prepare actix-multipart release 0.4.0-beta.8

Co-authored-by: Rob Ede <robjtede@icloud.com>

.cargo/config.toml

@@ -0,0 +1,12 @@
+[alias]
+lint = "clippy --workspace --tests --examples --bins -- -Dclippy::todo"
+lint-all = "clippy --workspace --all-features --tests --examples --bins -- -Dclippy::todo"
+
+# lib checking
+ci-check-min = "hack --workspace check --no-default-features"
+ci-check-default = "hack --workspace check"
+ci-check-all-feature-powerset="hack --workspace --feature-powerset --skip=__compress,io-uring check"
+ci-check-all-feature-powerset-linux="hack --workspace --feature-powerset --skip=__compress check"
+
+# testing
+ci-doctest = "test --workspace --all-features --doc --no-fail-fast -- --nocapture"

.github/ISSUE_TEMPLATE/config.yml

@@ -1,15 +1,8 @@
 blank_issues_enabled: true
 contact_links:
-  - name: GitHub Discussions
-    url: https://github.com/actix/actix-web/discussions
-    about: Actix Web Q&A
-  - name: Gitter chat (actix-web)
-    url: https://gitter.im/actix/actix-web
-    about: Actix Web Q&A
-  - name: Gitter chat (actix)
-    url: https://gitter.im/actix/actix
-    about: Actix (actor framework) Q&A
   - name: Actix Discord
     url: https://discord.gg/NWpN5mmg3x
     about: Actix developer discussion and community chat
-
+  - name: GitHub Discussions
+    url: https://github.com/actix/actix-web/discussions
+    about: Actix Web Q&A

.github/PULL_REQUEST_TEMPLATE.md

@@ -1,21 +1,21 @@
 <!-- Thanks for considering contributing actix! -->
-<!-- Please fill out the following to make our reviews easy. -->
+<!-- Please fill out the following to get your PR reviewed quicker. -->
 
 ## PR Type
 <!-- What kind of change does this PR make? -->
 <!-- Bug Fix / Feature / Refactor / Code Style / Other -->
-INSERT_PR_TYPE
+PR_TYPE
 
 
 ## PR Checklist
-Check your PR fulfills the following:
-
+<!-- Check your PR fulfills the following items. -->
 <!-- For draft PRs check the boxes as you complete them. -->
 
 - [ ] Tests for the changes have been added / updated.
 - [ ] Documentation comments have been added / updated.
 - [ ] A changelog entry has been made for the appropriate packages.
-- [ ] Format code with the latest stable rustfmt
+- [ ] Format code with the latest stable rustfmt.
+- [ ] (Team) Label with affected crates and semver status.
 
 
 ## Overview

.github/workflows/bench.yml

@@ -1,4 +1,4 @@
-name: Benchmark (Linux)
+name: Benchmark
 
 on:
   pull_request:

.github/workflows/ci.yml

@@ -0,0 +1,189 @@
+name: CI
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches: [master]
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        target:
+          - { name: Linux, os: ubuntu-latest, triple: x86_64-unknown-linux-gnu }
+          - { name: macOS, os: macos-latest, triple: x86_64-apple-darwin }
+          - { name: Windows, os: windows-2022, triple: x86_64-pc-windows-msvc }
+        version:
+          - 1.52.0 # MSRV
+          - stable
+          - nightly
+
+    name: ${{ matrix.target.name }} / ${{ matrix.version }}
+    runs-on: ${{ matrix.target.os }}
+
+    env:
+      CI: 1
+      CARGO_INCREMENTAL: 0
+      VCPKGRS_DYNAMIC: 1
+
+    steps:
+      - uses: actions/checkout@v2
+
+      # install OpenSSL on Windows
+      # TODO: GitHub actions docs state that OpenSSL is
+      # already installed on these Windows machines somewhere
+      - name: Set vcpkg root
+        if: matrix.target.triple == 'x86_64-pc-windows-msvc'
+        run: echo "VCPKG_ROOT=$env:VCPKG_INSTALLATION_ROOT" | Out-File -FilePath $env:GITHUB_ENV -Append
+      - name: Install OpenSSL
+        if: matrix.target.triple == 'x86_64-pc-windows-msvc'
+        run: vcpkg install openssl:x64-windows
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-${{ matrix.target.triple }}
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with: { command: generate-lockfile }
+      - name: Cache Dependencies
+        uses: Swatinem/rust-cache@v1.2.0
+
+      - name: Install cargo-hack
+        uses: actions-rs/cargo@v1
+        with:
+          command: install
+          args: cargo-hack
+
+      - name: check minimal
+        uses: actions-rs/cargo@v1
+        with: { command: ci-check-min }
+
+      - name: check default
+        uses: actions-rs/cargo@v1
+        with: { command: ci-check-default }
+
+      - name: tests
+        timeout-minutes: 60
+        run: |
+          cargo test --lib --tests -p=actix-router --all-features
+          cargo test --lib --tests -p=actix-http --all-features
+          cargo test --lib --tests -p=actix-web --features=rustls,openssl -- --skip=test_reading_deflate_encoding_large_random_rustls
+          cargo test --lib --tests -p=actix-web-codegen --all-features
+          cargo test --lib --tests -p=awc --all-features
+          cargo test --lib --tests -p=actix-http-test --all-features
+          cargo test --lib --tests -p=actix-test --all-features
+          cargo test --lib --tests -p=actix-files
+          cargo test --lib --tests -p=actix-multipart --all-features
+          cargo test --lib --tests -p=actix-web-actors --all-features
+
+      - name: tests (io-uring)
+        if: matrix.target.os == 'ubuntu-latest'
+        timeout-minutes: 60
+        run: >
+          sudo bash -c "ulimit -Sl 512
+          && ulimit -Hl 512
+          && PATH=$PATH:/usr/share/rust/.cargo/bin
+          && RUSTUP_TOOLCHAIN=${{ matrix.version }} cargo test --lib --tests -p=actix-files --all-features"
+
+      - name: Clear the cargo caches
+        run: |
+          cargo install cargo-cache --version 0.6.3 --no-default-features --features ci-autoclean
+          cargo-cache
+
+  ci_feature_powerset_check:
+    name: Verify Feature Combinations
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install stable
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable-x86_64-unknown-linux-gnu
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with: { command: generate-lockfile }
+      - name: Cache Dependencies
+        uses: Swatinem/rust-cache@v1.2.0
+
+      - name: Install cargo-hack
+        uses: actions-rs/cargo@v1
+        with:
+          command: install
+          args: cargo-hack
+
+      - name: check feature combinations
+        uses: actions-rs/cargo@v1
+        with: { command: ci-check-all-feature-powerset }
+      
+      - name: check feature combinations
+        uses: actions-rs/cargo@v1
+        with: { command: ci-check-all-feature-powerset-linux }
+
+  coverage:
+    name: coverage
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install stable
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable-x86_64-unknown-linux-gnu
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with: { command: generate-lockfile }
+      - name: Cache Dependencies
+        uses: Swatinem/rust-cache@v1.2.0
+
+      - name: Generate coverage file
+        if: github.ref == 'refs/heads/master'
+        run: |
+          cargo install cargo-tarpaulin --vers "^0.13"
+          cargo tarpaulin --workspace --features=rustls,openssl --out Xml --verbose
+      - name: Upload to Codecov
+        if: github.ref == 'refs/heads/master'
+        uses: codecov/codecov-action@v1
+        with: { file: cobertura.xml }
+
+  rustdoc:
+    name: rustdoc
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install Rust (nightly)
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: nightly-x86_64-unknown-linux-gnu
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with: { command: generate-lockfile }
+      - name: Cache Dependencies
+        uses: Swatinem/rust-cache@v1.3.0
+
+      # - name: Install cargo-hack
+      #   uses: actions-rs/cargo@v1
+      #   with:
+      #     command: install
+      #     args: cargo-hack
+
+      - name: doc tests
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 60
+        with: { command: ci-doctest }

.github/workflows/clippy-fmt.yml

@@ -1,32 +1,39 @@
+name: Lint
+
 on:
   pull_request:
     types: [opened, synchronize, reopened]
 
-name: Clippy and rustfmt Check
 jobs:
-  clippy_check:
+  fmt:
     runs-on: ubuntu-latest
     steps:
       - uses: actions/checkout@v2
 
-      - uses: actions-rs/toolchain@v1
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
         with:
           toolchain: stable
           components: rustfmt
-          override: true
       - name: Check with rustfmt
         uses: actions-rs/cargo@v1
         with:
           command: fmt
           args: --all -- --check
 
-      - uses: actions-rs/toolchain@v1
+  clippy:
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
         with:
-          toolchain: nightly
+          toolchain: stable
           components: clippy
           override: true
       - name: Check with Clippy
         uses: actions-rs/clippy-check@v1
         with:
           token: ${{ secrets.GITHUB_TOKEN }}
-          args: --all-features --all --tests
+          args: --workspace --all-features --tests

.github/workflows/linux.yml

@@ -1,81 +0,0 @@
-name: CI (Linux)
-
-on:
-  pull_request:
-    types: [opened, synchronize, reopened]
-  push:
-    branches:
-      - master
-
-jobs:
-  build_and_test:
-    strategy:
-      fail-fast: false
-      matrix:
-        version:
-          - 1.46.0 # MSRV
-          - stable
-          - nightly
-
-    name: ${{ matrix.version }} - x86_64-unknown-linux-gnu
-    runs-on: ubuntu-latest
-
-    steps:
-      - uses: actions/checkout@v2
-
-      - name: Install ${{ matrix.version }}
-        uses: actions-rs/toolchain@v1
-        with:
-          toolchain: ${{ matrix.version }}-x86_64-unknown-linux-gnu
-          profile: minimal
-          override: true
-
-      - name: Generate Cargo.lock
-        uses: actions-rs/cargo@v1
-        with:
-          command: generate-lockfile
-      - name: Cache Dependencies
-        uses: Swatinem/rust-cache@v1.0.1
-
-      - name: check build
-        uses: actions-rs/cargo@v1
-        with:
-          command: check
-          args: --all --bins --examples --tests
-
-      - name: tests
-        uses: actions-rs/cargo@v1
-        timeout-minutes: 40
-        with:
-          command: test
-          args: --all --all-features --no-fail-fast -- --nocapture
-
-      - name: tests (actix-http)
-        uses: actions-rs/cargo@v1
-        timeout-minutes: 40
-        with:
-          command: test
-          args: --package=actix-http --no-default-features --features=rustls -- --nocapture
-
-      - name: tests (awc)
-        uses: actions-rs/cargo@v1
-        timeout-minutes: 40
-        with:
-          command: test
-          args: --package=awc --no-default-features --features=rustls -- --nocapture
-
-      - name: Generate coverage file
-        if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
-        run: |
-          cargo install cargo-tarpaulin --vers "^0.13"
-          cargo tarpaulin --out Xml
-      - name: Upload to Codecov
-        if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
-        uses: codecov/codecov-action@v1
-        with:
-          file: cobertura.xml
-
-      - name: Clear the cargo caches
-        run: |
-          cargo install cargo-cache --no-default-features --features ci-autoclean
-          cargo-cache

.github/workflows/macos.yml

@@ -1,56 +0,0 @@
-name: CI (macOS)
-
-on:
-  pull_request:
-    types: [opened, synchronize, reopened]
-  push:
-    branches:
-      - master
-
-jobs:
-  build_and_test:
-    strategy:
-      fail-fast: false
-      matrix:
-        version:
-          - stable
-          - nightly
-
-    name: ${{ matrix.version }} - x86_64-apple-darwin
-    runs-on: macOS-latest
-
-    steps:
-      - uses: actions/checkout@v2
-
-      - name: Install ${{ matrix.version }}
-        uses: actions-rs/toolchain@v1
-        with:
-          toolchain: ${{ matrix.version }}-x86_64-apple-darwin
-          profile: minimal
-          override: true
-
-      - name: Generate Cargo.lock
-        uses: actions-rs/cargo@v1
-        with:
-          command: generate-lockfile
-      - name: Cache Dependencies
-        uses: Swatinem/rust-cache@v1.0.1
-
-      - name: check build
-        uses: actions-rs/cargo@v1
-        with:
-          command: check
-          args: --all --bins --examples --tests
-
-      - name: tests
-        uses: actions-rs/cargo@v1
-        with:
-          command: test
-          args: --all --all-features --no-fail-fast -- --nocapture
-                --skip=test_h2_content_length
-                --skip=test_reading_deflate_encoding_large_random_rustls
-
-      - name: Clear the cargo caches
-        run: |
-          cargo install cargo-cache --no-default-features --features ci-autoclean
-          cargo-cache

.github/workflows/upload-doc.yml

@@ -1,14 +1,12 @@
-name: Upload documentation
+name: Upload Documentation
 
 on:
   push:
-    branches:
-      - master
+    branches: [master]
 
 jobs:
   build:
     runs-on: ubuntu-latest
-    if: github.repository == 'actix/actix-web'
 
     steps:
       - uses: actions/checkout@v2
@@ -20,14 +18,14 @@ jobs:
           profile: minimal
           override: true
 
-      - name: check build
+      - name: Build Docs
         uses: actions-rs/cargo@v1
         with:
           command: doc
-          args: --no-deps --workspace --all-features
+          args: --workspace --all-features --no-deps
 
       - name: Tweak HTML
-        run: echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html
+        run: echo '<meta http-equiv="refresh" content="0;url=actix_web/index.html">' > target/doc/index.html
 
       - name: Deploy to GitHub Pages
         uses: JamesIves/github-pages-deploy-action@3.7.1

.github/workflows/windows.yml

@@ -1,76 +0,0 @@
-name: CI (Windows)
-
-on:
-  pull_request:
-    types: [opened, synchronize, reopened]
-  push:
-    branches:
-      - master
-
-env:
-  VCPKGRS_DYNAMIC: 1
-
-jobs:
-  build_and_test:
-    strategy:
-      fail-fast: false
-      matrix:
-        version:
-          - stable
-          - nightly
-
-    name: ${{ matrix.version }} - x86_64-pc-windows-msvc
-    runs-on: windows-latest
-
-    steps:
-      - uses: actions/checkout@v2
-
-      - name: Install ${{ matrix.version }}
-        uses: actions-rs/toolchain@v1
-        with:
-          toolchain: ${{ matrix.version }}-x86_64-pc-windows-msvc
-          profile: minimal
-          override: true
-
-      - name: Install OpenSSL
-        run: |
-          vcpkg integrate install
-          vcpkg install openssl:x64-windows
-          Copy-Item C:\vcpkg\installed\x64-windows\bin\libcrypto-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libcrypto.dll
-          Copy-Item C:\vcpkg\installed\x64-windows\bin\libssl-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libssl.dll
-          Get-ChildItem C:\vcpkg\installed\x64-windows\bin
-          Get-ChildItem C:\vcpkg\installed\x64-windows\lib
-
-      - name: Generate Cargo.lock
-        uses: actions-rs/cargo@v1
-        with:
-          command: generate-lockfile
-      - name: Cache Dependencies
-        uses: Swatinem/rust-cache@v1.0.1
-
-      - name: check build
-        uses: actions-rs/cargo@v1
-        with:
-          command: check
-          args: --all --bins --examples --tests
-
-      - name: tests
-        uses: actions-rs/cargo@v1
-        with:
-          command: test
-          args: --all --all-features --no-fail-fast -- --nocapture
-                --skip=test_h2_content_length
-                --skip=test_reading_deflate_encoding_large_random_rustls
-                --skip=test_params
-                --skip=test_simple
-                --skip=test_expect_continue
-                --skip=test_http10_keepalive
-                --skip=test_slow_request
-                --skip=test_connection_force_close
-                --skip=test_connection_server_close
-                --skip=test_connection_wait_queue_force_close
-
-      - name: Clear the cargo caches
-        run: |
-          cargo install cargo-cache --no-default-features --features ci-autoclean
-          cargo-cache

.gitignore

@@ -16,3 +16,6 @@ guide/build/
 
 # Configuration directory generated by CLion
 .idea
+
+# Configuration directory generated by VSCode
+.vscode

CHANGES.md

@@ -3,6 +3,217 @@
 ## Unreleased - 2021-xx-xx
 
 
+## 4.0.0-beta.12 - 2021-11-22
+### Changed
+* Compress middleware's response type is now `AnyBody<Encoder<B>>`. [#2448]
+
+### Fixed
+* Relax `Unpin` bound on `S` (stream) parameter of `HttpResponseBuilder::streaming`. [#2448]
+
+### Removed
+* `dev::ResponseBody` re-export; is function is replaced by the new `dev::AnyBody` enum. [#2446]
+
+[#2446]: https://github.com/actix/actix-web/pull/2446
+[#2448]: https://github.com/actix/actix-web/pull/2448
+
+
+## 4.0.0-beta.11 - 2021-11-15
+### Added
+* Re-export `dev::ServerHandle` from `actix-server`. [#2442]
+
+### Changed
+* `ContentType::html` now produces `text/html; charset=utf-8` instead of `text/html`. [#2423]
+* Update `actix-server` to `2.0.0-beta.9`. [#2442]
+
+[#2423]: https://github.com/actix/actix-web/pull/2423
+[#2442]: https://github.com/actix/actix-web/pull/2442
+
+
+## 4.0.0-beta.10 - 2021-10-20
+### Added
+* Option to allow `Json` extractor to work without a `Content-Type` header present. [#2362]
+* `#[actix_web::test]` macro for setting up tests with a runtime. [#2409]
+
+### Changed
+* Associated type `FromRequest::Config` was removed. [#2233]
+* Inner field made private on `web::Payload`. [#2384]
+* `Data::into_inner` and `Data::get_ref` no longer requires `T: Sized`. [#2403]
+* Updated rustls to v0.20. [#2414]
+* Minimum supported Rust version (MSRV) is now 1.52.
+
+### Removed
+* Useless `ServiceResponse::checked_expr` method. [#2401]
+
+[#2233]: https://github.com/actix/actix-web/pull/2233
+[#2362]: https://github.com/actix/actix-web/pull/2362
+[#2384]: https://github.com/actix/actix-web/pull/2384
+[#2401]: https://github.com/actix/actix-web/pull/2401
+[#2403]: https://github.com/actix/actix-web/pull/2403
+[#2409]: https://github.com/actix/actix-web/pull/2409
+[#2414]: https://github.com/actix/actix-web/pull/2414
+
+
+## 4.0.0-beta.9 - 2021-09-09
+### Added
+* Re-export actix-service `ServiceFactory` in `dev` module. [#2325]
+
+### Changed
+* Compress middleware will return 406 Not Acceptable when no content encoding is acceptable to the client. [#2344]
+* Move `BaseHttpResponse` to `dev::Response`. [#2379]
+* Enable `TestRequest::param` to accept more than just static strings. [#2172]
+* Minimum supported Rust version (MSRV) is now 1.51.
+
+### Fixed
+* Fix quality parse error in Accept-Encoding header. [#2344]
+* Re-export correct type at `web::HttpResponse`. [#2379]
+
+[#2172]: https://github.com/actix/actix-web/pull/2172
+[#2325]: https://github.com/actix/actix-web/pull/2325
+[#2344]: https://github.com/actix/actix-web/pull/2344
+[#2379]: https://github.com/actix/actix-web/pull/2379
+
+
+## 4.0.0-beta.8 - 2021-06-26
+### Added
+* Add `ServiceRequest::parts_mut`. [#2177]
+* Add extractors for `Uri` and `Method`. [#2263]
+* Add extractors for `ConnectionInfo` and `PeerAddr`. [#2263]
+* Add `Route::service` for using hand-written services as handlers. [#2262]
+
+### Changed
+* Change compression algorithm features flags. [#2250]
+* Deprecate `App::data` and `App::data_factory`. [#2271]
+* Smarter extraction of `ConnectionInfo` parts. [#2282]
+
+### Fixed
+* Scope and Resource middleware can access data items set on their own layer. [#2288]
+
+[#2177]: https://github.com/actix/actix-web/pull/2177
+[#2250]: https://github.com/actix/actix-web/pull/2250
+[#2271]: https://github.com/actix/actix-web/pull/2271
+[#2262]: https://github.com/actix/actix-web/pull/2262
+[#2263]: https://github.com/actix/actix-web/pull/2263
+[#2282]: https://github.com/actix/actix-web/pull/2282
+[#2288]: https://github.com/actix/actix-web/pull/2288
+
+
+## 4.0.0-beta.7 - 2021-06-17
+### Added
+* `HttpServer::worker_max_blocking_threads` for setting block thread pool. [#2200]
+
+### Changed
+* Adjusted default JSON payload limit to 2MB (from 32kb) and included size and limits in the `JsonPayloadError::Overflow` error variant. [#2162]
+[#2162]: (https://github.com/actix/actix-web/pull/2162)
+* `ServiceResponse::error_response` now uses body type of `Body`. [#2201]
+* `ServiceResponse::checked_expr` now returns a `Result`. [#2201]
+* Update `language-tags` to `0.3`.
+* `ServiceResponse::take_body`. [#2201]
+* `ServiceResponse::map_body` closure receives and returns `B` instead of `ResponseBody<B>` types. [#2201]
+* All error trait bounds in server service builders have changed from `Into<Error>` to `Into<Response<AnyBody>>`. [#2253]
+* All error trait bounds in message body and stream impls changed from `Into<Error>` to `Into<Box<dyn std::error::Error>>`. [#2253]
+* `HttpServer::{listen_rustls(), bind_rustls()}` now honor the ALPN protocols in the configuation parameter. [#2226]
+* `middleware::normalize` now will not try to normalize URIs with no valid path [#2246]
+
+### Removed
+* `HttpResponse::take_body` and old `HttpResponse::into_body` method that casted body type. [#2201]
+
+[#2200]: https://github.com/actix/actix-web/pull/2200
+[#2201]: https://github.com/actix/actix-web/pull/2201
+[#2253]: https://github.com/actix/actix-web/pull/2253
+[#2246]: https://github.com/actix/actix-web/pull/2246
+
+
+## 4.0.0-beta.6 - 2021-04-17
+### Added
+* `HttpResponse` and `HttpResponseBuilder` structs. [#2065]
+
+### Changed
+* Most error types are now marked `#[non_exhaustive]`. [#2148]
+* Methods on `ContentDisposition` that took `T: AsRef<str>` now take `impl AsRef<str>`.
+
+[#2065]: https://github.com/actix/actix-web/pull/2065
+[#2148]: https://github.com/actix/actix-web/pull/2148
+
+
+## 4.0.0-beta.5 - 2021-04-02
+### Added
+* `Header` extractor for extracting common HTTP headers in handlers. [#2094]
+* Added `TestServer::client_headers` method. [#2097]
+
+### Fixed
+* Double ampersand in Logger format is escaped correctly. [#2067]
+
+### Changed
+* `CustomResponder` would return error as `HttpResponse` when `CustomResponder::with_header` failed
+  instead of skipping. (Only the first error is kept when multiple error occur) [#2093]
+
+### Removed
+* The `client` mod was removed. Clients should now use `awc` directly.
+  [871ca5e4](https://github.com/actix/actix-web/commit/871ca5e4ae2bdc22d1ea02701c2992fa8d04aed7)
+* Integration testing was moved to new `actix-test` crate. Namely these items from the `test`
+  module: `TestServer`, `TestServerConfig`, `start`, `start_with`, and `unused_addr`. [#2112]
+
+[#2067]: https://github.com/actix/actix-web/pull/2067
+[#2093]: https://github.com/actix/actix-web/pull/2093
+[#2094]: https://github.com/actix/actix-web/pull/2094
+[#2097]: https://github.com/actix/actix-web/pull/2097
+[#2112]: https://github.com/actix/actix-web/pull/2112
+
+
+## 4.0.0-beta.4 - 2021-03-09
+### Changed
+* Feature `cookies` is now optional and enabled by default. [#1981]
+* `JsonBody::new` returns a default limit of 32kB to be consistent with `JsonConfig` and the default
+  behaviour of the `web::Json<T>` extractor. [#2010]
+
+[#1981]: https://github.com/actix/actix-web/pull/1981
+[#2010]: https://github.com/actix/actix-web/pull/2010
+
+
+## 4.0.0-beta.3 - 2021-02-10
+* Update `actix-web-codegen` to `0.5.0-beta.1`.
+
+
+## 4.0.0-beta.2 - 2021-02-10
+### Added
+* The method `Either<web::Json<T>, web::Form<T>>::into_inner()` which returns the inner type for
+  whichever variant was created. Also works for `Either<web::Form<T>, web::Json<T>>`. [#1894]
+* Add `services!` macro for helping register multiple services to `App`. [#1933]
+* Enable registering a vec of services of the same type to `App` [#1933]
+
+### Changed
+* Rework `Responder` trait to be sync and returns `Response`/`HttpResponse` directly.
+  Making it simpler and more performant. [#1891]
+* `ServiceRequest::into_parts` and `ServiceRequest::from_parts` can no longer fail. [#1893]
+* `ServiceRequest::from_request` can no longer fail. [#1893]
+* Our `Either` type now uses `Left`/`Right` variants (instead of `A`/`B`) [#1894]
+* `test::{call_service, read_response, read_response_json, send_request}` take `&Service`
+  in argument [#1905]
+* `App::wrap_fn`, `Resource::wrap_fn` and `Scope::wrap_fn` provide `&Service` in closure
+  argument. [#1905]
+* `web::block` no longer requires the output is a Result. [#1957]
+
+### Fixed
+* Multiple calls to `App::data` with the same type now keeps the latest call's data. [#1906]
+
+### Removed
+* Public field of `web::Path` has been made private. [#1894]
+* Public field of `web::Query` has been made private. [#1894]
+* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
+* `AppService::set_service_data`; for custom HTTP service factories adding application data, use the
+  layered data model by calling `ServiceRequest::add_data_container` when handling
+  requests instead. [#1906]
+
+[#1891]: https://github.com/actix/actix-web/pull/1891
+[#1893]: https://github.com/actix/actix-web/pull/1893
+[#1894]: https://github.com/actix/actix-web/pull/1894
+[#1869]: https://github.com/actix/actix-web/pull/1869
+[#1905]: https://github.com/actix/actix-web/pull/1905
+[#1906]: https://github.com/actix/actix-web/pull/1906
+[#1933]: https://github.com/actix/actix-web/pull/1933
+[#1957]: https://github.com/actix/actix-web/pull/1957
+
+
 ## 4.0.0-beta.1 - 2021-01-07
 ### Added
 * `Compat` middleware enabling generic response body/error type of middlewares like `Logger` and
@@ -24,13 +235,15 @@
 ### Removed
 * Public modules `middleware::{normalize, err_handlers}`. All necessary middleware structs are now
   exposed directly by the `middleware` module.
+* Remove `actix-threadpool` as dependency. `actix_threadpool::BlockingError` error type can be imported 
+  from `actix_web::error` module. [#1878]
 
 [#1812]: https://github.com/actix/actix-web/pull/1812
 [#1813]: https://github.com/actix/actix-web/pull/1813
 [#1852]: https://github.com/actix/actix-web/pull/1852
 [#1865]: https://github.com/actix/actix-web/pull/1865
 [#1875]: https://github.com/actix/actix-web/pull/1875
-
+[#1878]: https://github.com/actix/actix-web/pull/1878
 
 ## 3.3.2 - 2020-12-01
 ### Fixed
@@ -115,7 +328,7 @@
 
 ## 3.0.0-beta.4 - 2020-09-09
 ### Added
-* `middleware::NormalizePath` now has configurable behaviour for either always having a trailing
+* `middleware::NormalizePath` now has configurable behavior for either always having a trailing 
   slash, or as the new addition, always trimming trailing slashes. [#1639]
 
 ### Changed
@@ -443,7 +656,7 @@
 
 ## [1.0.0-rc] - 2019-05-18
 
-### Add
+### Added
 
 * Add `Query<T>::from_query()` to extract parameters from a query string. #846
 * `QueryConfig`, similar to `JsonConfig` for customizing error handling of query extractors.
@@ -459,7 +672,7 @@
 
 ## [1.0.0-beta.4] - 2019-05-12
 
-### Add
+### Added
 
 * Allow to set/override app data on scope level
 
@@ -485,7 +698,7 @@
 
 * CORS handling without headers #702
 
-* Allow to construct `Data` instances to avoid double `Arc` for `Send + Sync` types.
+* Allow constructing `Data` instances to avoid double `Arc` for `Send + Sync` types.
 
 ### Fixed
 
@@ -549,7 +762,7 @@
 
 ### Changed
 
-* Allow to use any service as default service.
+* Allow using any service as default service.
 
 * Remove generic type for request payload, always use default.
 
@@ -612,13 +825,13 @@
 
 ### Added
 
-* rustls support
+* Rustls support
 
 ### Changed
 
-* use forked cookie
+* Use forked cookie
 
-* multipart::Field renamed to MultipartField
+* Multipart::Field renamed to MultipartField
 
 ## [1.0.0-alpha.1] - 2019-03-28
 

Cargo.toml

@@ -1,121 +1,130 @@
 [package]
 name = "actix-web"
-version = "4.0.0-beta.1"
+version = "4.0.0-beta.12"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust"
-readme = "README.md"
 keywords = ["actix", "http", "web", "framework", "async"]
+categories = [
+    "network-programming",
+    "asynchronous",
+    "web-programming::http-server",
+    "web-programming::websocket"
+]
 homepage = "https://actix.rs"
 repository = "https://github.com/actix/actix-web.git"
-documentation = "https://docs.rs/actix-web/"
-categories = ["network-programming", "asynchronous",
-              "web-programming::http-server",
-              "web-programming::websocket"]
 license = "MIT OR Apache-2.0"
 edition = "2018"
 
 [package.metadata.docs.rs]
-features = ["openssl", "rustls", "compress", "secure-cookies"]
-
-[badges]
-travis-ci = { repository = "actix/actix-web", branch = "master" }
-codecov = { repository = "actix/actix-web", branch = "master", service = "github" }
+# features that docs.rs will build with
+features = ["openssl", "rustls", "compress-brotli", "compress-gzip", "compress-zstd", "cookies", "secure-cookies"]
+rustdoc-args = ["--cfg", "docsrs"]
 
 [lib]
 name = "actix_web"
 path = "src/lib.rs"
 
 [workspace]
+resolver = "2"
 members = [
-  ".",
-  "awc",
-  "actix-http",
-  "actix-files",
-  "actix-multipart",
-  "actix-web-actors",
-  "actix-web-codegen",
-  "actix-http-test",
+    ".",
+    "awc",
+    "actix-http",
+    "actix-files",
+    "actix-multipart",
+    "actix-web-actors",
+    "actix-web-codegen",
+    "actix-http-test",
+    "actix-test",
+    "actix-router",
 ]
 
 [features]
-default = ["compress"]
+default = ["compress-brotli", "compress-gzip", "compress-zstd", "cookies"]
 
-# content-encoding support
-compress = ["actix-http/compress", "awc/compress"]
+# Brotli algorithm content-encoding support
+compress-brotli = ["actix-http/compress-brotli", "__compress"]
+# Gzip and deflate algorithms content-encoding support
+compress-gzip = ["actix-http/compress-gzip", "__compress"]
+# Zstd algorithm content-encoding support
+compress-zstd = ["actix-http/compress-zstd", "__compress"]
 
-# sessions feature
-secure-cookies = ["actix-http/secure-cookies"]
+# support for cookies
+cookies = ["cookie"]
+
+# secure cookies feature
+secure-cookies = ["cookie/secure"]
 
 # openssl
-openssl = ["actix-tls/accept", "actix-tls/openssl", "awc/openssl", "open-ssl"]
+openssl = ["actix-http/openssl", "actix-tls/accept", "actix-tls/openssl"]
 
 # rustls
-rustls = ["actix-tls/accept", "actix-tls/rustls", "awc/rustls", "rust-tls"]
+rustls = ["actix-http/rustls", "actix-tls/accept", "actix-tls/rustls"]
 
-[[example]]
-name = "basic"
-required-features = ["compress"]
+# Internal (PRIVATE!) features used to aid testing and checking feature status.
+# Don't rely on these whatsoever. They may disappear at anytime.
+__compress = []
 
-[[example]]
-name = "uds"
-required-features = ["compress"]
-
-[[test]]
-name = "test_server"
-required-features = ["compress"]
-
-[[example]]
-name = "on_connect"
-required-features = []
-
-[[example]]
-name = "client"
-required-features = ["rustls"]
+# io-uring feature only avaiable for Linux OSes.
+experimental-io-uring = ["actix-server/io-uring"]
 
 [dependencies]
-actix-codec = "0.4.0-beta.1"
-actix-macros = "0.1.0"
-actix-router = "0.2.4"
-actix-rt = "2.0.0-beta.1"
-actix-server = "2.0.0-beta.2"
-actix-service = "2.0.0-beta.2"
-actix-utils = "3.0.0-beta.1"
-actix-threadpool = "0.3.1"
-actix-tls = { version = "3.0.0-beta.2", default-features = false, optional = true }
+actix-codec = "0.4.1"
+actix-macros = "0.2.3"
+actix-rt = "2.3"
+actix-server = "2.0.0-beta.9"
+actix-service = "2.0.0"
+actix-utils = "3.0.0"
+actix-tls = { version = "3.0.0-beta.9", default-features = false, optional = true }
 
-actix-web-codegen = "0.4.0"
-actix-http = "3.0.0-beta.1"
-awc = { version = "3.0.0-beta.1", default-features = false }
+actix-http = "3.0.0-beta.13"
+actix-router = "0.5.0-beta.2"
+actix-web-codegen = "0.5.0-beta.5"
 
-ahash = "0.6"
+ahash = "0.7"
 bytes = "1"
+cfg-if = "1"
+cookie = { version = "0.15", features = ["percent-encode"], optional = true }
 derive_more = "0.99.5"
+either = "1.5.3"
 encoding_rs = "0.8"
 futures-core = { version = "0.3.7", default-features = false }
 futures-util = { version = "0.3.7", default-features = false }
+itoa = "0.4"
+language-tags = "0.3"
+once_cell = "1.5"
 log = "0.4"
 mime = "0.3"
-socket2 = "0.3.16"
+paste = "1"
 pin-project = "1.0.0"
 regex = "1.4"
 serde = { version = "1.0", features = ["derive"] }
 serde_json = "1.0"
 serde_urlencoded = "0.7"
-time = { version = "0.2.7", default-features = false, features = ["std"] }
+smallvec = "1.6.1"
+socket2 = "0.4.0"
+time = { version = "0.3", default-features = false, features = ["formatting"] }
 url = "2.1"
-open-ssl = { package = "openssl", version = "0.10", optional = true }
-rust-tls = { package = "rustls", version = "0.19.0", optional = true }
-smallvec = "1.6"
 
 [dev-dependencies]
-actix = "0.11.0-beta.1"
-actix-http = { version = "3.0.0-beta.1", features = ["actors"] }
-rand = "0.8"
-env_logger = "0.8"
-serde_derive = "1.0"
+actix-test = { version = "0.1.0-beta.7", features = ["openssl", "rustls"] }
+awc = { version = "3.0.0-beta.11", features = ["openssl"] }
+
 brotli2 = "0.3.2"
+criterion = { version = "0.3", features = ["html_reports"] }
+env_logger = "0.9"
 flate2 = "1.0.13"
-criterion = "0.3"
+futures-util = { version = "0.3.7", default-features = false, features = ["std"] }
+rand = "0.8"
+rcgen = "0.8"
+rustls-pemfile = "0.2"
+tls-openssl = { package = "openssl", version = "0.10.9" }
+tls-rustls = { package = "rustls", version = "0.20.0" }
+zstd = "0.9"
+
+[profile.dev]
+# Disabling debug info speeds up builds a bunch and we don't rely on it for debugging that much.
+debug = 0
 
 [profile.release]
 lto = true
@@ -123,15 +132,33 @@ opt-level = 3
 codegen-units = 1
 
 [patch.crates-io]
-actix-web = { path = "." }
+actix-files = { path = "actix-files" }
 actix-http = { path = "actix-http" }
 actix-http-test = { path = "actix-http-test" }
+actix-multipart = { path = "actix-multipart" }
+actix-router = { path = "actix-router" }
+actix-test = { path = "actix-test" }
+actix-web = { path = "." }
 actix-web-actors = { path = "actix-web-actors" }
 actix-web-codegen = { path = "actix-web-codegen" }
-actix-multipart = { path = "actix-multipart" }
-actix-files = { path = "actix-files" }
 awc = { path = "awc" }
 
+[[test]]
+name = "test_server"
+required-features = ["compress-brotli", "compress-gzip", "compress-zstd", "cookies"]
+
+[[example]]
+name = "basic"
+required-features = ["compress-gzip"]
+
+[[example]]
+name = "uds"
+required-features = ["compress-gzip"]
+
+[[example]]
+name = "on_connect"
+required-features = []
+
 [[bench]]
 name = "server"
 harness = false
@@ -139,3 +166,7 @@ harness = false
 [[bench]]
 name = "service"
 harness = false
+
+[[bench]]
+name = "responder"
+harness = false

LICENSE-MIT

@@ -1,4 +1,4 @@
-Copyright (c) 2017 Actix Team
+Copyright (c) 2017-NOW Actix Team
 
 Permission is hereby granted, free of charge, to any
 person obtaining a copy of this software and associated

MIGRATION.md

@@ -3,13 +3,28 @@
 * The default `NormalizePath` behavior now strips trailing slashes by default. This was
   previously documented to be the case in v3 but the behavior now matches. The effect is that
   routes defined with trailing slashes will become inaccessible when
-  using `NormalizePath::default()`.
+  using `NormalizePath::default()`. As such, calling `NormalizePath::default()` will log a warning.
+  It is advised that the `new` method be used instead.
   
-  Before: `#[get("/test/")`  
-  After: `#[get("/test")`  
+  Before: `#[get("/test/")]`  
+  After:  `#[get("/test")]`  
 
   Alternatively, explicitly require trailing slashes: `NormalizePath::new(TrailingSlash::Always)`.
 
+* The `type Config` of `FromRequest` was removed.
+
+* Feature flag `compress` has been split into its supported algorithm (brotli, gzip, zstd).
+  By default all compression algorithms are enabled.
+  To select algorithm you want to include with `middleware::Compress` use following flags:
+  - `compress-brotli`
+  - `compress-gzip`
+  - `compress-zstd`
+  If you have set in your `Cargo.toml` dedicated `actix-web` features and you still want
+  to have compression enabled. Please change features selection like bellow:
+
+  Before: `"compress"`
+  After: `"compress-brotli", "compress-gzip", "compress-zstd"`
+
 
 ## 3.0.0
 

README.md

@@ -1,20 +1,19 @@
 <div align="center">
-  <h1>Actix web</h1>
+  <h1>Actix Web</h1>
   <p>
     <strong>Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust</strong>
   </p>
   <p>
 
 [![crates.io](https://img.shields.io/crates/v/actix-web?label=latest)](https://crates.io/crates/actix-web)
-[![Documentation](https://docs.rs/actix-web/badge.svg?version=3.3.2)](https://docs.rs/actix-web/3.3.2)
-[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
-![License](https://img.shields.io/crates/l/actix-web.svg)
-[![Dependency Status](https://deps.rs/crate/actix-web/3.3.2/status.svg)](https://deps.rs/crate/actix-web/3.3.2)
+[![Documentation](https://docs.rs/actix-web/badge.svg?version=4.0.0-beta.12)](https://docs.rs/actix-web/4.0.0-beta.12)
+[![Version](https://img.shields.io/badge/rustc-1.52+-ab6000.svg)](https://blog.rust-lang.org/2021/05/06/Rust-1.52.0.html)
+![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-web.svg)
+[![Dependency Status](https://deps.rs/crate/actix-web/4.0.0-beta.12/status.svg)](https://deps.rs/crate/actix-web/4.0.0-beta.12)
 <br />
-[![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) 
+[![build status](https://github.com/actix/actix-web/workflows/CI%20%28Linux%29/badge.svg?branch=master&event=push)](https://github.com/actix/actix-web/actions)
 [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) 
-[![Download](https://img.shields.io/crates/d/actix-web.svg)](https://crates.io/crates/actix-web)
-[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+![downloads](https://img.shields.io/crates/d/actix-web.svg)
 [![Chat on Discord](https://img.shields.io/discord/771444961383153695?label=chat&logo=discord)](https://discord.gg/NWpN5mmg3x)
 
   </p>
@@ -26,15 +25,14 @@
 * Streaming and pipelining
 * Keep-alive and slow requests handling
 * Client/server [WebSockets](https://actix.rs/docs/websockets/) support
-* Transparent content compression/decompression (br, gzip, deflate)
+* Transparent content compression/decompression (br, gzip, deflate, zstd)
 * Powerful [request routing](https://actix.rs/docs/url-dispatch/)
 * Multipart streams
 * Static assets
 * SSL support using OpenSSL or Rustls
 * Middlewares ([Logger, Session, CORS, etc](https://actix.rs/docs/middleware/))
-* Includes an async [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
-* Supports [Actix actor framework](https://github.com/actix/actix)
-* Runs on stable Rust 1.46+
+* Includes an async [HTTP client](https://docs.rs/awc/)
+* Runs on stable Rust 1.52+
 
 ## Documentation
 
@@ -73,18 +71,18 @@ async fn main() -> std::io::Result<()> {
 
 ### More examples
 
-* [Basic Setup](https://github.com/actix/examples/tree/master/basics/)
-* [Application State](https://github.com/actix/examples/tree/master/state/)
-* [JSON Handling](https://github.com/actix/examples/tree/master/json/)
-* [Multipart Streams](https://github.com/actix/examples/tree/master/multipart/)
-* [Diesel Integration](https://github.com/actix/examples/tree/master/diesel/)
-* [r2d2 Integration](https://github.com/actix/examples/tree/master/r2d2/)
-* [Simple WebSocket](https://github.com/actix/examples/tree/master/websocket/)
-* [Tera Templates](https://github.com/actix/examples/tree/master/template_tera/)
-* [Askama Templates](https://github.com/actix/examples/tree/master/template_askama/)
-* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/rustls/)
-* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/openssl/)
-* [WebSocket Chat](https://github.com/actix/examples/tree/master/websocket-chat/)
+* [Basic Setup](https://github.com/actix/examples/tree/master/basics/basics/)
+* [Application State](https://github.com/actix/examples/tree/master/basics/state/)
+* [JSON Handling](https://github.com/actix/examples/tree/master/json/json/)
+* [Multipart Streams](https://github.com/actix/examples/tree/master/forms/multipart/)
+* [Diesel Integration](https://github.com/actix/examples/tree/master/database_interactions/diesel/)
+* [r2d2 Integration](https://github.com/actix/examples/tree/master/database_interactions/r2d2/)
+* [Simple WebSocket](https://github.com/actix/examples/tree/master/websockets/websocket/)
+* [Tera Templates](https://github.com/actix/examples/tree/master/template_engines/tera/)
+* [Askama Templates](https://github.com/actix/examples/tree/master/template_engines/askama/)
+* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/security/rustls/)
+* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/security/openssl/)
+* [WebSocket Chat](https://github.com/actix/examples/tree/master/websockets/chat/)
 
 You may consider checking out
 [this directory](https://github.com/actix/examples/tree/master/) for more examples.
@@ -92,16 +90,16 @@ You may consider checking out
 ## Benchmarks
 
 One of the fastest web frameworks available according to the
-[TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r19).
+[TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r20&test=composite).
 
 ## License
 
 This project is licensed under either of
 
 * Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or
-  [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
+  [http://www.apache.org/licenses/LICENSE-2.0])
 * MIT license ([LICENSE-MIT](LICENSE-MIT) or
-  [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
+  [http://opensource.org/licenses/MIT])
 
 at your option.
 

actix-files/CHANGES.md

@@ -3,6 +3,64 @@
 ## Unreleased - 2021-xx-xx
 
 
+## 0.6.0-beta.9 - 2021-11-22
+* Add crate feature `experimental-io-uring`, enabling async file I/O to be utilized. This feature is only available on Linux OSes with recent kernel versions. This feature is semver-exempt. [#2408]
+* Add `NamedFile::open_async`. [#2408]
+* Fix 304 Not Modified responses to omit the Content-Length header, as per the spec. [#2453]
+* The `Responder` impl for `NamedFile` now has a boxed future associated type. [#2408]
+* The `Service` impl for `NamedFileService` now has a boxed future associated type. [#2408]
+* Add `impl Clone` for `FilesService`. [#2408]
+
+[#2408]: https://github.com/actix/actix-web/pull/2408
+[#2453]: https://github.com/actix/actix-web/pull/2453
+
+
+## 0.6.0-beta.8 - 2021-10-20
+* Minimum supported Rust version (MSRV) is now 1.52.
+
+
+## 0.6.0-beta.7 - 2021-09-09
+* Minimum supported Rust version (MSRV) is now 1.51.
+
+
+## 0.6.0-beta.6 - 2021-06-26
+* Added `Files::path_filter()`. [#2274]
+* `Files::show_files_listing()` can now be used with `Files::index_file()` to show files listing as a fallback when the index file is not found. [#2228]
+
+[#2274]: https://github.com/actix/actix-web/pull/2274
+[#2228]: https://github.com/actix/actix-web/pull/2228
+
+
+## 0.6.0-beta.5 - 2021-06-17
+* `NamedFile` now implements `ServiceFactory` and `HttpServiceFactory` making it much more useful in routing. For example, it can be used directly as a default service. [#2135]
+* For symbolic links, `Content-Disposition` header no longer shows the filename of the original file. [#2156]
+* `Files::redirect_to_slash_directory()` now works as expected when used with `Files::show_files_listing()`. [#2225]
+* `application/{javascript, json, wasm}` mime type now have `inline` disposition by default. [#2257]
+
+[#2135]: https://github.com/actix/actix-web/pull/2135
+[#2156]: https://github.com/actix/actix-web/pull/2156
+[#2225]: https://github.com/actix/actix-web/pull/2225
+[#2257]: https://github.com/actix/actix-web/pull/2257
+
+
+## 0.6.0-beta.4 - 2021-04-02
+* Add support for `.guard` in `Files` to selectively filter `Files` services. [#2046]
+
+[#2046]: https://github.com/actix/actix-web/pull/2046
+
+
+## 0.6.0-beta.3 - 2021-03-09
+* No notable changes.
+
+
+## 0.6.0-beta.2 - 2021-02-10
+* Fix If-Modified-Since and If-Unmodified-Since to not compare using sub-second timestamps. [#1887]
+* Replace `v_htmlescape` with `askama_escape`. [#1953]
+
+[#1887]: https://github.com/actix/actix-web/pull/1887
+[#1953]: https://github.com/actix/actix-web/pull/1953
+
+
 ## 0.6.0-beta.1 - 2021-01-07
 * `HttpRange::parse` now has its own error type.
 * Update `bytes` to `1.0`. [#1813]

actix-files/Cargo.toml

@@ -1,13 +1,15 @@
 [package]
 name = "actix-files"
-version = "0.6.0-beta.1"
-authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
+version = "0.6.0-beta.9"
+authors = [
+    "Nikolay Kim <fafhrd91@gmail.com>",
+    "fakeshadow <24548779@qq.com>",
+    "Rob Ede <robjtede@icloud.com>",
+]
 description = "Static file serving for Actix Web"
-readme = "README.md"
 keywords = ["actix", "http", "async", "futures"]
 homepage = "https://actix.rs"
-repository = "https://github.com/actix/actix-web.git"
-documentation = "https://docs.rs/actix-files/"
+repository = "https://github.com/actix/actix-web"
 categories = ["asynchronous", "web-programming::http-server"]
 license = "MIT OR Apache-2.0"
 edition = "2018"
@@ -16,20 +18,29 @@ edition = "2018"
 name = "actix_files"
 path = "src/lib.rs"
 
+[features]
+experimental-io-uring = ["actix-web/experimental-io-uring", "tokio-uring"]
+
 [dependencies]
-actix-web = { version = "4.0.0-beta.1", default-features = false }
-actix-service = "2.0.0-beta.2"
+actix-web = { version = "4.0.0-beta.11", default-features = false }
+actix-http = "3.0.0-beta.13"
+actix-service = "2.0.0"
+
+askama_escape = "0.10"
 bitflags = "1"
 bytes = "1"
-futures-core = { version = "0.3.7", default-features = false }
-futures-util = { version = "0.3.7", default-features = false }
+futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
+http-range = "0.1.4"
 derive_more = "0.99.5"
 log = "0.4"
 mime = "0.3"
 mime_guess = "2.0.1"
 percent-encoding = "2.1"
-v_htmlescape = "0.12"
+pin-project-lite = "0.2.7"
+
+tokio-uring = { version = "0.1", optional = true }
 
 [dev-dependencies]
-actix-rt = "2.0.0-beta.1"
-actix-web = "4.0.0-beta.1"
+actix-rt = "2.2"
+actix-web = "4.0.0-beta.11"
+actix-test = "0.1.0-beta.7"

actix-files/README.md

@@ -3,17 +3,16 @@
 > Static file serving for Actix Web
 
 [![crates.io](https://img.shields.io/crates/v/actix-files?label=latest)](https://crates.io/crates/actix-files)
-[![Documentation](https://docs.rs/actix-files/badge.svg?version=0.5.0)](https://docs.rs/actix-files/0.5.0)
-[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
+[![Documentation](https://docs.rs/actix-files/badge.svg?version=0.6.0-beta.9)](https://docs.rs/actix-files/0.6.0-beta.9)
+[![Version](https://img.shields.io/badge/rustc-1.52+-ab6000.svg)](https://blog.rust-lang.org/2021/05/06/Rust-1.52.0.html)
 ![License](https://img.shields.io/crates/l/actix-files.svg)
 <br />
-[![dependency status](https://deps.rs/crate/actix-files/0.5.0/status.svg)](https://deps.rs/crate/actix-files/0.5.0)
+[![dependency status](https://deps.rs/crate/actix-files/0.6.0-beta.9/status.svg)](https://deps.rs/crate/actix-files/0.6.0-beta.9)
 [![Download](https://img.shields.io/crates/d/actix-files.svg)](https://crates.io/crates/actix-files)
-[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+[![Chat on Discord](https://img.shields.io/discord/771444961383153695?label=chat&logo=discord)](https://discord.gg/NWpN5mmg3x)
 
 ## Documentation & Resources
 
 - [API Documentation](https://docs.rs/actix-files/)
-- [Example Project](https://github.com/actix/examples/tree/master/static_index)
-- [Chat on Gitter](https://gitter.im/actix/actix-web)
-- Minimum supported Rust version: 1.46 or later
+- [Example Project](https://github.com/actix/examples/tree/master/basics/static_index)
+- Minimum Supported Rust Version (MSRV): 1.52

actix-files/src/chunked.rs

@@ -1,94 +1,278 @@
 use std::{
     cmp, fmt,
-    fs::File,
     future::Future,
-    io::{self, Read, Seek},
+    io,
     pin::Pin,
     task::{Context, Poll},
 };
 
-use actix_web::{
-    error::{BlockingError, Error},
-    web,
-};
+use actix_web::error::Error;
 use bytes::Bytes;
 use futures_core::{ready, Stream};
-use futures_util::future::{FutureExt, LocalBoxFuture};
+use pin_project_lite::pin_project;
 
-use crate::handle_error;
+use super::named::File;
 
-type ChunkedBoxFuture =
-    LocalBoxFuture<'static, Result<(File, Bytes), BlockingError<io::Error>>>;
-
-#[doc(hidden)]
-/// A helper created from a `std::fs::File` which reads the file
-/// chunk-by-chunk on a `ThreadPool`.
-pub struct ChunkedReadFile {
-    pub(crate) size: u64,
-    pub(crate) offset: u64,
-    pub(crate) file: Option<File>,
-    pub(crate) fut: Option<ChunkedBoxFuture>,
-    pub(crate) counter: u64,
+pin_project! {
+    /// Adapter to read a `std::file::File` in chunks.
+    #[doc(hidden)]
+    pub struct ChunkedReadFile<F, Fut> {
+        size: u64,
+        offset: u64,
+        #[pin]
+        state: ChunkedReadFileState<Fut>,
+        counter: u64,
+        callback: F,
+    }
 }
 
-impl fmt::Debug for ChunkedReadFile {
+#[cfg(not(feature = "experimental-io-uring"))]
+pin_project! {
+    #[project = ChunkedReadFileStateProj]
+    #[project_replace = ChunkedReadFileStateProjReplace]
+    enum ChunkedReadFileState<Fut> {
+        File { file: Option<File>, },
+        Future { #[pin] fut: Fut },
+    }
+}
+
+#[cfg(feature = "experimental-io-uring")]
+pin_project! {
+    #[project = ChunkedReadFileStateProj]
+    #[project_replace = ChunkedReadFileStateProjReplace]
+    enum ChunkedReadFileState<Fut> {
+        File { file: Option<(File, BytesMut)> },
+        Future { #[pin] fut: Fut },
+    }
+}
+
+impl<F, Fut> fmt::Debug for ChunkedReadFile<F, Fut> {
     fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         f.write_str("ChunkedReadFile")
     }
 }
 
-impl Stream for ChunkedReadFile {
+pub(crate) fn new_chunked_read(
+    size: u64,
+    offset: u64,
+    file: File,
+) -> impl Stream<Item = Result<Bytes, Error>> {
+    ChunkedReadFile {
+        size,
+        offset,
+        #[cfg(not(feature = "experimental-io-uring"))]
+        state: ChunkedReadFileState::File { file: Some(file) },
+        #[cfg(feature = "experimental-io-uring")]
+        state: ChunkedReadFileState::File {
+            file: Some((file, BytesMut::new())),
+        },
+        counter: 0,
+        callback: chunked_read_file_callback,
+    }
+}
+
+#[cfg(not(feature = "experimental-io-uring"))]
+async fn chunked_read_file_callback(
+    mut file: File,
+    offset: u64,
+    max_bytes: usize,
+) -> Result<(File, Bytes), Error> {
+    use io::{Read as _, Seek as _};
+
+    let res = actix_web::rt::task::spawn_blocking(move || {
+        let mut buf = Vec::with_capacity(max_bytes);
+
+        file.seek(io::SeekFrom::Start(offset))?;
+
+        let n_bytes = file.by_ref().take(max_bytes as u64).read_to_end(&mut buf)?;
+
+        if n_bytes == 0 {
+            Err(io::Error::from(io::ErrorKind::UnexpectedEof))
+        } else {
+            Ok((file, Bytes::from(buf)))
+        }
+    })
+    .await
+    .map_err(|_| actix_web::error::BlockingError)??;
+
+    Ok(res)
+}
+
+#[cfg(feature = "experimental-io-uring")]
+async fn chunked_read_file_callback(
+    file: File,
+    offset: u64,
+    max_bytes: usize,
+    mut bytes_mut: BytesMut,
+) -> io::Result<(File, Bytes, BytesMut)> {
+    bytes_mut.reserve(max_bytes);
+
+    let (res, mut bytes_mut) = file.read_at(bytes_mut, offset).await;
+    let n_bytes = res?;
+
+    if n_bytes == 0 {
+        return Err(io::ErrorKind::UnexpectedEof.into());
+    }
+
+    let bytes = bytes_mut.split_to(n_bytes).freeze();
+
+    Ok((file, bytes, bytes_mut))
+}
+
+#[cfg(feature = "experimental-io-uring")]
+impl<F, Fut> Stream for ChunkedReadFile<F, Fut>
+where
+    F: Fn(File, u64, usize, BytesMut) -> Fut,
+    Fut: Future<Output = io::Result<(File, Bytes, BytesMut)>>,
+{
     type Item = Result<Bytes, Error>;
 
-    fn poll_next(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Self::Item>> {
-        if let Some(ref mut fut) = self.fut {
-            return match ready!(Pin::new(fut).poll(cx)) {
-                Ok((file, bytes)) => {
-                    self.fut.take();
-                    self.file = Some(file);
+    fn poll_next(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Option<Self::Item>> {
+        let mut this = self.as_mut().project();
+        match this.state.as_mut().project() {
+            ChunkedReadFileStateProj::File { file } => {
+                let size = *this.size;
+                let offset = *this.offset;
+                let counter = *this.counter;
 
-                    self.offset += bytes.len() as u64;
-                    self.counter += bytes.len() as u64;
+                if size == counter {
+                    Poll::Ready(None)
+                } else {
+                    let max_bytes = cmp::min(size.saturating_sub(counter), 65_536) as usize;
 
-                    Poll::Ready(Some(Ok(bytes)))
+                    let (file, bytes_mut) = file
+                        .take()
+                        .expect("ChunkedReadFile polled after completion");
+
+                    let fut = (this.callback)(file, offset, max_bytes, bytes_mut);
+
+                    this.state
+                        .project_replace(ChunkedReadFileState::Future { fut });
+
+                    self.poll_next(cx)
                 }
-                Err(e) => Poll::Ready(Some(Err(handle_error(e)))),
-            };
-        }
+            }
+            ChunkedReadFileStateProj::Future { fut } => {
+                let (file, bytes, bytes_mut) = ready!(fut.poll(cx))?;
 
-        let size = self.size;
-        let offset = self.offset;
-        let counter = self.counter;
+                this.state.project_replace(ChunkedReadFileState::File {
+                    file: Some((file, bytes_mut)),
+                });
 
-        if size == counter {
-            Poll::Ready(None)
-        } else {
-            let mut file = self.file.take().expect("Use after completion");
+                *this.offset += bytes.len() as u64;
+                *this.counter += bytes.len() as u64;
 
-            self.fut = Some(
-                web::block(move || {
-                    let max_bytes =
-                        cmp::min(size.saturating_sub(counter), 65_536) as usize;
-
-                    let mut buf = Vec::with_capacity(max_bytes);
-                    file.seek(io::SeekFrom::Start(offset))?;
-
-                    let n_bytes =
-                        file.by_ref().take(max_bytes as u64).read_to_end(&mut buf)?;
-
-                    if n_bytes == 0 {
-                        return Err(io::ErrorKind::UnexpectedEof.into());
-                    }
-
-                    Ok((file, Bytes::from(buf)))
-                })
-                .boxed_local(),
-            );
-
-            self.poll_next(cx)
+                Poll::Ready(Some(Ok(bytes)))
+            }
+        }
+    }
+}
+
+#[cfg(not(feature = "experimental-io-uring"))]
+impl<F, Fut> Stream for ChunkedReadFile<F, Fut>
+where
+    F: Fn(File, u64, usize) -> Fut,
+    Fut: Future<Output = Result<(File, Bytes), Error>>,
+{
+    type Item = Result<Bytes, Error>;
+
+    fn poll_next(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Option<Self::Item>> {
+        let mut this = self.as_mut().project();
+        match this.state.as_mut().project() {
+            ChunkedReadFileStateProj::File { file } => {
+                let size = *this.size;
+                let offset = *this.offset;
+                let counter = *this.counter;
+
+                if size == counter {
+                    Poll::Ready(None)
+                } else {
+                    let max_bytes = cmp::min(size.saturating_sub(counter), 65_536) as usize;
+
+                    let file = file
+                        .take()
+                        .expect("ChunkedReadFile polled after completion");
+
+                    let fut = (this.callback)(file, offset, max_bytes);
+
+                    this.state
+                        .project_replace(ChunkedReadFileState::Future { fut });
+
+                    self.poll_next(cx)
+                }
+            }
+            ChunkedReadFileStateProj::Future { fut } => {
+                let (file, bytes) = ready!(fut.poll(cx))?;
+
+                this.state
+                    .project_replace(ChunkedReadFileState::File { file: Some(file) });
+
+                *this.offset += bytes.len() as u64;
+                *this.counter += bytes.len() as u64;
+
+                Poll::Ready(Some(Ok(bytes)))
+            }
+        }
+    }
+}
+
+#[cfg(feature = "experimental-io-uring")]
+use bytes_mut::BytesMut;
+
+// TODO: remove new type and use bytes::BytesMut directly
+#[doc(hidden)]
+#[cfg(feature = "experimental-io-uring")]
+mod bytes_mut {
+    use std::ops::{Deref, DerefMut};
+
+    use tokio_uring::buf::{IoBuf, IoBufMut};
+
+    #[derive(Debug)]
+    pub struct BytesMut(bytes::BytesMut);
+
+    impl BytesMut {
+        pub(super) fn new() -> Self {
+            Self(bytes::BytesMut::new())
+        }
+    }
+
+    impl Deref for BytesMut {
+        type Target = bytes::BytesMut;
+
+        fn deref(&self) -> &Self::Target {
+            &self.0
+        }
+    }
+
+    impl DerefMut for BytesMut {
+        fn deref_mut(&mut self) -> &mut Self::Target {
+            &mut self.0
+        }
+    }
+
+    unsafe impl IoBuf for BytesMut {
+        fn stable_ptr(&self) -> *const u8 {
+            self.0.as_ptr()
+        }
+
+        fn bytes_init(&self) -> usize {
+            self.0.len()
+        }
+
+        fn bytes_total(&self) -> usize {
+            self.0.capacity()
+        }
+    }
+
+    unsafe impl IoBufMut for BytesMut {
+        fn stable_mut_ptr(&mut self) -> *mut u8 {
+            self.0.as_mut_ptr()
+        }
+
+        unsafe fn set_init(&mut self, init_len: usize) {
+            if self.len() < init_len {
+                self.0.set_len(init_len);
+            }
         }
     }
 }

actix-files/src/directory.rs

@@ -1,8 +1,8 @@
 use std::{fmt::Write, fs::DirEntry, io, path::Path, path::PathBuf};
 
 use actix_web::{dev::ServiceResponse, HttpRequest, HttpResponse};
+use askama_escape::{escape as escape_html_entity, Html};
 use percent_encoding::{utf8_percent_encode, CONTROLS};
-use v_htmlescape::escape as escape_html_entity;
 
 /// A directory; responds with the generated directory listing.
 #[derive(Debug)]
@@ -50,7 +50,7 @@ macro_rules! encode_file_url {
 // " -- &quot;  & -- &amp;  ' -- &#x27;  < -- &lt;  > -- &gt;  / -- &#x2f;
 macro_rules! encode_file_name {
     ($entry:ident) => {
-        escape_html_entity(&$entry.file_name().to_string_lossy())
+        escape_html_entity(&$entry.file_name().to_string_lossy(), Html)
     };
 }
 
@@ -66,9 +66,7 @@ pub(crate) fn directory_listing(
         if dir.is_visible(&entry) {
             let entry = entry.unwrap();
             let p = match entry.path().strip_prefix(&dir.path) {
-                Ok(p) if cfg!(windows) => {
-                    base.join(p).to_string_lossy().replace("\\", "/")
-                }
+                Ok(p) if cfg!(windows) => base.join(p).to_string_lossy().replace("\\", "/"),
                 Ok(p) => base.join(p).to_string_lossy().into_owned(),
                 Err(_) => continue,
             };

actix-files/src/error.rs

@@ -1,4 +1,4 @@
-use actix_web::{http::StatusCode, HttpResponse, ResponseError};
+use actix_web::{http::StatusCode, ResponseError};
 use derive_more::Display;
 
 /// Errors which can occur when serving static files.
@@ -16,11 +16,12 @@ pub enum FilesError {
 
 /// Return `NotFound` for `FilesError`
 impl ResponseError for FilesError {
-    fn error_response(&self) -> HttpResponse {
-        HttpResponse::new(StatusCode::NOT_FOUND)
+    fn status_code(&self) -> StatusCode {
+        StatusCode::NOT_FOUND
     }
 }
 
+#[allow(clippy::enum_variant_names)]
 #[derive(Display, Debug, PartialEq)]
 pub enum UriSegmentError {
     /// The segment started with the wrapped invalid character.

actix-files/src/files.rs

@@ -1,27 +1,34 @@
-use std::{cell::RefCell, fmt, io, path::PathBuf, rc::Rc};
+use std::{
+    cell::RefCell,
+    fmt, io,
+    path::{Path, PathBuf},
+    rc::Rc,
+};
 
 use actix_service::{boxed, IntoServiceFactory, ServiceFactory, ServiceFactoryExt};
 use actix_web::{
     dev::{
-        AppService, HttpServiceFactory, ResourceDef, ServiceRequest, ServiceResponse,
+        AppService, HttpServiceFactory, RequestHead, ResourceDef, ServiceRequest,
+        ServiceResponse,
     },
     error::Error,
     guard::Guard,
     http::header::DispositionType,
     HttpRequest,
 };
-use futures_util::future::{ok, FutureExt, LocalBoxFuture};
+use futures_core::future::LocalBoxFuture;
 
 use crate::{
-    directory_listing, named, Directory, DirectoryRenderer, FilesService,
-    HttpNewService, MimeOverride,
+    directory_listing, named,
+    service::{FilesService, FilesServiceInner},
+    Directory, DirectoryRenderer, HttpNewService, MimeOverride, PathFilter,
 };
 
 /// Static files handling service.
 ///
 /// `Files` service must be registered with `App::service()` method.
 ///
-/// ```rust
+/// ```
 /// use actix_web::App;
 /// use actix_files::Files;
 ///
@@ -37,8 +44,10 @@ pub struct Files {
     default: Rc<RefCell<Option<Rc<HttpNewService>>>>,
     renderer: Rc<DirectoryRenderer>,
     mime_override: Option<Rc<MimeOverride>>,
+    path_filter: Option<Rc<PathFilter>>,
     file_flags: named::Flags,
-    guards: Option<Rc<dyn Guard>>,
+    use_guards: Option<Rc<dyn Guard>>,
+    guards: Vec<Rc<dyn Guard>>,
     hidden_files: bool,
 }
 
@@ -60,6 +69,8 @@ impl Clone for Files {
             file_flags: self.file_flags,
             path: self.path.clone(),
             mime_override: self.mime_override.clone(),
+            path_filter: self.path_filter.clone(),
+            use_guards: self.use_guards.clone(),
             guards: self.guards.clone(),
             hidden_files: self.hidden_files,
         }
@@ -81,9 +92,9 @@ impl Files {
     /// If the mount path is set as the root path `/`, services registered after this one will
     /// be inaccessible. Register more specific handlers and services first.
     ///
-    /// `Files` uses a threadpool for blocking filesystem operations. By default, the pool uses a
-    /// number of threads equal to 5x the number of available logical CPUs. Pool size can be changed
-    /// by setting ACTIX_THREADPOOL environment variable.
+    /// `Files` utilizes the existing Tokio thread-pool for blocking filesystem operations.
+    /// The number of running threads is adjusted over time as needed, up to a maximum of 512 times
+    /// the number of server [workers](actix_web::HttpServer::workers), by default.
     pub fn new<T: Into<PathBuf>>(mount_path: &str, serve_from: T) -> Files {
         let orig_dir = serve_from.into();
         let dir = match orig_dir.canonicalize() {
@@ -95,7 +106,7 @@ impl Files {
         };
 
         Files {
-            path: mount_path.to_owned(),
+            path: mount_path.trim_end_matches('/').to_owned(),
             directory: dir,
             index: None,
             show_index: false,
@@ -103,8 +114,10 @@ impl Files {
             default: Rc::new(RefCell::new(None)),
             renderer: Rc::new(directory_listing),
             mime_override: None,
+            path_filter: None,
             file_flags: named::Flags::default(),
-            guards: None,
+            use_guards: None,
+            guards: Vec::new(),
             hidden_files: false,
         }
     }
@@ -112,6 +125,9 @@ impl Files {
     /// Show files listing for directories.
     ///
     /// By default show files listing is disabled.
+    ///
+    /// When used with [`Files::index_file()`], files listing is shown as a fallback
+    /// when the index file is not found.
     pub fn show_files_listing(mut self) -> Self {
         self.show_index = true;
         self
@@ -128,8 +144,8 @@ impl Files {
     /// Set custom directory renderer
     pub fn files_listing_renderer<F>(mut self, f: F) -> Self
     where
-        for<'r, 's> F: Fn(&'r Directory, &'s HttpRequest) -> Result<ServiceResponse, io::Error>
-            + 'static,
+        for<'r, 's> F:
+            Fn(&'r Directory, &'s HttpRequest) -> Result<ServiceResponse, io::Error> + 'static,
     {
         self.renderer = Rc::new(f);
         self
@@ -144,10 +160,45 @@ impl Files {
         self
     }
 
+    /// Sets path filtering closure.
+    ///
+    /// The path provided to the closure is relative to `serve_from` path.
+    /// You can safely join this path with the `serve_from` path to get the real path.
+    /// However, the real path may not exist since the filter is called before checking path existence.
+    ///
+    /// When a path doesn't pass the filter, [`Files::default_handler`] is called if set, otherwise,
+    /// `404 Not Found` is returned.
+    ///
+    /// # Examples
+    /// ```
+    /// use std::path::Path;
+    /// use actix_files::Files;
+    ///
+    /// // prevent searching subdirectories and following symlinks
+    /// let files_service = Files::new("/", "./static").path_filter(|path, _| {
+    ///     path.components().count() == 1
+    ///         && Path::new("./static")
+    ///             .join(path)
+    ///             .symlink_metadata()
+    ///             .map(|m| !m.file_type().is_symlink())
+    ///             .unwrap_or(false)
+    /// });
+    /// ```
+    pub fn path_filter<F>(mut self, f: F) -> Self
+    where
+        F: Fn(&Path, &RequestHead) -> bool + 'static,
+    {
+        self.path_filter = Some(Rc::new(f));
+        self
+    }
+
     /// Set index file
     ///
-    /// Shows specific index file for directory "/" instead of
+    /// Shows specific index file for directories instead of
     /// showing files listing.
+    ///
+    /// If the index file is not found, files listing is shown as a fallback if
+    /// [`Files::show_files_listing()`] is set.
     pub fn index_file<T: Into<String>>(mut self, index: T) -> Self {
         self.index = Some(index.into());
         self
@@ -156,7 +207,6 @@ impl Files {
     /// Specifies whether to use ETag or not.
     ///
     /// Default is true.
-    #[inline]
     pub fn use_etag(mut self, value: bool) -> Self {
         self.file_flags.set(named::Flags::ETAG, value);
         self
@@ -165,7 +215,6 @@ impl Files {
     /// Specifies whether to use Last-Modified or not.
     ///
     /// Default is true.
-    #[inline]
     pub fn use_last_modified(mut self, value: bool) -> Self {
         self.file_flags.set(named::Flags::LAST_MD, value);
         self
@@ -174,31 +223,80 @@ impl Files {
     /// Specifies whether text responses should signal a UTF-8 encoding.
     ///
     /// Default is false (but will default to true in a future version).
-    #[inline]
     pub fn prefer_utf8(mut self, value: bool) -> Self {
         self.file_flags.set(named::Flags::PREFER_UTF8, value);
         self
     }
 
-    /// Specifies custom guards to use for directory listings and files.
+    /// Adds a routing guard.
     ///
-    /// Default behaviour allows GET and HEAD.
-    #[inline]
-    pub fn use_guards<G: Guard + 'static>(mut self, guards: G) -> Self {
-        self.guards = Some(Rc::new(guards));
+    /// Use this to allow multiple chained file services that respond to strictly different
+    /// properties of a request. Due to the way routing works, if a guard check returns true and the
+    /// request starts being handled by the file service, it will not be able to back-out and try
+    /// the next service, you will simply get a 404 (or 405) error response.
+    ///
+    /// To allow `POST` requests to retrieve files, see [`Files::use_guards`].
+    ///
+    /// # Examples
+    /// ```
+    /// use actix_web::{guard::Header, App};
+    /// use actix_files::Files;
+    ///
+    /// App::new().service(
+    ///     Files::new("/","/my/site/files")
+    ///         .guard(Header("Host", "example.com"))
+    /// );
+    /// ```
+    pub fn guard<G: Guard + 'static>(mut self, guard: G) -> Self {
+        self.guards.push(Rc::new(guard));
         self
     }
 
+    /// Specifies guard to check before fetching directory listings or files.
+    ///
+    /// Note that this guard has no effect on routing; it's main use is to guard on the request's
+    /// method just before serving the file, only allowing `GET` and `HEAD` requests by default.
+    /// See [`Files::guard`] for routing guards.
+    pub fn method_guard<G: Guard + 'static>(mut self, guard: G) -> Self {
+        self.use_guards = Some(Rc::new(guard));
+        self
+    }
+
+    #[doc(hidden)]
+    #[deprecated(since = "0.6.0", note = "Renamed to `method_guard`.")]
+    /// See [`Files::method_guard`].
+    pub fn use_guards<G: Guard + 'static>(self, guard: G) -> Self {
+        self.method_guard(guard)
+    }
+
     /// Disable `Content-Disposition` header.
     ///
     /// By default Content-Disposition` header is enabled.
-    #[inline]
     pub fn disable_content_disposition(mut self) -> Self {
         self.file_flags.remove(named::Flags::CONTENT_DISPOSITION);
         self
     }
 
     /// Sets default handler which is used when no matched file could be found.
+    ///
+    /// # Examples
+    /// Setting a fallback static file handler:
+    /// ```
+    /// use actix_files::{Files, NamedFile};
+    /// use actix_web::dev::{ServiceRequest, ServiceResponse, fn_service};
+    ///
+    /// # fn run() -> Result<(), actix_web::Error> {
+    /// let files = Files::new("/", "./static")
+    ///     .index_file("index.html")
+    ///     .default_handler(fn_service(|req: ServiceRequest| async {
+    ///         let (req, _) = req.into_parts();
+    ///         let file = NamedFile::open_async("./static/404.html").await?;
+    ///         let res = file.into_response(&req);
+    ///         Ok(ServiceResponse::new(req, res))
+    ///     }));
+    /// # Ok(())
+    /// # }
+    /// ```
     pub fn default_handler<F, U>(mut self, f: F) -> Self
     where
         F: IntoServiceFactory<U, ServiceRequest>,
@@ -218,7 +316,6 @@ impl Files {
     }
 
     /// Enables serving hidden files and directories, allowing a leading dots in url fragments.
-    #[inline]
     pub fn use_hidden_files(mut self) -> Self {
         self.hidden_files = true;
         self
@@ -226,7 +323,19 @@ impl Files {
 }
 
 impl HttpServiceFactory for Files {
-    fn register(self, config: &mut AppService) {
+    fn register(mut self, config: &mut AppService) {
+        let guards = if self.guards.is_empty() {
+            None
+        } else {
+            let guards = std::mem::take(&mut self.guards);
+            Some(
+                guards
+                    .into_iter()
+                    .map(|guard| -> Box<dyn Guard> { Box::new(guard) })
+                    .collect::<Vec<_>>(),
+            )
+        };
+
         if self.default.borrow().is_none() {
             *self.default.borrow_mut() = Some(config.default_service());
         }
@@ -237,7 +346,7 @@ impl HttpServiceFactory for Files {
             ResourceDef::prefix(&self.path)
         };
 
-        config.register_service(rdef, None, self, None)
+        config.register_service(rdef, guards, self, None)
     }
 }
 
@@ -250,7 +359,7 @@ impl ServiceFactory<ServiceRequest> for Files {
     type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
-        let mut srv = FilesService {
+        let mut inner = FilesServiceInner {
             directory: self.directory.clone(),
             index: self.index.clone(),
             show_index: self.show_index,
@@ -258,24 +367,25 @@ impl ServiceFactory<ServiceRequest> for Files {
             default: None,
             renderer: self.renderer.clone(),
             mime_override: self.mime_override.clone(),
+            path_filter: self.path_filter.clone(),
             file_flags: self.file_flags,
-            guards: self.guards.clone(),
+            guards: self.use_guards.clone(),
             hidden_files: self.hidden_files,
         };
 
         if let Some(ref default) = *self.default.borrow() {
-            default
-                .new_service(())
-                .map(move |result| match result {
+            let fut = default.new_service(());
+            Box::pin(async {
+                match fut.await {
                     Ok(default) => {
-                        srv.default = Some(default);
-                        Ok(srv)
+                        inner.default = Some(default);
+                        Ok(FilesService(Rc::new(inner)))
                     }
                     Err(_) => Err(()),
-                })
-                .boxed_local()
+                }
+            })
         } else {
-            ok(srv).boxed_local()
+            Box::pin(async move { Ok(FilesService(Rc::new(inner))) })
         }
     }
 }

actix-files/src/lib.rs

@@ -3,7 +3,7 @@
 //! Provides a non-blocking service for serving static files from disk.
 //!
 //! # Example
-//! ```rust
+//! ```
 //! use actix_web::App;
 //! use actix_files::Files;
 //!
@@ -14,15 +14,14 @@
 #![deny(rust_2018_idioms)]
 #![warn(missing_docs, missing_debug_implementations)]
 
-use std::io;
-
 use actix_service::boxed::{BoxService, BoxServiceFactory};
 use actix_web::{
-    dev::{ServiceRequest, ServiceResponse},
-    error::{BlockingError, Error, ErrorInternalServerError},
+    dev::{RequestHead, ServiceRequest, ServiceResponse},
+    error::Error,
     http::header::DispositionType,
 };
 use mime_guess::from_ext;
+use std::path::Path;
 
 mod chunked;
 mod directory;
@@ -34,12 +33,12 @@ mod path_buf;
 mod range;
 mod service;
 
-pub use crate::chunked::ChunkedReadFile;
-pub use crate::directory::Directory;
-pub use crate::files::Files;
-pub use crate::named::NamedFile;
-pub use crate::range::HttpRange;
-pub use crate::service::FilesService;
+pub use self::chunked::ChunkedReadFile;
+pub use self::directory::Directory;
+pub use self::files::Files;
+pub use self::named::NamedFile;
+pub use self::range::HttpRange;
+pub use self::service::FilesService;
 
 use self::directory::{directory_listing, DirectoryRenderer};
 use self::error::FilesError;
@@ -56,19 +55,14 @@ pub fn file_extension_to_mime(ext: &str) -> mime::Mime {
     from_ext(ext).first_or_octet_stream()
 }
 
-pub(crate) fn handle_error(err: BlockingError<io::Error>) -> Error {
-    match err {
-        BlockingError::Error(err) => err.into(),
-        BlockingError::Canceled => ErrorInternalServerError("Unexpected error"),
-    }
-}
-
 type MimeOverride = dyn Fn(&mime::Name<'_>) -> DispositionType;
 
+type PathFilter = dyn Fn(&Path, &RequestHead) -> bool;
+
 #[cfg(test)]
 mod tests {
     use std::{
-        fs::{self, File},
+        fs::{self},
         ops::Add,
         time::{Duration, SystemTime},
     };
@@ -82,13 +76,14 @@ mod tests {
         },
         middleware::Compress,
         test::{self, TestRequest},
-        web, App, HttpResponse, Responder,
+        web::{self, Bytes},
+        App, HttpResponse, Responder,
     };
-    use futures_util::future::ok;
 
     use super::*;
+    use crate::named::File;
 
-    #[actix_rt::test]
+    #[actix_web::test]
     async fn test_file_extension_to_mime() {
         let m = file_extension_to_mime("");
         assert_eq!(m, mime::APPLICATION_OCTET_STREAM);
@@ -105,12 +100,23 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_if_modified_since_without_if_none_match() {
-        let file = NamedFile::open("Cargo.toml").unwrap();
-        let since =
-            header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
+        let file = NamedFile::open_async("Cargo.toml").await.unwrap();
+        let since = header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
 
         let req = TestRequest::default()
-            .header(header::IF_MODIFIED_SINCE, since)
+            .insert_header((header::IF_MODIFIED_SINCE, since))
+            .to_http_request();
+        let resp = file.respond_to(&req).await.unwrap();
+        assert_eq!(resp.status(), StatusCode::NOT_MODIFIED);
+    }
+
+    #[actix_rt::test]
+    async fn test_if_modified_since_without_if_none_match_same() {
+        let file = NamedFile::open_async("Cargo.toml").await.unwrap();
+        let since = file.last_modified().unwrap();
+
+        let req = TestRequest::default()
+            .insert_header((header::IF_MODIFIED_SINCE, since))
             .to_http_request();
         let resp = file.respond_to(&req).await.unwrap();
         assert_eq!(resp.status(), StatusCode::NOT_MODIFIED);
@@ -118,22 +124,45 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_if_modified_since_with_if_none_match() {
-        let file = NamedFile::open("Cargo.toml").unwrap();
-        let since =
-            header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
+        let file = NamedFile::open_async("Cargo.toml").await.unwrap();
+        let since = header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
 
         let req = TestRequest::default()
-            .header(header::IF_NONE_MATCH, "miss_etag")
-            .header(header::IF_MODIFIED_SINCE, since)
+            .insert_header((header::IF_NONE_MATCH, "miss_etag"))
+            .insert_header((header::IF_MODIFIED_SINCE, since))
             .to_http_request();
         let resp = file.respond_to(&req).await.unwrap();
         assert_ne!(resp.status(), StatusCode::NOT_MODIFIED);
     }
 
+    #[actix_rt::test]
+    async fn test_if_unmodified_since() {
+        let file = NamedFile::open_async("Cargo.toml").await.unwrap();
+        let since = file.last_modified().unwrap();
+
+        let req = TestRequest::default()
+            .insert_header((header::IF_UNMODIFIED_SINCE, since))
+            .to_http_request();
+        let resp = file.respond_to(&req).await.unwrap();
+        assert_eq!(resp.status(), StatusCode::OK);
+    }
+
+    #[actix_rt::test]
+    async fn test_if_unmodified_since_failed() {
+        let file = NamedFile::open_async("Cargo.toml").await.unwrap();
+        let since = header::HttpDate::from(SystemTime::UNIX_EPOCH);
+
+        let req = TestRequest::default()
+            .insert_header((header::IF_UNMODIFIED_SINCE, since))
+            .to_http_request();
+        let resp = file.respond_to(&req).await.unwrap();
+        assert_eq!(resp.status(), StatusCode::PRECONDITION_FAILED);
+    }
+
     #[actix_rt::test]
     async fn test_named_file_text() {
-        assert!(NamedFile::open("test--").is_err());
-        let mut file = NamedFile::open("Cargo.toml").unwrap();
+        assert!(NamedFile::open_async("test--").await.is_err());
+        let mut file = NamedFile::open_async("Cargo.toml").await.unwrap();
         {
             file.file();
             let _f: &File = &file;
@@ -156,8 +185,8 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_content_disposition() {
-        assert!(NamedFile::open("test--").is_err());
-        let mut file = NamedFile::open("Cargo.toml").unwrap();
+        assert!(NamedFile::open_async("test--").await.is_err());
+        let mut file = NamedFile::open_async("Cargo.toml").await.unwrap();
         {
             file.file();
             let _f: &File = &file;
@@ -173,7 +202,8 @@ mod tests {
             "inline; filename=\"Cargo.toml\""
         );
 
-        let file = NamedFile::open("Cargo.toml")
+        let file = NamedFile::open_async("Cargo.toml")
+            .await
             .unwrap()
             .disable_content_disposition();
         let req = TestRequest::default().to_http_request();
@@ -183,9 +213,19 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_non_ascii_file_name() {
-        let mut file =
-            NamedFile::from_file(File::open("Cargo.toml").unwrap(), "貨物.toml")
-                .unwrap();
+        let file = {
+            #[cfg(feature = "experimental-io-uring")]
+            {
+                crate::named::File::open("Cargo.toml").await.unwrap()
+            }
+
+            #[cfg(not(feature = "experimental-io-uring"))]
+            {
+                crate::named::File::open("Cargo.toml").unwrap()
+            }
+        };
+
+        let mut file = NamedFile::from_file(file, "貨物.toml").unwrap();
         {
             file.file();
             let _f: &File = &file;
@@ -208,7 +248,8 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_set_content_type() {
-        let mut file = NamedFile::open("Cargo.toml")
+        let mut file = NamedFile::open_async("Cargo.toml")
+            .await
             .unwrap()
             .set_content_type(mime::TEXT_XML);
         {
@@ -233,7 +274,7 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_image() {
-        let mut file = NamedFile::open("tests/test.png").unwrap();
+        let mut file = NamedFile::open_async("tests/test.png").await.unwrap();
         {
             file.file();
             let _f: &File = &file;
@@ -254,13 +295,30 @@ mod tests {
         );
     }
 
+    #[actix_rt::test]
+    async fn test_named_file_javascript() {
+        let file = NamedFile::open_async("tests/test.js").await.unwrap();
+
+        let req = TestRequest::default().to_http_request();
+        let resp = file.respond_to(&req).await.unwrap();
+        assert_eq!(
+            resp.headers().get(header::CONTENT_TYPE).unwrap(),
+            "application/javascript"
+        );
+        assert_eq!(
+            resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
+            "inline; filename=\"test.js\""
+        );
+    }
+
     #[actix_rt::test]
     async fn test_named_file_image_attachment() {
         let cd = ContentDisposition {
             disposition: DispositionType::Attachment,
             parameters: vec![DispositionParam::Filename(String::from("test.png"))],
         };
-        let mut file = NamedFile::open("tests/test.png")
+        let mut file = NamedFile::open_async("tests/test.png")
+            .await
             .unwrap()
             .set_content_disposition(cd);
         {
@@ -285,7 +343,7 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_binary() {
-        let mut file = NamedFile::open("tests/test.binary").unwrap();
+        let mut file = NamedFile::open_async("tests/test.binary").await.unwrap();
         {
             file.file();
             let _f: &File = &file;
@@ -308,7 +366,8 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_status_code_text() {
-        let mut file = NamedFile::open("Cargo.toml")
+        let mut file = NamedFile::open_async("Cargo.toml")
+            .await
             .unwrap()
             .set_status_code(StatusCode::NOT_FOUND);
         {
@@ -338,7 +397,7 @@ mod tests {
             DispositionType::Attachment
         }
 
-        let mut srv = test::init_service(
+        let srv = test::init_service(
             App::new().service(
                 Files::new("/", ".")
                     .mime_override(all_attachment)
@@ -348,7 +407,7 @@ mod tests {
         .await;
 
         let request = TestRequest::get().uri("/").to_request();
-        let response = test::call_service(&mut srv, request).await;
+        let response = test::call_service(&srv, request).await;
         assert_eq!(response.status(), StatusCode::OK);
 
         let content_disposition = response
@@ -363,7 +422,7 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_ranges_status_code() {
-        let mut srv = test::init_service(
+        let srv = test::init_service(
             App::new().service(Files::new("/test", ".").index_file("Cargo.toml")),
         )
         .await;
@@ -371,29 +430,29 @@ mod tests {
         // Valid range header
         let request = TestRequest::get()
             .uri("/t%65st/Cargo.toml")
-            .header(header::RANGE, "bytes=10-20")
+            .insert_header((header::RANGE, "bytes=10-20"))
             .to_request();
-        let response = test::call_service(&mut srv, request).await;
+        let response = test::call_service(&srv, request).await;
         assert_eq!(response.status(), StatusCode::PARTIAL_CONTENT);
 
         // Invalid range header
         let request = TestRequest::get()
             .uri("/t%65st/Cargo.toml")
-            .header(header::RANGE, "bytes=1-0")
+            .insert_header((header::RANGE, "bytes=1-0"))
             .to_request();
-        let response = test::call_service(&mut srv, request).await;
+        let response = test::call_service(&srv, request).await;
 
         assert_eq!(response.status(), StatusCode::RANGE_NOT_SATISFIABLE);
     }
 
     #[actix_rt::test]
     async fn test_named_file_content_range_headers() {
-        let srv = test::start(|| App::new().service(Files::new("/", ".")));
+        let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
 
         // Valid range header
         let response = srv
             .get("/tests/test.binary")
-            .header(header::RANGE, "bytes=10-20")
+            .insert_header((header::RANGE, "bytes=10-20"))
             .send()
             .await
             .unwrap();
@@ -403,7 +462,7 @@ mod tests {
         // Invalid range header
         let response = srv
             .get("/tests/test.binary")
-            .header(header::RANGE, "bytes=10-5")
+            .insert_header((header::RANGE, "bytes=10-5"))
             .send()
             .await
             .unwrap();
@@ -413,12 +472,12 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_named_file_content_length_headers() {
-        let srv = test::start(|| App::new().service(Files::new("/", ".")));
+        let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
 
         // Valid range header
         let response = srv
             .get("/tests/test.binary")
-            .header(header::RANGE, "bytes=10-20")
+            .insert_header((header::RANGE, "bytes=10-20"))
             .send()
             .await
             .unwrap();
@@ -428,7 +487,7 @@ mod tests {
         // Valid range header, starting from 0
         let response = srv
             .get("/tests/test.binary")
-            .header(header::RANGE, "bytes=0-20")
+            .insert_header((header::RANGE, "bytes=0-20"))
             .send()
             .await
             .unwrap();
@@ -452,7 +511,7 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_head_content_length_headers() {
-        let srv = test::start(|| App::new().service(Files::new("/", ".")));
+        let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
 
         let response = srv.head("/tests/test.binary").send().await.unwrap();
 
@@ -468,14 +527,14 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_static_files_with_spaces() {
-        let mut srv = test::init_service(
+        let srv = test::init_service(
             App::new().service(Files::new("/", ".").index_file("Cargo.toml")),
         )
         .await;
         let request = TestRequest::get()
             .uri("/tests/test%20space.binary")
             .to_request();
-        let response = test::call_service(&mut srv, request).await;
+        let response = test::call_service(&srv, request).await;
         assert_eq!(response.status(), StatusCode::OK);
 
         let bytes = test::read_body(response).await;
@@ -485,29 +544,29 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_files_not_allowed() {
-        let mut srv = test::init_service(App::new().service(Files::new("/", "."))).await;
+        let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
 
         let req = TestRequest::default()
             .uri("/Cargo.toml")
             .method(Method::POST)
             .to_request();
 
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::METHOD_NOT_ALLOWED);
 
-        let mut srv = test::init_service(App::new().service(Files::new("/", "."))).await;
+        let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
         let req = TestRequest::default()
             .method(Method::PUT)
             .uri("/Cargo.toml")
             .to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::METHOD_NOT_ALLOWED);
     }
 
     #[actix_rt::test]
     async fn test_files_guards() {
-        let mut srv = test::init_service(
-            App::new().service(Files::new("/", ".").use_guards(guard::Post())),
+        let srv = test::init_service(
+            App::new().service(Files::new("/", ".").method_guard(guard::Post())),
         )
         .await;
 
@@ -516,15 +575,16 @@ mod tests {
             .method(Method::POST)
             .to_request();
 
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::OK);
     }
 
     #[actix_rt::test]
     async fn test_named_file_content_encoding() {
-        let mut srv = test::init_service(App::new().wrap(Compress::default()).service(
+        let srv = test::init_service(App::new().wrap(Compress::default()).service(
             web::resource("/").to(|| async {
-                NamedFile::open("Cargo.toml")
+                NamedFile::open_async("Cargo.toml")
+                    .await
                     .unwrap()
                     .set_content_encoding(header::ContentEncoding::Identity)
             }),
@@ -533,18 +593,19 @@ mod tests {
 
         let request = TestRequest::get()
             .uri("/")
-            .header(header::ACCEPT_ENCODING, "gzip")
+            .insert_header((header::ACCEPT_ENCODING, "gzip"))
             .to_request();
-        let res = test::call_service(&mut srv, request).await;
+        let res = test::call_service(&srv, request).await;
         assert_eq!(res.status(), StatusCode::OK);
         assert!(!res.headers().contains_key(header::CONTENT_ENCODING));
     }
 
     #[actix_rt::test]
     async fn test_named_file_content_encoding_gzip() {
-        let mut srv = test::init_service(App::new().wrap(Compress::default()).service(
+        let srv = test::init_service(App::new().wrap(Compress::default()).service(
             web::resource("/").to(|| async {
-                NamedFile::open("Cargo.toml")
+                NamedFile::open_async("Cargo.toml")
+                    .await
                     .unwrap()
                     .set_content_encoding(header::ContentEncoding::Gzip)
             }),
@@ -553,9 +614,9 @@ mod tests {
 
         let request = TestRequest::get()
             .uri("/")
-            .header(header::ACCEPT_ENCODING, "gzip")
+            .insert_header((header::ACCEPT_ENCODING, "gzip"))
             .to_request();
-        let res = test::call_service(&mut srv, request).await;
+        let res = test::call_service(&srv, request).await;
         assert_eq!(res.status(), StatusCode::OK);
         assert_eq!(
             res.headers()
@@ -570,34 +631,32 @@ mod tests {
     #[actix_rt::test]
     async fn test_named_file_allowed_method() {
         let req = TestRequest::default().method(Method::GET).to_http_request();
-        let file = NamedFile::open("Cargo.toml").unwrap();
+        let file = NamedFile::open_async("Cargo.toml").await.unwrap();
         let resp = file.respond_to(&req).await.unwrap();
         assert_eq!(resp.status(), StatusCode::OK);
     }
 
     #[actix_rt::test]
     async fn test_static_files() {
-        let mut srv = test::init_service(
-            App::new().service(Files::new("/", ".").show_files_listing()),
-        )
-        .await;
+        let srv =
+            test::init_service(App::new().service(Files::new("/", ".").show_files_listing()))
+                .await;
         let req = TestRequest::with_uri("/missing").to_request();
 
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
 
-        let mut srv = test::init_service(App::new().service(Files::new("/", "."))).await;
+        let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
 
         let req = TestRequest::default().to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
 
-        let mut srv = test::init_service(
-            App::new().service(Files::new("/", ".").show_files_listing()),
-        )
-        .await;
+        let srv =
+            test::init_service(App::new().service(Files::new("/", ".").show_files_listing()))
+                .await;
         let req = TestRequest::with_uri("/tests").to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(
             resp.headers().get(header::CONTENT_TYPE).unwrap(),
             "text/html; charset=utf-8"
@@ -609,17 +668,17 @@ mod tests {
 
     #[actix_rt::test]
     async fn test_redirect_to_slash_directory() {
-        // should not redirect if no index
-        let mut srv = test::init_service(
+        // should not redirect if no index and files listing is disabled
+        let srv = test::init_service(
             App::new().service(Files::new("/", ".").redirect_to_slash_directory()),
         )
         .await;
         let req = TestRequest::with_uri("/tests").to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
 
         // should redirect if index present
-        let mut srv = test::init_service(
+        let srv = test::init_service(
             App::new().service(
                 Files::new("/", ".")
                     .index_file("test.png")
@@ -628,149 +687,270 @@ mod tests {
         )
         .await;
         let req = TestRequest::with_uri("/tests").to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
+        assert_eq!(resp.status(), StatusCode::FOUND);
+
+        // should redirect if files listing is enabled
+        let srv = test::init_service(
+            App::new().service(
+                Files::new("/", ".")
+                    .show_files_listing()
+                    .redirect_to_slash_directory(),
+            ),
+        )
+        .await;
+        let req = TestRequest::with_uri("/tests").to_request();
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::FOUND);
 
         // should not redirect if the path is wrong
         let req = TestRequest::with_uri("/not_existing").to_request();
-        let resp = test::call_service(&mut srv, req).await;
+        let resp = test::call_service(&srv, req).await;
         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
     }
 
     #[actix_rt::test]
     async fn test_static_files_bad_directory() {
-        let _st: Files = Files::new("/", "missing");
-        let _st: Files = Files::new("/", "Cargo.toml");
+        let service = Files::new("/", "./missing").new_service(()).await.unwrap();
+
+        let req = TestRequest::with_uri("/").to_srv_request();
+        let resp = test::call_service(&service, req).await;
+
+        assert_eq!(resp.status(), StatusCode::NOT_FOUND);
     }
 
     #[actix_rt::test]
     async fn test_default_handler_file_missing() {
-        let mut st = Files::new("/", ".")
-            .default_handler(|req: ServiceRequest| {
-                ok(req.into_response(HttpResponse::Ok().body("default content")))
+        let st = Files::new("/", ".")
+            .default_handler(|req: ServiceRequest| async {
+                Ok(req.into_response(HttpResponse::Ok().body("default content")))
             })
             .new_service(())
             .await
             .unwrap();
         let req = TestRequest::with_uri("/missing").to_srv_request();
+        let resp = test::call_service(&st, req).await;
 
-        let resp = test::call_service(&mut st, req).await;
         assert_eq!(resp.status(), StatusCode::OK);
         let bytes = test::read_body(resp).await;
         assert_eq!(bytes, web::Bytes::from_static(b"default content"));
     }
 
-    //     #[actix_rt::test]
-    //     async fn test_serve_index() {
-    //         let st = Files::new(".").index_file("test.binary");
-    //         let req = TestRequest::default().uri("/tests").finish();
+    #[actix_rt::test]
+    async fn test_serve_index_nested() {
+        let service = Files::new(".", ".")
+            .index_file("lib.rs")
+            .new_service(())
+            .await
+            .unwrap();
 
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
-    //         let resp = resp.as_msg();
-    //         assert_eq!(resp.status(), StatusCode::OK);
-    //         assert_eq!(
-    //             resp.headers()
-    //                 .get(header::CONTENT_TYPE)
-    //                 .expect("content type"),
-    //             "application/octet-stream"
-    //         );
-    //         assert_eq!(
-    //             resp.headers()
-    //                 .get(header::CONTENT_DISPOSITION)
-    //                 .expect("content disposition"),
-    //             "attachment; filename=\"test.binary\""
-    //         );
+        let req = TestRequest::default().uri("/src").to_srv_request();
+        let resp = test::call_service(&service, req).await;
 
-    //         let req = TestRequest::default().uri("/tests/").finish();
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
-    //         let resp = resp.as_msg();
-    //         assert_eq!(resp.status(), StatusCode::OK);
-    //         assert_eq!(
-    //             resp.headers().get(header::CONTENT_TYPE).unwrap(),
-    //             "application/octet-stream"
-    //         );
-    //         assert_eq!(
-    //             resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
-    //             "attachment; filename=\"test.binary\""
-    //         );
+        assert_eq!(resp.status(), StatusCode::OK);
+        assert_eq!(
+            resp.headers().get(header::CONTENT_TYPE).unwrap(),
+            "text/x-rust"
+        );
+        assert_eq!(
+            resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
+            "inline; filename=\"lib.rs\""
+        );
+    }
 
-    //         // nonexistent index file
-    //         let req = TestRequest::default().uri("/tests/unknown").finish();
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
-    //         let resp = resp.as_msg();
-    //         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
+    #[actix_rt::test]
+    async fn integration_serve_index() {
+        let srv = test::init_service(
+            App::new().service(Files::new("test", ".").index_file("Cargo.toml")),
+        )
+        .await;
 
-    //         let req = TestRequest::default().uri("/tests/unknown/").finish();
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
-    //         let resp = resp.as_msg();
-    //         assert_eq!(resp.status(), StatusCode::NOT_FOUND);
-    //     }
+        let req = TestRequest::get().uri("/test").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::OK);
 
-    //     #[actix_rt::test]
-    //     async fn test_serve_index_nested() {
-    //         let st = Files::new(".").index_file("mod.rs");
-    //         let req = TestRequest::default().uri("/src/client").finish();
-    //         let resp = st.handle(&req).respond_to(&req).unwrap();
-    //         let resp = resp.as_msg();
-    //         assert_eq!(resp.status(), StatusCode::OK);
-    //         assert_eq!(
-    //             resp.headers().get(header::CONTENT_TYPE).unwrap(),
-    //             "text/x-rust"
-    //         );
-    //         assert_eq!(
-    //             resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
-    //             "inline; filename=\"mod.rs\""
-    //         );
-    //     }
+        let bytes = test::read_body(res).await;
 
-    //     #[actix_rt::test]
-    //     fn integration_serve_index() {
-    //         let mut srv = test::TestServer::with_factory(|| {
-    //             App::new().handler(
-    //                 "test",
-    //                 Files::new(".").index_file("Cargo.toml"),
-    //             )
-    //         });
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+        assert_eq!(bytes, data);
 
-    //         let request = srv.get().uri(srv.url("/test")).finish().unwrap();
-    //         let response = srv.execute(request.send()).unwrap();
-    //         assert_eq!(response.status(), StatusCode::OK);
-    //         let bytes = srv.execute(response.body()).unwrap();
-    //         let data = Bytes::from(fs::read("Cargo.toml").unwrap());
-    //         assert_eq!(bytes, data);
+        let req = TestRequest::get().uri("/test/").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::OK);
 
-    //         let request = srv.get().uri(srv.url("/test/")).finish().unwrap();
-    //         let response = srv.execute(request.send()).unwrap();
-    //         assert_eq!(response.status(), StatusCode::OK);
-    //         let bytes = srv.execute(response.body()).unwrap();
-    //         let data = Bytes::from(fs::read("Cargo.toml").unwrap());
-    //         assert_eq!(bytes, data);
+        let bytes = test::read_body(res).await;
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+        assert_eq!(bytes, data);
 
-    //         // nonexistent index file
-    //         let request = srv.get().uri(srv.url("/test/unknown")).finish().unwrap();
-    //         let response = srv.execute(request.send()).unwrap();
-    //         assert_eq!(response.status(), StatusCode::NOT_FOUND);
+        // nonexistent index file
+        let req = TestRequest::get().uri("/test/unknown").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::NOT_FOUND);
 
-    //         let request = srv.get().uri(srv.url("/test/unknown/")).finish().unwrap();
-    //         let response = srv.execute(request.send()).unwrap();
-    //         assert_eq!(response.status(), StatusCode::NOT_FOUND);
-    //     }
+        let req = TestRequest::get().uri("/test/unknown/").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::NOT_FOUND);
+    }
 
-    //     #[actix_rt::test]
-    //     fn integration_percent_encoded() {
-    //         let mut srv = test::TestServer::with_factory(|| {
-    //             App::new().handler(
-    //                 "test",
-    //                 Files::new(".").index_file("Cargo.toml"),
-    //             )
-    //         });
+    #[actix_rt::test]
+    async fn integration_percent_encoded() {
+        let srv = test::init_service(
+            App::new().service(Files::new("test", ".").index_file("Cargo.toml")),
+        )
+        .await;
 
-    //         let request = srv
-    //             .get()
-    //             .uri(srv.url("/test/%43argo.toml"))
-    //             .finish()
-    //             .unwrap();
-    //         let response = srv.execute(request.send()).unwrap();
-    //         assert_eq!(response.status(), StatusCode::OK);
-    //     }
+        let req = TestRequest::get().uri("/test/%43argo.toml").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::OK);
+    }
+
+    #[actix_rt::test]
+    async fn test_serve_named_file() {
+        let factory = NamedFile::open_async("Cargo.toml").await.unwrap();
+        let srv = test::init_service(App::new().service(factory)).await;
+
+        let req = TestRequest::get().uri("/Cargo.toml").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::OK);
+
+        let bytes = test::read_body(res).await;
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+        assert_eq!(bytes, data);
+
+        let req = TestRequest::get().uri("/test/unknown").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::NOT_FOUND);
+    }
+
+    #[actix_rt::test]
+    async fn test_serve_named_file_prefix() {
+        let factory = NamedFile::open_async("Cargo.toml").await.unwrap();
+        let srv =
+            test::init_service(App::new().service(web::scope("/test").service(factory))).await;
+
+        let req = TestRequest::get().uri("/test/Cargo.toml").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::OK);
+
+        let bytes = test::read_body(res).await;
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+        assert_eq!(bytes, data);
+
+        let req = TestRequest::get().uri("/Cargo.toml").to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::NOT_FOUND);
+    }
+
+    #[actix_rt::test]
+    async fn test_named_file_default_service() {
+        let factory = NamedFile::open_async("Cargo.toml").await.unwrap();
+        let srv = test::init_service(App::new().default_service(factory)).await;
+
+        for route in ["/foobar", "/baz", "/"].iter() {
+            let req = TestRequest::get().uri(route).to_request();
+            let res = test::call_service(&srv, req).await;
+            assert_eq!(res.status(), StatusCode::OK);
+
+            let bytes = test::read_body(res).await;
+            let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+            assert_eq!(bytes, data);
+        }
+    }
+
+    #[actix_rt::test]
+    async fn test_default_handler_named_file() {
+        let factory = NamedFile::open_async("Cargo.toml").await.unwrap();
+        let st = Files::new("/", ".")
+            .default_handler(factory)
+            .new_service(())
+            .await
+            .unwrap();
+        let req = TestRequest::with_uri("/missing").to_srv_request();
+        let resp = test::call_service(&st, req).await;
+
+        assert_eq!(resp.status(), StatusCode::OK);
+        let bytes = test::read_body(resp).await;
+        let data = Bytes::from(fs::read("Cargo.toml").unwrap());
+        assert_eq!(bytes, data);
+    }
+
+    #[actix_rt::test]
+    async fn test_symlinks() {
+        let srv = test::init_service(App::new().service(Files::new("test", "."))).await;
+
+        let req = TestRequest::get()
+            .uri("/test/tests/symlink-test.png")
+            .to_request();
+        let res = test::call_service(&srv, req).await;
+        assert_eq!(res.status(), StatusCode::OK);
+        assert_eq!(
+            res.headers().get(header::CONTENT_DISPOSITION).unwrap(),
+            "inline; filename=\"symlink-test.png\""
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_index_with_show_files_listing() {
+        let service = Files::new(".", ".")
+            .index_file("lib.rs")
+            .show_files_listing()
+            .new_service(())
+            .await
+            .unwrap();
+
+        // Serve the index if exists
+        let req = TestRequest::default().uri("/src").to_srv_request();
+        let resp = test::call_service(&service, req).await;
+        assert_eq!(resp.status(), StatusCode::OK);
+        assert_eq!(
+            resp.headers().get(header::CONTENT_TYPE).unwrap(),
+            "text/x-rust"
+        );
+
+        // Show files listing, otherwise.
+        let req = TestRequest::default().uri("/tests").to_srv_request();
+        let resp = test::call_service(&service, req).await;
+        assert_eq!(
+            resp.headers().get(header::CONTENT_TYPE).unwrap(),
+            "text/html; charset=utf-8"
+        );
+        let bytes = test::read_body(resp).await;
+        assert!(format!("{:?}", bytes).contains("/tests/test.png"));
+    }
+
+    #[actix_rt::test]
+    async fn test_path_filter() {
+        // prevent searching subdirectories
+        let st = Files::new("/", ".")
+            .path_filter(|path, _| path.components().count() == 1)
+            .new_service(())
+            .await
+            .unwrap();
+
+        let req = TestRequest::with_uri("/Cargo.toml").to_srv_request();
+        let resp = test::call_service(&st, req).await;
+        assert_eq!(resp.status(), StatusCode::OK);
+
+        let req = TestRequest::with_uri("/src/lib.rs").to_srv_request();
+        let resp = test::call_service(&st, req).await;
+        assert_eq!(resp.status(), StatusCode::NOT_FOUND);
+    }
+
+    #[actix_rt::test]
+    async fn test_default_handler_filter() {
+        let st = Files::new("/", ".")
+            .default_handler(|req: ServiceRequest| async {
+                Ok(req.into_response(HttpResponse::Ok().body("default content")))
+            })
+            .path_filter(|path, _| path.extension() == Some("png".as_ref()))
+            .new_service(())
+            .await
+            .unwrap();
+        let req = TestRequest::with_uri("/Cargo.toml").to_srv_request();
+        let resp = test::call_service(&st, req).await;
+
+        assert_eq!(resp.status(), StatusCode::OK);
+        let bytes = test::read_body(resp).await;
+        assert_eq!(bytes, web::Bytes::from_static(b"default content"));
+    }
 }

actix-files/src/named.rs

@@ -1,28 +1,34 @@
-use std::fs::{File, Metadata};
-use std::io;
-use std::ops::{Deref, DerefMut};
-use std::path::{Path, PathBuf};
-use std::time::{SystemTime, UNIX_EPOCH};
+use std::{
+    fmt,
+    fs::Metadata,
+    io,
+    ops::{Deref, DerefMut},
+    path::{Path, PathBuf},
+    time::{SystemTime, UNIX_EPOCH},
+};
 
 #[cfg(unix)]
 use std::os::unix::fs::MetadataExt;
 
+use actix_http::body::AnyBody;
+use actix_service::{Service, ServiceFactory};
 use actix_web::{
-    dev::{BodyEncoding, SizedStream},
+    dev::{
+        AppService, BodyEncoding, HttpServiceFactory, ResourceDef, ServiceRequest,
+        ServiceResponse, SizedStream,
+    },
     http::{
         header::{
-            self, Charset, ContentDisposition, DispositionParam, DispositionType,
-            ExtendedValue,
+            self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
         },
         ContentEncoding, StatusCode,
     },
     Error, HttpMessage, HttpRequest, HttpResponse, Responder,
 };
 use bitflags::bitflags;
-use futures_util::future::{ready, Ready};
+use futures_core::future::LocalBoxFuture;
 use mime_guess::from_path;
 
-use crate::ChunkedReadFile;
 use crate::{encoding::equiv_utf8_text, range::HttpRange};
 
 bitflags! {
@@ -41,7 +47,29 @@ impl Default for Flags {
 }
 
 /// A file with an associated name.
-#[derive(Debug)]
+///
+/// `NamedFile` can be registered as services:
+/// ```
+/// use actix_web::App;
+/// use actix_files::NamedFile;
+///
+/// # async fn run() -> Result<(), Box<dyn std::error::Error>> {
+/// let file = NamedFile::open_async("./static/index.html").await?;
+/// let app = App::new().service(file);
+/// # Ok(())
+/// # }
+/// ```
+///
+/// They can also be returned from handlers:
+/// ```
+/// use actix_web::{Responder, get};
+/// use actix_files::NamedFile;
+///
+/// #[get("/")]
+/// async fn index() -> impl Responder {
+///     NamedFile::open_async("./static/index.html").await
+/// }
+/// ```
 pub struct NamedFile {
     path: PathBuf,
     file: File,
@@ -54,6 +82,37 @@ pub struct NamedFile {
     pub(crate) encoding: Option<ContentEncoding>,
 }
 
+impl fmt::Debug for NamedFile {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        f.debug_struct("NamedFile")
+            .field("path", &self.path)
+            .field(
+                "file",
+                #[cfg(feature = "experimental-io-uring")]
+                {
+                    &"tokio_uring::File"
+                },
+                #[cfg(not(feature = "experimental-io-uring"))]
+                {
+                    &self.file
+                },
+            )
+            .field("modified", &self.modified)
+            .field("md", &self.md)
+            .field("flags", &self.flags)
+            .field("status_code", &self.status_code)
+            .field("content_type", &self.content_type)
+            .field("content_disposition", &self.content_disposition)
+            .field("encoding", &self.encoding)
+            .finish()
+    }
+}
+
+#[cfg(not(feature = "experimental-io-uring"))]
+pub(crate) use std::fs::File;
+#[cfg(feature = "experimental-io-uring")]
+pub(crate) use tokio_uring::fs::File;
+
 impl NamedFile {
     /// Creates an instance from a previously opened file.
     ///
@@ -61,8 +120,7 @@ impl NamedFile {
     /// `ContentDisposition` headers.
     ///
     /// # Examples
-    ///
-    /// ```rust
+    /// ```ignore
     /// use actix_files::NamedFile;
     /// use std::io::{self, Write};
     /// use std::env;
@@ -96,6 +154,11 @@ impl NamedFile {
 
             let disposition = match ct.type_() {
                 mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
+                mime::APPLICATION => match ct.subtype() {
+                    mime::JAVASCRIPT | mime::JSON => DispositionType::Inline,
+                    name if name == "wasm" => DispositionType::Inline,
+                    _ => DispositionType::Attachment,
+                },
                 _ => DispositionType::Attachment,
             };
 
@@ -118,7 +181,30 @@ impl NamedFile {
             (ct, cd)
         };
 
-        let md = file.metadata()?;
+        let md = {
+            #[cfg(not(feature = "experimental-io-uring"))]
+            {
+                file.metadata()?
+            }
+
+            #[cfg(feature = "experimental-io-uring")]
+            {
+                use std::os::unix::prelude::{AsRawFd, FromRawFd};
+
+                let fd = file.as_raw_fd();
+
+                // SAFETY: fd is borrowed and lives longer than the unsafe block
+                unsafe {
+                    let file = std::fs::File::from_raw_fd(fd);
+                    let md = file.metadata();
+                    // SAFETY: forget the fd before exiting block in success or error case but don't
+                    // run destructor (that would close file handle)
+                    std::mem::forget(file);
+                    md?
+                }
+            }
+        };
+
         let modified = md.modified().ok();
         let encoding = None;
 
@@ -135,17 +221,45 @@ impl NamedFile {
         })
     }
 
+    #[cfg(not(feature = "experimental-io-uring"))]
     /// Attempts to open a file in read-only mode.
     ///
     /// # Examples
-    ///
-    /// ```rust
+    /// ```
     /// use actix_files::NamedFile;
-    ///
     /// let file = NamedFile::open("foo.txt");
     /// ```
     pub fn open<P: AsRef<Path>>(path: P) -> io::Result<NamedFile> {
-        Self::from_file(File::open(&path)?, path)
+        let file = File::open(&path)?;
+        Self::from_file(file, path)
+    }
+
+    /// Attempts to open a file asynchronously in read-only mode.
+    ///
+    /// When the `experimental-io-uring` crate feature is enabled, this will be async.
+    /// Otherwise, it will be just like [`open`][Self::open].
+    ///
+    /// # Examples
+    /// ```
+    /// use actix_files::NamedFile;
+    /// # async fn open() {
+    /// let file = NamedFile::open_async("foo.txt").await.unwrap();
+    /// # }
+    /// ```
+    pub async fn open_async<P: AsRef<Path>>(path: P) -> io::Result<NamedFile> {
+        let file = {
+            #[cfg(not(feature = "experimental-io-uring"))]
+            {
+                File::open(&path)?
+            }
+
+            #[cfg(feature = "experimental-io-uring")]
+            {
+                File::open(&path).await?
+            }
+        };
+
+        Self::from_file(file, path)
     }
 
     /// Returns reference to the underlying `File` object.
@@ -157,13 +271,12 @@ impl NamedFile {
     /// Retrieve the path of this file.
     ///
     /// # Examples
-    ///
-    /// ```rust
+    /// ```
     /// # use std::io;
     /// use actix_files::NamedFile;
     ///
-    /// # fn path() -> io::Result<()> {
-    /// let file = NamedFile::open("test.txt")?;
+    /// # async fn path() -> io::Result<()> {
+    /// let file = NamedFile::open_async("test.txt").await?;
     /// assert_eq!(file.path().as_os_str(), "foo.txt");
     /// # Ok(())
     /// # }
@@ -189,9 +302,11 @@ impl NamedFile {
 
     /// Set the Content-Disposition for serving this file. This allows
     /// changing the inline/attachment disposition as well as the filename
-    /// sent to the peer. By default the disposition is `inline` for text,
-    /// image, and video content types, and `attachment` otherwise, and
-    /// the filename is taken from the path provided in the `open` method
+    /// sent to the peer.
+    ///
+    /// By default the disposition is `inline` for `text/*`, `image/*`, `video/*` and
+    /// `application/{javascript, json, wasm}` mime types, and `attachment` otherwise,
+    /// and the filename is taken from the path provided in the `open` method
     /// after converting it to UTF-8 using.
     /// [`std::ffi::OsStr::to_string_lossy`]
     #[inline]
@@ -211,6 +326,8 @@ impl NamedFile {
     }
 
     /// Set content encoding for serving this file
+    ///
+    /// Must be used with [`actix_web::middleware::Compress`] to take effect.
     #[inline]
     pub fn set_content_encoding(mut self, enc: ContentEncoding) -> Self {
         self.encoding = Some(enc);
@@ -277,37 +394,31 @@ impl NamedFile {
     }
 
     /// Creates an `HttpResponse` with file as a streaming body.
-    pub fn into_response(self, req: &HttpRequest) -> Result<HttpResponse, Error> {
+    pub fn into_response(self, req: &HttpRequest) -> HttpResponse {
         if self.status_code != StatusCode::OK {
             let mut res = HttpResponse::build(self.status_code);
 
             if self.flags.contains(Flags::PREFER_UTF8) {
                 let ct = equiv_utf8_text(self.content_type.clone());
-                res.header(header::CONTENT_TYPE, ct.to_string());
+                res.insert_header((header::CONTENT_TYPE, ct.to_string()));
             } else {
-                res.header(header::CONTENT_TYPE, self.content_type.to_string());
+                res.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
             }
 
             if self.flags.contains(Flags::CONTENT_DISPOSITION) {
-                res.header(
+                res.insert_header((
                     header::CONTENT_DISPOSITION,
                     self.content_disposition.to_string(),
-                );
+                ));
             }
 
             if let Some(current_encoding) = self.encoding {
                 res.encoding(current_encoding);
             }
 
-            let reader = ChunkedReadFile {
-                size: self.md.len(),
-                offset: 0,
-                file: Some(self.file),
-                fut: None,
-                counter: 0,
-            };
+            let reader = super::chunked::new_chunked_read(self.md.len(), 0, self.file);
 
-            return Ok(res.streaming(reader));
+            return res.streaming(reader);
         }
 
         let etag = if self.flags.contains(Flags::ETAG) {
@@ -328,11 +439,11 @@ impl NamedFile {
         } else if let (Some(ref m), Some(header::IfUnmodifiedSince(ref since))) =
             (last_modified, req.get_header())
         {
-            let t1: SystemTime = m.clone().into();
-            let t2: SystemTime = since.clone().into();
+            let t1: SystemTime = (*m).into();
+            let t2: SystemTime = (*since).into();
 
             match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
-                (Ok(t1), Ok(t2)) => t1 > t2,
+                (Ok(t1), Ok(t2)) => t1.as_secs() > t2.as_secs(),
                 _ => false,
             }
         } else {
@@ -347,11 +458,11 @@ impl NamedFile {
         } else if let (Some(ref m), Some(header::IfModifiedSince(ref since))) =
             (last_modified, req.get_header())
         {
-            let t1: SystemTime = m.clone().into();
-            let t2: SystemTime = since.clone().into();
+            let t1: SystemTime = (*m).into();
+            let t2: SystemTime = (*since).into();
 
             match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
-                (Ok(t1), Ok(t2)) => t1 <= t2,
+                (Ok(t1), Ok(t2)) => t1.as_secs() <= t2.as_secs(),
                 _ => false,
             }
         } else {
@@ -362,16 +473,16 @@ impl NamedFile {
 
         if self.flags.contains(Flags::PREFER_UTF8) {
             let ct = equiv_utf8_text(self.content_type.clone());
-            resp.header(header::CONTENT_TYPE, ct.to_string());
+            resp.insert_header((header::CONTENT_TYPE, ct.to_string()));
         } else {
-            resp.header(header::CONTENT_TYPE, self.content_type.to_string());
+            resp.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
         }
 
         if self.flags.contains(Flags::CONTENT_DISPOSITION) {
-            resp.header(
+            resp.insert_header((
                 header::CONTENT_DISPOSITION,
                 self.content_disposition.to_string(),
-            );
+            ));
         }
 
         // default compressing
@@ -380,14 +491,14 @@ impl NamedFile {
         }
 
         if let Some(lm) = last_modified {
-            resp.header(header::LAST_MODIFIED, lm.to_string());
+            resp.insert_header((header::LAST_MODIFIED, lm.to_string()));
         }
 
         if let Some(etag) = etag {
-            resp.header(header::ETAG, etag.to_string());
+            resp.insert_header((header::ETAG, etag.to_string()));
         }
 
-        resp.header(header::ACCEPT_RANGES, "bytes");
+        resp.insert_header((header::ACCEPT_RANGES, "bytes"));
 
         let mut length = self.md.len();
         let mut offset = 0;
@@ -400,57 +511,32 @@ impl NamedFile {
                     offset = ranges[0].start;
 
                     resp.encoding(ContentEncoding::Identity);
-                    resp.header(
+                    resp.insert_header((
                         header::CONTENT_RANGE,
-                        format!(
-                            "bytes {}-{}/{}",
-                            offset,
-                            offset + length - 1,
-                            self.md.len()
-                        ),
-                    );
+                        format!("bytes {}-{}/{}", offset, offset + length - 1, self.md.len()),
+                    ));
                 } else {
-                    resp.header(header::CONTENT_RANGE, format!("bytes */{}", length));
-                    return Ok(resp.status(StatusCode::RANGE_NOT_SATISFIABLE).finish());
+                    resp.insert_header((header::CONTENT_RANGE, format!("bytes */{}", length)));
+                    return resp.status(StatusCode::RANGE_NOT_SATISFIABLE).finish();
                 };
             } else {
-                return Ok(resp.status(StatusCode::BAD_REQUEST).finish());
+                return resp.status(StatusCode::BAD_REQUEST).finish();
             };
         };
 
         if precondition_failed {
-            return Ok(resp.status(StatusCode::PRECONDITION_FAILED).finish());
+            return resp.status(StatusCode::PRECONDITION_FAILED).finish();
         } else if not_modified {
-            return Ok(resp.status(StatusCode::NOT_MODIFIED).finish());
+            return resp.status(StatusCode::NOT_MODIFIED).body(AnyBody::None);
         }
 
-        let reader = ChunkedReadFile {
-            offset,
-            size: length,
-            file: Some(self.file),
-            fut: None,
-            counter: 0,
-        };
+        let reader = super::chunked::new_chunked_read(length, offset, self.file);
 
         if offset != 0 || length != self.md.len() {
             resp.status(StatusCode::PARTIAL_CONTENT);
         }
 
-        Ok(resp.body(SizedStream::new(length, reader)))
-    }
-}
-
-impl Deref for NamedFile {
-    type Target = File;
-
-    fn deref(&self) -> &File {
-        &self.file
-    }
-}
-
-impl DerefMut for NamedFile {
-    fn deref_mut(&mut self) -> &mut File {
-        &mut self.file
+        resp.body(SizedStream::new(length, reader))
     }
 }
 
@@ -494,11 +580,75 @@ fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
     }
 }
 
-impl Responder for NamedFile {
-    type Error = Error;
-    type Future = Ready<Result<HttpResponse, Error>>;
+impl Deref for NamedFile {
+    type Target = File;
 
-    fn respond_to(self, req: &HttpRequest) -> Self::Future {
-        ready(self.into_response(req))
+    fn deref(&self) -> &Self::Target {
+        &self.file
+    }
+}
+
+impl DerefMut for NamedFile {
+    fn deref_mut(&mut self) -> &mut Self::Target {
+        &mut self.file
+    }
+}
+
+impl Responder for NamedFile {
+    fn respond_to(self, req: &HttpRequest) -> HttpResponse {
+        self.into_response(req)
+    }
+}
+
+impl ServiceFactory<ServiceRequest> for NamedFile {
+    type Response = ServiceResponse;
+    type Error = Error;
+    type Config = ();
+    type Service = NamedFileService;
+    type InitError = ();
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
+
+    fn new_service(&self, _: ()) -> Self::Future {
+        let service = NamedFileService {
+            path: self.path.clone(),
+        };
+
+        Box::pin(async move { Ok(service) })
+    }
+}
+
+#[doc(hidden)]
+#[derive(Debug)]
+pub struct NamedFileService {
+    path: PathBuf,
+}
+
+impl Service<ServiceRequest> for NamedFileService {
+    type Response = ServiceResponse;
+    type Error = Error;
+    type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
+
+    actix_service::always_ready!();
+
+    fn call(&self, req: ServiceRequest) -> Self::Future {
+        let (req, _) = req.into_parts();
+
+        let path = self.path.clone();
+        Box::pin(async move {
+            let file = NamedFile::open_async(path).await?;
+            let res = file.into_response(&req);
+            Ok(ServiceResponse::new(req, res))
+        })
+    }
+}
+
+impl HttpServiceFactory for NamedFile {
+    fn register(self, config: &mut AppService) {
+        config.register_service(
+            ResourceDef::root_prefix(self.path.to_string_lossy().as_ref()),
+            None,
+            self,
+            None,
+        )
     }
 }

actix-files/src/path_buf.rs

@@ -1,14 +1,14 @@
 use std::{
+    future::{ready, Ready},
     path::{Path, PathBuf},
     str::FromStr,
 };
 
 use actix_web::{dev::Payload, FromRequest, HttpRequest};
-use futures_util::future::{ready, Ready};
 
 use crate::error::UriSegmentError;
 
-#[derive(Debug)]
+#[derive(Debug, PartialEq, Eq)]
 pub(crate) struct PathBufWrap(PathBuf);
 
 impl FromStr for PathBufWrap {
@@ -21,6 +21,8 @@ impl FromStr for PathBufWrap {
 
 impl PathBufWrap {
     /// Parse a path, giving the choice of allowing hidden files to be considered valid segments.
+    ///
+    /// Path traversal is guarded by this method.
     pub fn parse_path(path: &str, hidden_files: bool) -> Result<Self, UriSegmentError> {
         let mut buf = PathBuf::new();
 
@@ -59,7 +61,6 @@ impl AsRef<Path> for PathBufWrap {
 impl FromRequest for PathBufWrap {
     type Error = UriSegmentError;
     type Future = Ready<Result<Self, Self::Error>>;
-    type Config = ();
 
     fn from_request(req: &HttpRequest, _: &mut Payload) -> Self::Future {
         ready(req.match_info().path().parse())
@@ -116,4 +117,24 @@ mod tests {
             PathBuf::from_iter(vec!["test", ".tt"])
         );
     }
+
+    #[test]
+    fn path_traversal() {
+        assert_eq!(
+            PathBufWrap::parse_path("/../README.md", false).unwrap().0,
+            PathBuf::from_iter(vec!["README.md"])
+        );
+
+        assert_eq!(
+            PathBufWrap::parse_path("/../README.md", true).unwrap().0,
+            PathBuf::from_iter(vec!["README.md"])
+        );
+
+        assert_eq!(
+            PathBufWrap::parse_path("/../../../../../../../../../../etc/passwd", false)
+                .unwrap()
+                .0,
+            PathBuf::from_iter(vec!["etc/passwd"])
+        );
+    }
 }

actix-files/src/range.rs

@@ -10,9 +10,6 @@ pub struct HttpRange {
     pub length: u64,
 }
 
-const PREFIX: &str = "bytes=";
-const PREFIX_LEN: usize = 6;
-
 #[derive(Debug, Clone, Display, Error)]
 #[display(fmt = "Parse HTTP Range failed")]
 pub struct ParseRangeErr(#[error(not(source))] ());
@@ -23,84 +20,16 @@ impl HttpRange {
     /// `header` is HTTP Range header (e.g. `bytes=bytes=0-9`).
     /// `size` is full size of response (file).
     pub fn parse(header: &str, size: u64) -> Result<Vec<HttpRange>, ParseRangeErr> {
-        if header.is_empty() {
-            return Ok(Vec::new());
+        match http_range::HttpRange::parse(header, size) {
+            Ok(ranges) => Ok(ranges
+                .iter()
+                .map(|range| HttpRange {
+                    start: range.start,
+                    length: range.length,
+                })
+                .collect()),
+            Err(_) => Err(ParseRangeErr(())),
         }
-        if !header.starts_with(PREFIX) {
-            return Err(ParseRangeErr(()));
-        }
-
-        let size_sig = size as i64;
-        let mut no_overlap = false;
-
-        let all_ranges: Vec<Option<HttpRange>> = header[PREFIX_LEN..]
-            .split(',')
-            .map(|x| x.trim())
-            .filter(|x| !x.is_empty())
-            .map(|ra| {
-                let mut start_end_iter = ra.split('-');
-
-                let start_str = start_end_iter.next().ok_or(ParseRangeErr(()))?.trim();
-                let end_str = start_end_iter.next().ok_or(ParseRangeErr(()))?.trim();
-
-                if start_str.is_empty() {
-                    // If no start is specified, end specifies the
-                    // range start relative to the end of the file.
-                    let mut length: i64 =
-                        end_str.parse().map_err(|_| ParseRangeErr(()))?;
-
-                    if length > size_sig {
-                        length = size_sig;
-                    }
-
-                    Ok(Some(HttpRange {
-                        start: (size_sig - length) as u64,
-                        length: length as u64,
-                    }))
-                } else {
-                    let start: i64 = start_str.parse().map_err(|_| ParseRangeErr(()))?;
-
-                    if start < 0 {
-                        return Err(ParseRangeErr(()));
-                    }
-                    if start >= size_sig {
-                        no_overlap = true;
-                        return Ok(None);
-                    }
-
-                    let length = if end_str.is_empty() {
-                        // If no end is specified, range extends to end of the file.
-                        size_sig - start
-                    } else {
-                        let mut end: i64 =
-                            end_str.parse().map_err(|_| ParseRangeErr(()))?;
-
-                        if start > end {
-                            return Err(ParseRangeErr(()));
-                        }
-
-                        if end >= size_sig {
-                            end = size_sig - 1;
-                        }
-
-                        end - start + 1
-                    };
-
-                    Ok(Some(HttpRange {
-                        start: start as u64,
-                        length: length as u64,
-                    }))
-                }
-            })
-            .collect::<Result<_, _>>()?;
-
-        let ranges: Vec<HttpRange> = all_ranges.into_iter().filter_map(|x| x).collect();
-
-        if no_overlap && ranges.is_empty() {
-            return Err(ParseRangeErr(()));
-        }
-
-        Ok(ranges)
     }
 }
 

actix-files/src/service.rs

@@ -1,9 +1,4 @@
-use std::{
-    fmt, io,
-    path::PathBuf,
-    rc::Rc,
-    task::{Context, Poll},
-};
+use std::{fmt, io, ops::Deref, path::PathBuf, rc::Rc};
 
 use actix_service::Service;
 use actix_web::{
@@ -13,15 +8,26 @@ use actix_web::{
     http::{header, Method},
     HttpResponse,
 };
-use futures_util::future::{ok, Either, LocalBoxFuture, Ready};
+use futures_core::future::LocalBoxFuture;
 
 use crate::{
-    named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride,
-    NamedFile, PathBufWrap,
+    named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride, NamedFile,
+    PathBufWrap, PathFilter,
 };
 
 /// Assembled file serving service.
-pub struct FilesService {
+#[derive(Clone)]
+pub struct FilesService(pub(crate) Rc<FilesServiceInner>);
+
+impl Deref for FilesService {
+    type Target = FilesServiceInner;
+
+    fn deref(&self) -> &Self::Target {
+        &*self.0
+    }
+}
+
+pub struct FilesServiceInner {
     pub(crate) directory: PathBuf,
     pub(crate) index: Option<String>,
     pub(crate) show_index: bool,
@@ -29,26 +35,56 @@ pub struct FilesService {
     pub(crate) default: Option<HttpService>,
     pub(crate) renderer: Rc<DirectoryRenderer>,
     pub(crate) mime_override: Option<Rc<MimeOverride>>,
+    pub(crate) path_filter: Option<Rc<PathFilter>>,
     pub(crate) file_flags: named::Flags,
     pub(crate) guards: Option<Rc<dyn Guard>>,
     pub(crate) hidden_files: bool,
 }
 
-type FilesServiceFuture = Either<
-    Ready<Result<ServiceResponse, Error>>,
-    LocalBoxFuture<'static, Result<ServiceResponse, Error>>,
->;
+impl fmt::Debug for FilesServiceInner {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        f.write_str("FilesServiceInner")
+    }
+}
 
 impl FilesService {
-    fn handle_err(&mut self, e: io::Error, req: ServiceRequest) -> FilesServiceFuture {
-        log::debug!("Failed to handle {}: {}", req.path(), e);
+    async fn handle_err(
+        &self,
+        err: io::Error,
+        req: ServiceRequest,
+    ) -> Result<ServiceResponse, Error> {
+        log::debug!("error handling {}: {}", req.path(), err);
 
-        if let Some(ref mut default) = self.default {
-            Either::Right(default.call(req))
+        if let Some(ref default) = self.default {
+            default.call(req).await
         } else {
-            Either::Left(ok(req.error_response(e)))
+            Ok(req.error_response(err))
         }
     }
+
+    fn serve_named_file(
+        &self,
+        req: ServiceRequest,
+        mut named_file: NamedFile,
+    ) -> ServiceResponse {
+        if let Some(ref mime_override) = self.mime_override {
+            let new_disposition = mime_override(&named_file.content_type.type_());
+            named_file.content_disposition.disposition = new_disposition;
+        }
+        named_file.flags = self.file_flags;
+
+        let (req, _) = req.into_parts();
+        let res = named_file.into_response(&req);
+        ServiceResponse::new(req, res)
+    }
+
+    fn show_index(&self, req: ServiceRequest, path: PathBuf) -> ServiceResponse {
+        let dir = Directory::new(self.directory.clone(), path);
+
+        let (req, _) = req.into_parts();
+
+        (self.renderer)(&dir, &req).unwrap_or_else(|e| ServiceResponse::from_err(e, req))
+    }
 }
 
 impl fmt::Debug for FilesService {
@@ -60,13 +96,11 @@ impl fmt::Debug for FilesService {
 impl Service<ServiceRequest> for FilesService {
     type Response = ServiceResponse;
     type Error = Error;
-    type Future = FilesServiceFuture;
+    type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        Poll::Ready(Ok(()))
-    }
+    actix_service::always_ready!();
 
-    fn call(&mut self, req: ServiceRequest) -> Self::Future {
+    fn call(&self, req: ServiceRequest) -> Self::Future {
         let is_method_valid = if let Some(guard) = &self.guards {
             // execute user defined guards
             (**guard).check(req.head())
@@ -75,94 +109,87 @@ impl Service<ServiceRequest> for FilesService {
             matches!(*req.method(), Method::HEAD | Method::GET)
         };
 
-        if !is_method_valid {
-            return Either::Left(ok(req.into_response(
-                actix_web::HttpResponse::MethodNotAllowed()
-                    .header(header::CONTENT_TYPE, "text/plain")
-                    .body("Request did not meet this resource's requirements."),
-            )));
-        }
+        let this = self.clone();
 
-        let real_path =
-            match PathBufWrap::parse_path(req.match_info().path(), self.hidden_files) {
-                Ok(item) => item,
-                Err(e) => return Either::Left(ok(req.error_response(e))),
-            };
+        Box::pin(async move {
+            if !is_method_valid {
+                return Ok(req.into_response(
+                    actix_web::HttpResponse::MethodNotAllowed()
+                        .insert_header(header::ContentType(mime::TEXT_PLAIN_UTF_8))
+                        .body("Request did not meet this resource's requirements."),
+                ));
+            }
 
-        // full file path
-        let path = match self.directory.join(&real_path).canonicalize() {
-            Ok(path) => path,
-            Err(e) => return self.handle_err(e, req),
-        };
+            let real_path =
+                match PathBufWrap::parse_path(req.match_info().path(), this.hidden_files) {
+                    Ok(item) => item,
+                    Err(e) => return Ok(req.error_response(e)),
+                };
 
-        if path.is_dir() {
-            if let Some(ref redir_index) = self.index {
-                if self.redirect_to_slash && !req.path().ends_with('/') {
+            if let Some(filter) = &this.path_filter {
+                if !filter(real_path.as_ref(), req.head()) {
+                    if let Some(ref default) = this.default {
+                        return default.call(req).await;
+                    } else {
+                        return Ok(
+                            req.into_response(actix_web::HttpResponse::NotFound().finish())
+                        );
+                    }
+                }
+            }
+
+            // full file path
+            let path = this.directory.join(&real_path);
+            if let Err(err) = path.canonicalize() {
+                return this.handle_err(err, req).await;
+            }
+
+            if path.is_dir() {
+                if this.redirect_to_slash
+                    && !req.path().ends_with('/')
+                    && (this.index.is_some() || this.show_index)
+                {
                     let redirect_to = format!("{}/", req.path());
 
-                    return Either::Left(ok(req.into_response(
+                    return Ok(req.into_response(
                         HttpResponse::Found()
-                            .header(header::LOCATION, redirect_to)
-                            .body("")
-                            .into_body(),
-                    )));
+                            .insert_header((header::LOCATION, redirect_to))
+                            .finish(),
+                    ));
                 }
 
-                let path = path.join(redir_index);
-
-                match NamedFile::open(path) {
+                match this.index {
+                    Some(ref index) => {
+                        let named_path = path.join(index);
+                        match NamedFile::open_async(named_path).await {
+                            Ok(named_file) => Ok(this.serve_named_file(req, named_file)),
+                            Err(_) if this.show_index => Ok(this.show_index(req, path)),
+                            Err(err) => this.handle_err(err, req).await,
+                        }
+                    }
+                    None if this.show_index => Ok(this.show_index(req, path)),
+                    _ => Ok(ServiceResponse::from_err(
+                        FilesError::IsDirectory,
+                        req.into_parts().0,
+                    )),
+                }
+            } else {
+                match NamedFile::open_async(&path).await {
                     Ok(mut named_file) => {
-                        if let Some(ref mime_override) = self.mime_override {
+                        if let Some(ref mime_override) = this.mime_override {
                             let new_disposition =
                                 mime_override(&named_file.content_type.type_());
                             named_file.content_disposition.disposition = new_disposition;
                         }
-                        named_file.flags = self.file_flags;
+                        named_file.flags = this.file_flags;
 
                         let (req, _) = req.into_parts();
-                        Either::Left(ok(match named_file.into_response(&req) {
-                            Ok(item) => ServiceResponse::new(req, item),
-                            Err(e) => ServiceResponse::from_err(e, req),
-                        }))
+                        let res = named_file.into_response(&req);
+                        Ok(ServiceResponse::new(req, res))
                     }
-                    Err(e) => self.handle_err(e, req),
+                    Err(err) => this.handle_err(err, req).await,
                 }
-            } else if self.show_index {
-                let dir = Directory::new(self.directory.clone(), path);
-
-                let (req, _) = req.into_parts();
-                let x = (self.renderer)(&dir, &req);
-
-                match x {
-                    Ok(resp) => Either::Left(ok(resp)),
-                    Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
-                }
-            } else {
-                Either::Left(ok(ServiceResponse::from_err(
-                    FilesError::IsDirectory,
-                    req.into_parts().0,
-                )))
             }
-        } else {
-            match NamedFile::open(path) {
-                Ok(mut named_file) => {
-                    if let Some(ref mime_override) = self.mime_override {
-                        let new_disposition =
-                            mime_override(&named_file.content_type.type_());
-                        named_file.content_disposition.disposition = new_disposition;
-                    }
-                    named_file.flags = self.file_flags;
-
-                    let (req, _) = req.into_parts();
-                    match named_file.into_response(&req) {
-                        Ok(item) => {
-                            Either::Left(ok(ServiceResponse::new(req.clone(), item)))
-                        }
-                        Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
-                    }
-                }
-                Err(e) => self.handle_err(e, req),
-            }
-        }
+        })
     }
 }

actix-files/tests/encoding.rs

@@ -8,14 +8,13 @@ use actix_web::{
     App,
 };
 
-#[actix_rt::test]
+#[actix_web::test]
 async fn test_utf8_file_contents() {
     // use default ISO-8859-1 encoding
-    let mut srv =
-        test::init_service(App::new().service(Files::new("/", "./tests"))).await;
+    let srv = test::init_service(App::new().service(Files::new("/", "./tests"))).await;
 
     let req = TestRequest::with_uri("/utf8.txt").to_request();
-    let res = test::call_service(&mut srv, req).await;
+    let res = test::call_service(&srv, req).await;
 
     assert_eq!(res.status(), StatusCode::OK);
     assert_eq!(
@@ -24,13 +23,12 @@ async fn test_utf8_file_contents() {
     );
 
     // prefer UTF-8 encoding
-    let mut srv = test::init_service(
-        App::new().service(Files::new("/", "./tests").prefer_utf8(true)),
-    )
-    .await;
+    let srv =
+        test::init_service(App::new().service(Files::new("/", "./tests").prefer_utf8(true)))
+            .await;
 
     let req = TestRequest::with_uri("/utf8.txt").to_request();
-    let res = test::call_service(&mut srv, req).await;
+    let res = test::call_service(&srv, req).await;
 
     assert_eq!(res.status(), StatusCode::OK);
     assert_eq!(

actix-files/tests/fixtures/guards/first/index.txt

@@ -0,0 +1 @@
+first

actix-files/tests/fixtures/guards/second/index.txt

@@ -0,0 +1 @@
+second

actix-files/tests/guard.rs

@@ -0,0 +1,36 @@
+use actix_files::Files;
+use actix_web::{
+    guard::Host,
+    http::StatusCode,
+    test::{self, TestRequest},
+    App,
+};
+use bytes::Bytes;
+
+#[actix_web::test]
+async fn test_guard_filter() {
+    let srv = test::init_service(
+        App::new()
+            .service(Files::new("/", "./tests/fixtures/guards/first").guard(Host("first.com")))
+            .service(
+                Files::new("/", "./tests/fixtures/guards/second").guard(Host("second.com")),
+            ),
+    )
+    .await;
+
+    let req = TestRequest::with_uri("/index.txt")
+        .append_header(("Host", "first.com"))
+        .to_request();
+    let res = test::call_service(&srv, req).await;
+
+    assert_eq!(res.status(), StatusCode::OK);
+    assert_eq!(test::read_body(res).await, Bytes::from("first"));
+
+    let req = TestRequest::with_uri("/index.txt")
+        .append_header(("Host", "second.com"))
+        .to_request();
+    let res = test::call_service(&srv, req).await;
+
+    assert_eq!(res.status(), StatusCode::OK);
+    assert_eq!(test::read_body(res).await, Bytes::from("second"));
+}

actix-files/tests/symlink-test.png

@@ -0,0 +1 @@
+test.png

actix-files/tests/test.js

@@ -0,0 +1 @@
+// this file is empty.

actix-files/tests/traversal.rs

@@ -0,0 +1,27 @@
+use actix_files::Files;
+use actix_web::{
+    http::StatusCode,
+    test::{self, TestRequest},
+    App,
+};
+
+#[actix_rt::test]
+async fn test_directory_traversal_prevention() {
+    let srv = test::init_service(App::new().service(Files::new("/", "./tests"))).await;
+
+    let req =
+        TestRequest::with_uri("/../../../../../../../../../../../etc/passwd").to_request();
+    let res = test::call_service(&srv, req).await;
+    assert_eq!(res.status(), StatusCode::NOT_FOUND);
+
+    let req = TestRequest::with_uri(
+        "/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/%2e%2e/etc/passwd",
+    )
+    .to_request();
+    let res = test::call_service(&srv, req).await;
+    assert_eq!(res.status(), StatusCode::NOT_FOUND);
+
+    let req = TestRequest::with_uri("/%00/etc/passwd%00").to_request();
+    let res = test::call_service(&srv, req).await;
+    assert_eq!(res.status(), StatusCode::NOT_FOUND);
+}

actix-http-test/CHANGES.md

@@ -3,6 +3,38 @@
 ## Unreleased - 2021-xx-xx
 
 
+## 3.0.0-beta.7 - 2021-11-22
+* Fix compatibility with experimental `io-uring` feature of `actix-rt`. [#2408]
+
+[#2408]: https://github.com/actix/actix-web/pull/2408
+
+
+## 3.0.0-beta.6 - 2021-11-15
+* `TestServer::stop` is now async and will wait for the server and system to shutdown. [#2442]
+* Update `actix-server` to `2.0.0-beta.9`. [#2442]
+* Minimum supported Rust version (MSRV) is now 1.52.
+
+[#2442]: https://github.com/actix/actix-web/pull/2442
+
+
+## 3.0.0-beta.5 - 2021-09-09
+* Minimum supported Rust version (MSRV) is now 1.51.
+
+
+## 3.0.0-beta.4 - 2021-04-02
+* Added `TestServer::client_headers` method. [#2097]
+
+[#2097]: https://github.com/actix/actix-web/pull/2097
+
+
+## 3.0.0-beta.3 - 2021-03-09
+* No notable changes.
+
+
+## 3.0.0-beta.2 - 2021-02-10
+* No notable changes.
+
+
 ## 3.0.0-beta.1 - 2021-01-07
 * Update `bytes` to `1.0`. [#1813]
 

actix-http-test/Cargo.toml

@@ -1,18 +1,18 @@
 [package]
 name = "actix-http-test"
-version = "3.0.0-beta.1"
+version = "3.0.0-beta.7"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Various helpers for Actix applications to use during testing"
-readme = "README.md"
 keywords = ["http", "web", "framework", "async", "futures"]
 homepage = "https://actix.rs"
 repository = "https://github.com/actix/actix-web.git"
-documentation = "https://docs.rs/actix-http-test/"
-categories = ["network-programming", "asynchronous",
-              "web-programming::http-server",
-              "web-programming::websocket"]
+categories = [
+    "network-programming",
+    "asynchronous",
+    "web-programming::http-server",
+    "web-programming::websocket",
+]
 license = "MIT OR Apache-2.0"
-exclude = [".gitignore", ".cargo/config"]
 edition = "2018"
 
 [package.metadata.docs.rs]
@@ -26,30 +26,30 @@ path = "src/lib.rs"
 default = []
 
 # openssl
-openssl = ["open-ssl", "awc/openssl"]
+openssl = ["tls-openssl", "awc/openssl"]
 
 [dependencies]
-actix-service = "2.0.0-beta.2"
-actix-codec = "0.4.0-beta.1"
-actix-tls = "3.0.0-beta.2"
-actix-utils = "3.0.0-beta.1"
-actix-rt = "2.0.0-beta.1"
-actix-server = "2.0.0-beta.2"
-awc = "3.0.0-beta.1"
+actix-service = "2.0.0"
+actix-codec = "0.4.1"
+actix-tls = "3.0.0-beta.9"
+actix-utils = "3.0.0"
+actix-rt = "2.2"
+actix-server = "2.0.0-beta.9"
+awc = { version = "3.0.0-beta.11", default-features = false }
 
 base64 = "0.13"
 bytes = "1"
 futures-core = { version = "0.3.7", default-features = false }
-http = "0.2.2"
+http = "0.2.5"
 log = "0.4"
-socket2 = "0.3"
+socket2 = "0.4"
 serde = "1.0"
 serde_json = "1.0"
 slab = "0.4"
 serde_urlencoded = "0.7"
-time = { version = "0.2.7", default-features = false, features = ["std"] }
-open-ssl = { version = "0.10", package = "openssl", optional = true }
+tls-openssl = { version = "0.10.9", package = "openssl", optional = true }
+tokio = { version = "1.2", features = ["sync"] }
 
 [dev-dependencies]
-actix-web = "4.0.0-beta.1"
-actix-http = "3.0.0-beta.1"
+actix-web = { version = "4.0.0-beta.11", default-features = false, features = ["cookies"] }
+actix-http = "3.0.0-beta.13"

actix-http-test/README.md

@@ -3,13 +3,15 @@
 > Various helpers for Actix applications to use during testing.
 
 [![crates.io](https://img.shields.io/crates/v/actix-http-test?label=latest)](https://crates.io/crates/actix-http-test)
-[![Documentation](https://docs.rs/actix-http-test/badge.svg?version=2.1.0)](https://docs.rs/actix-http-test/2.1.0)
-![Apache 2.0 or MIT licensed](https://img.shields.io/crates/l/actix-http-test)
-[![Dependency Status](https://deps.rs/crate/actix-http-test/2.1.0/status.svg)](https://deps.rs/crate/actix-http-test/2.1.0)
-[![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+[![Documentation](https://docs.rs/actix-http-test/badge.svg?version=3.0.0-beta.7)](https://docs.rs/actix-http-test/3.0.0-beta.7)
+[![Version](https://img.shields.io/badge/rustc-1.52+-ab6000.svg)](https://blog.rust-lang.org/2021/05/06/Rust-1.52.0.html)
+![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http-test)
+<br>
+[![Dependency Status](https://deps.rs/crate/actix-http-test/3.0.0-beta.7/status.svg)](https://deps.rs/crate/actix-http-test/3.0.0-beta.7)
+[![Download](https://img.shields.io/crates/d/actix-http-test.svg)](https://crates.io/crates/actix-http-test)
+[![Chat on Discord](https://img.shields.io/discord/771444961383153695?label=chat&logo=discord)](https://discord.gg/NWpN5mmg3x)
 
 ## Documentation & Resources
 
 - [API Documentation](https://docs.rs/actix-http-test)
-- [Chat on Gitter](https://gitter.im/actix/actix-web)
-- Minimum Supported Rust Version (MSRV): 1.46.0
+- Minimum Supported Rust Version (MSRV): 1.52

actix-http-test/src/lib.rs

@@ -4,40 +4,43 @@
 #![doc(html_logo_url = "https://actix.rs/img/logo.png")]
 #![doc(html_favicon_url = "https://actix.rs/favicon.ico")]
 
-use std::sync::mpsc;
-use std::{net, thread, time};
+#[cfg(feature = "openssl")]
+extern crate tls_openssl as openssl;
+
+use std::{net, thread, time::Duration};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_rt::{net::TcpStream, System};
 use actix_server::{Server, ServiceFactory};
-use awc::{error::PayloadError, ws, Client, ClientRequest, ClientResponse, Connector};
+use awc::{
+    error::PayloadError, http::HeaderMap, ws, Client, ClientRequest, ClientResponse, Connector,
+};
 use bytes::Bytes;
 use futures_core::stream::Stream;
 use http::Method;
 use socket2::{Domain, Protocol, Socket, Type};
+use tokio::sync::mpsc;
 
-/// Start test server
+/// Start test server.
 ///
-/// `TestServer` is very simple test server that simplify process of writing
-/// integration tests cases for actix web applications.
+/// `TestServer` is very simple test server that simplify process of writing integration tests cases
+/// for HTTP applications.
 ///
 /// # Examples
-///
-/// ```rust
+/// ```no_run
 /// use actix_http::HttpService;
-/// use actix_http_test::TestServer;
+/// use actix_http_test::test_server;
 /// use actix_web::{web, App, HttpResponse, Error};
 ///
 /// async fn my_handler() -> Result<HttpResponse, Error> {
 ///     Ok(HttpResponse::Ok().into())
 /// }
 ///
-/// #[actix_rt::test]
+/// #[actix_web::test]
 /// async fn test_example() {
-///     let mut srv = TestServer::start(
-///         || HttpService::new(
-///             App::new().service(
-///                 web::resource("/").to(my_handler))
+///     let mut srv = TestServer::start(||
+///         HttpService::new(
+///             App::new().service(web::resource("/").to(my_handler))
 ///         )
 ///     );
 ///
@@ -51,86 +54,86 @@ pub async fn test_server<F: ServiceFactory<TcpStream>>(factory: F) -> TestServer
     test_server_with_addr(tcp, factory).await
 }
 
-/// Start [`test server`](test_server()) on a concrete Address
+/// Start [`test server`](test_server()) on an existing address binding.
 pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
     tcp: net::TcpListener,
     factory: F,
 ) -> TestServer {
-    let (tx, rx) = mpsc::channel();
+    let (started_tx, started_rx) = std::sync::mpsc::channel();
+    let (thread_stop_tx, thread_stop_rx) = mpsc::channel(1);
 
     // run server in separate thread
     thread::spawn(move || {
-        let sys = System::new("actix-test-server");
-        let local_addr = tcp.local_addr().unwrap();
+        System::new().block_on(async move {
+            let local_addr = tcp.local_addr().unwrap();
 
-        let srv = Server::build()
-            .listen("test", tcp, factory)?
-            .workers(1)
-            .disable_signals();
+            let srv = Server::build()
+                .workers(1)
+                .disable_signals()
+                .system_exit()
+                .listen("test", tcp, factory)
+                .expect("test server could not be created");
 
-        sys.block_on(async {
-            srv.start();
-            tx.send((System::current(), local_addr)).unwrap();
+            let srv = srv.run();
+            started_tx
+                .send((System::current(), srv.handle(), local_addr))
+                .unwrap();
+
+            // drive server loop
+            srv.await.unwrap();
         });
 
-        sys.run()
+        // notify TestServer that server and system have shut down
+        // all thread managed resources should be dropped at this point
+        let _ = thread_stop_tx.send(());
     });
 
-    let (system, addr) = rx.recv().unwrap();
+    let (system, server, addr) = started_rx.recv().unwrap();
 
     let client = {
+        #[cfg(feature = "openssl")]
         let connector = {
-            #[cfg(feature = "openssl")]
-            {
-                use open_ssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
+            use openssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
 
-                let mut builder = SslConnector::builder(SslMethod::tls()).unwrap();
-                builder.set_verify(SslVerifyMode::NONE);
-                let _ = builder
-                    .set_alpn_protos(b"\x02h2\x08http/1.1")
-                    .map_err(|e| log::error!("Can not set alpn protocol: {:?}", e));
-                Connector::new()
-                    .conn_lifetime(time::Duration::from_secs(0))
-                    .timeout(time::Duration::from_millis(30000))
-                    .ssl(builder.build())
-                    .finish()
-            }
-            #[cfg(not(feature = "openssl"))]
-            {
-                Connector::new()
-                    .conn_lifetime(time::Duration::from_secs(0))
-                    .timeout(time::Duration::from_millis(30000))
-                    .finish()
-            }
+            let mut builder = SslConnector::builder(SslMethod::tls()).unwrap();
+
+            builder.set_verify(SslVerifyMode::NONE);
+            let _ = builder
+                .set_alpn_protos(b"\x02h2\x08http/1.1")
+                .map_err(|e| log::error!("Can not set alpn protocol: {:?}", e));
+
+            Connector::new()
+                .conn_lifetime(Duration::from_secs(0))
+                .timeout(Duration::from_millis(30000))
+                .ssl(builder.build())
+        };
+
+        #[cfg(not(feature = "openssl"))]
+        let connector = {
+            Connector::new()
+                .conn_lifetime(Duration::from_secs(0))
+                .timeout(Duration::from_millis(30000))
         };
 
         Client::builder().connector(connector).finish()
     };
-    actix_tls::connect::start_default_resolver().await.unwrap();
 
     TestServer {
-        addr,
+        server,
         client,
         system,
+        addr,
+        thread_stop_rx,
     }
 }
 
-/// Get first available unused address
-pub fn unused_addr() -> net::SocketAddr {
-    let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
-    let socket =
-        Socket::new(Domain::ipv4(), Type::stream(), Some(Protocol::tcp())).unwrap();
-    socket.bind(&addr.into()).unwrap();
-    socket.set_reuse_address(true).unwrap();
-    let tcp = socket.into_tcp_listener();
-    tcp.local_addr().unwrap()
-}
-
 /// Test server controller
 pub struct TestServer {
+    server: actix_server::ServerHandle,
+    client: awc::Client,
+    system: actix_rt::System,
     addr: net::SocketAddr,
-    client: Client,
-    system: System,
+    thread_stop_rx: mpsc::Receiver<()>,
 }
 
 impl TestServer {
@@ -148,7 +151,7 @@ impl TestServer {
         }
     }
 
-    /// Construct test https server url
+    /// Construct test HTTPS server URL.
     pub fn surl(&self, uri: &str) -> String {
         if uri.starts_with('/') {
             format!("https://localhost:{}{}", self.addr.port(), uri)
@@ -162,7 +165,7 @@ impl TestServer {
         self.client.get(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `GET` request
+    /// Create HTTPS `GET` request
     pub fn sget<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.get(self.surl(path.as_ref()).as_str())
     }
@@ -172,7 +175,7 @@ impl TestServer {
         self.client.post(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `POST` request
+    /// Create HTTPS `POST` request
     pub fn spost<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.post(self.surl(path.as_ref()).as_str())
     }
@@ -182,7 +185,7 @@ impl TestServer {
         self.client.head(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `HEAD` request
+    /// Create HTTPS `HEAD` request
     pub fn shead<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.head(self.surl(path.as_ref()).as_str())
     }
@@ -192,7 +195,7 @@ impl TestServer {
         self.client.put(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `PUT` request
+    /// Create HTTPS `PUT` request
     pub fn sput<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.put(self.surl(path.as_ref()).as_str())
     }
@@ -202,7 +205,7 @@ impl TestServer {
         self.client.patch(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `PATCH` request
+    /// Create HTTPS `PATCH` request
     pub fn spatch<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.patch(self.surl(path.as_ref()).as_str())
     }
@@ -212,7 +215,7 @@ impl TestServer {
         self.client.delete(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `DELETE` request
+    /// Create HTTPS `DELETE` request
     pub fn sdelete<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.delete(self.surl(path.as_ref()).as_str())
     }
@@ -222,12 +225,12 @@ impl TestServer {
         self.client.options(self.url(path.as_ref()).as_str())
     }
 
-    /// Create https `OPTIONS` request
+    /// Create HTTPS `OPTIONS` request
     pub fn soptions<S: AsRef<str>>(&self, path: S) -> ClientRequest {
         self.client.options(self.surl(path.as_ref()).as_str())
     }
 
-    /// Connect to test http server
+    /// Connect to test HTTP server
     pub fn request<S: AsRef<str>>(&self, method: Method, path: S) -> ClientRequest {
         self.client.request(method, path.as_ref())
     }
@@ -242,33 +245,66 @@ impl TestServer {
         response.body().limit(10_485_760).await
     }
 
-    /// Connect to websocket server at a given path
+    /// Connect to WebSocket server at a given path.
     pub async fn ws_at(
         &mut self,
         path: &str,
-    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError>
-    {
+    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
         let url = self.url(path);
         let connect = self.client.ws(url).connect();
         connect.await.map(|(_, framed)| framed)
     }
 
-    /// Connect to a websocket server
+    /// Connect to a WebSocket server.
     pub async fn ws(
         &mut self,
-    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError>
-    {
+    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
         self.ws_at("/").await
     }
 
-    /// Stop http server
-    fn stop(&mut self) {
+    /// Get default HeaderMap of Client.
+    ///
+    /// Returns Some(&mut HeaderMap) when Client object is unique
+    /// (No other clone of client exists at the same time).
+    pub fn client_headers(&mut self) -> Option<&mut HeaderMap> {
+        self.client.headers()
+    }
+
+    /// Stop HTTP server.
+    ///
+    /// Waits for spawned `Server` and `System` to (force) shutdown.
+    pub async fn stop(&mut self) {
+        // signal server to stop
+        self.server.stop(false).await;
+
+        // also signal system to stop
+        // though this is handled by `ServerBuilder::exit_system` too
         self.system.stop();
+
+        // wait for thread to be stopped but don't care about result
+        let _ = self.thread_stop_rx.recv().await;
     }
 }
 
 impl Drop for TestServer {
     fn drop(&mut self) {
-        self.stop()
+        // calls in this Drop impl should be enough to shut down the server, system, and thread
+        // without needing to await anything
+
+        // signal server to stop
+        let _ = self.server.stop(true);
+
+        // signal system to stop
+        self.system.stop();
     }
 }
+
+/// Get a localhost socket address with random, unused port.
+pub fn unused_addr() -> net::SocketAddr {
+    let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
+    let socket = Socket::new(Domain::IPV4, Type::STREAM, Some(Protocol::TCP)).unwrap();
+    socket.bind(&addr.into()).unwrap();
+    socket.set_reuse_address(true).unwrap();
+    let tcp = net::TcpListener::from(socket);
+    tcp.local_addr().unwrap()
+}

actix-http/CHANGES.md

@@ -3,6 +3,251 @@
 ## Unreleased - 2021-xx-xx
 
 
+## 3.0.0-beta.13 - 2021-11-22
+### Added
+* `body::AnyBody::empty` for quickly creating an empty body. [#2446]
+* `body::AnyBody::none` for quickly creating a "none" body. [#2456]
+* `impl Clone` for `body::AnyBody<S> where S: Clone`. [#2448]
+* `body::AnyBody::into_boxed` for quickly converting to a type-erased, boxed body type. [#2448]
+
+### Changed
+* Rename `body::AnyBody::{Message => Body}`. [#2446]
+* Rename `body::AnyBody::{from_message => new_boxed}`. [#2448]
+* Rename `body::AnyBody::{from_slice => copy_from_slice}`. [#2448]
+* Rename `body::{BoxAnyBody => BoxBody}`. [#2448]
+* Change representation of `AnyBody` to include a type parameter in `Body` variant. Defaults to `BoxBody`. [#2448]
+* `Encoder::response` now returns `AnyBody<Encoder<B>>`. [#2448]
+
+### Removed
+* `body::AnyBody::Empty`; an empty body can now only be represented as a zero-length `Bytes` variant. [#2446]
+* `body::BodySize::Empty`; an empty body can now only be represented as a `Sized(0)` variant. [#2446]
+* `EncoderError::Boxed`; it is no longer required. [#2446]
+* `body::ResponseBody`; is function is replaced by the new `body::AnyBody` enum. [#2446]
+
+[#2446]: https://github.com/actix/actix-web/pull/2446
+[#2448]: https://github.com/actix/actix-web/pull/2448
+[#2456]: https://github.com/actix/actix-web/pull/2456
+
+
+## 3.0.0-beta.12 - 2021-11-15
+### Changed
+* Update `actix-server` to `2.0.0-beta.9`. [#2442]
+
+### Removed
+* `client` module. [#2425]
+* `trust-dns` feature. [#2425]
+
+[#2425]: https://github.com/actix/actix-web/pull/2425
+[#2442]: https://github.com/actix/actix-web/pull/2442
+
+
+## 3.0.0-beta.11 - 2021-10-20
+### Changed
+* Updated rustls to v0.20. [#2414]
+* Minimum supported Rust version (MSRV) is now 1.52.
+
+[#2414]: https://github.com/actix/actix-web/pull/2414
+
+
+## 3.0.0-beta.10 - 2021-09-09
+### Changed
+* `ContentEncoding` is now marked `#[non_exhaustive]`. [#2377]
+* Minimum supported Rust version (MSRV) is now 1.51.
+
+### Fixed
+* Remove slice creation pointing to potential uninitialized data on h1 encoder. [#2364]
+* Remove `Into<Error>` bound on `Encoder` body types. [#2375]
+* Fix quality parse error in Accept-Encoding header. [#2344]
+
+[#2364]: https://github.com/actix/actix-web/pull/2364
+[#2375]: https://github.com/actix/actix-web/pull/2375
+[#2344]: https://github.com/actix/actix-web/pull/2344
+[#2377]: https://github.com/actix/actix-web/pull/2377
+
+
+## 3.0.0-beta.9 - 2021-08-09
+### Fixed
+* Potential HTTP request smuggling vulnerabilities. [RUSTSEC-2021-0081](https://github.com/rustsec/advisory-db/pull/977)
+
+
+## 3.0.0-beta.8 - 2021-06-26
+### Changed
+* Change compression algorithm features flags. [#2250]
+
+### Removed
+* `downcast` and `downcast_get_type_id` macros. [#2291]
+
+[#2291]: https://github.com/actix/actix-web/pull/2291
+[#2250]: https://github.com/actix/actix-web/pull/2250
+
+
+## 3.0.0-beta.7 - 2021-06-17
+### Added
+* Alias `body::Body` as `body::AnyBody`. [#2215]
+* `BoxAnyBody`: a boxed message body with boxed errors. [#2183]
+* Re-export `http` crate's `Error` type as `error::HttpError`. [#2171]
+* Re-export `StatusCode`, `Method`, `Version` and `Uri` at the crate root. [#2171]
+* Re-export `ContentEncoding` and `ConnectionType` at the crate root. [#2171]
+* `Response::into_body` that consumes response and returns body type. [#2201]
+* `impl Default` for `Response`. [#2201]
+* Add zstd support for `ContentEncoding`. [#2244]
+
+### Changed
+* The `MessageBody` trait now has an associated `Error` type. [#2183]
+* All error trait bounds in server service builders have changed from `Into<Error>` to `Into<Response<AnyBody>>`. [#2253]
+* All error trait bounds in message body and stream impls changed from `Into<Error>` to `Into<Box<dyn std::error::Error>>`. [#2253]
+* Places in `Response` where `ResponseBody<B>` was received or returned now simply use `B`. [#2201]
+* `header` mod is now public. [#2171]
+* `uri` mod is now public. [#2171]
+* Update `language-tags` to `0.3`.
+* Reduce the level from `error` to `debug` for the log line that is emitted when a `500 Internal Server Error` is built using `HttpResponse::from_error`. [#2201]
+* `ResponseBuilder::message_body` now returns a `Result`. [#2201]
+* Remove `Unpin` bound on `ResponseBuilder::streaming`. [#2253]
+* `HttpServer::{listen_rustls(), bind_rustls()}` now honor the ALPN protocols in the configuation parameter. [#2226]
+
+### Removed
+* Stop re-exporting `http` crate's `HeaderMap` types in addition to ours. [#2171]
+* Down-casting for `MessageBody` types. [#2183]
+* `error::Result` alias. [#2201]
+* Error field from `Response` and `Response::error`. [#2205]
+* `impl Future` for `Response`. [#2201]
+* `Response::take_body` and old `Response::into_body` method that casted body type. [#2201]
+* `InternalError` and all the error types it constructed. [#2215]
+* Conversion (`impl Into`) of `Response<Body>` and `ResponseBuilder` to `Error`. [#2215]
+
+[#2171]: https://github.com/actix/actix-web/pull/2171
+[#2183]: https://github.com/actix/actix-web/pull/2183
+[#2196]: https://github.com/actix/actix-web/pull/2196
+[#2201]: https://github.com/actix/actix-web/pull/2201
+[#2205]: https://github.com/actix/actix-web/pull/2205
+[#2215]: https://github.com/actix/actix-web/pull/2215
+[#2253]: https://github.com/actix/actix-web/pull/2253
+[#2244]: https://github.com/actix/actix-web/pull/2244
+
+
+
+## 3.0.0-beta.6 - 2021-04-17
+### Added
+* `impl<T: MessageBody> MessageBody for Pin<Box<T>>`. [#2152]
+* `Response::{ok, bad_request, not_found, internal_server_error}`. [#2159]
+* Helper `body::to_bytes` for async collecting message body into Bytes. [#2158]
+
+### Changes
+* The type parameter of `Response` no longer has a default. [#2152]
+* The `Message` variant of `body::Body` is now `Pin<Box<dyn MessageBody>>`. [#2152]
+* `BodyStream` and `SizedStream` are no longer restricted to Unpin types. [#2152]
+* Error enum types are marked `#[non_exhaustive]`. [#2161]
+
+### Removed
+* `cookies` feature flag. [#2065]
+* Top-level `cookies` mod (re-export). [#2065]
+* `HttpMessage` trait loses the `cookies` and `cookie` methods. [#2065]
+* `impl ResponseError for CookieParseError`. [#2065]
+* Deprecated methods on `ResponseBuilder`: `if_true`, `if_some`. [#2148]
+* `ResponseBuilder::json`. [#2148]
+* `ResponseBuilder::{set_header, header}`. [#2148]
+* `impl From<serde_json::Value> for Body`. [#2148]
+* `Response::build_from`. [#2159]
+* Most of the status code builders on `Response`. [#2159]
+
+[#2065]: https://github.com/actix/actix-web/pull/2065
+[#2148]: https://github.com/actix/actix-web/pull/2148
+[#2152]: https://github.com/actix/actix-web/pull/2152
+[#2159]: https://github.com/actix/actix-web/pull/2159
+[#2158]: https://github.com/actix/actix-web/pull/2158
+[#2161]: https://github.com/actix/actix-web/pull/2161
+
+
+## 3.0.0-beta.5 - 2021-04-02
+### Added
+* `client::Connector::handshake_timeout` method for customizing TLS connection handshake timeout. [#2081]
+* `client::ConnectorService` as `client::Connector::finish` method's return type [#2081]
+* `client::ConnectionIo` trait alias [#2081]
+
+### Changed
+* `client::Connector` type now only have one generic type for `actix_service::Service`. [#2063]
+
+### Removed
+* Common typed HTTP headers were moved to actix-web. [2094]
+* `ResponseError` impl for `actix_utils::timeout::TimeoutError`. [#2127]
+
+[#2063]: https://github.com/actix/actix-web/pull/2063
+[#2081]: https://github.com/actix/actix-web/pull/2081
+[#2094]: https://github.com/actix/actix-web/pull/2094
+[#2127]: https://github.com/actix/actix-web/pull/2127
+
+
+## 3.0.0-beta.4 - 2021-03-08
+### Changed
+* Feature `cookies` is now optional and disabled by default. [#1981]
+* `ws::hash_key` now returns array. [#2035]
+* `ResponseBuilder::json` now takes `impl Serialize`. [#2052]
+
+### Removed
+* Re-export of `futures_channel::oneshot::Canceled` is removed from `error` mod. [#1994]
+* `ResponseError` impl for `futures_channel::oneshot::Canceled` is removed. [#1994]
+
+[#1981]: https://github.com/actix/actix-web/pull/1981
+[#1994]: https://github.com/actix/actix-web/pull/1994
+[#2035]: https://github.com/actix/actix-web/pull/2035
+[#2052]: https://github.com/actix/actix-web/pull/2052
+
+
+## 3.0.0-beta.3 - 2021-02-10
+* No notable changes.
+
+
+## 3.0.0-beta.2 - 2021-02-10
+### Added
+* `IntoHeaderPair` trait that allows using typed and untyped headers in the same methods. [#1869]
+* `ResponseBuilder::insert_header` method which allows using typed headers. [#1869]
+* `ResponseBuilder::append_header` method which allows using typed headers. [#1869]
+* `TestRequest::insert_header` method which allows using typed headers. [#1869]
+* `ContentEncoding` implements all necessary header traits. [#1912]
+* `HeaderMap::len_keys` has the behavior of the old `len` method. [#1964]
+* `HeaderMap::drain` as an efficient draining iterator. [#1964]
+* Implement `IntoIterator` for owned `HeaderMap`. [#1964]
+* `trust-dns` optional feature to enable `trust-dns-resolver` as client dns resolver. [#1969]
+
+### Changed
+* `ResponseBuilder::content_type` now takes an `impl IntoHeaderValue` to support using typed
+  `mime` types. [#1894]
+* Renamed `IntoHeaderValue::{try_into => try_into_value}` to avoid ambiguity with std
+  `TryInto` trait. [#1894]
+* `Extensions::insert` returns Option of replaced item. [#1904]
+* Remove `HttpResponseBuilder::json2()`. [#1903]
+* Enable `HttpResponseBuilder::json()` to receive data by value and reference. [#1903]
+* `client::error::ConnectError` Resolver variant contains `Box<dyn std::error::Error>` type. [#1905]
+* `client::ConnectorConfig` default timeout changed to 5 seconds. [#1905]
+* Simplify `BlockingError` type to a unit struct. It's now only triggered when blocking thread pool
+  is dead. [#1957]
+* `HeaderMap::len` now returns number of values instead of number of keys. [#1964]
+* `HeaderMap::insert` now returns iterator of removed values. [#1964]
+* `HeaderMap::remove` now returns iterator of removed values. [#1964]
+
+### Removed
+* `ResponseBuilder::set`; use `ResponseBuilder::insert_header`. [#1869]
+* `ResponseBuilder::set_header`; use `ResponseBuilder::insert_header`. [#1869]
+* `ResponseBuilder::header`; use `ResponseBuilder::append_header`. [#1869]
+* `TestRequest::with_hdr`; use `TestRequest::default().insert_header()`. [#1869]
+* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
+* `actors` optional feature. [#1969]
+* `ResponseError` impl for `actix::MailboxError`. [#1969]
+
+### Documentation
+* Vastly improve docs and add examples for `HeaderMap`. [#1964]
+
+[#1869]: https://github.com/actix/actix-web/pull/1869
+[#1894]: https://github.com/actix/actix-web/pull/1894
+[#1903]: https://github.com/actix/actix-web/pull/1903
+[#1904]: https://github.com/actix/actix-web/pull/1904
+[#1905]: https://github.com/actix/actix-web/pull/1905
+[#1912]: https://github.com/actix/actix-web/pull/1912
+[#1957]: https://github.com/actix/actix-web/pull/1957
+[#1964]: https://github.com/actix/actix-web/pull/1964
+[#1969]: https://github.com/actix/actix-web/pull/1969
+
+
 ## 3.0.0-beta.1 - 2021-01-07
 ### Added
 * Add `Http3` to `Protocol` enum for future compatibility and also mark `#[non_exhaustive]`.
@@ -22,10 +267,19 @@
 * Remove `ConnectError::SslHandshakeError` and re-export of `HandshakeError`.
   due to the removal of this type from `tokio-openssl` crate. openssl handshake 
   error would return as `ConnectError::SslError`. [#1813]
+* Remove `actix-threadpool` dependency. Use `actix_rt::task::spawn_blocking`.
+  Due to this change `actix_threadpool::BlockingError` type is moved into 
+  `actix_http::error` module. [#1878]
 
 [#1813]: https://github.com/actix/actix-web/pull/1813
 [#1857]: https://github.com/actix/actix-web/pull/1857
 [#1864]: https://github.com/actix/actix-web/pull/1864
+[#1878]: https://github.com/actix/actix-web/pull/1878
+
+
+## 2.2.1 - 2021-08-09
+### Fixed
+* Potential HTTP request smuggling vulnerabilities. [RUSTSEC-2021-0081](https://github.com/rustsec/advisory-db/pull/977)
 
 
 ## 2.2.0 - 2020-11-25
@@ -72,15 +326,14 @@
 * Update actix-connect and actix-tls dependencies.
 
 
-## [2.0.0-beta.3] - 2020-08-14
-
+## 2.0.0-beta.3 - 2020-08-14
 ### Fixed
 * Memory leak of `client::pool::ConnectorPoolSupport`. [#1626]
 
 [#1626]: https://github.com/actix/actix-web/pull/1626
 
 
-## [2.0.0-beta.2] - 2020-07-21
+## 2.0.0-beta.2 - 2020-07-21
 ### Fixed
 * Potential UB in h1 decoder using uninitialized memory. [#1614]
 
@@ -91,10 +344,8 @@
 [#1615]: https://github.com/actix/actix-web/pull/1615
 
 
-## [2.0.0-beta.1] - 2020-07-11
-
+## 2.0.0-beta.1 - 2020-07-11
 ### Changed
-
 * Migrate cookie handling to `cookie` crate. [#1558]
 * Update `sha-1` to 0.9. [#1586]
 * Fix leak in client pool. [#1580]
@@ -104,33 +355,30 @@
 [#1586]: https://github.com/actix/actix-web/pull/1586
 [#1580]: https://github.com/actix/actix-web/pull/1580
 
-## [2.0.0-alpha.4] - 2020-05-21
 
+## 2.0.0-alpha.4 - 2020-05-21
 ### Changed
-
 * Bump minimum supported Rust version to 1.40
-* content_length function is removed, and you can set Content-Length by calling no_chunking function [#1439]
+* content_length function is removed, and you can set Content-Length by calling
+  no_chunking function [#1439]
 * `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
   `u64` instead of a `usize`.
 * Update `base64` dependency to 0.12
 
 ### Fixed
-
 * Support parsing of `SameSite=None` [#1503]
 
 [#1439]: https://github.com/actix/actix-web/pull/1439
 [#1503]: https://github.com/actix/actix-web/pull/1503
 
-## [2.0.0-alpha.3] - 2020-05-08
 
+## 2.0.0-alpha.3 - 2020-05-08
 ### Fixed
-
 * Correct spelling of ConnectError::Unresolved [#1487]
 * Fix a mistake in the encoding of websocket continuation messages wherein
   Item::FirstText and Item::FirstBinary are each encoded as the other.
 
 ### Changed
-
 * Implement `std::error::Error` for our custom errors [#1422]
 * Remove `failure` support for `ResponseError` since that crate
   will be deprecated in the near future.
@@ -138,338 +386,247 @@
 [#1422]: https://github.com/actix/actix-web/pull/1422
 [#1487]: https://github.com/actix/actix-web/pull/1487
 
-## [2.0.0-alpha.2] - 2020-03-07
 
+## 2.0.0-alpha.2 - 2020-03-07
 ### Changed
-
 * Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
-
-* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB respectively
-  to improve download speed for awc when downloading large objects. [#1394]
-
-* client::Connector accepts initial_window_size and initial_connection_window_size HTTP2 configuration. [#1394]
-
+* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB
+  respectively to improve download speed for awc when downloading large objects. [#1394]
+* client::Connector accepts initial_window_size and initial_connection_window_size
+  HTTP2 configuration. [#1394]
 * client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
 
 [#1394]: https://github.com/actix/actix-web/pull/1394
 [#1395]: https://github.com/actix/actix-web/pull/1395
 
-## [2.0.0-alpha.1] - 2020-02-27
 
+## 2.0.0-alpha.1 - 2020-02-27
 ### Changed
-
 * Update the `time` dependency to 0.2.7.
 * Moved actors messages support from actix crate, enabled with feature `actors`.
-* Breaking change: trait MessageBody requires Unpin and accepting Pin<&mut Self> instead of &mut self in the poll_next().
+* Breaking change: trait MessageBody requires Unpin and accepting `Pin<&mut Self>` instead of
+  `&mut self` in the poll_next().
 * MessageBody is not implemented for &'static [u8] anymore.
 
 ### Fixed
-
 * Allow `SameSite=None` cookies to be sent in a response.
 
-## [1.0.1] - 2019-12-20
 
+## 1.0.1 - 2019-12-20
 ### Fixed
-
 * Poll upgrade service's readiness from HTTP service handlers
-
 * Replace brotli with brotli2 #1224
 
-## [1.0.0] - 2019-12-13
 
+## 1.0.0 - 2019-12-13
 ### Added
-
 * Add websockets continuation frame support
 
 ### Changed
-
 * Replace `flate2-xxx` features with `compress`
 
-## [1.0.0-alpha.5] - 2019-12-09
 
+## 1.0.0-alpha.5 - 2019-12-09
 ### Fixed
-
 * Check `Upgrade` service readiness before calling it
-
-* Fix buffer remaining capacity calcualtion
+* Fix buffer remaining capacity calculation
 
 ### Changed
-
 * Websockets: Ping and Pong should have binary data #1049
 
-## [1.0.0-alpha.4] - 2019-12-08
 
+## 1.0.0-alpha.4 - 2019-12-08
 ### Added
-
 * Add impl ResponseBuilder for Error
 
 ### Changed
-
 * Use rust based brotli compression library
 
-## [1.0.0-alpha.3] - 2019-12-07
-
+## 1.0.0-alpha.3 - 2019-12-07
 ### Changed
-
 * Migrate to tokio 0.2
-
 * Migrate to `std::future`
 
 
-## [0.2.11] - 2019-11-06
-
+## 0.2.11 - 2019-11-06
 ### Added
-
 * Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
-
-* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
-
+* Add an additional `filename*` param in the `Content-Disposition` header of
+  `actix_files::NamedFile` to be more compatible. (#1151)
 * Allow to use `std::convert::Infallible` as `actix_http::error::Error`
 
 ### Fixed
+* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain;
+  charset=utf-8` header [#1118]
 
-* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain; charset=utf-8` header #1118
+[#1878]: https://github.com/actix/actix-web/pull/1878
 
 
-## [0.2.10] - 2019-09-11
-
+## 0.2.10 - 2019-09-11
 ### Added
-
-* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests with `RequestHead`
+* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests
+  with `RequestHead`
 
 ### Fixed
-
 * h2 will use error response #1080
-
 * on_connect result isn't added to request extensions for http2 requests #1009
 
 
-## [0.2.9] - 2019-08-13
-
+## 0.2.9 - 2019-08-13
 ### Changed
-
 * Dropped the `byteorder`-dependency in favor of `stdlib`-implementation
-
 * Update percent-encoding to 2.1
-
 * Update serde_urlencoded to 0.6.1
 
 ### Fixed
-
 * Fixed a panic in the HTTP2 handshake in client HTTP requests (#1031)
 
 
-## [0.2.8] - 2019-08-01
-
+## 0.2.8 - 2019-08-01
 ### Added
-
 * Add `rustls` support
-
 * Add `Clone` impl for `HeaderMap`
 
 ### Fixed
-
 * awc client panic #1016
-
-* Invalid response with compression middleware enabled, but compression-related features disabled #997
+* Invalid response with compression middleware enabled, but compression-related features
+  disabled #997
 
 
-## [0.2.7] - 2019-07-18
-
+## 0.2.7 - 2019-07-18
 ### Added
-
 * Add support for downcasting response errors #986
 
 
-## [0.2.6] - 2019-07-17
-
+## 0.2.6 - 2019-07-17
 ### Changed
-
 * Replace `ClonableService` with local copy
-
 * Upgrade `rand` dependency version to 0.7
 
 
-## [0.2.5] - 2019-06-28
-
+## 0.2.5 - 2019-06-28
 ### Added
-
 * Add `on-connect` callback, `HttpServiceBuilder::on_connect()` #946
 
 ### Changed
-
 * Use `encoding_rs` crate instead of unmaintained `encoding` crate
-
 * Add `Copy` and `Clone` impls for `ws::Codec`
 
 
-## [0.2.4] - 2019-06-16
-
+## 0.2.4 - 2019-06-16
 ### Fixed
-
 * Do not compress NoContent (204) responses #918
 
 
-## [0.2.3] - 2019-06-02
-
+## 0.2.3 - 2019-06-02
 ### Added
-
 * Debug impl for ResponseBuilder
-
 * From SizedStream and BodyStream for Body
 
 ### Changed
-
 * SizedStream uses u64
 
 
-## [0.2.2] - 2019-05-29
-
+## 0.2.2 - 2019-05-29
 ### Fixed
-
 * Parse incoming stream before closing stream on disconnect #868
 
 
-## [0.2.1] - 2019-05-25
-
+## 0.2.1 - 2019-05-25
 ### Fixed
-
 * Handle socket read disconnect
 
 
-## [0.2.0] - 2019-05-12
-
+## 0.2.0 - 2019-05-12
 ### Changed
-
 * Update actix-service to 0.4
-
 * Expect and upgrade services accept `ServerConfig` config.
 
 ### Deleted
-
 * `OneRequest` service
 
 
-## [0.1.5] - 2019-05-04
-
+## 0.1.5 - 2019-05-04
 ### Fixed
-
 * Clean up response extensions in response pool #817
 
 
-## [0.1.4] - 2019-04-24
-
+## 0.1.4 - 2019-04-24
 ### Added
-
 * Allow to render h1 request headers in `Camel-Case`
 
 ### Fixed
-
 * Read until eof for http/1.0 responses #771
 
 
-## [0.1.3] - 2019-04-23
-
+## 0.1.3 - 2019-04-23
 ### Fixed
-
 * Fix http client pool management
-
 * Fix http client wait queue management #794
 
 
-## [0.1.2] - 2019-04-23
-
+## 0.1.2 - 2019-04-23
 ### Fixed
-
 * Fix BorrowMutError panic in client connector #793
 
 
-## [0.1.1] - 2019-04-19
-
+## 0.1.1 - 2019-04-19
 ### Changed
-
 * Cookie::max_age() accepts value in seconds
-
 * Cookie::max_age_time() accepts value in time::Duration
-
 * Allow to specify server address for client connector
 
 
-## [0.1.0] - 2019-04-16
-
+## 0.1.0 - 2019-04-16
 ### Added
-
 * Expose peer addr via `Request::peer_addr()` and `RequestHead::peer_addr`
 
 ### Changed
-
 * `actix_http::encoding` always available
-
 * use trust-dns-resolver 0.11.0
 
 
-## [0.1.0-alpha.5] - 2019-04-12
-
+## 0.1.0-alpha.5 - 2019-04-12
 ### Added
-
 * Allow to use custom service for upgrade requests
-
 * Added `h1::SendResponse` future.
 
 ### Changed
-
 * MessageBody::length() renamed to MessageBody::size() for consistency
-
 * ws handshake verification functions take RequestHead instead of Request
 
 
-## [0.1.0-alpha.4] - 2019-04-08
-
+## 0.1.0-alpha.4 - 2019-04-08
 ### Added
-
 * Allow to use custom `Expect` handler
-
 * Add minimal `std::error::Error` impl for `Error`
 
 ### Changed
-
 * Export IntoHeaderValue
-
 * Render error and return as response body
-
-* Use thread pool for response body comression
+* Use thread pool for response body compression
 
 ### Deleted
-
 * Removed PayloadBuffer
 
 
-## [0.1.0-alpha.3] - 2019-04-02
-
+## 0.1.0-alpha.3 - 2019-04-02
 ### Added
-
 * Warn when an unsealed private cookie isn't valid UTF-8
 
 ### Fixed
-
 * Rust 1.31.0 compatibility
-
 * Preallocate read buffer for h1 codec
-
 * Detect socket disconnection during protocol selection
 
 
-## [0.1.0-alpha.2] - 2019-03-29
-
+## 0.1.0-alpha.2 - 2019-03-29
 ### Added
-
 * Added ws::Message::Nop, no-op websockets message
 
 ### Changed
-
-* Do not use thread pool for decomression if chunk size is smaller than 2048.
+* Do not use thread pool for decompression if chunk size is smaller than 2048.
 
 
-## [0.1.0-alpha.1] - 2019-03-28
-
+## 0.1.0-alpha.1 - 2019-03-28
 * Initial impl

actix-http/Cargo.toml

@@ -1,21 +1,23 @@
 [package]
 name = "actix-http"
-version = "3.0.0-beta.1"
+version = "3.0.0-beta.13"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "HTTP primitives for the Actix ecosystem"
-readme = "README.md"
 keywords = ["actix", "http", "framework", "async", "futures"]
 homepage = "https://actix.rs"
 repository = "https://github.com/actix/actix-web.git"
-documentation = "https://docs.rs/actix-http/"
-categories = ["network-programming", "asynchronous",
-              "web-programming::http-server",
-              "web-programming::websocket"]
+categories = [
+    "network-programming",
+    "asynchronous",
+    "web-programming::http-server",
+    "web-programming::websocket",
+]
 license = "MIT OR Apache-2.0"
 edition = "2018"
 
 [package.metadata.docs.rs]
-features = ["openssl", "rustls", "compress", "secure-cookies", "actors"]
+# features that docs.rs will build with
+features = ["openssl", "rustls", "compress-brotli", "compress-gzip", "compress-zstd"]
 
 [lib]
 name = "actix_http"
@@ -25,75 +27,79 @@ path = "src/lib.rs"
 default = []
 
 # openssl
-openssl = ["actix-tls/openssl"]
+openssl = ["actix-tls/accept", "actix-tls/openssl"]
 
 # rustls support
-rustls = ["actix-tls/rustls"]
+rustls = ["actix-tls/accept", "actix-tls/rustls"]
 
-# enable compressison support
-compress = ["flate2", "brotli2"]
+# enable compression support
+compress-brotli = ["brotli2", "__compress"]
+compress-gzip = ["flate2", "__compress"]
+compress-zstd = ["zstd", "__compress"]
 
-# support for secure cookies
-secure-cookies = ["cookie/secure"]
-
-# support for actix Actor messages
-actors = ["actix"]
+# Internal (PRIVATE!) features used to aid testing and cheking feature status.
+# Don't rely on these whatsoever. They may disappear at anytime.
+__compress = []
 
 [dependencies]
-actix-service = "2.0.0-beta.2"
-actix-codec = "0.4.0-beta.1"
-actix-utils = "3.0.0-beta.1"
-actix-rt = "2.0.0-beta.1"
-actix-threadpool = "0.3.1"
-actix-tls = "3.0.0-beta.2"
-actix = { version = "0.11.0-beta.1", optional = true }
+actix-service = "2.0.0"
+actix-codec = "0.4.1"
+actix-utils = "3.0.0"
+actix-rt = "2.2"
 
+ahash = "0.7"
 base64 = "0.13"
 bitflags = "1.2"
 bytes = "1"
 bytestring = "1"
-cookie = { version = "0.14.1", features = ["percent-encode"] }
-copyless = "0.1.4"
 derive_more = "0.99.5"
-either = "1.5.3"
 encoding_rs = "0.8"
-futures-channel = { version = "0.3.7", default-features = false }
-futures-core = { version = "0.3.7", default-features = false }
-futures-util = { version = "0.3.7", default-features = false, features = ["sink"] }
-fxhash = "0.2.1"
-h2 = "0.3.0"
-http = "0.2.2"
-httparse = "1.3"
-indexmap = "1.3"
+futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
+futures-util = { version = "0.3.7", default-features = false, features = ["alloc", "sink"] }
+h2 = "0.3.1"
+http = "0.2.5"
+httparse = "1.5.1"
+httpdate = "1.0.1"
 itoa = "0.4"
-lazy_static = "1.4"
-language-tags = "0.2"
+language-tags = "0.3"
+local-channel = "0.1"
 log = "0.4"
 mime = "0.3"
 percent-encoding = "2.1"
 pin-project = "1.0.0"
+pin-project-lite = "0.2"
 rand = "0.8"
-regex = "1.3"
-serde = "1.0"
-serde_json = "1.0"
 sha-1 = "0.9"
-slab = "0.4"
-serde_urlencoded = "0.7"
-time = { version = "0.2.7", default-features = false, features = ["std"] }
+smallvec = "1.6.1"
+
+# tls
+actix-tls = { version = "3.0.0-beta.9", default-features = false, optional = true }
 
 # compression
 brotli2 = { version="0.3.2", optional = true }
 flate2 = { version = "1.0.13", optional = true }
+zstd = { version = "0.9", optional = true }
 
 [dev-dependencies]
-actix-server = "2.0.0-beta.2"
-actix-http-test = { version = "3.0.0-beta.1", features = ["openssl"] }
-actix-tls = { version = "3.0.0-beta.2", features = ["openssl"] }
-criterion = "0.3"
-env_logger = "0.7"
-serde_derive = "1.0"
-open-ssl = { version="0.10", package = "openssl" }
-rust-tls = { version="0.19", package = "rustls" }
+actix-server = "2.0.0-beta.9"
+actix-http-test = { version = "3.0.0-beta.7", features = ["openssl"] }
+actix-tls = { version = "3.0.0-beta.9", features = ["openssl"] }
+async-stream = "0.3"
+criterion = { version = "0.3", features = ["html_reports"] }
+env_logger = "0.9"
+rcgen = "0.8"
+regex = "1.3"
+rustls-pemfile = "0.2"
+serde = { version = "1.0", features = ["derive"] }
+serde_json = "1.0"
+static_assertions = "1"
+tls-openssl = { package = "openssl", version = "0.10.9" }
+tls-rustls = { package = "rustls", version = "0.20.0" }
+tokio = { version = "1.2", features = ["net", "rt"] }
+
+[[example]]
+name = "ws"
+required-features = ["rustls"]
 
 [[bench]]
 name = "write-camel-case"

actix-http/README.md

@@ -3,16 +3,18 @@
 > HTTP primitives for the Actix ecosystem.
 
 [![crates.io](https://img.shields.io/crates/v/actix-http?label=latest)](https://crates.io/crates/actix-http)
-[![Documentation](https://docs.rs/actix-http/badge.svg?version=2.2.0)](https://docs.rs/actix-http/2.2.0)
-![Apache 2.0 or MIT licensed](https://img.shields.io/crates/l/actix-http)
-[![Dependency Status](https://deps.rs/crate/actix-http/2.2.0/status.svg)](https://deps.rs/crate/actix-http/2.2.0)
-[![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+[![Documentation](https://docs.rs/actix-http/badge.svg?version=3.0.0-beta.13)](https://docs.rs/actix-http/3.0.0-beta.13)
+[![Version](https://img.shields.io/badge/rustc-1.52+-ab6000.svg)](https://blog.rust-lang.org/2021/05/06/Rust-1.52.0.html)
+![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http.svg)
+<br />
+[![dependency status](https://deps.rs/crate/actix-http/3.0.0-beta.13/status.svg)](https://deps.rs/crate/actix-http/3.0.0-beta.13)
+[![Download](https://img.shields.io/crates/d/actix-http.svg)](https://crates.io/crates/actix-http)
+[![Chat on Discord](https://img.shields.io/discord/771444961383153695?label=chat&logo=discord)](https://discord.gg/NWpN5mmg3x)
 
 ## Documentation & Resources
 
 - [API Documentation](https://docs.rs/actix-http)
-- [Chat on Gitter](https://gitter.im/actix/actix-web)
-- Minimum Supported Rust Version (MSRV): 1.46.0
+- Minimum Supported Rust Version (MSRV): 1.52
 
 ## Example
 

actix-http/benches/uninit-headers.rs

@@ -78,12 +78,12 @@ impl HeaderIndex {
 // test cases taken from:
 // https://github.com/seanmonstar/httparse/blob/master/benches/parse.rs
 
-const REQ_SHORT: &'static [u8] = b"\
+const REQ_SHORT: &[u8] = b"\
 GET / HTTP/1.0\r\n\
 Host: example.com\r\n\
 Cookie: session=60; user_id=1\r\n\r\n";
 
-const REQ: &'static [u8] = b"\
+const REQ: &[u8] = b"\
 GET /wp-content/uploads/2010/03/hello-kitty-darth-vader-pink.jpg HTTP/1.1\r\n\
 Host: www.kittyhell.com\r\n\
 User-Agent: Mozilla/5.0 (Macintosh; U; Intel Mac OS X 10.6; ja-JP-mac; rv:1.9.2.3) Gecko/20100401 Firefox/3.6.3 Pathtraq/0.9\r\n\
@@ -119,6 +119,8 @@ mod _original {
     use std::mem::MaybeUninit;
 
     pub fn parse_headers(src: &mut BytesMut) -> usize {
+        #![allow(clippy::uninit_assumed_init)]
+
         let mut headers: [HeaderIndex; MAX_HEADERS] =
             unsafe { MaybeUninit::uninit().assume_init() };
 

actix-http/benches/write-camel-case.rs

@@ -18,7 +18,8 @@ fn bench_write_camel_case(c: &mut Criterion) {
         group.bench_with_input(BenchmarkId::new("New", i), bts, |b, bts| {
             b.iter(|| {
                 let mut buf = black_box([0; 24]);
-                _new::write_camel_case(black_box(bts), &mut buf)
+                let len = black_box(bts.len());
+                _new::write_camel_case(black_box(bts), buf.as_mut_ptr(), len)
             });
         });
     }
@@ -30,9 +31,12 @@ criterion_group!(benches, bench_write_camel_case);
 criterion_main!(benches);
 
 mod _new {
-    pub fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
+    pub fn write_camel_case(value: &[u8], buf: *mut u8, len: usize) {
         // first copy entire (potentially wrong) slice to output
-        buffer[..value.len()].copy_from_slice(value);
+        let buffer = unsafe {
+            std::ptr::copy_nonoverlapping(value.as_ptr(), buf, len);
+            std::slice::from_raw_parts_mut(buf, len)
+        };
 
         let mut iter = value.iter();
 

actix-http/examples/echo.rs

@@ -1,19 +1,17 @@
-use std::{env, io};
+use std::io;
 
-use actix_http::{Error, HttpService, Request, Response};
+use actix_http::{http::StatusCode, Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures_util::StreamExt;
+use futures_util::StreamExt as _;
 use http::header::HeaderValue;
-use log::info;
 
 #[actix_rt::main]
 async fn main() -> io::Result<()> {
-    env::set_var("RUST_LOG", "echo=info");
-    env_logger::init();
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
 
     Server::build()
-        .bind("echo", "127.0.0.1:8080", || {
+        .bind("echo", ("127.0.0.1", 8080), || {
             HttpService::build()
                 .client_timeout(1000)
                 .client_disconnect(1000)
@@ -23,10 +21,14 @@ async fn main() -> io::Result<()> {
                         body.extend_from_slice(&item?);
                     }
 
-                    info!("request body: {:?}", body);
+                    log::info!("request body: {:?}", body);
+
                     Ok::<_, Error>(
-                        Response::Ok()
-                            .header("x-head", HeaderValue::from_static("dummy value!"))
+                        Response::build(StatusCode::OK)
+                            .insert_header((
+                                "x-head",
+                                HeaderValue::from_static("dummy value!"),
+                            ))
                             .body(body),
                     )
                 })

actix-http/examples/echo2.rs

@@ -1,31 +1,30 @@
-use std::{env, io};
+use std::io;
 
-use actix_http::http::HeaderValue;
+use actix_http::{body::AnyBody, http::HeaderValue, http::StatusCode};
 use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures_util::StreamExt;
-use log::info;
+use futures_util::StreamExt as _;
 
-async fn handle_request(mut req: Request) -> Result<Response, Error> {
+async fn handle_request(mut req: Request) -> Result<Response<AnyBody>, Error> {
     let mut body = BytesMut::new();
     while let Some(item) = req.payload().next().await {
         body.extend_from_slice(&item?)
     }
 
-    info!("request body: {:?}", body);
-    Ok(Response::Ok()
-        .header("x-head", HeaderValue::from_static("dummy value!"))
+    log::info!("request body: {:?}", body);
+
+    Ok(Response::build(StatusCode::OK)
+        .insert_header(("x-head", HeaderValue::from_static("dummy value!")))
         .body(body))
 }
 
 #[actix_rt::main]
 async fn main() -> io::Result<()> {
-    env::set_var("RUST_LOG", "echo=info");
-    env_logger::init();
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
 
     Server::build()
-        .bind("echo", "127.0.0.1:8080", || {
+        .bind("echo", ("127.0.0.1", 8080), || {
             HttpService::build().finish(handle_request).tcp()
         })?
         .run()

actix-http/examples/hello-world.rs

@@ -1,26 +1,28 @@
-use std::{env, io};
+use std::{convert::Infallible, io};
 
-use actix_http::{HttpService, Response};
+use actix_http::{http::StatusCode, HttpService, Response};
 use actix_server::Server;
-use futures_util::future;
 use http::header::HeaderValue;
-use log::info;
 
 #[actix_rt::main]
 async fn main() -> io::Result<()> {
-    env::set_var("RUST_LOG", "hello_world=info");
-    env_logger::init();
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
 
     Server::build()
-        .bind("hello-world", "127.0.0.1:8080", || {
+        .bind("hello-world", ("127.0.0.1", 8080), || {
             HttpService::build()
                 .client_timeout(1000)
                 .client_disconnect(1000)
-                .finish(|_req| {
-                    info!("{:?}", _req);
-                    let mut res = Response::Ok();
-                    res.header("x-head", HeaderValue::from_static("dummy value!"));
-                    future::ok::<_, ()>(res.body("Hello world!"))
+                .finish(|req| async move {
+                    log::info!("{:?}", req);
+
+                    let mut res = Response::build(StatusCode::OK);
+                    res.insert_header((
+                        "x-head",
+                        HeaderValue::from_static("dummy value!"),
+                    ));
+
+                    Ok::<_, Infallible>(res.body("Hello world!"))
                 })
                 .tcp()
         })?

actix-http/examples/streaming-error.rs

@@ -0,0 +1,40 @@
+//! Example showing response body (chunked) stream erroring.
+//!
+//! Test using `nc` or `curl`.
+//! ```sh
+//! $ curl -vN 127.0.0.1:8080
+//! $ echo 'GET / HTTP/1.1\n\n' | nc 127.0.0.1 8080
+//! ```
+
+use std::{convert::Infallible, io, time::Duration};
+
+use actix_http::{body::BodyStream, HttpService, Response};
+use actix_server::Server;
+use async_stream::stream;
+use bytes::Bytes;
+
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
+
+    Server::build()
+        .bind("streaming-error", ("127.0.0.1", 8080), || {
+            HttpService::build()
+                .finish(|req| async move {
+                    log::info!("{:?}", req);
+                    let res = Response::ok();
+
+                    Ok::<_, Infallible>(res.set_body(BodyStream::new(stream! {
+                        yield Ok(Bytes::from("123"));
+                        yield Ok(Bytes::from("456"));
+
+                        actix_rt::time::sleep(Duration::from_millis(1000)).await;
+
+                        yield Err(io::Error::new(io::ErrorKind::Other, ""));
+                    })))
+                })
+                .tcp()
+        })?
+        .run()
+        .await
+}

actix-http/examples/ws.rs

@@ -0,0 +1,115 @@
+//! Sets up a WebSocket server over TCP and TLS.
+//! Sends a heartbeat message every 4 seconds but does not respond to any incoming frames.
+
+extern crate tls_rustls as rustls;
+
+use std::{
+    io,
+    pin::Pin,
+    task::{Context, Poll},
+    time::Duration,
+};
+
+use actix_codec::Encoder;
+use actix_http::{body::BodyStream, error::Error, ws, HttpService, Request, Response};
+use actix_rt::time::{interval, Interval};
+use actix_server::Server;
+use bytes::{Bytes, BytesMut};
+use bytestring::ByteString;
+use futures_core::{ready, Stream};
+
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
+    env_logger::init_from_env(env_logger::Env::new().default_filter_or("info"));
+
+    Server::build()
+        .bind("tcp", ("127.0.0.1", 8080), || {
+            HttpService::build().h1(handler).tcp()
+        })?
+        .bind("tls", ("127.0.0.1", 8443), || {
+            HttpService::build().finish(handler).rustls(tls_config())
+        })?
+        .run()
+        .await
+}
+
+async fn handler(req: Request) -> Result<Response<BodyStream<Heartbeat>>, Error> {
+    log::info!("handshaking");
+    let mut res = ws::handshake(req.head())?;
+
+    // handshake will always fail under HTTP/2
+
+    log::info!("responding");
+    Ok(res.message_body(BodyStream::new(Heartbeat::new(ws::Codec::new())))?)
+}
+
+struct Heartbeat {
+    codec: ws::Codec,
+    interval: Interval,
+}
+
+impl Heartbeat {
+    fn new(codec: ws::Codec) -> Self {
+        Self {
+            codec,
+            interval: interval(Duration::from_secs(4)),
+        }
+    }
+}
+
+impl Stream for Heartbeat {
+    type Item = Result<Bytes, Error>;
+
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        log::trace!("poll");
+
+        ready!(self.as_mut().interval.poll_tick(cx));
+
+        let mut buffer = BytesMut::new();
+
+        self.as_mut()
+            .codec
+            .encode(
+                ws::Message::Text(ByteString::from_static("hello world")),
+                &mut buffer,
+            )
+            .unwrap();
+
+        Poll::Ready(Some(Ok(buffer.freeze())))
+    }
+}
+
+fn tls_config() -> rustls::ServerConfig {
+    use std::io::BufReader;
+
+    use rustls::{Certificate, PrivateKey};
+    use rustls_pemfile::{certs, pkcs8_private_keys};
+
+    let cert = rcgen::generate_simple_self_signed(vec!["localhost".to_owned()]).unwrap();
+    let cert_file = cert.serialize_pem().unwrap();
+    let key_file = cert.serialize_private_key_pem();
+
+    let cert_file = &mut BufReader::new(cert_file.as_bytes());
+    let key_file = &mut BufReader::new(key_file.as_bytes());
+
+    let cert_chain = certs(cert_file)
+        .unwrap()
+        .into_iter()
+        .map(Certificate)
+        .collect();
+    let mut keys = pkcs8_private_keys(key_file).unwrap();
+
+    let mut config = rustls::ServerConfig::builder()
+        .with_safe_defaults()
+        .with_no_client_auth()
+        .with_single_cert(cert_chain, PrivateKey(keys.remove(0)))
+        .unwrap();
+
+    config.alpn_protocols.push(b"http/1.1".to_vec());
+    config.alpn_protocols.push(b"h2".to_vec());
+
+    config
+}

actix-http/src/body.rs

@@ -1,710 +0,0 @@
-use std::pin::Pin;
-use std::task::{Context, Poll};
-use std::{fmt, mem};
-
-use bytes::{Bytes, BytesMut};
-use futures_core::{ready, Stream};
-use pin_project::pin_project;
-
-use crate::error::Error;
-
-#[derive(Debug, PartialEq, Copy, Clone)]
-/// Body size hint
-pub enum BodySize {
-    None,
-    Empty,
-    Sized(u64),
-    Stream,
-}
-
-impl BodySize {
-    pub fn is_eof(&self) -> bool {
-        matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
-    }
-}
-
-/// Type that provides this trait can be streamed to a peer.
-pub trait MessageBody {
-    fn size(&self) -> BodySize;
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>>;
-
-    downcast_get_type_id!();
-}
-
-downcast!(MessageBody);
-
-impl MessageBody for () {
-    fn size(&self) -> BodySize {
-        BodySize::Empty
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        Poll::Ready(None)
-    }
-}
-
-impl<T: MessageBody + Unpin> MessageBody for Box<T> {
-    fn size(&self) -> BodySize {
-        self.as_ref().size()
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        Pin::new(self.get_mut().as_mut()).poll_next(cx)
-    }
-}
-
-#[pin_project(project = ResponseBodyProj)]
-pub enum ResponseBody<B> {
-    Body(#[pin] B),
-    Other(Body),
-}
-
-impl ResponseBody<Body> {
-    pub fn into_body<B>(self) -> ResponseBody<B> {
-        match self {
-            ResponseBody::Body(b) => ResponseBody::Other(b),
-            ResponseBody::Other(b) => ResponseBody::Other(b),
-        }
-    }
-}
-
-impl<B> ResponseBody<B> {
-    pub fn take_body(&mut self) -> ResponseBody<B> {
-        std::mem::replace(self, ResponseBody::Other(Body::None))
-    }
-}
-
-impl<B: MessageBody> ResponseBody<B> {
-    pub fn as_ref(&self) -> Option<&B> {
-        if let ResponseBody::Body(ref b) = self {
-            Some(b)
-        } else {
-            None
-        }
-    }
-}
-
-impl<B: MessageBody> MessageBody for ResponseBody<B> {
-    fn size(&self) -> BodySize {
-        match self {
-            ResponseBody::Body(ref body) => body.size(),
-            ResponseBody::Other(ref body) => body.size(),
-        }
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        match self.project() {
-            ResponseBodyProj::Body(body) => body.poll_next(cx),
-            ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
-        }
-    }
-}
-
-impl<B: MessageBody> Stream for ResponseBody<B> {
-    type Item = Result<Bytes, Error>;
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Self::Item>> {
-        match self.project() {
-            ResponseBodyProj::Body(body) => body.poll_next(cx),
-            ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
-        }
-    }
-}
-
-/// Represents various types of http message body.
-pub enum Body {
-    /// Empty response. `Content-Length` header is not set.
-    None,
-    /// Zero sized response body. `Content-Length` header is set to `0`.
-    Empty,
-    /// Specific response body.
-    Bytes(Bytes),
-    /// Generic message body.
-    Message(Box<dyn MessageBody + Unpin>),
-}
-
-impl Body {
-    /// Create body from slice (copy)
-    pub fn from_slice(s: &[u8]) -> Body {
-        Body::Bytes(Bytes::copy_from_slice(s))
-    }
-
-    /// Create body from generic message body.
-    pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
-        Body::Message(Box::new(body))
-    }
-}
-
-impl MessageBody for Body {
-    fn size(&self) -> BodySize {
-        match self {
-            Body::None => BodySize::None,
-            Body::Empty => BodySize::Empty,
-            Body::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
-            Body::Message(ref body) => body.size(),
-        }
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        match self.get_mut() {
-            Body::None => Poll::Ready(None),
-            Body::Empty => Poll::Ready(None),
-            Body::Bytes(ref mut bin) => {
-                let len = bin.len();
-                if len == 0 {
-                    Poll::Ready(None)
-                } else {
-                    Poll::Ready(Some(Ok(mem::take(bin))))
-                }
-            }
-            Body::Message(body) => Pin::new(&mut **body).poll_next(cx),
-        }
-    }
-}
-
-impl PartialEq for Body {
-    fn eq(&self, other: &Body) -> bool {
-        match *self {
-            Body::None => matches!(*other, Body::None),
-            Body::Empty => matches!(*other, Body::Empty),
-            Body::Bytes(ref b) => match *other {
-                Body::Bytes(ref b2) => b == b2,
-                _ => false,
-            },
-            Body::Message(_) => false,
-        }
-    }
-}
-
-impl fmt::Debug for Body {
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        match *self {
-            Body::None => write!(f, "Body::None"),
-            Body::Empty => write!(f, "Body::Empty"),
-            Body::Bytes(ref b) => write!(f, "Body::Bytes({:?})", b),
-            Body::Message(_) => write!(f, "Body::Message(_)"),
-        }
-    }
-}
-
-impl From<&'static str> for Body {
-    fn from(s: &'static str) -> Body {
-        Body::Bytes(Bytes::from_static(s.as_ref()))
-    }
-}
-
-impl From<&'static [u8]> for Body {
-    fn from(s: &'static [u8]) -> Body {
-        Body::Bytes(Bytes::from_static(s))
-    }
-}
-
-impl From<Vec<u8>> for Body {
-    fn from(vec: Vec<u8>) -> Body {
-        Body::Bytes(Bytes::from(vec))
-    }
-}
-
-impl From<String> for Body {
-    fn from(s: String) -> Body {
-        s.into_bytes().into()
-    }
-}
-
-impl<'a> From<&'a String> for Body {
-    fn from(s: &'a String) -> Body {
-        Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
-    }
-}
-
-impl From<Bytes> for Body {
-    fn from(s: Bytes) -> Body {
-        Body::Bytes(s)
-    }
-}
-
-impl From<BytesMut> for Body {
-    fn from(s: BytesMut) -> Body {
-        Body::Bytes(s.freeze())
-    }
-}
-
-impl From<serde_json::Value> for Body {
-    fn from(v: serde_json::Value) -> Body {
-        Body::Bytes(v.to_string().into())
-    }
-}
-
-impl<S> From<SizedStream<S>> for Body
-where
-    S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
-{
-    fn from(s: SizedStream<S>) -> Body {
-        Body::from_message(s)
-    }
-}
-
-impl<S, E> From<BodyStream<S>> for Body
-where
-    S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
-    E: Into<Error> + 'static,
-{
-    fn from(s: BodyStream<S>) -> Body {
-        Body::from_message(s)
-    }
-}
-
-impl MessageBody for Bytes {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
-        }
-    }
-}
-
-impl MessageBody for BytesMut {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
-        }
-    }
-}
-
-impl MessageBody for &'static str {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(Bytes::from_static(
-                mem::take(self.get_mut()).as_ref(),
-            ))))
-        }
-    }
-}
-
-impl MessageBody for Vec<u8> {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
-        }
-    }
-}
-
-impl MessageBody for String {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len() as u64)
-    }
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        _: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        if self.is_empty() {
-            Poll::Ready(None)
-        } else {
-            Poll::Ready(Some(Ok(Bytes::from(
-                mem::take(self.get_mut()).into_bytes(),
-            ))))
-        }
-    }
-}
-
-/// Type represent streaming body.
-/// Response does not contain `content-length` header and appropriate transfer encoding is used.
-pub struct BodyStream<S: Unpin> {
-    stream: S,
-}
-
-impl<S, E> BodyStream<S>
-where
-    S: Stream<Item = Result<Bytes, E>> + Unpin,
-    E: Into<Error>,
-{
-    pub fn new(stream: S) -> Self {
-        BodyStream { stream }
-    }
-}
-
-impl<S, E> MessageBody for BodyStream<S>
-where
-    S: Stream<Item = Result<Bytes, E>> + Unpin,
-    E: Into<Error>,
-{
-    fn size(&self) -> BodySize {
-        BodySize::Stream
-    }
-
-    /// Attempts to pull out the next value of the underlying [`Stream`].
-    ///
-    /// Empty values are skipped to prevent [`BodyStream`]'s transmission being
-    /// ended on a zero-length chunk, but rather proceed until the underlying
-    /// [`Stream`] ends.
-    fn poll_next(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        loop {
-            let stream = &mut self.as_mut().stream;
-            return Poll::Ready(match ready!(Pin::new(stream).poll_next(cx)) {
-                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
-                opt => opt.map(|res| res.map_err(Into::into)),
-            });
-        }
-    }
-}
-
-/// Type represent streaming body. This body implementation should be used
-/// if total size of stream is known. Data get sent as is without using transfer encoding.
-pub struct SizedStream<S: Unpin> {
-    size: u64,
-    stream: S,
-}
-
-impl<S> SizedStream<S>
-where
-    S: Stream<Item = Result<Bytes, Error>> + Unpin,
-{
-    pub fn new(size: u64, stream: S) -> Self {
-        SizedStream { size, stream }
-    }
-}
-
-impl<S> MessageBody for SizedStream<S>
-where
-    S: Stream<Item = Result<Bytes, Error>> + Unpin,
-{
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.size as u64)
-    }
-
-    /// Attempts to pull out the next value of the underlying [`Stream`].
-    ///
-    /// Empty values are skipped to prevent [`SizedStream`]'s transmission being
-    /// ended on a zero-length chunk, but rather proceed until the underlying
-    /// [`Stream`] ends.
-    fn poll_next(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
-        loop {
-            let stream = &mut self.as_mut().stream;
-            return Poll::Ready(match ready!(Pin::new(stream).poll_next(cx)) {
-                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
-                val => val,
-            });
-        }
-    }
-}
-
-#[cfg(test)]
-mod tests {
-    use super::*;
-    use futures_util::future::poll_fn;
-    use futures_util::pin_mut;
-    use futures_util::stream;
-
-    impl Body {
-        pub(crate) fn get_ref(&self) -> &[u8] {
-            match *self {
-                Body::Bytes(ref bin) => &bin,
-                _ => panic!(),
-            }
-        }
-    }
-
-    impl ResponseBody<Body> {
-        pub(crate) fn get_ref(&self) -> &[u8] {
-            match *self {
-                ResponseBody::Body(ref b) => b.get_ref(),
-                ResponseBody::Other(ref b) => b.get_ref(),
-            }
-        }
-    }
-
-    #[actix_rt::test]
-    async fn test_static_str() {
-        assert_eq!(Body::from("").size(), BodySize::Sized(0));
-        assert_eq!(Body::from("test").size(), BodySize::Sized(4));
-        assert_eq!(Body::from("test").get_ref(), b"test");
-
-        assert_eq!("test".size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
-                .await
-                .unwrap()
-                .ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_static_bytes() {
-        assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
-        assert_eq!(
-            Body::from_slice(b"test".as_ref()).size(),
-            BodySize::Sized(4)
-        );
-        assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
-        let sb = Bytes::from(&b"test"[..]);
-        pin_mut!(sb);
-
-        assert_eq!(sb.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_vec() {
-        assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
-        let test_vec = Vec::from("test");
-        pin_mut!(test_vec);
-
-        assert_eq!(test_vec.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| test_vec.as_mut().poll_next(cx))
-                .await
-                .unwrap()
-                .ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_bytes() {
-        let b = Bytes::from("test");
-        assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(b.clone()).get_ref(), b"test");
-        pin_mut!(b);
-
-        assert_eq!(b.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_bytes_mut() {
-        let b = BytesMut::from("test");
-        assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(b.clone()).get_ref(), b"test");
-        pin_mut!(b);
-
-        assert_eq!(b.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_string() {
-        let b = "test".to_owned();
-        assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(b.clone()).get_ref(), b"test");
-        assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
-        assert_eq!(Body::from(&b).get_ref(), b"test");
-        pin_mut!(b);
-
-        assert_eq!(b.size(), BodySize::Sized(4));
-        assert_eq!(
-            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
-            Some(Bytes::from("test"))
-        );
-    }
-
-    #[actix_rt::test]
-    async fn test_unit() {
-        assert_eq!(().size(), BodySize::Empty);
-        assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
-            .await
-            .is_none());
-    }
-
-    #[actix_rt::test]
-    async fn test_box() {
-        let val = Box::new(());
-        pin_mut!(val);
-        assert_eq!(val.size(), BodySize::Empty);
-        assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
-    }
-
-    #[actix_rt::test]
-    async fn test_body_eq() {
-        assert!(
-            Body::Bytes(Bytes::from_static(b"1"))
-                == Body::Bytes(Bytes::from_static(b"1"))
-        );
-        assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
-    }
-
-    #[actix_rt::test]
-    async fn test_body_debug() {
-        assert!(format!("{:?}", Body::None).contains("Body::None"));
-        assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
-        assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
-    }
-
-    #[actix_rt::test]
-    async fn test_serde_json() {
-        use serde_json::json;
-        assert_eq!(
-            Body::from(serde_json::Value::String("test".into())).size(),
-            BodySize::Sized(6)
-        );
-        assert_eq!(
-            Body::from(json!({"test-key":"test-value"})).size(),
-            BodySize::Sized(25)
-        );
-    }
-
-    mod body_stream {
-        use super::*;
-        //use futures::task::noop_waker;
-        //use futures::stream::once;
-
-        #[actix_rt::test]
-        async fn skips_empty_chunks() {
-            let body = BodyStream::new(stream::iter(
-                ["1", "", "2"]
-                    .iter()
-                    .map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
-            ));
-            pin_mut!(body);
-
-            assert_eq!(
-                poll_fn(|cx| body.as_mut().poll_next(cx))
-                    .await
-                    .unwrap()
-                    .ok(),
-                Some(Bytes::from("1")),
-            );
-            assert_eq!(
-                poll_fn(|cx| body.as_mut().poll_next(cx))
-                    .await
-                    .unwrap()
-                    .ok(),
-                Some(Bytes::from("2")),
-            );
-        }
-
-        /* Now it does not compile as it should
-        #[actix_rt::test]
-        async fn move_pinned_pointer() {
-            let (sender, receiver) = futures::channel::oneshot::channel();
-            let mut body_stream = Ok(BodyStream::new(once(async {
-                let x = Box::new(0i32);
-                let y = &x;
-                receiver.await.unwrap();
-                let _z = **y;
-                Ok::<_, ()>(Bytes::new())
-            })));
-
-            let waker = noop_waker();
-            let mut context = Context::from_waker(&waker);
-            pin_mut!(body_stream);
-
-            let _ = body_stream.as_mut().unwrap().poll_next(&mut context);
-            sender.send(()).unwrap();
-            let _ = std::mem::replace(&mut body_stream, Err([0; 32])).unwrap().poll_next(&mut context);
-        }*/
-    }
-
-    mod sized_stream {
-        use super::*;
-
-        #[actix_rt::test]
-        async fn skips_empty_chunks() {
-            let body = SizedStream::new(
-                2,
-                stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
-            );
-            pin_mut!(body);
-            assert_eq!(
-                poll_fn(|cx| body.as_mut().poll_next(cx))
-                    .await
-                    .unwrap()
-                    .ok(),
-                Some(Bytes::from("1")),
-            );
-            assert_eq!(
-                poll_fn(|cx| body.as_mut().poll_next(cx))
-                    .await
-                    .unwrap()
-                    .ok(),
-                Some(Bytes::from("2")),
-            );
-        }
-    }
-
-    #[actix_rt::test]
-    async fn test_body_casting() {
-        let mut body = String::from("hello cast");
-        let resp_body: &mut dyn MessageBody = &mut body;
-        let body = resp_body.downcast_ref::<String>().unwrap();
-        assert_eq!(body, "hello cast");
-        let body = &mut resp_body.downcast_mut::<String>().unwrap();
-        body.push('!');
-        let body = resp_body.downcast_ref::<String>().unwrap();
-        assert_eq!(body, "hello cast!");
-        let not_body = resp_body.downcast_ref::<()>();
-        assert!(not_body.is_none());
-    }
-}

actix-http/src/body/body.rs

@@ -0,0 +1,333 @@
+use std::{
+    borrow::Cow,
+    error::Error as StdError,
+    fmt, mem,
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use bytes::{Bytes, BytesMut};
+use futures_core::Stream;
+use pin_project::pin_project;
+
+use crate::error::Error;
+
+use super::{BodySize, BodyStream, MessageBody, MessageBodyMapErr, SizedStream};
+
+#[deprecated(since = "4.0.0", note = "Renamed to `AnyBody`.")]
+pub type Body = AnyBody;
+
+/// Represents various types of HTTP message body.
+#[pin_project(project = AnyBodyProj)]
+#[derive(Clone)]
+pub enum AnyBody<B = BoxBody> {
+    /// Empty response. `Content-Length` header is not set.
+    None,
+
+    /// Complete, in-memory response body.
+    Bytes(Bytes),
+
+    /// Generic / Other message body.
+    Body(#[pin] B),
+}
+
+impl AnyBody {
+    /// Constructs a "body" representing an empty response.
+    pub fn none() -> Self {
+        Self::None
+    }
+
+    /// Constructs a new, 0-length body.
+    pub fn empty() -> Self {
+        Self::Bytes(Bytes::new())
+    }
+
+    /// Create boxed body from generic message body.
+    pub fn new_boxed<B>(body: B) -> Self
+    where
+        B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError + 'static>>,
+    {
+        Self::Body(BoxBody::from_body(body))
+    }
+
+    /// Constructs new `AnyBody` instance from a slice of bytes by copying it.
+    ///
+    /// If your bytes container is owned, it may be cheaper to use a `From` impl.
+    pub fn copy_from_slice(s: &[u8]) -> Self {
+        Self::Bytes(Bytes::copy_from_slice(s))
+    }
+
+    #[doc(hidden)]
+    #[deprecated(since = "4.0.0", note = "Renamed to `copy_from_slice`.")]
+    pub fn from_slice(s: &[u8]) -> Self {
+        Self::Bytes(Bytes::copy_from_slice(s))
+    }
+}
+
+impl<B> AnyBody<B>
+where
+    B: MessageBody + 'static,
+    B::Error: Into<Box<dyn StdError + 'static>>,
+{
+    /// Create body from generic message body.
+    pub fn new(body: B) -> Self {
+        Self::Body(body)
+    }
+
+    pub fn into_boxed(self) -> AnyBody {
+        match self {
+            Self::None => AnyBody::None,
+            Self::Bytes(bytes) => AnyBody::Bytes(bytes),
+            Self::Body(body) => AnyBody::new_boxed(body),
+        }
+    }
+}
+
+impl<B> MessageBody for AnyBody<B>
+where
+    B: MessageBody,
+    B::Error: Into<Box<dyn StdError>> + 'static,
+{
+    type Error = Error;
+
+    fn size(&self) -> BodySize {
+        match self {
+            AnyBody::None => BodySize::None,
+            AnyBody::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
+            AnyBody::Body(ref body) => body.size(),
+        }
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        match self.project() {
+            AnyBodyProj::None => Poll::Ready(None),
+            AnyBodyProj::Bytes(bin) => {
+                let len = bin.len();
+                if len == 0 {
+                    Poll::Ready(None)
+                } else {
+                    Poll::Ready(Some(Ok(mem::take(bin))))
+                }
+            }
+
+            AnyBodyProj::Body(body) => body
+                .poll_next(cx)
+                .map_err(|err| Error::new_body().with_cause(err)),
+        }
+    }
+}
+
+impl PartialEq for AnyBody {
+    fn eq(&self, other: &AnyBody) -> bool {
+        match *self {
+            AnyBody::None => matches!(*other, AnyBody::None),
+            AnyBody::Bytes(ref b) => match *other {
+                AnyBody::Bytes(ref b2) => b == b2,
+                _ => false,
+            },
+            AnyBody::Body(_) => false,
+        }
+    }
+}
+
+impl<S: fmt::Debug> fmt::Debug for AnyBody<S> {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        match *self {
+            AnyBody::None => write!(f, "AnyBody::None"),
+            AnyBody::Bytes(ref bytes) => write!(f, "AnyBody::Bytes({:?})", bytes),
+            AnyBody::Body(ref stream) => write!(f, "AnyBody::Message({:?})", stream),
+        }
+    }
+}
+
+impl<B> From<&'static str> for AnyBody<B> {
+    fn from(string: &'static str) -> Self {
+        Self::Bytes(Bytes::from_static(string.as_ref()))
+    }
+}
+
+impl<B> From<&'static [u8]> for AnyBody<B> {
+    fn from(bytes: &'static [u8]) -> Self {
+        Self::Bytes(Bytes::from_static(bytes))
+    }
+}
+
+impl<B> From<Vec<u8>> for AnyBody<B> {
+    fn from(vec: Vec<u8>) -> Self {
+        Self::Bytes(Bytes::from(vec))
+    }
+}
+
+impl<B> From<String> for AnyBody<B> {
+    fn from(string: String) -> Self {
+        Self::Bytes(Bytes::from(string))
+    }
+}
+
+impl<B> From<&'_ String> for AnyBody<B> {
+    fn from(string: &String) -> Self {
+        Self::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&string)))
+    }
+}
+
+impl<B> From<Cow<'_, str>> for AnyBody<B> {
+    fn from(string: Cow<'_, str>) -> Self {
+        match string {
+            Cow::Owned(s) => Self::from(s),
+            Cow::Borrowed(s) => {
+                Self::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(s)))
+            }
+        }
+    }
+}
+
+impl<B> From<Bytes> for AnyBody<B> {
+    fn from(bytes: Bytes) -> Self {
+        Self::Bytes(bytes)
+    }
+}
+
+impl<B> From<BytesMut> for AnyBody<B> {
+    fn from(bytes: BytesMut) -> Self {
+        Self::Bytes(bytes.freeze())
+    }
+}
+
+impl<S, E> From<SizedStream<S>> for AnyBody<SizedStream<S>>
+where
+    S: Stream<Item = Result<Bytes, E>> + 'static,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    fn from(stream: SizedStream<S>) -> Self {
+        AnyBody::new(stream)
+    }
+}
+
+impl<S, E> From<SizedStream<S>> for AnyBody
+where
+    S: Stream<Item = Result<Bytes, E>> + 'static,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    fn from(stream: SizedStream<S>) -> Self {
+        AnyBody::new_boxed(stream)
+    }
+}
+
+impl<S, E> From<BodyStream<S>> for AnyBody<BodyStream<S>>
+where
+    S: Stream<Item = Result<Bytes, E>> + 'static,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    fn from(stream: BodyStream<S>) -> Self {
+        AnyBody::new(stream)
+    }
+}
+
+impl<S, E> From<BodyStream<S>> for AnyBody
+where
+    S: Stream<Item = Result<Bytes, E>> + 'static,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    fn from(stream: BodyStream<S>) -> Self {
+        AnyBody::new_boxed(stream)
+    }
+}
+
+/// A boxed message body with boxed errors.
+pub struct BoxBody(Pin<Box<dyn MessageBody<Error = Box<dyn StdError>>>>);
+
+impl BoxBody {
+    /// Boxes a `MessageBody` and any errors it generates.
+    pub fn from_body<B>(body: B) -> Self
+    where
+        B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError + 'static>>,
+    {
+        let body = MessageBodyMapErr::new(body, Into::into);
+        Self(Box::pin(body))
+    }
+
+    /// Returns a mutable pinned reference to the inner message body type.
+    pub fn as_pin_mut(
+        &mut self,
+    ) -> Pin<&mut (dyn MessageBody<Error = Box<dyn StdError>>)> {
+        self.0.as_mut()
+    }
+}
+
+impl fmt::Debug for BoxBody {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        f.write_str("BoxAnyBody(dyn MessageBody)")
+    }
+}
+
+impl MessageBody for BoxBody {
+    type Error = Error;
+
+    fn size(&self) -> BodySize {
+        self.0.size()
+    }
+
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        self.0
+            .as_mut()
+            .poll_next(cx)
+            .map_err(|err| Error::new_body().with_cause(err))
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use std::marker::PhantomPinned;
+
+    use static_assertions::{assert_impl_all, assert_not_impl_all};
+
+    use super::*;
+    use crate::body::to_bytes;
+
+    struct PinType(PhantomPinned);
+
+    impl MessageBody for PinType {
+        type Error = crate::Error;
+
+        fn size(&self) -> BodySize {
+            unimplemented!()
+        }
+
+        fn poll_next(
+            self: Pin<&mut Self>,
+            _cx: &mut Context<'_>,
+        ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+            unimplemented!()
+        }
+    }
+
+    assert_impl_all!(AnyBody<()>: MessageBody, fmt::Debug, Send, Sync, Unpin);
+    assert_impl_all!(AnyBody<AnyBody<()>>: MessageBody, fmt::Debug, Send, Sync, Unpin);
+    assert_impl_all!(AnyBody<Bytes>: MessageBody, fmt::Debug, Send, Sync, Unpin);
+    assert_impl_all!(AnyBody: MessageBody, fmt::Debug, Unpin);
+    assert_impl_all!(BoxBody: MessageBody, fmt::Debug, Unpin);
+    assert_impl_all!(AnyBody<PinType>: MessageBody);
+
+    assert_not_impl_all!(AnyBody: Send, Sync, Unpin);
+    assert_not_impl_all!(BoxBody: Send, Sync, Unpin);
+    assert_not_impl_all!(AnyBody<PinType>: Send, Sync, Unpin);
+
+    #[actix_rt::test]
+    async fn nested_boxed_body() {
+        let body = AnyBody::copy_from_slice(&[1, 2, 3]);
+        let boxed_body = BoxBody::from_body(BoxBody::from_body(body));
+
+        assert_eq!(
+            to_bytes(boxed_body).await.unwrap(),
+            Bytes::from(vec![1, 2, 3]),
+        );
+    }
+}

actix-http/src/body/body_stream.rs

@@ -0,0 +1,207 @@
+use std::{
+    error::Error as StdError,
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use bytes::Bytes;
+use futures_core::{ready, Stream};
+use pin_project_lite::pin_project;
+
+use super::{BodySize, MessageBody};
+
+pin_project! {
+    /// Streaming response wrapper.
+    ///
+    /// Response does not contain `Content-Length` header and appropriate transfer encoding is used.
+    pub struct BodyStream<S> {
+        #[pin]
+        stream: S,
+    }
+}
+
+impl<S, E> BodyStream<S>
+where
+    S: Stream<Item = Result<Bytes, E>>,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    pub fn new(stream: S) -> Self {
+        BodyStream { stream }
+    }
+}
+
+impl<S, E> MessageBody for BodyStream<S>
+where
+    S: Stream<Item = Result<Bytes, E>>,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    type Error = E;
+
+    fn size(&self) -> BodySize {
+        BodySize::Stream
+    }
+
+    /// Attempts to pull out the next value of the underlying [`Stream`].
+    ///
+    /// Empty values are skipped to prevent [`BodyStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        loop {
+            let stream = self.as_mut().project().stream;
+
+            let chunk = match ready!(stream.poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                opt => opt,
+            };
+
+            return Poll::Ready(chunk);
+        }
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use std::{convert::Infallible, time::Duration};
+
+    use actix_rt::{
+        pin,
+        time::{sleep, Sleep},
+    };
+    use actix_utils::future::poll_fn;
+    use derive_more::{Display, Error};
+    use futures_core::ready;
+    use futures_util::{stream, FutureExt as _};
+    use static_assertions::{assert_impl_all, assert_not_impl_all};
+
+    use super::*;
+    use crate::body::to_bytes;
+
+    assert_impl_all!(BodyStream<stream::Empty<Result<Bytes, crate::Error>>>: MessageBody);
+    assert_impl_all!(BodyStream<stream::Empty<Result<Bytes, &'static str>>>: MessageBody);
+    assert_impl_all!(BodyStream<stream::Repeat<Result<Bytes, &'static str>>>: MessageBody);
+    assert_impl_all!(BodyStream<stream::Empty<Result<Bytes, Infallible>>>: MessageBody);
+    assert_impl_all!(BodyStream<stream::Repeat<Result<Bytes, Infallible>>>: MessageBody);
+
+    assert_not_impl_all!(BodyStream<stream::Empty<Bytes>>: MessageBody);
+    assert_not_impl_all!(BodyStream<stream::Repeat<Bytes>>: MessageBody);
+    // crate::Error is not Clone
+    assert_not_impl_all!(BodyStream<stream::Repeat<Result<Bytes, crate::Error>>>: MessageBody);
+
+    #[actix_rt::test]
+    async fn skips_empty_chunks() {
+        let body = BodyStream::new(stream::iter(
+            ["1", "", "2"]
+                .iter()
+                .map(|&v| Ok::<_, Infallible>(Bytes::from(v))),
+        ));
+        pin!(body);
+
+        assert_eq!(
+            poll_fn(|cx| body.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("1")),
+        );
+        assert_eq!(
+            poll_fn(|cx| body.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("2")),
+        );
+    }
+
+    #[actix_rt::test]
+    async fn read_to_bytes() {
+        let body = BodyStream::new(stream::iter(
+            ["1", "", "2"]
+                .iter()
+                .map(|&v| Ok::<_, Infallible>(Bytes::from(v))),
+        ));
+
+        assert_eq!(to_bytes(body).await.ok(), Some(Bytes::from("12")));
+    }
+    #[derive(Debug, Display, Error)]
+    #[display(fmt = "stream error")]
+    struct StreamErr;
+
+    #[actix_rt::test]
+    async fn stream_immediate_error() {
+        let body = BodyStream::new(stream::once(async { Err(StreamErr) }));
+        assert!(matches!(to_bytes(body).await, Err(StreamErr)));
+    }
+
+    #[actix_rt::test]
+    async fn stream_string_error() {
+        // `&'static str` does not impl `Error`
+        // but it does impl `Into<Box<dyn Error>>`
+
+        let body = BodyStream::new(stream::once(async { Err("stringy error") }));
+        assert!(matches!(to_bytes(body).await, Err("stringy error")));
+    }
+
+    #[actix_rt::test]
+    async fn stream_boxed_error() {
+        // `Box<dyn Error>` does not impl `Error`
+        // but it does impl `Into<Box<dyn Error>>`
+
+        let body = BodyStream::new(stream::once(async {
+            Err(Box::<dyn StdError>::from("stringy error"))
+        }));
+
+        assert_eq!(
+            to_bytes(body).await.unwrap_err().to_string(),
+            "stringy error"
+        );
+    }
+
+    #[actix_rt::test]
+    async fn stream_delayed_error() {
+        let body =
+            BodyStream::new(stream::iter(vec![Ok(Bytes::from("1")), Err(StreamErr)]));
+        assert!(matches!(to_bytes(body).await, Err(StreamErr)));
+
+        #[pin_project::pin_project(project = TimeDelayStreamProj)]
+        #[derive(Debug)]
+        enum TimeDelayStream {
+            Start,
+            Sleep(Pin<Box<Sleep>>),
+            Done,
+        }
+
+        impl Stream for TimeDelayStream {
+            type Item = Result<Bytes, StreamErr>;
+
+            fn poll_next(
+                mut self: Pin<&mut Self>,
+                cx: &mut Context<'_>,
+            ) -> Poll<Option<Self::Item>> {
+                match self.as_mut().get_mut() {
+                    TimeDelayStream::Start => {
+                        let sleep = sleep(Duration::from_millis(1));
+                        self.as_mut().set(TimeDelayStream::Sleep(Box::pin(sleep)));
+                        cx.waker().wake_by_ref();
+                        Poll::Pending
+                    }
+
+                    TimeDelayStream::Sleep(ref mut delay) => {
+                        ready!(delay.poll_unpin(cx));
+                        self.set(TimeDelayStream::Done);
+                        cx.waker().wake_by_ref();
+                        Poll::Pending
+                    }
+
+                    TimeDelayStream::Done => Poll::Ready(Some(Err(StreamErr))),
+                }
+            }
+        }
+
+        let body = BodyStream::new(TimeDelayStream::Start);
+        assert!(matches!(to_bytes(body).await, Err(StreamErr)));
+    }
+}

actix-http/src/body/message_body.rs

@@ -0,0 +1,228 @@
+//! [`MessageBody`] trait and foreign implementations.
+
+use std::{
+    convert::Infallible,
+    mem,
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use bytes::{Bytes, BytesMut};
+use futures_core::ready;
+use pin_project_lite::pin_project;
+
+use super::BodySize;
+
+/// An interface for response bodies.
+pub trait MessageBody {
+    type Error;
+
+    /// Body size hint.
+    fn size(&self) -> BodySize;
+
+    /// Attempt to pull out the next chunk of body bytes.
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>>;
+}
+
+impl MessageBody for () {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(0)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        Poll::Ready(None)
+    }
+}
+
+impl<B> MessageBody for Box<B>
+where
+    B: MessageBody + Unpin,
+{
+    type Error = B::Error;
+
+    fn size(&self) -> BodySize {
+        self.as_ref().size()
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        Pin::new(self.get_mut().as_mut()).poll_next(cx)
+    }
+}
+
+impl<B> MessageBody for Pin<Box<B>>
+where
+    B: MessageBody,
+{
+    type Error = B::Error;
+
+    fn size(&self) -> BodySize {
+        self.as_ref().size()
+    }
+
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        self.as_mut().poll_next(cx)
+    }
+}
+
+impl MessageBody for Bytes {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
+        }
+    }
+}
+
+impl MessageBody for BytesMut {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
+        }
+    }
+}
+
+impl MessageBody for &'static str {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(Bytes::from_static(
+                mem::take(self.get_mut()).as_ref(),
+            ))))
+        }
+    }
+}
+
+impl MessageBody for Vec<u8> {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
+        }
+    }
+}
+
+impl MessageBody for String {
+    type Error = Infallible;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.len() as u64)
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        if self.is_empty() {
+            Poll::Ready(None)
+        } else {
+            Poll::Ready(Some(Ok(Bytes::from(
+                mem::take(self.get_mut()).into_bytes(),
+            ))))
+        }
+    }
+}
+
+pin_project! {
+    pub(crate) struct MessageBodyMapErr<B, F> {
+        #[pin]
+        body: B,
+        mapper: Option<F>,
+    }
+}
+
+impl<B, F, E> MessageBodyMapErr<B, F>
+where
+    B: MessageBody,
+    F: FnOnce(B::Error) -> E,
+{
+    pub(crate) fn new(body: B, mapper: F) -> Self {
+        Self {
+            body,
+            mapper: Some(mapper),
+        }
+    }
+}
+
+impl<B, F, E> MessageBody for MessageBodyMapErr<B, F>
+where
+    B: MessageBody,
+    F: FnOnce(B::Error) -> E,
+{
+    type Error = E;
+
+    fn size(&self) -> BodySize {
+        self.body.size()
+    }
+
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        let this = self.as_mut().project();
+
+        match ready!(this.body.poll_next(cx)) {
+            Some(Err(err)) => {
+                let f = self.as_mut().project().mapper.take().unwrap();
+                let mapped_err = (f)(err);
+                Poll::Ready(Some(Err(mapped_err)))
+            }
+            Some(Ok(val)) => Poll::Ready(Some(Ok(val))),
+            None => Poll::Ready(None),
+        }
+    }
+}

actix-http/src/body/mod.rs

@@ -0,0 +1,272 @@
+//! Traits and structures to aid consuming and writing HTTP payloads.
+
+use std::task::Poll;
+
+use actix_rt::pin;
+use actix_utils::future::poll_fn;
+use bytes::{Bytes, BytesMut};
+use futures_core::ready;
+
+#[allow(clippy::module_inception)]
+mod body;
+mod body_stream;
+mod message_body;
+mod size;
+mod sized_stream;
+
+#[allow(deprecated)]
+pub use self::body::{AnyBody, Body, BoxBody};
+pub use self::body_stream::BodyStream;
+pub use self::message_body::MessageBody;
+pub(crate) use self::message_body::MessageBodyMapErr;
+pub use self::size::BodySize;
+pub use self::sized_stream::SizedStream;
+
+/// Collects the body produced by a `MessageBody` implementation into `Bytes`.
+///
+/// Any errors produced by the body stream are returned immediately.
+///
+/// # Examples
+/// ```
+/// use actix_http::body::{AnyBody, to_bytes};
+/// use bytes::Bytes;
+///
+/// # async fn test_to_bytes() {
+/// let body = AnyBody::none();
+/// let bytes = to_bytes(body).await.unwrap();
+/// assert!(bytes.is_empty());
+///
+/// let body = AnyBody::copy_from_slice(b"123");
+/// let bytes = to_bytes(body).await.unwrap();
+/// assert_eq!(bytes, b"123"[..]);
+/// # }
+/// ```
+pub async fn to_bytes<B: MessageBody>(body: B) -> Result<Bytes, B::Error> {
+    let cap = match body.size() {
+        BodySize::None | BodySize::Sized(0) => return Ok(Bytes::new()),
+        BodySize::Sized(size) => size as usize,
+        // good enough first guess for chunk size
+        BodySize::Stream => 32_768,
+    };
+
+    let mut buf = BytesMut::with_capacity(cap);
+
+    pin!(body);
+
+    poll_fn(|cx| loop {
+        let body = body.as_mut();
+
+        match ready!(body.poll_next(cx)) {
+            Some(Ok(bytes)) => buf.extend_from_slice(&*bytes),
+            None => return Poll::Ready(Ok(())),
+            Some(Err(err)) => return Poll::Ready(Err(err)),
+        }
+    })
+    .await?;
+
+    Ok(buf.freeze())
+}
+
+#[cfg(test)]
+mod tests {
+    use std::pin::Pin;
+
+    use actix_rt::pin;
+    use actix_utils::future::poll_fn;
+    use bytes::{Bytes, BytesMut};
+
+    use super::{to_bytes, AnyBody as TestAnyBody, BodySize, MessageBody as _};
+
+    impl AnyBody {
+        pub(crate) fn get_ref(&self) -> &[u8] {
+            match *self {
+                AnyBody::Bytes(ref bin) => bin,
+                _ => panic!(),
+            }
+        }
+    }
+
+    /// AnyBody alias because rustc does not (can not?) infer the default type parameter.
+    type AnyBody = TestAnyBody;
+
+    #[actix_rt::test]
+    async fn test_static_str() {
+        assert_eq!(AnyBody::from("").size(), BodySize::Sized(0));
+        assert_eq!(AnyBody::from("test").size(), BodySize::Sized(4));
+        assert_eq!(AnyBody::from("test").get_ref(), b"test");
+
+        assert_eq!("test".size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_static_bytes() {
+        assert_eq!(AnyBody::from(b"test".as_ref()).size(), BodySize::Sized(4));
+        assert_eq!(AnyBody::from(b"test".as_ref()).get_ref(), b"test");
+        assert_eq!(
+            AnyBody::copy_from_slice(b"test".as_ref()).size(),
+            BodySize::Sized(4)
+        );
+        assert_eq!(
+            AnyBody::copy_from_slice(b"test".as_ref()).get_ref(),
+            b"test"
+        );
+        let sb = Bytes::from(&b"test"[..]);
+        pin!(sb);
+
+        assert_eq!(sb.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_vec() {
+        assert_eq!(AnyBody::from(Vec::from("test")).size(), BodySize::Sized(4));
+        assert_eq!(AnyBody::from(Vec::from("test")).get_ref(), b"test");
+        let test_vec = Vec::from("test");
+        pin!(test_vec);
+
+        assert_eq!(test_vec.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| test_vec.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_bytes() {
+        let b = Bytes::from("test");
+        assert_eq!(AnyBody::from(b.clone()).size(), BodySize::Sized(4));
+        assert_eq!(AnyBody::from(b.clone()).get_ref(), b"test");
+        pin!(b);
+
+        assert_eq!(b.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_bytes_mut() {
+        let b = BytesMut::from("test");
+        assert_eq!(AnyBody::from(b.clone()).size(), BodySize::Sized(4));
+        assert_eq!(AnyBody::from(b.clone()).get_ref(), b"test");
+        pin!(b);
+
+        assert_eq!(b.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_string() {
+        let b = "test".to_owned();
+        assert_eq!(AnyBody::from(b.clone()).size(), BodySize::Sized(4));
+        assert_eq!(AnyBody::from(b.clone()).get_ref(), b"test");
+        assert_eq!(AnyBody::from(&b).size(), BodySize::Sized(4));
+        assert_eq!(AnyBody::from(&b).get_ref(), b"test");
+        pin!(b);
+
+        assert_eq!(b.size(), BodySize::Sized(4));
+        assert_eq!(
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
+        );
+    }
+
+    #[actix_rt::test]
+    async fn test_unit() {
+        assert_eq!(().size(), BodySize::Sized(0));
+        assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
+            .await
+            .is_none());
+    }
+
+    #[actix_rt::test]
+    async fn test_box_and_pin() {
+        let val = Box::new(());
+        pin!(val);
+        assert_eq!(val.size(), BodySize::Sized(0));
+        assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
+
+        let mut val = Box::pin(());
+        assert_eq!(val.size(), BodySize::Sized(0));
+        assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
+    }
+
+    #[actix_rt::test]
+    async fn test_body_eq() {
+        assert!(
+            AnyBody::Bytes(Bytes::from_static(b"1"))
+                == AnyBody::Bytes(Bytes::from_static(b"1"))
+        );
+        assert!(AnyBody::Bytes(Bytes::from_static(b"1")) != AnyBody::None);
+    }
+
+    #[actix_rt::test]
+    async fn test_body_debug() {
+        assert!(format!("{:?}", AnyBody::None).contains("Body::None"));
+        assert!(format!("{:?}", AnyBody::from(Bytes::from_static(b"1"))).contains('1'));
+    }
+
+    #[actix_rt::test]
+    async fn test_serde_json() {
+        use serde_json::{json, Value};
+        assert_eq!(
+            AnyBody::from(
+                serde_json::to_vec(&Value::String("test".to_owned())).unwrap()
+            )
+            .size(),
+            BodySize::Sized(6)
+        );
+        assert_eq!(
+            AnyBody::from(
+                serde_json::to_vec(&json!({"test-key":"test-value"})).unwrap()
+            )
+            .size(),
+            BodySize::Sized(25)
+        );
+    }
+
+    // down-casting used to be done with a method on MessageBody trait
+    // test is kept to demonstrate equivalence of Any trait
+    #[actix_rt::test]
+    async fn test_body_casting() {
+        let mut body = String::from("hello cast");
+        // let mut resp_body: &mut dyn MessageBody<Error = Error> = &mut body;
+        let resp_body: &mut dyn std::any::Any = &mut body;
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast");
+        let body = &mut resp_body.downcast_mut::<String>().unwrap();
+        body.push('!');
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast!");
+        let not_body = resp_body.downcast_ref::<()>();
+        assert!(not_body.is_none());
+    }
+
+    #[actix_rt::test]
+    async fn test_to_bytes() {
+        let body = AnyBody::empty();
+        let bytes = to_bytes(body).await.unwrap();
+        assert!(bytes.is_empty());
+
+        let body = AnyBody::copy_from_slice(b"123");
+        let bytes = to_bytes(body).await.unwrap();
+        assert_eq!(bytes, b"123"[..]);
+    }
+}

actix-http/src/body/size.rs

@@ -0,0 +1,36 @@
+/// Body size hint.
+#[derive(Debug, Clone, Copy, PartialEq)]
+pub enum BodySize {
+    /// Absence of body can be assumed from method or status code.
+    ///
+    /// Will skip writing Content-Length header.
+    None,
+
+    /// Known size body.
+    ///
+    /// Will write `Content-Length: N` header.
+    Sized(u64),
+
+    /// Unknown size body.
+    ///
+    /// Will not write Content-Length header. Can be used with chunked Transfer-Encoding.
+    Stream,
+}
+
+impl BodySize {
+    /// Returns true if size hint indicates no or empty body.
+    ///
+    /// Streams will return false because it cannot be known without reading the stream.
+    ///
+    /// ```
+    /// # use actix_http::body::BodySize;
+    /// assert!(BodySize::None.is_eof());
+    /// assert!(BodySize::Sized(0).is_eof());
+    ///
+    /// assert!(!BodySize::Sized(64).is_eof());
+    /// assert!(!BodySize::Stream.is_eof());
+    /// ```
+    pub fn is_eof(&self) -> bool {
+        matches!(self, BodySize::None | BodySize::Sized(0))
+    }
+}

actix-http/src/body/sized_stream.rs

@@ -0,0 +1,167 @@
+use std::{
+    error::Error as StdError,
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use bytes::Bytes;
+use futures_core::{ready, Stream};
+use pin_project_lite::pin_project;
+
+use super::{BodySize, MessageBody};
+
+pin_project! {
+    /// Known sized streaming response wrapper.
+    ///
+    /// This body implementation should be used if total size of stream is known. Data is sent as-is
+    /// without using chunked transfer encoding.
+    pub struct SizedStream<S> {
+        size: u64,
+        #[pin]
+        stream: S,
+    }
+}
+
+impl<S, E> SizedStream<S>
+where
+    S: Stream<Item = Result<Bytes, E>>,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    pub fn new(size: u64, stream: S) -> Self {
+        SizedStream { size, stream }
+    }
+}
+
+impl<S, E> MessageBody for SizedStream<S>
+where
+    S: Stream<Item = Result<Bytes, E>>,
+    E: Into<Box<dyn StdError>> + 'static,
+{
+    type Error = E;
+
+    fn size(&self) -> BodySize {
+        BodySize::Sized(self.size as u64)
+    }
+
+    /// Attempts to pull out the next value of the underlying [`Stream`].
+    ///
+    /// Empty values are skipped to prevent [`SizedStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
+        loop {
+            let stream = self.as_mut().project().stream;
+
+            let chunk = match ready!(stream.poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                val => val,
+            };
+
+            return Poll::Ready(chunk);
+        }
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use std::convert::Infallible;
+
+    use actix_rt::pin;
+    use actix_utils::future::poll_fn;
+    use futures_util::stream;
+    use static_assertions::{assert_impl_all, assert_not_impl_all};
+
+    use super::*;
+    use crate::body::to_bytes;
+
+    assert_impl_all!(SizedStream<stream::Empty<Result<Bytes, crate::Error>>>: MessageBody);
+    assert_impl_all!(SizedStream<stream::Empty<Result<Bytes, &'static str>>>: MessageBody);
+    assert_impl_all!(SizedStream<stream::Repeat<Result<Bytes, &'static str>>>: MessageBody);
+    assert_impl_all!(SizedStream<stream::Empty<Result<Bytes, Infallible>>>: MessageBody);
+    assert_impl_all!(SizedStream<stream::Repeat<Result<Bytes, Infallible>>>: MessageBody);
+
+    assert_not_impl_all!(SizedStream<stream::Empty<Bytes>>: MessageBody);
+    assert_not_impl_all!(SizedStream<stream::Repeat<Bytes>>: MessageBody);
+    // crate::Error is not Clone
+    assert_not_impl_all!(SizedStream<stream::Repeat<Result<Bytes, crate::Error>>>: MessageBody);
+
+    #[actix_rt::test]
+    async fn skips_empty_chunks() {
+        let body = SizedStream::new(
+            2,
+            stream::iter(
+                ["1", "", "2"]
+                    .iter()
+                    .map(|&v| Ok::<_, Infallible>(Bytes::from(v))),
+            ),
+        );
+
+        pin!(body);
+
+        assert_eq!(
+            poll_fn(|cx| body.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("1")),
+        );
+
+        assert_eq!(
+            poll_fn(|cx| body.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("2")),
+        );
+    }
+
+    #[actix_rt::test]
+    async fn read_to_bytes() {
+        let body = SizedStream::new(
+            2,
+            stream::iter(
+                ["1", "", "2"]
+                    .iter()
+                    .map(|&v| Ok::<_, Infallible>(Bytes::from(v))),
+            ),
+        );
+
+        assert_eq!(to_bytes(body).await.ok(), Some(Bytes::from("12")));
+    }
+
+    #[actix_rt::test]
+    async fn stream_string_error() {
+        // `&'static str` does not impl `Error`
+        // but it does impl `Into<Box<dyn Error>>`
+
+        let body = SizedStream::new(0, stream::once(async { Err("stringy error") }));
+        assert_eq!(to_bytes(body).await, Ok(Bytes::new()));
+
+        let body = SizedStream::new(1, stream::once(async { Err("stringy error") }));
+        assert!(matches!(to_bytes(body).await, Err("stringy error")));
+    }
+
+    #[actix_rt::test]
+    async fn stream_boxed_error() {
+        // `Box<dyn Error>` does not impl `Error`
+        // but it does impl `Into<Box<dyn Error>>`
+
+        let body = SizedStream::new(
+            0,
+            stream::once(async { Err(Box::<dyn StdError>::from("stringy error")) }),
+        );
+        assert_eq!(to_bytes(body).await.unwrap(), Bytes::new());
+
+        let body = SizedStream::new(
+            1,
+            stream::once(async { Err(Box::<dyn StdError>::from("stringy error")) }),
+        );
+        assert_eq!(
+            to_bytes(body).await.unwrap_err().to_string(),
+            "stringy error"
+        );
+    }
+}

actix-http/src/builder.rs

@@ -1,19 +1,16 @@
-use std::marker::PhantomData;
-use std::rc::Rc;
-use std::{fmt, net};
+use std::{error::Error as StdError, fmt, marker::PhantomData, net, rc::Rc};
 
 use actix_codec::Framed;
 use actix_service::{IntoServiceFactory, Service, ServiceFactory};
 
-use crate::body::MessageBody;
-use crate::config::{KeepAlive, ServiceConfig};
-use crate::error::Error;
-use crate::h1::{Codec, ExpectHandler, H1Service, UpgradeHandler};
-use crate::h2::H2Service;
-use crate::request::Request;
-use crate::response::Response;
-use crate::service::HttpService;
-use crate::{ConnectCallback, Extensions};
+use crate::{
+    body::{AnyBody, MessageBody},
+    config::{KeepAlive, ServiceConfig},
+    h1::{self, ExpectHandler, H1Service, UpgradeHandler},
+    h2::H2Service,
+    service::HttpService,
+    ConnectCallback, Extensions, Request, Response,
+};
 
 /// A HTTP service builder
 ///
@@ -34,7 +31,7 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler> {
 impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::InitError: fmt::Debug,
     <S::Service as Service<Request>>::Future: 'static,
 {
@@ -57,17 +54,15 @@ where
 impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::InitError: fmt::Debug,
     <S::Service as Service<Request>>::Future: 'static,
     X: ServiceFactory<Request, Config = (), Response = Request>,
-    X::Error: Into<Error>,
+    X::Error: Into<Response<AnyBody>>,
     X::InitError: fmt::Debug,
-    <X::Service as Service<Request>>::Future: 'static,
-    U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
+    U: ServiceFactory<(Request, Framed<T, h1::Codec>), Config = (), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
-    <U::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
 {
     /// Set server keep-alive setting.
     ///
@@ -125,9 +120,8 @@ where
     where
         F: IntoServiceFactory<X1, Request>,
         X1: ServiceFactory<Request, Config = (), Response = Request>,
-        X1::Error: Into<Error>,
+        X1::Error: Into<Response<AnyBody>>,
         X1::InitError: fmt::Debug,
-        <X1::Service as Service<Request>>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
@@ -148,11 +142,10 @@ where
     /// and this service get called with original request and framed object.
     pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
     where
-        F: IntoServiceFactory<U1, (Request, Framed<T, Codec>)>,
-        U1: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
+        F: IntoServiceFactory<U1, (Request, Framed<T, h1::Codec>)>,
+        U1: ServiceFactory<(Request, Framed<T, h1::Codec>), Config = (), Response = ()>,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
-        <U1::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
@@ -185,7 +178,7 @@ where
     where
         B: MessageBody,
         F: IntoServiceFactory<S, Request>,
-        S::Error: Into<Error>,
+        S::Error: Into<Response<AnyBody>>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
     {
@@ -206,12 +199,13 @@ where
     /// Finish service configuration and create a HTTP service for HTTP/2 protocol.
     pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
     where
-        B: MessageBody + 'static,
         F: IntoServiceFactory<S, Request>,
-        S::Error: Into<Error> + 'static,
+        S::Error: Into<Response<AnyBody>> + 'static,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>> + 'static,
-        <S::Service as Service<Request>>::Future: 'static,
+
+        B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError>>,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,
@@ -228,12 +222,13 @@ where
     /// Finish service configuration and create `HttpService` instance.
     pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
     where
-        B: MessageBody + 'static,
         F: IntoServiceFactory<S, Request>,
-        S::Error: Into<Error> + 'static,
+        S::Error: Into<Response<AnyBody>> + 'static,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>> + 'static,
-        <S::Service as Service<Request>>::Future: 'static,
+
+        B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError>>,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,

actix-http/src/client/connection.rs

@@ -1,267 +0,0 @@
-use std::future::Future;
-use std::pin::Pin;
-use std::task::{Context, Poll};
-use std::{fmt, io, time};
-
-use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
-use bytes::Bytes;
-use futures_util::future::{err, Either, FutureExt, LocalBoxFuture, Ready};
-use h2::client::SendRequest;
-use pin_project::pin_project;
-
-use crate::body::MessageBody;
-use crate::h1::ClientCodec;
-use crate::message::{RequestHeadType, ResponseHead};
-use crate::payload::Payload;
-
-use super::error::SendRequestError;
-use super::pool::{Acquired, Protocol};
-use super::{h1proto, h2proto};
-
-pub(crate) enum ConnectionType<Io> {
-    H1(Io),
-    H2(SendRequest<Bytes>),
-}
-
-pub trait Connection {
-    type Io: AsyncRead + AsyncWrite + Unpin;
-    type Future: Future<Output = Result<(ResponseHead, Payload), SendRequestError>>;
-
-    fn protocol(&self) -> Protocol;
-
-    /// Send request and body
-    fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
-        self,
-        head: H,
-        body: B,
-    ) -> Self::Future;
-
-    type TunnelFuture: Future<
-        Output = Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
-    >;
-
-    /// Send request, returns Response and Framed
-    fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture;
-}
-
-pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
-    /// Close connection
-    fn close(self: Pin<&mut Self>);
-
-    /// Release connection to the connection pool
-    fn release(self: Pin<&mut Self>);
-}
-
-#[doc(hidden)]
-/// HTTP client connection
-pub struct IoConnection<T> {
-    io: Option<ConnectionType<T>>,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
-}
-
-impl<T> fmt::Debug for IoConnection<T>
-where
-    T: fmt::Debug,
-{
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        match self.io {
-            Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
-            Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
-            None => write!(f, "Connection(Empty)"),
-        }
-    }
-}
-
-impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
-    pub(crate) fn new(
-        io: ConnectionType<T>,
-        created: time::Instant,
-        pool: Option<Acquired<T>>,
-    ) -> Self {
-        IoConnection {
-            pool,
-            created,
-            io: Some(io),
-        }
-    }
-
-    pub(crate) fn into_inner(self) -> (ConnectionType<T>, time::Instant) {
-        (self.io.unwrap(), self.created)
-    }
-}
-
-impl<T> Connection for IoConnection<T>
-where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    type Io = T;
-    type Future =
-        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
-
-    fn protocol(&self) -> Protocol {
-        match self.io {
-            Some(ConnectionType::H1(_)) => Protocol::Http1,
-            Some(ConnectionType::H2(_)) => Protocol::Http2,
-            None => Protocol::Http1,
-        }
-    }
-
-    fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
-        mut self,
-        head: H,
-        body: B,
-    ) -> Self::Future {
-        match self.io.take().unwrap() {
-            ConnectionType::H1(io) => {
-                h1proto::send_request(io, head.into(), body, self.created, self.pool)
-                    .boxed_local()
-            }
-            ConnectionType::H2(io) => {
-                h2proto::send_request(io, head.into(), body, self.created, self.pool)
-                    .boxed_local()
-            }
-        }
-    }
-
-    type TunnelFuture = Either<
-        LocalBoxFuture<
-            'static,
-            Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
-        >,
-        Ready<Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>>,
-    >;
-
-    /// Send request, returns Response and Framed
-    fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
-        match self.io.take().unwrap() {
-            ConnectionType::H1(io) => {
-                Either::Left(h1proto::open_tunnel(io, head.into()).boxed_local())
-            }
-            ConnectionType::H2(io) => {
-                if let Some(mut pool) = self.pool.take() {
-                    pool.release(IoConnection::new(
-                        ConnectionType::H2(io),
-                        self.created,
-                        None,
-                    ));
-                }
-                Either::Right(err(SendRequestError::TunnelNotSupported))
-            }
-        }
-    }
-}
-
-#[allow(dead_code)]
-pub(crate) enum EitherConnection<A, B> {
-    A(IoConnection<A>),
-    B(IoConnection<B>),
-}
-
-impl<A, B> Connection for EitherConnection<A, B>
-where
-    A: AsyncRead + AsyncWrite + Unpin + 'static,
-    B: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    type Io = EitherIo<A, B>;
-    type Future =
-        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
-
-    fn protocol(&self) -> Protocol {
-        match self {
-            EitherConnection::A(con) => con.protocol(),
-            EitherConnection::B(con) => con.protocol(),
-        }
-    }
-
-    fn send_request<RB: MessageBody + 'static, H: Into<RequestHeadType>>(
-        self,
-        head: H,
-        body: RB,
-    ) -> Self::Future {
-        match self {
-            EitherConnection::A(con) => con.send_request(head, body),
-            EitherConnection::B(con) => con.send_request(head, body),
-        }
-    }
-
-    type TunnelFuture = LocalBoxFuture<
-        'static,
-        Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
-    >;
-
-    /// Send request, returns Response and Framed
-    fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
-        match self {
-            EitherConnection::A(con) => con
-                .open_tunnel(head)
-                .map(|res| {
-                    res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::A)))
-                })
-                .boxed_local(),
-            EitherConnection::B(con) => con
-                .open_tunnel(head)
-                .map(|res| {
-                    res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::B)))
-                })
-                .boxed_local(),
-        }
-    }
-}
-
-#[pin_project(project = EitherIoProj)]
-pub enum EitherIo<A, B> {
-    A(#[pin] A),
-    B(#[pin] B),
-}
-
-impl<A, B> AsyncRead for EitherIo<A, B>
-where
-    A: AsyncRead,
-    B: AsyncRead,
-{
-    fn poll_read(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &mut ReadBuf<'_>,
-    ) -> Poll<io::Result<()>> {
-        match self.project() {
-            EitherIoProj::A(val) => val.poll_read(cx, buf),
-            EitherIoProj::B(val) => val.poll_read(cx, buf),
-        }
-    }
-}
-
-impl<A, B> AsyncWrite for EitherIo<A, B>
-where
-    A: AsyncWrite,
-    B: AsyncWrite,
-{
-    fn poll_write(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &[u8],
-    ) -> Poll<io::Result<usize>> {
-        match self.project() {
-            EitherIoProj::A(val) => val.poll_write(cx, buf),
-            EitherIoProj::B(val) => val.poll_write(cx, buf),
-        }
-    }
-
-    fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
-        match self.project() {
-            EitherIoProj::A(val) => val.poll_flush(cx),
-            EitherIoProj::B(val) => val.poll_flush(cx),
-        }
-    }
-
-    fn poll_shutdown(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<io::Result<()>> {
-        match self.project() {
-            EitherIoProj::A(val) => val.poll_shutdown(cx),
-            EitherIoProj::B(val) => val.poll_shutdown(cx),
-        }
-    }
-}

actix-http/src/client/connector.rs

@@ -1,534 +0,0 @@
-use std::fmt;
-use std::marker::PhantomData;
-use std::time::Duration;
-
-use actix_codec::{AsyncRead, AsyncWrite};
-use actix_rt::net::TcpStream;
-use actix_service::{apply_fn, Service, ServiceExt};
-use actix_tls::connect::{
-    default_connector, Connect as TcpConnect, Connection as TcpConnection,
-};
-use actix_utils::timeout::{TimeoutError, TimeoutService};
-use http::Uri;
-
-use super::config::ConnectorConfig;
-use super::connection::Connection;
-use super::error::ConnectError;
-use super::pool::{ConnectionPool, Protocol};
-use super::Connect;
-
-#[cfg(feature = "openssl")]
-use actix_tls::connect::ssl::openssl::SslConnector as OpensslConnector;
-
-#[cfg(feature = "rustls")]
-use actix_tls::connect::ssl::rustls::ClientConfig;
-#[cfg(feature = "rustls")]
-use std::sync::Arc;
-
-#[cfg(any(feature = "openssl", feature = "rustls"))]
-enum SslConnector {
-    #[cfg(feature = "openssl")]
-    Openssl(OpensslConnector),
-    #[cfg(feature = "rustls")]
-    Rustls(Arc<ClientConfig>),
-}
-#[cfg(not(any(feature = "openssl", feature = "rustls")))]
-type SslConnector = ();
-
-/// Manages http client network connectivity
-/// The `Connector` type uses a builder-like combinator pattern for service
-/// construction that finishes by calling the `.finish()` method.
-///
-/// ```rust,ignore
-/// use std::time::Duration;
-/// use actix_http::client::Connector;
-///
-/// let connector = Connector::new()
-///      .timeout(Duration::from_secs(5))
-///      .finish();
-/// ```
-pub struct Connector<T, U> {
-    connector: T,
-    config: ConnectorConfig,
-    #[allow(dead_code)]
-    ssl: SslConnector,
-    _phantom: PhantomData<U>,
-}
-
-trait Io: AsyncRead + AsyncWrite + Unpin {}
-impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
-
-impl Connector<(), ()> {
-    #[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
-    pub fn new() -> Connector<
-        impl Service<
-                TcpConnect<Uri>,
-                Response = TcpConnection<Uri, TcpStream>,
-                Error = actix_tls::connect::ConnectError,
-            > + Clone,
-        TcpStream,
-    > {
-        Connector {
-            ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
-            connector: default_connector(),
-            config: ConnectorConfig::default(),
-            _phantom: PhantomData,
-        }
-    }
-
-    // Build Ssl connector with openssl, based on supplied alpn protocols
-    #[cfg(feature = "openssl")]
-    fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
-        use actix_tls::connect::ssl::openssl::SslMethod;
-        use bytes::{BufMut, BytesMut};
-
-        let mut alpn = BytesMut::with_capacity(20);
-        for proto in protocols.iter() {
-            alpn.put_u8(proto.len() as u8);
-            alpn.put(proto.as_slice());
-        }
-
-        let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
-        let _ = ssl
-            .set_alpn_protos(&alpn)
-            .map_err(|e| error!("Can not set alpn protocol: {:?}", e));
-        SslConnector::Openssl(ssl.build())
-    }
-
-    // Build Ssl connector with rustls, based on supplied alpn protocols
-    #[cfg(all(not(feature = "openssl"), feature = "rustls"))]
-    fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
-        let mut config = ClientConfig::new();
-        config.set_protocols(&protocols);
-        config
-            .root_store
-            .add_server_trust_anchors(&actix_tls::accept::rustls::TLS_SERVER_ROOTS);
-        SslConnector::Rustls(Arc::new(config))
-    }
-
-    // ssl turned off, provides empty ssl connector
-    #[cfg(not(any(feature = "openssl", feature = "rustls")))]
-    fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
-}
-
-impl<T, U> Connector<T, U> {
-    /// Use custom connector.
-    pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
-    where
-        U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
-        T1: Service<
-                TcpConnect<Uri>,
-                Response = TcpConnection<Uri, U1>,
-                Error = actix_tls::connect::ConnectError,
-            > + Clone,
-    {
-        Connector {
-            connector,
-            config: self.config,
-            ssl: self.ssl,
-            _phantom: PhantomData,
-        }
-    }
-}
-
-impl<T, U> Connector<T, U>
-where
-    U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
-    T: Service<
-            TcpConnect<Uri>,
-            Response = TcpConnection<Uri, U>,
-            Error = actix_tls::connect::ConnectError,
-        > + Clone
-        + 'static,
-{
-    /// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
-    /// Set to 1 second by default.
-    pub fn timeout(mut self, timeout: Duration) -> Self {
-        self.config.timeout = timeout;
-        self
-    }
-
-    #[cfg(feature = "openssl")]
-    /// Use custom `SslConnector` instance.
-    pub fn ssl(mut self, connector: OpensslConnector) -> Self {
-        self.ssl = SslConnector::Openssl(connector);
-        self
-    }
-
-    #[cfg(feature = "rustls")]
-    pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
-        self.ssl = SslConnector::Rustls(connector);
-        self
-    }
-
-    /// Maximum supported http major version
-    /// Supported versions http/1.1, http/2
-    pub fn max_http_version(mut self, val: http::Version) -> Self {
-        let versions = match val {
-            http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
-            http::Version::HTTP_2 => vec![b"h2".to_vec(), b"http/1.1".to_vec()],
-            _ => {
-                unimplemented!("actix-http:client: supported versions http/1.1, http/2")
-            }
-        };
-        self.ssl = Connector::build_ssl(versions);
-        self
-    }
-
-    /// Indicates the initial window size (in octets) for
-    /// HTTP2 stream-level flow control for received data.
-    ///
-    /// The default value is 65,535 and is good for APIs, but not for big objects.
-    pub fn initial_window_size(mut self, size: u32) -> Self {
-        self.config.stream_window_size = size;
-        self
-    }
-
-    /// Indicates the initial window size (in octets) for
-    /// HTTP2 connection-level flow control for received data.
-    ///
-    /// The default value is 65,535 and is good for APIs, but not for big objects.
-    pub fn initial_connection_window_size(mut self, size: u32) -> Self {
-        self.config.conn_window_size = size;
-        self
-    }
-
-    /// Set total number of simultaneous connections per type of scheme.
-    ///
-    /// If limit is 0, the connector has no limit.
-    /// The default limit size is 100.
-    pub fn limit(mut self, limit: usize) -> Self {
-        self.config.limit = limit;
-        self
-    }
-
-    /// Set keep-alive period for opened connection.
-    ///
-    /// Keep-alive period is the period between connection usage. If
-    /// the delay between repeated usages of the same connection
-    /// exceeds this period, the connection is closed.
-    /// Default keep-alive period is 15 seconds.
-    pub fn conn_keep_alive(mut self, dur: Duration) -> Self {
-        self.config.conn_keep_alive = dur;
-        self
-    }
-
-    /// Set max lifetime period for connection.
-    ///
-    /// Connection lifetime is max lifetime of any opened connection
-    /// until it is closed regardless of keep-alive period.
-    /// Default lifetime period is 75 seconds.
-    pub fn conn_lifetime(mut self, dur: Duration) -> Self {
-        self.config.conn_lifetime = dur;
-        self
-    }
-
-    /// Set server connection disconnect timeout in milliseconds.
-    ///
-    /// Defines a timeout for disconnect connection. If a disconnect procedure does not complete
-    /// within this time, the socket get dropped. This timeout affects only secure connections.
-    ///
-    /// To disable timeout set value to 0.
-    ///
-    /// By default disconnect timeout is set to 3000 milliseconds.
-    pub fn disconnect_timeout(mut self, dur: Duration) -> Self {
-        self.config.disconnect_timeout = Some(dur);
-        self
-    }
-
-    /// Finish configuration process and create connector service.
-    /// The Connector builder always concludes by calling `finish()` last in
-    /// its combinator chain.
-    pub fn finish(
-        self,
-    ) -> impl Service<Connect, Response = impl Connection, Error = ConnectError> + Clone
-    {
-        #[cfg(not(any(feature = "openssl", feature = "rustls")))]
-        {
-            let connector = TimeoutService::new(
-                self.config.timeout,
-                apply_fn(self.connector, |msg: Connect, srv| {
-                    srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
-                })
-                .map_err(ConnectError::from)
-                .map(|stream| (stream.into_parts().0, Protocol::Http1)),
-            )
-            .map_err(|e| match e {
-                TimeoutError::Service(e) => e,
-                TimeoutError::Timeout => ConnectError::Timeout,
-            });
-
-            connect_impl::InnerConnector {
-                tcp_pool: ConnectionPool::new(
-                    connector,
-                    self.config.no_disconnect_timeout(),
-                ),
-            }
-        }
-        #[cfg(any(feature = "openssl", feature = "rustls"))]
-        {
-            const H2: &[u8] = b"h2";
-            use actix_service::{boxed::service, pipeline};
-            #[cfg(feature = "openssl")]
-            use actix_tls::connect::ssl::openssl::OpensslConnector;
-            #[cfg(feature = "rustls")]
-            use actix_tls::connect::ssl::rustls::{RustlsConnector, Session};
-
-            let ssl_service = TimeoutService::new(
-                self.config.timeout,
-                pipeline(
-                    apply_fn(self.connector.clone(), |msg: Connect, srv| {
-                        srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
-                    })
-                    .map_err(ConnectError::from),
-                )
-                .and_then(match self.ssl {
-                    #[cfg(feature = "openssl")]
-                    SslConnector::Openssl(ssl) => service(
-                        OpensslConnector::service(ssl)
-                            .map(|stream| {
-                                let sock = stream.into_parts().0;
-                                let h2 = sock
-                                    .ssl()
-                                    .selected_alpn_protocol()
-                                    .map(|protos| protos.windows(2).any(|w| w == H2))
-                                    .unwrap_or(false);
-                                if h2 {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
-                                } else {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
-                                }
-                            })
-                            .map_err(ConnectError::from),
-                    ),
-                    #[cfg(feature = "rustls")]
-                    SslConnector::Rustls(ssl) => service(
-                        RustlsConnector::service(ssl)
-                            .map_err(ConnectError::from)
-                            .map(|stream| {
-                                let sock = stream.into_parts().0;
-                                let h2 = sock
-                                    .get_ref()
-                                    .1
-                                    .get_alpn_protocol()
-                                    .map(|protos| protos.windows(2).any(|w| w == H2))
-                                    .unwrap_or(false);
-                                if h2 {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
-                                } else {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
-                                }
-                            }),
-                    ),
-                }),
-            )
-            .map_err(|e| match e {
-                TimeoutError::Service(e) => e,
-                TimeoutError::Timeout => ConnectError::Timeout,
-            });
-
-            let tcp_service = TimeoutService::new(
-                self.config.timeout,
-                apply_fn(self.connector, |msg: Connect, srv| {
-                    srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
-                })
-                .map_err(ConnectError::from)
-                .map(|stream| (stream.into_parts().0, Protocol::Http1)),
-            )
-            .map_err(|e| match e {
-                TimeoutError::Service(e) => e,
-                TimeoutError::Timeout => ConnectError::Timeout,
-            });
-
-            connect_impl::InnerConnector {
-                tcp_pool: ConnectionPool::new(
-                    tcp_service,
-                    self.config.no_disconnect_timeout(),
-                ),
-                ssl_pool: ConnectionPool::new(ssl_service, self.config),
-            }
-        }
-    }
-}
-
-#[cfg(not(any(feature = "openssl", feature = "rustls")))]
-mod connect_impl {
-    use std::task::{Context, Poll};
-
-    use futures_util::future::{err, Either, Ready};
-
-    use super::*;
-    use crate::client::connection::IoConnection;
-
-    pub(crate) struct InnerConnector<T, Io>
-    where
-        Io: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
-    {
-        pub(crate) tcp_pool: ConnectionPool<T, Io>,
-    }
-
-    impl<T, Io> Clone for InnerConnector<T, Io>
-    where
-        Io: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
-    {
-        fn clone(&self) -> Self {
-            InnerConnector {
-                tcp_pool: self.tcp_pool.clone(),
-            }
-        }
-    }
-
-    impl<T, Io> Service<Connect> for InnerConnector<T, Io>
-    where
-        Io: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
-    {
-        type Response = IoConnection<Io>;
-        type Error = ConnectError;
-        type Future = Either<
-            <ConnectionPool<T, Io> as Service<Connect>>::Future,
-            Ready<Result<IoConnection<Io>, ConnectError>>,
-        >;
-
-        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-            self.tcp_pool.poll_ready(cx)
-        }
-
-        fn call(&mut self, req: Connect) -> Self::Future {
-            match req.uri.scheme_str() {
-                Some("https") | Some("wss") => {
-                    Either::Right(err(ConnectError::SslIsNotSupported))
-                }
-                _ => Either::Left(self.tcp_pool.call(req)),
-            }
-        }
-    }
-}
-
-#[cfg(any(feature = "openssl", feature = "rustls"))]
-mod connect_impl {
-    use std::future::Future;
-    use std::marker::PhantomData;
-    use std::pin::Pin;
-    use std::task::{Context, Poll};
-
-    use futures_core::ready;
-    use futures_util::future::Either;
-
-    use super::*;
-    use crate::client::connection::EitherConnection;
-
-    pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
-    where
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-        T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>,
-        T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>,
-    {
-        pub(crate) tcp_pool: ConnectionPool<T1, Io1>,
-        pub(crate) ssl_pool: ConnectionPool<T2, Io2>,
-    }
-
-    impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
-    where
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-        T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
-        T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
-    {
-        fn clone(&self) -> Self {
-            InnerConnector {
-                tcp_pool: self.tcp_pool.clone(),
-                ssl_pool: self.ssl_pool.clone(),
-            }
-        }
-    }
-
-    impl<T1, T2, Io1, Io2> Service<Connect> for InnerConnector<T1, T2, Io1, Io2>
-    where
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-        T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
-        T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
-    {
-        type Response = EitherConnection<Io1, Io2>;
-        type Error = ConnectError;
-        type Future = Either<
-            InnerConnectorResponseA<T1, Io1, Io2>,
-            InnerConnectorResponseB<T2, Io1, Io2>,
-        >;
-
-        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-            self.tcp_pool.poll_ready(cx)
-        }
-
-        fn call(&mut self, req: Connect) -> Self::Future {
-            match req.uri.scheme_str() {
-                Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
-                    fut: self.ssl_pool.call(req),
-                    _phantom: PhantomData,
-                }),
-                _ => Either::Left(InnerConnectorResponseA {
-                    fut: self.tcp_pool.call(req),
-                    _phantom: PhantomData,
-                }),
-            }
-        }
-    }
-
-    #[pin_project::pin_project]
-    pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
-    where
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
-    {
-        #[pin]
-        fut: <ConnectionPool<T, Io1> as Service<Connect>>::Future,
-        _phantom: PhantomData<Io2>,
-    }
-
-    impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
-    where
-        T: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-    {
-        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
-
-        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-            Poll::Ready(
-                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
-                    .map(EitherConnection::A),
-            )
-        }
-    }
-
-    #[pin_project::pin_project]
-    pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
-    where
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-        T: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
-    {
-        #[pin]
-        fut: <ConnectionPool<T, Io2> as Service<Connect>>::Future,
-        _phantom: PhantomData<Io1>,
-    }
-
-    impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
-    where
-        T: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
-        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
-        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
-    {
-        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
-
-        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-            Poll::Ready(
-                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
-                    .map(EitherConnection::B),
-            )
-        }
-    }
-}

actix-http/src/client/h1proto.rs

@@ -1,291 +0,0 @@
-use std::io::Write;
-use std::pin::Pin;
-use std::task::{Context, Poll};
-use std::{io, time};
-
-use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
-use bytes::buf::BufMut;
-use bytes::{Bytes, BytesMut};
-use futures_core::Stream;
-use futures_util::future::poll_fn;
-use futures_util::{pin_mut, SinkExt, StreamExt};
-
-use crate::error::PayloadError;
-use crate::h1;
-use crate::header::HeaderMap;
-use crate::http::header::{IntoHeaderValue, HOST};
-use crate::message::{RequestHeadType, ResponseHead};
-use crate::payload::{Payload, PayloadStream};
-
-use super::connection::{ConnectionLifetime, ConnectionType, IoConnection};
-use super::error::{ConnectError, SendRequestError};
-use super::pool::Acquired;
-use crate::body::{BodySize, MessageBody};
-
-pub(crate) async fn send_request<T, B>(
-    io: T,
-    mut head: RequestHeadType,
-    body: B,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
-) -> Result<(ResponseHead, Payload), SendRequestError>
-where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
-    B: MessageBody,
-{
-    // set request host header
-    if !head.as_ref().headers.contains_key(HOST)
-        && !head.extra_headers().iter().any(|h| h.contains_key(HOST))
-    {
-        if let Some(host) = head.as_ref().uri.host() {
-            let mut wrt = BytesMut::with_capacity(host.len() + 5).writer();
-
-            let _ = match head.as_ref().uri.port_u16() {
-                None | Some(80) | Some(443) => write!(wrt, "{}", host),
-                Some(port) => write!(wrt, "{}:{}", host, port),
-            };
-
-            match wrt.get_mut().split().freeze().try_into() {
-                Ok(value) => match head {
-                    RequestHeadType::Owned(ref mut head) => {
-                        head.headers.insert(HOST, value)
-                    }
-                    RequestHeadType::Rc(_, ref mut extra_headers) => {
-                        let headers = extra_headers.get_or_insert(HeaderMap::new());
-                        headers.insert(HOST, value)
-                    }
-                },
-                Err(e) => log::error!("Can not set HOST header {}", e),
-            }
-        }
-    }
-
-    let io = H1Connection {
-        created,
-        pool,
-        io: Some(io),
-    };
-
-    // create Framed and send request
-    let mut framed_inner = Framed::new(io, h1::ClientCodec::default());
-    framed_inner.send((head, body.size()).into()).await?;
-
-    // send request body
-    match body.size() {
-        BodySize::None | BodySize::Empty | BodySize::Sized(0) => {}
-        _ => send_body(body, Pin::new(&mut framed_inner)).await?,
-    };
-
-    // read response and init read body
-    let res = Pin::new(&mut framed_inner).into_future().await;
-    let (head, framed) = if let (Some(result), framed) = res {
-        let item = result.map_err(SendRequestError::from)?;
-        (item, framed)
-    } else {
-        return Err(SendRequestError::from(ConnectError::Disconnected));
-    };
-
-    match framed.codec_ref().message_type() {
-        h1::MessageType::None => {
-            let force_close = !framed.codec_ref().keepalive();
-            release_connection(framed, force_close);
-            Ok((head, Payload::None))
-        }
-        _ => {
-            let pl: PayloadStream = PlStream::new(framed_inner).boxed_local();
-            Ok((head, pl.into()))
-        }
-    }
-}
-
-pub(crate) async fn open_tunnel<T>(
-    io: T,
-    head: RequestHeadType,
-) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
-where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    // create Framed and send request
-    let mut framed = Framed::new(io, h1::ClientCodec::default());
-    framed.send((head, BodySize::None).into()).await?;
-
-    // read response
-    if let (Some(result), framed) = framed.into_future().await {
-        let head = result.map_err(SendRequestError::from)?;
-        Ok((head, framed))
-    } else {
-        Err(SendRequestError::from(ConnectError::Disconnected))
-    }
-}
-
-/// send request body to the peer
-pub(crate) async fn send_body<T, B>(
-    body: B,
-    mut framed: Pin<&mut Framed<T, h1::ClientCodec>>,
-) -> Result<(), SendRequestError>
-where
-    T: ConnectionLifetime + Unpin,
-    B: MessageBody,
-{
-    pin_mut!(body);
-
-    let mut eof = false;
-    while !eof {
-        while !eof && !framed.as_ref().is_write_buf_full() {
-            match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
-                Some(result) => {
-                    framed.as_mut().write(h1::Message::Chunk(Some(result?)))?;
-                }
-                None => {
-                    eof = true;
-                    framed.as_mut().write(h1::Message::Chunk(None))?;
-                }
-            }
-        }
-
-        if !framed.as_ref().is_write_buf_empty() {
-            poll_fn(|cx| match framed.as_mut().flush(cx) {
-                Poll::Ready(Ok(_)) => Poll::Ready(Ok(())),
-                Poll::Ready(Err(err)) => Poll::Ready(Err(err)),
-                Poll::Pending => {
-                    if !framed.as_ref().is_write_buf_full() {
-                        Poll::Ready(Ok(()))
-                    } else {
-                        Poll::Pending
-                    }
-                }
-            })
-            .await?;
-        }
-    }
-
-    SinkExt::flush(Pin::into_inner(framed)).await?;
-    Ok(())
-}
-
-#[doc(hidden)]
-/// HTTP client connection
-pub struct H1Connection<T> {
-    /// T should be `Unpin`
-    io: Option<T>,
-    created: time::Instant,
-    pool: Option<Acquired<T>>,
-}
-
-impl<T> ConnectionLifetime for H1Connection<T>
-where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    /// Close connection
-    fn close(mut self: Pin<&mut Self>) {
-        if let Some(mut pool) = self.pool.take() {
-            if let Some(io) = self.io.take() {
-                pool.close(IoConnection::new(
-                    ConnectionType::H1(io),
-                    self.created,
-                    None,
-                ));
-            }
-        }
-    }
-
-    /// Release this connection to the connection pool
-    fn release(mut self: Pin<&mut Self>) {
-        if let Some(mut pool) = self.pool.take() {
-            if let Some(io) = self.io.take() {
-                pool.release(IoConnection::new(
-                    ConnectionType::H1(io),
-                    self.created,
-                    None,
-                ));
-            }
-        }
-    }
-}
-
-impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
-    fn poll_read(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &mut ReadBuf<'_>,
-    ) -> Poll<io::Result<()>> {
-        Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
-    }
-}
-
-impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
-    fn poll_write(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-        buf: &[u8],
-    ) -> Poll<io::Result<usize>> {
-        Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
-    }
-
-    fn poll_flush(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<io::Result<()>> {
-        Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
-    }
-
-    fn poll_shutdown(
-        mut self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Result<(), io::Error>> {
-        Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
-    }
-}
-
-#[pin_project::pin_project]
-pub(crate) struct PlStream<Io> {
-    #[pin]
-    framed: Option<Framed<Io, h1::ClientPayloadCodec>>,
-}
-
-impl<Io: ConnectionLifetime> PlStream<Io> {
-    fn new(framed: Framed<Io, h1::ClientCodec>) -> Self {
-        let framed = framed.into_map_codec(|codec| codec.into_payload_codec());
-
-        PlStream {
-            framed: Some(framed),
-        }
-    }
-}
-
-impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
-    type Item = Result<Bytes, PayloadError>;
-
-    fn poll_next(
-        self: Pin<&mut Self>,
-        cx: &mut Context<'_>,
-    ) -> Poll<Option<Self::Item>> {
-        let mut this = self.project();
-
-        match this.framed.as_mut().as_pin_mut().unwrap().next_item(cx)? {
-            Poll::Pending => Poll::Pending,
-            Poll::Ready(Some(chunk)) => {
-                if let Some(chunk) = chunk {
-                    Poll::Ready(Some(Ok(chunk)))
-                } else {
-                    let framed = this.framed.as_mut().as_pin_mut().unwrap();
-                    let force_close = !framed.codec_ref().keepalive();
-                    release_connection(framed, force_close);
-                    Poll::Ready(None)
-                }
-            }
-            Poll::Ready(None) => Poll::Ready(None),
-        }
-    }
-}
-
-fn release_connection<T, U>(framed: Pin<&mut Framed<T, U>>, force_close: bool)
-where
-    T: ConnectionLifetime,
-{
-    if !force_close && framed.is_read_buf_empty() && framed.is_write_buf_empty() {
-        framed.io_pin().release()
-    } else {
-        framed.io_pin().close()
-    }
-}

actix-http/src/client/pool.rs

@@ -1,645 +0,0 @@
-use std::cell::RefCell;
-use std::collections::VecDeque;
-use std::future::Future;
-use std::pin::Pin;
-use std::rc::Rc;
-use std::task::{Context, Poll};
-use std::time::{Duration, Instant};
-
-use actix_codec::{AsyncRead, AsyncWrite, ReadBuf};
-use actix_rt::time::{sleep, Sleep};
-use actix_service::Service;
-use actix_utils::task::LocalWaker;
-use bytes::Bytes;
-use futures_channel::oneshot;
-use futures_util::future::{poll_fn, FutureExt, LocalBoxFuture};
-use fxhash::FxHashMap;
-use h2::client::{Connection, SendRequest};
-use http::uri::Authority;
-use indexmap::IndexSet;
-use pin_project::pin_project;
-use slab::Slab;
-
-use super::config::ConnectorConfig;
-use super::connection::{ConnectionType, IoConnection};
-use super::error::ConnectError;
-use super::h2proto::handshake;
-use super::Connect;
-
-#[derive(Clone, Copy, PartialEq)]
-/// Protocol version
-pub enum Protocol {
-    Http1,
-    Http2,
-}
-
-#[derive(Hash, Eq, PartialEq, Clone, Debug)]
-pub(crate) struct Key {
-    authority: Authority,
-}
-
-impl From<Authority> for Key {
-    fn from(authority: Authority) -> Key {
-        Key { authority }
-    }
-}
-
-/// Connections pool
-pub(crate) struct ConnectionPool<T, Io: 'static>(Rc<RefCell<T>>, Rc<RefCell<Inner<Io>>>);
-
-impl<T, Io> ConnectionPool<T, Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-    T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
-{
-    pub(crate) fn new(connector: T, config: ConnectorConfig) -> Self {
-        let connector_rc = Rc::new(RefCell::new(connector));
-        let inner_rc = Rc::new(RefCell::new(Inner {
-            config,
-            acquired: 0,
-            waiters: Slab::new(),
-            waiters_queue: IndexSet::new(),
-            available: FxHashMap::default(),
-            waker: LocalWaker::new(),
-        }));
-
-        // start support future
-        actix_rt::spawn(ConnectorPoolSupport {
-            connector: Rc::clone(&connector_rc),
-            inner: Rc::clone(&inner_rc),
-        });
-
-        ConnectionPool(connector_rc, inner_rc)
-    }
-}
-
-impl<T, Io> Clone for ConnectionPool<T, Io>
-where
-    Io: 'static,
-{
-    fn clone(&self) -> Self {
-        ConnectionPool(self.0.clone(), self.1.clone())
-    }
-}
-
-impl<T, Io> Drop for ConnectionPool<T, Io> {
-    fn drop(&mut self) {
-        // wake up the ConnectorPoolSupport when dropping so it can exit properly.
-        self.1.borrow().waker.wake();
-    }
-}
-
-impl<T, Io> Service<Connect> for ConnectionPool<T, Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-    T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
-{
-    type Response = IoConnection<Io>;
-    type Error = ConnectError;
-    type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
-
-    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        self.0.poll_ready(cx)
-    }
-
-    fn call(&mut self, req: Connect) -> Self::Future {
-        let mut connector = self.0.clone();
-        let inner = self.1.clone();
-
-        let fut = async move {
-            let key = if let Some(authority) = req.uri.authority() {
-                authority.clone().into()
-            } else {
-                return Err(ConnectError::Unresolved);
-            };
-
-            // acquire connection
-            match poll_fn(|cx| Poll::Ready(inner.borrow_mut().acquire(&key, cx))).await {
-                Acquire::Acquired(io, created) => {
-                    // use existing connection
-                    Ok(IoConnection::new(
-                        io,
-                        created,
-                        Some(Acquired(key, Some(inner))),
-                    ))
-                }
-                Acquire::Available => {
-                    // open tcp connection
-                    let (io, proto) = connector.call(req).await?;
-
-                    let config = inner.borrow().config.clone();
-
-                    let guard = OpenGuard::new(key, inner);
-
-                    if proto == Protocol::Http1 {
-                        Ok(IoConnection::new(
-                            ConnectionType::H1(io),
-                            Instant::now(),
-                            Some(guard.consume()),
-                        ))
-                    } else {
-                        let (snd, connection) = handshake(io, &config).await?;
-                        actix_rt::spawn(connection.map(|_| ()));
-                        Ok(IoConnection::new(
-                            ConnectionType::H2(snd),
-                            Instant::now(),
-                            Some(guard.consume()),
-                        ))
-                    }
-                }
-                _ => {
-                    // connection is not available, wait
-                    let (rx, token) = inner.borrow_mut().wait_for(req);
-
-                    let guard = WaiterGuard::new(key, token, inner);
-                    let res = match rx.await {
-                        Err(_) => Err(ConnectError::Disconnected),
-                        Ok(res) => res,
-                    };
-                    guard.consume();
-                    res
-                }
-            }
-        };
-
-        fut.boxed_local()
-    }
-}
-
-struct WaiterGuard<Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    key: Key,
-    token: usize,
-    inner: Option<Rc<RefCell<Inner<Io>>>>,
-}
-
-impl<Io> WaiterGuard<Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    fn new(key: Key, token: usize, inner: Rc<RefCell<Inner<Io>>>) -> Self {
-        Self {
-            key,
-            token,
-            inner: Some(inner),
-        }
-    }
-
-    fn consume(mut self) {
-        let _ = self.inner.take();
-    }
-}
-
-impl<Io> Drop for WaiterGuard<Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    fn drop(&mut self) {
-        if let Some(i) = self.inner.take() {
-            let mut inner = i.as_ref().borrow_mut();
-            inner.release_waiter(&self.key, self.token);
-            inner.check_availability();
-        }
-    }
-}
-
-struct OpenGuard<Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    key: Key,
-    inner: Option<Rc<RefCell<Inner<Io>>>>,
-}
-
-impl<Io> OpenGuard<Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>) -> Self {
-        Self {
-            key,
-            inner: Some(inner),
-        }
-    }
-
-    fn consume(mut self) -> Acquired<Io> {
-        Acquired(self.key.clone(), self.inner.take())
-    }
-}
-
-impl<Io> Drop for OpenGuard<Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    fn drop(&mut self) {
-        if let Some(i) = self.inner.take() {
-            let mut inner = i.as_ref().borrow_mut();
-            inner.release();
-            inner.check_availability();
-        }
-    }
-}
-
-enum Acquire<T> {
-    Acquired(ConnectionType<T>, Instant),
-    Available,
-    NotAvailable,
-}
-
-struct AvailableConnection<Io> {
-    io: ConnectionType<Io>,
-    used: Instant,
-    created: Instant,
-}
-
-pub(crate) struct Inner<Io> {
-    config: ConnectorConfig,
-    acquired: usize,
-    available: FxHashMap<Key, VecDeque<AvailableConnection<Io>>>,
-    waiters: Slab<
-        Option<(
-            Connect,
-            oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
-        )>,
-    >,
-    waiters_queue: IndexSet<(Key, usize)>,
-    waker: LocalWaker,
-}
-
-impl<Io> Inner<Io> {
-    fn reserve(&mut self) {
-        self.acquired += 1;
-    }
-
-    fn release(&mut self) {
-        self.acquired -= 1;
-    }
-
-    fn release_waiter(&mut self, key: &Key, token: usize) {
-        self.waiters.remove(token);
-        let _ = self.waiters_queue.shift_remove(&(key.clone(), token));
-    }
-}
-
-impl<Io> Inner<Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    /// connection is not available, wait
-    fn wait_for(
-        &mut self,
-        connect: Connect,
-    ) -> (
-        oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
-        usize,
-    ) {
-        let (tx, rx) = oneshot::channel();
-
-        let key: Key = connect.uri.authority().unwrap().clone().into();
-        let entry = self.waiters.vacant_entry();
-        let token = entry.key();
-        entry.insert(Some((connect, tx)));
-        assert!(self.waiters_queue.insert((key, token)));
-
-        (rx, token)
-    }
-
-    fn acquire(&mut self, key: &Key, cx: &mut Context<'_>) -> Acquire<Io> {
-        // check limits
-        if self.config.limit > 0 && self.acquired >= self.config.limit {
-            return Acquire::NotAvailable;
-        }
-
-        self.reserve();
-
-        // check if open connection is available
-        // cleanup stale connections at the same time
-        if let Some(ref mut connections) = self.available.get_mut(key) {
-            let now = Instant::now();
-            while let Some(conn) = connections.pop_back() {
-                // check if it still usable
-                if (now - conn.used) > self.config.conn_keep_alive
-                    || (now - conn.created) > self.config.conn_lifetime
-                {
-                    if let Some(timeout) = self.config.disconnect_timeout {
-                        if let ConnectionType::H1(io) = conn.io {
-                            actix_rt::spawn(CloseConnection::new(io, timeout))
-                        }
-                    }
-                } else {
-                    let mut io = conn.io;
-                    let mut buf = [0; 2];
-                    let mut read_buf = ReadBuf::new(&mut buf);
-                    if let ConnectionType::H1(ref mut s) = io {
-                        match Pin::new(s).poll_read(cx, &mut read_buf) {
-                            Poll::Pending => {}
-                            Poll::Ready(Ok(())) if !read_buf.filled().is_empty() => {
-                                if let Some(timeout) = self.config.disconnect_timeout {
-                                    if let ConnectionType::H1(io) = io {
-                                        actix_rt::spawn(CloseConnection::new(
-                                            io, timeout,
-                                        ))
-                                    }
-                                }
-                                continue;
-                            }
-                            _ => continue,
-                        }
-                    }
-                    return Acquire::Acquired(io, conn.created);
-                }
-            }
-        }
-        Acquire::Available
-    }
-
-    fn release_conn(&mut self, key: &Key, io: ConnectionType<Io>, created: Instant) {
-        self.acquired -= 1;
-        self.available
-            .entry(key.clone())
-            .or_insert_with(VecDeque::new)
-            .push_back(AvailableConnection {
-                io,
-                created,
-                used: Instant::now(),
-            });
-        self.check_availability();
-    }
-
-    fn release_close(&mut self, io: ConnectionType<Io>) {
-        self.acquired -= 1;
-        if let Some(timeout) = self.config.disconnect_timeout {
-            if let ConnectionType::H1(io) = io {
-                actix_rt::spawn(CloseConnection::new(io, timeout))
-            }
-        }
-        self.check_availability();
-    }
-
-    fn check_availability(&self) {
-        if !self.waiters_queue.is_empty() && self.acquired < self.config.limit {
-            self.waker.wake();
-        }
-    }
-}
-
-#[pin_project::pin_project]
-struct CloseConnection<T> {
-    io: T,
-    #[pin]
-    timeout: Sleep,
-}
-
-impl<T> CloseConnection<T>
-where
-    T: AsyncWrite + Unpin,
-{
-    fn new(io: T, timeout: Duration) -> Self {
-        CloseConnection {
-            io,
-            timeout: sleep(timeout),
-        }
-    }
-}
-
-impl<T> Future for CloseConnection<T>
-where
-    T: AsyncWrite + Unpin,
-{
-    type Output = ();
-
-    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<()> {
-        let this = self.project();
-
-        match this.timeout.poll(cx) {
-            Poll::Ready(_) => Poll::Ready(()),
-            Poll::Pending => match Pin::new(this.io).poll_shutdown(cx) {
-                Poll::Ready(_) => Poll::Ready(()),
-                Poll::Pending => Poll::Pending,
-            },
-        }
-    }
-}
-
-#[pin_project]
-struct ConnectorPoolSupport<T, Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    connector: T,
-    inner: Rc<RefCell<Inner<Io>>>,
-}
-
-impl<T, Io> Future for ConnectorPoolSupport<T, Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-    T: Service<Connect, Response = (Io, Protocol), Error = ConnectError>,
-    T::Future: 'static,
-{
-    type Output = ();
-
-    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let this = self.project();
-
-        if Rc::strong_count(this.inner) == 1 {
-            // If we are last copy of Inner<Io> it means the ConnectionPool is already gone
-            // and we are safe to exit.
-            return Poll::Ready(());
-        }
-
-        let mut inner = this.inner.borrow_mut();
-        inner.waker.register(cx.waker());
-
-        // check waiters
-        loop {
-            let (key, token) = {
-                if let Some((key, token)) = inner.waiters_queue.get_index(0) {
-                    (key.clone(), *token)
-                } else {
-                    break;
-                }
-            };
-            if inner.waiters.get(token).unwrap().is_none() {
-                continue;
-            }
-
-            match inner.acquire(&key, cx) {
-                Acquire::NotAvailable => break,
-                Acquire::Acquired(io, created) => {
-                    let tx = inner.waiters.get_mut(token).unwrap().take().unwrap().1;
-                    if let Err(conn) = tx.send(Ok(IoConnection::new(
-                        io,
-                        created,
-                        Some(Acquired(key.clone(), Some(this.inner.clone()))),
-                    ))) {
-                        let (io, created) = conn.unwrap().into_inner();
-                        inner.release_conn(&key, io, created);
-                    }
-                }
-                Acquire::Available => {
-                    let (connect, tx) =
-                        inner.waiters.get_mut(token).unwrap().take().unwrap();
-                    OpenWaitingConnection::spawn(
-                        key.clone(),
-                        tx,
-                        this.inner.clone(),
-                        this.connector.call(connect),
-                        inner.config.clone(),
-                    );
-                }
-            }
-            let _ = inner.waiters_queue.swap_remove_index(0);
-        }
-
-        Poll::Pending
-    }
-}
-
-#[pin_project::pin_project(PinnedDrop)]
-struct OpenWaitingConnection<F, Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    #[pin]
-    fut: F,
-    key: Key,
-    h2: Option<
-        LocalBoxFuture<
-            'static,
-            Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>,
-        >,
-    >,
-    rx: Option<oneshot::Sender<Result<IoConnection<Io>, ConnectError>>>,
-    inner: Option<Rc<RefCell<Inner<Io>>>>,
-    config: ConnectorConfig,
-}
-
-impl<F, Io> OpenWaitingConnection<F, Io>
-where
-    F: Future<Output = Result<(Io, Protocol), ConnectError>> + 'static,
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    fn spawn(
-        key: Key,
-        rx: oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
-        inner: Rc<RefCell<Inner<Io>>>,
-        fut: F,
-        config: ConnectorConfig,
-    ) {
-        actix_rt::spawn(OpenWaitingConnection {
-            key,
-            fut,
-            h2: None,
-            rx: Some(rx),
-            inner: Some(inner),
-            config,
-        })
-    }
-}
-
-#[pin_project::pinned_drop]
-impl<F, Io> PinnedDrop for OpenWaitingConnection<F, Io>
-where
-    Io: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    fn drop(self: Pin<&mut Self>) {
-        if let Some(inner) = self.project().inner.take() {
-            let mut inner = inner.as_ref().borrow_mut();
-            inner.release();
-            inner.check_availability();
-        }
-    }
-}
-
-impl<F, Io> Future for OpenWaitingConnection<F, Io>
-where
-    F: Future<Output = Result<(Io, Protocol), ConnectError>>,
-    Io: AsyncRead + AsyncWrite + Unpin,
-{
-    type Output = ();
-
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let this = self.as_mut().project();
-
-        if let Some(ref mut h2) = this.h2 {
-            return match Pin::new(h2).poll(cx) {
-                Poll::Ready(Ok((snd, connection))) => {
-                    actix_rt::spawn(connection.map(|_| ()));
-                    let rx = this.rx.take().unwrap();
-                    let _ = rx.send(Ok(IoConnection::new(
-                        ConnectionType::H2(snd),
-                        Instant::now(),
-                        Some(Acquired(this.key.clone(), this.inner.take())),
-                    )));
-                    Poll::Ready(())
-                }
-                Poll::Pending => Poll::Pending,
-                Poll::Ready(Err(err)) => {
-                    let _ = this.inner.take();
-                    if let Some(rx) = this.rx.take() {
-                        let _ = rx.send(Err(ConnectError::H2(err)));
-                    }
-                    Poll::Ready(())
-                }
-            };
-        }
-
-        match this.fut.poll(cx) {
-            Poll::Ready(Err(err)) => {
-                let _ = this.inner.take();
-                if let Some(rx) = this.rx.take() {
-                    let _ = rx.send(Err(err));
-                }
-                Poll::Ready(())
-            }
-            Poll::Ready(Ok((io, proto))) => {
-                if proto == Protocol::Http1 {
-                    let rx = this.rx.take().unwrap();
-                    let _ = rx.send(Ok(IoConnection::new(
-                        ConnectionType::H1(io),
-                        Instant::now(),
-                        Some(Acquired(this.key.clone(), this.inner.take())),
-                    )));
-                    Poll::Ready(())
-                } else {
-                    *this.h2 = Some(handshake(io, this.config).boxed_local());
-                    self.poll(cx)
-                }
-            }
-            Poll::Pending => Poll::Pending,
-        }
-    }
-}
-
-pub(crate) struct Acquired<T>(Key, Option<Rc<RefCell<Inner<T>>>>);
-
-impl<T> Acquired<T>
-where
-    T: AsyncRead + AsyncWrite + Unpin + 'static,
-{
-    pub(crate) fn close(&mut self, conn: IoConnection<T>) {
-        if let Some(inner) = self.1.take() {
-            let (io, _) = conn.into_inner();
-            inner.as_ref().borrow_mut().release_close(io);
-        }
-    }
-    pub(crate) fn release(&mut self, conn: IoConnection<T>) {
-        if let Some(inner) = self.1.take() {
-            let (io, created) = conn.into_inner();
-            inner
-                .as_ref()
-                .borrow_mut()
-                .release_conn(&self.0, io, created);
-        }
-    }
-}
-
-impl<T> Drop for Acquired<T> {
-    fn drop(&mut self) {
-        if let Some(inner) = self.1.take() {
-            inner.as_ref().borrow_mut().release();
-        }
-    }
-}

actix-http/src/config.rs

@@ -1,24 +1,29 @@
-use std::cell::Cell;
-use std::fmt::Write;
-use std::rc::Rc;
-use std::time::Duration;
-use std::{fmt, net};
+use std::{
+    cell::Cell,
+    fmt::{self, Write},
+    net,
+    rc::Rc,
+    time::{Duration, SystemTime},
+};
 
-use actix_rt::time::{sleep, sleep_until, Instant, Sleep};
+use actix_rt::{
+    task::JoinHandle,
+    time::{interval, sleep_until, Instant, Sleep},
+};
 use bytes::BytesMut;
-use futures_util::{future, FutureExt};
-use time::OffsetDateTime;
 
-// "Sun, 06 Nov 1994 08:49:37 GMT".len()
-const DATE_VALUE_LENGTH: usize = 29;
+/// "Sun, 06 Nov 1994 08:49:37 GMT".len()
+pub(crate) const DATE_VALUE_LENGTH: usize = 29;
 
 #[derive(Debug, PartialEq, Clone, Copy)]
 /// Server keep-alive setting
 pub enum KeepAlive {
     /// Keep alive in seconds
     Timeout(usize),
+
     /// Rely on OS to shutdown tcp connection
     Os,
+
     /// Disabled
     Disabled,
 }
@@ -49,7 +54,7 @@ struct Inner {
     ka_enabled: bool,
     secure: bool,
     local_addr: Option<std::net::SocketAddr>,
-    timer: DateService,
+    date_service: DateService,
 }
 
 impl Clone for ServiceConfig {
@@ -91,42 +96,42 @@ impl ServiceConfig {
             client_disconnect,
             secure,
             local_addr,
-            timer: DateService::new(),
+            date_service: DateService::new(),
         }))
     }
 
+    /// Returns true if connection is secure (HTTPS)
     #[inline]
-    /// Returns true if connection is secure(https)
     pub fn secure(&self) -> bool {
         self.0.secure
     }
 
-    #[inline]
     /// Returns the local address that this server is bound to.
+    ///
+    /// Returns `None` for connections via UDS (Unix Domain Socket).
+    #[inline]
     pub fn local_addr(&self) -> Option<net::SocketAddr> {
         self.0.local_addr
     }
 
-    #[inline]
     /// Keep alive duration if configured.
+    #[inline]
     pub fn keep_alive(&self) -> Option<Duration> {
         self.0.keep_alive
     }
 
-    #[inline]
     /// Return state of connection keep-alive functionality
+    #[inline]
     pub fn keep_alive_enabled(&self) -> bool {
         self.0.ka_enabled
     }
 
-    #[inline]
     /// Client timeout for first request.
+    #[inline]
     pub fn client_timer(&self) -> Option<Sleep> {
         let delay_time = self.0.client_timeout;
         if delay_time != 0 {
-            Some(sleep_until(
-                self.0.timer.now() + Duration::from_millis(delay_time),
-            ))
+            Some(sleep_until(self.now() + Duration::from_millis(delay_time)))
         } else {
             None
         }
@@ -136,7 +141,7 @@ impl ServiceConfig {
     pub fn client_timer_expire(&self) -> Option<Instant> {
         let delay = self.0.client_timeout;
         if delay != 0 {
-            Some(self.0.timer.now() + Duration::from_millis(delay))
+            Some(self.now() + Duration::from_millis(delay))
         } else {
             None
         }
@@ -146,34 +151,26 @@ impl ServiceConfig {
     pub fn client_disconnect_timer(&self) -> Option<Instant> {
         let delay = self.0.client_disconnect;
         if delay != 0 {
-            Some(self.0.timer.now() + Duration::from_millis(delay))
+            Some(self.now() + Duration::from_millis(delay))
         } else {
             None
         }
     }
 
-    #[inline]
     /// Return keep-alive timer delay is configured.
+    #[inline]
     pub fn keep_alive_timer(&self) -> Option<Sleep> {
-        if let Some(ka) = self.0.keep_alive {
-            Some(sleep_until(self.0.timer.now() + ka))
-        } else {
-            None
-        }
+        self.keep_alive().map(|ka| sleep_until(self.now() + ka))
     }
 
     /// Keep-alive expire time
     pub fn keep_alive_expire(&self) -> Option<Instant> {
-        if let Some(ka) = self.0.keep_alive {
-            Some(self.0.timer.now() + ka)
-        } else {
-            None
-        }
+        self.keep_alive().map(|ka| self.now() + ka)
     }
 
     #[inline]
     pub(crate) fn now(&self) -> Instant {
-        self.0.timer.now()
+        self.0.date_service.now()
     }
 
     #[doc(hidden)]
@@ -181,7 +178,7 @@ impl ServiceConfig {
         let mut buf: [u8; 39] = [0; 39];
         buf[..6].copy_from_slice(b"date: ");
         self.0
-            .timer
+            .date_service
             .set_date(|date| buf[6..35].copy_from_slice(&date.bytes));
         buf[35..].copy_from_slice(b"\r\n\r\n");
         dst.extend_from_slice(&buf);
@@ -189,7 +186,7 @@ impl ServiceConfig {
 
     pub(crate) fn set_date_header(&self, dst: &mut BytesMut) {
         self.0
-            .timer
+            .date_service
             .set_date(|date| dst.extend_from_slice(&date.bytes));
     }
 }
@@ -212,12 +209,7 @@ impl Date {
 
     fn update(&mut self) {
         self.pos = 0;
-        write!(
-            self,
-            "{}",
-            OffsetDateTime::now_utc().format("%a, %d %b %Y %H:%M:%S GMT")
-        )
-        .unwrap();
+        write!(self, "{}", httpdate::fmt_http_date(SystemTime::now())).unwrap();
     }
 }
 
@@ -230,57 +222,102 @@ impl fmt::Write for Date {
     }
 }
 
-#[derive(Clone)]
-struct DateService(Rc<DateServiceInner>);
-
-struct DateServiceInner {
-    current: Cell<Option<(Date, Instant)>>,
+/// Service for update Date and Instant periodically at 500 millis interval.
+struct DateService {
+    current: Rc<Cell<(Date, Instant)>>,
+    handle: JoinHandle<()>,
 }
 
-impl DateServiceInner {
-    fn new() -> Self {
-        DateServiceInner {
-            current: Cell::new(None),
-        }
-    }
-
-    fn reset(&self) {
-        self.current.take();
-    }
-
-    fn update(&self) {
-        let now = Instant::now();
-        let date = Date::new();
-        self.current.set(Some((date, now)));
+impl Drop for DateService {
+    fn drop(&mut self) {
+        // stop the timer update async task on drop.
+        self.handle.abort();
     }
 }
 
 impl DateService {
     fn new() -> Self {
-        DateService(Rc::new(DateServiceInner::new()))
-    }
+        // shared date and timer for DateService and update async task.
+        let current = Rc::new(Cell::new((Date::new(), Instant::now())));
+        let current_clone = Rc::clone(&current);
+        // spawn an async task sleep for 500 milli and update current date/timer in a loop.
+        // handle is used to stop the task on DateService drop.
+        let handle = actix_rt::spawn(async move {
+            #[cfg(test)]
+            let _notify = notify_on_drop::NotifyOnDrop::new();
 
-    fn check_date(&self) {
-        if self.0.current.get().is_none() {
-            self.0.update();
+            let mut interval = interval(Duration::from_millis(500));
+            loop {
+                let now = interval.tick().await;
+                let date = Date::new();
+                current_clone.set((date, now));
+            }
+        });
 
-            // periodic date update
-            let s = self.clone();
-            actix_rt::spawn(sleep(Duration::from_millis(500)).then(move |_| {
-                s.0.reset();
-                future::ready(())
-            }));
-        }
+        DateService { current, handle }
     }
 
     fn now(&self) -> Instant {
-        self.check_date();
-        self.0.current.get().unwrap().1
+        self.current.get().1
     }
 
     fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
-        self.check_date();
-        f(&self.0.current.get().unwrap().0);
+        f(&self.current.get().0);
+    }
+}
+
+// TODO: move to a util module for testing all spawn handle drop style tasks.
+/// Test Module for checking the drop state of certain async tasks that are spawned
+/// with `actix_rt::spawn`
+///
+/// The target task must explicitly generate `NotifyOnDrop` when spawn the task
+#[cfg(test)]
+mod notify_on_drop {
+    use std::cell::RefCell;
+
+    thread_local! {
+        static NOTIFY_DROPPED: RefCell<Option<bool>> = RefCell::new(None);
+    }
+
+    /// Check if the spawned task is dropped.
+    ///
+    /// # Panics
+    /// Panics when there was no `NotifyOnDrop` instance on current thread.
+    pub(crate) fn is_dropped() -> bool {
+        NOTIFY_DROPPED.with(|bool| {
+            bool.borrow()
+                .expect("No NotifyOnDrop existed on current thread")
+        })
+    }
+
+    pub(crate) struct NotifyOnDrop;
+
+    impl NotifyOnDrop {
+        /// # Panic:
+        ///
+        /// When construct multiple instances on any given thread.
+        pub(crate) fn new() -> Self {
+            NOTIFY_DROPPED.with(|bool| {
+                let mut bool = bool.borrow_mut();
+                if bool.is_some() {
+                    panic!("NotifyOnDrop existed on current thread");
+                } else {
+                    *bool = Some(false);
+                }
+            });
+
+            NotifyOnDrop
+        }
+    }
+
+    impl Drop for NotifyOnDrop {
+        fn drop(&mut self) {
+            NOTIFY_DROPPED.with(|bool| {
+                if let Some(b) = bool.borrow_mut().as_mut() {
+                    *b = true;
+                }
+            });
+        }
     }
 }
 
@@ -288,14 +325,67 @@ impl DateService {
 mod tests {
     use super::*;
 
-    // Test modifying the date from within the closure
-    // passed to `set_date`
-    #[test]
-    fn test_evil_date() {
-        let service = DateService::new();
-        // Make sure that `check_date` doesn't try to spawn a task
-        service.0.update();
-        service.set_date(|_| service.0.reset());
+    use actix_rt::{task::yield_now, time::sleep};
+
+    #[actix_rt::test]
+    async fn test_date_service_update() {
+        let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
+
+        yield_now().await;
+
+        let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
+        settings.set_date(&mut buf1);
+        let now1 = settings.now();
+
+        sleep_until(Instant::now() + Duration::from_secs(2)).await;
+        yield_now().await;
+
+        let now2 = settings.now();
+        let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
+        settings.set_date(&mut buf2);
+
+        assert_ne!(now1, now2);
+
+        assert_ne!(buf1, buf2);
+
+        drop(settings);
+
+        // Ensure the task will drop eventually
+        let mut times = 0;
+        while !notify_on_drop::is_dropped() {
+            sleep(Duration::from_millis(100)).await;
+            times += 1;
+            assert!(times < 10, "Timeout waiting for task drop");
+        }
+    }
+
+    #[actix_rt::test]
+    async fn test_date_service_drop() {
+        let service = Rc::new(DateService::new());
+
+        // yield so date service have a chance to register the spawned timer update task.
+        yield_now().await;
+
+        let clone1 = service.clone();
+        let clone2 = service.clone();
+        let clone3 = service.clone();
+
+        drop(clone1);
+        assert!(!notify_on_drop::is_dropped());
+        drop(clone2);
+        assert!(!notify_on_drop::is_dropped());
+        drop(clone3);
+        assert!(!notify_on_drop::is_dropped());
+
+        drop(service);
+
+        // Ensure the task will drop eventually
+        let mut times = 0;
+        while !notify_on_drop::is_dropped() {
+            sleep(Duration::from_millis(100)).await;
+            times += 1;
+            assert!(times < 10, "Timeout waiting for task drop");
+        }
     }
 
     #[test]

actix-http/src/encoding/decoder.rs

@@ -1,25 +1,38 @@
-use std::future::Future;
-use std::io::{self, Write};
-use std::pin::Pin;
-use std::task::{Context, Poll};
+//! Stream decoders.
 
-use actix_threadpool::{run, CpuFuture};
-use brotli2::write::BrotliDecoder;
+use std::{
+    future::Future,
+    io::{self, Write as _},
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use actix_rt::task::{spawn_blocking, JoinHandle};
 use bytes::Bytes;
-use flate2::write::{GzDecoder, ZlibDecoder};
 use futures_core::{ready, Stream};
 
-use super::Writer;
-use crate::error::PayloadError;
-use crate::http::header::{ContentEncoding, HeaderMap, CONTENT_ENCODING};
+#[cfg(feature = "compress-brotli")]
+use brotli2::write::BrotliDecoder;
 
-const INPLACE: usize = 2049;
+#[cfg(feature = "compress-gzip")]
+use flate2::write::{GzDecoder, ZlibDecoder};
+
+#[cfg(feature = "compress-zstd")]
+use zstd::stream::write::Decoder as ZstdDecoder;
+
+use crate::{
+    encoding::Writer,
+    error::{BlockingError, PayloadError},
+    http::header::{ContentEncoding, HeaderMap, CONTENT_ENCODING},
+};
+
+const MAX_CHUNK_SIZE_DECODE_IN_PLACE: usize = 2049;
 
 pub struct Decoder<S> {
     decoder: Option<ContentDecoder>,
     stream: S,
     eof: bool,
-    fut: Option<CpuFuture<(Option<Bytes>, ContentDecoder), io::Error>>,
+    fut: Option<JoinHandle<Result<(Option<Bytes>, ContentDecoder), io::Error>>>,
 }
 
 impl<S> Decoder<S>
@@ -30,17 +43,28 @@ where
     #[inline]
     pub fn new(stream: S, encoding: ContentEncoding) -> Decoder<S> {
         let decoder = match encoding {
+            #[cfg(feature = "compress-brotli")]
             ContentEncoding::Br => Some(ContentDecoder::Br(Box::new(
                 BrotliDecoder::new(Writer::new()),
             ))),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoding::Deflate => Some(ContentDecoder::Deflate(Box::new(
                 ZlibDecoder::new(Writer::new()),
             ))),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoding::Gzip => Some(ContentDecoder::Gzip(Box::new(
                 GzDecoder::new(Writer::new()),
             ))),
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoding::Zstd => Some(ContentDecoder::Zstd(Box::new(
+                ZstdDecoder::new(Writer::new()).expect(
+                    "Failed to create zstd decoder. This is a bug. \
+                         Please report it to the actix-web repository.",
+                ),
+            ))),
             _ => None,
         };
+
         Decoder {
             decoder,
             stream,
@@ -53,15 +77,11 @@ where
     #[inline]
     pub fn from_headers(stream: S, headers: &HeaderMap) -> Decoder<S> {
         // check content-encoding
-        let encoding = if let Some(enc) = headers.get(&CONTENT_ENCODING) {
-            if let Ok(enc) = enc.to_str() {
-                ContentEncoding::from(enc)
-            } else {
-                ContentEncoding::Identity
-            }
-        } else {
-            ContentEncoding::Identity
-        };
+        let encoding = headers
+            .get(&CONTENT_ENCODING)
+            .and_then(|val| val.to_str().ok())
+            .and_then(|x| x.parse().ok())
+            .unwrap_or(ContentEncoding::Identity);
 
         Self::new(stream, encoding)
     }
@@ -79,12 +99,12 @@ where
     ) -> Poll<Option<Self::Item>> {
         loop {
             if let Some(ref mut fut) = self.fut {
-                let (chunk, decoder) = match ready!(Pin::new(fut).poll(cx)) {
-                    Ok(item) => item,
-                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
-                };
+                let (chunk, decoder) =
+                    ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
+
                 self.decoder = Some(decoder);
                 self.fut.take();
+
                 if let Some(chunk) = chunk {
                     return Poll::Ready(Some(Ok(chunk)));
                 }
@@ -94,29 +114,34 @@ where
                 return Poll::Ready(None);
             }
 
-            match Pin::new(&mut self.stream).poll_next(cx) {
-                Poll::Ready(Some(Err(err))) => return Poll::Ready(Some(Err(err))),
-                Poll::Ready(Some(Ok(chunk))) => {
+            match ready!(Pin::new(&mut self.stream).poll_next(cx)) {
+                Some(Err(err)) => return Poll::Ready(Some(Err(err))),
+
+                Some(Ok(chunk)) => {
                     if let Some(mut decoder) = self.decoder.take() {
-                        if chunk.len() < INPLACE {
+                        if chunk.len() < MAX_CHUNK_SIZE_DECODE_IN_PLACE {
                             let chunk = decoder.feed_data(chunk)?;
                             self.decoder = Some(decoder);
+
                             if let Some(chunk) = chunk {
                                 return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
-                            self.fut = Some(run(move || {
+                            self.fut = Some(spawn_blocking(move || {
                                 let chunk = decoder.feed_data(chunk)?;
                                 Ok((chunk, decoder))
                             }));
                         }
+
                         continue;
                     } else {
                         return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Poll::Ready(None) => {
+
+                None => {
                     self.eof = true;
+
                     return if let Some(mut decoder) = self.decoder.take() {
                         match decoder.feed_eof() {
                             Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
@@ -127,25 +152,32 @@ where
                         Poll::Ready(None)
                     };
                 }
-                Poll::Pending => break,
             }
         }
-        Poll::Pending
     }
 }
 
 enum ContentDecoder {
+    #[cfg(feature = "compress-gzip")]
     Deflate(Box<ZlibDecoder<Writer>>),
+    #[cfg(feature = "compress-gzip")]
     Gzip(Box<GzDecoder<Writer>>),
+    #[cfg(feature = "compress-brotli")]
     Br(Box<BrotliDecoder<Writer>>),
+    // We need explicit 'static lifetime here because ZstdDecoder need lifetime
+    // argument, and we use `spawn_blocking` in `Decoder::poll_next` that require `FnOnce() -> R + Send + 'static`
+    #[cfg(feature = "compress-zstd")]
+    Zstd(Box<ZstdDecoder<'static, Writer>>),
 }
 
 impl ContentDecoder {
     fn feed_eof(&mut self) -> io::Result<Option<Bytes>> {
         match self {
+            #[cfg(feature = "compress-brotli")]
             ContentDecoder::Br(ref mut decoder) => match decoder.flush() {
                 Ok(()) => {
                     let b = decoder.get_mut().take();
+
                     if !b.is_empty() {
                         Ok(Some(b))
                     } else {
@@ -154,7 +186,23 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
+
+            #[cfg(feature = "compress-gzip")]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.try_finish() {
+                Ok(_) => {
+                    let b = decoder.get_mut().take();
+
+                    if !b.is_empty() {
+                        Ok(Some(b))
+                    } else {
+                        Ok(None)
+                    }
+                }
+                Err(e) => Err(e),
+            },
+
+            #[cfg(feature = "compress-gzip")]
+            ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
                     if !b.is_empty() {
@@ -165,7 +213,9 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
+
+            #[cfg(feature = "compress-zstd")]
+            ContentDecoder::Zstd(ref mut decoder) => match decoder.flush() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
                     if !b.is_empty() {
@@ -181,10 +231,12 @@ impl ContentDecoder {
 
     fn feed_data(&mut self, data: Bytes) -> io::Result<Option<Bytes>> {
         match self {
+            #[cfg(feature = "compress-brotli")]
             ContentDecoder::Br(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
                     let b = decoder.get_mut().take();
+
                     if !b.is_empty() {
                         Ok(Some(b))
                     } else {
@@ -193,9 +245,27 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
+
+            #[cfg(feature = "compress-gzip")]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
+                    let b = decoder.get_mut().take();
+
+                    if !b.is_empty() {
+                        Ok(Some(b))
+                    } else {
+                        Ok(None)
+                    }
+                }
+                Err(e) => Err(e),
+            },
+
+            #[cfg(feature = "compress-gzip")]
+            ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
+                Ok(_) => {
+                    decoder.flush()?;
+
                     let b = decoder.get_mut().take();
                     if !b.is_empty() {
                         Ok(Some(b))
@@ -205,9 +275,12 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
+
+            #[cfg(feature = "compress-zstd")]
+            ContentDecoder::Zstd(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
+
                     let b = decoder.get_mut().take();
                     if !b.is_empty() {
                         Ok(Some(b))

actix-http/src/encoding/encoder.rs

@@ -1,24 +1,41 @@
-//! Stream encoder
-use std::future::Future;
-use std::io::{self, Write};
-use std::pin::Pin;
-use std::task::{Context, Poll};
+//! Stream encoders.
 
-use actix_threadpool::{run, CpuFuture};
-use brotli2::write::BrotliEncoder;
+use std::{
+    error::Error as StdError,
+    future::Future,
+    io::{self, Write as _},
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use actix_rt::task::{spawn_blocking, JoinHandle};
 use bytes::Bytes;
-use flate2::write::{GzEncoder, ZlibEncoder};
+use derive_more::Display;
 use futures_core::ready;
 use pin_project::pin_project;
 
-use crate::body::{Body, BodySize, MessageBody, ResponseBody};
-use crate::http::header::{ContentEncoding, CONTENT_ENCODING};
-use crate::http::{HeaderValue, StatusCode};
-use crate::{Error, ResponseHead};
+#[cfg(feature = "compress-brotli")]
+use brotli2::write::BrotliEncoder;
+
+#[cfg(feature = "compress-gzip")]
+use flate2::write::{GzEncoder, ZlibEncoder};
+
+#[cfg(feature = "compress-zstd")]
+use zstd::stream::write::Encoder as ZstdEncoder;
+
+use crate::{
+    body::{AnyBody, BodySize, MessageBody},
+    http::{
+        header::{ContentEncoding, CONTENT_ENCODING},
+        HeaderValue, StatusCode,
+    },
+    ResponseHead,
+};
 
 use super::Writer;
+use crate::error::BlockingError;
 
-const INPLACE: usize = 1024;
+const MAX_CHUNK_SIZE_ENCODE_IN_PLACE: usize = 1024;
 
 #[pin_project]
 pub struct Encoder<B> {
@@ -26,15 +43,15 @@ pub struct Encoder<B> {
     #[pin]
     body: EncoderBody<B>,
     encoder: Option<ContentEncoder>,
-    fut: Option<CpuFuture<ContentEncoder, io::Error>>,
+    fut: Option<JoinHandle<Result<ContentEncoder, io::Error>>>,
 }
 
 impl<B: MessageBody> Encoder<B> {
     pub fn response(
         encoding: ContentEncoding,
         head: &mut ResponseHead,
-        body: ResponseBody<B>,
-    ) -> ResponseBody<Encoder<B>> {
+        body: AnyBody<B>,
+    ) -> AnyBody<Encoder<B>> {
         let can_encode = !(head.headers().contains_key(&CONTENT_ENCODING)
             || head.status == StatusCode::SWITCHING_PROTOCOLS
             || head.status == StatusCode::NO_CONTENT
@@ -42,19 +59,15 @@ impl<B: MessageBody> Encoder<B> {
             || encoding == ContentEncoding::Auto);
 
         let body = match body {
-            ResponseBody::Other(b) => match b {
-                Body::None => return ResponseBody::Other(Body::None),
-                Body::Empty => return ResponseBody::Other(Body::Empty),
-                Body::Bytes(buf) => {
-                    if can_encode {
-                        EncoderBody::Bytes(buf)
-                    } else {
-                        return ResponseBody::Other(Body::Bytes(buf));
-                    }
+            AnyBody::None => return AnyBody::None,
+            AnyBody::Bytes(buf) => {
+                if can_encode {
+                    EncoderBody::Bytes(buf)
+                } else {
+                    return AnyBody::Bytes(buf);
                 }
-                Body::Message(stream) => EncoderBody::BoxedStream(stream),
-            },
-            ResponseBody::Body(stream) => EncoderBody::Stream(stream),
+            }
+            AnyBody::Body(body) => EncoderBody::Stream(body),
         };
 
         if can_encode {
@@ -62,7 +75,8 @@ impl<B: MessageBody> Encoder<B> {
             if let Some(enc) = ContentEncoder::encoder(encoding) {
                 update_head(encoding, head);
                 head.no_chunking(false);
-                return ResponseBody::Body(Encoder {
+
+                return AnyBody::Body(Encoder {
                     body,
                     eof: false,
                     fut: None,
@@ -70,7 +84,8 @@ impl<B: MessageBody> Encoder<B> {
                 });
             }
         }
-        ResponseBody::Body(Encoder {
+
+        AnyBody::Body(Encoder {
             body,
             eof: false,
             fut: None,
@@ -83,22 +98,25 @@ impl<B: MessageBody> Encoder<B> {
 enum EncoderBody<B> {
     Bytes(Bytes),
     Stream(#[pin] B),
-    BoxedStream(Box<dyn MessageBody + Unpin>),
 }
 
-impl<B: MessageBody> MessageBody for EncoderBody<B> {
+impl<B> MessageBody for EncoderBody<B>
+where
+    B: MessageBody,
+{
+    type Error = EncoderError<B::Error>;
+
     fn size(&self) -> BodySize {
         match self {
             EncoderBody::Bytes(ref b) => b.size(),
             EncoderBody::Stream(ref b) => b.size(),
-            EncoderBody::BoxedStream(ref b) => b.size(),
         }
     }
 
     fn poll_next(
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
         match self.project() {
             EncoderBodyProj::Bytes(b) => {
                 if b.is_empty() {
@@ -107,15 +125,17 @@ impl<B: MessageBody> MessageBody for EncoderBody<B> {
                     Poll::Ready(Some(Ok(std::mem::take(b))))
                 }
             }
-            EncoderBodyProj::Stream(b) => b.poll_next(cx),
-            EncoderBodyProj::BoxedStream(ref mut b) => {
-                Pin::new(b.as_mut()).poll_next(cx)
-            }
+            EncoderBodyProj::Stream(b) => b.poll_next(cx).map_err(EncoderError::Body),
         }
     }
 }
 
-impl<B: MessageBody> MessageBody for Encoder<B> {
+impl<B> MessageBody for Encoder<B>
+where
+    B: MessageBody,
+{
+    type Error = EncoderError<B::Error>;
+
     fn size(&self) -> BodySize {
         if self.encoder.is_none() {
             self.body.size()
@@ -127,7 +147,7 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
     fn poll_next(
         self: Pin<&mut Self>,
         cx: &mut Context<'_>,
-    ) -> Poll<Option<Result<Bytes, Error>>> {
+    ) -> Poll<Option<Result<Bytes, Self::Error>>> {
         let mut this = self.project();
         loop {
             if *this.eof {
@@ -135,32 +155,36 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
             }
 
             if let Some(ref mut fut) = this.fut {
-                let mut encoder = match ready!(Pin::new(fut).poll(cx)) {
-                    Ok(item) => item,
-                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
-                };
+                let mut encoder = ready!(Pin::new(fut).poll(cx))
+                    .map_err(|_| EncoderError::Blocking(BlockingError))?
+                    .map_err(EncoderError::Io)?;
+
                 let chunk = encoder.take();
                 *this.encoder = Some(encoder);
                 this.fut.take();
+
                 if !chunk.is_empty() {
                     return Poll::Ready(Some(Ok(chunk)));
                 }
             }
 
-            let result = this.body.as_mut().poll_next(cx);
+            let result = ready!(this.body.as_mut().poll_next(cx));
 
             match result {
-                Poll::Ready(Some(Ok(chunk))) => {
+                Some(Err(err)) => return Poll::Ready(Some(Err(err))),
+
+                Some(Ok(chunk)) => {
                     if let Some(mut encoder) = this.encoder.take() {
-                        if chunk.len() < INPLACE {
-                            encoder.write(&chunk)?;
+                        if chunk.len() < MAX_CHUNK_SIZE_ENCODE_IN_PLACE {
+                            encoder.write(&chunk).map_err(EncoderError::Io)?;
                             let chunk = encoder.take();
                             *this.encoder = Some(encoder);
+
                             if !chunk.is_empty() {
                                 return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
-                            *this.fut = Some(run(move || {
+                            *this.fut = Some(spawn_blocking(move || {
                                 encoder.write(&chunk)?;
                                 Ok(encoder)
                             }));
@@ -169,9 +193,10 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
                         return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Poll::Ready(None) => {
+
+                None => {
                     if let Some(encoder) = this.encoder.take() {
-                        let chunk = encoder.finish()?;
+                        let chunk = encoder.finish().map_err(EncoderError::Io)?;
                         if chunk.is_empty() {
                             return Poll::Ready(None);
                         } else {
@@ -182,7 +207,6 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
                         return Poll::Ready(None);
                     }
                 }
-                val => return val,
             }
         }
     }
@@ -196,25 +220,40 @@ fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) {
 }
 
 enum ContentEncoder {
+    #[cfg(feature = "compress-gzip")]
     Deflate(ZlibEncoder<Writer>),
+    #[cfg(feature = "compress-gzip")]
     Gzip(GzEncoder<Writer>),
+    #[cfg(feature = "compress-brotli")]
     Br(BrotliEncoder<Writer>),
+    // We need explicit 'static lifetime here because ZstdEncoder need lifetime
+    // argument, and we use `spawn_blocking` in `Encoder::poll_next` that require `FnOnce() -> R + Send + 'static`
+    #[cfg(feature = "compress-zstd")]
+    Zstd(ZstdEncoder<'static, Writer>),
 }
 
 impl ContentEncoder {
     fn encoder(encoding: ContentEncoding) -> Option<Self> {
         match encoding {
+            #[cfg(feature = "compress-gzip")]
             ContentEncoding::Deflate => Some(ContentEncoder::Deflate(ZlibEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoding::Gzip => Some(ContentEncoder::Gzip(GzEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
+            #[cfg(feature = "compress-brotli")]
             ContentEncoding::Br => {
                 Some(ContentEncoder::Br(BrotliEncoder::new(Writer::new(), 3)))
             }
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoding::Zstd => {
+                let encoder = ZstdEncoder::new(Writer::new(), 3).ok()?;
+                Some(ContentEncoder::Zstd(encoder))
+            }
             _ => None,
         }
     }
@@ -222,31 +261,45 @@ impl ContentEncoder {
     #[inline]
     pub(crate) fn take(&mut self) -> Bytes {
         match *self {
+            #[cfg(feature = "compress-brotli")]
             ContentEncoder::Br(ref mut encoder) => encoder.get_mut().take(),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Deflate(ref mut encoder) => encoder.get_mut().take(),
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Gzip(ref mut encoder) => encoder.get_mut().take(),
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoder::Zstd(ref mut encoder) => encoder.get_mut().take(),
         }
     }
 
     fn finish(self) -> Result<Bytes, io::Error> {
         match self {
+            #[cfg(feature = "compress-brotli")]
             ContentEncoder::Br(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Gzip(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Deflate(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoder::Zstd(encoder) => match encoder.finish() {
+                Ok(writer) => Ok(writer.buf.freeze()),
+                Err(err) => Err(err),
+            },
         }
     }
 
     fn write(&mut self, data: &[u8]) -> Result<(), io::Error> {
         match *self {
+            #[cfg(feature = "compress-brotli")]
             ContentEncoder::Br(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -254,6 +307,7 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Gzip(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -261,6 +315,7 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
+            #[cfg(feature = "compress-gzip")]
             ContentEncoder::Deflate(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -268,6 +323,43 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
+            #[cfg(feature = "compress-zstd")]
+            ContentEncoder::Zstd(ref mut encoder) => match encoder.write_all(data) {
+                Ok(_) => Ok(()),
+                Err(err) => {
+                    trace!("Error decoding ztsd encoding: {}", err);
+                    Err(err)
+                }
+            },
         }
     }
 }
+
+#[derive(Debug, Display)]
+#[non_exhaustive]
+pub enum EncoderError<E> {
+    #[display(fmt = "body")]
+    Body(E),
+
+    #[display(fmt = "blocking")]
+    Blocking(BlockingError),
+
+    #[display(fmt = "io")]
+    Io(io::Error),
+}
+
+impl<E: StdError + 'static> StdError for EncoderError<E> {
+    fn source(&self) -> Option<&(dyn StdError + 'static)> {
+        match self {
+            EncoderError::Body(err) => Some(err),
+            EncoderError::Blocking(err) => Some(err),
+            EncoderError::Io(err) => Some(err),
+        }
+    }
+}
+
+impl<E: StdError + 'static> From<EncoderError<E>> for crate::Error {
+    fn from(err: EncoderError<E>) -> Self {
+        crate::Error::new_encoder().with_cause(err)
+    }
+}

actix-http/src/encoding/mod.rs

@@ -1,4 +1,5 @@
-//! Content-Encoding support
+//! Content-Encoding support.
+
 use std::io;
 
 use bytes::{Bytes, BytesMut};

actix-http/src/extensions.rs

@@ -1,62 +1,119 @@
-use std::any::{Any, TypeId};
-use std::{fmt, mem};
+use std::{
+    any::{Any, TypeId},
+    fmt, mem,
+};
 
-use fxhash::FxHashMap;
+use ahash::AHashMap;
 
-/// A type map of request extensions.
+/// A type map for request extensions.
+///
+/// All entries into this map must be owned types (or static references).
 #[derive(Default)]
 pub struct Extensions {
     /// Use FxHasher with a std HashMap with for faster
     /// lookups on the small `TypeId` (u64 equivalent) keys.
-    map: FxHashMap<TypeId, Box<dyn Any>>,
+    map: AHashMap<TypeId, Box<dyn Any>>,
 }
 
 impl Extensions {
-    /// Create an empty `Extensions`.
+    /// Creates an empty `Extensions`.
     #[inline]
     pub fn new() -> Extensions {
         Extensions {
-            map: FxHashMap::default(),
+            map: AHashMap::default(),
         }
     }
 
-    /// Insert a type into this `Extensions`.
+    /// Insert an item into the map.
     ///
-    /// If a extension of this type already existed, it will
-    /// be returned.
-    pub fn insert<T: 'static>(&mut self, val: T) {
-        self.map.insert(TypeId::of::<T>(), Box::new(val));
+    /// If an item of this type was already stored, it will be replaced and returned.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    /// assert_eq!(map.insert(""), None);
+    /// assert_eq!(map.insert(1u32), None);
+    /// assert_eq!(map.insert(2u32), Some(1u32));
+    /// assert_eq!(*map.get::<u32>().unwrap(), 2u32);
+    /// ```
+    pub fn insert<T: 'static>(&mut self, val: T) -> Option<T> {
+        self.map
+            .insert(TypeId::of::<T>(), Box::new(val))
+            .and_then(downcast_owned)
     }
 
-    /// Check if container contains entry
+    /// Check if map contains an item of a given type.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    /// assert!(!map.contains::<u32>());
+    ///
+    /// assert_eq!(map.insert(1u32), None);
+    /// assert!(map.contains::<u32>());
+    /// ```
     pub fn contains<T: 'static>(&self) -> bool {
         self.map.contains_key(&TypeId::of::<T>())
     }
 
-    /// Get a reference to a type previously inserted on this `Extensions`.
+    /// Get a reference to an item of a given type.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    /// map.insert(1u32);
+    /// assert_eq!(map.get::<u32>(), Some(&1u32));
+    /// ```
     pub fn get<T: 'static>(&self) -> Option<&T> {
         self.map
             .get(&TypeId::of::<T>())
             .and_then(|boxed| boxed.downcast_ref())
     }
 
-    /// Get a mutable reference to a type previously inserted on this `Extensions`.
+    /// Get a mutable reference to an item of a given type.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    /// map.insert(1u32);
+    /// assert_eq!(map.get_mut::<u32>(), Some(&mut 1u32));
+    /// ```
     pub fn get_mut<T: 'static>(&mut self) -> Option<&mut T> {
         self.map
             .get_mut(&TypeId::of::<T>())
             .and_then(|boxed| boxed.downcast_mut())
     }
 
-    /// Remove a type from this `Extensions`.
+    /// Remove an item from the map of a given type.
     ///
-    /// If a extension of this type existed, it will be returned.
+    /// If an item of this type was already stored, it will be returned.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    ///
+    /// map.insert(1u32);
+    /// assert_eq!(map.get::<u32>(), Some(&1u32));
+    ///
+    /// assert_eq!(map.remove::<u32>(), Some(1u32));
+    /// assert!(!map.contains::<u32>());
+    /// ```
     pub fn remove<T: 'static>(&mut self) -> Option<T> {
-        self.map
-            .remove(&TypeId::of::<T>())
-            .and_then(|boxed| boxed.downcast().ok().map(|boxed| *boxed))
+        self.map.remove(&TypeId::of::<T>()).and_then(downcast_owned)
     }
 
     /// Clear the `Extensions` of all inserted extensions.
+    ///
+    /// ```
+    /// # use actix_http::Extensions;
+    /// let mut map = Extensions::new();
+    ///
+    /// map.insert(1u32);
+    /// assert!(map.contains::<u32>());
+    ///
+    /// map.clear();
+    /// assert!(!map.contains::<u32>());
+    /// ```
     #[inline]
     pub fn clear(&mut self) {
         self.map.clear();
@@ -79,6 +136,10 @@ impl fmt::Debug for Extensions {
     }
 }
 
+fn downcast_owned<T: 'static>(boxed: Box<dyn Any>) -> Option<T> {
+    boxed.downcast().ok().map(|boxed| *boxed)
+}
+
 #[cfg(test)]
 mod tests {
     use super::*;

actix-http/src/h1/chunked.rs

@@ -0,0 +1,432 @@
+use std::{io, task::Poll};
+
+use bytes::{Buf as _, Bytes, BytesMut};
+
+macro_rules! byte (
+    ($rdr:ident) => ({
+        if $rdr.len() > 0 {
+            let b = $rdr[0];
+            $rdr.advance(1);
+            b
+        } else {
+            return Poll::Pending
+        }
+    })
+);
+
+#[derive(Debug, PartialEq, Clone)]
+pub(super) enum ChunkedState {
+    Size,
+    SizeLws,
+    Extension,
+    SizeLf,
+    Body,
+    BodyCr,
+    BodyLf,
+    EndCr,
+    EndLf,
+    End,
+}
+
+impl ChunkedState {
+    pub(super) fn step(
+        &self,
+        body: &mut BytesMut,
+        size: &mut u64,
+        buf: &mut Option<Bytes>,
+    ) -> Poll<Result<ChunkedState, io::Error>> {
+        use self::ChunkedState::*;
+        match *self {
+            Size => ChunkedState::read_size(body, size),
+            SizeLws => ChunkedState::read_size_lws(body),
+            Extension => ChunkedState::read_extension(body),
+            SizeLf => ChunkedState::read_size_lf(body, *size),
+            Body => ChunkedState::read_body(body, size, buf),
+            BodyCr => ChunkedState::read_body_cr(body),
+            BodyLf => ChunkedState::read_body_lf(body),
+            EndCr => ChunkedState::read_end_cr(body),
+            EndLf => ChunkedState::read_end_lf(body),
+            End => Poll::Ready(Ok(ChunkedState::End)),
+        }
+    }
+
+    fn read_size(
+        rdr: &mut BytesMut,
+        size: &mut u64,
+    ) -> Poll<Result<ChunkedState, io::Error>> {
+        let radix = 16;
+
+        let rem = match byte!(rdr) {
+            b @ b'0'..=b'9' => b - b'0',
+            b @ b'a'..=b'f' => b + 10 - b'a',
+            b @ b'A'..=b'F' => b + 10 - b'A',
+            b'\t' | b' ' => return Poll::Ready(Ok(ChunkedState::SizeLws)),
+            b';' => return Poll::Ready(Ok(ChunkedState::Extension)),
+            b'\r' => return Poll::Ready(Ok(ChunkedState::SizeLf)),
+            _ => {
+                return Poll::Ready(Err(io::Error::new(
+                    io::ErrorKind::InvalidInput,
+                    "Invalid chunk size line: Invalid Size",
+                )));
+            }
+        };
+
+        match size.checked_mul(radix) {
+            Some(n) => {
+                *size = n as u64;
+                *size += rem as u64;
+
+                Poll::Ready(Ok(ChunkedState::Size))
+            }
+            None => {
+                log::debug!("chunk size would overflow u64");
+                Poll::Ready(Err(io::Error::new(
+                    io::ErrorKind::InvalidInput,
+                    "Invalid chunk size line: Size is too big",
+                )))
+            }
+        }
+    }
+
+    fn read_size_lws(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
+        match byte!(rdr) {
+            // LWS can follow the chunk size, but no more digits can come
+            b'\t' | b' ' => Poll::Ready(Ok(ChunkedState::SizeLws)),
+            b';' => Poll::Ready(Ok(ChunkedState::Extension)),
+            b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
+            _ => Poll::Ready(Err(io::Error::new(
+                io::ErrorKind::InvalidInput,
+                "Invalid chunk size linear white space",
+            ))),
+        }
+    }
+    fn read_extension(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
+        match byte!(rdr) {
+            b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
+            // strictly 0x20 (space) should be disallowed but we don't parse quoted strings here
+            0x00..=0x08 | 0x0a..=0x1f | 0x7f => Poll::Ready(Err(io::Error::new(
+                io::ErrorKind::InvalidInput,
+                "Invalid character in chunk extension",
+            ))),
+            _ => Poll::Ready(Ok(ChunkedState::Extension)), // no supported extensions
+        }
+    }
+    fn read_size_lf(
+        rdr: &mut BytesMut,
+        size: u64,
+    ) -> Poll<Result<ChunkedState, io::Error>> {
+        match byte!(rdr) {
+            b'\n' if size > 0 => Poll::Ready(Ok(ChunkedState::Body)),
+            b'\n' if size == 0 => Poll::Ready(Ok(ChunkedState::EndCr)),
+            _ => Poll::Ready(Err(io::Error::new(
+                io::ErrorKind::InvalidInput,
+                "Invalid chunk size LF",
+            ))),
+        }
+    }
+
+    fn read_body(
+        rdr: &mut BytesMut,
+        rem: &mut u64,
+        buf: &mut Option<Bytes>,
+    ) -> Poll<Result<ChunkedState, io::Error>> {
+        log::trace!("Chunked read, remaining={:?}", rem);
+
+        let len = rdr.len() as u64;
+        if len == 0 {
+            Poll::Ready(Ok(ChunkedState::Body))
+        } else {
+            let slice;
+            if *rem > len {
+                slice = rdr.split().freeze();
+                *rem -= len;
+            } else {
+                slice = rdr.split_to(*rem as usize).freeze();
+                *rem = 0;
+            }
+            *buf = Some(slice);
+            if *rem > 0 {
+                Poll::Ready(Ok(ChunkedState::Body))
+            } else {
+                Poll::Ready(Ok(ChunkedState::BodyCr))
+            }
+        }
+    }
+
+    fn read_body_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
+        match byte!(rdr) {
+            b'\r' => Poll::Ready(Ok(ChunkedState::BodyLf)),
+            _ => Poll::Ready(Err(io::Error::new(
+                io::ErrorKind::InvalidInput,
+                "Invalid chunk body CR",
+            ))),
+        }
+    }
+    fn read_body_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
+        match byte!(rdr) {
+            b'\n' => Poll::Ready(Ok(ChunkedState::Size)),
+            _ => Poll::Ready(Err(io::Error::new(
+                io::ErrorKind::InvalidInput,
+                "Invalid chunk body LF",
+            ))),
+        }
+    }
+    fn read_end_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
+        match byte!(rdr) {
+            b'\r' => Poll::Ready(Ok(ChunkedState::EndLf)),
+            _ => Poll::Ready(Err(io::Error::new(
+                io::ErrorKind::InvalidInput,
+                "Invalid chunk end CR",
+            ))),
+        }
+    }
+    fn read_end_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
+        match byte!(rdr) {
+            b'\n' => Poll::Ready(Ok(ChunkedState::End)),
+            _ => Poll::Ready(Err(io::Error::new(
+                io::ErrorKind::InvalidInput,
+                "Invalid chunk end LF",
+            ))),
+        }
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use actix_codec::Decoder as _;
+    use bytes::{Bytes, BytesMut};
+    use http::Method;
+
+    use crate::{
+        error::ParseError,
+        h1::decoder::{MessageDecoder, PayloadItem},
+        HttpMessage as _, Request,
+    };
+
+    macro_rules! parse_ready {
+        ($e:expr) => {{
+            match MessageDecoder::<Request>::default().decode($e) {
+                Ok(Some((msg, _))) => msg,
+                Ok(_) => unreachable!("Eof during parsing http request"),
+                Err(err) => unreachable!("Error during parsing http request: {:?}", err),
+            }
+        }};
+    }
+
+    macro_rules! expect_parse_err {
+        ($e:expr) => {{
+            match MessageDecoder::<Request>::default().decode($e) {
+                Err(err) => match err {
+                    ParseError::Io(_) => unreachable!("Parse error expected"),
+                    _ => {}
+                },
+                _ => unreachable!("Error expected"),
+            }
+        }};
+    }
+
+    #[test]
+    fn test_parse_chunked_payload_chunk_extension() {
+        let mut buf = BytesMut::from(
+            "GET /test HTTP/1.1\r\n\
+            transfer-encoding: chunked\r\n\
+            \r\n",
+        );
+
+        let mut reader = MessageDecoder::<Request>::default();
+        let (msg, pl) = reader.decode(&mut buf).unwrap().unwrap();
+        let mut pl = pl.unwrap();
+        assert!(msg.chunked().unwrap());
+
+        buf.extend(b"4;test\r\ndata\r\n4\r\nline\r\n0\r\n\r\n"); // test: test\r\n\r\n")
+        let chunk = pl.decode(&mut buf).unwrap().unwrap().chunk();
+        assert_eq!(chunk, Bytes::from_static(b"data"));
+        let chunk = pl.decode(&mut buf).unwrap().unwrap().chunk();
+        assert_eq!(chunk, Bytes::from_static(b"line"));
+        let msg = pl.decode(&mut buf).unwrap().unwrap();
+        assert!(msg.eof());
+    }
+
+    #[test]
+    fn test_request_chunked() {
+        let mut buf = BytesMut::from(
+            "GET /test HTTP/1.1\r\n\
+             transfer-encoding: chunked\r\n\r\n",
+        );
+        let req = parse_ready!(&mut buf);
+
+        if let Ok(val) = req.chunked() {
+            assert!(val);
+        } else {
+            unreachable!("Error");
+        }
+
+        // intentional typo in "chunked"
+        let mut buf = BytesMut::from(
+            "GET /test HTTP/1.1\r\n\
+             transfer-encoding: chnked\r\n\r\n",
+        );
+        expect_parse_err!(&mut buf);
+    }
+
+    #[test]
+    fn test_http_request_chunked_payload() {
+        let mut buf = BytesMut::from(
+            "GET /test HTTP/1.1\r\n\
+             transfer-encoding: chunked\r\n\r\n",
+        );
+        let mut reader = MessageDecoder::<Request>::default();
+        let (req, pl) = reader.decode(&mut buf).unwrap().unwrap();
+        let mut pl = pl.unwrap();
+        assert!(req.chunked().unwrap());
+
+        buf.extend(b"4\r\ndata\r\n4\r\nline\r\n0\r\n\r\n");
+        assert_eq!(
+            pl.decode(&mut buf).unwrap().unwrap().chunk().as_ref(),
+            b"data"
+        );
+        assert_eq!(
+            pl.decode(&mut buf).unwrap().unwrap().chunk().as_ref(),
+            b"line"
+        );
+        assert!(pl.decode(&mut buf).unwrap().unwrap().eof());
+    }
+
+    #[test]
+    fn test_http_request_chunked_payload_and_next_message() {
+        let mut buf = BytesMut::from(
+            "GET /test HTTP/1.1\r\n\
+             transfer-encoding: chunked\r\n\r\n",
+        );
+        let mut reader = MessageDecoder::<Request>::default();
+        let (req, pl) = reader.decode(&mut buf).unwrap().unwrap();
+        let mut pl = pl.unwrap();
+        assert!(req.chunked().unwrap());
+
+        buf.extend(
+            b"4\r\ndata\r\n4\r\nline\r\n0\r\n\r\n\
+              POST /test2 HTTP/1.1\r\n\
+              transfer-encoding: chunked\r\n\r\n"
+                .iter(),
+        );
+        let msg = pl.decode(&mut buf).unwrap().unwrap();
+        assert_eq!(msg.chunk().as_ref(), b"data");
+        let msg = pl.decode(&mut buf).unwrap().unwrap();
+        assert_eq!(msg.chunk().as_ref(), b"line");
+        let msg = pl.decode(&mut buf).unwrap().unwrap();
+        assert!(msg.eof());
+
+        let (req, _) = reader.decode(&mut buf).unwrap().unwrap();
+        assert!(req.chunked().unwrap());
+        assert_eq!(*req.method(), Method::POST);
+        assert!(req.chunked().unwrap());
+    }
+
+    #[test]
+    fn test_http_request_chunked_payload_chunks() {
+        let mut buf = BytesMut::from(
+            "GET /test HTTP/1.1\r\n\
+             transfer-encoding: chunked\r\n\r\n",
+        );
+
+        let mut reader = MessageDecoder::<Request>::default();
+        let (req, pl) = reader.decode(&mut buf).unwrap().unwrap();
+        let mut pl = pl.unwrap();
+        assert!(req.chunked().unwrap());
+
+        buf.extend(b"4\r\n1111\r\n");
+        let msg = pl.decode(&mut buf).unwrap().unwrap();
+        assert_eq!(msg.chunk().as_ref(), b"1111");
+
+        buf.extend(b"4\r\ndata\r");
+        let msg = pl.decode(&mut buf).unwrap().unwrap();
+        assert_eq!(msg.chunk().as_ref(), b"data");
+
+        buf.extend(b"\n4");
+        assert!(pl.decode(&mut buf).unwrap().is_none());
+
+        buf.extend(b"\r");
+        assert!(pl.decode(&mut buf).unwrap().is_none());
+        buf.extend(b"\n");
+        assert!(pl.decode(&mut buf).unwrap().is_none());
+
+        buf.extend(b"li");
+        let msg = pl.decode(&mut buf).unwrap().unwrap();
+        assert_eq!(msg.chunk().as_ref(), b"li");
+
+        //trailers
+        //buf.feed_data("test: test\r\n");
+        //not_ready!(reader.parse(&mut buf, &mut readbuf));
+
+        buf.extend(b"ne\r\n0\r\n");
+        let msg = pl.decode(&mut buf).unwrap().unwrap();
+        assert_eq!(msg.chunk().as_ref(), b"ne");
+        assert!(pl.decode(&mut buf).unwrap().is_none());
+
+        buf.extend(b"\r\n");
+        assert!(pl.decode(&mut buf).unwrap().unwrap().eof());
+    }
+
+    #[test]
+    fn chunk_extension_quoted() {
+        let mut buf = BytesMut::from(
+            "GET /test HTTP/1.1\r\n\
+            Host: localhost:8080\r\n\
+            Transfer-Encoding: chunked\r\n\
+            \r\n\
+            2;hello=b;one=\"1 2 3\"\r\n\
+            xx",
+        );
+
+        let mut reader = MessageDecoder::<Request>::default();
+        let (_msg, pl) = reader.decode(&mut buf).unwrap().unwrap();
+        let mut pl = pl.unwrap();
+
+        let chunk = pl.decode(&mut buf).unwrap().unwrap();
+        assert_eq!(chunk, PayloadItem::Chunk(Bytes::from_static(b"xx")));
+    }
+
+    #[test]
+    fn hrs_chunk_extension_invalid() {
+        let mut buf = BytesMut::from(
+            "GET / HTTP/1.1\r\n\
+            Host: localhost:8080\r\n\
+            Transfer-Encoding: chunked\r\n\
+            \r\n\
+            2;x\nx\r\n\
+            4c\r\n\
+            0\r\n",
+        );
+
+        let mut reader = MessageDecoder::<Request>::default();
+        let (_msg, pl) = reader.decode(&mut buf).unwrap().unwrap();
+        let mut pl = pl.unwrap();
+
+        let err = pl.decode(&mut buf).unwrap_err();
+        assert!(err
+            .to_string()
+            .contains("Invalid character in chunk extension"));
+    }
+
+    #[test]
+    fn hrs_chunk_size_overflow() {
+        let mut buf = BytesMut::from(
+            "GET / HTTP/1.1\r\n\
+            Host: example.com\r\n\
+            Transfer-Encoding: chunked\r\n\
+            \r\n\
+            f0000000000000003\r\n\
+            abc\r\n\
+            0\r\n",
+        );
+
+        let mut reader = MessageDecoder::<Request>::default();
+        let (_msg, pl) = reader.decode(&mut buf).unwrap().unwrap();
+        let mut pl = pl.unwrap();
+
+        let err = pl.decode(&mut buf).unwrap_err();
+        assert!(err
+            .to_string()
+            .contains("Invalid chunk size line: Size is too big"));
+    }
+}

actix-http/src/h1/client.rs

@@ -120,7 +120,7 @@ impl Decoder for ClientCodec {
         debug_assert!(!self.inner.payload.is_some(), "Payload decoder is set");
 
         if let Some((req, payload)) = self.inner.decoder.decode(src)? {
-            if let Some(ctype) = req.ctype() {
+            if let Some(ctype) = req.conn_type() {
                 // do not use peer's keep-alive
                 self.inner.ctype = if ctype == ConnectionType::KeepAlive {
                     self.inner.ctype
@@ -223,15 +223,3 @@ impl Encoder<Message<(RequestHeadType, BodySize)>> for ClientCodec {
         Ok(())
     }
 }
-
-pub struct Writer<'a>(pub &'a mut BytesMut);
-
-impl<'a> io::Write for Writer<'a> {
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.0.extend_from_slice(buf);
-        Ok(buf.len())
-    }
-    fn flush(&mut self) -> io::Result<()> {
-        Ok(())
-    }
-}

actix-http/src/h1/codec.rs

@@ -29,7 +29,7 @@ pub struct Codec {
     decoder: decoder::MessageDecoder<Request>,
     payload: Option<PayloadDecoder>,
     version: Version,
-    ctype: ConnectionType,
+    conn_type: ConnectionType,
 
     // encoder part
     flags: Flags,
@@ -65,7 +65,7 @@ impl Codec {
             decoder: decoder::MessageDecoder::default(),
             payload: None,
             version: Version::HTTP_11,
-            ctype: ConnectionType::Close,
+            conn_type: ConnectionType::Close,
             encoder: encoder::MessageEncoder::default(),
         }
     }
@@ -73,13 +73,13 @@ impl Codec {
     /// Check if request is upgrade.
     #[inline]
     pub fn upgrade(&self) -> bool {
-        self.ctype == ConnectionType::Upgrade
+        self.conn_type == ConnectionType::Upgrade
     }
 
     /// Check if last response is keep-alive.
     #[inline]
     pub fn keepalive(&self) -> bool {
-        self.ctype == ConnectionType::KeepAlive
+        self.conn_type == ConnectionType::KeepAlive
     }
 
     /// Check if keep-alive enabled on server level.
@@ -124,11 +124,11 @@ impl Decoder for Codec {
             let head = req.head();
             self.flags.set(Flags::HEAD, head.method == Method::HEAD);
             self.version = head.version;
-            self.ctype = head.connection_type();
-            if self.ctype == ConnectionType::KeepAlive
+            self.conn_type = head.connection_type();
+            if self.conn_type == ConnectionType::KeepAlive
                 && !self.flags.contains(Flags::KEEPALIVE_ENABLED)
             {
-                self.ctype = ConnectionType::Close
+                self.conn_type = ConnectionType::Close
             }
             match payload {
                 PayloadType::None => self.payload = None,
@@ -159,14 +159,14 @@ impl Encoder<Message<(Response<()>, BodySize)>> for Codec {
                 res.head_mut().version = self.version;
 
                 // connection status
-                self.ctype = if let Some(ct) = res.head().ctype() {
+                self.conn_type = if let Some(ct) = res.head().conn_type() {
                     if ct == ConnectionType::KeepAlive {
-                        self.ctype
+                        self.conn_type
                     } else {
                         ct
                     }
                 } else {
-                    self.ctype
+                    self.conn_type
                 };
 
                 // encode message
@@ -177,10 +177,9 @@ impl Encoder<Message<(Response<()>, BodySize)>> for Codec {
                     self.flags.contains(Flags::STREAM),
                     self.version,
                     length,
-                    self.ctype,
+                    self.conn_type,
                     &self.config,
                 )?;
-                // self.headers_size = (dst.len() - len) as u32;
             }
             Message::Chunk(Some(bytes)) => {
                 self.encoder.encode_chunk(bytes.as_ref(), dst)?;
@@ -189,6 +188,7 @@ impl Encoder<Message<(Response<()>, BodySize)>> for Codec {
                 self.encoder.encode_eof(dst)?;
             }
         }
+
         Ok(())
     }
 }
@@ -199,10 +199,10 @@ mod tests {
     use http::Method;
 
     use super::*;
-    use crate::httpmessage::HttpMessage;
+    use crate::HttpMessage;
 
-    #[test]
-    fn test_http_request_chunked_payload_and_next_message() {
+    #[actix_rt::test]
+    async fn test_http_request_chunked_payload_and_next_message() {
         let mut codec = Codec::default();
 
         let mut buf = BytesMut::from(

actix-http/src/h1/decoder.rs

@@ -1,20 +1,20 @@
-use std::convert::TryFrom;
-use std::io;
-use std::marker::PhantomData;
-use std::task::Poll;
+use std::{convert::TryFrom, io, marker::PhantomData, mem::MaybeUninit, task::Poll};
 
 use actix_codec::Decoder;
-use bytes::{Buf, Bytes, BytesMut};
+use bytes::{Bytes, BytesMut};
 use http::header::{HeaderName, HeaderValue};
 use http::{header, Method, StatusCode, Uri, Version};
 use log::{debug, error, trace};
 
-use crate::error::ParseError;
-use crate::header::HeaderMap;
-use crate::message::{ConnectionType, ResponseHead};
-use crate::request::Request;
+use super::chunked::ChunkedState;
+use crate::{
+    error::ParseError,
+    header::HeaderMap,
+    message::{ConnectionType, ResponseHead},
+    request::Request,
+};
 
-const MAX_BUFFER_SIZE: usize = 131_072;
+pub(crate) const MAX_BUFFER_SIZE: usize = 131_072;
 const MAX_HEADERS: usize = 96;
 
 /// Incoming message decoder
@@ -67,6 +67,7 @@ pub(crate) trait MessageType: Sized {
         let mut has_upgrade_websocket = false;
         let mut expect = false;
         let mut chunked = false;
+        let mut seen_te = false;
         let mut content_length = None;
 
         {
@@ -85,8 +86,17 @@ pub(crate) trait MessageType: Sized {
                 };
 
                 match name {
-                    header::CONTENT_LENGTH => {
-                        if let Ok(s) = value.to_str() {
+                    header::CONTENT_LENGTH if content_length.is_some() => {
+                        debug!("multiple Content-Length");
+                        return Err(ParseError::Header);
+                    }
+
+                    header::CONTENT_LENGTH => match value.to_str() {
+                        Ok(s) if s.trim().starts_with('+') => {
+                            debug!("illegal Content-Length: {:?}", s);
+                            return Err(ParseError::Header);
+                        }
+                        Ok(s) => {
                             if let Ok(len) = s.parse::<u64>() {
                                 if len != 0 {
                                     content_length = Some(len);
@@ -95,22 +105,38 @@ pub(crate) trait MessageType: Sized {
                                 debug!("illegal Content-Length: {:?}", s);
                                 return Err(ParseError::Header);
                             }
-                        } else {
+                        }
+                        Err(_) => {
                             debug!("illegal Content-Length: {:?}", value);
                             return Err(ParseError::Header);
                         }
-                    }
+                    },
+
                     // transfer-encoding
+                    header::TRANSFER_ENCODING if seen_te => {
+                        debug!("multiple Transfer-Encoding not allowed");
+                        return Err(ParseError::Header);
+                    }
+
                     header::TRANSFER_ENCODING => {
-                        if let Ok(s) = value.to_str().map(|s| s.trim()) {
-                            chunked = s.eq_ignore_ascii_case("chunked");
+                        seen_te = true;
+
+                        if let Ok(s) = value.to_str().map(str::trim) {
+                            if s.eq_ignore_ascii_case("chunked") {
+                                chunked = true;
+                            } else if s.eq_ignore_ascii_case("identity") {
+                                // allow silently since multiple TE headers are already checked
+                            } else {
+                                debug!("illegal Transfer-Encoding: {:?}", s);
+                                return Err(ParseError::Header);
+                            }
                         } else {
                             return Err(ParseError::Header);
                         }
                     }
                     // connection keep-alive state
                     header::CONNECTION => {
-                        ka = if let Ok(conn) = value.to_str().map(|conn| conn.trim()) {
+                        ka = if let Ok(conn) = value.to_str().map(str::trim) {
                             if conn.eq_ignore_ascii_case("keep-alive") {
                                 Some(ConnectionType::KeepAlive)
                             } else if conn.eq_ignore_ascii_case("close") {
@@ -125,7 +151,7 @@ pub(crate) trait MessageType: Sized {
                         };
                     }
                     header::UPGRADE => {
-                        if let Ok(val) = value.to_str().map(|val| val.trim()) {
+                        if let Ok(val) = value.to_str().map(str::trim) {
                             if val.eq_ignore_ascii_case("websocket") {
                                 has_upgrade_websocket = true;
                             }
@@ -186,10 +212,17 @@ impl MessageType for Request {
         let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
 
         let (len, method, uri, ver, h_len) = {
-            let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
+            // SAFETY:
+            // Create an uninitialized array of `MaybeUninit`. The `assume_init` is
+            // safe because the type we are claiming to have initialized here is a
+            // bunch of `MaybeUninit`s, which do not require initialization.
+            let mut parsed = unsafe {
+                MaybeUninit::<[MaybeUninit<httparse::Header<'_>>; MAX_HEADERS]>::uninit()
+                    .assume_init()
+            };
 
-            let mut req = httparse::Request::new(&mut parsed);
-            match req.parse(src)? {
+            let mut req = httparse::Request::new(&mut []);
+            match req.parse_with_uninit_headers(src, &mut parsed)? {
                 httparse::Status::Complete(len) => {
                     let method = Method::from_bytes(req.method.unwrap().as_bytes())
                         .map_err(|_| ParseError::Method)?;
@@ -203,7 +236,15 @@ impl MessageType for Request {
 
                     (len, method, uri, version, req.headers.len())
                 }
-                httparse::Status::Partial => return Ok(None),
+                httparse::Status::Partial => {
+                    return if src.len() >= MAX_BUFFER_SIZE {
+                        trace!("MAX_BUFFER_SIZE unprocessed data reached, closing");
+                        Err(ParseError::TooLarge)
+                    } else {
+                        // Return None to notify more read are needed for parsing request
+                        Ok(None)
+                    };
+                }
             }
         };
 
@@ -216,15 +257,12 @@ impl MessageType for Request {
         let decoder = match length {
             PayloadLength::Payload(pl) => pl,
             PayloadLength::UpgradeWebSocket => {
-                // upgrade(websocket)
+                // upgrade (WebSocket)
                 PayloadType::Stream(PayloadDecoder::eof())
             }
             PayloadLength::None => {
                 if method == Method::CONNECT {
                     PayloadType::Stream(PayloadDecoder::eof())
-                } else if src.len() >= MAX_BUFFER_SIZE {
-                    trace!("MAX_BUFFER_SIZE unprocessed data reached, closing");
-                    return Err(ParseError::TooLarge);
                 } else {
                     PayloadType::None
                 }
@@ -273,7 +311,14 @@ impl MessageType for ResponseHead {
 
                     (len, version, status, res.headers.len())
                 }
-                httparse::Status::Partial => return Ok(None),
+                httparse::Status::Partial => {
+                    return if src.len() >= MAX_BUFFER_SIZE {
+                        error!("MAX_BUFFER_SIZE unprocessed data reached, closing");
+                        Err(ParseError::TooLarge)
+                    } else {
+                        Ok(None)
+                    }
+                }
             }
         };
 
@@ -289,9 +334,6 @@ impl MessageType for ResponseHead {
         } else if status == StatusCode::SWITCHING_PROTOCOLS {
             // switching protocol or connect
             PayloadType::Stream(PayloadDecoder::eof())
-        } else if src.len() >= MAX_BUFFER_SIZE {
-            error!("MAX_BUFFER_SIZE unprocessed data reached, closing");
-            return Err(ParseError::TooLarge);
         } else {
             // for HTTP/1.0 read to eof and close connection
             if msg.version == Version::HTTP_10 {
@@ -399,20 +441,6 @@ enum Kind {
     Eof,
 }
 
-#[derive(Debug, PartialEq, Clone)]
-enum ChunkedState {
-    Size,
-    SizeLws,
-    Extension,
-    SizeLf,
-    Body,
-    BodyCr,
-    BodyLf,
-    EndCr,
-    EndLf,
-    End,
-}
-
 impl Decoder for PayloadDecoder {
     type Item = PayloadItem;
     type Error = io::Error;
@@ -442,19 +470,23 @@ impl Decoder for PayloadDecoder {
             Kind::Chunked(ref mut state, ref mut size) => {
                 loop {
                     let mut buf = None;
+
                     // advances the chunked state
                     *state = match state.step(src, size, &mut buf) {
                         Poll::Pending => return Ok(None),
                         Poll::Ready(Ok(state)) => state,
                         Poll::Ready(Err(e)) => return Err(e),
                     };
+
                     if *state == ChunkedState::End {
                         trace!("End of chunked stream");
                         return Ok(Some(PayloadItem::Eof));
                     }
+
                     if let Some(buf) = buf {
                         return Ok(Some(PayloadItem::Chunk(buf)));
                     }
+
                     if src.is_empty() {
                         return Ok(None);
                     }
@@ -471,201 +503,40 @@ impl Decoder for PayloadDecoder {
     }
 }
 
-macro_rules! byte (
-    ($rdr:ident) => ({
-        if $rdr.len() > 0 {
-            let b = $rdr[0];
-            $rdr.advance(1);
-            b
-        } else {
-            return Poll::Pending
-        }
-    })
-);
-
-impl ChunkedState {
-    fn step(
-        &self,
-        body: &mut BytesMut,
-        size: &mut u64,
-        buf: &mut Option<Bytes>,
-    ) -> Poll<Result<ChunkedState, io::Error>> {
-        use self::ChunkedState::*;
-        match *self {
-            Size => ChunkedState::read_size(body, size),
-            SizeLws => ChunkedState::read_size_lws(body),
-            Extension => ChunkedState::read_extension(body),
-            SizeLf => ChunkedState::read_size_lf(body, size),
-            Body => ChunkedState::read_body(body, size, buf),
-            BodyCr => ChunkedState::read_body_cr(body),
-            BodyLf => ChunkedState::read_body_lf(body),
-            EndCr => ChunkedState::read_end_cr(body),
-            EndLf => ChunkedState::read_end_lf(body),
-            End => Poll::Ready(Ok(ChunkedState::End)),
-        }
-    }
-
-    fn read_size(
-        rdr: &mut BytesMut,
-        size: &mut u64,
-    ) -> Poll<Result<ChunkedState, io::Error>> {
-        let radix = 16;
-        match byte!(rdr) {
-            b @ b'0'..=b'9' => {
-                *size *= radix;
-                *size += u64::from(b - b'0');
-            }
-            b @ b'a'..=b'f' => {
-                *size *= radix;
-                *size += u64::from(b + 10 - b'a');
-            }
-            b @ b'A'..=b'F' => {
-                *size *= radix;
-                *size += u64::from(b + 10 - b'A');
-            }
-            b'\t' | b' ' => return Poll::Ready(Ok(ChunkedState::SizeLws)),
-            b';' => return Poll::Ready(Ok(ChunkedState::Extension)),
-            b'\r' => return Poll::Ready(Ok(ChunkedState::SizeLf)),
-            _ => {
-                return Poll::Ready(Err(io::Error::new(
-                    io::ErrorKind::InvalidInput,
-                    "Invalid chunk size line: Invalid Size",
-                )));
-            }
-        }
-        Poll::Ready(Ok(ChunkedState::Size))
-    }
-
-    fn read_size_lws(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
-        trace!("read_size_lws");
-        match byte!(rdr) {
-            // LWS can follow the chunk size, but no more digits can come
-            b'\t' | b' ' => Poll::Ready(Ok(ChunkedState::SizeLws)),
-            b';' => Poll::Ready(Ok(ChunkedState::Extension)),
-            b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
-            _ => Poll::Ready(Err(io::Error::new(
-                io::ErrorKind::InvalidInput,
-                "Invalid chunk size linear white space",
-            ))),
-        }
-    }
-    fn read_extension(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
-        match byte!(rdr) {
-            b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
-            _ => Poll::Ready(Ok(ChunkedState::Extension)), // no supported extensions
-        }
-    }
-    fn read_size_lf(
-        rdr: &mut BytesMut,
-        size: &mut u64,
-    ) -> Poll<Result<ChunkedState, io::Error>> {
-        match byte!(rdr) {
-            b'\n' if *size > 0 => Poll::Ready(Ok(ChunkedState::Body)),
-            b'\n' if *size == 0 => Poll::Ready(Ok(ChunkedState::EndCr)),
-            _ => Poll::Ready(Err(io::Error::new(
-                io::ErrorKind::InvalidInput,
-                "Invalid chunk size LF",
-            ))),
-        }
-    }
-
-    fn read_body(
-        rdr: &mut BytesMut,
-        rem: &mut u64,
-        buf: &mut Option<Bytes>,
-    ) -> Poll<Result<ChunkedState, io::Error>> {
-        trace!("Chunked read, remaining={:?}", rem);
-
-        let len = rdr.len() as u64;
-        if len == 0 {
-            Poll::Ready(Ok(ChunkedState::Body))
-        } else {
-            let slice;
-            if *rem > len {
-                slice = rdr.split().freeze();
-                *rem -= len;
-            } else {
-                slice = rdr.split_to(*rem as usize).freeze();
-                *rem = 0;
-            }
-            *buf = Some(slice);
-            if *rem > 0 {
-                Poll::Ready(Ok(ChunkedState::Body))
-            } else {
-                Poll::Ready(Ok(ChunkedState::BodyCr))
-            }
-        }
-    }
-
-    fn read_body_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
-        match byte!(rdr) {
-            b'\r' => Poll::Ready(Ok(ChunkedState::BodyLf)),
-            _ => Poll::Ready(Err(io::Error::new(
-                io::ErrorKind::InvalidInput,
-                "Invalid chunk body CR",
-            ))),
-        }
-    }
-    fn read_body_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
-        match byte!(rdr) {
-            b'\n' => Poll::Ready(Ok(ChunkedState::Size)),
-            _ => Poll::Ready(Err(io::Error::new(
-                io::ErrorKind::InvalidInput,
-                "Invalid chunk body LF",
-            ))),
-        }
-    }
-    fn read_end_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
-        match byte!(rdr) {
-            b'\r' => Poll::Ready(Ok(ChunkedState::EndLf)),
-            _ => Poll::Ready(Err(io::Error::new(
-                io::ErrorKind::InvalidInput,
-                "Invalid chunk end CR",
-            ))),
-        }
-    }
-    fn read_end_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
-        match byte!(rdr) {
-            b'\n' => Poll::Ready(Ok(ChunkedState::End)),
-            _ => Poll::Ready(Err(io::Error::new(
-                io::ErrorKind::InvalidInput,
-                "Invalid chunk end LF",
-            ))),
-        }
-    }
-}
-
 #[cfg(test)]
 mod tests {
     use bytes::{Bytes, BytesMut};
     use http::{Method, Version};
 
     use super::*;
-    use crate::error::ParseError;
-    use crate::http::header::{HeaderName, SET_COOKIE};
-    use crate::httpmessage::HttpMessage;
+    use crate::{
+        error::ParseError,
+        http::header::{HeaderName, SET_COOKIE},
+        HttpMessage as _,
+    };
 
     impl PayloadType {
-        fn unwrap(self) -> PayloadDecoder {
+        pub(crate) fn unwrap(self) -> PayloadDecoder {
             match self {
                 PayloadType::Payload(pl) => pl,
                 _ => panic!(),
             }
         }
 
-        fn is_unhandled(&self) -> bool {
+        pub(crate) fn is_unhandled(&self) -> bool {
             matches!(self, PayloadType::Stream(_))
         }
     }
 
     impl PayloadItem {
-        fn chunk(self) -> Bytes {
+        pub(crate) fn chunk(self) -> Bytes {
             match self {
                 PayloadItem::Chunk(chunk) => chunk,
                 _ => panic!("error"),
             }
         }
-        fn eof(&self) -> bool {
+
+        pub(crate) fn eof(&self) -> bool {
             matches!(*self, PayloadItem::Eof)
         }
     }
@@ -821,8 +692,8 @@ mod tests {
             .get_all(SET_COOKIE)
             .map(|v| v.to_str().unwrap().to_owned())
             .collect();
-        assert_eq!(val[1], "c1=cookie1");
-        assert_eq!(val[0], "c2=cookie2");
+        assert_eq!(val[0], "c1=cookie1");
+        assert_eq!(val[1], "c2=cookie2");
     }
 
     #[test]
@@ -958,34 +829,6 @@ mod tests {
         assert!(req.upgrade());
     }
 
-    #[test]
-    fn test_request_chunked() {
-        let mut buf = BytesMut::from(
-            "GET /test HTTP/1.1\r\n\
-             transfer-encoding: chunked\r\n\r\n",
-        );
-        let req = parse_ready!(&mut buf);
-
-        if let Ok(val) = req.chunked() {
-            assert!(val);
-        } else {
-            unreachable!("Error");
-        }
-
-        // intentional typo in "chunked"
-        let mut buf = BytesMut::from(
-            "GET /test HTTP/1.1\r\n\
-             transfer-encoding: chnked\r\n\r\n",
-        );
-        let req = parse_ready!(&mut buf);
-
-        if let Ok(val) = req.chunked() {
-            assert!(!val);
-        } else {
-            unreachable!("Error");
-        }
-    }
-
     #[test]
     fn test_headers_content_length_err_1() {
         let mut buf = BytesMut::from(
@@ -1103,128 +946,9 @@ mod tests {
         expect_parse_err!(&mut buf);
     }
 
-    #[test]
-    fn test_http_request_chunked_payload() {
-        let mut buf = BytesMut::from(
-            "GET /test HTTP/1.1\r\n\
-             transfer-encoding: chunked\r\n\r\n",
-        );
-        let mut reader = MessageDecoder::<Request>::default();
-        let (req, pl) = reader.decode(&mut buf).unwrap().unwrap();
-        let mut pl = pl.unwrap();
-        assert!(req.chunked().unwrap());
-
-        buf.extend(b"4\r\ndata\r\n4\r\nline\r\n0\r\n\r\n");
-        assert_eq!(
-            pl.decode(&mut buf).unwrap().unwrap().chunk().as_ref(),
-            b"data"
-        );
-        assert_eq!(
-            pl.decode(&mut buf).unwrap().unwrap().chunk().as_ref(),
-            b"line"
-        );
-        assert!(pl.decode(&mut buf).unwrap().unwrap().eof());
-    }
-
-    #[test]
-    fn test_http_request_chunked_payload_and_next_message() {
-        let mut buf = BytesMut::from(
-            "GET /test HTTP/1.1\r\n\
-             transfer-encoding: chunked\r\n\r\n",
-        );
-        let mut reader = MessageDecoder::<Request>::default();
-        let (req, pl) = reader.decode(&mut buf).unwrap().unwrap();
-        let mut pl = pl.unwrap();
-        assert!(req.chunked().unwrap());
-
-        buf.extend(
-            b"4\r\ndata\r\n4\r\nline\r\n0\r\n\r\n\
-              POST /test2 HTTP/1.1\r\n\
-              transfer-encoding: chunked\r\n\r\n"
-                .iter(),
-        );
-        let msg = pl.decode(&mut buf).unwrap().unwrap();
-        assert_eq!(msg.chunk().as_ref(), b"data");
-        let msg = pl.decode(&mut buf).unwrap().unwrap();
-        assert_eq!(msg.chunk().as_ref(), b"line");
-        let msg = pl.decode(&mut buf).unwrap().unwrap();
-        assert!(msg.eof());
-
-        let (req, _) = reader.decode(&mut buf).unwrap().unwrap();
-        assert!(req.chunked().unwrap());
-        assert_eq!(*req.method(), Method::POST);
-        assert!(req.chunked().unwrap());
-    }
-
-    #[test]
-    fn test_http_request_chunked_payload_chunks() {
-        let mut buf = BytesMut::from(
-            "GET /test HTTP/1.1\r\n\
-             transfer-encoding: chunked\r\n\r\n",
-        );
-
-        let mut reader = MessageDecoder::<Request>::default();
-        let (req, pl) = reader.decode(&mut buf).unwrap().unwrap();
-        let mut pl = pl.unwrap();
-        assert!(req.chunked().unwrap());
-
-        buf.extend(b"4\r\n1111\r\n");
-        let msg = pl.decode(&mut buf).unwrap().unwrap();
-        assert_eq!(msg.chunk().as_ref(), b"1111");
-
-        buf.extend(b"4\r\ndata\r");
-        let msg = pl.decode(&mut buf).unwrap().unwrap();
-        assert_eq!(msg.chunk().as_ref(), b"data");
-
-        buf.extend(b"\n4");
-        assert!(pl.decode(&mut buf).unwrap().is_none());
-
-        buf.extend(b"\r");
-        assert!(pl.decode(&mut buf).unwrap().is_none());
-        buf.extend(b"\n");
-        assert!(pl.decode(&mut buf).unwrap().is_none());
-
-        buf.extend(b"li");
-        let msg = pl.decode(&mut buf).unwrap().unwrap();
-        assert_eq!(msg.chunk().as_ref(), b"li");
-
-        //trailers
-        //buf.feed_data("test: test\r\n");
-        //not_ready!(reader.parse(&mut buf, &mut readbuf));
-
-        buf.extend(b"ne\r\n0\r\n");
-        let msg = pl.decode(&mut buf).unwrap().unwrap();
-        assert_eq!(msg.chunk().as_ref(), b"ne");
-        assert!(pl.decode(&mut buf).unwrap().is_none());
-
-        buf.extend(b"\r\n");
-        assert!(pl.decode(&mut buf).unwrap().unwrap().eof());
-    }
-
-    #[test]
-    fn test_parse_chunked_payload_chunk_extension() {
-        let mut buf = BytesMut::from(
-            &"GET /test HTTP/1.1\r\n\
-              transfer-encoding: chunked\r\n\r\n"[..],
-        );
-
-        let mut reader = MessageDecoder::<Request>::default();
-        let (msg, pl) = reader.decode(&mut buf).unwrap().unwrap();
-        let mut pl = pl.unwrap();
-        assert!(msg.chunked().unwrap());
-
-        buf.extend(b"4;test\r\ndata\r\n4\r\nline\r\n0\r\n\r\n"); // test: test\r\n\r\n")
-        let chunk = pl.decode(&mut buf).unwrap().unwrap().chunk();
-        assert_eq!(chunk, Bytes::from_static(b"data"));
-        let chunk = pl.decode(&mut buf).unwrap().unwrap().chunk();
-        assert_eq!(chunk, Bytes::from_static(b"line"));
-        let msg = pl.decode(&mut buf).unwrap().unwrap();
-        assert!(msg.eof());
-    }
-
     #[test]
     fn test_response_http10_read_until_eof() {
-        let mut buf = BytesMut::from(&"HTTP/1.0 200 Ok\r\n\r\ntest data"[..]);
+        let mut buf = BytesMut::from("HTTP/1.0 200 Ok\r\n\r\ntest data");
 
         let mut reader = MessageDecoder::<ResponseHead>::default();
         let (_msg, pl) = reader.decode(&mut buf).unwrap().unwrap();
@@ -1233,4 +957,84 @@ mod tests {
         let chunk = pl.decode(&mut buf).unwrap().unwrap();
         assert_eq!(chunk, PayloadItem::Chunk(Bytes::from_static(b"test data")));
     }
+
+    #[test]
+    fn hrs_multiple_content_length() {
+        let mut buf = BytesMut::from(
+            "GET / HTTP/1.1\r\n\
+            Host: example.com\r\n\
+            Content-Length: 4\r\n\
+            Content-Length: 2\r\n\
+            \r\n\
+            abcd",
+        );
+
+        expect_parse_err!(&mut buf);
+    }
+
+    #[test]
+    fn hrs_content_length_plus() {
+        let mut buf = BytesMut::from(
+            "GET / HTTP/1.1\r\n\
+            Host: example.com\r\n\
+            Content-Length: +3\r\n\
+            \r\n\
+            000",
+        );
+
+        expect_parse_err!(&mut buf);
+    }
+
+    #[test]
+    fn hrs_unknown_transfer_encoding() {
+        let mut buf = BytesMut::from(
+            "GET / HTTP/1.1\r\n\
+            Host: example.com\r\n\
+            Transfer-Encoding: JUNK\r\n\
+            Transfer-Encoding: chunked\r\n\
+            \r\n\
+            5\r\n\
+            hello\r\n\
+            0",
+        );
+
+        expect_parse_err!(&mut buf);
+    }
+
+    #[test]
+    fn hrs_multiple_transfer_encoding() {
+        let mut buf = BytesMut::from(
+            "GET / HTTP/1.1\r\n\
+            Host: example.com\r\n\
+            Content-Length: 51\r\n\
+            Transfer-Encoding: identity\r\n\
+            Transfer-Encoding: chunked\r\n\
+            \r\n\
+            0\r\n\
+            \r\n\
+            GET /forbidden HTTP/1.1\r\n\
+            Host: example.com\r\n\r\n",
+        );
+
+        expect_parse_err!(&mut buf);
+    }
+
+    #[test]
+    fn transfer_encoding_agrees() {
+        let mut buf = BytesMut::from(
+            "GET /test HTTP/1.1\r\n\
+            Host: example.com\r\n\
+            Content-Length: 3\r\n\
+            Transfer-Encoding: identity\r\n\
+            \r\n\
+            0\r\n",
+        );
+
+        let mut reader = MessageDecoder::<Request>::default();
+        let (_msg, pl) = reader.decode(&mut buf).unwrap().unwrap();
+        let mut pl = pl.unwrap();
+
+        let chunk = pl.decode(&mut buf).unwrap().unwrap();
+        assert_eq!(chunk, PayloadItem::Chunk(Bytes::from_static(b"0\r\n")));
+    }
 }

actix-http/src/h1/encoder.rs

@@ -6,19 +6,21 @@ use std::{cmp, io};
 
 use bytes::{BufMut, BytesMut};
 
-use crate::body::BodySize;
-use crate::config::ServiceConfig;
-use crate::header::map;
-use crate::helpers;
-use crate::http::header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
-use crate::http::{HeaderMap, StatusCode, Version};
-use crate::message::{ConnectionType, RequestHeadType};
-use crate::response::Response;
+use crate::{
+    body::BodySize,
+    config::ServiceConfig,
+    header::{map::Value, HeaderMap, HeaderName},
+    header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING},
+    helpers,
+    message::{ConnectionType, RequestHeadType},
+    Response, StatusCode, Version,
+};
 
 const AVERAGE_HEADER_SIZE: usize = 30;
 
 #[derive(Debug)]
 pub(crate) struct MessageEncoder<T: MessageType> {
+    #[allow(dead_code)]
     pub length: BodySize,
     pub te: TransferEncoding,
     _phantom: PhantomData<T>,
@@ -54,7 +56,7 @@ pub(crate) trait MessageType: Sized {
         dst: &mut BytesMut,
         version: Version,
         mut length: BodySize,
-        ctype: ConnectionType,
+        conn_type: ConnectionType,
         config: &ServiceConfig,
     ) -> io::Result<()> {
         let chunked = self.chunked();
@@ -69,17 +71,27 @@ pub(crate) trait MessageType: Sized {
                 | StatusCode::PROCESSING
                 | StatusCode::NO_CONTENT => {
                     // skip content-length and transfer-encoding headers
-                    // See https://tools.ietf.org/html/rfc7230#section-3.3.1
+                    // see https://tools.ietf.org/html/rfc7230#section-3.3.1
                     // and https://tools.ietf.org/html/rfc7230#section-3.3.2
                     skip_len = true;
                     length = BodySize::None
                 }
+
+                StatusCode::NOT_MODIFIED => {
+                    // 304 responses should never have a body but should retain a manually set
+                    // content-length header see https://tools.ietf.org/html/rfc7232#section-4.1
+                    skip_len = false;
+                    length = BodySize::None;
+                }
+
                 _ => {}
             }
         }
+
         match length {
             BodySize::Stream => {
                 if chunked {
+                    skip_len = true;
                     if camel_case {
                         dst.put_slice(b"\r\nTransfer-Encoding: chunked\r\n")
                     } else {
@@ -90,19 +102,16 @@ pub(crate) trait MessageType: Sized {
                     dst.put_slice(b"\r\n");
                 }
             }
-            BodySize::Empty => {
-                if camel_case {
-                    dst.put_slice(b"\r\nContent-Length: 0\r\n");
-                } else {
-                    dst.put_slice(b"\r\ncontent-length: 0\r\n");
-                }
+            BodySize::Sized(0) if camel_case => {
+                dst.put_slice(b"\r\nContent-Length: 0\r\n")
             }
+            BodySize::Sized(0) => dst.put_slice(b"\r\ncontent-length: 0\r\n"),
             BodySize::Sized(len) => helpers::write_content_length(len, dst),
             BodySize::None => dst.put_slice(b"\r\n"),
         }
 
         // Connection
-        match ctype {
+        match conn_type {
             ConnectionType::Upgrade => dst.put_slice(b"connection: upgrade\r\n"),
             ConnectionType::KeepAlive if version < Version::HTTP_11 => {
                 if camel_case {
@@ -121,21 +130,11 @@ pub(crate) trait MessageType: Sized {
             _ => {}
         }
 
-        // merging headers from head and extra headers. HeaderMap::new() does not allocate.
-        let empty_headers = HeaderMap::new();
-        let extra_headers = self.extra_headers().unwrap_or(&empty_headers);
-        let headers = self
-            .headers()
-            .inner
-            .iter()
-            .filter(|(name, _)| !extra_headers.contains_key(*name))
-            .chain(extra_headers.inner.iter());
-
         // write headers
 
         let mut has_date = false;
 
-        let mut buf = dst.chunk_mut().as_mut_ptr() as *mut u8;
+        let mut buf = dst.chunk_mut().as_mut_ptr();
         let mut remaining = dst.capacity() - dst.len();
 
         // tracks bytes written since last buffer resize
@@ -143,10 +142,10 @@ pub(crate) trait MessageType: Sized {
         // container's knowledge, this is used to sync the containers cursor after data is written
         let mut pos = 0;
 
-        for (key, value) in headers {
+        self.write_headers(|key, value| {
             match *key {
-                CONNECTION => continue,
-                TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => continue,
+                CONNECTION => return,
+                TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => return,
                 DATE => has_date = true,
                 _ => {}
             }
@@ -154,106 +153,56 @@ pub(crate) trait MessageType: Sized {
             let k = key.as_str().as_bytes();
             let k_len = k.len();
 
-            match value {
-                map::Value::One(ref val) => {
-                    let v = val.as_ref();
-                    let v_len = v.len();
+            // TODO: drain?
+            for val in value.iter() {
+                let v = val.as_ref();
+                let v_len = v.len();
 
-                    // key length + value length + colon + space + \r\n
-                    let len = k_len + v_len + 4;
+                // key length + value length + colon + space + \r\n
+                let len = k_len + v_len + 4;
 
-                    if len > remaining {
-                        // not enough room in buffer for this header; reserve more space
-
-                        // SAFETY: all the bytes written up to position "pos" are initialized
-                        // the written byte count and pointer advancement are kept in sync
-                        unsafe {
-                            dst.advance_mut(pos);
-                        }
-
-                        pos = 0;
-                        dst.reserve(len * 2);
-                        remaining = dst.capacity() - dst.len();
-
-                        // re-assign buf raw pointer since it's possible that the buffer was
-                        // reallocated and/or resized
-                        buf = dst.chunk_mut().as_mut_ptr() as *mut u8;
-                    }
-
-                    // SAFETY: on each write, it is enough to ensure that the advancement of the
-                    // cursor matches the number of bytes written
+                if len > remaining {
+                    // SAFETY: all the bytes written up to position "pos" are initialized
+                    // the written byte count and pointer advancement are kept in sync
                     unsafe {
-                        // use upper Camel-Case
-                        if camel_case {
-                            write_camel_case(k, from_raw_parts_mut(buf, k_len))
-                        } else {
-                            write_data(k, buf, k_len)
-                        }
-
-                        buf = buf.add(k_len);
-
-                        write_data(b": ", buf, 2);
-                        buf = buf.add(2);
-
-                        write_data(v, buf, v_len);
-                        buf = buf.add(v_len);
-
-                        write_data(b"\r\n", buf, 2);
-                        buf = buf.add(2);
+                        dst.advance_mut(pos);
                     }
 
-                    pos += len;
-                    remaining -= len;
+                    pos = 0;
+                    dst.reserve(len * 2);
+                    remaining = dst.capacity() - dst.len();
+
+                    // re-assign buf raw pointer since it's possible that the buffer was
+                    // reallocated and/or resized
+                    buf = dst.chunk_mut().as_mut_ptr();
                 }
 
-                map::Value::Multi(ref vec) => {
-                    for val in vec {
-                        let v = val.as_ref();
-                        let v_len = v.len();
-                        let len = k_len + v_len + 4;
-
-                        if len > remaining {
-                            // SAFETY: all the bytes written up to position "pos" are initialized
-                            // the written byte count and pointer advancement are kept in sync
-                            unsafe {
-                                dst.advance_mut(pos);
-                            }
-                            pos = 0;
-                            dst.reserve(len * 2);
-                            remaining = dst.capacity() - dst.len();
-
-                            // re-assign buf raw pointer since it's possible that the buffer was
-                            // reallocated and/or resized
-                            buf = dst.chunk_mut().as_mut_ptr() as *mut u8;
-                        }
-
-                        // SAFETY: on each write, it is enough to ensure that the advancement of
-                        // the cursor matches the number of bytes written
-                        unsafe {
-                            if camel_case {
-                                write_camel_case(k, from_raw_parts_mut(buf, k_len));
-                            } else {
-                                write_data(k, buf, k_len);
-                            }
-
-                            buf = buf.add(k_len);
-
-                            write_data(b": ", buf, 2);
-                            buf = buf.add(2);
-
-                            write_data(v, buf, v_len);
-                            buf = buf.add(v_len);
-
-                            write_data(b"\r\n", buf, 2);
-                            buf = buf.add(2);
-                        };
-
-                        pos += len;
-                        remaining -= len;
+                // SAFETY: on each write, it is enough to ensure that the advancement of
+                // the cursor matches the number of bytes written
+                unsafe {
+                    if camel_case {
+                        // use Camel-Case headers
+                        write_camel_case(k, buf, k_len);
+                    } else {
+                        write_data(k, buf, k_len);
                     }
-                }
+
+                    buf = buf.add(k_len);
+
+                    write_data(b": ", buf, 2);
+                    buf = buf.add(2);
+
+                    write_data(v, buf, v_len);
+                    buf = buf.add(v_len);
+
+                    write_data(b"\r\n", buf, 2);
+                    buf = buf.add(2);
+                };
+
+                pos += len;
+                remaining -= len;
             }
-        }
+        });
 
         // final cursor synchronization with the bytes container
         //
@@ -273,6 +222,24 @@ pub(crate) trait MessageType: Sized {
 
         Ok(())
     }
+
+    fn write_headers<F>(&mut self, mut f: F)
+    where
+        F: FnMut(&HeaderName, &Value),
+    {
+        match self.extra_headers() {
+            Some(headers) => {
+                // merging headers from head and extra headers.
+                self.headers()
+                    .inner
+                    .iter()
+                    .filter(|(name, _)| !headers.contains_key(*name))
+                    .chain(headers.inner.iter())
+                    .for_each(|(k, v)| f(k, v))
+            }
+            None => self.headers().inner.iter().for_each(|(k, v)| f(k, v)),
+        }
+    }
 }
 
 impl MessageType for Response<()> {
@@ -329,7 +296,7 @@ impl MessageType for RequestHeadType {
         let head = self.as_ref();
         dst.reserve(256 + head.headers.len() * AVERAGE_HEADER_SIZE);
         write!(
-            Writer(dst),
+            helpers::MutWriter(dst),
             "{} {} {}",
             head.method,
             head.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
@@ -369,13 +336,13 @@ impl<T: MessageType> MessageEncoder<T> {
         stream: bool,
         version: Version,
         length: BodySize,
-        ctype: ConnectionType,
+        conn_type: ConnectionType,
         config: &ServiceConfig,
     ) -> io::Result<()> {
         // transfer encoding
         if !head {
             self.te = match length {
-                BodySize::Empty => TransferEncoding::empty(),
+                BodySize::Sized(0) => TransferEncoding::empty(),
                 BodySize::Sized(len) => TransferEncoding::length(len),
                 BodySize::Stream => {
                     if message.chunked() && !stream {
@@ -391,7 +358,7 @@ impl<T: MessageType> MessageEncoder<T> {
         }
 
         message.encode_status(dst)?;
-        message.encode_headers(dst, version, length, ctype, config)
+        message.encode_headers(dst, version, length, conn_type, config)
     }
 }
 
@@ -405,10 +372,12 @@ pub(crate) struct TransferEncoding {
 enum TransferEncodingKind {
     /// An Encoder for when Transfer-Encoding includes `chunked`.
     Chunked(bool),
+
     /// An Encoder for when Content-Length is set.
     ///
     /// Enforces that the body is not longer than the Content-Length header.
     Length(u64),
+
     /// An Encoder for when Content-Length is not known.
     ///
     /// Application decides when to stop writing.
@@ -462,7 +431,7 @@ impl TransferEncoding {
                     *eof = true;
                     buf.extend_from_slice(b"0\r\n\r\n");
                 } else {
-                    writeln!(Writer(buf), "{:X}\r", msg.len())
+                    writeln!(helpers::MutWriter(buf), "{:X}\r", msg.len())
                         .map_err(|e| io::Error::new(io::ErrorKind::Other, e))?;
 
                     buf.reserve(msg.len() + 2);
@@ -512,28 +481,23 @@ impl TransferEncoding {
     }
 }
 
-struct Writer<'a>(pub &'a mut BytesMut);
-
-impl<'a> io::Write for Writer<'a> {
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.0.extend_from_slice(buf);
-        Ok(buf.len())
-    }
-    fn flush(&mut self) -> io::Result<()> {
-        Ok(())
-    }
-}
-
 /// # Safety
-/// Callers must ensure that the given length matches given value length.
+/// Callers must ensure that the given `len` matches the given `value` length and that `buf` is
+/// valid for writes of at least `len` bytes.
 unsafe fn write_data(value: &[u8], buf: *mut u8, len: usize) {
     debug_assert_eq!(value.len(), len);
     copy_nonoverlapping(value.as_ptr(), buf, len);
 }
 
-fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
+/// # Safety
+/// Callers must ensure that the given `len` matches the given `value` length and that `buf` is
+/// valid for writes of at least `len` bytes.
+unsafe fn write_camel_case(value: &[u8], buf: *mut u8, len: usize) {
     // first copy entire (potentially wrong) slice to output
-    buffer[..value.len()].copy_from_slice(value);
+    write_data(value, buf, len);
+
+    // SAFETY: We just initialized the buffer with `value`
+    let buffer = from_raw_parts_mut(buf, len);
 
     let mut iter = value.iter();
 
@@ -583,8 +547,8 @@ mod tests {
         );
     }
 
-    #[test]
-    fn test_camel_case() {
+    #[actix_rt::test]
+    async fn test_camel_case() {
         let mut bytes = BytesMut::with_capacity(2048);
         let mut head = RequestHead::default();
         head.set_camel_case_headers(true);
@@ -597,13 +561,12 @@ mod tests {
         let _ = head.encode_headers(
             &mut bytes,
             Version::HTTP_11,
-            BodySize::Empty,
+            BodySize::Sized(0),
             ConnectionType::Close,
             &ServiceConfig::default(),
         );
         let data =
             String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
-        eprintln!("{}", &data);
 
         assert!(data.contains("Content-Length: 0\r\n"));
         assert!(data.contains("Connection: close\r\n"));
@@ -647,8 +610,8 @@ mod tests {
         assert!(data.contains("date: date\r\n"));
     }
 
-    #[test]
-    fn test_extra_headers() {
+    #[actix_rt::test]
+    async fn test_extra_headers() {
         let mut bytes = BytesMut::with_capacity(2048);
 
         let mut head = RequestHead::default();
@@ -669,7 +632,7 @@ mod tests {
         let _ = head.encode_headers(
             &mut bytes,
             Version::HTTP_11,
-            BodySize::Empty,
+            BodySize::Sized(0),
             ConnectionType::Close,
             &ServiceConfig::default(),
         );
@@ -681,16 +644,14 @@ mod tests {
         assert!(data.contains("date: date\r\n"));
     }
 
-    #[test]
-    fn test_no_content_length() {
+    #[actix_rt::test]
+    async fn test_no_content_length() {
         let mut bytes = BytesMut::with_capacity(2048);
 
-        let mut res: Response<()> =
-            Response::new(StatusCode::SWITCHING_PROTOCOLS).into_body::<()>();
+        let mut res = Response::with_body(StatusCode::SWITCHING_PROTOCOLS, ());
+        res.headers_mut().insert(DATE, HeaderValue::from_static(""));
         res.headers_mut()
-            .insert(DATE, HeaderValue::from_static(&""));
-        res.headers_mut()
-            .insert(CONTENT_LENGTH, HeaderValue::from_static(&"0"));
+            .insert(CONTENT_LENGTH, HeaderValue::from_static("0"));
 
         let _ = res.encode_headers(
             &mut bytes,

actix-http/src/h1/expect.rs

@@ -1,7 +1,5 @@
-use std::task::{Context, Poll};
-
 use actix_service::{Service, ServiceFactory};
-use futures_util::future::{ready, Ready};
+use actix_utils::future::{ready, Ready};
 
 use crate::error::Error;
 use crate::request::Request;
@@ -26,11 +24,9 @@ impl Service<Request> for ExpectHandler {
     type Error = Error;
     type Future = Ready<Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        Poll::Ready(Ok(()))
-    }
+    actix_service::always_ready!();
 
-    fn call(&mut self, req: Request) -> Self::Future {
+    fn call(&self, req: Request) -> Self::Future {
         ready(Ok(req))
         // TODO: add some way to trigger error
         // Err(error::ErrorExpectationFailed("test"))

actix-http/src/h1/mod.rs

@@ -1,6 +1,8 @@
-//! HTTP/1 implementation
+//! HTTP/1 protocol implementation.
+
 use bytes::{Bytes, BytesMut};
 
+mod chunked;
 mod client;
 mod codec;
 mod decoder;

actix-http/src/h1/payload.rs

@@ -3,9 +3,8 @@ use std::cell::RefCell;
 use std::collections::VecDeque;
 use std::pin::Pin;
 use std::rc::{Rc, Weak};
-use std::task::{Context, Poll};
+use std::task::{Context, Poll, Waker};
 
-use actix_utils::task::LocalWaker;
 use bytes::Bytes;
 use futures_core::Stream;
 
@@ -134,7 +133,7 @@ impl PayloadSender {
             if shared.borrow().need_read {
                 PayloadStatus::Read
             } else {
-                shared.borrow_mut().io_task.register(cx.waker());
+                shared.borrow_mut().register_io(cx);
                 PayloadStatus::Pause
             }
         } else {
@@ -150,8 +149,8 @@ struct Inner {
     err: Option<PayloadError>,
     need_read: bool,
     items: VecDeque<Bytes>,
-    task: LocalWaker,
-    io_task: LocalWaker,
+    task: Option<Waker>,
+    io_task: Option<Waker>,
 }
 
 impl Inner {
@@ -162,8 +161,46 @@ impl Inner {
             err: None,
             items: VecDeque::new(),
             need_read: true,
-            task: LocalWaker::new(),
-            io_task: LocalWaker::new(),
+            task: None,
+            io_task: None,
+        }
+    }
+
+    /// Wake up future waiting for payload data to be available.
+    fn wake(&mut self) {
+        if let Some(waker) = self.task.take() {
+            waker.wake();
+        }
+    }
+
+    /// Wake up future feeding data to Payload.
+    fn wake_io(&mut self) {
+        if let Some(waker) = self.io_task.take() {
+            waker.wake();
+        }
+    }
+
+    /// Register future waiting data from payload.
+    /// Waker would be used in `Inner::wake`
+    fn register(&mut self, cx: &mut Context<'_>) {
+        if self
+            .task
+            .as_ref()
+            .map_or(true, |w| !cx.waker().will_wake(w))
+        {
+            self.task = Some(cx.waker().clone());
+        }
+    }
+
+    // Register future feeding data to payload.
+    /// Waker would be used in `Inner::wake_io`
+    fn register_io(&mut self, cx: &mut Context<'_>) {
+        if self
+            .io_task
+            .as_ref()
+            .map_or(true, |w| !cx.waker().will_wake(w))
+        {
+            self.io_task = Some(cx.waker().clone());
         }
     }
 
@@ -182,7 +219,7 @@ impl Inner {
         self.len += data.len();
         self.items.push_back(data);
         self.need_read = self.len < MAX_BUFFER_SIZE;
-        self.task.wake();
+        self.wake();
     }
 
     #[cfg(test)]
@@ -199,9 +236,9 @@ impl Inner {
             self.need_read = self.len < MAX_BUFFER_SIZE;
 
             if self.need_read && !self.eof {
-                self.task.register(cx.waker());
+                self.register(cx);
             }
-            self.io_task.wake();
+            self.wake_io();
             Poll::Ready(Some(Ok(data)))
         } else if let Some(err) = self.err.take() {
             Poll::Ready(Some(Err(err)))
@@ -209,8 +246,8 @@ impl Inner {
             Poll::Ready(None)
         } else {
             self.need_read = true;
-            self.task.register(cx.waker());
-            self.io_task.wake();
+            self.register(cx);
+            self.wake_io();
             Poll::Pending
         }
     }
@@ -224,7 +261,7 @@ impl Inner {
 #[cfg(test)]
 mod tests {
     use super::*;
-    use futures_util::future::poll_fn;
+    use actix_utils::future::poll_fn;
 
     #[actix_rt::test]
     async fn test_unread_data() {

actix-http/src/h1/service.rs

@@ -1,28 +1,29 @@
-use std::cell::RefCell;
-use std::future::Future;
-use std::marker::PhantomData;
-use std::pin::Pin;
-use std::rc::Rc;
-use std::task::{Context, Poll};
-use std::{fmt, net};
+use std::{
+    error::Error as StdError,
+    fmt,
+    marker::PhantomData,
+    net,
+    rc::Rc,
+    task::{Context, Poll},
+};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_rt::net::TcpStream;
-use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
-use futures_core::ready;
-use futures_util::future::ready;
+use actix_service::{
+    fn_service, IntoServiceFactory, Service, ServiceFactory, ServiceFactoryExt as _,
+};
+use actix_utils::future::ready;
+use futures_core::future::LocalBoxFuture;
 
-use crate::body::MessageBody;
-use crate::config::ServiceConfig;
-use crate::error::{DispatchError, Error};
-use crate::request::Request;
-use crate::response::Response;
-use crate::service::HttpFlow;
-use crate::{ConnectCallback, OnConnectData};
+use crate::{
+    body::{AnyBody, MessageBody},
+    config::ServiceConfig,
+    error::DispatchError,
+    service::HttpServiceHandler,
+    ConnectCallback, OnConnectData, Request, Response,
+};
 
-use super::codec::Codec;
-use super::dispatcher::Dispatcher;
-use super::{ExpectHandler, UpgradeHandler};
+use super::{codec::Codec, dispatcher::Dispatcher, ExpectHandler, UpgradeHandler};
 
 /// `ServiceFactory` implementation for HTTP1 transport
 pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler> {
@@ -37,7 +38,7 @@ pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler> {
 impl<T, S, B> H1Service<T, S, B>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error>,
+    S::Error: Into<Response<AnyBody>>,
     S::InitError: fmt::Debug,
     S::Response: Into<Response<B>>,
     B: MessageBody,
@@ -61,15 +62,22 @@ where
 impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error>,
+    S::Future: 'static,
+    S::Error: Into<Response<AnyBody>>,
     S::InitError: fmt::Debug,
     S::Response: Into<Response<B>>,
+
     B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
+
     X: ServiceFactory<Request, Config = (), Response = Request>,
-    X::Error: Into<Error>,
+    X::Future: 'static,
+    X::Error: Into<Response<AnyBody>>,
     X::InitError: fmt::Debug,
+
     U: ServiceFactory<(Request, Framed<TcpStream, Codec>), Config = (), Response = ()>,
-    U::Error: fmt::Display + Into<Error>,
+    U::Future: 'static,
+    U::Error: fmt::Display + Into<Response<AnyBody>>,
     U::InitError: fmt::Debug,
 {
     /// Create simple tcp stream service
@@ -82,7 +90,7 @@ where
         Error = DispatchError,
         InitError = (),
     > {
-        pipeline_factory(|io: TcpStream| {
+        fn_service(|io: TcpStream| {
             let peer_addr = io.peer_addr().ok();
             ready(Ok((io, peer_addr)))
         })
@@ -94,29 +102,37 @@ where
 mod openssl {
     use super::*;
 
-    use actix_service::ServiceFactoryExt;
-    use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, SslStream};
-    use actix_tls::accept::TlsError;
+    use actix_tls::accept::{
+        openssl::{Acceptor, SslAcceptor, SslError, TlsStream},
+        TlsError,
+    };
 
-    impl<S, B, X, U> H1Service<SslStream<TcpStream>, S, B, X, U>
+    impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
     where
         S: ServiceFactory<Request, Config = ()>,
-        S::Error: Into<Error>,
+        S::Future: 'static,
+        S::Error: Into<Response<AnyBody>>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
+
         B: MessageBody,
+        B::Error: Into<Box<dyn StdError>>,
+
         X: ServiceFactory<Request, Config = (), Response = Request>,
-        X::Error: Into<Error>,
+        X::Future: 'static,
+        X::Error: Into<Response<AnyBody>>,
         X::InitError: fmt::Debug,
+
         U: ServiceFactory<
-            (Request, Framed<SslStream<TcpStream>, Codec>),
+            (Request, Framed<TlsStream<TcpStream>, Codec>),
             Config = (),
             Response = (),
         >,
-        U::Error: fmt::Display + Into<Error>,
+        U::Future: 'static,
+        U::Error: fmt::Display + Into<Response<AnyBody>>,
         U::InitError: fmt::Debug,
     {
-        /// Create openssl based service
+        /// Create OpenSSL based service.
         pub fn openssl(
             self,
             acceptor: SslAcceptor,
@@ -127,47 +143,59 @@ mod openssl {
             Error = TlsError<SslError, DispatchError>,
             InitError = (),
         > {
-            pipeline_factory(
-                Acceptor::new(acceptor)
-                    .map_err(TlsError::Tls)
-                    .map_init_err(|_| panic!()),
-            )
-            .and_then(|io: SslStream<TcpStream>| {
-                let peer_addr = io.get_ref().peer_addr().ok();
-                ready(Ok((io, peer_addr)))
-            })
-            .and_then(self.map_err(TlsError::Service))
+            Acceptor::new(acceptor)
+                .map_init_err(|_| {
+                    unreachable!("TLS acceptor service factory does not error on init")
+                })
+                .map_err(TlsError::into_service_error)
+                .map(|io: TlsStream<TcpStream>| {
+                    let peer_addr = io.get_ref().peer_addr().ok();
+                    (io, peer_addr)
+                })
+                .and_then(self.map_err(TlsError::Service))
         }
     }
 }
 
 #[cfg(feature = "rustls")]
 mod rustls {
+
+    use std::io;
+
+    use actix_service::ServiceFactoryExt as _;
+    use actix_tls::accept::{
+        rustls::{Acceptor, ServerConfig, TlsStream},
+        TlsError,
+    };
+
     use super::*;
-    use actix_service::ServiceFactoryExt;
-    use actix_tls::accept::rustls::{Acceptor, ServerConfig, TlsStream};
-    use actix_tls::accept::TlsError;
-    use std::{fmt, io};
 
     impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
     where
         S: ServiceFactory<Request, Config = ()>,
-        S::Error: Into<Error>,
+        S::Future: 'static,
+        S::Error: Into<Response<AnyBody>>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
+
         B: MessageBody,
+        B::Error: Into<Box<dyn StdError>>,
+
         X: ServiceFactory<Request, Config = (), Response = Request>,
-        X::Error: Into<Error>,
+        X::Future: 'static,
+        X::Error: Into<Response<AnyBody>>,
         X::InitError: fmt::Debug,
+
         U: ServiceFactory<
             (Request, Framed<TlsStream<TcpStream>, Codec>),
             Config = (),
             Response = (),
         >,
-        U::Error: fmt::Display + Into<Error>,
+        U::Future: 'static,
+        U::Error: fmt::Display + Into<Response<AnyBody>>,
         U::InitError: fmt::Debug,
     {
-        /// Create rustls based service
+        /// Create Rustls based service.
         pub fn rustls(
             self,
             config: ServerConfig,
@@ -178,16 +206,16 @@ mod rustls {
             Error = TlsError<io::Error, DispatchError>,
             InitError = (),
         > {
-            pipeline_factory(
-                Acceptor::new(config)
-                    .map_err(TlsError::Tls)
-                    .map_init_err(|_| panic!()),
-            )
-            .and_then(|io: TlsStream<TcpStream>| {
-                let peer_addr = io.get_ref().0.peer_addr().ok();
-                ready(Ok((io, peer_addr)))
-            })
-            .and_then(self.map_err(TlsError::Service))
+            Acceptor::new(config)
+                .map_init_err(|_| {
+                    unreachable!("TLS acceptor service factory does not error on init")
+                })
+                .map_err(TlsError::into_service_error)
+                .map(|io: TlsStream<TcpStream>| {
+                    let peer_addr = io.get_ref().0.peer_addr().ok();
+                    (io, peer_addr)
+                })
+                .and_then(self.map_err(TlsError::Service))
         }
     }
 }
@@ -195,7 +223,7 @@ mod rustls {
 impl<T, S, B, X, U> H1Service<T, S, B, X, U>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error>,
+    S::Error: Into<Response<AnyBody>>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
     B: MessageBody,
@@ -203,7 +231,7 @@ where
     pub fn expect<X1>(self, expect: X1) -> H1Service<T, S, B, X1, U>
     where
         X1: ServiceFactory<Request, Response = Request>,
-        X1::Error: Into<Error>,
+        X1::Error: Into<Response<AnyBody>>,
         X1::InitError: fmt::Debug,
     {
         H1Service {
@@ -242,17 +270,25 @@ where
 impl<T, S, B, X, U> ServiceFactory<(T, Option<net::SocketAddr>)>
     for H1Service<T, S, B, X, U>
 where
-    T: AsyncRead + AsyncWrite + Unpin,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
+
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error>,
+    S::Future: 'static,
+    S::Error: Into<Response<AnyBody>>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
+
     B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
+
     X: ServiceFactory<Request, Config = (), Response = Request>,
-    X::Error: Into<Error>,
+    X::Future: 'static,
+    X::Error: Into<Response<AnyBody>>,
     X::InitError: fmt::Debug,
+
     U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
-    U::Error: fmt::Display + Into<Error>,
+    U::Future: 'static,
+    U::Error: fmt::Display + Into<Response<AnyBody>>,
     U::InitError: fmt::Debug,
 {
     type Response = ();
@@ -260,207 +296,78 @@ where
     type Config = ();
     type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
     type InitError = ();
-    type Future = H1ServiceResponse<T, S, B, X, U>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
-        H1ServiceResponse {
-            fut: self.srv.new_service(()),
-            fut_ex: Some(self.expect.new_service(())),
-            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
-            expect: None,
-            upgrade: None,
-            on_connect_ext: self.on_connect_ext.clone(),
-            cfg: Some(self.cfg.clone()),
-            _phantom: PhantomData,
-        }
-    }
-}
+        let service = self.srv.new_service(());
+        let expect = self.expect.new_service(());
+        let upgrade = self.upgrade.as_ref().map(|s| s.new_service(()));
+        let on_connect_ext = self.on_connect_ext.clone();
+        let cfg = self.cfg.clone();
 
-#[doc(hidden)]
-#[pin_project::pin_project]
-pub struct H1ServiceResponse<T, S, B, X, U>
-where
-    S: ServiceFactory<Request>,
-    S::Error: Into<Error>,
-    S::InitError: fmt::Debug,
-    X: ServiceFactory<Request, Response = Request>,
-    X::Error: Into<Error>,
-    X::InitError: fmt::Debug,
-    U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
-    U::InitError: fmt::Debug,
-{
-    #[pin]
-    fut: S::Future,
-    #[pin]
-    fut_ex: Option<X::Future>,
-    #[pin]
-    fut_upg: Option<U::Future>,
-    expect: Option<X::Service>,
-    upgrade: Option<U::Service>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    cfg: Option<ServiceConfig>,
-    _phantom: PhantomData<B>,
-}
+        Box::pin(async move {
+            let expect = expect
+                .await
+                .map_err(|e| log::error!("Init http expect service error: {:?}", e))?;
 
-impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
-where
-    T: AsyncRead + AsyncWrite + Unpin,
-    S: ServiceFactory<Request>,
-    S::Error: Into<Error>,
-    S::Response: Into<Response<B>>,
-    S::InitError: fmt::Debug,
-    B: MessageBody,
-    X: ServiceFactory<Request, Response = Request>,
-    X::Error: Into<Error>,
-    X::InitError: fmt::Debug,
-    U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
-    U::InitError: fmt::Debug,
-{
-    type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
+            let upgrade = match upgrade {
+                Some(upgrade) => {
+                    let upgrade = upgrade.await.map_err(|e| {
+                        log::error!("Init http upgrade service error: {:?}", e)
+                    })?;
+                    Some(upgrade)
+                }
+                None => None,
+            };
 
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let mut this = self.as_mut().project();
+            let service = service
+                .await
+                .map_err(|e| log::error!("Init http service error: {:?}", e))?;
 
-        if let Some(fut) = this.fut_ex.as_pin_mut() {
-            let expect = ready!(fut
-                .poll(cx)
-                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
-            this = self.as_mut().project();
-            *this.expect = Some(expect);
-            this.fut_ex.set(None);
-        }
-
-        if let Some(fut) = this.fut_upg.as_pin_mut() {
-            let upgrade = ready!(fut
-                .poll(cx)
-                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
-            this = self.as_mut().project();
-            *this.upgrade = Some(upgrade);
-            this.fut_upg.set(None);
-        }
-
-        let result = ready!(this
-            .fut
-            .poll(cx)
-            .map_err(|e| log::error!("Init http service error: {:?}", e)));
-
-        Poll::Ready(result.map(|service| {
-            let this = self.as_mut().project();
-
-            H1ServiceHandler::new(
-                this.cfg.take().unwrap(),
+            Ok(H1ServiceHandler::new(
+                cfg,
                 service,
-                this.expect.take().unwrap(),
-                this.upgrade.take(),
-                this.on_connect_ext.clone(),
-            )
-        }))
+                expect,
+                upgrade,
+                on_connect_ext,
+            ))
+        })
     }
 }
 
 /// `Service` implementation for HTTP/1 transport
-pub struct H1ServiceHandler<T, S, B, X, U>
-where
-    S: Service<Request>,
-    X: Service<Request>,
-    U: Service<(Request, Framed<T, Codec>)>,
-{
-    flow: Rc<RefCell<HttpFlow<S, X, U>>>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    cfg: ServiceConfig,
-    _phantom: PhantomData<B>,
-}
-
-impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
-where
-    S: Service<Request>,
-    S::Error: Into<Error>,
-    S::Response: Into<Response<B>>,
-    B: MessageBody,
-    X: Service<Request, Response = Request>,
-    X::Error: Into<Error>,
-    U: Service<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
-{
-    fn new(
-        cfg: ServiceConfig,
-        service: S,
-        expect: X,
-        upgrade: Option<U>,
-        on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    ) -> H1ServiceHandler<T, S, B, X, U> {
-        H1ServiceHandler {
-            flow: HttpFlow::new(service, expect, upgrade),
-            cfg,
-            on_connect_ext,
-            _phantom: PhantomData,
-        }
-    }
-}
+pub type H1ServiceHandler<T, S, B, X, U> = HttpServiceHandler<T, S, B, X, U>;
 
 impl<T, S, B, X, U> Service<(T, Option<net::SocketAddr>)>
-    for H1ServiceHandler<T, S, B, X, U>
+    for HttpServiceHandler<T, S, B, X, U>
 where
     T: AsyncRead + AsyncWrite + Unpin,
+
     S: Service<Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Response<AnyBody>>,
     S::Response: Into<Response<B>>,
+
     B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
+
     X: Service<Request, Response = Request>,
-    X::Error: Into<Error>,
+    X::Error: Into<Response<AnyBody>>,
+
     U: Service<(Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display + Into<Error>,
+    U::Error: fmt::Display + Into<Response<AnyBody>>,
 {
     type Response = ();
     type Error = DispatchError;
     type Future = Dispatcher<T, S, B, X, U>;
 
-    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        let mut flow = self.flow.borrow_mut();
-        let ready = flow
-            .expect
-            .poll_ready(cx)
-            .map_err(|e| {
-                let e = e.into();
-                log::error!("Http service readiness error: {:?}", e);
-                DispatchError::Service(e)
-            })?
-            .is_ready();
-
-        let ready = flow
-            .service
-            .poll_ready(cx)
-            .map_err(|e| {
-                let e = e.into();
-                log::error!("Http service readiness error: {:?}", e);
-                DispatchError::Service(e)
-            })?
-            .is_ready()
-            && ready;
-
-        let ready = if let Some(ref mut upg) = flow.upgrade {
-            upg.poll_ready(cx)
-                .map_err(|e| {
-                    let e = e.into();
-                    log::error!("Http service readiness error: {:?}", e);
-                    DispatchError::Service(e)
-                })?
-                .is_ready()
-                && ready
-        } else {
-            ready
-        };
-
-        if ready {
-            Poll::Ready(Ok(()))
-        } else {
-            Poll::Pending
-        }
+    fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        self._poll_ready(cx).map_err(|e| {
+            log::error!("HTTP/1 service readiness error: {:?}", e);
+            DispatchError::Service(e)
+        })
     }
 
-    fn call(&mut self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
+    fn call(&self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
         let on_connect_data =
             OnConnectData::from_io(&io, self.on_connect_ext.as_deref());
 

actix-http/src/h1/upgrade.rs

@@ -1,8 +1,6 @@
-use std::task::{Context, Poll};
-
 use actix_codec::Framed;
 use actix_service::{Service, ServiceFactory};
-use futures_util::future::{ready, Ready};
+use futures_core::future::LocalBoxFuture;
 
 use crate::error::Error;
 use crate::h1::Codec;
@@ -16,7 +14,7 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
     type Config = ();
     type Service = UpgradeHandler;
     type InitError = Error;
-    type Future = Ready<Result<Self::Service, Self::InitError>>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
         unimplemented!()
@@ -26,13 +24,11 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
 impl<T> Service<(Request, Framed<T, Codec>)> for UpgradeHandler {
     type Response = ();
     type Error = Error;
-    type Future = Ready<Result<Self::Response, Self::Error>>;
+    type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        Poll::Ready(Ok(()))
-    }
+    actix_service::always_ready!();
 
-    fn call(&mut self, _: (Request, Framed<T, Codec>)) -> Self::Future {
-        ready(Ok(()))
+    fn call(&self, _: (Request, Framed<T, Codec>)) -> Self::Future {
+        unimplemented!()
     }
 }

actix-http/src/h1/utils.rs

@@ -4,7 +4,7 @@ use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 
-use crate::body::{BodySize, MessageBody, ResponseBody};
+use crate::body::{BodySize, MessageBody};
 use crate::error::Error;
 use crate::h1::{Codec, Message};
 use crate::response::Response;
@@ -14,7 +14,7 @@ use crate::response::Response;
 pub struct SendResponse<T, B> {
     res: Option<Message<(Response<()>, BodySize)>>,
     #[pin]
-    body: Option<ResponseBody<B>>,
+    body: Option<B>,
     #[pin]
     framed: Option<Framed<T, Codec>>,
 }
@@ -22,6 +22,7 @@ pub struct SendResponse<T, B> {
 impl<T, B> SendResponse<T, B>
 where
     B: MessageBody,
+    B::Error: Into<Error>,
 {
     pub fn new(framed: Framed<T, Codec>, response: Response<B>) -> Self {
         let (res, body) = response.into_parts();
@@ -38,6 +39,7 @@ impl<T, B> Future for SendResponse<T, B>
 where
     T: AsyncRead + AsyncWrite + Unpin,
     B: MessageBody + Unpin,
+    B::Error: Into<Error>,
 {
     type Output = Result<Framed<T, Codec>, Error>;
 
@@ -60,7 +62,17 @@ where
                         .unwrap()
                         .is_write_buf_full()
                 {
-                    match this.body.as_mut().as_pin_mut().unwrap().poll_next(cx)? {
+                    let next =
+                        match this.body.as_mut().as_pin_mut().unwrap().poll_next(cx) {
+                            Poll::Ready(Some(Ok(item))) => Poll::Ready(Some(item)),
+                            Poll::Ready(Some(Err(err))) => {
+                                return Poll::Ready(Err(err.into()))
+                            }
+                            Poll::Ready(None) => Poll::Ready(None),
+                            Poll::Pending => Poll::Pending,
+                        };
+
+                    match next {
                         Poll::Ready(item) => {
                             // body is done when item is None
                             body_done = item.is_none();
@@ -68,7 +80,9 @@ where
                                 let _ = this.body.take();
                             }
                             let framed = this.framed.as_mut().as_pin_mut().unwrap();
-                            framed.write(Message::Chunk(item))?;
+                            framed.write(Message::Chunk(item)).map_err(|err| {
+                                Error::new_send_response().with_cause(err)
+                            })?;
                         }
                         Poll::Pending => body_ready = false,
                     }
@@ -79,7 +93,10 @@ where
 
             // flush write buffer
             if !framed.is_write_buf_empty() {
-                match framed.flush(cx)? {
+                match framed
+                    .flush(cx)
+                    .map_err(|err| Error::new_send_response().with_cause(err))?
+                {
                     Poll::Ready(_) => {
                         if body_ready {
                             continue;
@@ -93,7 +110,9 @@ where
 
             // send response
             if let Some(res) = this.res.take() {
-                framed.write(res)?;
+                framed
+                    .write(res)
+                    .map_err(|err| Error::new_send_response().with_cause(err))?;
                 continue;
             }
 

actix-http/src/h2/dispatcher.rs

@@ -1,132 +1,112 @@
-use std::cell::RefCell;
-use std::future::Future;
-use std::marker::PhantomData;
-use std::net;
-use std::pin::Pin;
-use std::rc::Rc;
-use std::task::{Context, Poll};
-use std::{cmp, convert::TryFrom};
+use std::{
+    cmp,
+    error::Error as StdError,
+    future::Future,
+    marker::PhantomData,
+    net,
+    pin::Pin,
+    rc::Rc,
+    task::{Context, Poll},
+};
 
 use actix_codec::{AsyncRead, AsyncWrite};
-use actix_rt::time::{Instant, Sleep};
+use actix_rt::time::Sleep;
 use actix_service::Service;
+use actix_utils::future::poll_fn;
 use bytes::{Bytes, BytesMut};
 use futures_core::ready;
-use h2::server::{Connection, SendResponse};
-use h2::SendStream;
+use h2::{
+    server::{Connection, SendResponse},
+    Ping, PingPong,
+};
 use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
 use log::{error, trace};
+use pin_project_lite::pin_project;
 
-use crate::body::{BodySize, MessageBody, ResponseBody};
-use crate::config::ServiceConfig;
-use crate::error::{DispatchError, Error};
-use crate::message::ResponseHead;
-use crate::payload::Payload;
-use crate::request::Request;
-use crate::response::Response;
-use crate::service::HttpFlow;
-use crate::OnConnectData;
+use crate::{
+    body::{AnyBody, BodySize, MessageBody},
+    config::ServiceConfig,
+    service::HttpFlow,
+    OnConnectData, Payload, Request, Response, ResponseHead,
+};
 
 const CHUNK_SIZE: usize = 16_384;
 
-/// Dispatcher for HTTP/2 protocol.
-#[pin_project::pin_project]
-pub struct Dispatcher<T, S, B, X, U>
-where
-    T: AsyncRead + AsyncWrite + Unpin,
-    S: Service<Request>,
-    B: MessageBody,
-{
-    flow: Rc<RefCell<HttpFlow<S, X, U>>>,
-    connection: Connection<T, Bytes>,
-    on_connect_data: OnConnectData,
-    config: ServiceConfig,
-    peer_addr: Option<net::SocketAddr>,
-    ka_expire: Instant,
-    ka_timer: Option<Sleep>,
-    _phantom: PhantomData<B>,
+pin_project! {
+    /// Dispatcher for HTTP/2 protocol.
+    pub struct Dispatcher<T, S, B, X, U> {
+        flow: Rc<HttpFlow<S, X, U>>,
+        connection: Connection<T, Bytes>,
+        on_connect_data: OnConnectData,
+        config: ServiceConfig,
+        peer_addr: Option<net::SocketAddr>,
+        ping_pong: Option<H2PingPong>,
+        _phantom: PhantomData<B>
+    }
 }
 
 impl<T, S, B, X, U> Dispatcher<T, S, B, X, U>
 where
     T: AsyncRead + AsyncWrite + Unpin,
-    S: Service<Request>,
-    S::Error: Into<Error>,
-    S::Response: Into<Response<B>>,
-    B: MessageBody,
 {
     pub(crate) fn new(
-        services: Rc<RefCell<HttpFlow<S, X, U>>>,
-        connection: Connection<T, Bytes>,
+        flow: Rc<HttpFlow<S, X, U>>,
+        mut connection: Connection<T, Bytes>,
         on_connect_data: OnConnectData,
         config: ServiceConfig,
-        timeout: Option<Sleep>,
         peer_addr: Option<net::SocketAddr>,
     ) -> Self {
-        // let keepalive = config.keep_alive_enabled();
-        // let flags = if keepalive {
-        // Flags::KEEPALIVE | Flags::KEEPALIVE_ENABLED
-        // } else {
-        //     Flags::empty()
-        // };
+        let ping_pong = config.keep_alive_timer().map(|timer| H2PingPong {
+            timer: Box::pin(timer),
+            on_flight: false,
+            ping_pong: connection.ping_pong().unwrap(),
+        });
 
-        // keep-alive timer
-        let (ka_expire, ka_timer) = if let Some(delay) = timeout {
-            (delay.deadline(), Some(delay))
-        } else if let Some(delay) = config.keep_alive_timer() {
-            (delay.deadline(), Some(delay))
-        } else {
-            (config.now(), None)
-        };
-
-        Dispatcher {
-            flow: services,
+        Self {
+            flow,
             config,
             peer_addr,
             connection,
             on_connect_data,
-            ka_expire,
-            ka_timer,
+            ping_pong,
             _phantom: PhantomData,
         }
     }
 }
 
+struct H2PingPong {
+    timer: Pin<Box<Sleep>>,
+    on_flight: bool,
+    ping_pong: PingPong,
+}
+
 impl<T, S, B, X, U> Future for Dispatcher<T, S, B, X, U>
 where
     T: AsyncRead + AsyncWrite + Unpin,
+
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>>,
     S::Future: 'static,
-    S::Response: Into<Response<B>> + 'static,
-    B: MessageBody + 'static,
+    S::Response: Into<Response<B>>,
+
+    B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
 {
-    type Output = Result<(), DispatchError>;
+    type Output = Result<(), crate::error::DispatchError>;
 
     #[inline]
     fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
         let this = self.get_mut();
 
         loop {
-            match ready!(Pin::new(&mut this.connection).poll_accept(cx)) {
-                None => return Poll::Ready(Ok(())),
-
-                Some(Err(err)) => return Poll::Ready(Err(err.into())),
-
-                Some(Ok((req, res))) => {
-                    // update keep-alive expire
-                    if this.ka_timer.is_some() {
-                        if let Some(expire) = this.config.keep_alive_expire() {
-                            this.ka_expire = expire;
-                        }
-                    }
-
+            match Pin::new(&mut this.connection).poll_accept(cx)? {
+                Poll::Ready(Some((req, tx))) => {
                     let (parts, body) = req.into_parts();
                     let pl = crate::h2::Payload::new(body);
                     let pl = Payload::<crate::payload::PayloadStream>::H2(pl);
                     let mut req = Request::with_payload(pl);
 
-                    let head = &mut req.head_mut();
+                    let head = req.head_mut();
                     head.uri = parts.uri;
                     head.method = parts.method;
                     head.version = parts.version;
@@ -136,236 +116,215 @@ where
                     // merge on_connect_ext data into request extensions
                     this.on_connect_data.merge_into(&mut req);
 
-                    let svc = ServiceResponse::<S::Future, S::Response, S::Error, B> {
-                        state: ServiceResponseState::ServiceCall(
-                            this.flow.borrow_mut().service.call(req),
-                            Some(res),
-                        ),
-                        config: this.config.clone(),
-                        buffer: None,
-                        _phantom: PhantomData,
-                    };
+                    let fut = this.flow.service.call(req);
+                    let config = this.config.clone();
 
-                    actix_rt::spawn(svc);
+                    // multiplex request handling with spawn task
+                    actix_rt::spawn(async move {
+                        // resolve service call and send response.
+                        let res = match fut.await {
+                            Ok(res) => handle_response(res.into(), tx, config).await,
+                            Err(err) => {
+                                let res: Response<AnyBody> = err.into();
+                                handle_response(res, tx, config).await
+                            }
+                        };
+
+                        // log error.
+                        if let Err(err) = res {
+                            match err {
+                                DispatchError::SendResponse(err) => {
+                                    trace!("Error sending HTTP/2 response: {:?}", err)
+                                }
+                                DispatchError::SendData(err) => warn!("{:?}", err),
+                                DispatchError::ResponseBody(err) => {
+                                    error!("Response payload stream error: {:?}", err)
+                                }
+                            }
+                        }
+                    });
                 }
+                Poll::Ready(None) => return Poll::Ready(Ok(())),
+                Poll::Pending => match this.ping_pong.as_mut() {
+                    Some(ping_pong) => loop {
+                        if ping_pong.on_flight {
+                            // When have on flight ping pong. poll pong and and keep alive timer.
+                            // on success pong received update keep alive timer to determine the next timing of
+                            // ping pong.
+                            match ping_pong.ping_pong.poll_pong(cx)? {
+                                Poll::Ready(_) => {
+                                    ping_pong.on_flight = false;
+
+                                    let dead_line =
+                                        this.config.keep_alive_expire().unwrap();
+                                    ping_pong.timer.as_mut().reset(dead_line);
+                                }
+                                Poll::Pending => {
+                                    return ping_pong
+                                        .timer
+                                        .as_mut()
+                                        .poll(cx)
+                                        .map(|_| Ok(()))
+                                }
+                            }
+                        } else {
+                            // When there is no on flight ping pong. keep alive timer is used to wait for next
+                            // timing of ping pong. Therefore at this point it serves as an interval instead.
+                            ready!(ping_pong.timer.as_mut().poll(cx));
+
+                            ping_pong.ping_pong.send_ping(Ping::opaque())?;
+
+                            let dead_line = this.config.keep_alive_expire().unwrap();
+                            ping_pong.timer.as_mut().reset(dead_line);
+
+                            ping_pong.on_flight = true;
+                        }
+                    },
+                    None => return Poll::Pending,
+                },
             }
         }
     }
 }
 
-#[pin_project::pin_project]
-struct ServiceResponse<F, I, E, B> {
-    #[pin]
-    state: ServiceResponseState<F, B>,
+enum DispatchError {
+    SendResponse(h2::Error),
+    SendData(h2::Error),
+    ResponseBody(Box<dyn StdError>),
+}
+
+async fn handle_response<B>(
+    res: Response<B>,
+    mut tx: SendResponse<Bytes>,
     config: ServiceConfig,
-    buffer: Option<Bytes>,
-    _phantom: PhantomData<(I, E)>,
-}
-
-#[pin_project::pin_project(project = ServiceResponseStateProj)]
-enum ServiceResponseState<F, B> {
-    ServiceCall(#[pin] F, Option<SendResponse<Bytes>>),
-    SendPayload(SendStream<Bytes>, #[pin] ResponseBody<B>),
-}
-
-impl<F, I, E, B> ServiceResponse<F, I, E, B>
+) -> Result<(), DispatchError>
 where
-    F: Future<Output = Result<I, E>>,
-    E: Into<Error>,
-    I: Into<Response<B>>,
     B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
 {
-    fn prepare_response(
-        &self,
-        head: &ResponseHead,
-        size: &mut BodySize,
-    ) -> http::Response<()> {
-        let mut has_date = false;
-        let mut skip_len = size != &BodySize::Stream;
+    let (res, body) = res.replace_body(());
 
-        let mut res = http::Response::new(());
-        *res.status_mut() = head.status;
-        *res.version_mut() = http::Version::HTTP_2;
+    // prepare response.
+    let mut size = body.size();
+    let res = prepare_response(config, res.head(), &mut size);
+    let eof = size.is_eof();
 
-        // Content length
-        match head.status {
-            http::StatusCode::NO_CONTENT
-            | http::StatusCode::CONTINUE
-            | http::StatusCode::PROCESSING => *size = BodySize::None,
-            http::StatusCode::SWITCHING_PROTOCOLS => {
-                skip_len = true;
-                *size = BodySize::Stream;
+    // send response head and return on eof.
+    let mut stream = tx
+        .send_response(res, eof)
+        .map_err(DispatchError::SendResponse)?;
+
+    if eof {
+        return Ok(());
+    }
+
+    // poll response body and send chunks to client.
+    actix_rt::pin!(body);
+
+    while let Some(res) = poll_fn(|cx| body.as_mut().poll_next(cx)).await {
+        let mut chunk = res.map_err(|err| DispatchError::ResponseBody(err.into()))?;
+
+        'send: loop {
+            // reserve enough space and wait for stream ready.
+            stream.reserve_capacity(cmp::min(chunk.len(), CHUNK_SIZE));
+
+            match poll_fn(|cx| stream.poll_capacity(cx)).await {
+                // No capacity left. drop body and return.
+                None => return Ok(()),
+                Some(res) => {
+                    // Split chuck to writeable size and send to client.
+                    let cap = res.map_err(DispatchError::SendData)?;
+
+                    let len = chunk.len();
+                    let bytes = chunk.split_to(cmp::min(cap, len));
+
+                    stream
+                        .send_data(bytes, false)
+                        .map_err(DispatchError::SendData)?;
+
+                    // Current chuck completely sent. break send loop and poll next one.
+                    if chunk.is_empty() {
+                        break 'send;
+                    }
+                }
             }
+        }
+    }
+
+    // response body streaming finished. send end of stream and return.
+    stream
+        .send_data(Bytes::new(), true)
+        .map_err(DispatchError::SendData)?;
+
+    Ok(())
+}
+
+fn prepare_response(
+    config: ServiceConfig,
+    head: &ResponseHead,
+    size: &mut BodySize,
+) -> http::Response<()> {
+    let mut has_date = false;
+    let mut skip_len = size != &BodySize::Stream;
+
+    let mut res = http::Response::new(());
+    *res.status_mut() = head.status;
+    *res.version_mut() = http::Version::HTTP_2;
+
+    // Content length
+    match head.status {
+        http::StatusCode::NO_CONTENT
+        | http::StatusCode::CONTINUE
+        | http::StatusCode::PROCESSING => *size = BodySize::None,
+        http::StatusCode::SWITCHING_PROTOCOLS => {
+            skip_len = true;
+            *size = BodySize::Stream;
+        }
+        _ => {}
+    }
+
+    let _ = match size {
+        BodySize::None | BodySize::Stream => None,
+
+        BodySize::Sized(0) => res
+            .headers_mut()
+            .insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
+
+        BodySize::Sized(len) => {
+            let mut buf = itoa::Buffer::new();
+
+            res.headers_mut().insert(
+                CONTENT_LENGTH,
+                HeaderValue::from_str(buf.format(*len)).unwrap(),
+            )
+        }
+    };
+
+    // copy headers
+    for (key, value) in head.headers.iter() {
+        match *key {
+            // TODO: consider skipping other headers according to:
+            //       https://tools.ietf.org/html/rfc7540#section-8.1.2.2
+            // omit HTTP/1.x only headers
+            CONNECTION | TRANSFER_ENCODING => continue,
+            CONTENT_LENGTH if skip_len => continue,
+            DATE => has_date = true,
             _ => {}
         }
 
-        let _ = match size {
-            BodySize::None | BodySize::Stream => None,
-            BodySize::Empty => res
-                .headers_mut()
-                .insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
-            BodySize::Sized(len) => res.headers_mut().insert(
-                CONTENT_LENGTH,
-                HeaderValue::try_from(format!("{}", len)).unwrap(),
-            ),
-        };
-
-        // copy headers
-        for (key, value) in head.headers.iter() {
-            match *key {
-                // omit HTTP/1 only headers
-                CONNECTION | TRANSFER_ENCODING => continue,
-                CONTENT_LENGTH if skip_len => continue,
-                DATE => has_date = true,
-                _ => {}
-            }
-
-            res.headers_mut().append(key, value.clone());
-        }
-
-        // set date header
-        if !has_date {
-            let mut bytes = BytesMut::with_capacity(29);
-            self.config.set_date_header(&mut bytes);
-            res.headers_mut().insert(
-                DATE,
-                // SAFETY: serialized date-times are known ASCII strings
-                unsafe { HeaderValue::from_maybe_shared_unchecked(bytes.freeze()) },
-            );
-        }
-
-        res
+        res.headers_mut().append(key, value.clone());
     }
-}
 
-impl<F, I, E, B> Future for ServiceResponse<F, I, E, B>
-where
-    F: Future<Output = Result<I, E>>,
-    E: Into<Error>,
-    I: Into<Response<B>>,
-    B: MessageBody,
-{
-    type Output = ();
-
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let mut this = self.as_mut().project();
-
-        match this.state.project() {
-            ServiceResponseStateProj::ServiceCall(call, send) => {
-                match ready!(call.poll(cx)) {
-                    Ok(res) => {
-                        let (res, body) = res.into().replace_body(());
-
-                        let mut send = send.take().unwrap();
-                        let mut size = body.size();
-                        let h2_res =
-                            self.as_mut().prepare_response(res.head(), &mut size);
-                        this = self.as_mut().project();
-
-                        let stream = match send.send_response(h2_res, size.is_eof()) {
-                            Err(e) => {
-                                trace!("Error sending HTTP/2 response: {:?}", e);
-                                return Poll::Ready(());
-                            }
-                            Ok(stream) => stream,
-                        };
-
-                        if size.is_eof() {
-                            Poll::Ready(())
-                        } else {
-                            this.state
-                                .set(ServiceResponseState::SendPayload(stream, body));
-                            self.poll(cx)
-                        }
-                    }
-
-                    Err(e) => {
-                        let res: Response = e.into().into();
-                        let (res, body) = res.replace_body(());
-
-                        let mut send = send.take().unwrap();
-                        let mut size = body.size();
-                        let h2_res =
-                            self.as_mut().prepare_response(res.head(), &mut size);
-                        this = self.as_mut().project();
-
-                        let stream = match send.send_response(h2_res, size.is_eof()) {
-                            Err(e) => {
-                                trace!("Error sending HTTP/2 response: {:?}", e);
-                                return Poll::Ready(());
-                            }
-                            Ok(stream) => stream,
-                        };
-
-                        if size.is_eof() {
-                            Poll::Ready(())
-                        } else {
-                            this.state.set(ServiceResponseState::SendPayload(
-                                stream,
-                                body.into_body(),
-                            ));
-                            self.poll(cx)
-                        }
-                    }
-                }
-            }
-
-            ServiceResponseStateProj::SendPayload(ref mut stream, ref mut body) => {
-                loop {
-                    loop {
-                        match this.buffer {
-                            Some(ref mut buffer) => {
-                                match ready!(stream.poll_capacity(cx)) {
-                                    None => return Poll::Ready(()),
-
-                                    Some(Ok(cap)) => {
-                                        let len = buffer.len();
-                                        let bytes = buffer.split_to(cmp::min(cap, len));
-
-                                        if let Err(e) = stream.send_data(bytes, false) {
-                                            warn!("{:?}", e);
-                                            return Poll::Ready(());
-                                        } else if !buffer.is_empty() {
-                                            let cap = cmp::min(buffer.len(), CHUNK_SIZE);
-                                            stream.reserve_capacity(cap);
-                                        } else {
-                                            this.buffer.take();
-                                        }
-                                    }
-
-                                    Some(Err(e)) => {
-                                        warn!("{:?}", e);
-                                        return Poll::Ready(());
-                                    }
-                                }
-                            }
-
-                            None => match ready!(body.as_mut().poll_next(cx)) {
-                                None => {
-                                    if let Err(e) = stream.send_data(Bytes::new(), true)
-                                    {
-                                        warn!("{:?}", e);
-                                    }
-                                    return Poll::Ready(());
-                                }
-
-                                Some(Ok(chunk)) => {
-                                    stream.reserve_capacity(cmp::min(
-                                        chunk.len(),
-                                        CHUNK_SIZE,
-                                    ));
-                                    *this.buffer = Some(chunk);
-                                }
-
-                                Some(Err(e)) => {
-                                    error!("Response payload stream error: {:?}", e);
-                                    return Poll::Ready(());
-                                }
-                            },
-                        }
-                    }
-                }
-            }
-        }
+    // set date header
+    if !has_date {
+        let mut bytes = BytesMut::with_capacity(29);
+        config.set_date_header(&mut bytes);
+        res.headers_mut().insert(
+            DATE,
+            // SAFETY: serialized date-times are known ASCII strings
+            unsafe { HeaderValue::from_maybe_shared_unchecked(bytes.freeze()) },
+        );
     }
+
+    res
 }

actix-http/src/h2/mod.rs

@@ -1,4 +1,4 @@
-//! HTTP/2 implementation.
+//! HTTP/2 protocol.
 
 use std::{
     pin::Pin,

actix-http/src/h2/service.rs

@@ -1,29 +1,32 @@
-use std::cell::RefCell;
-use std::future::Future;
-use std::marker::PhantomData;
-use std::pin::Pin;
-use std::task::{Context, Poll};
-use std::{net, rc::Rc};
+use std::{
+    error::Error as StdError,
+    future::Future,
+    marker::PhantomData,
+    net,
+    pin::Pin,
+    rc::Rc,
+    task::{Context, Poll},
+};
 
 use actix_codec::{AsyncRead, AsyncWrite};
 use actix_rt::net::TcpStream;
 use actix_service::{
-    fn_factory, fn_service, pipeline_factory, IntoServiceFactory, Service,
-    ServiceFactory,
+    fn_factory, fn_service, IntoServiceFactory, Service, ServiceFactory,
+    ServiceFactoryExt as _,
 };
+use actix_utils::future::ready;
 use bytes::Bytes;
-use futures_core::ready;
-use futures_util::future::ok;
-use h2::server::{self, Handshake};
+use futures_core::{future::LocalBoxFuture, ready};
+use h2::server::{handshake as h2_handshake, Handshake as H2Handshake};
 use log::error;
 
-use crate::body::MessageBody;
-use crate::config::ServiceConfig;
-use crate::error::{DispatchError, Error};
-use crate::request::Request;
-use crate::response::Response;
-use crate::service::HttpFlow;
-use crate::{ConnectCallback, OnConnectData};
+use crate::{
+    body::{AnyBody, MessageBody},
+    config::ServiceConfig,
+    error::DispatchError,
+    service::HttpFlow,
+    ConnectCallback, OnConnectData, Request, Response,
+};
 
 use super::dispatcher::Dispatcher;
 
@@ -38,10 +41,12 @@ pub struct H2Service<T, S, B> {
 impl<T, S, B> H2Service<T, S, B>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
+
     B: MessageBody + 'static,
+    B::Error: Into<Box<dyn StdError>>,
 {
     /// Create new `H2Service` instance with config.
     pub(crate) fn with_config<F: IntoServiceFactory<S, Request>>(
@@ -66,10 +71,13 @@ where
 impl<S, B> H2Service<TcpStream, S, B>
 where
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Future: 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
+
     B: MessageBody + 'static,
+    B::Error: Into<Box<dyn StdError>>,
 {
     /// Create plain TCP based service
     pub fn tcp(
@@ -81,33 +89,38 @@ where
         Error = DispatchError,
         InitError = S::InitError,
     > {
-        pipeline_factory(fn_factory(|| async {
-            Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
+        fn_factory(|| {
+            ready(Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
                 let peer_addr = io.peer_addr().ok();
-                ok::<_, DispatchError>((io, peer_addr))
-            }))
-        }))
+                ready(Ok::<_, DispatchError>((io, peer_addr)))
+            })))
+        })
         .and_then(self)
     }
 }
 
 #[cfg(feature = "openssl")]
 mod openssl {
-    use actix_service::{fn_factory, fn_service, ServiceFactoryExt};
-    use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, SslStream};
-    use actix_tls::accept::TlsError;
+    use actix_service::ServiceFactoryExt as _;
+    use actix_tls::accept::{
+        openssl::{Acceptor, SslAcceptor, SslError, TlsStream},
+        TlsError,
+    };
 
     use super::*;
 
-    impl<S, B> H2Service<SslStream<TcpStream>, S, B>
+    impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
     where
         S: ServiceFactory<Request, Config = ()>,
-        S::Error: Into<Error> + 'static,
+        S::Future: 'static,
+        S::Error: Into<Response<AnyBody>> + 'static,
         S::Response: Into<Response<B>> + 'static,
         <S::Service as Service<Request>>::Future: 'static,
+
         B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError>>,
     {
-        /// Create OpenSSL based service
+        /// Create OpenSSL based service.
         pub fn openssl(
             self,
             acceptor: SslAcceptor,
@@ -118,39 +131,44 @@ mod openssl {
             Error = TlsError<SslError, DispatchError>,
             InitError = S::InitError,
         > {
-            pipeline_factory(
-                Acceptor::new(acceptor)
-                    .map_err(TlsError::Tls)
-                    .map_init_err(|_| panic!()),
-            )
-            .and_then(fn_factory(|| {
-                ok::<_, S::InitError>(fn_service(|io: SslStream<TcpStream>| {
+            Acceptor::new(acceptor)
+                .map_init_err(|_| {
+                    unreachable!("TLS acceptor service factory does not error on init")
+                })
+                .map_err(TlsError::into_service_error)
+                .map(|io: TlsStream<TcpStream>| {
                     let peer_addr = io.get_ref().peer_addr().ok();
-                    ok((io, peer_addr))
-                }))
-            }))
-            .and_then(self.map_err(TlsError::Service))
+                    (io, peer_addr)
+                })
+                .and_then(self.map_err(TlsError::Service))
         }
     }
 }
 
 #[cfg(feature = "rustls")]
 mod rustls {
-    use super::*;
-    use actix_service::ServiceFactoryExt;
-    use actix_tls::accept::rustls::{Acceptor, ServerConfig, TlsStream};
-    use actix_tls::accept::TlsError;
     use std::io;
 
+    use actix_service::ServiceFactoryExt as _;
+    use actix_tls::accept::{
+        rustls::{Acceptor, ServerConfig, TlsStream},
+        TlsError,
+    };
+
+    use super::*;
+
     impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
     where
         S: ServiceFactory<Request, Config = ()>,
-        S::Error: Into<Error> + 'static,
+        S::Future: 'static,
+        S::Error: Into<Response<AnyBody>> + 'static,
         S::Response: Into<Response<B>> + 'static,
         <S::Service as Service<Request>>::Future: 'static,
+
         B: MessageBody + 'static,
+        B::Error: Into<Box<dyn StdError>>,
     {
-        /// Create Rustls based service
+        /// Create Rustls based service.
         pub fn rustls(
             self,
             mut config: ServerConfig,
@@ -161,95 +179,62 @@ mod rustls {
             Error = TlsError<io::Error, DispatchError>,
             InitError = S::InitError,
         > {
-            let protos = vec!["h2".to_string().into()];
-            config.set_protocols(&protos);
+            let mut protos = vec![b"h2".to_vec()];
+            protos.extend_from_slice(&config.alpn_protocols);
+            config.alpn_protocols = protos;
 
-            pipeline_factory(
-                Acceptor::new(config)
-                    .map_err(TlsError::Tls)
-                    .map_init_err(|_| panic!()),
-            )
-            .and_then(fn_factory(|| {
-                ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
+            Acceptor::new(config)
+                .map_init_err(|_| {
+                    unreachable!("TLS acceptor service factory does not error on init")
+                })
+                .map_err(TlsError::into_service_error)
+                .map(|io: TlsStream<TcpStream>| {
                     let peer_addr = io.get_ref().0.peer_addr().ok();
-                    ok((io, peer_addr))
-                }))
-            }))
-            .and_then(self.map_err(TlsError::Service))
+                    (io, peer_addr)
+                })
+                .and_then(self.map_err(TlsError::Service))
         }
     }
 }
 
 impl<T, S, B> ServiceFactory<(T, Option<net::SocketAddr>)> for H2Service<T, S, B>
 where
-    T: AsyncRead + AsyncWrite + Unpin,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
+
     S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
+    S::Future: 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Response: Into<Response<B>> + 'static,
     <S::Service as Service<Request>>::Future: 'static,
+
     B: MessageBody + 'static,
+    B::Error: Into<Box<dyn StdError>>,
 {
     type Response = ();
     type Error = DispatchError;
     type Config = ();
     type Service = H2ServiceHandler<T, S::Service, B>;
     type InitError = S::InitError;
-    type Future = H2ServiceResponse<T, S, B>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
 
     fn new_service(&self, _: ()) -> Self::Future {
-        H2ServiceResponse {
-            fut: self.srv.new_service(()),
-            cfg: Some(self.cfg.clone()),
-            on_connect_ext: self.on_connect_ext.clone(),
-            _phantom: PhantomData,
-        }
-    }
-}
+        let service = self.srv.new_service(());
+        let cfg = self.cfg.clone();
+        let on_connect_ext = self.on_connect_ext.clone();
 
-#[doc(hidden)]
-#[pin_project::pin_project]
-pub struct H2ServiceResponse<T, S, B>
-where
-    S: ServiceFactory<Request>,
-{
-    #[pin]
-    fut: S::Future,
-    cfg: Option<ServiceConfig>,
-    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
-    _phantom: PhantomData<B>,
-}
-
-impl<T, S, B> Future for H2ServiceResponse<T, S, B>
-where
-    T: AsyncRead + AsyncWrite + Unpin,
-    S: ServiceFactory<Request, Config = ()>,
-    S::Error: Into<Error> + 'static,
-    S::Response: Into<Response<B>> + 'static,
-    <S::Service as Service<Request>>::Future: 'static,
-    B: MessageBody + 'static,
-{
-    type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
-
-    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
-        let this = self.as_mut().project();
-
-        this.fut.poll(cx).map_ok(|service| {
-            let this = self.as_mut().project();
-            H2ServiceHandler::new(
-                this.cfg.take().unwrap(),
-                this.on_connect_ext.clone(),
-                service,
-            )
+        Box::pin(async move {
+            let service = service.await?;
+            Ok(H2ServiceHandler::new(cfg, on_connect_ext, service))
         })
     }
 }
 
-/// `Service` implementation for http/2 transport
+/// `Service` implementation for HTTP/2 transport
 pub struct H2ServiceHandler<T, S, B>
 where
     S: Service<Request>,
 {
-    flow: Rc<RefCell<HttpFlow<S, (), ()>>>,
+    flow: Rc<HttpFlow<S, (), ()>>,
     cfg: ServiceConfig,
     on_connect_ext: Option<Rc<ConnectCallback<T>>>,
     _phantom: PhantomData<B>,
@@ -258,7 +243,7 @@ where
 impl<T, S, B> H2ServiceHandler<T, S, B>
 where
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Future: 'static,
     S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
@@ -281,24 +266,25 @@ impl<T, S, B> Service<(T, Option<net::SocketAddr>)> for H2ServiceHandler<T, S, B
 where
     T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Future: 'static,
     S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
+    B::Error: Into<Box<dyn StdError>>,
 {
     type Response = ();
     type Error = DispatchError;
     type Future = H2ServiceHandlerResponse<T, S, B>;
 
-    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
-        self.flow.borrow_mut().service.poll_ready(cx).map_err(|e| {
+    fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        self.flow.service.poll_ready(cx).map_err(|e| {
             let e = e.into();
             error!("Service readiness error: {:?}", e);
             DispatchError::Service(e)
         })
     }
 
-    fn call(&mut self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
+    fn call(&self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
         let on_connect_data =
             OnConnectData::from_io(&io, self.on_connect_ext.as_deref());
 
@@ -308,7 +294,7 @@ where
                 Some(self.cfg.clone()),
                 addr,
                 on_connect_data,
-                server::handshake(io),
+                h2_handshake(io),
             ),
         }
     }
@@ -321,11 +307,11 @@ where
 {
     Incoming(Dispatcher<T, S, B, (), ()>),
     Handshake(
-        Option<Rc<RefCell<HttpFlow<S, (), ()>>>>,
+        Option<Rc<HttpFlow<S, (), ()>>>,
         Option<ServiceConfig>,
         Option<net::SocketAddr>,
         OnConnectData,
-        Handshake<T, Bytes>,
+        H2Handshake<T, Bytes>,
     ),
 }
 
@@ -333,7 +319,7 @@ pub struct H2ServiceHandlerResponse<T, S, B>
 where
     T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Future: 'static,
     S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
@@ -345,10 +331,11 @@ impl<T, S, B> Future for H2ServiceHandlerResponse<T, S, B>
 where
     T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request>,
-    S::Error: Into<Error> + 'static,
+    S::Error: Into<Response<AnyBody>> + 'static,
     S::Future: 'static,
     S::Response: Into<Response<B>> + 'static,
     B: MessageBody,
+    B::Error: Into<Box<dyn StdError>>,
 {
     type Output = Result<(), DispatchError>;
 
@@ -369,7 +356,6 @@ where
                         conn,
                         on_connect_data,
                         config.take().unwrap(),
-                        None,
                         *peer_addr,
                     ));
                     self.poll(cx)

actix-http/src/header/as_name.rs

@@ -0,0 +1,50 @@
+//! Helper trait for types that can be effectively borrowed as a [HeaderValue].
+//!
+//! [HeaderValue]: crate::http::HeaderValue
+
+use std::{borrow::Cow, str::FromStr};
+
+use http::header::{HeaderName, InvalidHeaderName};
+
+pub trait AsHeaderName: Sealed {}
+
+pub struct Seal;
+
+pub trait Sealed {
+    fn try_as_name(&self, seal: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName>;
+}
+
+impl Sealed for HeaderName {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        Ok(Cow::Borrowed(self))
+    }
+}
+impl AsHeaderName for HeaderName {}
+
+impl Sealed for &HeaderName {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        Ok(Cow::Borrowed(*self))
+    }
+}
+impl AsHeaderName for &HeaderName {}
+
+impl Sealed for &str {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        HeaderName::from_str(self).map(Cow::Owned)
+    }
+}
+impl AsHeaderName for &str {}
+
+impl Sealed for String {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        HeaderName::from_str(self).map(Cow::Owned)
+    }
+}
+impl AsHeaderName for String {}
+
+impl Sealed for &String {
+    fn try_as_name(&self, _: Seal) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
+        HeaderName::from_str(self).map(Cow::Owned)
+    }
+}
+impl AsHeaderName for &String {}

actix-http/src/header/common/content_language.rs

@@ -1,65 +0,0 @@
-use crate::header::{QualityItem, CONTENT_LANGUAGE};
-use language_tags::LanguageTag;
-
-header! {
-    /// `Content-Language` header, defined in
-    /// [RFC7231](https://tools.ietf.org/html/rfc7231#section-3.1.3.2)
-    ///
-    /// The `Content-Language` header field describes the natural language(s)
-    /// of the intended audience for the representation.  Note that this
-    /// might not be equivalent to all the languages used within the
-    /// representation.
-    ///
-    /// # ABNF
-    ///
-    /// ```text
-    /// Content-Language = 1#language-tag
-    /// ```
-    ///
-    /// # Example values
-    ///
-    /// * `da`
-    /// * `mi, en`
-    ///
-    /// # Examples
-    ///
-    /// ```rust
-    /// # extern crate actix_http;
-    /// # #[macro_use] extern crate language_tags;
-    /// use actix_http::Response;
-    /// # use actix_http::http::header::{ContentLanguage, qitem};
-    /// #
-    /// # fn main() {
-    /// let mut builder = Response::Ok();
-    /// builder.set(
-    ///     ContentLanguage(vec![
-    ///         qitem(langtag!(en)),
-    ///     ])
-    /// );
-    /// # }
-    /// ```
-    ///
-    /// ```rust
-    /// # extern crate actix_http;
-    /// # #[macro_use] extern crate language_tags;
-    /// use actix_http::Response;
-    /// # use actix_http::http::header::{ContentLanguage, qitem};
-    /// #
-    /// # fn main() {
-    ///
-    /// let mut builder = Response::Ok();
-    /// builder.set(
-    ///     ContentLanguage(vec![
-    ///         qitem(langtag!(da)),
-    ///         qitem(langtag!(en;;;GB)),
-    ///     ])
-    /// );
-    /// # }
-    /// ```
-    (ContentLanguage, CONTENT_LANGUAGE) => (QualityItem<LanguageTag>)+
-
-    test_content_language {
-        test_header!(test1, vec![b"da"]);
-        test_header!(test2, vec![b"mi, en"]);
-    }
-}

actix-http/src/header/into_pair.rs

@@ -0,0 +1,117 @@
+use std::convert::TryFrom;
+
+use http::{
+    header::{HeaderName, InvalidHeaderName, InvalidHeaderValue},
+    Error as HttpError, HeaderValue,
+};
+
+use super::{Header, IntoHeaderValue};
+
+/// Transforms structures into header K/V pairs for inserting into `HeaderMap`s.
+pub trait IntoHeaderPair: Sized {
+    type Error: Into<HttpError>;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error>;
+}
+
+#[derive(Debug)]
+pub enum InvalidHeaderPart {
+    Name(InvalidHeaderName),
+    Value(InvalidHeaderValue),
+}
+
+impl From<InvalidHeaderPart> for HttpError {
+    fn from(part_err: InvalidHeaderPart) -> Self {
+        match part_err {
+            InvalidHeaderPart::Name(err) => err.into(),
+            InvalidHeaderPart::Value(err) => err.into(),
+        }
+    }
+}
+
+impl<V> IntoHeaderPair for (HeaderName, V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        let value = value
+            .try_into_value()
+            .map_err(|err| InvalidHeaderPart::Value(err.into()))?;
+        Ok((name, value))
+    }
+}
+
+impl<V> IntoHeaderPair for (&HeaderName, V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        let value = value
+            .try_into_value()
+            .map_err(|err| InvalidHeaderPart::Value(err.into()))?;
+        Ok((name.clone(), value))
+    }
+}
+
+impl<V> IntoHeaderPair for (&[u8], V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        let name = HeaderName::try_from(name).map_err(InvalidHeaderPart::Name)?;
+        let value = value
+            .try_into_value()
+            .map_err(|err| InvalidHeaderPart::Value(err.into()))?;
+        Ok((name, value))
+    }
+}
+
+impl<V> IntoHeaderPair for (&str, V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        let name = HeaderName::try_from(name).map_err(InvalidHeaderPart::Name)?;
+        let value = value
+            .try_into_value()
+            .map_err(|err| InvalidHeaderPart::Value(err.into()))?;
+        Ok((name, value))
+    }
+}
+
+impl<V> IntoHeaderPair for (String, V)
+where
+    V: IntoHeaderValue,
+    V::Error: Into<InvalidHeaderValue>,
+{
+    type Error = InvalidHeaderPart;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        let (name, value) = self;
+        (name.as_str(), value).try_into_header_pair()
+    }
+}
+
+impl<T: Header> IntoHeaderPair for T {
+    type Error = <T as IntoHeaderValue>::Error;
+
+    fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
+        Ok((T::name(), self.try_into_value()?))
+    }
+}

actix-http/src/header/into_value.rs

@@ -0,0 +1,131 @@
+use std::convert::TryFrom;
+
+use bytes::Bytes;
+use http::{header::InvalidHeaderValue, Error as HttpError, HeaderValue};
+use mime::Mime;
+
+/// A trait for any object that can be Converted to a `HeaderValue`
+pub trait IntoHeaderValue: Sized {
+    /// The type returned in the event of a conversion error.
+    type Error: Into<HttpError>;
+
+    /// Try to convert value to a HeaderValue.
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error>;
+}
+
+impl IntoHeaderValue for HeaderValue {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        Ok(self)
+    }
+}
+
+impl IntoHeaderValue for &HeaderValue {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        Ok(self.clone())
+    }
+}
+
+impl IntoHeaderValue for &str {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        self.parse()
+    }
+}
+
+impl IntoHeaderValue for &[u8] {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::from_bytes(self)
+    }
+}
+
+impl IntoHeaderValue for Bytes {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::from_maybe_shared(self)
+    }
+}
+
+impl IntoHeaderValue for Vec<u8> {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self)
+    }
+}
+
+impl IntoHeaderValue for String {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self)
+    }
+}
+
+impl IntoHeaderValue for usize {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for i64 {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for u64 {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for i32 {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for u32 {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::try_from(self.to_string())
+    }
+}
+
+impl IntoHeaderValue for Mime {
+    type Error = InvalidHeaderValue;
+
+    #[inline]
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        HeaderValue::from_str(self.as_ref())
+    }
+}

actix-http/src/header/mod.rs

@@ -1,35 +1,58 @@
-//! Various http headers
-// This is mostly copy of [hyper](https://github.com/hyperium/hyper/tree/master/src/header)
+//! Pre-defined `HeaderName`s, traits for parsing and conversion, and other header utility methods.
 
-use std::convert::TryFrom;
-use std::{fmt, str::FromStr};
-
-use bytes::{Bytes, BytesMut};
-use http::Error as HttpError;
-use mime::Mime;
 use percent_encoding::{AsciiSet, CONTROLS};
 
-pub use http::header::*;
+// re-export from http except header map related items
+pub use http::header::{
+    HeaderName, HeaderValue, InvalidHeaderName, InvalidHeaderValue, ToStrError,
+};
+
+// re-export const header names
+pub use http::header::{
+    ACCEPT, ACCEPT_CHARSET, ACCEPT_ENCODING, ACCEPT_LANGUAGE, ACCEPT_RANGES,
+    ACCESS_CONTROL_ALLOW_CREDENTIALS, ACCESS_CONTROL_ALLOW_HEADERS,
+    ACCESS_CONTROL_ALLOW_METHODS, ACCESS_CONTROL_ALLOW_ORIGIN,
+    ACCESS_CONTROL_EXPOSE_HEADERS, ACCESS_CONTROL_MAX_AGE,
+    ACCESS_CONTROL_REQUEST_HEADERS, ACCESS_CONTROL_REQUEST_METHOD, AGE, ALLOW, ALT_SVC,
+    AUTHORIZATION, CACHE_CONTROL, CONNECTION, CONTENT_DISPOSITION, CONTENT_ENCODING,
+    CONTENT_LANGUAGE, CONTENT_LENGTH, CONTENT_LOCATION, CONTENT_RANGE,
+    CONTENT_SECURITY_POLICY, CONTENT_SECURITY_POLICY_REPORT_ONLY, CONTENT_TYPE, COOKIE,
+    DATE, DNT, ETAG, EXPECT, EXPIRES, FORWARDED, FROM, HOST, IF_MATCH,
+    IF_MODIFIED_SINCE, IF_NONE_MATCH, IF_RANGE, IF_UNMODIFIED_SINCE, LAST_MODIFIED,
+    LINK, LOCATION, MAX_FORWARDS, ORIGIN, PRAGMA, PROXY_AUTHENTICATE,
+    PROXY_AUTHORIZATION, PUBLIC_KEY_PINS, PUBLIC_KEY_PINS_REPORT_ONLY, RANGE, REFERER,
+    REFERRER_POLICY, REFRESH, RETRY_AFTER, SEC_WEBSOCKET_ACCEPT,
+    SEC_WEBSOCKET_EXTENSIONS, SEC_WEBSOCKET_KEY, SEC_WEBSOCKET_PROTOCOL,
+    SEC_WEBSOCKET_VERSION, SERVER, SET_COOKIE, STRICT_TRANSPORT_SECURITY, TE, TRAILER,
+    TRANSFER_ENCODING, UPGRADE, UPGRADE_INSECURE_REQUESTS, USER_AGENT, VARY, VIA,
+    WARNING, WWW_AUTHENTICATE, X_CONTENT_TYPE_OPTIONS, X_DNS_PREFETCH_CONTROL,
+    X_FRAME_OPTIONS, X_XSS_PROTECTION,
+};
 
 use crate::error::ParseError;
-use crate::httpmessage::HttpMessage;
+use crate::HttpMessage;
+
+mod as_name;
+mod into_pair;
+mod into_value;
+mod utils;
 
-mod common;
 pub(crate) mod map;
 mod shared;
-pub use self::common::*;
+
 #[doc(hidden)]
 pub use self::shared::*;
 
+pub use self::as_name::AsHeaderName;
+pub use self::into_pair::IntoHeaderPair;
+pub use self::into_value::IntoHeaderValue;
 #[doc(hidden)]
 pub use self::map::GetAll;
 pub use self::map::HeaderMap;
+pub use self::utils::*;
 
-/// A trait for any object that will represent a header field and value.
-pub trait Header
-where
-    Self: IntoHeaderValue,
-{
+/// A trait for any object that already represents a valid header field and value.
+pub trait Header: IntoHeaderValue {
     /// Returns the name of the header field
     fn name() -> HeaderName;
 
@@ -37,358 +60,15 @@ where
     fn parse<T: HttpMessage>(msg: &T) -> Result<Self, ParseError>;
 }
 
-/// A trait for any object that can be Converted to a `HeaderValue`
-pub trait IntoHeaderValue: Sized {
-    /// The type returned in the event of a conversion error.
-    type Error: Into<HttpError>;
-
-    /// Try to convert value to a Header value.
-    fn try_into(self) -> Result<HeaderValue, Self::Error>;
-}
-
-impl IntoHeaderValue for HeaderValue {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        Ok(self)
-    }
-}
-
-impl<'a> IntoHeaderValue for &'a str {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        self.parse()
-    }
-}
-
-impl<'a> IntoHeaderValue for &'a [u8] {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::from_bytes(self)
-    }
-}
-
-impl IntoHeaderValue for Bytes {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::from_maybe_shared(self)
-    }
-}
-
-impl IntoHeaderValue for Vec<u8> {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::try_from(self)
-    }
-}
-
-impl IntoHeaderValue for String {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::try_from(self)
-    }
-}
-
-impl IntoHeaderValue for usize {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        let s = format!("{}", self);
-        HeaderValue::try_from(s)
-    }
-}
-
-impl IntoHeaderValue for u64 {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        let s = format!("{}", self);
-        HeaderValue::try_from(s)
-    }
-}
-
-impl IntoHeaderValue for Mime {
-    type Error = InvalidHeaderValue;
-
-    #[inline]
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::try_from(format!("{}", self))
-    }
-}
-
-/// Represents supported types of content encodings
-#[derive(Copy, Clone, PartialEq, Debug)]
-pub enum ContentEncoding {
-    /// Automatically select encoding based on encoding negotiation
-    Auto,
-    /// A format using the Brotli algorithm
-    Br,
-    /// A format using the zlib structure with deflate algorithm
-    Deflate,
-    /// Gzip algorithm
-    Gzip,
-    /// Indicates the identity function (i.e. no compression, nor modification)
-    Identity,
-}
-
-impl ContentEncoding {
-    #[inline]
-    /// Is the content compressed?
-    pub fn is_compression(self) -> bool {
-        matches!(self, ContentEncoding::Identity | ContentEncoding::Auto)
-    }
-
-    #[inline]
-    /// Convert content encoding to string
-    pub fn as_str(self) -> &'static str {
-        match self {
-            ContentEncoding::Br => "br",
-            ContentEncoding::Gzip => "gzip",
-            ContentEncoding::Deflate => "deflate",
-            ContentEncoding::Identity | ContentEncoding::Auto => "identity",
-        }
-    }
-
-    #[inline]
-    /// default quality value
-    pub fn quality(self) -> f64 {
-        match self {
-            ContentEncoding::Br => 1.1,
-            ContentEncoding::Gzip => 1.0,
-            ContentEncoding::Deflate => 0.9,
-            ContentEncoding::Identity | ContentEncoding::Auto => 0.1,
-        }
-    }
-}
-
-impl<'a> From<&'a str> for ContentEncoding {
-    fn from(s: &'a str) -> ContentEncoding {
-        let s = s.trim();
-
-        if s.eq_ignore_ascii_case("br") {
-            ContentEncoding::Br
-        } else if s.eq_ignore_ascii_case("gzip") {
-            ContentEncoding::Gzip
-        } else if s.eq_ignore_ascii_case("deflate") {
-            ContentEncoding::Deflate
-        } else {
-            ContentEncoding::Identity
-        }
-    }
-}
-
-#[doc(hidden)]
-pub(crate) struct Writer {
-    buf: BytesMut,
-}
-
-impl Writer {
-    fn new() -> Writer {
-        Writer {
-            buf: BytesMut::new(),
-        }
-    }
-    fn take(&mut self) -> Bytes {
-        self.buf.split().freeze()
-    }
-}
-
-impl fmt::Write for Writer {
-    #[inline]
-    fn write_str(&mut self, s: &str) -> fmt::Result {
-        self.buf.extend_from_slice(s.as_bytes());
-        Ok(())
-    }
-
-    #[inline]
-    fn write_fmt(&mut self, args: fmt::Arguments<'_>) -> fmt::Result {
-        fmt::write(self, args)
-    }
-}
-
-#[inline]
-#[doc(hidden)]
-/// Reads a comma-delimited raw header into a Vec.
-pub fn from_comma_delimited<'a, I: Iterator<Item = &'a HeaderValue> + 'a, T: FromStr>(
-    all: I,
-) -> Result<Vec<T>, ParseError> {
-    let mut result = Vec::new();
-    for h in all {
-        let s = h.to_str().map_err(|_| ParseError::Header)?;
-        result.extend(
-            s.split(',')
-                .filter_map(|x| match x.trim() {
-                    "" => None,
-                    y => Some(y),
-                })
-                .filter_map(|x| x.trim().parse().ok()),
-        )
-    }
-    Ok(result)
-}
-
-#[inline]
-#[doc(hidden)]
-/// Reads a single string when parsing a header.
-pub fn from_one_raw_str<T: FromStr>(val: Option<&HeaderValue>) -> Result<T, ParseError> {
-    if let Some(line) = val {
-        let line = line.to_str().map_err(|_| ParseError::Header)?;
-        if !line.is_empty() {
-            return T::from_str(line).or(Err(ParseError::Header));
-        }
-    }
-    Err(ParseError::Header)
-}
-
-#[inline]
-#[doc(hidden)]
-/// Format an array into a comma-delimited string.
-pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter<'_>, parts: &[T]) -> fmt::Result
-where
-    T: fmt::Display,
-{
-    let mut iter = parts.iter();
-    if let Some(part) = iter.next() {
-        fmt::Display::fmt(part, f)?;
-    }
-    for part in iter {
-        f.write_str(", ")?;
-        fmt::Display::fmt(part, f)?;
-    }
-    Ok(())
-}
-
-// From hyper v0.11.27 src/header/parsing.rs
-
-/// The value part of an extended parameter consisting of three parts:
-/// the REQUIRED character set name (`charset`), the OPTIONAL language information (`language_tag`),
-/// and a character sequence representing the actual value (`value`), separated by single quote
-/// characters. It is defined in [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
-#[derive(Clone, Debug, PartialEq)]
-pub struct ExtendedValue {
-    /// The character set that is used to encode the `value` to a string.
-    pub charset: Charset,
-    /// The human language details of the `value`, if available.
-    pub language_tag: Option<LanguageTag>,
-    /// The parameter value, as expressed in octets.
-    pub value: Vec<u8>,
-}
-
-/// Parses extended header parameter values (`ext-value`), as defined in
-/// [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
-///
-/// Extended values are denoted by parameter names that end with `*`.
-///
-/// ## ABNF
-///
-/// ```text
-/// ext-value     = charset  "'" [ language ] "'" value-chars
-///               ; like RFC 2231's <extended-initial-value>
-///               ; (see [RFC2231], Section 7)
-///
-/// charset       = "UTF-8" / "ISO-8859-1" / mime-charset
-///
-/// mime-charset  = 1*mime-charsetc
-/// mime-charsetc = ALPHA / DIGIT
-///               / "!" / "#" / "$" / "%" / "&"
-///               / "+" / "-" / "^" / "_" / "`"
-///               / "{" / "}" / "~"
-///               ; as <mime-charset> in Section 2.3 of [RFC2978]
-///               ; except that the single quote is not included
-///               ; SHOULD be registered in the IANA charset registry
-///
-/// language      = <Language-Tag, defined in [RFC5646], Section 2.1>
-///
-/// value-chars   = *( pct-encoded / attr-char )
-///
-/// pct-encoded   = "%" HEXDIG HEXDIG
-///               ; see [RFC3986], Section 2.1
-///
-/// attr-char     = ALPHA / DIGIT
-///               / "!" / "#" / "$" / "&" / "+" / "-" / "."
-///               / "^" / "_" / "`" / "|" / "~"
-///               ; token except ( "*" / "'" / "%" )
-/// ```
-pub fn parse_extended_value(
-    val: &str,
-) -> Result<ExtendedValue, crate::error::ParseError> {
-    // Break into three pieces separated by the single-quote character
-    let mut parts = val.splitn(3, '\'');
-
-    // Interpret the first piece as a Charset
-    let charset: Charset = match parts.next() {
-        None => return Err(crate::error::ParseError::Header),
-        Some(n) => FromStr::from_str(n).map_err(|_| crate::error::ParseError::Header)?,
-    };
-
-    // Interpret the second piece as a language tag
-    let language_tag: Option<LanguageTag> = match parts.next() {
-        None => return Err(crate::error::ParseError::Header),
-        Some("") => None,
-        Some(s) => match s.parse() {
-            Ok(lt) => Some(lt),
-            Err(_) => return Err(crate::error::ParseError::Header),
-        },
-    };
-
-    // Interpret the third piece as a sequence of value characters
-    let value: Vec<u8> = match parts.next() {
-        None => return Err(crate::error::ParseError::Header),
-        Some(v) => percent_encoding::percent_decode(v.as_bytes()).collect(),
-    };
-
-    Ok(ExtendedValue {
-        value,
-        charset,
-        language_tag,
-    })
-}
-
-impl fmt::Display for ExtendedValue {
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        let encoded_value =
-            percent_encoding::percent_encode(&self.value[..], HTTP_VALUE);
-        if let Some(ref lang) = self.language_tag {
-            write!(f, "{}'{}'{}", self.charset, lang, encoded_value)
-        } else {
-            write!(f, "{}''{}", self.charset, encoded_value)
-        }
-    }
-}
-
-/// Percent encode a sequence of bytes with a character set defined in
-/// <https://tools.ietf.org/html/rfc5987#section-3.2>
-pub fn http_percent_encode(f: &mut fmt::Formatter<'_>, bytes: &[u8]) -> fmt::Result {
-    let encoded = percent_encoding::percent_encode(bytes, HTTP_VALUE);
-    fmt::Display::fmt(&encoded, f)
-}
-
-/// Convert http::HeaderMap to a HeaderMap
+/// Convert `http::HeaderMap` to our `HeaderMap`.
 impl From<http::HeaderMap> for HeaderMap {
-    fn from(map: http::HeaderMap) -> HeaderMap {
-        let mut new_map = HeaderMap::with_capacity(map.capacity());
-        for (h, v) in map.iter() {
-            new_map.append(h.clone(), v.clone());
-        }
-        new_map
+    fn from(mut map: http::HeaderMap) -> HeaderMap {
+        HeaderMap::from_drain(map.drain())
     }
 }
 
-// This encode set is used for HTTP header values and is defined at
-// https://tools.ietf.org/html/rfc5987#section-3.2
+/// This encode set is used for HTTP header values and is defined at
+/// https://tools.ietf.org/html/rfc5987#section-3.2.
 pub(crate) const HTTP_VALUE: &AsciiSet = &CONTROLS
     .add(b' ')
     .add(b'"')
@@ -410,91 +90,3 @@ pub(crate) const HTTP_VALUE: &AsciiSet = &CONTROLS
     .add(b']')
     .add(b'{')
     .add(b'}');
-
-#[cfg(test)]
-mod tests {
-    use super::shared::Charset;
-    use super::{parse_extended_value, ExtendedValue};
-    use language_tags::LanguageTag;
-
-    #[test]
-    fn test_parse_extended_value_with_encoding_and_language_tag() {
-        let expected_language_tag = "en".parse::<LanguageTag>().unwrap();
-        // RFC 5987, Section 3.2.2
-        // Extended notation, using the Unicode character U+00A3 (POUND SIGN)
-        let result = parse_extended_value("iso-8859-1'en'%A3%20rates");
-        assert!(result.is_ok());
-        let extended_value = result.unwrap();
-        assert_eq!(Charset::Iso_8859_1, extended_value.charset);
-        assert!(extended_value.language_tag.is_some());
-        assert_eq!(expected_language_tag, extended_value.language_tag.unwrap());
-        assert_eq!(
-            vec![163, b' ', b'r', b'a', b't', b'e', b's'],
-            extended_value.value
-        );
-    }
-
-    #[test]
-    fn test_parse_extended_value_with_encoding() {
-        // RFC 5987, Section 3.2.2
-        // Extended notation, using the Unicode characters U+00A3 (POUND SIGN)
-        // and U+20AC (EURO SIGN)
-        let result = parse_extended_value("UTF-8''%c2%a3%20and%20%e2%82%ac%20rates");
-        assert!(result.is_ok());
-        let extended_value = result.unwrap();
-        assert_eq!(Charset::Ext("UTF-8".to_string()), extended_value.charset);
-        assert!(extended_value.language_tag.is_none());
-        assert_eq!(
-            vec![
-                194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
-                b't', b'e', b's',
-            ],
-            extended_value.value
-        );
-    }
-
-    #[test]
-    fn test_parse_extended_value_missing_language_tag_and_encoding() {
-        // From: https://greenbytes.de/tech/tc2231/#attwithfn2231quot2
-        let result = parse_extended_value("foo%20bar.html");
-        assert!(result.is_err());
-    }
-
-    #[test]
-    fn test_parse_extended_value_partially_formatted() {
-        let result = parse_extended_value("UTF-8'missing third part");
-        assert!(result.is_err());
-    }
-
-    #[test]
-    fn test_parse_extended_value_partially_formatted_blank() {
-        let result = parse_extended_value("blank second part'");
-        assert!(result.is_err());
-    }
-
-    #[test]
-    fn test_fmt_extended_value_with_encoding_and_language_tag() {
-        let extended_value = ExtendedValue {
-            charset: Charset::Iso_8859_1,
-            language_tag: Some("en".parse().expect("Could not parse language tag")),
-            value: vec![163, b' ', b'r', b'a', b't', b'e', b's'],
-        };
-        assert_eq!("ISO-8859-1'en'%A3%20rates", format!("{}", extended_value));
-    }
-
-    #[test]
-    fn test_fmt_extended_value_with_encoding() {
-        let extended_value = ExtendedValue {
-            charset: Charset::Ext("UTF-8".to_string()),
-            language_tag: None,
-            value: vec![
-                194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
-                b't', b'e', b's',
-            ],
-        };
-        assert_eq!(
-            "UTF-8''%C2%A3%20and%20%E2%82%AC%20rates",
-            format!("{}", extended_value)
-        );
-    }
-}

actix-http/src/header/shared/charset.rs

@@ -104,7 +104,7 @@ impl Display for Charset {
 impl FromStr for Charset {
     type Err = crate::Error;
 
-    fn from_str(s: &str) -> crate::Result<Charset> {
+    fn from_str(s: &str) -> Result<Charset, crate::Error> {
         Ok(match s.to_ascii_uppercase().as_ref() {
             "US-ASCII" => Us_Ascii,
             "ISO-8859-1" => Iso_8859_1,

actix-http/src/header/shared/content_encoding.rs

@@ -0,0 +1,112 @@
+use std::{convert::TryFrom, str::FromStr};
+
+use derive_more::{Display, Error};
+use http::header::InvalidHeaderValue;
+
+use crate::{
+    error::ParseError,
+    header::{self, from_one_raw_str, Header, HeaderName, HeaderValue, IntoHeaderValue},
+    HttpMessage,
+};
+
+/// Error return when a content encoding is unknown.
+///
+/// Example: 'compress'
+#[derive(Debug, Display, Error)]
+#[display(fmt = "unsupported content encoding")]
+pub struct ContentEncodingParseError;
+
+/// Represents a supported content encoding.
+#[derive(Debug, Clone, Copy, PartialEq)]
+#[non_exhaustive]
+pub enum ContentEncoding {
+    /// Automatically select encoding based on encoding negotiation.
+    Auto,
+
+    /// A format using the Brotli algorithm.
+    Br,
+
+    /// A format using the zlib structure with deflate algorithm.
+    Deflate,
+
+    /// Gzip algorithm.
+    Gzip,
+
+    // Zstd algorithm.
+    Zstd,
+
+    /// Indicates the identity function (i.e. no compression, nor modification).
+    Identity,
+}
+
+impl ContentEncoding {
+    /// Is the content compressed?
+    #[inline]
+    pub fn is_compression(self) -> bool {
+        matches!(self, ContentEncoding::Identity | ContentEncoding::Auto)
+    }
+
+    /// Convert content encoding to string.
+    #[inline]
+    pub fn as_str(self) -> &'static str {
+        match self {
+            ContentEncoding::Br => "br",
+            ContentEncoding::Gzip => "gzip",
+            ContentEncoding::Deflate => "deflate",
+            ContentEncoding::Zstd => "zstd",
+            ContentEncoding::Identity | ContentEncoding::Auto => "identity",
+        }
+    }
+}
+
+impl Default for ContentEncoding {
+    fn default() -> Self {
+        Self::Identity
+    }
+}
+
+impl FromStr for ContentEncoding {
+    type Err = ContentEncodingParseError;
+
+    fn from_str(val: &str) -> Result<Self, Self::Err> {
+        let val = val.trim();
+
+        if val.eq_ignore_ascii_case("br") {
+            Ok(ContentEncoding::Br)
+        } else if val.eq_ignore_ascii_case("gzip") {
+            Ok(ContentEncoding::Gzip)
+        } else if val.eq_ignore_ascii_case("deflate") {
+            Ok(ContentEncoding::Deflate)
+        } else if val.eq_ignore_ascii_case("zstd") {
+            Ok(ContentEncoding::Zstd)
+        } else {
+            Err(ContentEncodingParseError)
+        }
+    }
+}
+
+impl TryFrom<&str> for ContentEncoding {
+    type Error = ContentEncodingParseError;
+
+    fn try_from(val: &str) -> Result<Self, Self::Error> {
+        val.parse()
+    }
+}
+
+impl IntoHeaderValue for ContentEncoding {
+    type Error = InvalidHeaderValue;
+
+    fn try_into_value(self) -> Result<http::HeaderValue, Self::Error> {
+        Ok(HeaderValue::from_static(self.as_str()))
+    }
+}
+
+impl Header for ContentEncoding {
+    fn name() -> HeaderName {
+        header::CONTENT_ENCODING
+    }
+
+    fn parse<T: HttpMessage>(msg: &T) -> Result<Self, ParseError> {
+        from_one_raw_str(msg.headers().get(Self::name()))
+    }
+}

actix-http/src/header/shared/extended.rs

@@ -0,0 +1,193 @@
+use std::{fmt, str::FromStr};
+
+use language_tags::LanguageTag;
+
+use crate::header::{Charset, HTTP_VALUE};
+
+// From hyper v0.11.27 src/header/parsing.rs
+
+/// The value part of an extended parameter consisting of three parts:
+/// - The REQUIRED character set name (`charset`).
+/// - The OPTIONAL language information (`language_tag`).
+/// - A character sequence representing the actual value (`value`), separated by single quotes.
+///
+/// It is defined in [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
+#[derive(Clone, Debug, PartialEq)]
+pub struct ExtendedValue {
+    /// The character set that is used to encode the `value` to a string.
+    pub charset: Charset,
+
+    /// The human language details of the `value`, if available.
+    pub language_tag: Option<LanguageTag>,
+
+    /// The parameter value, as expressed in octets.
+    pub value: Vec<u8>,
+}
+
+/// Parses extended header parameter values (`ext-value`), as defined in
+/// [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
+///
+/// Extended values are denoted by parameter names that end with `*`.
+///
+/// ## ABNF
+///
+/// ```text
+/// ext-value     = charset  "'" [ language ] "'" value-chars
+///               ; like RFC 2231's <extended-initial-value>
+///               ; (see [RFC2231], Section 7)
+///
+/// charset       = "UTF-8" / "ISO-8859-1" / mime-charset
+///
+/// mime-charset  = 1*mime-charsetc
+/// mime-charsetc = ALPHA / DIGIT
+///               / "!" / "#" / "$" / "%" / "&"
+///               / "+" / "-" / "^" / "_" / "`"
+///               / "{" / "}" / "~"
+///               ; as <mime-charset> in Section 2.3 of [RFC2978]
+///               ; except that the single quote is not included
+///               ; SHOULD be registered in the IANA charset registry
+///
+/// language      = <Language-Tag, defined in [RFC5646], Section 2.1>
+///
+/// value-chars   = *( pct-encoded / attr-char )
+///
+/// pct-encoded   = "%" HEXDIG HEXDIG
+///               ; see [RFC3986], Section 2.1
+///
+/// attr-char     = ALPHA / DIGIT
+///               / "!" / "#" / "$" / "&" / "+" / "-" / "."
+///               / "^" / "_" / "`" / "|" / "~"
+///               ; token except ( "*" / "'" / "%" )
+/// ```
+pub fn parse_extended_value(
+    val: &str,
+) -> Result<ExtendedValue, crate::error::ParseError> {
+    // Break into three pieces separated by the single-quote character
+    let mut parts = val.splitn(3, '\'');
+
+    // Interpret the first piece as a Charset
+    let charset: Charset = match parts.next() {
+        None => return Err(crate::error::ParseError::Header),
+        Some(n) => FromStr::from_str(n).map_err(|_| crate::error::ParseError::Header)?,
+    };
+
+    // Interpret the second piece as a language tag
+    let language_tag: Option<LanguageTag> = match parts.next() {
+        None => return Err(crate::error::ParseError::Header),
+        Some("") => None,
+        Some(s) => match s.parse() {
+            Ok(lt) => Some(lt),
+            Err(_) => return Err(crate::error::ParseError::Header),
+        },
+    };
+
+    // Interpret the third piece as a sequence of value characters
+    let value: Vec<u8> = match parts.next() {
+        None => return Err(crate::error::ParseError::Header),
+        Some(v) => percent_encoding::percent_decode(v.as_bytes()).collect(),
+    };
+
+    Ok(ExtendedValue {
+        charset,
+        language_tag,
+        value,
+    })
+}
+
+impl fmt::Display for ExtendedValue {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        let encoded_value =
+            percent_encoding::percent_encode(&self.value[..], HTTP_VALUE);
+        if let Some(ref lang) = self.language_tag {
+            write!(f, "{}'{}'{}", self.charset, lang, encoded_value)
+        } else {
+            write!(f, "{}''{}", self.charset, encoded_value)
+        }
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use super::*;
+
+    #[test]
+    fn test_parse_extended_value_with_encoding_and_language_tag() {
+        let expected_language_tag = "en".parse::<LanguageTag>().unwrap();
+        // RFC 5987, Section 3.2.2
+        // Extended notation, using the Unicode character U+00A3 (POUND SIGN)
+        let result = parse_extended_value("iso-8859-1'en'%A3%20rates");
+        assert!(result.is_ok());
+        let extended_value = result.unwrap();
+        assert_eq!(Charset::Iso_8859_1, extended_value.charset);
+        assert!(extended_value.language_tag.is_some());
+        assert_eq!(expected_language_tag, extended_value.language_tag.unwrap());
+        assert_eq!(
+            vec![163, b' ', b'r', b'a', b't', b'e', b's'],
+            extended_value.value
+        );
+    }
+
+    #[test]
+    fn test_parse_extended_value_with_encoding() {
+        // RFC 5987, Section 3.2.2
+        // Extended notation, using the Unicode characters U+00A3 (POUND SIGN)
+        // and U+20AC (EURO SIGN)
+        let result = parse_extended_value("UTF-8''%c2%a3%20and%20%e2%82%ac%20rates");
+        assert!(result.is_ok());
+        let extended_value = result.unwrap();
+        assert_eq!(Charset::Ext("UTF-8".to_string()), extended_value.charset);
+        assert!(extended_value.language_tag.is_none());
+        assert_eq!(
+            vec![
+                194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
+                b't', b'e', b's',
+            ],
+            extended_value.value
+        );
+    }
+
+    #[test]
+    fn test_parse_extended_value_missing_language_tag_and_encoding() {
+        // From: https://greenbytes.de/tech/tc2231/#attwithfn2231quot2
+        let result = parse_extended_value("foo%20bar.html");
+        assert!(result.is_err());
+    }
+
+    #[test]
+    fn test_parse_extended_value_partially_formatted() {
+        let result = parse_extended_value("UTF-8'missing third part");
+        assert!(result.is_err());
+    }
+
+    #[test]
+    fn test_parse_extended_value_partially_formatted_blank() {
+        let result = parse_extended_value("blank second part'");
+        assert!(result.is_err());
+    }
+
+    #[test]
+    fn test_fmt_extended_value_with_encoding_and_language_tag() {
+        let extended_value = ExtendedValue {
+            charset: Charset::Iso_8859_1,
+            language_tag: Some("en".parse().expect("Could not parse language tag")),
+            value: vec![163, b' ', b'r', b'a', b't', b'e', b's'],
+        };
+        assert_eq!("ISO-8859-1'en'%A3%20rates", format!("{}", extended_value));
+    }
+
+    #[test]
+    fn test_fmt_extended_value_with_encoding() {
+        let extended_value = ExtendedValue {
+            charset: Charset::Ext("UTF-8".to_string()),
+            language_tag: None,
+            value: vec![
+                194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
+                b't', b'e', b's',
+            ],
+        };
+        assert_eq!(
+            "UTF-8''%C2%A3%20and%20%E2%82%AC%20rates",
+            format!("{}", extended_value)
+        );
+    }
+}

actix-http/src/header/shared/http_date.rs

@@ -0,0 +1,82 @@
+use std::{fmt, io::Write, str::FromStr, time::SystemTime};
+
+use bytes::BytesMut;
+use http::header::{HeaderValue, InvalidHeaderValue};
+
+use crate::{
+    config::DATE_VALUE_LENGTH, error::ParseError, header::IntoHeaderValue,
+    helpers::MutWriter,
+};
+
+/// A timestamp with HTTP formatting and parsing.
+#[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord)]
+pub struct HttpDate(SystemTime);
+
+impl FromStr for HttpDate {
+    type Err = ParseError;
+
+    fn from_str(s: &str) -> Result<HttpDate, ParseError> {
+        match httpdate::parse_http_date(s) {
+            Ok(sys_time) => Ok(HttpDate(sys_time)),
+            Err(_) => Err(ParseError::Header),
+        }
+    }
+}
+
+impl fmt::Display for HttpDate {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        let date_str = httpdate::fmt_http_date(self.0);
+        f.write_str(&date_str)
+    }
+}
+
+impl IntoHeaderValue for HttpDate {
+    type Error = InvalidHeaderValue;
+
+    fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
+        let mut buf = BytesMut::with_capacity(DATE_VALUE_LENGTH);
+        let mut wrt = MutWriter(&mut buf);
+
+        // unwrap: date output is known to be well formed and of known length
+        write!(wrt, "{}", httpdate::fmt_http_date(self.0)).unwrap();
+
+        HeaderValue::from_maybe_shared(buf.split().freeze())
+    }
+}
+
+impl From<SystemTime> for HttpDate {
+    fn from(sys_time: SystemTime) -> HttpDate {
+        HttpDate(sys_time)
+    }
+}
+
+impl From<HttpDate> for SystemTime {
+    fn from(HttpDate(sys_time): HttpDate) -> SystemTime {
+        sys_time
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use std::time::Duration;
+
+    use super::*;
+
+    #[test]
+    fn date_header() {
+        macro_rules! assert_parsed_date {
+            ($case:expr, $exp:expr) => {
+                assert_eq!($case.parse::<HttpDate>().unwrap(), $exp);
+            };
+        }
+
+        // 784198117 = SystemTime::from(datetime!(1994-11-07 08:48:37).assume_utc()).duration_since(SystemTime::UNIX_EPOCH));
+        let nov_07 = HttpDate(SystemTime::UNIX_EPOCH + Duration::from_secs(784198117));
+
+        assert_parsed_date!("Mon, 07 Nov 1994 08:48:37 GMT", nov_07);
+        assert_parsed_date!("Monday, 07-Nov-94 08:48:37 GMT", nov_07);
+        assert_parsed_date!("Mon Nov  7 08:48:37 1994", nov_07);
+
+        assert!("this-is-no-date".parse::<HttpDate>().is_err());
+    }
+}

actix-http/src/header/shared/httpdate.rs

@@ -1,101 +0,0 @@
-use std::fmt::{self, Display};
-use std::io::Write;
-use std::str::FromStr;
-use std::time::{SystemTime, UNIX_EPOCH};
-
-use bytes::buf::BufMut;
-use bytes::BytesMut;
-use http::header::{HeaderValue, InvalidHeaderValue};
-use time::{offset, OffsetDateTime, PrimitiveDateTime};
-
-use crate::error::ParseError;
-use crate::header::IntoHeaderValue;
-use crate::time_parser;
-
-/// A timestamp with HTTP formatting and parsing
-#[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord)]
-pub struct HttpDate(OffsetDateTime);
-
-impl FromStr for HttpDate {
-    type Err = ParseError;
-
-    fn from_str(s: &str) -> Result<HttpDate, ParseError> {
-        match time_parser::parse_http_date(s) {
-            Some(t) => Ok(HttpDate(t.assume_utc())),
-            None => Err(ParseError::Header),
-        }
-    }
-}
-
-impl Display for HttpDate {
-    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
-        fmt::Display::fmt(&self.0.format("%a, %d %b %Y %H:%M:%S GMT"), f)
-    }
-}
-
-impl From<OffsetDateTime> for HttpDate {
-    fn from(dt: OffsetDateTime) -> HttpDate {
-        HttpDate(dt)
-    }
-}
-
-impl From<SystemTime> for HttpDate {
-    fn from(sys: SystemTime) -> HttpDate {
-        HttpDate(PrimitiveDateTime::from(sys).assume_utc())
-    }
-}
-
-impl IntoHeaderValue for HttpDate {
-    type Error = InvalidHeaderValue;
-
-    fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        let mut wrt = BytesMut::with_capacity(29).writer();
-        write!(
-            wrt,
-            "{}",
-            self.0
-                .to_offset(offset!(UTC))
-                .format("%a, %d %b %Y %H:%M:%S GMT")
-        )
-        .unwrap();
-        HeaderValue::from_maybe_shared(wrt.get_mut().split().freeze())
-    }
-}
-
-impl From<HttpDate> for SystemTime {
-    fn from(date: HttpDate) -> SystemTime {
-        let dt = date.0;
-        let epoch = OffsetDateTime::unix_epoch();
-
-        UNIX_EPOCH + (dt - epoch)
-    }
-}
-
-#[cfg(test)]
-mod tests {
-    use super::HttpDate;
-    use time::{date, time, PrimitiveDateTime};
-
-    #[test]
-    fn test_date() {
-        let nov_07 = HttpDate(
-            PrimitiveDateTime::new(date!(1994 - 11 - 07), time!(8:48:37)).assume_utc(),
-        );
-
-        assert_eq!(
-            "Sun, 07 Nov 1994 08:48:37 GMT".parse::<HttpDate>().unwrap(),
-            nov_07
-        );
-        assert_eq!(
-            "Sunday, 07-Nov-94 08:48:37 GMT"
-                .parse::<HttpDate>()
-                .unwrap(),
-            nov_07
-        );
-        assert_eq!(
-            "Sun Nov  7 08:48:37 1994".parse::<HttpDate>().unwrap(),
-            nov_07
-        );
-        assert!("this-is-no-date".parse::<HttpDate>().is_err());
-    }
-}

actix-http/src/header/shared/mod.rs

@@ -1,14 +1,14 @@
-//! Copied for `hyper::header::shared`;
-
-pub use self::charset::Charset;
-pub use self::encoding::Encoding;
-pub use self::entity::EntityTag;
-pub use self::httpdate::HttpDate;
-pub use self::quality_item::{q, qitem, Quality, QualityItem};
-pub use language_tags::LanguageTag;
+//! Originally taken from `hyper::header::shared`.
 
 mod charset;
-mod encoding;
-mod entity;
-mod httpdate;
+mod content_encoding;
+mod extended;
+mod http_date;
 mod quality_item;
+
+pub use self::charset::Charset;
+pub use self::content_encoding::ContentEncoding;
+pub use self::extended::{parse_extended_value, ExtendedValue};
+pub use self::http_date::HttpDate;
+pub use self::quality_item::{q, qitem, Quality, QualityItem};
+pub use language_tags::LanguageTag;

actix-http/src/header/shared/quality_item.rs

@@ -1,11 +1,14 @@
 use std::{
     cmp,
     convert::{TryFrom, TryInto},
-    fmt, str,
+    fmt,
+    str::{self, FromStr},
 };
 
 use derive_more::{Display, Error};
 
+use crate::error::ParseError;
+
 const MAX_QUALITY: u16 = 1000;
 const MAX_FLOAT_QUALITY: f32 = 1.0;
 
@@ -113,12 +116,12 @@ impl<T: fmt::Display> fmt::Display for QualityItem<T> {
     }
 }
 
-impl<T: str::FromStr> str::FromStr for QualityItem<T> {
-    type Err = crate::error::ParseError;
+impl<T: FromStr> FromStr for QualityItem<T> {
+    type Err = ParseError;
 
-    fn from_str(qitem_str: &str) -> Result<QualityItem<T>, crate::error::ParseError> {
+    fn from_str(qitem_str: &str) -> Result<Self, Self::Err> {
         if !qitem_str.is_ascii() {
-            return Err(crate::error::ParseError::Header);
+            return Err(ParseError::Header);
         }
 
         // Set defaults used if parsing fails.
@@ -139,7 +142,7 @@ impl<T: str::FromStr> str::FromStr for QualityItem<T> {
             if parts[0].len() < 2 {
                 // Can't possibly be an attribute since an attribute needs at least a name followed
                 // by an equals sign. And bare identifiers are forbidden.
-                return Err(crate::error::ParseError::Header);
+                return Err(ParseError::Header);
             }
 
             let start = &parts[0][0..2];
@@ -148,25 +151,21 @@ impl<T: str::FromStr> str::FromStr for QualityItem<T> {
                 let q_val = &parts[0][2..];
                 if q_val.len() > 5 {
                     // longer than 5 indicates an over-precise q-factor
-                    return Err(crate::error::ParseError::Header);
+                    return Err(ParseError::Header);
                 }
 
-                let q_value = q_val
-                    .parse::<f32>()
-                    .map_err(|_| crate::error::ParseError::Header)?;
+                let q_value = q_val.parse::<f32>().map_err(|_| ParseError::Header)?;
 
                 if (0f32..=1f32).contains(&q_value) {
                     quality = q_value;
                     raw_item = parts[1];
                 } else {
-                    return Err(crate::error::ParseError::Header);
+                    return Err(ParseError::Header);
                 }
             }
         }
 
-        let item = raw_item
-            .parse::<T>()
-            .map_err(|_| crate::error::ParseError::Header)?;
+        let item = raw_item.parse::<T>().map_err(|_| ParseError::Header)?;
 
         // we already checked above that the quality is within range
         Ok(QualityItem::new(item, Quality::from_f32(quality)))
@@ -193,21 +192,70 @@ where
 
 #[cfg(test)]
 mod tests {
-    use super::super::encoding::*;
     use super::*;
 
+    // copy of encoding from actix-web headers
+    #[allow(clippy::enum_variant_names)] // allow Encoding prefix on EncodingExt
+    #[derive(Clone, PartialEq, Debug)]
+    pub enum Encoding {
+        Chunked,
+        Brotli,
+        Gzip,
+        Deflate,
+        Compress,
+        Identity,
+        Trailers,
+        EncodingExt(String),
+    }
+
+    impl fmt::Display for Encoding {
+        fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+            use Encoding::*;
+            f.write_str(match *self {
+                Chunked => "chunked",
+                Brotli => "br",
+                Gzip => "gzip",
+                Deflate => "deflate",
+                Compress => "compress",
+                Identity => "identity",
+                Trailers => "trailers",
+                EncodingExt(ref s) => s.as_ref(),
+            })
+        }
+    }
+
+    impl FromStr for Encoding {
+        type Err = crate::error::ParseError;
+        fn from_str(s: &str) -> Result<Encoding, crate::error::ParseError> {
+            use Encoding::*;
+            match s {
+                "chunked" => Ok(Chunked),
+                "br" => Ok(Brotli),
+                "deflate" => Ok(Deflate),
+                "gzip" => Ok(Gzip),
+                "compress" => Ok(Compress),
+                "identity" => Ok(Identity),
+                "trailers" => Ok(Trailers),
+                _ => Ok(EncodingExt(s.to_owned())),
+            }
+        }
+    }
+
     #[test]
     fn test_quality_item_fmt_q_1() {
+        use Encoding::*;
         let x = qitem(Chunked);
         assert_eq!(format!("{}", x), "chunked");
     }
     #[test]
     fn test_quality_item_fmt_q_0001() {
+        use Encoding::*;
         let x = QualityItem::new(Chunked, Quality(1));
         assert_eq!(format!("{}", x), "chunked; q=0.001");
     }
     #[test]
     fn test_quality_item_fmt_q_05() {
+        use Encoding::*;
         // Custom value
         let x = QualityItem {
             item: EncodingExt("identity".to_owned()),
@@ -218,6 +266,7 @@ mod tests {
 
     #[test]
     fn test_quality_item_fmt_q_0() {
+        use Encoding::*;
         // Custom value
         let x = QualityItem {
             item: EncodingExt("identity".to_owned()),
@@ -228,6 +277,7 @@ mod tests {
 
     #[test]
     fn test_quality_item_from_str1() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "chunked".parse();
         assert_eq!(
             x.unwrap(),
@@ -237,8 +287,10 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str2() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "chunked; q=1".parse();
         assert_eq!(
             x.unwrap(),
@@ -248,8 +300,10 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str3() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.5".parse();
         assert_eq!(
             x.unwrap(),
@@ -259,8 +313,10 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str4() {
+        use Encoding::*;
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.273".parse();
         assert_eq!(
             x.unwrap(),
@@ -270,16 +326,19 @@ mod tests {
             }
         );
     }
+
     #[test]
     fn test_quality_item_from_str5() {
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.2739999".parse();
         assert!(x.is_err());
     }
+
     #[test]
     fn test_quality_item_from_str6() {
         let x: Result<QualityItem<Encoding>, _> = "gzip; q=2".parse();
         assert!(x.is_err());
     }
+
     #[test]
     fn test_quality_item_ordering() {
         let x: QualityItem<Encoding> = "gzip; q=0.5".parse().ok().unwrap();

actix-http/src/header/utils.rs

@@ -0,0 +1,62 @@
+use std::{fmt, str::FromStr};
+
+use super::HeaderValue;
+use crate::{error::ParseError, header::HTTP_VALUE};
+
+/// Reads a comma-delimited raw header into a Vec.
+#[inline]
+pub fn from_comma_delimited<'a, I, T>(all: I) -> Result<Vec<T>, ParseError>
+where
+    I: Iterator<Item = &'a HeaderValue> + 'a,
+    T: FromStr,
+{
+    let mut result = Vec::new();
+    for h in all {
+        let s = h.to_str().map_err(|_| ParseError::Header)?;
+        result.extend(
+            s.split(',')
+                .filter_map(|x| match x.trim() {
+                    "" => None,
+                    y => Some(y),
+                })
+                .filter_map(|x| x.trim().parse().ok()),
+        )
+    }
+    Ok(result)
+}
+
+/// Reads a single string when parsing a header.
+#[inline]
+pub fn from_one_raw_str<T: FromStr>(val: Option<&HeaderValue>) -> Result<T, ParseError> {
+    if let Some(line) = val {
+        let line = line.to_str().map_err(|_| ParseError::Header)?;
+        if !line.is_empty() {
+            return T::from_str(line).or(Err(ParseError::Header));
+        }
+    }
+    Err(ParseError::Header)
+}
+
+/// Format an array into a comma-delimited string.
+#[inline]
+pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter<'_>, parts: &[T]) -> fmt::Result
+where
+    T: fmt::Display,
+{
+    let mut iter = parts.iter();
+    if let Some(part) = iter.next() {
+        fmt::Display::fmt(part, f)?;
+    }
+    for part in iter {
+        f.write_str(", ")?;
+        fmt::Display::fmt(part, f)?;
+    }
+    Ok(())
+}
+
+/// Percent encode a sequence of bytes with a character set defined in
+/// <https://tools.ietf.org/html/rfc5987#section-3.2>
+pub fn http_percent_encode(f: &mut fmt::Formatter<'_>, bytes: &[u8]) -> fmt::Result {
+    let encoded = percent_encoding::percent_encode(bytes, HTTP_VALUE);
+    fmt::Display::fmt(&encoded, f)
+}

actix-http/src/helpers.rs

@@ -1,15 +1,15 @@
 use std::io;
 
-use bytes::{BufMut, BytesMut};
+use bytes::BufMut;
 use http::Version;
 
 const DIGITS_START: u8 = b'0';
 
-pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
+pub(crate) fn write_status_line<B: BufMut>(version: Version, n: u16, buf: &mut B) {
     match version {
-        Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
-        Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
-        Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
+        Version::HTTP_11 => buf.put_slice(b"HTTP/1.1 "),
+        Version::HTTP_10 => buf.put_slice(b"HTTP/1.0 "),
+        Version::HTTP_09 => buf.put_slice(b"HTTP/0.9 "),
         _ => {
             // other HTTP version handlers do not use this method
         }
@@ -19,33 +19,44 @@ pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut)
     let d10 = ((n / 10) % 10) as u8;
     let d1 = (n % 10) as u8;
 
-    bytes.put_u8(DIGITS_START + d100);
-    bytes.put_u8(DIGITS_START + d10);
-    bytes.put_u8(DIGITS_START + d1);
+    buf.put_u8(DIGITS_START + d100);
+    buf.put_u8(DIGITS_START + d10);
+    buf.put_u8(DIGITS_START + d1);
 
     // trailing space before reason
-    bytes.put_u8(b' ');
+    buf.put_u8(b' ');
 }
 
-/// NOTE: bytes object has to contain enough space
-pub fn write_content_length(n: u64, bytes: &mut BytesMut) {
+/// Write out content length header.
+///
+/// Buffer must to contain enough space or be implicitly extendable.
+pub fn write_content_length<B: BufMut>(n: u64, buf: &mut B) {
     if n == 0 {
-        bytes.put_slice(b"\r\ncontent-length: 0\r\n");
+        buf.put_slice(b"\r\ncontent-length: 0\r\n");
         return;
     }
 
-    let mut buf = itoa::Buffer::new();
+    let mut buffer = itoa::Buffer::new();
 
-    bytes.put_slice(b"\r\ncontent-length: ");
-    bytes.put_slice(buf.format(n).as_bytes());
-    bytes.put_slice(b"\r\n");
+    buf.put_slice(b"\r\ncontent-length: ");
+    buf.put_slice(buffer.format(n).as_bytes());
+    buf.put_slice(b"\r\n");
 }
 
-pub(crate) struct Writer<'a>(pub &'a mut BytesMut);
+/// An `io::Write`r that only requires mutable reference and assumes that there is space available
+/// in the buffer for every write operation or that it can be extended implicitly (like
+/// `bytes::BytesMut`, for example).
+///
+/// This is slightly faster (~10%) than `bytes::buf::Writer` in such cases because it does not
+/// perform a remaining length check before writing.
+pub(crate) struct MutWriter<'a, B>(pub(crate) &'a mut B);
 
-impl<'a> io::Write for Writer<'a> {
+impl<'a, B> io::Write for MutWriter<'a, B>
+where
+    B: BufMut,
+{
     fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.0.extend_from_slice(buf);
+        self.0.put_slice(buf);
         Ok(buf.len())
     }
 
@@ -58,6 +69,8 @@ impl<'a> io::Write for Writer<'a> {
 mod tests {
     use std::str::from_utf8;
 
+    use bytes::BytesMut;
+
     use super::*;
 
     #[test]

actix-http/src/http_message.rs

@@ -1,19 +1,20 @@
-use std::cell::{Ref, RefMut};
-use std::str;
+use std::{
+    cell::{Ref, RefMut},
+    str,
+};
 
 use encoding_rs::{Encoding, UTF_8};
 use http::header;
 use mime::Mime;
 
-use crate::cookie::Cookie;
-use crate::error::{ContentTypeError, CookieParseError, ParseError};
-use crate::extensions::Extensions;
-use crate::header::{Header, HeaderMap};
-use crate::payload::Payload;
+use crate::{
+    error::{ContentTypeError, ParseError},
+    header::{Header, HeaderMap},
+    payload::Payload,
+    Extensions,
+};
 
-struct Cookies(Vec<Cookie<'static>>);
-
-/// Trait that implements general purpose operations on http messages
+/// Trait that implements general purpose operations on HTTP messages.
 pub trait HttpMessage: Sized {
     /// Type of message payload stream
     type Stream;
@@ -30,8 +31,8 @@ pub trait HttpMessage: Sized {
     /// Mutable reference to a the request's extensions container
     fn extensions_mut(&self) -> RefMut<'_, Extensions>;
 
+    /// Get a header.
     #[doc(hidden)]
-    /// Get a header
     fn get_header<H: Header>(&self) -> Option<H>
     where
         Self: Sized,
@@ -43,8 +44,8 @@ pub trait HttpMessage: Sized {
         }
     }
 
-    /// Read the request content type. If request does not contain
-    /// *Content-Type* header, empty str get returned.
+    /// Read the request content type. If request did not contain a *Content-Type* header, an empty
+    /// string is returned.
     fn content_type(&self) -> &str {
         if let Some(content_type) = self.headers().get(header::CONTENT_TYPE) {
             if let Ok(content_type) = content_type.to_str() {
@@ -90,7 +91,7 @@ pub trait HttpMessage: Sized {
         Ok(None)
     }
 
-    /// Check if request has chunked transfer encoding
+    /// Check if request has chunked transfer encoding.
     fn chunked(&self) -> Result<bool, ParseError> {
         if let Some(encodings) = self.headers().get(header::TRANSFER_ENCODING) {
             if let Ok(s) = encodings.to_str() {
@@ -102,39 +103,6 @@ pub trait HttpMessage: Sized {
             Ok(false)
         }
     }
-
-    /// Load request cookies.
-    #[inline]
-    fn cookies(&self) -> Result<Ref<'_, Vec<Cookie<'static>>>, CookieParseError> {
-        if self.extensions().get::<Cookies>().is_none() {
-            let mut cookies = Vec::new();
-            for hdr in self.headers().get_all(header::COOKIE) {
-                let s =
-                    str::from_utf8(hdr.as_bytes()).map_err(CookieParseError::from)?;
-                for cookie_str in s.split(';').map(|s| s.trim()) {
-                    if !cookie_str.is_empty() {
-                        cookies.push(Cookie::parse_encoded(cookie_str)?.into_owned());
-                    }
-                }
-            }
-            self.extensions_mut().insert(Cookies(cookies));
-        }
-        Ok(Ref::map(self.extensions(), |ext| {
-            &ext.get::<Cookies>().unwrap().0
-        }))
-    }
-
-    /// Return request cookie.
-    fn cookie(&self, name: &str) -> Option<Cookie<'static>> {
-        if let Ok(cookies) = self.cookies() {
-            for cookie in cookies.iter() {
-                if cookie.name() == name {
-                    return Some(cookie.to_owned());
-                }
-            }
-        }
-        None
-    }
 }
 
 impl<'a, T> HttpMessage for &'a mut T
@@ -173,11 +141,13 @@ mod tests {
 
     #[test]
     fn test_content_type() {
-        let req = TestRequest::with_header("content-type", "text/plain").finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "text/plain"))
+            .finish();
         assert_eq!(req.content_type(), "text/plain");
-        let req =
-            TestRequest::with_header("content-type", "application/json; charset=utf=8")
-                .finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "application/json; charset=utf=8"))
+            .finish();
         assert_eq!(req.content_type(), "application/json");
         let req = TestRequest::default().finish();
         assert_eq!(req.content_type(), "");
@@ -185,13 +155,15 @@ mod tests {
 
     #[test]
     fn test_mime_type() {
-        let req = TestRequest::with_header("content-type", "application/json").finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "application/json"))
+            .finish();
         assert_eq!(req.mime_type().unwrap(), Some(mime::APPLICATION_JSON));
         let req = TestRequest::default().finish();
         assert_eq!(req.mime_type().unwrap(), None);
-        let req =
-            TestRequest::with_header("content-type", "application/json; charset=utf-8")
-                .finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "application/json; charset=utf-8"))
+            .finish();
         let mt = req.mime_type().unwrap().unwrap();
         assert_eq!(mt.get_param(mime::CHARSET), Some(mime::UTF_8));
         assert_eq!(mt.type_(), mime::APPLICATION);
@@ -200,11 +172,9 @@ mod tests {
 
     #[test]
     fn test_mime_type_error() {
-        let req = TestRequest::with_header(
-            "content-type",
-            "applicationadfadsfasdflknadsfklnadsfjson",
-        )
-        .finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "applicationadfadsfasdflknadsfklnadsfjson"))
+            .finish();
         assert_eq!(Err(ContentTypeError::ParseError), req.mime_type());
     }
 
@@ -213,27 +183,27 @@ mod tests {
         let req = TestRequest::default().finish();
         assert_eq!(UTF_8.name(), req.encoding().unwrap().name());
 
-        let req = TestRequest::with_header("content-type", "application/json").finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "application/json"))
+            .finish();
         assert_eq!(UTF_8.name(), req.encoding().unwrap().name());
 
-        let req = TestRequest::with_header(
-            "content-type",
-            "application/json; charset=ISO-8859-2",
-        )
-        .finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "application/json; charset=ISO-8859-2"))
+            .finish();
         assert_eq!(ISO_8859_2, req.encoding().unwrap());
     }
 
     #[test]
     fn test_encoding_error() {
-        let req = TestRequest::with_header("content-type", "applicatjson").finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "applicatjson"))
+            .finish();
         assert_eq!(Some(ContentTypeError::ParseError), req.encoding().err());
 
-        let req = TestRequest::with_header(
-            "content-type",
-            "application/json; charset=kkkttktk",
-        )
-        .finish();
+        let req = TestRequest::default()
+            .insert_header(("content-type", "application/json; charset=kkkttktk"))
+            .finish();
         assert_eq!(
             Some(ContentTypeError::UnknownEncoding),
             req.encoding().err()
@@ -245,15 +215,16 @@ mod tests {
         let req = TestRequest::default().finish();
         assert!(!req.chunked().unwrap());
 
-        let req =
-            TestRequest::with_header(header::TRANSFER_ENCODING, "chunked").finish();
+        let req = TestRequest::default()
+            .insert_header((header::TRANSFER_ENCODING, "chunked"))
+            .finish();
         assert!(req.chunked().unwrap());
 
         let req = TestRequest::default()
-            .header(
+            .insert_header((
                 header::TRANSFER_ENCODING,
                 Bytes::from_static(b"some va\xadscc\xacas0xsdasdlue"),
-            )
+            ))
             .finish();
         assert!(req.chunked().is_err());
     }

actix-http/src/lib.rs

@@ -1,6 +1,20 @@
 //! HTTP primitives for the Actix ecosystem.
+//!
+//! ## Crate Features
+//! | Feature             | Functionality                               |
+//! | ------------------- | ------------------------------------------- |
+//! | `openssl`           | TLS support via [OpenSSL].                  |
+//! | `rustls`            | TLS support via [rustls].                   |
+//! | `compress-brotli`   | Payload compression support: Brotli.        |
+//! | `compress-gzip`     | Payload compression support: Deflate, Gzip. |
+//! | `compress-zstd`     | Payload compression support: Zstd.          |
+//! | `trust-dns`         | Use [trust-dns] as the client DNS resolver. |
+//!
+//! [OpenSSL]: https://crates.io/crates/openssl
+//! [rustls]: https://crates.io/crates/rustls
+//! [trust-dns]: https://crates.io/crates/trust-dns
 
-#![deny(rust_2018_idioms)]
+#![deny(rust_2018_idioms, nonstandard_style, clippy::uninit_assumed_init)]
 #![allow(
     clippy::type_complexity,
     clippy::too_many_arguments,
@@ -13,28 +27,23 @@
 #[macro_use]
 extern crate log;
 
-#[macro_use]
-mod macros;
-
 pub mod body;
 mod builder;
-pub mod client;
 mod config;
-#[cfg(feature = "compress")]
+
+#[cfg(feature = "__compress")]
 pub mod encoding;
 mod extensions;
-mod header;
+pub mod header;
 mod helpers;
-mod httpcodes;
-pub mod httpmessage;
+mod http_message;
 mod message;
 mod payload;
 mod request;
 mod response;
+mod response_builder;
 mod service;
-mod time_parser;
 
-pub use cookie;
 pub mod error;
 pub mod h1;
 pub mod h2;
@@ -43,17 +52,24 @@ pub mod ws;
 
 pub use self::builder::HttpServiceBuilder;
 pub use self::config::{KeepAlive, ServiceConfig};
-pub use self::error::{Error, ResponseError, Result};
+pub use self::error::Error;
 pub use self::extensions::Extensions;
-pub use self::httpmessage::HttpMessage;
+pub use self::header::ContentEncoding;
+pub use self::http_message::HttpMessage;
+pub use self::message::ConnectionType;
 pub use self::message::{Message, RequestHead, RequestHeadType, ResponseHead};
 pub use self::payload::{Payload, PayloadStream};
 pub use self::request::Request;
-pub use self::response::{Response, ResponseBuilder};
+pub use self::response::Response;
+pub use self::response_builder::ResponseBuilder;
 pub use self::service::HttpService;
 
+pub use ::http::{uri, uri::Uri};
+pub use ::http::{Method, StatusCode, Version};
+
+// TODO: deprecate this mish-mash of random items
 pub mod http {
-    //! Various HTTP related types
+    //! Various HTTP related types.
 
     // re-exports
     pub use http::header::{HeaderName, HeaderValue};
@@ -61,10 +77,9 @@ pub mod http {
     pub use http::{uri, Error, Uri};
     pub use http::{Method, StatusCode, Version};
 
-    pub use crate::cookie::{Cookie, CookieBuilder};
     pub use crate::header::HeaderMap;
 
-    /// Various http headers
+    /// A collection of HTTP headers and helpers.
     pub mod header {
         pub use crate::header::*;
     }
@@ -87,14 +102,9 @@ type ConnectCallback<IO> = dyn Fn(&IO, &mut Extensions);
 ///
 /// # Implementation Details
 /// Uses Option to reduce necessary allocations when merging with request extensions.
+#[derive(Default)]
 pub(crate) struct OnConnectData(Option<Extensions>);
 
-impl Default for OnConnectData {
-    fn default() -> Self {
-        Self(None)
-    }
-}
-
 impl OnConnectData {
     /// Construct by calling the on-connect callback with the underlying transport I/O.
     pub(crate) fn from_io<T>(