@ -165,11 +159,12 @@ pub(crate) enum EitherConnection<A, B> {
impl<A, B> Connection for EitherConnection<A, B>
where
A: AsyncRead + AsyncWrite + 'static,
B: AsyncRead + AsyncWrite + 'static,
A: AsyncRead + AsyncWrite + Unpin + 'static,
B: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Io = EitherIo<A, B>;
type Future = Box<Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
type Future =
LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol {
match self {
@@ -178,9 +173,9 @@ where
}
}
fn send_request<RB: MessageBody + 'static>(
fn send_request<RB: MessageBody + 'static, H: Into<RequestHeadType>>(
self,
head: RequestHead,
head: H,
body: RB,
) -> Self::Future {
match self {
@@ -189,44 +184,30 @@ where
}
}
type TunnelFuture = Box<
Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
Error = SendRequestError,
>,
type TunnelFuture = LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>;
/// Send request, returns Response and Framed
fn open_tunnel(self, head: RequestHead) -> Self::TunnelFuture {
fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
match self {
EitherConnection::A(con) => Box::new(
con.open_tunnel(head)
.map(|(head, framed)| (head, framed.map_io(EitherIo::A))),
),
EitherConnection::B(con) => Box::new(
con.open_tunnel(head)
.map(|(head, framed)| (head, framed.map_io(EitherIo::B))),
),
EitherConnection::A(con) => con
.open_tunnel(head)
.map(|res| res.map(|(head, framed)| (head, framed.map_io(EitherIo::A))))
.boxed_local(),
EitherConnection::B(con) => con
.open_tunnel(head)
.map(|res| res.map(|(head, framed)| (head, framed.map_io(EitherIo::B))))
.boxed_local(),
}
}
}
#[pin_project]
pub enum EitherIo<A, B> {
A(A),
B(B),
}
impl<A, B> io::Read for EitherIo<A, B>
where
A: io::Read,
B: io::Read,
{
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
match self {
EitherIo::A(ref mut val) => val.read(buf),
EitherIo::B(ref mut val) => val.read(buf),
}
}
A(#[pin] A),
B(#[pin] B),
}
impl<A, B> AsyncRead for EitherIo<A, B>
@@ -234,7 +215,23 @@ where
A: AsyncRead,
B: AsyncRead,
{
unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool {
#[project]
fn poll_read(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut [u8],
) -> Poll<io::Result<usize>> {
#[project]
match self.project() {
EitherIo::A(val) => val.poll_read(cx, buf),
EitherIo::B(val) => val.poll_read(cx, buf),
}
}
unsafe fn prepare_uninitialized_buffer(
&self,
buf: &mut [mem::MaybeUninit<u8>],
) -> bool {
match self {
EitherIo::A(ref val) => val.prepare_uninitialized_buffer(buf),
EitherIo::B(ref val) => val.prepare_uninitialized_buffer(buf),
@@ -242,45 +239,58 @@ where
}
}
impl<A, B> io::Write for EitherIo<A, B>
where
A: io::Write,
B: io::Write,
{
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
match self {
EitherIo::A(ref mut val) => val.write(buf),
EitherIo::B(ref mut val) => val.write(buf),
}
}
fn flush(&mut self) -> io::Result<()> {
match self {
EitherIo::A(ref mut val) => val.flush(),
EitherIo::B(ref mut val) => val.flush(),
}
}
}
impl<A, B> AsyncWrite for EitherIo<A, B>
where
A: AsyncWrite,
B: AsyncWrite,
{
fn shutdown(&mut self) -> Poll<(), io::Error> {
match self {
EitherIo::A(ref mut val) => val.shutdown(),
EitherIo::B(ref mut val) => val.shutdown(),
#[project]
fn poll_write(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
#[project]
match self.project() {
EitherIo::A(val) => val.poll_write(cx, buf),
EitherIo::B(val) => val.poll_write(cx, buf),
}
}
fn write_buf<U: Buf>(&mut self, buf: &mut U) -> Poll<usize, io::Error>
#[project]
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
#[project]
match self.project() {
EitherIo::A(val) => val.poll_flush(cx),
EitherIo::B(val) => val.poll_flush(cx),
}
}
#[project]
fn poll_shutdown(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
#[project]
match self.project() {
EitherIo::A(val) => val.poll_shutdown(cx),
EitherIo::B(val) => val.poll_shutdown(cx),
}
}
#[project]
fn poll_write_buf<U: Buf>(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut U,
) -> Poll<Result<usize, io::Error>>
where
Self: Sized,
{
match self {
EitherIo::A(ref mut val) => val.write_buf(buf),
EitherIo::B(ref mut val) => val.write_buf(buf),
#[project]
match self.project() {
EitherIo::A(val) => val.poll_write_buf(cx, buf),
EitherIo::B(val) => val.poll_write_buf(cx, buf),
}
}
}

View File

@@ -6,20 +6,33 @@ use actix_codec::{AsyncRead, AsyncWrite};
use actix_connect::{
default_connector, Connect as TcpConnect, Connection as TcpConnection,
};
use actix_service::{apply_fn, Service, ServiceExt};
use actix_rt::net::TcpStream;
use actix_service::{apply_fn, Service};
use actix_utils::timeout::{TimeoutError, TimeoutService};
use http::Uri;
use tokio_tcp::TcpStream;
use super::config::ConnectorConfig;
use super::connection::Connection;
use super::error::ConnectError;
use super::pool::{ConnectionPool, Protocol};
use super::Connect;
#[cfg(feature = "ssl")]
use openssl::ssl::SslConnector;
#[cfg(feature = "openssl")]
use actix_connect::ssl::openssl::SslConnector as OpensslConnector;
#[cfg(not(feature = "ssl"))]
#[cfg(feature = "rustls")]
use actix_connect::ssl::rustls::ClientConfig;
#[cfg(feature = "rustls")]
use std::sync::Arc;
#[cfg(any(feature = "openssl", feature = "rustls"))]
enum SslConnector {
#[cfg(feature = "openssl")]
Openssl(OpensslConnector),
#[cfg(feature = "rustls")]
Rustls(Arc<ClientConfig>),
}
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
type SslConnector = ();
/// Manages http client network connectivity
@@ -36,17 +49,17 @@ type SslConnector = ();
/// ```
pub struct Connector<T, U> {
connector: T,
timeout: Duration,
conn_lifetime: Duration,
conn_keep_alive: Duration,
disconnect_timeout: Duration,
limit: usize,
config: ConnectorConfig,
#[allow(dead_code)]
ssl: SslConnector,
_t: PhantomData<U>,
}
trait Io: AsyncRead + AsyncWrite + Unpin {}
impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
impl Connector<(), ()> {
#[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
pub fn new() -> Connector<
impl Service<
Request = TcpConnect<Uri>,
@@ -55,39 +68,54 @@ impl Connector<(), ()> {
> + Clone,
TcpStream,
> {
let ssl = {
#[cfg(feature = "ssl")]
{
use openssl::ssl::SslMethod;
let mut ssl = SslConnector::builder(SslMethod::tls()).unwrap();
let _ = ssl
.set_alpn_protos(b"\x02h2\x08http/1.1")
.map_err(|e| error!("Can not set alpn protocol: {:?}", e));
ssl.build()
}
#[cfg(not(feature = "ssl"))]
{}
};
Connector {
ssl,
ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
connector: default_connector(),
timeout: Duration::from_secs(1),
conn_lifetime: Duration::from_secs(75),
conn_keep_alive: Duration::from_secs(15),
disconnect_timeout: Duration::from_millis(3000),
limit: 100,
config: ConnectorConfig::default(),
_t: PhantomData,
}
}
// Build Ssl connector with openssl, based on supplied alpn protocols
#[cfg(feature = "openssl")]
fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
use actix_connect::ssl::openssl::SslMethod;
use bytes::{BufMut, BytesMut};
let mut alpn = BytesMut::with_capacity(20);
for proto in protocols.iter() {
alpn.put_u8(proto.len() as u8);
alpn.put(proto.as_slice());
}
let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
let _ = ssl
.set_alpn_protos(&alpn)
.map_err(|e| error!("Can not set alpn protocol: {:?}", e));
SslConnector::Openssl(ssl.build())
}
// Build Ssl connector with rustls, based on supplied alpn protocols
#[cfg(all(not(feature = "openssl"), feature = "rustls"))]
fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
let mut config = ClientConfig::new();
config.set_protocols(&protocols);
config
.root_store
.add_server_trust_anchors(&actix_tls::rustls::TLS_SERVER_ROOTS);
SslConnector::Rustls(Arc::new(config))
}
// ssl turned off, provides empty ssl connector
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
}
impl<T, U> Connector<T, U> {
/// Use custom connector.
pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
where
U1: AsyncRead + AsyncWrite + fmt::Debug,
U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
T1: Service<
Request = TcpConnect<Uri>,
Response = TcpConnection<Uri, U1>,
@@ -96,11 +124,7 @@ impl<T, U> Connector<T, U> {
{
Connector {
connector,
timeout: self.timeout,
conn_lifetime: self.conn_lifetime,
conn_keep_alive: self.conn_keep_alive,
disconnect_timeout: self.disconnect_timeout,
limit: self.limit,
config: self.config,
ssl: self.ssl,
_t: PhantomData,
}
@@ -109,7 +133,7 @@ impl<T, U> Connector<T, U> {
impl<T, U> Connector<T, U>
where
U: AsyncRead + AsyncWrite + fmt::Debug + 'static,
U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
T: Service<
Request = TcpConnect<Uri>,
Response = TcpConnection<Uri, U>,
@@ -120,14 +144,52 @@ where
/// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
/// Set to 1 second by default.
pub fn timeout(mut self, timeout: Duration) -> Self {
self.timeout = timeout;
self.config.timeout = timeout;
self
}
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
/// Use custom `SslConnector` instance.
pub fn ssl(mut self, connector: SslConnector) -> Self {
self.ssl = connector;
pub fn ssl(mut self, connector: OpensslConnector) -> Self {
self.ssl = SslConnector::Openssl(connector);
self
}
#[cfg(feature = "rustls")]
pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
self.ssl = SslConnector::Rustls(connector);
self
}
/// Maximum supported http major version
/// Supported versions http/1.1, http/2
pub fn max_http_version(mut self, val: http::Version) -> Self {
let versions = match val {
http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
http::Version::HTTP_2 => vec![b"h2".to_vec(), b"http/1.1".to_vec()],
_ => {
unimplemented!("actix-http:client: supported versions http/1.1, http/2")
}
};
self.ssl = Connector::build_ssl(versions);
self
}
/// Indicates the initial window size (in octets) for
/// HTTP2 stream-level flow control for received data.
///
/// The default value is 65,535 and is good for APIs, but not for big objects.
pub fn initial_window_size(mut self, size: u32) -> Self {
self.config.stream_window_size = size;
self
}
/// Indicates the initial window size (in octets) for
/// HTTP2 connection-level flow control for received data.
///
/// The default value is 65,535 and is good for APIs, but not for big objects.
pub fn initial_connection_window_size(mut self, size: u32) -> Self {
self.config.conn_window_size = size;
self
}
@@ -136,7 +198,7 @@ where
/// If limit is 0, the connector has no limit.
/// The default limit size is 100.
pub fn limit(mut self, limit: usize) -> Self {
self.limit = limit;
self.config.limit = limit;
self
}
@@ -147,7 +209,7 @@ where
/// exceeds this period, the connection is closed.
/// Default keep-alive period is 15 seconds.
pub fn conn_keep_alive(mut self, dur: Duration) -> Self {
self.conn_keep_alive = dur;
self.config.conn_keep_alive = dur;
self
}
@@ -157,7 +219,7 @@ where
/// until it is closed regardless of keep-alive period.
/// Default lifetime period is 75 seconds.
pub fn conn_lifetime(mut self, dur: Duration) -> Self {
self.conn_lifetime = dur;
self.config.conn_lifetime = dur;
self
}
@@ -170,7 +232,7 @@ where
///
/// By default disconnect timeout is set to 3000 milliseconds.
pub fn disconnect_timeout(mut self, dur: Duration) -> Self {
self.disconnect_timeout = dur;
self.config.disconnect_timeout = Some(dur);
self
}
@@ -181,10 +243,10 @@ where
self,
) -> impl Service<Request = Connect, Response = impl Connection, Error = ConnectError>
+ Clone {
#[cfg(not(feature = "ssl"))]
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
{
let connector = TimeoutService::new(
self.timeout,
self.config.timeout,
apply_fn(self.connector, |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
@@ -199,42 +261,66 @@ where
connect_impl::InnerConnector {
tcp_pool: ConnectionPool::new(
connector,
self.conn_lifetime,
self.conn_keep_alive,
None,
self.limit,
self.config.no_disconnect_timeout(),
),
}
}
#[cfg(feature = "ssl")]
#[cfg(any(feature = "openssl", feature = "rustls"))]
{
const H2: &[u8] = b"h2";
use actix_connect::ssl::OpensslConnector;
#[cfg(feature = "openssl")]
use actix_connect::ssl::openssl::OpensslConnector;
#[cfg(feature = "rustls")]
use actix_connect::ssl::rustls::{RustlsConnector, Session};
use actix_service::{boxed::service, pipeline};
let ssl_service = TimeoutService::new(
self.timeout,
self.config.timeout,
pipeline(
apply_fn(self.connector.clone(), |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from)
.and_then(
OpensslConnector::service(self.ssl)
.map_err(ConnectError::from)
.map_err(ConnectError::from),
)
.and_then(match self.ssl {
#[cfg(feature = "openssl")]
SslConnector::Openssl(ssl) => service(
OpensslConnector::service(ssl)
.map(|stream| {
let sock = stream.into_parts().0;
let h2 = sock
.get_ref()
.ssl()
.selected_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
.unwrap_or(false);
if h2 {
(sock, Protocol::Http2)
(Box::new(sock) as Box<dyn Io>, Protocol::Http2)
} else {
(sock, Protocol::Http1)
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
}
})
.map_err(ConnectError::from),
),
#[cfg(feature = "rustls")]
SslConnector::Rustls(ssl) => service(
RustlsConnector::service(ssl)
.map_err(ConnectError::from)
.map(|stream| {
let sock = stream.into_parts().0;
let h2 = sock
.get_ref()
.1
.get_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
.unwrap_or(false);
if h2 {
(Box::new(sock) as Box<dyn Io>, Protocol::Http2)
} else {
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
}
}),
),
}),
)
.map_err(|e| match e {
TimeoutError::Service(e) => e,
@@ -242,8 +328,8 @@ where
});
let tcp_service = TimeoutService::new(
self.timeout,
apply_fn(self.connector.clone(), |msg: Connect, srv| {
self.config.timeout,
apply_fn(self.connector, |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from)
@@ -257,36 +343,27 @@ where
connect_impl::InnerConnector {
tcp_pool: ConnectionPool::new(
tcp_service,
self.conn_lifetime,
self.conn_keep_alive,
None,
self.limit,
),
ssl_pool: ConnectionPool::new(
ssl_service,
self.conn_lifetime,
self.conn_keep_alive,
Some(self.disconnect_timeout),
self.limit,
self.config.no_disconnect_timeout(),
),
ssl_pool: ConnectionPool::new(ssl_service, self.config),
}
}
}
}
#[cfg(not(feature = "ssl"))]
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
mod connect_impl {
use futures::future::{err, Either, FutureResult};
use futures::Poll;
use std::task::{Context, Poll};
use futures_util::future::{err, Either, Ready};
use super::*;
use crate::client::connection::IoConnection;
pub(crate) struct InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
pub(crate) tcp_pool: ConnectionPool<T, Io>,
@@ -294,9 +371,8 @@ mod connect_impl {
impl<T, Io> Clone for InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
fn clone(&self) -> Self {
@@ -308,9 +384,8 @@ mod connect_impl {
impl<T, Io> Service for InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
type Request = Connect;
@@ -318,38 +393,41 @@ mod connect_impl {
type Error = ConnectError;
type Future = Either<
<ConnectionPool<T, Io> as Service>::Future,
FutureResult<IoConnection<Io>, ConnectError>,
Ready<Result<IoConnection<Io>, ConnectError>>,
>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.tcp_pool.poll_ready()
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready(cx)
}
fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => {
Either::B(err(ConnectError::SslIsNotSupported))
Either::Right(err(ConnectError::SslIsNotSupported))
}
_ => Either::A(self.tcp_pool.call(req)),
_ => Either::Left(self.tcp_pool.call(req)),
}
}
}
}
#[cfg(feature = "ssl")]
#[cfg(any(feature = "openssl", feature = "rustls"))]
mod connect_impl {
use std::future::Future;
use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use futures::future::{Either, FutureResult};
use futures::{Async, Future, Poll};
use futures_core::ready;
use futures_util::future::Either;
use super::*;
use crate::client::connection::EitherConnection;
pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>,
{
@@ -359,13 +437,11 @@ mod connect_impl {
impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
fn clone(&self) -> Self {
@@ -378,53 +454,47 @@ mod connect_impl {
impl<T1, T2, Io1, Io2> Service for InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
type Request = Connect;
type Response = EitherConnection<Io1, Io2>;
type Error = ConnectError;
type Future = Either<
FutureResult<Self::Response, Self::Error>,
Either<
InnerConnectorResponseA<T1, Io1, Io2>,
InnerConnectorResponseB<T2, Io1, Io2>,
>,
>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.tcp_pool.poll_ready()
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready(cx)
}
fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => {
Either::B(Either::B(InnerConnectorResponseB {
Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
fut: self.ssl_pool.call(req),
_t: PhantomData,
}))
}
_ => Either::B(Either::A(InnerConnectorResponseA {
}),
_ => Either::Left(InnerConnectorResponseA {
fut: self.tcp_pool.call(req),
_t: PhantomData,
})),
}),
}
}
}
#[pin_project::pin_project]
pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
#[pin]
fut: <ConnectionPool<T, Io1> as Service>::Future,
_t: PhantomData<Io2>,
}
@@ -432,29 +502,28 @@ mod connect_impl {
impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
where
T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Item = EitherConnection<Io1, Io2>;
type Error = ConnectError;
type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.fut.poll()? {
Async::NotReady => Ok(Async::NotReady),
Async::Ready(res) => Ok(Async::Ready(EitherConnection::A(res))),
}
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
Poll::Ready(
ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
.map(EitherConnection::A),
)
}
}
#[pin_project::pin_project]
pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
where
Io2: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
#[pin]
fut: <ConnectionPool<T, Io2> as Service>::Future,
_t: PhantomData<Io1>,
}
@@ -462,19 +531,17 @@ mod connect_impl {
impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
where
T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Item = EitherConnection<Io1, Io2>;
type Error = ConnectError;
type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.fut.poll()? {
Async::NotReady => Ok(Async::NotReady),
Async::Ready(res) => Ok(Async::Ready(EitherConnection::B(res))),
}
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
Poll::Ready(
ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
.map(EitherConnection::B),
)
}
}
}

View File

@@ -1,14 +1,13 @@
use std::io;
use actix_connect::resolver::ResolveError;
use derive_more::{Display, From};
use trust_dns_resolver::error::ResolveError;
#[cfg(feature = "ssl")]
use openssl::ssl::{Error as SslError, HandshakeError};
#[cfg(feature = "openssl")]
use actix_connect::ssl::openssl::{HandshakeError, SslError};
use crate::error::{Error, ParseError, ResponseError};
use crate::http::Error as HttpError;
use crate::response::Response;
use crate::http::{Error as HttpError, StatusCode};
/// A set of errors that can occur while connecting to an HTTP host
#[derive(Debug, Display, From)]
@@ -18,10 +17,15 @@ pub enum ConnectError {
SslIsNotSupported,
/// SSL error
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
#[display(fmt = "{}", _0)]
SslError(SslError),
/// SSL Handshake error
#[cfg(feature = "openssl")]
#[display(fmt = "{}", _0)]
SslHandshakeError(String),
/// Failed to resolve the hostname
#[display(fmt = "Failed resolving hostname: {}", _0)]
Resolver(ResolveError),
@@ -63,14 +67,10 @@ impl From<actix_connect::ConnectError> for ConnectError {
}
}
#[cfg(feature = "ssl")]
impl<T> From<HandshakeError<T>> for ConnectError {
#[cfg(feature = "openssl")]
impl<T: std::fmt::Debug> From<HandshakeError<T>> for ConnectError {
fn from(err: HandshakeError<T>) -> ConnectError {
match err {
HandshakeError::SetupFailure(stack) => SslError::from(stack).into(),
HandshakeError::Failure(stream) => stream.into_error().into(),
HandshakeError::WouldBlock(stream) => stream.into_error().into(),
}
ConnectError::SslHandshakeError(format!("{:?}", err))
}
}
@@ -117,14 +117,33 @@ pub enum SendRequestError {
/// Convert `SendRequestError` to a server `Response`
impl ResponseError for SendRequestError {
fn error_response(&self) -> Response {
fn status_code(&self) -> StatusCode {
match *self {
SendRequestError::Connect(ConnectError::Timeout) => {
Response::GatewayTimeout()
StatusCode::GATEWAY_TIMEOUT
}
SendRequestError::Connect(_) => Response::BadGateway(),
_ => Response::InternalServerError(),
SendRequestError::Connect(_) => StatusCode::BAD_REQUEST,
_ => StatusCode::INTERNAL_SERVER_ERROR,
}
}
}
/// A set of errors that can occur during freezing a request
#[derive(Debug, Display, From)]
pub enum FreezeRequestError {
/// Invalid URL
#[display(fmt = "Invalid URL: {}", _0)]
Url(InvalidUrl),
/// Http error
#[display(fmt = "{}", _0)]
Http(HttpError),
}
impl From<FreezeRequestError> for SendRequestError {
fn from(e: FreezeRequestError) -> Self {
match e {
FreezeRequestError::Url(e) => e.into(),
FreezeRequestError::Http(e) => e.into(),
}
.into()
}
}

View File

@@ -1,15 +1,20 @@
use std::io::Write;
use std::{io, time};
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{io, mem, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use bytes::{BufMut, Bytes, BytesMut};
use futures::future::{ok, Either};
use futures::{Async, Future, Poll, Sink, Stream};
use bytes::buf::BufMutExt;
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use futures_util::future::poll_fn;
use futures_util::{pin_mut, SinkExt, StreamExt};
use crate::error::PayloadError;
use crate::h1;
use crate::header::HeaderMap;
use crate::http::header::{IntoHeaderValue, HOST};
use crate::message::{RequestHead, ResponseHead};
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::{Payload, PayloadStream};
use super::connection::{ConnectionLifetime, ConnectionType, IoConnection};
@@ -17,34 +22,40 @@ use super::error::{ConnectError, SendRequestError};
use super::pool::Acquired;
use crate::body::{BodySize, MessageBody};
pub(crate) fn send_request<T, B>(
pub(crate) async fn send_request<T, B>(
io: T,
mut head: RequestHead,
mut head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
) -> Result<(ResponseHead, Payload), SendRequestError>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
B: MessageBody,
{
// set request host header
if !head.headers.contains_key(HOST) {
if let Some(host) = head.uri.host() {
if !head.as_ref().headers.contains_key(HOST)
&& !head.extra_headers().iter().any(|h| h.contains_key(HOST))
{
if let Some(host) = head.as_ref().uri.host() {
let mut wrt = BytesMut::with_capacity(host.len() + 5).writer();
let _ = match head.uri.port_u16() {
let _ = match head.as_ref().uri.port_u16() {
None | Some(80) | Some(443) => write!(wrt, "{}", host),
Some(port) => write!(wrt, "{}:{}", host, port),
};
match wrt.get_mut().take().freeze().try_into() {
Ok(value) => {
head.headers.insert(HOST, value);
match wrt.get_mut().split().freeze().try_into() {
Ok(value) => match head {
RequestHeadType::Owned(ref mut head) => {
head.headers.insert(HOST, value)
}
Err(e) => {
log::error!("Can not set HOST header {}", e);
RequestHeadType::Rc(_, ref mut extra_headers) => {
let headers = extra_headers.get_or_insert(HeaderMap::new());
headers.insert(HOST, value)
}
},
Err(e) => log::error!("Can not set HOST header {}", e),
}
}
}
@@ -55,68 +66,100 @@ where
io: Some(io),
};
let len = body.size();
// create Framed and send request
let mut framed = Framed::new(io, h1::ClientCodec::default());
framed.send((head, body.size()).into()).await?;
// create Framed and send reqest
Framed::new(io, h1::ClientCodec::default())
.send((head, len).into())
.from_err()
// send request body
.and_then(move |framed| match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
Either::A(ok(framed))
}
_ => Either::B(SendBody::new(body, framed)),
})
match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => (),
_ => send_body(body, &mut framed).await?,
};
// read response and init read body
.and_then(|framed| {
framed
.into_future()
.map_err(|(e, _)| SendRequestError::from(e))
.and_then(|(item, framed)| {
if let Some(res) = item {
let res = framed.into_future().await;
let (head, framed) = if let (Some(result), framed) = res {
let item = result.map_err(SendRequestError::from)?;
(item, framed)
} else {
return Err(SendRequestError::from(ConnectError::Disconnected));
};
match framed.get_codec().message_type() {
h1::MessageType::None => {
let force_close = !framed.get_codec().keepalive();
release_connection(framed, force_close);
Ok((res, Payload::None))
Ok((head, Payload::None))
}
_ => {
let pl: PayloadStream = Box::new(PlStream::new(framed));
Ok((res, pl.into()))
let pl: PayloadStream = PlStream::new(framed).boxed_local();
Ok((head, pl.into()))
}
}
} else {
Err(ConnectError::Disconnected.into())
}
})
})
}
pub(crate) fn open_tunnel<T>(
pub(crate) async fn open_tunnel<T>(
io: T,
head: RequestHead,
) -> impl Future<Item = (ResponseHead, Framed<T, h1::ClientCodec>), Error = SendRequestError>
head: RequestHeadType,
) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
// create Framed and send reqest
Framed::new(io, h1::ClientCodec::default())
.send((head, BodySize::None).into())
.from_err()
// create Framed and send request
let mut framed = Framed::new(io, h1::ClientCodec::default());
framed.send((head, BodySize::None).into()).await?;
// read response
.and_then(|framed| {
framed
.into_future()
.map_err(|(e, _)| SendRequestError::from(e))
.and_then(|(head, framed)| {
if let Some(head) = head {
if let (Some(result), framed) = framed.into_future().await {
let head = result.map_err(SendRequestError::from)?;
Ok((head, framed))
} else {
Err(SendRequestError::from(ConnectError::Disconnected))
}
}
/// send request body to the peer
pub(crate) async fn send_body<I, B>(
body: B,
framed: &mut Framed<I, h1::ClientCodec>,
) -> Result<(), SendRequestError>
where
I: ConnectionLifetime,
B: MessageBody,
{
let mut eof = false;
pin_mut!(body);
while !eof {
while !eof && !framed.is_write_buf_full() {
match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
Some(result) => {
framed.write(h1::Message::Chunk(Some(result?)))?;
}
None => {
eof = true;
framed.write(h1::Message::Chunk(None))?;
}
}
}
if !framed.is_write_buf_empty() {
poll_fn(|cx| match framed.flush(cx) {
Poll::Ready(Ok(_)) => Poll::Ready(Ok(())),
Poll::Ready(Err(err)) => Poll::Ready(Err(err)),
Poll::Pending => {
if !framed.is_write_buf_full() {
Poll::Ready(Ok(()))
} else {
Poll::Pending
}
}
})
})
.await?;
}
}
SinkExt::flush(framed).await?;
Ok(())
}
#[doc(hidden)]
@@ -127,7 +170,10 @@ pub struct H1Connection<T> {
pool: Option<Acquired<T>>,
}
impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T> {
impl<T> ConnectionLifetime for H1Connection<T>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
/// Close connection
fn close(&mut self) {
if let Some(mut pool) = self.pool.take() {
@@ -155,98 +201,44 @@ impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T>
}
}
impl<T: AsyncRead + AsyncWrite + 'static> io::Read for H1Connection<T> {
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
self.io.as_mut().unwrap().read(buf)
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
unsafe fn prepare_uninitialized_buffer(
&self,
buf: &mut [mem::MaybeUninit<u8>],
) -> bool {
self.io.as_ref().unwrap().prepare_uninitialized_buffer(buf)
}
fn poll_read(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut [u8],
) -> Poll<io::Result<usize>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
}
}
impl<T: AsyncRead + AsyncWrite + 'static> AsyncRead for H1Connection<T> {}
impl<T: AsyncRead + AsyncWrite + 'static> io::Write for H1Connection<T> {
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
self.io.as_mut().unwrap().write(buf)
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
fn poll_write(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
}
fn flush(&mut self) -> io::Result<()> {
self.io.as_mut().unwrap().flush()
}
}
impl<T: AsyncRead + AsyncWrite + 'static> AsyncWrite for H1Connection<T> {
fn shutdown(&mut self) -> Poll<(), io::Error> {
self.io.as_mut().unwrap().shutdown()
}
}
/// Future responsible for sending request body to the peer
pub(crate) struct SendBody<I, B> {
body: Option<B>,
framed: Option<Framed<I, h1::ClientCodec>>,
flushed: bool,
}
impl<I, B> SendBody<I, B>
where
I: AsyncRead + AsyncWrite + 'static,
B: MessageBody,
{
pub(crate) fn new(body: B, framed: Framed<I, h1::ClientCodec>) -> Self {
SendBody {
body: Some(body),
framed: Some(framed),
flushed: true,
}
}
}
impl<I, B> Future for SendBody<I, B>
where
I: ConnectionLifetime,
B: MessageBody,
{
type Item = Framed<I, h1::ClientCodec>;
type Error = SendRequestError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let mut body_ready = true;
loop {
while body_ready
&& self.body.is_some()
&& !self.framed.as_ref().unwrap().is_write_buf_full()
{
match self.body.as_mut().unwrap().poll_next()? {
Async::Ready(item) => {
// check if body is done
if item.is_none() {
let _ = self.body.take();
}
self.flushed = false;
self.framed
.as_mut()
.unwrap()
.force_send(h1::Message::Chunk(item))?;
break;
}
Async::NotReady => body_ready = false,
}
fn poll_flush(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
}
if !self.flushed {
match self.framed.as_mut().unwrap().poll_complete()? {
Async::Ready(_) => {
self.flushed = true;
continue;
}
Async::NotReady => return Ok(Async::NotReady),
}
}
if self.body.is_none() {
return Ok(Async::Ready(self.framed.take().unwrap()));
}
return Ok(Async::NotReady);
}
fn poll_shutdown(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Result<(), io::Error>> {
Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
}
}
@@ -263,23 +255,27 @@ impl<Io: ConnectionLifetime> PlStream<Io> {
}
impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
type Item = Bytes;
type Error = PayloadError;
type Item = Result<Bytes, PayloadError>;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
match self.framed.as_mut().unwrap().poll()? {
Async::NotReady => Ok(Async::NotReady),
Async::Ready(Some(chunk)) => {
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
let this = self.get_mut();
match this.framed.as_mut().unwrap().next_item(cx)? {
Poll::Pending => Poll::Pending,
Poll::Ready(Some(chunk)) => {
if let Some(chunk) = chunk {
Ok(Async::Ready(Some(chunk)))
Poll::Ready(Some(Ok(chunk)))
} else {
let framed = self.framed.take().unwrap();
let framed = this.framed.take().unwrap();
let force_close = !framed.get_codec().keepalive();
release_connection(framed, force_close);
Ok(Async::Ready(None))
Poll::Ready(None)
}
}
Async::Ready(None) => Ok(Async::Ready(None)),
Poll::Ready(None) => Poll::Ready(None),
}
}
}

View File

@@ -1,46 +1,50 @@
use std::convert::TryFrom;
use std::future::Future;
use std::time;
use actix_codec::{AsyncRead, AsyncWrite};
use bytes::Bytes;
use futures::future::{err, Either};
use futures::{Async, Future, Poll};
use h2::{client::SendRequest, SendStream};
use futures_util::future::poll_fn;
use futures_util::pin_mut;
use h2::{
client::{Builder, Connection, SendRequest},
SendStream,
};
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING};
use http::{request::Request, HttpTryFrom, Method, Version};
use http::{request::Request, Method, Version};
use crate::body::{BodySize, MessageBody};
use crate::message::{RequestHead, ResponseHead};
use crate::header::HeaderMap;
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::Payload;
use super::config::ConnectorConfig;
use super::connection::{ConnectionType, IoConnection};
use super::error::SendRequestError;
use super::pool::Acquired;
pub(crate) fn send_request<T, B>(
io: SendRequest<Bytes>,
head: RequestHead,
pub(crate) async fn send_request<T, B>(
mut io: SendRequest<Bytes>,
head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
) -> Result<(ResponseHead, Payload), SendRequestError>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
B: MessageBody,
{
trace!("Sending client request: {:?} {:?}", head, body.size());
let head_req = head.method == Method::HEAD;
let head_req = head.as_ref().method == Method::HEAD;
let length = body.size();
let eof = match length {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => true,
_ => false,
};
io.ready()
.map_err(SendRequestError::from)
.and_then(move |mut io| {
let mut req = Request::new(());
*req.uri_mut() = head.uri;
*req.method_mut() = head.method;
*req.uri_mut() = head.as_ref().uri.clone();
*req.method_mut() = head.as_ref().method.clone();
*req.version_mut() = Version::HTTP_2;
let mut skip_len = true;
@@ -66,8 +70,25 @@ where
),
};
// Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
let (head, extra_headers) = match head {
RequestHeadType::Owned(head) => (RequestHeadType::Owned(head), HeaderMap::new()),
RequestHeadType::Rc(head, extra_headers) => (
RequestHeadType::Rc(head, None),
extra_headers.unwrap_or_else(HeaderMap::new),
),
};
// merging headers from head and extra headers.
let headers = head
.as_ref()
.headers
.iter()
.filter(|(name, _)| !extra_headers.contains_key(*name))
.chain(extra_headers.iter());
// copy headers
for (key, value) in head.headers.iter() {
for (key, value) in headers {
match *key {
CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
CONTENT_LENGTH if skip_len => continue,
@@ -77,30 +98,27 @@ where
req.headers_mut().append(key, value.clone());
}
match io.send_request(req, eof) {
Ok((res, send)) => {
let res = poll_fn(|cx| io.poll_ready(cx)).await;
if let Err(e) = res {
release(io, pool, created, e.is_io());
return Err(SendRequestError::from(e));
}
let resp = match io.send_request(req, eof) {
Ok((fut, send)) => {
release(io, pool, created, false);
if !eof {
Either::A(Either::B(
SendBody {
body,
send,
buf: None,
}
.and_then(move |_| res.map_err(SendRequestError::from)),
))
} else {
Either::B(res.map_err(SendRequestError::from))
send_body(body, send).await?;
}
fut.await.map_err(SendRequestError::from)?
}
Err(e) => {
release(io, pool, created, e.is_io());
Either::A(Either::A(err(e.into())))
return Err(e.into());
}
}
})
.and_then(move |resp| {
};
let (parts, body) = resp.into_parts();
let payload = if head_req { Payload::None } else { body.into() };
@@ -108,66 +126,57 @@ where
head.version = parts.version;
head.headers = parts.headers.into();
Ok((head, payload))
})
.from_err()
}
struct SendBody<B: MessageBody> {
async fn send_body<B: MessageBody>(
body: B,
send: SendStream<Bytes>,
buf: Option<Bytes>,
}
impl<B: MessageBody> Future for SendBody<B> {
type Item = ();
type Error = SendRequestError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
mut send: SendStream<Bytes>,
) -> Result<(), SendRequestError> {
let mut buf = None;
pin_mut!(body);
loop {
if self.buf.is_none() {
match self.body.poll_next() {
Ok(Async::Ready(Some(buf))) => {
self.send.reserve_capacity(buf.len());
self.buf = Some(buf);
if buf.is_none() {
match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
Some(Ok(b)) => {
send.reserve_capacity(b.len());
buf = Some(b);
}
Ok(Async::Ready(None)) => {
if let Err(e) = self.send.send_data(Bytes::new(), true) {
Some(Err(e)) => return Err(e.into()),
None => {
if let Err(e) = send.send_data(Bytes::new(), true) {
return Err(e.into());
}
self.send.reserve_capacity(0);
return Ok(Async::Ready(()));
send.reserve_capacity(0);
return Ok(());
}
Ok(Async::NotReady) => return Ok(Async::NotReady),
Err(e) => return Err(e.into()),
}
}
match self.send.poll_capacity() {
Ok(Async::NotReady) => return Ok(Async::NotReady),
Ok(Async::Ready(None)) => return Ok(Async::Ready(())),
Ok(Async::Ready(Some(cap))) => {
let mut buf = self.buf.take().unwrap();
let len = buf.len();
let bytes = buf.split_to(std::cmp::min(cap, len));
match poll_fn(|cx| send.poll_capacity(cx)).await {
None => return Ok(()),
Some(Ok(cap)) => {
let b = buf.as_mut().unwrap();
let len = b.len();
let bytes = b.split_to(std::cmp::min(cap, len));
if let Err(e) = self.send.send_data(bytes, false) {
if let Err(e) = send.send_data(bytes, false) {
return Err(e.into());
} else {
if !buf.is_empty() {
self.send.reserve_capacity(buf.len());
self.buf = Some(buf);
if !b.is_empty() {
send.reserve_capacity(b.len());
} else {
buf = None;
}
continue;
}
}
Err(e) => return Err(e.into()),
}
Some(Err(e)) => return Err(e.into()),
}
}
}
// release SendRequest object
fn release<T: AsyncRead + AsyncWrite + 'static>(
fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
io: SendRequest<Bytes>,
pool: Option<Acquired<T>>,
created: time::Instant,
@@ -181,3 +190,18 @@ fn release<T: AsyncRead + AsyncWrite + 'static>(
}
}
}
pub(crate) fn handshake<Io>(
io: Io,
config: &ConnectorConfig,
) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
let mut builder = Builder::new();
builder
.initial_window_size(config.stream_window_size)
.initial_connection_window_size(config.conn_window_size)
.enable_push(false);
builder.handshake(io)
}

View File

@@ -1,6 +1,7 @@
//! Http client api
use http::Uri;
mod config;
mod connection;
mod connector;
mod error;
@@ -10,7 +11,7 @@ mod pool;
pub use self::connection::Connection;
pub use self::connector::Connector;
pub use self::error::{ConnectError, InvalidUrl, SendRequestError};
pub use self::error::{ConnectError, FreezeRequestError, InvalidUrl, SendRequestError};
pub use self::pool::Protocol;
#[derive(Clone)]

View File

@@ -1,25 +1,28 @@
use std::cell::RefCell;
use std::collections::VecDeque;
use std::io;
use std::future::Future;
use std::pin::Pin;
use std::rc::Rc;
use std::task::{Context, Poll};
use std::time::{Duration, Instant};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::time::{delay_for, Delay};
use actix_service::Service;
use actix_utils::{oneshot, task::LocalWaker};
use bytes::Bytes;
use futures::future::{err, ok, Either, FutureResult};
use futures::task::AtomicTask;
use futures::unsync::oneshot;
use futures::{Async, Future, Poll};
use h2::client::{handshake, Handshake};
use hashbrown::HashMap;
use futures_util::future::{poll_fn, FutureExt, LocalBoxFuture};
use fxhash::FxHashMap;
use h2::client::{Connection, SendRequest};
use http::uri::Authority;
use indexmap::IndexSet;
use pin_project::pin_project;
use slab::Slab;
use tokio_timer::{sleep, Delay};
use super::config::ConnectorConfig;
use super::connection::{ConnectionType, IoConnection};
use super::error::ConnectError;
use super::h2proto::handshake;
use super::Connect;
#[derive(Clone, Copy, PartialEq)]
@@ -41,37 +44,24 @@ impl From<Authority> for Key {
}
/// Connections pool
pub(crate) struct ConnectionPool<T, Io: AsyncRead + AsyncWrite + 'static>(
T,
Rc<RefCell<Inner<Io>>>,
);
pub(crate) struct ConnectionPool<T, Io: 'static>(Rc<RefCell<T>>, Rc<RefCell<Inner<Io>>>);
impl<T, Io> ConnectionPool<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
pub(crate) fn new(
connector: T,
conn_lifetime: Duration,
conn_keep_alive: Duration,
disconnect_timeout: Option<Duration>,
limit: usize,
) -> Self {
pub(crate) fn new(connector: T, config: ConnectorConfig) -> Self {
ConnectionPool(
connector,
Rc::new(RefCell::new(connector)),
Rc::new(RefCell::new(Inner {
conn_lifetime,
conn_keep_alive,
disconnect_timeout,
limit,
config,
acquired: 0,
waiters: Slab::new(),
waiters_queue: IndexSet::new(),
available: HashMap::new(),
task: None,
available: FxHashMap::default(),
waker: LocalWaker::new(),
})),
)
}
@@ -79,8 +69,7 @@ where
impl<T, Io> Clone for ConnectionPool<T, Io>
where
T: Clone,
Io: AsyncRead + AsyncWrite + 'static,
Io: 'static,
{
fn clone(&self) -> Self {
ConnectionPool(self.0.clone(), self.1.clone())
@@ -89,86 +78,118 @@ where
impl<T, Io> Service for ConnectionPool<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
type Request = Connect;
type Response = IoConnection<Io>;
type Error = ConnectError;
type Future = Either<
FutureResult<Self::Response, Self::Error>,
Either<WaitForConnection<Io>, OpenConnection<T::Future, Io>>,
>;
type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.0.poll_ready()
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.0.poll_ready(cx)
}
fn call(&mut self, req: Connect) -> Self::Future {
let key = if let Some(authority) = req.uri.authority_part() {
// start support future
actix_rt::spawn(ConnectorPoolSupport {
connector: self.0.clone(),
inner: self.1.clone(),
});
let mut connector = self.0.clone();
let inner = self.1.clone();
let fut = async move {
let key = if let Some(authority) = req.uri.authority() {
authority.clone().into()
} else {
return Either::A(err(ConnectError::Unresolverd));
return Err(ConnectError::Unresolverd);
};
// acquire connection
match self.1.as_ref().borrow_mut().acquire(&key) {
match poll_fn(|cx| Poll::Ready(inner.borrow_mut().acquire(&key, cx))).await {
Acquire::Acquired(io, created) => {
// use existing connection
return Either::A(ok(IoConnection::new(
return Ok(IoConnection::new(
io,
created,
Some(Acquired(key, Some(self.1.clone()))),
)));
Some(Acquired(key, Some(inner))),
));
}
Acquire::Available => {
// open new connection
return Either::B(Either::B(OpenConnection::new(
key,
self.1.clone(),
self.0.call(req),
)));
}
_ => (),
}
// open tcp connection
let (io, proto) = connector.call(req).await?;
let config = inner.borrow().config.clone();
let guard = OpenGuard::new(key, inner);
if proto == Protocol::Http1 {
Ok(IoConnection::new(
ConnectionType::H1(io),
Instant::now(),
Some(guard.consume()),
))
} else {
let (snd, connection) = handshake(io, &config).await?;
actix_rt::spawn(connection.map(|_| ()));
Ok(IoConnection::new(
ConnectionType::H2(snd),
Instant::now(),
Some(guard.consume()),
))
}
}
_ => {
// connection is not available, wait
let (rx, token, support) = self.1.as_ref().borrow_mut().wait_for(req);
let (rx, token) = inner.borrow_mut().wait_for(req);
// start support future
if !support {
self.1.as_ref().borrow_mut().task = Some(AtomicTask::new());
tokio_current_thread::spawn(ConnectorPoolSupport {
connector: self.0.clone(),
inner: self.1.clone(),
})
let guard = WaiterGuard::new(key, token, inner);
let res = match rx.await {
Err(_) => Err(ConnectError::Disconnected),
Ok(res) => res,
};
guard.consume();
res
}
}
};
Either::B(Either::A(WaitForConnection {
rx,
key,
token,
inner: Some(self.1.clone()),
}))
fut.boxed_local()
}
}
#[doc(hidden)]
pub struct WaitForConnection<Io>
struct WaiterGuard<Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
key: Key,
token: usize,
rx: oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
inner: Option<Rc<RefCell<Inner<Io>>>>,
}
impl<Io> Drop for WaitForConnection<Io>
impl<Io> WaiterGuard<Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn new(key: Key, token: usize, inner: Rc<RefCell<Inner<Io>>>) -> Self {
Self {
key,
token,
inner: Some(inner),
}
}
fn consume(mut self) {
let _ = self.inner.take();
}
}
impl<Io> Drop for WaiterGuard<Io>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn drop(&mut self) {
if let Some(i) = self.inner.take() {
@@ -179,113 +200,43 @@ where
}
}
impl<Io> Future for WaitForConnection<Io>
struct OpenGuard<Io>
where
Io: AsyncRead + AsyncWrite,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Item = IoConnection<Io>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.rx.poll() {
Ok(Async::Ready(item)) => match item {
Err(err) => Err(err),
Ok(conn) => {
let _ = self.inner.take();
Ok(Async::Ready(conn))
}
},
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(_) => {
let _ = self.inner.take();
Err(ConnectError::Disconnected)
}
}
}
}
#[doc(hidden)]
pub struct OpenConnection<F, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
{
fut: F,
key: Key,
h2: Option<Handshake<Io, Bytes>>,
inner: Option<Rc<RefCell<Inner<Io>>>>,
}
impl<F, Io> OpenConnection<F, Io>
impl<Io> OpenGuard<Io>
where
F: Future<Item = (Io, Protocol), Error = ConnectError>,
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>, fut: F) -> Self {
OpenConnection {
fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>) -> Self {
Self {
key,
fut,
inner: Some(inner),
h2: None,
}
}
fn consume(mut self) -> Acquired<Io> {
Acquired(self.key.clone(), self.inner.take())
}
}
impl<F, Io> Drop for OpenConnection<F, Io>
impl<Io> Drop for OpenGuard<Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn drop(&mut self) {
if let Some(inner) = self.inner.take() {
let mut inner = inner.as_ref().borrow_mut();
if let Some(i) = self.inner.take() {
let mut inner = i.as_ref().borrow_mut();
inner.release();
inner.check_availibility();
}
}
}
impl<F, Io> Future for OpenConnection<F, Io>
where
F: Future<Item = (Io, Protocol), Error = ConnectError>,
Io: AsyncRead + AsyncWrite,
{
type Item = IoConnection<Io>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
if let Some(ref mut h2) = self.h2 {
return match h2.poll() {
Ok(Async::Ready((snd, connection))) => {
tokio_current_thread::spawn(connection.map_err(|_| ()));
Ok(Async::Ready(IoConnection::new(
ConnectionType::H2(snd),
Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())),
)))
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(e) => Err(e.into()),
};
}
match self.fut.poll() {
Err(err) => Err(err),
Ok(Async::Ready((io, proto))) => {
if proto == Protocol::Http1 {
Ok(Async::Ready(IoConnection::new(
ConnectionType::H1(io),
Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())),
)))
} else {
self.h2 = Some(handshake(io));
self.poll()
}
}
Ok(Async::NotReady) => Ok(Async::NotReady),
}
}
}
enum Acquire<T> {
Acquired(ConnectionType<T>, Instant),
Available,
@@ -299,18 +250,17 @@ struct AvailableConnection<Io> {
}
pub(crate) struct Inner<Io> {
conn_lifetime: Duration,
conn_keep_alive: Duration,
disconnect_timeout: Option<Duration>,
limit: usize,
config: ConnectorConfig,
acquired: usize,
available: HashMap<Key, VecDeque<AvailableConnection<Io>>>,
waiters: Slab<(
available: FxHashMap<Key, VecDeque<AvailableConnection<Io>>>,
waiters: Slab<
Option<(
Connect,
oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
)>,
>,
waiters_queue: IndexSet<(Key, usize)>,
task: Option<AtomicTask>,
waker: LocalWaker,
}
impl<Io> Inner<Io> {
@@ -324,13 +274,13 @@ impl<Io> Inner<Io> {
fn release_waiter(&mut self, key: &Key, token: usize) {
self.waiters.remove(token);
self.waiters_queue.remove(&(key.clone(), token));
let _ = self.waiters_queue.shift_remove(&(key.clone(), token));
}
}
impl<Io> Inner<Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
/// connection is not available, wait
fn wait_for(
@@ -339,22 +289,21 @@ where
) -> (
oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
usize,
bool,
) {
let (tx, rx) = oneshot::channel();
let key: Key = connect.uri.authority_part().unwrap().clone().into();
let key: Key = connect.uri.authority().unwrap().clone().into();
let entry = self.waiters.vacant_entry();
let token = entry.key();
entry.insert((connect, tx));
entry.insert(Some((connect, tx)));
assert!(self.waiters_queue.insert((key, token)));
(rx, token, self.task.is_some())
(rx, token)
}
fn acquire(&mut self, key: &Key) -> Acquire<Io> {
fn acquire(&mut self, key: &Key, cx: &mut Context<'_>) -> Acquire<Io> {
// check limits
if self.limit > 0 && self.acquired >= self.limit {
if self.config.limit > 0 && self.acquired >= self.config.limit {
return Acquire::NotAvailable;
}
@@ -366,33 +315,31 @@ where
let now = Instant::now();
while let Some(conn) = connections.pop_back() {
// check if it still usable
if (now - conn.used) > self.conn_keep_alive
|| (now - conn.created) > self.conn_lifetime
if (now - conn.used) > self.config.conn_keep_alive
|| (now - conn.created) > self.config.conn_lifetime
{
if let Some(timeout) = self.disconnect_timeout {
if let Some(timeout) = self.config.disconnect_timeout {
if let ConnectionType::H1(io) = conn.io {
tokio_current_thread::spawn(CloseConnection::new(
io, timeout,
))
actix_rt::spawn(CloseConnection::new(io, timeout))
}
}
} else {
let mut io = conn.io;
let mut buf = [0; 2];
if let ConnectionType::H1(ref mut s) = io {
match s.read(&mut buf) {
Err(ref e) if e.kind() == io::ErrorKind::WouldBlock => (),
Ok(n) if n > 0 => {
if let Some(timeout) = self.disconnect_timeout {
match Pin::new(s).poll_read(cx, &mut buf) {
Poll::Pending => (),
Poll::Ready(Ok(n)) if n > 0 => {
if let Some(timeout) = self.config.disconnect_timeout {
if let ConnectionType::H1(io) = io {
tokio_current_thread::spawn(
CloseConnection::new(io, timeout),
)
actix_rt::spawn(CloseConnection::new(
io, timeout,
))
}
}
continue;
}
Ok(_) | Err(_) => continue,
_ => continue,
}
}
return Acquire::Acquired(io, conn.created);
@@ -417,17 +364,17 @@ where
fn release_close(&mut self, io: ConnectionType<Io>) {
self.acquired -= 1;
if let Some(timeout) = self.disconnect_timeout {
if let Some(timeout) = self.config.disconnect_timeout {
if let ConnectionType::H1(io) = io {
tokio_current_thread::spawn(CloseConnection::new(io, timeout))
actix_rt::spawn(CloseConnection::new(io, timeout))
}
}
self.check_availibility();
}
fn check_availibility(&self) {
if !self.waiters_queue.is_empty() && self.acquired < self.limit {
self.task.as_ref().map(|t| t.notify());
if !self.waiters_queue.is_empty() && self.acquired < self.config.limit {
self.waker.wake();
}
}
}
@@ -439,37 +386,39 @@ struct CloseConnection<T> {
impl<T> CloseConnection<T>
where
T: AsyncWrite,
T: AsyncWrite + Unpin,
{
fn new(io: T, timeout: Duration) -> Self {
CloseConnection {
io,
timeout: sleep(timeout),
timeout: delay_for(timeout),
}
}
}
impl<T> Future for CloseConnection<T>
where
T: AsyncWrite,
T: AsyncWrite + Unpin,
{
type Item = ();
type Error = ();
type Output = ();
fn poll(&mut self) -> Poll<(), ()> {
match self.timeout.poll() {
Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
Ok(Async::NotReady) => match self.io.shutdown() {
Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
Ok(Async::NotReady) => Ok(Async::NotReady),
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<()> {
let this = self.get_mut();
match Pin::new(&mut this.timeout).poll(cx) {
Poll::Ready(_) => Poll::Ready(()),
Poll::Pending => match Pin::new(&mut this.io).poll_shutdown(cx) {
Poll::Ready(_) => Poll::Ready(()),
Poll::Pending => Poll::Pending,
},
}
}
}
#[pin_project]
struct ConnectorPoolSupport<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
connector: T,
inner: Rc<RefCell<Inner<Io>>>,
@@ -477,16 +426,17 @@ where
impl<T, Io> Future for ConnectorPoolSupport<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>,
T::Future: 'static,
{
type Item = ();
type Error = ();
type Output = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let mut inner = self.inner.as_ref().borrow_mut();
inner.task.as_ref().unwrap().register();
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.project();
let mut inner = this.inner.as_ref().borrow_mut();
inner.waker.register(cx.waker());
// check waiters
loop {
@@ -497,74 +447,91 @@ where
break;
}
};
match inner.acquire(&key) {
if inner.waiters.get(token).unwrap().is_none() {
continue;
}
match inner.acquire(&key, cx) {
Acquire::NotAvailable => break,
Acquire::Acquired(io, created) => {
let (_, tx) = inner.waiters.remove(token);
let tx = inner.waiters.get_mut(token).unwrap().take().unwrap().1;
if let Err(conn) = tx.send(Ok(IoConnection::new(
io,
created,
Some(Acquired(key.clone(), Some(self.inner.clone()))),
Some(Acquired(key.clone(), Some(this.inner.clone()))),
))) {
let (io, created) = conn.unwrap().into_inner();
inner.release_conn(&key, io, created);
}
}
Acquire::Available => {
let (connect, tx) = inner.waiters.remove(token);
let (connect, tx) =
inner.waiters.get_mut(token).unwrap().take().unwrap();
OpenWaitingConnection::spawn(
key.clone(),
tx,
self.inner.clone(),
self.connector.call(connect),
this.inner.clone(),
this.connector.call(connect),
inner.config.clone(),
);
}
}
let _ = inner.waiters_queue.swap_remove_index(0);
}
Ok(Async::NotReady)
Poll::Pending
}
}
#[pin_project::pin_project(PinnedDrop)]
struct OpenWaitingConnection<F, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
#[pin]
fut: F,
key: Key,
h2: Option<Handshake<Io, Bytes>>,
h2: Option<
LocalBoxFuture<
'static,
Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>,
>,
>,
rx: Option<oneshot::Sender<Result<IoConnection<Io>, ConnectError>>>,
inner: Option<Rc<RefCell<Inner<Io>>>>,
config: ConnectorConfig,
}
impl<F, Io> OpenWaitingConnection<F, Io>
where
F: Future<Item = (Io, Protocol), Error = ConnectError> + 'static,
Io: AsyncRead + AsyncWrite + 'static,
F: Future<Output = Result<(Io, Protocol), ConnectError>> + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn spawn(
key: Key,
rx: oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
inner: Rc<RefCell<Inner<Io>>>,
fut: F,
config: ConnectorConfig,
) {
tokio_current_thread::spawn(OpenWaitingConnection {
actix_rt::spawn(OpenWaitingConnection {
key,
fut,
h2: None,
rx: Some(rx),
inner: Some(inner),
config,
})
}
}
impl<F, Io> Drop for OpenWaitingConnection<F, Io>
#[pin_project::pinned_drop]
impl<F, Io> PinnedDrop for OpenWaitingConnection<F, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn drop(&mut self) {
if let Some(inner) = self.inner.take() {
fn drop(self: Pin<&mut Self>) {
if let Some(inner) = self.project().inner.take() {
let mut inner = inner.as_ref().borrow_mut();
inner.release();
inner.check_availibility();
@@ -574,36 +541,60 @@ where
impl<F, Io> Future for OpenWaitingConnection<F, Io>
where
F: Future<Item = (Io, Protocol), Error = ConnectError>,
Io: AsyncRead + AsyncWrite,
F: Future<Output = Result<(Io, Protocol), ConnectError>>,
Io: AsyncRead + AsyncWrite + Unpin,
{
type Item = ();
type Error = ();
type Output = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.fut.poll() {
Err(err) => {
let _ = self.inner.take();
if let Some(rx) = self.rx.take() {
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.as_mut().project();
if let Some(ref mut h2) = this.h2 {
return match Pin::new(h2).poll(cx) {
Poll::Ready(Ok((snd, connection))) => {
actix_rt::spawn(connection.map(|_| ()));
let rx = this.rx.take().unwrap();
let _ = rx.send(Ok(IoConnection::new(
ConnectionType::H2(snd),
Instant::now(),
Some(Acquired(this.key.clone(), this.inner.take())),
)));
Poll::Ready(())
}
Poll::Pending => Poll::Pending,
Poll::Ready(Err(err)) => {
let _ = this.inner.take();
if let Some(rx) = this.rx.take() {
let _ = rx.send(Err(ConnectError::H2(err)));
}
Poll::Ready(())
}
};
}
match this.fut.poll(cx) {
Poll::Ready(Err(err)) => {
let _ = this.inner.take();
if let Some(rx) = this.rx.take() {
let _ = rx.send(Err(err));
}
Err(())
Poll::Ready(())
}
Ok(Async::Ready((io, proto))) => {
Poll::Ready(Ok((io, proto))) => {
if proto == Protocol::Http1 {
let rx = self.rx.take().unwrap();
let rx = this.rx.take().unwrap();
let _ = rx.send(Ok(IoConnection::new(
ConnectionType::H1(io),
Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())),
Some(Acquired(this.key.clone(), this.inner.take())),
)));
Ok(Async::Ready(()))
Poll::Ready(())
} else {
self.h2 = Some(handshake(io));
self.poll()
*this.h2 = Some(handshake(io, this.config).boxed_local());
self.poll(cx)
}
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Poll::Pending => Poll::Pending,
}
}
}
@@ -612,7 +603,7 @@ pub(crate) struct Acquired<T>(Key, Option<Rc<RefCell<Inner<T>>>>);
impl<T> Acquired<T>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
pub(crate) fn close(&mut self, conn: IoConnection<T>) {
if let Some(inner) = self.1.take() {

View File

@@ -0,0 +1,40 @@
use std::cell::RefCell;
use std::rc::Rc;
use std::task::{Context, Poll};
use actix_service::Service;
#[doc(hidden)]
/// Service that allows to turn non-clone service to a service with `Clone` impl
///
/// # Panics
/// CloneableService might panic with some creative use of thread local storage.
/// See https://github.com/actix/actix-web/issues/1295 for example
pub(crate) struct CloneableService<T: Service>(Rc<RefCell<T>>);
impl<T: Service> CloneableService<T> {
pub(crate) fn new(service: T) -> Self {
Self(Rc::new(RefCell::new(service)))
}
}
impl<T: Service> Clone for CloneableService<T> {
fn clone(&self) -> Self {
Self(self.0.clone())
}
}
impl<T: Service> Service for CloneableService<T> {
type Request = T::Request;
type Response = T::Response;
type Error = T::Error;
type Future = T::Future;
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.0.borrow_mut().poll_ready(cx)
}
fn call(&mut self, req: T::Request) -> Self::Future {
self.0.borrow_mut().call(req)
}
}

View File

@@ -1,13 +1,13 @@
use std::cell::UnsafeCell;
use std::fmt;
use std::cell::Cell;
use std::fmt::Write;
use std::rc::Rc;
use std::time::{Duration, Instant};
use std::time::Duration;
use std::{fmt, net};
use actix_rt::time::{delay_for, delay_until, Delay, Instant};
use bytes::BytesMut;
use futures::{future, Future};
use time;
use tokio_timer::{sleep, Delay};
use futures_util::{future, FutureExt};
use time::OffsetDateTime;
// "Sun, 06 Nov 1994 08:49:37 GMT".len()
const DATE_VALUE_LENGTH: usize = 29;
@@ -47,6 +47,8 @@ struct Inner {
client_timeout: u64,
client_disconnect: u64,
ka_enabled: bool,
secure: bool,
local_addr: Option<std::net::SocketAddr>,
timer: DateService,
}
@@ -58,7 +60,7 @@ impl Clone for ServiceConfig {
impl Default for ServiceConfig {
fn default() -> Self {
Self::new(KeepAlive::Timeout(5), 0, 0)
Self::new(KeepAlive::Timeout(5), 0, 0, false, None)
}
}
@@ -68,6 +70,8 @@ impl ServiceConfig {
keep_alive: KeepAlive,
client_timeout: u64,
client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
) -> ServiceConfig {
let (keep_alive, ka_enabled) = match keep_alive {
KeepAlive::Timeout(val) => (val as u64, true),
@@ -85,10 +89,24 @@ impl ServiceConfig {
ka_enabled,
client_timeout,
client_disconnect,
secure,
local_addr,
timer: DateService::new(),
}))
}
#[inline]
/// Returns true if connection is secure(https)
pub fn secure(&self) -> bool {
self.0.secure
}
#[inline]
/// Returns the local address that this server is bound to.
pub fn local_addr(&self) -> Option<net::SocketAddr> {
self.0.local_addr
}
#[inline]
/// Keep alive duration if configured.
pub fn keep_alive(&self) -> Option<Duration> {
@@ -104,10 +122,10 @@ impl ServiceConfig {
#[inline]
/// Client timeout for first request.
pub fn client_timer(&self) -> Option<Delay> {
let delay = self.0.client_timeout;
if delay != 0 {
Some(Delay::new(
self.0.timer.now() + Duration::from_millis(delay),
let delay_time = self.0.client_timeout;
if delay_time != 0 {
Some(delay_until(
self.0.timer.now() + Duration::from_millis(delay_time),
))
} else {
None
@@ -138,7 +156,7 @@ impl ServiceConfig {
/// Return keep-alive timer delay is configured.
pub fn keep_alive_timer(&self) -> Option<Delay> {
if let Some(ka) = self.0.keep_alive {
Some(Delay::new(self.0.timer.now() + ka))
Some(delay_until(self.0.timer.now() + ka))
} else {
None
}
@@ -162,16 +180,21 @@ impl ServiceConfig {
pub fn set_date(&self, dst: &mut BytesMut) {
let mut buf: [u8; 39] = [0; 39];
buf[..6].copy_from_slice(b"date: ");
buf[6..35].copy_from_slice(&self.0.timer.date().bytes);
self.0
.timer
.set_date(|date| buf[6..35].copy_from_slice(&date.bytes));
buf[35..].copy_from_slice(b"\r\n\r\n");
dst.extend_from_slice(&buf);
}
pub(crate) fn set_date_header(&self, dst: &mut BytesMut) {
dst.extend_from_slice(&self.0.timer.date().bytes);
self.0
.timer
.set_date(|date| dst.extend_from_slice(&date.bytes));
}
}
#[derive(Copy, Clone)]
struct Date {
bytes: [u8; DATE_VALUE_LENGTH],
pos: usize,
@@ -188,7 +211,12 @@ impl Date {
}
fn update(&mut self) {
self.pos = 0;
write!(self, "{}", time::at_utc(time::get_time()).rfc822()).unwrap();
write!(
self,
"{}",
OffsetDateTime::now().format("%a, %d %b %Y %H:%M:%S GMT")
)
.unwrap();
}
}
@@ -205,28 +233,24 @@ impl fmt::Write for Date {
struct DateService(Rc<DateServiceInner>);
struct DateServiceInner {
current: UnsafeCell<Option<(Date, Instant)>>,
current: Cell<Option<(Date, Instant)>>,
}
impl DateServiceInner {
fn new() -> Self {
DateServiceInner {
current: UnsafeCell::new(None),
current: Cell::new(None),
}
}
fn get_ref(&self) -> &Option<(Date, Instant)> {
unsafe { &*self.current.get() }
}
fn reset(&self) {
unsafe { (&mut *self.current.get()).take() };
self.current.take();
}
fn update(&self) {
let now = Instant::now();
let date = Date::new();
*(unsafe { &mut *self.current.get() }) = Some((date, now));
self.current.set(Some((date, now)));
}
}
@@ -236,56 +260,55 @@ impl DateService {
}
fn check_date(&self) {
if self.0.get_ref().is_none() {
if self.0.current.get().is_none() {
self.0.update();
// periodic date update
let s = self.clone();
tokio_current_thread::spawn(sleep(Duration::from_millis(500)).then(
move |_| {
actix_rt::spawn(delay_for(Duration::from_millis(500)).then(move |_| {
s.0.reset();
future::ok(())
},
));
future::ready(())
}));
}
}
fn now(&self) -> Instant {
self.check_date();
self.0.get_ref().as_ref().unwrap().1
self.0.current.get().unwrap().1
}
fn date(&self) -> &Date {
fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
self.check_date();
let item = self.0.get_ref().as_ref().unwrap();
&item.0
f(&self.0.current.get().unwrap().0);
}
}
#[cfg(test)]
mod tests {
use super::*;
use actix_rt::System;
use futures::future;
// Test modifying the date from within the closure
// passed to `set_date`
#[test]
fn test_evil_date() {
let service = DateService::new();
// Make sure that `check_date` doesn't try to spawn a task
service.0.update();
service.set_date(|_| service.0.reset());
}
#[test]
fn test_date_len() {
assert_eq!(DATE_VALUE_LENGTH, "Sun, 06 Nov 1994 08:49:37 GMT".len());
}
#[test]
fn test_date() {
let mut rt = System::new("test");
let _ = rt.block_on(future::lazy(|| {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0);
#[actix_rt::test]
async fn test_date() {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1);
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2);
assert_eq!(buf1, buf2);
future::ok::<_, ()>(())
}));
}
}

View File

@@ -1,7 +1,6 @@
use std::borrow::Cow;
use chrono::Duration;
use time::Tm;
use time::{Duration, OffsetDateTime};
use super::{Cookie, SameSite};
@@ -18,7 +17,6 @@ use super::{Cookie, SameSite};
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let cookie: Cookie = Cookie::build("name", "value")
/// .domain("www.rust-lang.org")
/// .path("/")
@@ -26,7 +24,6 @@ use super::{Cookie, SameSite};
/// .http_only(true)
/// .max_age(84600)
/// .finish();
/// # }
/// ```
#[derive(Debug, Clone)]
pub struct CookieBuilder {
@@ -65,16 +62,14 @@ impl CookieBuilder {
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .expires(time::now())
/// .expires(time::OffsetDateTime::now())
/// .finish();
///
/// assert!(c.expires().is_some());
/// # }
/// ```
#[inline]
pub fn expires(mut self, when: Tm) -> CookieBuilder {
pub fn expires(mut self, when: OffsetDateTime) -> CookieBuilder {
self.cookie.set_expires(when);
self
}
@@ -86,13 +81,11 @@ impl CookieBuilder {
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .max_age(1800)
/// .finish();
///
/// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
/// # }
/// ```
#[inline]
pub fn max_age(self, seconds: i64) -> CookieBuilder {
@@ -106,17 +99,18 @@ impl CookieBuilder {
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .max_age_time(time::Duration::minutes(30))
/// .finish();
///
/// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
/// # }
/// ```
#[inline]
pub fn max_age_time(mut self, value: Duration) -> CookieBuilder {
self.cookie.set_max_age(value);
// Truncate any nanoseconds from the Duration, as they aren't represented within `Max-Age`
// and would cause two otherwise identical `Cookie` instances to not be equivalent to one another.
self.cookie
.set_max_age(Duration::seconds(value.whole_seconds()));
self
}
@@ -220,16 +214,14 @@ impl CookieBuilder {
///
/// ```rust
/// use actix_http::cookie::Cookie;
/// use chrono::Duration;
/// use time::Duration;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .permanent()
/// .finish();
///
/// assert_eq!(c.max_age(), Some(Duration::days(365 * 20)));
/// # assert!(c.expires().is_some());
/// # }
/// ```
#[inline]
pub fn permanent(mut self) -> CookieBuilder {

View File

@@ -10,18 +10,26 @@ use std::fmt;
/// attribute is "Strict", then the cookie is never sent in cross-site requests.
/// If the `SameSite` attribute is "Lax", the cookie is only sent in cross-site
/// requests with "safe" HTTP methods, i.e, `GET`, `HEAD`, `OPTIONS`, `TRACE`.
/// If the `SameSite` attribute is not present (made explicit via the
/// `SameSite::None` variant), then the cookie will be sent as normal.
/// If the `SameSite` attribute is not present then the cookie will be sent as
/// normal. In some browsers, this will implicitly handle the cookie as if "Lax"
/// and in others, "None". It's best to explicitly set the `SameSite` attribute
/// to avoid inconsistent behavior.
///
/// **Note:** Depending on browser, the `Secure` attribute may be required for
/// `SameSite` "None" cookies to be accepted.
///
/// **Note:** This cookie attribute is an HTTP draft! Its meaning and definition
/// are subject to change.
///
/// More info about these draft changes can be found in the draft spec:
/// - https://tools.ietf.org/html/draft-west-cookie-incrementalism-00
#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
pub enum SameSite {
/// The "Strict" `SameSite` attribute.
Strict,
/// The "Lax" `SameSite` attribute.
Lax,
/// No `SameSite` attribute.
/// The "None" `SameSite` attribute.
None,
}
@@ -88,11 +96,11 @@ impl SameSite {
}
impl fmt::Display for SameSite {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
SameSite::Strict => write!(f, "Strict"),
SameSite::Lax => write!(f, "Lax"),
SameSite::None => Ok(()),
SameSite::None => write!(f, "None"),
}
}
}

View File

@@ -1,7 +1,7 @@
use std::collections::HashSet;
use std::mem::replace;
use chrono::Duration;
use time::{Duration, OffsetDateTime};
use super::delta::DeltaCookie;
use super::Cookie;
@@ -188,9 +188,8 @@ impl CookieJar {
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
/// use chrono::Duration;
/// use time::Duration;
///
/// # fn main() {
/// let mut jar = CookieJar::new();
///
/// // Assume this cookie originally had a path of "/" and domain of "a.b".
@@ -203,8 +202,7 @@ impl CookieJar {
/// let delta: Vec<_> = jar.delta().collect();
/// assert_eq!(delta.len(), 1);
/// assert_eq!(delta[0].name(), "name");
/// assert_eq!(delta[0].max_age(), Some(Duration::seconds(0)));
/// # }
/// assert_eq!(delta[0].max_age(), Some(Duration::zero()));
/// ```
///
/// Removing a new cookie does not result in a _removal_ cookie:
@@ -222,8 +220,8 @@ impl CookieJar {
pub fn remove(&mut self, mut cookie: Cookie<'static>) {
if self.original_cookies.contains(cookie.name()) {
cookie.set_value("");
cookie.set_max_age(Duration::seconds(0));
cookie.set_expires(time::now() - Duration::days(365));
cookie.set_max_age(Duration::zero());
cookie.set_expires(OffsetDateTime::now() - Duration::days(365));
self.delta_cookies.replace(DeltaCookie::removed(cookie));
} else {
self.delta_cookies.remove(cookie.name());
@@ -241,9 +239,8 @@ impl CookieJar {
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
/// use chrono::Duration;
/// use time::Duration;
///
/// # fn main() {
/// let mut jar = CookieJar::new();
///
/// // Add an original cookie and a new cookie.
@@ -261,7 +258,6 @@ impl CookieJar {
/// jar.force_remove(Cookie::new("key", "value"));
/// assert_eq!(jar.delta().count(), 0);
/// assert_eq!(jar.iter().count(), 0);
/// # }
/// ```
pub fn force_remove<'a>(&mut self, cookie: Cookie<'a>) {
self.original_cookies.remove(cookie.name());
@@ -307,7 +303,7 @@ impl CookieJar {
/// // Delta contains two new cookies ("new", "yac") and a removal ("name").
/// assert_eq!(jar.delta().count(), 3);
/// ```
pub fn delta(&self) -> Delta {
pub fn delta(&self) -> Delta<'_> {
Delta {
iter: self.delta_cookies.iter(),
}
@@ -343,7 +339,7 @@ impl CookieJar {
/// }
/// }
/// ```
pub fn iter(&self) -> Iter {
pub fn iter(&self) -> Iter<'_> {
Iter {
delta_cookies: self
.delta_cookies
@@ -386,7 +382,7 @@ impl CookieJar {
/// assert!(jar.get("private").is_some());
/// ```
#[cfg(feature = "secure-cookies")]
pub fn private(&mut self, key: &Key) -> PrivateJar {
pub fn private(&mut self, key: &Key) -> PrivateJar<'_> {
PrivateJar::new(self, key)
}
@@ -424,7 +420,7 @@ impl CookieJar {
/// assert!(jar.get("signed").is_some());
/// ```
#[cfg(feature = "secure-cookies")]
pub fn signed(&mut self, key: &Key) -> SignedJar {
pub fn signed(&mut self, key: &Key) -> SignedJar<'_> {
SignedJar::new(self, key)
}
}
@@ -537,8 +533,8 @@ mod test {
#[test]
#[cfg(feature = "secure-cookies")]
fn delta() {
use chrono::Duration;
use std::collections::HashMap;
use time::Duration;
let mut c = CookieJar::new();
@@ -560,7 +556,7 @@ mod test {
assert!(names.get("test2").unwrap().is_none());
assert!(names.get("test3").unwrap().is_none());
assert!(names.get("test4").unwrap().is_none());
assert_eq!(names.get("original").unwrap(), &Some(Duration::seconds(0)));
assert_eq!(names.get("original").unwrap(), &Some(Duration::zero()));
}
#[test]

View File

@@ -47,7 +47,7 @@
//! ```
#![doc(html_root_url = "https://docs.rs/cookie/0.11")]
#![deny(missing_docs)]
#![warn(missing_docs)]
mod builder;
mod delta;
@@ -65,9 +65,8 @@ use std::borrow::Cow;
use std::fmt;
use std::str::FromStr;
use chrono::Duration;
use percent_encoding::{percent_encode, USERINFO_ENCODE_SET};
use time::Tm;
use percent_encoding::{percent_encode, AsciiSet, CONTROLS};
use time::{Duration, OffsetDateTime};
pub use self::builder::CookieBuilder;
pub use self::draft::*;
@@ -75,6 +74,25 @@ pub use self::jar::{CookieJar, Delta, Iter};
use self::parse::parse_cookie;
pub use self::parse::ParseError;
/// https://url.spec.whatwg.org/#fragment-percent-encode-set
const FRAGMENT: &AsciiSet = &CONTROLS.add(b' ').add(b'"').add(b'<').add(b'>').add(b'`');
/// https://url.spec.whatwg.org/#path-percent-encode-set
const PATH: &AsciiSet = &FRAGMENT.add(b'#').add(b'?').add(b'{').add(b'}');
/// https://url.spec.whatwg.org/#userinfo-percent-encode-set
pub const USERINFO: &AsciiSet = &PATH
.add(b'/')
.add(b':')
.add(b';')
.add(b'=')
.add(b'@')
.add(b'[')
.add(b'\\')
.add(b']')
.add(b'^')
.add(b'|');
#[derive(Debug, Clone)]
enum CookieStr {
/// An string derived from indexes (start, end).
@@ -91,7 +109,7 @@ impl CookieStr {
/// # Panics
///
/// Panics if `self` is an indexed string and `string` is None.
fn to_str<'s>(&'s self, string: Option<&'s Cow<str>>) -> &'s str {
fn to_str<'s>(&'s self, string: Option<&'s Cow<'_, str>>) -> &'s str {
match *self {
CookieStr::Indexed(i, j) => {
let s = string.expect(
@@ -104,6 +122,7 @@ impl CookieStr {
}
}
#[allow(clippy::ptr_arg)]
fn to_raw_str<'s, 'c: 's>(&'s self, string: &'s Cow<'c, str>) -> Option<&'c str> {
match *self {
CookieStr::Indexed(i, j) => match *string {
@@ -152,7 +171,7 @@ pub struct Cookie<'c> {
/// The cookie's value.
value: CookieStr,
/// The cookie's expiration, if any.
expires: Option<Tm>,
expires: Option<OffsetDateTime>,
/// The cookie's maximum age, if any.
max_age: Option<Duration>,
/// The cookie's domain, if any.
@@ -459,7 +478,7 @@ impl<'c> Cookie<'c> {
/// assert_eq!(c.max_age(), None);
///
/// let c = Cookie::parse("name=value; Max-Age=3600").unwrap();
/// assert_eq!(c.max_age().map(|age| age.num_hours()), Some(1));
/// assert_eq!(c.max_age().map(|age| age.whole_hours()), Some(1));
/// ```
#[inline]
pub fn max_age(&self) -> Option<Duration> {
@@ -524,10 +543,10 @@ impl<'c> Cookie<'c> {
/// let expire_time = "Wed, 21 Oct 2017 07:28:00 GMT";
/// let cookie_str = format!("name=value; Expires={}", expire_time);
/// let c = Cookie::parse(cookie_str).unwrap();
/// assert_eq!(c.expires().map(|t| t.tm_year), Some(117));
/// assert_eq!(c.expires().map(|t| t.year()), Some(2017));
/// ```
#[inline]
pub fn expires(&self) -> Option<Tm> {
pub fn expires(&self) -> Option<OffsetDateTime> {
self.expires
}
@@ -625,15 +644,13 @@ impl<'c> Cookie<'c> {
///
/// ```rust
/// use actix_http::cookie::Cookie;
/// use chrono::Duration;
/// use time::Duration;
///
/// # fn main() {
/// let mut c = Cookie::new("name", "value");
/// assert_eq!(c.max_age(), None);
///
/// c.set_max_age(Duration::hours(10));
/// assert_eq!(c.max_age(), Some(Duration::hours(10)));
/// # }
/// ```
#[inline]
pub fn set_max_age(&mut self, value: Duration) {
@@ -680,20 +697,19 @@ impl<'c> Cookie<'c> {
///
/// ```rust
/// use actix_http::cookie::Cookie;
/// use time::{Duration, OffsetDateTime};
///
/// # fn main() {
/// let mut c = Cookie::new("name", "value");
/// assert_eq!(c.expires(), None);
///
/// let mut now = time::now();
/// now.tm_year += 1;
/// let mut now = OffsetDateTime::now();
/// now += Duration::week();
///
/// c.set_expires(now);
/// assert!(c.expires().is_some())
/// # }
/// ```
#[inline]
pub fn set_expires(&mut self, time: Tm) {
pub fn set_expires(&mut self, time: OffsetDateTime) {
self.expires = Some(time);
}
@@ -704,9 +720,8 @@ impl<'c> Cookie<'c> {
///
/// ```rust
/// use actix_http::cookie::Cookie;
/// use chrono::Duration;
/// use time::Duration;
///
/// # fn main() {
/// let mut c = Cookie::new("foo", "bar");
/// assert!(c.expires().is_none());
/// assert!(c.max_age().is_none());
@@ -714,15 +729,14 @@ impl<'c> Cookie<'c> {
/// c.make_permanent();
/// assert!(c.expires().is_some());
/// assert_eq!(c.max_age(), Some(Duration::days(365 * 20)));
/// # }
/// ```
pub fn make_permanent(&mut self) {
let twenty_years = Duration::days(365 * 20);
self.set_max_age(twenty_years);
self.set_expires(time::now() + twenty_years);
self.set_expires(OffsetDateTime::now() + twenty_years);
}
fn fmt_parameters(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt_parameters(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
if let Some(true) = self.http_only() {
write!(f, "; HttpOnly")?;
}
@@ -732,10 +746,8 @@ impl<'c> Cookie<'c> {
}
if let Some(same_site) = self.same_site() {
if !same_site.is_none() {
write!(f, "; SameSite={}", same_site)?;
}
}
if let Some(path) = self.path() {
write!(f, "; Path={}", path)?;
@@ -746,11 +758,11 @@ impl<'c> Cookie<'c> {
}
if let Some(max_age) = self.max_age() {
write!(f, "; Max-Age={}", max_age.num_seconds())?;
write!(f, "; Max-Age={}", max_age.whole_seconds())?;
}
if let Some(time) = self.expires() {
write!(f, "; Expires={}", time.rfc822())?;
write!(f, "; Expires={}", time.format("%a, %d %b %Y %H:%M:%S GMT"))?;
}
Ok(())
@@ -904,13 +916,13 @@ impl<'c> Cookie<'c> {
/// let mut c = Cookie::new("my name", "this; value?");
/// assert_eq!(&c.encoded().to_string(), "my%20name=this%3B%20value%3F");
/// ```
pub struct EncodedCookie<'a, 'c: 'a>(&'a Cookie<'c>);
pub struct EncodedCookie<'a, 'c>(&'a Cookie<'c>);
impl<'a, 'c: 'a> fmt::Display for EncodedCookie<'a, 'c> {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
// Percent-encode the name and value.
let name = percent_encode(self.0.name().as_bytes(), USERINFO_ENCODE_SET);
let value = percent_encode(self.0.value().as_bytes(), USERINFO_ENCODE_SET);
let name = percent_encode(self.0.name().as_bytes(), USERINFO);
let value = percent_encode(self.0.value().as_bytes(), USERINFO);
// Write out the name/value pair and the cookie's parameters.
write!(f, "{}={}", name, value)?;
@@ -932,7 +944,7 @@ impl<'c> fmt::Display for Cookie<'c> {
///
/// assert_eq!(&cookie.to_string(), "foo=bar; Path=/");
/// ```
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "{}={}", self.name(), self.value())?;
self.fmt_parameters(f)
}
@@ -978,7 +990,7 @@ impl<'a, 'b> PartialEq<Cookie<'b>> for Cookie<'a> {
#[cfg(test)]
mod tests {
use super::{Cookie, SameSite};
use time::strptime;
use time::PrimitiveDateTime;
#[test]
fn format() {
@@ -1003,7 +1015,9 @@ mod tests {
assert_eq!(&cookie.to_string(), "foo=bar; Domain=www.rust-lang.org");
let time_str = "Wed, 21 Oct 2015 07:28:00 GMT";
let expires = strptime(time_str, "%a, %d %b %Y %H:%M:%S %Z").unwrap();
let expires = PrimitiveDateTime::parse(time_str, "%a, %d %b %Y %H:%M:%S")
.unwrap()
.assume_utc();
let cookie = Cookie::build("foo", "bar").expires(expires).finish();
assert_eq!(
&cookie.to_string(),
@@ -1023,7 +1037,7 @@ mod tests {
let cookie = Cookie::build("foo", "bar")
.same_site(SameSite::None)
.finish();
assert_eq!(&cookie.to_string(), "foo=bar");
assert_eq!(&cookie.to_string(), "foo=bar; SameSite=None");
}
#[test]

View File

@@ -5,11 +5,13 @@ use std::error::Error;
use std::fmt;
use std::str::Utf8Error;
use chrono::Duration;
use percent_encoding::percent_decode;
use time::Duration;
use super::{Cookie, CookieStr, SameSite};
use crate::time_parser;
/// Enum corresponding to a parsing error.
#[derive(Debug, PartialEq, Eq, Clone, Copy)]
pub enum ParseError {
@@ -40,7 +42,7 @@ impl ParseError {
}
impl fmt::Display for ParseError {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "{}", self.as_str())
}
}
@@ -51,11 +53,7 @@ impl From<Utf8Error> for ParseError {
}
}
impl Error for ParseError {
fn description(&self) -> &str {
self.as_str()
}
}
impl Error for ParseError {}
fn indexes_of(needle: &str, haystack: &str) -> Option<(usize, usize)> {
let haystack_start = haystack.as_ptr() as usize;
@@ -151,7 +149,7 @@ fn parse_inner<'c>(s: &str, decode: bool) -> Result<Cookie<'c>, ParseError> {
Ok(val) => {
// Don't panic if the max age seconds is greater than what's supported by
// `Duration`.
let val = cmp::min(val, Duration::max_value().num_seconds());
let val = cmp::min(val, Duration::max_value().whole_seconds());
Some(Duration::seconds(val))
}
Err(_) => continue,
@@ -183,16 +181,14 @@ fn parse_inner<'c>(s: &str, decode: bool) -> Result<Cookie<'c>, ParseError> {
}
}
("expires", Some(v)) => {
// Try strptime with three date formats according to
// Try parsing with three date formats according to
// http://tools.ietf.org/html/rfc2616#section-3.3.1. Try
// additional ones as encountered in the real world.
let tm = time::strptime(v, "%a, %d %b %Y %H:%M:%S %Z")
.or_else(|_| time::strptime(v, "%A, %d-%b-%y %H:%M:%S %Z"))
.or_else(|_| time::strptime(v, "%a, %d-%b-%Y %H:%M:%S %Z"))
.or_else(|_| time::strptime(v, "%a %b %d %H:%M:%S %Y"));
let tm = time_parser::parse_http_date(v)
.or_else(|| time::parse(v, "%a, %d-%b-%Y %H:%M:%S").ok());
if let Ok(time) = tm {
cookie.expires = Some(time)
if let Some(time) = tm {
cookie.expires = Some(time.assume_utc())
}
}
_ => {
@@ -220,8 +216,7 @@ where
#[cfg(test)]
mod tests {
use super::{Cookie, SameSite};
use chrono::Duration;
use time::strptime;
use time::{Duration, PrimitiveDateTime};
macro_rules! assert_eq_parse {
($string:expr, $expected:expr) => {
@@ -381,7 +376,9 @@ mod tests {
);
let time_str = "Wed, 21 Oct 2015 07:28:00 GMT";
let expires = strptime(time_str, "%a, %d %b %Y %H:%M:%S %Z").unwrap();
let expires = PrimitiveDateTime::parse(time_str, "%a, %d %b %Y %H:%M:%S")
.unwrap()
.assume_utc();
expected.set_expires(expires);
assert_eq_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
@@ -390,7 +387,9 @@ mod tests {
);
unexpected.set_domain("foo.com");
let bad_expires = strptime(time_str, "%a, %d %b %Y %H:%S:%M %Z").unwrap();
let bad_expires = PrimitiveDateTime::parse(time_str, "%a, %d %b %Y %H:%S:%M")
.unwrap()
.assume_utc();
expected.set_expires(bad_expires);
assert_ne_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
@@ -418,8 +417,16 @@ mod tests {
#[test]
fn do_not_panic_on_large_max_ages() {
let max_seconds = Duration::max_value().num_seconds();
let expected = Cookie::build("foo", "bar").max_age(max_seconds).finish();
assert_eq_parse!(format!(" foo=bar; Max-Age={:?}", max_seconds + 1), expected);
let max_duration = Duration::max_value();
let expected = Cookie::build("foo", "bar")
.max_age_time(max_duration)
.finish();
let overflow_duration = max_duration
.checked_add(Duration::nanoseconds(1))
.unwrap_or(max_duration);
assert_eq_parse!(
format!(" foo=bar; Max-Age={:?}", overflow_duration.whole_seconds()),
expected
);
}
}

View File

@@ -1,13 +1,11 @@
use ring::digest::{Algorithm, SHA256};
use ring::hkdf::expand;
use ring::hmac::SigningKey;
use ring::hkdf::{Algorithm, KeyType, Prk, HKDF_SHA256};
use ring::rand::{SecureRandom, SystemRandom};
use super::private::KEY_LEN as PRIVATE_KEY_LEN;
use super::signed::KEY_LEN as SIGNED_KEY_LEN;
static HKDF_DIGEST: &'static Algorithm = &SHA256;
const KEYS_INFO: &'static str = "COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM";
static HKDF_DIGEST: Algorithm = HKDF_SHA256;
const KEYS_INFO: &[&[u8]] = &[b"COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM"];
/// A cryptographic master key for use with `Signed` and/or `Private` jars.
///
@@ -25,6 +23,13 @@ pub struct Key {
encryption_key: [u8; PRIVATE_KEY_LEN],
}
impl KeyType for &Key {
#[inline]
fn len(&self) -> usize {
SIGNED_KEY_LEN + PRIVATE_KEY_LEN
}
}
impl Key {
/// Derives new signing/encryption keys from a master key.
///
@@ -56,21 +61,26 @@ impl Key {
);
}
// Expand the user's key into two.
let prk = SigningKey::new(HKDF_DIGEST, key);
// An empty `Key` structure; will be filled in with HKDF derived keys.
let mut output_key = Key {
signing_key: [0; SIGNED_KEY_LEN],
encryption_key: [0; PRIVATE_KEY_LEN],
};
// Expand the master key into two HKDF generated keys.
let mut both_keys = [0; SIGNED_KEY_LEN + PRIVATE_KEY_LEN];
expand(&prk, KEYS_INFO.as_bytes(), &mut both_keys);
let prk = Prk::new_less_safe(HKDF_DIGEST, key);
let okm = prk.expand(KEYS_INFO, &output_key).expect("okm expand");
okm.fill(&mut both_keys).expect("fill keys");
// Copy the keys into their respective arrays.
let mut signing_key = [0; SIGNED_KEY_LEN];
let mut encryption_key = [0; PRIVATE_KEY_LEN];
signing_key.copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
encryption_key.copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
Key {
signing_key,
encryption_key,
}
// Copy the key parts into their respective fields.
output_key
.signing_key
.copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
output_key
.encryption_key
.copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
output_key
}
/// Generates signing/encryption keys from a secure, random source. Keys are

View File

@@ -1,8 +1,8 @@
use std::str;
use log::warn;
use ring::aead::{open_in_place, seal_in_place, Aad, Algorithm, Nonce, AES_256_GCM};
use ring::aead::{OpeningKey, SealingKey};
use ring::aead::{Aad, Algorithm, Nonce, AES_256_GCM};
use ring::aead::{LessSafeKey, UnboundKey};
use ring::rand::{SecureRandom, SystemRandom};
use super::Key;
@@ -10,7 +10,7 @@ use crate::cookie::{Cookie, CookieJar};
// Keep these in sync, and keep the key len synced with the `private` docs as
// well as the `KEYS_INFO` const in secure::Key.
static ALGO: &'static Algorithm = &AES_256_GCM;
static ALGO: &Algorithm = &AES_256_GCM;
const NONCE_LEN: usize = 12;
pub const KEY_LEN: usize = 32;
@@ -53,11 +53,14 @@ impl<'a> PrivateJar<'a> {
}
let ad = Aad::from(name.as_bytes());
let key = OpeningKey::new(ALGO, &self.key).expect("opening key");
let (nonce, sealed) = data.split_at_mut(NONCE_LEN);
let key = LessSafeKey::new(
UnboundKey::new(&ALGO, &self.key).expect("matching key length"),
);
let (nonce, mut sealed) = data.split_at_mut(NONCE_LEN);
let nonce =
Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
let unsealed = open_in_place(&key, nonce, ad, 0, sealed)
let unsealed = key
.open_in_place(nonce, ad, &mut sealed)
.map_err(|_| "invalid key/nonce/value: bad seal")?;
if let Ok(unsealed_utf8) = str::from_utf8(unsealed) {
@@ -156,7 +159,7 @@ Please change it as soon as possible."
/// Encrypts the cookie's value with
/// authenticated encryption assuring confidentiality, integrity, and authenticity.
fn encrypt_cookie(&self, cookie: &mut Cookie) {
fn encrypt_cookie(&self, cookie: &mut Cookie<'_>) {
let name = cookie.name().as_bytes();
let value = cookie.value().as_bytes();
let data = encrypt_name_value(name, value, &self.key);
@@ -196,30 +199,33 @@ Please change it as soon as possible."
fn encrypt_name_value(name: &[u8], value: &[u8], key: &[u8]) -> Vec<u8> {
// Create the `SealingKey` structure.
let key = SealingKey::new(ALGO, key).expect("sealing key creation");
let unbound = UnboundKey::new(&ALGO, key).expect("matching key length");
let key = LessSafeKey::new(unbound);
// Create a vec to hold the [nonce | cookie value | overhead].
let overhead = ALGO.tag_len();
let mut data = vec![0; NONCE_LEN + value.len() + overhead];
let mut data = vec![0; NONCE_LEN + value.len() + ALGO.tag_len()];
// Randomly generate the nonce, then copy the cookie value as input.
let (nonce, in_out) = data.split_at_mut(NONCE_LEN);
let (in_out, tag) = in_out.split_at_mut(value.len());
in_out.copy_from_slice(value);
// Randomly generate the nonce into the nonce piece.
SystemRandom::new()
.fill(nonce)
.expect("couldn't random fill nonce");
in_out[..value.len()].copy_from_slice(value);
let nonce =
Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
let nonce = Nonce::try_assume_unique_for_key(nonce).expect("invalid `nonce` length");
// Use cookie's name as associated data to prevent value swapping.
let ad = Aad::from(name);
let ad_tag = key
.seal_in_place_separate_tag(nonce, ad, in_out)
.expect("in-place seal");
// Perform the actual sealing operation and get the output length.
let output_len =
seal_in_place(&key, nonce, ad, in_out, overhead).expect("in-place seal");
// Copy the tag into the tag piece.
tag.copy_from_slice(ad_tag.as_ref());
// Remove the overhead and return the sealed content.
data.truncate(NONCE_LEN + output_len);
data
}

View File

@@ -1,12 +1,11 @@
use ring::digest::{Algorithm, SHA256};
use ring::hmac::{sign, verify_with_own_key as verify, SigningKey};
use ring::hmac::{self, sign, verify};
use super::Key;
use crate::cookie::{Cookie, CookieJar};
// Keep these in sync, and keep the key len synced with the `signed` docs as
// well as the `KEYS_INFO` const in secure::Key.
static HMAC_DIGEST: &'static Algorithm = &SHA256;
static HMAC_DIGEST: hmac::Algorithm = hmac::HMAC_SHA256;
const BASE64_DIGEST_LEN: usize = 44;
pub const KEY_LEN: usize = 32;
@@ -21,7 +20,7 @@ pub const KEY_LEN: usize = 32;
/// This type is only available when the `secure` feature is enabled.
pub struct SignedJar<'a> {
parent: &'a mut CookieJar,
key: SigningKey,
key: hmac::Key,
}
impl<'a> SignedJar<'a> {
@@ -32,7 +31,7 @@ impl<'a> SignedJar<'a> {
pub fn new(parent: &'a mut CookieJar, key: &Key) -> SignedJar<'a> {
SignedJar {
parent,
key: SigningKey::new(HMAC_DIGEST, key.signing()),
key: hmac::Key::new(HMAC_DIGEST, key.signing()),
}
}
@@ -130,7 +129,7 @@ impl<'a> SignedJar<'a> {
}
/// Signs the cookie's value assuring integrity and authenticity.
fn sign_cookie(&self, cookie: &mut Cookie) {
fn sign_cookie(&self, cookie: &mut Cookie<'_>) {
let digest = sign(&self.key, cookie.value().as_bytes());
let mut new_value = base64::encode(digest.as_ref());
new_value.push_str(cookie.value());

View File

@@ -1,12 +1,13 @@
use std::future::Future;
use std::io::{self, Write};
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_threadpool::{run, CpuFuture};
#[cfg(feature = "brotli")]
use brotli2::write::BrotliDecoder;
use bytes::Bytes;
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
use flate2::write::{GzDecoder, ZlibDecoder};
use futures::{try_ready, Async, Future, Poll, Stream};
use futures_core::{ready, Stream};
use super::Writer;
use crate::error::PayloadError;
@@ -23,21 +24,18 @@ pub struct Decoder<S> {
impl<S> Decoder<S>
where
S: Stream<Item = Bytes, Error = PayloadError>,
S: Stream<Item = Result<Bytes, PayloadError>>,
{
/// Construct a decoder.
#[inline]
pub fn new(stream: S, encoding: ContentEncoding) -> Decoder<S> {
let decoder = match encoding {
#[cfg(feature = "brotli")]
ContentEncoding::Br => Some(ContentDecoder::Br(Box::new(
BrotliDecoder::new(Writer::new()),
))),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoding::Deflate => Some(ContentDecoder::Deflate(Box::new(
ZlibDecoder::new(Writer::new()),
))),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoding::Gzip => Some(ContentDecoder::Gzip(Box::new(
GzDecoder::new(Writer::new()),
))),
@@ -71,34 +69,40 @@ where
impl<S> Stream for Decoder<S>
where
S: Stream<Item = Bytes, Error = PayloadError>,
S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
{
type Item = Bytes;
type Error = PayloadError;
type Item = Result<Bytes, PayloadError>;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
loop {
if let Some(ref mut fut) = self.fut {
let (chunk, decoder) = try_ready!(fut.poll());
let (chunk, decoder) = match ready!(Pin::new(fut).poll(cx)) {
Ok(item) => item,
Err(e) => return Poll::Ready(Some(Err(e.into()))),
};
self.decoder = Some(decoder);
self.fut.take();
if let Some(chunk) = chunk {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
}
if self.eof {
return Ok(Async::Ready(None));
return Poll::Ready(None);
}
match self.stream.poll()? {
Async::Ready(Some(chunk)) => {
match Pin::new(&mut self.stream).poll_next(cx) {
Poll::Ready(Some(Err(err))) => return Poll::Ready(Some(Err(err))),
Poll::Ready(Some(Ok(chunk))) => {
if let Some(mut decoder) = self.decoder.take() {
if chunk.len() < INPLACE {
let chunk = decoder.feed_data(chunk)?;
self.decoder = Some(decoder);
if let Some(chunk) = chunk {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
} else {
self.fut = Some(run(move || {
@@ -108,41 +112,40 @@ where
}
continue;
} else {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
}
Async::Ready(None) => {
Poll::Ready(None) => {
self.eof = true;
return if let Some(mut decoder) = self.decoder.take() {
Ok(Async::Ready(decoder.feed_eof()?))
match decoder.feed_eof() {
Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
Ok(None) => Poll::Ready(None),
Err(err) => Poll::Ready(Some(Err(err.into()))),
}
} else {
Ok(Async::Ready(None))
Poll::Ready(None)
};
}
Async::NotReady => break,
Poll::Pending => break,
}
}
Ok(Async::NotReady)
Poll::Pending
}
}
enum ContentDecoder {
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
Deflate(Box<ZlibDecoder<Writer>>),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
Gzip(Box<GzDecoder<Writer>>),
#[cfg(feature = "brotli")]
Br(Box<BrotliDecoder<Writer>>),
}
impl ContentDecoder {
#[allow(unreachable_patterns)]
fn feed_eof(&mut self) -> io::Result<Option<Bytes>> {
match self {
#[cfg(feature = "brotli")]
ContentDecoder::Br(ref mut decoder) => match decoder.finish() {
Ok(mut writer) => {
let b = writer.take();
ContentDecoder::Br(ref mut decoder) => match decoder.flush() {
Ok(()) => {
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
@@ -151,7 +154,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentDecoder::Gzip(ref mut decoder) => match decoder.try_finish() {
Ok(_) => {
let b = decoder.get_mut().take();
@@ -163,7 +165,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
Ok(_) => {
let b = decoder.get_mut().take();
@@ -175,14 +176,11 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
_ => Ok(None),
}
}
#[allow(unreachable_patterns)]
fn feed_data(&mut self, data: Bytes) -> io::Result<Option<Bytes>> {
match self {
#[cfg(feature = "brotli")]
ContentDecoder::Br(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
@@ -195,7 +193,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentDecoder::Gzip(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
@@ -208,7 +205,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
@@ -221,7 +217,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
_ => Ok(Some(data)),
}
}
}

View File

@@ -1,25 +1,29 @@
//! Stream encoder
use std::future::Future;
use std::io::{self, Write};
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_threadpool::{run, CpuFuture};
#[cfg(feature = "brotli")]
use brotli2::write::BrotliEncoder;
use bytes::Bytes;
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
use flate2::write::{GzEncoder, ZlibEncoder};
use futures::{Async, Future, Poll};
use futures_core::ready;
use pin_project::{pin_project, project};
use crate::body::{Body, BodySize, MessageBody, ResponseBody};
use crate::http::header::{ContentEncoding, CONTENT_ENCODING};
use crate::http::{HeaderValue, HttpTryFrom, StatusCode};
use crate::http::{HeaderValue, StatusCode};
use crate::{Error, ResponseHead};
use super::Writer;
const INPLACE: usize = 2049;
const INPLACE: usize = 1024;
#[pin_project]
pub struct Encoder<B> {
eof: bool,
#[pin]
body: EncoderBody<B>,
encoder: Option<ContentEncoder>,
fut: Option<CpuFuture<ContentEncoder, io::Error>>,
@@ -54,15 +58,18 @@ impl<B: MessageBody> Encoder<B> {
};
if can_encode {
// Modify response body only if encoder is not None
if let Some(enc) = ContentEncoder::encoder(encoding) {
update_head(encoding, head);
head.no_chunking(false);
ResponseBody::Body(Encoder {
return ResponseBody::Body(Encoder {
body,
eof: false,
fut: None,
encoder: ContentEncoder::encoder(encoding),
})
} else {
encoder: Some(enc),
});
}
}
ResponseBody::Body(Encoder {
body,
eof: false,
@@ -70,89 +77,112 @@ impl<B: MessageBody> Encoder<B> {
encoder: None,
})
}
}
}
#[pin_project]
enum EncoderBody<B> {
Bytes(Bytes),
Stream(B),
BoxedStream(Box<dyn MessageBody>),
Stream(#[pin] B),
BoxedStream(Box<dyn MessageBody + Unpin>),
}
impl<B: MessageBody> MessageBody for EncoderBody<B> {
fn size(&self) -> BodySize {
match self {
EncoderBody::Bytes(ref b) => b.size(),
EncoderBody::Stream(ref b) => b.size(),
EncoderBody::BoxedStream(ref b) => b.size(),
}
}
#[project]
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
#[project]
match self.project() {
EncoderBody::Bytes(b) => {
if b.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(std::mem::replace(b, Bytes::new()))))
}
}
EncoderBody::Stream(b) => b.poll_next(cx),
EncoderBody::BoxedStream(ref mut b) => Pin::new(b.as_mut()).poll_next(cx),
}
}
}
impl<B: MessageBody> MessageBody for Encoder<B> {
fn size(&self) -> BodySize {
if self.encoder.is_none() {
match self.body {
EncoderBody::Bytes(ref b) => b.size(),
EncoderBody::Stream(ref b) => b.size(),
EncoderBody::BoxedStream(ref b) => b.size(),
}
self.body.size()
} else {
BodySize::Stream
}
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
let mut this = self.project();
loop {
if self.eof {
return Ok(Async::Ready(None));
if *this.eof {
return Poll::Ready(None);
}
if let Some(ref mut fut) = self.fut {
let mut encoder = futures::try_ready!(fut.poll());
let chunk = encoder.take();
self.encoder = Some(encoder);
self.fut.take();
if !chunk.is_empty() {
return Ok(Async::Ready(Some(chunk)));
}
}
let result = match self.body {
EncoderBody::Bytes(ref mut b) => {
if b.is_empty() {
Async::Ready(None)
} else {
Async::Ready(Some(std::mem::replace(b, Bytes::new())))
}
}
EncoderBody::Stream(ref mut b) => b.poll_next()?,
EncoderBody::BoxedStream(ref mut b) => b.poll_next()?,
if let Some(ref mut fut) = this.fut {
let mut encoder = match ready!(Pin::new(fut).poll(cx)) {
Ok(item) => item,
Err(e) => return Poll::Ready(Some(Err(e.into()))),
};
let chunk = encoder.take();
*this.encoder = Some(encoder);
this.fut.take();
if !chunk.is_empty() {
return Poll::Ready(Some(Ok(chunk)));
}
}
let result = this.body.as_mut().poll_next(cx);
match result {
Async::NotReady => return Ok(Async::NotReady),
Async::Ready(Some(chunk)) => {
if let Some(mut encoder) = self.encoder.take() {
Poll::Ready(Some(Ok(chunk))) => {
if let Some(mut encoder) = this.encoder.take() {
if chunk.len() < INPLACE {
encoder.write(&chunk)?;
let chunk = encoder.take();
self.encoder = Some(encoder);
*this.encoder = Some(encoder);
if !chunk.is_empty() {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
} else {
self.fut = Some(run(move || {
*this.fut = Some(run(move || {
encoder.write(&chunk)?;
Ok(encoder)
}));
}
} else {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
}
Async::Ready(None) => {
if let Some(encoder) = self.encoder.take() {
Poll::Ready(None) => {
if let Some(encoder) = this.encoder.take() {
let chunk = encoder.finish()?;
if chunk.is_empty() {
return Ok(Async::Ready(None));
return Poll::Ready(None);
} else {
self.eof = true;
return Ok(Async::Ready(Some(chunk)));
*this.eof = true;
return Poll::Ready(Some(Ok(chunk)));
}
} else {
return Ok(Async::Ready(None));
return Poll::Ready(None);
}
}
val => return val,
}
}
}
@@ -161,33 +191,27 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) {
head.headers_mut().insert(
CONTENT_ENCODING,
HeaderValue::try_from(Bytes::from_static(encoding.as_str().as_bytes())).unwrap(),
HeaderValue::from_static(encoding.as_str()),
);
}
enum ContentEncoder {
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
Deflate(ZlibEncoder<Writer>),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
Gzip(GzEncoder<Writer>),
#[cfg(feature = "brotli")]
Br(BrotliEncoder<Writer>),
}
impl ContentEncoder {
fn encoder(encoding: ContentEncoding) -> Option<Self> {
match encoding {
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoding::Deflate => Some(ContentEncoder::Deflate(ZlibEncoder::new(
Writer::new(),
flate2::Compression::fast(),
))),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoding::Gzip => Some(ContentEncoder::Gzip(GzEncoder::new(
Writer::new(),
flate2::Compression::fast(),
))),
#[cfg(feature = "brotli")]
ContentEncoding::Br => {
Some(ContentEncoder::Br(BrotliEncoder::new(Writer::new(), 3)))
}
@@ -198,28 +222,22 @@ impl ContentEncoder {
#[inline]
pub(crate) fn take(&mut self) -> Bytes {
match *self {
#[cfg(feature = "brotli")]
ContentEncoder::Br(ref mut encoder) => encoder.get_mut().take(),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Deflate(ref mut encoder) => encoder.get_mut().take(),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Gzip(ref mut encoder) => encoder.get_mut().take(),
}
}
fn finish(self) -> Result<Bytes, io::Error> {
match self {
#[cfg(feature = "brotli")]
ContentEncoder::Br(encoder) => match encoder.finish() {
Ok(writer) => Ok(writer.buf.freeze()),
Err(err) => Err(err),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Gzip(encoder) => match encoder.finish() {
Ok(writer) => Ok(writer.buf.freeze()),
Err(err) => Err(err),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Deflate(encoder) => match encoder.finish() {
Ok(writer) => Ok(writer.buf.freeze()),
Err(err) => Err(err),
@@ -229,7 +247,6 @@ impl ContentEncoder {
fn write(&mut self, data: &[u8]) -> Result<(), io::Error> {
match *self {
#[cfg(feature = "brotli")]
ContentEncoder::Br(ref mut encoder) => match encoder.write_all(data) {
Ok(_) => Ok(()),
Err(err) => {
@@ -237,7 +254,6 @@ impl ContentEncoder {
Err(err)
}
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Gzip(ref mut encoder) => match encoder.write_all(data) {
Ok(_) => Ok(()),
Err(err) => {
@@ -245,7 +261,6 @@ impl ContentEncoder {
Err(err)
}
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Deflate(ref mut encoder) => match encoder.write_all(data) {
Ok(_) => Ok(()),
Err(err) => {

View File

@@ -19,8 +19,9 @@ impl Writer {
buf: BytesMut::with_capacity(8192),
}
}
fn take(&mut self) -> Bytes {
self.buf.take().freeze()
self.buf.split().freeze()
}
}
@@ -29,6 +30,7 @@ impl io::Write for Writer {
self.buf.extend_from_slice(buf);
Ok(buf.len())
}
fn flush(&mut self) -> io::Result<()> {
Ok(())
}

View File

@@ -5,24 +5,24 @@ use std::str::Utf8Error;
use std::string::FromUtf8Error;
use std::{fmt, io, result};
use actix_codec::{Decoder, Encoder};
pub use actix_threadpool::BlockingError;
use actix_utils::framed::DispatcherError as FramedDispatcherError;
use actix_utils::timeout::TimeoutError;
use bytes::BytesMut;
use derive_more::{Display, From};
use futures::Canceled;
pub use futures_channel::oneshot::Canceled;
use http::uri::InvalidUri;
use http::{header, Error as HttpError, StatusCode};
use httparse;
use serde::de::value::Error as DeError;
use serde_json::error::Error as JsonError;
use serde_urlencoded::ser::Error as FormError;
use tokio_timer::Error as TimerError;
// re-export for convinience
use crate::body::Body;
pub use crate::cookie::ParseError as CookieParseError;
use crate::helpers::Writer;
use crate::response::Response;
use crate::response::{Response, ResponseBuilder};
/// A specialized [`Result`](https://doc.rust-lang.org/std/result/enum.Result.html)
/// for actix web operations
@@ -43,47 +43,68 @@ pub type Result<T, E = Error> = result::Result<T, E>;
/// if you have access to an actix `Error` you can always get a
/// `ResponseError` reference from it.
pub struct Error {
cause: Box<ResponseError>,
cause: Box<dyn ResponseError>,
}
impl Error {
/// Returns the reference to the underlying `ResponseError`.
pub fn as_response_error(&self) -> &ResponseError {
pub fn as_response_error(&self) -> &dyn ResponseError {
self.cause.as_ref()
}
/// Similar to `as_response_error` but downcasts.
pub fn as_error<T: ResponseError + 'static>(&self) -> Option<&T> {
ResponseError::downcast_ref(self.cause.as_ref())
}
}
/// Error that can be converted to `Response`
pub trait ResponseError: fmt::Debug + fmt::Display {
/// Response's status code
///
/// Internal server error is generated by default.
fn status_code(&self) -> StatusCode {
StatusCode::INTERNAL_SERVER_ERROR
}
/// Create response for error
///
/// Internal server error is generated by default.
fn error_response(&self) -> Response {
Response::new(StatusCode::INTERNAL_SERVER_ERROR)
}
/// Constructs an error response
fn render_response(&self) -> Response {
let mut resp = self.error_response();
let mut resp = Response::new(self.status_code());
let mut buf = BytesMut::new();
let _ = write!(Writer(&mut buf), "{}", self);
resp.headers_mut().insert(
header::CONTENT_TYPE,
header::HeaderValue::from_static("text/plain"),
header::HeaderValue::from_static("text/plain; charset=utf-8"),
);
resp.set_body(Body::from(buf))
}
downcast_get_type_id!();
}
downcast!(ResponseError);
impl fmt::Display for Error {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt::Display::fmt(&self.cause, f)
}
}
impl fmt::Debug for Error {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
writeln!(f, "{:?}", &self.cause)
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "{:?}", &self.cause)
}
}
impl std::error::Error for Error {
fn cause(&self) -> Option<&dyn std::error::Error> {
None
}
fn source(&self) -> Option<&(dyn std::error::Error + 'static)> {
None
}
}
@@ -93,17 +114,11 @@ impl From<()> for Error {
}
}
impl std::error::Error for Error {
fn description(&self) -> &str {
"actix-http::Error"
}
fn cause(&self) -> Option<&dyn std::error::Error> {
None
}
fn source(&self) -> Option<&(dyn std::error::Error + 'static)> {
None
impl From<std::convert::Infallible> for Error {
fn from(_: std::convert::Infallible) -> Self {
// `std::convert::Infallible` indicates an error
// that will never happen
unreachable!()
}
}
@@ -123,12 +138,26 @@ impl<T: ResponseError + 'static> From<T> for Error {
}
}
/// Convert Response to a Error
impl From<Response> for Error {
fn from(res: Response) -> Error {
InternalError::from_response("", res).into()
}
}
/// Convert ResponseBuilder to a Error
impl From<ResponseBuilder> for Error {
fn from(mut res: ResponseBuilder) -> Error {
InternalError::from_response("", res.finish()).into()
}
}
/// Return `GATEWAY_TIMEOUT` for `TimeoutError`
impl<E: ResponseError> ResponseError for TimeoutError<E> {
fn error_response(&self) -> Response {
fn status_code(&self) -> StatusCode {
match self {
TimeoutError::Service(e) => e.error_response(),
TimeoutError::Timeout => Response::new(StatusCode::GATEWAY_TIMEOUT),
TimeoutError::Service(e) => e.status_code(),
TimeoutError::Timeout => StatusCode::GATEWAY_TIMEOUT,
}
}
}
@@ -146,31 +175,31 @@ impl ResponseError for JsonError {}
/// `InternalServerError` for `FormError`
impl ResponseError for FormError {}
/// `InternalServerError` for `TimerError`
impl ResponseError for TimerError {}
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
/// `InternalServerError` for `openssl::ssl::Error`
impl ResponseError for openssl::ssl::Error {}
impl ResponseError for actix_connect::ssl::openssl::SslError {}
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
/// `InternalServerError` for `openssl::ssl::HandshakeError`
impl ResponseError for openssl::ssl::HandshakeError<tokio_tcp::TcpStream> {}
impl<T: std::fmt::Debug> ResponseError for actix_tls::openssl::HandshakeError<T> {}
/// Return `BAD_REQUEST` for `de::value::Error`
impl ResponseError for DeError {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
/// `InternalServerError` for `Canceled`
impl ResponseError for Canceled {}
/// `InternalServerError` for `BlockingError`
impl<E: fmt::Debug> ResponseError for BlockingError<E> {}
/// Return `BAD_REQUEST` for `Utf8Error`
impl ResponseError for Utf8Error {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
@@ -180,32 +209,22 @@ impl ResponseError for HttpError {}
/// Return `InternalServerError` for `io::Error`
impl ResponseError for io::Error {
fn error_response(&self) -> Response {
fn status_code(&self) -> StatusCode {
match self.kind() {
io::ErrorKind::NotFound => Response::new(StatusCode::NOT_FOUND),
io::ErrorKind::PermissionDenied => Response::new(StatusCode::FORBIDDEN),
_ => Response::new(StatusCode::INTERNAL_SERVER_ERROR),
io::ErrorKind::NotFound => StatusCode::NOT_FOUND,
io::ErrorKind::PermissionDenied => StatusCode::FORBIDDEN,
_ => StatusCode::INTERNAL_SERVER_ERROR,
}
}
}
/// `BadRequest` for `InvalidHeaderValue`
impl ResponseError for header::InvalidHeaderValue {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
/// `BadRequest` for `InvalidHeaderValue`
impl ResponseError for header::InvalidHeaderValueBytes {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
}
}
/// `InternalServerError` for `futures::Canceled`
impl ResponseError for Canceled {}
/// A set of errors that can occur during parsing HTTP streams
#[derive(Debug, Display)]
pub enum ParseError {
@@ -245,8 +264,8 @@ pub enum ParseError {
/// Return `BadRequest` for `ParseError`
impl ResponseError for ParseError {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
@@ -338,7 +357,7 @@ impl From<BlockingError<io::Error>> for PayloadError {
BlockingError::Error(e) => PayloadError::Io(e),
BlockingError::Canceled => PayloadError::Io(io::Error::new(
io::ErrorKind::Other,
"Thread pool is gone",
"Operation is canceled",
)),
}
}
@@ -349,18 +368,18 @@ impl From<BlockingError<io::Error>> for PayloadError {
/// - `Overflow` returns `PayloadTooLarge`
/// - Other errors returns `BadRequest`
impl ResponseError for PayloadError {
fn error_response(&self) -> Response {
fn status_code(&self) -> StatusCode {
match *self {
PayloadError::Overflow => Response::new(StatusCode::PAYLOAD_TOO_LARGE),
_ => Response::new(StatusCode::BAD_REQUEST),
PayloadError::Overflow => StatusCode::PAYLOAD_TOO_LARGE,
_ => StatusCode::BAD_REQUEST,
}
}
}
/// Return `BadRequest` for `cookie::ParseError`
impl ResponseError for crate::cookie::ParseError {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
@@ -424,11 +443,19 @@ pub enum ContentTypeError {
/// Return `BadRequest` for `ContentTypeError`
impl ResponseError for ContentTypeError {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
impl<E, U: Encoder + Decoder> ResponseError for FramedDispatcherError<E, U>
where
E: fmt::Debug + fmt::Display,
<U as Encoder>::Error: fmt::Debug,
<U as Decoder>::Error: fmt::Debug,
{
}
/// Helper type that can wrap any error and generate custom response.
///
/// In following example any `io::Error` will be converted into "BAD REQUEST"
@@ -436,14 +463,12 @@ impl ResponseError for ContentTypeError {
/// default.
///
/// ```rust
/// # extern crate actix_http;
/// # use std::io;
/// # use actix_http::*;
///
/// fn index(req: Request) -> Result<&'static str> {
/// Err(error::ErrorBadRequest(io::Error::new(io::ErrorKind::Other, "error")))
/// }
/// # fn main() {}
/// ```
pub struct InternalError<T> {
cause: T,
@@ -477,7 +502,7 @@ impl<T> fmt::Debug for InternalError<T>
where
T: fmt::Debug + 'static,
{
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt::Debug::fmt(&self.cause, f)
}
}
@@ -486,7 +511,7 @@ impl<T> fmt::Display for InternalError<T>
where
T: fmt::Display + 'static,
{
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt::Display::fmt(&self.cause, f)
}
}
@@ -495,6 +520,19 @@ impl<T> ResponseError for InternalError<T>
where
T: fmt::Debug + fmt::Display + 'static,
{
fn status_code(&self) -> StatusCode {
match self.status {
InternalErrorType::Status(st) => st,
InternalErrorType::Response(ref resp) => {
if let Some(resp) = resp.borrow().as_ref() {
resp.head().status
} else {
StatusCode::INTERNAL_SERVER_ERROR
}
}
}
}
fn error_response(&self) -> Response {
match self.status {
InternalErrorType::Status(st) => {
@@ -503,7 +541,7 @@ where
let _ = write!(Writer(&mut buf), "{}", self);
res.headers_mut().insert(
header::CONTENT_TYPE,
header::HeaderValue::from_static("text/plain"),
header::HeaderValue::from_static("text/plain; charset=utf-8"),
);
res.set_body(Body::from(buf))
}
@@ -516,18 +554,6 @@ where
}
}
}
/// Constructs an error response
fn render_response(&self) -> Response {
self.error_response()
}
}
/// Convert Response to a Error
impl From<Response> for Error {
fn from(res: Response) -> Error {
InternalError::from_response("", res).into()
}
}
/// Helper function that creates wrapper of any error and generate *BAD
@@ -920,24 +946,25 @@ where
InternalError::new(err, StatusCode::NETWORK_AUTHENTICATION_REQUIRED).into()
}
#[cfg(feature = "fail")]
mod failure_integration {
use super::*;
#[cfg(feature = "failure")]
/// Compatibility for `failure::Error`
impl ResponseError for fail_ure::Error {}
/// Compatibility for `failure::Error`
impl ResponseError for failure::Error {
fn error_response(&self) -> Response {
Response::new(StatusCode::INTERNAL_SERVER_ERROR)
}
}
}
#[cfg(feature = "actors")]
/// `InternalServerError` for `actix::MailboxError`
/// This is supported on feature=`actors` only
impl ResponseError for actix::MailboxError {}
#[cfg(feature = "actors")]
/// `InternalServerError` for `actix::ResolverError`
/// This is supported on feature=`actors` only
impl ResponseError for actix::actors::resolver::ResolverError {}
#[cfg(test)]
mod tests {
use super::*;
use http::{Error as HttpError, StatusCode};
use httparse;
use std::error::Error as StdError;
use std::io;
#[test]
@@ -966,7 +993,7 @@ mod tests {
#[test]
fn test_error_cause() {
let orig = io::Error::new(io::ErrorKind::Other, "other");
let desc = orig.description().to_owned();
let desc = orig.to_string();
let e = Error::from(orig);
assert_eq!(format!("{}", e.as_response_error()), desc);
}
@@ -974,7 +1001,7 @@ mod tests {
#[test]
fn test_error_display() {
let orig = io::Error::new(io::ErrorKind::Other, "other");
let desc = orig.description().to_owned();
let desc = orig.to_string();
let e = Error::from(orig);
assert_eq!(format!("{}", e), desc);
}
@@ -1016,7 +1043,7 @@ mod tests {
match ParseError::from($from) {
e @ $error => {
let desc = format!("{}", e);
assert_eq!(desc, format!("IO error: {}", $from.description()));
assert_eq!(desc, format!("IO error: {}", $from));
}
_ => unreachable!("{:?}", $from),
}
@@ -1044,6 +1071,16 @@ mod tests {
assert_eq!(resp.status(), StatusCode::OK);
}
#[test]
fn test_error_casting() {
let err = PayloadError::Overflow;
let resp_err: &dyn ResponseError = &err;
let err = resp_err.downcast_ref::<PayloadError>().unwrap();
assert_eq!(err.to_string(), "A payload reached size limit.");
let not_err = resp_err.downcast_ref::<ContentTypeError>();
assert!(not_err.is_none());
}
#[test]
fn test_error_helpers() {
let r: Response = ErrorBadRequest("err").into();

View File

@@ -1,12 +1,12 @@
use std::any::{Any, TypeId};
use std::fmt;
use hashbrown::HashMap;
use fxhash::FxHashMap;
#[derive(Default)]
/// A type map of request extensions.
pub struct Extensions {
map: HashMap<TypeId, Box<Any>>,
map: FxHashMap<TypeId, Box<dyn Any>>,
}
impl Extensions {
@@ -14,7 +14,7 @@ impl Extensions {
#[inline]
pub fn new() -> Extensions {
Extensions {
map: HashMap::default(),
map: FxHashMap::default(),
}
}
@@ -28,33 +28,30 @@ impl Extensions {
/// Check if container contains entry
pub fn contains<T: 'static>(&self) -> bool {
self.map.get(&TypeId::of::<T>()).is_some()
self.map.contains_key(&TypeId::of::<T>())
}
/// Get a reference to a type previously inserted on this `Extensions`.
pub fn get<T: 'static>(&self) -> Option<&T> {
self.map
.get(&TypeId::of::<T>())
.and_then(|boxed| (&**boxed as &(Any + 'static)).downcast_ref())
.and_then(|boxed| boxed.downcast_ref())
}
/// Get a mutable reference to a type previously inserted on this `Extensions`.
pub fn get_mut<T: 'static>(&mut self) -> Option<&mut T> {
self.map
.get_mut(&TypeId::of::<T>())
.and_then(|boxed| (&mut **boxed as &mut (Any + 'static)).downcast_mut())
.and_then(|boxed| boxed.downcast_mut())
}
/// Remove a type from this `Extensions`.
///
/// If a extension of this type existed, it will be returned.
pub fn remove<T: 'static>(&mut self) -> Option<T> {
self.map.remove(&TypeId::of::<T>()).and_then(|boxed| {
(boxed as Box<Any + 'static>)
.downcast()
.ok()
.map(|boxed| *boxed)
})
self.map
.remove(&TypeId::of::<T>())
.and_then(|boxed| boxed.downcast().ok().map(|boxed| *boxed))
}
/// Clear the `Extensions` of all inserted extensions.
@@ -65,11 +62,97 @@ impl Extensions {
}
impl fmt::Debug for Extensions {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.debug_struct("Extensions").finish()
}
}
#[test]
fn test_remove() {
let mut map = Extensions::new();
map.insert::<i8>(123);
assert!(map.get::<i8>().is_some());
map.remove::<i8>();
assert!(map.get::<i8>().is_none());
}
#[test]
fn test_clear() {
let mut map = Extensions::new();
map.insert::<i8>(8);
map.insert::<i16>(16);
map.insert::<i32>(32);
assert!(map.contains::<i8>());
assert!(map.contains::<i16>());
assert!(map.contains::<i32>());
map.clear();
assert!(!map.contains::<i8>());
assert!(!map.contains::<i16>());
assert!(!map.contains::<i32>());
map.insert::<i8>(10);
assert_eq!(*map.get::<i8>().unwrap(), 10);
}
#[test]
fn test_integers() {
let mut map = Extensions::new();
map.insert::<i8>(8);
map.insert::<i16>(16);
map.insert::<i32>(32);
map.insert::<i64>(64);
map.insert::<i128>(128);
map.insert::<u8>(8);
map.insert::<u16>(16);
map.insert::<u32>(32);
map.insert::<u64>(64);
map.insert::<u128>(128);
assert!(map.get::<i8>().is_some());
assert!(map.get::<i16>().is_some());
assert!(map.get::<i32>().is_some());
assert!(map.get::<i64>().is_some());
assert!(map.get::<i128>().is_some());
assert!(map.get::<u8>().is_some());
assert!(map.get::<u16>().is_some());
assert!(map.get::<u32>().is_some());
assert!(map.get::<u64>().is_some());
assert!(map.get::<u128>().is_some());
}
#[test]
fn test_composition() {
struct Magi<T>(pub T);
struct Madoka {
pub god: bool,
}
struct Homura {
pub attempts: usize,
}
struct Mami {
pub guns: usize,
}
let mut map = Extensions::new();
map.insert(Magi(Madoka { god: false }));
map.insert(Magi(Homura { attempts: 0 }));
map.insert(Magi(Mami { guns: 999 }));
assert!(!map.get::<Magi<Madoka>>().unwrap().0.god);
assert_eq!(0, map.get::<Magi<Homura>>().unwrap().0.attempts);
assert_eq!(999, map.get::<Magi<Mami>>().unwrap().0.guns);
}
#[test]
fn test_extensions() {
#[derive(Debug, PartialEq)]

View File

@@ -1,12 +1,8 @@
#![allow(unused_imports, unused_variables, dead_code)]
use std::io::{self, Write};
use std::io;
use actix_codec::{Decoder, Encoder};
use bitflags::bitflags;
use bytes::{BufMut, Bytes, BytesMut};
use http::header::{
HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING, UPGRADE,
};
use bytes::{Bytes, BytesMut};
use http::{Method, Version};
use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
@@ -15,8 +11,7 @@ use super::{Message, MessageType};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::error::{ParseError, PayloadError};
use crate::helpers;
use crate::message::{ConnectionType, Head, MessagePool, RequestHead, ResponseHead};
use crate::message::{ConnectionType, RequestHeadType, ResponseHead};
bitflags! {
struct Flags: u8 {
@@ -26,8 +21,6 @@ bitflags! {
}
}
const AVERAGE_HEADER_SIZE: usize = 30;
/// HTTP/1 Codec
pub struct ClientCodec {
inner: ClientCodecInner,
@@ -47,8 +40,7 @@ struct ClientCodecInner {
// encoder part
flags: Flags,
headers_size: u32,
encoder: encoder::MessageEncoder<RequestHead>,
encoder: encoder::MessageEncoder<RequestHeadType>,
}
impl Default for ClientCodec {
@@ -76,7 +68,6 @@ impl ClientCodec {
ctype: ConnectionType::Close,
flags,
headers_size: 0,
encoder: encoder::MessageEncoder::default(),
},
}
@@ -183,7 +174,7 @@ impl Decoder for ClientPayloadCodec {
}
impl Encoder for ClientCodec {
type Item = Message<(RequestHead, BodySize)>;
type Item = Message<(RequestHeadType, BodySize)>;
type Error = io::Error;
fn encode(
@@ -192,13 +183,15 @@ impl Encoder for ClientCodec {
dst: &mut BytesMut,
) -> Result<(), Self::Error> {
match item {
Message::Item((mut msg, length)) => {
Message::Item((mut head, length)) => {
let inner = &mut self.inner;
inner.version = msg.version;
inner.flags.set(Flags::HEAD, msg.method == Method::HEAD);
inner.version = head.as_ref().version;
inner
.flags
.set(Flags::HEAD, head.as_ref().method == Method::HEAD);
// connection status
inner.ctype = match msg.connection_type() {
inner.ctype = match head.as_ref().connection_type() {
ConnectionType::KeepAlive => {
if inner.flags.contains(Flags::KEEPALIVE_ENABLED) {
ConnectionType::KeepAlive
@@ -212,7 +205,7 @@ impl Encoder for ClientCodec {
inner.encoder.encode(
dst,
&mut msg,
&mut head,
false,
false,
inner.version,

View File

@@ -1,12 +1,9 @@
#![allow(unused_imports, unused_variables, dead_code)]
use std::io::Write;
use std::{fmt, io, net};
use std::{fmt, io};
use actix_codec::{Decoder, Encoder};
use bitflags::bitflags;
use bytes::{BufMut, Bytes, BytesMut};
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use http::{Method, StatusCode, Version};
use bytes::BytesMut;
use http::{Method, Version};
use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
use super::{decoder, encoder};
@@ -14,8 +11,7 @@ use super::{Message, MessageType};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::error::ParseError;
use crate::helpers;
use crate::message::{ConnectionType, Head, ResponseHead};
use crate::message::ConnectionType;
use crate::request::Request;
use crate::response::Response;
@@ -27,8 +23,6 @@ bitflags! {
}
}
const AVERAGE_HEADER_SIZE: usize = 30;
/// HTTP/1 Codec
pub struct Codec {
config: ServiceConfig,
@@ -49,7 +43,7 @@ impl Default for Codec {
}
impl fmt::Debug for Codec {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "h1::Codec({:?})", self.flags)
}
}
@@ -176,7 +170,6 @@ impl Encoder for Codec {
};
// encode message
let len = dst.len();
self.encoder.encode(
dst,
&mut res,
@@ -202,17 +195,11 @@ impl Encoder for Codec {
#[cfg(test)]
mod tests {
use std::{cmp, io};
use actix_codec::{AsyncRead, AsyncWrite};
use bytes::{Buf, Bytes, BytesMut};
use http::{Method, Version};
use bytes::BytesMut;
use http::Method;
use super::*;
use crate::error::ParseError;
use crate::h1::Message;
use crate::httpmessage::HttpMessage;
use crate::request::Request;
#[test]
fn test_http_request_chunked_payload_and_next_message() {

View File

@@ -1,12 +1,13 @@
use std::convert::TryFrom;
use std::io;
use std::marker::PhantomData;
use std::{io, mem};
use std::mem::MaybeUninit;
use std::task::Poll;
use actix_codec::Decoder;
use bytes::{Bytes, BytesMut};
use futures::{Async, Poll};
use bytes::{Buf, Bytes, BytesMut};
use http::header::{HeaderName, HeaderValue};
use http::{header, HttpTryFrom, Method, StatusCode, Uri, Version};
use httparse;
use http::{header, Method, StatusCode, Uri, Version};
use log::{debug, error, trace};
use crate::error::ParseError;
@@ -78,8 +79,8 @@ pub(crate) trait MessageType: Sized {
// Unsafe: httparse check header value for valid utf-8
let value = unsafe {
HeaderValue::from_shared_unchecked(
slice.slice(idx.value.0, idx.value.1),
HeaderValue::from_maybe_shared_unchecked(
slice.slice(idx.value.0..idx.value.1),
)
};
match name {
@@ -183,14 +184,16 @@ impl MessageType for Request {
&mut self.head_mut().headers
}
#[allow(clippy::uninit_assumed_init)]
fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
// Unsafe: we read only this data only after httparse parses headers into.
// performance bump for pipeline benchmarks.
let mut headers: [HeaderIndex; MAX_HEADERS] = unsafe { mem::uninitialized() };
let mut headers: [HeaderIndex; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let (len, method, uri, ver, h_len) = {
let mut parsed: [httparse::Header; MAX_HEADERS] =
unsafe { mem::uninitialized() };
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut req = httparse::Request::new(&mut parsed);
match req.parse(src)? {
@@ -257,14 +260,16 @@ impl MessageType for ResponseHead {
&mut self.headers
}
#[allow(clippy::uninit_assumed_init)]
fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
// Unsafe: we read only this data only after httparse parses headers into.
// performance bump for pipeline benchmarks.
let mut headers: [HeaderIndex; MAX_HEADERS] = unsafe { mem::uninitialized() };
let mut headers: [HeaderIndex; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let (len, ver, status, h_len) = {
let mut parsed: [httparse::Header; MAX_HEADERS] =
unsafe { mem::uninitialized() };
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut res = httparse::Response::new(&mut parsed);
match res.parse(src)? {
@@ -322,7 +327,7 @@ pub(crate) struct HeaderIndex {
impl HeaderIndex {
pub(crate) fn record(
bytes: &[u8],
headers: &[httparse::Header],
headers: &[httparse::Header<'_>],
indices: &mut [HeaderIndex],
) {
let bytes_ptr = bytes.as_ptr() as usize;
@@ -425,7 +430,7 @@ impl Decoder for PayloadDecoder {
let len = src.len() as u64;
let buf;
if *remaining > len {
buf = src.take().freeze();
buf = src.split().freeze();
*remaining -= len;
} else {
buf = src.split_to(*remaining as usize).freeze();
@@ -439,9 +444,10 @@ impl Decoder for PayloadDecoder {
loop {
let mut buf = None;
// advances the chunked state
*state = match state.step(src, size, &mut buf)? {
Async::NotReady => return Ok(None),
Async::Ready(state) => state,
*state = match state.step(src, size, &mut buf) {
Poll::Pending => return Ok(None),
Poll::Ready(Ok(state)) => state,
Poll::Ready(Err(e)) => return Err(e),
};
if *state == ChunkedState::End {
trace!("End of chunked stream");
@@ -459,7 +465,7 @@ impl Decoder for PayloadDecoder {
if src.is_empty() {
Ok(None)
} else {
Ok(Some(PayloadItem::Chunk(src.take().freeze())))
Ok(Some(PayloadItem::Chunk(src.split().freeze())))
}
}
}
@@ -470,10 +476,10 @@ macro_rules! byte (
($rdr:ident) => ({
if $rdr.len() > 0 {
let b = $rdr[0];
$rdr.split_to(1);
$rdr.advance(1);
b
} else {
return Ok(Async::NotReady)
return Poll::Pending
}
})
);
@@ -484,7 +490,7 @@ impl ChunkedState {
body: &mut BytesMut,
size: &mut u64,
buf: &mut Option<Bytes>,
) -> Poll<ChunkedState, io::Error> {
) -> Poll<Result<ChunkedState, io::Error>> {
use self::ChunkedState::*;
match *self {
Size => ChunkedState::read_size(body, size),
@@ -496,66 +502,71 @@ impl ChunkedState {
BodyLf => ChunkedState::read_body_lf(body),
EndCr => ChunkedState::read_end_cr(body),
EndLf => ChunkedState::read_end_lf(body),
End => Ok(Async::Ready(ChunkedState::End)),
End => Poll::Ready(Ok(ChunkedState::End)),
}
}
fn read_size(rdr: &mut BytesMut, size: &mut u64) -> Poll<ChunkedState, io::Error> {
fn read_size(
rdr: &mut BytesMut,
size: &mut u64,
) -> Poll<Result<ChunkedState, io::Error>> {
let radix = 16;
match byte!(rdr) {
b @ b'0'...b'9' => {
b @ b'0'..=b'9' => {
*size *= radix;
*size += u64::from(b - b'0');
}
b @ b'a'...b'f' => {
b @ b'a'..=b'f' => {
*size *= radix;
*size += u64::from(b + 10 - b'a');
}
b @ b'A'...b'F' => {
b @ b'A'..=b'F' => {
*size *= radix;
*size += u64::from(b + 10 - b'A');
}
b'\t' | b' ' => return Ok(Async::Ready(ChunkedState::SizeLws)),
b';' => return Ok(Async::Ready(ChunkedState::Extension)),
b'\r' => return Ok(Async::Ready(ChunkedState::SizeLf)),
b'\t' | b' ' => return Poll::Ready(Ok(ChunkedState::SizeLws)),
b';' => return Poll::Ready(Ok(ChunkedState::Extension)),
b'\r' => return Poll::Ready(Ok(ChunkedState::SizeLf)),
_ => {
return Err(io::Error::new(
return Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk size line: Invalid Size",
));
)));
}
}
Ok(Async::Ready(ChunkedState::Size))
Poll::Ready(Ok(ChunkedState::Size))
}
fn read_size_lws(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_size_lws(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
trace!("read_size_lws");
match byte!(rdr) {
// LWS can follow the chunk size, but no more digits can come
b'\t' | b' ' => Ok(Async::Ready(ChunkedState::SizeLws)),
b';' => Ok(Async::Ready(ChunkedState::Extension)),
b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)),
_ => Err(io::Error::new(
b'\t' | b' ' => Poll::Ready(Ok(ChunkedState::SizeLws)),
b';' => Poll::Ready(Ok(ChunkedState::Extension)),
b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk size linear white space",
)),
))),
}
}
fn read_extension(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_extension(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)),
_ => Ok(Async::Ready(ChunkedState::Extension)), // no supported extensions
b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
_ => Poll::Ready(Ok(ChunkedState::Extension)), // no supported extensions
}
}
fn read_size_lf(
rdr: &mut BytesMut,
size: &mut u64,
) -> Poll<ChunkedState, io::Error> {
) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\n' if *size > 0 => Ok(Async::Ready(ChunkedState::Body)),
b'\n' if *size == 0 => Ok(Async::Ready(ChunkedState::EndCr)),
_ => Err(io::Error::new(
b'\n' if *size > 0 => Poll::Ready(Ok(ChunkedState::Body)),
b'\n' if *size == 0 => Poll::Ready(Ok(ChunkedState::EndCr)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk size LF",
)),
))),
}
}
@@ -563,16 +574,16 @@ impl ChunkedState {
rdr: &mut BytesMut,
rem: &mut u64,
buf: &mut Option<Bytes>,
) -> Poll<ChunkedState, io::Error> {
) -> Poll<Result<ChunkedState, io::Error>> {
trace!("Chunked read, remaining={:?}", rem);
let len = rdr.len() as u64;
if len == 0 {
Ok(Async::Ready(ChunkedState::Body))
Poll::Ready(Ok(ChunkedState::Body))
} else {
let slice;
if *rem > len {
slice = rdr.take().freeze();
slice = rdr.split().freeze();
*rem -= len;
} else {
slice = rdr.split_to(*rem as usize).freeze();
@@ -580,47 +591,47 @@ impl ChunkedState {
}
*buf = Some(slice);
if *rem > 0 {
Ok(Async::Ready(ChunkedState::Body))
Poll::Ready(Ok(ChunkedState::Body))
} else {
Ok(Async::Ready(ChunkedState::BodyCr))
Poll::Ready(Ok(ChunkedState::BodyCr))
}
}
}
fn read_body_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_body_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\r' => Ok(Async::Ready(ChunkedState::BodyLf)),
_ => Err(io::Error::new(
b'\r' => Poll::Ready(Ok(ChunkedState::BodyLf)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk body CR",
)),
))),
}
}
fn read_body_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_body_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\n' => Ok(Async::Ready(ChunkedState::Size)),
_ => Err(io::Error::new(
b'\n' => Poll::Ready(Ok(ChunkedState::Size)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk body LF",
)),
))),
}
}
fn read_end_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_end_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\r' => Ok(Async::Ready(ChunkedState::EndLf)),
_ => Err(io::Error::new(
b'\r' => Poll::Ready(Ok(ChunkedState::EndLf)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk end CR",
)),
))),
}
}
fn read_end_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_end_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\n' => Ok(Async::Ready(ChunkedState::End)),
_ => Err(io::Error::new(
b'\n' => Poll::Ready(Ok(ChunkedState::End)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk end LF",
)),
))),
}
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -1,22 +1,18 @@
#![allow(unused_imports, unused_variables, dead_code)]
use std::fmt::Write as FmtWrite;
use std::io::Write;
use std::marker::PhantomData;
use std::str::FromStr;
use std::{cmp, fmt, io, mem};
use std::ptr::copy_nonoverlapping;
use std::slice::from_raw_parts_mut;
use std::{cmp, io};
use bytes::{BufMut, Bytes, BytesMut};
use bytes::{buf::BufMutExt, BufMut, BytesMut};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::header::{map, ContentEncoding};
use crate::header::map;
use crate::helpers;
use crate::http::header::{
HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING,
};
use crate::http::{HeaderMap, Method, StatusCode, Version};
use crate::message::{ConnectionType, Head, RequestHead, ResponseHead};
use crate::request::Request;
use crate::http::header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use crate::http::{HeaderMap, StatusCode, Version};
use crate::message::{ConnectionType, RequestHeadType};
use crate::response::Response;
const AVERAGE_HEADER_SIZE: usize = 30;
@@ -43,6 +39,8 @@ pub(crate) trait MessageType: Sized {
fn headers(&self) -> &HeaderMap;
fn extra_headers(&self) -> Option<&HeaderMap>;
fn camel_case(&self) -> bool {
false
}
@@ -103,6 +101,7 @@ pub(crate) trait MessageType: Sized {
} else {
dst.put_slice(b"\r\ncontent-length: ");
}
#[allow(clippy::write_with_newline)]
write!(dst.writer(), "{}\r\n", len)?;
}
BodySize::None => dst.put_slice(b"\r\n"),
@@ -128,12 +127,22 @@ pub(crate) trait MessageType: Sized {
_ => (),
}
// merging headers from head and extra headers. HeaderMap::new() does not allocate.
let empty_headers = HeaderMap::new();
let extra_headers = self.extra_headers().unwrap_or(&empty_headers);
let headers = self
.headers()
.inner
.iter()
.filter(|(name, _)| !extra_headers.contains_key(*name))
.chain(extra_headers.inner.iter());
// write headers
let mut pos = 0;
let mut has_date = false;
let mut remaining = dst.remaining_mut();
let mut buf = unsafe { &mut *(dst.bytes_mut() as *mut [u8]) };
for (key, value) in self.headers().inner.iter() {
let mut remaining = dst.capacity() - dst.len();
let mut buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
for (key, value) in headers {
match *key {
CONNECTION => continue,
TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => continue,
@@ -146,61 +155,67 @@ pub(crate) trait MessageType: Sized {
match value {
map::Value::One(ref val) => {
let v = val.as_ref();
let len = k.len() + v.len() + 4;
let v_len = v.len();
let k_len = k.len();
let len = k_len + v_len + 4;
if len > remaining {
unsafe {
dst.advance_mut(pos);
}
pos = 0;
dst.reserve(len * 2);
remaining = dst.remaining_mut();
unsafe {
buf = &mut *(dst.bytes_mut() as *mut _);
}
remaining = dst.capacity() - dst.len();
buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
}
// use upper Camel-Case
unsafe {
if camel_case {
write_camel_case(k, &mut buf[pos..pos + k.len()]);
write_camel_case(k, from_raw_parts_mut(buf, k_len))
} else {
buf[pos..pos + k.len()].copy_from_slice(k);
write_data(k, buf, k_len)
}
pos += k.len();
buf[pos..pos + 2].copy_from_slice(b": ");
pos += 2;
buf[pos..pos + v.len()].copy_from_slice(v);
pos += v.len();
buf[pos..pos + 2].copy_from_slice(b"\r\n");
pos += 2;
buf = buf.add(k_len);
write_data(b": ", buf, 2);
buf = buf.add(2);
write_data(v, buf, v_len);
buf = buf.add(v_len);
write_data(b"\r\n", buf, 2);
buf = buf.add(2);
pos += len;
remaining -= len;
}
}
map::Value::Multi(ref vec) => {
for val in vec {
let v = val.as_ref();
let len = k.len() + v.len() + 4;
let v_len = v.len();
let k_len = k.len();
let len = k_len + v_len + 4;
if len > remaining {
unsafe {
dst.advance_mut(pos);
}
pos = 0;
dst.reserve(len * 2);
remaining = dst.remaining_mut();
unsafe {
buf = &mut *(dst.bytes_mut() as *mut _);
}
remaining = dst.capacity() - dst.len();
buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
}
// use upper Camel-Case
unsafe {
if camel_case {
write_camel_case(k, &mut buf[pos..pos + k.len()]);
write_camel_case(k, from_raw_parts_mut(buf, k_len));
} else {
buf[pos..pos + k.len()].copy_from_slice(k);
write_data(k, buf, k_len);
}
pos += k.len();
buf[pos..pos + 2].copy_from_slice(b": ");
pos += 2;
buf[pos..pos + v.len()].copy_from_slice(v);
pos += v.len();
buf[pos..pos + 2].copy_from_slice(b"\r\n");
pos += 2;
buf = buf.add(k_len);
write_data(b": ", buf, 2);
buf = buf.add(2);
write_data(v, buf, v_len);
buf = buf.add(v_len);
write_data(b"\r\n", buf, 2);
buf = buf.add(2);
};
pos += len;
remaining -= len;
}
}
@@ -235,6 +250,10 @@ impl MessageType for Response<()> {
&self.head().headers
}
fn extra_headers(&self) -> Option<&HeaderMap> {
None
}
fn encode_status(&mut self, dst: &mut BytesMut) -> io::Result<()> {
let head = self.head();
let reason = head.reason().as_bytes();
@@ -247,35 +266,46 @@ impl MessageType for Response<()> {
}
}
impl MessageType for RequestHead {
impl MessageType for RequestHeadType {
fn status(&self) -> Option<StatusCode> {
None
}
fn chunked(&self) -> bool {
self.chunked()
self.as_ref().chunked()
}
fn camel_case(&self) -> bool {
RequestHead::camel_case_headers(self)
self.as_ref().camel_case_headers()
}
fn headers(&self) -> &HeaderMap {
&self.headers
self.as_ref().headers()
}
fn extra_headers(&self) -> Option<&HeaderMap> {
self.extra_headers()
}
fn encode_status(&mut self, dst: &mut BytesMut) -> io::Result<()> {
dst.reserve(256 + self.headers.len() * AVERAGE_HEADER_SIZE);
let head = self.as_ref();
dst.reserve(256 + head.headers.len() * AVERAGE_HEADER_SIZE);
write!(
Writer(dst),
"{} {} {}",
self.method,
self.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
match self.version {
head.method,
head.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
match head.version {
Version::HTTP_09 => "HTTP/0.9",
Version::HTTP_10 => "HTTP/1.0",
Version::HTTP_11 => "HTTP/1.1",
Version::HTTP_2 => "HTTP/2.0",
Version::HTTP_3 => "HTTP/3.0",
_ =>
return Err(io::Error::new(
io::ErrorKind::Other,
"unsupported version"
)),
}
)
.map_err(|e| io::Error::new(io::ErrorKind::Other, e))
@@ -457,6 +487,10 @@ impl<'a> io::Write for Writer<'a> {
}
}
unsafe fn write_data(value: &[u8], buf: *mut u8, len: usize) {
copy_nonoverlapping(value.as_ptr(), buf, len);
}
fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
let mut index = 0;
let key = value;
@@ -487,10 +521,14 @@ fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
#[cfg(test)]
mod tests {
use std::rc::Rc;
use bytes::Bytes;
use http::header::AUTHORIZATION;
use super::*;
use crate::http::header::{HeaderValue, CONTENT_TYPE};
use crate::RequestHead;
#[test]
fn test_chunked_te() {
@@ -501,7 +539,7 @@ mod tests {
assert!(enc.encode(b"", &mut bytes).ok().unwrap());
}
assert_eq!(
bytes.take().freeze(),
bytes.split().freeze(),
Bytes::from_static(b"4\r\ntest\r\n0\r\n\r\n")
);
}
@@ -515,6 +553,8 @@ mod tests {
head.headers
.insert(CONTENT_TYPE, HeaderValue::from_static("plain/text"));
let mut head = RequestHeadType::Owned(head);
let _ = head.encode_headers(
&mut bytes,
Version::HTTP_11,
@@ -522,10 +562,12 @@ mod tests {
ConnectionType::Close,
&ServiceConfig::default(),
);
assert_eq!(
bytes.take().freeze(),
Bytes::from_static(b"\r\nContent-Length: 0\r\nConnection: close\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n")
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("Content-Length: 0\r\n"));
assert!(data.contains("Connection: close\r\n"));
assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let _ = head.encode_headers(
&mut bytes,
@@ -534,10 +576,11 @@ mod tests {
ConnectionType::KeepAlive,
&ServiceConfig::default(),
);
assert_eq!(
bytes.take().freeze(),
Bytes::from_static(b"\r\nTransfer-Encoding: chunked\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n")
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("Transfer-Encoding: chunked\r\n"));
assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let _ = head.encode_headers(
&mut bytes,
@@ -546,13 +589,21 @@ mod tests {
ConnectionType::KeepAlive,
&ServiceConfig::default(),
);
assert_eq!(
bytes.take().freeze(),
Bytes::from_static(b"\r\nContent-Length: 100\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n")
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("Content-Length: 100\r\n"));
assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let mut head = RequestHead::default();
head.set_camel_case_headers(false);
head.headers.insert(DATE, HeaderValue::from_static("date"));
head.headers
.insert(CONTENT_TYPE, HeaderValue::from_static("plain/text"));
head.headers
.append(CONTENT_TYPE, HeaderValue::from_static("xml"));
let mut head = RequestHeadType::Owned(head);
let _ = head.encode_headers(
&mut bytes,
Version::HTTP_11,
@@ -560,22 +611,45 @@ mod tests {
ConnectionType::KeepAlive,
&ServiceConfig::default(),
);
assert_eq!(
bytes.take().freeze(),
Bytes::from_static(b"\r\nTransfer-Encoding: chunked\r\nDate: date\r\nContent-Type: xml\r\nContent-Type: plain/text\r\n\r\n")
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("transfer-encoding: chunked\r\n"));
assert!(data.contains("content-type: xml\r\n"));
assert!(data.contains("content-type: plain/text\r\n"));
assert!(data.contains("date: date\r\n"));
}
#[test]
fn test_extra_headers() {
let mut bytes = BytesMut::with_capacity(2048);
let mut head = RequestHead::default();
head.headers.insert(
AUTHORIZATION,
HeaderValue::from_static("some authorization"),
);
head.set_camel_case_headers(false);
let mut extra_headers = HeaderMap::new();
extra_headers.insert(
AUTHORIZATION,
HeaderValue::from_static("another authorization"),
);
extra_headers.insert(DATE, HeaderValue::from_static("date"));
let mut head = RequestHeadType::Rc(Rc::new(head), Some(extra_headers));
let _ = head.encode_headers(
&mut bytes,
Version::HTTP_11,
BodySize::Stream,
ConnectionType::KeepAlive,
BodySize::Empty,
ConnectionType::Close,
&ServiceConfig::default(),
);
assert_eq!(
bytes.take().freeze(),
Bytes::from_static(b"\r\ntransfer-encoding: chunked\r\ndate: date\r\ncontent-type: xml\r\ncontent-type: plain/text\r\n\r\n")
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("content-length: 0\r\n"));
assert!(data.contains("connection: close\r\n"));
assert!(data.contains("authorization: another authorization\r\n"));
assert!(data.contains("date: date\r\n"));
}
}

View File

@@ -1,23 +1,23 @@
use actix_server_config::ServerConfig;
use actix_service::{NewService, Service};
use futures::future::{ok, FutureResult};
use futures::{Async, Poll};
use std::task::{Context, Poll};
use actix_service::{Service, ServiceFactory};
use futures_util::future::{ok, Ready};
use crate::error::Error;
use crate::request::Request;
pub struct ExpectHandler;
impl NewService for ExpectHandler {
type Config = ServerConfig;
impl ServiceFactory for ExpectHandler {
type Config = ();
type Request = Request;
type Response = Request;
type Error = Error;
type Service = ExpectHandler;
type InitError = Error;
type Future = FutureResult<Self::Service, Self::InitError>;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &ServerConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
ok(ExpectHandler)
}
}
@@ -26,10 +26,10 @@ impl Service for ExpectHandler {
type Request = Request;
type Response = Request;
type Error = Error;
type Future = FutureResult<Self::Response, Self::Error>;
type Future = Ready<Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, req: Request) -> Self::Future {

View File

@@ -1,12 +1,13 @@
//! Payload stream
use std::cell::RefCell;
use std::collections::VecDeque;
use std::pin::Pin;
use std::rc::{Rc, Weak};
use std::task::{Context, Poll};
use actix_utils::task::LocalWaker;
use bytes::Bytes;
use futures::task::current as current_task;
use futures::task::Task;
use futures::{Async, Poll, Stream};
use futures_core::Stream;
use crate::error::PayloadError;
@@ -77,15 +78,24 @@ impl Payload {
pub fn unread_data(&mut self, data: Bytes) {
self.inner.borrow_mut().unread_data(data);
}
#[inline]
pub fn readany(
&mut self,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
self.inner.borrow_mut().readany(cx)
}
}
impl Stream for Payload {
type Item = Bytes;
type Error = PayloadError;
type Item = Result<Bytes, PayloadError>;
#[inline]
fn poll(&mut self) -> Poll<Option<Bytes>, PayloadError> {
self.inner.borrow_mut().readany()
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
self.inner.borrow_mut().readany(cx)
}
}
@@ -117,19 +127,14 @@ impl PayloadSender {
}
#[inline]
pub fn need_read(&self) -> PayloadStatus {
pub fn need_read(&self, cx: &mut Context<'_>) -> PayloadStatus {
// we check need_read only if Payload (other side) is alive,
// otherwise always return true (consume payload)
if let Some(shared) = self.inner.upgrade() {
if shared.borrow().need_read {
PayloadStatus::Read
} else {
#[cfg(not(test))]
{
if shared.borrow_mut().io_task.is_none() {
shared.borrow_mut().io_task = Some(current_task());
}
}
shared.borrow_mut().io_task.register(cx.waker());
PayloadStatus::Pause
}
} else {
@@ -145,8 +150,8 @@ struct Inner {
err: Option<PayloadError>,
need_read: bool,
items: VecDeque<Bytes>,
task: Option<Task>,
io_task: Option<Task>,
task: LocalWaker,
io_task: LocalWaker,
}
impl Inner {
@@ -157,8 +162,8 @@ impl Inner {
err: None,
items: VecDeque::new(),
need_read: true,
task: None,
io_task: None,
task: LocalWaker::new(),
io_task: LocalWaker::new(),
}
}
@@ -178,7 +183,7 @@ impl Inner {
self.items.push_back(data);
self.need_read = self.len < MAX_BUFFER_SIZE;
if let Some(task) = self.task.take() {
task.notify()
task.wake()
}
}
@@ -187,34 +192,28 @@ impl Inner {
self.len
}
fn readany(&mut self) -> Poll<Option<Bytes>, PayloadError> {
fn readany(
&mut self,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
if let Some(data) = self.items.pop_front() {
self.len -= data.len();
self.need_read = self.len < MAX_BUFFER_SIZE;
if self.need_read && self.task.is_none() && !self.eof {
self.task = Some(current_task());
if self.need_read && !self.eof {
self.task.register(cx.waker());
}
if let Some(task) = self.io_task.take() {
task.notify()
}
Ok(Async::Ready(Some(data)))
self.io_task.wake();
Poll::Ready(Some(Ok(data)))
} else if let Some(err) = self.err.take() {
Err(err)
Poll::Ready(Some(Err(err)))
} else if self.eof {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
self.need_read = true;
#[cfg(not(test))]
{
if self.task.is_none() {
self.task = Some(current_task());
}
if let Some(task) = self.io_task.take() {
task.notify()
}
}
Ok(Async::NotReady)
self.task.register(cx.waker());
self.io_task.wake();
Poll::Pending
}
}
@@ -227,14 +226,10 @@ impl Inner {
#[cfg(test)]
mod tests {
use super::*;
use actix_rt::Runtime;
use futures::future::{lazy, result};
use futures_util::future::poll_fn;
#[test]
fn test_unread_data() {
Runtime::new()
.unwrap()
.block_on(lazy(|| {
#[actix_rt::test]
async fn test_unread_data() {
let (_, mut payload) = Payload::create(false);
payload.unread_data(Bytes::from("data"));
@@ -242,13 +237,8 @@ mod tests {
assert_eq!(payload.len(), 4);
assert_eq!(
Async::Ready(Some(Bytes::from("data"))),
payload.poll().ok().unwrap()
Bytes::from("data"),
poll_fn(|cx| payload.readany(cx)).await.unwrap().unwrap()
);
let res: Result<(), ()> = Ok(());
result(res)
}))
.unwrap();
}
}

View File

@@ -1,16 +1,19 @@
use std::fmt;
use std::future::Future;
use std::marker::PhantomData;
use std::pin::Pin;
use std::rc::Rc;
use std::task::{Context, Poll};
use std::{fmt, net};
use actix_codec::Framed;
use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig};
use actix_service::{IntoNewService, NewService, Service};
use actix_utils::cloneable::CloneableService;
use futures::future::{ok, FutureResult};
use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_rt::net::TcpStream;
use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
use futures_core::ready;
use futures_util::future::{ok, Ready};
use crate::body::MessageBody;
use crate::config::{KeepAlive, ServiceConfig};
use crate::cloneable::CloneableService;
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error, ParseError};
use crate::helpers::DataFactory;
use crate::request::Request;
@@ -20,43 +23,32 @@ use super::codec::Codec;
use super::dispatcher::Dispatcher;
use super::{ExpectHandler, Message, UpgradeHandler};
/// `NewService` implementation for HTTP1 transport
pub struct H1Service<T, P, S, B, X = ExpectHandler, U = UpgradeHandler<T>> {
/// `ServiceFactory` implementation for HTTP1 transport
pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler<T>> {
srv: S,
cfg: ServiceConfig,
expect: X,
upgrade: Option<U>,
on_connect: Option<Rc<Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B> H1Service<T, P, S, B>
impl<T, S, B> H1Service<T, S, B>
where
S: NewService<Config = SrvConfig, Request = Request>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
{
/// Create new `HttpService` instance with default config.
pub fn new<F: IntoNewService<S>>(service: F) -> Self {
let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
H1Service {
cfg,
srv: service.into_new_service(),
expect: ExpectHandler,
upgrade: None,
on_connect: None,
_t: PhantomData,
}
}
/// Create new `HttpService` instance with config.
pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self {
pub(crate) fn with_config<F: IntoServiceFactory<S>>(
cfg: ServiceConfig,
service: F,
) -> Self {
H1Service {
cfg,
srv: service.into_new_service(),
srv: service.into_factory(),
expect: ExpectHandler,
upgrade: None,
on_connect: None,
@@ -65,17 +57,153 @@ where
}
}
impl<T, P, S, B, X, U> H1Service<T, P, S, B, X, U>
impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
where
S: NewService<Config = SrvConfig, Request = Request>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<TcpStream, Codec>),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
/// Create simple tcp stream service
pub fn tcp(
self,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = DispatchError,
InitError = (),
> {
pipeline_factory(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok((io, peer_addr))
})
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use super::*;
use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
use actix_tls::{openssl::HandshakeError, SslError};
impl<S, B, X, U> H1Service<SslStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<SslStream<TcpStream>, Codec>),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
/// Create openssl based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<HandshakeError<TcpStream>, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: SslStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_tls::rustls::{Acceptor, ServerConfig, TlsStream};
use actix_tls::SslError;
use std::{fmt, io};
impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<TlsStream<TcpStream>, Codec>),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
/// Create rustls based service
pub fn rustls(
self,
config: ServerConfig,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<io::Error, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(config)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
impl<T, S, B, X, U> H1Service<T, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
{
pub fn expect<X1>(self, expect: X1) -> H1Service<T, P, S, B, X1, U>
pub fn expect<X1>(self, expect: X1) -> H1Service<T, S, B, X1, U>
where
X1: NewService<Request = Request, Response = Request>,
X1: ServiceFactory<Request = Request, Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
{
@@ -89,9 +217,9 @@ where
}
}
pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, P, S, B, X, U1>
pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, S, B, X, U1>
where
U1: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
U1: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
{
@@ -108,45 +236,41 @@ where
/// Set on connect callback.
pub(crate) fn on_connect(
mut self,
f: Option<Rc<Fn(&T) -> Box<dyn DataFactory>>>,
f: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
) -> Self {
self.on_connect = f;
self
}
}
impl<T, P, S, B, X, U> NewService for H1Service<T, P, S, B, X, U>
impl<T, S, B, X, U> ServiceFactory for H1Service<T, S, B, X, U>
where
T: IoStream,
S: NewService<Config = SrvConfig, Request = Request>,
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<
Config = SrvConfig,
Request = (Request, Framed<T, Codec>),
Response = (),
>,
U::Error: fmt::Display,
U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
type Config = SrvConfig;
type Request = Io<T, P>;
type Config = ();
type Request = (T, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type InitError = ();
type Service = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
type Future = H1ServiceResponse<T, P, S, B, X, U>;
type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
type Future = H1ServiceResponse<T, S, B, X, U>;
fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
H1ServiceResponse {
fut: self.srv.new_service(cfg).into_future(),
fut_ex: Some(self.expect.new_service(cfg)),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(cfg)),
fut: self.srv.new_service(()),
fut_ex: Some(self.expect.new_service(())),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
expect: None,
upgrade: None,
on_connect: self.on_connect.clone(),
@@ -157,88 +281,99 @@ where
}
#[doc(hidden)]
pub struct H1ServiceResponse<T, P, S, B, X, U>
#[pin_project::pin_project]
pub struct H1ServiceResponse<T, S, B, X, U>
where
S: NewService<Request = Request>,
S: ServiceFactory<Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
X: NewService<Request = Request, Response = Request>,
X: ServiceFactory<Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
#[pin]
fut: S::Future,
#[pin]
fut_ex: Option<X::Future>,
#[pin]
fut_upg: Option<U::Future>,
expect: Option<X::Service>,
upgrade: Option<U::Service>,
on_connect: Option<Rc<Fn(&T) -> Box<dyn DataFactory>>>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
cfg: Option<ServiceConfig>,
_t: PhantomData<(T, P, B)>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B, X, U> Future for H1ServiceResponse<T, P, S, B, X, U>
impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
where
T: IoStream,
S: NewService<Request = Request>,
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
X: NewService<Request = Request, Response = Request>,
X: ServiceFactory<Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
type Item = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
type Error = ();
type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
if let Some(ref mut fut) = self.fut_ex {
let expect = try_ready!(fut
.poll()
.map_err(|e| log::error!("Init http service error: {:?}", e)));
self.expect = Some(expect);
self.fut_ex.take();
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
if let Some(fut) = this.fut_ex.as_pin_mut() {
let expect = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.expect = Some(expect);
this.fut_ex.set(None);
}
if let Some(ref mut fut) = self.fut_upg {
let upgrade = try_ready!(fut
.poll()
.map_err(|e| log::error!("Init http service error: {:?}", e)));
self.upgrade = Some(upgrade);
self.fut_ex.take();
if let Some(fut) = this.fut_upg.as_pin_mut() {
let upgrade = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.upgrade = Some(upgrade);
this.fut_ex.set(None);
}
let service = try_ready!(self
let result = ready!(this
.fut
.poll()
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)));
Ok(Async::Ready(H1ServiceHandler::new(
self.cfg.take().unwrap(),
Poll::Ready(result.map(|service| {
let this = self.as_mut().project();
H1ServiceHandler::new(
this.cfg.take().unwrap(),
service,
self.expect.take().unwrap(),
self.upgrade.take(),
self.on_connect.clone(),
)))
this.expect.take().unwrap(),
this.upgrade.take(),
this.on_connect.clone(),
)
}))
}
}
/// `Service` implementation for HTTP1 transport
pub struct H1ServiceHandler<T, P, S, B, X, U> {
pub struct H1ServiceHandler<T, S: Service, B, X: Service, U: Service> {
srv: CloneableService<S>,
expect: CloneableService<X>,
upgrade: Option<CloneableService<U>>,
on_connect: Option<Rc<Fn(&T) -> Box<dyn DataFactory>>>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
cfg: ServiceConfig,
_t: PhantomData<(T, P, B)>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B, X, U> H1ServiceHandler<T, P, S, B, X, U>
impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
where
S: Service<Request = Request>,
S::Error: Into<Error>,
@@ -254,12 +389,12 @@ where
srv: S,
expect: X,
upgrade: Option<U>,
on_connect: Option<Rc<Fn(&T) -> Box<dyn DataFactory>>>,
) -> H1ServiceHandler<T, P, S, B, X, U> {
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
) -> H1ServiceHandler<T, S, B, X, U> {
H1ServiceHandler {
srv: CloneableService::new(srv),
expect: CloneableService::new(expect),
upgrade: upgrade.map(|s| CloneableService::new(s)),
upgrade: upgrade.map(CloneableService::new),
cfg,
on_connect,
_t: PhantomData,
@@ -267,9 +402,9 @@ where
}
}
impl<T, P, S, B, X, U> Service for H1ServiceHandler<T, P, S, B, X, U>
impl<T, S, B, X, U> Service for H1ServiceHandler<T, S, B, X, U>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
@@ -277,17 +412,17 @@ where
X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::Error: fmt::Display + Into<Error>,
{
type Request = Io<T, P>;
type Request = (T, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type Future = Dispatcher<T, S, B, X, U>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
let ready = self
.expect
.poll_ready()
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
@@ -297,7 +432,7 @@ where
let ready = self
.srv
.poll_ready()
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
@@ -306,16 +441,27 @@ where
.is_ready()
&& ready;
if ready {
Ok(Async::Ready(()))
let ready = if let Some(ref mut upg) = self.upgrade {
upg.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready()
&& ready
} else {
Ok(Async::NotReady)
ready
};
if ready {
Poll::Ready(Ok(()))
} else {
Poll::Pending
}
}
fn call(&mut self, req: Self::Request) -> Self::Future {
let io = req.into_parts().0;
fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
let on_connect = if let Some(ref on_connect) = self.on_connect {
Some(on_connect(&io))
} else {
@@ -329,20 +475,21 @@ where
self.expect.clone(),
self.upgrade.clone(),
on_connect,
addr,
)
}
}
/// `NewService` implementation for `OneRequestService` service
/// `ServiceFactory` implementation for `OneRequestService` service
#[derive(Default)]
pub struct OneRequest<T, P> {
pub struct OneRequest<T> {
config: ServiceConfig,
_t: PhantomData<(T, P)>,
_t: PhantomData<T>,
}
impl<T, P> OneRequest<T, P>
impl<T> OneRequest<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
/// Create new `H1SimpleService` instance.
pub fn new() -> Self {
@@ -353,52 +500,49 @@ where
}
}
impl<T, P> NewService for OneRequest<T, P>
impl<T> ServiceFactory for OneRequest<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
type Config = SrvConfig;
type Request = Io<T, P>;
type Config = ();
type Request = T;
type Response = (Request, Framed<T, Codec>);
type Error = ParseError;
type InitError = ();
type Service = OneRequestService<T, P>;
type Future = FutureResult<Self::Service, Self::InitError>;
type Service = OneRequestService<T>;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &SrvConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
ok(OneRequestService {
config: self.config.clone(),
_t: PhantomData,
config: self.config.clone(),
})
}
}
/// `Service` implementation for HTTP1 transport. Reads one request and returns
/// request and framed object.
pub struct OneRequestService<T, P> {
pub struct OneRequestService<T> {
_t: PhantomData<T>,
config: ServiceConfig,
_t: PhantomData<(T, P)>,
}
impl<T, P> Service for OneRequestService<T, P>
impl<T> Service for OneRequestService<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
type Request = Io<T, P>;
type Request = T;
type Response = (Request, Framed<T, Codec>);
type Error = ParseError;
type Future = OneRequestServiceResponse<T>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, req: Self::Request) -> Self::Future {
OneRequestServiceResponse {
framed: Some(Framed::new(
req.into_parts().0,
Codec::new(self.config.clone()),
)),
framed: Some(Framed::new(req, Codec::new(self.config.clone()))),
}
}
}
@@ -406,28 +550,28 @@ where
#[doc(hidden)]
pub struct OneRequestServiceResponse<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
framed: Option<Framed<T, Codec>>,
}
impl<T> Future for OneRequestServiceResponse<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
type Item = (Request, Framed<T, Codec>);
type Error = ParseError;
type Output = Result<(Request, Framed<T, Codec>), ParseError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.framed.as_mut().unwrap().poll()? {
Async::Ready(Some(req)) => match req {
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
match self.framed.as_mut().unwrap().next_item(cx) {
Poll::Ready(Some(Ok(req))) => match req {
Message::Item(req) => {
Ok(Async::Ready((req, self.framed.take().unwrap())))
Poll::Ready(Ok((req, self.framed.take().unwrap())))
}
Message::Chunk(_) => unreachable!("Something is wrong"),
},
Async::Ready(None) => Err(ParseError::Incomplete),
Async::NotReady => Ok(Async::NotReady),
Poll::Ready(Some(Err(err))) => Poll::Ready(Err(err)),
Poll::Ready(None) => Poll::Ready(Err(ParseError::Incomplete)),
Poll::Pending => Poll::Pending,
}
}
}

View File

@@ -1,10 +1,9 @@
use std::marker::PhantomData;
use std::task::{Context, Poll};
use actix_codec::Framed;
use actix_server_config::ServerConfig;
use actix_service::{NewService, Service};
use futures::future::FutureResult;
use futures::{Async, Poll};
use actix_service::{Service, ServiceFactory};
use futures_util::future::Ready;
use crate::error::Error;
use crate::h1::Codec;
@@ -12,16 +11,16 @@ use crate::request::Request;
pub struct UpgradeHandler<T>(PhantomData<T>);
impl<T> NewService for UpgradeHandler<T> {
type Config = ServerConfig;
impl<T> ServiceFactory for UpgradeHandler<T> {
type Config = ();
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type Service = UpgradeHandler<T>;
type InitError = Error;
type Future = FutureResult<Self::Service, Self::InitError>;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &ServerConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
unimplemented!()
}
}
@@ -30,10 +29,10 @@ impl<T> Service for UpgradeHandler<T> {
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type Future = FutureResult<Self::Response, Self::Error>;
type Future = Ready<Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, _: Self::Request) -> Self::Future {

View File

@@ -1,5 +1,8 @@
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use futures::{Async, Future, Poll, Sink};
use crate::body::{BodySize, MessageBody, ResponseBody};
use crate::error::Error;
@@ -7,8 +10,10 @@ use crate::h1::{Codec, Message};
use crate::response::Response;
/// Send http/1 response
#[pin_project::pin_project]
pub struct SendResponse<T, B> {
res: Option<Message<(Response<()>, BodySize)>>,
#[pin]
body: Option<ResponseBody<B>>,
framed: Option<Framed<T, Codec>>,
}
@@ -31,62 +36,66 @@ where
impl<T, B> Future for SendResponse<T, B>
where
T: AsyncRead + AsyncWrite,
B: MessageBody,
B: MessageBody + Unpin,
{
type Item = Framed<T, Codec>;
type Error = Error;
type Output = Result<Framed<T, Codec>, Error>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
// TODO: rethink if we need loops in polls
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.project();
let mut body_done = this.body.is_none();
loop {
let mut body_ready = self.body.is_some();
let framed = self.framed.as_mut().unwrap();
let mut body_ready = !body_done;
let framed = this.framed.as_mut().unwrap();
// send body
if self.res.is_none() && self.body.is_some() {
while body_ready && self.body.is_some() && !framed.is_write_buf_full() {
match self.body.as_mut().unwrap().poll_next()? {
Async::Ready(item) => {
// body is done
if item.is_none() {
let _ = self.body.take();
if this.res.is_none() && body_ready {
while body_ready && !body_done && !framed.is_write_buf_full() {
match this.body.as_mut().as_pin_mut().unwrap().poll_next(cx)? {
Poll::Ready(item) => {
// body is done when item is None
body_done = item.is_none();
if body_done {
let _ = this.body.take();
}
framed.force_send(Message::Chunk(item))?;
framed.write(Message::Chunk(item))?;
}
Async::NotReady => body_ready = false,
Poll::Pending => body_ready = false,
}
}
}
// flush write buffer
if !framed.is_write_buf_empty() {
match framed.poll_complete()? {
Async::Ready(_) => {
match framed.flush(cx)? {
Poll::Ready(_) => {
if body_ready {
continue;
} else {
return Ok(Async::NotReady);
return Poll::Pending;
}
}
Async::NotReady => return Ok(Async::NotReady),
Poll::Pending => return Poll::Pending,
}
}
// send response
if let Some(res) = self.res.take() {
framed.force_send(res)?;
if let Some(res) = this.res.take() {
framed.write(res)?;
continue;
}
if self.body.is_some() {
if !body_done {
if body_ready {
continue;
} else {
return Ok(Async::NotReady);
return Poll::Pending;
}
} else {
break;
}
}
Ok(Async::Ready(self.framed.take().unwrap()))
Poll::Ready(Ok(this.framed.take().unwrap()))
}
}

View File

@@ -1,28 +1,25 @@
use std::collections::VecDeque;
use std::convert::TryFrom;
use std::future::Future;
use std::marker::PhantomData;
use std::time::Instant;
use std::{fmt, mem, net};
use std::net;
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_server_config::IoStream;
use actix_rt::time::{Delay, Instant};
use actix_service::Service;
use actix_utils::cloneable::CloneableService;
use bitflags::bitflags;
use bytes::{Bytes, BytesMut};
use futures::{try_ready, Async, Future, Poll, Sink, Stream};
use h2::server::{Connection, SendResponse};
use h2::{RecvStream, SendStream};
use http::header::{
HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING,
};
use http::HttpTryFrom;
use log::{debug, error, trace};
use tokio_timer::Delay;
use h2::SendStream;
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use log::{error, trace};
use crate::body::{Body, BodySize, MessageBody, ResponseBody};
use crate::body::{BodySize, MessageBody, ResponseBody};
use crate::cloneable::CloneableService;
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error, ParseError, PayloadError, ResponseError};
use crate::error::{DispatchError, Error};
use crate::helpers::DataFactory;
use crate::httpmessage::HttpMessage;
use crate::message::ResponseHead;
use crate::payload::Payload;
use crate::request::Request;
@@ -31,7 +28,11 @@ use crate::response::Response;
const CHUNK_SIZE: usize = 16_384;
/// Dispatcher for HTTP/2 protocol
pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody> {
#[pin_project::pin_project]
pub struct Dispatcher<T, S: Service<Request = Request>, B: MessageBody>
where
T: AsyncRead + AsyncWrite + Unpin,
{
service: CloneableService<S>,
connection: Connection<T, Bytes>,
on_connect: Option<Box<dyn DataFactory>>,
@@ -44,12 +45,12 @@ pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody
impl<T, S, B> Dispatcher<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Future: 'static,
// S::Future: 'static,
S::Response: Into<Response<B>>,
B: MessageBody + 'static,
B: MessageBody,
{
pub(crate) fn new(
service: CloneableService<S>,
@@ -90,70 +91,92 @@ where
impl<T, S, B> Future for Dispatcher<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
type Item = ();
type Error = DispatchError;
type Output = Result<(), DispatchError>;
#[inline]
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.get_mut();
loop {
match self.connection.poll()? {
Async::Ready(None) => return Ok(Async::Ready(())),
Async::Ready(Some((req, res))) => {
match Pin::new(&mut this.connection).poll_accept(cx) {
Poll::Ready(None) => return Poll::Ready(Ok(())),
Poll::Ready(Some(Err(err))) => return Poll::Ready(Err(err.into())),
Poll::Ready(Some(Ok((req, res)))) => {
// update keep-alive expire
if self.ka_timer.is_some() {
if let Some(expire) = self.config.keep_alive_expire() {
self.ka_expire = expire;
if this.ka_timer.is_some() {
if let Some(expire) = this.config.keep_alive_expire() {
this.ka_expire = expire;
}
}
let (parts, body) = req.into_parts();
let mut req = Request::with_payload(body.into());
let mut req = Request::with_payload(Payload::<
crate::payload::PayloadStream,
>::H2(
crate::h2::Payload::new(body)
));
let head = &mut req.head_mut();
head.uri = parts.uri;
head.method = parts.method;
head.version = parts.version;
head.headers = parts.headers.into();
head.peer_addr = self.peer_addr;
tokio_current_thread::spawn(ServiceResponse::<S::Future, B> {
head.peer_addr = this.peer_addr;
// set on_connect data
if let Some(ref on_connect) = this.on_connect {
on_connect.set(&mut req.extensions_mut());
}
actix_rt::spawn(ServiceResponse::<
S::Future,
S::Response,
S::Error,
B,
> {
state: ServiceResponseState::ServiceCall(
self.service.call(req),
this.service.call(req),
Some(res),
),
config: self.config.clone(),
config: this.config.clone(),
buffer: None,
})
_t: PhantomData,
});
}
Async::NotReady => return Ok(Async::NotReady),
Poll::Pending => return Poll::Pending,
}
}
}
}
struct ServiceResponse<F, B> {
#[pin_project::pin_project]
struct ServiceResponse<F, I, E, B> {
#[pin]
state: ServiceResponseState<F, B>,
config: ServiceConfig,
buffer: Option<Bytes>,
_t: PhantomData<(I, E)>,
}
#[pin_project::pin_project]
enum ServiceResponseState<F, B> {
ServiceCall(F, Option<SendResponse<Bytes>>),
SendPayload(SendStream<Bytes>, ResponseBody<B>),
ServiceCall(#[pin] F, Option<SendResponse<Bytes>>),
SendPayload(SendStream<Bytes>, #[pin] ResponseBody<B>),
}
impl<F, B> ServiceResponse<F, B>
impl<F, I, E, B> ServiceResponse<F, I, E, B>
where
F: Future,
F::Error: Into<Error>,
F::Item: Into<Response<B>>,
B: MessageBody + 'static,
F: Future<Output = Result<I, E>>,
E: Into<Error>,
I: Into<Response<B>>,
B: MessageBody,
{
fn prepare_response(
&self,
@@ -208,117 +231,128 @@ where
if !has_date {
let mut bytes = BytesMut::with_capacity(29);
self.config.set_date_header(&mut bytes);
res.headers_mut()
.insert(DATE, HeaderValue::try_from(bytes.freeze()).unwrap());
res.headers_mut().insert(DATE, unsafe {
HeaderValue::from_maybe_shared_unchecked(bytes.freeze())
});
}
res
}
}
impl<F, B> Future for ServiceResponse<F, B>
impl<F, I, E, B> Future for ServiceResponse<F, I, E, B>
where
F: Future,
F::Error: Into<Error>,
F::Item: Into<Response<B>>,
B: MessageBody + 'static,
F: Future<Output = Result<I, E>>,
E: Into<Error>,
I: Into<Response<B>>,
B: MessageBody,
{
type Item = ();
type Error = ();
type Output = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.state {
ServiceResponseState::ServiceCall(ref mut call, ref mut send) => {
match call.poll() {
Ok(Async::Ready(res)) => {
#[pin_project::project]
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
#[project]
match this.state.project() {
ServiceResponseState::ServiceCall(call, send) => match call.poll(cx) {
Poll::Ready(Ok(res)) => {
let (res, body) = res.into().replace_body(());
let mut send = send.take().unwrap();
let mut size = body.size();
let h2_res = self.prepare_response(res.head(), &mut size);
let h2_res = self.as_mut().prepare_response(res.head(), &mut size);
this = self.as_mut().project();
let stream =
send.send_response(h2_res, size.is_eof()).map_err(|e| {
let stream = match send.send_response(h2_res, size.is_eof()) {
Err(e) => {
trace!("Error sending h2 response: {:?}", e);
})?;
return Poll::Ready(());
}
Ok(stream) => stream,
};
if size.is_eof() {
Ok(Async::Ready(()))
Poll::Ready(())
} else {
self.state = ServiceResponseState::SendPayload(stream, body);
self.poll()
this.state
.set(ServiceResponseState::SendPayload(stream, body));
self.poll(cx)
}
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(_e) => {
let res: Response = Response::InternalServerError().finish();
Poll::Pending => Poll::Pending,
Poll::Ready(Err(e)) => {
let res: Response = e.into().into();
let (res, body) = res.replace_body(());
let mut send = send.take().unwrap();
let mut size = body.size();
let h2_res = self.prepare_response(res.head(), &mut size);
let h2_res = self.as_mut().prepare_response(res.head(), &mut size);
this = self.as_mut().project();
let stream =
send.send_response(h2_res, size.is_eof()).map_err(|e| {
let stream = match send.send_response(h2_res, size.is_eof()) {
Err(e) => {
trace!("Error sending h2 response: {:?}", e);
})?;
return Poll::Ready(());
}
Ok(stream) => stream,
};
if size.is_eof() {
Ok(Async::Ready(()))
Poll::Ready(())
} else {
self.state = ServiceResponseState::SendPayload(
this.state.set(ServiceResponseState::SendPayload(
stream,
body.into_body(),
);
self.poll()
}
}
));
self.poll(cx)
}
}
},
ServiceResponseState::SendPayload(ref mut stream, ref mut body) => loop {
loop {
if let Some(ref mut buffer) = self.buffer {
match stream.poll_capacity().map_err(|e| warn!("{:?}", e))? {
Async::NotReady => return Ok(Async::NotReady),
Async::Ready(None) => return Ok(Async::Ready(())),
Async::Ready(Some(cap)) => {
if let Some(ref mut buffer) = this.buffer {
match stream.poll_capacity(cx) {
Poll::Pending => return Poll::Pending,
Poll::Ready(None) => return Poll::Ready(()),
Poll::Ready(Some(Ok(cap))) => {
let len = buffer.len();
let bytes = buffer.split_to(std::cmp::min(cap, len));
if let Err(e) = stream.send_data(bytes, false) {
warn!("{:?}", e);
return Err(());
return Poll::Ready(());
} else if !buffer.is_empty() {
let cap = std::cmp::min(buffer.len(), CHUNK_SIZE);
stream.reserve_capacity(cap);
} else {
self.buffer.take();
this.buffer.take();
}
}
Poll::Ready(Some(Err(e))) => {
warn!("{:?}", e);
return Poll::Ready(());
}
}
} else {
match body.poll_next() {
Ok(Async::NotReady) => {
return Ok(Async::NotReady);
}
Ok(Async::Ready(None)) => {
match body.as_mut().poll_next(cx) {
Poll::Pending => return Poll::Pending,
Poll::Ready(None) => {
if let Err(e) = stream.send_data(Bytes::new(), true) {
warn!("{:?}", e);
return Err(());
} else {
return Ok(Async::Ready(()));
}
return Poll::Ready(());
}
Ok(Async::Ready(Some(chunk))) => {
Poll::Ready(Some(Ok(chunk))) => {
stream.reserve_capacity(std::cmp::min(
chunk.len(),
CHUNK_SIZE,
));
self.buffer = Some(chunk);
*this.buffer = Some(chunk);
}
Err(e) => {
Poll::Ready(Some(Err(e))) => {
error!("Response payload stream error: {:?}", e);
return Err(());
return Poll::Ready(());
}
}
}

View File

@@ -1,9 +1,9 @@
#![allow(dead_code, unused_imports)]
use std::fmt;
//! HTTP/2 implementation
use std::pin::Pin;
use std::task::{Context, Poll};
use bytes::Bytes;
use futures::{Async, Poll, Stream};
use futures_core::Stream;
use h2::RecvStream;
mod dispatcher;
@@ -25,22 +25,26 @@ impl Payload {
}
impl Stream for Payload {
type Item = Bytes;
type Error = PayloadError;
type Item = Result<Bytes, PayloadError>;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
match self.pl.poll() {
Ok(Async::Ready(Some(chunk))) => {
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
let this = self.get_mut();
match Pin::new(&mut this.pl).poll_data(cx) {
Poll::Ready(Some(Ok(chunk))) => {
let len = chunk.len();
if let Err(err) = self.pl.release_capacity().release_capacity(len) {
Err(err.into())
if let Err(err) = this.pl.flow_control().release_capacity(len) {
Poll::Ready(Some(Err(err.into())))
} else {
Ok(Async::Ready(Some(chunk)))
Poll::Ready(Some(Ok(chunk)))
}
}
Ok(Async::Ready(None)) => Ok(Async::Ready(None)),
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(err) => Err(err.into()),
Poll::Ready(Some(Err(err))) => Poll::Ready(Some(Err(err.into()))),
Poll::Pending => Poll::Pending,
Poll::Ready(None) => Poll::Ready(None),
}
}
}

View File

@@ -1,62 +1,56 @@
use std::fmt::Debug;
use std::future::Future;
use std::marker::PhantomData;
use std::{io, net, rc};
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{net, rc};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig};
use actix_service::{IntoNewService, NewService, Service};
use actix_utils::cloneable::CloneableService;
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::net::TcpStream;
use actix_service::{
fn_factory, fn_service, pipeline_factory, IntoServiceFactory, Service,
ServiceFactory,
};
use bytes::Bytes;
use futures::future::{ok, FutureResult};
use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream};
use h2::server::{self, Connection, Handshake};
use h2::RecvStream;
use futures_core::ready;
use futures_util::future::ok;
use h2::server::{self, Handshake};
use log::error;
use crate::body::MessageBody;
use crate::config::{KeepAlive, ServiceConfig};
use crate::error::{DispatchError, Error, ParseError, ResponseError};
use crate::cloneable::CloneableService;
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error};
use crate::helpers::DataFactory;
use crate::payload::Payload;
use crate::request::Request;
use crate::response::Response;
use super::dispatcher::Dispatcher;
/// `NewService` implementation for HTTP2 transport
pub struct H2Service<T, P, S, B> {
/// `ServiceFactory` implementation for HTTP2 transport
pub struct H2Service<T, S, B> {
srv: S,
cfg: ServiceConfig,
on_connect: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B> H2Service<T, P, S, B>
impl<T, S, B> H2Service<T, S, B>
where
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
/// Create new `HttpService` instance.
pub fn new<F: IntoNewService<S>>(service: F) -> Self {
let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
H2Service {
cfg,
on_connect: None,
srv: service.into_new_service(),
_t: PhantomData,
}
}
/// Create new `HttpService` instance with config.
pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self {
pub(crate) fn with_config<F: IntoServiceFactory<S>>(
cfg: ServiceConfig,
service: F,
) -> Self {
H2Service {
cfg,
on_connect: None,
srv: service.into_new_service(),
srv: service.into_factory(),
_t: PhantomData,
}
}
@@ -64,33 +58,149 @@ where
/// Set on connect callback.
pub(crate) fn on_connect(
mut self,
f: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
f: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
) -> Self {
self.on_connect = f;
self
}
}
impl<T, P, S, B> NewService for H2Service<T, P, S, B>
impl<S, B> H2Service<TcpStream, S, B>
where
T: IoStream,
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
type Config = SrvConfig;
type Request = Io<T, P>;
/// Create simple tcp based service
pub fn tcp(
self,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = DispatchError,
InitError = S::InitError,
> {
pipeline_factory(fn_factory(|| async {
Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok::<_, DispatchError>((io, peer_addr))
}))
}))
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use actix_service::{fn_factory, fn_service};
use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
use actix_tls::{openssl::HandshakeError, SslError};
use super::*;
impl<S, B> H2Service<SslStream<TcpStream>, S, B>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
/// Create ssl based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<HandshakeError<TcpStream>, DispatchError>,
InitError = S::InitError,
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(fn_factory(|| {
ok::<_, S::InitError>(fn_service(|io: SslStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, peer_addr))
}))
}))
.and_then(self.map_err(SslError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_tls::rustls::{Acceptor, ServerConfig, TlsStream};
use actix_tls::SslError;
use std::io;
impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
/// Create openssl based service
pub fn rustls(
self,
mut config: ServerConfig,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<io::Error, DispatchError>,
InitError = S::InitError,
> {
let protos = vec!["h2".to_string().into()];
config.set_protocols(&protos);
pipeline_factory(
Acceptor::new(config)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(fn_factory(|| {
ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, peer_addr))
}))
}))
.and_then(self.map_err(SslError::Service))
}
}
}
impl<T, S, B> ServiceFactory for H2Service<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
type Config = ();
type Request = (T, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type InitError = S::InitError;
type Service = H2ServiceHandler<T, P, S::Service, B>;
type Future = H2ServiceResponse<T, P, S, B>;
type Service = H2ServiceHandler<T, S::Service, B>;
type Future = H2ServiceResponse<T, S, B>;
fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
H2ServiceResponse {
fut: self.srv.new_service(cfg).into_future(),
fut: self.srv.new_service(()),
cfg: Some(self.cfg.clone()),
on_connect: self.on_connect.clone(),
_t: PhantomData,
@@ -99,56 +209,61 @@ where
}
#[doc(hidden)]
pub struct H2ServiceResponse<T, P, S: NewService, B> {
fut: <S::Future as IntoFuture>::Future,
#[pin_project::pin_project]
pub struct H2ServiceResponse<T, S: ServiceFactory, B> {
#[pin]
fut: S::Future,
cfg: Option<ServiceConfig>,
on_connect: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B> Future for H2ServiceResponse<T, P, S, B>
impl<T, S, B> Future for H2ServiceResponse<T, S, B>
where
T: IoStream,
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
type Item = H2ServiceHandler<T, P, S::Service, B>;
type Error = S::InitError;
type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let service = try_ready!(self.fut.poll());
Ok(Async::Ready(H2ServiceHandler::new(
self.cfg.take().unwrap(),
self.on_connect.clone(),
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.as_mut().project();
Poll::Ready(ready!(this.fut.poll(cx)).map(|service| {
let this = self.as_mut().project();
H2ServiceHandler::new(
this.cfg.take().unwrap(),
this.on_connect.clone(),
service,
)))
)
}))
}
}
/// `Service` implementation for http/2 transport
pub struct H2ServiceHandler<T, P, S, B> {
pub struct H2ServiceHandler<T, S: Service, B> {
srv: CloneableService<S>,
cfg: ServiceConfig,
on_connect: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B> H2ServiceHandler<T, P, S, B>
impl<T, S, B> H2ServiceHandler<T, S, B>
where
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
fn new(
cfg: ServiceConfig,
on_connect: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
srv: S,
) -> H2ServiceHandler<T, P, S, B> {
) -> H2ServiceHandler<T, S, B> {
H2ServiceHandler {
cfg,
on_connect,
@@ -158,31 +273,29 @@ where
}
}
impl<T, P, S, B> Service for H2ServiceHandler<T, P, S, B>
impl<T, S, B> Service for H2ServiceHandler<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
type Request = Io<T, P>;
type Request = (T, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type Future = H2ServiceHandlerResponse<T, S, B>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.srv.poll_ready().map_err(|e| {
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.srv.poll_ready(cx).map_err(|e| {
let e = e.into();
error!("Service readiness error: {:?}", e);
DispatchError::Service(e)
})
}
fn call(&mut self, req: Self::Request) -> Self::Future {
let io = req.into_parts().0;
let peer_addr = io.peer_addr();
fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
let on_connect = if let Some(ref on_connect) = self.on_connect {
Some(on_connect(&io))
} else {
@@ -193,7 +306,7 @@ where
state: State::Handshake(
Some(self.srv.clone()),
Some(self.cfg.clone()),
peer_addr,
addr,
on_connect,
server::handshake(io),
),
@@ -201,8 +314,9 @@ where
}
}
enum State<T: IoStream, S: Service<Request = Request>, B: MessageBody>
enum State<T, S: Service<Request = Request>, B: MessageBody>
where
T: AsyncRead + AsyncWrite + Unpin,
S::Future: 'static,
{
Incoming(Dispatcher<T, S, B>),
@@ -217,11 +331,11 @@ where
pub struct H2ServiceHandlerResponse<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
state: State<T, S, B>,
@@ -229,42 +343,41 @@ where
impl<T, S, B> Future for H2ServiceHandlerResponse<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody,
{
type Item = ();
type Error = DispatchError;
type Output = Result<(), DispatchError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
match self.state {
State::Incoming(ref mut disp) => disp.poll(),
State::Incoming(ref mut disp) => Pin::new(disp).poll(cx),
State::Handshake(
ref mut srv,
ref mut config,
ref peer_addr,
ref mut on_connect,
ref mut handshake,
) => match handshake.poll() {
Ok(Async::Ready(conn)) => {
) => match Pin::new(handshake).poll(cx) {
Poll::Ready(Ok(conn)) => {
self.state = State::Incoming(Dispatcher::new(
srv.take().unwrap(),
conn,
on_connect.take(),
config.take().unwrap(),
None,
peer_addr.clone(),
*peer_addr,
));
self.poll()
self.poll(cx)
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(err) => {
Poll::Ready(Err(err)) => {
trace!("H2 handshake error: {}", err);
Err(err.into())
Poll::Ready(Err(err.into()))
}
Poll::Pending => Poll::Pending,
},
}
}

View File

@@ -63,7 +63,7 @@ header! {
(AcceptCharset, ACCEPT_CHARSET) => (QualityItem<Charset>)+
test_accept_charset {
/// Test case from RFC
// Test case from RFC
test_header!(test1, vec![b"iso-8859-5, unicode-1-1;q=0.8"]);
}
}

View File

@@ -74,18 +74,18 @@ impl Header for CacheControl {
}
impl fmt::Display for CacheControl {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt_comma_delimited(f, &self[..])
}
}
impl IntoHeaderValue for CacheControl {
type Error = header::InvalidHeaderValueBytes;
type Error = header::InvalidHeaderValue;
fn try_into(self) -> Result<header::HeaderValue, Self::Error> {
let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self);
header::HeaderValue::from_shared(writer.take())
header::HeaderValue::from_maybe_shared(writer.take())
}
}
@@ -126,7 +126,7 @@ pub enum CacheDirective {
}
impl fmt::Display for CacheDirective {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
use self::CacheDirective::*;
fmt::Display::fmt(
match *self {

View File

@@ -70,11 +70,17 @@ impl<'a> From<&'a str> for DispositionType {
/// assert_eq!(param.as_filename().unwrap(), "sample.txt");
/// ```
#[derive(Clone, Debug, PartialEq)]
#[allow(clippy::large_enum_variant)]
pub enum DispositionParam {
/// For [`DispositionType::FormData`] (i.e. *multipart/form-data*), the name of an field from
/// the form.
Name(String),
/// A plain file name.
///
/// It is [not supposed](https://tools.ietf.org/html/rfc6266#appendix-D) to contain any
/// non-ASCII characters when used in a *Content-Disposition* HTTP response header, where
/// [`FilenameExt`](DispositionParam::FilenameExt) with charset UTF-8 may be used instead
/// in case there are Unicode characters in file names.
Filename(String),
/// An extended file name. It must not exist for `ContentType::Formdata` according to
/// [RFC7578 Section 4.2](https://tools.ietf.org/html/rfc7578#section-4.2).
@@ -219,7 +225,16 @@ impl DispositionParam {
/// ext-token = <the characters in token, followed by "*">
/// ```
///
/// **Note**: filename* [must not](https://tools.ietf.org/html/rfc7578#section-4.2) be used within
/// # Note
///
/// filename is [not supposed](https://tools.ietf.org/html/rfc6266#appendix-D) to contain any
/// non-ASCII characters when used in a *Content-Disposition* HTTP response header, where
/// filename* with charset UTF-8 may be used instead in case there are Unicode characters in file
/// names.
/// filename is [acceptable](https://tools.ietf.org/html/rfc7578#section-4.2) to be UTF-8 encoded
/// directly in a *Content-Disposition* header for *multipart/form-data*, though.
///
/// filename* [must not](https://tools.ietf.org/html/rfc7578#section-4.2) be used within
/// *multipart/form-data*.
///
/// # Example
@@ -250,6 +265,22 @@ impl DispositionParam {
/// };
/// assert_eq!(cd2.get_name(), Some("file")); // field name
/// assert_eq!(cd2.get_filename(), Some("bill.odt"));
///
/// // HTTP response header with Unicode characters in file names
/// let cd3 = ContentDisposition {
/// disposition: DispositionType::Attachment,
/// parameters: vec![
/// DispositionParam::FilenameExt(ExtendedValue {
/// charset: Charset::Ext(String::from("UTF-8")),
/// language_tag: None,
/// value: String::from("\u{1f600}.svg").into_bytes(),
/// }),
/// // fallback for better compatibility
/// DispositionParam::Filename(String::from("Grinning-Face-Emoji.svg"))
/// ],
/// };
/// assert_eq!(cd3.get_filename_ext().map(|ev| ev.value.as_ref()),
/// Some("\u{1f600}.svg".as_bytes()));
/// ```
///
/// # WARN
@@ -332,15 +363,17 @@ impl ContentDisposition {
// token: won't contains semicolon according to RFC 2616 Section 2.2
let (token, new_left) = split_once_and_trim(left, ';');
left = new_left;
token.to_owned()
};
if value.is_empty() {
if token.is_empty() {
// quoted-string can be empty, but token cannot be empty
return Err(crate::error::ParseError::Header);
}
token.to_owned()
};
let param = if param_name.eq_ignore_ascii_case("name") {
DispositionParam::Name(value)
} else if param_name.eq_ignore_ascii_case("filename") {
// See also comments in test_from_raw_uncessary_percent_decode.
DispositionParam::Filename(value)
} else {
DispositionParam::Unknown(param_name.to_owned(), value)
@@ -390,7 +423,7 @@ impl ContentDisposition {
/// Return the value of *name* if exists.
pub fn get_name(&self) -> Option<&str> {
self.parameters.iter().filter_map(|p| p.as_name()).nth(0)
self.parameters.iter().filter_map(|p| p.as_name()).next()
}
/// Return the value of *filename* if exists.
@@ -398,7 +431,7 @@ impl ContentDisposition {
self.parameters
.iter()
.filter_map(|p| p.as_filename())
.nth(0)
.next()
}
/// Return the value of *filename\** if exists.
@@ -406,7 +439,7 @@ impl ContentDisposition {
self.parameters
.iter()
.filter_map(|p| p.as_filename_ext())
.nth(0)
.next()
}
/// Return the value of the parameter which the `name` matches.
@@ -415,7 +448,7 @@ impl ContentDisposition {
self.parameters
.iter()
.filter_map(|p| p.as_unknown(name))
.nth(0)
.next()
}
/// Return the value of the extended parameter which the `name` matches.
@@ -424,17 +457,17 @@ impl ContentDisposition {
self.parameters
.iter()
.filter_map(|p| p.as_unknown_ext(name))
.nth(0)
.next()
}
}
impl IntoHeaderValue for ContentDisposition {
type Error = header::InvalidHeaderValueBytes;
type Error = header::InvalidHeaderValue;
fn try_into(self) -> Result<header::HeaderValue, Self::Error> {
let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self);
header::HeaderValue::from_shared(writer.take())
header::HeaderValue::from_maybe_shared(writer.take())
}
}
@@ -453,7 +486,7 @@ impl Header for ContentDisposition {
}
impl fmt::Display for DispositionType {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match self {
DispositionType::Inline => write!(f, "inline"),
DispositionType::Attachment => write!(f, "attachment"),
@@ -464,12 +497,41 @@ impl fmt::Display for DispositionType {
}
impl fmt::Display for DispositionParam {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
// All ASCII control charaters (0-30, 127) excepting horizontal tab, double quote, and
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
// All ASCII control characters (0-30, 127) including horizontal tab, double quote, and
// backslash should be escaped in quoted-string (i.e. "foobar").
// Ref: RFC6266 S4.1 -> RFC2616 S2.2; RFC 7578 S4.2 -> RFC2183 S2 -> ... .
// Ref: RFC6266 S4.1 -> RFC2616 S3.6
// filename-parm = "filename" "=" value
// value = token | quoted-string
// quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
// qdtext = <any TEXT except <">>
// quoted-pair = "\" CHAR
// TEXT = <any OCTET except CTLs,
// but including LWS>
// LWS = [CRLF] 1*( SP | HT )
// OCTET = <any 8-bit sequence of data>
// CHAR = <any US-ASCII character (octets 0 - 127)>
// CTL = <any US-ASCII control character
// (octets 0 - 31) and DEL (127)>
//
// Ref: RFC7578 S4.2 -> RFC2183 S2 -> RFC2045 S5.1
// parameter := attribute "=" value
// attribute := token
// ; Matching of attributes
// ; is ALWAYS case-insensitive.
// value := token / quoted-string
// token := 1*<any (US-ASCII) CHAR except SPACE, CTLs,
// or tspecials>
// tspecials := "(" / ")" / "<" / ">" / "@" /
// "," / ";" / ":" / "\" / <">
// "/" / "[" / "]" / "?" / "="
// ; Must be in quoted-string,
// ; to use within parameter values
//
//
// See also comments in test_from_raw_uncessary_percent_decode.
lazy_static! {
static ref RE: Regex = Regex::new("[\x01-\x08\x10\x1F\x7F\"\\\\]").unwrap();
static ref RE: Regex = Regex::new("[\x00-\x08\x10-\x1F\x7F\"\\\\]").unwrap();
}
match self {
DispositionParam::Name(ref value) => write!(f, "name={}", value),
@@ -493,7 +555,7 @@ impl fmt::Display for DispositionParam {
}
impl fmt::Display for ContentDisposition {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "{}", self.disposition)?;
self.parameters
.iter()
@@ -706,8 +768,7 @@ mod tests {
Mainstream browsers like Firefox (gecko) and Chrome use UTF-8 directly as above.
(And now, only UTF-8 is handled by this implementation.)
*/
let a =
HeaderValue::from_str("form-data; name=upload; filename=\"文件.webp\"")
let a = HeaderValue::from_str("form-data; name=upload; filename=\"文件.webp\"")
.unwrap();
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
@@ -719,8 +780,10 @@ mod tests {
};
assert_eq!(a, b);
let a =
HeaderValue::from_str("form-data; name=upload; filename=\"余固知謇謇之為患兮,忍而不能舍也.pptx\"").unwrap();
let a = HeaderValue::from_str(
"form-data; name=upload; filename=\"余固知謇謇之為患兮,忍而不能舍也.pptx\"",
)
.unwrap();
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
@@ -771,8 +834,18 @@ mod tests {
#[test]
fn test_from_raw_uncessary_percent_decode() {
// In fact, RFC7578 (multipart/form-data) Section 2 and 4.2 suggests that filename with
// non-ASCII characters MAY be percent-encoded.
// On the contrary, RFC6266 or other RFCs related to Content-Disposition response header
// do not mention such percent-encoding.
// So, it appears to be undecidable whether to percent-decode or not without
// knowing the usage scenario (multipart/form-data v.s. HTTP response header) and
// inevitable to unnecessarily percent-decode filename with %XX in the former scenario.
// Fortunately, it seems that almost all mainstream browsers just send UTF-8 encoded file
// names in quoted-string format (tested on Edge, IE11, Chrome and Firefox) without
// percent-encoding. So we do not bother to attempt to percent-decode.
let a = HeaderValue::from_static(
"form-data; name=photo; filename=\"%74%65%73%74%2e%70%6e%67\"", // Should not be decoded!
"form-data; name=photo; filename=\"%74%65%73%74%2e%70%6e%67\"",
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
@@ -808,6 +881,13 @@ mod tests {
let a = HeaderValue::from_static("inline; filename= ");
assert!(ContentDisposition::from_raw(&a).is_err());
let a = HeaderValue::from_static("inline; filename=\"\"");
assert!(ContentDisposition::from_raw(&a)
.expect("parse cd")
.get_filename()
.expect("filename")
.is_empty());
}
#[test]

View File

@@ -3,7 +3,7 @@ use std::str::FromStr;
use crate::error::ParseError;
use crate::header::{
HeaderValue, IntoHeaderValue, InvalidHeaderValueBytes, Writer, CONTENT_RANGE,
HeaderValue, IntoHeaderValue, InvalidHeaderValue, Writer, CONTENT_RANGE,
};
header! {
@@ -166,7 +166,7 @@ impl FromStr for ContentRangeSpec {
}
impl Display for ContentRangeSpec {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
ContentRangeSpec::Bytes {
range,
@@ -198,11 +198,11 @@ impl Display for ContentRangeSpec {
}
impl IntoHeaderValue for ContentRangeSpec {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self);
HeaderValue::from_shared(writer.take())
HeaderValue::from_maybe_shared(writer.take())
}
}

View File

@@ -3,7 +3,7 @@ use std::fmt::{self, Display, Write};
use crate::error::ParseError;
use crate::header::{
self, from_one_raw_str, EntityTag, Header, HeaderName, HeaderValue, HttpDate,
IntoHeaderValue, InvalidHeaderValueBytes, Writer,
IntoHeaderValue, InvalidHeaderValue, Writer,
};
use crate::httpmessage::HttpMessage;
@@ -87,7 +87,7 @@ impl Header for IfRange {
}
impl Display for IfRange {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
IfRange::EntityTag(ref x) => Display::fmt(x, f),
IfRange::Date(ref x) => Display::fmt(x, f),
@@ -96,12 +96,12 @@ impl Display for IfRange {
}
impl IntoHeaderValue for IfRange {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self);
HeaderValue::from_shared(writer.take())
HeaderValue::from_maybe_shared(writer.take())
}
}

View File

@@ -159,18 +159,18 @@ macro_rules! header {
}
impl std::fmt::Display for $id {
#[inline]
fn fmt(&self, f: &mut std::fmt::Formatter) -> ::std::fmt::Result {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> ::std::fmt::Result {
$crate::http::header::fmt_comma_delimited(f, &self.0[..])
}
}
impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes;
type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
use std::fmt::Write;
let mut writer = $crate::http::header::Writer::new();
let _ = write!(&mut writer, "{}", self);
$crate::http::header::HeaderValue::from_shared(writer.take())
$crate::http::header::HeaderValue::from_maybe_shared(writer.take())
}
}
};
@@ -195,18 +195,18 @@ macro_rules! header {
}
impl std::fmt::Display for $id {
#[inline]
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
$crate::http::header::fmt_comma_delimited(f, &self.0[..])
}
}
impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes;
type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
use std::fmt::Write;
let mut writer = $crate::http::header::Writer::new();
let _ = write!(&mut writer, "{}", self);
$crate::http::header::HeaderValue::from_shared(writer.take())
$crate::http::header::HeaderValue::from_maybe_shared(writer.take())
}
}
};
@@ -231,12 +231,12 @@ macro_rules! header {
}
impl std::fmt::Display for $id {
#[inline]
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
std::fmt::Display::fmt(&self.0, f)
}
}
impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes;
type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
self.0.try_into()
@@ -276,7 +276,7 @@ macro_rules! header {
}
impl std::fmt::Display for $id {
#[inline]
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
match *self {
$id::Any => f.write_str("*"),
$id::Items(ref fields) => $crate::http::header::fmt_comma_delimited(
@@ -285,13 +285,13 @@ macro_rules! header {
}
}
impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes;
type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
use std::fmt::Write;
let mut writer = $crate::http::header::Writer::new();
let _ = write!(&mut writer, "{}", self);
$crate::http::header::HeaderValue::from_shared(writer.take())
$crate::http::header::HeaderValue::from_maybe_shared(writer.take())
}
}
};

View File

@@ -1,20 +1,21 @@
use std::collections::hash_map::{self, Entry};
use std::convert::TryFrom;
use either::Either;
use hashbrown::hash_map::{self, Entry};
use hashbrown::HashMap;
use fxhash::FxHashMap;
use http::header::{HeaderName, HeaderValue};
use http::HttpTryFrom;
/// A set of HTTP headers
///
/// `HeaderMap` is an multimap of [`HeaderName`] to values.
///
/// [`HeaderName`]: struct.HeaderName.html
#[derive(Debug)]
#[derive(Debug, Clone)]
pub struct HeaderMap {
pub(crate) inner: HashMap<HeaderName, Value>,
pub(crate) inner: FxHashMap<HeaderName, Value>,
}
#[derive(Debug)]
#[derive(Debug, Clone)]
pub(crate) enum Value {
One(HeaderValue),
Multi(Vec<HeaderValue>),
@@ -56,7 +57,7 @@ impl HeaderMap {
/// allocate.
pub fn new() -> Self {
HeaderMap {
inner: HashMap::new(),
inner: FxHashMap::default(),
}
}
@@ -70,7 +71,7 @@ impl HeaderMap {
/// More capacity than requested may be allocated.
pub fn with_capacity(capacity: usize) -> HeaderMap {
HeaderMap {
inner: HashMap::with_capacity(capacity),
inner: FxHashMap::with_capacity_and_hasher(capacity, Default::default()),
}
}
@@ -142,7 +143,7 @@ impl HeaderMap {
/// Returns `None` if there are no values associated with the key.
///
/// [`GetAll`]: struct.GetAll.html
pub fn get_all<N: AsName>(&self, name: N) -> GetAll {
pub fn get_all<N: AsName>(&self, name: N) -> GetAll<'_> {
GetAll {
idx: 0,
item: self.get2(name),
@@ -186,7 +187,7 @@ impl HeaderMap {
/// The iteration order is arbitrary, but consistent across platforms for
/// the same crate version. Each key will be yielded once per associated
/// value. So, if a key has 3 associated values, it will be yielded 3 times.
pub fn iter(&self) -> Iter {
pub fn iter(&self) -> Iter<'_> {
Iter::new(self.inner.iter())
}
@@ -195,7 +196,7 @@ impl HeaderMap {
/// The iteration order is arbitrary, but consistent across platforms for
/// the same crate version. Each key will be yielded only once even if it
/// has multiple associated values.
pub fn keys(&self) -> Keys {
pub fn keys(&self) -> Keys<'_> {
Keys(self.inner.keys())
}

View File

@@ -1,11 +1,13 @@
//! Various http headers
// This is mostly copy of [hyper](https://github.com/hyperium/hyper/tree/master/src/header)
use std::convert::TryFrom;
use std::{fmt, str::FromStr};
use bytes::{Bytes, BytesMut};
use http::Error as HttpError;
use mime::Mime;
use percent_encoding::{AsciiSet, CONTROLS};
pub use http::header::*;
@@ -15,7 +17,6 @@ use crate::httpmessage::HttpMessage;
mod common;
pub(crate) mod map;
mod shared;
#[doc(hidden)]
pub use self::common::*;
#[doc(hidden)]
pub use self::shared::*;
@@ -73,58 +74,58 @@ impl<'a> IntoHeaderValue for &'a [u8] {
}
impl IntoHeaderValue for Bytes {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_shared(self)
HeaderValue::from_maybe_shared(self)
}
}
impl IntoHeaderValue for Vec<u8> {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_shared(Bytes::from(self))
HeaderValue::try_from(self)
}
}
impl IntoHeaderValue for String {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_shared(Bytes::from(self))
HeaderValue::try_from(self)
}
}
impl IntoHeaderValue for usize {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let s = format!("{}", self);
HeaderValue::from_shared(Bytes::from(s))
HeaderValue::try_from(s)
}
}
impl IntoHeaderValue for u64 {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let s = format!("{}", self);
HeaderValue::from_shared(Bytes::from(s))
HeaderValue::try_from(s)
}
}
impl IntoHeaderValue for Mime {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_shared(Bytes::from(format!("{}", self)))
HeaderValue::try_from(format!("{}", self))
}
}
@@ -204,7 +205,7 @@ impl Writer {
}
}
fn take(&mut self) -> Bytes {
self.buf.take().freeze()
self.buf.split().freeze()
}
}
@@ -216,7 +217,7 @@ impl fmt::Write for Writer {
}
#[inline]
fn write_fmt(&mut self, args: fmt::Arguments) -> fmt::Result {
fn write_fmt(&mut self, args: fmt::Arguments<'_>) -> fmt::Result {
fmt::write(self, args)
}
}
@@ -258,7 +259,7 @@ pub fn from_one_raw_str<T: FromStr>(val: Option<&HeaderValue>) -> Result<T, Pars
#[inline]
#[doc(hidden)]
/// Format an array into a comma-delimited string.
pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter, parts: &[T]) -> fmt::Result
pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter<'_>, parts: &[T]) -> fmt::Result
where
T: fmt::Display,
{
@@ -360,11 +361,9 @@ pub fn parse_extended_value(
}
impl fmt::Display for ExtendedValue {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
let encoded_value = percent_encoding::percent_encode(
&self.value[..],
self::percent_encoding_http::HTTP_VALUE,
);
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
let encoded_value =
percent_encoding::percent_encode(&self.value[..], HTTP_VALUE);
if let Some(ref lang) = self.language_tag {
write!(f, "{}'{}'{}", self.charset, lang, encoded_value)
} else {
@@ -377,9 +376,8 @@ impl fmt::Display for ExtendedValue {
/// [https://tools.ietf.org/html/rfc5987#section-3.2][url]
///
/// [url]: https://tools.ietf.org/html/rfc5987#section-3.2
pub fn http_percent_encode(f: &mut fmt::Formatter, bytes: &[u8]) -> fmt::Result {
let encoded =
percent_encoding::percent_encode(bytes, self::percent_encoding_http::HTTP_VALUE);
pub fn http_percent_encode(f: &mut fmt::Formatter<'_>, bytes: &[u8]) -> fmt::Result {
let encoded = percent_encoding::percent_encode(bytes, HTTP_VALUE);
fmt::Display::fmt(&encoded, f)
}
@@ -394,20 +392,29 @@ impl From<http::HeaderMap> for HeaderMap {
}
}
mod percent_encoding_http {
use percent_encoding::{self, define_encode_set};
// internal module because macro is hard-coded to make a public item
// but we don't want to public export this item
define_encode_set! {
// This encode set is used for HTTP header values and is defined at
// https://tools.ietf.org/html/rfc5987#section-3.2
pub HTTP_VALUE = [percent_encoding::SIMPLE_ENCODE_SET] | {
' ', '"', '%', '\'', '(', ')', '*', ',', '/', ':', ';', '<', '-', '>', '?',
'[', '\\', ']', '{', '}'
}
}
}
// This encode set is used for HTTP header values and is defined at
// https://tools.ietf.org/html/rfc5987#section-3.2
pub(crate) const HTTP_VALUE: &AsciiSet = &CONTROLS
.add(b' ')
.add(b'"')
.add(b'%')
.add(b'\'')
.add(b'(')
.add(b')')
.add(b'*')
.add(b',')
.add(b'/')
.add(b':')
.add(b';')
.add(b'<')
.add(b'-')
.add(b'>')
.add(b'?')
.add(b'[')
.add(b'\\')
.add(b']')
.add(b'{')
.add(b'}');
#[cfg(test)]
mod tests {

View File

@@ -98,7 +98,7 @@ impl Charset {
}
impl Display for Charset {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.write_str(self.label())
}
}

View File

@@ -27,7 +27,7 @@ pub enum Encoding {
}
impl fmt::Display for Encoding {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.write_str(match *self {
Chunked => "chunked",
Brotli => "br",

View File

@@ -1,7 +1,7 @@
use std::fmt::{self, Display, Write};
use std::str::FromStr;
use crate::header::{HeaderValue, IntoHeaderValue, InvalidHeaderValueBytes, Writer};
use crate::header::{HeaderValue, IntoHeaderValue, InvalidHeaderValue, Writer};
/// check that each char in the slice is either:
/// 1. `%x21`, or
@@ -113,7 +113,7 @@ impl EntityTag {
}
impl Display for EntityTag {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
if self.weak {
write!(f, "W/\"{}\"", self.tag)
} else {
@@ -157,12 +157,12 @@ impl FromStr for EntityTag {
}
impl IntoHeaderValue for EntityTag {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut wrt = Writer::new();
write!(wrt, "{}", self).unwrap();
HeaderValue::from_shared(wrt.take())
HeaderValue::from_maybe_shared(wrt.take())
}
}

View File

@@ -1,117 +1,99 @@
use std::fmt::{self, Display};
use std::io::Write;
use std::str::FromStr;
use std::time::{Duration, SystemTime, UNIX_EPOCH};
use std::time::{SystemTime, UNIX_EPOCH};
use bytes::{BufMut, BytesMut};
use http::header::{HeaderValue, InvalidHeaderValueBytes};
use bytes::{buf::BufMutExt, BytesMut};
use http::header::{HeaderValue, InvalidHeaderValue};
use time::{offset, OffsetDateTime, PrimitiveDateTime};
use crate::error::ParseError;
use crate::header::IntoHeaderValue;
use crate::time_parser;
/// A timestamp with HTTP formatting and parsing
#[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord)]
pub struct HttpDate(time::Tm);
pub struct HttpDate(OffsetDateTime);
impl FromStr for HttpDate {
type Err = ParseError;
fn from_str(s: &str) -> Result<HttpDate, ParseError> {
match time::strptime(s, "%a, %d %b %Y %T %Z")
.or_else(|_| time::strptime(s, "%A, %d-%b-%y %T %Z"))
.or_else(|_| time::strptime(s, "%c"))
{
Ok(t) => Ok(HttpDate(t)),
Err(_) => Err(ParseError::Header),
match time_parser::parse_http_date(s) {
Some(t) => Ok(HttpDate(t.assume_utc())),
None => Err(ParseError::Header),
}
}
}
impl Display for HttpDate {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fmt::Display::fmt(&self.0.to_utc().rfc822(), f)
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt::Display::fmt(&self.0.format("%a, %d %b %Y %H:%M:%S GMT"), f)
}
}
impl From<time::Tm> for HttpDate {
fn from(tm: time::Tm) -> HttpDate {
HttpDate(tm)
impl From<OffsetDateTime> for HttpDate {
fn from(dt: OffsetDateTime) -> HttpDate {
HttpDate(dt)
}
}
impl From<SystemTime> for HttpDate {
fn from(sys: SystemTime) -> HttpDate {
let tmspec = match sys.duration_since(UNIX_EPOCH) {
Ok(dur) => {
time::Timespec::new(dur.as_secs() as i64, dur.subsec_nanos() as i32)
}
Err(err) => {
let neg = err.duration();
time::Timespec::new(
-(neg.as_secs() as i64),
-(neg.subsec_nanos() as i32),
)
}
};
HttpDate(time::at_utc(tmspec))
HttpDate(PrimitiveDateTime::from(sys).assume_utc())
}
}
impl IntoHeaderValue for HttpDate {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut wrt = BytesMut::with_capacity(29).writer();
write!(wrt, "{}", self.0.rfc822()).unwrap();
HeaderValue::from_shared(wrt.get_mut().take().freeze())
write!(
wrt,
"{}",
self.0
.to_offset(offset!(UTC))
.format("%a, %d %b %Y %H:%M:%S GMT")
)
.unwrap();
HeaderValue::from_maybe_shared(wrt.get_mut().split().freeze())
}
}
impl From<HttpDate> for SystemTime {
fn from(date: HttpDate) -> SystemTime {
let spec = date.0.to_timespec();
if spec.sec >= 0 {
UNIX_EPOCH + Duration::new(spec.sec as u64, spec.nsec as u32)
} else {
UNIX_EPOCH - Duration::new(spec.sec as u64, spec.nsec as u32)
}
let dt = date.0;
let epoch = OffsetDateTime::unix_epoch();
UNIX_EPOCH + (dt - epoch)
}
}
#[cfg(test)]
mod tests {
use super::HttpDate;
use time::Tm;
const NOV_07: HttpDate = HttpDate(Tm {
tm_nsec: 0,
tm_sec: 37,
tm_min: 48,
tm_hour: 8,
tm_mday: 7,
tm_mon: 10,
tm_year: 94,
tm_wday: 0,
tm_isdst: 0,
tm_yday: 0,
tm_utcoff: 0,
});
use time::{date, time, PrimitiveDateTime};
#[test]
fn test_date() {
let nov_07 = HttpDate(
PrimitiveDateTime::new(date!(1994 - 11 - 07), time!(8:48:37)).assume_utc(),
);
assert_eq!(
"Sun, 07 Nov 1994 08:48:37 GMT".parse::<HttpDate>().unwrap(),
NOV_07
nov_07
);
assert_eq!(
"Sunday, 07-Nov-94 08:48:37 GMT"
.parse::<HttpDate>()
.unwrap(),
NOV_07
nov_07
);
assert_eq!(
"Sun Nov 7 08:48:37 1994".parse::<HttpDate>().unwrap(),
NOV_07
nov_07
);
assert!("this-is-no-date".parse::<HttpDate>().is_err());
}

View File

@@ -53,7 +53,7 @@ impl<T: PartialEq> cmp::PartialOrd for QualityItem<T> {
}
impl<T: fmt::Display> fmt::Display for QualityItem<T> {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt::Display::fmt(&self.item, f)?;
match self.quality.0 {
1000 => Ok(()),

View File

@@ -1,4 +1,4 @@
use std::{io, mem, ptr, slice};
use std::{io, ptr};
use bytes::{BufMut, BytesMut};
use http::Version;
@@ -14,9 +14,7 @@ const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
pub(crate) const STATUS_LINE_BUF_SIZE: usize = 13;
pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesMut) {
let mut buf: [u8; STATUS_LINE_BUF_SIZE] = [
b'H', b'T', b'T', b'P', b'/', b'1', b'.', b'1', b' ', b' ', b' ', b' ', b' ',
];
let mut buf: [u8; STATUS_LINE_BUF_SIZE] = *b"HTTP/1.1 ";
match version {
Version::HTTP_2 => buf[5] = b'2',
Version::HTTP_10 => buf[7] = b'0',
@@ -60,113 +58,108 @@ pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesM
bytes.put_slice(&buf);
if four {
bytes.put(b' ');
bytes.put_u8(b' ');
}
}
const DIGITS_START: u8 = b'0';
/// NOTE: bytes object has to contain enough space
pub fn write_content_length(mut n: usize, bytes: &mut BytesMut) {
if n < 10 {
let mut buf: [u8; 21] = [
b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l', b'e',
b'n', b'g', b't', b'h', b':', b' ', b'0', b'\r', b'\n',
];
buf[18] = (n as u8) + b'0';
bytes.put_slice(&buf);
} else if n < 100 {
let mut buf: [u8; 22] = [
b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l', b'e',
b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'\r', b'\n',
];
let d1 = n << 1;
unsafe {
ptr::copy_nonoverlapping(
DEC_DIGITS_LUT.as_ptr().add(d1),
buf.as_mut_ptr().offset(18),
2,
);
}
bytes.put_slice(&buf);
} else if n < 1000 {
let mut buf: [u8; 23] = [
b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l', b'e',
b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'0', b'\r', b'\n',
];
// decode 2 more chars, if > 2 chars
let d1 = (n % 100) << 1;
n /= 100;
unsafe {
ptr::copy_nonoverlapping(
DEC_DIGITS_LUT.as_ptr().add(d1),
buf.as_mut_ptr().offset(19),
2,
)
};
// decode last 1
buf[18] = (n as u8) + b'0';
bytes.put_slice(&buf);
} else {
pub fn write_content_length(n: usize, bytes: &mut BytesMut) {
bytes.put_slice(b"\r\ncontent-length: ");
convert_usize(n, bytes);
if n < 10 {
bytes.put_u8(DIGITS_START + (n as u8));
} else if n < 100 {
let n = n as u8;
let d10 = n / 10;
let d1 = n % 10;
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 1000 {
let n = n as u16;
let d100 = (n / 100) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 10_000 {
let n = n as u16;
let d1000 = (n / 1000) as u8;
let d100 = ((n / 100) % 10) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d1000);
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 100_000 {
let n = n as u32;
let d10000 = (n / 10000) as u8;
let d1000 = ((n / 1000) % 10) as u8;
let d100 = ((n / 100) % 10) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d10000);
bytes.put_u8(DIGITS_START + d1000);
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 1_000_000 {
let n = n as u32;
let d100000 = (n / 100_000) as u8;
let d10000 = ((n / 10000) % 10) as u8;
let d1000 = ((n / 1000) % 10) as u8;
let d100 = ((n / 100) % 10) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100000);
bytes.put_u8(DIGITS_START + d10000);
bytes.put_u8(DIGITS_START + d1000);
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else {
write_usize(n, bytes);
}
bytes.put_slice(b"\r\n");
}
pub(crate) fn convert_usize(mut n: usize, bytes: &mut BytesMut) {
let mut curr: isize = 39;
let mut buf: [u8; 41] = unsafe { mem::uninitialized() };
buf[39] = b'\r';
buf[40] = b'\n';
let buf_ptr = buf.as_mut_ptr();
let lut_ptr = DEC_DIGITS_LUT.as_ptr();
pub(crate) fn write_usize(n: usize, bytes: &mut BytesMut) {
let mut n = n;
// eagerly decode 4 characters at a time
while n >= 10_000 {
let rem = (n % 10_000) as isize;
n /= 10_000;
// 20 chars is max length of a usize (2^64)
// digits will be added to the buffer from lsd to msd
let mut buf = BytesMut::with_capacity(20);
let d1 = (rem / 100) << 1;
let d2 = (rem % 100) << 1;
curr -= 4;
unsafe {
ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
ptr::copy_nonoverlapping(lut_ptr.offset(d2), buf_ptr.offset(curr + 2), 2);
}
while n > 9 {
// "pop" the least-significant digit
let lsd = (n % 10) as u8;
// remove the lsd from n
n /= 10;
buf.put_u8(DIGITS_START + lsd);
}
// if we reach here numbers are <= 9999, so at most 4 chars long
let mut n = n as isize; // possibly reduce 64bit math
// put msd to result buffer
bytes.put_u8(DIGITS_START + (n as u8));
// decode 2 more chars, if > 2 chars
if n >= 100 {
let d1 = (n % 100) << 1;
n /= 100;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
}
}
// decode last 1 or 2 chars
if n < 10 {
curr -= 1;
unsafe {
*buf_ptr.offset(curr) = (n as u8) + b'0';
}
} else {
let d1 = n << 1;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
}
}
unsafe {
bytes.extend_from_slice(slice::from_raw_parts(
buf_ptr.offset(curr),
41 - curr as usize,
));
// put, in reverse (msd to lsd), remaining digits to buffer
for i in (0..buf.len()).rev() {
bytes.put_u8(buf[i]);
}
}
@@ -203,33 +196,76 @@ mod tests {
let mut bytes = BytesMut::new();
bytes.reserve(50);
write_content_length(0, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 0\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 0\r\n"[..]);
bytes.reserve(50);
write_content_length(9, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 9\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 9\r\n"[..]);
bytes.reserve(50);
write_content_length(10, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 10\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 10\r\n"[..]);
bytes.reserve(50);
write_content_length(99, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 99\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 99\r\n"[..]);
bytes.reserve(50);
write_content_length(100, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 100\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 100\r\n"[..]);
bytes.reserve(50);
write_content_length(101, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 101\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 101\r\n"[..]);
bytes.reserve(50);
write_content_length(998, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 998\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 998\r\n"[..]);
bytes.reserve(50);
write_content_length(1000, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 1000\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 1000\r\n"[..]);
bytes.reserve(50);
write_content_length(1001, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 1001\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 1001\r\n"[..]);
bytes.reserve(50);
write_content_length(5909, &mut bytes);
assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 5909\r\n"[..]);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 5909\r\n"[..]);
bytes.reserve(50);
write_content_length(9999, &mut bytes);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 9999\r\n"[..]);
bytes.reserve(50);
write_content_length(10001, &mut bytes);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 10001\r\n"[..]);
bytes.reserve(50);
write_content_length(59094, &mut bytes);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 59094\r\n"[..]);
bytes.reserve(50);
write_content_length(99999, &mut bytes);
assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 99999\r\n"[..]);
bytes.reserve(50);
write_content_length(590947, &mut bytes);
assert_eq!(
bytes.split().freeze(),
b"\r\ncontent-length: 590947\r\n"[..]
);
bytes.reserve(50);
write_content_length(999999, &mut bytes);
assert_eq!(
bytes.split().freeze(),
b"\r\ncontent-length: 999999\r\n"[..]
);
bytes.reserve(50);
write_content_length(5909471, &mut bytes);
assert_eq!(
bytes.split().freeze(),
b"\r\ncontent-length: 5909471\r\n"[..]
);
bytes.reserve(50);
write_content_length(59094718, &mut bytes);
assert_eq!(
bytes.split().freeze(),
b"\r\ncontent-length: 59094718\r\n"[..]
);
bytes.reserve(50);
write_content_length(4294973728, &mut bytes);
assert_eq!(
bytes.split().freeze(),
b"\r\ncontent-length: 4294973728\r\n"[..]
);
}
}

View File

@@ -29,7 +29,6 @@ impl Response {
STATIC_RESP!(AlreadyReported, StatusCode::ALREADY_REPORTED);
STATIC_RESP!(MultipleChoices, StatusCode::MULTIPLE_CHOICES);
STATIC_RESP!(MovedPermanenty, StatusCode::MOVED_PERMANENTLY);
STATIC_RESP!(MovedPermanently, StatusCode::MOVED_PERMANENTLY);
STATIC_RESP!(Found, StatusCode::FOUND);
STATIC_RESP!(SeeOther, StatusCode::SEE_OTHER);

View File

@@ -25,10 +25,10 @@ pub trait HttpMessage: Sized {
fn take_payload(&mut self) -> Payload<Self::Stream>;
/// Request's extensions container
fn extensions(&self) -> Ref<Extensions>;
fn extensions(&self) -> Ref<'_, Extensions>;
/// Mutable reference to a the request's extensions container
fn extensions_mut(&self) -> RefMut<Extensions>;
fn extensions_mut(&self) -> RefMut<'_, Extensions>;
#[doc(hidden)]
/// Get a header
@@ -105,7 +105,7 @@ pub trait HttpMessage: Sized {
/// Load request cookies.
#[inline]
fn cookies(&self) -> Result<Ref<Vec<Cookie<'static>>>, CookieParseError> {
fn cookies(&self) -> Result<Ref<'_, Vec<Cookie<'static>>>, CookieParseError> {
if self.extensions().get::<Cookies>().is_none() {
let mut cookies = Vec::new();
for hdr in self.headers().get_all(header::COOKIE) {
@@ -153,12 +153,12 @@ where
}
/// Request's extensions container
fn extensions(&self) -> Ref<Extensions> {
fn extensions(&self) -> Ref<'_, Extensions> {
(**self).extensions()
}
/// Mutable reference to a the request's extensions container
fn extensions_mut(&self) -> RefMut<Extensions> {
fn extensions_mut(&self) -> RefMut<'_, Extensions> {
(**self).extensions_mut()
}
}

View File

@@ -1,6 +1,8 @@
//! Basic http primitives for actix-net framework.
#![warn(rust_2018_idioms, warnings)]
#![allow(
clippy::type_complexity,
clippy::too_many_arguments,
clippy::new_without_default,
clippy::borrow_interior_mutable_const
)]
@@ -8,10 +10,15 @@
#[macro_use]
extern crate log;
#[macro_use]
mod macros;
pub mod body;
mod builder;
pub mod client;
mod cloneable;
mod config;
#[cfg(feature = "compress")]
pub mod encoding;
mod extensions;
mod header;
@@ -23,6 +30,7 @@ mod payload;
mod request;
mod response;
mod service;
mod time_parser;
pub mod cookie;
pub mod error;
@@ -36,7 +44,7 @@ pub use self::config::{KeepAlive, ServiceConfig};
pub use self::error::{Error, ResponseError, Result};
pub use self::extensions::Extensions;
pub use self::httpmessage::HttpMessage;
pub use self::message::{Message, RequestHead, ResponseHead};
pub use self::message::{Message, RequestHead, RequestHeadType, ResponseHead};
pub use self::payload::{Payload, PayloadStream};
pub use self::request::Request;
pub use self::response::{Response, ResponseBuilder};
@@ -48,7 +56,7 @@ pub mod http {
// re-exports
pub use http::header::{HeaderName, HeaderValue};
pub use http::uri::PathAndQuery;
pub use http::{uri, Error, HttpTryFrom, Uri};
pub use http::{uri, Error, Uri};
pub use http::{Method, StatusCode, Version};
pub use crate::cookie::{Cookie, CookieBuilder};
@@ -61,3 +69,10 @@ pub mod http {
pub use crate::header::ContentEncoding;
pub use crate::message::ConnectionType;
}
/// Http protocol
#[derive(Copy, Clone, Debug, PartialEq, Eq, Hash)]
pub enum Protocol {
Http1,
Http2,
}

95
actix-http/src/macros.rs Normal file
View File

@@ -0,0 +1,95 @@
#[macro_export]
macro_rules! downcast_get_type_id {
() => {
/// A helper method to get the type ID of the type
/// this trait is implemented on.
/// This method is unsafe to *implement*, since `downcast_ref` relies
/// on the returned `TypeId` to perform a cast.
///
/// Unfortunately, Rust has no notion of a trait method that is
/// unsafe to implement (marking it as `unsafe` makes it unsafe
/// to *call*). As a workaround, we require this method
/// to return a private type along with the `TypeId`. This
/// private type (`PrivateHelper`) has a private constructor,
/// making it impossible for safe code to construct outside of
/// this module. This ensures that safe code cannot violate
/// type-safety by implementing this method.
#[doc(hidden)]
fn __private_get_type_id__(&self) -> (std::any::TypeId, PrivateHelper)
where
Self: 'static,
{
(std::any::TypeId::of::<Self>(), PrivateHelper(()))
}
};
}
//Generate implementation for dyn $name
#[macro_export]
macro_rules! downcast {
($name:ident) => {
/// A struct with a private constructor, for use with
/// `__private_get_type_id__`. Its single field is private,
/// ensuring that it can only be constructed from this module
#[doc(hidden)]
pub struct PrivateHelper(());
impl dyn $name + 'static {
/// Downcasts generic body to a specific type.
pub fn downcast_ref<T: $name + 'static>(&self) -> Option<&T> {
if self.__private_get_type_id__().0 == std::any::TypeId::of::<T>() {
// Safety: external crates cannot override the default
// implementation of `__private_get_type_id__`, since
// it requires returning a private type. We can therefore
// rely on the returned `TypeId`, which ensures that this
// case is correct.
unsafe { Some(&*(self as *const dyn $name as *const T)) }
} else {
None
}
}
/// Downcasts a generic body to a mutable specific type.
pub fn downcast_mut<T: $name + 'static>(&mut self) -> Option<&mut T> {
if self.__private_get_type_id__().0 == std::any::TypeId::of::<T>() {
// Safety: external crates cannot override the default
// implementation of `__private_get_type_id__`, since
// it requires returning a private type. We can therefore
// rely on the returned `TypeId`, which ensures that this
// case is correct.
unsafe {
Some(&mut *(self as *const dyn $name as *const T as *mut T))
}
} else {
None
}
}
}
};
}
#[cfg(test)]
mod tests {
trait MB {
downcast_get_type_id!();
}
downcast!(MB);
impl MB for String {}
impl MB for () {}
#[actix_rt::test]
async fn test_any_casting() {
let mut body = String::from("hello cast");
let resp_body: &mut dyn MB = &mut body;
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast");
let body = &mut resp_body.downcast_mut::<String>().unwrap();
body.push_str("!");
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast!");
let not_body = resp_body.downcast_ref::<()>();
assert!(not_body.is_none());
}
}

View File

@@ -78,13 +78,13 @@ impl Head for RequestHead {
impl RequestHead {
/// Message extensions
#[inline]
pub fn extensions(&self) -> Ref<Extensions> {
pub fn extensions(&self) -> Ref<'_, Extensions> {
self.extensions.borrow()
}
/// Mutable reference to a the message's extensions
#[inline]
pub fn extensions_mut(&self) -> RefMut<Extensions> {
pub fn extensions_mut(&self) -> RefMut<'_, Extensions> {
self.extensions.borrow_mut()
}
@@ -181,6 +181,36 @@ impl RequestHead {
}
}
#[derive(Debug)]
pub enum RequestHeadType {
Owned(RequestHead),
Rc(Rc<RequestHead>, Option<HeaderMap>),
}
impl RequestHeadType {
pub fn extra_headers(&self) -> Option<&HeaderMap> {
match self {
RequestHeadType::Owned(_) => None,
RequestHeadType::Rc(_, headers) => headers.as_ref(),
}
}
}
impl AsRef<RequestHead> for RequestHeadType {
fn as_ref(&self) -> &RequestHead {
match self {
RequestHeadType::Owned(head) => &head,
RequestHeadType::Rc(head, _) => head.as_ref(),
}
}
}
impl From<RequestHead> for RequestHeadType {
fn from(head: RequestHead) -> Self {
RequestHeadType::Owned(head)
}
}
#[derive(Debug)]
pub struct ResponseHead {
pub version: Version,
@@ -207,13 +237,13 @@ impl ResponseHead {
/// Message extensions
#[inline]
pub fn extensions(&self) -> Ref<Extensions> {
pub fn extensions(&self) -> Ref<'_, Extensions> {
self.extensions.borrow()
}
/// Mutable reference to a the message's extensions
#[inline]
pub fn extensions_mut(&self) -> RefMut<Extensions> {
pub fn extensions_mut(&self) -> RefMut<'_, Extensions> {
self.extensions.borrow_mut()
}
@@ -358,6 +388,12 @@ impl BoxedResponseHead {
pub fn new(status: StatusCode) -> Self {
RESPONSE_POOL.with(|p| p.get_message(status))
}
pub(crate) fn take(&mut self) -> Self {
BoxedResponseHead {
head: self.head.take(),
}
}
}
impl std::ops::Deref for BoxedResponseHead {
@@ -376,7 +412,9 @@ impl std::ops::DerefMut for BoxedResponseHead {
impl Drop for BoxedResponseHead {
fn drop(&mut self) {
RESPONSE_POOL.with(|p| p.release(self.head.take().unwrap()))
if let Some(head) = self.head.take() {
RESPONSE_POOL.with(move |p| p.release(head))
}
}
}
@@ -385,6 +423,7 @@ impl Drop for BoxedResponseHead {
pub struct MessagePool<T: Head>(RefCell<Vec<Rc<T>>>);
#[doc(hidden)]
#[allow(clippy::vec_box)]
/// Request's objects pool
pub struct BoxedResponsePool(RefCell<Vec<Box<ResponseHead>>>);

View File

@@ -1,11 +1,14 @@
use std::pin::Pin;
use std::task::{Context, Poll};
use bytes::Bytes;
use futures::{Async, Poll, Stream};
use futures_core::Stream;
use h2::RecvStream;
use crate::error::PayloadError;
/// Type represent boxed payload
pub type PayloadStream = Box<dyn Stream<Item = Bytes, Error = PayloadError>>;
pub type PayloadStream = Pin<Box<dyn Stream<Item = Result<Bytes, PayloadError>>>>;
/// Type represent streaming payload
pub enum Payload<S = PayloadStream> {
@@ -48,18 +51,20 @@ impl<S> Payload<S> {
impl<S> Stream for Payload<S>
where
S: Stream<Item = Bytes, Error = PayloadError>,
S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
{
type Item = Bytes;
type Error = PayloadError;
type Item = Result<Bytes, PayloadError>;
#[inline]
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
match self {
Payload::None => Ok(Async::Ready(None)),
Payload::H1(ref mut pl) => pl.poll(),
Payload::H2(ref mut pl) => pl.poll(),
Payload::Stream(ref mut pl) => pl.poll(),
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
match self.get_mut() {
Payload::None => Poll::Ready(None),
Payload::H1(ref mut pl) => pl.readany(cx),
Payload::H2(ref mut pl) => Pin::new(pl).poll_next(cx),
Payload::Stream(ref mut pl) => Pin::new(pl).poll_next(cx),
}
}
}

View File

@@ -25,13 +25,13 @@ impl<P> HttpMessage for Request<P> {
/// Request extensions
#[inline]
fn extensions(&self) -> Ref<Extensions> {
fn extensions(&self) -> Ref<'_, Extensions> {
self.head.extensions()
}
/// Mutable reference to a the request's extensions
#[inline]
fn extensions_mut(&self) -> RefMut<Extensions> {
fn extensions_mut(&self) -> RefMut<'_, Extensions> {
self.head.extensions_mut()
}
@@ -80,6 +80,11 @@ impl<P> Request<P> {
)
}
/// Get request's payload
pub fn payload(&mut self) -> &mut Payload<P> {
&mut self.payload
}
/// Get request's payload
pub fn take_payload(&mut self) -> Payload<P> {
std::mem::replace(&mut self.payload, Payload::None)
@@ -160,7 +165,7 @@ impl<P> Request<P> {
}
impl<P> fmt::Debug for Request<P> {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
writeln!(
f,
"\nRequest {:?} {}:{}",
@@ -182,7 +187,7 @@ impl<P> fmt::Debug for Request<P> {
#[cfg(test)]
mod tests {
use super::*;
use http::HttpTryFrom;
use std::convert::TryFrom;
#[test]
fn test_basics() {
@@ -199,7 +204,6 @@ mod tests {
assert_eq!(req.uri().query(), Some("q=1"));
let s = format!("{:?}", req);
println!("T: {:?}", s);
assert!(s.contains("Request HTTP/1.1 GET:/index.html"));
}
}

View File

@@ -1,13 +1,14 @@
//! Http response
use std::cell::{Ref, RefMut};
use std::io::Write;
use std::convert::TryFrom;
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, str};
use bytes::{BufMut, Bytes, BytesMut};
use futures::future::{ok, FutureResult, IntoFuture};
use futures::Stream;
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use serde::Serialize;
use serde_json;
use crate::body::{Body, BodyStream, MessageBody, ResponseBody};
use crate::cookie::{Cookie, CookieJar};
@@ -15,7 +16,7 @@ use crate::error::Error;
use crate::extensions::Extensions;
use crate::header::{Header, IntoHeaderValue};
use crate::http::header::{self, HeaderName, HeaderValue};
use crate::http::{Error as HttpError, HeaderMap, HttpTryFrom, StatusCode};
use crate::http::{Error as HttpError, HeaderMap, StatusCode};
use crate::message::{BoxedResponseHead, ConnectionType, ResponseHead};
/// An HTTP Response
@@ -51,7 +52,10 @@ impl Response<Body> {
/// Constructs an error response
#[inline]
pub fn from_error(error: Error) -> Response {
let mut resp = error.as_response_error().render_response();
let mut resp = error.as_response_error().error_response();
if resp.head.status == StatusCode::INTERNAL_SERVER_ERROR {
error!("Internal Server Error: {:?}", error);
}
resp.error = Some(error);
resp
}
@@ -125,7 +129,7 @@ impl<B> Response<B> {
/// Get an iterator for the cookies set by this response
#[inline]
pub fn cookies(&self) -> CookieIter {
pub fn cookies(&self) -> CookieIter<'_> {
CookieIter {
iter: self.head.headers.get_all(header::SET_COOKIE),
}
@@ -133,7 +137,7 @@ impl<B> Response<B> {
/// Add a cookie to this response
#[inline]
pub fn add_cookie(&mut self, cookie: &Cookie) -> Result<(), HttpError> {
pub fn add_cookie(&mut self, cookie: &Cookie<'_>) -> Result<(), HttpError> {
let h = &mut self.head.headers;
HeaderValue::from_str(&cookie.to_string())
.map(|c| {
@@ -181,17 +185,17 @@ impl<B> Response<B> {
/// Responses extensions
#[inline]
pub fn extensions(&self) -> Ref<Extensions> {
pub fn extensions(&self) -> Ref<'_, Extensions> {
self.head.extensions.borrow()
}
/// Mutable reference to a the response's extensions
#[inline]
pub fn extensions_mut(&mut self) -> RefMut<Extensions> {
pub fn extensions_mut(&mut self) -> RefMut<'_, Extensions> {
self.head.extensions.borrow_mut()
}
/// Get body os this response
/// Get body of this response
#[inline]
pub fn body(&self) -> &ResponseBody<B> {
&self.body
@@ -260,7 +264,7 @@ impl<B> Response<B> {
}
impl<B: MessageBody> fmt::Debug for Response<B> {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
let res = writeln!(
f,
"\nResponse {:?} {}{}",
@@ -277,13 +281,15 @@ impl<B: MessageBody> fmt::Debug for Response<B> {
}
}
impl IntoFuture for Response {
type Item = Response;
type Error = Error;
type Future = FutureResult<Response, Error>;
impl Future for Response {
type Output = Result<Response, Error>;
fn into_future(self) -> Self::Future {
ok(self)
fn poll(mut self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<Self::Output> {
Poll::Ready(Ok(Response {
head: self.head.take(),
body: self.body.take_body(),
error: self.error.take(),
}))
}
}
@@ -347,7 +353,6 @@ impl ResponseBuilder {
/// ))
/// .finish())
/// }
/// fn main() {}
/// ```
#[doc(hidden)]
pub fn set<H: Header>(&mut self, hdr: H) -> &mut Self {
@@ -373,11 +378,11 @@ impl ResponseBuilder {
/// .header(http::header::CONTENT_TYPE, "application/json")
/// .finish()
/// }
/// fn main() {}
/// ```
pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self
where
HeaderName: HttpTryFrom<K>,
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue,
{
if let Some(parts) = parts(&mut self.head, &self.err) {
@@ -405,11 +410,11 @@ impl ResponseBuilder {
/// .set_header(http::header::CONTENT_TYPE, "application/json")
/// .finish()
/// }
/// fn main() {}
/// ```
pub fn set_header<K, V>(&mut self, key: K, value: V) -> &mut Self
where
HeaderName: HttpTryFrom<K>,
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue,
{
if let Some(parts) = parts(&mut self.head, &self.err) {
@@ -478,7 +483,8 @@ impl ResponseBuilder {
#[inline]
pub fn content_type<V>(&mut self, value: V) -> &mut Self
where
HeaderValue: HttpTryFrom<V>,
HeaderValue: TryFrom<V>,
<HeaderValue as TryFrom<V>>::Error: Into<HttpError>,
{
if let Some(parts) = parts(&mut self.head, &self.err) {
match HeaderValue::try_from(value) {
@@ -494,9 +500,7 @@ impl ResponseBuilder {
/// Set content length
#[inline]
pub fn content_length(&mut self, len: u64) -> &mut Self {
let mut wrt = BytesMut::new().writer();
let _ = write!(wrt, "{}", len);
self.header(header::CONTENT_LENGTH, wrt.get_mut().take().freeze())
self.header(header::CONTENT_LENGTH, len)
}
/// Set a cookie
@@ -580,14 +584,14 @@ impl ResponseBuilder {
/// Responses extensions
#[inline]
pub fn extensions(&self) -> Ref<Extensions> {
pub fn extensions(&self) -> Ref<'_, Extensions> {
let head = self.head.as_ref().expect("cannot reuse response builder");
head.extensions.borrow()
}
/// Mutable reference to a the response's extensions
#[inline]
pub fn extensions_mut(&mut self) -> RefMut<Extensions> {
pub fn extensions_mut(&mut self) -> RefMut<'_, Extensions> {
let head = self.head.as_ref().expect("cannot reuse response builder");
head.extensions.borrow_mut()
}
@@ -632,7 +636,7 @@ impl ResponseBuilder {
/// `ResponseBuilder` can not be used after this call.
pub fn streaming<S, E>(&mut self, stream: S) -> Response
where
S: Stream<Item = Bytes, Error = E> + 'static,
S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
E: Into<Error> + 'static,
{
self.body(Body::from_message(BodyStream::new(stream)))
@@ -754,18 +758,16 @@ impl<'a> From<&'a ResponseHead> for ResponseBuilder {
}
}
impl IntoFuture for ResponseBuilder {
type Item = Response;
type Error = Error;
type Future = FutureResult<Response, Error>;
impl Future for ResponseBuilder {
type Output = Result<Response, Error>;
fn into_future(mut self) -> Self::Future {
ok(self.finish())
fn poll(mut self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<Self::Output> {
Poll::Ready(Ok(self.finish()))
}
}
impl fmt::Debug for ResponseBuilder {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
let head = self.head.as_ref().unwrap();
let res = writeln!(
@@ -989,6 +991,14 @@ mod tests {
assert_eq!(resp.body().get_ref(), b"[\"v1\",\"v2\",\"v3\"]");
}
#[test]
fn test_serde_json_in_body() {
use serde_json::json;
let resp =
Response::build(StatusCode::OK).body(json!({"test-key":"test-value"}));
assert_eq!(resp.body().get_ref(), br#"{"test-key":"test-value"}"#);
}
#[test]
fn test_into_response() {
let resp: Response = "test".into();

View File

@@ -1,41 +1,43 @@
use std::marker::PhantomData;
use std::{fmt, io, net, rc};
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, net, rc};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_server_config::{
Io as ServerIo, IoStream, Protocol, ServerConfig as SrvConfig,
};
use actix_service::{IntoNewService, NewService, Service};
use actix_utils::cloneable::CloneableService;
use bytes::{Buf, BufMut, Bytes, BytesMut};
use futures::{try_ready, Async, Future, IntoFuture, Poll};
use actix_rt::net::TcpStream;
use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
use bytes::Bytes;
use futures_core::{ready, Future};
use futures_util::future::ok;
use h2::server::{self, Handshake};
use pin_project::{pin_project, project};
use crate::body::MessageBody;
use crate::builder::HttpServiceBuilder;
use crate::cloneable::CloneableService;
use crate::config::{KeepAlive, ServiceConfig};
use crate::error::{DispatchError, Error};
use crate::helpers::DataFactory;
use crate::request::Request;
use crate::response::Response;
use crate::{h1, h2::Dispatcher};
use crate::{h1, h2::Dispatcher, Protocol};
/// `NewService` HTTP1.1/HTTP2 transport implementation
pub struct HttpService<T, P, S, B, X = h1::ExpectHandler, U = h1::UpgradeHandler<T>> {
/// `ServiceFactory` HTTP1.1/HTTP2 transport implementation
pub struct HttpService<T, S, B, X = h1::ExpectHandler, U = h1::UpgradeHandler<T>> {
srv: S,
cfg: ServiceConfig,
expect: X,
upgrade: Option<U>,
on_connect: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, B)>,
}
impl<T, S, B> HttpService<T, (), S, B>
impl<T, S, B> HttpService<T, S, B>
where
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
@@ -45,22 +47,22 @@ where
}
}
impl<T, P, S, B> HttpService<T, P, S, B>
impl<T, S, B> HttpService<T, S, B>
where
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
/// Create new `HttpService` instance.
pub fn new<F: IntoNewService<S>>(service: F) -> Self {
let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
pub fn new<F: IntoServiceFactory<S>>(service: F) -> Self {
let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0, false, None);
HttpService {
cfg,
srv: service.into_new_service(),
srv: service.into_factory(),
expect: h1::ExpectHandler,
upgrade: None,
on_connect: None,
@@ -69,13 +71,13 @@ where
}
/// Create new `HttpService` instance with config.
pub(crate) fn with_config<F: IntoNewService<S>>(
pub(crate) fn with_config<F: IntoServiceFactory<S>>(
cfg: ServiceConfig,
service: F,
) -> Self {
HttpService {
cfg,
srv: service.into_new_service(),
srv: service.into_factory(),
expect: h1::ExpectHandler,
upgrade: None,
on_connect: None,
@@ -84,12 +86,13 @@ where
}
}
impl<T, P, S, B, X, U> HttpService<T, P, S, B, X, U>
impl<T, S, B, X, U> HttpService<T, S, B, X, U>
where
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody,
{
/// Provide service for `EXPECT: 100-Continue` support.
@@ -97,11 +100,12 @@ where
/// Service get called with request that contains `EXPECT` header.
/// Service must return request in case of success, in that case
/// request will be forwarded to main service.
pub fn expect<X1>(self, expect: X1) -> HttpService<T, P, S, B, X1, U>
pub fn expect<X1>(self, expect: X1) -> HttpService<T, S, B, X1, U>
where
X1: NewService<Config = SrvConfig, Request = Request, Response = Request>,
X1: ServiceFactory<Config = (), Request = Request, Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
<X1::Service as Service>::Future: 'static,
{
HttpService {
expect,
@@ -117,15 +121,16 @@ where
///
/// If service is provided then normal requests handling get halted
/// and this service get called with original request and framed object.
pub fn upgrade<U1>(self, upgrade: Option<U1>) -> HttpService<T, P, S, B, X, U1>
pub fn upgrade<U1>(self, upgrade: Option<U1>) -> HttpService<T, S, B, X, U1>
where
U1: NewService<
Config = SrvConfig,
U1: ServiceFactory<
Config = (),
Request = (Request, Framed<T, h1::Codec>),
Response = (),
>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
<U1::Service as Service>::Future: 'static,
{
HttpService {
upgrade,
@@ -140,133 +145,319 @@ where
/// Set on connect callback.
pub(crate) fn on_connect(
mut self,
f: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
f: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
) -> Self {
self.on_connect = f;
self
}
}
impl<T, P, S, B, X, U> NewService for HttpService<T, P, S, B, X, U>
impl<S, B, X, U> HttpService<TcpStream, S, B, X, U>
where
T: IoStream,
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<
Config = SrvConfig,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<TcpStream, h1::Codec>),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
/// Create simple tcp stream service
pub fn tcp(
self,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = DispatchError,
InitError = (),
> {
pipeline_factory(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok((io, Protocol::Http1, peer_addr))
})
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use super::*;
use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
use actix_tls::{openssl::HandshakeError, SslError};
impl<S, B, X, U> HttpService<SslStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<SslStream<TcpStream>, h1::Codec>),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
/// Create openssl based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<HandshakeError<TcpStream>, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: SslStream<TcpStream>| {
let proto = if let Some(protos) = io.ssl().selected_alpn_protocol() {
if protos.windows(2).any(|window| window == b"h2") {
Protocol::Http2
} else {
Protocol::Http1
}
} else {
Protocol::Http1
};
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, proto, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_tls::rustls::{Acceptor, ServerConfig, Session, TlsStream};
use actix_tls::SslError;
use std::io;
impl<S, B, X, U> HttpService<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<TlsStream<TcpStream>, h1::Codec>),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
/// Create openssl based service
pub fn rustls(
self,
mut config: ServerConfig,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<io::Error, DispatchError>,
InitError = (),
> {
let protos = vec!["h2".to_string().into(), "http/1.1".to_string().into()];
config.set_protocols(&protos);
pipeline_factory(
Acceptor::new(config)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: TlsStream<TcpStream>| {
let proto = if let Some(protos) = io.get_ref().1.get_alpn_protocol() {
if protos.windows(2).any(|window| window == b"h2") {
Protocol::Http2
} else {
Protocol::Http1
}
} else {
Protocol::Http1
};
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, proto, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
impl<T, S, B, X, U> ServiceFactory for HttpService<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<T, h1::Codec>),
Response = (),
>,
U::Error: fmt::Display,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
type Config = SrvConfig;
type Request = ServerIo<T, P>;
type Config = ();
type Request = (T, Protocol, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type InitError = ();
type Service = HttpServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
type Future = HttpServiceResponse<T, P, S, B, X, U>;
type Service = HttpServiceHandler<T, S::Service, B, X::Service, U::Service>;
type Future = HttpServiceResponse<T, S, B, X, U>;
fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
HttpServiceResponse {
fut: self.srv.new_service(cfg).into_future(),
fut_ex: Some(self.expect.new_service(cfg)),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(cfg)),
fut: self.srv.new_service(()),
fut_ex: Some(self.expect.new_service(())),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
expect: None,
upgrade: None,
on_connect: self.on_connect.clone(),
cfg: Some(self.cfg.clone()),
cfg: self.cfg.clone(),
_t: PhantomData,
}
}
}
#[doc(hidden)]
pub struct HttpServiceResponse<T, P, S: NewService, B, X: NewService, U: NewService> {
#[pin_project]
pub struct HttpServiceResponse<
T,
S: ServiceFactory,
B,
X: ServiceFactory,
U: ServiceFactory,
> {
#[pin]
fut: S::Future,
#[pin]
fut_ex: Option<X::Future>,
#[pin]
fut_upg: Option<U::Future>,
expect: Option<X::Service>,
upgrade: Option<U::Service>,
on_connect: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
cfg: Option<ServiceConfig>,
_t: PhantomData<(T, P, B)>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
cfg: ServiceConfig,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B, X, U> Future for HttpServiceResponse<T, P, S, B, X, U>
impl<T, S, B, X, U> Future for HttpServiceResponse<T, S, B, X, U>
where
T: IoStream,
S: NewService<Request = Request>,
S::Error: Into<Error>,
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
X: NewService<Request = Request, Response = Request>,
X: ServiceFactory<Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
type Item = HttpServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
type Error = ();
type Output =
Result<HttpServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
if let Some(ref mut fut) = self.fut_ex {
let expect = try_ready!(fut
.poll()
.map_err(|e| log::error!("Init http service error: {:?}", e)));
self.expect = Some(expect);
self.fut_ex.take();
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
if let Some(fut) = this.fut_ex.as_pin_mut() {
let expect = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.expect = Some(expect);
this.fut_ex.set(None);
}
if let Some(ref mut fut) = self.fut_upg {
let upgrade = try_ready!(fut
.poll()
.map_err(|e| log::error!("Init http service error: {:?}", e)));
self.upgrade = Some(upgrade);
self.fut_ex.take();
if let Some(fut) = this.fut_upg.as_pin_mut() {
let upgrade = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.upgrade = Some(upgrade);
this.fut_ex.set(None);
}
let service = try_ready!(self
let result = ready!(this
.fut
.poll()
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)));
Ok(Async::Ready(HttpServiceHandler::new(
self.cfg.take().unwrap(),
Poll::Ready(result.map(|service| {
let this = self.as_mut().project();
HttpServiceHandler::new(
this.cfg.clone(),
service,
self.expect.take().unwrap(),
self.upgrade.take(),
self.on_connect.clone(),
)))
this.expect.take().unwrap(),
this.upgrade.take(),
this.on_connect.clone(),
)
}))
}
}
/// `Service` implementation for http transport
pub struct HttpServiceHandler<T, P, S, B, X, U> {
pub struct HttpServiceHandler<T, S: Service, B, X: Service, U: Service> {
srv: CloneableService<S>,
expect: CloneableService<X>,
upgrade: Option<CloneableService<U>>,
cfg: ServiceConfig,
on_connect: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B, X)>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, B, X)>,
}
impl<T, P, S, B, X, U> HttpServiceHandler<T, P, S, B, X, U>
impl<T, S, B, X, U> HttpServiceHandler<T, S, B, X, U>
where
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>,
@@ -278,41 +469,41 @@ where
srv: S,
expect: X,
upgrade: Option<U>,
on_connect: Option<rc::Rc<Fn(&T) -> Box<dyn DataFactory>>>,
) -> HttpServiceHandler<T, P, S, B, X, U> {
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
) -> HttpServiceHandler<T, S, B, X, U> {
HttpServiceHandler {
cfg,
on_connect,
srv: CloneableService::new(srv),
expect: CloneableService::new(expect),
upgrade: upgrade.map(|s| CloneableService::new(s)),
upgrade: upgrade.map(CloneableService::new),
_t: PhantomData,
}
}
}
impl<T, P, S, B, X, U> Service for HttpServiceHandler<T, P, S, B, X, U>
impl<T, S, B, X, U> Service for HttpServiceHandler<T, S, B, X, U>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display,
U::Error: fmt::Display + Into<Error>,
{
type Request = ServerIo<T, P>;
type Request = (T, Protocol, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type Future = HttpServiceHandlerResponse<T, S, B, X, U>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
let ready = self
.expect
.poll_ready()
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
@@ -322,7 +513,7 @@ where
let ready = self
.srv
.poll_ready()
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
@@ -331,16 +522,27 @@ where
.is_ready()
&& ready;
if ready {
Ok(Async::Ready(()))
let ready = if let Some(ref mut upg) = self.upgrade {
upg.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready()
&& ready
} else {
Ok(Async::NotReady)
ready
};
if ready {
Poll::Ready(Ok(()))
} else {
Poll::Pending
}
}
fn call(&mut self, req: Self::Request) -> Self::Future {
let (io, _, proto) = req.into_parts();
fn call(&mut self, (io, proto, peer_addr): Self::Request) -> Self::Future {
let on_connect = if let Some(ref on_connect) = self.on_connect {
Some(on_connect(&io))
} else {
@@ -348,23 +550,16 @@ where
};
match proto {
Protocol::Http2 => {
let peer_addr = io.peer_addr();
let io = Io {
inner: io,
unread: None,
};
HttpServiceHandlerResponse {
state: State::Handshake(Some((
Protocol::Http2 => HttpServiceHandlerResponse {
state: State::H2Handshake(Some((
server::handshake(io),
self.cfg.clone(),
self.srv.clone(),
peer_addr,
on_connect,
peer_addr,
))),
}
}
Protocol::Http10 | Protocol::Http11 => HttpServiceHandlerResponse {
},
Protocol::Http1 => HttpServiceHandlerResponse {
state: State::H1(h1::Dispatcher::new(
io,
self.cfg.clone(),
@@ -372,232 +567,117 @@ where
self.expect.clone(),
self.upgrade.clone(),
on_connect,
peer_addr,
)),
},
_ => HttpServiceHandlerResponse {
state: State::Unknown(Some((
io,
BytesMut::with_capacity(14),
self.cfg.clone(),
self.srv.clone(),
self.expect.clone(),
self.upgrade.clone(),
on_connect,
))),
},
}
}
}
#[pin_project]
enum State<T, S, B, X, U>
where
S: Service<Request = Request>,
S::Future: 'static,
S::Error: Into<Error>,
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
B: MessageBody,
X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display,
{
H1(h1::Dispatcher<T, S, B, X, U>),
H2(Dispatcher<Io<T>, S, B>),
Unknown(
H1(#[pin] h1::Dispatcher<T, S, B, X, U>),
H2(#[pin] Dispatcher<T, S, B>),
H2Handshake(
Option<(
T,
BytesMut,
Handshake<T, Bytes>,
ServiceConfig,
CloneableService<S>,
CloneableService<X>,
Option<CloneableService<U>>,
Option<Box<dyn DataFactory>>,
)>,
),
Handshake(
Option<(
Handshake<Io<T>, Bytes>,
ServiceConfig,
CloneableService<S>,
Option<net::SocketAddr>,
Option<Box<dyn DataFactory>>,
)>,
),
}
#[pin_project]
pub struct HttpServiceHandlerResponse<T, S, B, X, U>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display,
{
#[pin]
state: State<T, S, B, X, U>,
}
const HTTP2_PREFACE: [u8; 14] = *b"PRI * HTTP/2.0";
impl<T, S, B, X, U> Future for HttpServiceHandlerResponse<T, S, B, X, U>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody,
X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display,
{
type Item = ();
type Error = DispatchError;
type Output = Result<(), DispatchError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.state {
State::H1(ref mut disp) => disp.poll(),
State::H2(ref mut disp) => disp.poll(),
State::Unknown(ref mut data) => {
if let Some(ref mut item) = data {
loop {
unsafe {
let b = item.1.bytes_mut();
let n = try_ready!(item.0.poll_read(b));
if n == 0 {
return Ok(Async::Ready(()));
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
self.project().state.poll(cx)
}
item.1.advance_mut(n);
if item.1.len() >= HTTP2_PREFACE.len() {
break;
}
}
}
} else {
panic!()
}
let (io, buf, cfg, srv, expect, upgrade, on_connect) =
data.take().unwrap();
if buf[..14] == HTTP2_PREFACE[..] {
let peer_addr = io.peer_addr();
let io = Io {
inner: io,
unread: Some(buf),
};
self.state = State::Handshake(Some((
server::handshake(io),
cfg,
srv,
peer_addr,
on_connect,
)));
} else {
self.state = State::H1(h1::Dispatcher::with_timeout(
io,
h1::Codec::new(cfg.clone()),
cfg,
buf,
None,
srv,
expect,
upgrade,
on_connect,
))
}
self.poll()
}
State::Handshake(ref mut data) => {
}
impl<T, S, B, X, U> State<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display,
{
#[project]
fn poll(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Result<(), DispatchError>> {
#[project]
match self.as_mut().project() {
State::H1(disp) => disp.poll(cx),
State::H2(disp) => disp.poll(cx),
State::H2Handshake(ref mut data) => {
let conn = if let Some(ref mut item) = data {
match item.0.poll() {
Ok(Async::Ready(conn)) => conn,
Ok(Async::NotReady) => return Ok(Async::NotReady),
Err(err) => {
match Pin::new(&mut item.0).poll(cx) {
Poll::Ready(Ok(conn)) => conn,
Poll::Ready(Err(err)) => {
trace!("H2 handshake error: {}", err);
return Err(err.into());
return Poll::Ready(Err(err.into()));
}
Poll::Pending => return Poll::Pending,
}
} else {
panic!()
};
let (_, cfg, srv, peer_addr, on_connect) = data.take().unwrap();
self.state = State::H2(Dispatcher::new(
let (_, cfg, srv, on_connect, peer_addr) = data.take().unwrap();
self.set(State::H2(Dispatcher::new(
srv, conn, on_connect, cfg, None, peer_addr,
));
self.poll()
)));
self.poll(cx)
}
}
}
}
/// Wrapper for `AsyncRead + AsyncWrite` types
struct Io<T> {
unread: Option<BytesMut>,
inner: T,
}
impl<T: io::Read> io::Read for Io<T> {
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
if let Some(mut bytes) = self.unread.take() {
let size = std::cmp::min(buf.len(), bytes.len());
buf[..size].copy_from_slice(&bytes[..size]);
if bytes.len() > size {
bytes.split_to(size);
self.unread = Some(bytes);
}
Ok(size)
} else {
self.inner.read(buf)
}
}
}
impl<T: io::Write> io::Write for Io<T> {
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
self.inner.write(buf)
}
fn flush(&mut self) -> io::Result<()> {
self.inner.flush()
}
}
impl<T: AsyncRead> AsyncRead for Io<T> {
unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool {
self.inner.prepare_uninitialized_buffer(buf)
}
}
impl<T: AsyncWrite> AsyncWrite for Io<T> {
fn shutdown(&mut self) -> Poll<(), io::Error> {
self.inner.shutdown()
}
fn write_buf<B: Buf>(&mut self, buf: &mut B) -> Poll<usize, io::Error> {
self.inner.write_buf(buf)
}
}
impl<T: IoStream> IoStream for Io<T> {
#[inline]
fn peer_addr(&self) -> Option<net::SocketAddr> {
self.inner.peer_addr()
}
#[inline]
fn set_nodelay(&mut self, nodelay: bool) -> io::Result<()> {
self.inner.set_nodelay(nodelay)
}
#[inline]
fn set_linger(&mut self, dur: Option<std::time::Duration>) -> io::Result<()> {
self.inner.set_linger(dur)
}
#[inline]
fn set_keepalive(&mut self, dur: Option<std::time::Duration>) -> io::Result<()> {
self.inner.set_keepalive(dur)
}
}

View File

@@ -1,17 +1,18 @@
//! Test Various helpers for Actix applications to use during testing.
use std::convert::TryFrom;
use std::fmt::Write as FmtWrite;
use std::io;
use std::io::{self, Read, Write};
use std::pin::Pin;
use std::str::FromStr;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_server_config::IoStream;
use bytes::{Buf, Bytes, BytesMut};
use futures::{Async, Poll};
use bytes::{Bytes, BytesMut};
use http::header::{self, HeaderName, HeaderValue};
use http::{HttpTryFrom, Method, Uri, Version};
use percent_encoding::{percent_encode, USERINFO_ENCODE_SET};
use http::{Error as HttpError, Method, Uri, Version};
use percent_encoding::percent_encode;
use crate::cookie::{Cookie, CookieJar};
use crate::cookie::{Cookie, CookieJar, USERINFO};
use crate::header::HeaderMap;
use crate::header::{Header, IntoHeaderValue};
use crate::payload::Payload;
@@ -20,8 +21,6 @@ use crate::Request;
/// Test `Request` builder
///
/// ```rust,ignore
/// # extern crate http;
/// # extern crate actix_web;
/// # use http::{header, StatusCode};
/// # use actix_web::*;
/// use actix_web::test::TestRequest;
@@ -34,7 +33,6 @@ use crate::Request;
/// }
/// }
///
/// fn main() {
/// let resp = TestRequest::with_header("content-type", "text/plain")
/// .run(&index)
/// .unwrap();
@@ -42,7 +40,6 @@ use crate::Request;
///
/// let resp = TestRequest::default().run(&index).unwrap();
/// assert_eq!(resp.status(), StatusCode::BAD_REQUEST);
/// }
/// ```
pub struct TestRequest(Option<Inner>);
@@ -82,7 +79,8 @@ impl TestRequest {
/// Create TestRequest and set header
pub fn with_header<K, V>(key: K, value: V) -> TestRequest
where
HeaderName: HttpTryFrom<K>,
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue,
{
TestRequest::default().header(key, value).take()
@@ -118,7 +116,8 @@ impl TestRequest {
/// Set a header
pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self
where
HeaderName: HttpTryFrom<K>,
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue,
{
if let Ok(key) = HeaderName::try_from(key) {
@@ -150,7 +149,7 @@ impl TestRequest {
/// Complete request creation and generate `Request` instance
pub fn finish(&mut self) -> Request {
let inner = self.0.take().expect("cannot reuse test request builder");;
let inner = self.0.take().expect("cannot reuse test request builder");
let mut req = if let Some(pl) = inner.payload {
Request::with_payload(pl)
@@ -166,8 +165,8 @@ impl TestRequest {
let mut cookie = String::new();
for c in inner.cookies.delta() {
let name = percent_encode(c.name().as_bytes(), USERINFO_ENCODE_SET);
let value = percent_encode(c.value().as_bytes(), USERINFO_ENCODE_SET);
let name = percent_encode(c.name().as_bytes(), USERINFO);
let value = percent_encode(c.value().as_bytes(), USERINFO);
let _ = write!(&mut cookie, "; {}={}", name, value);
}
if !cookie.is_empty() {
@@ -244,27 +243,30 @@ impl io::Write for TestBuffer {
}
}
impl AsyncRead for TestBuffer {}
impl AsyncRead for TestBuffer {
fn poll_read(
self: Pin<&mut Self>,
_: &mut Context<'_>,
buf: &mut [u8],
) -> Poll<io::Result<usize>> {
Poll::Ready(self.get_mut().read(buf))
}
}
impl AsyncWrite for TestBuffer {
fn shutdown(&mut self) -> Poll<(), io::Error> {
Ok(Async::Ready(()))
fn poll_write(
self: Pin<&mut Self>,
_: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
Poll::Ready(self.get_mut().write(buf))
}
fn write_buf<B: Buf>(&mut self, _: &mut B) -> Poll<usize, io::Error> {
Ok(Async::NotReady)
}
}
impl IoStream for TestBuffer {
fn set_nodelay(&mut self, _nodelay: bool) -> io::Result<()> {
Ok(())
}
fn set_linger(&mut self, _dur: Option<std::time::Duration>) -> io::Result<()> {
Ok(())
}
fn set_keepalive(&mut self, _dur: Option<std::time::Duration>) -> io::Result<()> {
Ok(())
fn poll_flush(self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<io::Result<()>> {
Poll::Ready(Ok(()))
}
fn poll_shutdown(self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<io::Result<()>> {
Poll::Ready(Ok(()))
}
}

Some files were not shown because too many files have changed in this diff Show More