commit 7cc380a04213f4a340902ad16d5be533ef547694 Author: Valentin Brandl Date: Mon Mar 30 18:33:48 2020 +0200 Initial commit diff --git a/Dockerfile b/Dockerfile new file mode 100644 index 0000000..7f64c92 --- /dev/null +++ b/Dockerfile @@ -0,0 +1,5 @@ +FROM openjdk:8-slim + +COPY Server/ /server/ +WORKDIR /server/ +ENTRYPOINT ./launch.sh diff --git a/Server/ForgeModLoader-server-0.log.lck b/Server/ForgeModLoader-server-0.log.lck new file mode 100644 index 0000000..e69de29 diff --git a/Server/TekkitLite.jar b/Server/TekkitLite.jar new file mode 100644 index 0000000..fb01e70 Binary files /dev/null and b/Server/TekkitLite.jar differ diff --git a/Server/Tekkit_Lite_Server_0.6.5.zip b/Server/Tekkit_Lite_Server_0.6.5.zip new file mode 100644 index 0000000..b32754d Binary files /dev/null and b/Server/Tekkit_Lite_Server_0.6.5.zip differ diff --git a/Server/banned-ips.txt b/Server/banned-ips.txt new file mode 100644 index 0000000..cedf662 --- /dev/null +++ b/Server/banned-ips.txt @@ -0,0 +1,3 @@ +# Updated 30/03/20 18:15 by Minecraft 1.4.7 +# victim name | ban date | banned by | banned until | reason + diff --git a/Server/banned-players.txt b/Server/banned-players.txt new file mode 100644 index 0000000..cedf662 --- /dev/null +++ b/Server/banned-players.txt @@ -0,0 +1,3 @@ +# Updated 30/03/20 18:15 by Minecraft 1.4.7 +# victim name | ban date | banned by | banned until | reason + diff --git a/Server/bukkit.yml b/Server/bukkit.yml new file mode 100644 index 0000000..8524274 --- /dev/null +++ b/Server/bukkit.yml @@ -0,0 +1,138 @@ +# This is the main configuration file for Bukkit. +# As you can see, there's actually not that much to configure without any plugins. +# For a reference for any variable inside this file, check out the bukkit wiki at +# http://wiki.bukkit.org/Bukkit.yml +settings: + allow-end: true + warn-on-overload: true + permissions-file: permissions.yml + update-folder: update + ping-packet-limit: 100 + use-exact-login-location: false + plugin-profiling: false + connection-throttle: 4000 + query-plugins: true + deprecated-verbose: default + shutdown-message: Server closed + restart-script-location: start.bat + timeout-time: 300 + restart-on-crash: false + filter-unsafe-ips: false + whitelist-message: You are not white-listed on this server! + fml-missing-message: You do not have FML installed, you cannot connect to this server + fml-missing-mods-message: The server requires mods that are absent or out of date on your client + fml-outdated-message: Your client is not running a new enough version of FML to connect to this server + fml-other-error-message: There was a problem during FML negotiation + log-commands: true + command-complete: true + restart-command: true + tps-command: true + spam-exclusions: + - /skill +mcpc: + connection-logging: false + dump-materials: false + world-leak-debug: false + infinite-water-source: true + flowing-lava-decay: false + load-chunk-on-request: false + simulate-block-place-event-IDs: [] + simulate-block-place-event-default: true + warn-place-no-tile-entity: true + fake-players: + com/eloraam/redpower/machine/EntityPlayerFake: + username: '[RedPower]' + do-login: false + dan200/turtle/shared/TurtlePlayer: + username: '[ComputerCraft]' + do-login: false + plugin-settings: + default: + debug: false + custom-class-loader: true + use-guava10: true + remap-nms-v1_4_R1: true + remap-nms-v1_4_6: true + remap-obc-v1_4_6: true + remap-obc-pre: false + remap-nms-pre: 'false' + global-inheritance: true + plugin-inheritance: true + remap-reflect-field: true + bukkit-to-forge-mappings: + world_nether: dim-1 + world_the_end: dim1 + world_twilightforest: dim7 +world-settings: + default: + growth-chunks-per-tick: 650 + mob-spawn-range: 4 + item-merge-radius: 3.5 + exp-merge-radius: 3.5 + random-light-updates: false + aggregate-chunkticks: 4 + wheat-growth-modifier: 100 + cactus-growth-modifier: 100 + melon-growth-modifier: 100 + pumpkin-growth-modifier: 100 + sugar-growth-modifier: 100 + tree-growth-modifier: 100 + mushroom-growth-modifier: 100 + verbose: false + keeploaded-environment-the_end: true + keeploaded-environment-twilightforest: true + worldgen-modbspkrsCore-ModLoaderWorldGenerator: true + worldgen-IC2-IC2: true + worldgen-factorization-Registry: true + keeploaded-environment-normal: true + keeploaded-environment-nether: true + keeploaded-environment-myst: false + worldgen-ThermalExpansion-WorldHandler: true + worldgen-AppliedEnergistics-AppEng: true + worldgen-DimensionalDoors-RiftGenerator: true + keeploaded-environment-pocket: false + keeploaded-environment-limbo: false + worldgen-FlatBedrock-FlatBedrockWorldGen: true + worldgen-RedPowerWorld-WorldGenHandler: true + worldgen-NetherOres-NetherOresWorldGenHandler: true + world: + growth-chunks-per-tick: 1000 + world_nether: + view-distance: 5 + growth-chunks-per-tick: 0 + random-light-updates: true + water-creatures-per-chunk: 0 +spawn-limits: + monsters: 70 + animals: 15 + water-animals: 5 + ambient: 15 +chunk-gc: + period-in-ticks: 600 + load-threshold: 0 +ticks-per: + animal-spawns: 400 + monster-spawns: 1 + autosave: 0 +auto-updater: + enabled: true + on-broken: + - warn-console + - warn-ops + on-update: + - warn-console + - warn-ops + preferred-channel: rb + host: dl.bukkit.org + suggest-channels: true +database: + username: bukkit + isolation: SERIALIZABLE + driver: org.sqlite.JDBC + password: walrus + url: jdbc:sqlite:{DIR}{NAME}.db +orebfuscator: + enable: false + update-radius: 2 + disabled-worlds: + - world_the_end diff --git a/Server/config.yml b/Server/config.yml new file mode 100644 index 0000000..3608a11 --- /dev/null +++ b/Server/config.yml @@ -0,0 +1,4 @@ +# RandomTP ~ Created by Dpasi314 # + +RandomTP: + RandomTP: {} diff --git a/Server/config/APUnofficial.cfg b/Server/config/APUnofficial.cfg new file mode 100644 index 0000000..ab2d1ce --- /dev/null +++ b/Server/config/APUnofficial.cfg @@ -0,0 +1,59 @@ +# Configuration file + +#################### +# block +#=================== +# Set id to 0 to disable loading the block, add - in front of id to disable recipe only. +#################### + +block { + I:chunkLoaderId=4077 +} + + +#################### +# general +#=================== +# Disabling items/blocks only disables recipes. +#################### + +general { + B:allowWRRemove=false + B:chunkSight=true + B:chunkSightAutorefresh=false + + # Range of chunk load boundaries. + I:chunkSightRange=4 + B:enableTriggers=true + + # Default key to toggle chunk load boundaries. + I:laserKeyChar=64 + + # Percentage of power a power teleport pipe transmits. Between 0 and 100. + I:powerLoss=95 +} + + +#################### +# item +#=================== +# Set id to 0 to disable loading the item, add - in front of id to disable recipe only. +#################### + +item { + I:pipeItemsAdvancedInsertionId=4032 + I:pipeItemsAdvancedWoodId=4033 + I:pipeItemsClosedId=4038 + I:pipeItemsDistributorId=4034 + I:pipeItemsRedStoneId=4031 + I:pipeItemsSwitchId=4039 + I:pipeItemsTeleportId=4035 + I:pipeLiquidsRedstoneId=4030 + I:pipeLiquidsSwitchId=4040 + I:pipeLiquidsTeleportId=4036 + I:pipeLiquidsWaterPumpId=4041 + I:pipePowerSwitchId=4042 + I:pipePowerTeleportId=4037 +} + + diff --git a/Server/config/AdvancedMachines.cfg b/Server/config/AdvancedMachines.cfg new file mode 100644 index 0000000..7e80b9e --- /dev/null +++ b/Server/config/AdvancedMachines.cfg @@ -0,0 +1,68 @@ +# Configuration file + +#################### +# ids +#################### + +ids { + I:AdvancedMachineBlock=188 + I:guiIdCentrifuge=42 + I:guiIdRotary=40 + I:guiIdSingularity=41 + I:refIronID=29775 +} + + +#################### +# opness control +#################### + +"opness control" { + # Base power draw per work tick. + S:baseEnergyConsumption=3 + + # Base machine speedup each work tick. + S:baseMachineAcceleration=2 + + # Exponent of Overclocker acceleration function. 1.6 equals a less-than-squared rise of acceleration speed as you add Overclockers. + S:overClockAccelRatio=1.6 + + # Exponent of Overclocker energy consumption function. 2.0 equals a squared rise of power draw as you add Overclockers. + S:overClockEnergyRatio=2.0 + + # How much additional max speed does each Overclocker grant. + S:overClockSpeedBonus=500 + + # Exponent of Transformer input function. Determines rise of maximum power intake as you add Transformers. + S:overLoadInputRatio=4.0 +} + + +#################### +# sounds +#################### + +sounds { + # Sound files to use on operation. Remember to use '/' instead of backslashes and the Sound directory starts on ic2/sounds. Set empty to disable. + S:advCompressorSound=Machines/CompressorOp.ogg + S:advExtractorSound=Machines/ExtractorOp.ogg + S:advMaceratorSound=Machines/MaceratorOp.ogg + + # Sound played when a machine process is interrupted + S:interuptSound=Machines/InterruptOne.ogg +} + + +#################### +# translation +#################### + +translation { + # Item names. This will also affect their GUI + S:nameAdvCompressor=Singularity Compressor + S:nameAdvExtractor=Centrifuge Extractor + S:nameAdvMacerator=Rotary Macerator + S:nameAdvRefIronDust=refined Iron dust +} + + diff --git a/Server/config/AdvancedPowerManagement.cfg b/Server/config/AdvancedPowerManagement.cfg new file mode 100644 index 0000000..e2a00b2 --- /dev/null +++ b/Server/config/AdvancedPowerManagement.cfg @@ -0,0 +1,31 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:AdvPowerManBlock=2491 +} + + +#################### +# general +#################### + +general { + B:debug=false +} + + +#################### +# item +#################### + +item { + I:BenchTools=22499 + I:LinkCard=22495 + I:LinkCardCreator=22496 +} + + diff --git a/Server/config/AdvancedRepulsionSystems.cfg b/Server/config/AdvancedRepulsionSystems.cfg new file mode 100644 index 0000000..cf5633f --- /dev/null +++ b/Server/config/AdvancedRepulsionSystems.cfg @@ -0,0 +1,55 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:beam=627 + I:blockField=1955 + I:blockMachine=1953 + I:blockUpgrade=1954 + I:teslaMachines=1952 +} + + +#################### +# general +#################### + +general { + I:cooldownBlocksPerTick=40 + I:coreRangeDefault=16 + I:coreStorageDefault=1000000 + I:coreStorageUpgradeAmount=2000000 + B:enableReactorBlocks=true + B:enableTeslaCoil=true + I:fieldCostBase=1 + I:fieldCostCreateMultiplier=10 + I:fieldCostZapperMultiplier=2 + I:maxDeflectorDistance=10 + I:maxOffset=48 + I:maxProjectorSize=32 + I:maxTeslaRange=100 + I:maxTubeRadius=5 + I:refreshSpeed=100 + B:useOldRecipes=false +} + + +#################### +# item +#################### + +item { + I:itemCardCoreLink=11372 + I:itemCardEmpty=11371 + I:itemCardReactorLink=11374 + I:itemCraftingComponent=11377 + I:itemDebuggerMFD=11367 + I:itemLogicCard=11376 + I:itemOffsetMFD=11375 + I:itemWrenchMFD=11370 +} + + diff --git a/Server/config/AppliedEnergistics.cfg b/Server/config/AppliedEnergistics.cfg new file mode 100644 index 0000000..350cc12 --- /dev/null +++ b/Server/config/AppliedEnergistics.cfg @@ -0,0 +1,144 @@ +# Configuration file + +#################### +# appeng +#################### + +appeng { + #################### + # options + #=================== + # Options for Applied Energistics as a whole. + # oreDepthModifier - This feature is deprecated, and will be removed in a future revision. + #################### + + options { + B:enableVersionChecker=false + B:enableWorldGenQuartz=true + I:ore.densityModifier=0 + I:ore.depthModifier=0 + } + + #################### + # bcintegration + #################### + + bcintegration { + B:enableBCtoMEChipRecipe=true + B:useBuildcraftChips=false + } + + #################### + # vesionchecker + #################### + + vesionchecker { + S:lastStarted=k8eoc5op + } + +} + + +#################### +# block +#=================== +# BlockID's for blocks added by Applied Energistics ( these are not shifted. +256 for Ingame ). +#################### + +block { + I:appeng.blockMulti=900 + I:appeng.blockMulti2=901 + I:appeng.blockWorld=902 +} + + +#################### +# features +#=================== +# Enable / Disable AE Features. +#################### + +features { + B:enableEntropyAcc=true + B:enableGrinder=true + B:enableSpaceClickMoving=true + B:enableVibrationCata=true +} + + +#################### +# graphics +#=================== +# Adjust Visual quality of complicated rendering. +#################### + +graphics { + B:gfxCableAnimation=true + B:gfxDrivesHighDef=true +} + + +#################### +# item +#=================== +# ItemID's for items added by Applied Energistics. +#################### + +item { + I:appeng.itemMulti=4105 + I:appeng.materialID=4106 + I:appeng.toolEntropyAccelerator=4107 + I:appeng.toolQuartzAxe=4109 + I:appeng.toolQuartzHoe=4110 + I:appeng.toolQuartzKnife=4115 + I:appeng.toolQuartzPick=4112 + I:appeng.toolQuartzShovel=4111 + I:appeng.toolQuartzSword=4113 + I:appeng.toolQuartzWrench=4114 + I:appeng.toolVibrationCatalyst=4108 +} + + +#################### +# logging +#=================== +# Enable or disable various logging features, enabling logging features will create large logs. +#################### + +logging { + B:enableLogging=false + B:logCrafting=false + B:logGrinderOres=false + B:logPowerUsage=false +} + + +#################### +# me +#################### + +me { + #################### + # options + #=================== + # Options for Mass Energy Components. + # largeDrives - This feature is deprecated, and will be removed in a future revision. + #################### + + options { + D:base.wireless.range=16.0 + B:largeDrives=false + I:max.wireless.extenderBonus=1 + I:max.wireless.extenders=16 + D:powerUsageMultiplier=1.0 + B:requirePower=true + B:terminalAutoSearch=true + S:terminalSortBy=Name + S:terminalSortDirection=ASC + B:terminalUseLargeFont=false + S:terminalViewItems=ALL + } + +} + + diff --git a/Server/config/CCTurtle.cfg b/Server/config/CCTurtle.cfg new file mode 100644 index 0000000..9aec650 --- /dev/null +++ b/Server/config/CCTurtle.cfg @@ -0,0 +1,25 @@ +# Configuration file + +#################### +# block +#################### + +block { + # The Block ID for turtles + I:turtleBlockID=209 + + # The Block ID for upgraded turtles + I:turtleUpgradedBlockID=210 +} + + +#################### +# general +#################### + +general { + # Enable hardcore mode (turtles require fuel to move) + B:turtlesNeedFuel=true +} + + diff --git a/Server/config/ChickenChunks.cfg b/Server/config/ChickenChunks.cfg new file mode 100644 index 0000000..e2352d0 --- /dev/null +++ b/Server/config/ChickenChunks.cfg @@ -0,0 +1,43 @@ +#ChunkLoader Configuration File +#Deleting any element will restore it to it's default value +#Block ID's will be automatically generated the first time it's run + + +#Per player chunk limiting. Values ignored if 0. +#Simply add = +players +{ + #Forge gives everyone 12500 by default + DEFAULT=5000 + #For server op's only. + OP=5000 +} + +#If set to false, players will have to be logged in for their chunkloaders to work. +#Simply add = +allowoffline +{ + DEFAULT=true + OP=true +} + +#Set to false to deny a player access to the chunk viewer +allowchunkviewer +{ + DEFAULT=true + OP=true +} + +#The number of minutes since last login within which chunks from a player will remain active, 0 for infinite. +awayTimeout=0 + +block.id=2048 + +#The number of ticks to wait between attempting to unload orphaned chunks +cleanuptime=1200 + +#The maximum number of chunks per chunkloader +maxchunks=400 + +#Set to false to disable the automatic reloading of mystcraft dimensions on server restart +reload-dimensions=true diff --git a/Server/config/CodeChickenCore.cfg b/Server/config/CodeChickenCore.cfg new file mode 100644 index 0000000..94e93a1 --- /dev/null +++ b/Server/config/CodeChickenCore.cfg @@ -0,0 +1,15 @@ +#CodeChickenCore configuration file. + + +#Various tweaks that can be applied to game mechanics. +tweaks +{ + #If set to true and doFireTick is disabed in the game rules, fire will still dissipate if it's not over a fire source + doFireTickOut=true + #If set to true, creepers will not destroy landscape. (A version of mobGreifing setting just for creepers) + environmentallyFriendlyCreepers=false + #Set to false to make lava fade away like water if all the source blocks are destroyed + persistantLava=true + #If set to false, leaves will only replace air when growing + softLeafReplace=false +} diff --git a/Server/config/CompactSolars.cfg b/Server/config/CompactSolars.cfg new file mode 100644 index 0000000..6f7b713 --- /dev/null +++ b/Server/config/CompactSolars.cfg @@ -0,0 +1,33 @@ +# Configuration file + +#################### +# block +#################### + +block { + # The block id for the compact solar arrays. + I:compactSolar=183 +} + + +#################### +# general +#################### + +general { + # The EU generation scaling factor. The average number of ticks needed to generate one EU packet.1 is every tick, 2 is every other tick etc. Each Solar will still generate a whole packet (8, 64, 512 EU). + I:scaleFactor=1 +} + + +#################### +# item +#################### + +item { + I:solarHatHV=19553 + I:solarHatLV=19551 + I:solarHatMV=19552 +} + + diff --git a/Server/config/ComputerCraft.cfg b/Server/config/ComputerCraft.cfg new file mode 100644 index 0000000..0c635d5 --- /dev/null +++ b/Server/config/ComputerCraft.cfg @@ -0,0 +1,149 @@ +# Configuration file + +#################### +# block +#################### + +block { + # The Block ID for Computers + I:computerBlockID=207 + + # The Block ID for all Peripherals + I:peripheralBlockID=208 +} + + +#################### +# computerspacelimit +#################### + +computerspacelimit { + I:general=2097152 +} + + +#################### +# enableapi_http +#################### + +enableapi_http { + B:general=true +} + + +#################### +# floppyspacelimit +#################### + +floppyspacelimit { + I:general=524288 +} + + +#################### +# general +#################### + +general { + # The disk space limit for computers and turtles, in bytes (0 is unlimited) + I:computerSpaceLimit=2097152 + + # Enable the "http" API on Computers + B:enableAPI_http=true + + # Enable Command Block support + B:enableCommandBlock=false + + # The disk space limit for floppy disks, in bytes (0 is unlimited) + I:floppySpaceLimit=524288 + + # The range of Wireless Modems at maximum altitude in clear weather, in meters + I:modem_highAltitudeRange=384 + + # The range of Wireless Modems at maximum altitude in stormy weather, in meters + I:modem_highAltitudeRangeDuringStorm=64 + + # The range of Wireless Modems at low altitude in clear weather, in meters + I:modem_range=64 + + # The range of Wireless Modems at low altitude in stormy weather, in meters + I:modem_rangeDuringStorm=16 + + # The height of Computer screens, in characters + I:terminal_height=19 + + # The width of Computer screens, in characters + I:terminal_width=51 +} + + +#################### +# item +#################### + +item { + # The Item ID for Coloured Floppy Disks + I:diskExpandedItemID=4001 + + # The Item ID for Floppy Disks + I:diskItemID=4000 + + # The Item ID for Printouts + I:printoutItemID=4002 +} + + +#################### +# modem_highaltituderange +#################### + +modem_highaltituderange { + I:general=384 +} + + +#################### +# modem_highaltituderangeduringstorm +#################### + +modem_highaltituderangeduringstorm { + I:general=64 +} + + +#################### +# modem_range +#################### + +modem_range { + I:general=64 +} + + +#################### +# modem_rangeduringstorm +#################### + +modem_rangeduringstorm { + I:general=16 +} + + +#################### +# terminal_height +#################### + +terminal_height { + I:general=19 +} + + +#################### +# terminal_width +#################### + +terminal_width { + I:general=51 +} + + diff --git a/Server/config/DimensionalDoors.cfg b/Server/config/DimensionalDoors.cfg new file mode 100644 index 0000000..3aa784c --- /dev/null +++ b/Server/config/DimensionalDoors.cfg @@ -0,0 +1,73 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:"Chaos Door"=1978 + I:"Dimensional Door"=1970 + I:"Dimensional Door Link"=1972 + I:"Fabric of Reality"=1973 + I:Rift=1977 + I:"Transdimensional Hatch"=1971 + I:"Transdimensional Trapdoor"=1974 + I:"Warp Door"=1975 + I:"Warp Door Link"=1976 + I:transientDoorID=1979 +} + + +#################### +# boolean +#################### + +boolean { + B:"EXPLOSIONS!!???!!!?!?!!"=false + B:"Should rifts generate natrually in the world? "=true + B:"Toggles limbo"=true + B:"Toggles the door render effect"=true + B:"toggles whether rifts eat blocks around them or not"=true + B:"true to cause player to respawn in Limbo"=false + B:"true to enable iron dim door crafting"=true + B:"true to enable rift blade crafting"=true + B:"true to enable rift remover crafting"=true + B:"true to enable rift signature crafting"=true + B:"true to enable trap door crafting"=true + B:"true to enable unstable door crafting"=true + B:"true to enable wooden door crafting"=true +} + + +#################### +# int +#################### + +int { + I:"Block ID for Limbo- must be below 256"=213 + I:"Block ID for blockDimWallPermID- must be below 256"=214 + I:"Chance that a block will not be TNT. must be greater than 1. Explosions!?!?? must be set to true, and you figure out what it does. "=25 + I:"How many times a rift can spread- 0 prevents rifts from spreading at all. I dont recommend putting it highter than 5, because its rather exponential. "=3 + I:"Limbo Dimension ID"=-23 + I:"Limbo Provider ID"=13 + I:ProviderID=12 + I:"The farthest possible distance that limbo can send you upon return to the overworld."=100000 +} + + +#################### +# item +#################### + +item { + I:"Chaos Door"=5173 + I:"Dimensional Door Item"=5174 + I:"Rift Blade"=5176 + I:"Rift Remover"=5171 + I:"Rift Signature Item"=5175 + I:"Stable Fabric"=5169 + I:"Unstable Fabric"=5172 + I:"Warp Door Item"=5170 +} + + diff --git a/Server/config/EE3.cfg b/Server/config/EE3.cfg new file mode 100644 index 0000000..48c6082 --- /dev/null +++ b/Server/config/EE3.cfg @@ -0,0 +1,123 @@ +# Configuration file + +#################### +# block +#################### + +block { + B:auto_resolve_block_ids=false + I:calcinator=2451 + I:redWaterStill=2453 + #################### + # properties + #=================== + # Custom block properties + #################### + + properties { + #################### + # red_water + #=================== + # Configuration settings for various properties of Red Water + #################### + + red_water { + I:duration.base=5 + I:duration.modifier=2 + I:range.base=1 + I:range.modifier=3 + } + + } + +} + + +#################### +# general +#################### + +general { + B:enable_particle_fx=true + B:enable_philosopher_stone_overlay=true + B:enable_sounds=true + B:enable_version_check=false + I:miniumStone.maxDurability=1521 + I:miniumStone.transmuteCost=1 + B:version_check.enabled=false +} + + +#################### +# graphics +#################### + +graphics { + D:block_overlay_opacity=0.75 + I:block_overlay_position=3 + D:block_overlay_scale=2.5 + B:particle_fx.enabled=true + B:world_transmutation_overlay.enabled=true +} + + +#################### +# item +#################### + +item { + I:alchemyBag=27005 + I:alchemyDust=27004 + I:inertStone=27001 + I:miniumShard=27000 + I:miniumStone=27002 + I:philStone=27003 + #################### + # durability + #################### + + durability { + I:miniumStone=1521 + I:philStone=10001 + } + +} + + +#################### +# keybindings +#=================== +# Keybindings for Equivalent Exchange 3. See http://www.minecraftwiki.net/wiki/Key_codes for mapping of key codes to keyboard keys +#################### + +keybindings { + I:key.charge=47 + I:key.extra=46 + I:key.release=19 + I:key.toggle=34 +} + + +#################### +# keybinds +#################### + +keybinds { + I:key.charge=47 + I:key.extra=46 + I:key.release=19 + I:key.toggle=34 +} + + +#################### +# transmutation +#################### + +transmutation { + I:block_cost=1 + I:item_cost=1 + I:mob_cost=1 +} + + diff --git a/Server/config/EnderStorage.cfg b/Server/config/EnderStorage.cfg new file mode 100644 index 0000000..ed22d82 --- /dev/null +++ b/Server/config/EnderStorage.cfg @@ -0,0 +1,21 @@ +#EnderStorage Configuration File +#Deleting any element will restore it to it's default value +#Block ID's will be automatically generated the first time it's run + + +block.id=251 + +#Set to true to make the vanilla enderchest unplaceable. +disable-vanilla=true + +#The size of each inventory of EnderStorage. 0 = 3x3, 1 = 3x9, 2 = 6x9 +item.storage-size=1 + + +#The ID of the item used to set the chest to personal. Diamond by default +personalItemID=264 + +pouch.id=7237 + +#The size of each inventory of EnderStorage. 0 = 3x3, 1 = 3x9, 2 = 6x9 +storage-size=1 diff --git a/Server/config/IC2.cfg b/Server/config/IC2.cfg new file mode 100644 index 0000000..98e862a --- /dev/null +++ b/Server/config/IC2.cfg @@ -0,0 +1,319 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:blockAlloy=231 + I:blockAlloyGlass=230 + I:blockBarrel=217 + I:blockCable=228 + I:blockCrop=218 + I:blockDoorAlloy=229 + I:blockDynamite=236 + I:blockDynamiteRemote=235 + I:blockElectric=227 + I:blockFenceIron=232 + I:blockFoam=222 + I:blockGenerator=246 + I:blockHarz=240 + I:blockITNT=239 + I:blockIronScaffold=216 + I:blockLuminator=226 + I:blockLuminatorDark=219 + I:blockMachine=250 + I:blockMachine2=223 + I:blockMetal=224 + I:blockMiningPipe=245 + I:blockMiningTip=244 + I:blockNuke=237 + I:blockOreCopper=249 + I:blockOreTin=248 + I:blockOreUran=247 + I:blockPersonal=225 + I:blockReactorChamber=233 + I:blockRubLeaves=242 + I:blockRubSapling=241 + I:blockRubWood=243 + I:blockRubber=234 + I:blockScaffold=220 + I:blockWall=221 +} + + +#################### +# general +#################### + +general { + # Enable burning of scrap in a generator + B:enableBurningScrap=true + + # Enable crafting of buckets out of tin + B:enableCraftingBucket=true + + # Enable crafting of Industrial Credit coins + B:enableCraftingCoin=true + + # Enable crafting of glowstone dust out of dusts + B:enableCraftingGlowstoneDust=true + + # Enable crafting of gunpowder out of dusts + B:enableCraftingGunpowder=true + + # Enable crafting of ITNT + B:enableCraftingITnt=true + + # Enable crafting of nukes + B:enableCraftingNuke=true + + # Enable crafting of rails out of bronze + B:enableCraftingRail=true + + # Enable searching for free block ids, will get disabled after the next successful load + B:enableDynamicIdAllocation=false + + # Enable logging of players when they remove a machine using a wrench + B:enableLoggingWrench=true + + # Enable usage of lapotron crystals on miners + B:enableMinerLapotron=false + + # Enable activation of the quantum leggings' speed boost when sprinting instead of holding the boost key + B:enableQuantumSpeedOnSprint=false + + # Enable hiding of secret recipes in CraftGuide/NEI + B:enableSecretRecipeHiding=false + + # Enable steam-outputting reactors if Railcraft is installed + B:enableSteamReactor=false + + # Enable calculation of inventory weight when going through a teleporter + B:enableTeleporterInventory=true + + # Enable generation of copper in the world + B:enableWorldGenOreCopper=false + + # Enable generation of tin in the world + B:enableWorldGenOreTin=false + + # Enable generation of uranium in the world + B:enableWorldGenOreUranium=true + + # Enable generation of rubber trees in the world + B:enableWorldGenTreeRubber=true + + # Base energy generation values - increase those for higher energy yield + I:energyGeneratorBase=10 + I:energyGeneratorGeo=20 + I:energyGeneratorNuclear=5 + I:energyGeneratorSolar=100 + I:energyGeneratorWater=100 + I:energyGeneratorWind=100 + + # Explosion power of a nuke, where TNT is 4 + S:explosionPowerNuke=35.0 + + # Maximum explosion power of a nuclear reactor, where TNT is 4 + S:explosionPowerReactorMax=45.0 + + # Factor to adjust the ore generation rate + S:oreDensityFactor=1.0 + + # List of blocks and items which should not be turned into scrap by the recycler. Comma separated, format is id-metadata + S:recyclerBlacklist=102, 280, 332, 220 + I:soundSourceLimit=32 + B:soundsEnabled=true + + # List of valuable ores the miner should look for. Comma separated, format is id-metadata:value where value should be at least 1 to be considered by the miner + S:valuableOres=14:3, 15:4, 16:1, 21:3, 56:5, 73:3, 129:5 +} + + +#################### +# item +#################### + +item { + I:itemArmorAlloyChestplate=29923 + I:itemArmorBatpack=29924 + I:itemArmorBronzeBoots=29936 + I:itemArmorBronzeChestplate=29938 + I:itemArmorBronzeHelmet=29939 + I:itemArmorBronzeLegs=29937 + I:itemArmorCFPack=29873 + I:itemArmorHazmatChestplate=29825 + I:itemArmorHazmatHelmet=29826 + I:itemArmorHazmatLeggings=29824 + I:itemArmorJetpack=29954 + I:itemArmorJetpackElectric=29953 + I:itemArmorLappack=29871 + I:itemArmorNanoBoots=29919 + I:itemArmorNanoChestplate=29921 + I:itemArmorNanoHelmet=29922 + I:itemArmorNanoLegs=29920 + I:itemArmorQuantumBoots=29915 + I:itemArmorQuantumChestplate=29917 + I:itemArmorQuantumHelmet=29918 + I:itemArmorQuantumLegs=29916 + I:itemArmorRubBoots=29955 + I:itemBarrel=29852 + I:itemBatCrystal=29985 + I:itemBatLamaCrystal=29984 + I:itemBatRE=29986 + I:itemBatREDischarged=29983 + I:itemBatSU=29982 + I:itemCable=29928 + I:itemCellAir=29823 + I:itemCellBio=29973 + I:itemCellBioRef=29971 + I:itemCellCoal=29974 + I:itemCellCoalRef=29972 + I:itemCellEmpty=29981 + I:itemCellHydrant=29864 + I:itemCellLava=29980 + I:itemCellUranEmpty=29945 + I:itemCellUranEnriched=29946 + I:itemCellWater=29962 + I:itemCellWaterElectro=29925 + I:itemCofeeBeans=29857 + I:itemCofeePowder=29856 + I:itemCoin=29930 + I:itemCoolant=29847 + I:itemCropSeed=29870 + I:itemCropnalyzer=29866 + I:itemDebug=29848 + I:itemDoorAlloy=29929 + I:itemDustBronze=29995 + I:itemDustClay=29877 + I:itemDustCoal=30000 + I:itemDustCopper=29997 + I:itemDustGold=29998 + I:itemDustIron=29999 + I:itemDustIronSmall=29994 + I:itemDustSilver=29874 + I:itemDustTin=29996 + I:itemDynamite=29959 + I:itemDynamiteSticky=29958 + I:itemFertilizer=29865 + I:itemFoamSprayer=29875 + I:itemFreq=29878 + I:itemFuelCan=29976 + I:itemFuelCanEmpty=29975 + I:itemFuelCoalCmpr=29969 + I:itemFuelCoalDust=29970 + I:itemFuelPlantBall=29968 + I:itemFuelPlantCmpr=29967 + I:itemGrinPowder=29850 + I:itemHarz=29961 + I:itemHops=29853 + I:itemIngotAdvIron=29993 + I:itemIngotAlloy=29989 + I:itemIngotBronze=29990 + I:itemIngotCopper=29992 + I:itemIngotTin=29991 + I:itemIngotUran=29988 + I:itemMatter=29932 + I:itemMugBooze=29851 + I:itemMugCoffee=29854 + I:itemMugEmpty=29855 + I:itemNanoSaber=29893 + I:itemNanoSaberOff=29892 + I:itemNightvisionGoggles=29822 + I:itemOreIridium=29872 + I:itemOreUran=29987 + I:itemPartAlloy=29931 + I:itemPartCarbonFibre=29896 + I:itemPartCarbonMesh=29895 + I:itemPartCarbonPlate=29894 + I:itemPartCircuit=29935 + I:itemPartCircuitAdv=29934 + I:itemPartCoalBall=29882 + I:itemPartCoalBlock=29881 + I:itemPartCoalChunk=29880 + I:itemPartDCP=29828 + I:itemPartIndustrialDiamond=29879 + I:itemPartIridium=29891 + I:itemPartPellet=29876 + I:itemRemote=29957 + I:itemRubber=29960 + I:itemScanner=29964 + I:itemScannerAdv=29963 + I:itemScrap=29933 + I:itemScrapbox=29883 + I:itemSolarHelmet=29860 + I:itemStaticBoots=29859 + I:itemTFBP=29890 + I:itemTFBPChilling=29887 + I:itemTFBPCultivation=29889 + I:itemTFBPDesertification=29886 + I:itemTFBPFlatification=29885 + I:itemTFBPIrrigation=29888 + I:itemTFBPMushroom=29862 + I:itemTerraWart=29858 + I:itemTinCan=29966 + I:itemTinCanFilled=29965 + I:itemToolBronzeAxe=29943 + I:itemToolBronzeHoe=29940 + I:itemToolBronzePickaxe=29944 + I:itemToolBronzeSpade=29941 + I:itemToolBronzeSword=29942 + I:itemToolChainsaw=29977 + I:itemToolCutter=29897 + I:itemToolDDrill=29978 + I:itemToolDrill=29979 + I:itemToolHoe=29863 + I:itemToolMEter=29926 + I:itemToolMiningLaser=29952 + I:itemToolPainter=29914 + I:itemToolPainterBlack=29913 + I:itemToolPainterBlue=29909 + I:itemToolPainterBrown=29910 + I:itemToolPainterCloud=29901 + I:itemToolPainterCyan=29907 + I:itemToolPainterDarkGrey=29905 + I:itemToolPainterGreen=29911 + I:itemToolPainterLightGrey=29906 + I:itemToolPainterLime=29903 + I:itemToolPainterMagenta=29900 + I:itemToolPainterOrange=29899 + I:itemToolPainterPink=29904 + I:itemToolPainterPurple=29908 + I:itemToolPainterRed=29912 + I:itemToolPainterWhite=29898 + I:itemToolPainterYellow=29902 + I:itemToolWrench=29927 + I:itemToolWrenchElectric=29884 + I:itemToolbox=29861 + I:itemTreetap=29956 + I:itemTreetapElectric=29868 + I:itemWeedEx=29849 + I:reactorCondensator=29829 + I:reactorCondensatorLap=29827 + I:reactorCoolantSimple=29950 + I:reactorCoolantSix=29843 + I:reactorCoolantTriple=29844 + I:reactorHeatSwitch=29948 + I:reactorHeatSwitchCore=29840 + I:reactorHeatSwitchDiamond=29838 + I:reactorHeatSwitchSpread=29839 + I:reactorHeatpack=29832 + I:reactorIsotopeCell=29947 + I:reactorPlating=29949 + I:reactorPlatingExplosive=29841 + I:reactorPlatingHeat=29842 + I:reactorReflector=29831 + I:reactorReflectorThick=29830 + I:reactorUraniumDual=29846 + I:reactorUraniumQuad=29845 + I:reactorUraniumSimple=29951 + I:reactorVent=29837 + I:reactorVentCore=29836 + I:reactorVentDiamond=29833 + I:reactorVentGold=29835 + I:reactorVentSpread=29834 + I:upgradeModule=29869 +} + + diff --git a/Server/config/IC2.lang b/Server/config/IC2.lang new file mode 100644 index 0000000..f439a01 --- /dev/null +++ b/Server/config/IC2.lang @@ -0,0 +1,316 @@ +# Configuration file + +#################### +# general +#################### + +general { + S:achievement.acquireMatter=Pink Blob + S:achievement.acquireMatter.desc=Produce some UU-Matter + S:achievement.acquireRefinedIron=Better than Iron + S:achievement.acquireRefinedIron.desc=Smelt a refined iron ingot + S:achievement.acquireResin=Sticky Situation + S:achievement.acquireResin.desc=Get resin from a rubber tree with a treetap + S:achievement.buildBatBox=Stash It + S:achievement.buildBatBox.desc=Build a BatBox + S:achievement.buildCable=Energy Flow + S:achievement.buildCable.desc=Make some cables + S:achievement.buildChainsaw=Lumberjack Assassin + S:achievement.buildChainsaw.desc=Build a chainsaw + S:achievement.buildCoalDiamond=Shiny + S:achievement.buildCoalDiamond.desc=Make a coal chunk to compress into a diamond + S:achievement.buildCompressor=Epic Squeeze + S:achievement.buildCompressor.desc=Build a compressor + S:achievement.buildDDrill=Valuable Upgrade + S:achievement.buildDDrill.desc=Upgrade your mining drill to a diamond-tipped mining drill + S:achievement.buildDrill=Meet the Dentist + S:achievement.buildDrill.desc=Build a mining drill + S:achievement.buildElecFurnace=Even Hotter Topic + S:achievement.buildElecFurnace.desc=Build an electric furnace + S:achievement.buildExtractor=Super Treetap + S:achievement.buildExtractor.desc=Build an extractor + S:achievement.buildGenerator=Suitable Power + S:achievement.buildGenerator.desc=Build a generator + S:achievement.buildIndFurnace=Hyperspeed + S:achievement.buildIndFurnace.desc=Build an induction furnace + S:achievement.buildMFE=Storage Upgrade + S:achievement.buildMFE.desc=Build a MFE Unit + S:achievement.buildMFS=Just Too Much + S:achievement.buildMFS.desc=Build a MFS Unit + S:achievement.buildMacerator=Double Trouble + S:achievement.buildMacerator.desc=Build a macerator + S:achievement.buildMassFab=Energy To Matter + S:achievement.buildMassFab.desc=Build a Mass Fabricator + S:achievement.buildMiningLaser=Laser Time + S:achievement.buildMiningLaser.desc=Build a mining laser + S:achievement.buildQArmor=Hi-Tech Wonder + S:achievement.buildQArmor.desc=Build a piece of the quantum suit + S:achievement.buildTeleporter=Intradimensional Warp + S:achievement.buildTeleporter.desc=Build a Teleporter + S:achievement.buildTerraformer=Change The World + S:achievement.buildTerraformer.desc=Build a terraformer + S:achievement.compressUranium=Radioactivity + S:achievement.compressUranium.desc=Compress uranium into an uranium fuel ingot + S:achievement.dieFromOwnNuke=Crazy Ivan + S:achievement.dieFromOwnNuke.desc=Die from a nuke you have placed + S:achievement.killCreeperChainsaw=Creeper Chainsaw Massacre + S:achievement.killCreeperChainsaw.desc=Kill a creeper with a chainsaw + S:achievement.killDragonMiningLaser=Like A Boss + S:achievement.killDragonMiningLaser.desc=Kill the enderdragon with a mining laser + S:achievement.mineOre=New Ore Miner + S:achievement.mineOre.desc=Mine copper, tin or uranium + S:achievement.starveWithQHelmet=Forgot to Recharge + S:achievement.starveWithQHelmet.desc=Starve to death or drown with a quantum helmet + S:achievement.teleportFarAway=Far Far Away + S:achievement.teleportFarAway.desc=Teleport for at least 1 km + S:achievement.terraformEndCultivation=Endgame Paradise + S:achievement.terraformEndCultivation.desc=Terraform the End to look like the overworld + S:blockAdvMachine.name=Advanced Machine Block + S:blockBatBox.name=BatBox + S:blockCanner.name=Canning Machine + S:blockCompressor.name=Compressor + S:blockCropmatron.name=Crop-Matron + S:blockElecFurnace.name=Electric Furnace + S:blockElectrolyzer.name=Electrolyzer + S:blockExtractor.name=Extractor + S:blockGenerator.name=Generator + S:blockGeoGenerator.name=Geothermal Generator + S:blockInduction.name=Induction Furnace + S:blockIronFurnace.name=Iron Furnace + S:blockMFE.name=MFE + S:blockMFSU.name=MFSU + S:blockMacerator.name=Macerator + S:blockMachine.name=Machine Block + S:blockMagnetizer.name=Magnetizer + S:blockMatter.name=Mass Fabricator + S:blockMetalBronze.name=Bronze Block + S:blockMetalCopper.name=Copper Block + S:blockMetalTin.name=Tin Block + S:blockMetalUranium.name=Uranium Block + S:blockMiner.name=Miner + S:blockNuclearReactor.name=Nuclear Reactor + S:blockPersonalChest.name=Personal Safe + S:blockPersonalTrader.name=Trade-O-Mat + S:blockPersonalTraderEnergy.name=Energy-O-Mat + S:blockPump.name=Pump + S:blockRecycler.name=Recycler + S:blockSolarGenerator.name=Solar Panel + S:blockTeleporter.name=Teleporter + S:blockTerra.name=Terraformer + S:blockTesla.name=Tesla Coil + S:blockTransformerHV.name=HV-Transformer + S:blockTransformerLV.name=LV-Transformer + S:blockTransformerMV.name=MV-Transformer + S:blockWaterGenerator.name=Water Mill + S:blockWindGenerator.name=Wind Mill + S:container.electricBlock.level=Power Level: + S:container.electricBlock.output=Out: %1$s EU/t + S:container.induction.heat=Heat: + S:container.matter.amplifier=Amplifier: + S:container.matter.progress=Progress: + S:container.personalTrader.offer=Offer: + S:container.personalTrader.totalTrades0=Performed + S:container.personalTrader.totalTrades1=Trades: + S:container.personalTrader.want=Want: + S:container.personalTraderEnergy.energyBuffer=Buffer: + S:container.personalTraderEnergy.paidFor=Paid For: %1$s EU + S:debugItem.name=Debug Item + S:energyStorageUpgrade.name=Energy Storage Upgrade + S:item.cropSeedInvalid.name=Seed is missing data - bug? + S:item.cropSeedUn.name=Unknown Seeds + S:item.itemArmorAlloyChestplate.name=Composite Vest + S:item.itemArmorBatpack.name=BatPack + S:item.itemArmorBronzeBoots.name=Bronze Boots + S:item.itemArmorBronzeChestplate.name=Bronze Chestplate + S:item.itemArmorBronzeHelmet.name=Bronze Helmet + S:item.itemArmorBronzeLegs.name=Bronze Legs + S:item.itemArmorCFPack.name=CF Backpack + S:item.itemArmorHazmatChestplate.name=Hazmat Suit + S:item.itemArmorHazmatHelmet.name=Scuba Helmet + S:item.itemArmorHazmatLeggings.name=Hazmat Suit Leggings + S:item.itemArmorJetpack.name=Jetpack + S:item.itemArmorJetpackElectric.name=Electric Jetpack + S:item.itemArmorLappack.name=Lappack + S:item.itemArmorNanoBoots.name=NanoSuit Boots + S:item.itemArmorNanoChestplate.name=NanoSuit Bodyarmor + S:item.itemArmorNanoHelmet.name=NanoSuit Helmet + S:item.itemArmorNanoLegs.name=NanoSuit Leggings + S:item.itemArmorQuantumBoots.name=QuantumSuit Boots + S:item.itemArmorQuantumChestplate.name=QuantumSuit Bodyarmor + S:item.itemArmorQuantumHelmet.name=QuantumSuit Helmet + S:item.itemArmorQuantumLegs.name=QuantumSuit Leggings + S:item.itemArmorRubBoots.name=Rubber Boots + S:item.itemBatCrystal.name=Energy Crystal + S:item.itemBatLamaCrystal.name=Lapotron Crystal + S:item.itemBatRE.name=RE-Battery + S:item.itemBatSU.name=Single-Use Battery + S:item.itemCellAir.name=Compressed Air Cell + S:item.itemCellBio.name=Bio Cell + S:item.itemCellBioRef.name=Biofuel Cell + S:item.itemCellCoal.name=H. Coal Cell + S:item.itemCellCoalRef.name=Coalfuel Cell + S:item.itemCellEmpty.name=Empty Cell + S:item.itemCellHydrant.name=Hydration Cell + S:item.itemCellLava.name=Lava Cell + S:item.itemCellUranEmpty.name=Near-depleted Uranium Cell + S:item.itemCellUranEnriched.name=Re-Enriched Uranium Cell + S:item.itemCellWater.name=Water Cell + S:item.itemCellWaterElectro.name=Electrolyzed Water Cell + S:item.itemCoffeeBeans.name=Coffee Beans + S:item.itemCoffeePowder.name=Coffee Powder + S:item.itemCoin.name=Industrial Credit + S:item.itemCoolant.name=Coolant + S:item.itemCropnalyzer.name=Cropnalyzer + S:item.itemDoorAlloy.name=Reinforced Door + S:item.itemDustBronze.name=Bronze Dust + S:item.itemDustClay.name=Clay Dust + S:item.itemDustCoal.name=Coal Dust + S:item.itemDustCopper.name=Copper Dust + S:item.itemDustGold.name=Gold Dust + S:item.itemDustIron.name=Iron Dust + S:item.itemDustIronSmall.name=Small Pile of Iron Dust + S:item.itemDustSilver.name=Silver Dust + S:item.itemDustTin.name=Tin Dust + S:item.itemDynamite.name=Dynamite + S:item.itemDynamiteSticky.name=Sticky Dynamite + S:item.itemFertilizer.name=Fertilizer + S:item.itemFoamSprayer.name=CF Sprayer + S:item.itemFreq.name=Frequency Transmitter + S:item.itemFuelCan.name=Filled Fuel Can + S:item.itemFuelCanEmpty.name=(Empty) Fuel Can + S:item.itemFuelCoalCmpr.name=H. Coal + S:item.itemFuelCoalDust.name=Hydrated Coal Dust + S:item.itemFuelPlantBall.name=Plantball + S:item.itemFuelPlantCmpr.name=Compressed Plants + S:item.itemGrinPowder.name=Grin Powder + S:item.itemHarz.name=Sticky Resin + S:item.itemHops.name=Hops + S:item.itemIngotAdvIron.name=Refined Iron + S:item.itemIngotAlloy.name=Mixed Metal Ingot + S:item.itemIngotBronze.name=Bronze + S:item.itemIngotCopper.name=Copper + S:item.itemIngotTin.name=Tin + S:item.itemIngotUran.name=Refined Uranium + S:item.itemMatter.name=UU-Matter + S:item.itemMugCoffee0.name=Cold Coffee + S:item.itemMugCoffee1.name=Dark Coffee + S:item.itemMugCoffee2.name=Coffee + S:item.itemMugEmpty.name=Stone Mug + S:item.itemNanoSaber.name=Nano Saber + S:item.itemNightvisionGoggles.name=Nightvision Goggles + S:item.itemOreIridium.name=Iridium Ore + S:item.itemOreUran.name=Uranium Ore + S:item.itemPartAlloy.name=Advanced Alloy + S:item.itemPartCarbonFibre.name=Raw Carbon Fibre + S:item.itemPartCarbonMesh.name=Raw Carbon Mesh + S:item.itemPartCarbonPlate.name=Carbon Plate + S:item.itemPartCircuit.name=Electronic Circuit + S:item.itemPartCircuitAdv.name=Advanced Circuit + S:item.itemPartCoalBall.name=Coal Ball + S:item.itemPartCoalBlock.name=Compressed Coal Ball + S:item.itemPartCoalChunk.name=Coal Chunk + S:item.itemPartDCP.name=Dense Copper Plate + S:item.itemPartIndustrialDiamond.name=Industrial Diamond + S:item.itemPartIridium.name=Iridium Plate + S:item.itemPartPellet.name=CF Pellet + S:item.itemRemote.name=Dynamite-O-Mote + S:item.itemRubber.name=Rubber + S:item.itemScanner.name=OD Scanner + S:item.itemScannerAdv.name=OV Scanner + S:item.itemScrap.name=Scrap + S:item.itemScrapbox.name=Scrap Box + S:item.itemSolarHelmet.name=Solar Helmet + S:item.itemStaticBoots.name=Static Boots + S:item.itemTFBP.name=TFBP - Empty + S:item.itemTFBPChilling.name=TFBP - Chilling + S:item.itemTFBPCultivation.name=TFBP - Cultivation + S:item.itemTFBPDesertification.name=TFBP - Desertification + S:item.itemTFBPFlatification.name=TFBP - Flatification + S:item.itemTFBPIrrigation.name=TFBP - Irrigation + S:item.itemTFBPMushroom.name=TFBP - Mushroom + S:item.itemTerraWart.name=Terra Wart + S:item.itemTinCan.name=Tin Can + S:item.itemTinCanFilled.name=(Filled) Tin Can + S:item.itemToolBronzeAxe.name=Bronze Axe + S:item.itemToolBronzeHoe.name=Bronze Hoe + S:item.itemToolBronzePickaxe.name=Bronze Pickaxe + S:item.itemToolBronzeSpade.name=Bronze Shovel + S:item.itemToolBronzeSword.name=Bronze Sword + S:item.itemToolChainsaw.name=Chainsaw + S:item.itemToolCutter.name=Insulation Cutter + S:item.itemToolDDrill.name=Diamond Drill + S:item.itemToolDrill.name=Mining Drill + S:item.itemToolHoe.name=Electric Hoe + S:item.itemToolMeter.name=EU-Reader + S:item.itemToolMiningLaser.name=Mining Laser + S:item.itemToolPainter.name=Painter + S:item.itemToolWrench.name=Wrench + S:item.itemToolWrenchElectric.name=Electric Wrench + S:item.itemToolbox.name=Tool Box + S:item.itemTreetap.name=Treetap + S:item.itemTreetapElectric.name=Electric Treetap + S:item.itemWeedEx.name=Weed-EX + S:item.reactorCondensator.name=RSH-Condensator + S:item.reactorCondensatorLap.name=LZH-Condensator + S:item.reactorCoolantSimple.name=10k Coolant Cell + S:item.reactorCoolantSix.name=60k Coolant Cell + S:item.reactorCoolantTriple.name=30k Coolant Cell + S:item.reactorHeatSwitch.name=Heat Exchanger + S:item.reactorHeatSwitchCore.name=Reactor Heat Exchanger + S:item.reactorHeatSwitchDiamond.name=Advanced Heat Exchanger + S:item.reactorHeatSwitchSpread.name=Component Heat Exchanger + S:item.reactorHeatpack.name=Heating Cell + S:item.reactorIsotopeCell.name=Depleted Isotope Cell + S:item.reactorPlating.name=Reactor Plating + S:item.reactorPlatingExplosive.name=Containment Reactor Plating + S:item.reactorPlatingHeat.name=Heat-Capacity Reactor Plating + S:item.reactorReflector.name=Neutron Reflector + S:item.reactorReflectorThick.name=Thick Neutron Reflector + S:item.reactorUraniumDual.name=Dual Uranium Cell + S:item.reactorUraniumQuad.name=Quad Uranium Cell + S:item.reactorUraniumSimple.name=Uranium Cell + S:item.reactorVent.name=Heat Vent + S:item.reactorVentCore.name=Reactor Heat Vent + S:item.reactorVentDiamond.name=Advanced Heat Vent + S:item.reactorVentGold.name=Overclocked Heat Vent + S:item.reactorVentSpread.name=Component Heat Vent + S:itemCable.name=Copper Cable + S:itemCableO.name=Uninsulated Copper Cable + S:itemDetectorCable.name=EU-Detector Cable + S:itemGlassCable.name=Glass Fibre Cable + S:itemGoldCable.name=Gold Cable + S:itemGoldCableI.name=Insulated Gold Cable + S:itemGoldCableII.name=2xIns. Gold Cable + S:itemGroup.IC2=IndustrialCraft 2 + S:itemIronCable.name=HV Cable + S:itemIronCableI.name=Insulated HV Cable + S:itemIronCableII.name=2xIns. HV Cable + S:itemIronCableIIII.name=4xIns. HV Cable + S:itemSplitterCable.name=EU-Splitter Cable + S:itemTinCable.name=Ultra-Low-Current Cable + S:overclockerUpgrade.name=Overclocker Upgrade + S:potion.radiation=Radiation + S:tile.blockAlloy.name=Reinforced Stone + S:tile.blockAlloyGlass.name=Reinforced Glass + S:tile.blockCrop.name=Crop + S:tile.blockFenceIron.name=Iron Fence + S:tile.blockFoam.name=Construction Foam + S:tile.blockITNT.name=Industrial TNT + S:tile.blockIronScaffold.name=Iron Scaffold + S:tile.blockLuminator.name=Luminator + S:tile.blockLuminatorD.name=Luminator + S:tile.blockMiningPipe.name=Mining Pipe + S:tile.blockMiningTip.name=Mining Pipe + S:tile.blockNuke.name=Nuke + S:tile.blockOreCopper.name=Copper Ore + S:tile.blockOreTin.name=Tin Ore + S:tile.blockOreUran.name=Uranium Ore + S:tile.blockReactorChamber.name=Reactor Chamber + S:tile.blockRubSapling.name=Rubber Tree Sapling + S:tile.blockRubWood.name=Rubber Wood + S:tile.blockRubber.name=Rubber Sheet + S:tile.blockScaffold.name=Scaffold + S:transformerUpgrade.name=Transformer Upgrade +} + + diff --git a/Server/config/IC2NuclearControl.cfg b/Server/config/IC2NuclearControl.cfg new file mode 100644 index 0000000..1b46af6 --- /dev/null +++ b/Server/config/IC2NuclearControl.cfg @@ -0,0 +1,47 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:blockNuclearControlMain=192 +} + + +#################### +# general +#################### + +general { + I:SMPMaxAlarmRange=256 + I:alarmRange=64 + S:allowedAlarms=default,sci-fi + I:infoPanelRefreshPeriod=20 + I:maxAlarmRange=128 + I:rangeTriggerRefreshPeriod=20 + I:remoteThermalMonitorEnergyConsumption=1 + B:stat=true +} + + +#################### +# item +#################### + +item { + I:itemCounterSensorKit=31009 + I:itemCounterSensorLocationCard=31010 + I:itemEnergyArrayLocationCard=31008 + I:itemEnergySensorKit=31006 + I:itemEnergySensorLocationCard=31007 + I:itemRangeUpgrade=31004 + I:itemRemoteSensorKit=31002 + I:itemSensorLocationCard=31003 + I:itemTextCard=31011 + I:itemTimeCard=31005 + I:itemToolDigitalThermometer=31001 + I:itemToolThermometer=31000 +} + + diff --git a/Server/config/IC2NuclearControl.lang b/Server/config/IC2NuclearControl.lang new file mode 100644 index 0000000..782365e --- /dev/null +++ b/Server/config/IC2NuclearControl.lang @@ -0,0 +1,90 @@ +# Configuration file + +#################### +# locale.en.us +#################### + +locale.en.us { + S:item.ItemColorUpgrade.name=Color Upgrade + S:item.ItemCounterSensorKit.name=Counter Sensor Kit + S:item.ItemCounterSensorLocationCard.name=Counter Sensor Location Card + S:item.ItemEnergyArrayLocationCard.name=Energy Array Location Card + S:item.ItemEnergySensorKit.name=Energy Sensor Kit + S:item.ItemEnergySensorLocationCard.name=Energy Sensor Location Card + S:item.ItemLiquidSensorKit.name=Liquid Sensor Kit + S:item.ItemLiquidSensorLocationCard.name=Liquid Sensor Location Card + S:item.ItemRangeUpgrade.name=Range Upgrade + S:item.ItemRemoteSensorKit.name=Remote Sensor Kit + S:item.ItemSensorLocationCard.name=Reactor Sensor Location Card + S:item.ItemTextCard.name=Text Card + S:item.ItemTimeCard.name=Time Card + S:item.ItemToolDigitalThermometer.name=Digital Thermometer + S:item.ItemToolThermometer.name=Thermometer + S:msg.nc.AverageCounterPeriod=Period: %ssec + S:msg.nc.EnergyCardQuantity=Cards quantity: %d + S:msg.nc.HowlerAlarmSound=Sound + S:msg.nc.HowlerAlarmSoundRange=Sound range: %s + S:msg.nc.InfoPanelEnergy=Energy: %s + S:msg.nc.InfoPanelEnergyCounter=Energy: %sEU + S:msg.nc.InfoPanelEnergyFree=Free: %s + S:msg.nc.InfoPanelEnergyFreeN=#%d Free: %s + S:msg.nc.InfoPanelEnergyN=#%d Energy: %s + S:msg.nc.InfoPanelEnergyPercentage=Fill: %s%% + S:msg.nc.InfoPanelEnergyPercentageN=#%d Fill: %s%% + S:msg.nc.InfoPanelEnergyStorage=Storage: %s + S:msg.nc.InfoPanelEnergyStorageN=#%d Storage: %s + S:msg.nc.InfoPanelHeat=T: %s + S:msg.nc.InfoPanelInvalidCard=Invalid Card + S:msg.nc.InfoPanelLiquidAmount=Amount: %s + S:msg.nc.InfoPanelLiquidCapacity=Capacity: %s + S:msg.nc.InfoPanelLiquidFree=Free: %s + S:msg.nc.InfoPanelLiquidName=Name: %s + S:msg.nc.InfoPanelLiquidPercentage=Fill: %s%% + S:msg.nc.InfoPanelMaxHeat=MaxHeat: %s + S:msg.nc.InfoPanelMelting=Melting: %s + S:msg.nc.InfoPanelNoTarget=Target Not Found + S:msg.nc.InfoPanelOff=Off + S:msg.nc.InfoPanelOn=On + S:msg.nc.InfoPanelOutOfRange=Out Of Range + S:msg.nc.InfoPanelOutput=Output: %sEU/t + S:msg.nc.InfoPanelOutputSteam=Output: %smB/t + S:msg.nc.InfoPanelTime=Time: %s + S:msg.nc.InfoPanelTimeRemaining=Remaining: %s + S:msg.nc.None=N/A + S:msg.nc.Reset=Reset + S:msg.nc.ScreenColor=Screen Color + S:msg.nc.SensorKit=Remote Sensor mounted, Sensor Location Card received + S:msg.nc.TextColor=Text Color + S:msg.nc.ThermalMonitorSave=Save setting + S:msg.nc.ThermalMonitorSignalAt=Signal at %s heat + S:msg.nc.Thermo=Hull heat: %s + S:msg.nc.ThermoDigital=Hull heat: %s (Water evaporate: %s / melting: %s) + S:msg.nc.cbInfoPanelEnergyCurrent=Energy + S:msg.nc.cbInfoPanelEnergyEach=Each card info + S:msg.nc.cbInfoPanelEnergyFree=Free + S:msg.nc.cbInfoPanelEnergyPercentage=Fill percentage + S:msg.nc.cbInfoPanelEnergyStorage=Storage + S:msg.nc.cbInfoPanelEnergyTotal=Summary + S:msg.nc.cbInfoPanelHeat=Heat level + S:msg.nc.cbInfoPanelLiquidAmount=Amount + S:msg.nc.cbInfoPanelLiquidCapacity=Capacity + S:msg.nc.cbInfoPanelLiquidFree=Free + S:msg.nc.cbInfoPanelLiquidName=Liquid name + S:msg.nc.cbInfoPanelLiquidPercentage=Fill percentage + S:msg.nc.cbInfoPanelMaxHeat=Max heat + S:msg.nc.cbInfoPanelMelting=Melting temp + S:msg.nc.cbInfoPanelOnOff=On/Off status + S:msg.nc.cbInfoPanelOutput=Output (EU/t) + S:msg.nc.cbInfoPanelTimeRemaining=Time to cycle end + S:tile.blockAverageCounter.name=Average Counter + S:tile.blockEnergyCounter.name=Energy Counter + S:tile.blockHowlerAlarm.name=Howler Alarm + S:tile.blockIndustrialAlarm.name=Industrial Alarm + S:tile.blockInfoPanel.name=Industrial Information Panel + S:tile.blockInfoPanelExtender.name=Information Panel Extender + S:tile.blockRangeTrigger.name=Range Trigger + S:tile.blockRemoteThermo.name=Remote Thermal Monitor + S:tile.blockThermalMonitor.name=Thermal Monitor +} + + diff --git a/Server/config/InvTweaks.cfg b/Server/config/InvTweaks.cfg new file mode 100644 index 0000000..9eafce2 --- /dev/null +++ b/Server/config/InvTweaks.cfg @@ -0,0 +1,19 @@ +#Inventory Tweaks Configuration +#(Regarding shortcuts, all key names can be found at: http://www.lwjgl.org/javadoc/org/lwjgl/input/Keyboard.html) +#Sun Mar 03 19:35:00 PST 2013 +enableMiddleClick=true +showChestButtons=true +enableSortingOnPickup=false +enableAutoRefill=true +autoRefillBeforeBreak=false +enableSounds=true +enableShortcuts=true +enableAutoEquipArmor=false +keySortInventory=R +shortcutKeyAllItems=LCONTROL+LSHIFT, RCONTROL+RSHIFT +shortcutKeyEverything=SPACE +shortcutKeyOneItem=LCONTROL, RCONTROL +shortcutKeyToUpperSection=UP +shortcutKeyToLowerSection=DOWN +shortcutKeyDrop=LALT, RALT +version=1.44 diff --git a/Server/config/InvTweaksRules.txt b/Server/config/InvTweaksRules.txt new file mode 100644 index 0000000..5c9549f --- /dev/null +++ b/Server/config/InvTweaksRules.txt @@ -0,0 +1,35 @@ +|==============================================================| +| INVENTORY TWEAKS Mod - By Jimeo Wan (jimeo.wan at gmail.com) | +| Sorting rules and general configuration | +|==============================================================| + +====== [ SETTINGS ] ====== + +D LOCKED + +======== [ GETTING STARTED ] ======== + +# SORTING RULES +# Each line you type is a new constraint you add for sorting your inventory. +# After any change, just press the sorting key to reload the settings. Some examples: +# * "D1 sword" puts any sword in row D, column 1 (see grid below) +# * "A edibleFood" fills the A row with food +# * "1 ironPickaxe" fills the 1 column with an iron pickaxe +# * "A1-C4 blocks" fills the rectangle with any blocks +# * "D LOCKED" avoids items from the hotbar to move out of it when sorting + +# INVENTORY GRID +# 1 2 3 4 5 6 7 8 9 +# A [A1][A2][A3][A4][A5][A6][A7][A8][A9] +# B [B1][B2][B3][B4][B5][B6][B7][B8][B9] +# C [C1][C2][C3][C4][C5][C6][C7][C8][C9] +# +# D [D1][D2][D3][D4][D5][D6][D7][D8][D9] + +# AVAILABLE KEYWORDS +# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item +# is missing from the item tree (for example mod items), you can either add it +# or create a rule by ID. Examples: "D5 203", "D9 12345-13" + +# FULL DOCUMENTATION +# http://modding.kalam-alami.net/?invtweaks \ No newline at end of file diff --git a/Server/config/InvTweaksTree.txt b/Server/config/InvTweaksTree.txt new file mode 100644 index 0000000..4b6f565 --- /dev/null +++ b/Server/config/InvTweaksTree.txt @@ -0,0 +1,690 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/Server/config/IronChest.cfg b/Server/config/IronChest.cfg new file mode 100644 index 0000000..d80df28 --- /dev/null +++ b/Server/config/IronChest.cfg @@ -0,0 +1,38 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:ironChests=181 +} + + +#################### +# general +#################### + +general { + B:cacheRenderingInformation=true + B:ocelotsSitOnChests=true +} + + +#################### +# item +#################### + +item { + I:copperIronUpgrade=29505 + I:copperSilverUpgrade=29503 + I:diamondCrystalUpgrade=29506 + I:diamondObsidianUpgrade=19509 + I:goldDiamondUpgrade=29502 + I:ironGoldUpgrade=29501 + I:silverGoldUpgrade=29504 + I:woodCopperUpgrade=29508 + I:woodIronUpgrade=29507 +} + + diff --git a/Server/config/LogisticsPipes-LangDatabase.cfg b/Server/config/LogisticsPipes-LangDatabase.cfg new file mode 100644 index 0000000..e69de29 diff --git a/Server/config/LogisticsPipes.cfg b/Server/config/LogisticsPipes.cfg new file mode 100644 index 0000000..4b7fa66 --- /dev/null +++ b/Server/config/LogisticsPipes.cfg @@ -0,0 +1,180 @@ +# Configuration file + +#################### +# block +#################### + +block { + # The ID of the LogisticsPipes Sign + I:logisticsSignId=1100 + + # The ID of the LogisticsPipes Solid Block + I:logisticsSolidBlockId=1101 +} + + +#################### +# general +#################### + +general { + # The max. distance between a player and the HUD that get's shown in blocks. + I:HUDRenderDistance=15 + + # Diable the Replacement of the TileGenericPipe trough the LogisticsTileGenericPipe + B:TileReplaceDisabled=false + + # The maximum number of buildcraft pipes (including forks) between logistics pipes. This is an indicator of the maximum amount of nodes the recursion algorithm will visit before giving up. As it is possible to fork a pipe connection using standard BC pipes the algorithm will attempt to discover all available destinations through that pipe. Do note that the logistics system will not interfere with the operation of non-logistics pipes. So a forked pipe will usually be sup-optimal, but it is possible. A low value might reduce CPU usage, a high value will be able to handle more complex pipe setups. If you never fork your connection between the logistics pipes this has the same meaning as detectionLength and the lower of the two will be used + I:detectionCount=100 + + # The amount of time that passes between checks to see if it is still connected to its neighbours. A low value will mean that it will detect changes faster but use more CPU. A high value means detection takes longer, but CPU consumption is reduced. A value of 20 will check about every second + I:detectionFrequency=20 + + # The maximum shortest length between logistics pipes. This is an indicator on the maxim depth of the recursion algorithm to discover logistics neighbours. A low value might use less CPU, a high value will allow longer pipe sections + I:detectionLength=50 + + # Set the default configuration for the popup of the Orderer Gui. Should it be used? + B:displayPopup=true + + # Whether or not special particles will spawn. + B:enableParticleFX=true + + # Whether or not the Carpenter is required to craft Forestry related pipes/modules. + B:mandatoryCarpenterRecipes=true + + # Inverts the the mouse wheel scrolling for remote order number of items + B:ordererCountInvertWheel=false + + # Inverts the the mouse wheel scrolling for remote order pages + B:ordererPageInvertWheel=false + + # Diable the power usage trough LogisticsPipes + B:powerUsageDisabled=false + + # A Multiplyer for the power usage. + I:powerUsageMultiplyer=1 +} + + +#################### +# item +#################### + +item { + # The item id for the logistics system destination pipe + I:logisticDestination.id=6895 + + # The item id for the logistics system entrance pipe + I:logisticEntrance.id=6894 + + # The item id for the inventory system connector pipe + I:logisticInvSysCon.id=6893 + + # The item id for the logistics item card + I:logisticItemCard.id=6869 + + # The item id for the crafting sign creator + I:logisticsCraftingSignCreator.id=6900 + + # The item id for the disk + I:logisticsDisk.id=6870 + + # The item id for the Logistics HUD glasses + I:logisticsHUD.id=6868 + + # The item id for the Logistics item parts + I:logisticsHUDParts.id=6867 + + # The item id for the modules + I:logisticsModules.id=6871 + + # The item id for the network monitor + I:logisticsNetworkMonitor.id=6873 + + # The item id for the basic logistics pipe + I:logisticsPipe.id=6874 + + # The item id for the apiarist logistics analyser pipe + I:logisticsPipeApiaristAnalyser.id=6891 + + # The item id for the apiarist logistics sink pipe + I:logisticsPipeApiaristSink.id=6892 + + # The item id for the builder supplier pipe + I:logisticsPipeBuilderSupplier.id=6880 + + # The item id for the chassi1 + I:logisticsPipeChassi1.id=6881 + + # The item id for the chassi2 + I:logisticsPipeChassi2.id=6882 + + # The item id for the chassi3 + I:logisticsPipeChassi3.id=6883 + + # The item id for the chassi4 + I:logisticsPipeChassi4.id=6884 + + # The item id for the chassi5 + I:logisticsPipeChassi5.id=6885 + + # The item id for the crafting logistics pipe + I:logisticsPipeCrafting.id=6877 + + # The item id for the crafting logistics pipe MK2 + I:logisticsPipeCraftingMK2.id=6887 + + # The item id for the crafting logistics pipe MK3 + I:logisticsPipeCraftingMK3.id=6896 + + # The item id for the firewall logistics pipe + I:logisticsPipeFirewall.id=6897 + + # The item id for the liquid supplier pipe + I:logisticsPipeLiquidSupplier.id=6886 + + # The item id for the providing logistics pipe + I:logisticsPipeProvider.id=6876 + + # The item id for the provider logistics pipe MK2 + I:logisticsPipeProviderMK2.id=6890 + + # The item id for the remote orderer logistics pipe + I:logisticsPipeRemoteOrderer.id=6889 + + # The item id for the requesting logistics pipe + I:logisticsPipeRequester.id=6875 + + # The item id for the requesting logistics pipe MK2 + I:logisticsPipeRequesterMK2.id=6888 + + # The item id for the crafting satellite pipe + I:logisticsPipeSatellite.id=6878 + + # The item id for the supplier pipe + I:logisticsPipeSupplier.id=6879 + + # The item id for the remote orderer + I:logisticsRemoteOrderer.id=6872 + + # The item id for the upgrade manager + I:logisticsUpgradeManager.id=6865 + + # The item id for the upgrades + I:logisticsUpgrades.id=6866 +} + + +#################### +# multithread +#################### + +multithread { + # Number of routing table update Threads, 0 to disable. + I:count=4 + + # Priority of the multiThread Threads. 10 is highest, 5 normal, 1 lowest + I:priority=5 +} + + diff --git a/Server/config/MFReloaded.cfg b/Server/config/MFReloaded.cfg new file mode 100644 index 0000000..d4b7b6c --- /dev/null +++ b/Server/config/MFReloaded.cfg @@ -0,0 +1,157 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:ID.Bricks=3133 + I:ID.CargoRailDropoffBlock=3125 + I:ID.CargoRailPickupBlock=3126 + I:ID.ConveyorBlock=3121 + I:ID.MachineBlock=3120 + I:ID.MachineBlock1=3131 + I:ID.PassengerRailDropoffBlock=3127 + I:ID.PassengerRailPickupBlock=3128 + I:ID.Road=3132 + I:ID.RubberLeaves=3123 + I:ID.RubberSapling=3124 + I:ID.RubberWood=3122 + I:ID.StainedGlass=3129 + I:ID.StainedGlassPane=3130 +} + + +#################### +# general +#################### + +general { + # Set to false to disable animation of harvester, rancher, conveyor, etc. This may be required if using certain mods that affect rendering. + B:AnimateBlockFaces=true + + # If true, the Auto Enchanter will accept entire stacks of books. This is provided to prevent a crash with BuildCraft. This will allow many books to be enchanted at once - only enable this if you know what you're doing. + B:AutoEnchanter.EnableSafeMode=false + + # If false, conveyors will not grab non-item entities. Breaks conveyor mob grinders but makes them safe for golems, etc. + B:Conveyor.CaptureNonItems=true + + # If true, DSU can be built out of chests instead of ender pearls. Does nothing if the DSU recipe is disabled. + B:DSU.EnableCheaperRecipe=true + + # If true, the fertilizer will use bonemeal as well as MFR fertilizer. Provided for those who want a less work-intensive farm. + B:Fertilizer.EnableBonemeal=false + + # Set to false to disable machines placing items into chests adjacent to them + B:MachinesCanDropInChests=true + + # Set to false to disable the harvester's sound when a block is harvested. + B:PlaySounds=true + + # If true, roads will be slippery like ice. + B:Road.Slippery=true + + # When searching for players or dropoff locations, how far out to the sides (radius) to search + I:SearchDistance.PassengerRailMaxHorizontal=3 + + # When searching for players or dropoff locations, how far up to search + I:SearchDistance.PassengerRailMaxVertical=2 + + # How far upward to search for members of "stacking" blocks, like cactus and sugarcane + I:SearchDistance.StackingBlockMaxVertical=3 + + # When searching for parts of a tree, how far out to the sides (radius) to search + I:SearchDistance.TreeMaxHoriztonal=5 + + # When searching for parts of a tree, how far up to search + I:SearchDistance.TreeMaxVertical=15 + + # If true, allows vanilla glass panes to connect to MFR stained glass panes. + B:VanillaOverride.GlassPanes=true + + # If true, enables MFR unmelting ice as well as vanilla ice. + B:VanillaOverride.Ice=true + + # Whether or not to generate rubber trees during map generation + B:WorldGen.RubberTree=false + + # A comma-separated list of biomes to disallow rubber trees to spawn in. Overrides any other biomes added. + S:WorldGen.RubberTreeBiomeBlacklist= + + # A comma-separated list of biomes to allow rubber trees to spawn in. Does nothing if rubber tree worldgen is disabled. + S:WorldGen.RubberTreeBiomeWhitelist= +} + + +#################### +# item +#################### + +item { + I:ID.BioFuel=12009 + I:ID.BioFuelBucket=12010 + I:ID.BlankRecord=12006 + I:ID.CeramicDye=12005 + I:ID.FertilizerItem=11992 + I:ID.Hammer=11987 + I:ID.MachineBlock=12003 + I:ID.Milk=11988 + I:ID.MobEssence=11991 + I:ID.MobEssenceBucket=11998 + I:ID.PlasticSheet=11993 + I:ID.RawPlastic=11994 + I:ID.RawRubber=12002 + I:ID.RubberBar=11995 + I:ID.SafariNet=12004 + I:ID.SafariNetLauncher=12012 + I:ID.SafariNetSingleUse=12008 + I:ID.Sewage=11990 + I:ID.SewageBucket=11996 + I:ID.Sludge=11989 + I:ID.SludgeBucket=11997 + I:ID.SyringeEmpty=11999 + I:ID.SyringeGrowth=12001 + I:ID.SyringeHealth=12000 + I:ID.SyringeZombie=12007 + I:ID.Upgrade=12011 +} + + +#################### +# machineenables +#=================== +# Set to false to disable that machine's recipes. Machines will still work if gotten through other means. +#################### + +machineenables { + B:AutoEnchanter=true + B:AutoJukebox=true + B:AutoSpawner=true + B:BioFuelGenerator=true + B:BioReactor=true + B:BlockBreaker=true + B:Breeder=true + B:Chronotyper=true + B:Composter=true + B:DeepStorageUnit=true + B:Ejector=true + B:Fertilizer=true + B:Fisher=true + B:Harvester=true + B:ItemCollector=true + B:ItemRouter=true + B:LavaFabricator=true + B:LiquiCrafter=true + B:LiquidRouter=true + B:MobGrinder=true + B:OilFabricator=true + B:Planter=true + B:Rancher=true + B:Sewer=true + B:SludgeBoiler=true + B:Unifier=true + B:Vet=true + B:WeatherCollector=true +} + + diff --git a/Server/config/NEIServer.cfg b/Server/config/NEIServer.cfg new file mode 100644 index 0000000..b459d32 --- /dev/null +++ b/Server/config/NEIServer.cfg @@ -0,0 +1,29 @@ +#NEI Server Permissions +# Names are Comma (,) separated +# ALL, OP and NONE are special names + + +#List of players who can use these blocks. +#Anyone not listed here will not have these blocks appear in their item panel. +#format is {itemID}:{itemDamage} +#Eg. 12:5=CodeChicken, Friend1 +BannedBlocks +{ + 7:0=NONE +} + +#List of players who can use these features. +#Eg. time=CodeChicken, Friend1 +permissions +{ + creative=OP + delete=OP + enchant=OP + heal=OP + item=OP + magnet=OP + notify-item=CONSOLE, OP + rain=OP + save-state=OP + time=OP +} diff --git a/Server/config/NetherOres.cfg b/Server/config/NetherOres.cfg new file mode 100644 index 0000000..c6932d7 --- /dev/null +++ b/Server/config/NetherOres.cfg @@ -0,0 +1,121 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:ID.NetherOreBlock=3093 +} + + +#################### +# general +#################### + +general { + # If true, when NetherOres are mined, nearby pigmen become angry to the player. + B:AngryPigmenEnable=true + + # Set this to false to remove the TE Induction Smelter recipes (ie, nether iron ore -> 2x normal iron ore). + B:EnableInductionSmelterRecipes=true + + # Set this to false to remove the IC2 Macerator recipes (ie, nether iron ore -> 4x iron dust). + B:EnableMaceratorRecipes=true + + # Set this to false to remove the TE Pulvierzer recipes (ie, nether iron ore -> 4x iron dust). + B:EnablePulverizerRecipes=true + + # Set this to false to remove the standard furnace recipes (ie, nether iron ore -> normal iron ore). + B:EnableStandardFurnaceRecipes=true + + # NetherOre explosions can trigger more explosions if true. Does nothing if ExplosionEnable is false. + B:ExplosionChainReactEnable=true + I:ExplosionChances=3 + + # NetherOres have a chance to explode when mined if true. + B:ExplosionEnable=true + + # How powerful an explosion will be. Creepers are 3, TNT is 4, electrified creepers are 6. This affects both the ability of the explosion to punch through blocks as well as the blast radius. + I:ExplosionPower=2 + + # The likelyhood an adjacent netherore will turn into an armed ore when one is mined. Percent chance out of 1000 (lower is less likely). + I:ExplosionProbability=75 + + # If true, will spawn nether ores regardless of if a furnace or macerator recipe was found. If false, at least one of those two must be found to spawn the ore. + B:ForceOreSpawn=false +} + + +#################### +# worldgen +#################### + +worldgen { + I:oreCoalBlocksPerGroup=16 + I:oreCoalGroupsPerChunk=8 + I:oreCoalMaxY=128 + I:oreCoalMinY=1 + I:oreCopperBlocksPerGroup=8 + I:oreCopperGroupsPerChunk=8 + I:oreCopperMaxY=128 + I:oreCopperMinY=1 + I:oreDiamondBlocksPerGroup=3 + I:oreDiamondGroupsPerChunk=4 + I:oreDiamondMaxY=128 + I:oreDiamondMinY=1 + I:oreEmeraldBlocksPerGroup=2 + I:oreEmeraldGroupsPerChunk=3 + I:oreEmeraldMaxY=128 + I:oreEmeraldMinY=1 + I:oreGoldBlocksPerGroup=6 + I:oreGoldGroupsPerChunk=8 + I:oreGoldMaxY=128 + I:oreGoldMinY=1 + I:oreGreenSapphireBlocksPerGroup=3 + I:oreGreenSapphireGroupsPerChunk=6 + I:oreGreenSapphireMaxY=128 + I:oreGreenSapphireMinY=1 + I:oreIronBlocksPerGroup=8 + I:oreIronGroupsPerChunk=8 + I:oreIronMaxY=128 + I:oreIronMinY=1 + I:oreLapisBlocksPerGroup=6 + I:oreLapisGroupsPerChunk=6 + I:oreLapisMaxY=128 + I:oreLapisMinY=1 + I:oreLeadBlocksPerGroup=6 + I:oreLeadGroupsPerChunk=6 + I:oreLeadMaxY=128 + I:oreLeadMinY=1 + I:oreNikoliteBlocksPerGroup=4 + I:oreNikoliteGroupsPerChunk=8 + I:oreNikoliteMaxY=128 + I:oreNikoliteMinY=1 + I:oreRedstoneBlocksPerGroup=8 + I:oreRedstoneGroupsPerChunk=6 + I:oreRedstoneMaxY=128 + I:oreRedstoneMinY=1 + I:oreRubyBlocksPerGroup=3 + I:oreRubyGroupsPerChunk=6 + I:oreRubyMaxY=128 + I:oreRubyMinY=1 + I:oreSapphireBlocksPerGroup=3 + I:oreSapphireGroupsPerChunk=6 + I:oreSapphireMaxY=128 + I:oreSapphireMinY=1 + I:oreSilverBlocksPerGroup=4 + I:oreSilverGroupsPerChunk=6 + I:oreSilverMaxY=128 + I:oreSilverMinY=1 + I:oreTinBlocksPerGroup=8 + I:oreTinGroupsPerChunk=8 + I:oreTinMaxY=128 + I:oreTinMinY=1 + I:oreUraniumBlocksPerGroup=2 + I:oreUraniumGroupsPerChunk=3 + I:oreUraniumMaxY=128 + I:oreUraniumMinY=1 +} + + diff --git a/Server/config/OCS.cfg b/Server/config/OCS.cfg new file mode 100644 index 0000000..9a59164 --- /dev/null +++ b/Server/config/OCS.cfg @@ -0,0 +1,39 @@ +# Configuration file + +#################### +# block +#################### + +block { + # The block ID for the gauge block + I:gaugeBlockID=3892 + + # The block ID for the sensor block + I:sensorBlockID=3893 + I:sensorBlockRenderID=3891 +} + + +#################### +# general +#################### + +general { + # Turtle Peripheral Enabled + B:turtlePeripheralEnabled=true +} + + +#################### +# item +#################### + +item { + # The block ID for the sensor card + I:sensorCardID=7486 + + # The block ID for the generic item + I:sensorUpgradeID=7487 +} + + diff --git a/Server/config/PowerConverters.cfg b/Server/config/PowerConverters.cfg new file mode 100644 index 0000000..642dce2 --- /dev/null +++ b/Server/config/PowerConverters.cfg @@ -0,0 +1,34 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:ID.BlockBuildcraft=2851 + I:ID.BlockCommon=2850 + I:ID.BlockFactorization=2855 + I:ID.BlockIndustrialCraft=2852 + I:ID.BlockSteam=2853 + I:ID.BlockUniversalElectricty=2854 +} + + +#################### +# ratios +#################### + +ratios { + I:BuildCraftInternalEnergyPerEachInput=4375 + I:BuildCraftInternalEnergyPerEachOutput=4375 + I:FactorizationInternalEnergyPerEachInput=1458 + I:FactorizationInternalEnergyPerEachOutput=1458 + I:IndustrialCraftInternalEnergyPerEachInput=1800 + I:IndustrialCraftInternalEnergyPerEachOutput=1800 + I:SteamInternalEnergyPerEachInput=875 + I:SteamInternalEnergyPerEachOutput=875 + I:UniversalElectricityInternalEnergyPerEachInput=10 + I:UniversalElectricityInternalEnergyPerEachOutput=10 +} + + diff --git a/Server/config/PowerCrystalsCore.cfg b/Server/config/PowerCrystalsCore.cfg new file mode 100644 index 0000000..a6890b0 --- /dev/null +++ b/Server/config/PowerCrystalsCore.cfg @@ -0,0 +1,12 @@ +# Configuration file + +#################### +# general +#################### + +general { + # Set to false to disable update checks for all Power Crystals' mods. + B:EnableUpdateCheck=false +} + + diff --git a/Server/config/StevesCarts.cfg b/Server/config/StevesCarts.cfg new file mode 100644 index 0000000..3f5432e --- /dev/null +++ b/Server/config/StevesCarts.cfg @@ -0,0 +1,106 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:AdvancedDetector=544 + I:CargoManager=541 + I:CartAssembler=542 + I:Detector=547 + I:Distributor=546 + I:Junctionrail=543 + I:Toggler=545 + I:Upgrade=548 +} + + +#################### +# enabledmodules +#################### + +enabledmodules { + B:AdvancedControlSystem=true + B:AdvancedShooter=true + B:BasicDrill=true + B:BasicSolarEngine=true + B:BrakeHandle=true + B:BridgeBuilder=true + B:Cage=true + B:ChunkLoader=true + B:CleaningMachine=true + B:CoalEngine=true + B:Colorizer=true + B:CompactSolarEngine=true + B:CreativeEngine=true + B:Crop_NetherWart=true + B:DivineShield=true + B:DynamiteCarrier=true + B:EntityDetector_Animal=true + B:EntityDetector_Bat=true + B:EntityDetector_Monster=true + B:EntityDetector_Player=true + B:EntityDetector_Villager=true + B:ExtractingChests=true + B:ExtremeMelter=true + B:Farmer=true + B:Fertilizer=true + B:Fireworkdisplay=true + B:Freezer=true + B:FrontChest=true + B:GalgadorianDrill=true + B:GiftStorage=true + B:HardenedDrill=true + B:HeightController=true + B:Hydrator=true + B:InternalStorage=true + B:InvisibilityCore=true + B:IronDrill=true + B:LargeHydrator=true + B:LargeRailer=true + B:LiquidSensors=true + B:MechanicalPig=true + B:Melter=true + B:NoteSequencer=true + B:Projectile_Egg=true + B:Projectile_FireCharge=false + B:Projectile_Potion=true + B:Projectile_Snowball=true + B:Pumpkinchariot=true + B:Railer=true + B:ReinforcedHull=true + B:Seat=true + B:Shooter=true + B:SideChests=true + B:SolarEngine=true + B:StandardHull=true + B:TinyCoalEngine=true + B:TopChest=true + B:TorchPlacer=true + B:TrackRemover=true + B:WoodCutter=true + B:WoodenHull=true +} + + +#################### +# item +#################### + +item { + I:CartModule=31741 + I:ModularCart=31743 + I:ModuleComponents=31742 +} + + +#################### +# settings +#################### + +settings { + I:MaximumNumberOfDynamites=50 +} + + diff --git a/Server/config/TreeCapitator.cfg b/Server/config/TreeCapitator.cfg new file mode 100644 index 0000000..190e416 --- /dev/null +++ b/Server/config/TreeCapitator.cfg @@ -0,0 +1,859 @@ +# Configuration file + +#################### +# 1_third_party_configs +#=================== +# Third-Party config entries tell TreeCapitator how to find the block IDs from +# other mods' config files. These values are case-sensitive! +# +# Format: +# { +# S:modID= +# S:configPath= +# S:blockValues=:; : +# S:itemValues=:; : +# B:useShiftedItemID= (true/false) +# } +# +# Example: +# extrabiomesxl { +# S:modID=ExtrabiomesXL +# S:configPath=extrabiomes/extrabiomes.cfg +# S:blockValues=block:customlog.id; block:quarterlog0.id; block:quarterlog1.id; block:quarterlog2.id; block:quarterlog3.id; block:autumnleaves.id; block:greenleaves.id +# S:itemValues=items.world:axeRuby.id; items.world:axeGreenSapphire.id; items.world:axeSapphire.id +# B:useShiftedItemID=true +# } +# +# Once your third-party config entries are setup, you can use replacement +# tags in your tree, axe, and shears ID configs. Replacement tags are structured like this: +# +#################### + +1_third_party_configs { + #################### + # biomesoplenty + #################### + + biomesoplenty { + S:blockValues=block:Acacia Leaves ID; block:Acacia Log ID; block:Apple Leaves ID; block:Fruitless Apple Leaves ID; block:Bamboo ID; block:Bamboo Leaves ID; block:Cherry Log ID; block:Dark Leaves ID; block:Dark Log ID; block:Dying Leaves ID; block:Dead Log ID; block:Fir Leaves ID; block:Fir Log ID; block:Magic Log ID; block:Magic Leaves ID; block:Mangrove Leaves ID; block:Mangrove Log ID; block:Maple Leaves ID; block:Orange Autumn Leaves ID; block:Origin Leaves ID; block:Palm Leaves ID; block:Palm Log ID; block:Pink Cherry Leaves ID; block:Redwood Leaves ID; block:Redwood Log ID; block:White Cherry Leaves ID; block:Willow Leaves ID; block:Willow Log ID; block:Yellow Autumn Leaves ID + S:configPath=BiomesOPlenty.cfg + S:itemValues=item:Muddy Axe ID + S:modID=BiomesOPlenty + S:useShiftedItemID=true + } + + #################### + # thaumcraft + #################### + + thaumcraft { + S:blockValues=block:BlockMagicalLog; block:BlockMagicalLeaves + S:configPath=Thaumcraft.cfg + S:itemValues=item:Thaumaxe + S:modID=Thaumcraft + S:useShiftedItemID=true + } + + #################### + # mfreloaded + #################### + + mfreloaded { + S:blockValues=block:ID.RubberWood; block:ID.RubberLeaves; block:ID.RubberSapling + S:configPath=MFReloaded.cfg + S:modID=MFReloaded + } + + #################### + # divinerpg + #################### + + divinerpg { + S:blockValues=block:eucalyptus + S:configPath=DivineRPG.cfg + S:itemValues=item:Bedrock Axe; item:Crystal Axe; item:Realmite Axe; item:azuriteaxe; item:corruptedaxe; item:denseaxe; item:divineaxe; item:donatoraxe; item:energyaxe; item:mythrilaxe; item:plasmaaxe; item:serenityaxe; item:twilightaxe + S:modID=DivineRPG + S:useShiftedItemID=true + } + + #################### + # twilightforest + #################### + + twilightforest { + S:blockValues=block:Log; block:MagicLog; block:MagicLogSpecial; block:Leaves; block:MagicLeaves; block:Hedge + S:configPath=TwilightForest.cfg + S:itemValues=item:IronwoodAxe; item:SteeleafAxe; item:MinotaurAxe + S:modID=TwilightForest + S:useShiftedItemID=true + } + + #################### + # inficraft + #################### + + inficraft { + S:blockValues=block:Bloodwood Block; block:Flora Leaves; block:Redwood Block; block:Sakura Leaves; block:Wood Block + S:configPath=InfiCraft/FloraSoma.txt + S:modID=Flora Trees + } + + #################### + # zapapples + #################### + + zapapples { + S:blockValues=block:zapAppleLogID; block:zapAppleLeavesID; block:zapAppleFlowersID + S:configPath=ZapApples.cfg + S:modID=ZapApples + } + + #################### + # ic2 + #################### + + ic2 { + S:blockValues=block:blockRubWood; block:blockRubLeaves + S:configPath=IC2.cfg + S:itemValues=item:itemToolBronzeAxe; item:itemToolChainsaw + S:modID=IC2 + S:useShiftedItemID=true + } + + #################### + # extrabiomesxl + #################### + + extrabiomesxl { + S:blockValues=block:customlog.id; block:quarterlog0.id; block:quarterlog1.id; block:quarterlog2.id; block:quarterlog3.id; block:autumnleaves.id; block:greenleaves.id + S:configPath=extrabiomes/extrabiomes.cfg + S:modID=ExtrabiomesXL + } + + #################### + # forestry + #################### + + forestry { + S:blockValues=block:log1; block:log2; block:log3; block:log4; block:leaves + S:configPath=forestry/base.conf + S:modID=Forestry + } + + #################### + # redpower + #################### + + redpower { + S:blockValues=blocks.world:log.id; blocks.world:leaves.id + S:configPath=redpower/redpower.cfg + S:itemValues=items.world:axeRuby.id; items.world:axeGreenSapphire.id; items.world:axeSapphire.id + S:modID=RedPowerWorld + S:useShiftedItemID=true + } + +} + + +#################### +# 2_tree_definitions +#=================== +# Add the log and leaf block IDs for all trees you want to be able to chop down. +# Each section below represents a type of tree. Each list may contain block IDs +# and/or third-party config replacement tags. You can change it to be more or +# less granular as long as all sections follow the basic structure. Do not use +# spaces or periods in your section names. Otherwise you can call them anything +# you like. +# +# EACH LOG ID MAY ONLY APPEAR IN EXACTLY ONE SECTION. +# +# NOTE: Some mod trees use vanilla log blocks as well as custom blocks. If a tree +# contains more than 1 type of log, all logs must be included in the same section. +# Examples of this are the default entries for vanilla_ebxl_oaks and vanilla_ebxl_spruces. +# +# Simple Example (all logs and leaves are grouped in one section, no metadata is specified): +# trees { +# S:leaves=18; ; ; +# S:logs=17; ; ; ; ; ; ; ; ; +# } +# +# Advanced Example (each mod tree has its own section, metadata is included): +# vanilla_ebxl_oaks { +# S:leaves=18,0 +# S:logs=17,0; 17,4; 17,8; ,2; ,2; ,2;,2; +# } +# +# birches { +# S:leaves=18,2 +# S:logs=17,2; 17,6; 17,10 +# } +# +# vanilla_ebxl_spruces { +# S:leaves=18,1; +# S:logs=17,1; 17,5; 17,9 +# } +# +# jungle_trees { +# S:leaves=18,3 +# S:logs=17,3; 17,7; 17,11 +# } +# +# ic2_rubber { +# S:leaves= +# S:logs= +# } +# +# ebxl_acacia { +# S:leaves=,2 +# S:logs=,1 +# } +# +# ebxl_firs { +# S:leaves=,0 +# S:logs=,0; ,1; ,1; ,1; ,1 +# } +# +# ebxl_redwoods { +# S:leaves=,1 +# S:logs=,0; ,0; ,0; ,0 +# } +#################### + +2_tree_definitions { + #################### + # inficraft_sakura + #################### + + inficraft_sakura { + S:leaves=,0 + S:logs=, 1; , 5; , 9 + } + + #################### + # forestry_wenge + #################### + + forestry_wenge { + S:leaves=,0; ,8 + S:logs=,1; ,5; ,9 + } + + #################### + # biomesoplenty_bamboo + #################### + + biomesoplenty_bamboo { + S:leaves= + S:logs= + } + + #################### + # biomesoplenty_cherry + #################### + + biomesoplenty_cherry { + S:leaves=; + S:logs= + } + + #################### + # forestry_kapok + #################### + + forestry_kapok { + S:leaves=,0; ,8 + S:logs=,0; ,4; ,8 + } + + #################### + # thaum_silverwood + #################### + + thaum_silverwood { + S:leaves=,1 + S:logs=,1; ,5; ,9 + } + + #################### + # biomesoplenty_willow + #################### + + biomesoplenty_willow { + S:leaves= + S:logs= + } + + #################### + # biomesoplenty_magic + #################### + + biomesoplenty_magic { + S:leaves= + S:logs= + } + + #################### + # biomesoplenty_palm + #################### + + biomesoplenty_palm { + S:leaves= + S:logs= + } + + #################### + # forestry_teak + #################### + + forestry_teak { + S:leaves=,0; ,8 + S:logs=,1; ,5; ,9 + } + + #################### + # forestry_larch + #################### + + forestry_larch { + S:leaves=,0; ,8 + S:logs=,0; ,4; ,8 + } + + #################### + # forestry_mahogany + #################### + + forestry_mahogany { + S:leaves=,0; ,8 + S:logs=,2; ,6; ,10 + } + + #################### + # ebxl_acacia + #################### + + ebxl_acacia { + S:leaves=,2 + S:logs=,1 + } + + #################### + # ic2_rubber + #################### + + ic2_rubber { + S:leaves= + S:logs= + } + + #################### + # mfr_rubber + #################### + + mfr_rubber { + S:leaves= + S:logs= + } + + #################### + # forestry_cherry + #################### + + forestry_cherry { + S:leaves=,0; ,8 + S:logs=,3; ,7; ,11 + } + + #################### + # forestry_ebony + #################### + + forestry_ebony { + S:leaves=,0; ,8 + S:logs=,1; ,5; ,9 + } + + #################### + # biomesoplenty_redwood + #################### + + biomesoplenty_redwood { + S:leaves= + S:logs= + } + + #################### + # forestry_acacia + #################### + + forestry_acacia { + S:leaves=,0; ,8 + S:logs=,2; ,6; ,10 + } + + #################### + # twilight_mangrove + #################### + + twilight_mangrove { + S:leaves=, 1; ,9 + S:logs=,2; ,6; ,10; ,14 + } + + #################### + # zapapple + #################### + + zapapple { + S:leaves=; + S:logs= + } + + #################### + # huge_red_mushrooms + #################### + + huge_red_mushrooms { + S:leaves=100,1; 100,2; 100,3; 100,4; 100,5; 100,6; 100,7; 100,8; 100,9; 100,14 + S:logs=100,10; 100,15 + } + + #################### + # forestry_balsa + #################### + + forestry_balsa { + S:leaves=,0; ,8 + S:logs=,3; ,7; ,11 + } + + #################### + # huge_brown_mushrooms + #################### + + huge_brown_mushrooms { + S:leaves=99,1; 99,2; 99,3; 99,4; 99,5; 99,6; 99,7; 99,8; 99,9; 99,14 + S:logs=99,10; 99,15 + } + + #################### + # twilight_time + #################### + + twilight_time { + S:leaves=,0; ,8 + S:logs=,0; ,4; ,8; ,12 + } + + #################### + # biomesoplenty_dead + #################### + + biomesoplenty_dead { + S:logs= + } + + #################### + # vanilla_ebxl_spruces + #################### + + vanilla_ebxl_spruces { + S:leaves=18,1; + S:logs=17,1; 17,5; 17,9; 17,13 + } + + #################### + # biomesoplenty_acacia + #################### + + biomesoplenty_acacia { + S:leaves= + S:logs= + } + + #################### + # divinerpg_eucalyptus + #################### + + divinerpg_eucalyptus { + S:leaves=18 + S:logs= + } + + #################### + # twilight_canopy + #################### + + twilight_canopy { + S:leaves=, 1; ,9 + S:logs=,1; ,5; ,9; ,13 + } + + #################### + # forestry_boojum + #################### + + forestry_boojum { + S:leaves=,0; ,8 + S:logs=,2; ,6; ,10 + } + + #################### + # vanilla_bop_birches + #################### + + vanilla_bop_birches { + S:leaves=18,2; + S:logs=17,2; 17,6; 17,10; 17,14 + } + + #################### + # ebxl_redwoods + #################### + + ebxl_redwoods { + S:leaves=,1 + S:logs=,0; ,0; ,0; ,0 + } + + #################### + # forestry_sequoia + #################### + + forestry_sequoia { + S:leaves=,0; ,8 + S:logs=,3; ,7; ,11 + } + + #################### + # twilight_oaks + #################### + + twilight_oaks { + S:leaves=,0; ,3; ,8; ,11 + S:logs=,0; ,4; ,8; ,12 + } + + #################### + # vanilla_ebxl_bop_oaks + #################### + + vanilla_ebxl_bop_oaks { + S:leaves=18,0; ; ; ; ; ; ; + S:logs=17,0; 17,4; 17,8; 17,12; ,2; ,2; ,2; ,2; + } + + #################### + # jungle_trees + #################### + + jungle_trees { + S:leaves=18,3 + S:logs=17,3; 17,7; 17,11; 17,15 + } + + #################### + # inficraft_hopseed + #################### + + inficraft_hopseed { + S:leaves=,2 + S:logs=,3; , 7; , 11 + } + + #################### + # biomesoplenty_mangrove + #################### + + biomesoplenty_mangrove { + S:leaves= + S:logs= + } + + #################### + # ebxl_firs + #################### + + ebxl_firs { + S:leaves=,0 + S:logs=,0; ,1; ,1; ,1; ,1 + } + + #################### + # forestry_lime + #################### + + forestry_lime { + S:leaves=,0; ,8 + S:logs=,3; ,7; ,11 + } + + #################### + # forestry_chestnut + #################### + + forestry_chestnut { + S:leaves=,0; ,8 + S:logs=,0; ,4; ,8 + } + + #################### + # inficraft_redwood + #################### + + inficraft_redwood { + S:leaves=,0 + S:logs= + } + + #################### + # forestry_baobab + #################### + + forestry_baobab { + S:leaves=,0; ,8 + S:logs=,2; ,6; ,10 + } + + #################### + # forestry_walnut + #################### + + forestry_walnut { + S:leaves=,0; ,8 + S:logs=,1; ,5; ,9 + } + + #################### + # biomesoplenty_darkwood + #################### + + biomesoplenty_darkwood { + S:leaves=; + S:logs= + } + + #################### + # biomesoplenty_fir + #################### + + biomesoplenty_fir { + S:leaves= + S:logs= + } + + #################### + # thaum_greatwood + #################### + + thaum_greatwood { + S:leaves=,0; ,8 + S:logs=,0; ,4; ,8 + } + + #################### + # inficraft_bloodwood + #################### + + inficraft_bloodwood { + S:leaves=,2 + S:logs= + } + + #################### + # forestry_willow + #################### + + forestry_willow { + S:leaves=,0; ,8 + S:logs=,0; ,4; ,8 + } + + #################### + # twilight_darkwood + #################### + + twilight_darkwood { + S:leaves=,1 + S:logs=,3; ,7; ,11; ,15 + } + + #################### + # rp2_rubber + #################### + + rp2_rubber { + S:leaves= + S:logs= + } + + #################### + # inficraft_ghostwood + #################### + + inficraft_ghostwood { + S:leaves=,1 + S:logs=,2; , 6; , 10 + } + + #################### + # inficraft_eucalyptus + #################### + + inficraft_eucalyptus { + S:leaves=,1 + S:logs=,0; ,4; ,8 + } + +} + + +#################### +# block_settings +#################### + +block_settings { + # Incomplete - do not use [default: false] + B:allowGetRemoteTreeConfig=false + + # Automatically generated: + S:localTreeConfig=,3; ,7; ,11|,0; ,8 ! ! ,2; ,6; ,10|,0; ,8 ! ,1; ,5; ,9|,0; ,8 ! ,2; ,6; ,10|,0; ,8 ! ,0; ,4; ,8|,0; ,8 ! ,0; ,4; ,8|,0; ,8 ! , 1; , 5; , 9|,0 ! ,3; ,7; ,11|,0; ,8 ! ,3; ,7; ,11|,0; ,8 ! |18 ! ,2; , 6; , 10|,1 ! | ! | ! |; ! ,3; , 7; , 11|,2 ! | ! ,2; ,6; ,10|,0; ,8 ! ,1; ,5; ,9|,1 ! |; ! ,1; ,5; ,9|,0; ,8 ! 17,3; 17,7; 17,11; 17,15|18,3 ! 17,1; 17,5; 17,9; 17,13|18,1; ! ,0; ,4; ,8|,0; ,8 ! ,1; ,5; ,9|,0; ,8 ! | ! 17,0; 17,4; 17,8; 17,12; ,2; ,2; ,2; ,2;|18,0; ; ; ; ; ; ; ! | ! ,3; ,7; ,11; ,15|,1 ! | ! ,1; ,5; ,9; ,13|, 1; ,9 ! |,2 ! |; ! ,2; ,6; ,10; ,14|, 1; ,9 ! | ! ,0; ,4; ,8|,1 ! ,0; ,4; ,8; ,12|,0; ,3; ,8; ,11 ! ,0; ,4; ,8|,0; ,8 ! |,0 ! | ! ,3; ,7; ,11|,0; ,8 ! ,0; ,4; ,8|,0; ,8 ! ,0; ,1; ,1; ,1; ,1|,0 ! | ! | ! 100,10; 100,15|100,1; 100,2; 100,3; 100,4; 100,5; 100,6; 100,7; 100,8; 100,9; 100,14 ! ,1; ,5; ,9|,0; ,8 ! 99,10; 99,15|99,1; 99,2; 99,3; 99,4; 99,5; 99,6; 99,7; 99,8; 99,9; 99,14 ! 17,2; 17,6; 17,10; 17,14|18,2; ! | ! ,2; ,6; ,10|,0; ,8 ! ,0; ,4; ,8; ,12|,0; ,8 ! ,1|,2 ! ,0; ,0; ,0; ,0|,1 + + # The hardness of logs for when you are using items that can chop down trees. [range: 0.0 ~ 100.0, default: 4.0] + S:logHardnessModified=4.0 + + # The hardness of logs for when you are using items that won't chop down the trees. [range: 0.0 ~ 100.0, default: 2.0] + S:logHardnessNormal=2.0 + + # Incomplete - do not use [default: http://dl.dropbox.com/u/20748481/Minecraft/1.4.6/treeCapitatorTreeConfig.txt] + S:remoteTreeConfigURL=http://dl.dropbox.com/u/20748481/Minecraft/1.4.6/treeCapitatorTreeConfig.txt + + # Incomplete - do not use [default: false] + B:useRemoteTreeConfig=false + + # Set to true if you want only the leaf blocks listed with each log in blockIDList + # to break when that log type is chopped. When set to false it will break + # any leaf type within range of the tree, not just the type for that tree. [default: false] + B:useStrictBlockPairing=false +} + + +#################### +# id_resolver_settings +#=================== +# If you are not using ID Resolver, you can safely ignore this section. +# If you ARE using ID Resolver and your log file does not show any warnings +# pertaining to ID Resolver, you can still ignore this section. In fact, the +# only reason you should mess with this section if ShaRose decides to change +# the Mod ID for ID Resolver. +#################### + +id_resolver_settings { + # The mod ID value for ID Resolver. [default: IDResolver] + S:idResolverModID=IDResolver +} + + +#################### +# item_settings +#################### + +item_settings { + # Enable to cause item damage based on number of blocks destroyed [default: true] + B:allowItemDamage=true + + # Enable to allow chopping down the entire tree even if your item does not have enough damage remaining to cover the number of blocks. [default: false] + B:allowMoreBlocksThanDamage=false + + # IDs of items that can chop down trees. Use ',' to split item id from metadata and ';' to split items. [default: 271; 275; 258; 286; 279; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ] + S:axeIDList=271; 275; 258; 286; 279; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; ; + + # When useIncreasingItemDamage=true the damage applied per block broken will increase by this amount every increaseDamageEveryXBlocks blocks broken in a tree. [range: 0.1 ~ 100.0, default: 1.0] + S:damageIncreaseAmount=1.0 + + # Axes and shears will take damage this many times for each log broken. + # Remaining damage is rounded and applied to tools when a tree is finished. [range: 0.1 ~ 50.0, default: 1.0] + S:damageMultiplier=1.0 + + # When useIncreasingItemDamage=true the damage applied per block broken will increase each time this many blocks are broken in a tree. [range: 1 ~ 500, default: 15] + I:increaseDamageEveryXBlocks=15 + + # Whether you need an item from the axeIDList to chop down a tree. Disabling will let you chop trees with any item. [default: true] + B:needItem=true + + # IDs of items that when placed in the hotbar will allow leaves to be sheared when shearLeaves is true. + # Use ',' to split item id from metadata and ';' to split items. [default: 359] + S:shearIDList=359 + + # Set to true to have the per-block item damage amount increase after every increaseDamageEveryXBlocks blocks are broken. [default: false] + B:useIncreasingItemDamage=false +} + + +#################### +# leaf_and_vine_settings +#################### + +leaf_and_vine_settings { + # Enabling this will make leaves be destroyed when trees are chopped. [default: true] + B:destroyLeaves=true + + # When true TreeCapitator will only instantly decay leaves that have actually been marked for decay. + # Set to false if you want leaves to be destroyed regardless of their decay status (hint: or for "leaf" blocks that are not really leaves). [default: true] + B:requireLeafDecayCheck=true + + # Enabling this will cause destroyed leaves to be sheared when a shearing item is in the hotbar (ignored if destroyLeaves is false). [default: false] + B:shearLeaves=false + + # Enabling this will shear /some/ of the vines on a tree when a shearing item is in the hotbar (ignored if destroyLeaves is false). [default: false] + B:shearVines=false +} + + +#################### +# miscellaneous_settings +#################### + +miscellaneous_settings { + # Set to true if you want TreeCapitator to log info about what it's doing, false to disable [default: false] + B:allowDebugLogging=false + + # Set to true if you want TreeCapitator to tell you what kind of block you have clicked when sneaking, false to disable. [default: false] + B:allowDebugOutput=false + + # Set to false to disable TreeCapitator Smart Tree Detection. + # Smart Tree Detection counts the number of leaf blocks that are adjacent to the + # top-most connected log block at the x, z location of a log you've broken. If + # there are at least minLeavesToID leaf blocks within maxLeafIDDist blocks then + # TreeCapitator considers it a tree and allows chopping. + # WARNING: Disabling Smart Tree Detection will remove the only safeguard against + # accidentally destroying a log structure. Make sure you know what you're doing! [default: true] + B:allowSmartTreeDetection=true + B:allowUpdateCheck=false + + # Flag to disable drops in Creative mode [default: false] + B:disableCreativeDrops=false + + # Flag to disable tree chopping in Creative mode [default: false] + B:disableInCreative=false + + # The maximum horizontal distance that the log breaking effect will travel (use -1 for no limit). [range: -1 ~ 100, default: 16] + I:maxBreakDistance=16 + + # If a tree's top log is not close enough to leaf blocks, the tree will not be chopped. + # Increasing this value will search further. I would try to keep it below 3. [range: 1 ~ 8, default: 1] + I:maxLeafIDDist=1 + + # The minimum number of leaves within maxLeafIDDist of the top log block required to identify a tree. [range: 0 ~ 8, default: 3] + I:minLeavesToID=3 + + # Setting this to false will allow the chopping to move downward as well as upward (and blocks below the one you break will be chopped) [default: true] + B:onlyDestroyUpwards=true + + # Set sneakAction = "disable" to disable tree chopping while sneaking, + # set sneakAction = "enable" to only enable tree chopping while sneaking, + # set sneakAction = "none" to have tree chopping enabled regardless of sneaking. [default: disable] + S:sneakAction=disable +} + + diff --git a/Server/config/WirelessRedstone.cfg b/Server/config/WirelessRedstone.cfg new file mode 100644 index 0000000..556a22a --- /dev/null +++ b/Server/config/WirelessRedstone.cfg @@ -0,0 +1,71 @@ +#Wireless Redstone Chicken Bones Edition Configuration File +#Deleting any element will restore it to it's default value +#Block ID's will be automatically generated the first time it's run + + +#RedPower Logic Wireless Integration. +rpwireless +{ + block.id=238 +} + +core +{ + boltEffect + { + #Damages are in half hearts + #If an entity gets knocked into another bolt it may suffer multiple hits + damage.entity=5 + damage.player=3 + } + item + { + blazeRecieverDish.id=6156 + blazeTransceiver.id=6154 + obsidianStick.id=6150 + recieverDish.id=6155 + retherPearl.id=6152 + stoneBowl.id=6151 + wirelessTransceiver.id=6153 + } + jammer + { + #Delay in seconds before jamming the first time + blockdelay=10 + entitydelay=5 + #Jam an entity again after x seconds + entityretry=10 + #Range In Blocks + range=10 + #Timeout In Seconds + #Applies to both blocks and players + timeout=60 + } +} + +addon +{ + item.rep.useFullName=false + private-sniffer.id=6107 + remote.id=6102 + rep.id=6106 + sniffer.id=6103 + sniffer.gui + { + border.jammed=ff505050 + border.off=ff500000 + border.on=ffee0000 + border.private.off=ff209000 + border.private.on=ff20e000 + colour.jammed=ff707070 + colour.off=ff700000 + #Colours are in 0xAARRGGBB format + #Alpha should be FF + colour.on=ffff0000 + colour.private.off=ff40a000 + colour.private.on=ff40f000 + } + tracker.id=6105 + triangulator.id=6101 + wirelessMap.id=6104 +} diff --git a/Server/config/buildcraft/main.conf b/Server/config/buildcraft/main.conf new file mode 100644 index 0000000..01f3114 --- /dev/null +++ b/Server/config/buildcraft/main.conf @@ -0,0 +1,140 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:architect.id=158 + I:assemblyTable.id=170 + I:autoWorkbench.id=152 + I:blueprintLibrary.id=168 + I:builder.id=157 + I:drill.id=151 + I:engine.id=161 + I:filler.id=155 + I:frame.id=160 + I:hopper.id=172 + I:laser.id=169 + I:marker.id=154 + I:miningWell.id=150 + I:oilMoving.id=162 + I:oilStill.id=163 + I:pathMarker.id=171 + I:pipe.id=166 + I:pump.id=164 + I:quarry.id=153 + I:refinery.id=167 + I:springBlock.id=1522 + I:tank.id=165 + S:woodenPipe.item.exclusion= + S:woodenPipe.liquid.exclusion= +} + + +#################### +# """"""block savers"""""" +#################### + +"""""""block savers""""""" { + B:hopper.disabled=false +} + + +#################### +# general +#################### + +general { + # set to true for allowing machines to be driven by continuous current + B:current.continuous=false + + # set to false to prevent fillers from dropping blocks. + B:dropBrokenBlocks=true + + # If true, Filler will destroy blocks instead of breaking them. + B:filler.destroy=false + + # the lifespan in ticks of items dropped on the ground by pipes and machines, vanilla = 6000, default = 1200 + I:itemLifespan=1200 + B:mining.enabled=true + + # set to false if BuildCraft should not generate custom blocks (e.g. oil) + B:modifyWorld=true + + # delay between full client sync packets, increasing it saves bandwidth, decreasing makes for better client syncronization. + I:network.stateRefreshPeriod=40 + + # increasing this number will decrease network update frequency, useful for overloaded servers + I:network.updateFactor=10 + + # set to false to deactivate pipe connection rules, true by default + B:pipes.alwaysConnect=false + + # How long a pipe will take to break + D:pipes.durability=0.25 + + # when reaching this amount of objects in a pipes, items will be automatically grouped + I:pipes.groupItemsTrigger=32 + + # pipes containing more than this amount of items will explode, not dropping any item + I:pipes.maxItems=100 + S:power.framework=buildcraft.energy.PneumaticPowerFramework + + # Set to false to turn off energy loss over distance on all power pipes + B:power.usePipeLoss=true + B:trackNetworkUsage=false + B:version=3.4.3 +} + + +#################### +# item +#################### + +item { + I:bluePipeWire.id=3814 + I:blueprintItem.id=3818 + I:bucketFuel.id=3810 + I:bucketOil.id=3807 + I:diamondGearItem.id=3804 + I:fuel.id=3808 + I:goldenGearItem.id=3803 + I:greenPipeWire.id=3815 + I:ironGearItem.id=3802 + I:pipeFacade.id=4080 + I:pipeGate.id=3811 + I:pipeGateAutarchic.id=3812 + I:pipeItemsCobblestone.id=4051 + I:pipeItemsDiamond.id=4055 + I:pipeItemsEmerald.id=19167 + I:pipeItemsGold.id=4054 + I:pipeItemsIron.id=4053 + I:pipeItemsObsidian.id=4056 + I:pipeItemsSandstone.id=4071 + I:pipeItemsStone.id=4052 + I:pipeItemsVoid.id=4069 + I:pipeItemsWood.id=4050 + I:pipeLiquidsCobblestone.id=4058 + I:pipeLiquidsEmerald.id=19187 + I:pipeLiquidsGold.id=4061 + I:pipeLiquidsIron.id=4060 + I:pipeLiquidsSandstone.id=4073 + I:pipeLiquidsStone.id=4059 + I:pipeLiquidsVoid.id=4070 + I:pipeLiquidsWood.id=4057 + I:pipePowerGold.id=4068 + I:pipePowerStone.id=4066 + I:pipePowerWood.id=4064 + I:pipeStructureCobblestone.id=4072 + I:pipeWaterproof.id=3809 + I:redPipeWire.id=3813 + I:redstoneChipset.id=3817 + I:stoneGearItem.id=3801 + I:templateItem.id=3805 + I:woodenGearItem.id=3800 + I:wrench.id=3806 + I:yellowPipeWire.id=3816 +} + + diff --git a/Server/config/cofh/lexicon.whitelist b/Server/config/cofh/lexicon.whitelist new file mode 100644 index 0000000..7a6f728 --- /dev/null +++ b/Server/config/cofh/lexicon.whitelist @@ -0,0 +1,60 @@ +dustBrass +dustBronze +dustClay +dustCoal +dustCopper +dustElectrum +dustGold +dustInvar +dustIron +dustLead +dustNickel +dustNikolite +dustObsidian +dustPlatinum +dustSilver +dustSulfur +dustTin +ingotBrass +ingotBronze +ingotCopper +ingotElectrum +ingotGold +ingotInvar +ingotIron +ingotLead +ingotNickel +ingotPlatinum +ingotRefinedIron +ingotSilver +ingotTin +ingotUranium +oreCopper +oreGold +oreGreenSapphire +oreIron +oreLead +oreNetherCoal +oreNetherCopper +oreNetherDiamond +oreNetherEmerald +oreNetherGold +oreNetherGreenSapphire +oreNetherIron +oreNetherLapis +oreNetherLead +oreNetherNikolite +oreNetherRedstone +oreNetherRuby +oreNetherSapphire +oreNetherSilver +oreNetherTin +oreNetherUranium +oreNickel +oreNikolite +oreRuby +oreSapphire +oreSilver +oreTin +oreTungsten +oreUranium diff --git a/Server/config/cofh/omnitools.cfg b/Server/config/cofh/omnitools.cfg new file mode 100644 index 0000000..6a56c5d --- /dev/null +++ b/Server/config/cofh/omnitools.cfg @@ -0,0 +1,55 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:block.plinth=2101 + I:block.utility=2101 + #################### + # feature + #################### + + feature { + B:lexicon.enable=true + B:plinth.enable=true + } + +} + + +#################### +# general +#################### + +general { + # This will generate a default List file depending on your list setting. This file will ONLY generate if it does not exist. + B:lexicon.generateDefaultList=true + + # If this setting is changed to false, a Blacklist model will instead be enforced. + B:lexicon.whitelist=true + S:version=3.0.4.0 +} + + +#################### +# item +#################### + +item { + I:item.artifact=21002 + I:item.wrench=21001 + #################### + # feature + #################### + + feature { + B:lexicon.enable=true + B:wrench.enable=true + B:wrench.logic2=false + } + +} + + diff --git a/Server/config/cofh/omnitools.ignore b/Server/config/cofh/omnitools.ignore new file mode 100644 index 0000000..e69de29 diff --git a/Server/config/cofh/thermalexpansion.cfg b/Server/config/cofh/thermalexpansion.cfg new file mode 100644 index 0000000..7e75986 --- /dev/null +++ b/Server/config/cofh/thermalexpansion.cfg @@ -0,0 +1,202 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:block.core.ore=2001 + I:block.energy.engine=2004 + I:block.energy.storage=2005 + I:block.factory.glass=2008 + I:block.factory.machine=2002 + I:block.factory.rockwool=2009 + I:block.factory.tank=2003 + I:block.transport.conduit=2006 + I:block.transport.teleport=2007 + #################### + # feature + #################### + + feature { + B:energy.engine.magmatic=true + B:energy.engine.steam=true + B:energy.storage.cell=true + B:factory.machine.crucible=true + B:factory.machine.furnace=true + B:factory.machine.iceGen=true + B:factory.machine.pulverizer=true + B:factory.machine.rockGen=true + B:factory.machine.sawmill=true + B:factory.machine.smelter=true + B:factory.machine.transposer=true + B:factory.machine.waterGen=true + B:factory.tank.portable=true + B:transport.conduit.energy=true + B:transport.conduit.liquid=true + B:transport.teleport.energy=true + B:transport.teleport.items=true + B:transport.teleport.liquid=true + } + +} + + +#################### +# general +#################### + +general { + B:graphics.colorblind=false + B:graphics.slotborders=true + B:tabs.info=true + B:tabs.tutorial=true + B:update.notifications=false + S:version=2.2.2.2 +} + + +#################### +# item +#################### + +item { + I:item.core.component=20004 + I:item.core.liquid=20006 + I:item.core.material=20005 + I:item.core.painter=20002 + I:item.core.wrench=20001 + I:item.factory.factory=20007 + I:item.transport.multimeter=20003 + #################### + # feature + #################### + + feature { + B:wrench.logDismantle=false + } + +} + + +#################### +# triggers +#################### + +triggers { + I:containsEnergy=902 + I:fullEnergy=904 + I:hasInputs=907 + I:hasOutputs=905 + I:noEnergy=901 + I:noInputs=908 + I:noOutputs=906 + I:spaceForEnergy=903 +} + + +#################### +# tweak +#################### + +tweak { + I:core.lava.mj=20000 + B:factory.crafting.machineFrame.useSteel=false + B:factory.crafting.machines.useGears=false + B:factory.crafting.pulverizer.addDiamonds=false + B:factory.crafting.smelter.addDiamonds=false + I:factory.crucible.netherrack.energy=12000 + B:factory.pulverizer.recipe.IngotsToDust=true + B:factory.pulverizer.recipe.blazerod=true + B:factory.pulverizer.recipe.bone=true + B:factory.pulverizer.recipe.netherrack=true + B:factory.pulverizer.recipe.reed=true + B:factory.pulverizer.recipe.sandstone=true + B:factory.pulverizer.recipe.wool=false + I:factory.rockGen.cobblestone.lava=0 + I:factory.rockGen.cobblestone.water=0 + I:factory.rockGen.obsidian.lava=1000 + I:factory.rockGen.obsidian.water=1000 + I:factory.rockGen.stone.lava=2 + I:factory.rockGen.stone.water=1000 + I:factory.waterGen.rate=25 + B:plugins.turtlesCanBreakBlocks=false + I:transport.conduit.energy.loss=5 + I:transport.teleport.energy.loss=25 + I:transport.teleport.energy.maxTransfer=100 + #################### + # recipehandlers + #################### + + recipehandlers { + B:factory.crucible.override=true + B:factory.furnace.override=false + B:factory.pulverizer.override=false + B:factory.sawmill.override=false + B:factory.smelter.override=false + B:factory.transposer.override=false + } + +} + + +#################### +# world +#################### + +world { + #################### + # feature + #################### + + feature { + B:ore.copper=true + B:ore.ferrous=true + B:ore.lead=true + B:ore.silver=true + B:ore.tin=true + B:vanilla.augment=true + } + + #################### + # tweak + #################### + + tweak { + I:ore.copper.clusterSize=9 + I:ore.copper.maxY=75 + I:ore.copper.minY=40 + I:ore.copper.numClusters=10 + I:ore.ferrous.clusterSize=4 + I:ore.ferrous.maxY=20 + I:ore.ferrous.minY=5 + I:ore.ferrous.numClusters=2 + I:ore.lead.clusterSize=7 + I:ore.lead.maxY=40 + I:ore.lead.minY=20 + I:ore.lead.numClusters=4 + I:ore.silver.clusterSize=9 + I:ore.silver.maxY=35 + I:ore.silver.minY=15 + I:ore.silver.numClusters=4 + I:ore.tin.clusterSize=9 + I:ore.tin.maxY=50 + I:ore.tin.minY=25 + I:ore.tin.numClusters=8 + I:vanilla.augment.coal.clusterSize=0 + I:vanilla.augment.coal.numClusters=0 + I:vanilla.augment.diamond.clusterSize=5 + I:vanilla.augment.diamond.numClusters=2 + I:vanilla.augment.gold.clusterSize=10 + I:vanilla.augment.gold.numClusters=2 + I:vanilla.augment.iron.clusterSize=11 + I:vanilla.augment.iron.numClusters=3 + I:vanilla.augment.lapis.clusterSize=0 + I:vanilla.augment.lapis.numClusters=0 + I:vanilla.augment.redstone.clusterSize=0 + I:vanilla.augment.redstone.numClusters=0 + } + +} + + diff --git a/Server/config/factorization.cfg b/Server/config/factorization.cfg new file mode 100644 index 0000000..6222948 --- /dev/null +++ b/Server/config/factorization.cfg @@ -0,0 +1,141 @@ +# Configuration file + +#################### +# block +#################### + +block { + # Factorization Machines. + I:factoryBlockId=2050 + + # WrathFire and invisible lamp-air made by WrathLamps + I:lightAirBlockId=2051 + + # Ores and metal blocks mostly + I:resourceBlockId=2052 +} + + +#################### +# client +#################### + +client { + B:allowUnpureCommands=true + B:anywhereBagSwap=true + B:anywherePocketCraft=true + B:debugLightAir=false + B:notifyInChat=false + S:pocketCraftingActionKeys=xcb + B:renderAmbientOcclusion=true + B:renderBarrelClose=false + B:renderBarrelItem=true + B:renderBarrelText=true + B:renderOtherTileEntities=true +} + + +#################### +# dimensionslices +#################### + +dimensionslices { + # work in progress; may be unstable + B:enableDimensionSlices=false +} + + +#################### +# general +#################### + +general { + B:addBranding=true + B:enableDimensionSlices=false + I:entityRelightTask=3 + + # This disables silver ore generation + B:generateSilverOre=false + + # The size of silver ore nodes. Between 5 & 35. Default is 25 + I:silverOreNodeSize=25 + I:sliceDimensionID=-7 +} + + +#################### +# item +#################### + +item { + I:acid=19024 + I:angularSaw=19042 + I:bagOfHolding=19001 + I:barrelEnlarge=19032 + I:battery=19033 + I:chargemeter=19029 + I:coil=19026 + I:darkIron=19008 + I:diamondCuttingHead=19038 + I:diamondShard=19006 + I:fan=19028 + I:heatHole=19046 + I:inverium=19040 + I:itemCraftId=19000 + I:leadIngot=19014 + I:logicMatrix=19044 + I:logicMatrixID=19045 + I:logicMatrixProgrammer=19043 + I:magnet=19025 + I:mechaBouyantBarrel=19021 + I:mechaChasis=19009 + I:mechaChest=19011 + I:mechaCobbleDrive=19022 + I:mechaFoot=19013 + I:mechaHead=19010 + I:mechaLeg=19012 + I:mechaMountedPiston=19023 + I:mechaSpring=19047 + I:mirror=19030 + I:motor=19027 + I:netherPowder=19003 + I:oreCleanGravel=19035 + I:oreCrystal=19037 + I:oreDirtyGravel=19034 + I:oreReduced=19036 + I:pocketCraftingTable=19002 + I:routerEject=19031 + I:routerItemFilter=19016 + I:routerMachineFilter=19017 + I:routerSpeed=19018 + I:routerThorough=19019 + I:routerThroughput=19020 + I:sculptTool=19041 + I:silverIngot=19015 + I:sludge=19039 + I:steam=19004 + I:wandOfCooling=19005 + I:wrathIgniter=19007 +} + + +#################### +# server +#################### + +server { + # This is a Java Regex to blacklist router access + S:bannedRouterInventoriesRegex= + + # If false, water must be piped in + B:boilersSuckWater=true + + # If false, notifications will be translated by the client + B:serversideTranslate=true + B:spreadWrathFire=true + + # Scale how much steam is produced by the solar boiler + D:steamOutputAdjustment=1.0 +} + + diff --git a/Server/config/forge.cfg b/Server/config/forge.cfg new file mode 100644 index 0000000..a6da1dd --- /dev/null +++ b/Server/config/forge.cfg @@ -0,0 +1,13 @@ +# Configuration file + +#################### +# general +#################### + +general { + # Controls the number threshold at which Packet51 is preferred over Packet52, default and minimum 64, maximum 1024 + I:clumpingThreshold=64 + B:enableGlobalConfig=false +} + + diff --git a/Server/config/forgeChunkLoading.cfg b/Server/config/forgeChunkLoading.cfg new file mode 100644 index 0000000..4ed7a7f --- /dev/null +++ b/Server/config/forgeChunkLoading.cfg @@ -0,0 +1,47 @@ +# Configuration file + +#################### +# Forge +#=================== +# Sample mod specific control section. +# Copy this section and rename the with the modid for the mod you wish to override. +# A value of zero in either entry effectively disables any chunkloading capabilities +# for that mod +#################### + +Forge { + # Maximum chunks per ticket for the mod. + I:maximumChunksPerTicket=25 + + # Maximum ticket count for the mod. Zero disables chunkloading capabilities. + I:maximumTicketCount=200 +} + + +#################### +# defaults +#=================== +# Default configuration for forge chunk loading control +#################### + +defaults { + # Unloaded chunks can first be kept in a dormant cache for quicker + # loading times. Specify the size (in chunks) of that cache here + I:dormantChunkCacheSize=0 + + # Are mod overrides enabled? + B:enabled=true + + # The default maximum number of chunks a mod can force, per ticket, + # for a mod without an override. This is the maximum number of chunks a single ticket can force. + I:maximumChunksPerTicket=25 + + # The default maximum ticket count for a mod which does not have an override + # in this file. This is the number of chunk loading requests a mod is allowed to make. + I:maximumTicketCount=200 + + # The number of tickets a player can be assigned instead of a mod. This is shared across all mods and it is up to the mods to use it. + I:playerTicketCount=500 +} + + diff --git a/Server/config/immibis-microblocks.cfg b/Server/config/immibis-microblocks.cfg new file mode 100644 index 0000000..23e3d0e --- /dev/null +++ b/Server/config/immibis-microblocks.cfg @@ -0,0 +1,22 @@ +# blockClass: StringListOption +# tileEntityClass: StringListOption +# autoDetectCuttableBlocks: BooleanOption +# cuttableBlock: ItemAndMetaListOption + +blockClass: buildcraft.transport.BlockGenericPipe +blockClass: thermalexpansion.transport.block.BlockConduit +blockClass: ic2.core.block.wiring.BlockCable +blockClass: appeng.common.AppEngMultiBlock + +tileEntityClass: buildcraft.transport.TileGenericPipe +tileEntityClass: thermalexpansion.transport.tileentity.TileConduitEnergy +tileEntityClass: thermalexpansion.transport.tileentity.TileConduitLiquid +tileEntityClass: ic2.core.block.wiring.TileEntityCable +tileEntityClass: appeng.me.tile.TileCable +tileEntityClass: appeng.me.tile.TileDarkCable +tileEntityClass: appeng.me.tile.TileInputCable +tileEntityClass: appeng.me.tile.TileOutputCable +tileEntityClass: appeng.me.tile.TileLevelEmitter +tileEntityClass: appeng.me.tile.TileStorageBus + +autoDetectCuttableBlocks: false diff --git a/Server/config/immibis.cfg b/Server/config/immibis.cfg new file mode 100644 index 0000000..17e67ff --- /dev/null +++ b/Server/config/immibis.cfg @@ -0,0 +1,78 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:blockMultipart.id=1439 + I:chunkloader.id=4090 + I:tubestuff.id=4092 + I:tubestuff.storage.id=194 +} + + +#################### +# chunkloader.playerQuotaOverride +#################### + +chunkloader.playerQuotaOverride { +} + + +#################### +# general +#################### + +general { + B:autoAssign=false + B:chunkloader.allowFuelPiping=false + B:chunkloader.bypassForgeChunkLimits=true + B:chunkloader.enableCrafting=true + + # comma-separated list of id:meta=number-of-ticks or id=number-of-ticks + S:chunkloader.fuels=3=20,4=20,87=80,263:0=12000,331=1200,263:1=1200,378=18000,381=36000,348=2400,1=60,112=200,368=18000 + B:chunkloader.hideOtherPlayersLoadersInF9=false + + # Type of quota management to use for chunk loaders. Allowed values: perplayer, unlimited + S:chunkloader.quotaType=unlimited + B:chunkloader.useFuel=false + B:enableMicroblocks=true + B:tubestuff.enableBHCAnim=true + B:tubestuff.enableBHCParticles=true + B:tubestuff.enableBlackHoleChest=false + B:tubestuff.enableCraftingBlockBreaker=true + B:tubestuff.enableCraftingIncinerator=true + B:tubestuff.enableCraftingLiquidIncinerator=true + B:tubestuff.enableCraftingOnlinePlayerDetector=true + B:tubestuff.enableCraftingRetrievulator=true + B:tubestuff.enableSlowDustFalling=false + B:tubestuff.enableStorageBlocks=true + B:tubestuff.enableStorageBlocks.useOreDictionary=true + B:tubestuff.enableStorageBlocks.vanilla=true +} + + +#################### +# item +#################### + +item { + I:itemSaw=14250 + I:tubestuff.uselessItem=7614 +} + + +#################### +# logging +#################### + +logging { + # Name of a file to keep updated with a list of all active chunk loaders. Blank for none. + S:chunkloader.listFileName= + + # Name of a file to log creation, deletion and editing of chunk loaders to. Blank for none. + S:chunkloader.logFileName= +} + + diff --git a/Server/config/mmmPowersuits.cfg b/Server/config/mmmPowersuits.cfg new file mode 100644 index 0000000..65874f1 --- /dev/null +++ b/Server/config/mmmPowersuits.cfg @@ -0,0 +1,192 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:"Power Armor Tinker Table"=2477 +} + + +#################### +# general +#################### + +general { + B:"Gregtech Recipes"=false + B:"IndustrialCraft Recipes"=true + D:"Joules per IC2 EU"=0.4 + D:"Joules per MJ"=1.0 + B:"Thermal Expansion Recipes"=true + B:"Universal Electricity Recipes"=false + B:"Vanilla Recipes"=false +} + + +#################### +# item +#################### + +item { + I:"Power Armor Component"=24775 + I:"Power Armor Feet"=24773 + I:"Power Armor Head"=24770 + I:"Power Armor Legs"=24772 + I:"Power Armor Torso"=24771 + I:"Power Tool"=24774 +} + + +#################### +# modules +#################### + +modules { + B:"Active Camouflage"=true + B:"Advanced Battery"=true + B:"Aqua Affinity"=true + B:Auto-Feeder=true + B:Axe=true + B:"Basic Battery"=true + B:"Blink Drive"=true + B:"Citizen Joe Style"=true + B:"Custom Colour Module"=true + B:"Diamond Drill Upgrade"=true + B:"Diamond Plating"=true + B:"Elite Battery"=true + B:"Energy Shield"=true + B:"Flight Control"=true + B:Glider=true + B:"In-Place Assembler"=true + B:"Iron Plating"=true + B:"Jet Boots"=true + B:Jetpack=true + B:"Jump Assist"=true + B:"Kinetic Generator"=true + B:"Melee Assist"=true + B:Multimeter=true + B:"Night Vision"=true + B:Parachute=true + B:Pickaxe=true + B:"Plasma Cannon"=true + B:Railgun=true + B:"Shock Absorber"=true + B:Shovel=true + B:"Solar Generator"=true + B:"Sprint Assist"=true + B:"Swim Boost"=true + B:"Transparent Armor"=true + B:"Uphill Step Assist"=true + B:"Water Electrolyzer"=true +} + + +#################### +# properties +#################### + +properties { + D:"Advanced Battery.Maximum Energy.Battery Size.multiplier"=400000.0 + D:"Advanced Battery.Maximum Energy.base"=100000.0 + D:"Advanced Battery.Weight.Battery Size.multiplier"=8000.0 + D:"Advanced Battery.Weight.base"=2000.0 + D:"Aqua Affinity.Underwater Energy Consumption.Power.multiplier"=100.0 + D:"Aqua Affinity.Underwater Energy Consumption.base"=0.0 + D:"Aqua Affinity.Underwater Harvest Speed.Power.multiplier"=0.8 + D:"Aqua Affinity.Underwater Harvest Speed.base"=0.2 + D:"Auto-Feeder.Auto-Feeder Efficiency.Efficiency.multiplier"=50.0 + D:"Auto-Feeder.Auto-Feeder Efficiency.base"=50.0 + D:"Auto-Feeder.Eating Energy Consumption.Efficiency.multiplier"=100.0 + D:"Auto-Feeder.Eating Energy Consumption.base"=100.0 + D:"Axe.Axe Energy Consumption.Overclock.multiplier"=900.0 + D:"Axe.Axe Energy Consumption.base"=100.0 + D:"Axe.Axe Harvest Speed.Overclock.multiplier"=17.0 + D:"Axe.Axe Harvest Speed.base"=8.0 + D:"Basic Battery.Maximum Energy.Battery Size.multiplier"=80000.0 + D:"Basic Battery.Maximum Energy.base"=20000.0 + D:"Basic Battery.Weight.Battery Size.multiplier"=8000.0 + D:"Basic Battery.Weight.base"=2000.0 + D:"Blink Drive.Blink Drive Energy Consuption.Range.multiplier"=3000.0 + D:"Blink Drive.Blink Drive Energy Consuption.base"=1000.0 + D:"Blink Drive.Blink Drive Range.Range.multiplier"=59.0 + D:"Blink Drive.Blink Drive Range.base"=5.0 + D:"Custom Colour Module.Blue Tint.Blue Intensity.multiplier"=1.0 + D:"Custom Colour Module.Green Tint.Green Intensity.multiplier"=1.0 + D:"Custom Colour Module.Red Tint.Red Intensity.multiplier"=1.0 + D:"Diamond Plating.Armor (Physical).Plating Thickness.multiplier"=6.0 + D:"Diamond Plating.Weight.Plating Thickness.multiplier"=6000.0 + D:"Elite Battery.Maximum Energy.Battery Size.multiplier"=4250000.0 + D:"Elite Battery.Maximum Energy.base"=750000.0 + D:"Elite Battery.Weight.Battery Size.multiplier"=8000.0 + D:"Elite Battery.Weight.base"=2000.0 + D:"Energy Shield.Armor (Energy).Field Strength.multiplier"=6.0 + D:"Energy Shield.Energy Per Damage.Field Strength.multiplier"=500.0 + D:"Iron Plating.Armor (Physical).Plating Thickness.multiplier"=5.0 + D:"Iron Plating.Weight.Plating Thickness.multiplier"=10000.0 + D:"Jet Boots.Jet Energy Consumption.Thrust.multiplier"=75.0 + D:"Jet Boots.Jet Energy Consumption.base"=0.0 + D:"Jet Boots.Jet Thrust.Thrust.multiplier"=0.08 + D:"Jet Boots.Jet Thrust.base"=0.0 + D:"Jetpack.Jet Energy Consumption.Thrust.multiplier"=150.0 + D:"Jetpack.Jet Energy Consumption.base"=0.0 + D:"Jetpack.Jet Thrust.Thrust.multiplier"=0.16 + D:"Jetpack.Jet Thrust.base"=0.0 + D:"Jump Assist.Jump Boost.Power.multiplier"=4.0 + D:"Jump Assist.Jump Boost.base"=1.0 + D:"Jump Assist.Jump Energy Consumption.Compensation.multiplier"=5.0 + D:"Jump Assist.Jump Energy Consumption.Power.multiplier"=25.0 + D:"Jump Assist.Jump Energy Consumption.base"=0.0 + D:"Jump Assist.Jump Exhaustion Compensation.Compensation.multiplier"=1.0 + D:"Jump Assist.Jump Exhaustion Compensation.base"=0.0 + D:"Kinetic Generator.Energy Generation Per 5 Blocks.Energy Generated.multiplier"=750.0 + D:"Kinetic Generator.Energy Generation Per 5 Blocks.base"=250.0 + D:"Kinetic Generator.Weight.Energy Generated.multiplier"=3000.0 + D:"Kinetic Generator.Weight.base"=1000.0 + D:"Melee Assist.Melee Damage.Impact.multiplier"=8.0 + D:"Melee Assist.Melee Damage.base"=2.0 + D:"Melee Assist.Melee Knockback.Carry-through.multiplier"=1.0 + D:"Melee Assist.Punch Energy Consumption.Carry-through.multiplier"=20.0 + D:"Melee Assist.Punch Energy Consumption.Impact.multiplier"=100.0 + D:"Melee Assist.Punch Energy Consumption.base"=10.0 + D:"Pickaxe.Pickaxe Energy Consumption.Overclock.multiplier"=900.0 + D:"Pickaxe.Pickaxe Energy Consumption.base"=100.0 + D:"Pickaxe.Pickaxe Harvest Speed.Overclock.multiplier"=17.0 + D:"Pickaxe.Pickaxe Harvest Speed.base"=8.0 + D:"Plasma Cannon.Plasma Damage At Full Charge.Amperage.multiplier"=18.0 + D:"Plasma Cannon.Plasma Damage At Full Charge.base"=2.0 + D:"Plasma Cannon.Plasma Energy Per Tick.Amperage.multiplier"=150.0 + D:"Plasma Cannon.Plasma Energy Per Tick.Voltage.multiplier"=50.0 + D:"Plasma Cannon.Plasma Energy Per Tick.base"=10.0 + D:"Plasma Cannon.Plasma Explosiveness.Voltage.multiplier"=0.5 + D:"Railgun.Railgun Energy Cost.Voltage.multiplier"=2500.0 + D:"Railgun.Railgun Energy Cost.base"=500.0 + D:"Railgun.Railgun Total Impulse.Voltage.multiplier"=2500.0 + D:"Railgun.Railgun Total Impulse.base"=500.0 + D:"Shock Absorber.Distance Reduction.Power.multiplier"=1.0 + D:"Shock Absorber.Distance Reduction.base"=0.0 + D:"Shock Absorber.Impact Energy consumption.Power.multiplier"=10.0 + D:"Shock Absorber.Impact Energy consumption.base"=0.0 + D:"Shovel.Shovel Energy Consumption.Overclock.multiplier"=900.0 + D:"Shovel.Shovel Energy Consumption.base"=100.0 + D:"Shovel.Shovel Harvest Speed.Overclock.multiplier"=17.0 + D:"Shovel.Shovel Harvest Speed.base"=8.0 + D:"Solar Generator.Daytime Solar Energy Generation.base"=2000.0 + D:"Solar Generator.Nighttime Solar Energy Generation.base"=200.0 + D:"Sprint Assist.Sprint Energy Consumption.Compensation.multiplier"=2.0 + D:"Sprint Assist.Sprint Energy Consumption.Power.multiplier"=10.0 + D:"Sprint Assist.Sprint Energy Consumption.base"=0.0 + D:"Sprint Assist.Sprint Exhaustion Compensation.Compensation.multiplier"=1.0 + D:"Sprint Assist.Sprint Exhaustion Compensation.base"=0.0 + D:"Sprint Assist.Sprint Speed Multiplier.Power.multiplier"=2.0 + D:"Sprint Assist.Sprint Speed Multiplier.base"=1.0 + D:"Sprint Assist.Walking Energy Consumption.Walking Assist.multiplier"=10.0 + D:"Sprint Assist.Walking Energy Consumption.base"=0.0 + D:"Sprint Assist.Walking Speed Multiplier.Walking Assist.multiplier"=1.0 + D:"Sprint Assist.Walking Speed Multiplier.base"=1.0 + D:"Swim Boost.Swim Boost Energy Consumption.Thrust.multiplier"=100.0 + D:"Swim Boost.Underwater Movement Boost.Thrust.multiplier"=1.0 + D:"Water Electrolyzer.Jolt Energy.base"=1000.0 +} + + diff --git a/Server/config/mod_bspkrsCore.bsprop.cfg b/Server/config/mod_bspkrsCore.bsprop.cfg new file mode 100644 index 0000000..d7ebb97 --- /dev/null +++ b/Server/config/mod_bspkrsCore.bsprop.cfg @@ -0,0 +1,7 @@ +# allowUpdateCheck (boolean:true) -- Set to true to allow checking for updates for ALL of my mods, false to disable +# allowDebugOutput (boolean:false) +# +# Mon Mar 30 18:15:34 CEST 2020 +allowDebugOutput=false +allowUpdateCheck=true +checksum=1wk diff --git a/Server/config/mod_bspkrsCore.cfg.bak b/Server/config/mod_bspkrsCore.cfg.bak new file mode 100644 index 0000000..b91ba96 --- /dev/null +++ b/Server/config/mod_bspkrsCore.cfg.bak @@ -0,0 +1,5 @@ +#MLProperties: name (type:default) min:max -- information +#MLProp : allowUpdateCheck (boolean:true) -- Set to true to allow checking for updates for ALL of my mods, false to disable +# +#Sun Mar 03 19:34:55 PST 2013 +allowUpdateCheck=false diff --git a/Server/config/modstats.cfg b/Server/config/modstats.cfg new file mode 100644 index 0000000..01de314 --- /dev/null +++ b/Server/config/modstats.cfg @@ -0,0 +1,23 @@ +# Configuration file + +#################### +# updates +#################### + +updates { + # Allow to send current mod versions to the server and check for updates. + # It allows to mod authors to see mod's popularity. Please don't disable it without necessity + B:AllowUpdates=true + + # Set true to receive notifications about beta versions. Otherwise you will only receive information about stable versions + B:BetaNotifications=false + + # Check for updates only for current MC version. + # Ex:if you have MC 1.4.2 and ForCurrentMinecraftVersion is true, then you wouldn't receive notifications about versions for MC 1.4.5 + B:ForCurrentMinecraftVersion=false + + # Don't display chat message, just add message to the log. + B:LogOnly=false +} + + diff --git a/Server/config/mystcraft_config.txt b/Server/config/mystcraft_config.txt new file mode 100644 index 0000000..d067585 --- /dev/null +++ b/Server/config/mystcraft_config.txt @@ -0,0 +1,279 @@ +# Configuration file + +#################### +# block +#################### + +block { + I:block.bookbinder.id=1285 + I:block.bookstand.id=200 + I:block.crystal.id=203 + I:block.lectern.id=4094 + I:block.linkmodifier.id=4095 + I:block.linkportal.id=205 + I:block.receptacle.id=206 + I:block.starfissure.id=204 + I:block.unstable.id=202 + I:block.writingdesk.id=201 +} + + +#################### +# entity +#################### + +entity { + I:entity.book.id=219 + I:entity.falling.id=218 + I:entity.meteor.id=217 +} + + +#################### +# general +#################### + +general { + B:options.crafting.binder.enabled=true + B:options.crafting.bookstand.enabled=true + B:options.crafting.desk.enabled=true + B:options.crafting.enableAgebook=true + B:options.crafting.enableBookstand=true + B:options.crafting.enableDesk=true + B:options.crafting.enableLectern=true + B:options.crafting.enableLinkModifier=true + B:options.crafting.enableLinkbook=true + B:options.crafting.enableNotebook=true + B:options.crafting.enableReceptacle=true + B:options.crafting.lectern.enabled=true + B:options.crafting.linkbook.enabled=true + B:options.crafting.notebook.enabled=true + B:options.crafting.receptacle.enabled=true + S:options.difficultyoverride= + B:options.instability=true + B:options.instability.blackdecay=true + I:options.providerId=9 + B:options.renderlabels=false + I:villager.archivist.id=1210950779 +} + + +#################### +# instability +#################### + +instability { + B:blindness.enabled=true + B:confusion.enabled=true + B:crumble.enabled=true + B:decayblack.enabled=true + B:decayblue.enabled=true + B:decaypurple.enabled=true + B:decayred.enabled=true + B:decaywhite.enabled=true + B:enemyregeneration.enabled=true + B:erosion.enabled=true + B:explosion.enabled=true + B:fatigue.enabled=true + B:hunger.enabled=true + B:lightning.enabled=true + B:meteors.enabled=true + B:poisonedsurface.enabled=true + B:scorched.enabled=true + B:slow.enabled=true + B:weakness.enabled=true +} + + +#################### +# item +#################### + +item { + I:item.agebook.id=8700 + I:item.linkbook.id=8701 + I:item.liquid.id=8705 + I:item.notebook.id=8702 + I:item.page.id=8704 + I:item.vial.id=8706 + I:item.writingdesk.id=8703 +} + + +#################### +# symbol +#################### + +symbol { + B:beach.enabled=true + B:bioconhuge.enabled=true + B:bioconlarge.enabled=true + B:bioconmedium.enabled=true + B:bioconnative.enabled=true + B:bioconsingle.enabled=true + B:bioconsmall.enabled=true + B:biocontiled.enabled=true + B:biocontiny.enabled=true + B:biomecontrollernative.enabled=true + B:caves.enabled=true + B:checkerboard_biomes.enabled=true + B:cloudblack.enabled=true + B:cloudblue.enabled=true + B:cloudchromatic.enabled=true + B:cloudgreen.enabled=true + B:cloudred.enabled=true + B:cloudwhite.enabled=true + B:colorcloud.enabled=true + B:colorfog.enabled=true + B:colorhorizon.enabled=true + B:colorsky.enabled=true + B:colorskynight.enabled=true + B:cryformcry.enabled=true + B:cryformglow.enabled=true + B:day.enabled=true + B:denseores.enabled=true + B:desert.enabled=true + B:deserthills.enabled=true + B:dungeons.enabled=true + B:dusk.enabled=true + B:envaccel.enabled=true + B:envexplosions.enabled=true + B:envlightning.enabled=true + B:envmeteor.enabled=true + B:envscorch.enabled=true + B:extreme_hills.enabled=true + B:extreme_hills_edge.enabled=true + B:flat.enabled=true + B:fogblack.enabled=true + B:fogblue.enabled=true + B:fogchromatic.enabled=true + B:foggreen.enabled=true + B:fognormal.enabled=true + B:fogred.enabled=true + B:fogwhite.enabled=true + B:forest.enabled=true + B:foresthills.enabled=true + B:frozenocean.enabled=true + B:frozenriver.enabled=true + B:ftime.enabled=true + B:hell.enabled=true + B:huge_trees.enabled=true + B:hugetrees.enabled=true + B:ice_mountains.enabled=true + B:ice_plains.enabled=true + B:jungle.enabled=true + B:junglehills.enabled=true + B:lakes.enabled=true + B:lava_lakes.enabled=true + B:lavalakes.enabled=true + B:lightingbright.enabled=true + B:lightingdark.enabled=true + B:lightingnormal.enabled=true + B:mineshafts.enabled=true + B:modblack.enabled=true + B:modblue.enabled=true + B:modclear.enabled=true + B:modcyan.enabled=true + B:moddouble.enabled=true + B:modeast.enabled=true + B:modend.enabled=true + B:modfull.enabled=true + B:modgradient.enabled=true + B:modgreen.enabled=true + B:modhalf.enabled=true + B:modmagenta.enabled=true + B:modmat_tile.glass.enabled=true + B:modmat_tile.hellrock.enabled=true + B:modmat_tile.ice.enabled=true + B:modmat_tile.lava.enabled=true + B:modmat_tile.log.birch.enabled=true + B:modmat_tile.log.jungle.enabled=true + B:modmat_tile.log.oak.enabled=true + B:modmat_tile.log.spruce.enabled=true + B:modmat_tile.netherbrick.enabled=true + B:modmat_tile.oilstill.enabled=true + B:modmat_tile.orecoal.enabled=true + B:modmat_tile.orediamond.enabled=true + B:modmat_tile.oregold.enabled=true + B:modmat_tile.oreiron.enabled=true + B:modmat_tile.stone.enabled=true + B:modmat_tile.water.enabled=true + B:modmat_tile.whitestone.enabled=true + B:modnoon.enabled=true + B:modnorth.enabled=true + B:modred.enabled=true + B:modrising.enabled=true + B:modsetting.enabled=true + B:modsouth.enabled=true + B:modwest.enabled=true + B:modwhite.enabled=true + B:modyellow.enabled=true + B:modzero.enabled=true + B:moondark.enabled=true + B:moonnormal.enabled=true + B:mushroomisland.enabled=true + B:mushroomislandshore.enabled=true + B:netherfort.enabled=true + B:night.enabled=true + B:nohorizon.enabled=true + B:nosea.enabled=true + B:ntime.enabled=true + B:obelisks.enabled=true + B:ocean.enabled=true + B:plains.enabled=true + B:rain.enabled=true + B:rainbow.enabled=true + B:ravines.enabled=true + B:river.enabled=true + B:single_biome.enabled=true + B:sky.enabled=true + B:skyblack.enabled=true + B:skyblue.enabled=true + B:skychromatic.enabled=true + B:skygreen.enabled=true + B:skylands.enabled=true + B:skynormal.enabled=true + B:skyred.enabled=true + B:skywhite.enabled=true + B:snow.enabled=true + B:standard_lighting.enabled=true + B:standard_terrain.enabled=true + B:star_fissure.enabled=true + B:starfissure.enabled=true + B:starsdark.enabled=true + B:starsendsky.enabled=true + B:starsnormal.enabled=true + B:stime.enabled=true + B:storm.enabled=true + B:strongholds.enabled=true + B:sundark.enabled=true + B:sunnormal.enabled=true + B:sunsetblack.enabled=true + B:sunsetblue.enabled=true + B:sunsetchromatic.enabled=true + B:sunsetgreen.enabled=true + B:sunsetred.enabled=true + B:sunsetwhite.enabled=true + B:swampland.enabled=true + B:taiga.enabled=true + B:taigahills.enabled=true + B:tendrils.enabled=true + B:terrainend.enabled=true + B:terrainnether.enabled=true + B:terrainnormal.enabled=true + B:villages.enabled=true + B:void.enabled=true + B:weathercloudy.enabled=true + B:weatherfast.enabled=true + B:weathernorm.enabled=true + B:weatheroff.enabled=true + B:weatheron.enabled=true + B:weatherrain.enabled=true + B:weatherslow.enabled=true + B:weathersnow.enabled=true + B:weatherstorm.enabled=true + B:weathersun.enabled=true + B:woodcaves.enabled=true +} + + diff --git a/Server/config/railcraft/liquid_filters.cfg b/Server/config/railcraft/liquid_filters.cfg new file mode 100644 index 0000000..4549ced --- /dev/null +++ b/Server/config/railcraft/liquid_filters.cfg @@ -0,0 +1,22 @@ +# Configuration file +# Generated on 11/3/12 12:40 PM + +#################### +# filters +#################### + +filters { + 1=326:0 + 2=327:0 + 3=7771:0 + 4=7770:0 + 5=4063:0 + 6=4066:0 + 7=373:0 + 8=30218:0 + 9=30236:0 + 10=30206:0 + 11=30100:0 + 12=30099:0 +} + diff --git a/Server/config/railcraft/modules.cfg b/Server/config/railcraft/modules.cfg new file mode 100644 index 0000000..7768678 --- /dev/null +++ b/Server/config/railcraft/modules.cfg @@ -0,0 +1,33 @@ +# Configuration file +# Generated on 12/31/12 6:18 PM + +#################### +# modules +#=================== +# Disabling these modules can greatly change how the mod functions. +# For example, disabling the Train Module will prevent you from linking carts. +# Disabling the World Module will disable all world gen. +# Disabling the Energy Module will remove the energy requirement from machines, but will only do so if Forestry or Buildcraft are not installed. +#################### + +modules { + B:automation=true + B:chunk.loading=true + B:energy=true + B:extras=true + B:factory=true + B:ic2=true + B:locomotives=true + B:seasonal=true + B:signals=true + B:structures=true + B:tracks=true + B:tracks.highspeed=true + B:tracks.reinforced=true + B:tracks.wood=true + B:train=true + B:transport=true + B:world=true +} + + diff --git a/Server/config/railcraft/railcraft.cfg b/Server/config/railcraft/railcraft.cfg new file mode 100644 index 0000000..7a45ecb --- /dev/null +++ b/Server/config/railcraft/railcraft.cfg @@ -0,0 +1,601 @@ +# Configuration file +# Generated on 12/31/12 6:18 PM + +#################### +# anchors +#################### + +anchors { + # + # change to 'delete.anchors=true' to delete every World Anchor or Anchor Cart in the world. + # Value resets to false after each session. + # To disable Anchors completely, disable the ChunkLoading Module from 'modules.cfg' + # + B:delete.anchors=false + + # + # the number of hours that a single Ender Pearl will power a Anchor, set it to -1 to disable the fuel requirement, default = 12, max = 480 + # + I:refuel=12 +} + + +#################### +# block +#=================== +# This is were block IDs are defined. +# Changing these will have adverse effects on existing worlds. +# For the list of which sub-blocks are on each ID see the sub-block section below. +#################### + +block { + I:block.cube=457 + I:block.detector=450 + I:block.elevator=455 + I:block.machine.alpha=451 + I:block.machine.beta=452 + I:block.machine.gamma=453 + I:block.ore=458 + I:block.post=459 + I:block.post.metal=460 + I:block.signal=456 + I:block.track=454 +} + + +#################### +# carts +#=================== +# Disable individual carts here. +#################### + +carts { + B:cart.anchor=true + B:cart.bore=true + B:cart.energy.batbox=true + B:cart.energy.mfe=true + B:cart.energy.mfsu=true + B:cart.gift=true + B:cart.loco.steam=true + B:cart.pumpkin=true + B:cart.tank=true + B:cart.tnt=true + B:cart.track.relayer=true + B:cart.undercutter=true + B:cart.work=true +} + + +#################### +# general +#################### + +general { + # + # change to 'check.version.online=false' to disable latest version checking + # + B:check.version.online=false + B:delete.anchors=false + + # + # change to 'play.sounds=false' to prevent all mod sounds from playing + # + B:play.sounds=true + B:register.handler.collision=true + S:tweaks.anchor.delete=false + B:tweaks.minecarts.basic.adjustDrag=true + B:tweaks.minecarts.bore.destroyBlocks=false + B:tweaks.minecarts.bore.mineAllBlocks=true + S:tweaks.minecarts.bore.mineableBlocks={} + B:tweaks.minecarts.breakOnDrop=false + B:tweaks.minecarts.collideWithItems=false + S:tweaks.minecarts.highspeed.max=1.0 + S:tweaks.minecarts.maxStackSize=3 + S:tweaks.minecarts.tank.capacity=16 + S:tweaks.minecarts.tank.fillrate=25 + B:tweaks.minecarts.tank.useCustomValues=false + S:tweaks.rails.launch.force.max=30 + B:tweaks.signals.printDebug=false + I:tweaks.signals.update.interval=4 + B:tweaks.sounds.play=true + S:tweaks.tanks.maxsize=7 + B:tweaks.tanks.stack=true + S:tweaks.utility.cart.dispenser.delay=0 +} + + +#################### +# item +#=================== +# Generally, many items can be disabled by setting the id to zero. +# This is not true for all item, so some experimentation may be needed. +# Some disabled items will cause a substitute to be used in crafting recipes. +#################### + +item { + I:armor.goggles=7552 + I:armor.steel.boots=7546 + I:armor.steel.helmet=7547 + I:armor.steel.legs=7548 + I:armor.steel.plate=7549 + I:dust=7500 + I:fuel.coke=7501 + I:ic2.upgrade.lapotron=7502 + I:item.cart.anchor=7503 + I:item.cart.batbox=7504 + I:item.cart.bore=7505 + I:item.cart.gift=7551 + I:item.cart.loco.steam=7550 + I:item.cart.mfe=7506 + I:item.cart.mfsu=7507 + I:item.cart.pumpkin=7508 + I:item.cart.tank=7509 + I:item.cart.tnt=7510 + I:item.cart.track.relayer=7511 + I:item.cart.undercutter=7512 + I:item.cart.work=7513 + I:liquid.creosote.bottle=7514 + I:liquid.creosote.bucket=7515 + I:liquid.creosote.can=7516 + I:liquid.creosote.liquid=7517 + I:liquid.creosote.refactory=7518 + I:liquid.creosote.wax=7519 + I:liquid.steam=7520 + I:part.circuit.controller=7521 + I:part.circuit.receiver=7522 + I:part.gear=7523 + I:part.ingot.steel=7524 + I:part.plate=7525 + I:part.rail=7526 + I:part.railbed=7527 + I:part.rebar=7528 + I:part.signal.lamp=7529 + I:part.tie=7530 + I:part.turbine.blade=7531 + I:part.turbine.disk=7532 + I:part.turbine.rotor=7533 + I:tool.bore.head.diamond=7534 + I:tool.bore.head.iron=7535 + I:tool.bore.head.steel=7536 + I:tool.crowbar=7537 + I:tool.magnifying.glass=7538 + I:tool.signal.tuner=7539 + I:tool.steel.axe=7540 + I:tool.steel.hoe=7541 + I:tool.steel.pickaxe=7542 + I:tool.steel.shovel=7543 + I:tool.steel.sword=7544 + I:tool.surveyor=7545 +} + + +#################### +# loot +#=================== +# Loot chances are defined here. +# Smaller values are rarer. +# Example Loot: +# Bread = 100 +# Redstone = 50 +# Record = 5 +# Golden Apple = 1 +#################### + +loot { + I:cart.basic=10 + I:cart.chest=10 + I:cart.tnt=5 + I:cart.work=8 + I:creosote.bottle=20 + I:fuel.coke=20 + I:steel.block=5 + I:steel.ingot=10 + I:tie.wood=20 + I:tool.crowbar=10 + I:tool.steel.axe=5 + I:tool.steel.pickaxe=5 + I:tool.steel.shovel=5 + I:tool.steel.sword=5 + I:track.basic=30 +} + + +#################### +# recipes +#=================== +# You can control which Ores generate in the world here. +# If wish to disable world gen entirely, +# it is recommended that you disable the World Module in 'modules.cfg' instead. +#################### + +recipes { + # + # change to 'recipes.forestry.fertilizer=false' to disable the saltpeter recipe for Forestry Fertilizer + # + B:recipes.forestry.fertilizer=true + + # + # change to 'recipes.furnace.creosote=true' to add smelting recipes for Creosote Oil to the vanilla furnace + # + B:recipes.furnace.creosote=false + + # + # change to 'recipes.gunpowder=false' to disable the sulfur, saltpeter, charcoal dust recipe for gunpowder + # + B:recipes.gunpowder=true + + # + # change to 'recipes.ic2.macerator.blaze=true' to disable the IC2 Macerator recipe for Blaze Powder + # + B:recipes.ic2.macerator.blaze=false + + # + # change to 'recipes.ic2.macerator.bones=true' to disable the IC2 Macerator recipe for Bonemeal + # + B:recipes.ic2.macerator.bones=false + + # + # change to 'recipes.ic2.macerator.charcoal=false' to disable the IC2 Macerator recipe for Charcoal Dust + # + B:recipes.ic2.macerator.charcoal=true + + # + # change to 'recipes.ic2.macerator.cobble=true' to disable the IC2 Macerator recipes for Cobblestone + # + B:recipes.ic2.macerator.cobble=false + + # + # change to 'recipes.ic2.macerator.dirt=true' to disable the IC2 Macerator recipe for Dirt + # + B:recipes.ic2.macerator.dirt=false + + # + # change to 'recipes.ic2.macerator.obsidian=false' to disable the IC2 Macerator recipes for Cushed Obsidian and Obsidian Dust + # + B:recipes.ic2.macerator.obsidian=true + + # + # change to 'recipes.ic2.macerator.ores=true' to disable the IC2 Macerator recipes for Ore Dusts + # + B:recipes.ic2.macerator.ores=false + + # + # change to 'recipes.ic2.remove.refined.iron=true' to prevent Refined Iron from being used in any IC2 recipe. Use in combination with 'recipes.ic2.use.steel' + # + B:recipes.ic2.remove.refined.iron=false + + # + # change to 'recipes.ic2.use.steel=true' to enable the use of Steel in any IC2 recipe that requires Refined Iron + # + B:recipes.ic2.use.steel=false + + # + # change to 'recipes.minecart.bronze=false' to disable the bronze recipe for minecarts + # + B:recipes.minecart.bronze=true + + # + # change to 'recipes.minecart.steel=true' to enable the steel recipe for minecarts + # + B:recipes.minecart.steel=false + + # + # change to 'recipes.rock.crusher.ores=false' to prevent the game from crushing ores into dusts (only available if IC2 installed) + # + B:recipes.rock.crusher.ores=true + + # + # change to 'recipes.track.vanilla=true' to use track recipes more similar to vanilla minecraft + # + B:recipes.track.vanilla=false +} + + +#################### +# subblocks +#=================== +# Here is were you can enable/disable various sub-blocks. +# Railcraft will attemtpt to compensate for any missing component by providing alternatives (usually). +#################### + +subblocks { + B:cube.brick.infernal=true + B:cube.concrete.block=true + B:cube.crushed.obsidian=true + B:cube.steel.block=true + B:cube.world.anchor=false + B:machine.alpha.blast.furnace=true + B:machine.alpha.coke.oven=true + B:machine.alpha.dispenser.cart=true + B:machine.alpha.dispenser.train=true + B:machine.alpha.feed.station=true + B:machine.alpha.loader.energy=true + B:machine.alpha.loader.item.advanced=true + B:machine.alpha.loader.liquid=true + B:machine.alpha.rock.crusher=true + B:machine.alpha.rolling.machine=true + B:machine.alpha.tank.water=true + B:machine.alpha.turbine=true + B:machine.alpha.unloader.energy=true + B:machine.alpha.unloader.item.advanced=true + B:machine.alpha.unloader.liquid=true + B:machine.alpha.world.anchor=true + B:machine.beta.anchor.sentinel=true + B:machine.beta.boiler.firebox.liquid=true + B:machine.beta.boiler.firebox.solid=true + B:machine.beta.boiler.tank.pressure.high=true + B:machine.beta.boiler.tank.pressure.low=true + B:machine.beta.engine.steam.high=true + B:machine.beta.engine.steam.hobby=true + B:machine.beta.engine.steam.low=true + B:machine.beta.tank.iron.gauge=true + B:machine.beta.tank.iron.valve=true + B:machine.beta.tank.iron.wall=true + B:machine.gamma.dispenser.cart=true + B:machine.gamma.dispenser.train=true + B:machine.gamma.loader.energy=true + B:machine.gamma.loader.item=true + B:machine.gamma.loader.item.advanced=true + B:machine.gamma.loader.liquid=true + B:machine.gamma.unloader.energy=true + B:machine.gamma.unloader.item=true + B:machine.gamma.unloader.item.advanced=true + B:machine.gamma.unloader.liquid=true + B:ore.saltpeter=true + B:ore.sulfur=true + B:signal.block.signal=true + B:signal.block.signal.dual=true + B:signal.box.controller=true + B:signal.box.receiver=true + B:signal.distant=true + B:signal.switch.lever=true + B:signal.switch.motor=true + B:structure.block.concrete=true + B:structure.box.controller=true + B:structure.box.receiver=true + B:structure.post.metal=true + B:structure.post.stone=true + B:structure.post.wood=true + B:structure.signal.block=true + B:structure.signal.block.dual=true + B:structure.signal.distant=true + B:structure.switch.lever=true + B:structure.switch.motor=true + B:track.boarding=true + B:track.boarding.train=true + B:track.buffer.stop=true + B:track.control=true + B:track.coupler=true + B:track.decoupler=true + B:track.detector.direction=true + B:track.disembarking=true + B:track.disposal=true + B:track.embarking=true + B:track.gated=true + B:track.gated.oneway=true + B:track.holding=true + B:track.holding.train=true + B:track.junction=true + B:track.launcher=true + B:track.lockdown=true + B:track.oneway=true + B:track.priming=true + B:track.reinforced=true + B:track.reinforced.boost=true + B:track.reinforced.junction=true + B:track.reinforced.switch=true + B:track.reinforced.wye=true + B:track.slow=true + B:track.slow.boost=true + B:track.slow.junction=true + B:track.slow.switch=true + B:track.slow.wye=true + B:track.speed=true + B:track.speed.boost=true + B:track.speed.switch=true + B:track.speed.transition=true + B:track.speed.wye=true + B:track.suspended=true + B:track.switch=true + B:track.wye=true +} + + +#################### +# tweaks +#=================== +# Here you can change the behavior of various things +#################### + +tweaks { + #################### + # blocks + #################### + + blocks { + #################### + # cartdispenser + #################### + + cartdispenser { + # + # set the minimum number of seconds between cart dispensing, default=0 + # + I:delay=0 + } + + #################### + # irontank + #################### + + irontank { + # + # Change to 'allow.stacking=false' to disable the stacking of Iron Tanks + # + B:allow.stacking=true + + # + # Allows you to set the max Iron Tank base dimension, valid values are 3, 5, 7, and 9 + # + I:maxsize=9 + } + + #################### + # signals + #################### + + signals { + # + # change to 'printDebug=true' to log debug info for Signal Blocks + # + B:printDebug=false + + # + # measured in tick, smaller numbers update more often, resulting in more sensitive signals, but cost more cpu power, default = 4 + # + I:update.interval=4 + } + + } + + #################### + # tracks + #################### + + tracks { + #################### + # speed + #################### + + speed { + # + # change 'max.speed' to limit max speed on high speed rails, useful if your computer can't keep up with chunk loading, min=0.6, default=1.0, max=1.2 + # + D:max.speed=1.0 + } + + #################### + # launch + #################### + + launch { + # + # change the value to your desired max launch rail force, min=5, default=30, max=50 + # + I:force.max=30 + } + + } + + #################### + # carts + #################### + + carts { + #################### + # general + #################### + + general { + # + # change to 'breakOnDrop=true' to restore vanilla behavior + # + B:breakOnDrop=false + + # + # change to 'collideWithItems=true' to restore minecart collisions with dropped items, ignored if 'register.handler.collision=false' + # + B:collideWithItems=false + + # + # change the value to your desired minecart stack size, vanilla=1, default=3, max=64 + # + I:maxStackSize=3 + + # + # change to 'register.collision.handler=false' to use a minecart collision handler from a different mod or vanilla behavior + # + B:register.collision.handler=true + + # + # change to 'solid.carts=false' to return minecarts to vanilla player vs cart ocllision behavior + # in vanilla minecarts are ghost like can be walked through + # but making carts solid also makes them hard to push by hand + # this setting is ignored if aren't using the Railcraft Collision Handler + # + B:solid.carts=true + } + + #################### + # basic + #################### + + basic { + # + # change to 'adjustDrag=false' to give basic carts the original vanilla drag values, after changing you may need to replace the carts to see any change in game + # + B:adjustDrag=true + } + + #################### + # bore + #################### + + bore { + # + # change to 'destroyBlocks=true' to cause the Bore to destroy the blocks it mines instead of dropping them + # + B:destroyBlocks=false + + # + # change to 'mineAllBlocks=false' to enable mining checks, use true setting with caution, especially on servers + # + B:mineAllBlocks=true + + # + # add block ids to 'mineableBlocks' in a common seperated list to define non-vanilla blocks mineable by the tunnel bore + # ignored if 'tweaks.carts.bore.mineAllBlocks=true' + # metadata sensative entries can be defined in the form 'blockid:metadata' + # inclusive ranges can be defined in the form 'startID-endID' + # Example:mineableBlocks= { 123, 134:3, 450-500 } + # + S:mineableBlocks={} + } + + #################### + # tank + #################### + + tank { + # + # change the value to your desired Tank Cart capacity in buckets, min=1, default=16, max=32, ignored if 'tweaks.minecarts.tank.useCustomValues=false' + # + I:capacity=16 + + # + # change the value to your desired Tank Cart fill rate in milli-buckets per tick, min=5, default=25, max=50 + # # there are 1000 milli-buckets in a bucket, ignored if 'tweaks.minecarts.tank.useCustomValues=false' + # + I:fillrate=25 + + # + # change to 'useCustomValues=true' to adjust the Tank Cart's capacity and fill rate + # + B:useCustomValues=false + } + + } + +} + + +#################### +# worldgen +#################### + +worldgen { + B:world.generate.saltpeter=true + B:world.generate.sulfur=true +} + + diff --git a/Server/config/redpower/redpower.cfg b/Server/config/redpower/redpower.cfg new file mode 100644 index 0000000..fc96a9a --- /dev/null +++ b/Server/config/redpower/redpower.cfg @@ -0,0 +1,189 @@ +# RedPower 2 Configuration +blocks { + base { + appliance.id=751 + microblock.id=750 + multiblock.id=752 + } + + compat.machine.id=767 + control { + backplane.id=760 + peripheral.id=761 + peripheralFlat.id=762 + } + + lighting { + lampInvOff.id=759 + lampInvOn.id=758 + lampOff.id=757 + lampOn.id=756 + lampShaped.id=768 + } + + logic.logic.id=753 + machine { + frame.id=765 + machine.id=763 + machine2.id=766 + machinePanel.id=764 + } + + world { + crops.id=252 + leaves.id=249 + log.id=248 + ores.id=254 + plants.id=253 + stone.id=255 + storage.id=754 + } + +} + +enchant { + disjunction.id=79 + vorpal.id=80 +} + +items { + base { + alloy.id=5318 + bag.id=9012 + drawplateDiamond.id=5319 + dyeIndigo.id=5320 + handsawDiamond.id=5321 + handsawIron.id=5322 + lumar.id=5323 + nuggets.id=5324 + planBlank.id=9010 + planFull.id=9011 + resource.id=5325 + screwdriver.id=5326 + } + + compat.parts.id=9087 + control.disk.id=5327 + logic.parts.id=5328 + machine { + battery { + empty.id=5329 + powered.id=5330 + } + + parts.id=9083 + sonicDriver.id=5331 + turbineWood.id=9084 + voltmeter.id=5332 + windmillWood.id=9085 + } + + world { + athame.id=5333 + axeGreenSapphire.id=5334 + axeRuby.id=5335 + axeSapphire.id=5336 + handsawGreenSapphire.id=5337 + handsawRuby.id=5338 + handsawSapphire.id=5339 + hoeGreenSapphire.id=5340 + hoeRuby.id=5341 + hoeSapphire.id=5342 + paintbrush { + black.id=5343 + blue.id=5344 + brown.id=5345 + cyan.id=5346 + dry.id=5347 + gray.id=5348 + green.id=5349 + lightBlue.id=5350 + lime.id=5351 + magenta.id=5352 + orange.id=5353 + pink.id=5354 + purple.id=5355 + red.id=5356 + silver.id=5357 + white.id=5358 + yellow.id=5359 + } + + paintcan { + black.id=5360 + blue.id=5361 + brown.id=5362 + cyan.id=5363 + empty.id=5364 + gray.id=5365 + green.id=5366 + lightBlue.id=5367 + lime.id=5368 + magenta.id=5369 + orange.id=5370 + pink.id=5371 + purple.id=5372 + red.id=5373 + silver.id=5374 + white.id=5375 + yellow.id=5376 + } + + pickaxeGreenSapphire.id=5377 + pickaxeRuby.id=5378 + pickaxeSapphire.id=5379 + seedbag.id=9043 + seeds.id=5380 + shovelGreenSapphire.id=5381 + shovelRuby.id=5382 + shovelSapphire.id=5383 + sickleDiamond.id=5384 + sickleGold.id=5386 + sickleGreenSapphire.id=5385 + sickleIron.id=5387 + sickleRuby.id=5388 + sickleSapphire.id=5389 + sickleStone.id=5390 + sickleWood.id=5391 + swordGreenSapphire.id=5392 + swordRuby.id=5393 + swordSapphire.id=5394 + woolcard.id=5395 + } + +} + +settings { + compat.gear.altRecipe=0 + core { + # Automatically remap conflicting IDs. + # WARNING: May corrupt existing worlds + autoAssign=0 + } + + logic.enableSounds=1 + machine { + frame { + alwayscrate=0 + linksize=1000 + } + + } + + world { + generate { + copper=0 + silver=0 + tin=0 + } + + tweaks { + craftcircle=1 + spreadmoss=1 + unbricks=1 + } + + } + +} + diff --git a/Server/config/redpower/redpower.lang b/Server/config/redpower/redpower.lang new file mode 100644 index 0000000..65d921c --- /dev/null +++ b/Server/config/redpower/redpower.lang @@ -0,0 +1,2563 @@ +#RedPower Language File +#Mon Mar 30 18:15:53 CEST 2020 +tile.rpcovs.wool.silver.name=Light Gray Wool Cover Strip +tile.rparmbwire.books.name=Bookshelf Jacketed Bluewire +tile.rpcov7s.wool.cyan.name=Cyan Wool Anticover Strip +tile.rpcov7c.rplog.name=Rubberwood Anticover Corner +tile.rphcov5.marble.name=Marble Hollow Cover Slab +tile.rpcovc.stonebrick2.name=Stone Brick Cover Corner +tile.rpslab.rplog.name=Rubberwood Slab +tile.rpslabs.stonebrick2.name=Stone Brick Slab Strip +tile.rppans.tinBlock.name=Tin Block Panel Strip +tile.rpcov6s.basaltPaver.name=Basalt Paver Triple Panel Strip +tile.rpcov5c.basaltCobble.name=Basalt Cobblestone Cover Slab Corner +tile.rppans.planks2.name=Wooden Plank Panel Strip +tile.rppole1.rubyBlock.name=Ruby Block Post +tile.rphpanel.greenSapphireBlock.name=Hollow Green Sapphire Block Panel +tile.rphslab.wool.magenta.name=Hollow Magenta Wool Slab +tile.rparmcable.silverBlock.name=Silver Block Jacketed Cable +tile.rpcov5s.wool.red.name=Red Wool Cover Slab Strip +tile.rpcov3s.dirt.name=Dirt Triple Cover Strip +item.ingotRed.name=Red Alloy Ingot +tile.rpcover.basaltPaver.name=Basalt Paver Cover +tile.rpcov7c.wool.black.name=Black Wool Anticover Corner +tile.rpcovc.planks2.name=Wooden Plank Cover Corner +tile.rpcov7s.sandstone.name=Sandstone Anticover Strip +tile.rparmwire.snow.name=Snow Jacketed Wire +tile.rpslabs.wood.name=Oak Wood Slab Strip +tile.rpcov6s.rubyBlock.name=Ruby Block Triple Panel Strip +tile.rpcovs.basaltCircle.name=Chiseled Basalt Brick Cover Strip +tile.rpslabc.silverBlock.name=Silver Block Slab Corner +tile.rpcov5s.greenSapphireBlock.name=Green Sapphire Block Cover Slab Strip +tile.rphcov3.clay.name=Clay Hollow Triple Cover +item.irwire.name=Stone Wire +tile.rppanc.sandstone1.name=Sandstone Panel Corner +tile.rpcovs.stone.name=Stone Cover Strip +tile.rphslab.stonebrick2.name=Hollow Stone Brick Slab +tile.rpcov7s.wool.magenta.name=Magenta Wool Anticover Strip +item.irchip.name=Silicon Chip +tile.rpcov6.wool.yellow.name=Yellow Wool Triple Panel +tile.rpslabs.rplog.name=Rubberwood Slab Strip +tile.rphcov5.tinBlock.name=Tin Block Hollow Cover Slab +tile.rpcov7s.wool.white.name=White Wool Anticover Strip +tile.rphcov6.stonebrick3.name=Stone Brick Hollow Triple Panel +tile.rpcov6.wool.brown.name=Brown Wool Triple Panel +tile.rpcovs.wool.magenta.name=Magenta Wool Cover Strip +tile.rpslabs.cobble.name=Cobblestone Slab Strip +tile.rphcov7.wool.black.name=Black Wool Hollow Anticover +tile.rpslab.silverBlock.name=Silver Block Slab +tile.rppanel.dirt.name=Dirt Panel +tile.rppole1.clay.name=Clay Post +tile.rpcov5s.wool.brown.name=Brown Wool Cover Slab Strip +item.paintbrush.black.name=Black Paint Brush +tile.rpishlamp.brown.name=Inverted Brown Fixture +tile.rphcover.diamond.name=Hollow Diamond Cover +tile.rphcov3.greenSapphireBlock.name=Green Sapphire Block Hollow Triple Cover +tile.rppole3.copperBlock.name=Copper Block Column +tile.rpcov7.slab.name=Polished Stone Anticover +tile.rpcov7.wool.lightBlue.name=Light Blue Wool Anticover +tile.rpcov5c.wool.lightBlue.name=Light Blue Wool Cover Slab Corner +tile.rphslab.rubyBlock.name=Hollow Ruby Block Slab +tile.irseq.name=Sequencer +tile.rpcov7s.planks3.name=Wooden Plank Anticover Strip +tile.rphpanel.diamond.name=Hollow Diamond Panel +tile.rpcov3.cobble.name=Cobblestone Triple Cover +tile.rppole3.planks1.name=Wooden Plank Column +tile.rphslab.stone.name=Hollow Stone Slab +tile.rppans.brick.name=Brick Panel Strip +tile.rpcov5c.tinBlock.name=Tin Block Cover Slab Corner +tile.rppole1.sandstone2.name=Sandstone Post +tile.rppole2.planks3.name=Wooden Plank Pillar +tile.irxor.name=XOR Gate +tile.rpcovc.netherrack.name=Netherrack Cover Corner +tile.rppans.books.name=Bookshelf Panel Strip +tile.rpilamp.black.name=Inverted Black Lamp +tile.rphcov7.wool.purple.name=Purple Wool Hollow Anticover +tile.rparmbwire.planks3.name=Wooden Plank Jacketed Bluewire +item.waferRed.name=Red-Doped Wafer +tile.rpbatbox.name=Battery Box +tile.rppole2.greenSapphireBlock.name=Green Sapphire Block Pillar +tile.rphpanel.wool.lime.name=Hollow Lime Wool Panel +tile.rpcov3c.diamond.name=Diamond Triple Cover Corner +tile.rpcovs.marbleBrick.name=Marble Brick Cover Strip +tile.rphcov7.basaltCircle.name=Chiseled Basalt Brick Hollow Anticover +tile.rpcov3.stonebrick.name=Stone Brick Triple Cover +tile.rphcov7.planks2.name=Wooden Plank Hollow Anticover +tile.rppole1.basaltCircle.name=Chiseled Basalt Brick Post +tile.rphcov7.wool.lightBlue.name=Light Blue Wool Hollow Anticover +tile.rphcov7.cobble.name=Cobblestone Hollow Anticover +tile.rpcov7s.stonebrick2.name=Stone Brick Anticover Strip +tile.rplog.name=Rubberwood +tile.rppanel.stone.name=Stone Panel +tile.rpslabs.tinBlock.name=Tin Block Slab Strip +tile.rppanc.snow.name=Snow Panel Corner +tile.rpcov7.wool.orange.name=Orange Wool Anticover +tile.rphcov7.wool.magenta.name=Magenta Wool Hollow Anticover +tile.rphcov3.slab.name=Polished Stone Hollow Triple Cover +tile.oreSilver.name=Silver Ore +tile.rpcov5.obsidian.name=Obsidian Cover Slab +tile.rpcov7s.marble.name=Marble Anticover Strip +tile.rpcov5s.basaltPaver.name=Basalt Paver Cover Slab Strip +tile.rpshlamp2.lightBlue.name=Light Blue Cage Lamp +tile.rparmbwire.basaltPaver.name=Basalt Paver Jacketed Bluewire +tile.rpslabs.basalt.name=Basalt Slab Strip +tile.irdlatch.name=Transparent Latch +tile.rpslab.wool.gray.name=Gray Wool Slab +tile.rphcov6.clay.name=Clay Hollow Triple Panel +tile.rphcov5.gold.name=Gold Hollow Cover Slab +tile.rppole1.slab.name=Polished Stone Post +tile.rpcov7c.silverBlock.name=Silver Block Anticover Corner +tile.rpcov3c.copperBlock.name=Copper Block Triple Cover Corner +tile.rppans.wool.green.name=Green Wool Panel Strip +tile.rpcov5s.wood1.name=Spruce Wood Cover Slab Strip +tile.rppole2.wood.name=Oak Wood Pillar +tile.rplamp.orange.name=Orange Lamp +tile.rpcovs.wood.name=Oak Wood Cover Strip +tile.rpcov6.snow.name=Snow Triple Panel +tile.oreTungsten.name=Tungsten Ore +tile.rpshlamp2.cyan.name=Cyan Cage Lamp +tile.rpcov3.clay.name=Clay Triple Cover +tile.rppans.wool.orange.name=Orange Wool Panel Strip +tile.rpcov3.basalt.name=Basalt Triple Cover +tile.rppole3.sandstone2.name=Sandstone Column +tile.rpslab.stonebrick1.name=Stone Brick Slab +tile.rphpanel.planks2.name=Hollow Wooden Plank Panel +tile.rppole3.gold.name=Gold Column +tile.rpcov3s.planks1.name=Wooden Plank Triple Cover Strip +tile.rpcov6.planks1.name=Wooden Plank Triple Panel +tile.rphcover.pumpkin.name=Hollow Pumpkin Cover +tile.rpcov6.stonebrick2.name=Stone Brick Triple Panel +tile.rppipe.name=Fluid Pipe +tile.rpcov5.planks3.name=Wooden Plank Cover Slab +tile.rpcovc.wool.white.name=White Wool Cover Corner +tile.rpcov3s.silverBlock.name=Silver Block Triple Cover Strip +tile.rphcover.wool.yellow.name=Hollow Yellow Wool Cover +tile.rpcov5.stonebrick.name=Stone Brick Cover Slab +tile.rphpanel.pumpkin.name=Hollow Pumpkin Panel +tile.rppanel.copperBlock.name=Copper Block Panel +tile.rppole2.wool.pink.name=Pink Wool Pillar +tile.rpslabs.stonebrick.name=Stone Brick Slab Strip +tile.rphcov7.basalt.name=Basalt Hollow Anticover +tile.rpcov7c.wool.red.name=Red Wool Anticover Corner +tile.rpcov3c.gold.name=Gold Triple Cover Corner +tile.rpcov7s.soul.name=Soul Sand Anticover Strip +tile.rppanel.wool.brown.name=Brown Wool Panel +item.btmotor.name=Blulectric Motor +tile.rppanc.stonebrick3.name=Stone Brick Panel Corner +tile.rpcov5c.cobble.name=Cobblestone Cover Slab Corner +tile.rparmcable.basaltCircle.name=Chiseled Basalt Brick Jacketed Cable +tile.rppanel.basaltCircle.name=Chiseled Basalt Brick Panel +tile.rparmwire.soul.name=Soul Sand Jacketed Wire +tile.rpcov6c.netherrack.name=Netherrack Triple Panel Corner +tile.rpcov5s.dirt.name=Dirt Cover Slab Strip +tile.rpinsulated.green.name=Green Insulated Wire +tile.rpcov3c.pumpkin.name=Pumpkin Triple Cover Corner +tile.rparmwire.brick.name=Brick Jacketed Wire +tile.rppanc.wood1.name=Spruce Wood Panel Corner +tile.rppole2.wool.yellow.name=Yellow Wool Pillar +tile.rpcover.greenSapphireBlock.name=Green Sapphire Block Cover +tile.rparmcable.wool.magenta.name=Magenta Wool Jacketed Cable +tile.rparmwire.books.name=Bookshelf Jacketed Wire +tile.rphcov6.slab.name=Polished Stone Hollow Triple Panel +item.paintcan.silver.name=Light Gray Paint +tile.rparmcable.wool.black.name=Black Wool Jacketed Cable +achievement.rpIngotRed.desc=Smelt a red alloy ingot +tile.rpcable.silver.name=Light Gray Bundled Cable +tile.rphcov7.wool.lime.name=Lime Wool Hollow Anticover +tile.rphcov7.wood.name=Oak Wood Hollow Anticover +tile.rphcov6.basaltCircle.name=Chiseled Basalt Brick Hollow Triple Panel +tile.rparmwire.stonebrick3.name=Stone Brick Jacketed Wire +tile.rpcov3s.wool.lime.name=Lime Wool Triple Cover Strip +tile.rppans.wool.blue.name=Blue Wool Panel Strip +tile.rphcov3.wool.green.name=Green Wool Hollow Triple Cover +tile.rpcov6s.stonebrick2.name=Stone Brick Triple Panel Strip +tile.rpcov3.slab.name=Polished Stone Triple Cover +item.sickleStone.name=Stone Sickle +tile.rpdiskdrive.name=Disk Drive +item.ingotTin.name=Tin Ingot +tile.rpcov7c.stonebrick1.name=Stone Brick Anticover Corner +tile.rpcov5.wool.silver.name=Light Gray Wool Cover Slab +tile.rppans.lapis.name=Lapis Lazuli Panel Strip +tile.rppans.netherbrick.name=Nether Brick Panel Strip +tile.rpcov7.stonebrick.name=Stone Brick Anticover +tile.rpcover.stonebrick2.name=Stone Brick Cover +tile.rpcov5.gold.name=Gold Cover Slab +tile.rppole1.obsidian.name=Obsidian Post +tile.rpilamp.purple.name=Inverted Purple Lamp +tile.rpshlamp2.black.name=Black Cage Lamp +tile.rpslab.stone.name=Stone Slab +tile.rphcov7.greenSapphireBlock.name=Green Sapphire Block Hollow Anticover +tile.rpcov6.rubyBlock.name=Ruby Block Triple Panel +tile.rpcov6c.silverBlock.name=Silver Block Triple Panel Corner +tile.rphcover.greenSapphireBlock.name=Hollow Green Sapphire Block Cover +tile.rphcov7.tinBlock.name=Tin Block Hollow Anticover +tile.rparmcable.wood1.name=Spruce Wood Jacketed Cable +tile.rpcov3s.brick.name=Brick Triple Cover Strip +item.rplumar.lightBlue.name=Light Blue Lumar +tile.rparmcable.gold.name=Gold Jacketed Cable +tile.rppole1.planks.name=Wooden Plank Post +tile.rphcov7.wool.brown.name=Brown Wool Hollow Anticover +tile.rpcov5c.basalt.name=Basalt Cover Slab Corner +tile.rpcov3s.stonebrick1.name=Stone Brick Triple Cover Strip +item.paintbrush.brown.name=Brown Paint Brush +tile.rppole3.wool.orange.name=Orange Wool Column +tile.rpcov3s.books.name=Bookshelf Triple Cover Strip +tile.rppole1.stonebrick3.name=Stone Brick Post +tile.rphpanel.moss.name=Hollow Moss Stone Panel +tile.basaltCircle.name=Chiseled Basalt Brick +item.paintbrush.dry.name=Paint Brush +tile.rppanc.soul.name=Soul Sand Panel Corner +tile.rparmwire.wool.magenta.name=Magenta Wool Jacketed Wire +tile.rphcov6.marbleBrick.name=Marble Brick Hollow Triple Panel +tile.rpcov6c.wool.white.name=White Wool Triple Panel Corner +tile.rphpanel.cobble.name=Hollow Cobblestone Panel +tile.rpishlamp.yellow.name=Inverted Yellow Fixture +tile.rpcov6.basaltCobble.name=Basalt Cobblestone Triple Panel +item.dyeIndigo.name=Indigo Dye +tile.rppans.iron.name=Iron Panel Strip +tile.rphcover.wool.purple.name=Hollow Purple Wool Cover +tile.rpcov3.basaltBrick.name=Basalt Brick Triple Cover +tile.rpcov6s.dirt.name=Dirt Triple Panel Strip +tile.rppanel.obsidian.name=Obsidian Panel +tile.rpcov3s.basaltCircle.name=Chiseled Basalt Brick Triple Cover Strip +tile.rpcov3.wool.magenta.name=Magenta Wool Triple Cover +tile.rpcovs.silverBlock.name=Silver Block Cover Strip +tile.rphcov5.basaltPaver.name=Basalt Paver Hollow Cover Slab +tile.rphpanel.stonebrick3.name=Hollow Stone Brick Panel +tile.rpcov7c.wool.pink.name=Pink Wool Anticover Corner +tile.rpcover.wood2.name=Birch Wood Cover +tile.rphcov5.snow.name=Snow Hollow Cover Slab +tile.rphcov5.wool.green.name=Green Wool Hollow Cover Slab +tile.rpcov6s.basaltBrick.name=Basalt Brick Triple Panel Strip +tile.rpcov6.soul.name=Soul Sand Triple Panel +tile.rpcov6c.planks1.name=Wooden Plank Triple Panel Corner +tile.rpcov5c.diamond.name=Diamond Cover Slab Corner +tile.rpcov7.basaltPaver.name=Basalt Paver Anticover +tile.rpcovc.wool.cyan.name=Cyan Wool Cover Corner +tile.rppole2.wool.purple.name=Purple Wool Pillar +tile.rppans.glass.name=Glass Panel Strip +tile.rpcov7.wool.black.name=Black Wool Anticover +tile.rppole3.snow.name=Snow Column +tile.rpcover.basaltBrick.name=Basalt Brick Cover +tile.rphcov3.netherbrick.name=Nether Brick Hollow Triple Cover +tile.rpcov6.slab.name=Polished Stone Triple Panel +tile.rpcov7.wood.name=Oak Wood Anticover +item.hoeGreenSapphire.name=Green Sapphire Hoe +tile.rpcov3.wool.cyan.name=Cyan Wool Triple Cover +tile.rphslab.planks2.name=Hollow Wooden Plank Slab +tile.rpcov7.obsidian.name=Obsidian Anticover +tile.rpcov7c.wool.green.name=Green Wool Anticover Corner +tile.rpcovc.sandstone.name=Sandstone Cover Corner +tile.rphcover.wood1.name=Hollow Spruce Wood Cover +tile.rphcov3.wool.blue.name=Blue Wool Hollow Triple Cover +tile.rphcov5.basaltCircle.name=Chiseled Basalt Brick Hollow Cover Slab +tile.rphpanel.basalt.name=Hollow Basalt Panel +tile.rpcovs.pumpkin.name=Pumpkin Cover Strip +achievement.rpMakeAlloy.desc=Build an alloy furnace +tile.rpcov5c.gold.name=Gold Cover Slab Corner +tile.rpcov6c.stonebrick1.name=Stone Brick Triple Panel Corner +tile.rpslabs.marble.name=Marble Slab Strip +tile.rpcov7s.copperBlock.name=Copper Block Anticover Strip +tile.rppole3.netherbrick.name=Nether Brick Column +tile.rpcov3.sandstone.name=Sandstone Triple Cover +tile.rpcovs.brick.name=Brick Cover Strip +tile.rpcovc.sandstone2.name=Sandstone Cover Corner +tile.rparmwire.lapis.name=Lapis Lazuli Jacketed Wire +tile.rppans.netherrack.name=Netherrack Panel Strip +tile.rppole3.wool.gray.name=Gray Wool Column +tile.rpcov7s.dirt.name=Dirt Anticover Strip +tile.rpslabs.wool.gray.name=Gray Wool Slab Strip +tile.rpcov7c.wood2.name=Birch Wood Anticover Corner +tile.rppole3.wool.pink.name=Pink Wool Column +tile.rpcover.wool.lightBlue.name=Light Blue Wool Cover +tile.rpslabs.wool.pink.name=Pink Wool Slab Strip +tile.rparmbwire.wool.green.name=Green Wool Jacketed Bluewire +tile.rpcov3.marble.name=Marble Triple Cover +tile.rphcover.sandstone1.name=Hollow Sandstone Cover +tile.irtimer.name=Timer +tile.rppans.rplog.name=Rubberwood Panel Strip +item.paintbrush.blue.name=Blue Paint Brush +tile.rphcov3.wood.name=Oak Wood Hollow Triple Cover +tile.blockRuby.name=Ruby Block +tile.rphcov6.stonebrick.name=Stone Brick Hollow Triple Panel +achievement.rpAdvBench=Civilized Crafting +tile.rpinsulated.cyan.name=Cyan Insulated Wire +tile.rparmwire.sandstone1.name=Sandstone Jacketed Wire +tile.rpcov3c.wood1.name=Spruce Wood Triple Cover Corner +tile.rpcov5c.planks2.name=Wooden Plank Cover Slab Corner +tile.rppans.obsidian.name=Obsidian Panel Strip +item.paintcan.blue.name=Blue Paint +tile.rpcov5s.basaltCobble.name=Basalt Cobblestone Cover Slab Strip +tile.rpslabc.wool.blue.name=Blue Wool Slab Corner +achievement.rpIngotRed=Won't Blow Away\! +tile.rppole1.wool.silver.name=Light Gray Wool Post +tile.rpcov5.basaltCobble.name=Basalt Cobblestone Cover Slab +tile.rppanc.basaltCircle.name=Chiseled Basalt Brick Panel Corner +tile.rpilamp.green.name=Inverted Green Lamp +tile.rppole1.wood.name=Oak Wood Post +tile.rpcov5.snow.name=Snow Cover Slab +tile.rpcov3.tinBlock.name=Tin Block Triple Cover +tile.rpshlamp2.silver.name=Light Gray Cage Lamp +tile.rphcov7.marble.name=Marble Hollow Anticover +tile.rphpanel.wool.silver.name=Hollow Light Gray Wool Panel +tile.rppanc.marbleBrick.name=Marble Brick Panel Corner +tile.rpcov3s.moss.name=Moss Stone Triple Cover Strip +tile.rppanc.wool.magenta.name=Magenta Wool Panel Corner +tile.rpcovs.gold.name=Gold Cover Strip +tile.rpcov5s.basaltBrick.name=Basalt Brick Cover Slab Strip +tile.rparmbwire.basaltBrick.name=Basalt Brick Jacketed Bluewire +tile.rpcov5.wool.lightBlue.name=Light Blue Wool Cover Slab +tile.rpslab.wool.red.name=Red Wool Slab +tile.rphcov6.wool.gray.name=Gray Wool Hollow Triple Panel +tile.rppanc.wool.black.name=Black Wool Panel Corner +tile.rparmcable.snow.name=Snow Jacketed Cable +tile.rpkgen.name=Kinetic Generator +tile.rparmcable.wool.brown.name=Brown Wool Jacketed Cable +tile.rphcov6.wool.pink.name=Pink Wool Hollow Triple Panel +item.handsawSapphire.name=Sapphire Handsaw +tile.rphcov5.obsidian.name=Obsidian Hollow Cover Slab +tile.rpcov3c.netherbrick.name=Nether Brick Triple Cover Corner +tile.rpcov3c.clay.name=Clay Triple Cover Corner +tile.rpcov6c.gold.name=Gold Triple Panel Corner +tile.rppole1.sapphireBlock.name=Sapphire Block Post +tile.rppanc.rubyBlock.name=Ruby Block Panel Corner +tile.rppole3.planks3.name=Wooden Plank Column +tile.rparmwire.marbleBrick.name=Marble Brick Jacketed Wire +tile.rpcover.planks.name=Wooden Plank Cover +tile.rppanel.moss.name=Moss Stone Panel +tile.rparmbwire.tinBlock.name=Tin Block Jacketed Bluewire +tile.rppans.wool.white.name=White Wool Panel Strip +tile.rplamp.yellow.name=Yellow Lamp +tile.rpcov7.rubyBlock.name=Ruby Block Anticover +tile.rpcov6.planks.name=Wooden Plank Triple Panel +tile.rphcov3.netherrack.name=Netherrack Hollow Triple Cover +tile.rppans.wool.yellow.name=Yellow Wool Panel Strip +tile.rpcov5s.planks.name=Wooden Plank Cover Slab Strip +tile.rpcov3.copperBlock.name=Copper Block Triple Cover +tile.rpaninv.name=Non-Invert Cell +tile.rphcov5.wool.lightBlue.name=Light Blue Wool Hollow Cover Slab +tile.rphcov6.silverBlock.name=Silver Block Hollow Triple Panel +item.iranode.name=Stone Anode +tile.rpcov5c.obsidian.name=Obsidian Cover Slab Corner +tile.rpslabc.sandstone1.name=Sandstone Slab Corner +tile.rpslabs.snow.name=Snow Slab Strip +tile.rpcov6c.sandstone2.name=Sandstone Triple Panel Corner +tile.rppans.wool.lightBlue.name=Light Blue Wool Panel Strip +tile.rppanel.netherbrick.name=Nether Brick Panel +tile.rppole3.soul.name=Soul Sand Column +tile.rphcov5.slab.name=Polished Stone Hollow Cover Slab +item.sickleSapphire.name=Sapphire Sickle +tile.rpcov5c.stonebrick1.name=Stone Brick Cover Slab Corner +tile.rpcov7c.sapphireBlock.name=Sapphire Block Anticover Corner +tile.rpcov6s.copperBlock.name=Copper Block Triple Panel Strip +tile.rphcov6.wood.name=Oak Wood Hollow Triple Panel +tile.rpcov5.cobble.name=Cobblestone Cover Slab +item.voltmeter.name=Voltmeter +tile.rpcov3.wool.green.name=Green Wool Triple Cover +tile.rphcover.wool.gray.name=Hollow Gray Wool Cover +tile.rparmwire.obsidian.name=Obsidian Jacketed Wire +tile.rpcovc.wood1.name=Spruce Wood Cover Corner +tile.rppans.wool.lime.name=Lime Wool Panel Strip +tile.rppole3.slab.name=Polished Stone Column +tile.rpslabs.obsidian.name=Obsidian Slab Strip +tile.rpcov3.wood.name=Oak Wood Triple Cover +tile.rphpanel.wool.gray.name=Hollow Gray Wool Panel +tile.rpcover.copperBlock.name=Copper Block Cover +tile.rppole1.marbleBrick.name=Marble Brick Post +tile.rpcov3s.glass.name=Glass Triple Cover Strip +tile.rpcov6s.wool.blue.name=Blue Wool Triple Panel Strip +tile.rpinsulated.white.name=White Insulated Wire +tile.rpcov3c.stonebrick.name=Stone Brick Triple Cover Corner +tile.rparmwire.planks.name=Wooden Plank Jacketed Wire +item.rplumar.green.name=Green Lumar +item.sickleGold.name=Gold Sickle +tile.rppans.cobble.name=Cobblestone Panel Strip +tile.rparmcable.basaltBrick.name=Basalt Brick Jacketed Cable +tile.rpcov5s.wood3.name=Jungle Wood Cover Slab Strip +tile.rpcov5c.wool.purple.name=Purple Wool Cover Slab Corner +tile.rparmcable.clay.name=Clay Jacketed Cable +tile.rpcov3c.slab.name=Polished Stone Triple Cover Corner +tile.rphcov5.netherrack.name=Netherrack Hollow Cover Slab +tile.rpslab.stonebrick3.name=Stone Brick Slab +tile.rpcov3s.planks3.name=Wooden Plank Triple Cover Strip +tile.rpcov7c.gold.name=Gold Anticover Corner +tile.rpcov6.planks3.name=Wooden Plank Triple Panel +tile.rpslabc.basaltBrick.name=Basalt Brick Slab Corner +tile.rparmcable.planks1.name=Wooden Plank Jacketed Cable +tile.rpcov7.stonebrick2.name=Stone Brick Anticover +tile.rphcov3.wool.white.name=White Wool Hollow Triple Cover +tile.rppanc.planks1.name=Wooden Plank Panel Corner +item.rplumar.blue.name=Blue Lumar +tile.rpcov3c.wool.cyan.name=Cyan Wool Triple Cover Corner +tile.rpcov7c.wool.magenta.name=Magenta Wool Anticover Corner +tile.rphcov7.wool.silver.name=Light Gray Wool Hollow Anticover +tile.rpcov7s.wood1.name=Spruce Wood Anticover Strip +tile.rpcovc.wool.magenta.name=Magenta Wool Cover Corner +tile.rppole1.planks2.name=Wooden Plank Post +tile.rpcovc.netherbrick.name=Nether Brick Cover Corner +tile.rpslabs.netherbrick.name=Nether Brick Slab Strip +tile.rparmbwire.moss.name=Moss Stone Jacketed Bluewire +tile.rpcov5.basalt.name=Basalt Cover Slab +tile.rpcov5.wool.green.name=Green Wool Cover Slab +item.pickaxeSapphire.name=Sapphire Pickaxe +tile.rpshlamp.white.name=White Fixture +tile.rpshlamp2.green.name=Green Cage Lamp +tile.rpcov7c.netherrack.name=Netherrack Anticover Corner +tile.rpslab.moss.name=Moss Stone Slab +tile.rpslabs.wool.green.name=Green Wool Slab Strip +tile.rphcov6.sapphireBlock.name=Sapphire Block Hollow Triple Panel +tile.rpcov5.soul.name=Soul Sand Cover Slab +tile.rpslabs.basaltCircle.name=Chiseled Basalt Brick Slab Strip +tile.rppole2.wool.cyan.name=Cyan Wool Pillar +tile.rphcov6.planks1.name=Wooden Plank Hollow Triple Panel +tile.rpcov3c.wool.red.name=Red Wool Triple Cover Corner +tile.rpcov3c.sandstone.name=Sandstone Triple Cover Corner +tile.rphcov7.sapphireBlock.name=Sapphire Block Hollow Anticover +tile.rppanc.wood3.name=Jungle Wood Panel Corner +tile.rppole3.wool.yellow.name=Yellow Wool Column +tile.rppole2.snow.name=Snow Pillar +tile.rpcovs.snow.name=Snow Cover Strip +tile.rppans.basalt.name=Basalt Panel Strip +tile.rphcov5.basaltBrick.name=Basalt Brick Hollow Cover Slab +tile.rpcov6.wool.red.name=Red Wool Triple Panel +tile.rpcov5s.moss.name=Moss Stone Cover Slab Strip +item.ingotBlue.name=Blue Alloy Ingot +tile.rphslab.netherbrick.name=Hollow Nether Brick Slab +tile.rparmbwire.basaltCircle.name=Chiseled Basalt Brick Jacketed Bluewire +item.swordSapphire.name=Sapphire Sword +tile.rpcov5s.copperBlock.name=Copper Block Cover Slab Strip +tile.rpcovs.sandstone1.name=Sandstone Cover Strip +tile.rparmbwire.copperBlock.name=Copper Block Jacketed Bluewire +tile.rppole2.sandstone.name=Sandstone Pillar +tile.rparmcable.slab.name=Polished Stone Jacketed Cable +tile.rpcovs.wool.blue.name=Blue Wool Cover Strip +tile.rparmbwire.netherrack.name=Netherrack Jacketed Bluewire +tile.rphcov3.stonebrick1.name=Stone Brick Hollow Triple Cover +tile.rpcov6c.wood2.name=Birch Wood Triple Panel Corner +tile.rpcov7c.stonebrick3.name=Stone Brick Anticover Corner +tile.rphcov3.wool.lime.name=Lime Wool Hollow Triple Cover +tile.rpcov5c.clay.name=Clay Cover Slab Corner +tile.rpcov5c.wool.cyan.name=Cyan Wool Cover Slab Corner +tile.irstate.name=State Cell +tile.rpcov7s.sapphireBlock.name=Sapphire Block Anticover Strip +tile.rparmbwire.wool.magenta.name=Magenta Wool Jacketed Bluewire +tile.rpainv.name=Invert Cell +tile.rpcov5.tinBlock.name=Tin Block Cover Slab +tile.rpcov5.stonebrick1.name=Stone Brick Cover Slab +tile.rphcov5.wool.cyan.name=Cyan Wool Hollow Cover Slab +tile.rpcover.diamond.name=Diamond Cover +tile.rpslabs.soul.name=Soul Sand Slab Strip +tile.rpcov7.wool.green.name=Green Wool Anticover +tile.rparmcable.wood3.name=Jungle Wood Jacketed Cable +tile.rppanc.wool.brown.name=Brown Wool Panel Corner +tile.rprstube.name=Redstone Tube +tile.rpcov3s.stonebrick3.name=Stone Brick Triple Cover Strip +tile.rpinsulated.orange.name=Orange Insulated Wire +tile.rphcov3.wool.purple.name=Purple Wool Hollow Triple Cover +tile.rpcov5c.sandstone.name=Sandstone Cover Slab Corner +tile.rphcov6.marble.name=Marble Hollow Triple Panel +tile.rpcov7c.wool.white.name=White Wool Anticover Corner +tile.rpcov6.stonebrick.name=Stone Brick Triple Panel +tile.rppans.sandstone2.name=Sandstone Panel Strip +tile.rpcov7.sapphireBlock.name=Sapphire Block Anticover +item.paintbrush.lime.name=Lime Paint Brush +tile.rpcov3c.wool.yellow.name=Yellow Wool Triple Cover Corner +tile.rpcov5s.stonebrick.name=Stone Brick Cover Slab Strip +tile.rphcov3.planks.name=Wooden Plank Hollow Triple Cover +tile.rphcov7.snow.name=Snow Hollow Anticover +tile.rpcov6c.obsidian.name=Obsidian Triple Panel Corner +tile.rparmbwire.marble.name=Marble Jacketed Bluewire +item.paintcan.lime.name=Lime Paint +tile.rphcov5.sandstone.name=Sandstone Hollow Cover Slab +tile.rpslabc.wool.lime.name=Lime Wool Slab Corner +tile.rpcov7s.netherbrick.name=Nether Brick Anticover Strip +tile.rpshlamp.magenta.name=Magenta Fixture +tile.rpcov5.wool.purple.name=Purple Wool Cover Slab +tile.rparmbwire.wood2.name=Birch Wood Jacketed Bluewire +tile.rpcov3.wool.orange.name=Orange Wool Triple Cover +tile.rpcover.wool.white.name=White Wool Cover +tile.rpcov5s.brick.name=Brick Cover Slab Strip +tile.rppole3.planks.name=Wooden Plank Column +tile.rpcov6s.moss.name=Moss Stone Triple Panel Strip +tile.rppanc.greenSapphireBlock.name=Green Sapphire Block Panel Corner +tile.rpcov5s.books.name=Bookshelf Cover Slab Strip +tile.rpcov6c.planks3.name=Wooden Plank Triple Panel Corner +item.handsawIron.name=Iron Handsaw +tile.rppole1.silverBlock.name=Silver Block Post +tile.rpcov7c.wool.cyan.name=Cyan Wool Anticover Corner +item.rplumar.yellow.name=Yellow Lumar +tile.rpcable.brown.name=Brown Bundled Cable +tile.rparmbwire.wool.white.name=White Wool Jacketed Bluewire +tile.rpcov6s.wool.orange.name=Orange Wool Triple Panel Strip +tile.rphpanel.wool.red.name=Hollow Red Wool Panel +tile.rppanel.wool.yellow.name=Yellow Wool Panel +item.rplumar.red.name=Red Lumar +tile.rpcov5c.slab.name=Polished Stone Cover Slab Corner +tile.rplamp.white.name=White Lamp +tile.rpcov6c.clay.name=Clay Triple Panel Corner +tile.rphpanel.silverBlock.name=Hollow Silver Block Panel +tile.rpcover.wool.orange.name=Orange Wool Cover +tile.rpcover.planks2.name=Wooden Plank Cover +tile.rpcov6s.sandstone1.name=Sandstone Triple Panel Strip +tile.rpcov6.netherbrick.name=Nether Brick Triple Panel +tile.rpcov3.netherrack.name=Netherrack Triple Cover +tile.rphcover.wood3.name=Hollow Jungle Wood Cover +tile.rpcov7c.sandstone.name=Sandstone Anticover Corner +tile.rphcov3.tinBlock.name=Tin Block Hollow Triple Cover +tile.rphcov6.wool.lightBlue.name=Light Blue Wool Hollow Triple Panel +tile.rpcovs.wool.red.name=Red Wool Cover Strip +tile.rppanel.planks2.name=Wooden Plank Panel +tile.rpcov5s.wool.black.name=Black Wool Cover Slab Strip +tile.rpcov6.wool.blue.name=Blue Wool Triple Panel +tile.rpcover.pumpkin.name=Pumpkin Cover +item.paintbrush.lightBlue.name=Light Blue Paint Brush +tile.rpcov6c.stonebrick3.name=Stone Brick Triple Panel Corner +tile.rphcov3.sandstone2.name=Sandstone Hollow Triple Cover +tile.rphcover.wool.silver.name=Hollow Light Gray Wool Cover +tile.rpslab.marble.name=Marble Slab +tile.rppole2.soul.name=Soul Sand Pillar +tile.rppanel.cobble.name=Cobblestone Panel +tile.rphcov5.wood.name=Oak Wood Hollow Cover Slab +tile.rpcovs.soul.name=Soul Sand Cover Strip +tile.rpslabc.wood1.name=Spruce Wood Slab Corner +tile.rpslab.marbleBrick.name=Marble Brick Slab +tile.rpshlamp.lime.name=Lime Fixture +tile.rpcover.wool.gray.name=Gray Wool Cover +tile.rpishlamp2.green.name=Inverted Green Cage Lamp +tile.rpcov7s.wool.lightBlue.name=Light Blue Wool Anticover Strip +tile.rppans.wood2.name=Birch Wood Panel Strip +tile.rpcover.wool.pink.name=Pink Wool Cover +tile.rppanel.wool.gray.name=Gray Wool Panel +tile.rpcov6c.planks.name=Wooden Plank Triple Panel Corner +tile.rpcovs.slab.name=Polished Stone Cover Strip +tile.rpcov3c.wood3.name=Jungle Wood Triple Cover Corner +tile.rppanel.wool.pink.name=Pink Wool Panel +tile.rplamp.gray.name=Gray Lamp +tile.rpcov7s.moss.name=Moss Stone Anticover Strip +achievement.rpDeploy=Steve in a Box +tile.rphcov5.copperBlock.name=Copper Block Hollow Cover Slab +tile.rplamp.pink.name=Pink Lamp +tile.rppole2.wool.silver.name=Light Gray Wool Pillar +tile.rphcover.wool.black.name=Hollow Black Wool Cover +tile.rpslabs.wool.yellow.name=Yellow Wool Slab Strip +tile.rpcov6s.wool.lime.name=Lime Wool Triple Panel Strip +tile.rparmwire.moss.name=Moss Stone Jacketed Wire +tile.rparmcable.cobble.name=Cobblestone Jacketed Cable +tile.rparmwire.wool.black.name=Black Wool Jacketed Wire +tile.rphcov6.wool.green.name=Green Wool Hollow Triple Panel +tile.rpcovs.basaltBrick.name=Basalt Brick Cover Strip +tile.rpcov3c.basaltCircle.name=Chiseled Basalt Brick Triple Cover Corner +tile.rppanel.stonebrick.name=Stone Brick Panel +tile.rpcov6c.slab.name=Polished Stone Triple Panel Corner +tile.rpcov5.netherrack.name=Netherrack Cover Slab +tile.rpcovc.tinBlock.name=Tin Block Cover Corner +tile.rpcov7.copperBlock.name=Copper Block Anticover +tile.rpcov7c.clay.name=Clay Anticover Corner +tile.rpcov3c.wood.name=Oak Wood Triple Cover Corner +tile.rpslabs.netherrack.name=Netherrack Slab Strip +tile.rpcov3.obsidian.name=Obsidian Triple Cover +item.rplumar.purple.name=Purple Lumar +tile.rpcov3.wool.white.name=White Wool Triple Cover +tile.rpcov3c.wool.magenta.name=Magenta Wool Triple Cover Corner +tile.rparmbwire.wool.blue.name=Blue Wool Jacketed Bluewire +tile.rparmcable.books.name=Bookshelf Jacketed Cable +tile.rppanc.basaltPaver.name=Basalt Paver Panel Corner +tile.rppans.wool.magenta.name=Magenta Wool Panel Strip +tile.rparmwire.planks2.name=Wooden Plank Jacketed Wire +tile.rphslab.wool.yellow.name=Hollow Yellow Wool Slab +tile.rphslab.wool.lime.name=Hollow Lime Wool Slab +tile.rpslabc.iron.name=Iron Slab Corner +tile.rpcov5s.wool.orange.name=Orange Wool Cover Slab Strip +tile.rparmbwire.wool.orange.name=Orange Wool Jacketed Bluewire +tile.rppans.marble.name=Marble Panel Strip +tile.rppanel.basalt.name=Basalt Panel +tile.rphcov7.soul.name=Soul Sand Hollow Anticover +tile.rprtube.name=Restriction Tube +item.rplumar.white.name=White Lumar +tile.rphcov3.snow.name=Snow Hollow Triple Cover +tile.rptube.name=Pneumatic Tube +tile.rpcovc.rubyBlock.name=Ruby Block Cover Corner +tile.rpcov3c.planks.name=Wooden Plank Triple Cover Corner +tile.rpcov7s.diamond.name=Diamond Anticover Strip +tile.rphcov7.silverBlock.name=Silver Block Hollow Anticover +tile.rpcable.lightBlue.name=Light Blue Bundled Cable +item.handsawDiamond.name=Diamond Handsaw +tile.rpcov7c.marbleBrick.name=Marble Brick Anticover Corner +tile.rpcov5s.lapis.name=Lapis Lazuli Cover Slab Strip +tile.rparmwire.basaltPaver.name=Basalt Paver Jacketed Wire +tile.rpslab.basaltCircle.name=Chiseled Basalt Brick Slab +tile.rpishlamp.gray.name=Inverted Gray Fixture +tile.rppole2.diamond.name=Diamond Pillar +tile.rppole1.snow.name=Snow Post +tile.rphcover.basaltCobble.name=Hollow Basalt Cobblestone Cover +tile.rpishlamp.silver.name=Inverted Light Gray Fixture +tile.rpcov3.rubyBlock.name=Ruby Block Triple Cover +tile.rpishlamp.pink.name=Inverted Pink Fixture +tile.rphcover.iron.name=Hollow Iron Cover +tile.rpcov7c.sandstone2.name=Sandstone Anticover Corner +tile.rparmcable.basalt.name=Basalt Jacketed Cable +tile.rpslabc.wool.black.name=Black Wool Slab Corner +tile.rpregulate.name=Regulator +tile.rpcov7.sandstone.name=Sandstone Anticover +tile.rpcov5c.stonebrick3.name=Stone Brick Cover Slab Corner +tile.rppanc.moss.name=Moss Stone Panel Corner +tile.rpcov7.netherrack.name=Netherrack Anticover +tile.rpsolar.name=Solar Panel +tile.rphcov7.stonebrick.name=Stone Brick Hollow Anticover +tile.rpcovc.wood3.name=Jungle Wood Cover Corner +tile.rpcov3s.marbleBrick.name=Marble Brick Triple Cover Strip +tile.rpcable.name=Bundled Cable +tile.rpcover.sandstone2.name=Sandstone Cover +tile.rpcov5.wool.white.name=White Wool Cover Slab +tile.rparmcable.wood.name=Oak Wood Jacketed Cable +tile.rpcov7c.slab.name=Polished Stone Anticover Corner +tile.rpcovs.wool.lime.name=Lime Wool Cover Strip +tile.rpcov7s.wool.yellow.name=Yellow Wool Anticover Strip +tile.rpslabs.wool.white.name=White Wool Slab Strip +tile.rpcovc.wool.purple.name=Purple Wool Cover Corner +tile.rpslabs.wool.purple.name=Purple Wool Slab Strip +tile.rparmwire.wood2.name=Birch Wood Jacketed Wire +tile.rppole2.wool.magenta.name=Magenta Wool Pillar +tile.rparmbwire.sandstone2.name=Sandstone Jacketed Bluewire +achievement.rpPump=I Drink Your Milkshake\! +tile.rpcov3c.wool.green.name=Green Wool Triple Cover Corner +tile.rphcov6.wool.red.name=Red Wool Hollow Triple Panel +tile.rpcov6c.basaltCobble.name=Basalt Cobblestone Triple Panel Corner +tile.rparmcable.wool.lightBlue.name=Light Blue Wool Jacketed Cable +item.ingotCopper.name=Copper Ingot +tile.rparmcable.planks3.name=Wooden Plank Jacketed Cable +tile.rpcov6.greenSapphireBlock.name=Green Sapphire Block Triple Panel +item.paintcan.white.name=White Paint +tile.rpcov5s.glass.name=Glass Cover Slab Strip +tile.rpcov5s.wool.blue.name=Blue Wool Cover Slab Strip +tile.rppole2.planks.name=Wooden Plank Pillar +item.irwafer.name=Stone Wafer +tile.rppanc.planks3.name=Wooden Plank Panel Corner +tile.rpcover.basaltCobble.name=Basalt Cobblestone Cover +tile.rphcov6.snow.name=Snow Hollow Triple Panel +tile.rpslabc.wool.orange.name=Orange Wool Slab Corner +tile.rpcov5.diamond.name=Diamond Cover Slab +tile.rpcov7s.wood3.name=Jungle Wood Anticover Strip +tile.rpcovc.iron.name=Iron Cover Corner +tile.rpcov7.soul.name=Soul Sand Anticover +item.rpSeedBag.name=Seed Bag +tile.rpcov7s.pumpkin.name=Pumpkin Anticover Strip +tile.rphcov7.stonebrick1.name=Stone Brick Hollow Anticover +tile.rpcov3.snow.name=Snow Triple Cover +tile.rpishlamp2.cyan.name=Inverted Cyan Cage Lamp +tile.rpcov5c.sandstone1.name=Sandstone Cover Slab Corner +tile.rpcov3s.greenSapphireBlock.name=Green Sapphire Block Triple Cover Strip +tile.rppole2.pumpkin.name=Pumpkin Pillar +tile.rpcov3s.wood2.name=Birch Wood Triple Cover Strip +tile.rpcov7.basaltCircle.name=Chiseled Basalt Brick Anticover +tile.rppole1.cobble.name=Cobblestone Post +tile.rpmanager.name=Manager +tile.rphslab.dirt.name=Hollow Dirt Slab +tile.rpinsulated.yellow.name=Yellow Insulated Wire +tile.rphcov6.planks3.name=Wooden Plank Hollow Triple Panel +tile.rparmcable.lapis.name=Lapis Lazuli Jacketed Cable +tile.rpcov6c.marbleBrick.name=Marble Brick Triple Panel Corner +tile.rphcov6.basaltBrick.name=Basalt Brick Hollow Triple Panel +tile.rpcov5c.wood.name=Oak Wood Cover Slab Corner +item.swordGreenSapphire.name=Green Sapphire Sword +tile.rpshlamp.yellow.name=Yellow Fixture +tile.blockSilver.name=Silver Block +tile.rphcov5.wool.orange.name=Orange Wool Hollow Cover Slab +tile.rpcov5c.wool.silver.name=Light Gray Wool Cover Slab Corner +tile.rphcov3.stonebrick3.name=Stone Brick Hollow Triple Cover +tile.rpcov7s.wool.blue.name=Blue Wool Anticover Strip +tile.rphcover.wool.brown.name=Hollow Brown Wool Cover +tile.rpcov5s.rplog.name=Rubberwood Cover Slab Strip +tile.rpslabc.greenSapphireBlock.name=Green Sapphire Block Slab Corner +tile.rphcov3.soul.name=Soul Sand Hollow Triple Cover +tile.rparmwire.wool.brown.name=Brown Wool Jacketed Wire +tile.rparmwire.tinBlock.name=Tin Block Jacketed Wire +tile.rpcov6s.stone.name=Stone Triple Panel Strip +tile.rpcov6.wool.lime.name=Lime Wool Triple Panel +tile.rppanc.wool.lightBlue.name=Light Blue Wool Panel Corner +tile.rpcov6s.wool.yellow.name=Yellow Wool Triple Panel Strip +tile.rpcov3.sandstone2.name=Sandstone Triple Cover +tile.rphpanel.basaltCircle.name=Hollow Chiseled Basalt Brick Panel +tile.rpcov5.stonebrick3.name=Stone Brick Cover Slab +tile.rphcov6.netherrack.name=Netherrack Hollow Triple Panel +tile.rppole1.soul.name=Soul Sand Post +tile.rphcov7.dirt.name=Dirt Hollow Anticover +tile.rppole1.wool.magenta.name=Magenta Wool Post +tile.rphcover.gold.name=Hollow Gold Cover +tile.rphslab.planks.name=Hollow Wooden Plank Slab +tile.rpcover.wool.yellow.name=Yellow Wool Cover +tile.rphpanel.wool.magenta.name=Hollow Magenta Wool Panel +tile.rpslab.wool.pink.name=Pink Wool Slab +tile.rppole1.basalt.name=Basalt Post +tile.rphcover.planks2.name=Hollow Wooden Plank Cover +tile.rpcov5.pumpkin.name=Pumpkin Cover Slab +tile.rpcover.iron.name=Iron Cover +tile.rphcover.silverBlock.name=Hollow Silver Block Cover +tile.rparmcable.stonebrick.name=Stone Brick Jacketed Cable +tile.rpslab.greenSapphireBlock.name=Green Sapphire Block Slab +tile.rpcovc.books.name=Bookshelf Cover Corner +tile.rpcov6.wool.green.name=Green Wool Triple Panel +tile.rpcov6.wool.purple.name=Purple Wool Triple Panel +tile.rpcov5s.wool.green.name=Green Wool Cover Slab Strip +tile.rparmbwire.dirt.name=Dirt Jacketed Bluewire +tile.rpishlamp.green.name=Inverted Green Fixture +tile.rpcovs.wood2.name=Birch Wood Cover Strip +tile.rppanel.marble.name=Marble Panel +achievement.rpIngotBlue.desc=Smelt a blue alloy ingot +tile.rpcov6c.wood.name=Oak Wood Triple Panel Corner +tile.rpslab.dirt.name=Dirt Slab +tile.rppole2.silverBlock.name=Silver Block Pillar +tile.rpcov3c.rubyBlock.name=Ruby Block Triple Cover Corner +tile.rpcov3c.planks2.name=Wooden Plank Triple Cover Corner +tile.rpslabc.wool.gray.name=Gray Wool Slab Corner +tile.rpishlamp2.white.name=Inverted White Cage Lamp +tile.rpslabc.wool.brown.name=Brown Wool Slab Corner +tile.rpcov5.sandstone2.name=Sandstone Cover Slab +tile.rpslabc.basaltCircle.name=Chiseled Basalt Brick Slab Corner +tile.rparmbwire.wool.lime.name=Lime Wool Jacketed Bluewire +tile.rpslabs.sandstone2.name=Sandstone Slab Strip +tile.rpcov5c.marbleBrick.name=Marble Brick Cover Slab Corner +tile.rppole1.wood1.name=Spruce Wood Post +tile.rphslab.wood2.name=Hollow Birch Wood Slab +tile.rpshlamp.purple.name=Purple Fixture +tile.rphcov6.soul.name=Soul Sand Hollow Triple Panel +tile.rparmcable.marble.name=Marble Jacketed Cable +tile.rpcov3c.lapis.name=Lapis Lazuli Triple Cover Corner +tile.rphcov6.wool.white.name=White Wool Hollow Triple Panel +tile.rpcov7s.sandstone1.name=Sandstone Anticover Strip +tile.rppole2.rubyBlock.name=Ruby Block Pillar +tile.rpcov7.netherbrick.name=Nether Brick Anticover +tile.rpslabc.wool.magenta.name=Magenta Wool Slab Corner +tile.rpcov3.stonebrick2.name=Stone Brick Triple Cover +tile.rpcov6c.wool.cyan.name=Cyan Wool Triple Panel Corner +tile.rpcov6s.wool.red.name=Red Wool Triple Panel Strip +tile.rppanel.wool.magenta.name=Magenta Wool Panel +tile.rpcov3.soul.name=Soul Sand Triple Cover +tile.rppole3.greenSapphireBlock.name=Green Sapphire Block Column +tile.rpcov7.planks.name=Wooden Plank Anticover +tile.rppanc.basaltBrick.name=Basalt Brick Panel Corner +tile.rpcov6s.wool.black.name=Black Wool Triple Panel Strip +tile.rparmcable.basaltPaver.name=Basalt Paver Jacketed Cable +tile.rpcov6c.sapphireBlock.name=Sapphire Block Triple Panel Corner +achievement.rpIngotBlue=Now in Blueberry\! +tile.rparmcable.rplog.name=Rubberwood Jacketed Cable +tile.rphcov3.wool.silver.name=Light Gray Wool Hollow Triple Cover +tile.rphcov3.obsidian.name=Obsidian Hollow Triple Cover +tile.rpcov3.planks1.name=Wooden Plank Triple Cover +tile.rphcover.tinBlock.name=Hollow Tin Block Cover +tile.rpsorter.name=Sorting Machine +tile.rpcov7.dirt.name=Dirt Anticover +tile.rppanel.wood2.name=Birch Wood Panel +tile.rpilamp.blue.name=Inverted Blue Lamp +tile.rppanc.sapphireBlock.name=Sapphire Block Panel Corner +item.sickleWood.name=Wood Sickle +tile.rparmbwire.wool.yellow.name=Yellow Wool Jacketed Bluewire +tile.rpslabc.basaltPaver.name=Basalt Paver Slab Corner +tile.rpcov3c.netherrack.name=Netherrack Triple Cover Corner +tile.rpslabc.wood3.name=Jungle Wood Slab Corner +tile.rphcov3.wood1.name=Spruce Wood Hollow Triple Cover +tile.rpcov6c.sandstone.name=Sandstone Triple Panel Corner +tile.rphcov6.wool.magenta.name=Magenta Wool Hollow Triple Panel +tile.rphcover.stonebrick1.name=Hollow Stone Brick Cover +item.rpbgear.name=Brass Gear +tile.irnor.name=NOR Gate +tile.rpcover.cobble.name=Cobblestone Cover +tile.rpcov5c.rubyBlock.name=Ruby Block Cover Slab Corner +tile.rpshlamp2.blue.name=Blue Cage Lamp +tile.rpcov6.cobble.name=Cobblestone Triple Panel +tile.rparmwire.basaltBrick.name=Basalt Brick Jacketed Wire +tile.rpcable.gray.name=Gray Bundled Cable +tile.rpcovs.diamond.name=Diamond Cover Strip +tile.rpcov5s.cobble.name=Cobblestone Cover Slab Strip +tile.rpcov7c.wood.name=Oak Wood Anticover Corner +tile.rpcable.pink.name=Pink Bundled Cable +tile.blockTin.name=Tin Block +tile.rpslab.basaltPaver.name=Basalt Paver Slab +tile.rphcov5.rubyBlock.name=Ruby Block Hollow Cover Slab +tile.rpcov6c.tinBlock.name=Tin Block Triple Panel Corner +tile.rparmwire.wool.gray.name=Gray Wool Jacketed Wire +tile.rppole2.stonebrick1.name=Stone Brick Pillar +tile.rparmwire.wool.pink.name=Pink Wool Jacketed Wire +tile.rplamp.cyan.name=Cyan Lamp +tile.rpcov6s.wood3.name=Jungle Wood Triple Panel Strip +tile.rphpanel.wood1.name=Hollow Spruce Wood Panel +tile.rpsortron.name=Sortron +tile.rpbuffer.name=Buffer +tile.rppole2.wood1.name=Spruce Wood Pillar +tile.rppanel.wool.green.name=Green Wool Panel +tile.rpcovc.obsidian.name=Obsidian Cover Corner +tile.rpcov5s.wool.lime.name=Lime Wool Cover Slab Strip +item.paintbrush.orange.name=Orange Paint Brush +tile.rpcov5s.tinBlock.name=Tin Block Cover Slab Strip +tile.irand.name=AND Gate +tile.rppole1.basaltBrick.name=Basalt Brick Post +tile.rpcov3s.wool.magenta.name=Magenta Wool Triple Cover Strip +tile.rpcovc.lapis.name=Lapis Lazuli Cover Corner +tile.rparmwire.cobble.name=Cobblestone Jacketed Wire +tile.rpcover.gold.name=Gold Cover +tile.irlatch.name=RS Latch +tile.rpmtube.name=Magtube +tile.rphpanel.sandstone1.name=Hollow Sandstone Panel +tile.rpilamp.lightBlue.name=Inverted Light Blue Lamp +tile.rpcov7c.rubyBlock.name=Ruby Block Anticover Corner +tile.rpcovs.wool.brown.name=Brown Wool Cover Strip +tile.rpcov5.wool.gray.name=Gray Wool Cover Slab +tile.rpcov3c.wool.white.name=White Wool Triple Cover Corner +tile.rpcover.basalt.name=Basalt Cover +tile.rpcov6.basalt.name=Basalt Triple Panel +item.ingotBrass.name=Brass Ingot +tile.rpcov5.wool.pink.name=Pink Wool Cover Slab +item.rplumar.gray.name=Gray Lumar +tile.rpslabs.moss.name=Moss Stone Slab Strip +tile.rpcov5s.basalt.name=Basalt Cover Slab Strip +item.rplumar.pink.name=Pink Lumar +tile.rpcovs.planks2.name=Wooden Plank Cover Strip +tile.rpcov3c.wool.silver.name=Light Gray Wool Triple Cover Corner +tile.rpshlamp.red.name=Red Fixture +tile.rpcov7c.basaltPaver.name=Basalt Paver Anticover Corner +tile.rpcov5.marbleBrick.name=Marble Brick Cover Slab +tile.rpcov3c.snow.name=Snow Triple Cover Corner +tile.rpcov3c.rplog.name=Rubberwood Triple Cover Corner +tile.rplamp.red.name=Red Lamp +tile.rpcov5s.stone.name=Stone Cover Slab Strip +tile.rpcov5s.stonebrick2.name=Stone Brick Cover Slab Strip +tile.rparmbwire.stonebrick2.name=Stone Brick Jacketed Bluewire +tile.rpcov6s.sapphireBlock.name=Sapphire Block Triple Panel Strip +tile.rpslabc.clay.name=Clay Slab Corner +tile.rppanc.stonebrick.name=Stone Brick Panel Corner +tile.rphcov5.wool.magenta.name=Magenta Wool Hollow Cover Slab +tile.rpcov7s.wool.lime.name=Lime Wool Anticover Strip +tile.rppole1.marble.name=Marble Post +tile.rphpanel.iron.name=Hollow Iron Panel +tile.rppans.sapphireBlock.name=Sapphire Block Panel Strip +tile.rphcov7.wool.green.name=Green Wool Hollow Anticover +tile.rppole3.wood1.name=Spruce Wood Column +item.paintbrush.green.name=Green Paint Brush +tile.rpcov3s.basaltPaver.name=Basalt Paver Triple Cover Strip +item.rplumar.silver.name=Light Gray Lumar +tile.rpslab.wood2.name=Birch Wood Slab +item.disk.forth.name=FORTH Boot Disk +tile.rphslab.basaltCobble.name=Hollow Basalt Cobblestone Slab +tile.rppanel.wool.silver.name=Light Gray Wool Panel +tile.rparmwire.dirt.name=Dirt Jacketed Wire +tile.rparmcable.wool.blue.name=Blue Wool Jacketed Cable +tile.rpcov6.netherrack.name=Netherrack Triple Panel +tile.rparmwire.basalt.name=Basalt Jacketed Wire +tile.rpcov5c.silverBlock.name=Silver Block Cover Slab Corner +tile.rphcov6.dirt.name=Dirt Hollow Triple Panel +tile.rpcov5s.netherrack.name=Netherrack Cover Slab Strip +tile.rpishlamp.purple.name=Inverted Purple Fixture +tile.rphcover.clay.name=Hollow Clay Cover +tile.rpcovs.wool.gray.name=Gray Wool Cover Strip +tile.rpcov7c.greenSapphireBlock.name=Green Sapphire Block Anticover Corner +tile.rpcov7c.wool.lightBlue.name=Light Blue Wool Anticover Corner +tile.rpslabc.diamond.name=Diamond Slab Corner +tile.rppanc.copperBlock.name=Copper Block Panel Corner +tile.rpslabc.brick.name=Brick Slab Corner +tile.rpcov6s.basaltCobble.name=Basalt Cobblestone Triple Panel Strip +tile.rpslabs.rubyBlock.name=Ruby Block Slab Strip +tile.rphcov5.wool.yellow.name=Yellow Wool Hollow Cover Slab +tile.rphcov6.sandstone2.name=Sandstone Hollow Triple Panel +tile.rpcov7s.wool.red.name=Red Wool Anticover Strip +tile.rpcov3s.diamond.name=Diamond Triple Cover Strip +tile.rpslabc.books.name=Bookshelf Slab Corner +tile.rppanc.stone.name=Stone Panel Corner +tile.rpcovc.wool.blue.name=Blue Wool Cover Corner +tile.rphcov5.wood1.name=Spruce Wood Hollow Cover Slab +tile.rpslab.wool.brown.name=Brown Wool Slab +tile.rpcov3.wood1.name=Spruce Wood Triple Cover +tile.rpslabs.wood2.name=Birch Wood Slab Strip +tile.rpcov7.wool.yellow.name=Yellow Wool Anticover +tile.indigo.name=Indigo Flower +tile.rphcov7.stonebrick3.name=Stone Brick Hollow Anticover +tile.rpcov6s.wool.brown.name=Brown Wool Triple Panel Strip +tile.rparmwire.copperBlock.name=Copper Block Jacketed Wire +tile.rpcov6s.brick.name=Brick Triple Panel Strip +tile.rpslabc.slab.name=Polished Stone Slab Corner +tile.rphslab.sandstone1.name=Hollow Sandstone Slab +tile.rparmcable.stonebrick2.name=Stone Brick Jacketed Cable +tile.rpcov5c.wool.black.name=Black Wool Cover Slab Corner +tile.rppans.gold.name=Gold Panel Strip +tile.rpcov6s.books.name=Bookshelf Triple Panel Strip +tile.rpcovc.rplog.name=Rubberwood Cover Corner +item.pickaxeRuby.name=Ruby Pickaxe +item.screwdriver.name=Screwdriver +tile.rppole2.sapphireBlock.name=Sapphire Block Pillar +tile.rpcovc.wool.silver.name=Light Gray Wool Cover Corner +tile.rpslabs.planks1.name=Wooden Plank Slab Strip +tile.rpslabs.wool.silver.name=Light Gray Wool Slab Strip +tile.rpeject.name=Ejector +tile.rphslab.moss.name=Hollow Moss Stone Slab +tile.rphcov5.diamond.name=Diamond Hollow Cover Slab +tile.rppanc.dirt.name=Dirt Panel Corner +tile.rphcov5.soul.name=Soul Sand Hollow Cover Slab +tile.rpslabc.stonebrick2.name=Stone Brick Slab Corner +tile.rpcov6c.basaltPaver.name=Basalt Paver Triple Panel Corner +tile.rpcov6.wool.white.name=White Wool Triple Panel +tile.rpcov7c.tinBlock.name=Tin Block Anticover Corner +tile.rphcov6.wool.orange.name=Orange Wool Hollow Triple Panel +tile.rparmcable.stone.name=Stone Jacketed Cable +tile.rpcov5s.wool.white.name=White Wool Cover Slab Strip +tile.rphcover.slab.name=Hollow Polished Stone Cover +tile.rpishlamp.white.name=Inverted White Fixture +tile.rpcovc.planks.name=Wooden Plank Cover Corner +tile.rpslabc.planks.name=Wooden Plank Slab Corner +tile.rpslabc.planks2.name=Wooden Plank Slab Corner +tile.rpcable.black.name=Black Bundled Cable +tile.rppole1.wool.blue.name=Blue Wool Post +tile.rpshlamp.blue.name=Blue Fixture +tile.rpcovs.basaltPaver.name=Basalt Paver Cover Strip +tile.rphslab.wool.silver.name=Hollow Light Gray Wool Slab +tile.rpcov6.dirt.name=Dirt Triple Panel +tile.rphcover.wool.pink.name=Hollow Pink Wool Cover +tile.rpcov5c.marble.name=Marble Cover Slab Corner +tile.rppole2.obsidian.name=Obsidian Pillar +tile.rpslabc.pumpkin.name=Pumpkin Slab Corner +item.waferSilicon.name=Silicon Wafer +tile.rphcov6.wood1.name=Spruce Wood Hollow Triple Panel +tile.rpilamp.lime.name=Inverted Lime Lamp +tile.rphpanel.wool.pink.name=Hollow Pink Wool Panel +tile.rpcov3s.pumpkin.name=Pumpkin Triple Cover Strip +tile.rubbersapling.name=Rubber Sapling +tile.rpcov3c.soul.name=Soul Sand Triple Cover Corner +tile.rphcov3.silverBlock.name=Silver Block Hollow Triple Cover +tile.rpcov3s.iron.name=Iron Triple Cover Strip +tile.rppole2.sandstone1.name=Sandstone Pillar +tile.rphcov5.stonebrick2.name=Stone Brick Hollow Cover Slab +tile.rppanel.netherrack.name=Netherrack Panel +tile.rpshlamp2.lime.name=Lime Cage Lamp +tile.rphcov7.moss.name=Moss Stone Hollow Anticover +tile.rphpanel.marbleBrick.name=Hollow Marble Brick Panel +tile.rpcov5c.snow.name=Snow Cover Slab Corner +item.shovelRuby.name=Ruby Shovel +tile.rpabench.name=Project Table +tile.rphslab.obsidian.name=Hollow Obsidian Slab +tile.rpcov3c.sandstone2.name=Sandstone Triple Cover Corner +tile.rpcov7.planks1.name=Wooden Plank Anticover +tile.rppans.stonebrick1.name=Stone Brick Panel Strip +tile.rpcov5.silverBlock.name=Silver Block Cover Slab +tile.rpishlamp2.red.name=Inverted Red Cage Lamp +tile.rpslab.wool.cyan.name=Cyan Wool Slab +tile.rparmcable.wool.green.name=Green Wool Jacketed Cable +tile.rphcov5.planks2.name=Wooden Plank Hollow Cover Slab +item.swordRuby.name=Ruby Sword +tile.rphslab.wool.blue.name=Hollow Blue Wool Slab +tile.rppanel.iron.name=Iron Panel +tile.rphcover.stone.name=Hollow Stone Cover +tile.rpcover.marble.name=Marble Cover +tile.rpslab.basaltBrick.name=Basalt Brick Slab +tile.rpcov6c.cobble.name=Cobblestone Triple Panel Corner +tile.rpcov7c.planks1.name=Wooden Plank Anticover Corner +tile.rpcov6c.diamond.name=Diamond Triple Panel Corner +tile.rphcov5.pumpkin.name=Pumpkin Hollow Cover Slab +tile.rpcov7s.wool.silver.name=Light Gray Wool Anticover Strip +tile.rpslabc.lapis.name=Lapis Lazuli Slab Corner +tile.rplamp.purple.name=Purple Lamp +tile.rpslab.sandstone.name=Sandstone Slab +tile.rppans.wool.purple.name=Purple Wool Panel Strip +tile.rpcover.clay.name=Clay Cover +tile.rparmbwire.wool.lightBlue.name=Light Blue Wool Jacketed Bluewire +item.paintbrush.magenta.name=Magenta Paint Brush +tile.rppole1.wood3.name=Jungle Wood Post +tile.rparmcable.obsidian.name=Obsidian Jacketed Cable +tile.rphpanel.marble.name=Hollow Marble Panel +tile.rppans.greenSapphireBlock.name=Green Sapphire Block Panel Strip +tile.rphcov7.wood1.name=Spruce Wood Hollow Anticover +tile.rphcov3.basaltCircle.name=Chiseled Basalt Brick Hollow Triple Cover +tile.rparmbwire.wool.gray.name=Gray Wool Jacketed Bluewire +tile.rpioexp.name=IO Expander +tile.rparmcable.soul.name=Soul Sand Jacketed Cable +tile.rpcov5.wood1.name=Spruce Wood Cover Slab +tile.rpslabs.wool.magenta.name=Magenta Wool Slab Strip +tile.rphcov7.netherrack.name=Netherrack Hollow Anticover +tile.rpcov3c.stone.name=Stone Triple Cover Corner +item.ircathode.name=Stone Cathode +tile.rppanel.wool.white.name=White Wool Panel +tile.rpcov3.planks3.name=Wooden Plank Triple Cover +tile.rpcov6s.lapis.name=Lapis Lazuli Triple Panel Strip +tile.rpcov6c.snow.name=Snow Triple Panel Corner +tile.rpassemble.name=Assembler +tile.rppanc.wool.orange.name=Orange Wool Panel Corner +tile.rpcov6s.greenSapphireBlock.name=Green Sapphire Block Triple Panel Strip +tile.irxnor.name=XNOR Gate +tile.rphcov5.wool.white.name=White Wool Hollow Cover Slab +tile.rphcover.obsidian.name=Hollow Obsidian Cover +tile.rphcov3.wood3.name=Jungle Wood Hollow Triple Cover +tile.rpcov6.wool.silver.name=Light Gray Wool Triple Panel +tile.rphcover.stonebrick3.name=Hollow Stone Brick Cover +tile.irnot.name=NOT Gate +tile.rpcov6s.planks1.name=Wooden Plank Triple Panel Strip +tile.rpcov5s.diamond.name=Diamond Cover Slab Strip +tile.rphcov7.wool.gray.name=Gray Wool Hollow Anticover +tile.rpishlamp2.orange.name=Inverted Orange Cage Lamp +tile.rphcov7.wool.pink.name=Pink Wool Hollow Anticover +tile.rpcov3s.wool.gray.name=Gray Wool Triple Cover Strip +tile.rpcov7.moss.name=Moss Stone Anticover +tile.rpcov3s.wool.pink.name=Pink Wool Triple Cover Strip +tile.rpcov6c.basalt.name=Basalt Triple Panel Corner +tile.rpslabc.glass.name=Glass Slab Corner +tile.rpcov7c.basaltBrick.name=Basalt Brick Anticover Corner +tile.rparmwire.wool.orange.name=Orange Wool Jacketed Wire +tile.rpcov3.basaltCobble.name=Basalt Cobblestone Triple Cover +tile.rphcov3.planks1.name=Wooden Plank Hollow Triple Cover +tile.rpcov3c.wool.blue.name=Blue Wool Triple Cover Corner +tile.rphcov5.dirt.name=Dirt Hollow Cover Slab +tile.rppole3.stonebrick1.name=Stone Brick Column +tile.rppole2.stonebrick3.name=Stone Brick Pillar +tile.rparmcable.wool.lime.name=Lime Wool Jacketed Cable +tile.rpcover.slab.name=Polished Stone Cover +tile.rphcov7.marbleBrick.name=Marble Brick Hollow Anticover +tile.rpcov5c.wool.brown.name=Brown Wool Cover Slab Corner +tile.rphpanel.wood3.name=Hollow Jungle Wood Panel +tile.rpshlamp.silver.name=Light Gray Fixture +tile.rppole2.wood3.name=Jungle Wood Pillar +tile.rpcov6c.pumpkin.name=Pumpkin Triple Panel Corner +tile.rpslab.iron.name=Iron Slab +tile.rpcov6.sandstone2.name=Sandstone Triple Panel +tile.rppole3.dirt.name=Dirt Column +tile.rphcover.cobble.name=Hollow Cobblestone Cover +tile.rphcov6.basaltPaver.name=Basalt Paver Hollow Triple Panel +tile.rpcov3s.basaltBrick.name=Basalt Brick Triple Cover Strip +tile.rppanc.wool.red.name=Red Wool Panel Corner +tile.rpcov5s.sandstone2.name=Sandstone Cover Slab Strip +tile.rpcov6s.glass.name=Glass Triple Panel Strip +tile.rpcov6.wood1.name=Spruce Wood Triple Panel +tile.rphcov7.wool.white.name=White Wool Hollow Anticover +tile.rpcovc.wool.lime.name=Lime Wool Cover Corner +tile.rpcov5c.soul.name=Soul Sand Cover Slab Corner +item.paintbrush.white.name=White Paint Brush +tile.rphcov3.moss.name=Moss Stone Hollow Triple Cover +tile.rpcov5s.obsidian.name=Obsidian Cover Slab Strip +tile.rpcov5s.iron.name=Iron Cover Slab Strip +tile.rppole3.wool.purple.name=Purple Wool Column +tile.rpcov3c.dirt.name=Dirt Triple Cover Corner +tile.rpcov7c.snow.name=Snow Anticover Corner +tile.rptransformer.name=Voltage Transformer +tile.rparmcable.copperBlock.name=Copper Block Jacketed Cable +tile.rpcov5s.wool.gray.name=Gray Wool Cover Slab Strip +tile.rpcov5s.planks2.name=Wooden Plank Cover Slab Strip +tile.rpcovc.stone.name=Stone Cover Corner +tile.rphcover.stonebrick.name=Hollow Stone Brick Cover +item.rplumar.magenta.name=Magenta Lumar +tile.rphpanel.wool.black.name=Hollow Black Wool Panel +tile.rpslab.sandstone1.name=Sandstone Slab +tile.rppole1.moss.name=Moss Stone Post +tile.rpslabc.wood.name=Oak Wood Slab Corner +tile.rparmwire.stonebrick.name=Stone Brick Jacketed Wire +tile.rppans.clay.name=Clay Panel Strip +tile.rpslabc.rplog.name=Rubberwood Slab Corner +tile.rpslab.tinBlock.name=Tin Block Slab +tile.rppole2.cobble.name=Cobblestone Pillar +tile.rpcovs.stonebrick2.name=Stone Brick Cover Strip +tile.rpgrate.name=Grate +tile.rpslabc.copperBlock.name=Copper Block Slab Corner +tile.rpilamp.white.name=Inverted White Lamp +tile.rpcov5s.pumpkin.name=Pumpkin Cover Slab Strip +achievement.rpFrames.desc=Build a Frame Motor +tile.rpcov6c.rubyBlock.name=Ruby Block Triple Panel Corner +tile.rpcov3c.stonebrick1.name=Stone Brick Triple Cover Corner +tile.rphcov5.wool.blue.name=Blue Wool Hollow Cover Slab +tile.rpslab.copperBlock.name=Copper Block Slab +tile.rppanc.brick.name=Brick Panel Corner +tile.rphcover.wood.name=Hollow Oak Wood Cover +tile.rphcover.basalt.name=Hollow Basalt Cover +tile.rppanc.wool.green.name=Green Wool Panel Corner +tile.rpcovc.silverBlock.name=Silver Block Cover Corner +tile.rpslabs.silverBlock.name=Silver Block Slab Strip +tile.rppanc.books.name=Bookshelf Panel Corner +tile.rppole3.wood3.name=Jungle Wood Column +tile.rpcov6s.rplog.name=Rubberwood Triple Panel Strip +tile.rpcovs.wool.lightBlue.name=Light Blue Wool Cover Strip +tile.rppole1.wool.lime.name=Lime Wool Post +tile.irsync.name=Synchronizer +tile.rpslab.planks1.name=Wooden Plank Slab +tile.rpcov5.dirt.name=Dirt Cover Slab +tile.rpinsulated.lime.name=Lime Insulated Wire +tile.rpcov7s.stone.name=Stone Anticover Strip +tile.rpcov6c.basaltBrick.name=Basalt Brick Triple Panel Corner +tile.rparmcable.netherrack.name=Netherrack Jacketed Cable +tile.rpcov3s.sandstone1.name=Sandstone Triple Cover Strip +tile.rpcov3.netherbrick.name=Nether Brick Triple Cover +tile.rppanel.stonebrick1.name=Stone Brick Panel +tile.rpcov3c.wool.purple.name=Purple Wool Triple Cover Corner +tile.rpwire.name=Red Alloy Wire +tile.rpcov7.wood1.name=Spruce Wood Anticover +tile.rppole3.wool.cyan.name=Cyan Wool Column +tile.rpcov6c.soul.name=Soul Sand Triple Panel Corner +tile.rpslabs.wool.cyan.name=Cyan Wool Slab Strip +tile.rpcov6s.iron.name=Iron Triple Panel Strip +tile.rparmcable.dirt.name=Dirt Jacketed Cable +tile.rpslabc.wool.red.name=Red Wool Slab Corner +tile.rpbackplane.name=Backplane +tile.rphcov6.moss.name=Moss Stone Hollow Triple Panel +tile.rpslabc.stonebrick.name=Stone Brick Slab Corner +tile.rpcov3.wool.lightBlue.name=Light Blue Wool Triple Cover +tile.rpcov6s.netherbrick.name=Nether Brick Triple Panel Strip +tile.rppole2.basalt.name=Basalt Pillar +tile.rparmcable.diamond.name=Diamond Jacketed Cable +tile.rphcov5.wood3.name=Jungle Wood Hollow Cover Slab +tile.rppans.slab.name=Polished Stone Panel Strip +tile.rppanc.diamond.name=Diamond Panel Corner +tile.rpcov3.wood3.name=Jungle Wood Triple Cover +tile.rpcov5.marble.name=Marble Cover Slab +tile.rparmcable.brick.name=Brick Jacketed Cable +tile.rpcable.green.name=Green Bundled Cable +tile.rpcov3.moss.name=Moss Stone Triple Cover +tile.rpcov5c.basaltCircle.name=Chiseled Basalt Brick Cover Slab Corner +tile.rpcov3s.wool.red.name=Red Wool Triple Cover Strip +tile.rppanel.sandstone2.name=Sandstone Panel +tile.rppole3.sandstone.name=Sandstone Column +tile.rpcov5c.wood1.name=Spruce Wood Cover Slab Corner +tile.rpcover.netherbrick.name=Nether Brick Cover +tile.rpslabs.sandstone.name=Sandstone Slab Strip +tile.rppanel.wool.purple.name=Purple Wool Panel +tile.rpdeploy.name=Deployer +tile.rpcov7s.wool.brown.name=Brown Wool Anticover Strip +tile.rphcov5.sandstone2.name=Sandstone Hollow Cover Slab +tile.rphslab.cobble.name=Hollow Cobblestone Slab +tile.irtoggle.name=Toggle Latch +tile.rpslabs.dirt.name=Dirt Slab Strip +tile.rpcov7c.copperBlock.name=Copper Block Anticover Corner +tile.rphcov3.wool.lightBlue.name=Light Blue Wool Hollow Triple Cover +tile.rpishlamp2.lightBlue.name=Inverted Light Blue Cage Lamp +tile.rphcov6.wool.cyan.name=Cyan Wool Hollow Triple Panel +tile.rphpanel.books.name=Hollow Bookshelf Panel +tile.rpcover.sandstone1.name=Sandstone Cover +tile.rpcov6s.planks.name=Wooden Plank Triple Panel Strip +tile.rphslab.wool.black.name=Hollow Black Wool Slab +tile.rpslabs.planks3.name=Wooden Plank Slab Strip +tile.rparmwire.greenSapphireBlock.name=Green Sapphire Block Jacketed Wire +tile.rpcov3.greenSapphireBlock.name=Green Sapphire Block Triple Cover +tile.rphcov3.sapphireBlock.name=Sapphire Block Hollow Triple Cover +tile.rpcov5c.sapphireBlock.name=Sapphire Block Cover Slab Corner +tile.rphcover.marbleBrick.name=Hollow Marble Brick Cover +tile.rpcovc.stonebrick1.name=Stone Brick Cover Corner +tile.rpslabs.stonebrick1.name=Stone Brick Slab Strip +tile.rparmcable.wool.white.name=White Wool Jacketed Cable +tile.rppans.planks1.name=Wooden Plank Panel Strip +tile.rpcov3s.copperBlock.name=Copper Block Triple Cover Strip +tile.rparmbwire.diamond.name=Diamond Jacketed Bluewire +tile.rpcov7c.obsidian.name=Obsidian Anticover Corner +tile.rphcov6.sandstone.name=Sandstone Hollow Triple Panel +tile.rpcov7c.soul.name=Soul Sand Anticover Corner +tile.rpcov3c.tinBlock.name=Tin Block Triple Cover Corner +tile.rpslab.wool.magenta.name=Magenta Wool Slab +tile.rpcov7s.iron.name=Iron Anticover Strip +tile.rpcov6c.marble.name=Marble Triple Panel Corner +tile.rpcovc.planks1.name=Wooden Plank Cover Corner +achievement.rpMakeSaw.desc=Craft a diamond handsaw +tile.rpcov5c.dirt.name=Dirt Cover Slab Corner +tile.rparmwire.iron.name=Iron Jacketed Wire +tile.rpcov6.tinBlock.name=Tin Block Triple Panel +tile.rppole2.marbleBrick.name=Marble Brick Pillar +tile.rphcov6.wood3.name=Jungle Wood Hollow Triple Panel +tile.rphcover.brick.name=Hollow Brick Cover +tile.rpshlamp2.white.name=White Cage Lamp +tile.rpcov6s.obsidian.name=Obsidian Triple Panel Strip +tile.rphcov7.sandstone2.name=Sandstone Hollow Anticover +tile.rphslab.stonebrick1.name=Hollow Stone Brick Slab +tile.rpcov5c.basaltBrick.name=Basalt Brick Cover Slab Corner +tile.rphcover.books.name=Hollow Bookshelf Cover +tile.rparmcable.pumpkin.name=Pumpkin Jacketed Cable +tile.rphslab.basalt.name=Hollow Basalt Slab +tile.rpslabs.greenSapphireBlock.name=Green Sapphire Block Slab Strip +tile.rppole1.basaltPaver.name=Basalt Paver Post +tile.rphcover.wool.cyan.name=Hollow Cyan Wool Cover +tile.rphcov6.stonebrick2.name=Stone Brick Hollow Triple Panel +tile.rppanc.pumpkin.name=Pumpkin Panel Corner +tile.rpcov6.moss.name=Moss Stone Triple Panel +tile.rpcov3s.planks.name=Wooden Plank Triple Cover Strip +tile.rppans.wool.gray.name=Gray Wool Panel Strip +tile.rpcov7.cobble.name=Cobblestone Anticover +tile.rphpanel.wool.cyan.name=Hollow Cyan Wool Panel +tile.rpcov7.planks3.name=Wooden Plank Anticover +tile.rppanc.lapis.name=Lapis Lazuli Panel Corner +tile.rppans.stonebrick3.name=Stone Brick Panel Strip +tile.rpslab.wool.lightBlue.name=Light Blue Wool Slab +tile.rppans.wool.pink.name=Pink Wool Panel Strip +tile.rpcov6.silverBlock.name=Silver Block Triple Panel +tile.rparmcable.wool.orange.name=Orange Wool Jacketed Cable +tile.rpcov7c.basaltCobble.name=Basalt Cobblestone Anticover Corner +tile.rpcov5s.netherbrick.name=Nether Brick Cover Slab Strip +tile.rparmbwire.netherbrick.name=Nether Brick Jacketed Bluewire +tile.rphpanel.basaltPaver.name=Hollow Basalt Paver Panel +tile.rpcov3.sapphireBlock.name=Sapphire Block Triple Cover +tile.rpcov7s.planks2.name=Wooden Plank Anticover Strip +tile.rphpanel.wool.brown.name=Hollow Brown Wool Panel +tile.rpcovc.basaltCobble.name=Basalt Cobblestone Cover Corner +tile.rpcov3c.wool.lime.name=Lime Wool Triple Cover Corner +tile.rpcover.wool.red.name=Red Wool Cover +tile.rpcover.wood.name=Oak Wood Cover +tile.rppanc.wool.blue.name=Blue Wool Panel Corner +tile.rphslab.wool.purple.name=Hollow Purple Wool Slab +tile.rppole1.sandstone1.name=Sandstone Post +tile.rphcover.sandstone.name=Hollow Sandstone Cover +tile.rpcovs.stonebrick.name=Stone Brick Cover Strip +tile.rppole2.planks2.name=Wooden Plank Pillar +tile.rpcov3c.brick.name=Brick Triple Cover Corner +tile.rpcov7.wool.blue.name=Blue Wool Anticover +tile.rphcov6.pumpkin.name=Pumpkin Hollow Triple Panel +tile.rphpanel.sandstone.name=Hollow Sandstone Panel +tile.rppole2.dirt.name=Dirt Pillar +tile.rpishlamp2.yellow.name=Inverted Yellow Cage Lamp +tile.rparmbwire.planks2.name=Wooden Plank Jacketed Bluewire +tile.rpcov3c.books.name=Bookshelf Triple Cover Corner +tile.rpcovs.dirt.name=Dirt Cover Strip +tile.rpcov7c.planks3.name=Wooden Plank Anticover Corner +tile.rphcov3.lapis.name=Lapis Lazuli Hollow Triple Cover +tile.rpcov3s.clay.name=Clay Triple Cover Strip +tile.rpcov6c.copperBlock.name=Copper Block Triple Panel Corner +tile.rpcov7.wool.white.name=White Wool Anticover +tile.rphcov7.planks1.name=Wooden Plank Hollow Anticover +tile.rppole2.wool.lime.name=Lime Wool Pillar +item.hoeRuby.name=Ruby Hoe +tile.rpslab.wool.orange.name=Orange Wool Slab +tile.oreGreenSapphire.name=Green Sapphire Ore +tile.rpcov7s.stonebrick1.name=Stone Brick Anticover Strip +tile.rparmbwire.pumpkin.name=Pumpkin Jacketed Bluewire +item.axeSapphire.name=Sapphire Axe +tile.rpcov6c.dirt.name=Dirt Triple Panel Corner +tile.rpdisplay.name=Monitor +tile.rpslabc.stone.name=Stone Slab Corner +tile.rppole3.wool.red.name=Red Wool Column +tile.rphcov7.wood3.name=Jungle Wood Hollow Anticover +tile.rpcov7.wool.magenta.name=Magenta Wool Anticover +tile.rpcovs.copperBlock.name=Copper Block Cover Strip +tile.rpcov5.wood3.name=Jungle Wood Cover Slab +tile.rppanc.netherrack.name=Netherrack Panel Corner +tile.rphcover.marble.name=Hollow Marble Cover +item.woolcard.name=Wool Card +item.sonicDriver.name=Sonic Screwdriver +tile.rpcov7.basalt.name=Basalt Anticover +tile.rppanc.glass.name=Glass Panel Corner +tile.rpcov5s.sapphireBlock.name=Sapphire Block Cover Slab Strip +tile.rphpanel.tinBlock.name=Hollow Tin Block Panel +tile.rpcov3.wool.yellow.name=Yellow Wool Triple Cover +tile.rphpanel.lapis.name=Hollow Lapis Lazuli Panel +tile.rpslabc.gold.name=Gold Slab Corner +tile.rpcov5c.wool.lime.name=Lime Wool Cover Slab Corner +tile.rpcov7s.wool.purple.name=Purple Wool Anticover Strip +tile.rpcov7.wool.silver.name=Light Gray Wool Anticover +tile.rpthermo.name=Thermopile +tile.rpcov6s.planks3.name=Wooden Plank Triple Panel Strip +tile.rppole3.sandstone1.name=Sandstone Column +tile.rplamp.magenta.name=Magenta Lamp +tile.rphpanel.planks1.name=Hollow Wooden Plank Panel +tile.rpcovs.wool.black.name=Black Wool Cover Strip +enchantment.damage.vorpal=Vorpal +tile.rppole2.tinBlock.name=Tin Block Pillar +tile.rparmcable.netherbrick.name=Nether Brick Jacketed Cable +tile.rphcov5.wool.lime.name=Lime Wool Hollow Cover Slab +tile.rpilamp.orange.name=Inverted Orange Lamp +tile.rpcov6.stonebrick1.name=Stone Brick Triple Panel +tile.rpcov5.planks2.name=Wooden Plank Cover Slab +tile.rphcov3.basaltBrick.name=Basalt Brick Hollow Triple Cover +tile.rpcovs.tinBlock.name=Tin Block Cover Strip +tile.rphcov3.wool.gray.name=Gray Wool Hollow Triple Cover +tile.rppole2.marble.name=Marble Pillar +tile.rpslabc.netherbrick.name=Nether Brick Slab Corner +tile.rpslab.stonebrick.name=Stone Brick Slab +tile.rphcov3.wool.pink.name=Pink Wool Hollow Triple Cover +tile.rphcov3.planks3.name=Wooden Plank Hollow Triple Cover +tile.rphslab.tinBlock.name=Hollow Tin Block Slab +tile.rplamp.silver.name=Light Gray Lamp +item.windmillWood.name=Wooden Windmill +tile.rpcov3s.slab.name=Polished Stone Triple Cover Strip +tile.rppole3.stonebrick3.name=Stone Brick Column +tile.rppans.wool.silver.name=Light Gray Wool Panel Strip +tile.rpcovc.brick.name=Brick Cover Corner +tile.rpcov5.basaltBrick.name=Basalt Brick Cover Slab +tile.rpcov7c.wool.orange.name=Orange Wool Anticover Corner +tile.rppanc.stonebrick2.name=Stone Brick Panel Corner +tile.rpcov6s.stonebrick.name=Stone Brick Triple Panel Strip +tile.rpcov7.greenSapphireBlock.name=Green Sapphire Block Anticover +tile.rphcover.lapis.name=Hollow Lapis Lazuli Cover +tile.rphslab.wool.brown.name=Hollow Brown Wool Slab +tile.rphcov7.basaltPaver.name=Basalt Paver Hollow Anticover +tile.rpishlamp2.blue.name=Inverted Blue Cage Lamp +tile.rparmcable.sandstone2.name=Sandstone Jacketed Cable +tile.rphcov5.moss.name=Moss Stone Hollow Cover Slab +tile.rpslab.rubyBlock.name=Ruby Block Slab +tile.rppanc.rplog.name=Rubberwood Panel Corner +tile.rparmcable.wool.gray.name=Gray Wool Jacketed Cable +tile.rparmwire.wool.lightBlue.name=Light Blue Wool Jacketed Wire +tile.rphpanel.glass.name=Hollow Glass Panel +tile.rppanc.wool.white.name=White Wool Panel Corner +tile.rpcov6.wood3.name=Jungle Wood Triple Panel +item.paintbrush.gray.name=Gray Paint Brush +tile.rppans.wood.name=Oak Wood Panel Strip +tile.rpinsulated.purple.name=Purple Insulated Wire +tile.rpcov3s.wool.orange.name=Orange Wool Triple Cover Strip +item.paintbrush.pink.name=Pink Paint Brush +item.paintcan.gray.name=Gray Paint +tile.rparmwire.stonebrick2.name=Stone Brick Jacketed Wire +tile.rppole3.moss.name=Moss Stone Column +item.paintcan.pink.name=Pink Paint +tile.rphcov5.planks.name=Wooden Plank Hollow Cover Slab +tile.rpcov6.basaltCircle.name=Chiseled Basalt Brick Triple Panel +tile.rpslabc.wool.pink.name=Pink Wool Slab Corner +tile.rphcov5.netherbrick.name=Nether Brick Hollow Cover Slab +tile.rpcov6s.stonebrick1.name=Stone Brick Triple Panel Strip +item.paintbrush.red.name=Red Paint Brush +tile.rparmcable.tinBlock.name=Tin Block Jacketed Cable +tile.rphcov3.rplog.name=Rubberwood Hollow Triple Cover +tile.rpcov7s.brick.name=Brick Anticover Strip +tile.rpcover.stonebrick1.name=Stone Brick Cover +tile.rpcov6.wool.magenta.name=Magenta Wool Triple Panel +tile.rphcover.wool.green.name=Hollow Green Wool Cover +tile.rpslab.wool.black.name=Black Wool Slab +tile.oreSapphire.name=Sapphire Ore +tile.rpcov3c.moss.name=Moss Stone Triple Cover Corner +tile.rpleaves.name=Leaves +tile.rparmwire.wool.green.name=Green Wool Jacketed Wire +tile.rpcovc.gold.name=Gold Cover Corner +tile.rpslab.obsidian.name=Obsidian Slab +tile.rpcov7s.books.name=Bookshelf Anticover Strip +item.ruby.name=Ruby +itemGroup.RPLights=RedPower Lighting +tile.rpcov3c.stonebrick3.name=Stone Brick Triple Cover Corner +tile.rpcable.white.name=White Bundled Cable +tile.rpcov6s.wool.purple.name=Purple Wool Triple Panel Strip +tile.rpcov5s.clay.name=Clay Cover Slab Strip +tile.rphcover.glass.name=Hollow Glass Cover +tile.rpcov3.lapis.name=Lapis Lazuli Triple Cover +tile.rppole1.stonebrick2.name=Stone Brick Post +tile.rppole2.wool.brown.name=Brown Wool Pillar +tile.rpcov6s.wood2.name=Birch Wood Triple Panel Strip +tile.rpcov5s.wool.yellow.name=Yellow Wool Cover Slab Strip +tile.rphslab.sapphireBlock.name=Hollow Sapphire Block Slab +tile.rphpanel.rplog.name=Hollow Rubberwood Panel +tile.rppole3.basaltCobble.name=Basalt Cobblestone Column +tile.rpcover.wool.purple.name=Purple Wool Cover +tile.rppans.marbleBrick.name=Marble Brick Panel Strip +tile.rpcov7c.planks.name=Wooden Plank Anticover Corner +tile.rpslab.planks3.name=Wooden Plank Slab +tile.rphpanel.stonebrick2.name=Hollow Stone Brick Panel +tile.rpcover.wood1.name=Spruce Wood Cover +item.disk.forthxp.name=Extended FORTH Disk +tile.rppanel.stonebrick3.name=Stone Brick Panel +tile.rpcov7.wood3.name=Jungle Wood Anticover +tile.rpslabc.snow.name=Snow Slab Corner +tile.rpcov7.sandstone2.name=Sandstone Anticover +tile.rphcov6.copperBlock.name=Copper Block Hollow Triple Panel +tile.rppole3.wool.silver.name=Light Gray Wool Column +tile.ircounter.name=Counter +tile.rpbtengine.name=Blulectric Engine +tile.rphcov7.wool.red.name=Red Wool Hollow Anticover +tile.rpcovc.greenSapphireBlock.name=Green Sapphire Block Cover Corner +tile.rpcov3s.wool.black.name=Black Wool Triple Cover Strip +tile.rpcov6c.wool.orange.name=Orange Wool Triple Panel Corner +tile.rppole1.wool.gray.name=Gray Wool Post +tile.rpcover.wool.cyan.name=Cyan Wool Cover +tile.rpcovc.cobble.name=Cobblestone Cover Corner +tile.rpshlamp.gray.name=Gray Fixture +tile.rpcov5.moss.name=Moss Stone Cover Slab +tile.rppanel.wool.cyan.name=Cyan Wool Panel +tile.rpcov3c.glass.name=Glass Triple Cover Corner +tile.rpinsulated.red.name=Red Insulated Wire +tile.rpslabc.wool.green.name=Green Wool Slab Corner +tile.rparmcable.moss.name=Moss Stone Jacketed Cable +tile.rpcov6s.wool.gray.name=Gray Wool Triple Panel Strip +tile.rphcov3.dirt.name=Dirt Hollow Triple Cover +tile.rpcovs.wool.orange.name=Orange Wool Cover Strip +tile.rpcov5c.wood3.name=Jungle Wood Cover Slab Corner +tile.rphslab.planks1.name=Hollow Wooden Plank Slab +tile.rphcover.snow.name=Hollow Snow Cover +tile.rpcov6s.wool.pink.name=Pink Wool Triple Panel Strip +tile.rpcov6s.wool.lightBlue.name=Light Blue Wool Triple Panel Strip +tile.rpcov5s.basaltCircle.name=Chiseled Basalt Brick Cover Slab Strip +tile.rphcov6.tinBlock.name=Tin Block Hollow Triple Panel +tile.rpcover.sandstone.name=Sandstone Cover +tile.rphcov5.greenSapphireBlock.name=Green Sapphire Block Hollow Cover Slab +tile.rphcover.rplog.name=Hollow Rubberwood Cover +tile.rparmwire.rubyBlock.name=Ruby Block Jacketed Wire +tile.rppanc.wool.lime.name=Lime Wool Panel Corner +tile.rpcov5.basaltCircle.name=Chiseled Basalt Brick Cover Slab +tile.rppanel.sandstone.name=Sandstone Panel +tile.rppole1.dirt.name=Dirt Post +tile.rpcov7.wool.lime.name=Lime Wool Anticover +tile.rpcov7s.planks.name=Wooden Plank Anticover Strip +tile.oreCopper.name=Copper Ore +tile.rpcov6c.wool.blue.name=Blue Wool Triple Panel Corner +tile.rpcov6s.clay.name=Clay Triple Panel Strip +tile.rpslab.sapphireBlock.name=Sapphire Block Slab +tile.rpcov7.marble.name=Marble Anticover +tile.rphpanel.basaltBrick.name=Hollow Basalt Brick Panel +tile.rpcovc.sandstone1.name=Sandstone Cover Corner +tile.rphcov3.marbleBrick.name=Marble Brick Hollow Triple Cover +tile.rppole3.diamond.name=Diamond Column +tile.rpcov5.copperBlock.name=Copper Block Cover Slab +tile.rparmcable.wool.yellow.name=Yellow Wool Jacketed Cable +tile.rpcov7c.wood1.name=Spruce Wood Anticover Corner +tile.rphslab.wool.gray.name=Hollow Gray Wool Slab +tile.rpcovc.stonebrick3.name=Stone Brick Cover Corner +tile.rpslabs.stonebrick3.name=Stone Brick Slab Strip +tile.bluewire1M.name=1MV Wire +item.seedFlax.name=Flax Seeds +item.nuggetSilver.name=Silver Nugget +tile.rppans.planks3.name=Wooden Plank Panel Strip +item.tinplate.name=Tinplate +tile.rpcovc.basalt.name=Basalt Cover Corner +tile.rpcov5s.wool.purple.name=Purple Wool Cover Slab Strip +itemGroup.RPMicroblocks=RedPower Microblocks +tile.rpcov5c.planks1.name=Wooden Plank Cover Slab Corner +tile.rphcover.basaltPaver.name=Hollow Basalt Paver Cover +tile.rparmbwire.wool.purple.name=Purple Wool Jacketed Bluewire +tile.rpslabc.wool.yellow.name=Yellow Wool Slab Corner +achievement.rpFrames=I Like to Move it, Move it. +tile.rppole1.stonebrick.name=Stone Brick Post +tile.rpcovc.planks3.name=Wooden Plank Cover Corner +tile.rpishlamp.cyan.name=Inverted Cyan Fixture +item.shovelGreenSapphire.name=Green Sapphire Shovel +tile.rpishlamp.red.name=Inverted Red Fixture +tile.rpcov3c.obsidian.name=Obsidian Triple Cover Corner +tile.rppole2.basaltCobble.name=Basalt Cobblestone Pillar +tile.rppole3.marbleBrick.name=Marble Brick Column +tile.rpcov7s.lapis.name=Lapis Lazuli Anticover Strip +item.finecopper.name=Fine Copper Wire +tile.rpslab.wool.yellow.name=Yellow Wool Slab +tile.rppanc.sandstone2.name=Sandstone Panel Corner +tile.rphslab.stonebrick3.name=Hollow Stone Brick Slab +tile.rphcov5.rplog.name=Rubberwood Hollow Cover Slab +tile.rpcov5c.stonebrick.name=Stone Brick Cover Slab Corner +tile.rpcov6.obsidian.name=Obsidian Triple Panel +tile.rpcov3.rplog.name=Rubberwood Triple Cover +tile.rpslabs.wood1.name=Spruce Wood Slab Strip +tile.rpcovc.glass.name=Glass Cover Corner +tile.rppole2.basaltPaver.name=Basalt Paver Pillar +tile.rpcov5c.moss.name=Moss Stone Cover Slab Corner +tile.rpcovs.netherbrick.name=Nether Brick Cover Strip +tile.marbleBrick.name=Marble Brick +tile.rpilamp.red.name=Inverted Red Lamp +tile.rppump.name=Pump +tile.rpcov3s.wool.lightBlue.name=Light Blue Wool Triple Cover Strip +tile.rpcovs.wool.pink.name=Pink Wool Cover Strip +tile.rplamp.lightBlue.name=Light Blue Lamp +tile.rppole3.rubyBlock.name=Ruby Block Column +tile.rpcov3.dirt.name=Dirt Triple Cover +item.paintcan.lightBlue.name=Light Blue Paint +tile.rpcov7s.clay.name=Clay Anticover Strip +tile.rpcov3s.wood.name=Oak Wood Triple Cover Strip +tile.rppole3.planks2.name=Wooden Plank Column +tile.rppole1.stone.name=Stone Post +item.athame.name=Athame +tile.rpcov7s.basaltCobble.name=Basalt Cobblestone Anticover Strip +tile.rpcov6.diamond.name=Diamond Triple Panel +tile.rpfilter.name=Filter +tile.rpcovs.basaltCobble.name=Basalt Cobblestone Cover Strip +tile.rpanc.name=Null Cell +tile.rpcov5c.greenSapphireBlock.name=Green Sapphire Block Cover Slab Corner +tile.rpslabc.soul.name=Soul Sand Slab Corner +tile.rpishlamp2.lime.name=Inverted Lime Cage Lamp +tile.rppole1.wool.black.name=Black Wool Post +tile.rpcovs.wool.green.name=Green Wool Cover Strip +tile.rppole3.pumpkin.name=Pumpkin Column +tile.rpslabs.iron.name=Iron Slab Strip +tile.rppans.silverBlock.name=Silver Block Panel Strip +tile.rphcover.netherrack.name=Hollow Netherrack Cover +tile.rpcov6c.sandstone1.name=Sandstone Triple Panel Corner +tile.rpcovc.sapphireBlock.name=Sapphire Block Cover Corner +tile.rphcov7.planks3.name=Wooden Plank Hollow Anticover +tile.rpcov3.wool.blue.name=Blue Wool Triple Cover +tile.rparmwire.netherrack.name=Netherrack Jacketed Wire +tile.rpafurnace.name=Alloy Furnace +tile.rpcov7s.stonebrick3.name=Stone Brick Anticover Strip +tile.rpcov7s.glass.name=Glass Anticover Strip +tile.rpcov3c.marbleBrick.name=Marble Brick Triple Cover Corner +tile.rppole2.moss.name=Moss Stone Pillar +tile.rpcovs.moss.name=Moss Stone Cover Strip +item.windSailWood.name=Wooden Sail +tile.rphcov3.stone.name=Stone Hollow Triple Cover +tile.rphcov7.basaltBrick.name=Basalt Brick Hollow Anticover +tile.rpcov7c.wool.yellow.name=Yellow Wool Anticover Corner +tile.rparmbwire.wool.red.name=Red Wool Jacketed Bluewire +tile.rphcov3.cobble.name=Cobblestone Hollow Triple Cover +tile.rphcov6.rubyBlock.name=Ruby Block Hollow Triple Panel +tile.rphcover.soul.name=Hollow Soul Sand Cover +tile.rppole3.sapphireBlock.name=Sapphire Block Column +tile.rpcov5c.books.name=Bookshelf Cover Slab Corner +tile.rpcov6c.moss.name=Moss Stone Triple Panel Corner +tile.rpcovc.clay.name=Clay Cover Corner +tile.rpram.name=8K RAM Module +tile.rpcover.snow.name=Snow Cover +tile.rphcov5.stonebrick1.name=Stone Brick Hollow Cover Slab +tile.rpcov5s.wood2.name=Birch Wood Cover Slab Strip +tile.rppole3.cobble.name=Cobblestone Column +tile.rpcov3s.wool.brown.name=Brown Wool Triple Cover Strip +tile.rphpanel.obsidian.name=Hollow Obsidian Panel +tile.rppanel.marbleBrick.name=Marble Brick Panel +tile.rphcov7.basaltCobble.name=Basalt Cobblestone Hollow Anticover +tile.rpcov3s.wool.yellow.name=Yellow Wool Triple Cover Strip +tile.rppole1.copperBlock.name=Copper Block Post +tile.rpslab.stonebrick2.name=Stone Brick Slab +tile.rphpanel.planks3.name=Hollow Wooden Plank Panel +tile.rppole1.basaltCobble.name=Basalt Cobblestone Post +tile.rpcov3s.planks2.name=Wooden Plank Triple Cover Strip +tile.rpcov6.planks2.name=Wooden Plank Triple Panel +tile.rphpanel.stone.name=Hollow Stone Panel +tile.rpinsulated.blue.name=Blue Insulated Wire +tile.rppole2.stone.name=Stone Pillar +tile.rpcov7.stonebrick1.name=Stone Brick Anticover +tile.rpcov6.stonebrick3.name=Stone Brick Triple Panel +tile.rpcov6s.tinBlock.name=Tin Block Triple Panel Strip +tile.rppole3.wool.black.name=Black Wool Column +tile.rphpanel.copperBlock.name=Hollow Copper Block Panel +tile.rpignite.name=Igniter +tile.rpcov6.pumpkin.name=Pumpkin Triple Panel +tile.rphcov5.wool.purple.name=Purple Wool Hollow Cover Slab +tile.rppole1.planks1.name=Wooden Plank Post +tile.rpcov7s.rplog.name=Rubberwood Anticover Strip +item.paintcan.orange.name=Orange Paint +tile.rpslabc.netherrack.name=Netherrack Slab Corner +tile.rpcovs.obsidian.name=Obsidian Cover Strip +tile.rpcable.orange.name=Orange Bundled Cable +tile.rphcover.wool.white.name=Hollow White Wool Cover +tile.rpcov6.wool.gray.name=Gray Wool Triple Panel +item.btbattery.name=BT Battery +tile.rpcov6.wool.pink.name=Pink Wool Triple Panel +tile.rpcov7s.stonebrick.name=Stone Brick Anticover Strip +tile.rparmwire.wool.white.name=White Wool Jacketed Wire +tile.rphcover.rubyBlock.name=Hollow Ruby Block Cover +tile.rpslab.wool.green.name=Green Wool Slab +tile.rphcov3.wool.cyan.name=Cyan Wool Hollow Triple Cover +tile.rphpanel.rubyBlock.name=Hollow Ruby Block Panel +tile.rphcov3.basalt.name=Basalt Hollow Triple Cover +tile.rpcov7.wool.purple.name=Purple Wool Anticover +tile.rppanc.wood2.name=Birch Wood Panel Corner +tile.rpcov6s.wool.green.name=Green Wool Triple Panel Strip +tile.rpcov5.wool.orange.name=Orange Wool Cover Slab +tile.rphpanel.gold.name=Hollow Gold Panel +tile.rpcovs.planks.name=Wooden Plank Cover Strip +tile.rpcover.wool.brown.name=Brown Wool Cover +tile.rpslabs.planks.name=Wooden Plank Slab Strip +item.sickleRuby.name=Ruby Sickle +tile.rppole3.basalt.name=Basalt Column +tile.rpcov5.rplog.name=Rubberwood Cover Slab +tile.rpinsulated.magenta.name=Magenta Insulated Wire +tile.rppole3.silverBlock.name=Silver Block Column +item.shovelSapphire.name=Sapphire Shovel +tile.rpcovc.slab.name=Polished Stone Cover Corner +tile.rphslab.iron.name=Hollow Iron Slab +tile.rpslabs.wool.lightBlue.name=Light Blue Wool Slab Strip +tile.rpcov7c.moss.name=Moss Stone Anticover Corner +tile.rpcov6.marble.name=Marble Triple Panel +tile.rpcovc.marbleBrick.name=Marble Brick Cover Corner +tile.rphcov3.sandstone.name=Sandstone Hollow Triple Cover +tile.rpslabs.marbleBrick.name=Marble Brick Slab Strip +tile.rpcov6s.stonebrick3.name=Stone Brick Triple Panel Strip +tile.rphcov6.netherbrick.name=Nether Brick Hollow Triple Panel +tile.irpulse.name=Pulse Former +tile.rpcov5s.marble.name=Marble Cover Slab Strip +tile.rpcov3.planks.name=Wooden Plank Triple Cover +tile.rpcov6c.wood1.name=Spruce Wood Triple Panel Corner +achievement.rpMakeAlloy=Mixed Metal Surprise +tile.rpcovs.sapphireBlock.name=Sapphire Block Cover Strip +tile.rpcov7c.stonebrick2.name=Stone Brick Anticover Corner +tile.rplamp.brown.name=Brown Lamp +tile.rparmcable.basaltCobble.name=Basalt Cobblestone Jacketed Cable +tile.rpcover.sapphireBlock.name=Sapphire Block Cover +tile.rpcovc.marble.name=Marble Cover Corner +tile.rpcover.stonebrick3.name=Stone Brick Cover +tile.rpcov3.pumpkin.name=Pumpkin Triple Cover +tile.rpslabc.wool.cyan.name=Cyan Wool Slab Corner +achievement.rpBreaker=OM NOM NOM\! +tile.blockSapphire.name=Sapphire Block +tile.rpcov5s.wood.name=Oak Wood Cover Slab Strip +tile.rppole3.stone.name=Stone Column +tile.rpcov6c.wool.lime.name=Lime Wool Triple Panel Corner +tile.blockGreenSapphire.name=Green Sapphire Block +tile.rpcov5c.basaltPaver.name=Basalt Paver Cover Slab Corner +tile.rparmcable.wood2.name=Birch Wood Jacketed Cable +tile.rpcov7s.wool.black.name=Black Wool Anticover Strip +tile.rparmbwire.wool.pink.name=Pink Wool Jacketed Bluewire +tile.rphslab.marbleBrick.name=Hollow Marble Brick Slab +tile.rpslabc.wool.white.name=White Wool Slab Corner +tile.rpcov3s.stonebrick2.name=Stone Brick Triple Cover Strip +tile.rpcovs.wool.yellow.name=Yellow Wool Cover Strip +item.planBlank.name=Blank Plan +tile.rphcov6.basaltCobble.name=Basalt Cobblestone Hollow Triple Panel +item.paintbrush.yellow.name=Yellow Paint Brush +tile.rppans.sandstone1.name=Sandstone Panel Strip +tile.rpslabc.sandstone.name=Sandstone Slab Corner +tile.rphcov3.wool.magenta.name=Magenta Wool Hollow Triple Cover +tile.rppans.snow.name=Snow Panel Strip +tile.rphcover.sapphireBlock.name=Hollow Sapphire Block Cover +tile.rphcov7.iron.name=Iron Hollow Anticover +tile.rparmwire.marble.name=Marble Jacketed Wire +tile.rpcov5c.lapis.name=Lapis Lazuli Cover Slab Corner +tile.rphcov5.stone.name=Stone Hollow Cover Slab +tile.rpcov6s.cobble.name=Cobblestone Triple Panel Strip +tile.rparmbwire.wood1.name=Spruce Wood Jacketed Bluewire +item.irtchip.name=Tainted Silicon Chip +tile.rpcov5.wool.red.name=Red Wool Cover Slab +tile.rpcover.wood3.name=Jungle Wood Cover +tile.rpcov3.stone.name=Stone Triple Cover +tile.rpcov3c.cobble.name=Cobblestone Triple Cover Corner +tile.basalt.name=Basalt +tile.rpcov3c.silverBlock.name=Silver Block Triple Cover Corner +tile.rphpanel.stonebrick.name=Hollow Stone Brick Panel +tile.rpcover.soul.name=Soul Sand Cover +tile.rphcov7.copperBlock.name=Copper Block Hollow Anticover +tile.rpinsulated.silver.name=Light Gray Insulated Wire +tile.rparmwire.basaltCobble.name=Basalt Cobblestone Jacketed Wire +tile.rppole1.wool.brown.name=Brown Wool Post +tile.rpcov6c.planks2.name=Wooden Plank Triple Panel Corner +tile.rphcover.basaltBrick.name=Hollow Basalt Brick Cover +tile.bluewire10.name=10kV Wire +tile.rphcov7.rubyBlock.name=Ruby Block Hollow Anticover +tile.rppole3.wool.lightBlue.name=Light Blue Wool Column +tile.rpcable.cyan.name=Cyan Bundled Cable +tile.rpcovs.netherrack.name=Netherrack Cover Strip +tile.rparmbwire.iron.name=Iron Jacketed Bluewire +tile.basaltCobble.name=Basalt Cobblestone +tile.rpcov3.wool.silver.name=Light Gray Wool Triple Cover +tile.rpcov7s.marbleBrick.name=Marble Brick Anticover Strip +tile.rpcov3s.basaltCobble.name=Basalt Cobblestone Triple Cover Strip +tile.rppanel.silverBlock.name=Silver Block Panel +tile.rphslab.planks3.name=Hollow Wooden Plank Slab +tile.rpcover.planks1.name=Wooden Plank Cover +tile.rparmwire.wool.cyan.name=Cyan Wool Jacketed Wire +tile.rphcover.wood2.name=Hollow Birch Wood Cover +tile.rppole2.basaltBrick.name=Basalt Brick Pillar +tile.rppole2.wool.blue.name=Blue Wool Pillar +tile.rpcov3s.gold.name=Gold Triple Cover Strip +tile.rpcov6s.wool.silver.name=Light Gray Wool Triple Panel Strip +tile.rppanel.planks1.name=Wooden Plank Panel +tile.rphcov6.obsidian.name=Obsidian Hollow Triple Panel +tile.rpcov5c.glass.name=Glass Cover Slab Corner +tile.rpcov6c.stonebrick2.name=Stone Brick Triple Panel Corner +tile.rppole1.wool.orange.name=Orange Wool Post +tile.rphcov3.sandstone1.name=Sandstone Hollow Triple Cover +tile.rpcov6s.basalt.name=Basalt Triple Panel Strip +tile.rppanc.netherbrick.name=Nether Brick Panel Corner +tile.rpcover.wool.silver.name=Light Gray Wool Cover +tile.rpcov5s.wool.pink.name=Pink Wool Cover Slab Strip +tile.rpcov7c.wood3.name=Jungle Wood Anticover Corner +tile.rpcov3.wool.lime.name=Lime Wool Triple Cover +tile.rpcov3c.basalt.name=Basalt Triple Cover Corner +tile.rparmwire.sandstone.name=Sandstone Jacketed Wire +tile.rppanc.wool.gray.name=Gray Wool Panel Corner +tile.rpslabs.diamond.name=Diamond Slab Strip +tile.rpshlamp2.orange.name=Orange Cage Lamp +item.paintcan.red.name=Red Paint +tile.rppole3.wool.brown.name=Brown Wool Column +tile.rphcov6.stone.name=Stone Hollow Triple Panel +tile.rpcovc.wool.black.name=Black Wool Cover Corner +tile.rphpanel.wool.orange.name=Hollow Orange Wool Panel +tile.rppans.wood1.name=Spruce Wood Panel Strip +tile.rphcov3.basaltPaver.name=Basalt Paver Hollow Triple Cover +tile.rppanel.gold.name=Gold Panel +tile.rphcover.sandstone2.name=Hollow Sandstone Cover +tile.rpcov6.marbleBrick.name=Marble Brick Triple Panel +tile.rpcov5c.wool.blue.name=Blue Wool Cover Slab Corner +tile.rparmwire.sandstone2.name=Sandstone Jacketed Wire +tile.rpcov3c.wood2.name=Birch Wood Triple Cover Corner +tile.rpcov5.wool.cyan.name=Cyan Wool Cover Slab +tile.rpcov5c.planks3.name=Wooden Plank Cover Slab Corner +tile.rpcov7.iron.name=Iron Anticover +item.rplumar.cyan.name=Cyan Lumar +tile.rppole1.brick.name=Brick Post +tile.rparmwire.netherbrick.name=Nether Brick Jacketed Wire +tile.rpcov5.basaltPaver.name=Basalt Paver Cover Slab +tile.rpcovs.wool.white.name=White Wool Cover Strip +tile.rppole1.books.name=Bookshelf Post +tile.rppole1.wool.red.name=Red Wool Post +tile.rpslab.netherrack.name=Netherrack Slab +tile.rphcover.basaltCircle.name=Hollow Chiseled Basalt Brick Cover +tile.rpcov5.sandstone.name=Sandstone Cover Slab +tile.rphslab.stonebrick.name=Hollow Stone Brick Slab +tile.rpcable.red.name=Red Bundled Cable +tile.rpcov5c.rplog.name=Rubberwood Cover Slab Corner +tile.oreNikolite.name=Nikolite Ore +tile.rphcov3.marble.name=Marble Hollow Triple Cover +tile.rpcov6s.netherrack.name=Netherrack Triple Panel Strip +tile.rpcov5c.wool.green.name=Green Wool Cover Slab Corner +tile.rparmwire.planks1.name=Wooden Plank Jacketed Wire +tile.rpcov7s.wool.gray.name=Gray Wool Anticover Strip +tile.rpcov6c.stone.name=Stone Triple Panel Corner +tile.rpcov7s.wool.pink.name=Pink Wool Anticover Strip +tile.rppans.soul.name=Soul Sand Panel Strip +tile.rphcov3.brick.name=Brick Hollow Triple Cover +tile.rphcov6.wool.yellow.name=Yellow Wool Hollow Triple Panel +achievement.rpIngotBrass=Brass Monkey +tile.rppole3.marble.name=Marble Column +item.paintcan.brown.name=Brown Paint +tile.rppanel.wool.red.name=Red Wool Panel +tile.rphcov3.books.name=Bookshelf Hollow Triple Cover +tile.rpcover.rubyBlock.name=Ruby Block Cover +tile.rphslab.silverBlock.name=Hollow Silver Block Slab +tile.rppanc.basaltCobble.name=Basalt Cobblestone Panel Corner +tile.rppole1.netherbrick.name=Nether Brick Post +tile.rpcov7c.wool.blue.name=Blue Wool Anticover Corner +tile.rppanel.rubyBlock.name=Ruby Block Panel +tile.rpcovs.wool.cyan.name=Cyan Wool Cover Strip +tile.rphpanel.clay.name=Hollow Clay Panel +tile.rpslabc.sandstone2.name=Sandstone Slab Corner +tile.rphcov7.stone.name=Stone Hollow Anticover +tile.rppole1.iron.name=Iron Post +tile.rpcov5.stone.name=Stone Cover Slab +tile.rpcov6c.basaltCircle.name=Chiseled Basalt Brick Triple Panel Corner +tile.rpcov7c.sandstone1.name=Sandstone Anticover Corner +tile.rpcov5s.wool.silver.name=Light Gray Wool Cover Slab Strip +tile.rpslabs.pumpkin.name=Pumpkin Slab Strip +tile.rparmbwire.wool.silver.name=Light Gray Wool Jacketed Bluewire +tile.rpcov5c.stonebrick2.name=Stone Brick Cover Slab Corner +tile.rphpanel.brick.name=Hollow Brick Panel +tile.rpcov6c.wool.lightBlue.name=Light Blue Wool Triple Panel Corner +tile.rppole2.brick.name=Brick Pillar +tile.rpcov5c.wool.magenta.name=Magenta Wool Cover Slab Corner +tile.rpcov6c.wool.black.name=Black Wool Triple Panel Corner +tile.rpcovc.wood.name=Oak Wood Cover Corner +tile.rpcable.yellow.name=Yellow Bundled Cable +tile.rparmbwire.gold.name=Gold Jacketed Bluewire +tile.rpcovs.sandstone.name=Sandstone Cover Strip +tile.rpcovc.wood2.name=Birch Wood Cover Corner +tile.rphcover.copperBlock.name=Hollow Copper Block Cover +tile.rpcover.basaltCircle.name=Chiseled Basalt Brick Cover +tile.rphcov6.diamond.name=Diamond Hollow Triple Panel +tile.rppole2.books.name=Bookshelf Pillar +tile.rpslab.gold.name=Gold Slab +tile.rppole2.stonebrick.name=Stone Brick Pillar +tile.rphcov6.planks.name=Wooden Plank Hollow Triple Panel +tile.rpcov7.wool.red.name=Red Wool Anticover +tile.rparmwire.wood1.name=Spruce Wood Jacketed Wire +tile.rparmbwire.planks.name=Wooden Plank Jacketed Bluewire +tile.rpcov3s.snow.name=Snow Triple Cover Strip +tile.rphcov7.wool.orange.name=Orange Wool Hollow Anticover +tile.rpshlamp2.red.name=Red Cage Lamp +tile.rpcov6s.wool.white.name=White Wool Triple Panel Strip +tile.rparmbwire.sandstone1.name=Sandstone Jacketed Bluewire +tile.rpcov7s.silverBlock.name=Silver Block Anticover Strip +tile.rpcov5s.gold.name=Gold Cover Slab Strip +tile.rppole2.copperBlock.name=Copper Block Pillar +tile.rpshlamp.lightBlue.name=Light Blue Fixture +tile.rphcov5.cobble.name=Cobblestone Hollow Cover Slab +tile.rpcov7.stonebrick3.name=Stone Brick Anticover +tile.rparmcable.planks2.name=Wooden Plank Jacketed Cable +tile.rpshlamp2.magenta.name=Magenta Cage Lamp +tile.rpcov6s.diamond.name=Diamond Triple Panel Strip +item.nuggetIron.name=Iron Nugget +tile.rpishlamp2.magenta.name=Inverted Magenta Cage Lamp +tile.rppole3.wool.blue.name=Blue Wool Column +item.sapphire.name=Sapphire +tile.rppanc.planks2.name=Wooden Plank Panel Corner +tile.rpslabs.wool.blue.name=Blue Wool Slab Strip +tile.rphcov6.iron.name=Iron Hollow Triple Panel +tile.rphpanel.slab.name=Hollow Polished Stone Panel +tile.rpcov7s.wood2.name=Birch Wood Anticover Strip +item.bouleSilicon.name=Silicon Boule +item.handsawRuby.name=Ruby Handsaw +tile.rppole1.planks3.name=Wooden Plank Post +tile.rpcov6.stone.name=Stone Triple Panel +tile.rppans.wool.red.name=Red Wool Panel Strip +tile.rpcov3.iron.name=Iron Triple Cover +item.paintcan.empty.name=Paint Can +tile.rphcov3.diamond.name=Diamond Hollow Triple Cover +tile.rppole1.lapis.name=Lapis Lazuli Post +tile.rpcov3s.wood1.name=Spruce Wood Triple Cover Strip +tile.rpslab.wool.lime.name=Lime Wool Slab +tile.rpilamp.magenta.name=Inverted Magenta Lamp +tile.rppole2.wool.black.name=Black Wool Pillar +tile.rpilamp.gray.name=Inverted Gray Lamp +tile.rppole3.brick.name=Brick Column +tile.rphcov6.planks2.name=Wooden Plank Hollow Triple Panel +tile.rpilamp.pink.name=Inverted Pink Lamp +tile.rpcov7s.wool.green.name=Green Wool Anticover Strip +item.drawplateDiamond.name=Diamond Drawplate +tile.rppole3.books.name=Bookshelf Column +tile.rpslabc.wool.silver.name=Light Gray Wool Slab Corner +tile.rpcov3c.wool.lightBlue.name=Light Blue Wool Triple Cover Corner +tile.rppanc.wool.yellow.name=Yellow Wool Panel Corner +tile.rpshlamp2.gray.name=Gray Cage Lamp +tile.rpshlamp2.pink.name=Pink Cage Lamp +tile.rpcovc.wool.brown.name=Brown Wool Cover Corner +tile.rpslab.planks.name=Wooden Plank Slab +tile.rpcov7c.cobble.name=Cobblestone Anticover Corner +tile.rphcov6.wool.blue.name=Blue Wool Hollow Triple Panel +tile.rppans.basaltBrick.name=Basalt Brick Panel Strip +tile.rpcov6s.marble.name=Marble Triple Panel Strip +tile.rpcov3c.marble.name=Marble Triple Cover Corner +tile.rppanc.planks.name=Wooden Plank Panel Corner +tile.rphcov5.wool.red.name=Red Wool Hollow Cover Slab +tile.rpcovs.sandstone2.name=Sandstone Cover Strip +tile.rphcov3.stonebrick2.name=Stone Brick Hollow Triple Cover +tile.rphslab.wool.lightBlue.name=Hollow Light Blue Wool Slab +tile.rpcov6c.wood3.name=Jungle Wood Triple Panel Corner +tile.rpcov6s.gold.name=Gold Triple Panel Strip +tile.rphcov5.brick.name=Brick Hollow Cover Slab +tile.rparmwire.wool.yellow.name=Yellow Wool Jacketed Wire +tile.rpcovc.basaltPaver.name=Basalt Paver Cover Corner +tile.rpslabs.basaltPaver.name=Basalt Paver Slab Strip +tile.rpcov3.brick.name=Brick Triple Cover +tile.rppanc.tinBlock.name=Tin Block Panel Corner +tile.rppanc.iron.name=Iron Panel Corner +tile.rpslabs.basaltCobble.name=Basalt Cobblestone Slab Strip +tile.rpcov3.sandstone1.name=Sandstone Triple Cover +tile.rphcov5.books.name=Bookshelf Hollow Cover Slab +tile.rpcov5.stonebrick2.name=Stone Brick Cover Slab +tile.rppans.dirt.name=Dirt Panel Strip +tile.rpcov3.books.name=Bookshelf Triple Cover +tile.rpcov5c.wool.red.name=Red Wool Cover Slab Corner +tile.rppole1.netherrack.name=Netherrack Post +tile.rppole1.glass.name=Glass Post +tile.rpcov6s.pumpkin.name=Pumpkin Triple Panel Strip +tile.rphcov5.wool.silver.name=Light Gray Wool Hollow Cover Slab +tile.rppanel.clay.name=Clay Panel +item.greenSapphire.name=Green Sapphire +tile.rpcov6s.silverBlock.name=Silver Block Triple Panel Strip +tile.rpcov7.stone.name=Stone Anticover +tile.rphslab.clay.name=Hollow Clay Slab +tile.rphcover.planks1.name=Hollow Wooden Plank Cover +tile.rparmbwire.basaltCobble.name=Basalt Cobblestone Jacketed Bluewire +item.disk.name=Blank Floppy +tile.rppole2.lapis.name=Lapis Lazuli Pillar +tile.rpcov6.iron.name=Iron Triple Panel +tile.rpcov5c.netherrack.name=Netherrack Cover Slab Corner +tile.rparmbwire.wool.cyan.name=Cyan Wool Jacketed Bluewire +tile.rpcover.silverBlock.name=Silver Block Cover +tile.rparmwire.wool.red.name=Red Wool Jacketed Wire +tile.rpinsulated.lightBlue.name=Light Blue Insulated Wire +tile.rppans.wool.black.name=Black Wool Panel Strip +tile.rphcov3.pumpkin.name=Pumpkin Hollow Triple Cover +tile.rpslabs.wool.red.name=Red Wool Slab Strip +tile.rparmbwire.wood3.name=Jungle Wood Jacketed Bluewire +tile.rppole1.wool.yellow.name=Yellow Wool Post +tile.rppans.planks.name=Wooden Plank Panel Strip +tile.rpcov7c.basalt.name=Basalt Anticover Corner +itemGroup.RPMachines=RedPower Machinery +tile.rpcovs.wood1.name=Spruce Wood Cover Strip +tile.rpcov3s.soul.name=Soul Sand Triple Cover Strip +item.ingotSilver.name=Silver Ingot +item.irpointer.name=Stone Pointer +tile.rpitemdet.name=Item Detector +tile.rpcov5c.stone.name=Stone Cover Slab Corner +tile.rphcov3.glass.name=Glass Hollow Triple Cover +tile.bluewire.name=Blue Alloy Wire +tile.rpshlamp2.yellow.name=Yellow Cage Lamp +tile.rpcov5s.snow.name=Snow Cover Slab Strip +tile.rphpanel.wool.yellow.name=Hollow Yellow Wool Panel +tile.rpcov3c.planks1.name=Wooden Plank Triple Cover Corner +tile.rphpanel.wool.green.name=Hollow Green Wool Panel +tile.rphcov7.wool.cyan.name=Cyan Wool Hollow Anticover +tile.rparmbwire.sandstone.name=Sandstone Jacketed Bluewire +tile.rppanc.wool.purple.name=Purple Wool Panel Corner +tile.rpcov3s.wool.cyan.name=Cyan Wool Triple Cover Strip +tile.rpcov5.sandstone1.name=Sandstone Cover Slab +tile.rpcov7s.gold.name=Gold Anticover Strip +tile.rppole3.basaltCircle.name=Chiseled Basalt Brick Column +tile.rpcov6c.wool.brown.name=Brown Wool Triple Panel Corner +tile.rphcover.wool.orange.name=Hollow Orange Wool Cover +tile.rphcov6.brick.name=Brick Hollow Triple Panel +tile.rpslabs.sandstone1.name=Sandstone Slab Strip +tile.rpslab.netherbrick.name=Nether Brick Slab +tile.rparmwire.gold.name=Gold Jacketed Wire +tile.rphslab.wood1.name=Hollow Spruce Wood Slab +tile.rphcover.moss.name=Hollow Moss Stone Cover +tile.rpishlamp2.purple.name=Inverted Purple Cage Lamp +tile.rppole1.rplog.name=Rubberwood Post +tile.rpcover.planks3.name=Wooden Plank Cover +tile.rphcov3.rubyBlock.name=Ruby Block Hollow Triple Cover +tile.rpcov7c.dirt.name=Dirt Anticover Corner +tile.rpcov6s.sandstone2.name=Sandstone Triple Panel Strip +tile.rphcov6.books.name=Bookshelf Hollow Triple Panel +tile.irbuf.name=Buffer Gate +tile.rppole3.basaltBrick.name=Basalt Brick Column +tile.rpinsulated.black.name=Black Insulated Wire +tile.rpcov3.stonebrick1.name=Stone Brick Triple Cover +tile.rphcov7.sandstone.name=Sandstone Hollow Anticover +tile.rpcovs.greenSapphireBlock.name=Green Sapphire Block Cover Strip +tile.rparmcable.wool.pink.name=Pink Wool Jacketed Cable +tile.rppanel.slab.name=Polished Stone Panel +tile.rppole2.glass.name=Glass Pillar +tile.rpcov3s.sandstone.name=Sandstone Triple Cover Strip +tile.rparmwire.wool.purple.name=Purple Wool Jacketed Wire +tile.rppanel.planks3.name=Wooden Plank Panel +tile.rpcov7c.wool.lime.name=Lime Wool Anticover Corner +tile.rpslabc.tinBlock.name=Tin Block Slab Corner +tile.rphslab.slab.name=Hollow Polished Stone Slab +tile.rpcov5c.copperBlock.name=Copper Block Cover Slab Corner +tile.rppole2.wool.orange.name=Orange Wool Pillar +achievement.rpMakeSaw=It Slices, it Dices +tile.rppole3.lapis.name=Lapis Lazuli Column +tile.rpcov5c.wool.white.name=White Wool Cover Slab Corner +tile.basaltBrick.name=Basalt Brick +tile.rppanel.wood1.name=Spruce Wood Panel +tile.rpcov7s.obsidian.name=Obsidian Anticover Strip +tile.rpcov3s.stonebrick.name=Stone Brick Triple Cover Strip +tile.rphpanel.wool.lightBlue.name=Hollow Light Blue Wool Panel +tile.rparmbwire.clay.name=Clay Jacketed Bluewire +tile.rpslabc.wood2.name=Birch Wood Slab Corner +tile.rpcovc.wool.gray.name=Gray Wool Cover Corner +tile.rpbfurnace.name=Blulectric Furnace +tile.rppans.wood3.name=Jungle Wood Panel Strip +tile.rpcovc.wool.pink.name=Pink Wool Cover Corner +tile.rpcov3.wool.purple.name=Purple Wool Triple Cover +tile.rpslab.clay.name=Clay Slab +tile.rpcover.rplog.name=Rubberwood Cover +tile.rpslabc.rubyBlock.name=Ruby Block Slab Corner +tile.rpcov7.marbleBrick.name=Marble Brick Anticover +tile.rpcov5s.silverBlock.name=Silver Block Cover Slab Strip +tile.irrand.name=Randomizer +tile.rparmbwire.silverBlock.name=Silver Block Jacketed Bluewire +tile.rpcov5s.wool.cyan.name=Cyan Wool Cover Slab Strip +item.irbundle.name=Stone Bundle +tile.rpcov6c.brick.name=Brick Triple Panel Corner +tile.rppans.diamond.name=Diamond Panel Strip +tile.rpcov6s.snow.name=Snow Triple Panel Strip +tile.rprtframe.name=Redstone Tube Frame +tile.rpcov6c.books.name=Bookshelf Triple Panel Corner +tile.rpshlamp.black.name=Black Fixture +tile.rpcov6.basaltPaver.name=Basalt Paver Triple Panel +tile.rpslab.pumpkin.name=Pumpkin Slab +achievement.rpIngotBrass.desc=Smelt a brass ingot +tile.rphcov5.lapis.name=Lapis Lazuli Hollow Cover Slab +tile.rpcpu.name=Central Processing Unit +tile.rpcovc.diamond.name=Diamond Cover Corner +tile.rpaccel.name=Accelerator +tile.rphslab.marble.name=Hollow Marble Slab +tile.rppanc.gold.name=Gold Panel Corner +tile.rphcov7.brick.name=Brick Hollow Anticover +tile.rpcov7c.netherbrick.name=Nether Brick Anticover Corner +item.nuggetTin.name=Tin Nugget +tile.rpcov5.brick.name=Brick Cover Slab +tile.rpcov5s.sandstone.name=Sandstone Cover Slab Strip +tile.rpcov3c.basaltBrick.name=Basalt Brick Triple Cover Corner +tile.rppole2.rplog.name=Rubberwood Pillar +tile.rphcov7.books.name=Bookshelf Hollow Anticover +tile.rpcov5.books.name=Bookshelf Cover Slab +tile.rpcov7s.netherrack.name=Netherrack Anticover Strip +tile.rppole3.wool.lime.name=Lime Wool Column +tile.rphcov5.iron.name=Iron Hollow Cover Slab +tile.rparmwire.planks3.name=Wooden Plank Jacketed Wire +tile.rpslabs.wool.lime.name=Lime Wool Slab Strip +tile.rpishlamp.orange.name=Inverted Orange Fixture +tile.rpcover.stonebrick.name=Stone Brick Cover +tile.ribbon.name=Ribbon Cable +tile.rppole3.glass.name=Glass Column +tile.rppole1.greenSapphireBlock.name=Green Sapphire Block Post +tile.rphslab.wool.green.name=Hollow Green Wool Slab +tile.rphpanel.wood.name=Hollow Oak Wood Panel +tile.rphcov7.wool.yellow.name=Yellow Wool Hollow Anticover +tile.rpcov3s.netherbrick.name=Nether Brick Triple Cover Strip +tile.rppole1.wool.pink.name=Pink Wool Post +tile.rppole3.iron.name=Iron Column +tile.rpcov6c.wool.red.name=Red Wool Triple Panel Corner +tile.rpslabc.cobble.name=Cobblestone Slab Corner +tile.rpshlamp.pink.name=Pink Fixture +tile.rpinsulated.gray.name=Gray Insulated Wire +tile.rparmbwire.slab.name=Polished Stone Jacketed Bluewire +tile.rphslab.basaltCircle.name=Hollow Chiseled Basalt Brick Slab +tile.rppanel.basaltBrick.name=Basalt Brick Panel +tile.blockCopper.name=Copper Block +tile.rpinsulated.pink.name=Pink Insulated Wire +tile.rpcov3c.basaltCobble.name=Basalt Cobblestone Triple Cover Corner +tile.rpishlamp.lightBlue.name=Inverted Light Blue Fixture +tile.rppans.basaltCobble.name=Basalt Cobblestone Panel Strip +item.paintbrush.silver.name=Light Gray Paint Brush +tile.rpslab.slab.name=Polished Stone Slab +tile.rpcovs.planks1.name=Wooden Plank Cover Strip +tile.rptframe.name=Tube Frame +tile.rpcov5s.soul.name=Soul Sand Cover Slab Strip +tile.rpcov7s.greenSapphireBlock.name=Green Sapphire Block Anticover Strip +tile.rphcov5.glass.name=Glass Hollow Cover Slab +tile.rpcov3c.iron.name=Iron Triple Cover Corner +tile.rpcov3.glass.name=Glass Triple Cover +tile.rpcov6s.basaltCircle.name=Chiseled Basalt Brick Triple Panel Strip +tile.rphcov3.copperBlock.name=Copper Block Hollow Triple Cover +tile.rpcov7s.snow.name=Snow Anticover Strip +tile.rphcov7.diamond.name=Diamond Hollow Anticover +tile.rpcov5s.stonebrick1.name=Stone Brick Cover Slab Strip +tile.rparmbwire.stonebrick1.name=Stone Brick Jacketed Bluewire +tile.rphcov6.wool.lime.name=Lime Wool Hollow Triple Panel +tile.rpcov7s.basaltCircle.name=Chiseled Basalt Brick Anticover Strip +tile.rpcov5s.slab.name=Polished Stone Cover Slab Strip +tile.rpcov3c.sapphireBlock.name=Sapphire Block Triple Cover Corner +tile.rphcov6.lapis.name=Lapis Lazuli Hollow Triple Panel +tile.rppans.pumpkin.name=Pumpkin Panel Strip +tile.rpcover.tinBlock.name=Tin Block Cover +tile.rpcov5s.wool.magenta.name=Magenta Wool Cover Slab Strip +tile.rppans.wool.brown.name=Brown Wool Panel Strip +tile.rpcov6s.wool.magenta.name=Magenta Wool Triple Panel Strip +tile.rpcov5.wool.magenta.name=Magenta Wool Cover Slab +tile.rplightsensor.name=Light Sensor +tile.rpcov6.brick.name=Brick Triple Panel +tile.oreRuby.name=Ruby Ore +tile.rpcover.wool.black.name=Black Wool Cover +tile.rparmwire.wood3.name=Jungle Wood Jacketed Wire +tile.rppole3.rplog.name=Rubberwood Column +tile.rpslab.wood1.name=Spruce Wood Slab +tile.rpcover.moss.name=Moss Stone Cover +tile.rpcovc.pumpkin.name=Pumpkin Cover Corner +tile.rphslab.wool.pink.name=Hollow Pink Wool Slab +tile.rppole2.wool.green.name=Green Wool Pillar +tile.rpcovs.cobble.name=Cobblestone Cover Strip +tile.rpframe.name=Support Frame +tile.rpcov6.books.name=Bookshelf Triple Panel +tile.rpslab.basaltCobble.name=Basalt Cobblestone Slab +tile.rpcov7c.marble.name=Marble Anticover Corner +tile.rppanel.planks.name=Wooden Plank Panel +tile.rparmbwire.wool.black.name=Black Wool Jacketed Bluewire +tile.rpslabc.basalt.name=Basalt Slab Corner +tile.rpcov5.rubyBlock.name=Ruby Block Cover Slab +tile.rplamp.black.name=Black Lamp +tile.rphcov6.sandstone1.name=Sandstone Hollow Triple Panel +tile.rpcovc.basaltBrick.name=Basalt Brick Cover Corner +tile.rpcov6c.netherbrick.name=Nether Brick Triple Panel Corner +tile.rppole3.tinBlock.name=Tin Block Column +tile.rpslabs.basaltBrick.name=Basalt Brick Slab Strip +tile.rphpanel.netherrack.name=Hollow Netherrack Panel +tile.rprelay.name=Relay +tile.rpcov5.iron.name=Iron Cover Slab +tile.rpcover.wool.blue.name=Blue Wool Cover +tile.rpcovc.snow.name=Snow Cover Corner +tile.rphcov5.silverBlock.name=Silver Block Hollow Cover Slab +tile.rphcover.wool.lime.name=Hollow Lime Wool Cover +tile.rppanel.wool.blue.name=Blue Wool Panel +tile.rpinsulated.brown.name=Brown Insulated Wire +tile.rpcov6c.lapis.name=Lapis Lazuli Triple Panel Corner +tile.rparmcable.planks.name=Wooden Plank Jacketed Cable +tile.rphcov7.stonebrick2.name=Stone Brick Hollow Anticover +tile.rplamp.blue.name=Blue Lamp +tile.rpcov6s.soul.name=Soul Sand Triple Panel Strip +tile.rparmcable.iron.name=Iron Jacketed Cable +tile.rpcov5c.sandstone2.name=Sandstone Cover Slab Corner +tile.rppole2.wool.lightBlue.name=Light Blue Wool Pillar +tile.rpcovc.wool.lightBlue.name=Light Blue Wool Cover Corner +tile.rphcov6.glass.name=Glass Hollow Triple Panel +tile.rpcov5c.wool.orange.name=Orange Wool Cover Slab Corner +tile.rpcov3s.wood3.name=Jungle Wood Triple Cover Strip +tile.rpibutton.name=Iron Button +tile.rpcov7.silverBlock.name=Silver Block Anticover +tile.rparmwire.sapphireBlock.name=Sapphire Block Jacketed Wire +tile.rphslab.basaltBrick.name=Hollow Basalt Brick Slab +tile.rparmcable.stonebrick1.name=Stone Brick Jacketed Cable +tile.rpcov6s.slab.name=Polished Stone Triple Panel Strip +tile.rphcov7.lapis.name=Lapis Lazuli Hollow Anticover +tile.rpcov5.lapis.name=Lapis Lazuli Cover Slab +achievement.rpTranspose.desc=Build a transposer +tile.rphcov7.pumpkin.name=Pumpkin Hollow Anticover +tile.rphcov3.wool.brown.name=Brown Wool Hollow Triple Cover +tile.rparmwire.clay.name=Clay Jacketed Wire +tile.rpcovs.basalt.name=Basalt Cover Strip +tile.rpcov3.wool.red.name=Red Wool Triple Cover +tile.rppans.wool.cyan.name=Cyan Wool Panel Strip +tile.rpcov7.brick.name=Brick Anticover +tile.rpilamp.cyan.name=Inverted Cyan Lamp +tile.rpslabc.stonebrick1.name=Stone Brick Slab Corner +tile.rpcovs.rubyBlock.name=Ruby Block Cover Strip +tile.rphcov6.greenSapphireBlock.name=Green Sapphire Block Hollow Triple Panel +enchantment.damage.disjunction=Disjunction +tile.rppole3.stonebrick.name=Stone Brick Column +tile.rpcov7.books.name=Bookshelf Anticover +tile.rpilamp.yellow.name=Inverted Yellow Lamp +item.coppercoil.name=Copper Coil +tile.rpmotor.name=Frame Motor +tile.rpslabc.sapphireBlock.name=Sapphire Block Slab Corner +tile.rpcov3c.wool.gray.name=Gray Wool Triple Cover Corner +tile.rpslabc.planks1.name=Wooden Plank Slab Corner +tile.rpshlamp.brown.name=Brown Fixture +tile.rparmbwire.lapis.name=Lapis Lazuli Jacketed Bluewire +tile.rpcov3c.wool.pink.name=Pink Wool Triple Cover Corner +tile.rparmcable.wool.purple.name=Purple Wool Jacketed Cable +tile.rpcov3c.greenSapphireBlock.name=Green Sapphire Block Triple Cover Corner +tile.rppanel.wood.name=Oak Wood Panel +tile.rpcov7.basaltCobble.name=Basalt Cobblestone Anticover +tile.rppans.sandstone.name=Sandstone Panel Strip +tile.rphpanel.wool.white.name=Hollow White Wool Panel +tile.rphslab.wood.name=Hollow Oak Wood Slab +tile.rpcov3s.sapphireBlock.name=Sapphire Block Triple Cover Strip +tile.rpcov5c.brick.name=Brick Cover Slab Corner +tile.rpcov6c.glass.name=Glass Triple Panel Corner +tile.rppanc.obsidian.name=Obsidian Panel Corner +tile.rpslabc.wool.purple.name=Purple Wool Slab Corner +tile.rpcover.stone.name=Stone Cover +tile.rpishlamp.blue.name=Inverted Blue Fixture +tile.rphcov6.wool.silver.name=Light Gray Wool Hollow Triple Panel +tile.rpcov3.wool.black.name=Black Wool Triple Cover +tile.rphcov6.rplog.name=Rubberwood Hollow Triple Panel +tile.rppole2.wool.gray.name=Gray Wool Pillar +tile.rpcable.magenta.name=Magenta Bundled Cable +tile.rpcov7s.basaltBrick.name=Basalt Brick Anticover Strip +tile.rphcover.planks3.name=Hollow Wooden Plank Cover +tile.rppans.moss.name=Moss Stone Panel Strip +tile.rphcov7.glass.name=Glass Hollow Anticover +tile.rpcov5c.iron.name=Iron Cover Slab Corner +tile.rpslab.wool.purple.name=Purple Wool Slab +tile.rpcov3.diamond.name=Diamond Triple Cover +tile.rpcov3c.sandstone1.name=Sandstone Triple Cover Corner +tile.rpcov5.glass.name=Glass Cover Slab +item.rplumar.black.name=Black Lumar +tile.rphcov5.wool.brown.name=Brown Wool Hollow Cover Slab +tile.rpcov5c.netherbrick.name=Nether Brick Cover Slab Corner +tile.rpcov7s.slab.name=Polished Stone Anticover Strip +tile.rphslab.netherrack.name=Hollow Netherrack Slab +tile.rpcov6.lapis.name=Lapis Lazuli Triple Panel +tile.rpcovs.wood3.name=Jungle Wood Cover Strip +tile.rppanc.clay.name=Clay Panel Corner +tile.rparmwire.slab.name=Polished Stone Jacketed Wire +tile.rphcov5.planks1.name=Wooden Plank Hollow Cover Slab +tile.rphpanel.basaltCobble.name=Hollow Basalt Cobblestone Panel +tile.rpcov5c.wool.gray.name=Gray Wool Cover Slab Corner +achievement.rpBreaker.desc=Build a block breaker +tile.rpcov3c.planks3.name=Wooden Plank Triple Cover Corner +tile.rpcov5c.wool.pink.name=Pink Wool Cover Slab Corner +tile.rphcov3.wool.orange.name=Orange Wool Hollow Triple Cover +tile.rphcov5.wool.gray.name=Gray Wool Hollow Cover Slab +tile.rpcov6.basaltBrick.name=Basalt Brick Triple Panel +tile.rpcov7c.wool.brown.name=Brown Wool Anticover Corner +tile.rphcov5.wool.pink.name=Pink Wool Hollow Cover Slab +tile.rpcov6c.rplog.name=Rubberwood Triple Panel Corner +item.nuggetCopper.name=Copper Nugget +tile.rphslab.wood3.name=Hollow Jungle Wood Slab +tile.rppole1.wood2.name=Birch Wood Post +tile.rpcov6.clay.name=Clay Triple Panel +tile.rpcov5.wool.black.name=Black Wool Cover Slab +tile.rpcov7s.sandstone2.name=Sandstone Anticover Strip +tile.rpcovc.soul.name=Soul Sand Cover Corner +tile.rpcov7c.stone.name=Stone Anticover Corner +tile.rppole2.iron.name=Iron Pillar +tile.rpslabs.wool.black.name=Black Wool Slab Strip +tile.rpshlamp.green.name=Green Fixture +tile.rpcov3.stonebrick3.name=Stone Brick Triple Cover +item.nikolite.name=Nikolite +tile.rpcovs.iron.name=Iron Cover Strip +tile.rpcovc.copperBlock.name=Copper Block Cover Corner +tile.rpslabs.copperBlock.name=Copper Block Slab Strip +tile.rparmwire.basaltCircle.name=Chiseled Basalt Brick Jacketed Wire +tile.rphslab.diamond.name=Hollow Diamond Slab +tile.rphslab.greenSapphireBlock.name=Hollow Green Sapphire Block Slab +tile.rparmbwire.wood.name=Oak Wood Jacketed Bluewire +tile.rphcov7.rplog.name=Rubberwood Hollow Anticover +tile.rpcov3.basaltCircle.name=Chiseled Basalt Brick Triple Cover +item.irredwire.name=Stone Redwire +tile.rpslab.wood.name=Oak Wood Slab +tile.rpcov3.planks2.name=Wooden Plank Triple Cover +tile.rpcov7c.wool.purple.name=Purple Wool Anticover Corner +tile.rppole2.netherrack.name=Netherrack Pillar +tile.rpslabc.obsidian.name=Obsidian Slab Corner +tile.rparmbwire.wool.brown.name=Brown Wool Jacketed Bluewire +tile.rpcov6c.iron.name=Iron Triple Panel Corner +tile.rppanel.wood3.name=Jungle Wood Panel +tile.rparmcable.wool.cyan.name=Cyan Wool Jacketed Cable +tile.rpcov6.glass.name=Glass Triple Panel +tile.rpslabs.sapphireBlock.name=Sapphire Block Slab Strip +item.paintcan.black.name=Black Paint +tile.rpslabc.basaltCobble.name=Basalt Cobblestone Slab Corner +tile.rphcov3.wood2.name=Birch Wood Hollow Triple Cover +item.paintbrush.cyan.name=Cyan Paint Brush +tile.rphslab.wool.white.name=Hollow White Wool Slab +tile.rphcover.stonebrick2.name=Hollow Stone Brick Cover +tile.rppanel.basaltCobble.name=Basalt Cobblestone Panel +tile.rpcov7c.wool.gray.name=Gray Wool Anticover Corner +tile.rpcov6c.wool.yellow.name=Yellow Wool Triple Panel Corner +item.paintcan.cyan.name=Cyan Paint +tile.rppanc.slab.name=Polished Stone Panel Corner +tile.rphslab.copperBlock.name=Hollow Copper Block Slab +tile.rpcov7.lapis.name=Lapis Lazuli Anticover +tile.rpslabc.marble.name=Marble Slab Corner +tile.rparmbwire.rplog.name=Rubberwood Jacketed Bluewire +tile.rpcov3s.wool.green.name=Green Wool Triple Cover Strip +tile.rpslabs.stone.name=Stone Slab Strip +tile.rpcov3s.obsidian.name=Obsidian Triple Cover Strip +tile.rpilamp.brown.name=Inverted Brown Lamp +tile.rpcov3s.wool.purple.name=Purple Wool Triple Cover Strip +tile.rpslabs.gold.name=Gold Slab Strip +item.windTurbineWood.name=Wooden Wind Turbine +tile.rphcov7.planks.name=Wooden Plank Hollow Anticover +tile.rparmcable.sandstone.name=Sandstone Jacketed Cable +tile.rppanc.wool.silver.name=Light Gray Wool Panel Corner +tile.rppole2.stonebrick2.name=Stone Brick Pillar +item.rpcanvas.name=Canvas +tile.rpslabc.dirt.name=Dirt Slab Corner +item.waferBlue.name=Blue-Doped Wafer +tile.rphpanel.wood2.name=Hollow Birch Wood Panel +tile.rpishlamp2.silver.name=Inverted Light Gray Cage Lamp +tile.rppole2.wood2.name=Birch Wood Pillar +tile.rparmbwire.rubyBlock.name=Ruby Block Jacketed Bluewire +tile.rpcov6.sandstone1.name=Sandstone Triple Panel +achievement.rpDeploy.desc=Build a deployer +tile.rpcov5s.sandstone1.name=Sandstone Cover Slab Strip +tile.rpcov5.netherbrick.name=Nether Brick Cover Slab +tile.rphcov6.cobble.name=Cobblestone Hollow Triple Panel +item.axeGreenSapphire.name=Green Sapphire Axe +item.sickleIron.name=Iron Sickle +tile.rparmwire.wool.silver.name=Light Gray Wool Jacketed Wire +tile.rppans.basaltPaver.name=Basalt Paver Panel Strip +tile.rpslab.wool.blue.name=Blue Wool Slab +tile.rpcov3c.wool.orange.name=Orange Wool Triple Cover Corner +tile.rpcov6.rplog.name=Rubberwood Triple Panel +tile.rpcover.wool.lime.name=Lime Wool Cover +tile.rparmbwire.cobble.name=Cobblestone Jacketed Bluewire +tile.rpcovc.stonebrick.name=Stone Brick Cover Corner +tile.rpcovs.marble.name=Marble Cover Strip +tile.rphcover.dirt.name=Hollow Dirt Cover +tile.rphslab.pumpkin.name=Hollow Pumpkin Slab +tile.rphpanel.sandstone2.name=Hollow Sandstone Panel +tile.irmux.name=Multiplexer +tile.rppanel.wool.lime.name=Lime Wool Panel +tile.rppole2.wool.white.name=White Wool Pillar +tile.rpcover.wool.green.name=Green Wool Cover +tile.rplamp.lime.name=Lime Lamp +tile.rpcov7c.iron.name=Iron Anticover Corner +tile.rphcover.wool.lightBlue.name=Hollow Light Blue Wool Cover +tile.rpcov7.glass.name=Glass Anticover +tile.rpcov3s.rubyBlock.name=Ruby Block Triple Cover Strip +tile.rpcov5s.planks1.name=Wooden Plank Cover Slab Strip +tile.rpcovs.books.name=Bookshelf Cover Strip +tile.rpcovs.planks3.name=Wooden Plank Cover Strip +tile.rppole1.wool.cyan.name=Cyan Wool Post +tile.rpcov6s.wood.name=Oak Wood Triple Panel Strip +tile.rpcovs.stonebrick1.name=Stone Brick Cover Strip +item.rplumar.orange.name=Orange Lumar +tile.rpshlamp.cyan.name=Cyan Fixture +tile.rpcov3.wool.brown.name=Brown Wool Triple Cover +tile.rppanel.wool.orange.name=Orange Wool Panel +tile.rplamp.green.name=Green Lamp +tile.rpcov5c.planks.name=Wooden Plank Cover Slab Corner +tile.rphcov5.clay.name=Clay Hollow Cover Slab +tile.rpcov5s.stonebrick3.name=Stone Brick Cover Slab Strip +tile.rparmbwire.stonebrick3.name=Stone Brick Jacketed Bluewire +tile.rpcov6c.wool.purple.name=Purple Wool Triple Panel Corner +tile.rphslab.brick.name=Hollow Brick Slab +tile.rpcov7s.tinBlock.name=Tin Block Anticover Strip +tile.rpcov6s.wool.cyan.name=Cyan Wool Triple Panel Strip +item.sickleDiamond.name=Diamond Sickle +item.rplumar.brown.name=Brown Lumar +tile.rpcov3s.cobble.name=Cobblestone Triple Cover Strip +tile.rphslab.books.name=Hollow Bookshelf Slab +tile.rpcov5c.wool.yellow.name=Yellow Wool Cover Slab Corner +tile.rpcov5c.pumpkin.name=Pumpkin Cover Slab Corner +tile.rppole1.sandstone.name=Sandstone Post +tile.rppole3.clay.name=Clay Column +tile.rphpanel.snow.name=Hollow Snow Panel +tile.rpcov6.copperBlock.name=Copper Block Triple Panel +tile.rppole3.wood2.name=Birch Wood Column +tile.rppole2.gold.name=Gold Pillar +tile.rpcover.obsidian.name=Obsidian Cover +tile.rphcov6.basalt.name=Basalt Hollow Triple Panel +tile.rpslab.wood3.name=Jungle Wood Slab +tile.rpcovs.wool.purple.name=Purple Wool Cover Strip +tile.rppanc.wool.pink.name=Pink Wool Panel Corner +tile.rpcov7.wool.gray.name=Gray Wool Anticover +tile.rpcov3s.lapis.name=Lapis Lazuli Triple Cover Strip +tile.rparmbwire.basalt.name=Basalt Jacketed Bluewire +tile.rpcov7.wool.pink.name=Pink Wool Anticover +item.paintbrush.purple.name=Purple Paint Brush +tile.rpcov5s.wool.lightBlue.name=Light Blue Wool Cover Slab Strip +tile.rpslab.cobble.name=Cobblestone Slab +tile.rpcov6s.sandstone.name=Sandstone Triple Panel Strip +tile.rphslab.gold.name=Hollow Gold Slab +tile.rppanel.brick.name=Brick Panel +tile.rpcovc.dirt.name=Dirt Cover Corner +tile.rphcov3.wool.red.name=Red Wool Hollow Triple Cover +tile.rpishlamp2.black.name=Inverted Black Cage Lamp +tile.rpcov7.rplog.name=Rubberwood Anticover +tile.rphcov5.basaltCobble.name=Basalt Cobblestone Hollow Cover Slab +tile.rpcov5s.rubyBlock.name=Ruby Block Cover Slab Strip +tile.rpishlamp.lime.name=Inverted Lime Fixture +tile.rphslab.wool.cyan.name=Hollow Cyan Wool Slab +tile.rppanel.books.name=Bookshelf Panel +tile.rppanc.cobble.name=Cobblestone Panel Corner +tile.rppole1.wool.green.name=Green Wool Post +tile.rpcov5.wool.brown.name=Brown Wool Cover Slab +tile.rpcharge.name=Charging Bench +tile.rphcov5.wood2.name=Birch Wood Hollow Cover Slab +tile.rphcov6.wool.black.name=Black Wool Hollow Triple Panel +tile.rpshlamp2.brown.name=Brown Cage Lamp +tile.rppole3.obsidian.name=Obsidian Column +tile.rpcov6c.stonebrick.name=Stone Brick Triple Panel Corner +tile.rpcov3.wood2.name=Birch Wood Triple Cover +tile.rpcovc.wool.orange.name=Orange Wool Cover Corner +tile.rpslabs.wood3.name=Jungle Wood Slab Strip +tile.rpslabs.wool.brown.name=Brown Wool Slab Strip +tile.rpslabs.wool.orange.name=Orange Wool Slab Strip +tile.rpcov7s.wood.name=Oak Wood Anticover Strip +tile.rpcable.blue.name=Blue Bundled Cable +tile.rppole3.basaltPaver.name=Basalt Paver Column +tile.rppanel.sandstone1.name=Sandstone Panel +tile.rphslab.sandstone.name=Hollow Sandstone Slab +tile.rppole1.diamond.name=Diamond Post +tile.rparmwire.wood.name=Oak Wood Jacketed Wire +tile.rpcov3.marbleBrick.name=Marble Brick Triple Cover +tile.rphcov5.sandstone1.name=Sandstone Hollow Cover Slab +tile.rphpanel.planks.name=Hollow Wooden Plank Panel +tile.rpcov3s.basalt.name=Basalt Triple Cover Strip +tile.rphcover.wool.magenta.name=Hollow Magenta Wool Cover +tile.rphslab.sandstone2.name=Hollow Sandstone Slab +tile.rparmcable.stonebrick3.name=Stone Brick Jacketed Cable +tile.rparmwire.wool.blue.name=Blue Wool Jacketed Wire +tile.rpcov7.diamond.name=Diamond Anticover +tile.basaltPaver.name=Basalt Paver +tile.rphcov7.gold.name=Gold Hollow Anticover +tile.rphcov3.iron.name=Iron Hollow Triple Cover +tile.irbusxcvr.name=Bus Transceiver +tile.rpcover.brick.name=Brick Cover +tile.rpslabs.planks2.name=Wooden Plank Slab Strip +tile.rpcov6s.marbleBrick.name=Marble Brick Triple Panel Strip +tile.rphslab.wool.orange.name=Hollow Orange Wool Slab +tile.rpcov5.clay.name=Clay Cover Slab +tile.rpcovc.wool.red.name=Red Wool Cover Corner +tile.rpslabc.stonebrick3.name=Stone Brick Slab Corner +tile.rpcover.books.name=Bookshelf Cover +tile.rpslab.basalt.name=Basalt Slab +tile.rpcov7s.rubyBlock.name=Ruby Block Anticover Strip +tile.rparmwire.rplog.name=Rubberwood Jacketed Wire +tile.rphpanel.netherbrick.name=Hollow Nether Brick Panel +tile.rpcover.marbleBrick.name=Marble Brick Cover +tile.rpslabc.planks3.name=Wooden Plank Slab Corner +tile.rppanc.basalt.name=Basalt Panel Corner +tile.rpcov3s.netherrack.name=Netherrack Triple Cover Strip +tile.rpcov7c.diamond.name=Diamond Anticover Corner +tile.rpcov7c.basaltCircle.name=Chiseled Basalt Brick Anticover Corner +tile.rppole3.wool.green.name=Green Wool Column +tile.rpcov7.wool.brown.name=Brown Wool Anticover +tile.rpcovs.lapis.name=Lapis Lazuli Cover Strip +item.paintcan.yellow.name=Yellow Paint +tile.rpcovc.basaltCircle.name=Chiseled Basalt Brick Cover Corner +tile.rpcover.dirt.name=Dirt Cover +tile.rpcov5.wool.blue.name=Blue Wool Cover Slab +tile.rphcov3.wool.yellow.name=Yellow Wool Hollow Triple Cover +tile.oreTin.name=Tin Ore +tile.rpcov6c.wool.magenta.name=Magenta Wool Triple Panel Corner +tile.rpishlamp2.gray.name=Inverted Gray Cage Lamp +tile.rppanel.sapphireBlock.name=Sapphire Block Panel +tile.rparmbwire.stone.name=Stone Jacketed Bluewire +tile.rpishlamp2.pink.name=Inverted Pink Cage Lamp +tile.rphcov6.wood2.name=Birch Wood Hollow Triple Panel +tile.rpcov3c.basaltPaver.name=Basalt Paver Triple Cover Corner +tile.rpslab.wool.white.name=White Wool Slab +tile.rphcov7.sandstone1.name=Sandstone Hollow Anticover +tile.rpcov5.wool.yellow.name=Yellow Wool Cover Slab +tile.rppole2.sandstone2.name=Sandstone Pillar +tile.rppanc.wood.name=Oak Wood Panel Corner +tile.rpcover.wool.magenta.name=Magenta Wool Cover +tile.rphcov6.stonebrick1.name=Stone Brick Hollow Triple Panel +tile.rphcov5.stonebrick3.name=Stone Brick Hollow Cover Slab +tile.rpretriever.name=Retriever +tile.rphcov5.sapphireBlock.name=Sapphire Block Hollow Cover Slab +tile.rphslab.lapis.name=Hollow Lapis Lazuli Slab +tile.rpslabs.clay.name=Clay Slab Strip +tile.rpcov7.planks2.name=Wooden Plank Anticover +tile.rpcov7s.wool.orange.name=Orange Wool Anticover Strip +tile.rppans.stonebrick2.name=Stone Brick Panel Strip +tile.rpcov3s.rplog.name=Rubberwood Triple Cover Strip +tile.marble.name=Marble +tile.rphpanel.soul.name=Hollow Soul Sand Panel +tile.rpcov7c.brick.name=Brick Anticover Corner +tile.rppole1.pumpkin.name=Pumpkin Post +tile.rpslab.brick.name=Brick Slab +tile.rpcov3c.wool.black.name=Black Wool Triple Cover Corner +tile.rpishlamp.magenta.name=Inverted Magenta Fixture +tile.rphpanel.sapphireBlock.name=Hollow Sapphire Block Panel +tile.rpcov7s.planks1.name=Wooden Plank Anticover Strip +tile.rphcov5.planks3.name=Wooden Plank Hollow Cover Slab +tile.rppanel.basaltPaver.name=Basalt Paver Panel +tile.rpcov7c.books.name=Bookshelf Anticover Corner +tile.rpcover.netherrack.name=Netherrack Cover +tile.rpslab.books.name=Bookshelf Slab +tile.rpcov5.slab.name=Polished Stone Cover Slab +tile.rpcov7.pumpkin.name=Pumpkin Anticover +tile.rppanel.snow.name=Snow Panel +tile.rppole2.planks1.name=Wooden Plank Pillar +tile.rpcov6.wood.name=Oak Wood Triple Panel +tile.rphslab.snow.name=Hollow Snow Slab +tile.rpbreaker.name=Block Breaker +tile.rphcov6.wool.purple.name=Purple Wool Hollow Triple Panel +item.paintcan.green.name=Green Paint +tile.rppanel.lapis.name=Lapis Lazuli Panel +tile.rppanc.silverBlock.name=Silver Block Panel Corner +tile.rparmbwire.planks1.name=Wooden Plank Jacketed Bluewire +tile.rpcovs.glass.name=Glass Cover Strip +tile.rpcov7c.planks2.name=Wooden Plank Anticover Corner +tile.rpcov7.gold.name=Gold Anticover +tile.rpcov3s.wool.white.name=White Wool Triple Cover Strip +tile.rpcov7.basaltBrick.name=Basalt Brick Anticover +tile.rparmcable.wool.silver.name=Light Gray Wool Jacketed Cable +item.axeRuby.name=Ruby Axe +tile.rpslabs.brick.name=Brick Slab Strip +tile.rpcov5s.marbleBrick.name=Marble Brick Cover Slab Strip +tile.rparmbwire.marbleBrick.name=Marble Brick Jacketed Bluewire +tile.rpcov6.wool.orange.name=Orange Wool Triple Panel +tile.rpcov7c.pumpkin.name=Pumpkin Anticover Corner +tile.rpcov6.wool.cyan.name=Cyan Wool Triple Panel +tile.rpslabs.books.name=Bookshelf Slab Strip +tile.rphcov7.wood2.name=Birch Wood Hollow Anticover +tile.rparmwire.silverBlock.name=Silver Block Jacketed Wire +tile.rppans.stone.name=Stone Panel Strip +item.sickleGreenSapphire.name=Green Sapphire Sickle +tile.rpcov5.wood2.name=Birch Wood Cover Slab +tile.rppans.stonebrick.name=Stone Brick Panel Strip +tile.rphslab.glass.name=Hollow Glass Slab +tile.rpcov5.sapphireBlock.name=Sapphire Block Cover Slab +item.hoeSapphire.name=Sapphire Hoe +tile.rppans.rubyBlock.name=Ruby Block Panel Strip +item.paintcan.purple.name=Purple Paint +tile.rpcable.purple.name=Purple Bundled Cable +tile.rpcov6.sapphireBlock.name=Sapphire Block Triple Panel +tile.rppanel.diamond.name=Diamond Panel +tile.rphcov7.obsidian.name=Obsidian Hollow Anticover +tile.rphcov7.netherbrick.name=Nether Brick Hollow Anticover +tile.rpslabs.slab.name=Polished Stone Slab Strip +tile.rpslab.wool.silver.name=Light Gray Wool Slab +tile.rpishlamp2.brown.name=Inverted Brown Cage Lamp +tile.rphcov5.basalt.name=Basalt Hollow Cover Slab +tile.rpcov6.sandstone.name=Sandstone Triple Panel +tile.rpcover.lapis.name=Lapis Lazuli Cover +tile.rphcov3.gold.name=Gold Hollow Triple Cover +tile.rpcov6s.planks2.name=Wooden Plank Triple Panel Strip +tile.rpcov3.silverBlock.name=Silver Block Triple Cover +tile.rpshlamp.orange.name=Orange Fixture +tile.rphcov6.wool.brown.name=Brown Wool Hollow Triple Panel +tile.rppanel.glass.name=Glass Panel +tile.rpcovs.rplog.name=Rubberwood Cover Strip +tile.rpcov5.planks1.name=Wooden Plank Cover Slab +tile.rppole2.clay.name=Clay Pillar +tile.rpcovs.clay.name=Clay Cover Strip +tile.rppole1.gold.name=Gold Post +tile.rphcov3.basaltCobble.name=Basalt Cobblestone Hollow Triple Cover +itemGroup.RPWires=RedPower Wiring and Logic +tile.rpcov6.wool.lightBlue.name=Light Blue Wool Triple Panel +tile.rpcov5.planks.name=Wooden Plank Cover Slab +tile.rphcov3.planks2.name=Wooden Plank Hollow Triple Cover +item.rpBag.name=Canvas Bag +tile.rppole3.stonebrick2.name=Stone Brick Column +tile.rpcov6c.wool.gray.name=Gray Wool Triple Panel Corner +tile.rparmbwire.snow.name=Snow Jacketed Bluewire +tile.iror.name=OR Gate +tile.rpcov6c.wool.pink.name=Pink Wool Triple Panel Corner +tile.rppanc.stonebrick1.name=Stone Brick Panel Corner +tile.rphslab.basaltPaver.name=Hollow Basalt Paver Slab +tile.irrepeater.name=Repeater +tile.rpcov6c.greenSapphireBlock.name=Green Sapphire Block Triple Panel Corner +tile.irnand.name=NAND Gate +tile.rpcov7s.cobble.name=Cobblestone Anticover Strip +tile.rpilamp.silver.name=Inverted Light Gray Lamp +tile.rphcover.wool.blue.name=Hollow Blue Wool Cover +tile.rpslab.snow.name=Snow Slab +tile.rphslab.rplog.name=Hollow Rubberwood Slab +tile.rppole2.wool.red.name=Red Wool Pillar +tile.rpcov3s.marble.name=Marble Triple Cover Strip +item.handsawGreenSapphire.name=Green Sapphire Handsaw +tile.rparmcable.marbleBrick.name=Marble Brick Jacketed Cable +tile.rphpanel.wool.blue.name=Hollow Blue Wool Panel +tile.rparmcable.sandstone1.name=Sandstone Jacketed Cable +tile.rpslabc.moss.name=Moss Stone Slab Corner +tile.rppole1.wool.lightBlue.name=Light Blue Wool Post +tile.rpcov6.wool.black.name=Black Wool Triple Panel +tile.rpslab.diamond.name=Diamond Slab +tile.rpcov6.wood2.name=Birch Wood Triple Panel +tile.rphcov3.stonebrick.name=Stone Brick Hollow Triple Cover +tile.rptranspose.name=Transposer +tile.rparmwire.diamond.name=Diamond Jacketed Wire +tile.rpishlamp.black.name=Inverted Black Fixture +tile.rpslabc.marbleBrick.name=Marble Brick Slab Corner +tile.rparmwire.stonebrick1.name=Stone Brick Jacketed Wire +tile.rpcov7c.wool.silver.name=Light Gray Wool Anticover Corner +tile.rpcover.glass.name=Glass Cover +tile.rphslab.wool.red.name=Hollow Red Wool Slab +tile.rpcable.lime.name=Lime Bundled Cable +tile.rpcov7c.lapis.name=Lapis Lazuli Anticover Corner +tile.rpcovc.wool.green.name=Green Wool Cover Corner +tile.rpslab.lapis.name=Lapis Lazuli Slab +tile.rpcov5s.planks3.name=Wooden Plank Cover Slab Strip +tile.rppanel.rplog.name=Rubberwood Panel +tile.rppole1.tinBlock.name=Tin Block Post +tile.rpslab.sandstone2.name=Sandstone Slab +tile.rppanel.pumpkin.name=Pumpkin Panel +tile.rppanc.marble.name=Marble Panel Corner +tile.rppanel.soul.name=Soul Sand Panel +tile.rphcov7.clay.name=Clay Hollow Anticover +tile.rppole3.netherrack.name=Netherrack Column +tile.rparmwire.wool.lime.name=Lime Wool Jacketed Wire +tile.rparmbwire.sapphireBlock.name=Sapphire Block Jacketed Bluewire +tile.rparmcable.sapphireBlock.name=Sapphire Block Jacketed Cable +tile.rpcovs.stonebrick3.name=Stone Brick Cover Strip +item.paintcan.magenta.name=Magenta Paint +tile.rphcov6.gold.name=Gold Hollow Triple Panel +tile.rphslab.soul.name=Hollow Soul Sand Slab +tile.rppole2.slab.name=Polished Stone Pillar +tile.rphpanel.dirt.name=Hollow Dirt Panel +tile.rparmwire.stone.name=Stone Jacketed Wire +tile.rppole3.wood.name=Oak Wood Column +tile.rppole3.wool.magenta.name=Magenta Wool Column +tile.rpcov3s.wool.silver.name=Light Gray Wool Triple Cover Strip +tile.rppole1.wool.white.name=White Wool Post +tile.rpcov7.snow.name=Snow Anticover +tile.rpcov7s.basaltPaver.name=Basalt Paver Anticover Strip +tile.rpcov3c.stonebrick2.name=Stone Brick Triple Cover Corner +tile.rpcovc.wool.yellow.name=Yellow Wool Cover Corner +tile.rpcov3.gold.name=Gold Triple Cover +achievement.rpTranspose=Dual Cyclonic Action\! +item.irplate.name=Plate Assembly +item.pickaxeGreenSapphire.name=Green Sapphire Pickaxe +tile.rppanel.tinBlock.name=Tin Block Panel +tile.rpcov7s.basalt.name=Basalt Anticover Strip +tile.rppole1.stonebrick1.name=Stone Brick Post +tile.rppans.basaltCircle.name=Chiseled Basalt Brick Panel Strip +tile.rphcov5.marbleBrick.name=Marble Brick Hollow Cover Slab +tile.rpslabs.lapis.name=Lapis Lazuli Slab Strip +tile.rpcov6s.wood1.name=Spruce Wood Triple Panel Strip +tile.rpcov5.greenSapphireBlock.name=Green Sapphire Block Cover Slab +item.fineiron.name=Fine Iron Wire +achievement.rpPump.desc=Build a Pump +tile.rpslabc.wool.lightBlue.name=Light Blue Wool Slab Corner +tile.rpcov3c.wool.brown.name=Brown Wool Triple Cover Corner +tile.rparmcable.rubyBlock.name=Ruby Block Jacketed Cable +tile.rphcov5.stonebrick.name=Stone Brick Hollow Cover Slab +tile.rpcov3s.tinBlock.name=Tin Block Triple Cover Strip +tile.rparmcable.wool.red.name=Red Wool Jacketed Cable +tile.rphcov3.wool.black.name=Black Wool Hollow Triple Cover +tile.rpslab.planks2.name=Wooden Plank Slab +tile.rphpanel.stonebrick1.name=Hollow Stone Brick Panel +tile.rppanel.wool.lightBlue.name=Light Blue Wool Panel +tile.rpcov5.wool.lime.name=Lime Wool Cover Slab +tile.rpcov3s.sandstone2.name=Sandstone Triple Cover Strip +tile.rppanel.stonebrick2.name=Stone Brick Panel +tile.rpcov7.wood2.name=Birch Wood Anticover +item.rplumar.lime.name=Lime Lumar +tile.rpcov7c.glass.name=Glass Anticover Corner +tile.rpcov7.sandstone1.name=Sandstone Anticover +tile.rpslab.glass.name=Glass Slab +tile.rppanc.wool.cyan.name=Cyan Wool Panel Corner +tile.rpcov3.wool.gray.name=Gray Wool Triple Cover +tile.rpcov3.wool.pink.name=Pink Wool Triple Cover +tile.rpcov7.wool.cyan.name=Cyan Wool Anticover +tile.rpcov3s.stone.name=Stone Triple Cover Strip +tile.rppole1.wool.purple.name=Purple Wool Post +tile.rppans.copperBlock.name=Copper Block Panel Strip +tile.rparmcable.greenSapphireBlock.name=Green Sapphire Block Jacketed Cable +tile.rphcover.wool.red.name=Hollow Red Wool Cover +tile.rparmbwire.greenSapphireBlock.name=Green Sapphire Block Jacketed Bluewire +tile.rparmwire.pumpkin.name=Pumpkin Jacketed Wire +tile.rpcovc.moss.name=Moss Stone Cover Corner +tile.rphcov7.wool.blue.name=Blue Wool Hollow Anticover +tile.rpcov7.tinBlock.name=Tin Block Anticover +tile.rpcov7c.stonebrick.name=Stone Brick Anticover Corner +tile.rpshlamp2.purple.name=Purple Cage Lamp +tile.rphcov7.slab.name=Polished Stone Hollow Anticover +tile.rparmbwire.obsidian.name=Obsidian Jacketed Bluewire +achievement.rpAdvBench.desc=Construct a project table +tile.rppole3.wool.white.name=White Wool Column +tile.rpcov3s.wool.blue.name=Blue Wool Triple Cover Strip +tile.rphcover.netherbrick.name=Hollow Nether Brick Cover +tile.rphpanel.wool.purple.name=Hollow Purple Wool Panel +tile.rppanel.greenSapphireBlock.name=Green Sapphire Block Panel +tile.rpcov5c.wood2.name=Birch Wood Cover Slab Corner +tile.rpbafurnace.name=Blulectric Alloy Furnace +tile.rppanc.sandstone.name=Sandstone Panel Corner +tile.rpcov6c.wool.green.name=Green Wool Triple Panel Corner +tile.rpcov5.wood.name=Oak Wood Cover Slab +tile.rpcov6c.wool.silver.name=Light Gray Wool Triple Panel Corner +tile.rppanel.wool.black.name=Black Wool Panel +tile.rparmbwire.soul.name=Soul Sand Jacketed Bluewire +tile.rpslabs.glass.name=Glass Slab Strip +tile.rpcov7.clay.name=Clay Anticover +tile.rppole2.basaltCircle.name=Chiseled Basalt Brick Pillar +tile.rphcov5.wool.black.name=Black Wool Hollow Cover Slab +tile.rpcov6.gold.name=Gold Triple Panel +tile.rphcover.planks.name=Hollow Wooden Plank Cover +tile.rpcov3.basaltPaver.name=Basalt Paver Triple Cover +tile.rpslab.soul.name=Soul Sand Slab +tile.rparmbwire.brick.name=Brick Jacketed Bluewire +tile.rppole2.netherbrick.name=Nether Brick Pillar +tile.rparmbwire.stonebrick.name=Stone Brick Jacketed Bluewire diff --git a/Server/coremods/CodeChickenCore 0.7.3.jar b/Server/coremods/CodeChickenCore 0.7.3.jar new file mode 100644 index 0000000..daf1678 Binary files /dev/null and b/Server/coremods/CodeChickenCore 0.7.3.jar differ diff --git a/Server/coremods/NotEnoughItems 1.4.7.0.jar b/Server/coremods/NotEnoughItems 1.4.7.0.jar new file mode 100644 index 0000000..65599cc Binary files /dev/null and b/Server/coremods/NotEnoughItems 1.4.7.0.jar differ diff --git a/Server/coremods/PowerCrystalsCore-1.0.3-34.jar b/Server/coremods/PowerCrystalsCore-1.0.3-34.jar new file mode 100644 index 0000000..147551b Binary files /dev/null and b/Server/coremods/PowerCrystalsCore-1.0.3-34.jar differ diff --git a/Server/coremods/[1.4.6]TreeCapitator.Forge.1.4.6.r07.Uni.CoreMod.jar b/Server/coremods/[1.4.6]TreeCapitator.Forge.1.4.6.r07.Uni.CoreMod.jar new file mode 100644 index 0000000..4cf3106 Binary files /dev/null and b/Server/coremods/[1.4.6]TreeCapitator.Forge.1.4.6.r07.Uni.CoreMod.jar differ diff --git a/Server/help.yml b/Server/help.yml new file mode 100644 index 0000000..c0ac928 --- /dev/null +++ b/Server/help.yml @@ -0,0 +1,56 @@ +# This is the help configuration file for Bukkit. +# +# By default you do not need to modify this file. Help topics for all plugin commands are automatically provided by +# or extracted from your installed plugins. You only need to modify this file if you wish to add new help pages to +# your server or override the help pages of existing plugin commands. +# +# This file is divided up into the following parts: +# -- general-topics: lists admin defined help topics +# -- index-topics: lists admin defined index topics +# -- amend-topics: lists topic amendments to apply to existing help topics +# -- ignore-plugins: lists any plugins that should be excluded from help +# +# Examples are given below. When amending command topic, the string will be replaced with the existing value +# in the help topic. Color codes can be used in topic text. The color code character is & followed by 0-F. +# ================================================================ +# +# Set this to true to list the individual command help topics in the master help. +# command-topics-in-master-index: true +# +# Each general topic will show up as a separate topic in the help index along with all the plugin command topics. +# general-topics: +# Rules: +# shortText: Rules of the server +# fullText: | +# &61. Be kind to your fellow players. +# &B2. No griefing. +# &D3. No swearing. +# permission: topics.rules +# +# Each index topic will show up as a separate sub-index in the help index along with all the plugin command topics. +# To override the default help index (displayed when the user executes /help), name the index topic "Default". +# index-topics: +# Ban Commands: +# shortText: Player banning commands +# preamble: Moderator - do not abuse these commands +# permission: op +# commands: +# - /ban +# - /ban-ip +# - /banlist +# +# Topic amendments are used to change the content of automatically generated plugin command topics. +# amended-topics: +# /stop: +# shortText: Stops the server cold....in its tracks! +# fullText: - This kills the server. +# permission: you.dont.have +# +# Any plugin in the ignored plugins list will be excluded from help. The name must match the name displayed by +# the /plugins command. Ignore "Bukkit" to remove the standard bukkit commands from the index. Ignore "All" +# to completely disable automatic help topic generation. +# ignore-plugins: +# - PluginNameOne +# - PluginNameTwo +# - PluginNameThree + diff --git a/Server/launch.bat b/Server/launch.bat new file mode 100644 index 0000000..97c2be9 --- /dev/null +++ b/Server/launch.bat @@ -0,0 +1,9 @@ +@Echo OFF + +SET BINDIR=%~dp0 + +CD /C "%BINDIR%" + +"%ProgramFiles%\Java\jre7\bin\java.exe" -Xmx6G -Xms4G -jar mcpc-plus-1.4.7-R1.1-SNAPSHOT-f534-authfix1.jar -nojline + +PAUSE \ No newline at end of file diff --git a/Server/launch.sh b/Server/launch.sh new file mode 100755 index 0000000..8d150ef --- /dev/null +++ b/Server/launch.sh @@ -0,0 +1,2 @@ +#!/bin/sh +java -Xmx3G -Xms2G -jar TekkitLite.jar nogui \ No newline at end of file diff --git a/Server/lib/argo-2.25.jar b/Server/lib/argo-2.25.jar new file mode 100644 index 0000000..a1c167b Binary files /dev/null and b/Server/lib/argo-2.25.jar differ diff --git a/Server/lib/asm-all-4.0.jar b/Server/lib/asm-all-4.0.jar new file mode 100644 index 0000000..221baed Binary files /dev/null and b/Server/lib/asm-all-4.0.jar differ diff --git a/Server/lib/bcprov-jdk15on-147.jar b/Server/lib/bcprov-jdk15on-147.jar new file mode 100644 index 0000000..0b80922 Binary files /dev/null and b/Server/lib/bcprov-jdk15on-147.jar differ diff --git a/Server/lib/guava-12.0.1.jar b/Server/lib/guava-12.0.1.jar new file mode 100644 index 0000000..b185ee6 Binary files /dev/null and b/Server/lib/guava-12.0.1.jar differ diff --git a/Server/mcpc-plus-1.4.7-R1.1-SNAPSHOT-f534-authfix1.jar b/Server/mcpc-plus-1.4.7-R1.1-SNAPSHOT-f534-authfix1.jar new file mode 100644 index 0000000..0edcd9f Binary files /dev/null and b/Server/mcpc-plus-1.4.7-R1.1-SNAPSHOT-f534-authfix1.jar differ diff --git a/Server/minecraft_server.jar b/Server/minecraft_server.jar new file mode 100644 index 0000000..41334e8 Binary files /dev/null and b/Server/minecraft_server.jar differ diff --git a/Server/mods/AdditionalPipes2.1.3u42-BC3.4.2-MC1.4.7.jar b/Server/mods/AdditionalPipes2.1.3u42-BC3.4.2-MC1.4.7.jar new file mode 100644 index 0000000..2320c69 Binary files /dev/null and b/Server/mods/AdditionalPipes2.1.3u42-BC3.4.2-MC1.4.7.jar differ diff --git a/Server/mods/AdvancedMachines_1.4.6.zip b/Server/mods/AdvancedMachines_1.4.6.zip new file mode 100644 index 0000000..5fb9f0b Binary files /dev/null and b/Server/mods/AdvancedMachines_1.4.6.zip differ diff --git a/Server/mods/AdvancedPowerManagement-1.1.55-IC2_1.112.jar b/Server/mods/AdvancedPowerManagement-1.1.55-IC2_1.112.jar new file mode 100644 index 0000000..8a948e2 Binary files /dev/null and b/Server/mods/AdvancedPowerManagement-1.1.55-IC2_1.112.jar differ diff --git a/Server/mods/ChickenChunks 1.3.1.0.jar b/Server/mods/ChickenChunks 1.3.1.0.jar new file mode 100644 index 0000000..096ed83 Binary files /dev/null and b/Server/mods/ChickenChunks 1.3.1.0.jar differ diff --git a/Server/mods/CoFHCore-1.4.7.3.zip b/Server/mods/CoFHCore-1.4.7.3.zip new file mode 100644 index 0000000..5813b61 Binary files /dev/null and b/Server/mods/CoFHCore-1.4.7.3.zip differ diff --git a/Server/mods/ComputerCraft1.5.zip b/Server/mods/ComputerCraft1.5.zip new file mode 100644 index 0000000..e375382 Binary files /dev/null and b/Server/mods/ComputerCraft1.5.zip differ diff --git a/Server/mods/EnderStorage 1.4.1.2.jar b/Server/mods/EnderStorage 1.4.1.2.jar new file mode 100644 index 0000000..1e29da6 Binary files /dev/null and b/Server/mods/EnderStorage 1.4.1.2.jar differ diff --git a/Server/mods/Factorization-0.7.21.jar b/Server/mods/Factorization-0.7.21.jar new file mode 100644 index 0000000..b32a271 Binary files /dev/null and b/Server/mods/Factorization-0.7.21.jar differ diff --git a/Server/mods/FlatBedrock_1.0.3.zip b/Server/mods/FlatBedrock_1.0.3.zip new file mode 100644 index 0000000..78c557d Binary files /dev/null and b/Server/mods/FlatBedrock_1.0.3.zip differ diff --git a/Server/mods/IC2NuclearControl-1.4.6.zip b/Server/mods/IC2NuclearControl-1.4.6.zip new file mode 100644 index 0000000..8367607 Binary files /dev/null and b/Server/mods/IC2NuclearControl-1.4.6.zip differ diff --git a/Server/mods/LogisticsPipes-MC1.4.7-0.7.0.96.jar b/Server/mods/LogisticsPipes-MC1.4.7-0.7.0.96.jar new file mode 100644 index 0000000..137fabc Binary files /dev/null and b/Server/mods/LogisticsPipes-MC1.4.7-0.7.0.96.jar differ diff --git a/Server/mods/MineFactoryReloaded-2.3.2-287.jar b/Server/mods/MineFactoryReloaded-2.3.2-287.jar new file mode 100644 index 0000000..a2fb716 Binary files /dev/null and b/Server/mods/MineFactoryReloaded-2.3.2-287.jar differ diff --git a/Server/mods/ModularPowersuits-0.3.2-199.jar b/Server/mods/ModularPowersuits-0.3.2-199.jar new file mode 100644 index 0000000..418783e Binary files /dev/null and b/Server/mods/ModularPowersuits-0.3.2-199.jar differ diff --git a/Server/mods/NEI_RedPowerPlugin 1.4.3.1.jar b/Server/mods/NEI_RedPowerPlugin 1.4.3.1.jar new file mode 100644 index 0000000..a7fcd25 Binary files /dev/null and b/Server/mods/NEI_RedPowerPlugin 1.4.3.1.jar differ diff --git a/Server/mods/NetherOres-2.0.6-32.jar b/Server/mods/NetherOres-2.0.6-32.jar new file mode 100644 index 0000000..5fa61ef Binary files /dev/null and b/Server/mods/NetherOres-2.0.6-32.jar differ diff --git a/Server/mods/OCSLua/lua/apis/graph b/Server/mods/OCSLua/lua/apis/graph new file mode 100644 index 0000000..beb2a0f --- /dev/null +++ b/Server/mods/OCSLua/lua/apis/graph @@ -0,0 +1,132 @@ +local Graph = { + getColor = function(self, value, trace) + local colorIndex = math.ceil((value - self.min[trace]) / ((self.max[trace] - self.min[trace]) / #self.gradient[trace])) + if colorIndex == 0 then colorIndex = 1 end + if self.target.isColor() then + return self.gradient[trace][colorIndex] + else + return colors.white + end + end, + draw = function(self) + --get the updates first. + for i=1, #self.update do + self.history[i][#self.history[i] + 1] = self.update[i]() + end + if self.target.setTextScale then self.target.setTextScale(0.5) end + self.target.setBackgroundColor(colors.black) + self.target.setTextColor(colors.white) + self.target.clear() + local newMax, newMin = self.max[1], self.min[1] + --draw traces + for trace=1,#self.update do + if self.history[trace][#self.history[trace]] > self.max[trace] then + if self.sharedBounds and self.history[trace][#self.history[trace]] > newMax then + newMax = self.history[trace][#self.history[trace]] + else + self.max[trace] = self.history[trace][#self.history[trace]] + end + elseif self.history[trace][#self.history[trace]] < self.min[trace] then + if self.sharedBounds and self.history[trace][#self.history[trace]] < newMin then + newMin = self.history[trace][#self.history[trace]] + else + self.min[trace] = self.history[trace][#self.history[trace]] + end + end + local xLim, yLim = self.target.getSize() + if #self.history[trace] > xLim then table.remove(self.history[trace], 1) end + --we set up our value string for numeric value readout here, but draw it later so it doesn't interfere with the full-screen trace. + for i=1, #self.history[trace] do + self.target.setCursorPos(i, yLim - math.ceil((yLim - 1) * (self.history[trace][i] - self.min[trace]) / (self.max[trace] - self.min[trace]))) + self.target.setBackgroundColor(self:getColor(self.history[trace][i], trace)) + self.target.write(" ") + self.target.setBackgroundColor(colors.black) + end + end + --adjust min-max for next round. + if self.sharedBounds then + for i=1, #self.update do + self.max[i] = newMax + self.min[i] = newMin + end + end + --draw trace labels. + for trace = 1, #self.update do + local valueString, cStart, cEnd = "" + if self.valueText[trace] then + valueString = self.valueText[trace]..": " + cStart = #valueString + 1 + valueString = valueString..tostring(self.history[trace][#self.history[trace]]) + cEnd = #valueString + valueString = valueString.." / "..self.max[trace] + end + local xLim, yLim = self.target.getSize() + if trace + 1 <= yLim then + self.target.setCursorPos(2, trace + 1) + for i=1, #valueString do + if i >= cStart and i <= cEnd then + self.target.setTextColor(self:getColor(self.history[trace][#self.history[trace]], trace)) + end + self.target.write(string.sub(valueString, i, i)) + self.target.setTextColor(colors.white) + end + end + end + end, + tostring = function(self) + local valueString = "" + if self.valueText[1] then + valueString = self.valueText[1]..": " + end + valueString = valueString..tostring(self.history[1][#self.history[1]]).." / "..self.max[1] + return valueString + end, +} + +local gmetatable = { + __index = Graph, + __tostring = function(g) return g:tostring() end, +} + +function new(target, updateFunction, valueText, gradientTable, min, max, sharedBounds) + if not target then return nil, "Must specify output target!" end + if not updateFunction then return nil, "Must specify update function!" end + local g = { + min = type(min) == "table" and min or {}, + max = type(max) == "table" and max or {}, + target = target, + update = type(updateFunction) == "table" and updateFunction or {updateFunction}, + history = {}, + gradient = {}, + valueText = type(valueText) == "table" and valueText or {valueText}, + sharedBounds = shareBounds or false + } + for i=1, #g.update do + g.history[i] = {} + end + if type(min) ~= "table" then + local setMin = min or 0 + for i=1, #g.update do + g.min[i] = setMin + end + end + if type(max) ~= "table" then + local setMax = max or 1 + for i=1, #g.update do + g.max[i] = setMax + end + end + if gradientTable and type(gradientTable) == "table" and type(gradientTable[1]) == "table" then + g.gradient = gradientTable + elseif gradientTable and type(gradientTable) == "table" then + for i=1, #g.update do + g.gradient[i] = gradientTable + end + else + for i=1, #g.update do + g.gradient[i] = {colors.red, colors.orange, colors.yellow, colors.lime, colors.green} + end + end + setmetatable(g, gmetatable) + return g +end \ No newline at end of file diff --git a/Server/mods/OCSLua/lua/apis/sensor b/Server/mods/OCSLua/lua/apis/sensor new file mode 100644 index 0000000..b96350e --- /dev/null +++ b/Server/mods/OCSLua/lua/apis/sensor @@ -0,0 +1,45 @@ +local function waitForResponse( _id ) + while true do + local event = {os.pullEvent()} + if event[2] == _id then + if event[1] == "ocs_success" then + return event[3] + elseif event[1] == "ocs_error" then + error(event[3],2) + end + end + end +end + +function wrap(side) + local wrappedTable = {} + if peripheral.getType(side) == "sensor" then + local periph = peripheral.wrap(side) + for k,v in pairs(periph) do + if type(k) == "string" and type(v) == "function" then + wrappedTable[k] = function(...) + local id = periph[k](...) + if id == -1 then + return false + end + return waitForResponse(id) + end + end + end + return wrappedTable + else + return nil, "not a sensor" + end +end + +function call(side, ...) + if peripheral.getType(side) == "sensor" then + local id = peripheral.call(side, ...) + if id == -1 then + return false + end + return waitForResponse(id) + else + return nil, "not a sensor" + end +end \ No newline at end of file diff --git a/Server/mods/OCSLua/lua/programs/sensorview b/Server/mods/OCSLua/lua/programs/sensorview new file mode 100644 index 0000000..1cb04f4 --- /dev/null +++ b/Server/mods/OCSLua/lua/programs/sensorview @@ -0,0 +1,285 @@ +local sideNames = rs.getSides() +local sensorSides = {} +local sideSelection, targetSelection, targetOffset, detailOffset = 1, 1, 1, 1 +local detailLines, targetNameMenuTable +local graphing, graphSide, graphTarget, graphMatch, graphInstance = false + +os.loadAPI("ocs/apis/graph") +os.loadAPI("ocs/apis/sensor") + +local function checkSensors() + for _,side in ipairs(sideNames) do + if peripheral.getType(side) == "sensor" then + sensorSides[side] = true + else + sensorSides[side] = false + end + end +end + +local function writeEntry(menuTable, index, cursorPos) + if cursorPos == index then + term.setBackgroundColor(term.isColor() and colors.blue or colors.white) + term.setTextColor(term.isColor() and colors.white or colors.black) + term.write(string.sub(menuTable[index], 1, 16)) + term.setBackgroundColor(colors.black) + term.setTextColor(colors.white) + else + term.write(string.sub(menuTable[index], 1, 16)) + end +end + +local function toLines(currTable, linesTable, trackingTable, depth) + for k,v in pairs(currTable) do + if type(v) == "table" then + table.insert(linesTable, string.rep(" ", depth)..tostring(k)..":") + if trackingTable[v] then + table.insert(linesTable, string.rep(" ", depth + 1).."") + else + trackingTable[v] = #linesTable + toLines(v, linesTable, trackingTable, depth + 1) + end + else + table.insert(linesTable, string.rep(" ", depth)..tostring(k).."> "..tostring(v)) + end + end +end + +local function drawDividerDown(startY) + local w, h = term.getSize() + for i=startY, h do + term.setCursorPos(17, i) + term.write("|") + end +end + +local function redraw() + w, h = term.getSize() + --pre-fetch sensor targets and detailed target information. + local targetNames = nil + detailLines = {} + checkSensors() + if sensorSides[sideNames[sideSelection]] then + targetNames = sensor.call(sideNames[sideSelection], "getSensorName") and sensor.call(sideNames[sideSelection], "getTargets") + targetNameMenuTable = {} + if targetNames then + for k,v in pairs(targetNames) do + table.insert(targetNameMenuTable, k) + end + table.sort(targetNameMenuTable) + if #targetNameMenuTable > 0 then + toLines(sensor.call(sideNames[sideSelection], "getTargetDetails", targetNameMenuTable[targetSelection]), detailLines, {}, 0) + end + end + end + --now draw the screen. + term.clear() + term.setCursorPos(1, 1) + term.write("=Sensor Info Viewer="..string.rep("=", w - 20)) + term.setCursorPos(1, 2) + for n,side in ipairs(sideNames) do + if n == sideSelection then + term.setBackgroundColor(term.isColor() and colors.blue or colors.white) + term.setTextColor(term.isColor() and colors.white or colors.black) + term.write(side) + term.setBackgroundColor(colors.black) + term.setTextColor(colors.white) + term.write(" ") + else + term.write(side.." ") + end + end + term.setCursorPos(1, 3) + term.write("-Targets--------+-Info-"..string.rep("-", w - 23)) + + if targetNames then + --make sure we have valid targets, even if we have a valid sensor. + if #targetNameMenuTable > 0 then + term.setCursorPos(1, 4) + if targetOffset > 1 then + term.write("/\\") + else + writeEntry(targetNameMenuTable, 1, targetSelection) + end + --h-5 to leave room for top and bottom entries. + for i=1, math.min(h - 5, #targetNameMenuTable - 1) do + term.setCursorPos(1, i + 4) + writeEntry(targetNameMenuTable, targetOffset + i, targetSelection) + end + if #targetNameMenuTable >= h then + term.setCursorPos(1, h) + if #targetNameMenuTable > targetOffset + h - 4 then + term.write("\\/") + else + writeEntry(targetNameMenuTable, #targetNameMenuTable, targetSelection) + end + end + + --detailed info. + for i=1, math.min(h - 3, #detailLines - ((detailOffset - 1) * (h - 3))) do + term.setCursorPos(17, i + 3) + term.write("|"..string.sub(detailLines[(detailOffset - 1) * (h - 3) + i], 1, w - 17)) + end + local currX, currY = term.getCursorPos() + drawDividerDown(currY + 1) + else + term.setCursorPos(1, 4) + term.write("No targets found|") + drawDividerDown(5) + end + else + if peripheral.getType(sideNames[sideSelection]) == "sensor" then + term.setCursorPos(1, 4) + term.write("No sensor card |") + drawDividerDown(5) + else + term.setCursorPos(1, 4) + term.write("No sensor found |") + drawDividerDown(5) + end + end + term.setCursorPos(1, h) +end + +local function findGraphMatch(currTable, target, matchCount, trackingTable) + for k, v in pairs(currTable) do + if type(v) == "table" then + if trackingTable[v] then return false end + trackingTable[v] = true + ret, path, count = findGraphMatch(v, target, matchCount, trackingTable) + if ret and path then + return ret, tostring(k).."-"..path + elseif count then + matchCount = count + end + elseif type(v) == "number" then + matchCount = matchCount + 1 + if matchCount == target then return v, tostring(k) end + end + end + return false, nil, matchCount +end + +local function createGraph(targetNum) + local monSide = "" + for k, side in ipairs(rs.getSides()) do + if peripheral.getType(side) == "monitor" then + monSide = side + break + end + end + if monSide and targetNum >= 1 and findGraphMatch(sensor.call(graphSide, "getTargetDetails", graphTarget), targetNum, 0, {}) then + graphMatch = targetNum + local val, name = findGraphMatch(sensor.call(graphSide, "getTargetDetails", graphTarget), targetNum, 0, {}) + local updateFunc = function() return (findGraphMatch(sensor.call(graphSide, "getTargetDetails", graphTarget), graphMatch, 0, {})) end + graphInst = graph.new(peripheral.wrap(monSide), updateFunc, name) + return graphInst + end +end + +while true do + redraw() + local e, p1 = os.pullEvent() + if e == "key" then + local w, h = term.getSize() + if p1 == 203 then + --left, selects previous side + if sideSelection > 1 then + sideSelection = sideSelection - 1 + targetSelection = 1 + targetOffset = 1 + detailOffset = 1 + detailLines = nil + end + elseif p1 == 205 then + --right, selects next side + if sideSelection < 6 then + sideSelection = sideSelection + 1 + targetSelection = 1 + targetOffset = 1 + detailOffset = 1 + detailLines = nil + end + elseif p1 == 200 then + --up, selects previous target, adjusting offset if necessary. + if targetSelection > 1 then + if targetSelection - targetOffset + 1 == 2 and targetOffset > 1 then + targetOffset = targetOffset - 1 + end + targetSelection = targetSelection - 1 + detailOffset = 1 + detailLines = nil + end + elseif p1 == 208 then + --down, selects next target, adjusting offset if necessary. + if targetNameMenuTable and targetSelection < #targetNameMenuTable then + if targetSelection - targetOffset + 1 == h - 4 and targetSelection ~= #targetNameMenuTable - 1 then + targetOffset = targetOffset + 1 + end + targetSelection = targetSelection + 1 + detailOffset = 1 + detailLines = nil + end + elseif p1 == 201 then + --pgup, moves detail + if detailOffset > 1 then + detailOffset = detailOffset - 1 + end + elseif p1 == 209 then + --pgdown, moves detail + local w, h = term.getSize() + if detailLines and detailOffset < math.ceil(#detailLines / (h - 3)) then + detailOffset = detailOffset + 1 + end + --and now, since redraw() will eat char events with the change to sensor.call: + elseif p1 == 31 then --s + if detailLines then + local fileHandle = io.open("sensorDetailed-"..sideNames[sideSelection].."-"..targetNameMenuTable[targetSelection], "w") + if fileHandle then + for k, v in ipairs(detailLines) do + fileHandle:write(v.."\n") + end + fileHandle:close() + end + end + elseif p1 == 16 then --q + sleep(0) + return + elseif p1 == 34 then --g + if graph then + graphing = not graphing + if not graphing then + graphSide = nil + graphTarget = nil + graphUpdate = nil + else + graphSide = sideNames[sideSelection] + graphTarget = targetNameMenuTable[targetSelection] + graphInstance = createGraph(1) + graphUpdate = os.startTimer(0.5) + end + end + elseif p1 == 49 then --n + if graphing then + local newGraph = createGraph(graphMatch + 1) + if newGraph then + graphInstance = newGraph + graphUpdate = os.startTimer(0.5) + end + end + elseif p1 == 25 then --p + if graphing then + local newGraph = createGraph(graphMatch - 1) + if newGraph then + graphInstance = newGraph + graphUpdate = os.startTimer(0.5) + end + end + end + elseif e == "timer" then + if p1 == graphUpdate then + graphInstance:draw() + graphUpdate = os.startTimer(0.5) + end + end +end \ No newline at end of file diff --git a/Server/mods/OmniTools-3.0.4.zip b/Server/mods/OmniTools-3.0.4.zip new file mode 100644 index 0000000..f3e541f Binary files /dev/null and b/Server/mods/OmniTools-3.0.4.zip differ diff --git a/Server/mods/OpenCCSensors-0.1.4b.zip b/Server/mods/OpenCCSensors-0.1.4b.zip new file mode 100644 index 0000000..91262d3 Binary files /dev/null and b/Server/mods/OpenCCSensors-0.1.4b.zip differ diff --git a/Server/mods/PowerConverters-2.2.2-29.jar b/Server/mods/PowerConverters-2.2.2-29.jar new file mode 100644 index 0000000..25ff28a Binary files /dev/null and b/Server/mods/PowerConverters-2.2.2-29.jar differ diff --git a/Server/mods/RedPowerCompat-2.0pr6.zip b/Server/mods/RedPowerCompat-2.0pr6.zip new file mode 100644 index 0000000..b21143c Binary files /dev/null and b/Server/mods/RedPowerCompat-2.0pr6.zip differ diff --git a/Server/mods/RedPowerCore-2.0pr6.zip b/Server/mods/RedPowerCore-2.0pr6.zip new file mode 100644 index 0000000..ca3ef5b Binary files /dev/null and b/Server/mods/RedPowerCore-2.0pr6.zip differ diff --git a/Server/mods/RedPowerDigital-2.0pr6.zip b/Server/mods/RedPowerDigital-2.0pr6.zip new file mode 100644 index 0000000..56484d4 Binary files /dev/null and b/Server/mods/RedPowerDigital-2.0pr6.zip differ diff --git a/Server/mods/RedPowerMechanical-2.0pr6.zip b/Server/mods/RedPowerMechanical-2.0pr6.zip new file mode 100644 index 0000000..d20447a Binary files /dev/null and b/Server/mods/RedPowerMechanical-2.0pr6.zip differ diff --git a/Server/mods/StevesCarts2.0.0.a62.zip b/Server/mods/StevesCarts2.0.0.a62.zip new file mode 100644 index 0000000..18039b0 Binary files /dev/null and b/Server/mods/StevesCarts2.0.0.a62.zip differ diff --git a/Server/mods/ThermalExpansion-2.2.2.2.zip b/Server/mods/ThermalExpansion-2.2.2.2.zip new file mode 100644 index 0000000..ee3f18f Binary files /dev/null and b/Server/mods/ThermalExpansion-2.2.2.2.zip differ diff --git a/Server/mods/WR-CBE Addons 1.3.2.8.jar b/Server/mods/WR-CBE Addons 1.3.2.8.jar new file mode 100644 index 0000000..6568b2e Binary files /dev/null and b/Server/mods/WR-CBE Addons 1.3.2.8.jar differ diff --git a/Server/mods/WR-CBE Core 1.3.2.8.jar b/Server/mods/WR-CBE Core 1.3.2.8.jar new file mode 100644 index 0000000..8287c02 Binary files /dev/null and b/Server/mods/WR-CBE Core 1.3.2.8.jar differ diff --git a/Server/mods/WR-CBE RedPower 1.3.2.8.jar b/Server/mods/WR-CBE RedPower 1.3.2.8.jar new file mode 100644 index 0000000..62cadf9 Binary files /dev/null and b/Server/mods/WR-CBE RedPower 1.3.2.8.jar differ diff --git a/Server/mods/Weaponmod.zip b/Server/mods/Weaponmod.zip new file mode 100644 index 0000000..ec04327 Binary files /dev/null and b/Server/mods/Weaponmod.zip differ diff --git a/Server/mods/[1.4.7]bspkrsCorev2.02.zip b/Server/mods/[1.4.7]bspkrsCorev2.02.zip new file mode 100644 index 0000000..f835f86 Binary files /dev/null and b/Server/mods/[1.4.7]bspkrsCorev2.02.zip differ diff --git a/Server/mods/adv-repulsion-systems-52.0.6.jar b/Server/mods/adv-repulsion-systems-52.0.6.jar new file mode 100644 index 0000000..a2d323f Binary files /dev/null and b/Server/mods/adv-repulsion-systems-52.0.6.jar differ diff --git a/Server/mods/appeng-rv9-i.zip b/Server/mods/appeng-rv9-i.zip new file mode 100644 index 0000000..de26e06 Binary files /dev/null and b/Server/mods/appeng-rv9-i.zip differ diff --git a/Server/mods/buildcraft-A-3.4.3.jar b/Server/mods/buildcraft-A-3.4.3.jar new file mode 100644 index 0000000..e7b7c9c Binary files /dev/null and b/Server/mods/buildcraft-A-3.4.3.jar differ diff --git a/Server/mods/compactsolars-universal-1.4.7-4.0.3.29.zip b/Server/mods/compactsolars-universal-1.4.7-4.0.3.29.zip new file mode 100644 index 0000000..880f057 Binary files /dev/null and b/Server/mods/compactsolars-universal-1.4.7-4.0.3.29.zip differ diff --git a/Server/mods/dimensional-anchor-52.2.0.jar b/Server/mods/dimensional-anchor-52.2.0.jar new file mode 100644 index 0000000..88b7c36 Binary files /dev/null and b/Server/mods/dimensional-anchor-52.2.0.jar differ diff --git a/Server/mods/ee3-universal-pre1f.jar b/Server/mods/ee3-universal-pre1f.jar new file mode 100644 index 0000000..2b3cd9e Binary files /dev/null and b/Server/mods/ee3-universal-pre1f.jar differ diff --git a/Server/mods/immibis-core-52.4.6.jar b/Server/mods/immibis-core-52.4.6.jar new file mode 100644 index 0000000..af713f4 Binary files /dev/null and b/Server/mods/immibis-core-52.4.6.jar differ diff --git a/Server/mods/industrialcraft-2_1.115.231-lf.jar b/Server/mods/industrialcraft-2_1.115.231-lf.jar new file mode 100644 index 0000000..1484723 Binary files /dev/null and b/Server/mods/industrialcraft-2_1.115.231-lf.jar differ diff --git a/Server/mods/ironchest-universal-1.4.7-5.1.0.275.zip b/Server/mods/ironchest-universal-1.4.7-5.1.0.275.zip new file mode 100644 index 0000000..6100e24 Binary files /dev/null and b/Server/mods/ironchest-universal-1.4.7-5.1.0.275.zip differ diff --git a/Server/mods/mystcraft-uni-1.4.7-0.10.1.00.zip b/Server/mods/mystcraft-uni-1.4.7-0.10.1.00.zip new file mode 100644 index 0000000..71438d0 Binary files /dev/null and b/Server/mods/mystcraft-uni-1.4.7-0.10.1.00.zip differ diff --git a/Server/mods/nei_plugins-1.0.4.5a.jar b/Server/mods/nei_plugins-1.0.4.5a.jar new file mode 100644 index 0000000..aaed8e1 Binary files /dev/null and b/Server/mods/nei_plugins-1.0.4.5a.jar differ diff --git a/Server/mods/tubestuff-52.3.2.jar b/Server/mods/tubestuff-52.3.2.jar new file mode 100644 index 0000000..cf6dfad Binary files /dev/null and b/Server/mods/tubestuff-52.3.2.jar differ diff --git a/Server/mods/weaponmod/weaponmod.properties b/Server/mods/weaponmod/weaponmod.properties new file mode 100644 index 0000000..33ffd27 --- /dev/null +++ b/Server/mods/weaponmod/weaponmod.properties @@ -0,0 +1,146 @@ +#Balkon's WeaponMod 1.4.6 v1.10.3 +#Properties file + +#Set the following values to "true" to use them in your game, +#and "false" if you don't want them. +#If you disable the knife, you disable the bayonet too. + +cannon-block-damage=true +dynamite-block-damage=true +can-throw-knife=true +can-throw-spear=true +#Turn this to "owner" to allow only the thrower/shooter of the projectile to pick the item up. If set to "all" everyone can pick the item up. Only affects projectiles that can be picked up. +#projectile-accessibility=owner +projectile-accessibility=all + +spear=true +halberd=true +battleaxe=true +warhammer=true +knife=true +javelin=true +musket=true +crossbow=true +blowgun=true +dynamite=true +flail=true +firerod=true +cannon=true +blunderbuss=true +dummy=true +boomerang=true + +#Entity ID's +#Since v9.0 you cannot leave the entity ID's 0 anymore. +#Client- and server-side entity ID's MUST be equal. + +spear-entity=2300 +knife-entity=2301 +flail-entity=2302 +dynamite-entity=2303 +javelin-entity=2304 +bullet-entity=2305 +dart-entity=2306 +bolt-entity=2307 +cannon-entity=2308 +cannonball-entity=2309 +shot-entity=2310 +dummy-entity=2311 +boomerang-entity=2312 + +#Item ID's +#Since v9.0 you cannot leave the item ID's 0 anymore. +#Client- and server-side item ID's MUST be equal. + +#Spear +wood-spear-id=11520 +stone-spear-id=11521 +iron-spear-id=11522 +diamond-spear-id=11523 +gold-spear-id=11524 + +#Halberd +wood-halberd-id=11525 +stone-halberd-id=11526 +iron-halberd-id=11527 +diamond-halberd-id=11528 +gold-halberd-id=11529 + +#Battleaxe +wood-battleaxe-id=11530 +stone-battleaxe-id=11531 +iron-battleaxe-id=11532 +diamond-battleaxe-id=11533 +gold-battleaxe-id=11534 + +#Warhammer +wood-warhammer-id=11535 +stone-warhammer-id=11536 +iron-warhammer-id=11537 +diamond-warhammer-id=11538 +gold-warhammer-id=11539 + +#Knife +wood-knife-id=11540 +stone-knife-id=11541 +iron-knife-id=11542 +diamond-knife-id=11543 +gold-knife-id=11544 + +#Flail +wood-flail-id=11545 +stone-flail-id=11546 +iron-flail-id=11547 +diamond-flail-id=11548 +gold-flail-id=11549 + +#Javelin +javelin-id=11550 + +#Musket +musket-id=11551 +musketbayonet-id=11552 +musket-ironpart-id=11553 +bullet-id=11554 + +#Crossbow +crossbow-id=11555 +bolt-id=11556 + +#Blowgun +blowgun-id=11557 +dart-id=11558 + +#Dynamite +dynamite-id=11559 + +#Fire Rod +firerod-id=11560 + +#Cannon +cannon-id=11561 +cannonball-id=11562 + +#Blunderbuss +blunderbuss-id=11563 +shot-id=11564 +blunder-ironpart-id=11565 + +#Training Dummy +dummy-id=11566 + +#Overall +gun-stock-id=11567 + +#Boomerang +wood-boomerang-id=11568 +stone-boomerang-id=11569 +iron-boomerang-id=11570 +diamond-boomerang-id=11571 +gold-boomerang-id=11572 + +#Reload durations +musket-reloadtime=30 +blunderbuss-reloadtime=20 +crossbow-reloadtime=15 +blowgun-reloadtime=10 diff --git a/Server/ops.txt b/Server/ops.txt new file mode 100644 index 0000000..fbc8ba4 --- /dev/null +++ b/Server/ops.txt @@ -0,0 +1 @@ +Lorenz_von_Baum diff --git a/Server/permissions.yml b/Server/permissions.yml new file mode 100644 index 0000000..e69de29 diff --git a/Server/plugins/ChatManager.jar b/Server/plugins/ChatManager.jar new file mode 100644 index 0000000..d9f5ca8 Binary files /dev/null and b/Server/plugins/ChatManager.jar differ diff --git a/Server/plugins/ChatManager/config.yml b/Server/plugins/ChatManager/config.yml new file mode 100644 index 0000000..31ad44f --- /dev/null +++ b/Server/plugins/ChatManager/config.yml @@ -0,0 +1,5 @@ +enable: false +message-format: <%prefix%player%suffix> %message +global-message-format: <%prefix%player%suffix> &e%message +ranged-mode: false +chat-range: 100.0 diff --git a/Server/plugins/ChestShop/config.yml b/Server/plugins/ChestShop/config.yml new file mode 100644 index 0000000..0851220 --- /dev/null +++ b/Server/plugins/ChestShop/config.yml @@ -0,0 +1,84 @@ + +PREFERRED_ECONOMY_PLUGIN: "" +#WHEN NOT USING VAULT. Preferred (if not found, uses any other) economy plugin (iConomy, BOSEconomy, Essentials). + +SHOP_INTERACTION_INTERVAL: 100 +#(In 1/1000th of a second) How often can a player use the shop sign? +IGNORE_CREATIVE_MODE: true +#Do you want to allow using shops to people in creative mode? +REVERSE_BUTTONS: false +#If true, people will buy with left-click and sell with right-click. +ALLOW_SIGN_CHEST_OPEN: true +#Can shop's chest be opened by owner with right-clicking a shop's sign? +ALLOW_LEFT_CLICK_DESTROYING: true +#If true, if you left-click your own shop sign you won't open chest's inventory, but instead you will start destroying the sign. + +REMOVE_EMPTY_SHOPS: false +#If true, if the shop is empty, the sign is destroyed and put into the chest, so the shop isn't usable anymore. + +ADMIN_SHOP_NAME: "Admin Shop" +#First line of your Admin Shop's sign should look like this +SERVER_ECONOMY_ACCOUNT: "" +#The economy account which Admin Shops should use and to which all taxes will go +TAX_AMOUNT: 0 +#Percent of the price that should go to the server's account. (100 = 100 percent) +SERVER_TAX_AMOUNT: 0 +#Percent of the price that should go to the server's account when buying from an Admin Shop + +SHOP_CREATION_PRICE: 0 +#Amount of money player must pay to create a shop +SHOP_REFUND_PRICE: 0 +#How much money do you get back when destroying a sign? + +BLOCK_SHOPS_WITH_SELL_PRICE_HIGHER_THAN_BUY_PRICE: true +#Should we block shops that sell things for more than they buy? (This prevents newbies from creating shops that would be exploited) + +ALLOW_MULTIPLE_SHOPS_AT_ONE_BLOCK: false +#Do you want to allow other players to build a shop on a block where there's one already? +ALLOW_PARTIAL_TRANSACTIONS: true +#Can shops be used even when the seller doesn't have enough items? (The price will be scaled adequatly to the item amount) + +SHOW_MESSAGE_OUT_OF_STOCK: true +#Do you want to show "Out of stock" messages? +SHOW_TRANSACTION_INFORMATION_CLIENT: true +#Do you want to show "You bought/sold... " messages? +SHOW_TRANSACTION_INFORMATION_OWNER: true +#Do you want to show "Somebody bought/sold... " messages? + +LOG_TO_FILE: false +#If true, plugin will log transactions in its own file +LOG_TO_CONSOLE: true +#Do you want ChestShop's messages to show up in console? +LOG_TO_DATABASE: false +#If true, plugin will log transactions in EBean database +RECORD_TIME_TO_LIVE: 600 +#How long should transaction information be stored in the database (in seconds, -1 means forever)? + +USE_BUILT_IN_PROTECTION: true +#Do you want to use built-in protection against chest destruction? +PROTECT_CHEST_WITH_LWC: false +#Do you want to protect shop chests with LWC? +PROTECT_SIGN_WITH_LWC: false +#Do you want to protect shop signs with LWC? + +GENERATE_STATISTICS_PAGE: false +#If true, plugin will generate shop statistics webpage. +STATISTICS_PAGE_PATH: "plugins/ChestShop/website.html" +#Where should your generated website be saved? +STATISTICS_PAGE_GENERATION_INTERVAL: 60 +#How often should the website be generated? + +TOWNY_INTEGRATION: false +#Do you want to only let people build inside shop plots? +TOWNY_SHOPS_FOR_OWNERS_ONLY: true +#If true, only plot owners are able to build inside a shop plot. If false, every town's resident is able to build there. + +WORLDGUARD_INTEGRATION: false +#Do you want to only let people build inside regions? +WORLDGUARD_USE_FLAG: true +#Do you want to only let poeple build inside region flagged by doing /region regionName flag chestshop allow? +WORLDGUARD_USE_PROTECTION: false +#Do you want ChestShop to respect WorldGuard's chest protection? + +HEROES_EXP: 100 +#How much Heroes exp should people get for creating a ChestShop? diff --git a/Server/plugins/ChestShop/local.yml b/Server/plugins/ChestShop/local.yml new file mode 100644 index 0000000..1f522cc --- /dev/null +++ b/Server/plugins/ChestShop/local.yml @@ -0,0 +1,28 @@ + +prefix: "&a[Shop] &f" +iteminfo: "&aItem Information:&f" +ACCESS_DENIED: "You don't have permission to do that!" +NOT_ENOUGH_MONEY: "You don't have enough money!" +NOT_ENOUGH_MONEY_SHOP: "Shop owner doesn't have enough money!" +NO_BUYING_HERE: "You can't buy here!" +NO_SELLING_HERE: "You can't sell here!" +NOT_ENOUGH_SPACE_IN_INVENTORY: "You haven't got enough space in inventory!" +NOT_ENOUGH_SPACE_IN_CHEST: "There isn't enough space in chest!" +NOT_ENOUGH_ITEMS_TO_SELL: "You don't have enough items to sell!" +NOT_ENOUGH_STOCK: "This shop is out of stock." +NOT_ENOUGH_STOCK_IN_YOUR_SHOP: "Your %material shop is out of stock!" +YOU_BOUGHT_FROM_SHOP: "You bought %amount %item from %owner for %price." +SOMEBODY_BOUGHT_FROM_YOUR_SHOP: "%buyer bought %amount %item for %price from you." +YOU_SOLD_TO_SHOP: "You sold %amount %item to %buyer for %price." +SOMEBODY_SOLD_TO_YOUR_SHOP: "%seller sold %amount %item for %price to you." +YOU_CANNOT_CREATE_SHOP: "You can't create this type of shop!" +NO_CHEST_DETECTED: "Couldn't find a chest!" +ANOTHER_SHOP_DETECTED: "Another player's shop detected!" +CANNOT_ACCESS_THE_CHEST: "You don't have permissions to access this chest!" +PROTECTED_SHOP: "Successfully protected the shop with LWC!" +SHOP_CREATED: "Shop successfully created!" +SHOP_REFUNDED: "You have been refunded %amount." +NO_PERMISSION: "You don't have permissions to do that!" +INCORRECT_ITEM_ID: "You have specified invalid item id!" +NOT_ENOUGH_PROTECTIONS: "You have reached the protection limit!" +CANNOT_CREATE_SHOP_HERE: "You can't create shop here!" \ No newline at end of file diff --git a/Server/plugins/ChestShop/longName.storage b/Server/plugins/ChestShop/longName.storage new file mode 100644 index 0000000..e69de29 diff --git a/Server/plugins/ChestShop3-46.jar b/Server/plugins/ChestShop3-46.jar new file mode 100644 index 0000000..4efd85c Binary files /dev/null and b/Server/plugins/ChestShop3-46.jar differ diff --git a/Server/plugins/ClearLag.jar b/Server/plugins/ClearLag.jar new file mode 100644 index 0000000..3fb7f6e Binary files /dev/null and b/Server/plugins/ClearLag.jar differ diff --git a/Server/plugins/ClearLag/config.yml b/Server/plugins/ClearLag/config.yml new file mode 100644 index 0000000..771acf9 --- /dev/null +++ b/Server/plugins/ClearLag/config.yml @@ -0,0 +1,121 @@ +#--------------------------------------------------------------------# +# ClearLag Configuration File # +#--------------------------------------------------------------------# +# Configure to your liking, reload the config by tying: /lagg reload # +# - # +# Here is a helpful tutorial on this configuration setup! # +# http://dev.bukkit.org/server-mods/clearlagg/pages/config-setup/ # +#--------------------------------------------------------------------# +# All possible mob names # +# http://dev.bukkit.org/server-mods/clearlagg/pages/mob-types/nodes/ # +#--------------------------------------------------------------------# +settings: + auto-update: true + enable-signs: true + config-version: three + broadcast-message: '&6[ClearLag] &aRemoved +RemoveAmount Entities!' + enable-scheduler: true + enable-limit: true + autoremoval-interval: 400 + +warning: + autoremoval-warning: true + autoremoval-warningdelay: 60 + broadcast-warning: true + autoremoval-warningmessage: '&4[ClearLag] &cWarning Ground items will be removed in one minute!' + +#This is /lagg killmobs, put what you DON'T want removed! +kill-mobs: + disable-build-wither: false + mob-filter: + - Villager + - Wolf + +#This takes care of mob spawners +mobspawner: + enabled: false + max-spawn: 4 + +remove: + world-filter: + - this_world + broadcast-removal: true + boat: true + falling-block: true + experienceOrb: true + painting: true + projectile: true + item: true + itemframe: false + minecart: true + primed-tnt: true + arrow: true + snowball: true + fireball: true + ender-signal: true + mobs: + - None + - None + +command-remove: + world-filter: + - this_world + broadcast-removal: false + boat: true + falling-block: true + experienceOrb: true + painting: true + projectile: true + item: true + itemframe: false + minecart: true + primed-tnt: true + arrow: true + snowball: true + fireball: true + ender-signal: true + mobs: + - None + - None + +check: + world-filter: + - this_world + boat: true + falling-block: true + experienceOrb: true + painting: true + projectile: true + item: true + itemframe: false + minecart: true + primed-tnt: true + arrow: true + snowball: true + fireball: true + ender-signal: true + mobs: + creature: true + animals: true + monster: true + +limit: + max: 1000 + check-interval: 60 + world-filter: + - this_world + broadcast-removal: true + remove: + boat: true + falling-block: true + experienceOrb: true + painting: true + projectile: true + item: true + itemframe: false + minecart: true + primed-tnt: true + arrow: true + snowball: true + fireball: true + ender-signal: true \ No newline at end of file diff --git a/Server/plugins/Essentials.jar b/Server/plugins/Essentials.jar new file mode 100644 index 0000000..497a33a Binary files /dev/null and b/Server/plugins/Essentials.jar differ diff --git a/Server/plugins/Essentials/EssentialsProtect.db b/Server/plugins/Essentials/EssentialsProtect.db new file mode 100644 index 0000000..a50291e Binary files /dev/null and b/Server/plugins/Essentials/EssentialsProtect.db differ diff --git a/Server/plugins/Essentials/config.yml b/Server/plugins/Essentials/config.yml new file mode 100644 index 0000000..bbf1517 --- /dev/null +++ b/Server/plugins/Essentials/config.yml @@ -0,0 +1,703 @@ +############################################################ +# +------------------------------------------------------+ # +# | Notes | # +# +------------------------------------------------------+ # +############################################################ + +# If you want to use special characters in this document, such as accented letters, you MUST save the file as UTF-8, not ANSI. +# If you receive an error when Essentials loads, ensure that: +# - No tabs are present: YAML only allows spaces +# - Indents are correct: YAML hierarchy is based entirely on indentation +# - You have "escaped" all apostrophes in your text: If you want to write "don't", for example, write "don''t" instead (note the doubled apostrophe) +# - Text with symbols is enclosed in single or double quotation marks + +# If you have problems join the Essentials help support channel: http://tiny.cc/EssentialsChat + +############################################################ +# +------------------------------------------------------+ # +# | Essentials (Global) | # +# +------------------------------------------------------+ # +############################################################ + +# A color code between 0-9 or a-f. Set to 'none' to disable. +ops-name-color: '4' + +# The character(s) to prefix all nicknames, so that you know they are not true usernames. +nickname-prefix: '~' + +# Disable this if you have any other plugin, that modifies the displayname of a user. +change-displayname: true + +# When this option is enabled, the (tab) player list will be updated with the displayname. +# The value of change-displayname (above) has to be true. +#change-playerlist: true + +# When essentialschat.jar isnt used, force essentials to add the prefix and suffix from permission plugins to displayname +# This setting is ignored if essentialschat.jar is used, and defaults to 'true' +# The value of change-displayname (above) has to be true. +# Do not edit this setting unless you know what you are doing! +#add-prefix-suffix: false + +# The delay, in seconds, required between /home, /tp, etc. +teleport-cooldown: 0 + +# The delay, in seconds, before a user actually teleports. If the user moves or gets attacked in this timeframe, the teleport never occurs. +teleport-delay: 0 + +# The delay, in seconds, a player can't be attacked by other players after they have been teleported by a command +# This will also prevent the player attacking other players +teleport-invulnerability: 4 + +# The delay, in seconds, required between /heal attempts +heal-cooldown: 60 + +# What to prevent from /i /give +# e.g item-spawn-blacklist: 46,11,10 +item-spawn-blacklist: + +# Set this to true if you want permission based item spawn rules +# Note: The blacklist above will be ignored then. +# Permissions: +# - essentials.itemspawn.item-all +# - essentials.itemspawn.item-[itemname] +# - essentials.itemspawn.item-[itemid] +# - essentials.give.item-all +# - essentials.give.item-[itemname] +# - essentials.give.item-[itemid] +# For more information, visit http://wiki.ess3.net/wiki/Command_Reference/ICheat#Item.2FGive +permission-based-item-spawn: false + +# Mob limit on the /spawnmob command per execution +spawnmob-limit: 10 + +# Shall we notify users when using /lightning +warn-on-smite: true + +# motd and rules are now configured in the files motd.txt and rules.txt + +# When a command conflicts with another plugin, by default, Essentials will try to force the OTHER plugin to take priority. +# Commands in this list, will tell Essentials to 'not give up' the command to other plugins. +# In this state, which plugin 'wins' appears to be almost random. +# +# If you have two plugin with the same command and you wish to force Essentials to take over, you need an alias. +# To force essentials to take 'god' alias 'god' to 'egod'. +# See http://wiki.bukkit.org/Bukkit.yml#aliases for more information + +overridden-commands: +# - god + +# Disabled commands will be completely unavailable on the server. +# Disabling commands here will have no effect on command conflicts. +disabled-commands: +# - nick + +# These commands will be shown to players with socialSpy enabled +# You can add commands from other plugins you may want to track or +# remove commands that are used for something you dont want to spy on +socialspy-commands: + - msg + - w + - r + - mail + - m + - t + - whisper + - emsg + - tell + - er + - reply + - ereply + - email + - action + - describe + - eme + - eaction + - edescribe + - etell + - ewhisper + - pm + +# If you do not wish to use a permission system, you can define a list of 'player perms' below. +# This list has no effect if you are using a supported permissions system. +# If you are using an unsupported permissions system simply delete this section. +# Whitelist the commands and permissions you wish to give players by default (everything else is op only). +# These are the permissions without the "essentials." part. +player-commands: + - afk + - afk.auto + - back + - back.ondeath + - balance + - balance.others + - balancetop + - build + - chat.color + - chat.format + - chat.shout + - chat.question + - clearinventory + - compass + - depth + - delhome + - getpos + - geoip.show + - help + - helpop + - home + - home.others + - ignore + - info + - itemdb + - kit + - kits.tools + - list + - mail + - mail.send + - me + - motd + - msg + - msg.color + - nick + - near + - pay + - ping + - protect + - r + - rules + - realname + - seen + - sell + - sethome + - setxmpp + - signs.create.protection + - signs.create.trade + - signs.break.protection + - signs.break.trade + - signs.use.balance + - signs.use.buy + - signs.use.disposal + - signs.use.enchant + - signs.use.free + - signs.use.gamemode + - signs.use.heal + - signs.use.info + - signs.use.kit + - signs.use.mail + - signs.use.protection + - signs.use.repair + - signs.use.sell + - signs.use.time + - signs.use.trade + - signs.use.warp + - signs.use.weather + - spawn + - suicide + - time + - tpa + - tpaccept + - tpahere + - tpdeny + - warp + - warp.list + - world + - worth + - xmpp + +# Note: All items MUST be followed by a quantity! +# All kit names should be lower case, and will be treated as lower in permissions/costs. +# Syntax: - itemID[:DataValue/Durability] Amount [Enchantment:Level].. [itemmeta:value]... +# For Item meta information visit http://wiki.ess3.net/wiki/Item_Meta +# 'delay' refers to the cooldown between how often you can use each kit, measured in seconds. +# For more information, visit http://wiki.ess3.net/wiki/Kits +kits: + tools: + delay: 10 + items: + - 272 1 + - 273 1 + - 274 1 + - 275 1 + dtools: + delay: 600 + items: + - 278 1 efficiency:1 durability:1 fortune:1 name:&4Gigadrill lore:The_drill_that_&npierces|the_heavens + - 277 1 digspeed:3 name:Dwarf lore:Diggy|Diggy|Hole + - 298 1 color:255,255,255 name:Top_Hat lore:Good_day,_Good_day + - 279:780 1 + notch: + delay: 6000 + items: + - 397:3 1 player:Notch + color: + delay: 6000 + items: + - 387 1 title:&4Book_&9o_&6Colors author:KHobbits lore:Ingame_color_codes book:Colors + firework: + delay: 6000 + items: + - 401 1 name:Angry_Creeper color:red fade:green type:creeper power:1 + - 401 1 name:StarryNight color:yellow,orange fade:blue type:star effect:trail,twinkle power:1 + - 401 2 name:SolarWind color:yellow,orange fade:red shape:large effect:twinkle color:yellow,orange fade:red shape:ball effect:trail color:red,purple fade:pink shape:star effect:trail power:1 + +# Essentials Sign Control +# See http://wiki.ess3.net/wiki/Sign_Tutorial for instructions on how to use these. +# To enable signs, remove # symbol. To disable all signs, comment/remove each sign. +# Essentials Colored sign support will be enabled when any sign types are enabled. +# Color is not an actual sign, it's for enabling using color codes on signs, when the correct permissions are given. + +enabledSigns: + #- color + #- balance + #- buy + #- sell + #- trade + #- free + #- disposal + #- warp + #- kit + #- mail + #- enchant + #- gamemode + #- heal + #- info + #- spawnmob + #- repair + #- time + #- weather + +# How many times per second can Essentials signs be interacted with per player. +# Values should be between 1-20, 20 being virtually no lag protection. +# Lower numbers will reduce the possibility of lag, but may annoy players. +sign-use-per-second: 4 + +# Backup runs a batch/bash command while saving is disabled +backup: + # Interval in minutes + interval: 30 + # Unless you add a valid backup command or script here, this feature will be useless. + # Use 'save-all' to simply force regular world saving without backup. + #command: 'rdiff-backup World1 backups/World1' + +# Set this true to enable permission per warp. +per-warp-permission: false + +# Sort output of /list command by groups +sort-list-by-groups: false + +# More output to the console +debug: false + +# Set the locale for all messages +# If you don't set this, the default locale of the server will be used. +# For example, to set language to English, set locale to en, to use the file "messages_en.properties" +# Don't forget to remove the # in front of the line +# For more information, visit http://wiki.ess3.net/wiki/Locale +#locale: en + +# Turn off god mode when people exit +remove-god-on-disconnect: false + +# Auto-AFK +# After this timeout in seconds, the user will be set as afk. +# Set to -1 for no timeout. +auto-afk: 300 + +# Auto-AFK Kick +# After this timeout in seconds, the user will be kicked from the server. +# Set to -1 for no timeout. +auto-afk-kick: -1 + +# Set this to true, if you want to freeze the player, if he is afk. +# Other players or monsters can't push him out of afk mode then. +# This will also enable temporary god mode for the afk player. +# The player has to use the command /afk to leave the afk mode. +freeze-afk-players: false + +# When the player is afk, should he be able to pickup items? +# Enable this, when you don't want people idling in mob traps. +disable-item-pickup-while-afk: false + +# This setting controls if a player is marked as active on interaction. +# When this setting is false, you will need to manually un-AFK using the /afk command. +cancel-afk-on-interact: true + +# Should we automatically remove afk status when the player moves? +# Player will be removed from AFK on chat/command regardless of this setting. +# Disable this to reduce server lag. +cancel-afk-on-move: true + +# You can disable the death messages of Minecraft here +death-messages: true + +# Add worlds to this list, if you want to automatically disable god mode there +no-god-in-worlds: +# - world_nether + +# Set to true to enable per-world permissions for teleporting between worlds with essentials commands +# This applies to /world, /back, /tp[a|o][here|all], but not warps. +# Give someone permission to teleport to a world with essentials.worlds. +# This does not affect the /home command, there is a separate toggle below for this. +world-teleport-permissions: false + +# The number of items given if the quantity parameter is left out in /item or /give. +# If this number is below 1, the maximum stack size size is given. If over-sized stacks +# are not enabled, any number higher than the maximum stack size results in more than one stack. +default-stack-size: -1 + +# Over-sized stacks are stacks that ignore the normal max stack size. +# They can be obtained using /give and /item, if the player has essentials.oversizedstacks permission. +# How many items should be in an over-sized stack? +oversized-stacksize: 64 + +# Allow repair of enchanted weapons and armor. +# If you set this to false, you can still allow it for certain players using the permission +# essentials.repair.enchanted +repair-enchanted: true + +# Allow 'unsafe' enchantments in kits and item spawning. +# Warning: Mixing and overleveling some enchantments can cause issues with clients, servers and plugins. +unsafe-enchantments: false + +#Do you want essentials to keep track of previous location for /back in the teleport listener? +#If you set this to true any plugin that uses teleport will have the previous location registered. +register-back-in-listener: false + +#Delay to wait before people can cause attack damage after logging in +login-attack-delay: 5 + +#Set the max fly speed, values range from 0.1 to 1.0 +max-fly-speed: 0.8 + +#Set the maximum amount of mail that can be sent within a minute. +mails-per-minute: 1000 + +# Set the maximum time /tempban can be used for in seconds. +# Set to -1 to disable, and essentials.tempban.unlimited can be used to override. +max-tempban-time: -1 + +############################################################ +# +------------------------------------------------------+ # +# | EssentialsHome | # +# +------------------------------------------------------+ # +############################################################ + +# Allows people to set their bed at daytime +update-bed-at-daytime: true + +# Set to true to enable per-world permissions for using homes to teleport between worlds +# This applies to the /home only. +# Give someone permission to teleport to a world with essentials.worlds. +world-home-permissions: false + +# Allow players to have multiple homes. +# Players need essentials.sethome.multiple before they can have more than 1 home, defaults to 'default' below. +# Define different amounts of multiple homes for different permissions, e.g. essentials.sethome.multiple.vip +# People with essentials.sethome.multiple.unlimited are not limited by these numbers. +# For more information, visit http://wiki.ess3.net/wiki/Multihome +sethome-multiple: + default: 3 + # essentials.sethome.multiple.vip + vip: 5 + # essentials.sethome.multiple.staff + staff: 10 + +# Set timeout in seconds for players to accept tpa before request is cancelled. +# Set to 0 for no timeout +tpa-accept-cancellation: 120 + +############################################################ +# +------------------------------------------------------+ # +# | EssentialsEco | # +# +------------------------------------------------------+ # +############################################################ + +# For more information, visit http://wiki.ess3.net/wiki/Essentials_Economy + +# Defines the balance with which new players begin. Defaults to 0. +starting-balance: 0 + +# worth-# defines the value of an item when it is sold to the server via /sell. +# These are now defined in worth.yml + +# Defines the cost to use the given commands PER USE +# Some commands like /repair have sub-costs, check the wiki for more information. +command-costs: + # /example costs $1000 PER USE + #example: 1000 + # /kit tools costs $1500 PER USE + #kit-tools: 1500 + +# Set this to a currency symbol you want to use. +currency-symbol: '$' + +# Set the maximum amount of money a player can have +# The amount is always limited to 10 trillion because of the limitations of a java double +max-money: 10000000000000 + +# Set the minimum amount of money a player can have (must be above the negative of max-money). +# Setting this to 0, will disable overdrafts/loans completely. Users need 'essentials.eco.loan' perm to go below 0. +min-money: -10000 + +# Enable this to log all interactions with trade/buy/sell signs and sell command +economy-log-enabled: false + +############################################################ +# +------------------------------------------------------+ # +# | EssentialsHelp | # +# +------------------------------------------------------+ # +############################################################ + +# Show other plugins commands in help +non-ess-in-help: true + +# Hide plugins which do not give a permission +# You can override a true value here for a single plugin by adding a permission to a user/group. +# The individual permission is: essentials.help., anyone with essentials.* or '*' will see all help regardless. +# You can use negative permissions to remove access to just a single plugins help if the following is enabled. +hide-permissionless-help: true + +############################################################ +# +------------------------------------------------------+ # +# | EssentialsChat | # +# +------------------------------------------------------+ # +############################################################ + +chat: + + # If EssentialsChat is installed, this will define how far a player's voice travels, in blocks. Set to 0 to make all chat global. + # Note that users with the "essentials.chat.spy" permission will hear everything, regardless of this setting. + # Users with essentials.chat.shout can override this by prefixing text with an exclamation mark (!) + # Users with essentials.chat.question can override this by prefixing text with a question mark (?) + # You can add command costs for shout/question by adding chat-shout and chat-question to the command costs section." + radius: 0 + + # Chat formatting can be done in two ways, you can either define a standard format for all chat + # Or you can give a group specific chat format, to give some extra variation. + # If set to the default chat format which "should" be compatible with ichat. + # For more information of chat formatting, check out the wiki: http://wiki.ess3.net/wiki/Chat_Formatting + + format: '<{DISPLAYNAME}> {MESSAGE}' + #format: '&7[{GROUP}]&r {DISPLAYNAME}&7:&r {MESSAGE}' + + group-formats: + # Default: '{WORLDNAME} {DISPLAYNAME}&7:&r {MESSAGE}' + # Admins: '{WORLDNAME} &c[{GROUP}]&r {DISPLAYNAME}&7:&c {MESSAGE}' + + # If you are using group formats make sure to remove the '#' to allow the setting to be read. + +############################################################ +# +------------------------------------------------------+ # +# | EssentialsProtect | # +# +------------------------------------------------------+ # +############################################################ + +protect: + # Database settings for sign/rail protection + + # mysql or sqlite + # We strongly recommend against using mysql here, unless you have a good reason. + # Sqlite seems to be faster in almost all cases, and in some cases mysql can be much slower. + datatype: 'sqlite' + + # If you specified MySQL above, you MUST enter the appropriate details here. + # If you specified SQLite above, these will be IGNORED. + username: 'root' + password: 'root' + mysqlDb: 'jdbc:mysql://localhost:3306/minecraft' + + # General physics/behavior modifications + prevent: + lava-flow: false + water-flow: false + water-bucket-flow: false + fire-spread: true + lava-fire-spread: true + flint-fire: false + lightning-fire-spread: true + portal-creation: false + tnt-explosion: false + tnt-playerdamage: false + fireball-explosion: false + fireball-fire: false + fireball-playerdamage: false + witherskull-explosion: false + witherskull-playerdamage: false + wither-spawnexplosion: false + wither-blockreplace: false + creeper-explosion: false + creeper-playerdamage: false + creeper-blockdamage: false + enderdragon-blockdamage: true + enderman-pickup: false + villager-death: false + # Monsters won't follow players + # permission essentials.protect.entitytarget.bypass disables this + entitytarget: false + # Prevent the spawning of creatures + spawn: + creeper: false + skeleton: false + spider: false + giant: false + zombie: false + slime: false + ghast: false + pig_zombie: false + enderman: false + cave_spider: false + silverfish: false + blaze: false + magma_cube: false + ender_dragon: false + pig: false + sheep: false + cow: false + chicken: false + squid: false + wolf: false + mushroom_cow: false + snowman: false + ocelot: false + iron_golem: false + villager: false + wither: false + bat: false + witch: false + + # Maximum height the creeper should explode. -1 allows them to explode everywhere. + # Set prevent.creeper-explosion to true, if you want to disable creeper explosions. + creeper: + max-height: -1 + + # Protect various blocks. + protect: + # Protect all signs + signs: false + + # Prevent users from destroying rails + rails: false + + # Blocks below rails/signs are also protected if the respective rail/sign is protected. + # This makes it more difficult to circumvent protection, and should be enabled. + # This only has an effect if "rails" or "signs" is also enabled. + block-below: true + + # Prevent placing blocks above protected rails, this is to stop a potential griefing + prevent-block-on-rails: false + + # Store blocks / signs in memory before writing + memstore: false + + # Disable various default physics and behaviors + disable: + # Should fall damage be disabled? + fall: false + + # Users with the essentials.protect.pvp permission will still be able to attack each other if this is set to true. + # They will be unable to attack users without that same permission node. + pvp: false + + # Should drowning damage be disabled? + # (Split into two behaviors; generally, you want both set to the same value) + drown: false + suffocate: false + + # Should damage via lava be disabled? Items that fall into lava will still burn to a crisp. ;) + lavadmg: false + + # Should arrow damage be disabled + projectiles: false + + # This will disable damage from touching cacti. + contactdmg: false + + # Burn, baby, burn! Should fire damage be disabled? + firedmg: false + + # Should the damage after hit by a lightning be disabled? + lightning: false + + # Should Wither damage be disabled? + wither: false + + # Disable weather options + weather: + storm: false + thunder: false + lightning: false + +############################################################ +# +------------------------------------------------------+ # +# | EssentialsAntiBuild | # +# +------------------------------------------------------+ # +############################################################ + + # Disable various default physics and behaviors + # For more information, visit http://wiki.ess3.net/wiki/AntiBuild + + # Should people with build: false in permissions be allowed to build + # Set true to disable building for those people + # Setting to false means EssentialsAntiBuild will never prevent you from building + build: true + + # Should people with build: false in permissions be allowed to use items + # Set true to disable using for those people + # Setting to false means EssentialsAntiBuild will never prevent you from using + use: true + + # Should we tell people they are not allowed to build + warn-on-build-disallow: true + + # For which block types would you like to be alerted? + # You can find a list of IDs in plugins/Essentials/items.csv after loading Essentials for the first time. + # 10 = lava :: 11 = still lava :: 46 = TNT :: 327 = lava bucket + alert: + on-placement: 10,11,46,327 + on-use: 327 + on-break: + + blacklist: + + # Which blocks should people be prevented from placing + placement: 10,11,46,327 + + # Which items should people be prevented from using + usage: 327 + + # Which blocks should people be prevented from breaking + break: + + # Which blocks should not be pushed by pistons + piston: + +############################################################ +# +------------------------------------------------------+ # +# | Essentials Spawn / New Players | # +# +------------------------------------------------------+ # +############################################################ + +newbies: + # Should we announce to the server when someone logs in for the first time? + # If so, use this format, replacing {DISPLAYNAME} with the player name. + # If not, set to '' + #announce-format: '' + announce-format: '&dWelcome {DISPLAYNAME}&d to the server!' + + # When we spawn for the first time, which spawnpoint do we use? + # Set to "none" if you want to use the spawn point of the world. + spawnpoint: newbies + + # Do we want to give users anything on first join? Set to '' to disable + # This kit will be given regardless of cost, and permissions. + #kit: '' + kit: tools + +# Set this to lowest, if you want Multiverse to handle the respawning +# Set this to high, if you want EssentialsSpawn to handle the respawning +# Set this to highest, if you want to force EssentialsSpawn to handle the respawning +respawn-listener-priority: high + +# When users die, should they respawn at their first home or bed, instead of the spawnpoint? +respawn-at-home: false + +# End of File <-- No seriously, you're done with configuration. diff --git a/Server/plugins/Essentials/items.csv b/Server/plugins/Essentials/items.csv new file mode 100644 index 0000000..178d088 --- /dev/null +++ b/Server/plugins/Essentials/items.csv @@ -0,0 +1,6355 @@ +#version: 2.10.1 +#If you change this file, it will not be automatically updated after the next release, +#item,id,metadata +stone,1,0 +sstone,1,0 +smoothstone,1,0 +rock,1,0 +grass,2,0 +greendirt,2,0 +greenearth,2,0 +greenland,2,0 +dirt,3,0 +earth,3,0 +land,3,0 +cobblestone,4,0 +cstone,4,0 +cobble,4,0 +plank,5,0 +woodenplank,5,0 +woodplank,5,0 +wplank,5,0 +plankwooden,5,0 +plankwood,5,0 +plankw,5,0 +oakplank,5,0 +oakwoodenplank,5,0 +oakwoodplank,5,0 +oakwplank,5,0 +oakplankwooden,5,0 +oakplankwood,5,0 +oakplankw,5,0 +oplank,5,0 +owoodenplank,5,0 +owoodplank,5,0 +owplank,5,0 +oplankwooden,5,0 +oplankwood,5,0 +oplankw,5,0 +darkplank,5,1 +darkwoodenplank,5,1 +darkwoodplank,5,1 +darkwplank,5,1 +darkplankwooden,5,1 +darkplankwood,5,1 +darkplankw,5,1 +dplank,5,1 +dwoodenplank,5,1 +dwoodplank,5,1 +dwplank,5,1 +dplankwooden,5,1 +dplankwood,5,1 +dplankw,5,1 +spruceplank,5,1 +sprucewoodenplank,5,1 +sprucewoodplank,5,1 +sprucewplank,5,1 +spruceplankwooden,5,1 +spruceplankwood,5,1 +spruceplankw,5,1 +splank,5,1 +swoodenplank,5,1 +swoodplank,5,1 +swplank,5,1 +splankwooden,5,1 +splankwood,5,1 +splankw,5,1 +pineplank,5,1 +pinewoodenplank,5,1 +pinewoodplank,5,1 +pinewplank,5,1 +pineplankwooden,5,1 +pineplankwood,5,1 +pineplankw,5,1 +pplank,5,1 +pwoodenplank,5,1 +pwoodplank,5,1 +pwplank,5,1 +pplankwooden,5,1 +pplankwood,5,1 +pplankw,5,1 +lightplank,5,2 +lightwoodenplank,5,2 +lightwoodplank,5,2 +lightwplank,5,2 +lightplankwooden,5,2 +lightplankwood,5,2 +lightplankw,5,2 +lplank,5,2 +lwoodenplank,5,2 +lwoodplank,5,2 +lwplank,5,2 +lplankwooden,5,2 +lplankwood,5,2 +lplankw,5,2 +birchplank,5,2 +birchwoodenplank,5,2 +birchwoodplank,5,2 +birchwplank,5,2 +birchplankwooden,5,2 +birchplankwood,5,2 +birchplankw,5,2 +bplank,5,2 +bwoodenplank,5,2 +bwoodplank,5,2 +bwplank,5,2 +bplankwooden,5,2 +bplankwood,5,2 +bplankw,5,2 +whiteplank,5,2 +whitewoodenplank,5,2 +whitewoodplank,5,2 +whitewplank,5,2 +whiteplankwooden,5,2 +whiteplankwood,5,2 +whiteplankw,5,2 +wwoodenplank,5,2 +wwoodplank,5,2 +wwplank,5,2 +wplankwooden,5,2 +wplankwood,5,2 +wplankw,5,2 +jungleplank,5,3 +junglewoodenplank,5,3 +junglewoodplank,5,3 +junglewplank,5,3 +jungleplankwooden,5,3 +jungleplankwood,5,3 +jungleplankw,5,3 +jplank,5,3 +jwoodenplank,5,3 +jwoodplank,5,3 +jwplank,5,3 +jplankwooden,5,3 +jplankwood,5,3 +jplankw,5,3 +forestplank,5,3 +forestwoodenplank,5,3 +forestwoodplank,5,3 +forestwplank,5,3 +forestplankwooden,5,3 +forestplankwood,5,3 +forestplankw,5,3 +fplank,5,3 +fwoodenplank,5,3 +fwoodplank,5,3 +fwplank,5,3 +fplankwooden,5,3 +fplankwood,5,3 +fplankw,5,3 +sapling,6,0 +treesapling,6,0 +logsapling,6,0 +trunksapling,6,0 +woodsapling,6,0 +oaktreesapling,6,0 +oaklogsapling,6,0 +oaktrunksapling,6,0 +oakwoodsapling,6,0 +osapling,6,0 +otreesapling,6,0 +ologsapling,6,0 +otrunksapling,6,0 +owoodsapling,6,0 +darksapling,6,1 +darktreesapling,6,1 +darklogsapling,6,1 +darktrunksapling,6,1 +darkwoodsapling,6,1 +sprucesapling,6,1 +sprucetreesapling,6,1 +sprucelogsapling,6,1 +sprucetrunksapling,6,1 +sprucewoodsapling,6,1 +pinesapling,6,1 +pinetreesapling,6,1 +pinelogsapling,6,1 +pinetrunksapling,6,1 +pinewoodsapling,6,1 +dsapling,6,1 +dtreesapling,6,1 +dlogsapling,6,1 +dtrunksapling,6,1 +dwoodsapling,6,1 +ssapling,6,1 +streesapling,6,1 +slogsapling,6,1 +strunksapling,6,1 +swoodsapling,6,1 +psapling,6,1 +ptreesapling,6,1 +plogsapling,6,1 +ptrunksapling,6,1 +pwoodsapling,6,1 +birchsapling,6,2 +birchtreesapling,6,2 +birchlogsapling,6,2 +birchtrunksapling,6,2 +birchwoodsapling,6,2 +lightsapling,6,2 +lighttreesapling,6,2 +lightlogsapling,6,2 +lighttrunksapling,6,2 +lightwoodsapling,6,2 +whitesapling,6,2 +whitetreesapling,6,2 +whitelogsapling,6,2 +whitetrunksapling,6,2 +whitewoodsapling,6,2 +bsapling,6,2 +btreesapling,6,2 +blogsapling,6,2 +btrunksapling,6,2 +bwoodsapling,6,2 +lsapling,6,2 +ltreesapling,6,2 +llogsapling,6,2 +ltrunksapling,6,2 +lwoodsapling,6,2 +wsapling,6,2 +wtreesapling,6,2 +wlogsapling,6,2 +wtrunksapling,6,2 +wwoodsapling,6,2 +junglesapling,6,3 +jungletreesapling,6,3 +junglelogsapling,6,3 +jungletrunksapling,6,3 +junglewoodsapling,6,3 +forestsapling,6,3 +foresttreesapling,6,3 +forestlogsapling,6,3 +foresttrunksapling,6,3 +forestwoodsapling,6,3 +jsapling,6,3 +jtreesapling,6,3 +jlogsapling,6,3 +jtrunksapling,6,3 +jwoodsapling,6,3 +fsapling,6,3 +ftreesapling,6,3 +flogsapling,6,3 +ftrunksapling,6,3 +fwoodsapling,6,3 +bedrock,7,0 +oprock,7,0 +opblock,7,0 +adminblock,7,0 +adminrock,7,0 +adminium,7,0 +water,8,0 +stationarywater,9,0 +swater,9,0 +lava,10,0 +stationarylava,11,0 +slava,11,0 +sand,12,0 +gravel,13,0 +goldore,14,0 +oregold,14,0 +goldo,14,0 +ogold,14,0 +gore,14,0 +oreg,14,0 +ironore,15,0 +oreiron,15,0 +irono,15,0 +oiron,15,0 +steelore,15,0 +oresteel,15,0 +steelo,15,0 +osteel,15,0 +iore,15,0 +orei,15,0 +sore,15,0 +ores,15,0 +coalore,16,0 +orecoal,16,0 +coalo,16,0 +ocoal,16,0 +core,16,0 +tree,17,0 +log,17,0 +trunk,17,0 +wood,17,0 +oak,17,0 +oaktree,17,0 +oaklog,17,0 +oaktrunk,17,0 +oakwood,17,0 +otree,17,0 +olog,17,0 +otrunk,17,0 +owood,17,0 +dark,17,1 +darktree,17,1 +darklog,17,1 +darktrunk,17,1 +darkwood,17,1 +spruce,17,1 +sprucetree,17,1 +sprucelog,17,1 +sprucetrunk,17,1 +sprucewood,17,1 +pine,17,1 +pinetree,17,1 +pinelog,17,1 +pinetrunk,17,1 +pinewood,17,1 +dtree,17,1 +dlog,17,1 +dtrunk,17,1 +dwood,17,1 +stree,17,1 +slog,17,1 +strunk,17,1 +swood,17,1 +ptree,17,1 +plog,17,1 +ptrunk,17,1 +pwood,17,1 +birch,17,2 +birchtree,17,2 +birchlog,17,2 +birchtrunk,17,2 +birchwood,17,2 +white,17,2 +whitetree,17,2 +whitelog,17,2 +whitetrunk,17,2 +whitewood,17,2 +light,17,2 +lighttree,17,2 +lightlog,17,2 +lighttrunk,17,2 +lightwood,17,2 +btree,17,2 +blog,17,2 +btrunk,17,2 +bwood,17,2 +wtree,17,2 +wlog,17,2 +wtrunk,17,2 +wwood,17,2 +ltree,17,2 +llog,17,2 +ltrunk,17,2 +lwood,17,2 +jungle,17,3 +jungletree,17,3 +junglelog,17,3 +jungletrunk,17,3 +junglewood,17,3 +forest,17,3 +foresttree,17,3 +forestlog,17,3 +foresttrunk,17,3 +forestwood,17,3 +jtree,17,3 +jlog,17,3 +jtrunk,17,3 +jwood,17,3 +ftree,17,3 +flog,17,3 +ftrunk,17,3 +fwood,17,3 +leaves,18,4 +leaf,18,4 +treeleaves,18,4 +logleaves,18,4 +trunkleaves,18,4 +woodleaves,18,4 +oakleaves,18,4 +oakleaf,18,4 +oleaves,18,4 +oleaf,18,4 +oaktreeleaves,18,4 +oaklogleaves,18,4 +oaktrunkleaves,18,4 +oakwoodleaves,18,4 +otreeleaves,18,4 +ologleaves,18,4 +otrunkleaves,18,4 +owoodleaves,18,4 +treeleaf,18,4 +logleaf,18,4 +trunkleaf,18,4 +woodleaf,18,4 +oaktreeleaf,18,4 +oaklogleaf,18,4 +oaktrunkleaf,18,4 +oakwoodleaf,18,4 +otreeleaf,18,4 +ologleaf,18,4 +otrunkleaf,18,4 +owoodleaf,18,4 +spruceleaves,18,5 +spruceleaf,18,5 +sleaves,18,5 +sleaf,18,5 +sprucetreeleaves,18,5 +sprucelogleaves,18,5 +sprucetrunkleaves,18,5 +sprucewoodleaves,18,5 +streeleaves,18,5 +slogleaves,18,5 +strunkleaves,18,5 +swoodleaves,18,5 +pineleaves,18,5 +pineleaf,18,5 +pleaves,18,5 +pleaf,18,5 +pinetreeleaves,18,5 +pinelogleaves,18,5 +pinetrunkleaves,18,5 +pinewoodleaves,18,5 +ptreeleaves,18,5 +plogleaves,18,5 +ptrunkleaves,18,5 +pwoodleaves,18,5 +darkleaves,18,5 +darkleaf,18,5 +dleaves,18,5 +dleaf,18,5 +darktreeleaves,18,5 +darklogleaves,18,5 +darktrunkleaves,18,5 +darkwoodleaves,18,5 +dtreeleaves,18,5 +dlogleaves,18,5 +dtrunkleaves,18,5 +dwoodleaves,18,5 +sprucetreeleaf,18,5 +sprucelogleaf,18,5 +sprucetrunkleaf,18,5 +sprucewoodleaf,18,5 +streeleaf,18,5 +slogleaf,18,5 +strunkleaf,18,5 +swoodleaf,18,5 +pinetreeleaf,18,5 +pinelogleaf,18,5 +pinetrunkleaf,18,5 +pinewoodleaf,18,5 +ptreeleaf,18,5 +plogleaf,18,5 +ptrunkleaf,18,5 +pwoodleaf,18,5 +darktreeleaf,18,5 +darklogleaf,18,5 +darktrunkleaf,18,5 +darkwoodleaf,18,5 +dtreeleaf,18,5 +dlogleaf,18,5 +dtrunkleaf,18,5 +dwoodleaf,18,5 +birchleaves,18,6 +birchleaf,18,6 +bleaves,18,6 +bleaf,18,6 +birchtreeleaves,18,6 +birchlogleaves,18,6 +birchtrunkleaves,18,6 +birchwoodleaves,18,6 +btreeleaves,18,6 +blogleaves,18,6 +btrunkleaves,18,6 +bwoodleaves,18,6 +lightleaves,18,6 +lightleaf,18,6 +lleaves,18,6 +lleaf,18,6 +lighttreeleaves,18,6 +lightlogleaves,18,6 +lighttrunkleaves,18,6 +lightwoodleaves,18,6 +ltreeleaves,18,6 +llogleaves,18,6 +ltrunkleaves,18,6 +lwoodleaves,18,6 +whiteleaves,18,6 +whiteleaf,18,6 +wleaves,18,6 +wleaf,18,6 +whitetreeleaves,18,6 +whitelogleaves,18,6 +whitetrunkleaves,18,6 +whitewoodleaves,18,6 +wtreeleaves,18,6 +wlogleaves,18,6 +wtrunkleaves,18,6 +wwoodleaves,18,6 +birchtreeleaf,18,6 +birchlogleaf,18,6 +birchtrunkleaf,18,6 +birchwoodleaf,18,6 +btreeleaf,18,6 +blogleaf,18,6 +btrunkleaf,18,6 +bwoodleaf,18,6 +lighttreeleaf,18,6 +lightlogleaf,18,6 +lighttrunkleaf,18,6 +lightwoodleaf,18,6 +ltreeleaf,18,6 +llogleaf,18,6 +ltrunkleaf,18,6 +lwoodleaf,18,6 +whitetreeleaf,18,6 +whitelogleaf,18,6 +whitetrunkleaf,18,6 +whitewoodleaf,18,6 +wtreeleaf,18,6 +wlogleaf,18,6 +wtrunkleaf,18,6 +wwoodleaf,18,6 +jungleleaves,18,7 +jungleleaf,18,7 +jleaves,18,7 +jleaf,18,7 +jungletreeleaves,18,7 +junglelogleaves,18,7 +jungletrunkleaves,18,7 +junglewoodleaves,18,7 +jtreeleaves,18,7 +jlogleaves,18,7 +jtrunkleaves,18,7 +jwoodleaves,18,7 +forestleaves,18,7 +forestleaf,18,7 +fleaves,18,7 +fleaf,18,7 +foresttreeleaves,18,7 +forestlogleaves,18,7 +foresttrunkleaves,18,7 +forestwoodleaves,18,7 +ftreeleaves,18,7 +flogleaves,18,7 +ftrunkleaves,18,7 +fwoodleaves,18,7 +jungletreeleaf,18,7 +junglelogleaf,18,7 +jungletrunkleaf,18,7 +junglewoodleaf,18,7 +jtreeleaf,18,7 +jlogleaf,18,7 +jtrunkleaf,18,7 +jwoodleaf,18,7 +foresttreeleaf,18,7 +forestlogleaf,18,7 +foresttrunkleaf,18,7 +forestwoodleaf,18,7 +ftreeleaf,18,7 +flogleaf,18,7 +ftrunkleaf,18,7 +fwoodleaf,18,7 +sponge,19,0 +glass,20,0 +lapislazuliore,21,0 +lapislazulio,21,0 +orelapislazuli,21,0 +olapislazuli,21,0 +lapisore,21,0 +lapiso,21,0 +orelapis,21,0 +olapis,21,0 +lore,21,0 +orel,21,0 +lapislazuliblock,22,0 +blocklapislazuli,22,0 +lapisblock,22,0 +blocklapis,22,0 +lblock,22,0 +blockl,22,0 +dispenser,23,0 +dispense,23,0 +sandstone,24,0 +sastone,24,0 +csandstone,24,1 +csastone,24,1 +creepsandstone,24,1 +creepsastone,24,1 +creepersandstone,24,1 +creepersastone,24,1 +hieroglyphicsandstone,24,1 +hieroglyphicsastone,24,1 +hieroglyphsandstone,24,1 +hieroglyphsastone,24,1 +hsandstone,24,1 +hsastone,24,1 +pyramidsandstone,24,1 +pyramidsastone,24,1 +psandstone,24,1 +psastone,24,1 +smoothsandstone,24,2 +smoothsastone,24,2 +ssandstone,24,2 +smsastone,24,2 +ssastone,24,2 +noteblock,25,0 +musicblock,25,0 +nblock,25,0 +mblock,25,0 +bedblock,26,0 +poweredtrack,27,0 +poweredrail,27,0 +boostertrack,27,0 +boosterrail,27,0 +powertrack,27,0 +powerrail,27,0 +boosttrack,27,0 +boostrail,27,0 +ptrack,27,0 +prail,27,0 +btrack,27,0 +brail,27,0 +detectortrack,28,0 +detectorrail,28,0 +detectingtrack,28,0 +detectingrail,28,0 +detecttrack,28,0 +detectrail,28,0 +dtrack,28,0 +drail,28,0 +stickypistonbase,29,7 +stickypiston,29,7 +stickpistonbase,29,7 +stickpiston,29,7 +stickyp,29,7 +spistonbase,29,7 +spiston,29,7 +pistonstickybase,29,7 +pistonsticky,29,7 +pistonstickbase,29,7 +pistonstick,29,7 +pistonsbase,29,7 +pistons,29,7 +psticky,29,7 +pstick,29,7 +spiderweb,30,0 +sweb,30,0 +web,30,0 +longgrass,31,1 +tallgrass,31,1 +wildgrass,31,1 +grasslong,31,1 +grasstall,31,1 +grasswild,31,1 +lgrass,31,1 +tgrass,31,1 +wgrass,31,1 +fern,31,2 +bush,31,2 +deadshrub,32,0 +dshrub,32,0 +deadbush,32,0 +dbush,32,0 +deadsapling,32,0 +normalpistonbase,33,7 +normalpiston,33,7 +normpistonbase,33,7 +normpiston,33,7 +npistonbase,33,7 +npiston,33,7 +pistonnormalbase,33,7 +pistonnormal,33,7 +pistonnormbase,33,7 +pistonnorm,33,7 +pistonnbase,33,7 +pistonn,33,7 +pistonbase,33,7 +piston,33,7 +pistonblock,33,7 +pistonextensionnormal,34,0 +pistonextension,34,0 +pistonextnormal,34,0 +pistonext,34,0 +pistonenormal,34,0 +pistone,34,0 +extensionpistonnormal,34,0 +extensionpiston,34,0 +extpistonnormal,34,0 +extpiston,34,0 +epistonnormal,34,0 +episton,34,0 +whitecloth,35,0 +whitewool,35,0 +whitecotton,35,0 +wcloth,35,0 +wwool,35,0 +wcotton,35,0 +cloth,35,0 +wool,35,0 +cotton,35,0 +orangecloth,35,1 +orangewool,35,1 +orangecotton,35,1 +ocloth,35,1 +owool,35,1 +ocotton,35,1 +magentacloth,35,2 +magentawool,35,2 +magentacotton,35,2 +mcloth,35,2 +mwool,35,2 +mcotton,35,2 +lightbluecloth,35,3 +lightbluewool,35,3 +lightbluecotton,35,3 +lbluecloth,35,3 +lbluewool,35,3 +lbluecotton,35,3 +lightblucloth,35,3 +lightbluwool,35,3 +lightblucotton,35,3 +lblucloth,35,3 +lbluwool,35,3 +lblucotton,35,3 +yellowcloth,35,4 +yellowwool,35,4 +yellowcotton,35,4 +ycloth,35,4 +ywool,35,4 +ycotton,35,4 +lightgreencloth,35,5 +lightgreenwool,35,5 +lightgreencotton,35,5 +lgreencloth,35,5 +lgreenwool,35,5 +lgreencotton,35,5 +lightgrecloth,35,5 +lightgrewool,35,5 +lightgrecotton,35,5 +lgrecloth,35,5 +lgrewool,35,5 +lgrecotton,35,5 +limecloth,35,5 +limewool,35,5 +limecotton,35,5 +lcloth,35,5 +lwool,35,5 +lcotton,35,5 +pinkcloth,35,6 +pinkwool,35,6 +pinkcotton,35,6 +picloth,35,6 +piwool,35,6 +picotton,35,6 +graycloth,35,7 +graywool,35,7 +graycotton,35,7 +gracloth,35,7 +grawool,35,7 +gracotton,35,7 +lightgraycloth,35,8 +lightgraywool,35,8 +lightgraycotton,35,8 +lgraycloth,35,8 +lgraywool,35,8 +lgraycotton,35,8 +lightgracloth,35,8 +lightgrawool,35,8 +lightgracotton,35,8 +lgracloth,35,8 +lgrawool,35,8 +lgracotton,35,8 +cyancloth,35,9 +cyanwool,35,9 +cyancotton,35,9 +ccloth,35,9 +cwool,35,9 +ccotton,35,9 +purplecloth,35,10 +purplewool,35,10 +purplecotton,35,10 +pucloth,35,10 +puwool,35,10 +pucotton,35,10 +bluecloth,35,11 +bluewool,35,11 +bluecotton,35,11 +blucloth,35,11 +bluwool,35,11 +blucotton,35,11 +browncloth,35,12 +brownwool,35,12 +browncotton,35,12 +brocloth,35,12 +browool,35,12 +brocotton,35,12 +darkgreencloth,35,13 +darkgreenwool,35,13 +darkgreencotton,35,13 +dgreencloth,35,13 +dgreenwool,35,13 +dgreencotton,35,13 +greencloth,35,13 +greenwool,35,13 +greencotton,35,13 +darkgrecloth,35,13 +darkgrewool,35,13 +darkgrecotton,35,13 +dgrecloth,35,13 +dgrewool,35,13 +dgrecotton,35,13 +grecloth,35,13 +grewool,35,13 +grecotton,35,13 +redcloth,35,14 +redwool,35,14 +redcotton,35,14 +rcloth,35,14 +rwool,35,14 +rcotton,35,14 +blackcloth,35,15 +blackwool,35,15 +blackcotton,35,15 +blacloth,35,15 +blawool,35,15 +blacotton,35,15 +pistonmovingpiece,36,0 +pistonmp,36,0 +pistontop,36,0 +yellowflower,37,0 +yflower,37,0 +flower,37,0 +redrose,38,0 +rrose,38,0 +rose,38,0 +redflower,38,0 +rflower,38,0 +brownmushroom,39,0 +brownshroom,39,0 +brownmush,39,0 +bmushroom,39,0 +bshroom,39,0 +bmush,39,0 +redmushroom,40,0 +redshroom,40,0 +redmush,40,0 +rmushroom,40,0 +rshroom,40,0 +rmush,40,0 +goldblock,41,0 +blockgold,41,0 +gblock,41,0 +blockg,41,0 +ironblock,42,0 +steelblock,42,0 +blockiron,42,0 +blocksteel,42,0 +iblock,42,0 +stblock,42,0 +blocki,42,0 +blockst,42,0 +smoothstonedoublestep,43,0 +smoothstonedstep,43,0 +stonedoublestep,43,0 +stonedstep,43,0 +sdoublestep,43,0 +sdstep,43,0 +doublesmoothstonestep,43,0 +dsmoothstonestep,43,0 +doublestonestep,43,0 +dstonestep,43,0 +doublesstep,43,0 +doublestep,43,0 +dstep,43,0 +smoothstonedoubleslab,43,0 +smoothstonedslab,43,0 +stonedoubleslab,43,0 +stonedslab,43,0 +sdoubleslab,43,0 +sdslab,43,0 +doublesmoothstoneslab,43,0 +dsmoothstoneslab,43,0 +doublestoneslab,43,0 +dstoneslab,43,0 +doublesslab,43,0 +doubleslab,43,0 +dslab,43,0 +smoothstonedoublehalfblock,43,0 +smoothstonedhalfblock,43,0 +stonedoublehalfblock,43,0 +stonedhalfblock,43,0 +sdoublehalfblock,43,0 +sdhalfblock,43,0 +doublesmoothstonehalfblock,43,0 +dsmoothstonehalfblock,43,0 +doublestonehalfblock,43,0 +dstonehalfblock,43,0 +doubleshalfblock,43,0 +doublehalfblock,43,0 +dhalfblock,43,0 +sandstonedoublestep,43,1 +sandstonedstep,43,1 +sstonedoublestep,43,1 +sstonedstep,43,1 +ssdoublestep,43,1 +ssdstep,43,1 +doublesandstonestep,43,1 +dsandstonestep,43,1 +doublesstonestep,43,1 +dsstonestep,43,1 +doublessstep,43,1 +dsstep,43,1 +sandstonedoubleslab,43,1 +sandstonedslab,43,1 +sstonedoubleslab,43,1 +sstonedslab,43,1 +ssdoubleslab,43,1 +ssdslab,43,1 +doublesandstoneslab,43,1 +dsandstoneslab,43,1 +doublesstoneslab,43,1 +dsstoneslab,43,1 +doublessslab,43,1 +dsslab,43,1 +sandstonedoublehalfblock,43,1 +sandstonedhalfblock,43,1 +sstonedoublehalfblock,43,1 +sstonedhalfblock,43,1 +ssdoublehalfblock,43,1 +ssdhalfblock,43,1 +doublesandstonehalfblock,43,1 +dsandstonehalfblock,43,1 +doublesstonehalfblock,43,1 +dsstonehalfblock,43,1 +doublesshalfblock,43,1 +dsshalfblock,43,1 +woodenplankstonedoublehalfblock,43,2 +woodenplankstonedhalfblock,43,2 +woodplankstonedoublehalfblock,43,2 +woodplankstonedhalfblock,43,2 +wplankstonedoublehalfblock,43,2 +wplankstonedhalfblock,43,2 +plankstonedoublehalfblock,43,2 +planstonekdhalfblock,43,2 +woodenstonedoublehalfblock,43,2 +woodenstonedhalfblock,43,2 +woodstonedoublehalfblock,43,2 +woodstonedhalfblock,43,2 +wstonedoublehalfblock,43,2 +wstonedhalfblock,43,2 +doublewoodenplankstonehalfblock,43,2 +dwoodenplankstonehalfblock,43,2 +doublewoodplankstonehalfblock,43,2 +dwoodplankstonehalfblock,43,2 +doublewplankstonehalfblock,43,2 +dwplankstonehalfblock,43,2 +doubleplankstonehalfblock,43,2 +dplankstonehalfblock,43,2 +doublewoodenstonehalfblock,43,2 +dwoodenstonehalfblock,43,2 +doublewoodstonehalfblock,43,2 +dwoodstonehalfblock,43,2 +doublewstonehalfblock,43,2 +dwstonehalfblock,43,2 +woodenplankstonedoublestep,43,2 +woodenplankstonedstep,43,2 +woodplankstonedoublestep,43,2 +woodplankstonedstep,43,2 +wplankstonedoublestep,43,2 +wplankstonedstep,43,2 +plankstonedoublestep,43,2 +plankstonedstep,43,2 +woodenstonedoublestep,43,2 +woodenstonedstep,43,2 +woodstonedoublestep,43,2 +woodstonedstep,43,2 +wstonedoublestep,43,2 +wstonedstep,43,2 +doublewoodenplankstonestep,43,2 +dwoodenplankstonestep,43,2 +doublewoodplankstonestep,43,2 +dwoodplankstonestep,43,2 +doublewplankstonestep,43,2 +dwplankstonestep,43,2 +doubleplankstonestep,43,2 +dplankstonestep,43,2 +doublewoodenstonestep,43,2 +dwoodenstonestep,43,2 +doublewoodstonestep,43,2 +dwoodstonestep,43,2 +doublewstonestep,43,2 +dwstonestep,43,2 +woodenplankstonedoubleslab,43,2 +woodenplankstonedslab,43,2 +woodplankstonedoubleslab,43,2 +woodplankstonedslab,43,2 +wplankstonedoubleslab,43,2 +wplankstonedslab,43,2 +plankstonedoubleslab,43,2 +plankstonedslab,43,2 +woodenstonedoubleslab,43,2 +woodenstonedslab,43,2 +woodstonedoubleslab,43,2 +woodstonedslab,43,2 +wstonedoubleslab,43,2 +wstonedslab,43,2 +doublewoodenplankstoneslab,43,2 +dwoodenplankstoneslab,43,2 +doublewoodplankstoneslab,43,2 +dwoodplankstoneslab,43,2 +doublewplankstoneslab,43,2 +dwplankstoneslab,43,2 +doubleplankstoneslab,43,2 +dplankstoneslab,43,2 +doublewoodenstoneslab,43,2 +dwoodenstoneslab,43,2 +doublewoodstoneslab,43,2 +dwoodstoneslab,43,2 +doublewstoneslab,43,2 +dwstoneslab,43,2 +cobblestonedoublestep,43,3 +cobblestonedstep,43,3 +cobbledoublestep,43,3 +cobbledstep,43,3 +cstonedoublestep,43,3 +cstonedstep,43,3 +csdoublestep,43,3 +csdstep,43,3 +doublecobblestonestep,43,3 +dcobblestonestep,43,3 +doublecobblestep,43,3 +dcobblestep,43,3 +doublecstonestep,43,3 +dcstonestep,43,3 +doublecsstep,43,3 +dcsstep,43,3 +cobblestonedoubleslab,43,3 +cobblestonedslab,43,3 +cobbledoubleslab,43,3 +cobbledslab,43,3 +cstonedoubleslab,43,3 +cstonedslab,43,3 +csdoubleslab,43,3 +csdslab,43,3 +doublecobblestoneslab,43,3 +dcobblestoneslab,43,3 +doublecobbleslab,43,3 +dcobbleslab,43,3 +doublecstoneslab,43,3 +dcstoneslab,43,3 +doublecsslab,43,3 +dcsslab,43,3 +cobblestonedoublehalfblock,43,3 +cobblestonedhalfblock,43,3 +cobbledoublehalfblock,43,3 +cobbledhalfblock,43,3 +cstonedoublehalfblock,43,3 +cstonedhalfblock,43,3 +csdoublehalfblock,43,3 +csdhalfblock,43,3 +doublecobblestonehalfblock,43,3 +dcobblestonehalfblock,43,3 +doublecobblehalfblock,43,3 +dcobblehalfblock,43,3 +doublecstonehalfblock,43,3 +dcstonehalfblock,43,3 +doublecshalfblock,43,3 +dcshalfblock,43,3 +brickblockdoublestep,43,4 +brickblockdstep,43,4 +brickbdoublestep,43,4 +brickbdstep,43,4 +brickdoublestep,43,4 +brickdstep,43,4 +bdoublestep,43,4 +bdstep,43,4 +brickblockdoubleslab,43,4 +brickblockdslab,43,4 +brickbdoubleslab,43,4 +brickbdslab,43,4 +brickdoubleslab,43,4 +brickdslab,43,4 +bdoubleslab,43,4 +bdslab,43,4 +doublebrickblockstep,43,4 +dbrickblockstep,43,4 +doublebrickbstep,43,4 +dbrickbstep,43,4 +doublebrickstep,43,4 +dbrickstep,43,4 +doublebstep,43,4 +dbstep,43,4 +doublebrickblockslab,43,4 +dbrickblockslab,43,4 +doublebrickbslab,43,4 +dbrickbslab,43,4 +doublebrickslab,43,4 +dbrickslab,43,4 +doublebslab,43,4 +dbslab,43,4 +brickblockdoublehalfblock,43,4 +brickblockdhalfblock,43,4 +brickbdoublehalfblock,43,4 +brickbdhalfblock,43,4 +brickdoublehalfblock,43,4 +brickdhalfblock,43,4 +bdoublehalfblock,43,4 +bdhalfblock,43,4 +doublebrickblockhalfblock,43,4 +dbrickblockhalfblock,43,4 +doublebrickbhalfblock,43,4 +dbrickbhalfblock,43,4 +doublebrickhalfblock,43,4 +dbrickhalfblock,43,4 +doublebhalfblock,43,4 +dbhalfblock,43,4 +stonebrickdoublestep,43,5 +stonebrickdstep,43,5 +stonebdoublestep,43,5 +stonebdstep,43,5 +sbrickdoublestep,43,5 +sbrickdstep,43,5 +sbdoublestep,43,5 +sbdstep,43,5 +stonebrickdoubleslab,43,5 +stonebrickdslab,43,5 +stonebdoubleslab,43,5 +stonebdslab,43,5 +sbrickdoubleslab,43,5 +sbrickdslab,43,5 +sbdoubleslab,43,5 +sbdslab,43,5 +doublestonebrickstep,43,5 +dstonebrickstep,43,5 +doublestonebstep,43,5 +dstonebstep,43,5 +doublesbrickstep,43,5 +dsbrickstep,43,5 +doublesbstep,43,5 +dsbstep,43,5 +doublestonebrickslab,43,5 +dstonebrickslab,43,5 +doublestonebslab,43,5 +dstonebslab,43,5 +doublesbrickslab,43,5 +dsbrickdslab,43,5 +doublesbslab,43,5 +dsbslab,43,5 +stonebrickdoublehalfblock,43,5 +stonebrickdhalfblock,43,5 +stonebdoublehalfblock,43,5 +stonebdhalfblock,43,5 +sbrickdoublehalfblock,43,5 +sbrickdhalfblock,43,5 +sbdoublehalfblock,43,5 +sbdhalfblock,43,5 +doublestonebrickhalfblock,43,5 +dstonebrickhalfblock,43,5 +doublestonebhalfblock,43,5 +dstonebhalfblock,43,5 +doublesbrickhalfblock,43,5 +dsbrickhalfblock,43,5 +doublesbhalfblock,43,5 +dsbhalfblock,43,5 +netherbrickdoubleslab,43,6 +hellbrickdoubleslab,43,6 +nbrickdoubleslab,43,6 +hbrickdoubleslab,43,6 +netherdoubleslab,43,6 +helldoubleslab,43,6 +nbdoubleslab,43,6 +hbdoubleslab,43,6 +hdoubleslab,43,6 +ndoubleslab,43,6 +netherbrickdoublestep,43,6 +hellbrickdoublestep,43,6 +nbrickdoublestep,43,6 +hbrickdoublestep,43,6 +netherdoublestep,43,6 +helldoublestep,43,6 +nbdoublestep,43,6 +hbdoublestep,43,6 +ndoublestep,43,6 +hdoublestep,43,6 +netherbrickdoublehalfblock,43,6 +hellbrickdoublehalfblock,43,6 +nbrickdoublehalfblock,43,6 +hbrickdoublehalfblock,43,6 +netherdoublehalfblock,43,6 +helldoublehalfblock,43,6 +nbdoublehalfblock,43,6 +hbdoublehalfblock,43,6 +ndoublehalfblock,43,6 +hdoublehalfblock,43,6 +netherbrickdslab,43,6 +hellbrickdslab,43,6 +nbrickdslab,43,6 +hbrickdslab,43,6 +netherdslab,43,6 +helldslab,43,6 +nbdslab,43,6 +hbdslab,43,6 +hdslab,43,6 +ndslab,43,6 +netherbrickdstep,43,6 +hellbrickdstep,43,6 +nbrickdstep,43,6 +hbrickdstep,43,6 +netherdstep,43,6 +helldstep,43,6 +nbdstep,43,6 +hbdstep,43,6 +ndstep,43,6 +hdstep,43,6 +netherbrickdhalfblock,43,6 +hellbrickdhalfblock,43,6 +nbrickdhalfblock,43,6 +hbrickdhalfblock,43,6 +netherdhalfblock,43,6 +helldhalfblock,43,6 +nbdhalfblock,43,6 +hbdhalfblock,43,6 +ndhalfblock,43,6 +hdhalfblock,43,6 +doublenetherbrickslab,43,6 +doublehellbrickslab,43,6 +doublenbrickslab,43,6 +doublehbrickslab,43,6 +doublenetherslab,43,6 +doublehellslab,43,6 +doublenbslab,43,6 +doublehbslab,43,6 +doublehslab,43,6 +doublenslab,43,6 +doublenetherbrickstep,43,6 +doublehellbrickstep,43,6 +doublenbrickstep,43,6 +doublehbrickstep,43,6 +doublenetherstep,43,6 +doublehellstep,43,6 +doublenbstep,43,6 +doublehbstep,43,6 +doublenstep,43,6 +doublehstep,43,6 +doublenetherbrickhalfblock,43,6 +doublehellbrickhalfblock,43,6 +doublenbrickhalfblock,43,6 +doublehbrickhalfblock,43,6 +doublenetherhalfblock,43,6 +doublehellhalfblock,43,6 +doublenbhalfblock,43,6 +doublehbhalfblock,43,6 +doublenhalfblock,43,6 +doublehhalfblock,43,6 +dnetherbrickslab,43,6 +dhellbrickslab,43,6 +dnbrickslab,43,6 +dhbrickslab,43,6 +dnetherslab,43,6 +dhellslab,43,6 +dnbslab,43,6 +dhbslab,43,6 +dhslab,43,6 +dnslab,43,6 +dnetherbrickstep,43,6 +dhellbrickstep,43,6 +dnbrickstep,43,6 +dhbrickstep,43,6 +dnetherstep,43,6 +dhellstep,43,6 +dnbstep,43,6 +dhbstep,43,6 +dnstep,43,6 +dhstep,43,6 +dnetherbrickhalfblock,43,6 +dhellbrickhalfblock,43,6 +dnbrickhalfblock,43,6 +dhbrickhalfblock,43,6 +dnetherhalfblock,43,6 +dhellhalfblock,43,6 +dnbhalfblock,43,6 +dhbhalfblock,43,6 +dnhalfblock,43,6 +dhhalfblock,43,6 +smoothstonestep,44,0 +stonestep,44,0 +sstep,44,0 +step,44,0 +smoothstoneslab,44,0 +stoneslab,44,0 +sslab,44,0 +slab,44,0 +smoothstonehalfblock,44,0 +stonehalfblock,44,0 +shalfblock,44,0 +halfblock,44,0 +sandstonestep,44,1 +sstonestep,44,1 +ssstep,44,1 +sandstoneslab,44,1 +sstoneslab,44,1 +ssslab,44,1 +sandstonehalfblock,44,1 +sstonehalfblock,44,1 +sshalfblock,44,1 +woodenplankstonestep,44,2 +woodplankstonestep,44,2 +wplankstonestep,44,2 +plankstonestep,44,2 +woodenstonestep,44,2 +woodstonestep,44,2 +wstonestep,44,2 +woodenplankstoneslab,44,2 +woodplankstoneslab,44,2 +wplankstoneslab,44,2 +plankstoneslab,44,2 +woodenstoneslab,44,2 +woodstoneslab,44,2 +wstoneslab,44,2 +woodenplankstonehalfblock,44,2 +woodplankstonehalfblock,44,2 +wplankstonehalfblock,44,2 +plankstonehalfblock,44,2 +woodenstonehalfblock,44,2 +woodstonehalfblock,44,2 +wstonehalfblock,44,2 +cobblestonestep,44,3 +cobblestep,44,3 +cstonestep,44,3 +csstep,44,3 +cobblestoneslab,44,3 +cobbleslab,44,3 +cstoneslab,44,3 +csslab,44,3 +cobblestonehalfblock,44,3 +cobblehalfblock,44,3 +cstonehalfblock,44,3 +cshalfblock,44,3 +brickblockstep,44,4 +brickbstep,44,4 +brickstep,44,4 +bstep,44,4 +brickblockslab,44,4 +brickbslab,44,4 +brickslab,44,4 +bslab,44,4 +brickblockhalfblock,44,4 +brickbhalfblock,44,4 +brickhalfblock,44,4 +bhalfblock,44,4 +stonebrickstep,44,5 +stonebstep,44,5 +sbrickstep,44,5 +sbstep,44,5 +stonebrickslab,44,5 +stonebslab,44,5 +sbrickslab,44,5 +sbslab,44,5 +stonebrickhalfblock,44,5 +stonebhalfblock,44,5 +sbrickhalfblock,44,5 +sbhalfblock,44,5 +hellbrickslab,44,6 +nbrickslab,44,6 +hbrickslab,44,6 +netherslab,44,6 +hellslab,44,6 +nbslab,44,6 +hbslab,44,6 +hslab,44,6 +nslab,44,6 +netherbrickstep,44,6 +hellbrickstep,44,6 +nbrickstep,44,6 +hbrickstep,44,6 +netherstep,44,6 +hellstep,44,6 +nbstep,44,6 +hbstep,44,6 +nstep,44,6 +hstep,44,6 +netherbrickhalfblock,44,6 +hellbrickhalfblock,44,6 +nbrickhalfblock,44,6 +hbrickhalfblock,44,6 +netherhalfblock,44,6 +hellhalfblock,44,6 +nbhalfblock,44,6 +hbhalfblock,44,6 +nhalfblock,44,6 +hhalfblock,44,6 +brickblock,45,0 +blockbrick,45,0 +bblock,45,0 +blockb,45,0 +tntblock,46,0 +blocktnt,46,0 +bombblock,46,0 +blockbomb,46,0 +dynamiteblock,46,0 +blockdynamite,46,0 +tnt,46,0 +bomb,46,0 +dynamite,46,0 +bookcase,47,0 +casebook,47,0 +bookshelf,47,0 +shelfbook,47,0 +bookblock,47,0 +blockbook,47,0 +mossycobblestone,48,0 +mosscobblestone,48,0 +mcobblestone,48,0 +mossycobble,48,0 +mosscobble,48,0 +mcobble,48,0 +mossstone,48,0 +mossystone,48,0 +mstone,48,0 +obsidian,49,0 +obsi,49,0 +obby,49,0 +torch,50,0 +burningstick,50,0 +burnstick,50,0 +fire,51,0 +flame,51,0 +flames,51,0 +mobspawner,52,0 +mobcage,52,0 +monsterspawner,52,0 +monstercage,52,0 +mspawner,52,0 +mcage,52,0 +spawner,52,0 +cage,52,0 +woodenstairs,53,0 +woodstairs,53,0 +wstairs,53,0 +woodenstair,53,0 +woodstair,53,0 +wstair,53,0 +chest,54,0 +container,54,0 +redstonewireblock,55,0 +rstonewireblock,55,0 +redswireblock,55,0 +redwireblock,55,0 +rswireblock,55,0 +rwireblock,55,0 +redstonewire,55,0 +rstonewire,55,0 +redswire,55,0 +redwire,55,0 +rswire,55,0 +rwire,55,0 +wire,55,0 +diamondore,56,0 +crystalore,56,0 +diamondo,56,0 +crystalo,56,0 +orediamond,56,0 +odiamond,56,0 +orecrystal,56,0 +ocrystal,56,0 +dore,56,0 +ored,56,0 +diamondblock,57,0 +blockdiamond,57,0 +crystalblock,57,0 +blockcrystal,57,0 +dblock,57,0 +blockd,57,0 +workbench,58,0 +craftingbench,58,0 +crafterbench,58,0 +craftbench,58,0 +worktable,58,0 +craftingtable,58,0 +craftertable,58,0 +crafttable,58,0 +wbench,58,0 +cbench,58,0 +crops,59,0 +crop,59,0 +soil,60,0 +furnace,61,0 +burningfurnace,62,0 +bfurnace,62,0 +signpost,63,0 +spost,63,0 +woodendoorhalf,64,0 +wooddoorhalf,64,0 +wdoorhalf,64,0 +woodendoorbottom,64,0 +wooddoorbottom,64,0 +wdoorbottom,64,0 +woodendoorblock,64,0 +wooddoorblock,64,0 +wdoorblock,64,0 +ladder,65,0 +minecarttrack,66,0 +minecartrail,66,0 +mcarttrack,66,0 +mcartrail,66,0 +mctrack,66,0 +mcrail,66,0 +track,66,0 +rail,66,0 +cobblestonestairs,67,0 +cstonestairs,67,0 +stonestairs,67,0 +cobblestairs,67,0 +csstairs,67,0 +sstairs,67,0 +cstairs,67,0 +cobblestonestair,67,0 +cstonestair,67,0 +stonestair,67,0 +cobblestair,67,0 +csstair,67,0 +sstair,67,0 +cstair,67,0 +wallsign,68,0 +wsign,68,0 +lever,69,0 +smoothstonepressureplate,70,0 +smoothstonepressplate,70,0 +smoothstonepplate,70,0 +smoothstoneplate,70,0 +sstonepressureplate,70,0 +sstonepressplate,70,0 +sstonepplate,70,0 +sstoneplate,70,0 +stonepressureplate,70,0 +stonepressplate,70,0 +stonepplate,70,0 +stoneplate,70,0 +spressureplate,70,0 +spressplate,70,0 +spplate,70,0 +splate,70,0 +irondoorhalf,71,0 +idoorhalf,71,0 +irondoorbottom,71,0 +idoorbottom,71,0 +irondoorblock,71,0 +idoorblock,71,0 +steeldoorhalf,71,0 +sdoorhalf,71,0 +steeldoorbottom,71,0 +sdoorbottom,71,0 +steeldoorblock,71,0 +sdoorblock,71,0 +woodenpressureplate,72,0 +woodenpressplate,72,0 +woodenpplate,72,0 +woodenplate,72,0 +woodpressureplate,72,0 +woodpressplate,72,0 +woodpplate,72,0 +woodplate,72,0 +wpressureplate,72,0 +wpressplate,72,0 +wpplate,72,0 +wplate,72,0 +redstoneore,73,0 +redsore,73,0 +redore,73,0 +rstoneore,73,0 +rsore,73,0 +rore,73,0 +oreredstone,73,0 +orereds,73,0 +orered,73,0 +orerstone,73,0 +orers,73,0 +orer,73,0 +glowingredstoneore,74,0 +glowredstoneore,74,0 +gredstoneore,74,0 +glowingrstoneore,74,0 +glowrstoneore,74,0 +grstoneore,74,0 +glowingredsore,74,0 +glowredsore,74,0 +gredsore,74,0 +glowingredore,74,0 +glowredore,74,0 +gredore,74,0 +glowingrsore,74,0 +glowrsore,74,0 +grsore,74,0 +grore,74,0 +oreglowingredstone,74,0 +oreglowredstone,74,0 +oregredstone,74,0 +oreglowingrstone,74,0 +oreglowrstone,74,0 +oregrstone,74,0 +oreglowingreds,74,0 +oreglowreds,74,0 +oregreds,74,0 +oreglowingred,74,0 +oreglowred,74,0 +oregred,74,0 +oreglowingrs,74,0 +oreglowrs,74,0 +oregrs,74,0 +oregr,74,0 +redstonetorchoff,75,0 +rstonetorchoff,75,0 +redstorchoff,75,0 +redtorchoff,75,0 +rstorchoff,75,0 +redstonetorchon,76,0 +redstonetorch,76,0 +rstonetorchon,76,0 +rstonetorch,76,0 +redstorchon,76,0 +redstorch,76,0 +redtorchon,76,0 +redtorch,76,0 +rstorchon,76,0 +rstorch,76,0 +smoothstonebutton,77,0 +sstonebutton,77,0 +stonebutton,77,0 +sbutton,77,0 +button,77,0 +snowcovering,78,0 +snowcover,78,0 +scover,78,0 +ice,79,0 +frozenwater,79,0 +waterfrozen,79,0 +freezewater,79,0 +waterfreeze,79,0 +snowblock,80,0 +blocksnow,80,0 +sblock,80,0 +blocks,80,0 +cactus,81,0 +cactuses,81,0 +cacti,81,0 +clayblock,82,0 +blockclay,82,0 +cblock,82,0 +blockc,82,0 +reedblock,83,0 +reedsblock,83,0 +sugarcaneblock,83,0 +scaneblock,83,0 +bambooblock,83,0 +blockreed,83,0 +blockreeds,83,0 +blocksugarcane,83,0 +blockscane,83,0 +blockbamboo,83,0 +jukebox,84,0 +jbox,84,0 +fence,85,0 +woodenfence,85,0 +woodfence,85,0 +wfence,85,0 +fencewooden,85,0 +fencewood,85,0 +fencew,85,0 +pumpkin,86,0 +netherrack,87,0 +netherrock,87,0 +netherstone,87,0 +hellstone,87,0 +nstone,87,0 +hstone,87,0 +soulsand,88,0 +slowsand,88,0 +slowmud,88,0 +ssand,88,0 +smud,88,0 +mud,88,0 +glowingstoneblock,89,0 +lightstoneblock,89,0 +glowstoneblock,89,0 +blockglowingstone,89,0 +blocklightstone,89,0 +blockglowstone,89,0 +glowingstoneb,89,0 +lightstoneb,89,0 +glowstoneb,89,0 +bglowingstone,89,0 +blightstone,89,0 +bglowstone,89,0 +glowingstone,89,0 +lightstone,89,0 +glowstone,89,0 +glowingblock,89,0 +lightblock,89,0 +glowblock,89,0 +lstone,89,0 +gstone,89,0 +portal,90,0 +jackolantern,91,0 +pumpkinlantern,91,0 +glowingpumpkin,91,0 +lightpumpkin,91,0 +jpumpkin,91,0 +plantren,91,0 +glowpumpkin,91,0 +gpumpkin,91,0 +lpumpkin,91,0 +cakeblock,92,0 +repeateroff,93,0 +repeatoff,93,0 +delayeroff,93,0 +delayoff,93,0 +dioderoff,93,0 +diodeoff,93,0 +repeaterblockoff,93,0 +repeatblockoff,93,0 +delayerblockoff,93,0 +delayblockoff,93,0 +dioderblockoff,93,0 +diodeblockoff,93,0 +repeateron,94,0 +repeaton,94,0 +delayeron,94,0 +delayon,94,0 +dioderon,94,0 +diodeon,94,0 +repeaterblockon,94,0 +repeatblockon,94,0 +delayerblockon,94,0 +delayblockon,94,0 +dioderblockon,94,0 +diodeblockon,94,0 +lockedchest,95,0 +lockchest,95,0 +jokechest,95,0 +aprilfoolschest,95,0 +aprilchest,95,0 +lootchest,95,0 +trapdoor,96,0 +doortrap,96,0 +hatch,96,0 +tdoor,96,0 +doort,96,0 +trapd,96,0 +dtrap,96,0 +silverfish,97,0 +monsteregg,97,0 +monstereggsmoothstone,97,0 +monstereggsstone,97,0 +meggsmoothstone,97,0 +meggsstone,97,0 +mesmoothstone,97,0 +messtone,97,0 +silverfishsmoothstone,97,0 +silverfishsstone,97,0 +silverfishstone,97,0 +sfishsmoothstone,97,0 +sfishsstone,97,0 +sfishstone,97,0 +fishsmoothstone,97,0 +fishsstone,97,0 +fishstone,97,0 +sfsmoothstone,97,0 +sfsstone,97,0 +sfstone,97,0 +trapsmoothstone,97,0 +trapsstone,97,0 +trapstone,97,0 +monstereggcobblestone,97,1 +monstereggcstone,97,1 +meggcobblestone,97,1 +meggcstone,97,1 +mecobblestone,97,1 +mecstone,97,1 +silverfishcobblestone,97,1 +silverfishcstone,97,1 +sfishcobblestone,97,1 +sfishcstone,97,1 +fishcobblestone,97,1 +fishcstone,97,1 +sfcobblestone,97,1 +sfcstone,97,1 +trapcobblestone,97,1 +trapcstone,97,1 +monstereggstonebrick,97,2 +monstereggsbrick,97,2 +meggstonebrick,97,2 +meggsbrick,97,2 +mestonebrick,97,2 +mesbrick,97,2 +silverfishstonebrick,97,2 +silverfishsbrick,97,2 +sfishstonebrick,97,2 +sfishsbrick,97,2 +fishstonebrick,97,2 +fishsbrick,97,2 +sfstonebrick,97,2 +sfsbrick,97,2 +trapstonebrick,97,2 +trapsbrick,97,2 +stonebrick,98,0 +stonebricks,98,0 +stonebrickblock,98,0 +stonebb,98,0 +sbrick,98,0 +mossystonebrick,98,1 +mossystonebricks,98,1 +mossystonebrickblock,98,1 +mossystonebb,98,1 +crackedstonebrick,98,2 +crackedstonebricks,98,2 +crackedstonebrickblock,98,2 +crackedstonebb,98,2 +circlestonebrick,98,3 +circlestonebb,98,3 +circlestone,98,3 +circlesbb,98,3 +giantredmushroom,99,0 +hugeredmushroom,99,0 +bigredmushroom,99,0 +gredmushroom,99,0 +hredmushroom,99,0 +bredmushroom,99,0 +giantrmushroom,99,0 +hugermushroom,99,0 +bigrmushroom,99,0 +grmushroom,99,0 +hrmushroom,99,0 +brmushroom,99,0 +giantbrownmushroom,100,0 +hugebrownmushroom,100,0 +bigbrownmushroom,100,0 +gbrownmushroom,100,0 +hbrownmushroom,100,0 +bbrownmushroom,100,0 +giantbmushroom,100,0 +hugebmushroom,100,0 +bigbmushroom,100,0 +gbmushroom,100,0 +hbmushroom,100,0 +bbmushroom,100,0 +ironbars,101,0 +ironbarsb,101,0 +ironbarsblock,101,0 +ironfence,101,0 +metalbars,101,0 +metalbarsb,101,0 +metalbarsblock,101,0 +metalfence,101,0 +jailbars,101,0 +jailbarsb,101,0 +jailbarsblock,101,0 +jailfence,101,0 +mbars,101,0 +mbarsb,101,0 +mbarsblock,101,0 +mfence,101,0 +jbars,101,0 +jbarsb,101,0 +jbarsblock,101,0 +jfence,101,0 +ibars,101,0 +ibarsb,101,0 +ibarsblock,101,0 +ifence,101,0 +glasspane,102,0 +glassp,102,0 +paneglass,102,0 +pglass,102,0 +flatglass,102,0 +fglass,102,0 +skinnyglass,102,0 +sglass,102,0 +glassflat,102,0 +glassf,102,0 +glassskinny,102,0 +glasss,102,0 +melon,103,0 +watermelon,103,0 +greenmelon,103,0 +melongreen,103,0 +melonblock,103,0 +watermelonblock,103,0 +greenmelonblock,103,0 +pumpkinstem,104,0 +stempumpkin,104,0 +pumpstem,104,0 +stempump,104,0 +melonstem,105,0 +watermelonstem,105,0 +greenmelonstem,105,0 +stemmelon,105,0 +stemwatermelon,105,0 +stemgreenmelon,105,0 +vines,106,0 +vine,106,0 +greenvines,106,0 +greenvine,106,0 +gardenvines,106,0 +gardenvine,106,0 +vinesgreen,106,0 +vinegreen,106,0 +vinesgarden,106,0 +vinegarden,106,0 +vinesg,106,0 +vineg,106,0 +gvines,106,0 +gvine,106,0 +wfencegate,107,0 +woodfencegate,107,0 +woodenfencegate,107,0 +woodengate,107,0 +woodgate,107,0 +wgate,107,0 +gate,107,0 +gardengate,107,0 +ggate,107,0 +fencegate,107,0 +fencegatewooden,107,0 +fencegatewood,107,0 +brickstairs,108,0 +redbrickstairs,108,0 +redbstairs,108,0 +rbrickstairs,108,0 +bstairs,108,0 +redstairs,108,0 +brickstair,108,0 +redbrickstair,108,0 +redbstair,108,0 +rbrickstair,108,0 +bstair,108,0 +redstair,108,0 +stonebrickstairs,109,0 +stonebstairs,109,0 +sbstairs,109,0 +cementbrickstairs,109,0 +cementstairs,109,0 +cementbstairs,109,0 +cbstairs,109,0 +greybrickstairs,109,0 +greybstairs,109,0 +greystairs,109,0 +purplegrass,110,0 +pinkgrass,110,0 +mycel,110,0 +mycelium,110,0 +swampgrass,110,0 +sgrass,110,0 +mushroomgrass,110,0 +mushgrass,110,0 +waterlily,111,0 +lilypad,111,0 +lily,111,0 +swamppad,111,0 +lpad,111,0 +wlily,111,0 +netherbrick,112,0 +nbrick,112,0 +hellbrick,112,0 +deathbrick,112,0 +dbrick,112,0 +hbrick,112,0 +netherbrickfence,113,0 +hellbrickfence,113,0 +nbrickfence,113,0 +hbrickfence,113,0 +netherbfence,113,0 +hellbfence,113,0 +netherfence,113,0 +hellfence,113,0 +nbfence,113,0 +hbfence,113,0 +nfence,113,0 +hfence,113,0 +netherbrickstairs,114,0 +hellbrickstairs,114,0 +nbrickstairs,114,0 +hbrickstairs,114,0 +netherbstairs,114,0 +hellbstairs,114,0 +netherstairs,114,0 +hellstairs,114,0 +nbstairs,114,0 +hbstairs,114,0 +nstairs,114,0 +hstairs,114,0 +netherbrickstair,114,0 +hellbrickstair,114,0 +nbrickstair,114,0 +hbrickstair,114,0 +netherbstair,114,0 +hellbstair,114,0 +netherstair,114,0 +hellstair,114,0 +nbstair,114,0 +hbstair,114,0 +nstair,114,0 +hstair,114,0 +netherwarts,115,0 +netherwart,115,0 +netherplant,115,0 +nethercrop,115,0 +hellwarts,115,0 +hellwart,115,0 +hellplant,115,0 +hellcrop,115,0 +deathwarts,115,0 +deathwart,115,0 +deathplant,115,0 +deathcrop,115,0 +nwarts,115,0 +nwart,115,0 +ncrop,115,0 +nplant,115,0 +hwarts,115,0 +hwart,115,0 +hplant,115,0 +hcrop,115,0 +dwarts,115,0 +dwart,115,0 +dplant,115,0 +dcrop,115,0 +enchantmenttable,116,0 +enchantingtable,116,0 +enchanttable,116,0 +etable,116,0 +magicaltable,116,0 +magictable,116,0 +mtable,116,0 +enchantmentdesk,116,0 +enchantingdesk,116,0 +enchantdesk,116,0 +edesk,116,0 +magicaldesk,116,0 +magicdesk,116,0 +mdesk,116,0 +booktable,116,0 +bookdesk,116,0 +btable,116,0 +bdesk,116,0 +brewingstandblock,117,0 +brewerblock,117,0 +potionstandblock,117,0 +potionbrewerblock,117,0 +pstandblock,117,0 +bstandblock,117,0 +pbrewerblock,117,0 +cauldron,118,0 +steelcauldron,118,0 +ironcauldron,118,0 +icauldron,118,0 +scauldron,118,0 +potioncauldron,118,0 +pcauldron,118,0 +enderportal,119,0 +endergoo,119,0 +endgoo,119,0 +endportal,119,0 +egoo,119,0 +eportal,119,0 +enderportalframe,120,0 +endportalframe,120,0 +endgooframe,120,0 +endergooframe,120,0 +egooframe,120,0 +eportalframe,120,0 +enderframe,120,0 +endframe,120,0 +enderstone,121,0 +endstone,121,0 +endrock,121,0 +enderrock,121,0 +erock,121,0 +estone,121,0 +enderdragonegg,122,0 +endegg,122,0 +dragonegg,122,0 +degg,122,0 +bossegg,122,0 +begg,122,0 +redstonelamp,123,0 +redstonelampoff,123,0 +redlamp,123,0 +redlampoff,123,0 +rslamp,123,0 +rslampoff,123,0 +redstonelampon,124,0 +redlampon,124,0 +rslampon,124,0 +woodenplankdoublehalfblock,125,0 +woodenplankdhalfblock,125,0 +woodplankdoublehalfblock,125,0 +woodplankdhalfblock,125,0 +wplankdoublehalfblock,125,0 +wplankdhalfblock,125,0 +plankdoublehalfblock,125,0 +plankdhalfblock,125,0 +woodendoublehalfblock,125,0 +woodendhalfblock,125,0 +wooddoublehalfblock,125,0 +wooddhalfblock,125,0 +wdoublehalfblock,125,0 +wdhalfblock,125,0 +doublewoodenplankhalfblock,125,0 +dwoodenplankhalfblock,125,0 +doublewoodplankhalfblock,125,0 +dwoodplankhalfblock,125,0 +doublewplankhalfblock,125,0 +dwplankhalfblock,125,0 +doubleplankhalfblock,125,0 +dplankhalfblock,125,0 +doublewoodenhalfblock,125,0 +dwoodenhalfblock,125,0 +doublewoodhalfblock,125,0 +dwoodhalfblock,125,0 +doublewhalfblock,125,0 +dwhalfblock,125,0 +woodenplankdoublestep,125,0 +woodenplankdstep,125,0 +woodplankdoublestep,125,0 +woodplankdstep,125,0 +wplankdoublestep,125,0 +wplankdstep,125,0 +plankdoublestep,125,0 +plankdstep,125,0 +woodendoublestep,125,0 +woodendstep,125,0 +wooddoublestep,125,0 +wooddstep,125,0 +wdoublestep,125,0 +wdstep,125,0 +doublewoodenplankstep,125,0 +dwoodenplankstep,125,0 +doublewoodplankstep,125,0 +dwoodplankstep,125,0 +doublewplankstep,125,0 +dwplankstep,125,0 +doubleplankstep,125,0 +dplankstep,125,0 +doublewoodenstep,125,0 +dwoodenstep,125,0 +doublewoodstep,125,0 +dwoodstep,125,0 +doublewstep,125,0 +dwstep,125,0 +woodenplankdoubleslab,125,0 +woodenplankdslab,125,0 +woodplankdoubleslab,125,0 +woodplankdslab,125,0 +wplankdoubleslab,125,0 +wplankdslab,125,0 +plankdoubleslab,125,0 +plankdslab,125,0 +woodendoubleslab,125,0 +woodendslab,125,0 +wooddoubleslab,125,0 +wooddslab,125,0 +wdoubleslab,125,0 +wdslab,125,0 +doublewoodenplankslab,125,0 +dwoodenplankslab,125,0 +doublewoodplankslab,125,0 +dwoodplankslab,125,0 +doublewplankslab,125,0 +dwplankslab,125,0 +doubleplankslab,125,0 +dplankslab,125,0 +doublewoodenslab,125,0 +dwoodenslab,125,0 +doublewoodslab,125,0 +dwoodslab,125,0 +doublewslab,125,0 +dwslab,125,0 +oakwoodenplankdoublehalfblock,125,0 +oakwoodenplankdhalfblock,125,0 +oakwoodplankdoublehalfblock,125,0 +oakwoodplankdhalfblock,125,0 +oakwplankdoublehalfblock,125,0 +oakwplankdhalfblock,125,0 +oakplankdoublehalfblock,125,0 +oakplankdhalfblock,125,0 +oakwoodendoublehalfblock,125,0 +oakwoodendhalfblock,125,0 +oakwooddoublehalfblock,125,0 +oakwooddhalfblock,125,0 +oakwdoublehalfblock,125,0 +oakwdhalfblock,125,0 +oakdoublewoodenplankhalfblock,125,0 +oakdwoodenplankhalfblock,125,0 +oakdoublewoodplankhalfblock,125,0 +oakdwoodplankhalfblock,125,0 +oakdoublewplankhalfblock,125,0 +oakdwplankhalfblock,125,0 +oakdoubleplankhalfblock,125,0 +oakdplankhalfblock,125,0 +oakdoublewoodenhalfblock,125,0 +oakdwoodenhalfblock,125,0 +oakdoublewoodhalfblock,125,0 +oakdwoodhalfblock,125,0 +oakdoublewhalfblock,125,0 +oakdwhalfblock,125,0 +oakdoublehalfblock,125,0 +oakdhalfblock,125,0 +oakwoodenplankdoublestep,125,0 +oakwoodenplankdstep,125,0 +oakwoodplankdoublestep,125,0 +oakwoodplankdstep,125,0 +oakwplankdoublestep,125,0 +oakwplankdstep,125,0 +oakplankdoublestep,125,0 +oakplankdstep,125,0 +oakwoodendoublestep,125,0 +oakwoodendstep,125,0 +oakwooddoublestep,125,0 +oakwooddstep,125,0 +oakwdoublestep,125,0 +oakwdstep,125,0 +oakdoublewoodenplankstep,125,0 +oakdwoodenplankstep,125,0 +oakdoublewoodplankstep,125,0 +oakdwoodplankstep,125,0 +oakdoublewplankstep,125,0 +oakdwplankstep,125,0 +oakdoubleplankstep,125,0 +oakdplankstep,125,0 +oakdoublewoodenstep,125,0 +oakdwoodenstep,125,0 +oakdoublewoodstep,125,0 +oakdwoodstep,125,0 +oakdoublewstep,125,0 +oakdwstep,125,0 +oakdoublestep,125,0 +oakdstep,125,0 +oakwoodenplankdoubleslab,125,0 +oakwoodenplankdslab,125,0 +oakwoodplankdoubleslab,125,0 +oakwoodplankdslab,125,0 +oakwplankdoubleslab,125,0 +oakwplankdslab,125,0 +oakplankdoubleslab,125,0 +oakplankdslab,125,0 +oakwoodendoubleslab,125,0 +oakwoodendslab,125,0 +oakwooddoubleslab,125,0 +oakwooddslab,125,0 +oakwdoubleslab,125,0 +oakwdslab,125,0 +oakdoublewoodenplankslab,125,0 +oakdwoodenplankslab,125,0 +oakdoublewoodplankslab,125,0 +oakdwoodplankslab,125,0 +oakdoublewplankslab,125,0 +oakdwplankslab,125,0 +oakdoubleplankslab,125,0 +oakdplankslab,125,0 +oakdoublewoodenslab,125,0 +oakdwoodenslab,125,0 +oakdoublewoodslab,125,0 +oakdwoodslab,125,0 +oakdoublewslab,125,0 +oakdwslab,125,0 +oakdoubleslab,125,0 +oakdslab,125,0 +sprucewoodenplankdoublehalfblock,125,1 +sprucewoodenplankdhalfblock,125,1 +sprucewoodplankdoublehalfblock,125,1 +sprucewoodplankdhalfblock,125,1 +sprucewplankdoublehalfblock,125,1 +sprucewplankdhalfblock,125,1 +spruceplankdoublehalfblock,125,1 +spruceplankdhalfblock,125,1 +sprucewoodendoublehalfblock,125,1 +sprucewoodendhalfblock,125,1 +sprucewooddoublehalfblock,125,1 +sprucewooddhalfblock,125,1 +sprucewdoublehalfblock,125,1 +sprucewdhalfblock,125,1 +sprucedoublewoodenplankhalfblock,125,1 +sprucedwoodenplankhalfblock,125,1 +sprucedoublewoodplankhalfblock,125,1 +sprucedwoodplankhalfblock,125,1 +sprucedoublewplankhalfblock,125,1 +sprucedwplankhalfblock,125,1 +sprucedoubleplankhalfblock,125,1 +sprucedplankhalfblock,125,1 +sprucedoublewoodenhalfblock,125,1 +sprucedwoodenhalfblock,125,1 +sprucedoublewoodhalfblock,125,1 +sprucedwoodhalfblock,125,1 +sprucedoublewhalfblock,125,1 +sprucedwhalfblock,125,1 +sprucedoublehalfblock,125,1 +sprucedhalfblock,125,1 +sprucewoodenplankdoublestep,125,1 +sprucewoodenplankdstep,125,1 +sprucewoodplankdoublestep,125,1 +sprucewoodplankdstep,125,1 +sprucewplankdoublestep,125,1 +sprucewplankdstep,125,1 +spruceplankdoublestep,125,1 +spruceplankdstep,125,1 +sprucewoodendoublestep,125,1 +sprucewoodendstep,125,1 +sprucewooddoublestep,125,1 +sprucewooddstep,125,1 +sprucewdoublestep,125,1 +sprucewdstep,125,1 +sprucedoublewoodenplankstep,125,1 +sprucedwoodenplankstep,125,1 +sprucedoublewoodplankstep,125,1 +sprucedwoodplankstep,125,1 +sprucedoublewplankstep,125,1 +sprucedwplankstep,125,1 +sprucedoubleplankstep,125,1 +sprucedplankstep,125,1 +sprucedoublewoodenstep,125,1 +sprucedwoodenstep,125,1 +sprucedoublewoodstep,125,1 +sprucedwoodstep,125,1 +sprucedoublewstep,125,1 +sprucedwstep,125,1 +sprucedoublestep,125,1 +sprucedstep,125,1 +sprucewoodenplankdoubleslab,125,1 +sprucewoodenplankdslab,125,1 +sprucewoodplankdoubleslab,125,1 +sprucewoodplankdslab,125,1 +sprucewplankdoubleslab,125,1 +sprucewplankdslab,125,1 +spruceplankdoubleslab,125,1 +spruceplankdslab,125,1 +sprucewoodendoubleslab,125,1 +sprucewoodendslab,125,1 +sprucewooddoubleslab,125,1 +sprucewooddslab,125,1 +sprucewdoubleslab,125,1 +sprucewdslab,125,1 +sprucedoublewoodenplankslab,125,1 +sprucedwoodenplankslab,125,1 +sprucedoublewoodplankslab,125,1 +sprucedwoodplankslab,125,1 +sprucedoublewplankslab,125,1 +sprucedwplankslab,125,1 +sprucedoubleplankslab,125,1 +sprucedplankslab,125,1 +sprucedoublewoodenslab,125,1 +sprucedwoodenslab,125,1 +sprucedoublewoodslab,125,1 +sprucedwoodslab,125,1 +sprucedoublewslab,125,1 +sprucedwslab,125,1 +sprucedoubleslab,125,1 +sprucedslab,125,1 +darkwoodenplankdoublehalfblock,125,1 +darkwoodenplankdhalfblock,125,1 +darkwoodplankdoublehalfblock,125,1 +darkwoodplankdhalfblock,125,1 +darkwplankdoublehalfblock,125,1 +darkwplankdhalfblock,125,1 +darkplankdoublehalfblock,125,1 +darkplankdhalfblock,125,1 +darkwoodendoublehalfblock,125,1 +darkwoodendhalfblock,125,1 +darkwooddoublehalfblock,125,1 +darkwooddhalfblock,125,1 +darkwdoublehalfblock,125,1 +darkwdhalfblock,125,1 +darkdoublewoodenplankhalfblock,125,1 +darkdwoodenplankhalfblock,125,1 +darkdoublewoodplankhalfblock,125,1 +darkdwoodplankhalfblock,125,1 +darkdoublewplankhalfblock,125,1 +darkdwplankhalfblock,125,1 +darkdoubleplankhalfblock,125,1 +darkdplankhalfblock,125,1 +darkdoublewoodenhalfblock,125,1 +darkdwoodenhalfblock,125,1 +darkdoublewoodhalfblock,125,1 +darkdwoodhalfblock,125,1 +darkdoublewhalfblock,125,1 +darkdwhalfblock,125,1 +darkdoublehalfblock,125,1 +darkdhalfblock,125,1 +darkwoodenplankdoublestep,125,1 +darkwoodenplankdstep,125,1 +darkwoodplankdoublestep,125,1 +darkwoodplankdstep,125,1 +darkwplankdoublestep,125,1 +darkwplankdstep,125,1 +darkplankdoublestep,125,1 +darkplankdstep,125,1 +darkwoodendoublestep,125,1 +darkwoodendstep,125,1 +darkwooddoublestep,125,1 +darkwooddstep,125,1 +darkwdoublestep,125,1 +darkwdstep,125,1 +darkdoublewoodenplankstep,125,1 +darkdwoodenplankstep,125,1 +darkdoublewoodplankstep,125,1 +darkdwoodplankstep,125,1 +darkdoublewplankstep,125,1 +darkdwplankstep,125,1 +darkdoubleplankstep,125,1 +darkdplankstep,125,1 +darkdoublewoodenstep,125,1 +darkdwoodenstep,125,1 +darkdoublewoodstep,125,1 +darkdwoodstep,125,1 +darkdoublewstep,125,1 +darkdwstep,125,1 +darkdoublestep,125,1 +darkdstep,125,1 +darkwoodenplankdoubleslab,125,1 +darkwoodenplankdslab,125,1 +darkwoodplankdoubleslab,125,1 +darkwoodplankdslab,125,1 +darkwplankdoubleslab,125,1 +darkwplankdslab,125,1 +darkplankdoubleslab,125,1 +darkplankdslab,125,1 +darkwoodendoubleslab,125,1 +darkwoodendslab,125,1 +darkwooddoubleslab,125,1 +darkwooddslab,125,1 +darkwdoubleslab,125,1 +darkwdslab,125,1 +darkdoublewoodenplankslab,125,1 +darkdwoodenplankslab,125,1 +darkdoublewoodplankslab,125,1 +darkdwoodplankslab,125,1 +darkdoublewplankslab,125,1 +darkdwplankslab,125,1 +darkdoubleplankslab,125,1 +darkdplankslab,125,1 +darkdoublewoodenslab,125,1 +darkdwoodenslab,125,1 +darkdoublewoodslab,125,1 +darkdwoodslab,125,1 +darkdoublewslab,125,1 +darkdwslab,125,1 +darkdoubleslab,125,1 +darkdslab,125,1 +birchwoodenplankdoublehalfblock,125,2 +birchwoodenplankdhalfblock,125,2 +birchwoodplankdoublehalfblock,125,2 +birchwoodplankdhalfblock,125,2 +birchwplankdoublehalfblock,125,2 +birchwplankdhalfblock,125,2 +birchplankdoublehalfblock,125,2 +birchplankdhalfblock,125,2 +birchwoodendoublehalfblock,125,2 +birchwoodendhalfblock,125,2 +birchwooddoublehalfblock,125,2 +birchwooddhalfblock,125,2 +birchwdoublehalfblock,125,2 +birchwdhalfblock,125,2 +birchdoublewoodenplankhalfblock,125,2 +birchdwoodenplankhalfblock,125,2 +birchdoublewoodplankhalfblock,125,2 +birchdwoodplankhalfblock,125,2 +birchdoublewplankhalfblock,125,2 +birchdwplankhalfblock,125,2 +birchdoubleplankhalfblock,125,2 +birchdplankhalfblock,125,2 +birchdoublewoodenhalfblock,125,2 +birchdwoodenhalfblock,125,2 +birchdoublewoodhalfblock,125,2 +birchdwoodhalfblock,125,2 +birchdoublewhalfblock,125,2 +birchdwhalfblock,125,2 +birchdoublehalfblock,125,2 +birchdhalfblock,125,2 +birchwoodenplankdoublestep,125,2 +birchwoodenplankdstep,125,2 +birchwoodplankdoublestep,125,2 +birchwoodplankdstep,125,2 +birchwplankdoublestep,125,2 +birchwplankdstep,125,2 +birchplankdoublestep,125,2 +birchplankdstep,125,2 +birchwoodendoublestep,125,2 +birchwoodendstep,125,2 +birchwooddoublestep,125,2 +birchwooddstep,125,2 +birchwdoublestep,125,2 +birchwdstep,125,2 +birchdoublewoodenplankstep,125,2 +birchdwoodenplankstep,125,2 +birchdoublewoodplankstep,125,2 +birchdwoodplankstep,125,2 +birchdoublewplankstep,125,2 +birchdwplankstep,125,2 +birchdoubleplankstep,125,2 +birchdplankstep,125,2 +birchdoublewoodenstep,125,2 +birchdwoodenstep,125,2 +birchdoublewoodstep,125,2 +birchdwoodstep,125,2 +birchdoublewstep,125,2 +birchdwstep,125,2 +birchdoublestep,125,2 +birchdstep,125,2 +birchwoodenplankdoubleslab,125,2 +birchwoodenplankdslab,125,2 +birchwoodplankdoubleslab,125,2 +birchwoodplankdslab,125,2 +birchwplankdoubleslab,125,2 +birchwplankdslab,125,2 +birchplankdoubleslab,125,2 +birchplankdslab,125,2 +birchwoodendoubleslab,125,2 +birchwoodendslab,125,2 +birchwooddoubleslab,125,2 +birchwooddslab,125,2 +birchwdoubleslab,125,2 +birchwdslab,125,2 +birchdoublewoodenplankslab,125,2 +birchdwoodenplankslab,125,2 +birchdoublewoodplankslab,125,2 +birchdwoodplankslab,125,2 +birchdoublewplankslab,125,2 +birchdwplankslab,125,2 +birchdoubleplankslab,125,2 +birchdplankslab,125,2 +birchdoublewoodenslab,125,2 +birchdwoodenslab,125,2 +birchdoublewoodslab,125,2 +birchdwoodslab,125,2 +birchdoublewslab,125,2 +birchdwslab,125,2 +birchdoubleslab,125,2 +birchdslab,125,2 +lightwoodenplankdoublehalfblock,125,2 +lightwoodenplankdhalfblock,125,2 +lightwoodplankdoublehalfblock,125,2 +lightwoodplankdhalfblock,125,2 +lightwplankdoublehalfblock,125,2 +lightwplankdhalfblock,125,2 +lightplankdoublehalfblock,125,2 +lightplankdhalfblock,125,2 +lightwoodendoublehalfblock,125,2 +lightwoodendhalfblock,125,2 +lightwooddoublehalfblock,125,2 +lightwooddhalfblock,125,2 +lightwdoublehalfblock,125,2 +lightwdhalfblock,125,2 +lightdoublewoodenplankhalfblock,125,2 +lightdwoodenplankhalfblock,125,2 +lightdoublewoodplankhalfblock,125,2 +lightdwoodplankhalfblock,125,2 +lightdoublewplankhalfblock,125,2 +lightdwplankhalfblock,125,2 +lightdoubleplankhalfblock,125,2 +lightdplankhalfblock,125,2 +lightdoublewoodenhalfblock,125,2 +lightdwoodenhalfblock,125,2 +lightdoublewoodhalfblock,125,2 +lightdwoodhalfblock,125,2 +lightdoublewhalfblock,125,2 +lightdwhalfblock,125,2 +lightdoublehalfblock,125,2 +lightdhalfblock,125,2 +lightwoodenplankdoublestep,125,2 +lightwoodenplankdstep,125,2 +lightwoodplankdoublestep,125,2 +lightwoodplankdstep,125,2 +lightwplankdoublestep,125,2 +lightwplankdstep,125,2 +lightplankdoublestep,125,2 +lightplankdstep,125,2 +lightwoodendoublestep,125,2 +lightwoodendstep,125,2 +lightwooddoublestep,125,2 +lightwooddstep,125,2 +lightwdoublestep,125,2 +lightwdstep,125,2 +lightdoublewoodenplankstep,125,2 +lightdwoodenplankstep,125,2 +lightdoublewoodplankstep,125,2 +lightdwoodplankstep,125,2 +lightdoublewplankstep,125,2 +lightdwplankstep,125,2 +lightdoubleplankstep,125,2 +lightdplankstep,125,2 +lightdoublewoodenstep,125,2 +lightdwoodenstep,125,2 +lightdoublewoodstep,125,2 +lightdwoodstep,125,2 +lightdoublewstep,125,2 +lightdwstep,125,2 +lightdoublestep,125,2 +lightdstep,125,2 +lightwoodenplankdoubleslab,125,2 +lightwoodenplankdslab,125,2 +lightwoodplankdoubleslab,125,2 +lightwoodplankdslab,125,2 +lightwplankdoubleslab,125,2 +lightwplankdslab,125,2 +lightplankdoubleslab,125,2 +lightplankdslab,125,2 +lightwoodendoubleslab,125,2 +lightwoodendslab,125,2 +lightwooddoubleslab,125,2 +lightwooddslab,125,2 +lightwdoubleslab,125,2 +lightwdslab,125,2 +lightdoublewoodenplankslab,125,2 +lightdwoodenplankslab,125,2 +lightdoublewoodplankslab,125,2 +lightdwoodplankslab,125,2 +lightdoublewplankslab,125,2 +lightdwplankslab,125,2 +lightdoubleplankslab,125,2 +lightdplankslab,125,2 +lightdoublewoodenslab,125,2 +lightdwoodenslab,125,2 +lightdoublewoodslab,125,2 +lightdwoodslab,125,2 +lightdoublewslab,125,2 +lightdwslab,125,2 +lightdoubleslab,125,2 +lightdslab,125,2 +junglewoodenplankdoublehalfblock,125,3 +junglewoodenplankdhalfblock,125,3 +junglewoodplankdoublehalfblock,125,3 +junglewoodplankdhalfblock,125,3 +junglewplankdoublehalfblock,125,3 +junglewplankdhalfblock,125,3 +jungleplankdoublehalfblock,125,3 +jungleplankdhalfblock,125,3 +junglewoodendoublehalfblock,125,3 +junglewoodendhalfblock,125,3 +junglewooddoublehalfblock,125,3 +junglewooddhalfblock,125,3 +junglewdoublehalfblock,125,3 +junglewdhalfblock,125,3 +jungledoublewoodenplankhalfblock,125,3 +jungledwoodenplankhalfblock,125,3 +jungledoublewoodplankhalfblock,125,3 +jungledwoodplankhalfblock,125,3 +jungledoublewplankhalfblock,125,3 +jungledwplankhalfblock,125,3 +jungledoubleplankhalfblock,125,3 +jungledplankhalfblock,125,3 +jungledoublewoodenhalfblock,125,3 +jungledwoodenhalfblock,125,3 +jungledoublewoodhalfblock,125,3 +jungledwoodhalfblock,125,3 +jungledoublewhalfblock,125,3 +jungledwhalfblock,125,3 +jungledoublehalfblock,125,3 +jungledhalfblock,125,3 +junglewoodenplankdoublestep,125,3 +junglewoodenplankdstep,125,3 +junglewoodplankdoublestep,125,3 +junglewoodplankdstep,125,3 +junglewplankdoublestep,125,3 +junglewplankdstep,125,3 +jungleplankdoublestep,125,3 +jungleplankdstep,125,3 +junglewoodendoublestep,125,3 +junglewoodendstep,125,3 +junglewooddoublestep,125,3 +junglewooddstep,125,3 +junglewdoublestep,125,3 +junglewdstep,125,3 +jungledoublewoodenplankstep,125,3 +jungledwoodenplankstep,125,3 +jungledoublewoodplankstep,125,3 +jungledwoodplankstep,125,3 +jungledoublewplankstep,125,3 +jungledwplankstep,125,3 +jungledoubleplankstep,125,3 +jungledplankstep,125,3 +jungledoublewoodenstep,125,3 +jungledwoodenstep,125,3 +jungledoublewoodstep,125,3 +jungledwoodstep,125,3 +jungledoublewstep,125,3 +jungledwstep,125,3 +jungledoublestep,125,3 +jungledstep,125,3 +junglewoodenplankdoubleslab,125,3 +junglewoodenplankdslab,125,3 +junglewoodplankdoubleslab,125,3 +junglewoodplankdslab,125,3 +junglewplankdoubleslab,125,3 +junglewplankdslab,125,3 +jungleplankdoubleslab,125,3 +jungleplankdslab,125,3 +junglewoodendoubleslab,125,3 +junglewoodendslab,125,3 +junglewooddoubleslab,125,3 +junglewooddslab,125,3 +junglewdoubleslab,125,3 +junglewdslab,125,3 +jungledoublewoodenplankslab,125,3 +jungledwoodenplankslab,125,3 +jungledoublewoodplankslab,125,3 +jungledwoodplankslab,125,3 +jungledoublewplankslab,125,3 +jungledwplankslab,125,3 +jungledoubleplankslab,125,3 +jungledplankslab,125,3 +jungledoublewoodenslab,125,3 +jungledwoodenslab,125,3 +jungledoublewoodslab,125,3 +jungledwoodslab,125,3 +jungledoublewslab,125,3 +jungledwslab,125,3 +jungledoubleslab,125,3 +jungledslab,125,3 +forestwoodenplankdoublehalfblock,125,3 +forestwoodenplankdhalfblock,125,3 +forestwoodplankdoublehalfblock,125,3 +forestwoodplankdhalfblock,125,3 +forestwplankdoublehalfblock,125,3 +forestwplankdhalfblock,125,3 +forestplankdoublehalfblock,125,3 +forestplankdhalfblock,125,3 +forestwoodendoublehalfblock,125,3 +forestwoodendhalfblock,125,3 +forestwooddoublehalfblock,125,3 +forestwooddhalfblock,125,3 +forestwdoublehalfblock,125,3 +forestwdhalfblock,125,3 +forestdoublewoodenplankhalfblock,125,3 +forestdwoodenplankhalfblock,125,3 +forestdoublewoodplankhalfblock,125,3 +forestdwoodplankhalfblock,125,3 +forestdoublewplankhalfblock,125,3 +forestdwplankhalfblock,125,3 +forestdoubleplankhalfblock,125,3 +forestdplankhalfblock,125,3 +forestdoublewoodenhalfblock,125,3 +forestdwoodenhalfblock,125,3 +forestdoublewoodhalfblock,125,3 +forestdwoodhalfblock,125,3 +forestdoublewhalfblock,125,3 +forestdwhalfblock,125,3 +forestdoublehalfblock,125,3 +forestdhalfblock,125,3 +forestwoodenplankdoublestep,125,3 +forestwoodenplankdstep,125,3 +forestwoodplankdoublestep,125,3 +forestwoodplankdstep,125,3 +forestwplankdoublestep,125,3 +forestwplankdstep,125,3 +forestplankdoublestep,125,3 +forestplankdstep,125,3 +forestwoodendoublestep,125,3 +forestwoodendstep,125,3 +forestwooddoublestep,125,3 +forestwooddstep,125,3 +forestwdoublestep,125,3 +forestwdstep,125,3 +forestdoublewoodenplankstep,125,3 +forestdwoodenplankstep,125,3 +forestdoublewoodplankstep,125,3 +forestdwoodplankstep,125,3 +forestdoublewplankstep,125,3 +forestdwplankstep,125,3 +forestdoubleplankstep,125,3 +forestdplankstep,125,3 +forestdoublewoodenstep,125,3 +forestdwoodenstep,125,3 +forestdoublewoodstep,125,3 +forestdwoodstep,125,3 +forestdoublewstep,125,3 +forestdwstep,125,3 +forestdoublestep,125,3 +forestdstep,125,3 +forestwoodenplankdoubleslab,125,3 +forestwoodenplankdslab,125,3 +forestwoodplankdoubleslab,125,3 +forestwoodplankdslab,125,3 +forestwplankdoubleslab,125,3 +forestwplankdslab,125,3 +forestplankdoubleslab,125,3 +forestplankdslab,125,3 +forestwoodendoubleslab,125,3 +forestwoodendslab,125,3 +forestwooddoubleslab,125,3 +forestwooddslab,125,3 +forestwdoubleslab,125,3 +forestwdslab,125,3 +forestdoublewoodenplankslab,125,3 +forestdwoodenplankslab,125,3 +forestdoublewoodplankslab,125,3 +forestdwoodplankslab,125,3 +forestdoublewplankslab,125,3 +forestdwplankslab,125,3 +forestdoubleplankslab,125,3 +forestdplankslab,125,3 +forestdoublewoodenslab,125,3 +forestdwoodenslab,125,3 +forestdoublewoodslab,125,3 +forestdwoodslab,125,3 +forestdoublewslab,125,3 +forestdwslab,125,3 +forestdoubleslab,125,3 +forestdslab,125,3 +woodenplankstep,126,0 +woodplankstep,126,0 +wplankstep,126,0 +plankstep,126,0 +woodenstep,126,0 +woodstep,126,0 +wstep,126,0 +woodenplankslab,126,0 +woodplankslab,126,0 +wplankslab,126,0 +plankslab,126,0 +woodenslab,126,0 +woodslab,126,0 +wslab,126,0 +woodenplankhalfblock,126,0 +woodplankhalfblock,126,0 +wplankhalfblock,126,0 +plankhalfblock,126,0 +woodenhalfblock,126,0 +woodhalfblock,126,0 +whalfblock,126,0 +oakwoodenplankstep,126,0 +oakwoodplankstep,126,0 +oakwplankstep,126,0 +oakplankstep,126,0 +oakwoodenstep,126,0 +oakwoodstep,126,0 +oakwstep,126,0 +oakstep,126,0 +oakwoodenplankslab,126,0 +oakwoodplankslab,126,0 +oakwplankslab,126,0 +oakplankslab,126,0 +oakwoodenslab,126,0 +oakwoodslab,126,0 +oakwslab,126,0 +oakslab,126,0 +oakwoodenplankhalfblock,126,0 +oakwoodplankhalfblock,126,0 +oakwplankhalfblock,126,0 +oakplankhalfblock,126,0 +oakwoodenhalfblock,126,0 +oakwoodhalfblock,126,0 +oakwhalfblock,126,0 +oakhalfblock,126,0 +sprucewoodenplankstep,126,1 +sprucewoodplankstep,126,1 +sprucewplankstep,126,1 +spruceplankstep,126,1 +sprucewoodenstep,126,1 +sprucewoodstep,126,1 +sprucewstep,126,1 +sprucestep,126,1 +sprucewoodenplankslab,126,1 +sprucewoodplankslab,126,1 +sprucewplankslab,126,1 +spruceplankslab,126,1 +sprucewoodenslab,126,1 +sprucewoodslab,126,1 +sprucewslab,126,1 +spruceslab,126,1 +sprucewoodenplankhalfblock,126,1 +sprucewoodplankhalfblock,126,1 +sprucewplankhalfblock,126,1 +spruceplankhalfblock,126,1 +sprucewoodenhalfblock,126,1 +sprucewoodhalfblock,126,1 +sprucewhalfblock,126,1 +sprucehalfblock,126,1 +darkwoodenplankstep,126,1 +darkwoodplankstep,126,1 +darkwplankstep,126,1 +darkplankstep,126,1 +darkwoodenstep,126,1 +darkwoodstep,126,1 +darkwstep,126,1 +darkstep,126,1 +darkwoodenplankslab,126,1 +darkwoodplankslab,126,1 +darkwplankslab,126,1 +darkplankslab,126,1 +darkwoodenslab,126,1 +darkwoodslab,126,1 +darkwslab,126,1 +darkslab,126,1 +darkwoodenplankhalfblock,126,1 +darkwoodplankhalfblock,126,1 +darkwplankhalfblock,126,1 +darkplankhalfblock,126,1 +darkwoodenhalfblock,126,1 +darkwoodhalfblock,126,1 +darkwhalfblock,126,1 +darkhalfblock,126,1 +birchwoodenplankstep,126,2 +birchwoodplankstep,126,2 +birchwplankstep,126,2 +birchplankstep,126,2 +birchwoodenstep,126,2 +birchwoodstep,126,2 +birchwstep,126,2 +birchstep,126,2 +birchwoodenplankslab,126,2 +birchwoodplankslab,126,2 +birchwplankslab,126,2 +birchplankslab,126,2 +birchwoodenslab,126,2 +birchwoodslab,126,2 +birchwslab,126,2 +birchslab,126,2 +birchwoodenplankhalfblock,126,2 +birchwoodplankhalfblock,126,2 +birchwplankhalfblock,126,2 +birchplankhalfblock,126,2 +birchwoodenhalfblock,126,2 +birchwoodhalfblock,126,2 +birchwhalfblock,126,2 +birchhalfblock,126,2 +lightwoodenplankstep,126,2 +lightwoodplankstep,126,2 +lightwplankstep,126,2 +lightplankstep,126,2 +lightwoodenstep,126,2 +lightwoodstep,126,2 +lightwstep,126,2 +lightstep,126,2 +lightwoodenplankslab,126,2 +lightwoodplankslab,126,2 +lightwplankslab,126,2 +lightplankslab,126,2 +lightwoodenslab,126,2 +lightwoodslab,126,2 +lightwslab,126,2 +lightslab,126,2 +lightwoodenplankhalfblock,126,2 +lightwoodplankhalfblock,126,2 +lightwplankhalfblock,126,2 +lightplankhalfblock,126,2 +lightwoodenhalfblock,126,2 +lightwoodhalfblock,126,2 +lightwhalfblock,126,2 +lighthalfblock,126,2 +junglewoodenplankstep,126,3 +junglewoodplankstep,126,3 +junglewplankstep,126,3 +jungleplankstep,126,3 +junglewoodenstep,126,3 +junglewoodstep,126,3 +junglewstep,126,3 +junglestep,126,3 +junglewoodenplankslab,126,3 +junglewoodplankslab,126,3 +junglewplankslab,126,3 +jungleplankslab,126,3 +junglewoodenslab,126,3 +junglewoodslab,126,3 +junglewslab,126,3 +jungleslab,126,3 +junglewoodenplankhalfblock,126,3 +junglewoodplankhalfblock,126,3 +junglewplankhalfblock,126,3 +jungleplankhalfblock,126,3 +junglewoodenhalfblock,126,3 +junglewoodhalfblock,126,3 +junglewhalfblock,126,3 +junglehalfblock,126,3 +forestwoodenplankstep,126,3 +forestwoodplankstep,126,3 +forestwplankstep,126,3 +forestplankstep,126,3 +forestwoodenstep,126,3 +forestwoodstep,126,3 +forestwstep,126,3 +foreststep,126,3 +forestwoodenplankslab,126,3 +forestwoodplankslab,126,3 +forestwplankslab,126,3 +forestplankslab,126,3 +forestwoodenslab,126,3 +forestwoodslab,126,3 +forestwslab,126,3 +forestslab,126,3 +forestwoodenplankhalfblock,126,3 +forestwoodplankhalfblock,126,3 +forestwplankhalfblock,126,3 +forestplankhalfblock,126,3 +forestwoodenhalfblock,126,3 +forestwoodhalfblock,126,3 +forestwhalfblock,126,3 +foresthalfblock,126,3 +cocoaplant,127,0 +cocoplant,127,0 +cplant,127,0 +cocoafruit,127,0 +cocofruit,127,0 +cfruit,127,0 +cocoapod,127,0 +cocopod,127,0 +cpod,127,0 +sandstairs,128,0 +sandstonestairs,128,0 +sandsstairs,128,0 +sstonestairs,128,0 +ssstairs,128,0 +sandstair,128,0 +sandstonestair,128,0 +sandsstair,128,0 +sstonestair,128,0 +ssstair,128,0 +emeraldore,129,0 +eore,129,0 +oreemerald,129,0 +oree,129,0 +enderchest,130,0 +endchest,130,0 +echest,130,0 +chestender,130,0 +chestend,130,0 +cheste,130,0 +endercontainer,130,0 +endcontainer,130,0 +econtainer,130,0 +tripwirehook,131,0 +tripwire,131,0 +trip,131,0 +tripwirelever,131,0 +triphook,131,0 +tripwireblock,132,0 +tripblock,132,0 +blocktrip,132,0 +blocktripwire,132,0 +emeraldblock,133,0 +blockemerald,133,0 +eblock,133,0 +blocke,133,0 +sprucewoodenplankstairs,134,0 +sprucewoodplankstairs,134,0 +sprucewplankstairs,134,0 +spruceplankstairs,134,0 +sprucewoodenstairs,134,0 +sprucewoodstairs,134,0 +sprucewstairs,134,0 +sprucestairs,134,0 +darkwoodenplankstairs,134,0 +darkwoodplankstairs,134,0 +darkwplankstairs,134,0 +darkplankstairs,134,0 +darkwoodenstairs,134,0 +darkwoodstairs,134,0 +darkwstairs,134,0 +darkstairs,134,0 +sprucewoodenplankstair,134,0 +sprucewoodplankstair,134,0 +sprucewplankstair,134,0 +spruceplankstair,134,0 +sprucewoodenstair,134,0 +sprucewoodstair,134,0 +sprucewstair,134,0 +sprucestair,134,0 +darkwoodenplankstair,134,0 +darkwoodplankstair,134,0 +darkwplankstair,134,0 +darkplankstair,134,0 +darkwoodenstair,134,0 +darkwoodstair,134,0 +darkwstair,134,0 +darkstair,134,0 +birchwoodenplankstairs,135,0 +birchwoodplankstairs,135,0 +birchwplankstairs,135,0 +birchplankstairs,135,0 +birchwoodenstairs,135,0 +birchwoodstairs,135,0 +birchwstairs,135,0 +birchstairs,135,0 +lightwoodenplankstairs,135,0 +lightwoodplankstairs,135,0 +lightwplankstairs,135,0 +lightplankstairs,135,0 +lightwoodenstairs,135,0 +lightwoodstairs,135,0 +lightwstairs,135,0 +lightstairs,135,0 +birchwoodenplankstair,135,0 +birchwoodplankstair,135,0 +birchwplankstair,135,0 +birchplankstair,135,0 +birchwoodenstair,135,0 +birchwoodstair,135,0 +birchwstair,135,0 +birchstair,135,0 +lightwoodenplankstair,135,0 +lightwoodplankstair,135,0 +lightwplankstair,135,0 +lightplankstair,135,0 +lightwoodenstair,135,0 +lightwoodstair,135,0 +lightwstair,135,0 +lightstair,135,0 +junglewoodenplankstairs,136,0 +junglewoodplankstairs,136,0 +junglewplankstairs,136,0 +jungleplankstairs,136,0 +junglewoodenstairs,136,0 +junglewoodstairs,136,0 +junglewstairs,136,0 +junglestairs,136,0 +forestwoodenplankstairs,136,0 +forestwoodplankstairs,136,0 +forestwplankstairs,136,0 +forestplankstairs,136,0 +forestwoodenstairs,136,0 +forestwoodstairs,136,0 +forestwstairs,136,0 +foreststairs,136,0 +junglewoodenplankstair,136,0 +junglewoodplankstair,136,0 +junglewplankstair,136,0 +jungleplankstair,136,0 +junglewoodenstair,136,0 +junglewoodstair,136,0 +junglewstair,136,0 +junglestair,136,0 +forestwoodenplankstair,136,0 +forestwoodplankstair,136,0 +forestwplankstair,136,0 +forestplankstair,136,0 +forestwoodenstair,136,0 +forestwoodstair,136,0 +forestwstair,136,0 +foreststair,136,0 +commandblock,137,0 +blockcommand,137,0 +cmdblock,137,0 +blockcmd,137,0 +macroblock,137,0 +blockmacro,137,0 +beacon,138,0 +beaconblock,138,0 +cobblestonewall,139,0 +cstonewall,139,0 +cobblewall,139,0 +cobblestonefence,139,0 +cstonefence,139,0 +cobblefence,139,0 +mosscobblestonewall,139,1 +mosscstonewall,139,1 +mosscobblewall,139,1 +mcobblestonewall,139,1 +mcstonewall,139,1 +mcobblewall,139,1 +mosscobblestonefence,139,1 +mosscstonefence,139,1 +mosscobblefence,139,1 +mcobblestonefence,139,1 +mcstonefence,139,1 +mcobblefence,139,1 +emptyflowerpot,140,0 +emptypot,140,0 +flowerpotblock,140,0 +potblock,140,0 +roseflowerpot,140,1 +rosepot,140,1 +dandelionflowerpot,140,2 +dandelionpot,140,2 +oaksaplingflowerpot,140,3 +saplingflowerpot,140,3 +oakflowerpot,140,3 +oaksaplingpot,140,3 +saplingpot,140,3 +oakpot,140,3 +sprucesaplingflowerpot,140,4 +spruceflowerpot,140,4 +darksaplingflowerpot,140,4 +darkflowerpot,140,4 +pinesaplingflowerpot,140,4 +pineflowerpot,140,4 +sprucesaplingpot,140,4 +sprucepot,140,4 +darksaplingpot,140,4 +darkpot,140,4 +pinesaplingpot,140,4 +pinepot,140,4 +birchsaplingflowerpot,140,5 +birchflowerpot,140,5 +lightsaplingflowerpot,140,5 +lightflowerpot,140,5 +whitesaplingflowerpot,140,5 +whiteflowerpot,140,5 +birchsaplingpot,140,5 +birchpot,140,5 +lightsaplingpot,140,5 +lightpot,140,5 +whitesaplingpot,140,5 +whitepot,140,5 +forestsaplingflowerpot,140,6 +forestflowerpot,140,6 +junglesaplingflowerpot,140,6 +jungleflowerpot,140,6 +forestsaplingpot,140,6 +forestpot,140,6 +junglesaplingpot,140,6 +junglepot,140,6 +redmushroomflowerpot,140,7 +redshroomflowerpot,140,7 +redmushflowerpot,140,7 +rmushroomflowerpot,140,7 +rshroomflowerpot,140,7 +rmushflowerpot,140,7 +redmushroompot,140,7 +redshroompot,140,7 +redmushpot,140,7 +rmushroompot,140,7 +rshroompot,140,7 +rmushpot,140,7 +brownmushroomflowerpot,140,8 +brownshroomflowerpot,140,8 +brownmushflowerpot,140,8 +bmushroomflowerpot,140,8 +bshroomflowerpot,140,7 +bmushflowerpot,140,8 +brownmushroompot,140,8 +brownshroompot,140,8 +brownmushpot,140,8 +bmushroompot,140,8 +bshroompot,140,8 +bmushpot,140,8 +cactusflowerpot,140,9 +cactuspot,140,9 +deadbushflowerpot,140,10 +dbushflowerpot,140,10 +deadsaplingflowerpot,140,10 +dsaplingflowerpot,140,10 +deadshrubflowerpot,140,10 +dshrubflowerpot,140,10 +deadbushpot,140,10 +dbushpot,140,10 +deadsaplingpot,140,10 +dsaplingpot,140,10 +deadshrubpot,140,10 +dshrubpot,140,10 +fernflowerpot,140,11 +bushflowerpot,140,11 +fernpot,140,11 +bushpot,140,11 +carrots,141,0 +plantedcarrot,141,0 +plantcarrot,141,0 +growingcarrot,141,0 +potatoes,142,0 +plantedpotato,142,0 +plantpotato,142,0 +growingpotato,142,0 +woodenplankbutton,143,0 +woodplankbutton,143,0 +wplankbutton,143,0 +plankbutton,143,0 +woodenbutton,143,0 +woodbutton,143,0 +wbutton,143,0 +headblock,144,0 +anvil,145,0 +slightlydamagedanvil,145,1 +slightdamageanvil,145,1 +damagedanvil,145,1 +verydamagedanvil,145,2 +ironshovel,256,0 +ironspade,256,0 +ishovel,256,0 +ispade,256,0 +steelshovel,256,0 +steelspade,256,0 +ironpickaxe,257,0 +ironpick,257,0 +steelpickaxe,257,0 +steelpick,257,0 +ipickaxe,257,0 +ipick,257,0 +ironaxe,258,0 +iaxe,258,0 +steelaxe,258,0 +flintandsteel,259,0 +flintandiron,259,0 +flintandtinder,259,0 +flintnsteel,259,0 +flintniron,259,0 +flintntinder,259,0 +flintsteel,259,0 +flintiron,259,0 +flinttinder,259,0 +lighter,259,0 +apple,260,0 +normalapple,260,0 +redapple,260,0 +bow,261,0 +arrow,262,0 +coal,263,0 +charcoal,263,1 +ccoal,263,1 +diamond,264,0 +crystal,264,0 +ironingot,265,0 +ironbar,265,0 +ironi,265,0 +steelingot,265,0 +steelbar,265,0 +steeli,265,0 +iingot,265,0 +ibar,265,0 +ingotiron,265,0 +bariron,265,0 +iiron,265,0 +ingotsteel,265,0 +barsteel,265,0 +isteel,265,0 +ingoti,265,0 +bari,265,0 +goldingot,266,0 +goldbar,266,0 +goldi,266,0 +gingot,266,0 +gbar,266,0 +ingotgold,266,0 +bargold,266,0 +igold,266,0 +ingotg,266,0 +barg,266,0 +ironsword,267,0 +steelsword,267,0 +isword,267,0 +woodensword,268,0 +woodsword,268,0 +wsword,268,0 +woodenshovel,269,0 +woodenspade,269,0 +woodshovel,269,0 +woodspade,269,0 +wshovel,269,0 +wspade,269,0 +woodenpickaxe,270,0 +woodenpick,270,0 +woodpickaxe,270,0 +woodpick,270,0 +wpickaxe,270,0 +wpick,270,0 +woodenaxe,271,0 +woodaxe,271,0 +waxe,271,0 +smoothstonesword,272,0 +cobblestonesword,272,0 +sstonesword,272,0 +cstonesword,272,0 +stonesword,272,0 +sssword,272,0 +cssword,272,0 +ssword,272,0 +smoothstoneshovel,273,0 +smoothstonespade,273,0 +cobblestoneshovel,273,0 +cobblestonespade,273,0 +sstoneshovel,273,0 +sstonespade,273,0 +cstoneshovel,273,0 +cstonespade,273,0 +stoneshovel,273,0 +stonespade,273,0 +ssshovel,273,0 +csshovel,273,0 +ssspade,273,0 +csspade,273,0 +sshovel,273,0 +sspade,273,0 +smoothstonepickaxe,274,0 +cobblestonepickaxe,274,0 +smoothstonepick,274,0 +cobblestonepick,274,0 +sstonepickaxe,274,0 +sstonepick,274,0 +cstonepickaxe,274,0 +cstonepick,274,0 +stonepickaxe,274,0 +stonepick,274,0 +sspickaxe,274,0 +sspick,274,0 +cspickaxe,274,0 +cspick,274,0 +spickaxe,274,0 +spick,274,0 +smoothstoneaxe,275,0 +cobblestoneaxe,275,0 +sstoneaxe,275,0 +cstoneaxe,275,0 +stoneaxe,275,0 +ssaxe,275,0 +csaxe,275,0 +saxe,275,0 +diamondsword,276,0 +crystalsword,276,0 +dsword,276,0 +diamondshovel,277,0 +diamondspade,277,0 +crystalshovel,277,0 +crystalspade,277,0 +dshovel,277,0 +dspade,277,0 +diamondpickaxe,278,0 +diamondpick,278,0 +crystalpickaxe,278,0 +crystalpick,278,0 +dpickaxe,278,0 +dpick,278,0 +diamondaxe,279,0 +crystalaxe,279,0 +daxe,279,0 +stick,280,0 +twig,280,0 +branch,280,0 +bowl,281,0 +mushroomsoup,282,0 +mrsoup,282,0 +soup,282,0 +goldsword,283,0 +gsword,283,0 +goldshovel,284,0 +goldspade,284,0 +gshovel,284,0 +gspade,284,0 +goldpickaxe,285,0 +goldpick,285,0 +gpickaxe,285,0 +gpick,285,0 +goldaxe,286,0 +gaxe,286,0 +string,287,0 +rope,287,0 +feather,288,0 +gunpowder,289,0 +sulfur,289,0 +woodenhoe,290,0 +woodhoe,290,0 +whoe,290,0 +smoothstonehoe,291,0 +cobblestonehoe,291,0 +sstonehoe,291,0 +cstonehoe,291,0 +stonehoe,291,0 +sshoe,291,0 +cshoe,291,0 +shoe,291,0 +ironhoe,292,0 +steelhoe,292,0 +ihoe,292,0 +diamondhoe,293,0 +crystalhoe,293,0 +dhoe,293,0 +goldhoe,294,0 +ghoe,294,0 +seeds,295,0 +seed,295,0 +wheat,296,0 +bread,297,0 +leatherhelmet,298,0 +leatherhelm,298,0 +leatherhat,298,0 +lhelmet,298,0 +lhelm,298,0 +lhat,298,0 +leatherchestplate,299,0 +leatherplatebody,299,0 +leatherplate,299,0 +leathershirt,299,0 +lchestplate,299,0 +lplatebody,299,0 +lplate,299,0 +lshirt,299,0 +leatherleggings,300,0 +leatherlegs,300,0 +leatherpants,300,0 +lleggings,300,0 +llegs,300,0 +lpants,300,0 +leatherboots,301,0 +leathershoes,301,0 +lboots,301,0 +lshoes,301,0 +chainmailhelmet,302,0 +chainmailhelm,302,0 +chainmailhat,302,0 +chainmhelmet,302,0 +chainmhelm,302,0 +chainmhat,302,0 +cmailhelmet,302,0 +cmailhelm,302,0 +cmailhat,302,0 +chainhelmet,302,0 +chainhelm,302,0 +chainhat,302,0 +cmhelmet,302,0 +cmhelm,302,0 +cmhat,302,0 +chainmailchestplate,303,0 +chainmailplatebody,303,0 +chainmailplate,303,0 +chainmailshirt,303,0 +chainmchestplate,303,0 +chainmplatebody,303,0 +chainmplate,303,0 +chainmshirt,303,0 +cmailchestplate,303,0 +cmailplatebody,303,0 +cmailplate,303,0 +cmailshirt,303,0 +chainchestplate,303,0 +chainplatebody,303,0 +chainplate,303,0 +chainshirt,303,0 +cmchestplate,303,0 +cmplatebody,303,0 +cmplate,303,0 +cmshirt,303,0 +chainmailleggings,304,0 +chainmaillegs,304,0 +chainmailpants,304,0 +chainmleggings,304,0 +chainmlegs,304,0 +chainmpants,304,0 +cmailleggings,304,0 +cmaillegs,304,0 +cmailpants,304,0 +chainleggings,304,0 +chainlegs,304,0 +chainpants,304,0 +cmleggings,304,0 +cmlegs,304,0 +cmpants,304,0 +chainmailboots,305,0 +chainmailshoes,305,0 +chainmboots,305,0 +chainmshoes,305,0 +cmailboots,305,0 +cmailshoes,305,0 +chainboots,305,0 +chainshoes,305,0 +cmboots,305,0 +cmshoes,305,0 +ironhelmet,306,0 +ironhelm,306,0 +ironhat,306,0 +ihelmet,306,0 +ihelm,306,0 +ihat,306,0 +steelhelmet,306,0 +steelhelm,306,0 +steelhat,306,0 +shelmet,306,0 +shelm,306,0 +shat,306,0 +ironchestplate,307,0 +ironplatebody,307,0 +ironplate,307,0 +ironshirt,307,0 +ichestplate,307,0 +iplatebody,307,0 +iplate,307,0 +ishirt,307,0 +steelchestplate,307,0 +steelplatebody,307,0 +steelplate,307,0 +steelshirt,307,0 +schestplate,307,0 +splatebody,307,0 +sshirt,307,0 +ironleggings,308,0 +ironlegs,308,0 +ironpants,308,0 +ileggings,308,0 +ilegs,308,0 +ipants,308,0 +steelleggings,308,0 +steellegs,308,0 +steelpants,308,0 +sleggings,308,0 +slegs,308,0 +spants,308,0 +ironboots,309,0 +ironshoes,309,0 +iboots,309,0 +ishoes,309,0 +steelboots,309,0 +steelshoes,309,0 +sboots,309,0 +sshoes,309,0 +diamondhelmet,310,0 +diamondhelm,310,0 +diamondhat,310,0 +dhelmet,310,0 +dhelm,310,0 +dhat,310,0 +crystalhelmet,310,0 +crystalhelm,310,0 +crystalhat,310,0 +chelmet,310,0 +chelm,310,0 +chat,310,0 +diamondchestplate,311,0 +diamondplatebody,311,0 +diamondplate,311,0 +diamondshirt,311,0 +dchestplate,311,0 +dplatebody,311,0 +dplate,311,0 +dshirt,311,0 +crystalchestplate,311,0 +crystalplatebody,311,0 +crystalplate,311,0 +crystalshirt,311,0 +cchestplate,311,0 +cplatebody,311,0 +cplate,311,0 +cshirt,311,0 +diamondleggings,312,0 +diamondlegs,312,0 +diamondpants,312,0 +dleggings,312,0 +dlegs,312,0 +dpants,312,0 +crystalleggings,312,0 +crystallegs,312,0 +crystalpants,312,0 +cleggings,312,0 +clegs,312,0 +cpants,312,0 +diamondboots,313,0 +diamondshoes,313,0 +dboots,313,0 +dshoes,313,0 +crystalboots,313,0 +crystalshoes,313,0 +cboots,313,0 +cshoes,313,0 +goldhelmet,314,0 +goldhelm,314,0 +goldhat,314,0 +ghelmet,314,0 +ghelm,314,0 +ghat,314,0 +goldchestplate,315,0 +goldplatebody,315,0 +goldplate,315,0 +goldshirt,315,0 +gchestplate,315,0 +gplatebody,315,0 +gplateplate,315,0 +gshirt,315,0 +goldleggings,316,0 +goldlegs,316,0 +goldpants,316,0 +gleggings,316,0 +glegs,316,0 +gpants,316,0 +goldboots,317,0 +goldshoes,317,0 +gboots,317,0 +gshoes,317,0 +flint,318,0 +pork,319,0 +porkchop,319,0 +rawpork,319,0 +rpork,319,0 +rawporkchop,319,0 +rporkchop,319,0 +grilledpork,320,0 +grillpork,320,0 +gpork,320,0 +cookedpork,320,0 +cookpork,320,0 +cpork,320,0 +grilledporkchop,320,0 +grillporkchop,320,0 +gporkchop,320,0 +cookedporkchop,320,0 +cookporkchop,320,0 +cporkchop,320,0 +bacon,320,0 +painting,321,0 +picture,321,0 +goldenapple,322,0 +goldapple,322,0 +gapple,322,0 +enchantedgoldenapple,322,1 +enchantedgoldapple,322,1 +enchantedgapple,322,1 +supergoldenapple,322,1 +supergoldapple,322,1 +supergapple,322,1 +magicalgoldenapple,322,1 +magicalgoldapple,322,1 +magicalgapple,322,1 +magicgoldenapple,322,1 +magicgoldapple,322,1 +magicgapple,322,1 +egoldenapple,322,1 +egoldapple,322,1 +egapple,322,1 +sgoldenapple,322,1 +sgoldapple,322,1 +sgapple,322,1 +mgoldenapple,322,1 +mgoldapple,322,1 +mgapple,322,1 +sign,323,0 +woodendoor,324,0 +wooddoor,324,0 +wdoor,324,0 +door,324,0 +bucket,325,0 +bukkit,325,0 +waterbucket,326,0 +waterbukkit,326,0 +wbucket,326,0 +wbukkit,326,0 +magmabucket,327,0 +magmabukkit,327,0 +lavabucket,327,0 +lavabukkit,327,0 +lbucket,327,0 +lbukkit,327,0 +minecart,328,0 +mcart,328,0 +cart,328,0 +saddle,329,0 +irondoor,330,0 +idoor,330,0 +steeldoor,330,0 +sdoor,330,0 +dooriron,330,0 +doori,330,0 +doorsteel,330,0 +doors,330,0 +redstonedust,331,0 +redstone,331,0 +rstonedust,331,0 +rstone,331,0 +redsdust,331,0 +reddust,331,0 +rsdust,331,0 +rdust,331,0 +snow,332,0 +snowball,332,0 +snball,332,0 +boat,333,0 +leather,334,0 +milkbucket,335,0 +milkbukkit,335,0 +mbucket,335,0 +mbukkit,335,0 +claybrick,336,0 +brick,336,0 +clayball,337,0 +cball,337,0 +clay,337,0 +reeds,338,0 +reed,338,0 +sugarcane,338,0 +scane,338,0 +bamboo,338,0 +paper,339,0 +papyrus,339,0 +book,340,0 +slimeball,341,0 +slball,341,0 +storageminecart,342,0 +chestminecart,342,0 +storagemcart,342,0 +chestmcart,342,0 +storagecart,342,0 +chestcart,342,0 +sminecart,342,0 +cminecart,342,0 +smcart,342,0 +cmcart,342,0 +scart,342,0 +ccart,342,0 +engineminecart,343,0 +poweredminecart,343,0 +powerminecart,343,0 +furnaceminecart,343,0 +enginemcart,343,0 +poweredmcart,343,0 +powermcart,343,0 +furnacemcart,343,0 +enginecart,343,0 +poweredcart,343,0 +powercart,343,0 +furnacecart,343,0 +eminecart,343,0 +pminecart,343,0 +fminecart,343,0 +emcart,343,0 +pmcart,343,0 +fmcart,343,0 +ecart,343,0 +pcart,343,0 +fcart,343,0 +egg,344,0 +compass,345,0 +fishingrod,346,0 +fishrod,346,0 +frod,346,0 +rod,346,0 +goldwatch,347,0 +goldclock,347,0 +gwatch,347,0 +gclock,347,0 +watch,347,0 +clock,347,0 +glowingstoneblockdust,348,0 +lightstoneblockdust,348,0 +glowstoneblockdust,348,0 +blockglowingstonedust,348,0 +blocklightstonedust,348,0 +blockglowstonedust,348,0 +glowingstonebdust,348,0 +lightstonebdust,348,0 +glowstonebdust,348,0 +bglowingstonedust,348,0 +blightstonedust,348,0 +bglowstonedust,348,0 +glowingstonedust,348,0 +lightstonedust,348,0 +glowstonedust,348,0 +glowingblockdust,348,0 +lightblockdust,348,0 +glowblockdust,348,0 +lbdust,348,0 +gbdust,348,0 +lsdust,348,0 +gsdust,348,0 +rawfish,349,0 +rafish,349,0 +fish,349,0 +cookedfish,350,0 +cookfish,350,0 +cfish,350,0 +grilledfish,350,0 +grillfish,350,0 +gfish,350,0 +roastedfish,350,0 +roastfish,350,0 +rofish,350,0 +dye,351,0 +inksack,351,0 +inksac,351,0 +isack,351,0 +isac,351,0 +sack,351,0 +sac,351,0 +blackinksack,351,0 +blackinksac,351,0 +blackisack,351,0 +blackisac,351,0 +blacksack,351,0 +blacksac,351,0 +inksackblack,351,0 +inksacblack,351,0 +isackblack,351,0 +isacclack,351,0 +sackblack,351,0 +sacblack,351,0 +blackinksackcolour,351,0 +blackinksaccolour,351,0 +blackisackcolour,351,0 +blackisaccolour,351,0 +blacksackcolour,351,0 +blacksaccolour,351,0 +inksackblackcolour,351,0 +inksacblackcolour,351,0 +isackblackcolour,351,0 +isacclackcolour,351,0 +sackblackcolour,351,0 +sacblackcolour,351,0 +blackinksackcolor,351,0 +blackinksaccolor,351,0 +blackisackcolor,351,0 +blackisaccolor,351,0 +blacksackcolor,351,0 +blacksaccolor,351,0 +inksackblackcolor,351,0 +inksacblackcolor,351,0 +isackblackcolor,351,0 +isacblackcolor,351,0 +sackblackcolor,351,0 +sacblackcolor,351,0 +blackinksackdye,351,0 +blackinksacdye,351,0 +blackisackdye,351,0 +blackisacdye,351,0 +blacksackdye,351,0 +blacksacdye,351,0 +inksackblackdye,351,0 +inksacblackdye,351,0 +isackblackdye,351,0 +isacclackdye,351,0 +sackblackdye,351,0 +sacblackdye,351,0 +blackcolor,351,0 +blackdye,351,0 +rosered,351,1 +roseredcolor,351,1 +roseredcolour,351,1 +rosereddye,351,1 +redrosecolor,351,1 +redrosecolour,351,1 +redrosedye,351,1 +redr,351,1 +redrcolor,351,1 +redrcolour,351,1 +redrdye,351,1 +redcolor,351,1 +redcolour,351,1 +reddye,351,1 +cactusgreen,351,2 +greencactus,351,2 +cactusgreencolour,351,2 +greencactuscolour,351,2 +cactusgreencolor,351,2 +greencactuscolor,351,2 +cactusgreendye,351,2 +greencactusdye,351,2 +greencolour,351,2 +greencolor,351,2 +greendye,351,2 +cocoabeans,351,3 +cocoabean,351,3 +cocobeans,351,3 +cocobean,351,3 +cbeans,351,3 +cbean,351,3 +beans,351,3 +bean,351,3 +browncocoabeans,351,3 +browncocoabean,351,3 +browncocobeans,351,3 +browncocobean,351,3 +browncbeans,351,3 +browncbean,351,3 +brownbeans,351,3 +brownbean,351,3 +brownb,351,3 +cocoabeanscolour,351,3 +cocoabeancolour,351,3 +cocobeanscolour,351,3 +cocobeancolour,351,3 +cbeanscolour,351,3 +cbeancolour,351,3 +beanscolour,351,3 +beancolour,351,3 +browncocoabeanscolour,351,3 +browncocoabeancolour,351,3 +browncocobeanscolour,351,3 +browncocobeancolour,351,3 +browncbeanscolour,351,3 +browncbeancolour,351,3 +brownbeanscolour,351,3 +brownbeancolour,351,3 +brownbcolour,351,3 +cocoabeanscolor,351,3 +cocoabeancolor,351,3 +cocobeanscolor,351,3 +cocobeancolor,351,3 +cbeanscolor,351,3 +cbeancolor,351,3 +beanscolor,351,3 +beancolor,351,3 +browncocoabeanscolor,351,3 +browncocoabeancolor,351,3 +browncocobeanscolor,351,3 +browncocobeancolor,351,3 +browncbeanscolor,351,3 +browncbeancolor,351,3 +brownbeanscolor,351,3 +brownbeancolor,351,3 +brownbcolor,351,3 +cocoabeansdye,351,3 +cocoabeandye,351,3 +cocobeansdye,351,3 +cocobeandye,351,3 +cbeansdye,351,3 +cbeandye,351,3 +beansdye,351,3 +beandye,351,3 +browncocoabeansdye,351,3 +browncocoabeandye,351,3 +browncocobeansdye,351,3 +browncocobeandye,351,3 +browncbeansdye,351,3 +browncbeandye,351,3 +brownbeansdye,351,3 +brownbeandye,351,3 +brownbdye,351,3 +browncolour,351,3 +browncolor,351,3 +browndye,351,3 +bluelapislzuli,351,4 +bluelapisl,351,4 +bluelapis,351,4 +bluel,351,4 +lapislazuliblue,351,4 +lapislblue,351,4 +lapisblue,351,4 +lapislazuli,351,4 +lapisl,351,4 +lapis,351,4 +bluelapislazulicolour,351,4 +bluelapislcolour,351,4 +bluelapiscolour,351,4 +lapislazulibluecolour,351,4 +lapislbluecolour,351,4 +lapisbluecolour,351,4 +lapislazulicolour,351,4 +lapislcolour,351,4 +lapiscolour,351,4 +bluelapislazulicolor,351,4 +bluelapislcolor,351,4 +bluelapiscolor,351,4 +lapislazulibluecolor,351,4 +lapislbluecolor,351,4 +lapisbluecolor,351,4 +lapislazulicolor,351,4 +lapislcolor,351,4 +lapiscolor,351,4 +bluelapislazulidye,351,4 +bluelapisldye,351,4 +bluelapisdye,351,4 +lapislazulibluedye,351,4 +lapislbluedye,351,4 +lapisbluedye,351,4 +lapislazulidye,351,4 +lapisldye,351,4 +lapisdye,351,4 +bluecolour,351,4 +bluecolor,351,4 +bluedye,351,4 +purplecolour,351,5 +purplecolor,351,5 +purpledye,351,5 +cyancolour,351,6 +cyancolor,351,6 +cyandye,351,6 +lightgraycolour,351,7 +lightgraycolor,351,7 +lightgraydye,351,7 +lgraycolour,351,7 +lgraycolor,351,7 +lgraydye,351,7 +graycolour,351,8 +graycolor,351,8 +graydye,351,8 +pinkcolour,351,9 +pinkcolor,351,9 +pinkdye,351,9 +limecolour,351,10 +limecolor,351,10 +limedye,351,10 +dandelionyellow,351,11 +dandelionyellowcolour,351,11 +dandelionyellowcolor,351,11 +dandelionyellowdye,351,11 +yellowdandelion,351,11 +yellowdandelioncolour,351,11 +yellowdandelioncolor,351,11 +yellowdandeliondye,351,11 +yellowd,351,11 +yellowdcolour,351,11 +yellowdcolor,351,11 +yellowddye,351,11 +dyellow,351,11 +dyellowcolour,351,11 +dyellowcolor,351,11 +dyellowdye,351,11 +yellowcolour,351,11 +yellowcolor,351,11 +yellowdye,351,11 +lightbluecolour,351,12 +lightbluecolor,351,12 +lightbluedye,351,12 +lbluecolour,351,12 +lbluecolor,351,12 +lbluedye,351,12 +magentacolour,351,13 +magentacolor,351,13 +magentadye,351,13 +orangecolour,351,14 +orangecolor,351,14 +orangedye,351,14 +whitebonemeal,351,15 +whitebonemealcolour,351,15 +whitebonemealcolor,351,15 +whitebonemealdye,351,15 +bonemealwhite,351,15 +bonemealwhitecolour,351,15 +bonemealwhitecolor,351,15 +bonemealwhitedye,351,15 +whitebonem,351,15 +whitebonemcolour,351,15 +whitebonemcolor,351,15 +whitebonemdye,351,15 +bonemwhite,351,15 +bonemwhitecolour,351,15 +bonemwhitecolor,351,15 +bonemwhitedye,351,15 +bonemeal,351,15 +bonemealcolour,351,15 +bonemealcolor,351,15 +bonemealdye,351,15 +bonem,351,15 +bonemcolour,351,15 +bonemcolor,351,15 +bonemdye,351,15 +whitecolour,351,15 +whitecolor,351,15 +whitedye,351,15 +bone,352,0 +sugar,353,0 +whitedust,353,0 +cake,354,0 +bed,355,0 +repeater,356,0 +repeat,356,0 +delayer,356,0 +delay,356,0 +dioder,356,0 +diode,356,0 +cookie,357,0 +chart,358,0 +map0,358,0 +map1,358,1 +map2,358,2 +map3,358,3 +map4,358,4 +map5,358,5 +map6,358,6 +map7,358,7 +map8,358,8 +map9,358,9 +map10,358,10 +map11,358,11 +map12,358,12 +map13,358,13 +map14,358,14 +map15,358,15 +shears,359,0 +shear,359,0 +sheers,359,0 +sheer,359,0 +woolcutters,359,0 +woolcutter,359,0 +cutterswool,359,0 +cutterwool,359,0 +melonslice,360,0 +mslice,360,0 +slicemelon,360,0 +watermelonslice,360,0 +greenmelonslice,360,0 +melongreenslice,360,0 +pumpkinseeds,361,0 +pseeds,361,0 +seedsp,361,0 +seedspumpkin,361,0 +pumpseeds,361,0 +seedspump,361,0 +melonseeds,362,0 +mseeds,362,0 +watermelonseeds,362,0 +greenmelonseeds,362,0 +gmelonseeds,362,0 +seedsmelon,362,0 +seedswatermelon,362,0 +rawbeef,363,0 +rawsteak,363,0 +uncookedbeef,363,0 +uncookedsteak,363,0 +cowmeat,363,0 +plainbeef,363,0 +beef,364,0 +steak,364,0 +cookedbeef,364,0 +grilledbeef,364,0 +cookedsteak,364,0 +grilledsteak,364,0 +cookedcowmeat,364,0 +rawchicken,365,0 +uncookedchicken,365,0 +plainchicken,365,0 +chickenplain,365,0 +chickenuncooked,365,0 +chickenraw,365,0 +cookedchicken,366,0 +grilledchicken,366,0 +toastedchicken,366,0 +gchicken,366,0 +bbqchicken,366,0 +friedchicken,366,0 +cchicken,366,0 +rottenflesh,367,0 +zombieflesh,367,0 +rottenmeat,367,0 +zombiemeat,367,0 +badflesh,367,0 +poisonflesh,367,0 +zombieremains,367,0 +enderpearl,368,0 +endpearl,368,0 +pearl,368,0 +epearl,368,0 +bluepearl,368,0 +endergem,368,0 +blazerod,369,0 +goldenrod,369,0 +goldrod,369,0 +blazestick,369,0 +goldstick,369,0 +brod,369,0 +grod,369,0 +bstick,369,0 +gstick,369,0 +ghasttear,370,0 +ghastdrop,370,0 +ghosttear,370,0 +ghostdrop,370,0 +gtear,370,0 +gdrop,370,0 +tear,370,0 +goldnugget,371,0 +gnugget,371,0 +goldball,371,0 +goldpebble,371,0 +gball,371,0 +gpebble,371,0 +pigzombienugget,371,0 +pigznugget,371,0 +pzombienugget,371,0 +pznugget,371,0 +pigzombieball,371,0 +pigzball,371,0 +pzombieball,371,0 +pzball,371,0 +pigzombiepebble,371,0 +pigzpebble,371,0 +pzombiepebble,371,0 +pzpebble,371,0 +netherstalk,372,0 +deathstalk,372,0 +hellstalk,372,0 +nstalk,372,0 +dstalk,372,0 +hstalk,372,0 +potion,373,0 +mixture,373,0 +potions,373,0 +waterbottle,373,0 +fullbottle,373,0 +watervase,373,0 +fullvase,373,0 +clearpotion,373,6 +clearpot,373,6 +clearextendedpotion,373,7 +clearexpotion,373,7 +clear2potion,373,7 +clearextendedpot,373,7 +clearexpot,373,7 +clear2pot,373,7 +diffusepotion,373,11 +diffusepot,373,11 +artlesspotion,373,13 +artlesspot,373,13 +thinpotion,373,14 +thinpot,373,14 +thinextendedpotion,373,15 +thinexpotion,373,15 +thin2potion,373,15 +thinextendedpot,373,15 +thinexpot,373,15 +thin2pot,373,15 +awkwardpotion,373,16 +awkwardpot,373,16 +bunglingpotion,373,22 +bunglingpot,373,22 +bunglingextendedpotion,373,23 +bunglingexpotion,373,23 +bungling2potion,373,23 +bunglingextendedpot,373,23 +bunglingexpot,373,23 +bungling2pot,373,23 +smoothpotion,373,27 +smoothpot,373,27 +suavepotion,373,29 +suavepot,373,29 +debonairpotion,373,30 +debonairpot,373,30 +debonairextendedpotion,373,31 +debonairexpotion,373,31 +debonair2potion,373,31 +debonairextendedpot,373,31 +debonairexpot,373,31 +debonair2pot,373,31 +thickpotion,373,32 +thickpot,373,32 +charmingpotion,373,38 +charmingpot,373,38 +charmingextendedpotion,373,39 +charmingexpotion,373,39 +charming2potion,373,39 +charmingextendedpot,373,39 +charmingexpot,373,39 +charming2pot,373,39 +refinedpotion,373,43 +refinedpot,373,43 +cordialpotion,373,45 +cordialpot,373,45 +sparklingpotion,373,46 +sparklingpot,373,46 +sparklingextendedpotion,373,47 +sparklingexpotion,373,47 +sparkling2potion,373,47 +sparklingextendedpot,373,47 +sparklingexpot,373,47 +sparkling2pot,373,47 +potentpotion,373,48 +potentpot,373,48 +rankpotion,373,54 +rankpot,373,54 +rankextendedpotion,373,55 +rankexpotion,373,55 +rank2potion,373,55 +rankextendedpot,373,55 +rankexpot,373,55 +rank2pot,373,55 +acridpotion,373,59 +acridpot,373,59 +grosspotion,373,61 +grosspot,373,61 +stinkypotion,373,62 +stinkypot,373,62 +stinkyextendedpotion,373,63 +stinkyexpotion,373,63 +stinky2potion,373,63 +stinkyextendedpot,373,63 +stinkyexpot,373,63 +stinky2pot,373,63 +mundaneextendedpotion,373,64 +mundaneexpotion,373,64 +mundane2potion,373,64 +mundaneextendedpot,373,64 +mundaneexpot,373,64 +mundane2pot,373,64 +mundanepotion,373,8192 +mundanepot,373,8192 +regenerationpotion,373,8193 +regeneratepotion,373,8193 +regenpotion,373,8193 +regenerationpot,373,8193 +regeneratepot,373,8193 +regenpot,373,8193 +rpot,373,8193 +swiftnesspotion,373,8194 +swiftpotion,373,8194 +speedpotion,373,8194 +swiftnesspot,373,8194 +swiftpot,373,8194 +speedpot,373,8194 +swpot,373,8194 +fireresistancepotion,373,8195 +fireresistpotion,373,8195 +firerespotion,373,8195 +fireresistancepot,373,8195 +fireresistpot,373,8195 +firerespot,373,8195 +fpot,373,8195 +posionpotion,373,8196 +acidpotion,373,8196 +posionpot,373,8196 +acidpot,373,8196 +ppot,373,8196 +healingpotion,373,8197 +healpotion,373,8197 +lifepotion,373,8197 +healingpot,373,8197 +healpot,373,8197 +lifepot,373,8197 +hpot,373,8197 +nightvisionpotion,373,8198 +nvisionpotion,373,8198 +nightvpotion,373,8198 +darkvisionpotion,373,8198 +dvisionpotion,373,8198 +darkvpotion,373,8198 +nightvisionpot,373,8198 +nvisionpot,373,8198 +nightvpot,373,8198 +darkvisionpot,373,8198 +dvisionpot,373,8198 +darkvpot,373,8198 +npot,373,8198 +weaknesspotion,373,8200 +weakpotion,373,8200 +weaknesspot,373,8200 +weakpot,373,8200 +wpot,373,8200 +strengthpotion,373,8201 +strongpotion,373,8201 +strpotion,373,8201 +strengthpot,373,8201 +strongpot,373,8201 +strpot,373,8201 +stpot,373,8201 +slownesspotion,373,8202 +slowpotion,373,8202 +slownesspot,373,8202 +slowpot,373,8202 +slpot,373,8202 +harmingpotion,373,8204 +damagepotion,373,8204 +dmgpotion,373,8204 +harmingpot,373,8204 +damagepot,373,8204 +dmgpot,373,8204 +dpot,373,8204 +invisibilitypotion,373,8206 +invisiblepotion,373,8206 +invpotion,373,8206 +invisibilitypot,373,8206 +invisiblepot,373,8206 +invpot,373,8206 +ipot,373,8206 +regenerationleveliipotion,373,8225 +regenerateleveliipotion,373,8225 +regenleveliipotion,373,8225 +regenerationlevel2potion,373,8225 +regeneratelevel2potion,373,8225 +regenlevel2potion,373,8225 +regenerationiipotion,373,8225 +regenerateiipotion,373,8225 +regeniipotion,373,8225 +regenerationleveliipot,373,8225 +regenerateleveliipot,373,8225 +regenleveliipot,373,8225 +regenerationlevel2pot,373,8225 +regeneratelevel2pot,373,8225 +regenlevel2pot,373,8225 +regenerationiipot,373,8225 +regenerateiipot,373,8225 +regeniipot,373,8225 +r2pot,373,8225 +swiftnessleveliipotion,373,8226 +swiftleveliipotion,373,8226 +speedleveliipotion,373,8226 +swiftnesslevel2potion,373,8226 +swiftlevel2potion,373,8226 +speedlevel2potion,373,8226 +swiftnessiipotion,373,8226 +swiftiipotion,373,8226 +speediipotion,373,8226 +swiftnessleveliipot,373,8226 +swiftleveliipot,373,8226 +speedleveliipot,373,8226 +swiftnesslevel2pot,373,8226 +swiftlevel2pot,373,8226 +speedlevel2pot,373,8226 +swiftnessiipot,373,8226 +swiftiipot,373,8226 +speediipot,373,8226 +sw2pot,373,8226 +posionleveliipotion,373,8228 +acidleveliipotion,373,8228 +posionlevel2potion,373,8228 +acidlevel2potion,373,8228 +posioniipotion,373,8228 +acidiipotion,373,8228 +posionleveliipot,373,8228 +acidleveliipot,373,8228 +posionlevel2pot,373,8228 +acidlevel2pot,373,8228 +posioniipot,373,8228 +acidiipot,373,8228 +p2pot,373,8228 +healingleveliipotion,373,8229 +healleveliipotion,373,8229 +healinglevel2potion,373,8229 +heallevel2potion,373,8229 +healingiipotion,373,8229 +healiipotion,373,8229 +healingleveliipot,373,8229 +healleveliipot,373,8229 +healinglevel2pot,373,8229 +heallevel2pot,373,8229 +healingiipot,373,8229 +healiipot,373,8229 +h2pot,373,8229 +strengthleveliipotion,373,8233 +strongleveliipotion,373,8233 +strleveliipotion,373,8233 +strengthlevel2potion,373,8233 +stronglevel2potion,373,8233 +strlevel2potion,373,8233 +strengthiipotion,373,8233 +strongiipotion,373,8233 +striipotion,373,8233 +strengthleveliipot,373,8233 +strongleveliipot,373,8233 +strleveliipot,373,8233 +strengthlevel2pot,373,8233 +stronglevel2pot,373,8233 +strlevel2pot,373,8233 +strengthiipot,373,8233 +strongiipot,373,8233 +striipot,373,8233 +st2pot,373,8233 +harmingleveliipotion,373,8236 +damageleveliipotion,373,8236 +dmgleveliipotion,373,8236 +harminglevel2potion,373,8236 +damagelevel2potion,373,8236 +dmglevel2potion,373,8236 +harmingiipotion,373,8236 +damageiipotion,373,8236 +dmgiipotion,373,8236 +harmingleveliipot,373,8236 +damageleveliipot,373,8236 +dmgleveliipot,373,8236 +harminglevel2pot,373,8236 +damagelevel2pot,373,8236 +dmglevel2pot,373,8236 +harmingiipot,373,8236 +damageiipot,373,8236 +dmgiipot,373,8236 +d2pot,373,8236 +regenerationextendedpotion,373,8257 +regenerateextendedpotion,373,8257 +regenextendepotion,373,8257 +regenerationexpotion,373,8257 +regenerateexpotion,373,8257 +regenexpotion,373,8257 +regenerationextendedpot,373,8257 +regenerateextendedpot,373,8257 +regenextendepot,373,8257 +regenerationexpot,373,8257 +regenerateexpot,373,8257 +regenexpot,373,8257 +repot,373,8257 +swiftnessextendedpotion,373,8258 +swiftextendedpotion,373,8258 +speedextendedpotion,373,8258 +swiftnessexpotion,373,8258 +swiftexpotion,373,8258 +speedexpotion,373,8258 +swiftnessextendedpot,373,8258 +swiftextendedpot,373,8258 +speedextendedpot,373,8258 +swiftnessexpot,373,8258 +swiftexpot,373,8258 +speedexpot,373,8258 +swepot,373,8258 +fireresistanceextendedpotion,373,8259 +fireresistextendedpotion,373,8259 +fireresextendedpotion,373,8259 +fireresistanceexpotion,373,8259 +fireresistexpotion,373,8259 +fireresexpotion,373,8259 +fireresistanceextendedpot,373,8259 +fireresistextendedpot,373,8259 +fireresextendedpot,373,8259 +fireresistanceexpot,373,8259 +fireresistexpot,373,8259 +fireresexpot,373,8259 +fepot,373,8259 +posionextendedpotion,373,8260 +acidextendedpotion,373,8260 +posionexpotion,373,8260 +acidexpotion,373,8260 +posionextendedpot,373,8260 +acidextendedpot,373,8260 +posionexpot,373,8260 +acidexpot,373,8260 +pepot,373,8260 +nightvisionextendedpotion,373,8262 +nvisionextendedpotion,373,8262 +nightvextendedpotion,373,8262 +darkvisionextendedpotion,373,8262 +dvisionextendedpotion,373,8262 +darkvextendedpotion,373,8262 +nightvisionexpotion,373,8262 +nvisionexpotion,373,8262 +nightvexpotion,373,8262 +darkvisionexpotion,373,8262 +dvisionexpotion,373,8262 +darkvexpotion,373,8262 +nightvisionextendedpot,373,8262 +nvisionextendedpot,373,8262 +nightvextendedpot,373,8262 +darkvisionextendedpot,373,8262 +dvisionextendedpot,373,8262 +darkvextendedpot,373,8262 +nightvisionexpot,373,8262 +nvisionexpot,373,8262 +nightvexpot,373,8262 +darkvisionexpot,373,8262 +dvisionexpot,373,8262 +darkvexpot,373,8262 +nepot,373,8262 +weaknessextendedpotion,373,8264 +weakextendedpotion,373,8264 +weaknessexpotion,373,8264 +weakexpotion,373,8264 +weaknessextendedpot,373,8264 +weakextendedpot,373,8264 +weaknessexpot,373,8264 +weakexpot,373,8264 +wepot,373,8264 +strengthextendedpotion,373,8265 +strongextendedpotion,373,8265 +strextendedpotion,373,8265 +strengthexpotion,373,8265 +strongexpotion,373,8265 +strexpotion,373,8265 +strengthextendedpot,373,8265 +strongextendedpot,373,8265 +strextendedpot,373,8265 +strengthexpot,373,8265 +strongexpot,373,8265 +strexpot,373,8265 +stepot,373,8265 +slownessextendedpotion,373,8266 +slowextenedpotion,373,8266 +slownessexpotion,373,8266 +slowexpotion,373,8266 +slownessextendedpot,373,8266 +slowextenedpot,373,8266 +slownessexpot,373,8266 +slowexpot,373,8266 +slepot,373,8266 +invisibilityextendedpotion,373,8270 +invisibleextendedpotion,373,8270 +invextendedpotion,373,8270 +invisibilityexpotion,373,8270 +invisibleexpotion,373,8270 +invexpotion,373,8270 +invisibilityextendedpot,373,8270 +invisibleextendedpot,373,8270 +invextendedpot,373,8270 +invisibilityexpot,373,8270 +invisibleexpot,373,8270 +invexpot,373,8270 +iepot,373,8270 +regenerationdualbitpotion,373,8289 +regeneratedualbitpotion,373,8289 +regendualbitpotion,373,8289 +regenerationdbpotion,373,8289 +regeneratedbpotion,373,8289 +regendbpotion,373,8289 +regenerationdualbitpot,373,8289 +regeneratedualbitpot,373,8289 +regendualbitpot,373,8289 +regenerationdbpot,373,8289 +regeneratedbpot,373,8289 +regendbpot,373,8289 +rdbpot,373,8289 +swiftnessdualbitpotion,373,8290 +swiftdualbitpotion,373,8290 +speeddualbitpotion,373,8290 +swiftnessdualbitpot,373,8290 +swiftdualbitpot,373,8290 +speeddualbitpot,373,8290 +swiftnessdbpotion,373,8290 +swiftdbpotion,373,8290 +speeddbpotion,373,8290 +swiftnessdbpot,373,8290 +swiftdbpot,373,8290 +speeddbpot,373,8290 +swdbpot,373,8290 +poisondualbitpotion,373,8292 +aciddualbitpotion,373,8292 +poisondualbitpot,373,8292 +aciddualbitpot,373,8292 +poisondbpotion,373,8292 +aciddbpotion,373,8292 +poisondbpot,373,8292 +aciddbpot,373,8292 +pdbpot,373,8292 +strengthdualbitpotion,373,8297 +strongdualbitpotion,373,8297 +strdualbitpotion,373,8297 +strengthdualbitpot,373,8297 +strongdualbitpot,373,8297 +strdualbitpot,373,8297 +strengthdbpotion,373,8297 +strongdbpotion,373,8297 +strdbpotion,373,8297 +strengthdbpot,373,8297 +strongdbpot,373,8297 +strdbpot,373,8297 +stdbpot,373,8297 +splashmundanepotion,373,16384 +splmundanepotion,373,16384 +splashregenerationpotion,373,16385 +splashregeneratepotion,373,16385 +splashregenpotion,373,16385 +splashregenerationpot,373,16385 +splashregeneratepot,373,16385 +splashregenpot,373,16385 +regenerationsplashpotion,373,16385 +regeneratesplashpotion,373,16385 +regensplashpotion,373,16385 +splregenerationpotion,373,16385 +splregeneratepotion,373,16385 +splregenpotion,373,16385 +splregenerationpot,373,16385 +splregeneratepot,373,16385 +splregenpot,373,16385 +sprpot,373,16385 +splashswiftnesspotion,373,16386 +splashswiftpotion,373,16386 +splashspeedpotion,373,16386 +splashswiftnesspot,373,16386 +splashswiftpot,373,16386 +splashspeedpot,373,16386 +splswiftnesspotion,373,16386 +splswiftpotion,373,16386 +splspeedpotion,373,16386 +splswiftnesspot,373,16386 +splswiftpot,373,16386 +splspeedpot,373,16386 +spswpot,373,16386 +splashfireresistancepotion,373,16387 +splashfireresistpotion,373,16387 +splashfirerespotion,373,16387 +splashfireresistancepot,373,16387 +splashfireresistpot,373,16387 +splashfirerespot,373,16387 +splfireresistancepotion,373,16387 +splfireresistpotion,373,16387 +splfirerespotion,373,16387 +splfireresistancepot,373,16387 +splfireresistpot,373,16387 +splfirerespot,373,16387 +spfpot,373,16387 +splashposionpotion,373,16388 +splashacidpotion,373,16388 +splashposionpot,373,16388 +splashacidpot,373,16388 +splposionpotion,373,16388 +splacidpotion,373,16388 +splposionpot,373,16388 +splacidpot,373,16388 +spppot,373,16388 +splashhealingpotion,373,16389 +splashhealpotion,373,16389 +splashlifepotion,373,16389 +splashhealingpot,373,16389 +splashhealpot,373,16389 +splashlifepot,373,16389 +splhealingpotion,373,16389 +splhealpotion,373,16389 +spllifepotion,373,16389 +splhealingpot,373,16389 +splhealpot,373,16389 +spllifepot,373,16389 +sphpot,373,16389 +splashclearpotion,373,16390 +splashclearpot,373,16390 +splclearpotion,373,16390 +splclearpot,373,16390 +splashnightvisionpotion,373,16390 +splashnvisionpotion,373,16390 +splashnightvpotion,373,16390 +splashdarkvisionpotion,373,16390 +splashdvisionpotion,373,16390 +splashdarkvpotion,373,16390 +splashnightvisionpot,373,16390 +splashnvisionpot,373,16390 +splashnightvpot,373,16390 +splashdarkvisionpot,373,16390 +splashdvisionpot,373,16390 +splashdarkvpot,373,16390 +splnightvisionpotion,373,16390 +splnvisionpotion,373,16390 +splnightvpotion,373,16390 +spldarkvisionpotion,373,16390 +spldvisionpotion,373,16390 +spldarkvpotion,373,16390 +splnightvisionpot,373,16390 +splnvisionpot,373,16390 +splnightvpot,373,16390 +spldarkvisionpot,373,16390 +spldvisionpot,373,16390 +spldarkvpot,373,16390 +spnpot,373,16390 +splashclearextendedpotion,373,16391 +splashclearexpotion,373,16391 +splashclear2potion,373,16391 +splashclearextendedpot,373,16391 +splashclearexpot,373,16391 +splashclear2pot,373,16391 +splclearextendedpotion,373,16391 +splclearexpotion,373,16391 +splclear2potion,373,16391 +splclearextendedpot,373,16391 +splclearexpot,373,16391 +splclear2pot,373,16391 +splashweaknesspotion,373,16392 +splashweakpotion,373,16392 +splashweaknesspot,373,16392 +splashweakpot,373,16392 +splweaknesspotion,373,16392 +splweakpotion,373,16392 +splweaknesspot,373,16392 +splweakpot,373,16392 +spwpot,373,16392 +splashstrengthpotion,373,16393 +splashstrongpotion,373,16393 +splashstrpotion,373,16393 +splashstrengthpot,373,16393 +splashstrongpot,373,16393 +splashstrpot,373,16393 +splstrengthpotion,373,16393 +splstrongpotion,373,16393 +splstrpotion,373,16393 +splstrengthpot,373,16393 +splstrongpot,373,16393 +splstrpot,373,16393 +spstpot,373,16393 +splashslownesspotion,373,16394 +splashslowpotion,373,16394 +splashslownesspot,373,16394 +splashslowpot,373,16394 +splslownesspotion,373,16394 +splslowpotion,373,16394 +splslownesspot,373,16394 +splslowpot,373,16394 +spslpot,373,16394 +splashdiffusepotion,373,16395 +splashdiffusepot,373,16395 +spldiffusepotion,373,16395 +spldiffusepot,373,16395 +splashharmingpotion,373,16396 +splashdamagepotion,373,16396 +splashdmgpotion,373,16396 +splashharmingpot,373,16396 +splashdamagepot,373,16396 +splashdmgpot,373,16396 +splharmingpotion,373,16396 +spldamagepotion,373,16396 +spldmgpotion,373,16396 +splharmingpot,373,16396 +spldamagepot,373,16396 +spldmgpot,373,16396 +spdpot,373,16396 +splashartlesspotion,373,16397 +splashartlesspot,373,16397 +splartlesspotion,373,16397 +splartlesspot,373,16397 +splashthinpotion,373,16398 +splashthinpot,373,16398 +splthinpotion,373,16398 +splthinpot,373,16398 +splashinvisibilitypotion,373,16398 +splashinvisiblepotion,373,16398 +splashinvpotion,373,16398 +splashinvisibilitypot,373,16398 +splashinvisiblepot,373,16398 +splashinvpot,373,16398 +splinvisibilitypotion,373,16398 +splinvisiblepotion,373,16398 +splinvpotion,373,16398 +splinvisibilitypot,373,16398 +splinvisiblepot,373,16398 +splinvpot,373,16398 +spipot,373,16398 +splashthinextendedpotion,373,16399 +splashthinexpotion,373,16399 +splashthin2potion,373,16399 +splashthinextendedpot,373,16399 +splashthinexpot,373,16399 +splashthin2pot,373,16399 +splthinextendedpotion,373,16399 +splthinexpotion,373,16399 +splthin2potion,373,16399 +splthinextendedpot,373,16399 +splthinexpot,373,16399 +splthin2pot,373,16399 +splashawkwardpotion,373,16400 +splashawkwardpot,373,16400 +splawkwardpotion,373,16400 +splawkwardpot,373,16400 +splashbunglingpotion,373,16406 +splashbunglingpot,373,16406 +splbunglingpotion,373,16406 +splbunglingpot,373,16406 +splashbunglingextendedpotion,373,16407 +splashbunglingexpotion,373,16407 +splashbungling2potion,373,16407 +splashbunglingextendedpot,373,16407 +splashbunglingexpot,373,16407 +splashbungling2pot,373,16407 +splbunglingextendedpotion,373,16407 +splbunglingexpotion,373,16407 +splbungling2potion,373,16407 +splbunglingextendedpot,373,16407 +splbunglingexpot,373,16407 +splbungling2pot,373,16407 +splashsmoothpotion,373,16411 +splashsmoothpot,373,16411 +splsmoothpotion,373,16411 +splsmoothpot,373,16411 +splashsuavepotion,373,16413 +splashsuavepot,373,16413 +splsuavepotion,373,16413 +splsuavepot,373,16413 +splashdebonairpotion,373,16414 +splashdebonairpot,373,16414 +spldebonairpotion,373,16414 +spldebonairpot,373,16414 +splashdebonairextendedpotion,373,16415 +splashdebonairexpotion,373,16415 +splashdebonair2potion,373,16415 +splashdebonairextendedpot,373,16415 +splashdebonairexpot,373,16415 +splashdebonair2pot,373,16415 +spldebonairextendedpotion,373,16415 +spldebonairexpotion,373,16415 +spldebonair2potion,373,16415 +spldebonairextendedpot,373,16415 +spldebonairexpot,373,16415 +spldebonair2pot,373,16415 +splashthickpotion,373,16416 +splashthickpot,373,16416 +splthickpotion,373,16416 +splthickpot,373,16416 +splashregenerationleveliipotion,373,16417 +splashregenerateleveliipotion,373,16417 +splashregenleveliipotion,373,16417 +splashregenerationlevel2potion,373,16417 +splashregeneratelevel2potion,373,16417 +splashregenlevel2potion,373,16417 +splashregenerationiipotion,373,16417 +splashregenerateiipotion,373,16417 +splashregeniipotion,373,16417 +splashregenerationleveliipot,373,16417 +splashregenerateleveliipot,373,16417 +splashregenleveliipot,373,16417 +splashregenerationlevel2pot,373,16417 +splashregeneratelevel2pot,373,16417 +splashregenlevel2pot,373,16417 +splashregenerationiipot,373,16417 +splashregenerateiipot,373,16417 +splashregeniipot,373,16417 +splregenerationleveliipotion,373,16417 +splregenerateleveliipotion,373,16417 +splregenleveliipotion,373,16417 +splregenerationlevel2potion,373,16417 +splregeneratelevel2potion,373,16417 +splregenlevel2potion,373,16417 +splregenerationiipotion,373,16417 +splregenerateiipotion,373,16417 +splregeniipotion,373,16417 +splregenerationleveliipot,373,16417 +splregenerateleveliipot,373,16417 +splregenleveliipot,373,16417 +splregenerationlevel2pot,373,16417 +splregeneratelevel2pot,373,16417 +splregenlevel2pot,373,16417 +splregenerationiipot,373,16417 +splregenerateiipot,373,16417 +splregeniipot,373,16417 +spr2pot,373,16417 +splashswiftnessleveliipotion,373,16418 +splashswiftleveliipotion,373,16418 +splashspeedleveliipotion,373,16418 +splashswiftnesslevel2potion,373,16418 +splashswiftlevel2potion,373,16418 +splashspeedlevel2potion,373,16418 +splashswiftnessiipotion,373,16418 +splashswiftiipotion,373,16418 +splashspeediipotion,373,16418 +splashswiftnessleveliipot,373,16418 +splashswiftleveliipot,373,16418 +splashspeedleveliipot,373,16418 +splashswiftnesslevel2pot,373,16418 +splashswiftlevel2pot,373,16418 +splashspeedlevel2pot,373,16418 +splashswiftnessiipot,373,16418 +splashswiftiipot,373,16418 +splashspeediipot,373,16418 +splswiftnessleveliipotion,373,16418 +splswiftleveliipotion,373,16418 +splspeedleveliipotion,373,16418 +splswiftnesslevel2potion,373,16418 +splswiftlevel2potion,373,16418 +splspeedlevel2potion,373,16418 +splswiftnessiipotion,373,16418 +splswiftiipotion,373,16418 +splspeediipotion,373,16418 +splswiftnessleveliipot,373,16418 +splswiftleveliipot,373,16418 +splspeedleveliipot,373,16418 +splswiftnesslevel2pot,373,16418 +splswiftlevel2pot,373,16418 +splspeedlevel2pot,373,16418 +splswiftnessiipot,373,16418 +splswiftiipot,373,16418 +splspeediipot,373,16418 +spsw2pot,373,16418 +splashposionleveliipotion,373,16420 +splashacidleveliipotion,373,16420 +splashposionlevel2potion,373,16420 +splashacidlevel2potion,373,16420 +splashposioniipotion,373,16420 +splashacidiipotion,373,16420 +splashposionleveliipot,373,16420 +splashacidleveliipot,373,16420 +splashposionlevel2pot,373,16420 +splashacidlevel2pot,373,16420 +splashposioniipot,373,16420 +splashacidiipot,373,16420 +splposionleveliipotion,373,16420 +splacidleveliipotion,373,16420 +splposionlevel2potion,373,16420 +splcidlevel2potion,373,16420 +splposioniipotion,373,16420 +splacidiipotion,373,16420 +splposionleveliipot,373,16420 +splacidleveliipot,373,16420 +splposionlevel2pot,373,16420 +splacidlevel2pot,373,16420 +splposioniipot,373,16420 +splacidiipot,373,16420 +spp2pot,373,16420 +splashhealingleveliipotion,373,16421 +splashhealleveliipotion,373,16421 +splashhealinglevel2potion,373,16421 +splashheallevel2potion,373,16421 +splashhealingiipotion,373,16421 +splashhealiipotion,373,16421 +splashhealingleveliipot,373,16421 +splashhealleveliipot,373,16421 +splashhealinglevel2pot,373,16421 +splashheallevel2pot,373,16421 +splashhealingiipot,373,16421 +splashhealiipot,373,16421 +splhealingleveliipotion,373,16421 +splhealleveliipotion,373,16421 +splhealinglevel2potion,373,16421 +splheallevel2potion,373,16421 +splhealingiipotion,373,16421 +splhealiipotion,373,16421 +splhealingleveliipot,373,16421 +splhealleveliipot,373,16421 +splhealinglevel2pot,373,16421 +splheallevel2pot,373,16421 +splhealingiipot,373,16421 +splhealiipot,373,16421 +sph2pot,373,16421 +splashcharmingpotion,373,16422 +splashcharmingpot,373,16422 +splcharmingpotion,373,16422 +splcharmingpot,373,16422 +splashcharmingextendedpotion,373,16423 +splashcharmingexpotion,373,16423 +splashcharming2potion,373,16423 +splashcharmingextendedpot,373,16423 +splashcharmingexpot,373,16423 +splashcharming2pot,373,16423 +splcharmingextendedpotion,373,16423 +splcharmingexpotion,373,16423 +splcharming2potion,373,16423 +splcharmingextendedpot,373,16423 +splcharmingexpot,373,16423 +splcharming2pot,373,16423 +splashstrengthleveliipotion,373,16425 +splashstrongleveliipotion,373,16425 +splashstrleveliipotion,373,16425 +splashstrengthlevel2potion,373,16425 +splashstronglevel2potion,373,16425 +splashstrlevel2potion,373,16425 +splashstrengthiipotion,373,16425 +splashstrongiipotion,373,16425 +splashstriipotion,373,16425 +splashstrengthleveliipot,373,16425 +splashstrongleveliipot,373,16425 +splashstrleveliipot,373,16425 +splashstrengthlevel2pot,373,16425 +splashstronglevel2pot,373,16425 +splashstrlevel2pot,373,16425 +splashstrengthiipot,373,16425 +splashstrongiipot,373,16425 +splashstriipot,373,16425 +splstrengthleveliipotion,373,16425 +splstrongleveliipotion,373,16425 +splstrleveliipotion,373,16425 +splstrengthlevel2potion,373,16425 +splstronglevel2potion,373,16425 +splstrlevel2potion,373,16425 +splstrengthiipotion,373,16425 +splstrongiipotion,373,16425 +splstriipotion,373,16425 +splstrengthleveliipot,373,16425 +splstrongleveliipot,373,16425 +splstrleveliipot,373,16425 +splstrengthlevel2pot,373,16425 +splstronglevel2pot,373,16425 +splstrlevel2pot,373,16425 +splstrengthiipot,373,16425 +splstrongiipot,373,16425 +splstriipot,373,16425 +spst2pot,373,16425 +splashrefinedpotion,373,16427 +splashrefinedpot,373,16427 +splrefinedpotion,373,16427 +splrefinedpot,373,16427 +splashharmingleveliipotion,373,16428 +splashdamageleveliipotion,373,16428 +splashdmgleveliipotion,373,16428 +splashharminglevel2potion,373,16428 +splashdamagelevel2potion,373,16428 +splashdmglevel2potion,373,16428 +splashharmingiipotion,373,16428 +splashdamageiipotion,373,16428 +splashdmgiipotion,373,16428 +splashharmingleveliipot,373,16428 +splashdamageleveliipot,373,16428 +splashdmgleveliipot,373,16428 +splashharminglevel2pot,373,16428 +splashdamagelevel2pot,373,16428 +splashdmglevel2pot,373,16428 +splashharmingiipot,373,16428 +splashdamageiipot,373,16428 +splashdmgiipot,373,16428 +splharmingleveliipotion,373,16428 +spldamageleveliipotion,373,16428 +spldmgleveliipotion,373,16428 +splharminglevel2potion,373,16428 +spldamagelevel2potion,373,16428 +spldmglevel2potion,373,16428 +splharmingiipotion,373,16428 +spldamageiipotion,373,16428 +spldmgiipotion,373,16428 +splharmingleveliipot,373,16428 +spldamageleveliipot,373,16428 +spldmgleveliipot,373,16428 +splharminglevel2pot,373,16428 +spldamagelevel2pot,373,16428 +spldmglevel2pot,373,16428 +splharmingiipot,373,16428 +spldamageiipot,373,16428 +spldmgiipot,373,16428 +spd2pot,373,16428 +splashcordialpotion,373,16429 +splashcordialpot,373,16429 +splcordialpotion,373,16429 +splcordialpot,373,16429 +splashsparklingpotion,373,16430 +splashsparklingpot,373,16430 +splsparklingpotion,373,16430 +splsparklingpot,373,16430 +splashsparklingextendedpotion,373,16431 +splashsparklingexpotion,373,16431 +splashsparkling2potion,373,16431 +splashsparklingextendedpot,373,16431 +splashsparklingexpot,373,16431 +splashsparkling2pot,373,16431 +splsparklingextendedpotion,373,16431 +splsparklingexpotion,373,16431 +splsparkling2potion,373,16431 +splsparklingextendedpot,373,16431 +splsparklingexpot,373,16431 +splsparkling2pot,373,16431 +splashpotentpotion,373,16432 +splashpotentpot,373,16432 +splpotentpotion,373,16432 +splpotentpot,373,16432 +splashrankpotion,373,16438 +splashrankpot,373,16438 +splrankpotion,373,16438 +splrankpot,373,16438 +splashrankextendedpotion,373,16439 +splashrankexpotion,373,16439 +splashrank2potion,373,16439 +splashrankextendedpot,373,16439 +splashrankexpot,373,16439 +splashrank2pot,373,16439 +splrankextendedpotion,373,16439 +splrankexpotion,373,16439 +splrank2potion,373,16439 +splrankextendedpot,373,16439 +splrankexpot,373,16439 +splrank2pot,373,16439 +splashacridpotion,373,16443 +splashacridpot,373,16443 +splacridpotion,373,16443 +splacridpot,373,16443 +splashgrosspotion,373,16445 +splashgrosspot,373,16445 +splgrosspotion,373,16445 +splgrosspot,373,16445 +splashstinkypotion,373,16446 +splashstinkypot,373,16446 +splstinkypotion,373,16446 +splstinkypot,373,16446 +splashstinkyextendedpotion,373,16447 +splashstinkyexpotion,373,16447 +splashstinky2potion,373,16447 +splashstinkyextendedpot,373,16447 +splashstinkyexpot,373,16447 +splashstinky2pot,373,16447 +splstinkyextendedpotion,373,16447 +splstinkyexpotion,373,16447 +splstinky2potion,373,16447 +splstinkyextendedpot,373,16447 +splstinkyexpot,373,16447 +splstinky2pot,373,16447 +splashmundaneextendedpotion,373,16448 +splashmundaneexpotion,373,16448 +splashmundane2potion,373,16448 +splashmundaneextendedpot,373,16448 +splashmundaneexpot,373,16448 +splashmundane2pot,373,16448 +splmundaneextendedpotion,373,16448 +splmundaneexpotion,373,16448 +splmundane2potion,373,16448 +splmundaneextendedpot,373,16448 +splmundaneexpot,373,16448 +splmundane2pot,373,16448 +splashregenerationextendedpotion,373,16449 +splashregenerateextendedpotion,373,16449 +splashregenextendepotion,373,16449 +splashregenerationexpotion,373,16449 +splashregenerateexpotion,373,16449 +splashregenexpotion,373,16449 +splashregenerationextendedpot,373,16449 +splashregenerateextendedpot,373,16449 +splashregenextendepot,373,16449 +splashregenerationexpot,373,16449 +splashregenerateexpot,373,16449 +splashregenexpot,373,16449 +splregenerationextendedpotion,373,16449 +splregenerateextendedpotion,373,16449 +splregenextendepotion,373,16449 +splregenerationexpotion,373,16449 +splregenerateexpotion,373,16449 +splregenexpotion,373,16449 +splregenerationextendedpot,373,16449 +splregenerateextendedpot,373,16449 +splregenextendepot,373,16449 +splregenerationexpot,373,16449 +splregenerateexpot,373,16449 +splregenexpot,373,16449 +sprepot,373,16449 +splashswiftnessextendedpotion,373,16450 +splashswiftextendedpotion,373,16450 +splashspeedextendedpotion,373,16450 +splashswiftnessexpotion,373,16450 +splashswiftexpotion,373,16450 +splashspeedexpotion,373,16450 +splashswiftnessextendedpot,373,16450 +splashswiftextendedpot,373,16450 +splashspeedextendedpot,373,16450 +splashswiftnessexpot,373,16450 +splashswiftexpot,373,16450 +splashspeedexpot,373,16450 +splswiftnessextendedpotion,373,16450 +splswiftextendedpotion,373,16450 +splspeedextendedpotion,373,16450 +splswiftnessexpotion,373,16450 +splswiftexpotion,373,16450 +splspeedexpotion,373,16450 +splswiftnessextendedpot,373,16450 +splswiftextendedpot,373,16450 +splspeedextendedpot,373,16450 +splswiftnessexpot,373,16450 +splswiftexpot,373,16450 +splspeedexpot,373,16450 +spswepot,373,16450 +splashfireresistanceextendedpotion,373,16451 +splashfireresistextendedpotion,373,16451 +splashfireresextendedpotion,373,16451 +splashfireresistanceexpotion,373,16451 +splashfireresistexpotion,373,16451 +splashfireresexpotion,373,16451 +splashfireresistanceextendedpot,373,16451 +splashfireresistextendedpot,373,16451 +splashfireresextendedpot,373,16451 +splashfireresistanceexpot,373,16451 +splashfireresistexpot,373,16451 +splashfireresexpot,373,16451 +splfireresistanceextendedpotion,373,16451 +splfireresistextendedpotion,373,16451 +splfireresextendedpotion,373,16451 +splfireresistanceexpotion,373,16451 +splfireresistexpotion,373,16451 +splfireresexpotion,373,16451 +splfireresistanceextendedpot,373,16451 +splfireresistextendedpot,373,16451 +splfireresextendedpot,373,16451 +splfireresistanceexpot,373,16451 +splfireresistexpot,373,16451 +splfireresexpot,373,16451 +spfepot,373,16451 +splashposionextendedpotion,373,16452 +splashacidextendedpotion,373,16452 +splashposionexpotion,373,16452 +splashacidexpotion,373,16452 +splashposionextendedpot,373,16452 +splashacidextendedpot,373,16452 +splashposionexpot,373,16452 +splashacidexpot,373,16452 +splposionextendedpotion,373,16452 +splacidextendedpotion,373,16452 +splposionexpotion,373,16452 +splacidexpotion,373,16452 +splposionextendedpot,373,16452 +splacidextendedpot,373,16452 +splposionexpot,373,16452 +splacidexpot,373,16452 +sppepot,373,16452 +splashnightvisionextendedpotion,373,16454 +splashnvisionextendedpotion,373,16454 +splashnightvextendedpotion,373,16454 +splashdarkvisionextendedpotion,373,16454 +splashdvisionextendedpotion,373,16454 +splashdarkvextendedpotion,373,16454 +splashnightvisionextendedpot,373,16454 +splashnvisionextendedpot,373,16454 +splashnightvextendedpot,373,16454 +splashdarkvisionextendedpot,373,16454 +splashdvisionextendedpot,373,16454 +splashdarkvextendedpot,373,16454 +splashnightvisionexpotion,373,16454 +splashnvisionexpotion,373,16454 +splashnightvexpotion,373,16454 +splashdarkvisionexpotion,373,16454 +splashdvisionexpotion,373,16454 +splashdarkvexpotion,373,16454 +splashnightvisionexpot,373,16454 +splashnvisionexpot,373,16454 +splashnightvexpot,373,16454 +splashdarkvisionexpot,373,16454 +splashdvisionexpot,373,16454 +splashdarkvexpot,373,16454 +splnightvisionextendedpotion,373,16454 +splnvisionextendedpotion,373,16454 +splnightvextendedpotion,373,16454 +spldarkvisionextendedpotion,373,16454 +spldvisionextendedpotion,373,16454 +spldarkvextendedpotion,373,16454 +splnightvisionextendedpot,373,16454 +splnvisionextendedpot,373,16454 +splnightvextendedpot,373,16454 +spldarkvisionextendedpot,373,16454 +spldvisionextendedpot,373,16454 +spldarkvextendedpot,373,16454 +splnightvisionexpotion,373,16454 +splnvisionexpotion,373,16454 +splnightvexpotion,373,16454 +spldarkvisionexpotion,373,16454 +spldvisionexpotion,373,16454 +spldarkvexpotion,373,16454 +splnightvisionexpot,373,16454 +splnvisionexpot,373,16454 +splnightvexpot,373,16454 +spldarkvisionexpot,373,16454 +spldvisionexpot,373,16454 +spldarkvexpot,373,16454 +spnepot,373,16454 +splashweaknessextendedpotion,373,16456 +splashweakextendedpotion,373,16456 +splashweaknessexpotion,373,16456 +splashweakexpotion,373,16456 +splashweaknessextendedpot,373,16456 +splashweakextendedpot,373,16456 +splashweaknessexpot,373,16456 +splashweakexpot,373,16456 +splweaknessextendedpotion,373,16456 +sphweakextendedpotion,373,16456 +splweaknessexpotion,373,16456 +splweakexpotion,373,16456 +splweaknessextendedpot,373,16456 +splweakextendedpot,373,16456 +splweaknessexpot,373,16456 +splweakexpot,373,16456 +spwepot,373,16456 +splashstrengthextendedpotion,373,16457 +splashstrongextendedpotion,373,16457 +splashstrextendedpotion,373,16457 +splashstrengthexpotion,373,16457 +splashstrongexpotion,373,16457 +splashstrexpotion,373,16457 +splashstrengthextendedpot,373,16457 +splashstrongextendedpot,373,16457 +splashstrextendedpot,373,16457 +splashstrengthexpot,373,16457 +splashstrongexpot,373,16457 +splashstrexpot,373,16457 +splstrengthextendedpotion,373,16457 +splstrongextendedpotion,373,16457 +splstrextendedpotion,373,16457 +splstrengthexpotion,373,16457 +splstrongexpotion,373,16457 +splstrexpotion,373,16457 +splstrengthextendedpot,373,16457 +splstrongextendedpot,373,16457 +splstrextendedpot,373,16457 +splstrengthexpot,373,16457 +splstrongexpot,373,16457 +splstrexpot,373,16457 +spstepot,373,16457 +splashslownessextendedpotion,373,16458 +splashslowextenedpotion,373,16458 +splashslownessexpotion,373,16458 +splashslowexpotion,373,16458 +splashslownessextendedpot,373,16458 +splashslowextenedpot,373,16458 +splashslownessexpot,373,16458 +splashslowexpot,373,16458 +splslownessextendedpotion,373,16458 +splslowextenedpotion,373,16458 +splslownessexpotion,373,16458 +splslowexpotion,373,16458 +splslownessextendedpot,373,16458 +splslowextenedpot,373,16458 +splslownessexpot,373,16458 +splslowexpot,373,16458 +spslepot,373,16458 +splashinvisibilityextendedpotion,373,16462 +splashinvisibleextendedpotion,373,16462 +splashinvextendedpotion,373,16462 +splashinvisibilityextendedpot,373,16462 +splashinvisibleextendedpot,373,16462 +splashinvextendedpot,373,16462 +splashinvisibilityexpotion,373,16462 +splashinvisibleexpotion,373,16462 +splashinvexpotion,373,16462 +splashinvisibilityexpot,373,16462 +splashinvisibleexpot,373,16462 +splashinvexpot,373,16462 +splinvisibilityextendedpotion,373,16462 +splinvisibleextendedpotion,373,16462 +splinvextendedpotion,373,16462 +splinvisibilityextendedpot,373,16462 +splinvisibleextendedpot,373,16462 +splinvextendedpot,373,16462 +splinvisibilityexpotion,373,16462 +splinvisibleexpotion,373,16462 +splinvexpotion,373,16462 +splinvisibilityexpot,373,16462 +splinvisibleexpot,373,16462 +splinvexpot,373,16462 +spiepot,373,16462 +splashregenerationdualbitpotion,373,16481 +splashregeneratedualbitpotion,373,16481 +splashregendualbitpotion,373,16481 +splashregenerationdualbitpot,373,16481 +splashregeneratedualbitpot,373,16481 +splashregendualbitpot,373,16481 +splregenerationdualbitpotion,373,16481 +splregeneratedualbitpotion,373,16481 +splregendualbitpotion,373,16481 +splregenerationdualbitpot,373,16481 +splregeneratedualbitpot,373,16481 +splregendualbitpot,373,16481 +splashregenerationdbpotion,373,16481 +splashregeneratedbpotion,373,16481 +splashregendbpotion,373,16481 +splashregenerationdbpot,373,16481 +splashregeneratedbpot,373,16481 +splashregendbpot,373,16481 +splregenerationdbpotion,373,16481 +splregeneratedbpotion,373,16481 +splregendbpotion,373,16481 +splregenerationdbpot,373,16481 +splregeneratedbpot,373,16481 +splregendbpot,373,16481 +sprdbpot,373,16481 +splashswiftnessdualbitpotion,373,16482 +splashswiftdualbitpotion,373,16482 +splashspeeddualbitpotion,373,16482 +splashswiftnessdualbitpot,373,16482 +splashswiftdualbitpot,373,16482 +splashspeeddualbitpot,373,16482 +splswiftnessdualbitpotion,373,16482 +splswiftdualbitpotion,373,16482 +splspeeddualbitpotion,373,16482 +splswiftnessdualbitpot,373,16482 +splswiftdualbitpot,373,16482 +splspeeddualbitpot,373,16482 +splashswiftnessdbpotion,373,16482 +splashswiftdbpotion,373,16482 +splashspeeddbpotion,373,16482 +splashswiftnessdbpot,373,16482 +splashswiftdbpot,373,16482 +splashspeeddbpot,373,16482 +splswiftnessdbpotion,373,16482 +splswiftdbpotion,373,16482 +splspeeddbpotion,373,16482 +splswiftnessdbpot,373,16482 +splswiftdbpot,373,16482 +splspeeddbpot,373,16482 +spswdbpot,373,16482 +splashpoisondualbitpotion,373,16484 +splashaciddualbitpotion,373,16484 +splashpoisondualbitpot,373,16484 +splashaciddualbitpot,373,16484 +splpoisondualbitpotion,373,16484 +splaciddualbitpotion,373,16484 +splpoisondualbitpot,373,16484 +splaciddualbitpot,373,16484 +splashpoisondbpotion,373,16484 +splashaciddbpotion,373,16484 +splashpoisondbpot,373,16484 +splashaciddbpot,373,16484 +splpoisondbpotion,373,16484 +splaciddbpotion,373,16484 +splpoisondbpot,373,16484 +splaciddbpot,373,16484 +sppdbpot,373,16484 +splashstrengthdualbitpotion,373,16489 +splashstrongdualbitpotion,373,16489 +splashstrdualbitpotion,373,16489 +splashstrengthdualbitpot,373,16489 +splashstrongdualbitpot,373,16489 +splashstrdualbitpot,373,16489 +splstrengthdualbitpotion,373,16489 +splstrongdualbitpotion,373,16489 +splstrdualbitpotion,373,16489 +splstrengthdualbitpot,373,16489 +splstrongdualbitpot,373,16489 +splstrdualbitpot,373,16489 +splashstrengthdbpotion,373,16489 +splashstrongdbpotion,373,16489 +splashstrdbpotion,373,16489 +splashstrengthdbpot,373,16489 +splashstrongdbpot,373,16489 +splashstrdbpot,373,16489 +splstrengthdbpotion,373,16489 +splstrongdbpotion,373,16489 +splstrdbpotion,373,16489 +splstrengthdbpot,373,16489 +splstrongdbpot,373,16489 +splstrdbpot,373,16489 +spstdbpot,373,16489 +glassbottle,374,0 +bottle,374,0 +gbottle,374,0 +gvase,374,0 +vase,374,0 +glassvase,374,0 +emptyglassbottle,374,0 +emptybottle,374,0 +emptygbottle,374,0 +emptygvase,374,0 +emptyvase,374,0 +emptyglassvase,374,0 +eglassbottle,374,0 +ebottle,374,0 +egbottle,374,0 +egvase,374,0 +evase,374,0 +eglassvase,374,0 +spidereye,375,0 +eyeofspider,375,0 +spiderseye,375,0 +spiderball,375,0 +spidernugget,375,0 +spidersball,375,0 +spidersnugget,375,0 +seye,375,0 +sball,375,0 +snugget,375,0 +fermentedspidereye,376,0 +craftedspidereye,376,0 +fermentedeyeofspider,376,0 +craftedeyeofspider,376,0 +fspidereye,376,0 +feyeofspider,376,0 +ceyeofspider,376,0 +cspidereye,376,0 +blazepowder,377,0 +blazedust,377,0 +goldpowder,377,0 +golddust,377,0 +gdust,377,0 +gpowder,377,0 +bpowder,377,0 +bdust,377,0 +magmacream,378,0 +goldcream,378,0 +blazecream,378,0 +mcream,378,0 +gcream,378,0 +bcream,378,0 +combinedcream,378,0 +ccream,378,0 +bstand,379,0 +pstand,379,0 +brewingstand,379,0 +potionstand,379,0 +cauldronitem,380,0 +ironcauldronitem,380,0 +steelcauldronitem,380,0 +icauldronitem,380,0 +scauldronitem,380,0 +eyeofender,381,0 +endereye,381,0 +endeye,381,0 +evilendereye,381,0 +evileyeofender,381,0 +evilenderpearl,381,0 +eeye,381,0 +eofender,381,0 +speckledmelon,382,0 +goldmelon,382,0 +sparklymelon,382,0 +glisteningmelon,382,0 +glisteringmelon,382,0 +shiningmelon,382,0 +gmelon,382,0 +smelon,382,0 +creeperegg,383,50 +eggcreeper,383,50 +skeletonegg,383,51 +eggskeleton,383,51 +spideregg,383,52 +eggspider,383,52 +giantegg,383,53 +egggiant,383,53 +zombieegg,383,54 +eggzombie,383,54 +slimeegg,383,55 +eggslime,383,55 +ghastegg,383,56 +eggghast,383,56 +zombiepigmanegg,383,57 +zpigmanegg,383,57 +pigmanegg,383,57 +zombiepmanegg,383,57 +zpmanegg,383,57 +zombiepigmegg,383,57 +zpigmegg,383,57 +zombiepigegg,383,57 +zpigegg,383,57 +zombiepmegg,383,57 +zombiepegg,383,57 +eggzombiepigman,383,57 +eggzpigman,383,57 +eggpigman,383,57 +eggzombiepman,383,57 +eggzpman,383,57 +eggzombiepigm,383,57 +eggzpigm,383,57 +eggzombiepig,383,57 +eggzpig,383,57 +eggzombiepm,383,57 +eggzombiep,383,57 +endermanegg,383,58 +eggenderman,383,58 +eggcavespider,383,59 +cavespideregg,383,59 +silverfishegg,383,60 +eggsilverfish,383,60 +blazeegg,383,61 +eggblaze,383,61 +lavaslimeegg,383,62 +lavacubeegg,383,62 +magmacubeegg,383,62 +magmaslimeegg,383,62 +egglavaslime,383,62 +egglavacube,383,62 +eggmagmacube,383,62 +eggmagmaslime,383,62 +bategg,383,65 +eggbat,383,65 +witchegg,383,66 +eggwitch,383,66 +pigegg,383,90 +eggpig,383,90 +sheepegg,383,91 +eggsheep,383,91 +cowegg,383,92 +eggcow,383,92 +chickenegg,383,93 +eggchicken,383,93 +squidegg,383,94 +eggsquid,383,94 +wolfegg,383,95 +eggwolf,383,95 +mooshroomegg,383,96 +mushroomcowegg,383,96 +eggmooshroom,383,96 +eggmushroomcow,383,96 +snowgolemegg,383,97 +sgolemegg,383,97 +eggsnowgolem,383,97 +eggsgolem,383,97 +ocelotegg,383,98 +eggocelot,383,98 +irongolemegg,383,99 +igolemegg,383,99 +eggirongolem,383,99 +eggigolem,383,99 +villageregg,383,120 +eggvillager,383,120 +bottleofenchanting,384,0 +enchantingbottle,384,0 +expbottle,384,0 +xpbottle,384,0 +bottleexp,384,0 +bottlexp,384,0 +enchantbottle,384,0 +bottleenchanting,384,0 +bottleenchant,384,0 +bottleoenchanting,384,0 +firecharge,385,0 +fireball,385,0 +grenade,385,0 +bookandquill,386,0 +booknquill,386,0 +bookandfeather,386,0 +booknfeather,386,0 +writeablebook,386,0 +writtenbook,387,0 +readablebook,387,0 +sealedbook,387,0 +diary,387,0 +ownedbook,387,0 +emerald,388,0 +itemframe,389,0 +pictureframe,389,0 +iframe,389,0 +pframe,389,0 +flowerpot,390,0 +pot,390,0 +carrot,391,0 +potato,392,0 +bakedpotato,393,0 +roastedpotato,393,0 +cookedpotato,393,0 +bakepotato,393,0 +roastpotato,393,0 +cookpotato,393,0 +posionouspotato,394,0 +posionpotato,394,0 +emptymap,395,0 +map,395,0 +goldencarrot,396,0 +goldcarrot,396,0 +gcarrot,396,0 +head,397,0 +skeletonhead,397,0 +headskeleton,397,0 +witherhead,397,1 +witherskeletonhead,397,1 +wskeletionhead,397,1 +headwither,397,1 +headwitherskeleton,397,1 +headwskeletion,397,1 +zombiehead,397,2 +headzombie,397,2 +playerhead,397,3 +humanhead,397,3 +stevehead,397,3 +headplayer,397,3 +headhuman,397,3 +headsteve,397,3 +creeperhead,397,4 +headcreeper,397,4 +carrotonastick,398,0 +carrotonstick,398,0 +netherstar,399,0 +hellstar,399,0 +nstar,399,0 +hstar,399,0 +star,399,0 +pumpkinpie,400,0 +pumpkincake,400,0 +ppie,400,0 +pcake,400,0 +pie,400,0 +fireworkrocket,401,0 +fireworkmissle,401,0 +firework,401,0 +fworkrocket,401,0 +fworkmissle,401,0 +fwork,401,0 +fwrocket,401,0 +fwmissle,401,0 +fireworkstar,402,0 +fworkstar,402,0 +fwstar,402,0 +fireworkball,402,0 +fworkball,402,0 +fwball,402,0 +fireworkpowder,402,0 +fworkpowder,402,0 +fwpowder,402,0 +fireworkcharge,402,0 +fworkcharge,402,0 +fwcharge,402,0 +enchantmentbook,403,0 +enchantedbook,403,0 +enchantingbook,403,0 +enchantbook,403,0 +magicalbook,403,0 +magicbook,403,0 +ebook,403,0 +mbook,403,0 +goldmusicrecord,2256,0 +goldmusicdisk,2256,0 +goldmusicdisc,2256,0 +goldmusiccd,2256,0 +13musicrecord,2256,0 +13musicdisk,2256,0 +13musicdisc,2256,0 +13musiccd,2256,0 +gomusicrecord,2256,0 +gomusicdisk,2256,0 +gomusicdisc,2256,0 +gomusiccd,2256,0 +goldmrecord,2256,0 +goldmdisk,2256,0 +goldmdisc,2256,0 +goldmcd,2256,0 +13mrecord,2256,0 +13mdisk,2256,0 +13mdisc,2256,0 +13mcd,2256,0 +gomrecord,2256,0 +gomdisk,2256,0 +gomdisc,2256,0 +gomcd,2256,0 +goldrecord,2256,0 +golddisk,2256,0 +golddisc,2256,0 +goldcd,2256,0 +13record,2256,0 +13disk,2256,0 +13disc,2256,0 +13cd,2256,0 +gorecord,2256,0 +godisk,2256,0 +godisc,2256,0 +gocd,2256,0 +record1,2256,0 +disk1,2256,0 +disc1,2256,0 +cd1,2256,0 +1record,2256,0 +1disk,2256,0 +1disc,2256,0 +1cd,2256,0 +greenmusicrecord,2257,0 +greenmusicdisk,2257,0 +greenmusicdisc,2257,0 +greenmusiccd,2257,0 +catmusicrecord,2257,0 +catmusicdisk,2257,0 +catmusicdisc,2257,0 +catmusiccd,2257,0 +grmusicrecord,2257,0 +grmusicdisk,2257,0 +grmusicdisc,2257,0 +grmusiccd,2257,0 +greenmrecord,2257,0 +greenmdisk,2257,0 +greenmdisc,2257,0 +greenmcd,2257,0 +catmrecord,2257,0 +catmdisk,2257,0 +catmdisc,2257,0 +catmcd,2257,0 +grmrecord,2257,0 +grmdisk,2257,0 +grmdisc,2257,0 +grmcd,2257,0 +greenrecord,2257,0 +greendisk,2257,0 +greendisc,2257,0 +greencd,2257,0 +catrecord,2257,0 +catdisk,2257,0 +catdisc,2257,0 +catcd,2257,0 +grrecord,2257,0 +grdisk,2257,0 +grdisc,2257,0 +grcd,2257,0 +record2,2257,0 +disk2,2257,0 +disc2,2257,0 +cd2,2257,0 +2record,2257,0 +2disk,2257,0 +2disc,2257,0 +2cd,2257,0 +orangemusicrecord,2258,0 +orangemusicdisk,2258,0 +orangemusicdisc,2258,0 +orangemusiccd,2258,0 +blocksmusicrecord,2258,0 +blocksmusicdisk,2258,0 +blocksmusicdisc,2258,0 +blocksmusiccd,2258,0 +ormusicrecord,2258,0 +ormusicdisk,2258,0 +ormusicdisc,2258,0 +ormusiccd,2258,0 +orangemrecord,2258,0 +orangemdisk,2258,0 +orangemdisc,2258,0 +orangemcd,2258,0 +blocksmrecord,2258,0 +blocksmdisk,2258,0 +blocksmdisc,2258,0 +blocksmcd,2258,0 +ormrecord,2258,0 +ormdisk,2258,0 +ormdisc,2258,0 +ormcd,2258,0 +orangerecord,2258,0 +orangedisk,2258,0 +orangedisc,2258,0 +orangecd,2258,0 +blocksrecord,2258,0 +blocksdisk,2258,0 +blocksdisc,2258,0 +blockscd,2258,0 +orrecord,2258,0 +ordisk,2258,0 +ordisc,2258,0 +orcd,2258,0 +record3,2258,0 +disk3,2258,0 +disc3,2258,0 +cd3,2258,0 +3record,2258,0 +3disk,2258,0 +3disc,2258,0 +3cd,2258,0 +redmusicrecord,2259,0 +redmusicdisk,2259,0 +redmusicdisc,2259,0 +redmusiccd,2259,0 +chirpmusicrecord,2259,0 +chirpmusicdisk,2259,0 +chirpmusicdisc,2259,0 +chirpmusiccd,2259,0 +remusicrecord,2259,0 +remusicdisk,2259,0 +remusicdisc,2259,0 +remusiccd,2259,0 +redmrecord,2259,0 +redmdisk,2259,0 +redmdisc,2259,0 +redmcd,2259,0 +chirpmrecord,2259,0 +chirpmdisk,2259,0 +chirpmdisc,2259,0 +chirpmcd,2259,0 +remrecord,2259,0 +remdisk,2259,0 +remdisc,2259,0 +remcd,2259,0 +redrecord,2259,0 +reddisk,2259,0 +reddisc,2259,0 +redcd,2259,0 +chirprecord,2259,0 +chirpdisk,2259,0 +chirpdisc,2259,0 +chirpcd,2259,0 +rerecord,2259,0 +redisk,2259,0 +redisc,2259,0 +recd,2259,0 +record4,2259,0 +disk4,2259,0 +disc4,2259,0 +cd4,2259,0 +4record,2259,0 +4disk,2259,0 +4disc,2259,0 +4cd,2259,0 +lightgreenmusicrecord,2260,0 +lightgreenmusicdisk,2260,0 +lightgreenmusicdisc,2260,0 +lightgreenmusiccd,2260,0 +lgreenmusicrecord,2260,0 +lgreenmusicdisk,2260,0 +lgreenmusicdisc,2260,0 +lgreenmusiccd,2260,0 +lightgrmusicrecord,2260,0 +lightgrmusicdisk,2260,0 +lightgrmusicdisc,2260,0 +lightgrmusiccd,2260,0 +farmusicrecord,2260,0 +farmusicdisk,2260,0 +farmusicdisc,2260,0 +farmusiccd,2260,0 +lgrmusicrecord,2260,0 +lgrmusicdisk,2260,0 +lgrmusicdisc,2260,0 +lgrmusiccd,2260,0 +lightgreenmrecord,2260,0 +lightgreenmdisk,2260,0 +lightgreenmdisc,2260,0 +lightgreenmcd,2260,0 +lgreenmrecord,2260,0 +lgreenmdisk,2260,0 +lgreenmdisc,2260,0 +lgreenmcd,2260,0 +lightgrmrecord,2260,0 +lightgrmdisk,2260,0 +lightgrmdisc,2260,0 +lightgrmcd,2260,0 +farmrecord,2260,0 +farmdisk,2260,0 +farmdisc,2260,0 +farmcd,2260,0 +lgrmrecord,2260,0 +lgrmdisk,2260,0 +lgrmdisc,2260,0 +lgrmcd,2260,0 +lightgreenrecord,2260,0 +lightgreendisk,2260,0 +lightgreendisc,2260,0 +lightgreencd,2260,0 +lgreenrecord,2260,0 +lgreendisk,2260,0 +lgreendisc,2260,0 +lgreencd,2260,0 +lightgrrecord,2260,0 +lightgrdisk,2260,0 +lightgrdisc,2260,0 +lightgrcd,2260,0 +farrecord,2260,0 +fardisk,2260,0 +fardisc,2260,0 +farcd,2260,0 +lgrrecord,2260,0 +lgrdisk,2260,0 +lgrdisc,2260,0 +lgrcd,2260,0 +record5,2260,0 +disk5,2260,0 +disc5,2260,0 +cd5,2260,0 +5record,2260,0 +5disk,2260,0 +5disc,2260,0 +5cd,2260,0 +purplemusicrecord,2261,0 +purplemusicdisk,2261,0 +purplemusicdisc,2261,0 +purplemusiccd,2261,0 +mallmusicrecord,2261,0 +mallmusicdisk,2261,0 +mallmusicdisc,2261,0 +mallmusiccd,2261,0 +pumusicrecord,2261,0 +pumusicdisk,2261,0 +pumusicdisc,2261,0 +pumusiccd,2261,0 +purplemrecord,2261,0 +purplemdisk,2261,0 +purplemdisc,2261,0 +purplemcd,2261,0 +mallmrecord,2261,0 +mallmdisk,2261,0 +mallmdisc,2261,0 +mallmcd,2261,0 +pumrecord,2261,0 +pumdisk,2261,0 +pumdisc,2261,0 +pumcd,2261,0 +purplerecord,2261,0 +purpledisk,2261,0 +purpledisc,2261,0 +purplecd,2261,0 +mallrecord,2261,0 +malldisk,2261,0 +malldisc,2261,0 +mallcd,2261,0 +purecord,2261,0 +pudisk,2261,0 +pudisc,2261,0 +pucd,2261,0 +record6,2261,0 +disk6,2261,0 +disc6,2261,0 +cd6,2261,0 +6record,2261,0 +6disk,2261,0 +6disc,2261,0 +6cd,2261,0 +pinkmusicrecord,2262,0 +pinkmusicdisk,2262,0 +pinkmusicdisc,2262,0 +pinkmusiccd,2262,0 +mellohimusicrecord,2262,0 +mellohimusicdisk,2262,0 +mellohimusicdisc,2262,0 +mellohimusiccd,2262,0 +pimusicrecord,2262,0 +pimusicdisk,2262,0 +pimusicdisc,2262,0 +pimusiccd,2262,0 +pinkmrecord,2262,0 +pinkmdisk,2262,0 +pinkmdisc,2262,0 +pinkmcd,2262,0 +mellohimrecord,2262,0 +mellohimdisk,2262,0 +mellohimdisc,2262,0 +mellohimcd,2262,0 +pimrecord,2262,0 +pimdisk,2262,0 +pimdisc,2262,0 +pimcd,2262,0 +pinkrecord,2262,0 +pinkdisk,2262,0 +pinkdisc,2262,0 +pinkcd,2262,0 +mellohirecord,2262,0 +mellohidisk,2262,0 +mellohidisc,2262,0 +mellohicd,2262,0 +pirecord,2262,0 +pidisk,2262,0 +pidisc,2262,0 +picd,2262,0 +record7,2262,0 +disk7,2262,0 +disc7,2262,0 +cd7,2262,0 +7record,2262,0 +7disk,2262,0 +7disc,2262,0 +7cd,2262,0 +blackmusicrecord,2263,0 +blackmusicdisk,2263,0 +blackmusicdisc,2263,0 +blackmusiccd,2263,0 +stalmusicrecord,2263,0 +stalmusicdisk,2263,0 +stalmusicdisc,2263,0 +stalmusiccd,2263,0 +blmusicrecord,2263,0 +blmusicdisk,2263,0 +blmusicdisc,2263,0 +blmusiccd,2263,0 +blackmrecord,2263,0 +blackmdisk,2263,0 +blackmdisc,2263,0 +blackmcd,2263,0 +stalmrecord,2263,0 +stalmdisk,2263,0 +stalmdisc,2263,0 +stalmcd,2263,0 +blmrecord,2263,0 +blmdisk,2263,0 +blmdisc,2263,0 +blmcd,2263,0 +blackrecord,2263,0 +blackdisk,2263,0 +blackdisc,2263,0 +blackcd,2263,0 +stalrecord,2263,0 +staldisk,2263,0 +staldisc,2263,0 +stalcd,2263,0 +blrecord,2263,0 +bldisk,2263,0 +bldisc,2263,0 +blcd,2263,0 +record8,2263,0 +disk8,2263,0 +disc8,2263,0 +cd8,2263,0 +8record,2263,0 +8disk,2263,0 +8disc,2263,0 +8cd,2263,0 +whitemusicrecord,2264,0 +whitemusicdisk,2264,0 +whitemusicdisc,2264,0 +whitemusiccd,2264,0 +stradmusicrecord,2264,0 +stradmusicdisk,2264,0 +stradmusicdisc,2264,0 +stradmusiccd,2264,0 +whmusicrecord,2264,0 +whmusicdisk,2264,0 +whmusicdisc,2264,0 +whmusiccd,2264,0 +whitemrecord,2264,0 +whitemdisk,2264,0 +whitemdisc,2264,0 +whitemcd,2264,0 +stradmrecord,2264,0 +stradmdisk,2264,0 +stradmdisc,2264,0 +stradmcd,2264,0 +whmrecord,2264,0 +whmdisk,2264,0 +whmdisc,2264,0 +whmcd,2264,0 +whiterecord,2264,0 +whitedisk,2264,0 +whitedisc,2264,0 +whitecd,2264,0 +stradrecord,2264,0 +straddisk,2264,0 +straddisc,2264,0 +stradcd,2264,0 +whrecord,2264,0 +whdisk,2264,0 +whdisc,2264,0 +whcd,2264,0 +record9,2264,0 +disk9,2264,0 +disc9,2264,0 +cd9,2264,0 +9record,2264,0 +9disk,2264,0 +9disc,2264,0 +9cd,2264,0 +darkgreenmusicrecord,2265,0 +darkgreenmusicdisk,2265,0 +darkgreenmusicdisc,2265,0 +darkgreenmusiccd,2265,0 +dgreenmusicrecord,2265,0 +dgreenmusicdisk,2265,0 +dgreenmusicdisc,2265,0 +dgreenmusiccd,2265,0 +darkgrmusicrecord,2265,0 +darkgrmusicdisk,2265,0 +darkgrmusicdisc,2265,0 +darkgrmusiccd,2265,0 +wardmusicrecord,2265,0 +wardmusicdisk,2265,0 +wardmusicdisc,2265,0 +wardmusiccd,2265,0 +dgrmusicrecord,2265,0 +dgrmusicdisk,2265,0 +dgrmusicdisc,2265,0 +dgrmusiccd,2265,0 +darkgreenmrecord,2265,0 +darkgreenmdisk,2265,0 +darkgreenmdisc,2265,0 +darkgreenmcd,2265,0 +dgreenmrecord,2265,0 +dgreenmdisk,2265,0 +dgreenmdisc,2265,0 +dgreenmcd,2265,0 +darkgrmrecord,2265,0 +darkgrmdisk,2265,0 +darkgrmdisc,2265,0 +darkgrmcd,2265,0 +wardmrecord,2265,0 +wardmdisk,2265,0 +wardmdisc,2265,0 +wardmcd,2265,0 +dgrmrecord,2265,0 +dgrmdisk,2265,0 +dgrmdisc,2265,0 +dgrmcd,2265,0 +darkgreenrecord,2265,0 +darkgreendisk,2265,0 +darkgreendisc,2265,0 +darkgreencd,2265,0 +dgreenrecord,2265,0 +dgreendisk,2265,0 +dgreendisc,2265,0 +dgreencd,2265,0 +darkgrrecord,2265,0 +darkgrdisk,2265,0 +darkgrdisc,2265,0 +darkgrcd,2265,0 +wardrecord,2265,0 +warddisk,2265,0 +warddisc,2265,0 +wardcd,2265,0 +dgrrecord,2265,0 +dgrdisk,2265,0 +dgrdisc,2265,0 +dgrcd,2265,0 +record10,2265,0 +disk10,2265,0 +disc10,2265,0 +cd10,2265,0 +10record,2265,0 +10disk,2265,0 +10disc,2265,0 +10cd,2265,0 +crackedmusicrecord,2266,0 +crackedmusicdisk,2266,0 +crackedmusicdisc,2266,0 +crackedmusiccd,2266,0 +crackmusicrecord,2266,0 +crackmusicdisk,2266,0 +crackmusicdisc,2266,0 +crackmusiccd,2266,0 +11musicrecord,2266,0 +11musicdisk,2266,0 +11musicdisc,2266,0 +11musiccd,2266,0 +cmusicrecord,2266,0 +cmusicdisk,2266,0 +cmusicdisc,2266,0 +cmusiccd,2266,0 +crackedmrecord,2266,0 +crackedmdisk,2266,0 +crackedmdisc,2266,0 +crackedmcd,2266,0 +crackmrecord,2266,0 +crackmdisk,2266,0 +crackmdisc,2266,0 +crackmcd,2266,0 +11mrecord,2266,0 +11mdisk,2266,0 +11mdisc,2266,0 +11mcd,2266,0 +cmrecord,2266,0 +cmdisk,2266,0 +cmdisc,2266,0 +cmcd,2266,0 +crackedrecord,2266,0 +crackeddisk,2266,0 +crackeddisc,2266,0 +crackedcd,2266,0 +crackrecord,2266,0 +crackdisk,2266,0 +crackdisc,2266,0 +crackcd,2266,0 +crecord,2266,0 +cdisk,2266,0 +cdisc,2266,0 +ccd,2266,0 +record11,2266,0 +disk11,2266,0 +disc11,2266,0 +cd11,2266,0 +11record,2266,0 +11disk,2266,0 +11disc,2266,0 +11cd,2266,0 + +#e31a38b781cc382d5f926c87008b2cf2 \ No newline at end of file diff --git a/Server/plugins/Essentials/motd.txt b/Server/plugins/Essentials/motd.txt new file mode 100644 index 0000000..3f0aa02 --- /dev/null +++ b/Server/plugins/Essentials/motd.txt @@ -0,0 +1,3 @@ +&6Welcome, {PLAYER}&6! +&6Type &c/help&6 for a list of commands. +&6Currently online:&r {PLAYERLIST} \ No newline at end of file diff --git a/Server/plugins/Essentials/spawn.yml b/Server/plugins/Essentials/spawn.yml new file mode 100644 index 0000000..b9f482f --- /dev/null +++ b/Server/plugins/Essentials/spawn.yml @@ -0,0 +1,8 @@ +spawns: + default: + world: world + x: -662.6748781690452 + y: 65.0 + z: -104.55741397408157 + yaw: -269.8505 + pitch: -0.30003697 diff --git a/Server/plugins/Essentials/upgrades-done.yml b/Server/plugins/Essentials/upgrades-done.yml new file mode 100644 index 0000000..eb83f4b --- /dev/null +++ b/Server/plugins/Essentials/upgrades-done.yml @@ -0,0 +1,11 @@ +updateSpawnsToNewSpawnsConfig: true +updateJailsToNewJailsConfig: true +warnMetrics: true +moveWorthValuesToWorthYml: true +movemotdToFile: true +moverulesToFile: true +sanitizeAllUserFilenames: true +updateUsersToNewDefaultHome: true +updateUsersPowerToolsFormat: true +updateUsersHomesFormat: true +deleteOldItemsCsv: true diff --git a/Server/plugins/Essentials/userdata/zeya187.yml b/Server/plugins/Essentials/userdata/zeya187.yml new file mode 100644 index 0000000..0ce1b16 --- /dev/null +++ b/Server/plugins/Essentials/userdata/zeya187.yml @@ -0,0 +1,28 @@ +timestamps: + login: 1569782446692 + logout: 1569782763920 + lastteleport: 1569782760310 +ipAddress: 10.0.0.201 +logoutlocation: + world: world + x: -662.5 + y: 65.0 + z: -104.5 + yaw: -265.5005 + pitch: 6.899963 +afk: false +lastlocation: + world: world + x: 0.35806838516365574 + y: 110.0 + z: -0.8794313066438502 + yaw: -3.5999835 + pitch: 50.24999 +homes: + home: + world: world + x: 0.062461299016312144 + y: 111.0 + z: -0.019200432335597845 + yaw: 7.8000164 + pitch: 90.0 diff --git a/Server/plugins/Essentials/warps/quarry.yml b/Server/plugins/Essentials/warps/quarry.yml new file mode 100644 index 0000000..b4ea0c3 --- /dev/null +++ b/Server/plugins/Essentials/warps/quarry.yml @@ -0,0 +1,7 @@ +world: quarry +x: -49.06109502813471 +y: 76.0 +z: 254.68395970765465 +yaw: -266.54984 +pitch: 19.350021 +name: quarry diff --git a/Server/plugins/Essentials/warps/warps.yml b/Server/plugins/Essentials/warps/warps.yml new file mode 100644 index 0000000..41043ef --- /dev/null +++ b/Server/plugins/Essentials/warps/warps.yml @@ -0,0 +1,7 @@ +world: world +x: -707.5139907489001 +y: 63.0 +z: -62.36009831582589 +yaw: -0.15020752 +pitch: -3.449991 +name: warps diff --git a/Server/plugins/Essentials/worth.yml b/Server/plugins/Essentials/worth.yml new file mode 100644 index 0000000..600795d --- /dev/null +++ b/Server/plugins/Essentials/worth.yml @@ -0,0 +1,167 @@ +worth: + stonebutton: 6.0 + wood: 0.50 + arrow: 3.50 + diamondpickaxe: 650.0 + rawfish: 5.0 + minecart: 23.0 + leatherchestplate: 85.0 + storageminecart: 30.0 + leaves: 1.0 + feather: 3.0 + goldchestplate: 6.5 + mushroomsoup: 4.5 + bread: 30.0 + stationarywater: 1.0 + workbench: 2.5 + stonehoe: 2.5 + brownmushroom: 2.0 + wool: 20.0 + mossycobblestone: 90.0 + diamondhoe: 400.0 + woodsword: 1.0 + torch: 4.0 + grass: 1.0 + poweredminecart: 32.0 + snowball: 1.0 + goldenapple: 100.0 + leatherleggings: 75.0 + log: 2.0 + diamondaxe: 650.0 + slimeball: 50.0 + fence: 1.0 + stonespade: 1.5 + claybrick: 5.0 + noteblock: 36.0 + ironaxe: 22.0 + coalore: 15.0 + clayball: 3.0 + fishingrod: 10.0 + ironhoe: 22.0 + goldrecord: 100.0 + ironpickaxe: 22.0 + irondoor: 22.0 + bucket: 22.0 + redrose: 2.0 + grilledpork: 7.0 + gravel: 1.0 + wooddoor: 3.0 + chainmailhelmet: 40.0 + ironchestplate: 22.0 + diamondblock: 2000.0 + diamondhelmet: 1000.0 + goldhelmet: 6.0 + redstonetorchon: 32.0 + ironspade: 22.0 + furnace: 8.5 + ironsword: 22.0 + dispenser: 58.0 + woodaxe: 2.0 + seeds: 2.0 + painting: 25.0 + woodplate: 1.0 + redstoneore: 30.0 + diamondspade: 210.0 + waterbucket: 40.0 + water: 1.0 + bedrock: 100.0 + irondoorblock: 15.0 + goldhoe: 6.0 + sand: 1.0 + goldsword: 6.0 + stoneaxe: 3.0 + bookshelf: 140.0 + ironblock: 190.0 + jackolantern: 56.0 + boat: 3.0 + diamondchestplate: 1750.0 + redstonewire: 30.0 + redmushroom: 2.0 + string: 5.0 + stoneplate: 6.0 + wallsign: 1.0 + cactus: 10.0 + sulphur: 20.0 + rails: 22.0 + ironore: 18.0 + leatherhelmet: 52.0 + stone: 3.00 + egg: 1.0 + diamondore: 200.0 + woodhoe: 2.0 + goldleggings: 6.0 + chainmailleggings: 50.0 + yellowflower: 2.0 + ironhelmet: 22.0 + obsidian: 130.0 + dirt: 1.0 + leather: 10.0 + leatherboots: 42.0 + lever: 1.0 + cobblestone: 1.0 + cake: 180.0 + woodstairs: 1.0 + ironingot: 22.0 + goldore: 45.0 + pumpkin: 50.0 + bed: 68.0 + watch: 6.0 + ironleggings: 22.0 + sign: 1.5 + doublestep: 1.0 + woodpickaxe: 2.0 + stonepickaxe: 4.0 + chainmailboots: 30.0 + diamondleggings: 1500.0 + cookedfish: 7.0 + saddle: 100.0 + cobblestonestairs: 1.5 + tnt: 100.0 + glowingredstoneore: 30.0 + apple: 10.0 + woodspade: 1.0 + goldingot: 105.0 + diode: 110.0 + soil: 1.0 + clay: 12.0 + goldblock: 450.0 + stick: 0.25 + paper: 10.0 + brick: 21.0 + stationarylava: 1.0 + chest: 4.0 + sandstone: 3.0 + goldpickaxe: 6.0 + compass: 22.0 + sugarcane: 10.0 + diamondsword: 420.0 + goldboots: 6.0 + sponge: 80.0 + stonesword: 2.5 + coal: 15.0 + goldaxe: 6.0 + bone: 2.0 + diamond: 200.0 + glass: 3.00 + goldspade: 6.0 + lapisblock: 950.0 + lavabucket: 40.0 + wheat: 9.0 + ladder: 0.5 + sugarcaneblock: 15.0 + bowl: 0.50 + chainmailchestplate: 40.0 + sapling: 2.0 + diamondboots: 850.0 + lapisore: 100.0 + lava: 25.0 + milkbucket: 40.0 + redstone: 32.0 + greenrecord: 100.0 + inksack: 10.0 + glowstonedust: 10.0 + book: 45.0 + bow: 15.0 + ironboots: 22.0 + step: 1.5 + sugar: 10.0 diff --git a/Server/plugins/EssentialsChat.jar b/Server/plugins/EssentialsChat.jar new file mode 100644 index 0000000..dbeec4d Binary files /dev/null and b/Server/plugins/EssentialsChat.jar differ diff --git a/Server/plugins/EssentialsProtect.jar b/Server/plugins/EssentialsProtect.jar new file mode 100644 index 0000000..910ede9 Binary files /dev/null and b/Server/plugins/EssentialsProtect.jar differ diff --git a/Server/plugins/EssentialsSpawn.jar b/Server/plugins/EssentialsSpawn.jar new file mode 100644 index 0000000..9002f8b Binary files /dev/null and b/Server/plugins/EssentialsSpawn.jar differ diff --git a/Server/plugins/GriefPrevention.jar b/Server/plugins/GriefPrevention.jar new file mode 100644 index 0000000..e10f501 Binary files /dev/null and b/Server/plugins/GriefPrevention.jar differ diff --git a/Server/plugins/LotteryPlus/colors.yml b/Server/plugins/LotteryPlus/colors.yml new file mode 100644 index 0000000..858a5bf --- /dev/null +++ b/Server/plugins/LotteryPlus/colors.yml @@ -0,0 +1,23 @@ +colors: + BLACK: '0' + DARK_BLUE: '1' + DARK_GREEN: '2' + DARK_AQUA: '3' + DARK_RED: '4' + DARK_PURPLE: '5' + GOLD: '6' + GRAY: '7' + DARK_GRAY: '8' + BLUE: '9' + GREEN: a + AQUA: b + RED: c + LIGHT_PURPLE: d + YELLOW: e + WHITE: f + MAGIC: k + BOLD: l + STRIKETHROUGH: m + UNDERLINE: n + ITALIC: o + RESET: r diff --git a/Server/plugins/LotteryPlus/config.yml b/Server/plugins/LotteryPlus/config.yml new file mode 100644 index 0000000..d8fcea1 --- /dev/null +++ b/Server/plugins/LotteryPlus/config.yml @@ -0,0 +1,271 @@ +# config properties +# +properties: + + # whether to broadcast out the buy message or not + # look for 'lottery.mess.buy' in 'lang.properties' to edit the message + buy-enable: true + + # delay between lottery savings, x minutes: can also use '/lottery save' to force save lotteries + save-delay: 15 + + # enable lottery savings + save-enable: true + + # delay between update checks, x minutes: can also use '/lottery update' to check on updates + update-delay: 60 + + # enable the update checks + update-enable: false + + # the delay that takes place between a lottery drawing and when it announces the winner, x seconds + draw-delay: 3 + + # the delay that people have to wait after buying a ticket from a lottery + # NOTE: this is the delay between a lottery NOT all lotteries + buy-delay: 30 + + # delay between reminder messages, look for 'lottery.mess.reminder' in 'lang.properties' to edit the message + reminder-message-delay: 10 + + # enable the reminder message + reminder-message-enable: true + + # whether item rewards should drop on the ground near players or + # should it go in their inventory, applies to economies + should-drop: true + + # whether rewards should be allowed drop if there is no room for them + # if false and there is no room for them it will create a lottery claim for the player + drop-reward: false + + # whether to log lottery savings or not + should-log: false + + # whether players should be allowed to buy tickets during the lottery drawing + buy-during-draw: false + + # the line separator used in the 'lang.properties' + line-separator: '' + + # the format used for money, must contain '' in format + money-format: '$' + + # sign tag used for lottery signs, can have color codes + sign-tag: '&a[Lottery+]' + + # prefix used in chat, can have color codes + chat-prefix: '&e[LotteryPlus] - ' + + # the lottery that will be used when a user doesn't specify one in the buy command + main-lottery: 'MAIN' + + # the lotteries that the user will be notified about when a player joins the server + # ex: 'MAIN1 MAIN2 MAIN3', ect... + # look for 'lottery.mess.main' in the 'lang.properties' to edit the message + main-lotteries: '' + + # the default filter used in '/lottery list ' + default-filter: '' + + +# various sign formats used in different states of a lottery +# +# - name of the lottery +# - cost of a ticket for the lottery +# - reward of the lottery +#