prepare v4 beta releases (#1881)

* major cleanup of middleware module

* update changelog

.appveyor.yml

@@ -1,41 +0,0 @@
-environment:
-  global:
-    PROJECT_NAME: actix-web
-  matrix:
-    # Stable channel
-    - TARGET: i686-pc-windows-msvc
-      CHANNEL: stable
-    - TARGET: x86_64-pc-windows-gnu
-      CHANNEL: stable
-    - TARGET: x86_64-pc-windows-msvc
-      CHANNEL: stable
-    # Nightly channel
-    - TARGET: i686-pc-windows-msvc
-      CHANNEL: nightly
-    - TARGET: x86_64-pc-windows-gnu
-      CHANNEL: nightly
-    - TARGET: x86_64-pc-windows-msvc
-      CHANNEL: nightly
-
-# Install Rust and Cargo
-# (Based on from https://github.com/rust-lang/libc/blob/master/appveyor.yml)
-install:
-  - ps: >-
-        If ($Env:TARGET -eq 'x86_64-pc-windows-gnu') {
-           $Env:PATH += ';C:\msys64\mingw64\bin'
-        } ElseIf ($Env:TARGET -eq 'i686-pc-windows-gnu') {
-           $Env:PATH += ';C:\MinGW\bin'
-        }
-  - curl -sSf -o rustup-init.exe https://win.rustup.rs
-  - rustup-init.exe --default-host %TARGET% --default-toolchain %CHANNEL% -y
-  - set PATH=%PATH%;C:\Users\appveyor\.cargo\bin
-  - rustc -Vv
-  - cargo -V
-
-# 'cargo test' takes care of building for us, so disable Appveyor's build stage.
-build: false
-
-# Equivalent to Travis' `script` phase
-test_script:
-  - cargo clean
-  - cargo test --no-default-features --features="flate2-rust"

.github/ISSUE_TEMPLATE/bug_report.md

@@ -0,0 +1,37 @@
+---
+name: Bug Report
+about: Create a bug report.
+---
+
+Your issue may already be reported!
+Please search on the [Actix Web issue tracker](https://github.com/actix/actix-web/issues) before creating one.
+
+## Expected Behavior
+<!--- If you're describing a bug, tell us what should happen -->
+<!--- If you're suggesting a change/improvement, tell us how it should work -->
+
+## Current Behavior
+<!--- If describing a bug, tell us what happens instead of the expected behavior -->
+<!--- If suggesting a change/improvement, explain the difference from current behavior -->
+
+## Possible Solution
+<!--- Not obligatory, but suggest a fix/reason for the bug, -->
+<!--- or ideas how to implement the addition or change -->
+
+## Steps to Reproduce (for bugs)
+<!--- Provide a link to a live example, or an unambiguous set of steps to -->
+<!--- reproduce this bug. Include code to reproduce, if relevant -->
+1.
+2.
+3.
+4.
+
+## Context
+<!--- How has this issue affected you? What are you trying to accomplish? -->
+<!--- Providing context helps us come up with a solution that is most useful in the real world -->
+
+## Your Environment
+<!--- Include as many relevant details about the environment you experienced the bug in -->
+
+* Rust Version (I.e, output of `rustc -V`):
+* Actix Web Version:

.github/ISSUE_TEMPLATE/config.yml

@@ -0,0 +1,15 @@
+blank_issues_enabled: true
+contact_links:
+  - name: GitHub Discussions
+    url: https://github.com/actix/actix-web/discussions
+    about: Actix Web Q&A
+  - name: Gitter chat (actix-web)
+    url: https://gitter.im/actix/actix-web
+    about: Actix Web Q&A
+  - name: Gitter chat (actix)
+    url: https://gitter.im/actix/actix
+    about: Actix (actor framework) Q&A
+  - name: Actix Discord
+    url: https://discord.gg/NWpN5mmg3x
+    about: Actix developer discussion and community chat
+

.github/PULL_REQUEST_TEMPLATE.md

@@ -0,0 +1,27 @@
+<!-- Thanks for considering contributing actix! -->
+<!-- Please fill out the following to make our reviews easy. -->
+
+## PR Type
+<!-- What kind of change does this PR make? -->
+<!-- Bug Fix / Feature / Refactor / Code Style / Other -->
+INSERT_PR_TYPE
+
+
+## PR Checklist
+Check your PR fulfills the following:
+
+<!-- For draft PRs check the boxes as you complete them. -->
+
+- [ ] Tests for the changes have been added / updated.
+- [ ] Documentation comments have been added / updated.
+- [ ] A changelog entry has been made for the appropriate packages.
+- [ ] Format code with the latest stable rustfmt
+
+
+## Overview
+<!-- Describe the current and new behavior. -->
+<!-- Emphasize any breaking changes. -->
+
+
+<!-- If this PR fixes or closes an issue, reference it here. -->
+<!-- Closes #000 -->

.github/workflows/bench.yml

@@ -0,0 +1,28 @@
+name: Benchmark (Linux)
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches:
+      - master
+
+jobs:
+  check_benchmark:
+    runs-on: ubuntu-latest
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: nightly
+          profile: minimal
+          override: true
+
+      - name: Check benchmark
+        uses: actions-rs/cargo@v1
+        with:
+          command: bench
+          args: --bench=server -- --sample-size=15

.github/workflows/clippy-fmt.yml

@@ -0,0 +1,32 @@
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+
+name: Clippy and rustfmt Check
+jobs:
+  clippy_check:
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v2
+
+      - uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable
+          components: rustfmt
+          override: true
+      - name: Check with rustfmt
+        uses: actions-rs/cargo@v1
+        with:
+          command: fmt
+          args: --all -- --check
+
+      - uses: actions-rs/toolchain@v1
+        with:
+          toolchain: nightly
+          components: clippy
+          override: true
+      - name: Check with Clippy
+        uses: actions-rs/clippy-check@v1
+        with:
+          token: ${{ secrets.GITHUB_TOKEN }}
+          args: --all-features --all --tests

.github/workflows/linux.yml

@@ -0,0 +1,81 @@
+name: CI (Linux)
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches:
+      - master
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        version:
+          - 1.46.0 # MSRV
+          - stable
+          - nightly
+
+    name: ${{ matrix.version }} - x86_64-unknown-linux-gnu
+    runs-on: ubuntu-latest
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-x86_64-unknown-linux-gnu
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with:
+          command: generate-lockfile
+      - name: Cache Dependencies
+        uses: Swatinem/rust-cache@v1.0.1
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --all --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --all --all-features --no-fail-fast -- --nocapture
+
+      - name: tests (actix-http)
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --package=actix-http --no-default-features --features=rustls -- --nocapture
+
+      - name: tests (awc)
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --package=awc --no-default-features --features=rustls -- --nocapture
+
+      - name: Generate coverage file
+        if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
+        run: |
+          cargo install cargo-tarpaulin --vers "^0.13"
+          cargo tarpaulin --out Xml
+      - name: Upload to Codecov
+        if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
+        uses: codecov/codecov-action@v1
+        with:
+          file: cobertura.xml
+
+      - name: Clear the cargo caches
+        run: |
+          cargo install cargo-cache --no-default-features --features ci-autoclean
+          cargo-cache

.github/workflows/macos.yml

@@ -0,0 +1,56 @@
+name: CI (macOS)
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches:
+      - master
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        version:
+          - stable
+          - nightly
+
+    name: ${{ matrix.version }} - x86_64-apple-darwin
+    runs-on: macOS-latest
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-x86_64-apple-darwin
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with:
+          command: generate-lockfile
+      - name: Cache Dependencies
+        uses: Swatinem/rust-cache@v1.0.1
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --all --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: test
+          args: --all --all-features --no-fail-fast -- --nocapture
+                --skip=test_h2_content_length
+                --skip=test_reading_deflate_encoding_large_random_rustls
+
+      - name: Clear the cargo caches
+        run: |
+          cargo install cargo-cache --no-default-features --features ci-autoclean
+          cargo-cache

.github/workflows/upload-doc.yml

@@ -0,0 +1,37 @@
+name: Upload documentation
+
+on:
+  push:
+    branches:
+      - master
+
+jobs:
+  build:
+    runs-on: ubuntu-latest
+    if: github.repository == 'actix/actix-web'
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: nightly-x86_64-unknown-linux-gnu
+          profile: minimal
+          override: true
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: doc
+          args: --no-deps --workspace --all-features
+
+      - name: Tweak HTML
+        run: echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html
+
+      - name: Deploy to GitHub Pages
+        uses: JamesIves/github-pages-deploy-action@3.7.1
+        with:
+          GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+          BRANCH: gh-pages
+          FOLDER: target/doc

.github/workflows/windows.yml

@@ -0,0 +1,76 @@
+name: CI (Windows)
+
+on:
+  pull_request:
+    types: [opened, synchronize, reopened]
+  push:
+    branches:
+      - master
+
+env:
+  VCPKGRS_DYNAMIC: 1
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        version:
+          - stable
+          - nightly
+
+    name: ${{ matrix.version }} - x86_64-pc-windows-msvc
+    runs-on: windows-latest
+
+    steps:
+      - uses: actions/checkout@v2
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-x86_64-pc-windows-msvc
+          profile: minimal
+          override: true
+
+      - name: Install OpenSSL
+        run: |
+          vcpkg integrate install
+          vcpkg install openssl:x64-windows
+          Copy-Item C:\vcpkg\installed\x64-windows\bin\libcrypto-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libcrypto.dll
+          Copy-Item C:\vcpkg\installed\x64-windows\bin\libssl-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libssl.dll
+          Get-ChildItem C:\vcpkg\installed\x64-windows\bin
+          Get-ChildItem C:\vcpkg\installed\x64-windows\lib
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with:
+          command: generate-lockfile
+      - name: Cache Dependencies
+        uses: Swatinem/rust-cache@v1.0.1
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --all --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: test
+          args: --all --all-features --no-fail-fast -- --nocapture
+                --skip=test_h2_content_length
+                --skip=test_reading_deflate_encoding_large_random_rustls
+                --skip=test_params
+                --skip=test_simple
+                --skip=test_expect_continue
+                --skip=test_http10_keepalive
+                --skip=test_slow_request
+                --skip=test_connection_force_close
+                --skip=test_connection_server_close
+                --skip=test_connection_wait_queue_force_close
+
+      - name: Clear the cargo caches
+        run: |
+          cargo install cargo-cache --no-default-features --features ci-autoclean
+          cargo-cache

.gitignore

@@ -9,6 +9,10 @@ guide/build/
 *.pid
 *.sock
 *~
+.DS_Store
 
 # These are backup files generated by rustfmt
 **/*.rs.bk
+
+# Configuration directory generated by CLion
+.idea

.travis.yml

@@ -1,58 +0,0 @@
-language: rust
-sudo: required
-dist: trusty
-
-cache:
-  # cargo: true
-  apt: true
-
-matrix:
-  include:
-    - rust: stable
-    - rust: beta
-    - rust: nightly-2019-08-10
-  allow_failures:
-    - rust: nightly-2019-08-10
-
-env:
-  global:
-    # - RUSTFLAGS="-C link-dead-code"
-    - OPENSSL_VERSION=openssl-1.0.2
-
-before_install:
-  - sudo add-apt-repository -y ppa:0k53d-karl-f830m/openssl
-  - sudo apt-get update -qq
-  - sudo apt-get install -y openssl libssl-dev libelf-dev libdw-dev cmake gcc binutils-dev libiberty-dev
-
-before_cache: |
-  if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-08-10" ]]; then
-    RUSTFLAGS="--cfg procmacro2_semver_exempt" cargo install --version 0.6.11 cargo-tarpaulin
-  fi
-
-# Add clippy
-before_script:
-  - export PATH=$PATH:~/.cargo/bin
-
-script:
-  - cargo update
-  - cargo check --all --no-default-features
-  - cargo test --all-features --all -- --nocapture
-  - cd actix-http; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd ..
-  - cd awc; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd ..
-
-# Upload docs
-after_success:
-  - |
-    if [[ "$TRAVIS_OS_NAME" == "linux" && "$TRAVIS_PULL_REQUEST" = "false" && "$TRAVIS_BRANCH" == "master" && "$TRAVIS_RUST_VERSION" == "stable" ]]; then
-      cargo doc --no-deps --all-features &&
-      echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html &&
-      git clone https://github.com/davisp/ghp-import.git &&
-      ./ghp-import/ghp_import.py -n -p -f -m "Documentation upload" -r https://"$GH_TOKEN"@github.com/"$TRAVIS_REPO_SLUG.git" target/doc &&
-      echo "Uploaded documentation"
-    fi
-  - |
-    if [[ "$TRAVIS_RUST_VERSION" ==  "nightly-2019-08-10" ]]; then
-        taskset -c 0 cargo tarpaulin --out Xml --all --all-features
-        bash <(curl -s https://codecov.io/bash)
-        echo "Uploaded code coverage"
-    fi

CHANGES.md

@@ -1,6 +1,298 @@
 # Changes
 
-## [1.0.8] - 2019-09-xx
+## Unreleased - 2021-xx-xx
+
+
+## 4.0.0-beta.1 - 2021-01-07
+### Added
+* `Compat` middleware enabling generic response body/error type of middlewares like `Logger` and
+  `Compress` to be used in `middleware::Condition` and `Resource`, `Scope` services. [#1865]
+
+### Changed
+* Update `actix-*` dependencies to tokio `1.0` based versions. [#1813]
+* Bumped `rand` to `0.8`.
+* Update `rust-tls` to `0.19`. [#1813]
+* Rename `Handler` to `HandlerService` and rename `Factory` to `Handler`. [#1852]
+* The default `TrailingSlash` is now `Trim`, in line with existing documentation. See migration
+  guide for implications. [#1875]
+* Rename `DefaultHeaders::{content_type => add_content_type}`. [#1875]
+* MSRV is now 1.46.0.
+
+### Fixed
+* Added the underlying parse error to `test::read_body_json`'s panic message. [#1812]
+
+### Removed
+* Public modules `middleware::{normalize, err_handlers}`. All necessary middleware structs are now
+  exposed directly by the `middleware` module.
+
+[#1812]: https://github.com/actix/actix-web/pull/1812
+[#1813]: https://github.com/actix/actix-web/pull/1813
+[#1852]: https://github.com/actix/actix-web/pull/1852
+[#1865]: https://github.com/actix/actix-web/pull/1865
+[#1875]: https://github.com/actix/actix-web/pull/1875
+
+
+## 3.3.2 - 2020-12-01
+### Fixed
+* Removed an occasional `unwrap` on `None` panic in `NormalizePathNormalization`. [#1762]
+* Fix `match_pattern()` returning `None` for scope with empty path resource. [#1798]
+* Increase minimum `socket2` version. [#1803]
+
+[#1762]: https://github.com/actix/actix-web/pull/1762
+[#1798]: https://github.com/actix/actix-web/pull/1798
+[#1803]: https://github.com/actix/actix-web/pull/1803
+
+
+## 3.3.1 - 2020-11-29
+* Ensure `actix-http` dependency uses same `serde_urlencoded`.
+
+
+## 3.3.0 - 2020-11-25
+### Added
+* Add `Either<A, B>` extractor helper. [#1788]
+
+### Changed
+* Upgrade `serde_urlencoded` to `0.7`. [#1773]
+
+[#1773]: https://github.com/actix/actix-web/pull/1773
+[#1788]: https://github.com/actix/actix-web/pull/1788
+
+
+## 3.2.0 - 2020-10-30
+### Added
+* Implement `exclude_regex` for Logger middleware. [#1723]
+* Add request-local data extractor `web::ReqData`. [#1748]
+* Add ability to register closure for request middleware logging. [#1749]
+* Add `app_data` to `ServiceConfig`. [#1757]
+* Expose `on_connect` for access to the connection stream before request is handled. [#1754]
+
+### Changed
+* Updated actix-web-codegen dependency for access to new `#[route(...)]` multi-method macro.
+* Print non-configured `Data<T>` type when attempting extraction. [#1743]
+* Re-export bytes::Buf{Mut} in web module. [#1750]
+* Upgrade `pin-project` to `1.0`.
+
+[#1723]: https://github.com/actix/actix-web/pull/1723
+[#1743]: https://github.com/actix/actix-web/pull/1743
+[#1748]: https://github.com/actix/actix-web/pull/1748
+[#1750]: https://github.com/actix/actix-web/pull/1750
+[#1754]: https://github.com/actix/actix-web/pull/1754
+[#1749]: https://github.com/actix/actix-web/pull/1749
+
+
+## 3.1.0 - 2020-09-29
+### Changed
+* Add `TrailingSlash::MergeOnly` behaviour to `NormalizePath`, which allows `NormalizePath`
+  to retain any trailing slashes. [#1695]
+* Remove bound `std::marker::Sized` from `web::Data` to support storing `Arc<dyn Trait>`
+  via `web::Data::from` [#1710]
+
+### Fixed
+* `ResourceMap` debug printing is no longer infinitely recursive. [#1708]
+
+[#1695]: https://github.com/actix/actix-web/pull/1695
+[#1708]: https://github.com/actix/actix-web/pull/1708
+[#1710]: https://github.com/actix/actix-web/pull/1710
+
+
+## 3.0.2 - 2020-09-15
+### Fixed
+* `NormalizePath` when used with `TrailingSlash::Trim` no longer trims the root path "/". [#1678]
+
+[#1678]: https://github.com/actix/actix-web/pull/1678
+
+
+## 3.0.1 - 2020-09-13
+### Changed
+* `middleware::normalize::TrailingSlash` enum is now accessible. [#1673]
+
+[#1673]: https://github.com/actix/actix-web/pull/1673
+
+
+## 3.0.0 - 2020-09-11
+* No significant changes from `3.0.0-beta.4`.
+
+
+## 3.0.0-beta.4 - 2020-09-09
+### Added
+* `middleware::NormalizePath` now has configurable behaviour for either always having a trailing
+  slash, or as the new addition, always trimming trailing slashes. [#1639]
+
+### Changed
+* Update actix-codec and actix-utils dependencies. [#1634]
+* `FormConfig` and `JsonConfig` configurations are now also considered when set
+  using `App::data`. [#1641]
+* `HttpServer::maxconn` is renamed to the more expressive `HttpServer::max_connections`. [#1655]
+* `HttpServer::maxconnrate` is renamed to the more expressive
+  `HttpServer::max_connection_rate`. [#1655]
+
+[#1639]: https://github.com/actix/actix-web/pull/1639
+[#1641]: https://github.com/actix/actix-web/pull/1641
+[#1634]: https://github.com/actix/actix-web/pull/1634
+[#1655]: https://github.com/actix/actix-web/pull/1655
+
+## 3.0.0-beta.3 - 2020-08-17
+### Changed
+* Update `rustls` to 0.18
+
+
+## 3.0.0-beta.2 - 2020-08-17
+### Changed
+* `PayloadConfig` is now also considered in `Bytes` and `String` extractors when set
+  using `App::data`. [#1610]
+* `web::Path` now has a public representation: `web::Path(pub T)` that enables
+  destructuring. [#1594]
+* `ServiceRequest::app_data` allows retrieval of non-Data data without splitting into parts to
+  access `HttpRequest` which already allows this. [#1618]
+* Re-export all error types from `awc`. [#1621]
+* MSRV is now 1.42.0.
+
+### Fixed
+* Memory leak of app data in pooled requests. [#1609]
+
+[#1594]: https://github.com/actix/actix-web/pull/1594
+[#1609]: https://github.com/actix/actix-web/pull/1609
+[#1610]: https://github.com/actix/actix-web/pull/1610
+[#1618]: https://github.com/actix/actix-web/pull/1618
+[#1621]: https://github.com/actix/actix-web/pull/1621
+
+
+## 3.0.0-beta.1 - 2020-07-13
+### Added
+* Re-export `actix_rt::main` as `actix_web::main`.
+* `HttpRequest::match_pattern` and `ServiceRequest::match_pattern` for extracting the matched
+  resource pattern.
+* `HttpRequest::match_name` and `ServiceRequest::match_name` for extracting matched resource name.
+
+### Changed
+* Fix actix_http::h1::dispatcher so it returns when HW_BUFFER_SIZE is reached. Should reduce peak memory consumption during large uploads. [#1550]
+* Migrate cookie handling to `cookie` crate. Actix-web no longer requires `ring` dependency.
+* MSRV is now 1.41.1
+
+### Fixed
+* `NormalizePath` improved consistency when path needs slashes added _and_ removed.
+
+
+## 3.0.0-alpha.3 - 2020-05-21
+### Added
+* Add option to create `Data<T>` from `Arc<T>` [#1509]
+
+### Changed
+* Resources and Scopes can now access non-overridden data types set on App (or containing scopes) when setting their own data. [#1486]
+* Fix audit issue logging by default peer address [#1485]
+* Bump minimum supported Rust version to 1.40
+* Replace deprecated `net2` crate with `socket2`
+
+[#1485]: https://github.com/actix/actix-web/pull/1485
+[#1509]: https://github.com/actix/actix-web/pull/1509
+
+## [3.0.0-alpha.2] - 2020-05-08
+
+### Changed
+
+* `{Resource,Scope}::default_service(f)` handlers now support app data extraction. [#1452]
+* Implement `std::error::Error` for our custom errors [#1422]
+* NormalizePath middleware now appends trailing / so that routes of form /example/ respond to /example requests. [#1433]
+* Remove the `failure` feature and support.
+
+[#1422]: https://github.com/actix/actix-web/pull/1422
+[#1433]: https://github.com/actix/actix-web/pull/1433
+[#1452]: https://github.com/actix/actix-web/pull/1452
+[#1486]: https://github.com/actix/actix-web/pull/1486
+
+
+## [3.0.0-alpha.1] - 2020-03-11
+
+### Added
+
+* Add helper function for creating routes with `TRACE` method guard `web::trace()`
+* Add convenience functions `test::read_body_json()` and `test::TestRequest::send_request()` for testing.
+
+### Changed
+
+* Use `sha-1` crate instead of unmaintained `sha1` crate
+* Skip empty chunks when returning response from a `Stream` [#1308]
+* Update the `time` dependency to 0.2.7
+* Update `actix-tls` dependency to 2.0.0-alpha.1
+* Update `rustls` dependency to 0.17
+
+[#1308]: https://github.com/actix/actix-web/pull/1308
+
+## [2.0.0] - 2019-12-25
+
+### Changed
+
+* Rename `HttpServer::start()` to `HttpServer::run()`
+
+* Allow to gracefully stop test server via `TestServer::stop()`
+
+* Allow to specify multi-patterns for resources
+
+## [2.0.0-rc] - 2019-12-20
+
+### Changed
+
+* Move `BodyEncoding` to `dev` module #1220
+
+* Allow to set `peer_addr` for TestRequest #1074
+
+* Make web::Data deref to Arc<T> #1214
+
+* Rename `App::register_data()` to `App::app_data()`
+
+* `HttpRequest::app_data<T>()` returns `Option<&T>` instead of `Option<&Data<T>>`
+
+### Fixed
+
+* Fix `AppConfig::secure()` is always false. #1202
+
+
+## [2.0.0-alpha.6] - 2019-12-15
+
+### Fixed
+
+* Fixed compilation with default features off
+
+## [2.0.0-alpha.5] - 2019-12-13
+
+### Added
+
+* Add test server, `test::start()` and `test::start_with()`
+
+## [2.0.0-alpha.4] - 2019-12-08
+
+### Deleted
+
+* Delete HttpServer::run(), it is not useful with async/await
+
+## [2.0.0-alpha.3] - 2019-12-07
+
+### Changed
+
+* Migrate to tokio 0.2
+
+
+## [2.0.0-alpha.1] - 2019-11-22
+
+### Changed
+
+* Migrated to `std::future`
+
+* Remove implementation of `Responder` for `()`. (#1167)
+
+
+## [1.0.9] - 2019-11-14
+
+### Added
+
+* Add `Payload::into_inner` method and make stored `def::Payload` public. (#1110)
+
+### Changed
+
+* Support `Host` guards when the `Host` header is unset (e.g. HTTP/2 requests) (#1129)
+
+
+## [1.0.8] - 2019-09-25
 
 ### Added
 
@@ -16,7 +308,7 @@
 
 ### Changed
 
-* Make UrlEncodedError::Overflow more informativve
+* Make UrlEncodedError::Overflow more informative
 
 * Use actix-testing for testing utils
 
@@ -34,7 +326,7 @@
 
 * Re-implement Host predicate (#989)
 
-* Form immplements Responder, returning a `application/x-www-form-urlencoded` response
+* Form implements Responder, returning a `application/x-www-form-urlencoded` response
 
 * Add `into_inner` to `Data`
 

CODE_OF_CONDUCT.md

@@ -34,10 +34,13 @@ This Code of Conduct applies both within project spaces and in public spaces whe
 
 ## Enforcement
 
-Instances of abusive, harassing, or otherwise unacceptable behavior may be reported by contacting the project team at fafhrd91@gmail.com. The project team will review and investigate all complaints, and will respond in a way that it deems appropriate to the circumstances. The project team is obligated to maintain confidentiality with regard to the reporter of an incident. Further details of specific enforcement policies may be posted separately.
+Instances of abusive, harassing, or otherwise unacceptable behavior may be reported by contacting the project team at robjtede@icloud.com ([@robjtede]) or huyuumi@neet.club ([@JohnTitor]). The project team will review and investigate all complaints, and will respond in a way that it deems appropriate to the circumstances. The project team is obligated to maintain confidentiality with regard to the reporter of an incident. Further details of specific enforcement policies may be posted separately.
 
 Project maintainers who do not follow or enforce the Code of Conduct in good faith may face temporary or permanent repercussions as determined by other members of the project's leadership.
 
+[@robjtede]: https://github.com/robjtede
+[@JohnTitor]: https://github.com/JohnTitor
+
 ## Attribution
 
 This Code of Conduct is adapted from the [Contributor Covenant][homepage], version 1.4, available at [http://contributor-covenant.org/version/1/4][version]

Cargo.toml

@@ -1,8 +1,8 @@
 [package]
 name = "actix-web"
-version = "1.0.8"
+version = "4.0.0-beta.1"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
-description = "Actix web is a simple, pragmatic and extremely fast web framework for Rust."
+description = "Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust"
 readme = "README.md"
 keywords = ["actix", "http", "web", "framework", "async"]
 homepage = "https://actix.rs"
@@ -11,12 +11,11 @@ documentation = "https://docs.rs/actix-web/"
 categories = ["network-programming", "asynchronous",
               "web-programming::http-server",
               "web-programming::websocket"]
-license = "MIT/Apache-2.0"
-exclude = [".gitignore", ".travis.yml", ".cargo/config", "appveyor.yml"]
+license = "MIT OR Apache-2.0"
 edition = "2018"
 
 [package.metadata.docs.rs]
-features = ["ssl", "brotli", "flate2-zlib", "secure-cookies", "client", "rust-tls", "uds"]
+features = ["openssl", "rustls", "compress", "secure-cookies"]
 
 [badges]
 travis-ci = { repository = "actix/actix-web", branch = "master" }
@@ -31,90 +30,92 @@ members = [
   ".",
   "awc",
   "actix-http",
-  "actix-cors",
   "actix-files",
-  "actix-framed",
-  "actix-session",
-  "actix-identity",
   "actix-multipart",
   "actix-web-actors",
   "actix-web-codegen",
-  "test-server",
+  "actix-http-test",
 ]
 
 [features]
-default = ["brotli", "flate2-zlib", "client", "fail"]
+default = ["compress"]
 
-# http client
-client = ["awc"]
+# content-encoding support
+compress = ["actix-http/compress", "awc/compress"]
 
-# brotli encoding, requires c compiler
-brotli = ["actix-http/brotli"]
-
-# miniz-sys backend for flate2 crate
-flate2-zlib = ["actix-http/flate2-zlib"]
-
-# rust backend for flate2 crate
-flate2-rust = ["actix-http/flate2-rust"]
-
-# sessions feature, session require "ring" crate and c compiler
+# sessions feature
 secure-cookies = ["actix-http/secure-cookies"]
 
-fail = ["actix-http/fail"]
-
 # openssl
-ssl = ["openssl", "actix-server/ssl", "awc/ssl"]
+openssl = ["actix-tls/accept", "actix-tls/openssl", "awc/openssl", "open-ssl"]
 
 # rustls
-rust-tls = ["rustls", "actix-server/rust-tls", "awc/rust-tls"]
+rustls = ["actix-tls/accept", "actix-tls/rustls", "awc/rustls", "rust-tls"]
 
-# unix domain sockets support
-uds = ["actix-server/uds"]
+[[example]]
+name = "basic"
+required-features = ["compress"]
+
+[[example]]
+name = "uds"
+required-features = ["compress"]
+
+[[test]]
+name = "test_server"
+required-features = ["compress"]
+
+[[example]]
+name = "on_connect"
+required-features = []
+
+[[example]]
+name = "client"
+required-features = ["rustls"]
 
 [dependencies]
-actix-codec = "0.1.2"
-actix-service = "0.4.1"
-actix-utils = "0.4.4"
-actix-router = "0.1.5"
-actix-rt = "0.2.4"
-actix-web-codegen = "0.1.2"
-actix-http = "0.2.9"
-actix-server = "0.6.1"
-actix-server-config = "0.1.2"
-actix-testing = "0.1.0"
-actix-threadpool = "0.1.1"
-awc = { version = "0.2.4", optional = true }
+actix-codec = "0.4.0-beta.1"
+actix-macros = "0.1.0"
+actix-router = "0.2.4"
+actix-rt = "2.0.0-beta.1"
+actix-server = "2.0.0-beta.2"
+actix-service = "2.0.0-beta.2"
+actix-utils = "3.0.0-beta.1"
+actix-threadpool = "0.3.1"
+actix-tls = { version = "3.0.0-beta.2", default-features = false, optional = true }
 
-bytes = "0.4"
-derive_more = "0.15.0"
+actix-web-codegen = "0.4.0"
+actix-http = "3.0.0-beta.1"
+awc = { version = "3.0.0-beta.1", default-features = false }
+
+ahash = "0.6"
+bytes = "1"
+derive_more = "0.99.5"
 encoding_rs = "0.8"
-futures = "0.1.25"
-hashbrown = "0.5.0"
+futures-core = { version = "0.3.7", default-features = false }
+futures-util = { version = "0.3.7", default-features = false }
 log = "0.4"
 mime = "0.3"
-net2 = "0.2.33"
-parking_lot = "0.9"
-regex = "1.0"
-serde = { version = "1.0", features=["derive"] }
+socket2 = "0.3.16"
+pin-project = "1.0.0"
+regex = "1.4"
+serde = { version = "1.0", features = ["derive"] }
 serde_json = "1.0"
-serde_urlencoded = "0.6.1"
-time = "0.1.42"
+serde_urlencoded = "0.7"
+time = { version = "0.2.7", default-features = false, features = ["std"] }
 url = "2.1"
-
-# ssl support
-openssl = { version="0.10", optional = true }
-rustls = { version = "0.15", optional = true }
+open-ssl = { package = "openssl", version = "0.10", optional = true }
+rust-tls = { package = "rustls", version = "0.19.0", optional = true }
+smallvec = "1.6"
 
 [dev-dependencies]
-actix = "0.8.3"
-actix-connect = "0.2.2"
-actix-http-test = "0.2.4"
-rand = "0.7"
-env_logger = "0.6"
+actix = "0.11.0-beta.1"
+actix-http = { version = "3.0.0-beta.1", features = ["actors"] }
+rand = "0.8"
+env_logger = "0.8"
 serde_derive = "1.0"
-tokio-timer = "0.2.8"
 brotli2 = "0.3.2"
-flate2 = "1.0.2"
+flate2 = "1.0.13"
+criterion = "0.3"
 
 [profile.release]
 lto = true
@@ -124,10 +125,17 @@ codegen-units = 1
 [patch.crates-io]
 actix-web = { path = "." }
 actix-http = { path = "actix-http" }
-actix-http-test = { path = "test-server" }
-actix-web-codegen = { path = "actix-web-codegen" }
+actix-http-test = { path = "actix-http-test" }
 actix-web-actors = { path = "actix-web-actors" }
-actix-session = { path = "actix-session" }
-actix-files = { path = "actix-files" }
+actix-web-codegen = { path = "actix-web-codegen" }
 actix-multipart = { path = "actix-multipart" }
+actix-files = { path = "actix-files" }
 awc = { path = "awc" }
+
+[[bench]]
+name = "server"
+harness = false
+
+[[bench]]
+name = "service"
+harness = false

LICENSE-APACHE

@@ -186,7 +186,7 @@
       same "printed page" as the copyright notice for easier
       identification within third-party archives.
 
-   Copyright 2017-NOW Nikolay Kim
+   Copyright 2017-NOW Actix Team
 
    Licensed under the Apache License, Version 2.0 (the "License");
    you may not use this file except in compliance with the License.

LICENSE-MIT

@@ -1,4 +1,4 @@
-Copyright (c) 2017 Nikolay Kim
+Copyright (c) 2017 Actix Team
 
 Permission is hereby granted, free of charge, to any
 person obtaining a copy of this software and associated

MIGRATION.md

@@ -1,3 +1,118 @@
+## Unreleased
+
+* The default `NormalizePath` behavior now strips trailing slashes by default. This was
+  previously documented to be the case in v3 but the behavior now matches. The effect is that
+  routes defined with trailing slashes will become inaccessible when
+  using `NormalizePath::default()`.
+  
+  Before: `#[get("/test/")`  
+  After: `#[get("/test")`  
+
+  Alternatively, explicitly require trailing slashes: `NormalizePath::new(TrailingSlash::Always)`.
+
+
+## 3.0.0
+
+* The return type for `ServiceRequest::app_data::<T>()` was changed from returning a `Data<T>` to
+  simply a `T`. To access a `Data<T>` use `ServiceRequest::app_data::<Data<T>>()`.
+
+* Cookie handling has been offloaded to the `cookie` crate:
+  * `USERINFO_ENCODE_SET` is no longer exposed. Percent-encoding is still supported; check docs.
+  * Some types now require lifetime parameters.
+
+* The time crate was updated to `v0.2`, a major breaking change to the time crate, which affects
+  any `actix-web` method previously expecting a time v0.1 input.
+
+* Setting a cookie's SameSite property, explicitly, to `SameSite::None` will now
+  result in `SameSite=None` being sent with the response Set-Cookie header.
+  To create a cookie without a SameSite attribute, remove any calls setting same_site.
+
+* actix-http support for Actors messages was moved to actix-http crate and is enabled 
+  with feature `actors`
+
+* content_length function is removed from actix-http.
+  You can set Content-Length by normally setting the response body or calling no_chunking function. 
+
+* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
+  `u64` instead of a `usize`.
+
+* Code that was using `path.<index>` to access a `web::Path<(A, B, C)>`s elements now needs to use
+  destructuring or `.into_inner()`. For example:
+
+  ```rust
+  // Previously:
+  async fn some_route(path: web::Path<(String, String)>) -> String {
+    format!("Hello, {} {}", path.0, path.1)
+  }
+
+  // Now (this also worked before):
+  async fn some_route(path: web::Path<(String, String)>) -> String {
+    let (first_name, last_name) = path.into_inner();
+    format!("Hello, {} {}", first_name, last_name)
+  }
+  // Or (this wasn't previously supported):
+  async fn some_route(web::Path((first_name, last_name)): web::Path<(String, String)>) -> String {
+    format!("Hello, {} {}", first_name, last_name)
+  }
+  ```
+
+* `middleware::NormalizePath` can now also be configured to trim trailing slashes instead of always keeping one.
+  It will need `middleware::normalize::TrailingSlash` when being constructed with `NormalizePath::new(...)`,
+  or for an easier migration you can replace `wrap(middleware::NormalizePath)` with `wrap(middleware::NormalizePath::new(TrailingSlash::MergeOnly))`.
+
+* `HttpServer::maxconn` is renamed to the more expressive `HttpServer::max_connections`.
+
+* `HttpServer::maxconnrate` is renamed to the more expressive `HttpServer::max_connection_rate`.
+
+
+## 2.0.0
+
+* `HttpServer::start()` renamed to `HttpServer::run()`. It also possible to
+  `.await` on `run` method result, in that case it awaits server exit.
+
+* `App::register_data()` renamed to `App::app_data()` and accepts any type `T: 'static`.
+  Stored data is available via `HttpRequest::app_data()` method at runtime.
+
+* Extractor configuration must be registered with `App::app_data()` instead of `App::data()`
+
+* Sync handlers has been removed. `.to_async()` method has been renamed to `.to()`
+  replace `fn` with `async fn` to convert sync handler to async
+
+* `actix_http_test::TestServer` moved to `actix_web::test` module. To start
+  test server use `test::start()` or `test_start_with_config()` methods
+
+* `ResponseError` trait has been reafctored. `ResponseError::error_response()` renders
+  http response.
+
+* Feature `rust-tls` renamed to `rustls`
+
+  instead of
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["rust-tls"] }
+    ```
+
+  use
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["rustls"] }
+    ```
+
+* Feature `ssl` renamed to `openssl`
+
+  instead of
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["ssl"] }
+    ```
+
+  use
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["openssl"] }
+    ```
+* `Cors` builder now requires that you call `.finish()` to construct the middleware
+
 ## 1.0.1
 
 * Cors middleware has been moved to `actix-cors` crate
@@ -34,52 +149,52 @@
 * Extractor configuration. In version 1.0 this is handled with the new `Data` mechanism for both setting and retrieving the configuration
 
   instead of
-    
+
   ```rust
-    
+
   #[derive(Default)]
   struct ExtractorConfig {
      config: String,
   }
-    
+
   impl FromRequest for YourExtractor {
      type Config = ExtractorConfig;
      type Result = Result<YourExtractor, Error>;
-  
+
      fn from_request(req: &HttpRequest, cfg: &Self::Config) -> Self::Result {
          println!("use the config: {:?}", cfg.config);
          ...
      }
   }
-    
+
   App::new().resource("/route_with_config", |r| {
      r.post().with_config(handler_fn, |cfg| {
          cfg.0.config = "test".to_string();
      })
   })
-    
+
   ```
-    
+
   use the HttpRequest to get the configuration like any other `Data` with `req.app_data::<C>()` and set it with the `data()` method on the `resource`
-    
+
   ```rust
   #[derive(Default)]
   struct ExtractorConfig {
      config: String,
   }
-    
+
   impl FromRequest for YourExtractor {
      type Error = Error;
      type Future = Result<Self, Self::Error>;
      type Config = ExtractorConfig;
-    
+
      fn from_request(req: &HttpRequest, payload: &mut Payload) -> Self::Future {
          let cfg = req.app_data::<ExtractorConfig>();
          println!("config data?: {:?}", cfg.unwrap().role);
          ...
      }
   }
-    
+
   App::new().service(
      resource("/route_with_config")
          .data(ExtractorConfig {
@@ -88,7 +203,7 @@
          .route(post().to(handler_fn)),
   )
   ```
-  
+
 * Resource registration. 1.0 version uses generalized resource
   registration via `.service()` method.
 
@@ -304,7 +419,7 @@
 
 * `actix_web::server` module has been removed. To start http server use `actix_web::HttpServer` type
 
-* StaticFiles and NamedFile has been move to separate create.
+* StaticFiles and NamedFile have been moved to a separate crate.
 
   instead of `use actix_web::fs::StaticFile`
 
@@ -314,7 +429,7 @@
 
   use `use actix_files::NamedFile`
 
-* Multipart has been move to separate create.
+* Multipart has been moved to a separate crate.
 
   instead of `use actix_web::multipart::Multipart`
 
@@ -379,9 +494,9 @@
 
 * `HttpRequest` does not implement `Stream` anymore. If you need to read request payload
   use `HttpMessage::payload()` method.
-  
+
   instead of
-  
+
     ```rust
     fn index(req: HttpRequest) -> impl Responder {
          req
@@ -407,8 +522,8 @@
   trait uses `&HttpRequest` instead of `&mut HttpRequest`.
 
 * Removed `Route::with2()` and `Route::with3()` use tuple of extractors instead.
-    
-    instead of 
+
+    instead of
 
     ```rust
     fn index(query: Query<..>, info: Json<MyStruct) -> impl Responder {}
@@ -424,7 +539,7 @@
 
 * `Handler::handle()` accepts reference to `HttpRequest<_>` instead of value
 
-* Removed deprecated `HttpServer::threads()`, use 
+* Removed deprecated `HttpServer::threads()`, use
   [HttpServer::workers()](https://actix.rs/actix-web/actix_web/server/struct.HttpServer.html#method.workers) instead.
 
 * Renamed `client::ClientConnectorError::Connector` to
@@ -433,7 +548,7 @@
 * `Route::with()` does not return `ExtractorConfig`, to configure
   extractor use `Route::with_config()`
 
-    instead of 
+    instead of
 
     ```rust
     fn main() {
@@ -444,11 +559,11 @@
          });
     }
     ```
-    
-    use 
-    
+
+    use
+
     ```rust
-  
+
     fn main() {
          let app = App::new().resource("/index.html", |r| {
              r.method(http::Method::GET)
@@ -478,12 +593,12 @@
 * `HttpRequest::extensions()` returns read only reference to the request's Extension
   `HttpRequest::extensions_mut()` returns mutable reference.
 
-* Instead of 
+* Instead of
 
    `use actix_web::middleware::{
         CookieSessionBackend, CookieSessionError, RequestSession,
         Session, SessionBackend, SessionImpl, SessionStorage};`
-                                
+
   use `actix_web::middleware::session`
 
    `use actix_web::middleware::session{CookieSessionBackend, CookieSessionError,

README.md

@@ -1,79 +1,111 @@
-# Actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+<div align="center">
+  <h1>Actix web</h1>
+  <p>
+    <strong>Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust</strong>
+  </p>
+  <p>
 
-Actix web is a simple, pragmatic and extremely fast web framework for Rust.
+[![crates.io](https://img.shields.io/crates/v/actix-web?label=latest)](https://crates.io/crates/actix-web)
+[![Documentation](https://docs.rs/actix-web/badge.svg?version=3.3.2)](https://docs.rs/actix-web/3.3.2)
+[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
+![License](https://img.shields.io/crates/l/actix-web.svg)
+[![Dependency Status](https://deps.rs/crate/actix-web/3.3.2/status.svg)](https://deps.rs/crate/actix-web/3.3.2)
+<br />
+[![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) 
+[![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) 
+[![Download](https://img.shields.io/crates/d/actix-web.svg)](https://crates.io/crates/actix-web)
+[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+[![Chat on Discord](https://img.shields.io/discord/771444961383153695?label=chat&logo=discord)](https://discord.gg/NWpN5mmg3x)
 
-* Supported *HTTP/1.x* and *HTTP/2.0* protocols
+  </p>
+</div>
+
+## Features
+
+* Supports *HTTP/1.x* and *HTTP/2*
 * Streaming and pipelining
 * Keep-alive and slow requests handling
 * Client/server [WebSockets](https://actix.rs/docs/websockets/) support
 * Transparent content compression/decompression (br, gzip, deflate)
-* Configurable [request routing](https://actix.rs/docs/url-dispatch/)
+* Powerful [request routing](https://actix.rs/docs/url-dispatch/)
 * Multipart streams
 * Static assets
-* SSL support with OpenSSL or Rustls
+* SSL support using OpenSSL or Rustls
 * Middlewares ([Logger, Session, CORS, etc](https://actix.rs/docs/middleware/))
-* Includes an asynchronous [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
+* Includes an async [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
 * Supports [Actix actor framework](https://github.com/actix/actix)
+* Runs on stable Rust 1.46+
 
-## Documentation & community resources
+## Documentation
 
-* [User Guide](https://actix.rs/docs/)
-* [API Documentation (1.0)](https://docs.rs/actix-web/)
-* [API Documentation (0.7)](https://docs.rs/actix-web/0.7.19/actix_web/)
-* [Chat on gitter](https://gitter.im/actix/actix)
-* Cargo package: [actix-web](https://crates.io/crates/actix-web)
-* Minimum supported Rust version: 1.36 or later
+* [Website & User Guide](https://actix.rs)
+* [Examples Repository](https://github.com/actix/examples)
+* [API Documentation](https://docs.rs/actix-web)
+* [API Documentation (master branch)](https://actix.rs/actix-web/actix_web)
 
 ## Example
 
-```rust
-use actix_web::{web, App, HttpServer, Responder};
+Dependencies:
 
-fn index(info: web::Path<(u32, String)>) -> impl Responder {
-    format!("Hello {}! id:{}", info.1, info.0)
+```toml
+[dependencies]
+actix-web = "3"
+```
+
+Code:
+
+```rust
+use actix_web::{get, web, App, HttpServer, Responder};
+
+#[get("/{id}/{name}/index.html")]
+async fn index(web::Path((id, name)): web::Path<(u32, String)>) -> impl Responder {
+    format!("Hello {}! id:{}", name, id)
 }
 
-fn main() -> std::io::Result<()> {
-    HttpServer::new(
-        || App::new().service(
-              web::resource("/{id}/{name}/index.html").to(index)))
+#[actix_web::main]
+async fn main() -> std::io::Result<()> {
+    HttpServer::new(|| App::new().service(index))
         .bind("127.0.0.1:8080")?
         .run()
+        .await
 }
 ```
 
 ### More examples
 
-* [Basics](https://github.com/actix/examples/tree/master/basics/)
-* [Stateful](https://github.com/actix/examples/tree/master/state/)
-* [Multipart streams](https://github.com/actix/examples/tree/master/multipart/)
-* [Simple websocket](https://github.com/actix/examples/tree/master/websocket/)
-* [Tera](https://github.com/actix/examples/tree/master/template_tera/) /
-  [Askama](https://github.com/actix/examples/tree/master/template_askama/) templates
-* [Diesel integration](https://github.com/actix/examples/tree/master/diesel/)
-* [r2d2](https://github.com/actix/examples/tree/master/r2d2/)
-* [SSL / HTTP/2.0](https://github.com/actix/examples/tree/master/tls/)
-* [Tcp/Websocket chat](https://github.com/actix/examples/tree/master/websocket-chat/)
-* [Json](https://github.com/actix/examples/tree/master/json/)
+* [Basic Setup](https://github.com/actix/examples/tree/master/basics/)
+* [Application State](https://github.com/actix/examples/tree/master/state/)
+* [JSON Handling](https://github.com/actix/examples/tree/master/json/)
+* [Multipart Streams](https://github.com/actix/examples/tree/master/multipart/)
+* [Diesel Integration](https://github.com/actix/examples/tree/master/diesel/)
+* [r2d2 Integration](https://github.com/actix/examples/tree/master/r2d2/)
+* [Simple WebSocket](https://github.com/actix/examples/tree/master/websocket/)
+* [Tera Templates](https://github.com/actix/examples/tree/master/template_tera/)
+* [Askama Templates](https://github.com/actix/examples/tree/master/template_askama/)
+* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/rustls/)
+* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/openssl/)
+* [WebSocket Chat](https://github.com/actix/examples/tree/master/websocket-chat/)
 
 You may consider checking out
 [this directory](https://github.com/actix/examples/tree/master/) for more examples.
 
 ## Benchmarks
 
-* [TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r18)
+One of the fastest web frameworks available according to the
+[TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r19).
 
 ## License
 
 This project is licensed under either of
 
-* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
-* MIT license ([LICENSE-MIT](LICENSE-MIT) or [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
+* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or
+  [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
+* MIT license ([LICENSE-MIT](LICENSE-MIT) or
+  [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
 
 at your option.
 
 ## Code of Conduct
 
-Contribution to the actix-web crate is organized under the terms of the
-Contributor Covenant, the maintainer of actix-web, @fafhrd91, promises to
-intervene to uphold that code of conduct.
+Contribution to the actix-web repo is organized under the terms of the Contributor Covenant.
+The Actix team promises to intervene to uphold that code of conduct.

actix-cors/CHANGES.md

@@ -1,9 +0,0 @@
-# Changes
-
-## [0.1.1] - unreleased
-
-* Bump `derive_more` crate version to 0.15.0
-
-## [0.1.0] - 2019-06-15
-
-* Move cors middleware to separate crate

actix-cors/Cargo.toml

@@ -1,23 +0,0 @@
-[package]
-name = "actix-cors"
-version = "0.1.0"
-authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
-description = "Cross-origin resource sharing (CORS) for Actix applications."
-readme = "README.md"
-keywords = ["web", "framework"]
-homepage = "https://actix.rs"
-repository = "https://github.com/actix/actix-web.git"
-documentation = "https://docs.rs/actix-cors/"
-license = "MIT/Apache-2.0"
-edition = "2018"
-#workspace = ".."
-
-[lib]
-name = "actix_cors"
-path = "src/lib.rs"
-
-[dependencies]
-actix-web = "1.0.0"
-actix-service = "0.4.0"
-derive_more = "0.15.0"
-futures = "0.1.25"

actix-cors/README.md

@@ -1,9 +0,0 @@
-# Cors Middleware for actix web framework [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-cors)](https://crates.io/crates/actix-cors) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
-
-## Documentation & community resources
-
-* [User Guide](https://actix.rs/docs/)
-* [API Documentation](https://docs.rs/actix-cors/)
-* [Chat on gitter](https://gitter.im/actix/actix)
-* Cargo package: [actix-cors](https://crates.io/crates/actix-cors)
-* Minimum supported Rust version: 1.34 or later

actix-files/CHANGES.md

@@ -1,56 +1,115 @@
 # Changes
 
-## [0.1.5] - unreleased
+## Unreleased - 2021-xx-xx
 
+
+## 0.6.0-beta.1 - 2021-01-07
+* `HttpRange::parse` now has its own error type.
+* Update `bytes` to `1.0`. [#1813]
+
+[#1813]: https://github.com/actix/actix-web/pull/1813
+
+
+## 0.5.0 - 2020-12-26
+* Optionally support hidden files/directories. [#1811]
+
+[#1811]: https://github.com/actix/actix-web/pull/1811
+
+
+## 0.4.1 - 2020-11-24
+* Clarify order of parameters in `Files::new` and improve docs.
+
+
+## 0.4.0 - 2020-10-06
+* Add `Files::prefer_utf8` option that adds UTF-8 charset on certain response types. [#1714]
+
+[#1714]: https://github.com/actix/actix-web/pull/1714
+
+
+## 0.3.0 - 2020-09-11
+* No significant changes from 0.3.0-beta.1.
+
+
+## 0.3.0-beta.1 - 2020-07-15
+* Update `v_htmlescape` to 0.10
+* Update `actix-web` and `actix-http` dependencies to beta.1
+
+
+## 0.3.0-alpha.1 - 2020-05-23
+* Update `actix-web` and `actix-http` dependencies to alpha
+* Fix some typos in the docs
+* Bump minimum supported Rust version to 1.40
+* Support sending Content-Length when Content-Range is specified [#1384]
+
+[#1384]: https://github.com/actix/actix-web/pull/1384
+
+
+## 0.2.1 - 2019-12-22
+* Use the same format for file URLs regardless of platforms
+
+
+## 0.2.0 - 2019-12-20
+* Fix BodyEncoding trait import #1220
+
+
+## 0.2.0-alpha.1 - 2019-12-07
+* Migrate to `std::future`
+
+
+## 0.1.7 - 2019-11-06
+* Add an additional `filename*` param in the `Content-Disposition` header of
+  `actix_files::NamedFile` to be more compatible. (#1151)
+
+## 0.1.6 - 2019-10-14
+* Add option to redirect to a slash-ended path `Files` #1132
+
+
+## 0.1.5 - 2019-10-08
 * Bump up `mime_guess` crate version to 2.0.1
-
 * Bump up `percent-encoding` crate version to 2.1
+* Allow user defined request guards for `Files` #1113
 
-## [0.1.4] - 2019-07-20
 
+## 0.1.4 - 2019-07-20
 * Allow to disable `Content-Disposition` header #686
 
 
-## [0.1.3] - 2019-06-28
-
+## 0.1.3 - 2019-06-28
 * Do not set `Content-Length` header, let actix-http set it #930
 
 
-## [0.1.2] - 2019-06-13
-
+## 0.1.2 - 2019-06-13
 * Content-Length is 0 for NamedFile HEAD request #914
-
 * Fix ring dependency from actix-web default features for #741
 
-## [0.1.1] - 2019-06-01
 
+## 0.1.1 - 2019-06-01
 * Static files are incorrectly served as both chunked and with length #812
 
-## [0.1.0] - 2019-05-25
 
-* NamedFile last-modified check always fails due to nano-seconds
-  in file modified date #820
+## 0.1.0 - 2019-05-25
+* NamedFile last-modified check always fails due to nano-seconds in file modified date #820
 
-## [0.1.0-beta.4] - 2019-05-12
 
+## 0.1.0-beta.4 - 2019-05-12
 * Update actix-web to beta.4
 
-## [0.1.0-beta.1] - 2019-04-20
 
+## 0.1.0-beta.1 - 2019-04-20
 * Update actix-web to beta.1
 
-## [0.1.0-alpha.6] - 2019-04-14
 
+## 0.1.0-alpha.6 - 2019-04-14
 * Update actix-web to alpha6
 
-## [0.1.0-alpha.4] - 2019-04-08
 
+## 0.1.0-alpha.4 - 2019-04-08
 * Update actix-web to alpha4
 
-## [0.1.0-alpha.2] - 2019-04-02
 
+## 0.1.0-alpha.2 - 2019-04-02
 * Add default handler support
 
-## [0.1.0-alpha.1] - 2019-03-28
 
+## 0.1.0-alpha.1 - 2019-03-28
 * Initial impl

actix-files/Cargo.toml

@@ -1,35 +1,35 @@
 [package]
 name = "actix-files"
-version = "0.1.4"
+version = "0.6.0-beta.1"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
-description = "Static files support for actix web."
+description = "Static file serving for Actix Web"
 readme = "README.md"
 keywords = ["actix", "http", "async", "futures"]
 homepage = "https://actix.rs"
 repository = "https://github.com/actix/actix-web.git"
 documentation = "https://docs.rs/actix-files/"
 categories = ["asynchronous", "web-programming::http-server"]
-license = "MIT/Apache-2.0"
+license = "MIT OR Apache-2.0"
 edition = "2018"
-workspace = ".."
 
 [lib]
 name = "actix_files"
 path = "src/lib.rs"
 
 [dependencies]
-actix-web = { version = "1.0.2", default-features = false }
-actix-http = "0.2.9"
-actix-service = "0.4.1"
+actix-web = { version = "4.0.0-beta.1", default-features = false }
+actix-service = "2.0.0-beta.2"
 bitflags = "1"
-bytes = "0.4"
-futures = "0.1.25"
-derive_more = "0.15.0"
+bytes = "1"
+futures-core = { version = "0.3.7", default-features = false }
+futures-util = { version = "0.3.7", default-features = false }
+derive_more = "0.99.5"
 log = "0.4"
 mime = "0.3"
 mime_guess = "2.0.1"
 percent-encoding = "2.1"
-v_htmlescape = "0.4"
+v_htmlescape = "0.12"
 
 [dev-dependencies]
-actix-web = { version = "1.0.2", features=["ssl"] }
+actix-rt = "2.0.0-beta.1"
+actix-web = "4.0.0-beta.1"

actix-files/README.md

@@ -1,9 +1,19 @@
-# Static files support for actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-files)](https://crates.io/crates/actix-files) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+# actix-files
 
-## Documentation & community resources
+> Static file serving for Actix Web
 
-* [User Guide](https://actix.rs/docs/)
-* [API Documentation](https://docs.rs/actix-files/)
-* [Chat on gitter](https://gitter.im/actix/actix)
-* Cargo package: [actix-files](https://crates.io/crates/actix-files)
-* Minimum supported Rust version: 1.33 or later
+[![crates.io](https://img.shields.io/crates/v/actix-files?label=latest)](https://crates.io/crates/actix-files)
+[![Documentation](https://docs.rs/actix-files/badge.svg?version=0.5.0)](https://docs.rs/actix-files/0.5.0)
+[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
+![License](https://img.shields.io/crates/l/actix-files.svg)
+<br />
+[![dependency status](https://deps.rs/crate/actix-files/0.5.0/status.svg)](https://deps.rs/crate/actix-files/0.5.0)
+[![Download](https://img.shields.io/crates/d/actix-files.svg)](https://crates.io/crates/actix-files)
+[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+
+## Documentation & Resources
+
+- [API Documentation](https://docs.rs/actix-files/)
+- [Example Project](https://github.com/actix/examples/tree/master/static_index)
+- [Chat on Gitter](https://gitter.im/actix/actix-web)
+- Minimum supported Rust version: 1.46 or later

actix-files/src/chunked.rs

@@ -0,0 +1,94 @@
+use std::{
+    cmp, fmt,
+    fs::File,
+    future::Future,
+    io::{self, Read, Seek},
+    pin::Pin,
+    task::{Context, Poll},
+};
+
+use actix_web::{
+    error::{BlockingError, Error},
+    web,
+};
+use bytes::Bytes;
+use futures_core::{ready, Stream};
+use futures_util::future::{FutureExt, LocalBoxFuture};
+
+use crate::handle_error;
+
+type ChunkedBoxFuture =
+    LocalBoxFuture<'static, Result<(File, Bytes), BlockingError<io::Error>>>;
+
+#[doc(hidden)]
+/// A helper created from a `std::fs::File` which reads the file
+/// chunk-by-chunk on a `ThreadPool`.
+pub struct ChunkedReadFile {
+    pub(crate) size: u64,
+    pub(crate) offset: u64,
+    pub(crate) file: Option<File>,
+    pub(crate) fut: Option<ChunkedBoxFuture>,
+    pub(crate) counter: u64,
+}
+
+impl fmt::Debug for ChunkedReadFile {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        f.write_str("ChunkedReadFile")
+    }
+}
+
+impl Stream for ChunkedReadFile {
+    type Item = Result<Bytes, Error>;
+
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        if let Some(ref mut fut) = self.fut {
+            return match ready!(Pin::new(fut).poll(cx)) {
+                Ok((file, bytes)) => {
+                    self.fut.take();
+                    self.file = Some(file);
+
+                    self.offset += bytes.len() as u64;
+                    self.counter += bytes.len() as u64;
+
+                    Poll::Ready(Some(Ok(bytes)))
+                }
+                Err(e) => Poll::Ready(Some(Err(handle_error(e)))),
+            };
+        }
+
+        let size = self.size;
+        let offset = self.offset;
+        let counter = self.counter;
+
+        if size == counter {
+            Poll::Ready(None)
+        } else {
+            let mut file = self.file.take().expect("Use after completion");
+
+            self.fut = Some(
+                web::block(move || {
+                    let max_bytes =
+                        cmp::min(size.saturating_sub(counter), 65_536) as usize;
+
+                    let mut buf = Vec::with_capacity(max_bytes);
+                    file.seek(io::SeekFrom::Start(offset))?;
+
+                    let n_bytes =
+                        file.by_ref().take(max_bytes as u64).read_to_end(&mut buf)?;
+
+                    if n_bytes == 0 {
+                        return Err(io::ErrorKind::UnexpectedEof.into());
+                    }
+
+                    Ok((file, Bytes::from(buf)))
+                })
+                .boxed_local(),
+            );
+
+            self.poll_next(cx)
+        }
+    }
+}

actix-files/src/directory.rs

@@ -0,0 +1,114 @@
+use std::{fmt::Write, fs::DirEntry, io, path::Path, path::PathBuf};
+
+use actix_web::{dev::ServiceResponse, HttpRequest, HttpResponse};
+use percent_encoding::{utf8_percent_encode, CONTROLS};
+use v_htmlescape::escape as escape_html_entity;
+
+/// A directory; responds with the generated directory listing.
+#[derive(Debug)]
+pub struct Directory {
+    /// Base directory.
+    pub base: PathBuf,
+
+    /// Path of subdirectory to generate listing for.
+    pub path: PathBuf,
+}
+
+impl Directory {
+    /// Create a new directory
+    pub fn new(base: PathBuf, path: PathBuf) -> Directory {
+        Directory { base, path }
+    }
+
+    /// Is this entry visible from this directory?
+    pub fn is_visible(&self, entry: &io::Result<DirEntry>) -> bool {
+        if let Ok(ref entry) = *entry {
+            if let Some(name) = entry.file_name().to_str() {
+                if name.starts_with('.') {
+                    return false;
+                }
+            }
+            if let Ok(ref md) = entry.metadata() {
+                let ft = md.file_type();
+                return ft.is_dir() || ft.is_file() || ft.is_symlink();
+            }
+        }
+        false
+    }
+}
+
+pub(crate) type DirectoryRenderer =
+    dyn Fn(&Directory, &HttpRequest) -> Result<ServiceResponse, io::Error>;
+
+// show file url as relative to static path
+macro_rules! encode_file_url {
+    ($path:ident) => {
+        utf8_percent_encode(&$path, CONTROLS)
+    };
+}
+
+// " -- &quot;  & -- &amp;  ' -- &#x27;  < -- &lt;  > -- &gt;  / -- &#x2f;
+macro_rules! encode_file_name {
+    ($entry:ident) => {
+        escape_html_entity(&$entry.file_name().to_string_lossy())
+    };
+}
+
+pub(crate) fn directory_listing(
+    dir: &Directory,
+    req: &HttpRequest,
+) -> Result<ServiceResponse, io::Error> {
+    let index_of = format!("Index of {}", req.path());
+    let mut body = String::new();
+    let base = Path::new(req.path());
+
+    for entry in dir.path.read_dir()? {
+        if dir.is_visible(&entry) {
+            let entry = entry.unwrap();
+            let p = match entry.path().strip_prefix(&dir.path) {
+                Ok(p) if cfg!(windows) => {
+                    base.join(p).to_string_lossy().replace("\\", "/")
+                }
+                Ok(p) => base.join(p).to_string_lossy().into_owned(),
+                Err(_) => continue,
+            };
+
+            // if file is a directory, add '/' to the end of the name
+            if let Ok(metadata) = entry.metadata() {
+                if metadata.is_dir() {
+                    let _ = write!(
+                        body,
+                        "<li><a href=\"{}\">{}/</a></li>",
+                        encode_file_url!(p),
+                        encode_file_name!(entry),
+                    );
+                } else {
+                    let _ = write!(
+                        body,
+                        "<li><a href=\"{}\">{}</a></li>",
+                        encode_file_url!(p),
+                        encode_file_name!(entry),
+                    );
+                }
+            } else {
+                continue;
+            }
+        }
+    }
+
+    let html = format!(
+        "<html>\
+         <head><title>{}</title></head>\
+         <body><h1>{}</h1>\
+         <ul>\
+         {}\
+         </ul></body>\n</html>",
+        index_of, index_of, body
+    );
+    Ok(ServiceResponse::new(
+        req.clone(),
+        HttpResponse::Ok()
+            .content_type("text/html; charset=utf-8")
+            .body(html),
+    ))
+}

actix-files/src/encoding.rs

@@ -0,0 +1,52 @@
+use mime::Mime;
+
+/// Transforms MIME `text/*` types into their UTF-8 equivalent, if supported.
+///
+/// MIME types that are converted
+/// - application/javascript
+/// - text/html
+/// - text/css
+/// - text/plain
+/// - text/csv
+/// - text/tab-separated-values
+pub(crate) fn equiv_utf8_text(ct: Mime) -> Mime {
+    // use (roughly) order of file-type popularity for a web server
+
+    if ct == mime::APPLICATION_JAVASCRIPT {
+        return mime::APPLICATION_JAVASCRIPT_UTF_8;
+    }
+
+    if ct == mime::TEXT_HTML {
+        return mime::TEXT_HTML_UTF_8;
+    }
+
+    if ct == mime::TEXT_CSS {
+        return mime::TEXT_CSS_UTF_8;
+    }
+
+    if ct == mime::TEXT_PLAIN {
+        return mime::TEXT_PLAIN_UTF_8;
+    }
+
+    if ct == mime::TEXT_CSV {
+        return mime::TEXT_CSV_UTF_8;
+    }
+
+    if ct == mime::TEXT_TAB_SEPARATED_VALUES {
+        return mime::TEXT_TAB_SEPARATED_VALUES_UTF_8;
+    }
+
+    ct
+}
+
+#[cfg(test)]
+mod tests {
+    use super::*;
+
+    #[test]
+    fn test_equiv_utf8_text() {
+        assert_eq!(equiv_utf8_text(mime::TEXT_PLAIN), mime::TEXT_PLAIN_UTF_8);
+        assert_eq!(equiv_utf8_text(mime::TEXT_XML), mime::TEXT_XML);
+        assert_eq!(equiv_utf8_text(mime::IMAGE_PNG), mime::IMAGE_PNG);
+    }
+}

actix-files/src/error.rs

@@ -5,6 +5,7 @@ use derive_more::Display;
 #[derive(Display, Debug, PartialEq)]
 pub enum FilesError {
     /// Path is not a directory
+    #[allow(dead_code)]
     #[display(fmt = "Path is not a directory. Unable to serve static files")]
     IsNotDirectory,
 
@@ -35,7 +36,7 @@ pub enum UriSegmentError {
 
 /// Return `BadRequest` for `UriSegmentError`
 impl ResponseError for UriSegmentError {
-    fn error_response(&self) -> HttpResponse {
-        HttpResponse::new(StatusCode::BAD_REQUEST)
+    fn status_code(&self) -> StatusCode {
+        StatusCode::BAD_REQUEST
     }
 }

actix-files/src/files.rs

@@ -0,0 +1,281 @@
+use std::{cell::RefCell, fmt, io, path::PathBuf, rc::Rc};
+
+use actix_service::{boxed, IntoServiceFactory, ServiceFactory, ServiceFactoryExt};
+use actix_web::{
+    dev::{
+        AppService, HttpServiceFactory, ResourceDef, ServiceRequest, ServiceResponse,
+    },
+    error::Error,
+    guard::Guard,
+    http::header::DispositionType,
+    HttpRequest,
+};
+use futures_util::future::{ok, FutureExt, LocalBoxFuture};
+
+use crate::{
+    directory_listing, named, Directory, DirectoryRenderer, FilesService,
+    HttpNewService, MimeOverride,
+};
+
+/// Static files handling service.
+///
+/// `Files` service must be registered with `App::service()` method.
+///
+/// ```rust
+/// use actix_web::App;
+/// use actix_files::Files;
+///
+/// let app = App::new()
+///     .service(Files::new("/static", "."));
+/// ```
+pub struct Files {
+    path: String,
+    directory: PathBuf,
+    index: Option<String>,
+    show_index: bool,
+    redirect_to_slash: bool,
+    default: Rc<RefCell<Option<Rc<HttpNewService>>>>,
+    renderer: Rc<DirectoryRenderer>,
+    mime_override: Option<Rc<MimeOverride>>,
+    file_flags: named::Flags,
+    guards: Option<Rc<dyn Guard>>,
+    hidden_files: bool,
+}
+
+impl fmt::Debug for Files {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        f.write_str("Files")
+    }
+}
+
+impl Clone for Files {
+    fn clone(&self) -> Self {
+        Self {
+            directory: self.directory.clone(),
+            index: self.index.clone(),
+            show_index: self.show_index,
+            redirect_to_slash: self.redirect_to_slash,
+            default: self.default.clone(),
+            renderer: self.renderer.clone(),
+            file_flags: self.file_flags,
+            path: self.path.clone(),
+            mime_override: self.mime_override.clone(),
+            guards: self.guards.clone(),
+            hidden_files: self.hidden_files,
+        }
+    }
+}
+
+impl Files {
+    /// Create new `Files` instance for a specified base directory.
+    ///
+    /// # Argument Order
+    /// The first argument (`mount_path`) is the root URL at which the static files are served.
+    /// For example, `/assets` will serve files at `example.com/assets/...`.
+    ///
+    /// The second argument (`serve_from`) is the location on disk at which files are loaded.
+    /// This can be a relative path. For example, `./` would serve files from the current
+    /// working directory.
+    ///
+    /// # Implementation Notes
+    /// If the mount path is set as the root path `/`, services registered after this one will
+    /// be inaccessible. Register more specific handlers and services first.
+    ///
+    /// `Files` uses a threadpool for blocking filesystem operations. By default, the pool uses a
+    /// number of threads equal to 5x the number of available logical CPUs. Pool size can be changed
+    /// by setting ACTIX_THREADPOOL environment variable.
+    pub fn new<T: Into<PathBuf>>(mount_path: &str, serve_from: T) -> Files {
+        let orig_dir = serve_from.into();
+        let dir = match orig_dir.canonicalize() {
+            Ok(canon_dir) => canon_dir,
+            Err(_) => {
+                log::error!("Specified path is not a directory: {:?}", orig_dir);
+                PathBuf::new()
+            }
+        };
+
+        Files {
+            path: mount_path.to_owned(),
+            directory: dir,
+            index: None,
+            show_index: false,
+            redirect_to_slash: false,
+            default: Rc::new(RefCell::new(None)),
+            renderer: Rc::new(directory_listing),
+            mime_override: None,
+            file_flags: named::Flags::default(),
+            guards: None,
+            hidden_files: false,
+        }
+    }
+
+    /// Show files listing for directories.
+    ///
+    /// By default show files listing is disabled.
+    pub fn show_files_listing(mut self) -> Self {
+        self.show_index = true;
+        self
+    }
+
+    /// Redirects to a slash-ended path when browsing a directory.
+    ///
+    /// By default never redirect.
+    pub fn redirect_to_slash_directory(mut self) -> Self {
+        self.redirect_to_slash = true;
+        self
+    }
+
+    /// Set custom directory renderer
+    pub fn files_listing_renderer<F>(mut self, f: F) -> Self
+    where
+        for<'r, 's> F: Fn(&'r Directory, &'s HttpRequest) -> Result<ServiceResponse, io::Error>
+            + 'static,
+    {
+        self.renderer = Rc::new(f);
+        self
+    }
+
+    /// Specifies mime override callback
+    pub fn mime_override<F>(mut self, f: F) -> Self
+    where
+        F: Fn(&mime::Name<'_>) -> DispositionType + 'static,
+    {
+        self.mime_override = Some(Rc::new(f));
+        self
+    }
+
+    /// Set index file
+    ///
+    /// Shows specific index file for directory "/" instead of
+    /// showing files listing.
+    pub fn index_file<T: Into<String>>(mut self, index: T) -> Self {
+        self.index = Some(index.into());
+        self
+    }
+
+    /// Specifies whether to use ETag or not.
+    ///
+    /// Default is true.
+    #[inline]
+    pub fn use_etag(mut self, value: bool) -> Self {
+        self.file_flags.set(named::Flags::ETAG, value);
+        self
+    }
+
+    /// Specifies whether to use Last-Modified or not.
+    ///
+    /// Default is true.
+    #[inline]
+    pub fn use_last_modified(mut self, value: bool) -> Self {
+        self.file_flags.set(named::Flags::LAST_MD, value);
+        self
+    }
+
+    /// Specifies whether text responses should signal a UTF-8 encoding.
+    ///
+    /// Default is false (but will default to true in a future version).
+    #[inline]
+    pub fn prefer_utf8(mut self, value: bool) -> Self {
+        self.file_flags.set(named::Flags::PREFER_UTF8, value);
+        self
+    }
+
+    /// Specifies custom guards to use for directory listings and files.
+    ///
+    /// Default behaviour allows GET and HEAD.
+    #[inline]
+    pub fn use_guards<G: Guard + 'static>(mut self, guards: G) -> Self {
+        self.guards = Some(Rc::new(guards));
+        self
+    }
+
+    /// Disable `Content-Disposition` header.
+    ///
+    /// By default Content-Disposition` header is enabled.
+    #[inline]
+    pub fn disable_content_disposition(mut self) -> Self {
+        self.file_flags.remove(named::Flags::CONTENT_DISPOSITION);
+        self
+    }
+
+    /// Sets default handler which is used when no matched file could be found.
+    pub fn default_handler<F, U>(mut self, f: F) -> Self
+    where
+        F: IntoServiceFactory<U, ServiceRequest>,
+        U: ServiceFactory<
+                ServiceRequest,
+                Config = (),
+                Response = ServiceResponse,
+                Error = Error,
+            > + 'static,
+    {
+        // create and configure default resource
+        self.default = Rc::new(RefCell::new(Some(Rc::new(boxed::factory(
+            f.into_factory().map_init_err(|_| ()),
+        )))));
+
+        self
+    }
+
+    /// Enables serving hidden files and directories, allowing a leading dots in url fragments.
+    #[inline]
+    pub fn use_hidden_files(mut self) -> Self {
+        self.hidden_files = true;
+        self
+    }
+}
+
+impl HttpServiceFactory for Files {
+    fn register(self, config: &mut AppService) {
+        if self.default.borrow().is_none() {
+            *self.default.borrow_mut() = Some(config.default_service());
+        }
+
+        let rdef = if config.is_root() {
+            ResourceDef::root_prefix(&self.path)
+        } else {
+            ResourceDef::prefix(&self.path)
+        };
+
+        config.register_service(rdef, None, self, None)
+    }
+}
+
+impl ServiceFactory<ServiceRequest> for Files {
+    type Response = ServiceResponse;
+    type Error = Error;
+    type Config = ();
+    type Service = FilesService;
+    type InitError = ();
+    type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
+
+    fn new_service(&self, _: ()) -> Self::Future {
+        let mut srv = FilesService {
+            directory: self.directory.clone(),
+            index: self.index.clone(),
+            show_index: self.show_index,
+            redirect_to_slash: self.redirect_to_slash,
+            default: None,
+            renderer: self.renderer.clone(),
+            mime_override: self.mime_override.clone(),
+            file_flags: self.file_flags,
+            guards: self.guards.clone(),
+            hidden_files: self.hidden_files,
+        };
+
+        if let Some(ref default) = *self.default.borrow() {
+            default
+                .new_service(())
+                .map(move |result| match result {
+                    Ok(default) => {
+                        srv.default = Some(default);
+                        Ok(srv)
+                    }
+                    Err(_) => Err(()),
+                })
+                .boxed_local()
+        } else {
+            ok(srv).boxed_local()
+        }
+    }
+}

actix-files/src/named.rs

@@ -7,32 +7,36 @@ use std::time::{SystemTime, UNIX_EPOCH};
 #[cfg(unix)]
 use std::os::unix::fs::MetadataExt;
 
+use actix_web::{
+    dev::{BodyEncoding, SizedStream},
+    http::{
+        header::{
+            self, Charset, ContentDisposition, DispositionParam, DispositionType,
+            ExtendedValue,
+        },
+        ContentEncoding, StatusCode,
+    },
+    Error, HttpMessage, HttpRequest, HttpResponse, Responder,
+};
 use bitflags::bitflags;
-use mime;
+use futures_util::future::{ready, Ready};
 use mime_guess::from_path;
 
-use actix_http::body::SizedStream;
-use actix_web::http::header::{
-    self, ContentDisposition, DispositionParam, DispositionType,
-};
-use actix_web::http::{ContentEncoding, Method, StatusCode};
-use actix_web::middleware::BodyEncoding;
-use actix_web::{Error, HttpMessage, HttpRequest, HttpResponse, Responder};
-
-use crate::range::HttpRange;
 use crate::ChunkedReadFile;
+use crate::{encoding::equiv_utf8_text, range::HttpRange};
 
 bitflags! {
     pub(crate) struct Flags: u8 {
-        const ETAG = 0b0000_0001;
-        const LAST_MD = 0b0000_0010;
+        const ETAG =                0b0000_0001;
+        const LAST_MD =             0b0000_0010;
         const CONTENT_DISPOSITION = 0b0000_0100;
+        const PREFER_UTF8 =         0b0000_1000;
     }
 }
 
 impl Default for Flags {
     fn default() -> Self {
-        Flags::all()
+        Flags::from_bits_truncate(0b0000_0111)
     }
 }
 
@@ -89,20 +93,35 @@ impl NamedFile {
             };
 
             let ct = from_path(&path).first_or_octet_stream();
-            let disposition_type = match ct.type_() {
+
+            let disposition = match ct.type_() {
                 mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
                 _ => DispositionType::Attachment,
             };
+
+            let mut parameters =
+                vec![DispositionParam::Filename(String::from(filename.as_ref()))];
+
+            if !filename.is_ascii() {
+                parameters.push(DispositionParam::FilenameExt(ExtendedValue {
+                    charset: Charset::Ext(String::from("UTF-8")),
+                    language_tag: None,
+                    value: filename.into_owned().into_bytes(),
+                }))
+            }
+
             let cd = ContentDisposition {
-                disposition: disposition_type,
-                parameters: vec![DispositionParam::Filename(filename.into_owned())],
+                disposition,
+                parameters,
             };
+
             (ct, cd)
         };
 
         let md = file.metadata()?;
         let modified = md.modified().ok();
         let encoding = None;
+
         Ok(NamedFile {
             path,
             file,
@@ -174,7 +193,7 @@ impl NamedFile {
     /// image, and video content types, and `attachment` otherwise, and
     /// the filename is taken from the path provided in the `open` method
     /// after converting it to UTF-8 using.
-    /// [to_string_lossy](https://doc.rust-lang.org/std/ffi/struct.OsStr.html#method.to_string_lossy).
+    /// [`std::ffi::OsStr::to_string_lossy`]
     #[inline]
     pub fn set_content_disposition(mut self, cd: header::ContentDisposition) -> Self {
         self.content_disposition = cd;
@@ -198,24 +217,33 @@ impl NamedFile {
         self
     }
 
-    #[inline]
-    ///Specifies whether to use ETag or not.
+    /// Specifies whether to use ETag or not.
     ///
-    ///Default is true.
+    /// Default is true.
+    #[inline]
     pub fn use_etag(mut self, value: bool) -> Self {
         self.flags.set(Flags::ETAG, value);
         self
     }
 
-    #[inline]
-    ///Specifies whether to use Last-Modified or not.
+    /// Specifies whether to use Last-Modified or not.
     ///
-    ///Default is true.
+    /// Default is true.
+    #[inline]
     pub fn use_last_modified(mut self, value: bool) -> Self {
         self.flags.set(Flags::LAST_MD, value);
         self
     }
 
+    /// Specifies whether text responses should signal a UTF-8 encoding.
+    ///
+    /// Default is false (but will default to true in a future version).
+    #[inline]
+    pub fn prefer_utf8(mut self, value: bool) -> Self {
+        self.flags.set(Flags::PREFER_UTF8, value);
+        self
+    }
+
     pub(crate) fn etag(&self) -> Option<header::EntityTag> {
         // This etag format is similar to Apache's.
         self.modified.as_ref().map(|mtime| {
@@ -233,6 +261,7 @@ impl NamedFile {
             let dur = mtime
                 .duration_since(UNIX_EPOCH)
                 .expect("modification time must be after epoch");
+
             header::EntityTag::strong(format!(
                 "{:x}:{:x}:{:x}:{:x}",
                 ino,
@@ -246,74 +275,30 @@ impl NamedFile {
     pub(crate) fn last_modified(&self) -> Option<header::HttpDate> {
         self.modified.map(|mtime| mtime.into())
     }
-}
 
-impl Deref for NamedFile {
-    type Target = File;
-
-    fn deref(&self) -> &File {
-        &self.file
-    }
-}
-
-impl DerefMut for NamedFile {
-    fn deref_mut(&mut self) -> &mut File {
-        &mut self.file
-    }
-}
-
-/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
-fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
-    match req.get_header::<header::IfMatch>() {
-        None | Some(header::IfMatch::Any) => true,
-        Some(header::IfMatch::Items(ref items)) => {
-            if let Some(some_etag) = etag {
-                for item in items {
-                    if item.strong_eq(some_etag) {
-                        return true;
-                    }
-                }
-            }
-            false
-        }
-    }
-}
-
-/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
-fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
-    match req.get_header::<header::IfNoneMatch>() {
-        Some(header::IfNoneMatch::Any) => false,
-        Some(header::IfNoneMatch::Items(ref items)) => {
-            if let Some(some_etag) = etag {
-                for item in items {
-                    if item.weak_eq(some_etag) {
-                        return false;
-                    }
-                }
-            }
-            true
-        }
-        None => true,
-    }
-}
-
-impl Responder for NamedFile {
-    type Error = Error;
-    type Future = Result<HttpResponse, Error>;
-
-    fn respond_to(self, req: &HttpRequest) -> Self::Future {
+    /// Creates an `HttpResponse` with file as a streaming body.
+    pub fn into_response(self, req: &HttpRequest) -> Result<HttpResponse, Error> {
         if self.status_code != StatusCode::OK {
-            let mut resp = HttpResponse::build(self.status_code);
-            resp.set(header::ContentType(self.content_type.clone()))
-                .if_true(self.flags.contains(Flags::CONTENT_DISPOSITION), |res| {
-                    res.header(
-                        header::CONTENT_DISPOSITION,
-                        self.content_disposition.to_string(),
-                    );
-                });
-            if let Some(current_encoding) = self.encoding {
-                resp.encoding(current_encoding);
+            let mut res = HttpResponse::build(self.status_code);
+
+            if self.flags.contains(Flags::PREFER_UTF8) {
+                let ct = equiv_utf8_text(self.content_type.clone());
+                res.header(header::CONTENT_TYPE, ct.to_string());
+            } else {
+                res.header(header::CONTENT_TYPE, self.content_type.to_string());
             }
+
+            if self.flags.contains(Flags::CONTENT_DISPOSITION) {
+                res.header(
+                    header::CONTENT_DISPOSITION,
+                    self.content_disposition.to_string(),
+                );
+            }
+
+            if let Some(current_encoding) = self.encoding {
+                res.encoding(current_encoding);
+            }
+
             let reader = ChunkedReadFile {
                 size: self.md.len(),
                 offset: 0,
@@ -321,17 +306,8 @@ impl Responder for NamedFile {
                 fut: None,
                 counter: 0,
             };
-            return Ok(resp.streaming(reader));
-        }
 
-        match *req.method() {
-            Method::HEAD | Method::GET => (),
-            _ => {
-                return Ok(HttpResponse::MethodNotAllowed()
-                    .header(header::CONTENT_TYPE, "text/plain")
-                    .header(header::ALLOW, "GET, HEAD")
-                    .body("This resource only supports GET and HEAD."));
-            }
+            return Ok(res.streaming(reader));
         }
 
         let etag = if self.flags.contains(Flags::ETAG) {
@@ -339,6 +315,7 @@ impl Responder for NamedFile {
         } else {
             None
         };
+
         let last_modified = if self.flags.contains(Flags::LAST_MD) {
             self.last_modified()
         } else {
@@ -353,6 +330,7 @@ impl Responder for NamedFile {
         {
             let t1: SystemTime = m.clone().into();
             let t2: SystemTime = since.clone().into();
+
             match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
                 (Ok(t1), Ok(t2)) => t1 > t2,
                 _ => false,
@@ -364,13 +342,14 @@ impl Responder for NamedFile {
         // check last modified
         let not_modified = if !none_match(etag.as_ref(), req) {
             true
-        } else if req.headers().contains_key(&header::IF_NONE_MATCH) {
+        } else if req.headers().contains_key(header::IF_NONE_MATCH) {
             false
         } else if let (Some(ref m), Some(header::IfModifiedSince(ref since))) =
             (last_modified, req.get_header())
         {
             let t1: SystemTime = m.clone().into();
             let t2: SystemTime = since.clone().into();
+
             match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
                 (Ok(t1), Ok(t2)) => t1 <= t2,
                 _ => false,
@@ -380,24 +359,33 @@ impl Responder for NamedFile {
         };
 
         let mut resp = HttpResponse::build(self.status_code);
-        resp.set(header::ContentType(self.content_type.clone()))
-            .if_true(self.flags.contains(Flags::CONTENT_DISPOSITION), |res| {
-                res.header(
-                    header::CONTENT_DISPOSITION,
-                    self.content_disposition.to_string(),
-                );
-            });
+
+        if self.flags.contains(Flags::PREFER_UTF8) {
+            let ct = equiv_utf8_text(self.content_type.clone());
+            resp.header(header::CONTENT_TYPE, ct.to_string());
+        } else {
+            resp.header(header::CONTENT_TYPE, self.content_type.to_string());
+        }
+
+        if self.flags.contains(Flags::CONTENT_DISPOSITION) {
+            resp.header(
+                header::CONTENT_DISPOSITION,
+                self.content_disposition.to_string(),
+            );
+        }
+
         // default compressing
         if let Some(current_encoding) = self.encoding {
             resp.encoding(current_encoding);
         }
 
-        resp.if_some(last_modified, |lm, resp| {
-            resp.set(header::LastModified(lm));
-        })
-        .if_some(etag, |etag, resp| {
-            resp.set(header::ETag(etag));
-        });
+        if let Some(lm) = last_modified {
+            resp.header(header::LAST_MODIFIED, lm.to_string());
+        }
+
+        if let Some(etag) = etag {
+            resp.header(header::ETAG, etag.to_string());
+        }
 
         resp.header(header::ACCEPT_RANGES, "bytes");
 
@@ -405,11 +393,12 @@ impl Responder for NamedFile {
         let mut offset = 0;
 
         // check for range header
-        if let Some(ranges) = req.headers().get(&header::RANGE) {
-            if let Ok(rangesheader) = ranges.to_str() {
-                if let Ok(rangesvec) = HttpRange::parse(rangesheader, length) {
-                    length = rangesvec[0].length;
-                    offset = rangesvec[0].start;
+        if let Some(ranges) = req.headers().get(header::RANGE) {
+            if let Ok(ranges_header) = ranges.to_str() {
+                if let Ok(ranges) = HttpRange::parse(ranges_header, length) {
+                    length = ranges[0].length;
+                    offset = ranges[0].start;
+
                     resp.encoding(ContentEncoding::Identity);
                     resp.header(
                         header::CONTENT_RANGE,
@@ -442,9 +431,74 @@ impl Responder for NamedFile {
             fut: None,
             counter: 0,
         };
+
         if offset != 0 || length != self.md.len() {
-            return Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader));
-        };
+            resp.status(StatusCode::PARTIAL_CONTENT);
+        }
+
         Ok(resp.body(SizedStream::new(length, reader)))
     }
 }
+
+impl Deref for NamedFile {
+    type Target = File;
+
+    fn deref(&self) -> &File {
+        &self.file
+    }
+}
+
+impl DerefMut for NamedFile {
+    fn deref_mut(&mut self) -> &mut File {
+        &mut self.file
+    }
+}
+
+/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
+fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
+    match req.get_header::<header::IfMatch>() {
+        None | Some(header::IfMatch::Any) => true,
+
+        Some(header::IfMatch::Items(ref items)) => {
+            if let Some(some_etag) = etag {
+                for item in items {
+                    if item.strong_eq(some_etag) {
+                        return true;
+                    }
+                }
+            }
+
+            false
+        }
+    }
+}
+
+/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
+fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
+    match req.get_header::<header::IfNoneMatch>() {
+        Some(header::IfNoneMatch::Any) => false,
+
+        Some(header::IfNoneMatch::Items(ref items)) => {
+            if let Some(some_etag) = etag {
+                for item in items {
+                    if item.weak_eq(some_etag) {
+                        return false;
+                    }
+                }
+            }
+
+            true
+        }
+
+        None => true,
+    }
+}
+
+impl Responder for NamedFile {
+    type Error = Error;
+    type Future = Ready<Result<HttpResponse, Error>>;
+
+    fn respond_to(self, req: &HttpRequest) -> Self::Future {
+        ready(self.into_response(req))
+    }
+}

actix-files/src/path_buf.rs

@@ -0,0 +1,119 @@
+use std::{
+    path::{Path, PathBuf},
+    str::FromStr,
+};
+
+use actix_web::{dev::Payload, FromRequest, HttpRequest};
+use futures_util::future::{ready, Ready};
+
+use crate::error::UriSegmentError;
+
+#[derive(Debug)]
+pub(crate) struct PathBufWrap(PathBuf);
+
+impl FromStr for PathBufWrap {
+    type Err = UriSegmentError;
+
+    fn from_str(path: &str) -> Result<Self, Self::Err> {
+        Self::parse_path(path, false)
+    }
+}
+
+impl PathBufWrap {
+    /// Parse a path, giving the choice of allowing hidden files to be considered valid segments.
+    pub fn parse_path(path: &str, hidden_files: bool) -> Result<Self, UriSegmentError> {
+        let mut buf = PathBuf::new();
+
+        for segment in path.split('/') {
+            if segment == ".." {
+                buf.pop();
+            } else if !hidden_files && segment.starts_with('.') {
+                return Err(UriSegmentError::BadStart('.'));
+            } else if segment.starts_with('*') {
+                return Err(UriSegmentError::BadStart('*'));
+            } else if segment.ends_with(':') {
+                return Err(UriSegmentError::BadEnd(':'));
+            } else if segment.ends_with('>') {
+                return Err(UriSegmentError::BadEnd('>'));
+            } else if segment.ends_with('<') {
+                return Err(UriSegmentError::BadEnd('<'));
+            } else if segment.is_empty() {
+                continue;
+            } else if cfg!(windows) && segment.contains('\\') {
+                return Err(UriSegmentError::BadChar('\\'));
+            } else {
+                buf.push(segment)
+            }
+        }
+
+        Ok(PathBufWrap(buf))
+    }
+}
+
+impl AsRef<Path> for PathBufWrap {
+    fn as_ref(&self) -> &Path {
+        self.0.as_ref()
+    }
+}
+
+impl FromRequest for PathBufWrap {
+    type Error = UriSegmentError;
+    type Future = Ready<Result<Self, Self::Error>>;
+    type Config = ();
+
+    fn from_request(req: &HttpRequest, _: &mut Payload) -> Self::Future {
+        ready(req.match_info().path().parse())
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use std::iter::FromIterator;
+
+    use super::*;
+
+    #[test]
+    fn test_path_buf() {
+        assert_eq!(
+            PathBufWrap::from_str("/test/.tt").map(|t| t.0),
+            Err(UriSegmentError::BadStart('.'))
+        );
+        assert_eq!(
+            PathBufWrap::from_str("/test/*tt").map(|t| t.0),
+            Err(UriSegmentError::BadStart('*'))
+        );
+        assert_eq!(
+            PathBufWrap::from_str("/test/tt:").map(|t| t.0),
+            Err(UriSegmentError::BadEnd(':'))
+        );
+        assert_eq!(
+            PathBufWrap::from_str("/test/tt<").map(|t| t.0),
+            Err(UriSegmentError::BadEnd('<'))
+        );
+        assert_eq!(
+            PathBufWrap::from_str("/test/tt>").map(|t| t.0),
+            Err(UriSegmentError::BadEnd('>'))
+        );
+        assert_eq!(
+            PathBufWrap::from_str("/seg1/seg2/").unwrap().0,
+            PathBuf::from_iter(vec!["seg1", "seg2"])
+        );
+        assert_eq!(
+            PathBufWrap::from_str("/seg1/../seg2/").unwrap().0,
+            PathBuf::from_iter(vec!["seg2"])
+        );
+    }
+
+    #[test]
+    fn test_parse_path() {
+        assert_eq!(
+            PathBufWrap::parse_path("/test/.tt", false).map(|t| t.0),
+            Err(UriSegmentError::BadStart('.'))
+        );
+
+        assert_eq!(
+            PathBufWrap::parse_path("/test/.tt", true).unwrap().0,
+            PathBuf::from_iter(vec!["test", ".tt"])
+        );
+    }
+}

actix-files/src/range.rs

@@ -1,24 +1,33 @@
+use derive_more::{Display, Error};
+
 /// HTTP Range header representation.
 #[derive(Debug, Clone, Copy)]
 pub struct HttpRange {
+    /// Start of range.
     pub start: u64,
+
+    /// Length of range.
     pub length: u64,
 }
 
-static PREFIX: &str = "bytes=";
+const PREFIX: &str = "bytes=";
 const PREFIX_LEN: usize = 6;
 
+#[derive(Debug, Clone, Display, Error)]
+#[display(fmt = "Parse HTTP Range failed")]
+pub struct ParseRangeErr(#[error(not(source))] ());
+
 impl HttpRange {
     /// Parses Range HTTP header string as per RFC 2616.
     ///
     /// `header` is HTTP Range header (e.g. `bytes=bytes=0-9`).
     /// `size` is full size of response (file).
-    pub fn parse(header: &str, size: u64) -> Result<Vec<HttpRange>, ()> {
+    pub fn parse(header: &str, size: u64) -> Result<Vec<HttpRange>, ParseRangeErr> {
         if header.is_empty() {
             return Ok(Vec::new());
         }
         if !header.starts_with(PREFIX) {
-            return Err(());
+            return Err(ParseRangeErr(()));
         }
 
         let size_sig = size as i64;
@@ -31,13 +40,14 @@ impl HttpRange {
             .map(|ra| {
                 let mut start_end_iter = ra.split('-');
 
-                let start_str = start_end_iter.next().ok_or(())?.trim();
-                let end_str = start_end_iter.next().ok_or(())?.trim();
+                let start_str = start_end_iter.next().ok_or(ParseRangeErr(()))?.trim();
+                let end_str = start_end_iter.next().ok_or(ParseRangeErr(()))?.trim();
 
                 if start_str.is_empty() {
                     // If no start is specified, end specifies the
                     // range start relative to the end of the file.
-                    let mut length: i64 = end_str.parse().map_err(|_| ())?;
+                    let mut length: i64 =
+                        end_str.parse().map_err(|_| ParseRangeErr(()))?;
 
                     if length > size_sig {
                         length = size_sig;
@@ -48,10 +58,10 @@ impl HttpRange {
                         length: length as u64,
                     }))
                 } else {
-                    let start: i64 = start_str.parse().map_err(|_| ())?;
+                    let start: i64 = start_str.parse().map_err(|_| ParseRangeErr(()))?;
 
                     if start < 0 {
-                        return Err(());
+                        return Err(ParseRangeErr(()));
                     }
                     if start >= size_sig {
                         no_overlap = true;
@@ -62,10 +72,11 @@ impl HttpRange {
                         // If no end is specified, range extends to end of the file.
                         size_sig - start
                     } else {
-                        let mut end: i64 = end_str.parse().map_err(|_| ())?;
+                        let mut end: i64 =
+                            end_str.parse().map_err(|_| ParseRangeErr(()))?;
 
                         if start > end {
-                            return Err(());
+                            return Err(ParseRangeErr(()));
                         }
 
                         if end >= size_sig {
@@ -86,7 +97,7 @@ impl HttpRange {
         let ranges: Vec<HttpRange> = all_ranges.into_iter().filter_map(|x| x).collect();
 
         if no_overlap && ranges.is_empty() {
-            return Err(());
+            return Err(ParseRangeErr(()));
         }
 
         Ok(ranges)
@@ -330,8 +341,7 @@ mod tests {
                 if expected.is_empty() {
                     continue;
                 } else {
-                    assert!(
-                        false,
+                    panic!(
                         "parse({}, {}) returned error {:?}",
                         header,
                         size,
@@ -343,28 +353,24 @@ mod tests {
             let got = res.unwrap();
 
             if got.len() != expected.len() {
-                assert!(
-                    false,
+                panic!(
                     "len(parseRange({}, {})) = {}, want {}",
                     header,
                     size,
                     got.len(),
                     expected.len()
                 );
-                continue;
             }
 
             for i in 0..expected.len() {
                 if got[i].start != expected[i].start {
-                    assert!(
-                        false,
+                    panic!(
                         "parseRange({}, {})[{}].start = {}, want {}",
                         header, size, i, got[i].start, expected[i].start
                     )
                 }
                 if got[i].length != expected[i].length {
-                    assert!(
-                        false,
+                    panic!(
                         "parseRange({}, {})[{}].length = {}, want {}",
                         header, size, i, got[i].length, expected[i].length
                     )

actix-files/src/service.rs

@@ -0,0 +1,168 @@
+use std::{
+    fmt, io,
+    path::PathBuf,
+    rc::Rc,
+    task::{Context, Poll},
+};
+
+use actix_service::Service;
+use actix_web::{
+    dev::{ServiceRequest, ServiceResponse},
+    error::Error,
+    guard::Guard,
+    http::{header, Method},
+    HttpResponse,
+};
+use futures_util::future::{ok, Either, LocalBoxFuture, Ready};
+
+use crate::{
+    named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride,
+    NamedFile, PathBufWrap,
+};
+
+/// Assembled file serving service.
+pub struct FilesService {
+    pub(crate) directory: PathBuf,
+    pub(crate) index: Option<String>,
+    pub(crate) show_index: bool,
+    pub(crate) redirect_to_slash: bool,
+    pub(crate) default: Option<HttpService>,
+    pub(crate) renderer: Rc<DirectoryRenderer>,
+    pub(crate) mime_override: Option<Rc<MimeOverride>>,
+    pub(crate) file_flags: named::Flags,
+    pub(crate) guards: Option<Rc<dyn Guard>>,
+    pub(crate) hidden_files: bool,
+}
+
+type FilesServiceFuture = Either<
+    Ready<Result<ServiceResponse, Error>>,
+    LocalBoxFuture<'static, Result<ServiceResponse, Error>>,
+>;
+
+impl FilesService {
+    fn handle_err(&mut self, e: io::Error, req: ServiceRequest) -> FilesServiceFuture {
+        log::debug!("Failed to handle {}: {}", req.path(), e);
+
+        if let Some(ref mut default) = self.default {
+            Either::Right(default.call(req))
+        } else {
+            Either::Left(ok(req.error_response(e)))
+        }
+    }
+}
+
+impl fmt::Debug for FilesService {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        f.write_str("FilesService")
+    }
+}
+
+impl Service<ServiceRequest> for FilesService {
+    type Response = ServiceResponse;
+    type Error = Error;
+    type Future = FilesServiceFuture;
+
+    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        Poll::Ready(Ok(()))
+    }
+
+    fn call(&mut self, req: ServiceRequest) -> Self::Future {
+        let is_method_valid = if let Some(guard) = &self.guards {
+            // execute user defined guards
+            (**guard).check(req.head())
+        } else {
+            // default behavior
+            matches!(*req.method(), Method::HEAD | Method::GET)
+        };
+
+        if !is_method_valid {
+            return Either::Left(ok(req.into_response(
+                actix_web::HttpResponse::MethodNotAllowed()
+                    .header(header::CONTENT_TYPE, "text/plain")
+                    .body("Request did not meet this resource's requirements."),
+            )));
+        }
+
+        let real_path =
+            match PathBufWrap::parse_path(req.match_info().path(), self.hidden_files) {
+                Ok(item) => item,
+                Err(e) => return Either::Left(ok(req.error_response(e))),
+            };
+
+        // full file path
+        let path = match self.directory.join(&real_path).canonicalize() {
+            Ok(path) => path,
+            Err(e) => return self.handle_err(e, req),
+        };
+
+        if path.is_dir() {
+            if let Some(ref redir_index) = self.index {
+                if self.redirect_to_slash && !req.path().ends_with('/') {
+                    let redirect_to = format!("{}/", req.path());
+
+                    return Either::Left(ok(req.into_response(
+                        HttpResponse::Found()
+                            .header(header::LOCATION, redirect_to)
+                            .body("")
+                            .into_body(),
+                    )));
+                }
+
+                let path = path.join(redir_index);
+
+                match NamedFile::open(path) {
+                    Ok(mut named_file) => {
+                        if let Some(ref mime_override) = self.mime_override {
+                            let new_disposition =
+                                mime_override(&named_file.content_type.type_());
+                            named_file.content_disposition.disposition = new_disposition;
+                        }
+                        named_file.flags = self.file_flags;
+
+                        let (req, _) = req.into_parts();
+                        Either::Left(ok(match named_file.into_response(&req) {
+                            Ok(item) => ServiceResponse::new(req, item),
+                            Err(e) => ServiceResponse::from_err(e, req),
+                        }))
+                    }
+                    Err(e) => self.handle_err(e, req),
+                }
+            } else if self.show_index {
+                let dir = Directory::new(self.directory.clone(), path);
+
+                let (req, _) = req.into_parts();
+                let x = (self.renderer)(&dir, &req);
+
+                match x {
+                    Ok(resp) => Either::Left(ok(resp)),
+                    Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
+                }
+            } else {
+                Either::Left(ok(ServiceResponse::from_err(
+                    FilesError::IsDirectory,
+                    req.into_parts().0,
+                )))
+            }
+        } else {
+            match NamedFile::open(path) {
+                Ok(mut named_file) => {
+                    if let Some(ref mime_override) = self.mime_override {
+                        let new_disposition =
+                            mime_override(&named_file.content_type.type_());
+                        named_file.content_disposition.disposition = new_disposition;
+                    }
+                    named_file.flags = self.file_flags;
+
+                    let (req, _) = req.into_parts();
+                    match named_file.into_response(&req) {
+                        Ok(item) => {
+                            Either::Left(ok(ServiceResponse::new(req.clone(), item)))
+                        }
+                        Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
+                    }
+                }
+                Err(e) => self.handle_err(e, req),
+            }
+        }
+    }
+}

actix-files/tests/encoding.rs

@@ -0,0 +1,40 @@
+use actix_files::Files;
+use actix_web::{
+    http::{
+        header::{self, HeaderValue},
+        StatusCode,
+    },
+    test::{self, TestRequest},
+    App,
+};
+
+#[actix_rt::test]
+async fn test_utf8_file_contents() {
+    // use default ISO-8859-1 encoding
+    let mut srv =
+        test::init_service(App::new().service(Files::new("/", "./tests"))).await;
+
+    let req = TestRequest::with_uri("/utf8.txt").to_request();
+    let res = test::call_service(&mut srv, req).await;
+
+    assert_eq!(res.status(), StatusCode::OK);
+    assert_eq!(
+        res.headers().get(header::CONTENT_TYPE),
+        Some(&HeaderValue::from_static("text/plain")),
+    );
+
+    // prefer UTF-8 encoding
+    let mut srv = test::init_service(
+        App::new().service(Files::new("/", "./tests").prefer_utf8(true)),
+    )
+    .await;
+
+    let req = TestRequest::with_uri("/utf8.txt").to_request();
+    let res = test::call_service(&mut srv, req).await;
+
+    assert_eq!(res.status(), StatusCode::OK);
+    assert_eq!(
+        res.headers().get(header::CONTENT_TYPE),
+        Some(&HeaderValue::from_static("text/plain; charset=utf-8")),
+    );
+}

actix-files/tests/utf8.txt

@@ -0,0 +1,3 @@
+中文内容显示正确。
+
+English is OK.

actix-framed/Cargo.toml

@@ -1,38 +0,0 @@
-[package]
-name = "actix-framed"
-version = "0.2.1"
-authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
-description = "Actix framed app server"
-readme = "README.md"
-keywords = ["http", "web", "framework", "async", "futures"]
-homepage = "https://actix.rs"
-repository = "https://github.com/actix/actix-web.git"
-documentation = "https://docs.rs/actix-framed/"
-categories = ["network-programming", "asynchronous",
-              "web-programming::http-server",
-              "web-programming::websocket"]
-license = "MIT/Apache-2.0"
-edition = "2018"
-workspace =".."
-
-[lib]
-name = "actix_framed"
-path = "src/lib.rs"
-
-[dependencies]
-actix-codec = "0.1.2"
-actix-service = "0.4.1"
-actix-router = "0.1.2"
-actix-rt = "0.2.2"
-actix-http = "0.2.7"
-actix-server-config = "0.1.2"
-
-bytes = "0.4"
-futures = "0.1.25"
-log = "0.4"
-
-[dev-dependencies]
-actix-server = { version = "0.6.0", features=["ssl"] }
-actix-connect = { version = "0.2.0", features=["ssl"] }
-actix-http-test = { version = "0.2.4", features=["ssl"] }
-actix-utils = "0.4.4"

actix-framed/LICENSE-APACHE

@@ -1,201 +0,0 @@
-                                 Apache License
-                           Version 2.0, January 2004
-                        http://www.apache.org/licenses/
-
-   TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
-
-   1. Definitions.
-
-      "License" shall mean the terms and conditions for use, reproduction,
-      and distribution as defined by Sections 1 through 9 of this document.
-
-      "Licensor" shall mean the copyright owner or entity authorized by
-      the copyright owner that is granting the License.
-
-      "Legal Entity" shall mean the union of the acting entity and all
-      other entities that control, are controlled by, or are under common
-      control with that entity. For the purposes of this definition,
-      "control" means (i) the power, direct or indirect, to cause the
-      direction or management of such entity, whether by contract or
-      otherwise, or (ii) ownership of fifty percent (50%) or more of the
-      outstanding shares, or (iii) beneficial ownership of such entity.
-
-      "You" (or "Your") shall mean an individual or Legal Entity
-      exercising permissions granted by this License.
-
-      "Source" form shall mean the preferred form for making modifications,
-      including but not limited to software source code, documentation
-      source, and configuration files.
-
-      "Object" form shall mean any form resulting from mechanical
-      transformation or translation of a Source form, including but
-      not limited to compiled object code, generated documentation,
-      and conversions to other media types.
-
-      "Work" shall mean the work of authorship, whether in Source or
-      Object form, made available under the License, as indicated by a
-      copyright notice that is included in or attached to the work
-      (an example is provided in the Appendix below).
-
-      "Derivative Works" shall mean any work, whether in Source or Object
-      form, that is based on (or derived from) the Work and for which the
-      editorial revisions, annotations, elaborations, or other modifications
-      represent, as a whole, an original work of authorship. For the purposes
-      of this License, Derivative Works shall not include works that remain
-      separable from, or merely link (or bind by name) to the interfaces of,
-      the Work and Derivative Works thereof.
-
-      "Contribution" shall mean any work of authorship, including
-      the original version of the Work and any modifications or additions
-      to that Work or Derivative Works thereof, that is intentionally
-      submitted to Licensor for inclusion in the Work by the copyright owner
-      or by an individual or Legal Entity authorized to submit on behalf of
-      the copyright owner. For the purposes of this definition, "submitted"
-      means any form of electronic, verbal, or written communication sent
-      to the Licensor or its representatives, including but not limited to
-      communication on electronic mailing lists, source code control systems,
-      and issue tracking systems that are managed by, or on behalf of, the
-      Licensor for the purpose of discussing and improving the Work, but
-      excluding communication that is conspicuously marked or otherwise
-      designated in writing by the copyright owner as "Not a Contribution."
-
-      "Contributor" shall mean Licensor and any individual or Legal Entity
-      on behalf of whom a Contribution has been received by Licensor and
-      subsequently incorporated within the Work.
-
-   2. Grant of Copyright License. Subject to the terms and conditions of
-      this License, each Contributor hereby grants to You a perpetual,
-      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
-      copyright license to reproduce, prepare Derivative Works of,
-      publicly display, publicly perform, sublicense, and distribute the
-      Work and such Derivative Works in Source or Object form.
-
-   3. Grant of Patent License. Subject to the terms and conditions of
-      this License, each Contributor hereby grants to You a perpetual,
-      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
-      (except as stated in this section) patent license to make, have made,
-      use, offer to sell, sell, import, and otherwise transfer the Work,
-      where such license applies only to those patent claims licensable
-      by such Contributor that are necessarily infringed by their
-      Contribution(s) alone or by combination of their Contribution(s)
-      with the Work to which such Contribution(s) was submitted. If You
-      institute patent litigation against any entity (including a
-      cross-claim or counterclaim in a lawsuit) alleging that the Work
-      or a Contribution incorporated within the Work constitutes direct
-      or contributory patent infringement, then any patent licenses
-      granted to You under this License for that Work shall terminate
-      as of the date such litigation is filed.
-
-   4. Redistribution. You may reproduce and distribute copies of the
-      Work or Derivative Works thereof in any medium, with or without
-      modifications, and in Source or Object form, provided that You
-      meet the following conditions:
-
-      (a) You must give any other recipients of the Work or
-          Derivative Works a copy of this License; and
-
-      (b) You must cause any modified files to carry prominent notices
-          stating that You changed the files; and
-
-      (c) You must retain, in the Source form of any Derivative Works
-          that You distribute, all copyright, patent, trademark, and
-          attribution notices from the Source form of the Work,
-          excluding those notices that do not pertain to any part of
-          the Derivative Works; and
-
-      (d) If the Work includes a "NOTICE" text file as part of its
-          distribution, then any Derivative Works that You distribute must
-          include a readable copy of the attribution notices contained
-          within such NOTICE file, excluding those notices that do not
-          pertain to any part of the Derivative Works, in at least one
-          of the following places: within a NOTICE text file distributed
-          as part of the Derivative Works; within the Source form or
-          documentation, if provided along with the Derivative Works; or,
-          within a display generated by the Derivative Works, if and
-          wherever such third-party notices normally appear. The contents
-          of the NOTICE file are for informational purposes only and
-          do not modify the License. You may add Your own attribution
-          notices within Derivative Works that You distribute, alongside
-          or as an addendum to the NOTICE text from the Work, provided
-          that such additional attribution notices cannot be construed
-          as modifying the License.
-
-      You may add Your own copyright statement to Your modifications and
-      may provide additional or different license terms and conditions
-      for use, reproduction, or distribution of Your modifications, or
-      for any such Derivative Works as a whole, provided Your use,
-      reproduction, and distribution of the Work otherwise complies with
-      the conditions stated in this License.
-
-   5. Submission of Contributions. Unless You explicitly state otherwise,
-      any Contribution intentionally submitted for inclusion in the Work
-      by You to the Licensor shall be under the terms and conditions of
-      this License, without any additional terms or conditions.
-      Notwithstanding the above, nothing herein shall supersede or modify
-      the terms of any separate license agreement you may have executed
-      with Licensor regarding such Contributions.
-
-   6. Trademarks. This License does not grant permission to use the trade
-      names, trademarks, service marks, or product names of the Licensor,
-      except as required for reasonable and customary use in describing the
-      origin of the Work and reproducing the content of the NOTICE file.
-
-   7. Disclaimer of Warranty. Unless required by applicable law or
-      agreed to in writing, Licensor provides the Work (and each
-      Contributor provides its Contributions) on an "AS IS" BASIS,
-      WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
-      implied, including, without limitation, any warranties or conditions
-      of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
-      PARTICULAR PURPOSE. You are solely responsible for determining the
-      appropriateness of using or redistributing the Work and assume any
-      risks associated with Your exercise of permissions under this License.
-
-   8. Limitation of Liability. In no event and under no legal theory,
-      whether in tort (including negligence), contract, or otherwise,
-      unless required by applicable law (such as deliberate and grossly
-      negligent acts) or agreed to in writing, shall any Contributor be
-      liable to You for damages, including any direct, indirect, special,
-      incidental, or consequential damages of any character arising as a
-      result of this License or out of the use or inability to use the
-      Work (including but not limited to damages for loss of goodwill,
-      work stoppage, computer failure or malfunction, or any and all
-      other commercial damages or losses), even if such Contributor
-      has been advised of the possibility of such damages.
-
-   9. Accepting Warranty or Additional Liability. While redistributing
-      the Work or Derivative Works thereof, You may choose to offer,
-      and charge a fee for, acceptance of support, warranty, indemnity,
-      or other liability obligations and/or rights consistent with this
-      License. However, in accepting such obligations, You may act only
-      on Your own behalf and on Your sole responsibility, not on behalf
-      of any other Contributor, and only if You agree to indemnify,
-      defend, and hold each Contributor harmless for any liability
-      incurred by, or claims asserted against, such Contributor by reason
-      of your accepting any such warranty or additional liability.
-
-   END OF TERMS AND CONDITIONS
-
-   APPENDIX: How to apply the Apache License to your work.
-
-      To apply the Apache License to your work, attach the following
-      boilerplate notice, with the fields enclosed by brackets "{}"
-      replaced with your own identifying information. (Don't include
-      the brackets!)  The text should be enclosed in the appropriate
-      comment syntax for the file format. We also recommend that a
-      file or class name and description of purpose be included on the
-      same "printed page" as the copyright notice for easier
-      identification within third-party archives.
-
-   Copyright 2017-NOW Nikolay Kim
-
-   Licensed under the Apache License, Version 2.0 (the "License");
-   you may not use this file except in compliance with the License.
-   You may obtain a copy of the License at
-
-       http://www.apache.org/licenses/LICENSE-2.0
-
-   Unless required by applicable law or agreed to in writing, software
-   distributed under the License is distributed on an "AS IS" BASIS,
-   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-   See the License for the specific language governing permissions and
-   limitations under the License.

actix-framed/LICENSE-MIT

@@ -1,25 +0,0 @@
-Copyright (c) 2017 Nikolay Kim
-
-Permission is hereby granted, free of charge, to any
-person obtaining a copy of this software and associated
-documentation files (the "Software"), to deal in the
-Software without restriction, including without
-limitation the rights to use, copy, modify, merge,
-publish, distribute, sublicense, and/or sell copies of
-the Software, and to permit persons to whom the Software
-is furnished to do so, subject to the following
-conditions:
-
-The above copyright notice and this permission notice
-shall be included in all copies or substantial portions
-of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF
-ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED
-TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A
-PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT
-SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
-CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
-OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR
-IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
-DEALINGS IN THE SOFTWARE.

actix-framed/README.md

@@ -1,8 +0,0 @@
-# Framed app for actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-framed)](https://crates.io/crates/actix-framed) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
-
-## Documentation & community resources
-
-* [API Documentation](https://docs.rs/actix-framed/)
-* [Chat on gitter](https://gitter.im/actix/actix)
-* Cargo package: [actix-framed](https://crates.io/crates/actix-framed)
-* Minimum supported Rust version: 1.33 or later

actix-framed/changes.md

@@ -1,20 +0,0 @@
-# Changes
-
-## [0.2.1] - 2019-07-20
-
-* Remove unneeded actix-utils dependency
-
-
-## [0.2.0] - 2019-05-12
-
-* Update dependencies
-
-
-## [0.1.0] - 2019-04-16
-
-* Update tests
-
-
-## [0.1.0-alpha.1] - 2019-04-12
-
-* Initial release

actix-framed/src/app.rs

@@ -1,217 +0,0 @@
-use std::rc::Rc;
-
-use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use actix_http::h1::{Codec, SendResponse};
-use actix_http::{Error, Request, Response};
-use actix_router::{Path, Router, Url};
-use actix_server_config::ServerConfig;
-use actix_service::{IntoNewService, NewService, Service};
-use futures::{Async, Future, Poll};
-
-use crate::helpers::{BoxedHttpNewService, BoxedHttpService, HttpNewService};
-use crate::request::FramedRequest;
-use crate::state::State;
-
-type BoxedResponse = Box<dyn Future<Item = (), Error = Error>>;
-
-pub trait HttpServiceFactory {
-    type Factory: NewService;
-
-    fn path(&self) -> &str;
-
-    fn create(self) -> Self::Factory;
-}
-
-/// Application builder
-pub struct FramedApp<T, S = ()> {
-    state: State<S>,
-    services: Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>,
-}
-
-impl<T: 'static> FramedApp<T, ()> {
-    pub fn new() -> Self {
-        FramedApp {
-            state: State::new(()),
-            services: Vec::new(),
-        }
-    }
-}
-
-impl<T: 'static, S: 'static> FramedApp<T, S> {
-    pub fn with(state: S) -> FramedApp<T, S> {
-        FramedApp {
-            services: Vec::new(),
-            state: State::new(state),
-        }
-    }
-
-    pub fn service<U>(mut self, factory: U) -> Self
-    where
-        U: HttpServiceFactory,
-        U::Factory: NewService<
-                Config = (),
-                Request = FramedRequest<T, S>,
-                Response = (),
-                Error = Error,
-                InitError = (),
-            > + 'static,
-        <U::Factory as NewService>::Future: 'static,
-        <U::Factory as NewService>::Service: Service<
-            Request = FramedRequest<T, S>,
-            Response = (),
-            Error = Error,
-            Future = Box<dyn Future<Item = (), Error = Error>>,
-        >,
-    {
-        let path = factory.path().to_string();
-        self.services
-            .push((path, Box::new(HttpNewService::new(factory.create()))));
-        self
-    }
-}
-
-impl<T, S> IntoNewService<FramedAppFactory<T, S>> for FramedApp<T, S>
-where
-    T: AsyncRead + AsyncWrite + 'static,
-    S: 'static,
-{
-    fn into_new_service(self) -> FramedAppFactory<T, S> {
-        FramedAppFactory {
-            state: self.state,
-            services: Rc::new(self.services),
-        }
-    }
-}
-
-#[derive(Clone)]
-pub struct FramedAppFactory<T, S> {
-    state: State<S>,
-    services: Rc<Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>>,
-}
-
-impl<T, S> NewService for FramedAppFactory<T, S>
-where
-    T: AsyncRead + AsyncWrite + 'static,
-    S: 'static,
-{
-    type Config = ServerConfig;
-    type Request = (Request, Framed<T, Codec>);
-    type Response = ();
-    type Error = Error;
-    type InitError = ();
-    type Service = FramedAppService<T, S>;
-    type Future = CreateService<T, S>;
-
-    fn new_service(&self, _: &ServerConfig) -> Self::Future {
-        CreateService {
-            fut: self
-                .services
-                .iter()
-                .map(|(path, service)| {
-                    CreateServiceItem::Future(
-                        Some(path.clone()),
-                        service.new_service(&()),
-                    )
-                })
-                .collect(),
-            state: self.state.clone(),
-        }
-    }
-}
-
-#[doc(hidden)]
-pub struct CreateService<T, S> {
-    fut: Vec<CreateServiceItem<T, S>>,
-    state: State<S>,
-}
-
-enum CreateServiceItem<T, S> {
-    Future(
-        Option<String>,
-        Box<dyn Future<Item = BoxedHttpService<FramedRequest<T, S>>, Error = ()>>,
-    ),
-    Service(String, BoxedHttpService<FramedRequest<T, S>>),
-}
-
-impl<S: 'static, T: 'static> Future for CreateService<T, S>
-where
-    T: AsyncRead + AsyncWrite,
-{
-    type Item = FramedAppService<T, S>;
-    type Error = ();
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        let mut done = true;
-
-        // poll http services
-        for item in &mut self.fut {
-            let res = match item {
-                CreateServiceItem::Future(ref mut path, ref mut fut) => {
-                    match fut.poll()? {
-                        Async::Ready(service) => Some((path.take().unwrap(), service)),
-                        Async::NotReady => {
-                            done = false;
-                            None
-                        }
-                    }
-                }
-                CreateServiceItem::Service(_, _) => continue,
-            };
-
-            if let Some((path, service)) = res {
-                *item = CreateServiceItem::Service(path, service);
-            }
-        }
-
-        if done {
-            let router = self
-                .fut
-                .drain(..)
-                .fold(Router::build(), |mut router, item| {
-                    match item {
-                        CreateServiceItem::Service(path, service) => {
-                            router.path(&path, service);
-                        }
-                        CreateServiceItem::Future(_, _) => unreachable!(),
-                    }
-                    router
-                });
-            Ok(Async::Ready(FramedAppService {
-                router: router.finish(),
-                state: self.state.clone(),
-            }))
-        } else {
-            Ok(Async::NotReady)
-        }
-    }
-}
-
-pub struct FramedAppService<T, S> {
-    state: State<S>,
-    router: Router<BoxedHttpService<FramedRequest<T, S>>>,
-}
-
-impl<S: 'static, T: 'static> Service for FramedAppService<T, S>
-where
-    T: AsyncRead + AsyncWrite,
-{
-    type Request = (Request, Framed<T, Codec>);
-    type Response = ();
-    type Error = Error;
-    type Future = BoxedResponse;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
-    }
-
-    fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
-        let mut path = Path::new(Url::new(req.uri().clone()));
-
-        if let Some((srv, _info)) = self.router.recognize_mut(&mut path) {
-            return srv.call(FramedRequest::new(req, framed, path, self.state.clone()));
-        }
-        Box::new(
-            SendResponse::new(framed, Response::NotFound().finish()).then(|_| Ok(())),
-        )
-    }
-}

actix-framed/src/helpers.rs

@@ -1,90 +0,0 @@
-use actix_http::Error;
-use actix_service::{NewService, Service};
-use futures::{Future, Poll};
-
-pub(crate) type BoxedHttpService<Req> = Box<
-    dyn Service<
-        Request = Req,
-        Response = (),
-        Error = Error,
-        Future = Box<dyn Future<Item = (), Error = Error>>,
-    >,
->;
-
-pub(crate) type BoxedHttpNewService<Req> = Box<
-    dyn NewService<
-        Config = (),
-        Request = Req,
-        Response = (),
-        Error = Error,
-        InitError = (),
-        Service = BoxedHttpService<Req>,
-        Future = Box<dyn Future<Item = BoxedHttpService<Req>, Error = ()>>,
-    >,
->;
-
-pub(crate) struct HttpNewService<T: NewService>(T);
-
-impl<T> HttpNewService<T>
-where
-    T: NewService<Response = (), Error = Error>,
-    T::Response: 'static,
-    T::Future: 'static,
-    T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static,
-    <T::Service as Service>::Future: 'static,
-{
-    pub fn new(service: T) -> Self {
-        HttpNewService(service)
-    }
-}
-
-impl<T> NewService for HttpNewService<T>
-where
-    T: NewService<Config = (), Response = (), Error = Error>,
-    T::Request: 'static,
-    T::Future: 'static,
-    T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static,
-    <T::Service as Service>::Future: 'static,
-{
-    type Config = ();
-    type Request = T::Request;
-    type Response = ();
-    type Error = Error;
-    type InitError = ();
-    type Service = BoxedHttpService<T::Request>;
-    type Future = Box<dyn Future<Item = Self::Service, Error = ()>>;
-
-    fn new_service(&self, _: &()) -> Self::Future {
-        Box::new(self.0.new_service(&()).map_err(|_| ()).and_then(|service| {
-            let service: BoxedHttpService<_> = Box::new(HttpServiceWrapper { service });
-            Ok(service)
-        }))
-    }
-}
-
-struct HttpServiceWrapper<T: Service> {
-    service: T,
-}
-
-impl<T> Service for HttpServiceWrapper<T>
-where
-    T: Service<
-        Response = (),
-        Future = Box<dyn Future<Item = (), Error = Error>>,
-        Error = Error,
-    >,
-    T::Request: 'static,
-{
-    type Request = T::Request;
-    type Response = ();
-    type Error = Error;
-    type Future = Box<dyn Future<Item = (), Error = Error>>;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        self.service.poll_ready()
-    }
-
-    fn call(&mut self, req: Self::Request) -> Self::Future {
-        self.service.call(req)
-    }
-}

actix-framed/src/lib.rs

@@ -1,17 +0,0 @@
-#![allow(clippy::type_complexity, clippy::new_without_default, dead_code)]
-mod app;
-mod helpers;
-mod request;
-mod route;
-mod service;
-mod state;
-pub mod test;
-
-// re-export for convinience
-pub use actix_http::{http, Error, HttpMessage, Response, ResponseError};
-
-pub use self::app::{FramedApp, FramedAppService};
-pub use self::request::FramedRequest;
-pub use self::route::FramedRoute;
-pub use self::service::{SendError, VerifyWebSockets};
-pub use self::state::State;

actix-framed/src/request.rs

@@ -1,170 +0,0 @@
-use std::cell::{Ref, RefMut};
-
-use actix_codec::Framed;
-use actix_http::http::{HeaderMap, Method, Uri, Version};
-use actix_http::{h1::Codec, Extensions, Request, RequestHead};
-use actix_router::{Path, Url};
-
-use crate::state::State;
-
-pub struct FramedRequest<Io, S = ()> {
-    req: Request,
-    framed: Framed<Io, Codec>,
-    state: State<S>,
-    pub(crate) path: Path<Url>,
-}
-
-impl<Io, S> FramedRequest<Io, S> {
-    pub fn new(
-        req: Request,
-        framed: Framed<Io, Codec>,
-        path: Path<Url>,
-        state: State<S>,
-    ) -> Self {
-        Self {
-            req,
-            framed,
-            state,
-            path,
-        }
-    }
-}
-
-impl<Io, S> FramedRequest<Io, S> {
-    /// Split request into a parts
-    pub fn into_parts(self) -> (Request, Framed<Io, Codec>, State<S>) {
-        (self.req, self.framed, self.state)
-    }
-
-    /// This method returns reference to the request head
-    #[inline]
-    pub fn head(&self) -> &RequestHead {
-        self.req.head()
-    }
-
-    /// This method returns muttable reference to the request head.
-    /// panics if multiple references of http request exists.
-    #[inline]
-    pub fn head_mut(&mut self) -> &mut RequestHead {
-        self.req.head_mut()
-    }
-
-    /// Shared application state
-    #[inline]
-    pub fn state(&self) -> &S {
-        self.state.get_ref()
-    }
-
-    /// Request's uri.
-    #[inline]
-    pub fn uri(&self) -> &Uri {
-        &self.head().uri
-    }
-
-    /// Read the Request method.
-    #[inline]
-    pub fn method(&self) -> &Method {
-        &self.head().method
-    }
-
-    /// Read the Request Version.
-    #[inline]
-    pub fn version(&self) -> Version {
-        self.head().version
-    }
-
-    #[inline]
-    /// Returns request's headers.
-    pub fn headers(&self) -> &HeaderMap {
-        &self.head().headers
-    }
-
-    /// The target path of this Request.
-    #[inline]
-    pub fn path(&self) -> &str {
-        self.head().uri.path()
-    }
-
-    /// The query string in the URL.
-    ///
-    /// E.g., id=10
-    #[inline]
-    pub fn query_string(&self) -> &str {
-        if let Some(query) = self.uri().query().as_ref() {
-            query
-        } else {
-            ""
-        }
-    }
-
-    /// Get a reference to the Path parameters.
-    ///
-    /// Params is a container for url parameters.
-    /// A variable segment is specified in the form `{identifier}`,
-    /// where the identifier can be used later in a request handler to
-    /// access the matched value for that segment.
-    #[inline]
-    pub fn match_info(&self) -> &Path<Url> {
-        &self.path
-    }
-
-    /// Request extensions
-    #[inline]
-    pub fn extensions(&self) -> Ref<Extensions> {
-        self.head().extensions()
-    }
-
-    /// Mutable reference to a the request's extensions
-    #[inline]
-    pub fn extensions_mut(&self) -> RefMut<Extensions> {
-        self.head().extensions_mut()
-    }
-}
-
-#[cfg(test)]
-mod tests {
-    use actix_http::http::{HeaderName, HeaderValue, HttpTryFrom};
-    use actix_http::test::{TestBuffer, TestRequest};
-
-    use super::*;
-
-    #[test]
-    fn test_reqest() {
-        let buf = TestBuffer::empty();
-        let framed = Framed::new(buf, Codec::default());
-        let req = TestRequest::with_uri("/index.html?q=1")
-            .header("content-type", "test")
-            .finish();
-        let path = Path::new(Url::new(req.uri().clone()));
-
-        let mut freq = FramedRequest::new(req, framed, path, State::new(10u8));
-        assert_eq!(*freq.state(), 10);
-        assert_eq!(freq.version(), Version::HTTP_11);
-        assert_eq!(freq.method(), Method::GET);
-        assert_eq!(freq.path(), "/index.html");
-        assert_eq!(freq.query_string(), "q=1");
-        assert_eq!(
-            freq.headers()
-                .get("content-type")
-                .unwrap()
-                .to_str()
-                .unwrap(),
-            "test"
-        );
-
-        freq.head_mut().headers.insert(
-            HeaderName::try_from("x-hdr").unwrap(),
-            HeaderValue::from_static("test"),
-        );
-        assert_eq!(
-            freq.headers().get("x-hdr").unwrap().to_str().unwrap(),
-            "test"
-        );
-
-        freq.extensions_mut().insert(100usize);
-        assert_eq!(*freq.extensions().get::<usize>().unwrap(), 100usize);
-
-        let (_, _, state) = freq.into_parts();
-        assert_eq!(*state, 10);
-    }
-}

actix-framed/src/route.rs

@@ -1,157 +0,0 @@
-use std::fmt;
-use std::marker::PhantomData;
-
-use actix_codec::{AsyncRead, AsyncWrite};
-use actix_http::{http::Method, Error};
-use actix_service::{NewService, Service};
-use futures::future::{ok, FutureResult};
-use futures::{Async, Future, IntoFuture, Poll};
-use log::error;
-
-use crate::app::HttpServiceFactory;
-use crate::request::FramedRequest;
-
-/// Resource route definition
-///
-/// Route uses builder-like pattern for configuration.
-/// If handler is not explicitly set, default *404 Not Found* handler is used.
-pub struct FramedRoute<Io, S, F = (), R = ()> {
-    handler: F,
-    pattern: String,
-    methods: Vec<Method>,
-    state: PhantomData<(Io, S, R)>,
-}
-
-impl<Io, S> FramedRoute<Io, S> {
-    pub fn new(pattern: &str) -> Self {
-        FramedRoute {
-            handler: (),
-            pattern: pattern.to_string(),
-            methods: Vec::new(),
-            state: PhantomData,
-        }
-    }
-
-    pub fn get(path: &str) -> FramedRoute<Io, S> {
-        FramedRoute::new(path).method(Method::GET)
-    }
-
-    pub fn post(path: &str) -> FramedRoute<Io, S> {
-        FramedRoute::new(path).method(Method::POST)
-    }
-
-    pub fn put(path: &str) -> FramedRoute<Io, S> {
-        FramedRoute::new(path).method(Method::PUT)
-    }
-
-    pub fn delete(path: &str) -> FramedRoute<Io, S> {
-        FramedRoute::new(path).method(Method::DELETE)
-    }
-
-    pub fn method(mut self, method: Method) -> Self {
-        self.methods.push(method);
-        self
-    }
-
-    pub fn to<F, R>(self, handler: F) -> FramedRoute<Io, S, F, R>
-    where
-        F: FnMut(FramedRequest<Io, S>) -> R,
-        R: IntoFuture<Item = ()>,
-        R::Future: 'static,
-        R::Error: fmt::Debug,
-    {
-        FramedRoute {
-            handler,
-            pattern: self.pattern,
-            methods: self.methods,
-            state: PhantomData,
-        }
-    }
-}
-
-impl<Io, S, F, R> HttpServiceFactory for FramedRoute<Io, S, F, R>
-where
-    Io: AsyncRead + AsyncWrite + 'static,
-    F: FnMut(FramedRequest<Io, S>) -> R + Clone,
-    R: IntoFuture<Item = ()>,
-    R::Future: 'static,
-    R::Error: fmt::Display,
-{
-    type Factory = FramedRouteFactory<Io, S, F, R>;
-
-    fn path(&self) -> &str {
-        &self.pattern
-    }
-
-    fn create(self) -> Self::Factory {
-        FramedRouteFactory {
-            handler: self.handler,
-            methods: self.methods,
-            _t: PhantomData,
-        }
-    }
-}
-
-pub struct FramedRouteFactory<Io, S, F, R> {
-    handler: F,
-    methods: Vec<Method>,
-    _t: PhantomData<(Io, S, R)>,
-}
-
-impl<Io, S, F, R> NewService for FramedRouteFactory<Io, S, F, R>
-where
-    Io: AsyncRead + AsyncWrite + 'static,
-    F: FnMut(FramedRequest<Io, S>) -> R + Clone,
-    R: IntoFuture<Item = ()>,
-    R::Future: 'static,
-    R::Error: fmt::Display,
-{
-    type Config = ();
-    type Request = FramedRequest<Io, S>;
-    type Response = ();
-    type Error = Error;
-    type InitError = ();
-    type Service = FramedRouteService<Io, S, F, R>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
-
-    fn new_service(&self, _: &()) -> Self::Future {
-        ok(FramedRouteService {
-            handler: self.handler.clone(),
-            methods: self.methods.clone(),
-            _t: PhantomData,
-        })
-    }
-}
-
-pub struct FramedRouteService<Io, S, F, R> {
-    handler: F,
-    methods: Vec<Method>,
-    _t: PhantomData<(Io, S, R)>,
-}
-
-impl<Io, S, F, R> Service for FramedRouteService<Io, S, F, R>
-where
-    Io: AsyncRead + AsyncWrite + 'static,
-    F: FnMut(FramedRequest<Io, S>) -> R + Clone,
-    R: IntoFuture<Item = ()>,
-    R::Future: 'static,
-    R::Error: fmt::Display,
-{
-    type Request = FramedRequest<Io, S>;
-    type Response = ();
-    type Error = Error;
-    type Future = Box<dyn Future<Item = (), Error = Error>>;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
-    }
-
-    fn call(&mut self, req: FramedRequest<Io, S>) -> Self::Future {
-        Box::new((self.handler)(req).into_future().then(|res| {
-            if let Err(e) = res {
-                error!("Error in request handler: {}", e);
-            }
-            Ok(())
-        }))
-    }
-}

actix-framed/src/service.rs

@@ -1,149 +0,0 @@
-use std::marker::PhantomData;
-
-use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use actix_http::body::BodySize;
-use actix_http::error::ResponseError;
-use actix_http::h1::{Codec, Message};
-use actix_http::ws::{verify_handshake, HandshakeError};
-use actix_http::{Request, Response};
-use actix_service::{NewService, Service};
-use futures::future::{ok, Either, FutureResult};
-use futures::{Async, Future, IntoFuture, Poll, Sink};
-
-/// Service that verifies incoming request if it is valid websocket
-/// upgrade request. In case of error returns `HandshakeError`
-pub struct VerifyWebSockets<T, C> {
-    _t: PhantomData<(T, C)>,
-}
-
-impl<T, C> Default for VerifyWebSockets<T, C> {
-    fn default() -> Self {
-        VerifyWebSockets { _t: PhantomData }
-    }
-}
-
-impl<T, C> NewService for VerifyWebSockets<T, C> {
-    type Config = C;
-    type Request = (Request, Framed<T, Codec>);
-    type Response = (Request, Framed<T, Codec>);
-    type Error = (HandshakeError, Framed<T, Codec>);
-    type InitError = ();
-    type Service = VerifyWebSockets<T, C>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
-
-    fn new_service(&self, _: &C) -> Self::Future {
-        ok(VerifyWebSockets { _t: PhantomData })
-    }
-}
-
-impl<T, C> Service for VerifyWebSockets<T, C> {
-    type Request = (Request, Framed<T, Codec>);
-    type Response = (Request, Framed<T, Codec>);
-    type Error = (HandshakeError, Framed<T, Codec>);
-    type Future = FutureResult<Self::Response, Self::Error>;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
-    }
-
-    fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
-        match verify_handshake(req.head()) {
-            Err(e) => Err((e, framed)).into_future(),
-            Ok(_) => Ok((req, framed)).into_future(),
-        }
-    }
-}
-
-/// Send http/1 error response
-pub struct SendError<T, R, E, C>(PhantomData<(T, R, E, C)>);
-
-impl<T, R, E, C> Default for SendError<T, R, E, C>
-where
-    T: AsyncRead + AsyncWrite,
-    E: ResponseError,
-{
-    fn default() -> Self {
-        SendError(PhantomData)
-    }
-}
-
-impl<T, R, E, C> NewService for SendError<T, R, E, C>
-where
-    T: AsyncRead + AsyncWrite + 'static,
-    R: 'static,
-    E: ResponseError + 'static,
-{
-    type Config = C;
-    type Request = Result<R, (E, Framed<T, Codec>)>;
-    type Response = R;
-    type Error = (E, Framed<T, Codec>);
-    type InitError = ();
-    type Service = SendError<T, R, E, C>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
-
-    fn new_service(&self, _: &C) -> Self::Future {
-        ok(SendError(PhantomData))
-    }
-}
-
-impl<T, R, E, C> Service for SendError<T, R, E, C>
-where
-    T: AsyncRead + AsyncWrite + 'static,
-    R: 'static,
-    E: ResponseError + 'static,
-{
-    type Request = Result<R, (E, Framed<T, Codec>)>;
-    type Response = R;
-    type Error = (E, Framed<T, Codec>);
-    type Future = Either<FutureResult<R, (E, Framed<T, Codec>)>, SendErrorFut<T, R, E>>;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
-    }
-
-    fn call(&mut self, req: Result<R, (E, Framed<T, Codec>)>) -> Self::Future {
-        match req {
-            Ok(r) => Either::A(ok(r)),
-            Err((e, framed)) => {
-                let res = e.error_response().drop_body();
-                Either::B(SendErrorFut {
-                    framed: Some(framed),
-                    res: Some((res, BodySize::Empty).into()),
-                    err: Some(e),
-                    _t: PhantomData,
-                })
-            }
-        }
-    }
-}
-
-pub struct SendErrorFut<T, R, E> {
-    res: Option<Message<(Response<()>, BodySize)>>,
-    framed: Option<Framed<T, Codec>>,
-    err: Option<E>,
-    _t: PhantomData<R>,
-}
-
-impl<T, R, E> Future for SendErrorFut<T, R, E>
-where
-    E: ResponseError,
-    T: AsyncRead + AsyncWrite,
-{
-    type Item = R;
-    type Error = (E, Framed<T, Codec>);
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        if let Some(res) = self.res.take() {
-            if self.framed.as_mut().unwrap().force_send(res).is_err() {
-                return Err((self.err.take().unwrap(), self.framed.take().unwrap()));
-            }
-        }
-        match self.framed.as_mut().unwrap().poll_complete() {
-            Ok(Async::Ready(_)) => {
-                Err((self.err.take().unwrap(), self.framed.take().unwrap()))
-            }
-            Ok(Async::NotReady) => Ok(Async::NotReady),
-            Err(_) => Err((self.err.take().unwrap(), self.framed.take().unwrap())),
-        }
-    }
-}

actix-framed/src/state.rs

@@ -1,29 +0,0 @@
-use std::ops::Deref;
-use std::sync::Arc;
-
-/// Application state
-pub struct State<S>(Arc<S>);
-
-impl<S> State<S> {
-    pub fn new(state: S) -> State<S> {
-        State(Arc::new(state))
-    }
-
-    pub fn get_ref(&self) -> &S {
-        self.0.as_ref()
-    }
-}
-
-impl<S> Deref for State<S> {
-    type Target = S;
-
-    fn deref(&self) -> &S {
-        self.0.as_ref()
-    }
-}
-
-impl<S> Clone for State<S> {
-    fn clone(&self) -> State<S> {
-        State(self.0.clone())
-    }
-}

actix-framed/src/test.rs

@@ -1,153 +0,0 @@
-//! Various helpers for Actix applications to use during testing.
-use actix_codec::Framed;
-use actix_http::h1::Codec;
-use actix_http::http::header::{Header, HeaderName, IntoHeaderValue};
-use actix_http::http::{HttpTryFrom, Method, Uri, Version};
-use actix_http::test::{TestBuffer, TestRequest as HttpTestRequest};
-use actix_router::{Path, Url};
-use actix_rt::Runtime;
-use futures::IntoFuture;
-
-use crate::{FramedRequest, State};
-
-/// Test `Request` builder.
-pub struct TestRequest<S = ()> {
-    req: HttpTestRequest,
-    path: Path<Url>,
-    state: State<S>,
-}
-
-impl Default for TestRequest<()> {
-    fn default() -> TestRequest {
-        TestRequest {
-            req: HttpTestRequest::default(),
-            path: Path::new(Url::new(Uri::default())),
-            state: State::new(()),
-        }
-    }
-}
-
-impl TestRequest<()> {
-    /// Create TestRequest and set request uri
-    pub fn with_uri(path: &str) -> Self {
-        Self::get().uri(path)
-    }
-
-    /// Create TestRequest and set header
-    pub fn with_hdr<H: Header>(hdr: H) -> Self {
-        Self::default().set(hdr)
-    }
-
-    /// Create TestRequest and set header
-    pub fn with_header<K, V>(key: K, value: V) -> Self
-    where
-        HeaderName: HttpTryFrom<K>,
-        V: IntoHeaderValue,
-    {
-        Self::default().header(key, value)
-    }
-
-    /// Create TestRequest and set method to `Method::GET`
-    pub fn get() -> Self {
-        Self::default().method(Method::GET)
-    }
-
-    /// Create TestRequest and set method to `Method::POST`
-    pub fn post() -> Self {
-        Self::default().method(Method::POST)
-    }
-}
-
-impl<S> TestRequest<S> {
-    /// Create TestRequest and set request uri
-    pub fn with_state(state: S) -> TestRequest<S> {
-        let req = TestRequest::get();
-        TestRequest {
-            state: State::new(state),
-            req: req.req,
-            path: req.path,
-        }
-    }
-
-    /// Set HTTP version of this request
-    pub fn version(mut self, ver: Version) -> Self {
-        self.req.version(ver);
-        self
-    }
-
-    /// Set HTTP method of this request
-    pub fn method(mut self, meth: Method) -> Self {
-        self.req.method(meth);
-        self
-    }
-
-    /// Set HTTP Uri of this request
-    pub fn uri(mut self, path: &str) -> Self {
-        self.req.uri(path);
-        self
-    }
-
-    /// Set a header
-    pub fn set<H: Header>(mut self, hdr: H) -> Self {
-        self.req.set(hdr);
-        self
-    }
-
-    /// Set a header
-    pub fn header<K, V>(mut self, key: K, value: V) -> Self
-    where
-        HeaderName: HttpTryFrom<K>,
-        V: IntoHeaderValue,
-    {
-        self.req.header(key, value);
-        self
-    }
-
-    /// Set request path pattern parameter
-    pub fn param(mut self, name: &'static str, value: &'static str) -> Self {
-        self.path.add_static(name, value);
-        self
-    }
-
-    /// Complete request creation and generate `Request` instance
-    pub fn finish(mut self) -> FramedRequest<TestBuffer, S> {
-        let req = self.req.finish();
-        self.path.get_mut().update(req.uri());
-        let framed = Framed::new(TestBuffer::empty(), Codec::default());
-        FramedRequest::new(req, framed, self.path, self.state)
-    }
-
-    /// This method generates `FramedRequest` instance and executes async handler
-    pub fn run<F, R, I, E>(self, f: F) -> Result<I, E>
-    where
-        F: FnOnce(FramedRequest<TestBuffer, S>) -> R,
-        R: IntoFuture<Item = I, Error = E>,
-    {
-        let mut rt = Runtime::new().unwrap();
-        rt.block_on(f(self.finish()).into_future())
-    }
-}
-
-#[cfg(test)]
-mod tests {
-    use super::*;
-
-    #[test]
-    fn test() {
-        let req = TestRequest::with_uri("/index.html")
-            .header("x-test", "test")
-            .param("test", "123")
-            .finish();
-
-        assert_eq!(*req.state(), ());
-        assert_eq!(req.version(), Version::HTTP_11);
-        assert_eq!(req.method(), Method::GET);
-        assert_eq!(req.path(), "/index.html");
-        assert_eq!(req.query_string(), "");
-        assert_eq!(
-            req.headers().get("x-test").unwrap().to_str().unwrap(),
-            "test"
-        );
-        assert_eq!(&req.match_info()["test"], "123");
-    }
-}

actix-framed/tests/test_server.rs

@@ -1,141 +0,0 @@
-use actix_codec::{AsyncRead, AsyncWrite};
-use actix_http::{body, http::StatusCode, ws, Error, HttpService, Response};
-use actix_http_test::TestServer;
-use actix_service::{IntoNewService, NewService};
-use actix_utils::framed::FramedTransport;
-use bytes::{Bytes, BytesMut};
-use futures::future::{self, ok};
-use futures::{Future, Sink, Stream};
-
-use actix_framed::{FramedApp, FramedRequest, FramedRoute, SendError, VerifyWebSockets};
-
-fn ws_service<T: AsyncRead + AsyncWrite>(
-    req: FramedRequest<T>,
-) -> impl Future<Item = (), Error = Error> {
-    let (req, framed, _) = req.into_parts();
-    let res = ws::handshake(req.head()).unwrap().message_body(());
-
-    framed
-        .send((res, body::BodySize::None).into())
-        .map_err(|_| panic!())
-        .and_then(|framed| {
-            FramedTransport::new(framed.into_framed(ws::Codec::new()), service)
-                .map_err(|_| panic!())
-        })
-}
-
-fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> {
-    let msg = match msg {
-        ws::Frame::Ping(msg) => ws::Message::Pong(msg),
-        ws::Frame::Text(text) => {
-            ws::Message::Text(String::from_utf8_lossy(&text.unwrap()).to_string())
-        }
-        ws::Frame::Binary(bin) => ws::Message::Binary(bin.unwrap().freeze()),
-        ws::Frame::Close(reason) => ws::Message::Close(reason),
-        _ => panic!(),
-    };
-    ok(msg)
-}
-
-#[test]
-fn test_simple() {
-    let mut srv = TestServer::new(|| {
-        HttpService::build()
-            .upgrade(
-                FramedApp::new().service(FramedRoute::get("/index.html").to(ws_service)),
-            )
-            .finish(|_| future::ok::<_, Error>(Response::NotFound()))
-    });
-
-    assert!(srv.ws_at("/test").is_err());
-
-    // client service
-    let framed = srv.ws_at("/index.html").unwrap();
-    let framed = srv
-        .block_on(framed.send(ws::Message::Text("text".to_string())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Binary("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(
-        item,
-        Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
-    );
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Ping("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
-        .unwrap();
-
-    let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(
-        item,
-        Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
-    );
-}
-
-#[test]
-fn test_service() {
-    let mut srv = TestServer::new(|| {
-        actix_http::h1::OneRequest::new().map_err(|_| ()).and_then(
-            VerifyWebSockets::default()
-                .then(SendError::default())
-                .map_err(|_| ())
-                .and_then(
-                    FramedApp::new()
-                        .service(FramedRoute::get("/index.html").to(ws_service))
-                        .into_new_service()
-                        .map_err(|_| ()),
-                ),
-        )
-    });
-
-    // non ws request
-    let res = srv.block_on(srv.get("/index.html").send()).unwrap();
-    assert_eq!(res.status(), StatusCode::BAD_REQUEST);
-
-    // not found
-    assert!(srv.ws_at("/test").is_err());
-
-    // client service
-    let framed = srv.ws_at("/index.html").unwrap();
-    let framed = srv
-        .block_on(framed.send(ws::Message::Text("text".to_string())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Binary("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(
-        item,
-        Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
-    );
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Ping("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
-        .unwrap();
-
-    let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(
-        item,
-        Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
-    );
-}

actix-http-test/CHANGES.md

@@ -0,0 +1,86 @@
+# Changes
+
+## Unreleased - 2021-xx-xx
+
+
+## 3.0.0-beta.1 - 2021-01-07
+* Update `bytes` to `1.0`. [#1813]
+
+[#1813]: https://github.com/actix/actix-web/pull/1813
+
+
+## 2.1.0 - 2020-11-25
+* Add ability to set address for `TestServer`. [#1645]
+* Upgrade `base64` to `0.13`.
+* Upgrade `serde_urlencoded` to `0.7`. [#1773]
+
+[#1773]: https://github.com/actix/actix-web/pull/1773
+[#1645]: https://github.com/actix/actix-web/pull/1645
+
+
+## 2.0.0 - 2020-09-11
+* Update actix-codec and actix-utils dependencies.
+
+
+## 2.0.0-alpha.1 - 2020-05-23
+* Update the `time` dependency to 0.2.7
+* Update `actix-connect` dependency to 2.0.0-alpha.2
+* Make `test_server` `async` fn.
+* Bump minimum supported Rust version to 1.40
+* Replace deprecated `net2` crate with `socket2`
+* Update `base64` dependency to 0.12
+* Update `env_logger` dependency to 0.7
+
+## 1.0.0 - 2019-12-13
+* Replaced `TestServer::start()` with `test_server()`
+
+
+## 1.0.0-alpha.3 - 2019-12-07
+* Migrate to `std::future`
+
+
+## 0.2.5 - 2019-09-17
+* Update serde_urlencoded to "0.6.1"
+* Increase TestServerRuntime timeouts from 500ms to 3000ms
+* Do not override current `System`
+
+
+## 0.2.4 - 2019-07-18
+* Update actix-server to 0.6
+
+
+## 0.2.3 - 2019-07-16
+* Add `delete`, `options`, `patch` methods to `TestServerRunner`
+
+
+## 0.2.2 - 2019-06-16
+* Add .put() and .sput() methods
+
+
+## 0.2.1 - 2019-06-05
+* Add license files
+
+
+## 0.2.0 - 2019-05-12
+* Update awc and actix-http deps
+
+
+## 0.1.1 - 2019-04-24
+* Always make new connection for http client
+
+
+## 0.1.0 - 2019-04-16
+* No changes
+
+
+## 0.1.0-alpha.3 - 2019-04-02
+* Request functions accept path #743
+
+
+## 0.1.0-alpha.2 - 2019-03-29
+* Added TestServerRuntime::load_body() method
+* Update actix-http and awc libraries
+
+
+## 0.1.0-alpha.1 - 2019-03-28
+* Initial impl

actix-http-test/Cargo.toml

@@ -0,0 +1,55 @@
+[package]
+name = "actix-http-test"
+version = "3.0.0-beta.1"
+authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
+description = "Various helpers for Actix applications to use during testing"
+readme = "README.md"
+keywords = ["http", "web", "framework", "async", "futures"]
+homepage = "https://actix.rs"
+repository = "https://github.com/actix/actix-web.git"
+documentation = "https://docs.rs/actix-http-test/"
+categories = ["network-programming", "asynchronous",
+              "web-programming::http-server",
+              "web-programming::websocket"]
+license = "MIT OR Apache-2.0"
+exclude = [".gitignore", ".cargo/config"]
+edition = "2018"
+
+[package.metadata.docs.rs]
+features = []
+
+[lib]
+name = "actix_http_test"
+path = "src/lib.rs"
+
+[features]
+default = []
+
+# openssl
+openssl = ["open-ssl", "awc/openssl"]
+
+[dependencies]
+actix-service = "2.0.0-beta.2"
+actix-codec = "0.4.0-beta.1"
+actix-tls = "3.0.0-beta.2"
+actix-utils = "3.0.0-beta.1"
+actix-rt = "2.0.0-beta.1"
+actix-server = "2.0.0-beta.2"
+awc = "3.0.0-beta.1"
+
+base64 = "0.13"
+bytes = "1"
+futures-core = { version = "0.3.7", default-features = false }
+http = "0.2.2"
+log = "0.4"
+socket2 = "0.3"
+serde = "1.0"
+serde_json = "1.0"
+slab = "0.4"
+serde_urlencoded = "0.7"
+time = { version = "0.2.7", default-features = false, features = ["std"] }
+open-ssl = { version = "0.10", package = "openssl", optional = true }
+
+[dev-dependencies]
+actix-web = "4.0.0-beta.1"
+actix-http = "3.0.0-beta.1"

actix-http-test/README.md

@@ -0,0 +1,15 @@
+# actix-http-test
+
+> Various helpers for Actix applications to use during testing.
+
+[![crates.io](https://img.shields.io/crates/v/actix-http-test?label=latest)](https://crates.io/crates/actix-http-test)
+[![Documentation](https://docs.rs/actix-http-test/badge.svg?version=2.1.0)](https://docs.rs/actix-http-test/2.1.0)
+![Apache 2.0 or MIT licensed](https://img.shields.io/crates/l/actix-http-test)
+[![Dependency Status](https://deps.rs/crate/actix-http-test/2.1.0/status.svg)](https://deps.rs/crate/actix-http-test/2.1.0)
+[![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+
+## Documentation & Resources
+
+- [API Documentation](https://docs.rs/actix-http-test)
+- [Chat on Gitter](https://gitter.im/actix/actix-web)
+- Minimum Supported Rust Version (MSRV): 1.46.0

actix-http-test/src/lib.rs

@@ -0,0 +1,274 @@
+//! Various helpers for Actix applications to use during testing.
+
+#![deny(rust_2018_idioms)]
+#![doc(html_logo_url = "https://actix.rs/img/logo.png")]
+#![doc(html_favicon_url = "https://actix.rs/favicon.ico")]
+
+use std::sync::mpsc;
+use std::{net, thread, time};
+
+use actix_codec::{AsyncRead, AsyncWrite, Framed};
+use actix_rt::{net::TcpStream, System};
+use actix_server::{Server, ServiceFactory};
+use awc::{error::PayloadError, ws, Client, ClientRequest, ClientResponse, Connector};
+use bytes::Bytes;
+use futures_core::stream::Stream;
+use http::Method;
+use socket2::{Domain, Protocol, Socket, Type};
+
+/// Start test server
+///
+/// `TestServer` is very simple test server that simplify process of writing
+/// integration tests cases for actix web applications.
+///
+/// # Examples
+///
+/// ```rust
+/// use actix_http::HttpService;
+/// use actix_http_test::TestServer;
+/// use actix_web::{web, App, HttpResponse, Error};
+///
+/// async fn my_handler() -> Result<HttpResponse, Error> {
+///     Ok(HttpResponse::Ok().into())
+/// }
+///
+/// #[actix_rt::test]
+/// async fn test_example() {
+///     let mut srv = TestServer::start(
+///         || HttpService::new(
+///             App::new().service(
+///                 web::resource("/").to(my_handler))
+///         )
+///     );
+///
+///     let req = srv.get("/");
+///     let response = req.send().await.unwrap();
+///     assert!(response.status().is_success());
+/// }
+/// ```
+pub async fn test_server<F: ServiceFactory<TcpStream>>(factory: F) -> TestServer {
+    let tcp = net::TcpListener::bind("127.0.0.1:0").unwrap();
+    test_server_with_addr(tcp, factory).await
+}
+
+/// Start [`test server`](test_server()) on a concrete Address
+pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
+    tcp: net::TcpListener,
+    factory: F,
+) -> TestServer {
+    let (tx, rx) = mpsc::channel();
+
+    // run server in separate thread
+    thread::spawn(move || {
+        let sys = System::new("actix-test-server");
+        let local_addr = tcp.local_addr().unwrap();
+
+        let srv = Server::build()
+            .listen("test", tcp, factory)?
+            .workers(1)
+            .disable_signals();
+
+        sys.block_on(async {
+            srv.start();
+            tx.send((System::current(), local_addr)).unwrap();
+        });
+
+        sys.run()
+    });
+
+    let (system, addr) = rx.recv().unwrap();
+
+    let client = {
+        let connector = {
+            #[cfg(feature = "openssl")]
+            {
+                use open_ssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
+
+                let mut builder = SslConnector::builder(SslMethod::tls()).unwrap();
+                builder.set_verify(SslVerifyMode::NONE);
+                let _ = builder
+                    .set_alpn_protos(b"\x02h2\x08http/1.1")
+                    .map_err(|e| log::error!("Can not set alpn protocol: {:?}", e));
+                Connector::new()
+                    .conn_lifetime(time::Duration::from_secs(0))
+                    .timeout(time::Duration::from_millis(30000))
+                    .ssl(builder.build())
+                    .finish()
+            }
+            #[cfg(not(feature = "openssl"))]
+            {
+                Connector::new()
+                    .conn_lifetime(time::Duration::from_secs(0))
+                    .timeout(time::Duration::from_millis(30000))
+                    .finish()
+            }
+        };
+
+        Client::builder().connector(connector).finish()
+    };
+    actix_tls::connect::start_default_resolver().await.unwrap();
+
+    TestServer {
+        addr,
+        client,
+        system,
+    }
+}
+
+/// Get first available unused address
+pub fn unused_addr() -> net::SocketAddr {
+    let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
+    let socket =
+        Socket::new(Domain::ipv4(), Type::stream(), Some(Protocol::tcp())).unwrap();
+    socket.bind(&addr.into()).unwrap();
+    socket.set_reuse_address(true).unwrap();
+    let tcp = socket.into_tcp_listener();
+    tcp.local_addr().unwrap()
+}
+
+/// Test server controller
+pub struct TestServer {
+    addr: net::SocketAddr,
+    client: Client,
+    system: System,
+}
+
+impl TestServer {
+    /// Construct test server url
+    pub fn addr(&self) -> net::SocketAddr {
+        self.addr
+    }
+
+    /// Construct test server url
+    pub fn url(&self, uri: &str) -> String {
+        if uri.starts_with('/') {
+            format!("http://localhost:{}{}", self.addr.port(), uri)
+        } else {
+            format!("http://localhost:{}/{}", self.addr.port(), uri)
+        }
+    }
+
+    /// Construct test https server url
+    pub fn surl(&self, uri: &str) -> String {
+        if uri.starts_with('/') {
+            format!("https://localhost:{}{}", self.addr.port(), uri)
+        } else {
+            format!("https://localhost:{}/{}", self.addr.port(), uri)
+        }
+    }
+
+    /// Create `GET` request
+    pub fn get<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.get(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create https `GET` request
+    pub fn sget<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.get(self.surl(path.as_ref()).as_str())
+    }
+
+    /// Create `POST` request
+    pub fn post<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.post(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create https `POST` request
+    pub fn spost<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.post(self.surl(path.as_ref()).as_str())
+    }
+
+    /// Create `HEAD` request
+    pub fn head<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.head(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create https `HEAD` request
+    pub fn shead<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.head(self.surl(path.as_ref()).as_str())
+    }
+
+    /// Create `PUT` request
+    pub fn put<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.put(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create https `PUT` request
+    pub fn sput<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.put(self.surl(path.as_ref()).as_str())
+    }
+
+    /// Create `PATCH` request
+    pub fn patch<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.patch(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create https `PATCH` request
+    pub fn spatch<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.patch(self.surl(path.as_ref()).as_str())
+    }
+
+    /// Create `DELETE` request
+    pub fn delete<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.delete(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create https `DELETE` request
+    pub fn sdelete<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.delete(self.surl(path.as_ref()).as_str())
+    }
+
+    /// Create `OPTIONS` request
+    pub fn options<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.options(self.url(path.as_ref()).as_str())
+    }
+
+    /// Create https `OPTIONS` request
+    pub fn soptions<S: AsRef<str>>(&self, path: S) -> ClientRequest {
+        self.client.options(self.surl(path.as_ref()).as_str())
+    }
+
+    /// Connect to test http server
+    pub fn request<S: AsRef<str>>(&self, method: Method, path: S) -> ClientRequest {
+        self.client.request(method, path.as_ref())
+    }
+
+    pub async fn load_body<S>(
+        &mut self,
+        mut response: ClientResponse<S>,
+    ) -> Result<Bytes, PayloadError>
+    where
+        S: Stream<Item = Result<Bytes, PayloadError>> + Unpin + 'static,
+    {
+        response.body().limit(10_485_760).await
+    }
+
+    /// Connect to websocket server at a given path
+    pub async fn ws_at(
+        &mut self,
+        path: &str,
+    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError>
+    {
+        let url = self.url(path);
+        let connect = self.client.ws(url).connect();
+        connect.await.map(|(_, framed)| framed)
+    }
+
+    /// Connect to a websocket server
+    pub async fn ws(
+        &mut self,
+    ) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError>
+    {
+        self.ws_at("/").await
+    }
+
+    /// Stop http server
+    fn stop(&mut self) {
+        self.system.stop();
+    }
+}
+
+impl Drop for TestServer {
+    fn drop(&mut self) {
+        self.stop()
+    }
+}

actix-http/.appveyor.yml

@@ -1,41 +0,0 @@
-environment:
-  global:
-    PROJECT_NAME: actix-http
-  matrix:
-    # Stable channel
-    - TARGET: i686-pc-windows-msvc
-      CHANNEL: stable
-    - TARGET: x86_64-pc-windows-gnu
-      CHANNEL: stable
-    - TARGET: x86_64-pc-windows-msvc
-      CHANNEL: stable
-    # Nightly channel
-    - TARGET: i686-pc-windows-msvc
-      CHANNEL: nightly
-    - TARGET: x86_64-pc-windows-gnu
-      CHANNEL: nightly
-    - TARGET: x86_64-pc-windows-msvc
-      CHANNEL: nightly
-
-# Install Rust and Cargo
-# (Based on from https://github.com/rust-lang/libc/blob/master/appveyor.yml)
-install:
-  - ps: >-
-        If ($Env:TARGET -eq 'x86_64-pc-windows-gnu') {
-           $Env:PATH += ';C:\msys64\mingw64\bin'
-        } ElseIf ($Env:TARGET -eq 'i686-pc-windows-gnu') {
-           $Env:PATH += ';C:\MinGW\bin'
-        }
-  - curl -sSf -o rustup-init.exe https://win.rustup.rs
-  - rustup-init.exe --default-host %TARGET% --default-toolchain %CHANNEL% -y
-  - set PATH=%PATH%;C:\Users\appveyor\.cargo\bin
-  - rustc -Vv
-  - cargo -V
-
-# 'cargo test' takes care of building for us, so disable Appveyor's build stage.
-build: false
-
-# Equivalent to Travis' `script` phase
-test_script:
-  - cargo clean
-  - cargo test

actix-http/CHANGES.md

@@ -1,21 +1,242 @@
 # Changes
 
-## Not released yet
+## Unreleased - 2021-xx-xx
+
+
+## 3.0.0-beta.1 - 2021-01-07
+### Added
+* Add `Http3` to `Protocol` enum for future compatibility and also mark `#[non_exhaustive]`.
+
+### Changed
+* Update `actix-*` dependencies to tokio `1.0` based versions. [#1813]
+* Bumped `rand` to `0.8`.
+* Update `bytes` to `1.0`. [#1813]
+* Update `h2` to `0.3`. [#1813]
+* The `ws::Message::Text` enum variant now contains a `bytestring::ByteString`. [#1864]
+
+### Removed
+* Deprecated `on_connect` methods have been removed. Prefer the new
+  `on_connect_ext` technique. [#1857]
+* Remove `ResponseError` impl for `actix::actors::resolver::ResolverError`
+  due to deprecate of resolver actor. [#1813]
+* Remove `ConnectError::SslHandshakeError` and re-export of `HandshakeError`.
+  due to the removal of this type from `tokio-openssl` crate. openssl handshake 
+  error would return as `ConnectError::SslError`. [#1813]
+
+[#1813]: https://github.com/actix/actix-web/pull/1813
+[#1857]: https://github.com/actix/actix-web/pull/1857
+[#1864]: https://github.com/actix/actix-web/pull/1864
+
+
+## 2.2.0 - 2020-11-25
+### Added
+* HttpResponse builders for 1xx status codes. [#1768]
+* `Accept::mime_precedence` and `Accept::mime_preference`. [#1793]
+* `TryFrom<u16>` and `TryFrom<f32>` for `http::header::Quality`. [#1797]
+
+### Fixed
+* Started dropping `transfer-encoding: chunked` and `Content-Length` for 1XX and 204 responses. [#1767]
+
+### Changed
+* Upgrade `serde_urlencoded` to `0.7`. [#1773]
+
+[#1773]: https://github.com/actix/actix-web/pull/1773
+[#1767]: https://github.com/actix/actix-web/pull/1767
+[#1768]: https://github.com/actix/actix-web/pull/1768
+[#1793]: https://github.com/actix/actix-web/pull/1793
+[#1797]: https://github.com/actix/actix-web/pull/1797
+
+
+## 2.1.0 - 2020-10-30
+### Added
+* Added more flexible `on_connect_ext` methods for on-connect handling. [#1754]
+
+### Changed
+* Upgrade `base64` to `0.13`. [#1744]
+* Upgrade `pin-project` to `1.0`. [#1733]
+* Deprecate `ResponseBuilder::{if_some, if_true}`. [#1760]
+
+[#1760]: https://github.com/actix/actix-web/pull/1760
+[#1754]: https://github.com/actix/actix-web/pull/1754
+[#1733]: https://github.com/actix/actix-web/pull/1733
+[#1744]: https://github.com/actix/actix-web/pull/1744
+
+
+## 2.0.0 - 2020-09-11
+* No significant changes from `2.0.0-beta.4`.
+
+
+## 2.0.0-beta.4 - 2020-09-09
+### Changed
+* Update actix-codec and actix-utils dependencies.
+* Update actix-connect and actix-tls dependencies.
+
+
+## [2.0.0-beta.3] - 2020-08-14
+
+### Fixed
+* Memory leak of `client::pool::ConnectorPoolSupport`. [#1626]
+
+[#1626]: https://github.com/actix/actix-web/pull/1626
+
+
+## [2.0.0-beta.2] - 2020-07-21
+### Fixed
+* Potential UB in h1 decoder using uninitialized memory. [#1614]
+
+### Changed
+* Fix illegal chunked encoding. [#1615]
+
+[#1614]: https://github.com/actix/actix-web/pull/1614
+[#1615]: https://github.com/actix/actix-web/pull/1615
+
+
+## [2.0.0-beta.1] - 2020-07-11
+
+### Changed
+
+* Migrate cookie handling to `cookie` crate. [#1558]
+* Update `sha-1` to 0.9. [#1586]
+* Fix leak in client pool. [#1580]
+* MSRV is now 1.41.1.
+
+[#1558]: https://github.com/actix/actix-web/pull/1558
+[#1586]: https://github.com/actix/actix-web/pull/1586
+[#1580]: https://github.com/actix/actix-web/pull/1580
+
+## [2.0.0-alpha.4] - 2020-05-21
+
+### Changed
+
+* Bump minimum supported Rust version to 1.40
+* content_length function is removed, and you can set Content-Length by calling no_chunking function [#1439]
+* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
+  `u64` instead of a `usize`.
+* Update `base64` dependency to 0.12
+
+### Fixed
+
+* Support parsing of `SameSite=None` [#1503]
+
+[#1439]: https://github.com/actix/actix-web/pull/1439
+[#1503]: https://github.com/actix/actix-web/pull/1503
+
+## [2.0.0-alpha.3] - 2020-05-08
+
+### Fixed
+
+* Correct spelling of ConnectError::Unresolved [#1487]
+* Fix a mistake in the encoding of websocket continuation messages wherein
+  Item::FirstText and Item::FirstBinary are each encoded as the other.
+
+### Changed
+
+* Implement `std::error::Error` for our custom errors [#1422]
+* Remove `failure` support for `ResponseError` since that crate
+  will be deprecated in the near future.
+
+[#1422]: https://github.com/actix/actix-web/pull/1422
+[#1487]: https://github.com/actix/actix-web/pull/1487
+
+## [2.0.0-alpha.2] - 2020-03-07
+
+### Changed
+
+* Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
+
+* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB respectively
+  to improve download speed for awc when downloading large objects. [#1394]
+
+* client::Connector accepts initial_window_size and initial_connection_window_size HTTP2 configuration. [#1394]
+
+* client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
+
+[#1394]: https://github.com/actix/actix-web/pull/1394
+[#1395]: https://github.com/actix/actix-web/pull/1395
+
+## [2.0.0-alpha.1] - 2020-02-27
+
+### Changed
+
+* Update the `time` dependency to 0.2.7.
+* Moved actors messages support from actix crate, enabled with feature `actors`.
+* Breaking change: trait MessageBody requires Unpin and accepting Pin<&mut Self> instead of &mut self in the poll_next().
+* MessageBody is not implemented for &'static [u8] anymore.
+
+### Fixed
+
+* Allow `SameSite=None` cookies to be sent in a response.
+
+## [1.0.1] - 2019-12-20
+
+### Fixed
+
+* Poll upgrade service's readiness from HTTP service handlers
+
+* Replace brotli with brotli2 #1224
+
+## [1.0.0] - 2019-12-13
+
+### Added
+
+* Add websockets continuation frame support
+
+### Changed
+
+* Replace `flate2-xxx` features with `compress`
+
+## [1.0.0-alpha.5] - 2019-12-09
+
+### Fixed
+
+* Check `Upgrade` service readiness before calling it
+
+* Fix buffer remaining capacity calcualtion
+
+### Changed
+
+* Websockets: Ping and Pong should have binary data #1049
+
+## [1.0.0-alpha.4] - 2019-12-08
+
+### Added
+
+* Add impl ResponseBuilder for Error
+
+### Changed
+
+* Use rust based brotli compression library
+
+## [1.0.0-alpha.3] - 2019-12-07
+
+### Changed
+
+* Migrate to tokio 0.2
+
+* Migrate to `std::future`
+
+
+## [0.2.11] - 2019-11-06
 
 ### Added
 
 * Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
 
+* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
 
-## [0.2.11] - 2019-09-11
+* Allow to use `std::convert::Infallible` as `actix_http::error::Error`
+
+### Fixed
+
+* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain; charset=utf-8` header #1118
+
+
+## [0.2.10] - 2019-09-11
 
 ### Added
 
 * Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests with `RequestHead`
 
-* Allow to use `std::convert::Infallible` as `actix_http::error::Error`
-
-
 ### Fixed
 
 * h2 will use error response #1080

actix-http/CODE_OF_CONDUCT.md

@@ -1,46 +0,0 @@
-# Contributor Covenant Code of Conduct
-
-## Our Pledge
-
-In the interest of fostering an open and welcoming environment, we as contributors and maintainers pledge to making participation in our project and our community a harassment-free experience for everyone, regardless of age, body size, disability, ethnicity, gender identity and expression, level of experience, nationality, personal appearance, race, religion, or sexual identity and orientation.
-
-## Our Standards
-
-Examples of behavior that contributes to creating a positive environment include:
-
-* Using welcoming and inclusive language
-* Being respectful of differing viewpoints and experiences
-* Gracefully accepting constructive criticism
-* Focusing on what is best for the community
-* Showing empathy towards other community members
-
-Examples of unacceptable behavior by participants include:
-
-* The use of sexualized language or imagery and unwelcome sexual attention or advances
-* Trolling, insulting/derogatory comments, and personal or political attacks
-* Public or private harassment
-* Publishing others' private information, such as a physical or electronic address, without explicit permission
-* Other conduct which could reasonably be considered inappropriate in a professional setting
-
-## Our Responsibilities
-
-Project maintainers are responsible for clarifying the standards of acceptable behavior and are expected to take appropriate and fair corrective action in response to any instances of unacceptable behavior.
-
-Project maintainers have the right and responsibility to remove, edit, or reject comments, commits, code, wiki edits, issues, and other contributions that are not aligned to this Code of Conduct, or to ban temporarily or permanently any contributor for other behaviors that they deem inappropriate, threatening, offensive, or harmful.
-
-## Scope
-
-This Code of Conduct applies both within project spaces and in public spaces when an individual is representing the project or its community. Examples of representing a project or community include using an official project e-mail address, posting via an official social media account, or acting as an appointed representative at an online or offline event. Representation of a project may be further defined and clarified by project maintainers.
-
-## Enforcement
-
-Instances of abusive, harassing, or otherwise unacceptable behavior may be reported by contacting the project team at fafhrd91@gmail.com. The project team will review and investigate all complaints, and will respond in a way that it deems appropriate to the circumstances. The project team is obligated to maintain confidentiality with regard to the reporter of an incident. Further details of specific enforcement policies may be posted separately.
-
-Project maintainers who do not follow or enforce the Code of Conduct in good faith may face temporary or permanent repercussions as determined by other members of the project's leadership.
-
-## Attribution
-
-This Code of Conduct is adapted from the [Contributor Covenant][homepage], version 1.4, available at [http://contributor-covenant.org/version/1/4][version]
-
-[homepage]: http://contributor-covenant.org
-[version]: http://contributor-covenant.org/version/1/4/

actix-http/Cargo.toml

@@ -1,8 +1,8 @@
 [package]
 name = "actix-http"
-version = "0.2.10"
+version = "3.0.0-beta.1"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
-description = "Actix http primitives"
+description = "HTTP primitives for the Actix ecosystem"
 readme = "README.md"
 keywords = ["actix", "http", "framework", "async", "futures"]
 homepage = "https://actix.rs"
@@ -11,12 +11,11 @@ documentation = "https://docs.rs/actix-http/"
 categories = ["network-programming", "asynchronous",
               "web-programming::http-server",
               "web-programming::websocket"]
-license = "MIT/Apache-2.0"
+license = "MIT OR Apache-2.0"
 edition = "2018"
-workspace = ".."
 
 [package.metadata.docs.rs]
-features = ["ssl", "fail", "brotli", "flate2-zlib", "secure-cookies"]
+features = ["openssl", "rustls", "compress", "secure-cookies", "actors"]
 
 [lib]
 name = "actix_http"
@@ -26,85 +25,84 @@ path = "src/lib.rs"
 default = []
 
 # openssl
-ssl = ["openssl", "actix-connect/ssl"]
+openssl = ["actix-tls/openssl"]
 
 # rustls support
-rust-tls = ["rustls", "webpki-roots", "actix-connect/rust-tls"]
+rustls = ["actix-tls/rustls"]
 
-# brotli encoding, requires c compiler
-brotli = ["brotli2"]
-
-# miniz-sys backend for flate2 crate
-flate2-zlib = ["flate2/miniz-sys"]
-
-# rust backend for flate2 crate
-flate2-rust = ["flate2/rust_backend"]
-
-# failure integration. actix does not use failure anymore
-fail = ["failure"]
+# enable compressison support
+compress = ["flate2", "brotli2"]
 
 # support for secure cookies
-secure-cookies = ["ring"]
+secure-cookies = ["cookie/secure"]
+
+# support for actix Actor messages
+actors = ["actix"]
 
 [dependencies]
-actix-service = "0.4.1"
-actix-codec = "0.1.2"
-actix-connect = "0.2.4"
-actix-utils = "0.4.4"
-actix-server-config = "0.1.2"
-actix-threadpool = "0.1.1"
+actix-service = "2.0.0-beta.2"
+actix-codec = "0.4.0-beta.1"
+actix-utils = "3.0.0-beta.1"
+actix-rt = "2.0.0-beta.1"
+actix-threadpool = "0.3.1"
+actix-tls = "3.0.0-beta.2"
+actix = { version = "0.11.0-beta.1", optional = true }
 
-base64 = "0.10"
-bitflags = "1.0"
-bytes = "0.4"
+base64 = "0.13"
+bitflags = "1.2"
+bytes = "1"
+bytestring = "1"
+cookie = { version = "0.14.1", features = ["percent-encode"] }
 copyless = "0.1.4"
-derive_more = "0.15.0"
-either = "1.5.2"
+derive_more = "0.99.5"
+either = "1.5.3"
 encoding_rs = "0.8"
-futures = "0.1.25"
-hashbrown = "0.5.0"
-h2 = "0.1.16"
-http = "0.1.17"
+futures-channel = { version = "0.3.7", default-features = false }
+futures-core = { version = "0.3.7", default-features = false }
+futures-util = { version = "0.3.7", default-features = false, features = ["sink"] }
+fxhash = "0.2.1"
+h2 = "0.3.0"
+http = "0.2.2"
 httparse = "1.3"
-indexmap = "1.2"
-lazy_static = "1.0"
+indexmap = "1.3"
+itoa = "0.4"
+lazy_static = "1.4"
 language-tags = "0.2"
 log = "0.4"
 mime = "0.3"
 percent-encoding = "2.1"
-rand = "0.7"
-regex = "1.0"
+pin-project = "1.0.0"
+rand = "0.8"
+regex = "1.3"
 serde = "1.0"
 serde_json = "1.0"
-sha1 = "0.6"
+sha-1 = "0.9"
 slab = "0.4"
-serde_urlencoded = "0.6.1"
-time = "0.1.42"
-tokio-tcp = "0.1.3"
-tokio-timer = "0.2.8"
-tokio-current-thread = "0.1"
-trust-dns-resolver = { version="0.11.1", default-features = false }
-
-# for secure cookie
-ring = { version = "0.14.6", optional = true }
+serde_urlencoded = "0.7"
+time = { version = "0.2.7", default-features = false, features = ["std"] }
 
 # compression
 brotli2 = { version="0.3.2", optional = true }
-flate2 = { version="1.0.7", optional = true, default-features = false }
-
-# optional deps
-failure = { version = "0.1.5", optional = true }
-openssl = { version="0.10", optional = true }
-rustls = { version = "0.15.2", optional = true }
-webpki-roots = { version = "0.16", optional = true }
-chrono = "0.4.6"
+flate2 = { version = "1.0.13", optional = true }
 
 [dev-dependencies]
-actix-rt = "0.2.2"
-actix-server = { version = "0.6.0", features=["ssl", "rust-tls"] }
-actix-connect = { version = "0.2.0", features=["ssl"] }
-actix-http-test = { version = "0.2.4", features=["ssl"] }
-env_logger = "0.6"
+actix-server = "2.0.0-beta.2"
+actix-http-test = { version = "3.0.0-beta.1", features = ["openssl"] }
+actix-tls = { version = "3.0.0-beta.2", features = ["openssl"] }
+criterion = "0.3"
+env_logger = "0.7"
 serde_derive = "1.0"
-openssl = { version="0.10" }
-tokio-tcp = "0.1"
+open-ssl = { version="0.10", package = "openssl" }
+rust-tls = { version="0.19", package = "rustls" }
+
+[[bench]]
+name = "write-camel-case"
+harness = false
+
+[[bench]]
+name = "status-line"
+harness = false
+
+[[bench]]
+name = "uninit-headers"
+harness = false

actix-http/LICENSE-APACHE

@@ -1,201 +0,0 @@
-                                 Apache License
-                           Version 2.0, January 2004
-                        http://www.apache.org/licenses/
-
-   TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
-
-   1. Definitions.
-
-      "License" shall mean the terms and conditions for use, reproduction,
-      and distribution as defined by Sections 1 through 9 of this document.
-
-      "Licensor" shall mean the copyright owner or entity authorized by
-      the copyright owner that is granting the License.
-
-      "Legal Entity" shall mean the union of the acting entity and all
-      other entities that control, are controlled by, or are under common
-      control with that entity. For the purposes of this definition,
-      "control" means (i) the power, direct or indirect, to cause the
-      direction or management of such entity, whether by contract or
-      otherwise, or (ii) ownership of fifty percent (50%) or more of the
-      outstanding shares, or (iii) beneficial ownership of such entity.
-
-      "You" (or "Your") shall mean an individual or Legal Entity
-      exercising permissions granted by this License.
-
-      "Source" form shall mean the preferred form for making modifications,
-      including but not limited to software source code, documentation
-      source, and configuration files.
-
-      "Object" form shall mean any form resulting from mechanical
-      transformation or translation of a Source form, including but
-      not limited to compiled object code, generated documentation,
-      and conversions to other media types.
-
-      "Work" shall mean the work of authorship, whether in Source or
-      Object form, made available under the License, as indicated by a
-      copyright notice that is included in or attached to the work
-      (an example is provided in the Appendix below).
-
-      "Derivative Works" shall mean any work, whether in Source or Object
-      form, that is based on (or derived from) the Work and for which the
-      editorial revisions, annotations, elaborations, or other modifications
-      represent, as a whole, an original work of authorship. For the purposes
-      of this License, Derivative Works shall not include works that remain
-      separable from, or merely link (or bind by name) to the interfaces of,
-      the Work and Derivative Works thereof.
-
-      "Contribution" shall mean any work of authorship, including
-      the original version of the Work and any modifications or additions
-      to that Work or Derivative Works thereof, that is intentionally
-      submitted to Licensor for inclusion in the Work by the copyright owner
-      or by an individual or Legal Entity authorized to submit on behalf of
-      the copyright owner. For the purposes of this definition, "submitted"
-      means any form of electronic, verbal, or written communication sent
-      to the Licensor or its representatives, including but not limited to
-      communication on electronic mailing lists, source code control systems,
-      and issue tracking systems that are managed by, or on behalf of, the
-      Licensor for the purpose of discussing and improving the Work, but
-      excluding communication that is conspicuously marked or otherwise
-      designated in writing by the copyright owner as "Not a Contribution."
-
-      "Contributor" shall mean Licensor and any individual or Legal Entity
-      on behalf of whom a Contribution has been received by Licensor and
-      subsequently incorporated within the Work.
-
-   2. Grant of Copyright License. Subject to the terms and conditions of
-      this License, each Contributor hereby grants to You a perpetual,
-      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
-      copyright license to reproduce, prepare Derivative Works of,
-      publicly display, publicly perform, sublicense, and distribute the
-      Work and such Derivative Works in Source or Object form.
-
-   3. Grant of Patent License. Subject to the terms and conditions of
-      this License, each Contributor hereby grants to You a perpetual,
-      worldwide, non-exclusive, no-charge, royalty-free, irrevocable
-      (except as stated in this section) patent license to make, have made,
-      use, offer to sell, sell, import, and otherwise transfer the Work,
-      where such license applies only to those patent claims licensable
-      by such Contributor that are necessarily infringed by their
-      Contribution(s) alone or by combination of their Contribution(s)
-      with the Work to which such Contribution(s) was submitted. If You
-      institute patent litigation against any entity (including a
-      cross-claim or counterclaim in a lawsuit) alleging that the Work
-      or a Contribution incorporated within the Work constitutes direct
-      or contributory patent infringement, then any patent licenses
-      granted to You under this License for that Work shall terminate
-      as of the date such litigation is filed.
-
-   4. Redistribution. You may reproduce and distribute copies of the
-      Work or Derivative Works thereof in any medium, with or without
-      modifications, and in Source or Object form, provided that You
-      meet the following conditions:
-
-      (a) You must give any other recipients of the Work or
-          Derivative Works a copy of this License; and
-
-      (b) You must cause any modified files to carry prominent notices
-          stating that You changed the files; and
-
-      (c) You must retain, in the Source form of any Derivative Works
-          that You distribute, all copyright, patent, trademark, and
-          attribution notices from the Source form of the Work,
-          excluding those notices that do not pertain to any part of
-          the Derivative Works; and
-
-      (d) If the Work includes a "NOTICE" text file as part of its
-          distribution, then any Derivative Works that You distribute must
-          include a readable copy of the attribution notices contained
-          within such NOTICE file, excluding those notices that do not
-          pertain to any part of the Derivative Works, in at least one
-          of the following places: within a NOTICE text file distributed
-          as part of the Derivative Works; within the Source form or
-          documentation, if provided along with the Derivative Works; or,
-          within a display generated by the Derivative Works, if and
-          wherever such third-party notices normally appear. The contents
-          of the NOTICE file are for informational purposes only and
-          do not modify the License. You may add Your own attribution
-          notices within Derivative Works that You distribute, alongside
-          or as an addendum to the NOTICE text from the Work, provided
-          that such additional attribution notices cannot be construed
-          as modifying the License.
-
-      You may add Your own copyright statement to Your modifications and
-      may provide additional or different license terms and conditions
-      for use, reproduction, or distribution of Your modifications, or
-      for any such Derivative Works as a whole, provided Your use,
-      reproduction, and distribution of the Work otherwise complies with
-      the conditions stated in this License.
-
-   5. Submission of Contributions. Unless You explicitly state otherwise,
-      any Contribution intentionally submitted for inclusion in the Work
-      by You to the Licensor shall be under the terms and conditions of
-      this License, without any additional terms or conditions.
-      Notwithstanding the above, nothing herein shall supersede or modify
-      the terms of any separate license agreement you may have executed
-      with Licensor regarding such Contributions.
-
-   6. Trademarks. This License does not grant permission to use the trade
-      names, trademarks, service marks, or product names of the Licensor,
-      except as required for reasonable and customary use in describing the
-      origin of the Work and reproducing the content of the NOTICE file.
-
-   7. Disclaimer of Warranty. Unless required by applicable law or
-      agreed to in writing, Licensor provides the Work (and each
-      Contributor provides its Contributions) on an "AS IS" BASIS,
-      WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
-      implied, including, without limitation, any warranties or conditions
-      of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
-      PARTICULAR PURPOSE. You are solely responsible for determining the
-      appropriateness of using or redistributing the Work and assume any
-      risks associated with Your exercise of permissions under this License.
-
-   8. Limitation of Liability. In no event and under no legal theory,
-      whether in tort (including negligence), contract, or otherwise,
-      unless required by applicable law (such as deliberate and grossly
-      negligent acts) or agreed to in writing, shall any Contributor be
-      liable to You for damages, including any direct, indirect, special,
-      incidental, or consequential damages of any character arising as a
-      result of this License or out of the use or inability to use the
-      Work (including but not limited to damages for loss of goodwill,
-      work stoppage, computer failure or malfunction, or any and all
-      other commercial damages or losses), even if such Contributor
-      has been advised of the possibility of such damages.
-
-   9. Accepting Warranty or Additional Liability. While redistributing
-      the Work or Derivative Works thereof, You may choose to offer,
-      and charge a fee for, acceptance of support, warranty, indemnity,
-      or other liability obligations and/or rights consistent with this
-      License. However, in accepting such obligations, You may act only
-      on Your own behalf and on Your sole responsibility, not on behalf
-      of any other Contributor, and only if You agree to indemnify,
-      defend, and hold each Contributor harmless for any liability
-      incurred by, or claims asserted against, such Contributor by reason
-      of your accepting any such warranty or additional liability.
-
-   END OF TERMS AND CONDITIONS
-
-   APPENDIX: How to apply the Apache License to your work.
-
-      To apply the Apache License to your work, attach the following
-      boilerplate notice, with the fields enclosed by brackets "{}"
-      replaced with your own identifying information. (Don't include
-      the brackets!)  The text should be enclosed in the appropriate
-      comment syntax for the file format. We also recommend that a
-      file or class name and description of purpose be included on the
-      same "printed page" as the copyright notice for easier
-      identification within third-party archives.
-
-   Copyright 2017-NOW Nikolay Kim
-
-   Licensed under the Apache License, Version 2.0 (the "License");
-   you may not use this file except in compliance with the License.
-   You may obtain a copy of the License at
-
-       http://www.apache.org/licenses/LICENSE-2.0
-
-   Unless required by applicable law or agreed to in writing, software
-   distributed under the License is distributed on an "AS IS" BASIS,
-   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-   See the License for the specific language governing permissions and
-   limitations under the License.

actix-http/LICENSE-APACHE

@@ -0,0 +1 @@
+../LICENSE-APACHE

actix-http/LICENSE-MIT

@@ -1,25 +0,0 @@
-Copyright (c) 2017 Nikolay Kim
-
-Permission is hereby granted, free of charge, to any
-person obtaining a copy of this software and associated
-documentation files (the "Software"), to deal in the
-Software without restriction, including without
-limitation the rights to use, copy, modify, merge,
-publish, distribute, sublicense, and/or sell copies of
-the Software, and to permit persons to whom the Software
-is furnished to do so, subject to the following
-conditions:
-
-The above copyright notice and this permission notice
-shall be included in all copies or substantial portions
-of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF
-ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED
-TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A
-PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT
-SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
-CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
-OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR
-IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
-DEALINGS IN THE SOFTWARE.

actix-http/LICENSE-MIT

@@ -0,0 +1 @@
+../LICENSE-MIT

actix-http/README.md

@@ -1,32 +1,50 @@
-# Actix http [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web)  [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-http)](https://crates.io/crates/actix-http) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+# actix-http
 
-Actix http
+> HTTP primitives for the Actix ecosystem.
 
-## Documentation & community resources
+[![crates.io](https://img.shields.io/crates/v/actix-http?label=latest)](https://crates.io/crates/actix-http)
+[![Documentation](https://docs.rs/actix-http/badge.svg?version=2.2.0)](https://docs.rs/actix-http/2.2.0)
+![Apache 2.0 or MIT licensed](https://img.shields.io/crates/l/actix-http)
+[![Dependency Status](https://deps.rs/crate/actix-http/2.2.0/status.svg)](https://deps.rs/crate/actix-http/2.2.0)
+[![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
 
-* [User Guide](https://actix.rs/docs/)
-* [API Documentation](https://docs.rs/actix-http/)
-* [Chat on gitter](https://gitter.im/actix/actix)
-* Cargo package: [actix-http](https://crates.io/crates/actix-http)
-* Minimum supported Rust version: 1.31 or later
+## Documentation & Resources
+
+- [API Documentation](https://docs.rs/actix-http)
+- [Chat on Gitter](https://gitter.im/actix/actix-web)
+- Minimum Supported Rust Version (MSRV): 1.46.0
 
 ## Example
 
 ```rust
-// see examples/framed_hello.rs for complete list of used crates.
-extern crate actix_http;
-use actix_http::{h1, Response, ServiceConfig};
+use std::{env, io};
 
-fn main() {
-    Server::new().bind("framed_hello", "127.0.0.1:8080", || {
-        IntoFramed::new(|| h1::Codec::new(ServiceConfig::default()))	// <- create h1 codec
-            .and_then(TakeItem::new().map_err(|_| ()))	                // <- read one request
-            .and_then(|(_req, _framed): (_, Framed<_, _>)| {	        // <- send response and close conn
-                SendResponse::send(_framed, Response::Ok().body("Hello world!"))
-                    .map_err(|_| ())
-                    .map(|_| ())
-            })
-    }).unwrap().run();
+use actix_http::{HttpService, Response};
+use actix_server::Server;
+use futures_util::future;
+use http::header::HeaderValue;
+use log::info;
+
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
+    env::set_var("RUST_LOG", "hello_world=info");
+    env_logger::init();
+
+    Server::build()
+        .bind("hello-world", "127.0.0.1:8080", || {
+            HttpService::build()
+                .client_timeout(1000)
+                .client_disconnect(1000)
+                .finish(|_req| {
+                    info!("{:?}", _req);
+                    let mut res = Response::Ok();
+                    res.header("x-head", HeaderValue::from_static("dummy value!"));
+                    future::ok::<_, ()>(res.body("Hello world!"))
+                })
+                .tcp()
+        })?
+        .run()
+        .await
 }
 ```
 

actix-http/benches/status-line.rs

@@ -0,0 +1,222 @@
+use criterion::{criterion_group, criterion_main, BenchmarkId, Criterion};
+
+use bytes::BytesMut;
+use http::Version;
+
+const CODES: &[u16] = &[201, 303, 404, 515];
+
+fn bench_write_status_line_11(c: &mut Criterion) {
+    let mut group = c.benchmark_group("write_status_line v1.1");
+
+    let version = Version::HTTP_11;
+
+    for i in CODES.iter() {
+        group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _original::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _new::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _naive::write_status_line(version, i, &mut b);
+            })
+        });
+    }
+
+    group.finish();
+}
+
+fn bench_write_status_line_10(c: &mut Criterion) {
+    let mut group = c.benchmark_group("write_status_line v1.0");
+
+    let version = Version::HTTP_10;
+
+    for i in CODES.iter() {
+        group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _original::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _new::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _naive::write_status_line(version, i, &mut b);
+            })
+        });
+    }
+
+    group.finish();
+}
+
+fn bench_write_status_line_09(c: &mut Criterion) {
+    let mut group = c.benchmark_group("write_status_line v0.9");
+
+    let version = Version::HTTP_09;
+
+    for i in CODES.iter() {
+        group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _original::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _new::write_status_line(version, i, &mut b);
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _naive::write_status_line(version, i, &mut b);
+            })
+        });
+    }
+
+    group.finish();
+}
+
+criterion_group!(
+    benches,
+    bench_write_status_line_11,
+    bench_write_status_line_10,
+    bench_write_status_line_09
+);
+criterion_main!(benches);
+
+mod _naive {
+    use bytes::{BufMut, BytesMut};
+    use http::Version;
+
+    pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
+        match version {
+            Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
+            Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
+            Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
+            _ => {
+                // other HTTP version handlers do not use this method
+            }
+        }
+
+        bytes.put_slice(n.to_string().as_bytes());
+    }
+}
+
+mod _new {
+    use bytes::{BufMut, BytesMut};
+    use http::Version;
+
+    const DIGITS_START: u8 = b'0';
+
+    pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
+        match version {
+            Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
+            Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
+            Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
+            _ => {
+                // other HTTP version handlers do not use this method
+            }
+        }
+
+        let d100 = (n / 100) as u8;
+        let d10 = ((n / 10) % 10) as u8;
+        let d1 = (n % 10) as u8;
+
+        bytes.put_u8(DIGITS_START + d100);
+        bytes.put_u8(DIGITS_START + d10);
+        bytes.put_u8(DIGITS_START + d1);
+
+        bytes.put_u8(b' ');
+    }
+}
+
+mod _original {
+    use std::ptr;
+
+    use bytes::{BufMut, BytesMut};
+    use http::Version;
+
+    const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
+        2021222324252627282930313233343536373839\
+        4041424344454647484950515253545556575859\
+        6061626364656667686970717273747576777879\
+        8081828384858687888990919293949596979899";
+
+    pub(crate) const STATUS_LINE_BUF_SIZE: usize = 13;
+
+    pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesMut) {
+        let mut buf: [u8; STATUS_LINE_BUF_SIZE] = *b"HTTP/1.1     ";
+
+        match version {
+            Version::HTTP_2 => buf[5] = b'2',
+            Version::HTTP_10 => buf[7] = b'0',
+            Version::HTTP_09 => {
+                buf[5] = b'0';
+                buf[7] = b'9';
+            }
+            _ => {}
+        }
+
+        let mut curr: isize = 12;
+        let buf_ptr = buf.as_mut_ptr();
+        let lut_ptr = DEC_DIGITS_LUT.as_ptr();
+        let four = n > 999;
+
+        // decode 2 more chars, if > 2 chars
+        let d1 = (n % 100) << 1;
+        n /= 100;
+        curr -= 2;
+        unsafe {
+            ptr::copy_nonoverlapping(
+                lut_ptr.offset(d1 as isize),
+                buf_ptr.offset(curr),
+                2,
+            );
+        }
+
+        // decode last 1 or 2 chars
+        if n < 10 {
+            curr -= 1;
+            unsafe {
+                *buf_ptr.offset(curr) = (n as u8) + b'0';
+            }
+        } else {
+            let d1 = n << 1;
+            curr -= 2;
+            unsafe {
+                ptr::copy_nonoverlapping(
+                    lut_ptr.offset(d1 as isize),
+                    buf_ptr.offset(curr),
+                    2,
+                );
+            }
+        }
+
+        bytes.put_slice(&buf);
+        if four {
+            bytes.put_u8(b' ');
+        }
+    }
+}

actix-http/benches/uninit-headers.rs

@@ -0,0 +1,137 @@
+use criterion::{criterion_group, criterion_main, Criterion};
+
+use bytes::BytesMut;
+
+// A Miri run detects UB, seen on this playground:
+// https://play.rust-lang.org/?version=stable&mode=debug&edition=2018&gist=f5d9aa166aa48df8dca05fce2b6c3915
+
+fn bench_header_parsing(c: &mut Criterion) {
+    c.bench_function("Original (Unsound) [short]", |b| {
+        b.iter(|| {
+            let mut buf = BytesMut::from(REQ_SHORT);
+            _original::parse_headers(&mut buf);
+        })
+    });
+
+    c.bench_function("New (safe) [short]", |b| {
+        b.iter(|| {
+            let mut buf = BytesMut::from(REQ_SHORT);
+            _new::parse_headers(&mut buf);
+        })
+    });
+
+    c.bench_function("Original (Unsound) [realistic]", |b| {
+        b.iter(|| {
+            let mut buf = BytesMut::from(REQ);
+            _original::parse_headers(&mut buf);
+        })
+    });
+
+    c.bench_function("New (safe) [realistic]", |b| {
+        b.iter(|| {
+            let mut buf = BytesMut::from(REQ);
+            _new::parse_headers(&mut buf);
+        })
+    });
+}
+
+criterion_group!(benches, bench_header_parsing);
+criterion_main!(benches);
+
+const MAX_HEADERS: usize = 96;
+
+const EMPTY_HEADER_ARRAY: [httparse::Header<'static>; MAX_HEADERS] =
+    [httparse::EMPTY_HEADER; MAX_HEADERS];
+
+#[derive(Clone, Copy)]
+struct HeaderIndex {
+    name: (usize, usize),
+    value: (usize, usize),
+}
+
+const EMPTY_HEADER_INDEX: HeaderIndex = HeaderIndex {
+    name: (0, 0),
+    value: (0, 0),
+};
+
+const EMPTY_HEADER_INDEX_ARRAY: [HeaderIndex; MAX_HEADERS] =
+    [EMPTY_HEADER_INDEX; MAX_HEADERS];
+
+impl HeaderIndex {
+    fn record(
+        bytes: &[u8],
+        headers: &[httparse::Header<'_>],
+        indices: &mut [HeaderIndex],
+    ) {
+        let bytes_ptr = bytes.as_ptr() as usize;
+        for (header, indices) in headers.iter().zip(indices.iter_mut()) {
+            let name_start = header.name.as_ptr() as usize - bytes_ptr;
+            let name_end = name_start + header.name.len();
+            indices.name = (name_start, name_end);
+            let value_start = header.value.as_ptr() as usize - bytes_ptr;
+            let value_end = value_start + header.value.len();
+            indices.value = (value_start, value_end);
+        }
+    }
+}
+
+// test cases taken from:
+// https://github.com/seanmonstar/httparse/blob/master/benches/parse.rs
+
+const REQ_SHORT: &'static [u8] = b"\
+GET / HTTP/1.0\r\n\
+Host: example.com\r\n\
+Cookie: session=60; user_id=1\r\n\r\n";
+
+const REQ: &'static [u8] = b"\
+GET /wp-content/uploads/2010/03/hello-kitty-darth-vader-pink.jpg HTTP/1.1\r\n\
+Host: www.kittyhell.com\r\n\
+User-Agent: Mozilla/5.0 (Macintosh; U; Intel Mac OS X 10.6; ja-JP-mac; rv:1.9.2.3) Gecko/20100401 Firefox/3.6.3 Pathtraq/0.9\r\n\
+Accept: text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8\r\n\
+Accept-Language: ja,en-us;q=0.7,en;q=0.3\r\n\
+Accept-Encoding: gzip,deflate\r\n\
+Accept-Charset: Shift_JIS,utf-8;q=0.7,*;q=0.7\r\n\
+Keep-Alive: 115\r\n\
+Connection: keep-alive\r\n\
+Cookie: wp_ozh_wsa_visits=2; wp_ozh_wsa_visit_lasttime=xxxxxxxxxx; __utma=xxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.x; __utmz=xxxxxxxxx.xxxxxxxxxx.x.x.utmccn=(referral)|utmcsr=reader.livedoor.com|utmcct=/reader/|utmcmd=referral|padding=under256\r\n\r\n";
+
+mod _new {
+    use super::*;
+
+    pub fn parse_headers(src: &mut BytesMut) -> usize {
+        let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
+        let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
+
+        let mut req = httparse::Request::new(&mut parsed);
+        match req.parse(src).unwrap() {
+            httparse::Status::Complete(_len) => {
+                HeaderIndex::record(src, req.headers, &mut headers);
+                req.headers.len()
+            }
+            _ => unreachable!(),
+        }
+    }
+}
+
+mod _original {
+    use super::*;
+
+    use std::mem::MaybeUninit;
+
+    pub fn parse_headers(src: &mut BytesMut) -> usize {
+        let mut headers: [HeaderIndex; MAX_HEADERS] =
+            unsafe { MaybeUninit::uninit().assume_init() };
+
+        let mut parsed: [httparse::Header<'_>; MAX_HEADERS] =
+            unsafe { MaybeUninit::uninit().assume_init() };
+
+        let mut req = httparse::Request::new(&mut parsed);
+        match req.parse(src).unwrap() {
+            httparse::Status::Complete(_len) => {
+                HeaderIndex::record(src, req.headers, &mut headers);
+                req.headers.len()
+            }
+            _ => unreachable!(),
+        }
+    }
+}

actix-http/benches/write-camel-case.rs

@@ -0,0 +1,89 @@
+use criterion::{black_box, criterion_group, criterion_main, BenchmarkId, Criterion};
+
+fn bench_write_camel_case(c: &mut Criterion) {
+    let mut group = c.benchmark_group("write_camel_case");
+
+    let names = ["connection", "Transfer-Encoding", "transfer-encoding"];
+
+    for &i in &names {
+        let bts = i.as_bytes();
+
+        group.bench_with_input(BenchmarkId::new("Original", i), bts, |b, bts| {
+            b.iter(|| {
+                let mut buf = black_box([0; 24]);
+                _original::write_camel_case(black_box(bts), &mut buf)
+            });
+        });
+
+        group.bench_with_input(BenchmarkId::new("New", i), bts, |b, bts| {
+            b.iter(|| {
+                let mut buf = black_box([0; 24]);
+                _new::write_camel_case(black_box(bts), &mut buf)
+            });
+        });
+    }
+
+    group.finish();
+}
+
+criterion_group!(benches, bench_write_camel_case);
+criterion_main!(benches);
+
+mod _new {
+    pub fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
+        // first copy entire (potentially wrong) slice to output
+        buffer[..value.len()].copy_from_slice(value);
+
+        let mut iter = value.iter();
+
+        // first character should be uppercase
+        if let Some(c @ b'a'..=b'z') = iter.next() {
+            buffer[0] = c & 0b1101_1111;
+        }
+
+        // track 1 ahead of the current position since that's the location being assigned to
+        let mut index = 2;
+
+        // remaining characters after hyphens should also be uppercase
+        while let Some(&c) = iter.next() {
+            if c == b'-' {
+                // advance iter by one and uppercase if needed
+                if let Some(c @ b'a'..=b'z') = iter.next() {
+                    buffer[index] = c & 0b1101_1111;
+                }
+            }
+
+            index += 1;
+        }
+    }
+}
+
+mod _original {
+    pub fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
+        let mut index = 0;
+        let key = value;
+        let mut key_iter = key.iter();
+
+        if let Some(c) = key_iter.next() {
+            if *c >= b'a' && *c <= b'z' {
+                buffer[index] = *c ^ b' ';
+                index += 1;
+            }
+        } else {
+            return;
+        }
+
+        while let Some(c) = key_iter.next() {
+            buffer[index] = *c;
+            index += 1;
+            if *c == b'-' {
+                if let Some(c) = key_iter.next() {
+                    if *c >= b'a' && *c <= b'z' {
+                        buffer[index] = *c ^ b' ';
+                        index += 1;
+                    }
+                }
+            }
+        }
+    }
+}

actix-http/examples/echo.rs

@@ -1,13 +1,14 @@
 use std::{env, io};
 
-use actix_http::{error::PayloadError, HttpService, Request, Response};
+use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures::{Future, Stream};
+use futures_util::StreamExt;
 use http::header::HeaderValue;
 use log::info;
 
-fn main() -> io::Result<()> {
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
     env::set_var("RUST_LOG", "echo=info");
     env_logger::init();
 
@@ -16,22 +17,21 @@ fn main() -> io::Result<()> {
             HttpService::build()
                 .client_timeout(1000)
                 .client_disconnect(1000)
-                .finish(|mut req: Request| {
-                    req.take_payload()
-                        .fold(BytesMut::new(), move |mut body, chunk| {
-                            body.extend_from_slice(&chunk);
-                            Ok::<_, PayloadError>(body)
-                        })
-                        .and_then(|bytes| {
-                            info!("request body: {:?}", bytes);
-                            let mut res = Response::Ok();
-                            res.header(
-                                "x-head",
-                                HeaderValue::from_static("dummy value!"),
-                            );
-                            Ok(res.body(bytes))
-                        })
+                .finish(|mut req: Request| async move {
+                    let mut body = BytesMut::new();
+                    while let Some(item) = req.payload().next().await {
+                        body.extend_from_slice(&item?);
+                    }
+
+                    info!("request body: {:?}", body);
+                    Ok::<_, Error>(
+                        Response::Ok()
+                            .header("x-head", HeaderValue::from_static("dummy value!"))
+                            .body(body),
+                    )
                 })
+                .tcp()
         })?
         .run()
+        .await
 }

actix-http/examples/echo2.rs

@@ -1,34 +1,33 @@
 use std::{env, io};
 
 use actix_http::http::HeaderValue;
-use actix_http::{error::PayloadError, Error, HttpService, Request, Response};
+use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures::{Future, Stream};
+use futures_util::StreamExt;
 use log::info;
 
-fn handle_request(mut req: Request) -> impl Future<Item = Response, Error = Error> {
-    req.take_payload()
-        .fold(BytesMut::new(), move |mut body, chunk| {
-            body.extend_from_slice(&chunk);
-            Ok::<_, PayloadError>(body)
-        })
-        .from_err()
-        .and_then(|bytes| {
-            info!("request body: {:?}", bytes);
-            let mut res = Response::Ok();
-            res.header("x-head", HeaderValue::from_static("dummy value!"));
-            Ok(res.body(bytes))
-        })
+async fn handle_request(mut req: Request) -> Result<Response, Error> {
+    let mut body = BytesMut::new();
+    while let Some(item) = req.payload().next().await {
+        body.extend_from_slice(&item?)
+    }
+
+    info!("request body: {:?}", body);
+    Ok(Response::Ok()
+        .header("x-head", HeaderValue::from_static("dummy value!"))
+        .body(body))
 }
 
-fn main() -> io::Result<()> {
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
     env::set_var("RUST_LOG", "echo=info");
     env_logger::init();
 
     Server::build()
         .bind("echo", "127.0.0.1:8080", || {
-            HttpService::build().finish(|_req: Request| handle_request(_req))
+            HttpService::build().finish(handle_request).tcp()
         })?
         .run()
+        .await
 }

actix-http/examples/hello-world.rs

@@ -2,11 +2,12 @@ use std::{env, io};
 
 use actix_http::{HttpService, Response};
 use actix_server::Server;
-use futures::future;
+use futures_util::future;
 use http::header::HeaderValue;
 use log::info;
 
-fn main() -> io::Result<()> {
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
     env::set_var("RUST_LOG", "hello_world=info");
     env_logger::init();
 
@@ -21,6 +22,8 @@ fn main() -> io::Result<()> {
                     res.header("x-head", HeaderValue::from_static("dummy value!"));
                     future::ok::<_, ()>(res.body("Hello world!"))
                 })
+                .tcp()
         })?
         .run()
+        .await
 }

actix-http/src/body.rs

@@ -1,8 +1,10 @@
-use std::marker::PhantomData;
+use std::pin::Pin;
+use std::task::{Context, Poll};
 use std::{fmt, mem};
 
 use bytes::{Bytes, BytesMut};
-use futures::{Async, Poll, Stream};
+use futures_core::{ready, Stream};
+use pin_project::pin_project;
 
 use crate::error::Error;
 
@@ -11,20 +13,13 @@ use crate::error::Error;
 pub enum BodySize {
     None,
     Empty,
-    Sized(usize),
-    Sized64(u64),
+    Sized(u64),
     Stream,
 }
 
 impl BodySize {
     pub fn is_eof(&self) -> bool {
-        match self {
-            BodySize::None
-            | BodySize::Empty
-            | BodySize::Sized(0)
-            | BodySize::Sized64(0) => true,
-            _ => false,
-        }
+        matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
     }
 }
 
@@ -32,31 +27,45 @@ impl BodySize {
 pub trait MessageBody {
     fn size(&self) -> BodySize;
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error>;
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>>;
+
+    downcast_get_type_id!();
 }
 
+downcast!(MessageBody);
+
 impl MessageBody for () {
     fn size(&self) -> BodySize {
         BodySize::Empty
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        Ok(Async::Ready(None))
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        Poll::Ready(None)
     }
 }
 
-impl<T: MessageBody> MessageBody for Box<T> {
+impl<T: MessageBody + Unpin> MessageBody for Box<T> {
     fn size(&self) -> BodySize {
         self.as_ref().size()
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        self.as_mut().poll_next()
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        Pin::new(self.get_mut().as_mut()).poll_next(cx)
     }
 }
 
+#[pin_project(project = ResponseBodyProj)]
 pub enum ResponseBody<B> {
-    Body(B),
+    Body(#[pin] B),
     Other(Body),
 }
 
@@ -93,20 +102,28 @@ impl<B: MessageBody> MessageBody for ResponseBody<B> {
         }
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        match self {
-            ResponseBody::Body(ref mut body) => body.poll_next(),
-            ResponseBody::Other(ref mut body) => body.poll_next(),
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        match self.project() {
+            ResponseBodyProj::Body(body) => body.poll_next(cx),
+            ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
         }
     }
 }
 
 impl<B: MessageBody> Stream for ResponseBody<B> {
-    type Item = Bytes;
-    type Error = Error;
+    type Item = Result<Bytes, Error>;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
-        self.poll_next()
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        match self.project() {
+            ResponseBodyProj::Body(body) => body.poll_next(cx),
+            ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
+        }
     }
 }
 
@@ -119,17 +136,17 @@ pub enum Body {
     /// Specific response body.
     Bytes(Bytes),
     /// Generic message body.
-    Message(Box<dyn MessageBody>),
+    Message(Box<dyn MessageBody + Unpin>),
 }
 
 impl Body {
     /// Create body from slice (copy)
     pub fn from_slice(s: &[u8]) -> Body {
-        Body::Bytes(Bytes::from(s))
+        Body::Bytes(Bytes::copy_from_slice(s))
     }
 
     /// Create body from generic message body.
-    pub fn from_message<B: MessageBody + 'static>(body: B) -> Body {
+    pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
         Body::Message(Box::new(body))
     }
 }
@@ -139,24 +156,27 @@ impl MessageBody for Body {
         match self {
             Body::None => BodySize::None,
             Body::Empty => BodySize::Empty,
-            Body::Bytes(ref bin) => BodySize::Sized(bin.len()),
+            Body::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
             Body::Message(ref body) => body.size(),
         }
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        match self {
-            Body::None => Ok(Async::Ready(None)),
-            Body::Empty => Ok(Async::Ready(None)),
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        match self.get_mut() {
+            Body::None => Poll::Ready(None),
+            Body::Empty => Poll::Ready(None),
             Body::Bytes(ref mut bin) => {
                 let len = bin.len();
                 if len == 0 {
-                    Ok(Async::Ready(None))
+                    Poll::Ready(None)
                 } else {
-                    Ok(Async::Ready(Some(mem::replace(bin, Bytes::new()))))
+                    Poll::Ready(Some(Ok(mem::take(bin))))
                 }
             }
-            Body::Message(ref mut body) => body.poll_next(),
+            Body::Message(body) => Pin::new(&mut **body).poll_next(cx),
         }
     }
 }
@@ -164,14 +184,8 @@ impl MessageBody for Body {
 impl PartialEq for Body {
     fn eq(&self, other: &Body) -> bool {
         match *self {
-            Body::None => match *other {
-                Body::None => true,
-                _ => false,
-            },
-            Body::Empty => match *other {
-                Body::Empty => true,
-                _ => false,
-            },
+            Body::None => matches!(*other, Body::None),
+            Body::Empty => matches!(*other, Body::Empty),
             Body::Bytes(ref b) => match *other {
                 Body::Bytes(ref b2) => b == b2,
                 _ => false,
@@ -182,7 +196,7 @@ impl PartialEq for Body {
 }
 
 impl fmt::Debug for Body {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match *self {
             Body::None => write!(f, "Body::None"),
             Body::Empty => write!(f, "Body::Empty"),
@@ -218,7 +232,7 @@ impl From<String> for Body {
 
 impl<'a> From<&'a String> for Body {
     fn from(s: &'a String) -> Body {
-        Body::Bytes(Bytes::from(AsRef::<[u8]>::as_ref(&s)))
+        Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
     }
 }
 
@@ -242,113 +256,107 @@ impl From<serde_json::Value> for Body {
 
 impl<S> From<SizedStream<S>> for Body
 where
-    S: Stream<Item = Bytes, Error = Error> + 'static,
+    S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
 {
     fn from(s: SizedStream<S>) -> Body {
         Body::from_message(s)
     }
 }
 
-impl<S, E> From<BodyStream<S, E>> for Body
+impl<S, E> From<BodyStream<S>> for Body
 where
-    S: Stream<Item = Bytes, Error = E> + 'static,
+    S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
     E: Into<Error> + 'static,
 {
-    fn from(s: BodyStream<S, E>) -> Body {
+    fn from(s: BodyStream<S>) -> Body {
         Body::from_message(s)
     }
 }
 
 impl MessageBody for Bytes {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(mem::replace(self, Bytes::new()))))
+            Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
         }
     }
 }
 
 impl MessageBody for BytesMut {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(
-                mem::replace(self, BytesMut::new()).freeze(),
-            )))
+            Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
         }
     }
 }
 
 impl MessageBody for &'static str {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(Bytes::from_static(
-                mem::replace(self, "").as_ref(),
+            Poll::Ready(Some(Ok(Bytes::from_static(
+                mem::take(self.get_mut()).as_ref(),
             ))))
         }
     }
 }
 
-impl MessageBody for &'static [u8] {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
-    }
-
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        if self.is_empty() {
-            Ok(Async::Ready(None))
-        } else {
-            Ok(Async::Ready(Some(Bytes::from_static(mem::replace(
-                self, b"",
-            )))))
-        }
-    }
-}
-
 impl MessageBody for Vec<u8> {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(Bytes::from(mem::replace(
-                self,
-                Vec::new(),
-            )))))
+            Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
         }
     }
 }
 
 impl MessageBody for String {
     fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
+        BodySize::Sized(self.len() as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(Bytes::from(
-                mem::replace(self, String::new()).into_bytes(),
+            Poll::Ready(Some(Ok(Bytes::from(
+                mem::take(self.get_mut()).into_bytes(),
             ))))
         }
     }
@@ -356,48 +364,58 @@ impl MessageBody for String {
 
 /// Type represent streaming body.
 /// Response does not contain `content-length` header and appropriate transfer encoding is used.
-pub struct BodyStream<S, E> {
+pub struct BodyStream<S: Unpin> {
     stream: S,
-    _t: PhantomData<E>,
 }
 
-impl<S, E> BodyStream<S, E>
+impl<S, E> BodyStream<S>
 where
-    S: Stream<Item = Bytes, Error = E>,
+    S: Stream<Item = Result<Bytes, E>> + Unpin,
     E: Into<Error>,
 {
     pub fn new(stream: S) -> Self {
-        BodyStream {
-            stream,
-            _t: PhantomData,
-        }
+        BodyStream { stream }
     }
 }
 
-impl<S, E> MessageBody for BodyStream<S, E>
+impl<S, E> MessageBody for BodyStream<S>
 where
-    S: Stream<Item = Bytes, Error = E>,
+    S: Stream<Item = Result<Bytes, E>> + Unpin,
     E: Into<Error>,
 {
     fn size(&self) -> BodySize {
         BodySize::Stream
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        self.stream.poll().map_err(std::convert::Into::into)
+    /// Attempts to pull out the next value of the underlying [`Stream`].
+    ///
+    /// Empty values are skipped to prevent [`BodyStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        loop {
+            let stream = &mut self.as_mut().stream;
+            return Poll::Ready(match ready!(Pin::new(stream).poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                opt => opt.map(|res| res.map_err(Into::into)),
+            });
+        }
     }
 }
 
 /// Type represent streaming body. This body implementation should be used
 /// if total size of stream is known. Data get sent as is without using transfer encoding.
-pub struct SizedStream<S> {
+pub struct SizedStream<S: Unpin> {
     size: u64,
     stream: S,
 }
 
 impl<S> SizedStream<S>
 where
-    S: Stream<Item = Bytes, Error = Error>,
+    S: Stream<Item = Result<Bytes, Error>> + Unpin,
 {
     pub fn new(size: u64, stream: S) -> Self {
         SizedStream { size, stream }
@@ -406,20 +424,37 @@ where
 
 impl<S> MessageBody for SizedStream<S>
 where
-    S: Stream<Item = Bytes, Error = Error>,
+    S: Stream<Item = Result<Bytes, Error>> + Unpin,
 {
     fn size(&self) -> BodySize {
-        BodySize::Sized64(self.size)
+        BodySize::Sized(self.size as u64)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        self.stream.poll()
+    /// Attempts to pull out the next value of the underlying [`Stream`].
+    ///
+    /// Empty values are skipped to prevent [`SizedStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        loop {
+            let stream = &mut self.as_mut().stream;
+            return Poll::Ready(match ready!(Pin::new(stream).poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                val => val,
+            });
+        }
     }
 }
 
 #[cfg(test)]
 mod tests {
     use super::*;
+    use futures_util::future::poll_fn;
+    use futures_util::pin_mut;
+    use futures_util::stream;
 
     impl Body {
         pub(crate) fn get_ref(&self) -> &[u8] {
@@ -439,21 +474,24 @@ mod tests {
         }
     }
 
-    #[test]
-    fn test_static_str() {
+    #[actix_rt::test]
+    async fn test_static_str() {
         assert_eq!(Body::from("").size(), BodySize::Sized(0));
         assert_eq!(Body::from("test").size(), BodySize::Sized(4));
         assert_eq!(Body::from("test").get_ref(), b"test");
 
         assert_eq!("test".size(), BodySize::Sized(4));
         assert_eq!(
-            "test".poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_static_bytes() {
+    #[actix_rt::test]
+    async fn test_static_bytes() {
         assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
         assert_eq!(
@@ -461,86 +499,95 @@ mod tests {
             BodySize::Sized(4)
         );
         assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
+        let sb = Bytes::from(&b"test"[..]);
+        pin_mut!(sb);
 
-        assert_eq!((&b"test"[..]).size(), BodySize::Sized(4));
+        assert_eq!(sb.size(), BodySize::Sized(4));
         assert_eq!(
-            (&b"test"[..]).poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_vec() {
+    #[actix_rt::test]
+    async fn test_vec() {
         assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
         assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
+        let test_vec = Vec::from("test");
+        pin_mut!(test_vec);
 
-        assert_eq!(Vec::from("test").size(), BodySize::Sized(4));
+        assert_eq!(test_vec.size(), BodySize::Sized(4));
         assert_eq!(
-            Vec::from("test").poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| test_vec.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_bytes() {
-        let mut b = Bytes::from("test");
+    #[actix_rt::test]
+    async fn test_bytes() {
+        let b = Bytes::from("test");
         assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b.clone()).get_ref(), b"test");
+        pin_mut!(b);
 
         assert_eq!(b.size(), BodySize::Sized(4));
         assert_eq!(
-            b.poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_bytes_mut() {
-        let mut b = BytesMut::from("test");
+    #[actix_rt::test]
+    async fn test_bytes_mut() {
+        let b = BytesMut::from("test");
         assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b.clone()).get_ref(), b"test");
+        pin_mut!(b);
 
         assert_eq!(b.size(), BodySize::Sized(4));
         assert_eq!(
-            b.poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_string() {
-        let mut b = "test".to_owned();
+    #[actix_rt::test]
+    async fn test_string() {
+        let b = "test".to_owned();
         assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b.clone()).get_ref(), b"test");
         assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
         assert_eq!(Body::from(&b).get_ref(), b"test");
+        pin_mut!(b);
 
         assert_eq!(b.size(), BodySize::Sized(4));
         assert_eq!(
-            b.poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_unit() {
+    #[actix_rt::test]
+    async fn test_unit() {
         assert_eq!(().size(), BodySize::Empty);
-        assert_eq!(().poll_next().unwrap(), Async::Ready(None));
+        assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
+            .await
+            .is_none());
     }
 
-    #[test]
-    fn test_box() {
-        let mut val = Box::new(());
+    #[actix_rt::test]
+    async fn test_box() {
+        let val = Box::new(());
+        pin_mut!(val);
         assert_eq!(val.size(), BodySize::Empty);
-        assert_eq!(val.poll_next().unwrap(), Async::Ready(None));
+        assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
     }
 
-    #[test]
-    fn test_body_eq() {
-        assert!(Body::None == Body::None);
-        assert!(Body::None != Body::Empty);
-        assert!(Body::Empty == Body::Empty);
-        assert!(Body::Empty != Body::None);
+    #[actix_rt::test]
+    async fn test_body_eq() {
         assert!(
             Body::Bytes(Bytes::from_static(b"1"))
                 == Body::Bytes(Bytes::from_static(b"1"))
@@ -548,15 +595,15 @@ mod tests {
         assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
     }
 
-    #[test]
-    fn test_body_debug() {
+    #[actix_rt::test]
+    async fn test_body_debug() {
         assert!(format!("{:?}", Body::None).contains("Body::None"));
         assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
-        assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains("1"));
+        assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
     }
 
-    #[test]
-    fn test_serde_json() {
+    #[actix_rt::test]
+    async fn test_serde_json() {
         use serde_json::json;
         assert_eq!(
             Body::from(serde_json::Value::String("test".into())).size(),
@@ -567,4 +614,97 @@ mod tests {
             BodySize::Sized(25)
         );
     }
+
+    mod body_stream {
+        use super::*;
+        //use futures::task::noop_waker;
+        //use futures::stream::once;
+
+        #[actix_rt::test]
+        async fn skips_empty_chunks() {
+            let body = BodyStream::new(stream::iter(
+                ["1", "", "2"]
+                    .iter()
+                    .map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
+            ));
+            pin_mut!(body);
+
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("1")),
+            );
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("2")),
+            );
+        }
+
+        /* Now it does not compile as it should
+        #[actix_rt::test]
+        async fn move_pinned_pointer() {
+            let (sender, receiver) = futures::channel::oneshot::channel();
+            let mut body_stream = Ok(BodyStream::new(once(async {
+                let x = Box::new(0i32);
+                let y = &x;
+                receiver.await.unwrap();
+                let _z = **y;
+                Ok::<_, ()>(Bytes::new())
+            })));
+
+            let waker = noop_waker();
+            let mut context = Context::from_waker(&waker);
+            pin_mut!(body_stream);
+
+            let _ = body_stream.as_mut().unwrap().poll_next(&mut context);
+            sender.send(()).unwrap();
+            let _ = std::mem::replace(&mut body_stream, Err([0; 32])).unwrap().poll_next(&mut context);
+        }*/
+    }
+
+    mod sized_stream {
+        use super::*;
+
+        #[actix_rt::test]
+        async fn skips_empty_chunks() {
+            let body = SizedStream::new(
+                2,
+                stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
+            );
+            pin_mut!(body);
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("1")),
+            );
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("2")),
+            );
+        }
+    }
+
+    #[actix_rt::test]
+    async fn test_body_casting() {
+        let mut body = String::from("hello cast");
+        let resp_body: &mut dyn MessageBody = &mut body;
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast");
+        let body = &mut resp_body.downcast_mut::<String>().unwrap();
+        body.push('!');
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast!");
+        let not_body = resp_body.downcast_ref::<()>();
+        assert!(not_body.is_none());
+    }
 }

actix-http/src/builder.rs

@@ -1,40 +1,42 @@
-use std::fmt;
 use std::marker::PhantomData;
 use std::rc::Rc;
+use std::{fmt, net};
 
 use actix_codec::Framed;
-use actix_server_config::ServerConfig as SrvConfig;
-use actix_service::{IntoNewService, NewService, Service};
+use actix_service::{IntoServiceFactory, Service, ServiceFactory};
 
 use crate::body::MessageBody;
 use crate::config::{KeepAlive, ServiceConfig};
 use crate::error::Error;
 use crate::h1::{Codec, ExpectHandler, H1Service, UpgradeHandler};
 use crate::h2::H2Service;
-use crate::helpers::{Data, DataFactory};
 use crate::request::Request;
 use crate::response::Response;
 use crate::service::HttpService;
+use crate::{ConnectCallback, Extensions};
 
-/// A http service builder
+/// A HTTP service builder
 ///
-/// This type can be used to construct an instance of `http service` through a
+/// This type can be used to construct an instance of [`HttpService`] through a
 /// builder-like pattern.
-pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
+pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler> {
     keep_alive: KeepAlive,
     client_timeout: u64,
     client_disconnect: u64,
+    secure: bool,
+    local_addr: Option<net::SocketAddr>,
     expect: X,
     upgrade: Option<U>,
-    on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
-    _t: PhantomData<(T, S)>,
+    on_connect_ext: Option<Rc<ConnectCallback<T>>>,
+    _phantom: PhantomData<S>,
 }
 
-impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler<T>>
+impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
+    S: ServiceFactory<Request, Config = ()>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
+    <S::Service as Service<Request>>::Future: 'static,
 {
     /// Create instance of `ServiceConfigBuilder`
     pub fn new() -> Self {
@@ -42,29 +44,30 @@ where
             keep_alive: KeepAlive::Timeout(5),
             client_timeout: 5000,
             client_disconnect: 0,
+            secure: false,
+            local_addr: None,
             expect: ExpectHandler,
             upgrade: None,
-            on_connect: None,
-            _t: PhantomData,
+            on_connect_ext: None,
+            _phantom: PhantomData,
         }
     }
 }
 
 impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
+    S: ServiceFactory<Request, Config = ()>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
-    X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+    <S::Service as Service<Request>>::Future: 'static,
+    X: ServiceFactory<Request, Config = (), Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<
-        Config = SrvConfig,
-        Request = (Request, Framed<T, Codec>),
-        Response = (),
-    >,
+    <X::Service as Service<Request>>::Future: 'static,
+    U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
+    <U::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
 {
     /// Set server keep-alive setting.
     ///
@@ -74,6 +77,18 @@ where
         self
     }
 
+    /// Set connection secure state
+    pub fn secure(mut self) -> Self {
+        self.secure = true;
+        self
+    }
+
+    /// Set the local address that this service is bound to.
+    pub fn local_addr(mut self, addr: net::SocketAddr) -> Self {
+        self.local_addr = Some(addr);
+        self
+    }
+
     /// Set server client timeout in milliseconds for first request.
     ///
     /// Defines a timeout for reading client request header. If a client does not transmit
@@ -108,19 +123,22 @@ where
     /// request will be forwarded to main service.
     pub fn expect<F, X1>(self, expect: F) -> HttpServiceBuilder<T, S, X1, U>
     where
-        F: IntoNewService<X1>,
-        X1: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+        F: IntoServiceFactory<X1, Request>,
+        X1: ServiceFactory<Request, Config = (), Response = Request>,
         X1::Error: Into<Error>,
         X1::InitError: fmt::Debug,
+        <X1::Service as Service<Request>>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
             client_timeout: self.client_timeout,
             client_disconnect: self.client_disconnect,
-            expect: expect.into_new_service(),
+            secure: self.secure,
+            local_addr: self.local_addr,
+            expect: expect.into_factory(),
             upgrade: self.upgrade,
-            on_connect: self.on_connect,
-            _t: PhantomData,
+            on_connect_ext: self.on_connect_ext,
+            _phantom: PhantomData,
         }
     }
 
@@ -130,44 +148,43 @@ where
     /// and this service get called with original request and framed object.
     pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
     where
-        F: IntoNewService<U1>,
-        U1: NewService<
-            Config = SrvConfig,
-            Request = (Request, Framed<T, Codec>),
-            Response = (),
-        >,
+        F: IntoServiceFactory<U1, (Request, Framed<T, Codec>)>,
+        U1: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
+        <U1::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
             client_timeout: self.client_timeout,
             client_disconnect: self.client_disconnect,
+            secure: self.secure,
+            local_addr: self.local_addr,
             expect: self.expect,
-            upgrade: Some(upgrade.into_new_service()),
-            on_connect: self.on_connect,
-            _t: PhantomData,
+            upgrade: Some(upgrade.into_factory()),
+            on_connect_ext: self.on_connect_ext,
+            _phantom: PhantomData,
         }
     }
 
-    /// Set on-connect callback.
+    /// Sets the callback to be run on connection establishment.
     ///
-    /// It get called once per connection and result of the call
-    /// get stored to the request's extensions.
-    pub fn on_connect<F, I>(mut self, f: F) -> Self
+    /// Has mutable access to a data container that will be merged into request extensions.
+    /// This enables transport layer data (like client certificates) to be accessed in middleware
+    /// and handlers.
+    pub fn on_connect_ext<F>(mut self, f: F) -> Self
     where
-        F: Fn(&T) -> I + 'static,
-        I: Clone + 'static,
+        F: Fn(&T, &mut Extensions) + 'static,
     {
-        self.on_connect = Some(Rc::new(move |io| Box::new(Data(f(io)))));
+        self.on_connect_ext = Some(Rc::new(f));
         self
     }
 
-    /// Finish service configuration and create *http service* for HTTP/1 protocol.
-    pub fn h1<F, P, B>(self, service: F) -> H1Service<T, P, S, B, X, U>
+    /// Finish service configuration and create a HTTP Service for HTTP/1 protocol.
+    pub fn h1<F, B>(self, service: F) -> H1Service<T, S, B, X, U>
     where
-        B: MessageBody + 'static,
-        F: IntoNewService<S>,
+        B: MessageBody,
+        F: IntoServiceFactory<S, Request>,
         S::Error: Into<Error>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
@@ -176,50 +193,59 @@ where
             self.keep_alive,
             self.client_timeout,
             self.client_disconnect,
+            self.secure,
+            self.local_addr,
         );
-        H1Service::with_config(cfg, service.into_new_service())
+
+        H1Service::with_config(cfg, service.into_factory())
             .expect(self.expect)
             .upgrade(self.upgrade)
-            .on_connect(self.on_connect)
+            .on_connect_ext(self.on_connect_ext)
     }
 
-    /// Finish service configuration and create *http service* for HTTP/2 protocol.
-    pub fn h2<F, P, B>(self, service: F) -> H2Service<T, P, S, B>
+    /// Finish service configuration and create a HTTP service for HTTP/2 protocol.
+    pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
     where
         B: MessageBody + 'static,
-        F: IntoNewService<S>,
-        S::Error: Into<Error>,
+        F: IntoServiceFactory<S, Request>,
+        S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
-        S::Response: Into<Response<B>>,
-        <S::Service as Service>::Future: 'static,
+        S::Response: Into<Response<B>> + 'static,
+        <S::Service as Service<Request>>::Future: 'static,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,
             self.client_timeout,
             self.client_disconnect,
+            self.secure,
+            self.local_addr,
         );
-        H2Service::with_config(cfg, service.into_new_service())
-            .on_connect(self.on_connect)
+
+        H2Service::with_config(cfg, service.into_factory())
+            .on_connect_ext(self.on_connect_ext)
     }
 
     /// Finish service configuration and create `HttpService` instance.
-    pub fn finish<F, P, B>(self, service: F) -> HttpService<T, P, S, B, X, U>
+    pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
     where
         B: MessageBody + 'static,
-        F: IntoNewService<S>,
-        S::Error: Into<Error>,
+        F: IntoServiceFactory<S, Request>,
+        S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
-        S::Response: Into<Response<B>>,
-        <S::Service as Service>::Future: 'static,
+        S::Response: Into<Response<B>> + 'static,
+        <S::Service as Service<Request>>::Future: 'static,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,
             self.client_timeout,
             self.client_disconnect,
+            self.secure,
+            self.local_addr,
         );
-        HttpService::with_config(cfg, service.into_new_service())
+
+        HttpService::with_config(cfg, service.into_factory())
             .expect(self.expect)
             .upgrade(self.upgrade)
-            .on_connect(self.on_connect)
+            .on_connect_ext(self.on_connect_ext)
     }
 }

actix-http/src/client/config.rs

@@ -0,0 +1,39 @@
+use std::time::Duration;
+
+// These values are taken from hyper/src/proto/h2/client.rs
+const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2mb
+const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1mb
+
+/// Connector configuration
+#[derive(Clone)]
+pub(crate) struct ConnectorConfig {
+    pub(crate) timeout: Duration,
+    pub(crate) conn_lifetime: Duration,
+    pub(crate) conn_keep_alive: Duration,
+    pub(crate) disconnect_timeout: Option<Duration>,
+    pub(crate) limit: usize,
+    pub(crate) conn_window_size: u32,
+    pub(crate) stream_window_size: u32,
+}
+
+impl Default for ConnectorConfig {
+    fn default() -> Self {
+        Self {
+            timeout: Duration::from_secs(1),
+            conn_lifetime: Duration::from_secs(75),
+            conn_keep_alive: Duration::from_secs(15),
+            disconnect_timeout: Some(Duration::from_millis(3000)),
+            limit: 100,
+            conn_window_size: DEFAULT_H2_CONN_WINDOW,
+            stream_window_size: DEFAULT_H2_STREAM_WINDOW,
+        }
+    }
+}
+
+impl ConnectorConfig {
+    pub(crate) fn no_disconnect_timeout(&self) -> Self {
+        let mut res = self.clone();
+        res.disconnect_timeout = None;
+        res
+    }
+}

actix-http/src/client/connection.rs

@@ -1,10 +1,13 @@
+use std::future::Future;
+use std::pin::Pin;
+use std::task::{Context, Poll};
 use std::{fmt, io, time};
 
-use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use bytes::{Buf, Bytes};
-use futures::future::{err, Either, Future, FutureResult};
-use futures::Poll;
+use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
+use bytes::Bytes;
+use futures_util::future::{err, Either, FutureExt, LocalBoxFuture, Ready};
 use h2::client::SendRequest;
+use pin_project::pin_project;
 
 use crate::body::MessageBody;
 use crate::h1::ClientCodec;
@@ -21,8 +24,8 @@ pub(crate) enum ConnectionType<Io> {
 }
 
 pub trait Connection {
-    type Io: AsyncRead + AsyncWrite;
-    type Future: Future<Item = (ResponseHead, Payload), Error = SendRequestError>;
+    type Io: AsyncRead + AsyncWrite + Unpin;
+    type Future: Future<Output = Result<(ResponseHead, Payload), SendRequestError>>;
 
     fn protocol(&self) -> Protocol;
 
@@ -34,8 +37,7 @@ pub trait Connection {
     ) -> Self::Future;
 
     type TunnelFuture: Future<
-        Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
-        Error = SendRequestError,
+        Output = Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
     >;
 
     /// Send request, returns Response and Framed
@@ -44,10 +46,10 @@ pub trait Connection {
 
 pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
     /// Close connection
-    fn close(&mut self);
+    fn close(self: Pin<&mut Self>);
 
     /// Release connection to the connection pool
-    fn release(&mut self);
+    fn release(self: Pin<&mut Self>);
 }
 
 #[doc(hidden)]
@@ -62,7 +64,7 @@ impl<T> fmt::Debug for IoConnection<T>
 where
     T: fmt::Debug,
 {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match self.io {
             Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
             Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
@@ -71,7 +73,7 @@ where
     }
 }
 
-impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
+impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
     pub(crate) fn new(
         io: ConnectionType<T>,
         created: time::Instant,
@@ -91,11 +93,11 @@ impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
 
 impl<T> Connection for IoConnection<T>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     type Io = T;
     type Future =
-        Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
+        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
 
     fn protocol(&self) -> Protocol {
         match self.io {
@@ -111,38 +113,30 @@ where
         body: B,
     ) -> Self::Future {
         match self.io.take().unwrap() {
-            ConnectionType::H1(io) => Box::new(h1proto::send_request(
-                io,
-                head.into(),
-                body,
-                self.created,
-                self.pool,
-            )),
-            ConnectionType::H2(io) => Box::new(h2proto::send_request(
-                io,
-                head.into(),
-                body,
-                self.created,
-                self.pool,
-            )),
+            ConnectionType::H1(io) => {
+                h1proto::send_request(io, head.into(), body, self.created, self.pool)
+                    .boxed_local()
+            }
+            ConnectionType::H2(io) => {
+                h2proto::send_request(io, head.into(), body, self.created, self.pool)
+                    .boxed_local()
+            }
         }
     }
 
     type TunnelFuture = Either<
-        Box<
-            dyn Future<
-                Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
-                Error = SendRequestError,
-            >,
+        LocalBoxFuture<
+            'static,
+            Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
         >,
-        FutureResult<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
+        Ready<Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>>,
     >;
 
     /// Send request, returns Response and Framed
     fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
         match self.io.take().unwrap() {
             ConnectionType::H1(io) => {
-                Either::A(Box::new(h1proto::open_tunnel(io, head.into())))
+                Either::Left(h1proto::open_tunnel(io, head.into()).boxed_local())
             }
             ConnectionType::H2(io) => {
                 if let Some(mut pool) = self.pool.take() {
@@ -152,7 +146,7 @@ where
                         None,
                     ));
                 }
-                Either::B(err(SendRequestError::TunnelNotSupported))
+                Either::Right(err(SendRequestError::TunnelNotSupported))
             }
         }
     }
@@ -166,12 +160,12 @@ pub(crate) enum EitherConnection<A, B> {
 
 impl<A, B> Connection for EitherConnection<A, B>
 where
-    A: AsyncRead + AsyncWrite + 'static,
-    B: AsyncRead + AsyncWrite + 'static,
+    A: AsyncRead + AsyncWrite + Unpin + 'static,
+    B: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     type Io = EitherIo<A, B>;
     type Future =
-        Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
+        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
 
     fn protocol(&self) -> Protocol {
         match self {
@@ -191,44 +185,34 @@ where
         }
     }
 
-    type TunnelFuture = Box<
-        dyn Future<
-            Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
-            Error = SendRequestError,
-        >,
+    type TunnelFuture = LocalBoxFuture<
+        'static,
+        Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
     >;
 
     /// Send request, returns Response and Framed
     fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
         match self {
-            EitherConnection::A(con) => Box::new(
-                con.open_tunnel(head)
-                    .map(|(head, framed)| (head, framed.map_io(EitherIo::A))),
-            ),
-            EitherConnection::B(con) => Box::new(
-                con.open_tunnel(head)
-                    .map(|(head, framed)| (head, framed.map_io(EitherIo::B))),
-            ),
+            EitherConnection::A(con) => con
+                .open_tunnel(head)
+                .map(|res| {
+                    res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::A)))
+                })
+                .boxed_local(),
+            EitherConnection::B(con) => con
+                .open_tunnel(head)
+                .map(|res| {
+                    res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::B)))
+                })
+                .boxed_local(),
         }
     }
 }
 
+#[pin_project(project = EitherIoProj)]
 pub enum EitherIo<A, B> {
-    A(A),
-    B(B),
-}
-
-impl<A, B> io::Read for EitherIo<A, B>
-where
-    A: io::Read,
-    B: io::Read,
-{
-    fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
-        match self {
-            EitherIo::A(ref mut val) => val.read(buf),
-            EitherIo::B(ref mut val) => val.read(buf),
-        }
-    }
+    A(#[pin] A),
+    B(#[pin] B),
 }
 
 impl<A, B> AsyncRead for EitherIo<A, B>
@@ -236,30 +220,14 @@ where
     A: AsyncRead,
     B: AsyncRead,
 {
-    unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool {
-        match self {
-            EitherIo::A(ref val) => val.prepare_uninitialized_buffer(buf),
-            EitherIo::B(ref val) => val.prepare_uninitialized_buffer(buf),
-        }
-    }
-}
-
-impl<A, B> io::Write for EitherIo<A, B>
-where
-    A: io::Write,
-    B: io::Write,
-{
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        match self {
-            EitherIo::A(ref mut val) => val.write(buf),
-            EitherIo::B(ref mut val) => val.write(buf),
-        }
-    }
-
-    fn flush(&mut self) -> io::Result<()> {
-        match self {
-            EitherIo::A(ref mut val) => val.flush(),
-            EitherIo::B(ref mut val) => val.flush(),
+    fn poll_read(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &mut ReadBuf<'_>,
+    ) -> Poll<io::Result<()>> {
+        match self.project() {
+            EitherIoProj::A(val) => val.poll_read(cx, buf),
+            EitherIoProj::B(val) => val.poll_read(cx, buf),
         }
     }
 }
@@ -269,20 +237,31 @@ where
     A: AsyncWrite,
     B: AsyncWrite,
 {
-    fn shutdown(&mut self) -> Poll<(), io::Error> {
-        match self {
-            EitherIo::A(ref mut val) => val.shutdown(),
-            EitherIo::B(ref mut val) => val.shutdown(),
+    fn poll_write(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &[u8],
+    ) -> Poll<io::Result<usize>> {
+        match self.project() {
+            EitherIoProj::A(val) => val.poll_write(cx, buf),
+            EitherIoProj::B(val) => val.poll_write(cx, buf),
         }
     }
 
-    fn write_buf<U: Buf>(&mut self, buf: &mut U) -> Poll<usize, io::Error>
-    where
-        Self: Sized,
-    {
-        match self {
-            EitherIo::A(ref mut val) => val.write_buf(buf),
-            EitherIo::B(ref mut val) => val.write_buf(buf),
+    fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
+        match self.project() {
+            EitherIoProj::A(val) => val.poll_flush(cx),
+            EitherIoProj::B(val) => val.poll_flush(cx),
+        }
+    }
+
+    fn poll_shutdown(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<io::Result<()>> {
+        match self.project() {
+            EitherIoProj::A(val) => val.poll_shutdown(cx),
+            EitherIoProj::B(val) => val.poll_shutdown(cx),
         }
     }
 }

actix-http/src/client/connector.rs

@@ -3,35 +3,36 @@ use std::marker::PhantomData;
 use std::time::Duration;
 
 use actix_codec::{AsyncRead, AsyncWrite};
-use actix_connect::{
+use actix_rt::net::TcpStream;
+use actix_service::{apply_fn, Service, ServiceExt};
+use actix_tls::connect::{
     default_connector, Connect as TcpConnect, Connection as TcpConnection,
 };
-use actix_service::{apply_fn, Service, ServiceExt};
 use actix_utils::timeout::{TimeoutError, TimeoutService};
 use http::Uri;
-use tokio_tcp::TcpStream;
 
+use super::config::ConnectorConfig;
 use super::connection::Connection;
 use super::error::ConnectError;
 use super::pool::{ConnectionPool, Protocol};
 use super::Connect;
 
-#[cfg(feature = "ssl")]
-use openssl::ssl::SslConnector as OpensslConnector;
+#[cfg(feature = "openssl")]
+use actix_tls::connect::ssl::openssl::SslConnector as OpensslConnector;
 
-#[cfg(feature = "rust-tls")]
-use rustls::ClientConfig;
-#[cfg(feature = "rust-tls")]
+#[cfg(feature = "rustls")]
+use actix_tls::connect::ssl::rustls::ClientConfig;
+#[cfg(feature = "rustls")]
 use std::sync::Arc;
 
-#[cfg(any(feature = "ssl", feature = "rust-tls"))]
+#[cfg(any(feature = "openssl", feature = "rustls"))]
 enum SslConnector {
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     Openssl(OpensslConnector),
-    #[cfg(feature = "rust-tls")]
+    #[cfg(feature = "rustls")]
     Rustls(Arc<ClientConfig>),
 }
-#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+#[cfg(not(any(feature = "openssl", feature = "rustls")))]
 type SslConnector = ();
 
 /// Manages http client network connectivity
@@ -48,127 +49,156 @@ type SslConnector = ();
 /// ```
 pub struct Connector<T, U> {
     connector: T,
-    timeout: Duration,
-    conn_lifetime: Duration,
-    conn_keep_alive: Duration,
-    disconnect_timeout: Duration,
-    limit: usize,
+    config: ConnectorConfig,
     #[allow(dead_code)]
     ssl: SslConnector,
-    _t: PhantomData<U>,
+    _phantom: PhantomData<U>,
 }
 
-trait Io: AsyncRead + AsyncWrite {}
-impl<T: AsyncRead + AsyncWrite> Io for T {}
+trait Io: AsyncRead + AsyncWrite + Unpin {}
+impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
 
 impl Connector<(), ()> {
-    #[allow(clippy::new_ret_no_self)]
+    #[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
     pub fn new() -> Connector<
         impl Service<
-                Request = TcpConnect<Uri>,
+                TcpConnect<Uri>,
                 Response = TcpConnection<Uri, TcpStream>,
-                Error = actix_connect::ConnectError,
+                Error = actix_tls::connect::ConnectError,
             > + Clone,
         TcpStream,
     > {
-        let ssl = {
-            #[cfg(feature = "ssl")]
-            {
-                use openssl::ssl::SslMethod;
-
-                let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
-                let _ = ssl
-                    .set_alpn_protos(b"\x02h2\x08http/1.1")
-                    .map_err(|e| error!("Can not set alpn protocol: {:?}", e));
-                SslConnector::Openssl(ssl.build())
-            }
-            #[cfg(all(not(feature = "ssl"), feature = "rust-tls"))]
-            {
-                let protos = vec![b"h2".to_vec(), b"http/1.1".to_vec()];
-                let mut config = ClientConfig::new();
-                config.set_protocols(&protos);
-                config
-                    .root_store
-                    .add_server_trust_anchors(&webpki_roots::TLS_SERVER_ROOTS);
-                SslConnector::Rustls(Arc::new(config))
-            }
-            #[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
-            {}
-        };
-
         Connector {
-            ssl,
+            ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
             connector: default_connector(),
-            timeout: Duration::from_secs(1),
-            conn_lifetime: Duration::from_secs(75),
-            conn_keep_alive: Duration::from_secs(15),
-            disconnect_timeout: Duration::from_millis(3000),
-            limit: 100,
-            _t: PhantomData,
+            config: ConnectorConfig::default(),
+            _phantom: PhantomData,
         }
     }
+
+    // Build Ssl connector with openssl, based on supplied alpn protocols
+    #[cfg(feature = "openssl")]
+    fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
+        use actix_tls::connect::ssl::openssl::SslMethod;
+        use bytes::{BufMut, BytesMut};
+
+        let mut alpn = BytesMut::with_capacity(20);
+        for proto in protocols.iter() {
+            alpn.put_u8(proto.len() as u8);
+            alpn.put(proto.as_slice());
+        }
+
+        let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
+        let _ = ssl
+            .set_alpn_protos(&alpn)
+            .map_err(|e| error!("Can not set alpn protocol: {:?}", e));
+        SslConnector::Openssl(ssl.build())
+    }
+
+    // Build Ssl connector with rustls, based on supplied alpn protocols
+    #[cfg(all(not(feature = "openssl"), feature = "rustls"))]
+    fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
+        let mut config = ClientConfig::new();
+        config.set_protocols(&protocols);
+        config
+            .root_store
+            .add_server_trust_anchors(&actix_tls::accept::rustls::TLS_SERVER_ROOTS);
+        SslConnector::Rustls(Arc::new(config))
+    }
+
+    // ssl turned off, provides empty ssl connector
+    #[cfg(not(any(feature = "openssl", feature = "rustls")))]
+    fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
 }
 
 impl<T, U> Connector<T, U> {
     /// Use custom connector.
     pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
     where
-        U1: AsyncRead + AsyncWrite + fmt::Debug,
+        U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
         T1: Service<
-                Request = TcpConnect<Uri>,
+                TcpConnect<Uri>,
                 Response = TcpConnection<Uri, U1>,
-                Error = actix_connect::ConnectError,
+                Error = actix_tls::connect::ConnectError,
             > + Clone,
     {
         Connector {
             connector,
-            timeout: self.timeout,
-            conn_lifetime: self.conn_lifetime,
-            conn_keep_alive: self.conn_keep_alive,
-            disconnect_timeout: self.disconnect_timeout,
-            limit: self.limit,
+            config: self.config,
             ssl: self.ssl,
-            _t: PhantomData,
+            _phantom: PhantomData,
         }
     }
 }
 
 impl<T, U> Connector<T, U>
 where
-    U: AsyncRead + AsyncWrite + fmt::Debug + 'static,
+    U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
     T: Service<
-            Request = TcpConnect<Uri>,
+            TcpConnect<Uri>,
             Response = TcpConnection<Uri, U>,
-            Error = actix_connect::ConnectError,
+            Error = actix_tls::connect::ConnectError,
         > + Clone
         + 'static,
 {
     /// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
     /// Set to 1 second by default.
     pub fn timeout(mut self, timeout: Duration) -> Self {
-        self.timeout = timeout;
+        self.config.timeout = timeout;
         self
     }
 
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     /// Use custom `SslConnector` instance.
     pub fn ssl(mut self, connector: OpensslConnector) -> Self {
         self.ssl = SslConnector::Openssl(connector);
         self
     }
 
-    #[cfg(feature = "rust-tls")]
+    #[cfg(feature = "rustls")]
     pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
         self.ssl = SslConnector::Rustls(connector);
         self
     }
 
+    /// Maximum supported http major version
+    /// Supported versions http/1.1, http/2
+    pub fn max_http_version(mut self, val: http::Version) -> Self {
+        let versions = match val {
+            http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
+            http::Version::HTTP_2 => vec![b"h2".to_vec(), b"http/1.1".to_vec()],
+            _ => {
+                unimplemented!("actix-http:client: supported versions http/1.1, http/2")
+            }
+        };
+        self.ssl = Connector::build_ssl(versions);
+        self
+    }
+
+    /// Indicates the initial window size (in octets) for
+    /// HTTP2 stream-level flow control for received data.
+    ///
+    /// The default value is 65,535 and is good for APIs, but not for big objects.
+    pub fn initial_window_size(mut self, size: u32) -> Self {
+        self.config.stream_window_size = size;
+        self
+    }
+
+    /// Indicates the initial window size (in octets) for
+    /// HTTP2 connection-level flow control for received data.
+    ///
+    /// The default value is 65,535 and is good for APIs, but not for big objects.
+    pub fn initial_connection_window_size(mut self, size: u32) -> Self {
+        self.config.conn_window_size = size;
+        self
+    }
+
     /// Set total number of simultaneous connections per type of scheme.
     ///
     /// If limit is 0, the connector has no limit.
     /// The default limit size is 100.
     pub fn limit(mut self, limit: usize) -> Self {
-        self.limit = limit;
+        self.config.limit = limit;
         self
     }
 
@@ -179,7 +209,7 @@ where
     /// exceeds this period, the connection is closed.
     /// Default keep-alive period is 15 seconds.
     pub fn conn_keep_alive(mut self, dur: Duration) -> Self {
-        self.conn_keep_alive = dur;
+        self.config.conn_keep_alive = dur;
         self
     }
 
@@ -189,7 +219,7 @@ where
     /// until it is closed regardless of keep-alive period.
     /// Default lifetime period is 75 seconds.
     pub fn conn_lifetime(mut self, dur: Duration) -> Self {
-        self.conn_lifetime = dur;
+        self.config.conn_lifetime = dur;
         self
     }
 
@@ -202,7 +232,7 @@ where
     ///
     /// By default disconnect timeout is set to 3000 milliseconds.
     pub fn disconnect_timeout(mut self, dur: Duration) -> Self {
-        self.disconnect_timeout = dur;
+        self.config.disconnect_timeout = Some(dur);
         self
     }
 
@@ -211,12 +241,12 @@ where
     /// its combinator chain.
     pub fn finish(
         self,
-    ) -> impl Service<Request = Connect, Response = impl Connection, Error = ConnectError>
-                 + Clone {
-        #[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+    ) -> impl Service<Connect, Response = impl Connection, Error = ConnectError> + Clone
+    {
+        #[cfg(not(any(feature = "openssl", feature = "rustls")))]
         {
             let connector = TimeoutService::new(
-                self.timeout,
+                self.config.timeout,
                 apply_fn(self.connector, |msg: Connect, srv| {
                     srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
                 })
@@ -231,39 +261,34 @@ where
             connect_impl::InnerConnector {
                 tcp_pool: ConnectionPool::new(
                     connector,
-                    self.conn_lifetime,
-                    self.conn_keep_alive,
-                    None,
-                    self.limit,
+                    self.config.no_disconnect_timeout(),
                 ),
             }
         }
-        #[cfg(any(feature = "ssl", feature = "rust-tls"))]
+        #[cfg(any(feature = "openssl", feature = "rustls"))]
         {
             const H2: &[u8] = b"h2";
-            #[cfg(feature = "ssl")]
-            use actix_connect::ssl::OpensslConnector;
-            #[cfg(feature = "rust-tls")]
-            use actix_connect::ssl::RustlsConnector;
-            use actix_service::boxed::service;
-            #[cfg(feature = "rust-tls")]
-            use rustls::Session;
+            use actix_service::{boxed::service, pipeline};
+            #[cfg(feature = "openssl")]
+            use actix_tls::connect::ssl::openssl::OpensslConnector;
+            #[cfg(feature = "rustls")]
+            use actix_tls::connect::ssl::rustls::{RustlsConnector, Session};
 
             let ssl_service = TimeoutService::new(
-                self.timeout,
-                apply_fn(self.connector.clone(), |msg: Connect, srv| {
-                    srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
-                })
-                .map_err(ConnectError::from)
+                self.config.timeout,
+                pipeline(
+                    apply_fn(self.connector.clone(), |msg: Connect, srv| {
+                        srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
+                    })
+                    .map_err(ConnectError::from),
+                )
                 .and_then(match self.ssl {
-                    #[cfg(feature = "ssl")]
+                    #[cfg(feature = "openssl")]
                     SslConnector::Openssl(ssl) => service(
                         OpensslConnector::service(ssl)
-                            .map_err(ConnectError::from)
                             .map(|stream| {
                                 let sock = stream.into_parts().0;
                                 let h2 = sock
-                                    .get_ref()
                                     .ssl()
                                     .selected_alpn_protocol()
                                     .map(|protos| protos.windows(2).any(|w| w == H2))
@@ -273,9 +298,10 @@ where
                                 } else {
                                     (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
                                 }
-                            }),
+                            })
+                            .map_err(ConnectError::from),
                     ),
-                    #[cfg(feature = "rust-tls")]
+                    #[cfg(feature = "rustls")]
                     SslConnector::Rustls(ssl) => service(
                         RustlsConnector::service(ssl)
                             .map_err(ConnectError::from)
@@ -302,8 +328,8 @@ where
             });
 
             let tcp_service = TimeoutService::new(
-                self.timeout,
-                apply_fn(self.connector.clone(), |msg: Connect, srv| {
+                self.config.timeout,
+                apply_fn(self.connector, |msg: Connect, srv| {
                     srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
                 })
                 .map_err(ConnectError::from)
@@ -317,47 +343,35 @@ where
             connect_impl::InnerConnector {
                 tcp_pool: ConnectionPool::new(
                     tcp_service,
-                    self.conn_lifetime,
-                    self.conn_keep_alive,
-                    None,
-                    self.limit,
-                ),
-                ssl_pool: ConnectionPool::new(
-                    ssl_service,
-                    self.conn_lifetime,
-                    self.conn_keep_alive,
-                    Some(self.disconnect_timeout),
-                    self.limit,
+                    self.config.no_disconnect_timeout(),
                 ),
+                ssl_pool: ConnectionPool::new(ssl_service, self.config),
             }
         }
     }
 }
 
-#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+#[cfg(not(any(feature = "openssl", feature = "rustls")))]
 mod connect_impl {
-    use futures::future::{err, Either, FutureResult};
-    use futures::Poll;
+    use std::task::{Context, Poll};
+
+    use futures_util::future::{err, Either, Ready};
 
     use super::*;
     use crate::client::connection::IoConnection;
 
     pub(crate) struct InnerConnector<T, Io>
     where
-        Io: AsyncRead + AsyncWrite + 'static,
-        T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
+        Io: AsyncRead + AsyncWrite + Unpin + 'static,
+        T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
     {
         pub(crate) tcp_pool: ConnectionPool<T, Io>,
     }
 
     impl<T, Io> Clone for InnerConnector<T, Io>
     where
-        Io: AsyncRead + AsyncWrite + 'static,
-        T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
+        Io: AsyncRead + AsyncWrite + Unpin + 'static,
+        T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
     {
         fn clone(&self) -> Self {
             InnerConnector {
@@ -366,52 +380,52 @@ mod connect_impl {
         }
     }
 
-    impl<T, Io> Service for InnerConnector<T, Io>
+    impl<T, Io> Service<Connect> for InnerConnector<T, Io>
     where
-        Io: AsyncRead + AsyncWrite + 'static,
-        T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
+        Io: AsyncRead + AsyncWrite + Unpin + 'static,
+        T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
     {
-        type Request = Connect;
         type Response = IoConnection<Io>;
         type Error = ConnectError;
         type Future = Either<
-            <ConnectionPool<T, Io> as Service>::Future,
-            FutureResult<IoConnection<Io>, ConnectError>,
+            <ConnectionPool<T, Io> as Service<Connect>>::Future,
+            Ready<Result<IoConnection<Io>, ConnectError>>,
         >;
 
-        fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-            self.tcp_pool.poll_ready()
+        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+            self.tcp_pool.poll_ready(cx)
         }
 
         fn call(&mut self, req: Connect) -> Self::Future {
             match req.uri.scheme_str() {
                 Some("https") | Some("wss") => {
-                    Either::B(err(ConnectError::SslIsNotSupported))
+                    Either::Right(err(ConnectError::SslIsNotSupported))
                 }
-                _ => Either::A(self.tcp_pool.call(req)),
+                _ => Either::Left(self.tcp_pool.call(req)),
             }
         }
     }
 }
 
-#[cfg(any(feature = "ssl", feature = "rust-tls"))]
+#[cfg(any(feature = "openssl", feature = "rustls"))]
 mod connect_impl {
+    use std::future::Future;
     use std::marker::PhantomData;
+    use std::pin::Pin;
+    use std::task::{Context, Poll};
 
-    use futures::future::{Either, FutureResult};
-    use futures::{Async, Future, Poll};
+    use futures_core::ready;
+    use futures_util::future::Either;
 
     use super::*;
     use crate::client::connection::EitherConnection;
 
     pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
-        T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>,
-        T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+        T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>,
+        T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>,
     {
         pub(crate) tcp_pool: ConnectionPool<T1, Io1>,
         pub(crate) ssl_pool: ConnectionPool<T2, Io2>,
@@ -419,14 +433,10 @@ mod connect_impl {
 
     impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
-        T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
-        T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+        T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
+        T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
     {
         fn clone(&self) -> Self {
             InnerConnector {
@@ -436,105 +446,89 @@ mod connect_impl {
         }
     }
 
-    impl<T1, T2, Io1, Io2> Service for InnerConnector<T1, T2, Io1, Io2>
+    impl<T1, T2, Io1, Io2> Service<Connect> for InnerConnector<T1, T2, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
-        T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
-        T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+        T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
+        T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
     {
-        type Request = Connect;
         type Response = EitherConnection<Io1, Io2>;
         type Error = ConnectError;
         type Future = Either<
-            FutureResult<Self::Response, Self::Error>,
-            Either<
-                InnerConnectorResponseA<T1, Io1, Io2>,
-                InnerConnectorResponseB<T2, Io1, Io2>,
-            >,
+            InnerConnectorResponseA<T1, Io1, Io2>,
+            InnerConnectorResponseB<T2, Io1, Io2>,
         >;
 
-        fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-            self.tcp_pool.poll_ready()
+        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+            self.tcp_pool.poll_ready(cx)
         }
 
         fn call(&mut self, req: Connect) -> Self::Future {
             match req.uri.scheme_str() {
-                Some("https") | Some("wss") => {
-                    Either::B(Either::B(InnerConnectorResponseB {
-                        fut: self.ssl_pool.call(req),
-                        _t: PhantomData,
-                    }))
-                }
-                _ => Either::B(Either::A(InnerConnectorResponseA {
+                Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
+                    fut: self.ssl_pool.call(req),
+                    _phantom: PhantomData,
+                }),
+                _ => Either::Left(InnerConnectorResponseA {
                     fut: self.tcp_pool.call(req),
-                    _t: PhantomData,
-                })),
+                    _phantom: PhantomData,
+                }),
             }
         }
     }
 
+    #[pin_project::pin_project]
     pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
-        T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        T: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
     {
-        fut: <ConnectionPool<T, Io1> as Service>::Future,
-        _t: PhantomData<Io2>,
+        #[pin]
+        fut: <ConnectionPool<T, Io1> as Service<Connect>>::Future,
+        _phantom: PhantomData<Io2>,
     }
 
     impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
     where
-        T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        T: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
     {
-        type Item = EitherConnection<Io1, Io2>;
-        type Error = ConnectError;
+        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
 
-        fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-            match self.fut.poll()? {
-                Async::NotReady => Ok(Async::NotReady),
-                Async::Ready(res) => Ok(Async::Ready(EitherConnection::A(res))),
-            }
+        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+            Poll::Ready(
+                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
+                    .map(EitherConnection::A),
+            )
         }
     }
 
+    #[pin_project::pin_project]
     pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
     where
-        Io2: AsyncRead + AsyncWrite + 'static,
-        T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
+        T: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
     {
-        fut: <ConnectionPool<T, Io2> as Service>::Future,
-        _t: PhantomData<Io1>,
+        #[pin]
+        fut: <ConnectionPool<T, Io2> as Service<Connect>>::Future,
+        _phantom: PhantomData<Io1>,
     }
 
     impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
     where
-        T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
-            + 'static,
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        T: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
     {
-        type Item = EitherConnection<Io1, Io2>;
-        type Error = ConnectError;
+        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
 
-        fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-            match self.fut.poll()? {
-                Async::NotReady => Ok(Async::NotReady),
-                Async::Ready(res) => Ok(Async::Ready(EitherConnection::B(res))),
-            }
+        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+            Poll::Ready(
+                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
+                    .map(EitherConnection::B),
+            )
         }
     }
 }

actix-http/src/client/error.rs

@@ -1,14 +1,13 @@
 use std::io;
 
+use actix_tls::connect::resolver::ResolveError;
 use derive_more::{Display, From};
-use trust_dns_resolver::error::ResolveError;
 
-#[cfg(feature = "ssl")]
-use openssl::ssl::{Error as SslError, HandshakeError};
+#[cfg(feature = "openssl")]
+use actix_tls::accept::openssl::SslError;
 
 use crate::error::{Error, ParseError, ResponseError};
-use crate::http::Error as HttpError;
-use crate::response::Response;
+use crate::http::{Error as HttpError, StatusCode};
 
 /// A set of errors that can occur while connecting to an HTTP host
 #[derive(Debug, Display, From)]
@@ -18,7 +17,7 @@ pub enum ConnectError {
     SslIsNotSupported,
 
     /// SSL error
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     #[display(fmt = "{}", _0)]
     SslError(SslError),
 
@@ -35,7 +34,7 @@ pub enum ConnectError {
     H2(h2::Error),
 
     /// Connecting took too long
-    #[display(fmt = "Timeout out while establishing connection")]
+    #[display(fmt = "Timeout while establishing connection")]
     Timeout,
 
     /// Connector has been disconnected
@@ -44,32 +43,23 @@ pub enum ConnectError {
 
     /// Unresolved host name
     #[display(fmt = "Connector received `Connect` method with unresolved host")]
-    Unresolverd,
+    Unresolved,
 
     /// Connection io error
     #[display(fmt = "{}", _0)]
     Io(io::Error),
 }
 
-impl From<actix_connect::ConnectError> for ConnectError {
-    fn from(err: actix_connect::ConnectError) -> ConnectError {
-        match err {
-            actix_connect::ConnectError::Resolver(e) => ConnectError::Resolver(e),
-            actix_connect::ConnectError::NoRecords => ConnectError::NoRecords,
-            actix_connect::ConnectError::InvalidInput => panic!(),
-            actix_connect::ConnectError::Unresolverd => ConnectError::Unresolverd,
-            actix_connect::ConnectError::Io(e) => ConnectError::Io(e),
-        }
-    }
-}
+impl std::error::Error for ConnectError {}
 
-#[cfg(feature = "ssl")]
-impl<T> From<HandshakeError<T>> for ConnectError {
-    fn from(err: HandshakeError<T>) -> ConnectError {
+impl From<actix_tls::connect::ConnectError> for ConnectError {
+    fn from(err: actix_tls::connect::ConnectError) -> ConnectError {
         match err {
-            HandshakeError::SetupFailure(stack) => SslError::from(stack).into(),
-            HandshakeError::Failure(stream) => stream.into_error().into(),
-            HandshakeError::WouldBlock(stream) => stream.into_error().into(),
+            actix_tls::connect::ConnectError::Resolver(e) => ConnectError::Resolver(e),
+            actix_tls::connect::ConnectError::NoRecords => ConnectError::NoRecords,
+            actix_tls::connect::ConnectError::InvalidInput => panic!(),
+            actix_tls::connect::ConnectError::Unresolved => ConnectError::Unresolved,
+            actix_tls::connect::ConnectError::Io(e) => ConnectError::Io(e),
         }
     }
 }
@@ -86,6 +76,8 @@ pub enum InvalidUrl {
     HttpError(http::Error),
 }
 
+impl std::error::Error for InvalidUrl {}
+
 /// A set of errors that can occur during request sending and response reading
 #[derive(Debug, Display, From)]
 pub enum SendRequestError {
@@ -106,7 +98,7 @@ pub enum SendRequestError {
     #[display(fmt = "{}", _0)]
     H2(h2::Error),
     /// Response took too long
-    #[display(fmt = "Timeout out while waiting for response")]
+    #[display(fmt = "Timeout while waiting for response")]
     Timeout,
     /// Tunnels are not supported for http2 connection
     #[display(fmt = "Tunnels are not supported for http2 connection")]
@@ -115,17 +107,18 @@ pub enum SendRequestError {
     Body(Error),
 }
 
+impl std::error::Error for SendRequestError {}
+
 /// Convert `SendRequestError` to a server `Response`
 impl ResponseError for SendRequestError {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
         match *self {
             SendRequestError::Connect(ConnectError::Timeout) => {
-                Response::GatewayTimeout()
+                StatusCode::GATEWAY_TIMEOUT
             }
-            SendRequestError::Connect(_) => Response::BadGateway(),
-            _ => Response::InternalServerError(),
+            SendRequestError::Connect(_) => StatusCode::BAD_REQUEST,
+            _ => StatusCode::INTERNAL_SERVER_ERROR,
         }
-        .into()
     }
 }
 
@@ -140,6 +133,8 @@ pub enum FreezeRequestError {
     Http(HttpError),
 }
 
+impl std::error::Error for FreezeRequestError {}
+
 impl From<FreezeRequestError> for SendRequestError {
     fn from(e: FreezeRequestError) -> Self {
         match e {

actix-http/src/client/h1proto.rs

@@ -1,10 +1,14 @@
 use std::io::Write;
+use std::pin::Pin;
+use std::task::{Context, Poll};
 use std::{io, time};
 
-use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use bytes::{BufMut, Bytes, BytesMut};
-use futures::future::{ok, Either};
-use futures::{Async, Future, Poll, Sink, Stream};
+use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
+use bytes::buf::BufMut;
+use bytes::{Bytes, BytesMut};
+use futures_core::Stream;
+use futures_util::future::poll_fn;
+use futures_util::{pin_mut, SinkExt, StreamExt};
 
 use crate::error::PayloadError;
 use crate::h1;
@@ -18,15 +22,15 @@ use super::error::{ConnectError, SendRequestError};
 use super::pool::Acquired;
 use crate::body::{BodySize, MessageBody};
 
-pub(crate) fn send_request<T, B>(
+pub(crate) async fn send_request<T, B>(
     io: T,
     mut head: RequestHeadType,
     body: B,
     created: time::Instant,
     pool: Option<Acquired<T>>,
-) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
+) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     B: MessageBody,
 {
     // set request host header
@@ -41,7 +45,7 @@ where
                 Some(port) => write!(wrt, "{}:{}", host, port),
             };
 
-            match wrt.get_mut().take().freeze().try_into() {
+            match wrt.get_mut().split().freeze().try_into() {
                 Ok(value) => match head {
                     RequestHeadType::Owned(ref mut head) => {
                         head.headers.insert(HOST, value)
@@ -62,81 +66,118 @@ where
         io: Some(io),
     };
 
-    let len = body.size();
-
     // create Framed and send request
-    Framed::new(io, h1::ClientCodec::default())
-        .send((head, len).into())
-        .from_err()
-        // send request body
-        .and_then(move |framed| match body.size() {
-            BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
-                Either::A(ok(framed))
-            }
-            _ => Either::B(SendBody::new(body, framed)),
-        })
-        // read response and init read body
-        .and_then(|framed| {
-            framed
-                .into_future()
-                .map_err(|(e, _)| SendRequestError::from(e))
-                .and_then(|(item, framed)| {
-                    if let Some(res) = item {
-                        match framed.get_codec().message_type() {
-                            h1::MessageType::None => {
-                                let force_close = !framed.get_codec().keepalive();
-                                release_connection(framed, force_close);
-                                Ok((res, Payload::None))
-                            }
-                            _ => {
-                                let pl: PayloadStream = Box::new(PlStream::new(framed));
-                                Ok((res, pl.into()))
-                            }
-                        }
-                    } else {
-                        Err(ConnectError::Disconnected.into())
-                    }
-                })
-        })
+    let mut framed_inner = Framed::new(io, h1::ClientCodec::default());
+    framed_inner.send((head, body.size()).into()).await?;
+
+    // send request body
+    match body.size() {
+        BodySize::None | BodySize::Empty | BodySize::Sized(0) => {}
+        _ => send_body(body, Pin::new(&mut framed_inner)).await?,
+    };
+
+    // read response and init read body
+    let res = Pin::new(&mut framed_inner).into_future().await;
+    let (head, framed) = if let (Some(result), framed) = res {
+        let item = result.map_err(SendRequestError::from)?;
+        (item, framed)
+    } else {
+        return Err(SendRequestError::from(ConnectError::Disconnected));
+    };
+
+    match framed.codec_ref().message_type() {
+        h1::MessageType::None => {
+            let force_close = !framed.codec_ref().keepalive();
+            release_connection(framed, force_close);
+            Ok((head, Payload::None))
+        }
+        _ => {
+            let pl: PayloadStream = PlStream::new(framed_inner).boxed_local();
+            Ok((head, pl.into()))
+        }
+    }
 }
 
-pub(crate) fn open_tunnel<T>(
+pub(crate) async fn open_tunnel<T>(
     io: T,
     head: RequestHeadType,
-) -> impl Future<Item = (ResponseHead, Framed<T, h1::ClientCodec>), Error = SendRequestError>
+) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     // create Framed and send request
-    Framed::new(io, h1::ClientCodec::default())
-        .send((head, BodySize::None).into())
-        .from_err()
-        // read response
-        .and_then(|framed| {
-            framed
-                .into_future()
-                .map_err(|(e, _)| SendRequestError::from(e))
-                .and_then(|(head, framed)| {
-                    if let Some(head) = head {
-                        Ok((head, framed))
+    let mut framed = Framed::new(io, h1::ClientCodec::default());
+    framed.send((head, BodySize::None).into()).await?;
+
+    // read response
+    if let (Some(result), framed) = framed.into_future().await {
+        let head = result.map_err(SendRequestError::from)?;
+        Ok((head, framed))
+    } else {
+        Err(SendRequestError::from(ConnectError::Disconnected))
+    }
+}
+
+/// send request body to the peer
+pub(crate) async fn send_body<T, B>(
+    body: B,
+    mut framed: Pin<&mut Framed<T, h1::ClientCodec>>,
+) -> Result<(), SendRequestError>
+where
+    T: ConnectionLifetime + Unpin,
+    B: MessageBody,
+{
+    pin_mut!(body);
+
+    let mut eof = false;
+    while !eof {
+        while !eof && !framed.as_ref().is_write_buf_full() {
+            match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
+                Some(result) => {
+                    framed.as_mut().write(h1::Message::Chunk(Some(result?)))?;
+                }
+                None => {
+                    eof = true;
+                    framed.as_mut().write(h1::Message::Chunk(None))?;
+                }
+            }
+        }
+
+        if !framed.as_ref().is_write_buf_empty() {
+            poll_fn(|cx| match framed.as_mut().flush(cx) {
+                Poll::Ready(Ok(_)) => Poll::Ready(Ok(())),
+                Poll::Ready(Err(err)) => Poll::Ready(Err(err)),
+                Poll::Pending => {
+                    if !framed.as_ref().is_write_buf_full() {
+                        Poll::Ready(Ok(()))
                     } else {
-                        Err(SendRequestError::from(ConnectError::Disconnected))
+                        Poll::Pending
                     }
-                })
-        })
+                }
+            })
+            .await?;
+        }
+    }
+
+    SinkExt::flush(Pin::into_inner(framed)).await?;
+    Ok(())
 }
 
 #[doc(hidden)]
 /// HTTP client connection
 pub struct H1Connection<T> {
+    /// T should be `Unpin`
     io: Option<T>,
     created: time::Instant,
     pool: Option<Acquired<T>>,
 }
 
-impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T> {
+impl<T> ConnectionLifetime for H1Connection<T>
+where
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
+{
     /// Close connection
-    fn close(&mut self) {
+    fn close(mut self: Pin<&mut Self>) {
         if let Some(mut pool) = self.pool.take() {
             if let Some(io) = self.io.take() {
                 pool.close(IoConnection::new(
@@ -149,7 +190,7 @@ impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T>
     }
 
     /// Release this connection to the connection pool
-    fn release(&mut self) {
+    fn release(mut self: Pin<&mut Self>) {
         if let Some(mut pool) = self.pool.take() {
             if let Some(io) = self.io.take() {
                 pool.release(IoConnection::new(
@@ -162,143 +203,89 @@ impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T>
     }
 }
 
-impl<T: AsyncRead + AsyncWrite + 'static> io::Read for H1Connection<T> {
-    fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
-        self.io.as_mut().unwrap().read(buf)
+impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
+    fn poll_read(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &mut ReadBuf<'_>,
+    ) -> Poll<io::Result<()>> {
+        Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
     }
 }
 
-impl<T: AsyncRead + AsyncWrite + 'static> AsyncRead for H1Connection<T> {}
-
-impl<T: AsyncRead + AsyncWrite + 'static> io::Write for H1Connection<T> {
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.io.as_mut().unwrap().write(buf)
+impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
+    fn poll_write(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &[u8],
+    ) -> Poll<io::Result<usize>> {
+        Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
     }
 
-    fn flush(&mut self) -> io::Result<()> {
-        self.io.as_mut().unwrap().flush()
-    }
-}
-
-impl<T: AsyncRead + AsyncWrite + 'static> AsyncWrite for H1Connection<T> {
-    fn shutdown(&mut self) -> Poll<(), io::Error> {
-        self.io.as_mut().unwrap().shutdown()
-    }
-}
-
-/// Future responsible for sending request body to the peer
-pub(crate) struct SendBody<I, B> {
-    body: Option<B>,
-    framed: Option<Framed<I, h1::ClientCodec>>,
-    flushed: bool,
-}
-
-impl<I, B> SendBody<I, B>
-where
-    I: AsyncRead + AsyncWrite + 'static,
-    B: MessageBody,
-{
-    pub(crate) fn new(body: B, framed: Framed<I, h1::ClientCodec>) -> Self {
-        SendBody {
-            body: Some(body),
-            framed: Some(framed),
-            flushed: true,
-        }
-    }
-}
-
-impl<I, B> Future for SendBody<I, B>
-where
-    I: ConnectionLifetime,
-    B: MessageBody,
-{
-    type Item = Framed<I, h1::ClientCodec>;
-    type Error = SendRequestError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        let mut body_ready = true;
-        loop {
-            while body_ready
-                && self.body.is_some()
-                && !self.framed.as_ref().unwrap().is_write_buf_full()
-            {
-                match self.body.as_mut().unwrap().poll_next()? {
-                    Async::Ready(item) => {
-                        // check if body is done
-                        if item.is_none() {
-                            let _ = self.body.take();
-                        }
-                        self.flushed = false;
-                        self.framed
-                            .as_mut()
-                            .unwrap()
-                            .force_send(h1::Message::Chunk(item))?;
-                        break;
-                    }
-                    Async::NotReady => body_ready = false,
-                }
-            }
-
-            if !self.flushed {
-                match self.framed.as_mut().unwrap().poll_complete()? {
-                    Async::Ready(_) => {
-                        self.flushed = true;
-                        continue;
-                    }
-                    Async::NotReady => return Ok(Async::NotReady),
-                }
-            }
-
-            if self.body.is_none() {
-                return Ok(Async::Ready(self.framed.take().unwrap()));
-            }
-            return Ok(Async::NotReady);
-        }
+    fn poll_flush(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<io::Result<()>> {
+        Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
+    }
+
+    fn poll_shutdown(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Result<(), io::Error>> {
+        Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
     }
 }
 
+#[pin_project::pin_project]
 pub(crate) struct PlStream<Io> {
+    #[pin]
     framed: Option<Framed<Io, h1::ClientPayloadCodec>>,
 }
 
 impl<Io: ConnectionLifetime> PlStream<Io> {
     fn new(framed: Framed<Io, h1::ClientCodec>) -> Self {
+        let framed = framed.into_map_codec(|codec| codec.into_payload_codec());
+
         PlStream {
-            framed: Some(framed.map_codec(|codec| codec.into_payload_codec())),
+            framed: Some(framed),
         }
     }
 }
 
 impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
-    type Item = Bytes;
-    type Error = PayloadError;
+    type Item = Result<Bytes, PayloadError>;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
-        match self.framed.as_mut().unwrap().poll()? {
-            Async::NotReady => Ok(Async::NotReady),
-            Async::Ready(Some(chunk)) => {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        let mut this = self.project();
+
+        match this.framed.as_mut().as_pin_mut().unwrap().next_item(cx)? {
+            Poll::Pending => Poll::Pending,
+            Poll::Ready(Some(chunk)) => {
                 if let Some(chunk) = chunk {
-                    Ok(Async::Ready(Some(chunk)))
+                    Poll::Ready(Some(Ok(chunk)))
                 } else {
-                    let framed = self.framed.take().unwrap();
-                    let force_close = !framed.get_codec().keepalive();
+                    let framed = this.framed.as_mut().as_pin_mut().unwrap();
+                    let force_close = !framed.codec_ref().keepalive();
                     release_connection(framed, force_close);
-                    Ok(Async::Ready(None))
+                    Poll::Ready(None)
                 }
             }
-            Async::Ready(None) => Ok(Async::Ready(None)),
+            Poll::Ready(None) => Poll::Ready(None),
         }
     }
 }
 
-fn release_connection<T, U>(framed: Framed<T, U>, force_close: bool)
+fn release_connection<T, U>(framed: Pin<&mut Framed<T, U>>, force_close: bool)
 where
     T: ConnectionLifetime,
 {
-    let mut parts = framed.into_parts();
-    if !force_close && parts.read_buf.is_empty() && parts.write_buf.is_empty() {
-        parts.io.release()
+    if !force_close && framed.is_read_buf_empty() && framed.is_write_buf_empty() {
+        framed.io_pin().release()
     } else {
-        parts.io.close()
+        framed.io_pin().close()
     }
 }

actix-http/src/client/h2proto.rs

@@ -1,193 +1,178 @@
+use std::convert::TryFrom;
+use std::future::Future;
 use std::time;
 
 use actix_codec::{AsyncRead, AsyncWrite};
 use bytes::Bytes;
-use futures::future::{err, Either};
-use futures::{Async, Future, Poll};
-use h2::{client::SendRequest, SendStream};
+use futures_util::future::poll_fn;
+use futures_util::pin_mut;
+use h2::{
+    client::{Builder, Connection, SendRequest},
+    SendStream,
+};
 use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING};
-use http::{request::Request, HttpTryFrom, Method, Version};
+use http::{request::Request, Method, Version};
 
 use crate::body::{BodySize, MessageBody};
 use crate::header::HeaderMap;
 use crate::message::{RequestHeadType, ResponseHead};
 use crate::payload::Payload;
 
+use super::config::ConnectorConfig;
 use super::connection::{ConnectionType, IoConnection};
 use super::error::SendRequestError;
 use super::pool::Acquired;
 
-pub(crate) fn send_request<T, B>(
-    io: SendRequest<Bytes>,
+pub(crate) async fn send_request<T, B>(
+    mut io: SendRequest<Bytes>,
     head: RequestHeadType,
     body: B,
     created: time::Instant,
     pool: Option<Acquired<T>>,
-) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
+) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     B: MessageBody,
 {
     trace!("Sending client request: {:?} {:?}", head, body.size());
     let head_req = head.as_ref().method == Method::HEAD;
     let length = body.size();
-    let eof = match length {
-        BodySize::None | BodySize::Empty | BodySize::Sized(0) => true,
-        _ => false,
+    let eof = matches!(
+        length,
+        BodySize::None | BodySize::Empty | BodySize::Sized(0)
+    );
+
+    let mut req = Request::new(());
+    *req.uri_mut() = head.as_ref().uri.clone();
+    *req.method_mut() = head.as_ref().method.clone();
+    *req.version_mut() = Version::HTTP_2;
+
+    let mut skip_len = true;
+    // let mut has_date = false;
+
+    // Content length
+    let _ = match length {
+        BodySize::None => None,
+        BodySize::Stream => {
+            skip_len = false;
+            None
+        }
+        BodySize::Empty => req
+            .headers_mut()
+            .insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
+        BodySize::Sized(len) => req.headers_mut().insert(
+            CONTENT_LENGTH,
+            HeaderValue::try_from(format!("{}", len)).unwrap(),
+        ),
     };
 
-    io.ready()
-        .map_err(SendRequestError::from)
-        .and_then(move |mut io| {
-            let mut req = Request::new(());
-            *req.uri_mut() = head.as_ref().uri.clone();
-            *req.method_mut() = head.as_ref().method.clone();
-            *req.version_mut() = Version::HTTP_2;
+    // Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
+    let (head, extra_headers) = match head {
+        RequestHeadType::Owned(head) => (RequestHeadType::Owned(head), HeaderMap::new()),
+        RequestHeadType::Rc(head, extra_headers) => (
+            RequestHeadType::Rc(head, None),
+            extra_headers.unwrap_or_else(HeaderMap::new),
+        ),
+    };
 
-            let mut skip_len = true;
-            // let mut has_date = false;
+    // merging headers from head and extra headers.
+    let headers = head
+        .as_ref()
+        .headers
+        .iter()
+        .filter(|(name, _)| !extra_headers.contains_key(*name))
+        .chain(extra_headers.iter());
 
-            // Content length
-            let _ = match length {
-                BodySize::None => None,
-                BodySize::Stream => {
-                    skip_len = false;
-                    None
-                }
-                BodySize::Empty => req
-                    .headers_mut()
-                    .insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
-                BodySize::Sized(len) => req.headers_mut().insert(
-                    CONTENT_LENGTH,
-                    HeaderValue::try_from(format!("{}", len)).unwrap(),
-                ),
-                BodySize::Sized64(len) => req.headers_mut().insert(
-                    CONTENT_LENGTH,
-                    HeaderValue::try_from(format!("{}", len)).unwrap(),
-                ),
-            };
+    // copy headers
+    for (key, value) in headers {
+        match *key {
+            CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
+            CONTENT_LENGTH if skip_len => continue,
+            // DATE => has_date = true,
+            _ => {}
+        }
+        req.headers_mut().append(key, value.clone());
+    }
 
-            // Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
-            let (head, extra_headers) = match head {
-                RequestHeadType::Owned(head) => {
-                    (RequestHeadType::Owned(head), HeaderMap::new())
-                }
-                RequestHeadType::Rc(head, extra_headers) => (
-                    RequestHeadType::Rc(head, None),
-                    extra_headers.unwrap_or_else(HeaderMap::new),
-                ),
-            };
+    let res = poll_fn(|cx| io.poll_ready(cx)).await;
+    if let Err(e) = res {
+        release(io, pool, created, e.is_io());
+        return Err(SendRequestError::from(e));
+    }
 
-            // merging headers from head and extra headers.
-            let headers = head
-                .as_ref()
-                .headers
-                .iter()
-                .filter(|(name, _)| !extra_headers.contains_key(*name))
-                .chain(extra_headers.iter());
+    let resp = match io.send_request(req, eof) {
+        Ok((fut, send)) => {
+            release(io, pool, created, false);
 
-            // copy headers
-            for (key, value) in headers {
-                match *key {
-                    CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
-                    CONTENT_LENGTH if skip_len => continue,
-                    // DATE => has_date = true,
-                    _ => (),
-                }
-                req.headers_mut().append(key, value.clone());
+            if !eof {
+                send_body(body, send).await?;
             }
+            fut.await.map_err(SendRequestError::from)?
+        }
+        Err(e) => {
+            release(io, pool, created, e.is_io());
+            return Err(e.into());
+        }
+    };
 
-            match io.send_request(req, eof) {
-                Ok((res, send)) => {
-                    release(io, pool, created, false);
+    let (parts, body) = resp.into_parts();
+    let payload = if head_req { Payload::None } else { body.into() };
 
-                    if !eof {
-                        Either::A(Either::B(
-                            SendBody {
-                                body,
-                                send,
-                                buf: None,
-                            }
-                            .and_then(move |_| res.map_err(SendRequestError::from)),
-                        ))
-                    } else {
-                        Either::B(res.map_err(SendRequestError::from))
-                    }
-                }
-                Err(e) => {
-                    release(io, pool, created, e.is_io());
-                    Either::A(Either::A(err(e.into())))
-                }
-            }
-        })
-        .and_then(move |resp| {
-            let (parts, body) = resp.into_parts();
-            let payload = if head_req { Payload::None } else { body.into() };
-
-            let mut head = ResponseHead::new(parts.status);
-            head.version = parts.version;
-            head.headers = parts.headers.into();
-            Ok((head, payload))
-        })
-        .from_err()
+    let mut head = ResponseHead::new(parts.status);
+    head.version = parts.version;
+    head.headers = parts.headers.into();
+    Ok((head, payload))
 }
 
-struct SendBody<B: MessageBody> {
+async fn send_body<B: MessageBody>(
     body: B,
-    send: SendStream<Bytes>,
-    buf: Option<Bytes>,
-}
-
-impl<B: MessageBody> Future for SendBody<B> {
-    type Item = ();
-    type Error = SendRequestError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        loop {
-            if self.buf.is_none() {
-                match self.body.poll_next() {
-                    Ok(Async::Ready(Some(buf))) => {
-                        self.send.reserve_capacity(buf.len());
-                        self.buf = Some(buf);
-                    }
-                    Ok(Async::Ready(None)) => {
-                        if let Err(e) = self.send.send_data(Bytes::new(), true) {
-                            return Err(e.into());
-                        }
-                        self.send.reserve_capacity(0);
-                        return Ok(Async::Ready(()));
-                    }
-                    Ok(Async::NotReady) => return Ok(Async::NotReady),
-                    Err(e) => return Err(e.into()),
+    mut send: SendStream<Bytes>,
+) -> Result<(), SendRequestError> {
+    let mut buf = None;
+    pin_mut!(body);
+    loop {
+        if buf.is_none() {
+            match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
+                Some(Ok(b)) => {
+                    send.reserve_capacity(b.len());
+                    buf = Some(b);
                 }
-            }
-
-            match self.send.poll_capacity() {
-                Ok(Async::NotReady) => return Ok(Async::NotReady),
-                Ok(Async::Ready(None)) => return Ok(Async::Ready(())),
-                Ok(Async::Ready(Some(cap))) => {
-                    let mut buf = self.buf.take().unwrap();
-                    let len = buf.len();
-                    let bytes = buf.split_to(std::cmp::min(cap, len));
-
-                    if let Err(e) = self.send.send_data(bytes, false) {
+                Some(Err(e)) => return Err(e.into()),
+                None => {
+                    if let Err(e) = send.send_data(Bytes::new(), true) {
                         return Err(e.into());
-                    } else {
-                        if !buf.is_empty() {
-                            self.send.reserve_capacity(buf.len());
-                            self.buf = Some(buf);
-                        }
-                        continue;
                     }
+                    send.reserve_capacity(0);
+                    return Ok(());
                 }
-                Err(e) => return Err(e.into()),
             }
         }
+
+        match poll_fn(|cx| send.poll_capacity(cx)).await {
+            None => return Ok(()),
+            Some(Ok(cap)) => {
+                let b = buf.as_mut().unwrap();
+                let len = b.len();
+                let bytes = b.split_to(std::cmp::min(cap, len));
+
+                if let Err(e) = send.send_data(bytes, false) {
+                    return Err(e.into());
+                } else {
+                    if !b.is_empty() {
+                        send.reserve_capacity(b.len());
+                    } else {
+                        buf = None;
+                    }
+                    continue;
+                }
+            }
+            Some(Err(e)) => return Err(e.into()),
+        }
     }
 }
 
 // release SendRequest object
-fn release<T: AsyncRead + AsyncWrite + 'static>(
+fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
     io: SendRequest<Bytes>,
     pool: Option<Acquired<T>>,
     created: time::Instant,
@@ -201,3 +186,18 @@ fn release<T: AsyncRead + AsyncWrite + 'static>(
         }
     }
 }
+
+pub(crate) fn handshake<Io>(
+    io: Io,
+    config: &ConnectorConfig,
+) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
+where
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+{
+    let mut builder = Builder::new();
+    builder
+        .initial_window_size(config.stream_window_size)
+        .initial_connection_window_size(config.conn_window_size)
+        .enable_push(false);
+    builder.handshake(io)
+}

actix-http/src/client/mod.rs

@@ -1,6 +1,7 @@
 //! Http client api
 use http::Uri;
 
+mod config;
 mod connection;
 mod connector;
 mod error;

actix-http/src/client/pool.rs

@@ -1,25 +1,29 @@
 use std::cell::RefCell;
 use std::collections::VecDeque;
-use std::io;
+use std::future::Future;
+use std::pin::Pin;
 use std::rc::Rc;
+use std::task::{Context, Poll};
 use std::time::{Duration, Instant};
 
-use actix_codec::{AsyncRead, AsyncWrite};
+use actix_codec::{AsyncRead, AsyncWrite, ReadBuf};
+use actix_rt::time::{sleep, Sleep};
 use actix_service::Service;
+use actix_utils::task::LocalWaker;
 use bytes::Bytes;
-use futures::future::{err, ok, Either, FutureResult};
-use futures::task::AtomicTask;
-use futures::unsync::oneshot;
-use futures::{Async, Future, Poll};
-use h2::client::{handshake, Handshake};
-use hashbrown::HashMap;
+use futures_channel::oneshot;
+use futures_util::future::{poll_fn, FutureExt, LocalBoxFuture};
+use fxhash::FxHashMap;
+use h2::client::{Connection, SendRequest};
 use http::uri::Authority;
 use indexmap::IndexSet;
+use pin_project::pin_project;
 use slab::Slab;
-use tokio_timer::{sleep, Delay};
 
+use super::config::ConnectorConfig;
 use super::connection::{ConnectionType, IoConnection};
 use super::error::ConnectError;
+use super::h2proto::handshake;
 use super::Connect;
 
 #[derive(Clone, Copy, PartialEq)]
@@ -41,247 +45,199 @@ impl From<Authority> for Key {
 }
 
 /// Connections pool
-pub(crate) struct ConnectionPool<T, Io: AsyncRead + AsyncWrite + 'static>(
-    T,
-    Rc<RefCell<Inner<Io>>>,
-);
+pub(crate) struct ConnectionPool<T, Io: 'static>(Rc<RefCell<T>>, Rc<RefCell<Inner<Io>>>);
 
 impl<T, Io> ConnectionPool<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
-    T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-        + Clone
-        + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+    T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
 {
-    pub(crate) fn new(
-        connector: T,
-        conn_lifetime: Duration,
-        conn_keep_alive: Duration,
-        disconnect_timeout: Option<Duration>,
-        limit: usize,
-    ) -> Self {
-        ConnectionPool(
-            connector,
-            Rc::new(RefCell::new(Inner {
-                conn_lifetime,
-                conn_keep_alive,
-                disconnect_timeout,
-                limit,
-                acquired: 0,
-                waiters: Slab::new(),
-                waiters_queue: IndexSet::new(),
-                available: HashMap::new(),
-                task: None,
-            })),
-        )
+    pub(crate) fn new(connector: T, config: ConnectorConfig) -> Self {
+        let connector_rc = Rc::new(RefCell::new(connector));
+        let inner_rc = Rc::new(RefCell::new(Inner {
+            config,
+            acquired: 0,
+            waiters: Slab::new(),
+            waiters_queue: IndexSet::new(),
+            available: FxHashMap::default(),
+            waker: LocalWaker::new(),
+        }));
+
+        // start support future
+        actix_rt::spawn(ConnectorPoolSupport {
+            connector: Rc::clone(&connector_rc),
+            inner: Rc::clone(&inner_rc),
+        });
+
+        ConnectionPool(connector_rc, inner_rc)
     }
 }
 
 impl<T, Io> Clone for ConnectionPool<T, Io>
 where
-    T: Clone,
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: 'static,
 {
     fn clone(&self) -> Self {
         ConnectionPool(self.0.clone(), self.1.clone())
     }
 }
 
-impl<T, Io> Service for ConnectionPool<T, Io>
+impl<T, Io> Drop for ConnectionPool<T, Io> {
+    fn drop(&mut self) {
+        // wake up the ConnectorPoolSupport when dropping so it can exit properly.
+        self.1.borrow().waker.wake();
+    }
+}
+
+impl<T, Io> Service<Connect> for ConnectionPool<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
-    T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-        + Clone
-        + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+    T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
 {
-    type Request = Connect;
     type Response = IoConnection<Io>;
     type Error = ConnectError;
-    type Future = Either<
-        FutureResult<Self::Response, Self::Error>,
-        Either<WaitForConnection<Io>, OpenConnection<T::Future, Io>>,
-    >;
+    type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        self.0.poll_ready()
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        self.0.poll_ready(cx)
     }
 
     fn call(&mut self, req: Connect) -> Self::Future {
-        let key = if let Some(authority) = req.uri.authority_part() {
-            authority.clone().into()
-        } else {
-            return Either::A(err(ConnectError::Unresolverd));
+        let mut connector = self.0.clone();
+        let inner = self.1.clone();
+
+        let fut = async move {
+            let key = if let Some(authority) = req.uri.authority() {
+                authority.clone().into()
+            } else {
+                return Err(ConnectError::Unresolved);
+            };
+
+            // acquire connection
+            match poll_fn(|cx| Poll::Ready(inner.borrow_mut().acquire(&key, cx))).await {
+                Acquire::Acquired(io, created) => {
+                    // use existing connection
+                    Ok(IoConnection::new(
+                        io,
+                        created,
+                        Some(Acquired(key, Some(inner))),
+                    ))
+                }
+                Acquire::Available => {
+                    // open tcp connection
+                    let (io, proto) = connector.call(req).await?;
+
+                    let config = inner.borrow().config.clone();
+
+                    let guard = OpenGuard::new(key, inner);
+
+                    if proto == Protocol::Http1 {
+                        Ok(IoConnection::new(
+                            ConnectionType::H1(io),
+                            Instant::now(),
+                            Some(guard.consume()),
+                        ))
+                    } else {
+                        let (snd, connection) = handshake(io, &config).await?;
+                        actix_rt::spawn(connection.map(|_| ()));
+                        Ok(IoConnection::new(
+                            ConnectionType::H2(snd),
+                            Instant::now(),
+                            Some(guard.consume()),
+                        ))
+                    }
+                }
+                _ => {
+                    // connection is not available, wait
+                    let (rx, token) = inner.borrow_mut().wait_for(req);
+
+                    let guard = WaiterGuard::new(key, token, inner);
+                    let res = match rx.await {
+                        Err(_) => Err(ConnectError::Disconnected),
+                        Ok(res) => res,
+                    };
+                    guard.consume();
+                    res
+                }
+            }
         };
 
-        // acquire connection
-        match self.1.as_ref().borrow_mut().acquire(&key) {
-            Acquire::Acquired(io, created) => {
-                // use existing connection
-                return Either::A(ok(IoConnection::new(
-                    io,
-                    created,
-                    Some(Acquired(key, Some(self.1.clone()))),
-                )));
-            }
-            Acquire::Available => {
-                // open new connection
-                return Either::B(Either::B(OpenConnection::new(
-                    key,
-                    self.1.clone(),
-                    self.0.call(req),
-                )));
-            }
-            _ => (),
-        }
-
-        // connection is not available, wait
-        let (rx, token, support) = self.1.as_ref().borrow_mut().wait_for(req);
-
-        // start support future
-        if !support {
-            self.1.as_ref().borrow_mut().task = Some(AtomicTask::new());
-            tokio_current_thread::spawn(ConnectorPoolSupport {
-                connector: self.0.clone(),
-                inner: self.1.clone(),
-            })
-        }
-
-        Either::B(Either::A(WaitForConnection {
-            rx,
-            key,
-            token,
-            inner: Some(self.1.clone()),
-        }))
+        fut.boxed_local()
     }
 }
 
-#[doc(hidden)]
-pub struct WaitForConnection<Io>
+struct WaiterGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     key: Key,
     token: usize,
-    rx: oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
     inner: Option<Rc<RefCell<Inner<Io>>>>,
 }
 
-impl<Io> Drop for WaitForConnection<Io>
+impl<Io> WaiterGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+{
+    fn new(key: Key, token: usize, inner: Rc<RefCell<Inner<Io>>>) -> Self {
+        Self {
+            key,
+            token,
+            inner: Some(inner),
+        }
+    }
+
+    fn consume(mut self) {
+        let _ = self.inner.take();
+    }
+}
+
+impl<Io> Drop for WaiterGuard<Io>
+where
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     fn drop(&mut self) {
         if let Some(i) = self.inner.take() {
             let mut inner = i.as_ref().borrow_mut();
             inner.release_waiter(&self.key, self.token);
-            inner.check_availibility();
+            inner.check_availability();
         }
     }
 }
 
-impl<Io> Future for WaitForConnection<Io>
+struct OpenGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    type Item = IoConnection<Io>;
-    type Error = ConnectError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        match self.rx.poll() {
-            Ok(Async::Ready(item)) => match item {
-                Err(err) => Err(err),
-                Ok(conn) => {
-                    let _ = self.inner.take();
-                    Ok(Async::Ready(conn))
-                }
-            },
-            Ok(Async::NotReady) => Ok(Async::NotReady),
-            Err(_) => {
-                let _ = self.inner.take();
-                Err(ConnectError::Disconnected)
-            }
-        }
-    }
-}
-
-#[doc(hidden)]
-pub struct OpenConnection<F, Io>
-where
-    Io: AsyncRead + AsyncWrite + 'static,
-{
-    fut: F,
     key: Key,
-    h2: Option<Handshake<Io, Bytes>>,
     inner: Option<Rc<RefCell<Inner<Io>>>>,
 }
 
-impl<F, Io> OpenConnection<F, Io>
+impl<Io> OpenGuard<Io>
 where
-    F: Future<Item = (Io, Protocol), Error = ConnectError>,
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>, fut: F) -> Self {
-        OpenConnection {
+    fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>) -> Self {
+        Self {
             key,
-            fut,
             inner: Some(inner),
-            h2: None,
         }
     }
+
+    fn consume(mut self) -> Acquired<Io> {
+        Acquired(self.key.clone(), self.inner.take())
+    }
 }
 
-impl<F, Io> Drop for OpenConnection<F, Io>
+impl<Io> Drop for OpenGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     fn drop(&mut self) {
-        if let Some(inner) = self.inner.take() {
-            let mut inner = inner.as_ref().borrow_mut();
+        if let Some(i) = self.inner.take() {
+            let mut inner = i.as_ref().borrow_mut();
             inner.release();
-            inner.check_availibility();
-        }
-    }
-}
-
-impl<F, Io> Future for OpenConnection<F, Io>
-where
-    F: Future<Item = (Io, Protocol), Error = ConnectError>,
-    Io: AsyncRead + AsyncWrite,
-{
-    type Item = IoConnection<Io>;
-    type Error = ConnectError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        if let Some(ref mut h2) = self.h2 {
-            return match h2.poll() {
-                Ok(Async::Ready((snd, connection))) => {
-                    tokio_current_thread::spawn(connection.map_err(|_| ()));
-                    Ok(Async::Ready(IoConnection::new(
-                        ConnectionType::H2(snd),
-                        Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
-                    )))
-                }
-                Ok(Async::NotReady) => Ok(Async::NotReady),
-                Err(e) => Err(e.into()),
-            };
-        }
-
-        match self.fut.poll() {
-            Err(err) => Err(err),
-            Ok(Async::Ready((io, proto))) => {
-                if proto == Protocol::Http1 {
-                    Ok(Async::Ready(IoConnection::new(
-                        ConnectionType::H1(io),
-                        Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
-                    )))
-                } else {
-                    self.h2 = Some(handshake(io));
-                    self.poll()
-                }
-            }
-            Ok(Async::NotReady) => Ok(Async::NotReady),
+            inner.check_availability();
         }
     }
 }
@@ -299,12 +255,9 @@ struct AvailableConnection<Io> {
 }
 
 pub(crate) struct Inner<Io> {
-    conn_lifetime: Duration,
-    conn_keep_alive: Duration,
-    disconnect_timeout: Option<Duration>,
-    limit: usize,
+    config: ConnectorConfig,
     acquired: usize,
-    available: HashMap<Key, VecDeque<AvailableConnection<Io>>>,
+    available: FxHashMap<Key, VecDeque<AvailableConnection<Io>>>,
     waiters: Slab<
         Option<(
             Connect,
@@ -312,7 +265,7 @@ pub(crate) struct Inner<Io> {
         )>,
     >,
     waiters_queue: IndexSet<(Key, usize)>,
-    task: Option<AtomicTask>,
+    waker: LocalWaker,
 }
 
 impl<Io> Inner<Io> {
@@ -332,7 +285,7 @@ impl<Io> Inner<Io> {
 
 impl<Io> Inner<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     /// connection is not available, wait
     fn wait_for(
@@ -341,22 +294,21 @@ where
     ) -> (
         oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
         usize,
-        bool,
     ) {
         let (tx, rx) = oneshot::channel();
 
-        let key: Key = connect.uri.authority_part().unwrap().clone().into();
+        let key: Key = connect.uri.authority().unwrap().clone().into();
         let entry = self.waiters.vacant_entry();
         let token = entry.key();
         entry.insert(Some((connect, tx)));
         assert!(self.waiters_queue.insert((key, token)));
 
-        (rx, token, self.task.is_some())
+        (rx, token)
     }
 
-    fn acquire(&mut self, key: &Key) -> Acquire<Io> {
+    fn acquire(&mut self, key: &Key, cx: &mut Context<'_>) -> Acquire<Io> {
         // check limits
-        if self.limit > 0 && self.acquired >= self.limit {
+        if self.config.limit > 0 && self.acquired >= self.config.limit {
             return Acquire::NotAvailable;
         }
 
@@ -368,33 +320,32 @@ where
             let now = Instant::now();
             while let Some(conn) = connections.pop_back() {
                 // check if it still usable
-                if (now - conn.used) > self.conn_keep_alive
-                    || (now - conn.created) > self.conn_lifetime
+                if (now - conn.used) > self.config.conn_keep_alive
+                    || (now - conn.created) > self.config.conn_lifetime
                 {
-                    if let Some(timeout) = self.disconnect_timeout {
+                    if let Some(timeout) = self.config.disconnect_timeout {
                         if let ConnectionType::H1(io) = conn.io {
-                            tokio_current_thread::spawn(CloseConnection::new(
-                                io, timeout,
-                            ))
+                            actix_rt::spawn(CloseConnection::new(io, timeout))
                         }
                     }
                 } else {
                     let mut io = conn.io;
                     let mut buf = [0; 2];
+                    let mut read_buf = ReadBuf::new(&mut buf);
                     if let ConnectionType::H1(ref mut s) = io {
-                        match s.read(&mut buf) {
-                            Err(ref e) if e.kind() == io::ErrorKind::WouldBlock => (),
-                            Ok(n) if n > 0 => {
-                                if let Some(timeout) = self.disconnect_timeout {
+                        match Pin::new(s).poll_read(cx, &mut read_buf) {
+                            Poll::Pending => {}
+                            Poll::Ready(Ok(())) if !read_buf.filled().is_empty() => {
+                                if let Some(timeout) = self.config.disconnect_timeout {
                                     if let ConnectionType::H1(io) = io {
-                                        tokio_current_thread::spawn(
-                                            CloseConnection::new(io, timeout),
-                                        )
+                                        actix_rt::spawn(CloseConnection::new(
+                                            io, timeout,
+                                        ))
                                     }
                                 }
                                 continue;
                             }
-                            Ok(_) | Err(_) => continue,
+                            _ => continue,
                         }
                     }
                     return Acquire::Acquired(io, conn.created);
@@ -414,36 +365,36 @@ where
                 created,
                 used: Instant::now(),
             });
-        self.check_availibility();
+        self.check_availability();
     }
 
     fn release_close(&mut self, io: ConnectionType<Io>) {
         self.acquired -= 1;
-        if let Some(timeout) = self.disconnect_timeout {
+        if let Some(timeout) = self.config.disconnect_timeout {
             if let ConnectionType::H1(io) = io {
-                tokio_current_thread::spawn(CloseConnection::new(io, timeout))
+                actix_rt::spawn(CloseConnection::new(io, timeout))
             }
         }
-        self.check_availibility();
+        self.check_availability();
     }
 
-    fn check_availibility(&self) {
-        if !self.waiters_queue.is_empty() && self.acquired < self.limit {
-            if let Some(t) = self.task.as_ref() {
-                t.notify()
-            }
+    fn check_availability(&self) {
+        if !self.waiters_queue.is_empty() && self.acquired < self.config.limit {
+            self.waker.wake();
         }
     }
 }
 
+#[pin_project::pin_project]
 struct CloseConnection<T> {
     io: T,
-    timeout: Delay,
+    #[pin]
+    timeout: Sleep,
 }
 
 impl<T> CloseConnection<T>
 where
-    T: AsyncWrite,
+    T: AsyncWrite + Unpin,
 {
     fn new(io: T, timeout: Duration) -> Self {
         CloseConnection {
@@ -455,25 +406,27 @@ where
 
 impl<T> Future for CloseConnection<T>
 where
-    T: AsyncWrite,
+    T: AsyncWrite + Unpin,
 {
-    type Item = ();
-    type Error = ();
+    type Output = ();
 
-    fn poll(&mut self) -> Poll<(), ()> {
-        match self.timeout.poll() {
-            Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
-            Ok(Async::NotReady) => match self.io.shutdown() {
-                Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
-                Ok(Async::NotReady) => Ok(Async::NotReady),
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<()> {
+        let this = self.project();
+
+        match this.timeout.poll(cx) {
+            Poll::Ready(_) => Poll::Ready(()),
+            Poll::Pending => match Pin::new(this.io).poll_shutdown(cx) {
+                Poll::Ready(_) => Poll::Ready(()),
+                Poll::Pending => Poll::Pending,
             },
         }
     }
 }
 
+#[pin_project]
 struct ConnectorPoolSupport<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     connector: T,
     inner: Rc<RefCell<Inner<Io>>>,
@@ -481,16 +434,23 @@ where
 
 impl<T, Io> Future for ConnectorPoolSupport<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
-    T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+    T: Service<Connect, Response = (Io, Protocol), Error = ConnectError>,
     T::Future: 'static,
 {
-    type Item = ();
-    type Error = ();
+    type Output = ();
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        let mut inner = self.inner.as_ref().borrow_mut();
-        inner.task.as_ref().unwrap().register();
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let this = self.project();
+
+        if Rc::strong_count(this.inner) == 1 {
+            // If we are last copy of Inner<Io> it means the ConnectionPool is already gone
+            // and we are safe to exit.
+            return Poll::Ready(());
+        }
+
+        let mut inner = this.inner.borrow_mut();
+        inner.waker.register(cx.waker());
 
         // check waiters
         loop {
@@ -505,14 +465,14 @@ where
                 continue;
             }
 
-            match inner.acquire(&key) {
+            match inner.acquire(&key, cx) {
                 Acquire::NotAvailable => break,
                 Acquire::Acquired(io, created) => {
                     let tx = inner.waiters.get_mut(token).unwrap().take().unwrap().1;
                     if let Err(conn) = tx.send(Ok(IoConnection::new(
                         io,
                         created,
-                        Some(Acquired(key.clone(), Some(self.inner.clone()))),
+                        Some(Acquired(key.clone(), Some(this.inner.clone()))),
                     ))) {
                         let (io, created) = conn.unwrap().into_inner();
                         inner.release_conn(&key, io, created);
@@ -524,118 +484,131 @@ where
                     OpenWaitingConnection::spawn(
                         key.clone(),
                         tx,
-                        self.inner.clone(),
-                        self.connector.call(connect),
+                        this.inner.clone(),
+                        this.connector.call(connect),
+                        inner.config.clone(),
                     );
                 }
             }
             let _ = inner.waiters_queue.swap_remove_index(0);
         }
 
-        Ok(Async::NotReady)
+        Poll::Pending
     }
 }
 
+#[pin_project::pin_project(PinnedDrop)]
 struct OpenWaitingConnection<F, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
+    #[pin]
     fut: F,
     key: Key,
-    h2: Option<Handshake<Io, Bytes>>,
+    h2: Option<
+        LocalBoxFuture<
+            'static,
+            Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>,
+        >,
+    >,
     rx: Option<oneshot::Sender<Result<IoConnection<Io>, ConnectError>>>,
     inner: Option<Rc<RefCell<Inner<Io>>>>,
+    config: ConnectorConfig,
 }
 
 impl<F, Io> OpenWaitingConnection<F, Io>
 where
-    F: Future<Item = (Io, Protocol), Error = ConnectError> + 'static,
-    Io: AsyncRead + AsyncWrite + 'static,
+    F: Future<Output = Result<(Io, Protocol), ConnectError>> + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     fn spawn(
         key: Key,
         rx: oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
         inner: Rc<RefCell<Inner<Io>>>,
         fut: F,
+        config: ConnectorConfig,
     ) {
-        tokio_current_thread::spawn(OpenWaitingConnection {
+        actix_rt::spawn(OpenWaitingConnection {
             key,
             fut,
             h2: None,
             rx: Some(rx),
             inner: Some(inner),
+            config,
         })
     }
 }
 
-impl<F, Io> Drop for OpenWaitingConnection<F, Io>
+#[pin_project::pinned_drop]
+impl<F, Io> PinnedDrop for OpenWaitingConnection<F, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    fn drop(&mut self) {
-        if let Some(inner) = self.inner.take() {
+    fn drop(self: Pin<&mut Self>) {
+        if let Some(inner) = self.project().inner.take() {
             let mut inner = inner.as_ref().borrow_mut();
             inner.release();
-            inner.check_availibility();
+            inner.check_availability();
         }
     }
 }
 
 impl<F, Io> Future for OpenWaitingConnection<F, Io>
 where
-    F: Future<Item = (Io, Protocol), Error = ConnectError>,
-    Io: AsyncRead + AsyncWrite,
+    F: Future<Output = Result<(Io, Protocol), ConnectError>>,
+    Io: AsyncRead + AsyncWrite + Unpin,
 {
-    type Item = ();
-    type Error = ();
+    type Output = ();
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        if let Some(ref mut h2) = self.h2 {
-            return match h2.poll() {
-                Ok(Async::Ready((snd, connection))) => {
-                    tokio_current_thread::spawn(connection.map_err(|_| ()));
-                    let rx = self.rx.take().unwrap();
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let this = self.as_mut().project();
+
+        if let Some(ref mut h2) = this.h2 {
+            return match Pin::new(h2).poll(cx) {
+                Poll::Ready(Ok((snd, connection))) => {
+                    actix_rt::spawn(connection.map(|_| ()));
+                    let rx = this.rx.take().unwrap();
                     let _ = rx.send(Ok(IoConnection::new(
                         ConnectionType::H2(snd),
                         Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
+                        Some(Acquired(this.key.clone(), this.inner.take())),
                     )));
-                    Ok(Async::Ready(()))
+                    Poll::Ready(())
                 }
-                Ok(Async::NotReady) => Ok(Async::NotReady),
-                Err(err) => {
-                    let _ = self.inner.take();
-                    if let Some(rx) = self.rx.take() {
+                Poll::Pending => Poll::Pending,
+                Poll::Ready(Err(err)) => {
+                    let _ = this.inner.take();
+                    if let Some(rx) = this.rx.take() {
                         let _ = rx.send(Err(ConnectError::H2(err)));
                     }
-                    Err(())
+                    Poll::Ready(())
                 }
             };
         }
 
-        match self.fut.poll() {
-            Err(err) => {
-                let _ = self.inner.take();
-                if let Some(rx) = self.rx.take() {
+        match this.fut.poll(cx) {
+            Poll::Ready(Err(err)) => {
+                let _ = this.inner.take();
+                if let Some(rx) = this.rx.take() {
                     let _ = rx.send(Err(err));
                 }
-                Err(())
+                Poll::Ready(())
             }
-            Ok(Async::Ready((io, proto))) => {
+            Poll::Ready(Ok((io, proto))) => {
                 if proto == Protocol::Http1 {
-                    let rx = self.rx.take().unwrap();
+                    let rx = this.rx.take().unwrap();
                     let _ = rx.send(Ok(IoConnection::new(
                         ConnectionType::H1(io),
                         Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
+                        Some(Acquired(this.key.clone(), this.inner.take())),
                     )));
-                    Ok(Async::Ready(()))
+                    Poll::Ready(())
                 } else {
-                    self.h2 = Some(handshake(io));
-                    self.poll()
+                    *this.h2 = Some(handshake(io, this.config).boxed_local());
+                    self.poll(cx)
                 }
             }
-            Ok(Async::NotReady) => Ok(Async::NotReady),
+            Poll::Pending => Poll::Pending,
         }
     }
 }
@@ -644,7 +617,7 @@ pub(crate) struct Acquired<T>(Key, Option<Rc<RefCell<Inner<T>>>>);
 
 impl<T> Acquired<T>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     pub(crate) fn close(&mut self, conn: IoConnection<T>) {
         if let Some(inner) = self.1.take() {

actix-http/src/cloneable.rs

@@ -1,42 +0,0 @@
-use std::cell::UnsafeCell;
-use std::rc::Rc;
-
-use actix_service::Service;
-use futures::Poll;
-
-#[doc(hidden)]
-/// Service that allows to turn non-clone service to a service with `Clone` impl
-pub(crate) struct CloneableService<T>(Rc<UnsafeCell<T>>);
-
-impl<T> CloneableService<T> {
-    pub(crate) fn new(service: T) -> Self
-    where
-        T: Service,
-    {
-        Self(Rc::new(UnsafeCell::new(service)))
-    }
-}
-
-impl<T> Clone for CloneableService<T> {
-    fn clone(&self) -> Self {
-        Self(self.0.clone())
-    }
-}
-
-impl<T> Service for CloneableService<T>
-where
-    T: Service,
-{
-    type Request = T::Request;
-    type Response = T::Response;
-    type Error = T::Error;
-    type Future = T::Future;
-
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        unsafe { &mut *self.0.as_ref().get() }.poll_ready()
-    }
-
-    fn call(&mut self, req: T::Request) -> Self::Future {
-        unsafe { &mut *self.0.as_ref().get() }.call(req)
-    }
-}

actix-http/src/config.rs

@@ -1,13 +1,13 @@
-use std::cell::UnsafeCell;
-use std::fmt;
+use std::cell::Cell;
 use std::fmt::Write;
 use std::rc::Rc;
-use std::time::{Duration, Instant};
+use std::time::Duration;
+use std::{fmt, net};
 
+use actix_rt::time::{sleep, sleep_until, Instant, Sleep};
 use bytes::BytesMut;
-use futures::{future, Future};
-use time;
-use tokio_timer::{sleep, Delay};
+use futures_util::{future, FutureExt};
+use time::OffsetDateTime;
 
 // "Sun, 06 Nov 1994 08:49:37 GMT".len()
 const DATE_VALUE_LENGTH: usize = 29;
@@ -17,7 +17,7 @@ const DATE_VALUE_LENGTH: usize = 29;
 pub enum KeepAlive {
     /// Keep alive in seconds
     Timeout(usize),
-    /// Relay on OS to shutdown tcp connection
+    /// Rely on OS to shutdown tcp connection
     Os,
     /// Disabled
     Disabled,
@@ -47,6 +47,8 @@ struct Inner {
     client_timeout: u64,
     client_disconnect: u64,
     ka_enabled: bool,
+    secure: bool,
+    local_addr: Option<std::net::SocketAddr>,
     timer: DateService,
 }
 
@@ -58,7 +60,7 @@ impl Clone for ServiceConfig {
 
 impl Default for ServiceConfig {
     fn default() -> Self {
-        Self::new(KeepAlive::Timeout(5), 0, 0)
+        Self::new(KeepAlive::Timeout(5), 0, 0, false, None)
     }
 }
 
@@ -68,6 +70,8 @@ impl ServiceConfig {
         keep_alive: KeepAlive,
         client_timeout: u64,
         client_disconnect: u64,
+        secure: bool,
+        local_addr: Option<net::SocketAddr>,
     ) -> ServiceConfig {
         let (keep_alive, ka_enabled) = match keep_alive {
             KeepAlive::Timeout(val) => (val as u64, true),
@@ -85,10 +89,24 @@ impl ServiceConfig {
             ka_enabled,
             client_timeout,
             client_disconnect,
+            secure,
+            local_addr,
             timer: DateService::new(),
         }))
     }
 
+    #[inline]
+    /// Returns true if connection is secure(https)
+    pub fn secure(&self) -> bool {
+        self.0.secure
+    }
+
+    #[inline]
+    /// Returns the local address that this server is bound to.
+    pub fn local_addr(&self) -> Option<net::SocketAddr> {
+        self.0.local_addr
+    }
+
     #[inline]
     /// Keep alive duration if configured.
     pub fn keep_alive(&self) -> Option<Duration> {
@@ -96,18 +114,18 @@ impl ServiceConfig {
     }
 
     #[inline]
-    /// Return state of connection keep-alive funcitonality
+    /// Return state of connection keep-alive functionality
     pub fn keep_alive_enabled(&self) -> bool {
         self.0.ka_enabled
     }
 
     #[inline]
     /// Client timeout for first request.
-    pub fn client_timer(&self) -> Option<Delay> {
-        let delay = self.0.client_timeout;
-        if delay != 0 {
-            Some(Delay::new(
-                self.0.timer.now() + Duration::from_millis(delay),
+    pub fn client_timer(&self) -> Option<Sleep> {
+        let delay_time = self.0.client_timeout;
+        if delay_time != 0 {
+            Some(sleep_until(
+                self.0.timer.now() + Duration::from_millis(delay_time),
             ))
         } else {
             None
@@ -136,9 +154,9 @@ impl ServiceConfig {
 
     #[inline]
     /// Return keep-alive timer delay is configured.
-    pub fn keep_alive_timer(&self) -> Option<Delay> {
+    pub fn keep_alive_timer(&self) -> Option<Sleep> {
         if let Some(ka) = self.0.keep_alive {
-            Some(Delay::new(self.0.timer.now() + ka))
+            Some(sleep_until(self.0.timer.now() + ka))
         } else {
             None
         }
@@ -191,9 +209,15 @@ impl Date {
         date.update();
         date
     }
+
     fn update(&mut self) {
         self.pos = 0;
-        write!(self, "{}", time::at_utc(time::get_time()).rfc822()).unwrap();
+        write!(
+            self,
+            "{}",
+            OffsetDateTime::now_utc().format("%a, %d %b %Y %H:%M:%S GMT")
+        )
+        .unwrap();
     }
 }
 
@@ -210,24 +234,24 @@ impl fmt::Write for Date {
 struct DateService(Rc<DateServiceInner>);
 
 struct DateServiceInner {
-    current: UnsafeCell<Option<(Date, Instant)>>,
+    current: Cell<Option<(Date, Instant)>>,
 }
 
 impl DateServiceInner {
     fn new() -> Self {
         DateServiceInner {
-            current: UnsafeCell::new(None),
+            current: Cell::new(None),
         }
     }
 
     fn reset(&self) {
-        unsafe { (&mut *self.current.get()).take() };
+        self.current.take();
     }
 
     fn update(&self) {
         let now = Instant::now();
         let date = Date::new();
-        *(unsafe { &mut *self.current.get() }) = Some((date, now));
+        self.current.set(Some((date, now)));
     }
 }
 
@@ -237,54 +261,55 @@ impl DateService {
     }
 
     fn check_date(&self) {
-        if unsafe { (&*self.0.current.get()).is_none() } {
+        if self.0.current.get().is_none() {
             self.0.update();
 
             // periodic date update
             let s = self.clone();
-            tokio_current_thread::spawn(sleep(Duration::from_millis(500)).then(
-                move |_| {
-                    s.0.reset();
-                    future::ok(())
-                },
-            ));
+            actix_rt::spawn(sleep(Duration::from_millis(500)).then(move |_| {
+                s.0.reset();
+                future::ready(())
+            }));
         }
     }
 
     fn now(&self) -> Instant {
         self.check_date();
-        unsafe { (&*self.0.current.get()).as_ref().unwrap().1 }
+        self.0.current.get().unwrap().1
     }
 
     fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
         self.check_date();
-        f(&unsafe { (&*self.0.current.get()).as_ref().unwrap().0 })
+        f(&self.0.current.get().unwrap().0);
     }
 }
 
 #[cfg(test)]
 mod tests {
     use super::*;
-    use actix_rt::System;
-    use futures::future;
+
+    // Test modifying the date from within the closure
+    // passed to `set_date`
+    #[test]
+    fn test_evil_date() {
+        let service = DateService::new();
+        // Make sure that `check_date` doesn't try to spawn a task
+        service.0.update();
+        service.set_date(|_| service.0.reset());
+    }
 
     #[test]
     fn test_date_len() {
         assert_eq!(DATE_VALUE_LENGTH, "Sun, 06 Nov 1994 08:49:37 GMT".len());
     }
 
-    #[test]
-    fn test_date() {
-        let mut rt = System::new("test");
-
-        let _ = rt.block_on(future::lazy(|| {
-            let settings = ServiceConfig::new(KeepAlive::Os, 0, 0);
-            let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
-            settings.set_date(&mut buf1);
-            let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
-            settings.set_date(&mut buf2);
-            assert_eq!(buf1, buf2);
-            future::ok::<_, ()>(())
-        }));
+    #[actix_rt::test]
+    async fn test_date() {
+        let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
+        let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
+        settings.set_date(&mut buf1);
+        let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
+        settings.set_date(&mut buf2);
+        assert_eq!(buf1, buf2);
     }
 }

actix-http/src/cookie/builder.rs

@@ -1,260 +0,0 @@
-use std::borrow::Cow;
-
-use chrono::Duration;
-use time::Tm;
-
-use super::{Cookie, SameSite};
-
-/// Structure that follows the builder pattern for building `Cookie` structs.
-///
-/// To construct a cookie:
-///
-///   1. Call [`Cookie::build`](struct.Cookie.html#method.build) to start building.
-///   2. Use any of the builder methods to set fields in the cookie.
-///   3. Call [finish](#method.finish) to retrieve the built cookie.
-///
-/// # Example
-///
-/// ```rust
-/// use actix_http::cookie::Cookie;
-///
-/// # fn main() {
-/// let cookie: Cookie = Cookie::build("name", "value")
-///     .domain("www.rust-lang.org")
-///     .path("/")
-///     .secure(true)
-///     .http_only(true)
-///     .max_age(84600)
-///     .finish();
-/// # }
-/// ```
-#[derive(Debug, Clone)]
-pub struct CookieBuilder {
-    /// The cookie being built.
-    cookie: Cookie<'static>,
-}
-
-impl CookieBuilder {
-    /// Creates a new `CookieBuilder` instance from the given name and value.
-    ///
-    /// This method is typically called indirectly via
-    /// [Cookie::build](struct.Cookie.html#method.build).
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar").finish();
-    /// assert_eq!(c.name_value(), ("foo", "bar"));
-    /// ```
-    pub fn new<N, V>(name: N, value: V) -> CookieBuilder
-    where
-        N: Into<Cow<'static, str>>,
-        V: Into<Cow<'static, str>>,
-    {
-        CookieBuilder {
-            cookie: Cookie::new(name, value),
-        }
-    }
-
-    /// Sets the `expires` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// # fn main() {
-    /// let c = Cookie::build("foo", "bar")
-    ///     .expires(time::now())
-    ///     .finish();
-    ///
-    /// assert!(c.expires().is_some());
-    /// # }
-    /// ```
-    #[inline]
-    pub fn expires(mut self, when: Tm) -> CookieBuilder {
-        self.cookie.set_expires(when);
-        self
-    }
-
-    /// Sets the `max_age` field in seconds in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// # fn main() {
-    /// let c = Cookie::build("foo", "bar")
-    ///     .max_age(1800)
-    ///     .finish();
-    ///
-    /// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
-    /// # }
-    /// ```
-    #[inline]
-    pub fn max_age(self, seconds: i64) -> CookieBuilder {
-        self.max_age_time(Duration::seconds(seconds))
-    }
-
-    /// Sets the `max_age` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// # fn main() {
-    /// let c = Cookie::build("foo", "bar")
-    ///     .max_age_time(time::Duration::minutes(30))
-    ///     .finish();
-    ///
-    /// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
-    /// # }
-    /// ```
-    #[inline]
-    pub fn max_age_time(mut self, value: Duration) -> CookieBuilder {
-        self.cookie.set_max_age(value);
-        self
-    }
-
-    /// Sets the `domain` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .domain("www.rust-lang.org")
-    ///     .finish();
-    ///
-    /// assert_eq!(c.domain(), Some("www.rust-lang.org"));
-    /// ```
-    pub fn domain<D: Into<Cow<'static, str>>>(mut self, value: D) -> CookieBuilder {
-        self.cookie.set_domain(value);
-        self
-    }
-
-    /// Sets the `path` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .path("/")
-    ///     .finish();
-    ///
-    /// assert_eq!(c.path(), Some("/"));
-    /// ```
-    pub fn path<P: Into<Cow<'static, str>>>(mut self, path: P) -> CookieBuilder {
-        self.cookie.set_path(path);
-        self
-    }
-
-    /// Sets the `secure` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .secure(true)
-    ///     .finish();
-    ///
-    /// assert_eq!(c.secure(), Some(true));
-    /// ```
-    #[inline]
-    pub fn secure(mut self, value: bool) -> CookieBuilder {
-        self.cookie.set_secure(value);
-        self
-    }
-
-    /// Sets the `http_only` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .http_only(true)
-    ///     .finish();
-    ///
-    /// assert_eq!(c.http_only(), Some(true));
-    /// ```
-    #[inline]
-    pub fn http_only(mut self, value: bool) -> CookieBuilder {
-        self.cookie.set_http_only(value);
-        self
-    }
-
-    /// Sets the `same_site` field in the cookie being built.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{Cookie, SameSite};
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .same_site(SameSite::Strict)
-    ///     .finish();
-    ///
-    /// assert_eq!(c.same_site(), Some(SameSite::Strict));
-    /// ```
-    #[inline]
-    pub fn same_site(mut self, value: SameSite) -> CookieBuilder {
-        self.cookie.set_same_site(value);
-        self
-    }
-
-    /// Makes the cookie being built 'permanent' by extending its expiration and
-    /// max age 20 years into the future.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    /// use chrono::Duration;
-    ///
-    /// # fn main() {
-    /// let c = Cookie::build("foo", "bar")
-    ///     .permanent()
-    ///     .finish();
-    ///
-    /// assert_eq!(c.max_age(), Some(Duration::days(365 * 20)));
-    /// # assert!(c.expires().is_some());
-    /// # }
-    /// ```
-    #[inline]
-    pub fn permanent(mut self) -> CookieBuilder {
-        self.cookie.make_permanent();
-        self
-    }
-
-    /// Finishes building and returns the built `Cookie`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Cookie;
-    ///
-    /// let c = Cookie::build("foo", "bar")
-    ///     .domain("crates.io")
-    ///     .path("/")
-    ///     .finish();
-    ///
-    /// assert_eq!(c.name_value(), ("foo", "bar"));
-    /// assert_eq!(c.domain(), Some("crates.io"));
-    /// assert_eq!(c.path(), Some("/"));
-    /// ```
-    #[inline]
-    pub fn finish(self) -> Cookie<'static> {
-        self.cookie
-    }
-}

actix-http/src/cookie/delta.rs

@@ -1,71 +0,0 @@
-use std::borrow::Borrow;
-use std::hash::{Hash, Hasher};
-use std::ops::{Deref, DerefMut};
-
-use super::Cookie;
-
-/// A `DeltaCookie` is a helper structure used in a cookie jar. It wraps a
-/// `Cookie` so that it can be hashed and compared purely by name. It further
-/// records whether the wrapped cookie is a "removal" cookie, that is, a cookie
-/// that when sent to the client removes the named cookie on the client's
-/// machine.
-#[derive(Clone, Debug)]
-pub struct DeltaCookie {
-    pub cookie: Cookie<'static>,
-    pub removed: bool,
-}
-
-impl DeltaCookie {
-    /// Create a new `DeltaCookie` that is being added to a jar.
-    #[inline]
-    pub fn added(cookie: Cookie<'static>) -> DeltaCookie {
-        DeltaCookie {
-            cookie,
-            removed: false,
-        }
-    }
-
-    /// Create a new `DeltaCookie` that is being removed from a jar. The
-    /// `cookie` should be a "removal" cookie.
-    #[inline]
-    pub fn removed(cookie: Cookie<'static>) -> DeltaCookie {
-        DeltaCookie {
-            cookie,
-            removed: true,
-        }
-    }
-}
-
-impl Deref for DeltaCookie {
-    type Target = Cookie<'static>;
-
-    fn deref(&self) -> &Cookie<'static> {
-        &self.cookie
-    }
-}
-
-impl DerefMut for DeltaCookie {
-    fn deref_mut(&mut self) -> &mut Cookie<'static> {
-        &mut self.cookie
-    }
-}
-
-impl PartialEq for DeltaCookie {
-    fn eq(&self, other: &DeltaCookie) -> bool {
-        self.name() == other.name()
-    }
-}
-
-impl Eq for DeltaCookie {}
-
-impl Hash for DeltaCookie {
-    fn hash<H: Hasher>(&self, state: &mut H) {
-        self.name().hash(state);
-    }
-}
-
-impl Borrow<str> for DeltaCookie {
-    fn borrow(&self) -> &str {
-        self.name()
-    }
-}

actix-http/src/cookie/draft.rs

@@ -1,98 +0,0 @@
-//! This module contains types that represent cookie properties that are not yet
-//! standardized. That is, _draft_ features.
-
-use std::fmt;
-
-/// The `SameSite` cookie attribute.
-///
-/// A cookie with a `SameSite` attribute is imposed restrictions on when it is
-/// sent to the origin server in a cross-site request. If the `SameSite`
-/// attribute is "Strict", then the cookie is never sent in cross-site requests.
-/// If the `SameSite` attribute is "Lax", the cookie is only sent in cross-site
-/// requests with "safe" HTTP methods, i.e, `GET`, `HEAD`, `OPTIONS`, `TRACE`.
-/// If the `SameSite` attribute is not present (made explicit via the
-/// `SameSite::None` variant), then the cookie will be sent as normal.
-///
-/// **Note:** This cookie attribute is an HTTP draft! Its meaning and definition
-/// are subject to change.
-#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
-pub enum SameSite {
-    /// The "Strict" `SameSite` attribute.
-    Strict,
-    /// The "Lax" `SameSite` attribute.
-    Lax,
-    /// No `SameSite` attribute.
-    None,
-}
-
-impl SameSite {
-    /// Returns `true` if `self` is `SameSite::Strict` and `false` otherwise.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::SameSite;
-    ///
-    /// let strict = SameSite::Strict;
-    /// assert!(strict.is_strict());
-    /// assert!(!strict.is_lax());
-    /// assert!(!strict.is_none());
-    /// ```
-    #[inline]
-    pub fn is_strict(self) -> bool {
-        match self {
-            SameSite::Strict => true,
-            SameSite::Lax | SameSite::None => false,
-        }
-    }
-
-    /// Returns `true` if `self` is `SameSite::Lax` and `false` otherwise.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::SameSite;
-    ///
-    /// let lax = SameSite::Lax;
-    /// assert!(lax.is_lax());
-    /// assert!(!lax.is_strict());
-    /// assert!(!lax.is_none());
-    /// ```
-    #[inline]
-    pub fn is_lax(self) -> bool {
-        match self {
-            SameSite::Lax => true,
-            SameSite::Strict | SameSite::None => false,
-        }
-    }
-
-    /// Returns `true` if `self` is `SameSite::None` and `false` otherwise.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::SameSite;
-    ///
-    /// let none = SameSite::None;
-    /// assert!(none.is_none());
-    /// assert!(!none.is_lax());
-    /// assert!(!none.is_strict());
-    /// ```
-    #[inline]
-    pub fn is_none(self) -> bool {
-        match self {
-            SameSite::None => true,
-            SameSite::Lax | SameSite::Strict => false,
-        }
-    }
-}
-
-impl fmt::Display for SameSite {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
-        match *self {
-            SameSite::Strict => write!(f, "Strict"),
-            SameSite::Lax => write!(f, "Lax"),
-            SameSite::None => Ok(()),
-        }
-    }
-}

actix-http/src/cookie/jar.rs

@@ -1,655 +0,0 @@
-use std::collections::HashSet;
-use std::mem::replace;
-
-use chrono::Duration;
-
-use super::delta::DeltaCookie;
-use super::Cookie;
-
-#[cfg(feature = "secure-cookies")]
-use super::secure::{Key, PrivateJar, SignedJar};
-
-/// A collection of cookies that tracks its modifications.
-///
-/// A `CookieJar` provides storage for any number of cookies. Any changes made
-/// to the jar are tracked; the changes can be retrieved via the
-/// [delta](#method.delta) method which returns an interator over the changes.
-///
-/// # Usage
-///
-/// A jar's life begins via [new](#method.new) and calls to
-/// [`add_original`](#method.add_original):
-///
-/// ```rust
-/// use actix_http::cookie::{Cookie, CookieJar};
-///
-/// let mut jar = CookieJar::new();
-/// jar.add_original(Cookie::new("name", "value"));
-/// jar.add_original(Cookie::new("second", "another"));
-/// ```
-///
-/// Cookies can be added via [add](#method.add) and removed via
-/// [remove](#method.remove). Finally, cookies can be looked up via
-/// [get](#method.get):
-///
-/// ```rust
-/// # use actix_http::cookie::{Cookie, CookieJar};
-/// let mut jar = CookieJar::new();
-/// jar.add(Cookie::new("a", "one"));
-/// jar.add(Cookie::new("b", "two"));
-///
-/// assert_eq!(jar.get("a").map(|c| c.value()), Some("one"));
-/// assert_eq!(jar.get("b").map(|c| c.value()), Some("two"));
-///
-/// jar.remove(Cookie::named("b"));
-/// assert!(jar.get("b").is_none());
-/// ```
-///
-/// # Deltas
-///
-/// A jar keeps track of any modifications made to it over time. The
-/// modifications are recorded as cookies. The modifications can be retrieved
-/// via [delta](#method.delta). Any new `Cookie` added to a jar via `add`
-/// results in the same `Cookie` appearing in the `delta`; cookies added via
-/// `add_original` do not count towards the delta. Any _original_ cookie that is
-/// removed from a jar results in a "removal" cookie appearing in the delta. A
-/// "removal" cookie is a cookie that a server sends so that the cookie is
-/// removed from the client's machine.
-///
-/// Deltas are typically used to create `Set-Cookie` headers corresponding to
-/// the changes made to a cookie jar over a period of time.
-///
-/// ```rust
-/// # use actix_http::cookie::{Cookie, CookieJar};
-/// let mut jar = CookieJar::new();
-///
-/// // original cookies don't affect the delta
-/// jar.add_original(Cookie::new("original", "value"));
-/// assert_eq!(jar.delta().count(), 0);
-///
-/// // new cookies result in an equivalent `Cookie` in the delta
-/// jar.add(Cookie::new("a", "one"));
-/// jar.add(Cookie::new("b", "two"));
-/// assert_eq!(jar.delta().count(), 2);
-///
-/// // removing an original cookie adds a "removal" cookie to the delta
-/// jar.remove(Cookie::named("original"));
-/// assert_eq!(jar.delta().count(), 3);
-///
-/// // removing a new cookie that was added removes that `Cookie` from the delta
-/// jar.remove(Cookie::named("a"));
-/// assert_eq!(jar.delta().count(), 2);
-/// ```
-#[derive(Default, Debug, Clone)]
-pub struct CookieJar {
-    original_cookies: HashSet<DeltaCookie>,
-    delta_cookies: HashSet<DeltaCookie>,
-}
-
-impl CookieJar {
-    /// Creates an empty cookie jar.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::CookieJar;
-    ///
-    /// let jar = CookieJar::new();
-    /// assert_eq!(jar.iter().count(), 0);
-    /// ```
-    pub fn new() -> CookieJar {
-        CookieJar::default()
-    }
-
-    /// Returns a reference to the `Cookie` inside this jar with the name
-    /// `name`. If no such cookie exists, returns `None`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// assert!(jar.get("name").is_none());
-    ///
-    /// jar.add(Cookie::new("name", "value"));
-    /// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
-    /// ```
-    pub fn get(&self, name: &str) -> Option<&Cookie<'static>> {
-        self.delta_cookies
-            .get(name)
-            .or_else(|| self.original_cookies.get(name))
-            .and_then(|c| if !c.removed { Some(&c.cookie) } else { None })
-    }
-
-    /// Adds an "original" `cookie` to this jar. If an original cookie with the
-    /// same name already exists, it is replaced with `cookie`. Cookies added
-    /// with `add` take precedence and are not replaced by this method.
-    ///
-    /// Adding an original cookie does not affect the [delta](#method.delta)
-    /// computation. This method is intended to be used to seed the cookie jar
-    /// with cookies received from a client's HTTP message.
-    ///
-    /// For accurate `delta` computations, this method should not be called
-    /// after calling `remove`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// jar.add_original(Cookie::new("name", "value"));
-    /// jar.add_original(Cookie::new("second", "two"));
-    ///
-    /// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
-    /// assert_eq!(jar.get("second").map(|c| c.value()), Some("two"));
-    /// assert_eq!(jar.iter().count(), 2);
-    /// assert_eq!(jar.delta().count(), 0);
-    /// ```
-    pub fn add_original(&mut self, cookie: Cookie<'static>) {
-        self.original_cookies.replace(DeltaCookie::added(cookie));
-    }
-
-    /// Adds `cookie` to this jar. If a cookie with the same name already
-    /// exists, it is replaced with `cookie`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// jar.add(Cookie::new("name", "value"));
-    /// jar.add(Cookie::new("second", "two"));
-    ///
-    /// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
-    /// assert_eq!(jar.get("second").map(|c| c.value()), Some("two"));
-    /// assert_eq!(jar.iter().count(), 2);
-    /// assert_eq!(jar.delta().count(), 2);
-    /// ```
-    pub fn add(&mut self, cookie: Cookie<'static>) {
-        self.delta_cookies.replace(DeltaCookie::added(cookie));
-    }
-
-    /// Removes `cookie` from this jar. If an _original_ cookie with the same
-    /// name as `cookie` is present in the jar, a _removal_ cookie will be
-    /// present in the `delta` computation. To properly generate the removal
-    /// cookie, `cookie` must contain the same `path` and `domain` as the cookie
-    /// that was initially set.
-    ///
-    /// A "removal" cookie is a cookie that has the same name as the original
-    /// cookie but has an empty value, a max-age of 0, and an expiration date
-    /// far in the past.
-    ///
-    /// # Example
-    ///
-    /// Removing an _original_ cookie results in a _removal_ cookie:
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    /// use chrono::Duration;
-    ///
-    /// # fn main() {
-    /// let mut jar = CookieJar::new();
-    ///
-    /// // Assume this cookie originally had a path of "/" and domain of "a.b".
-    /// jar.add_original(Cookie::new("name", "value"));
-    ///
-    /// // If the path and domain were set, they must be provided to `remove`.
-    /// jar.remove(Cookie::build("name", "").path("/").domain("a.b").finish());
-    ///
-    /// // The delta will contain the removal cookie.
-    /// let delta: Vec<_> = jar.delta().collect();
-    /// assert_eq!(delta.len(), 1);
-    /// assert_eq!(delta[0].name(), "name");
-    /// assert_eq!(delta[0].max_age(), Some(Duration::seconds(0)));
-    /// # }
-    /// ```
-    ///
-    /// Removing a new cookie does not result in a _removal_ cookie:
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// jar.add(Cookie::new("name", "value"));
-    /// assert_eq!(jar.delta().count(), 1);
-    ///
-    /// jar.remove(Cookie::named("name"));
-    /// assert_eq!(jar.delta().count(), 0);
-    /// ```
-    pub fn remove(&mut self, mut cookie: Cookie<'static>) {
-        if self.original_cookies.contains(cookie.name()) {
-            cookie.set_value("");
-            cookie.set_max_age(Duration::seconds(0));
-            cookie.set_expires(time::now() - Duration::days(365));
-            self.delta_cookies.replace(DeltaCookie::removed(cookie));
-        } else {
-            self.delta_cookies.remove(cookie.name());
-        }
-    }
-
-    /// Removes `cookie` from this jar completely. This method differs from
-    /// `remove` in that no delta cookie is created under any condition. Neither
-    /// the `delta` nor `iter` methods will return a cookie that is removed
-    /// using this method.
-    ///
-    /// # Example
-    ///
-    /// Removing an _original_ cookie; no _removal_ cookie is generated:
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    /// use chrono::Duration;
-    ///
-    /// # fn main() {
-    /// let mut jar = CookieJar::new();
-    ///
-    /// // Add an original cookie and a new cookie.
-    /// jar.add_original(Cookie::new("name", "value"));
-    /// jar.add(Cookie::new("key", "value"));
-    /// assert_eq!(jar.delta().count(), 1);
-    /// assert_eq!(jar.iter().count(), 2);
-    ///
-    /// // Now force remove the original cookie.
-    /// jar.force_remove(Cookie::new("name", "value"));
-    /// assert_eq!(jar.delta().count(), 1);
-    /// assert_eq!(jar.iter().count(), 1);
-    ///
-    /// // Now force remove the new cookie.
-    /// jar.force_remove(Cookie::new("key", "value"));
-    /// assert_eq!(jar.delta().count(), 0);
-    /// assert_eq!(jar.iter().count(), 0);
-    /// # }
-    /// ```
-    pub fn force_remove<'a>(&mut self, cookie: Cookie<'a>) {
-        self.original_cookies.remove(cookie.name());
-        self.delta_cookies.remove(cookie.name());
-    }
-
-    /// Removes all cookies from this cookie jar.
-    #[deprecated(
-        since = "0.7.0",
-        note = "calling this method may not remove \
-                all cookies since the path and domain are not specified; use \
-                `remove` instead"
-    )]
-    pub fn clear(&mut self) {
-        self.delta_cookies.clear();
-        for delta in replace(&mut self.original_cookies, HashSet::new()) {
-            self.remove(delta.cookie);
-        }
-    }
-
-    /// Returns an iterator over cookies that represent the changes to this jar
-    /// over time. These cookies can be rendered directly as `Set-Cookie` header
-    /// values to affect the changes made to this jar on the client.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    /// jar.add_original(Cookie::new("name", "value"));
-    /// jar.add_original(Cookie::new("second", "two"));
-    ///
-    /// // Add new cookies.
-    /// jar.add(Cookie::new("new", "third"));
-    /// jar.add(Cookie::new("another", "fourth"));
-    /// jar.add(Cookie::new("yac", "fifth"));
-    ///
-    /// // Remove some cookies.
-    /// jar.remove(Cookie::named("name"));
-    /// jar.remove(Cookie::named("another"));
-    ///
-    /// // Delta contains two new cookies ("new", "yac") and a removal ("name").
-    /// assert_eq!(jar.delta().count(), 3);
-    /// ```
-    pub fn delta(&self) -> Delta {
-        Delta {
-            iter: self.delta_cookies.iter(),
-        }
-    }
-
-    /// Returns an iterator over all of the cookies present in this jar.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie};
-    ///
-    /// let mut jar = CookieJar::new();
-    ///
-    /// jar.add_original(Cookie::new("name", "value"));
-    /// jar.add_original(Cookie::new("second", "two"));
-    ///
-    /// jar.add(Cookie::new("new", "third"));
-    /// jar.add(Cookie::new("another", "fourth"));
-    /// jar.add(Cookie::new("yac", "fifth"));
-    ///
-    /// jar.remove(Cookie::named("name"));
-    /// jar.remove(Cookie::named("another"));
-    ///
-    /// // There are three cookies in the jar: "second", "new", and "yac".
-    /// # assert_eq!(jar.iter().count(), 3);
-    /// for cookie in jar.iter() {
-    ///     match cookie.name() {
-    ///         "second" => assert_eq!(cookie.value(), "two"),
-    ///         "new" => assert_eq!(cookie.value(), "third"),
-    ///         "yac" => assert_eq!(cookie.value(), "fifth"),
-    ///         _ => unreachable!("there are only three cookies in the jar")
-    ///     }
-    /// }
-    /// ```
-    pub fn iter(&self) -> Iter {
-        Iter {
-            delta_cookies: self
-                .delta_cookies
-                .iter()
-                .chain(self.original_cookies.difference(&self.delta_cookies)),
-        }
-    }
-
-    /// Returns a `PrivateJar` with `self` as its parent jar using the key `key`
-    /// to sign/encrypt and verify/decrypt cookies added/retrieved from the
-    /// child jar.
-    ///
-    /// Any modifications to the child jar will be reflected on the parent jar,
-    /// and any retrievals from the child jar will be made from the parent jar.
-    ///
-    /// This method is only available when the `secure` feature is enabled.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{Cookie, CookieJar, Key};
-    ///
-    /// // Generate a secure key.
-    /// let key = Key::generate();
-    ///
-    /// // Add a private (signed + encrypted) cookie.
-    /// let mut jar = CookieJar::new();
-    /// jar.private(&key).add(Cookie::new("private", "text"));
-    ///
-    /// // The cookie's contents are encrypted.
-    /// assert_ne!(jar.get("private").unwrap().value(), "text");
-    ///
-    /// // They can be decrypted and verified through the child jar.
-    /// assert_eq!(jar.private(&key).get("private").unwrap().value(), "text");
-    ///
-    /// // A tampered with cookie does not validate but still exists.
-    /// let mut cookie = jar.get("private").unwrap().clone();
-    /// jar.add(Cookie::new("private", cookie.value().to_string() + "!"));
-    /// assert!(jar.private(&key).get("private").is_none());
-    /// assert!(jar.get("private").is_some());
-    /// ```
-    #[cfg(feature = "secure-cookies")]
-    pub fn private(&mut self, key: &Key) -> PrivateJar {
-        PrivateJar::new(self, key)
-    }
-
-    /// Returns a `SignedJar` with `self` as its parent jar using the key `key`
-    /// to sign/verify cookies added/retrieved from the child jar.
-    ///
-    /// Any modifications to the child jar will be reflected on the parent jar,
-    /// and any retrievals from the child jar will be made from the parent jar.
-    ///
-    /// This method is only available when the `secure` feature is enabled.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{Cookie, CookieJar, Key};
-    ///
-    /// // Generate a secure key.
-    /// let key = Key::generate();
-    ///
-    /// // Add a signed cookie.
-    /// let mut jar = CookieJar::new();
-    /// jar.signed(&key).add(Cookie::new("signed", "text"));
-    ///
-    /// // The cookie's contents are signed but still in plaintext.
-    /// assert_ne!(jar.get("signed").unwrap().value(), "text");
-    /// assert!(jar.get("signed").unwrap().value().contains("text"));
-    ///
-    /// // They can be verified through the child jar.
-    /// assert_eq!(jar.signed(&key).get("signed").unwrap().value(), "text");
-    ///
-    /// // A tampered with cookie does not validate but still exists.
-    /// let mut cookie = jar.get("signed").unwrap().clone();
-    /// jar.add(Cookie::new("signed", cookie.value().to_string() + "!"));
-    /// assert!(jar.signed(&key).get("signed").is_none());
-    /// assert!(jar.get("signed").is_some());
-    /// ```
-    #[cfg(feature = "secure-cookies")]
-    pub fn signed(&mut self, key: &Key) -> SignedJar {
-        SignedJar::new(self, key)
-    }
-}
-
-use std::collections::hash_set::Iter as HashSetIter;
-
-/// Iterator over the changes to a cookie jar.
-pub struct Delta<'a> {
-    iter: HashSetIter<'a, DeltaCookie>,
-}
-
-impl<'a> Iterator for Delta<'a> {
-    type Item = &'a Cookie<'static>;
-
-    fn next(&mut self) -> Option<&'a Cookie<'static>> {
-        self.iter.next().map(|c| &c.cookie)
-    }
-}
-
-use std::collections::hash_map::RandomState;
-use std::collections::hash_set::Difference;
-use std::iter::Chain;
-
-/// Iterator over all of the cookies in a jar.
-pub struct Iter<'a> {
-    delta_cookies:
-        Chain<HashSetIter<'a, DeltaCookie>, Difference<'a, DeltaCookie, RandomState>>,
-}
-
-impl<'a> Iterator for Iter<'a> {
-    type Item = &'a Cookie<'static>;
-
-    fn next(&mut self) -> Option<&'a Cookie<'static>> {
-        for cookie in self.delta_cookies.by_ref() {
-            if !cookie.removed {
-                return Some(&*cookie);
-            }
-        }
-
-        None
-    }
-}
-
-#[cfg(test)]
-mod test {
-    #[cfg(feature = "secure-cookies")]
-    use super::Key;
-    use super::{Cookie, CookieJar};
-
-    #[test]
-    #[allow(deprecated)]
-    fn simple() {
-        let mut c = CookieJar::new();
-
-        c.add(Cookie::new("test", ""));
-        c.add(Cookie::new("test2", ""));
-        c.remove(Cookie::named("test"));
-
-        assert!(c.get("test").is_none());
-        assert!(c.get("test2").is_some());
-
-        c.add(Cookie::new("test3", ""));
-        c.clear();
-
-        assert!(c.get("test").is_none());
-        assert!(c.get("test2").is_none());
-        assert!(c.get("test3").is_none());
-    }
-
-    #[test]
-    fn jar_is_send() {
-        fn is_send<T: Send>(_: T) -> bool {
-            true
-        }
-
-        assert!(is_send(CookieJar::new()))
-    }
-
-    #[test]
-    #[cfg(feature = "secure-cookies")]
-    fn iter() {
-        let key = Key::generate();
-        let mut c = CookieJar::new();
-
-        c.add_original(Cookie::new("original", "original"));
-
-        c.add(Cookie::new("test", "test"));
-        c.add(Cookie::new("test2", "test2"));
-        c.add(Cookie::new("test3", "test3"));
-        assert_eq!(c.iter().count(), 4);
-
-        c.signed(&key).add(Cookie::new("signed", "signed"));
-        c.private(&key).add(Cookie::new("encrypted", "encrypted"));
-        assert_eq!(c.iter().count(), 6);
-
-        c.remove(Cookie::named("test"));
-        assert_eq!(c.iter().count(), 5);
-
-        c.remove(Cookie::named("signed"));
-        c.remove(Cookie::named("test2"));
-        assert_eq!(c.iter().count(), 3);
-
-        c.add(Cookie::new("test2", "test2"));
-        assert_eq!(c.iter().count(), 4);
-
-        c.remove(Cookie::named("test2"));
-        assert_eq!(c.iter().count(), 3);
-    }
-
-    #[test]
-    #[cfg(feature = "secure-cookies")]
-    fn delta() {
-        use chrono::Duration;
-        use std::collections::HashMap;
-
-        let mut c = CookieJar::new();
-
-        c.add_original(Cookie::new("original", "original"));
-        c.add_original(Cookie::new("original1", "original1"));
-
-        c.add(Cookie::new("test", "test"));
-        c.add(Cookie::new("test2", "test2"));
-        c.add(Cookie::new("test3", "test3"));
-        c.add(Cookie::new("test4", "test4"));
-
-        c.remove(Cookie::named("test"));
-        c.remove(Cookie::named("original"));
-
-        assert_eq!(c.delta().count(), 4);
-
-        let names: HashMap<_, _> = c.delta().map(|c| (c.name(), c.max_age())).collect();
-
-        assert!(names.get("test2").unwrap().is_none());
-        assert!(names.get("test3").unwrap().is_none());
-        assert!(names.get("test4").unwrap().is_none());
-        assert_eq!(names.get("original").unwrap(), &Some(Duration::seconds(0)));
-    }
-
-    #[test]
-    fn replace_original() {
-        let mut jar = CookieJar::new();
-        jar.add_original(Cookie::new("original_a", "a"));
-        jar.add_original(Cookie::new("original_b", "b"));
-        assert_eq!(jar.get("original_a").unwrap().value(), "a");
-
-        jar.add(Cookie::new("original_a", "av2"));
-        assert_eq!(jar.get("original_a").unwrap().value(), "av2");
-    }
-
-    #[test]
-    fn empty_delta() {
-        let mut jar = CookieJar::new();
-        jar.add(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().count(), 0);
-
-        jar.add_original(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 0);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.add(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().count(), 1);
-    }
-
-    #[test]
-    fn add_remove_add() {
-        let mut jar = CookieJar::new();
-        jar.add_original(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 0);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-
-        // The cookie's been deleted. Another original doesn't change that.
-        jar.add_original(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.add(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().filter(|c| !c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().count(), 1);
-    }
-
-    #[test]
-    fn replace_remove() {
-        let mut jar = CookieJar::new();
-        jar.add_original(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 0);
-
-        jar.add(Cookie::new("name", "val"));
-        assert_eq!(jar.delta().count(), 1);
-        assert_eq!(jar.delta().filter(|c| !c.value().is_empty()).count(), 1);
-
-        jar.remove(Cookie::named("name"));
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-    }
-
-    #[test]
-    fn remove_with_path() {
-        let mut jar = CookieJar::new();
-        jar.add_original(Cookie::build("name", "val").finish());
-        assert_eq!(jar.iter().count(), 1);
-        assert_eq!(jar.delta().count(), 0);
-        assert_eq!(jar.iter().filter(|c| c.path().is_none()).count(), 1);
-
-        jar.remove(Cookie::build("name", "").path("/").finish());
-        assert_eq!(jar.iter().count(), 0);
-        assert_eq!(jar.delta().count(), 1);
-        assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
-        assert_eq!(jar.delta().filter(|c| c.path() == Some("/")).count(), 1);
-    }
-}

actix-http/src/cookie/parse.rs

@@ -1,425 +0,0 @@
-use std::borrow::Cow;
-use std::cmp;
-use std::convert::From;
-use std::error::Error;
-use std::fmt;
-use std::str::Utf8Error;
-
-use chrono::Duration;
-use percent_encoding::percent_decode;
-
-use super::{Cookie, CookieStr, SameSite};
-
-/// Enum corresponding to a parsing error.
-#[derive(Debug, PartialEq, Eq, Clone, Copy)]
-pub enum ParseError {
-    /// The cookie did not contain a name/value pair.
-    MissingPair,
-    /// The cookie's name was empty.
-    EmptyName,
-    /// Decoding the cookie's name or value resulted in invalid UTF-8.
-    Utf8Error(Utf8Error),
-    /// It is discouraged to exhaustively match on this enum as its variants may
-    /// grow without a breaking-change bump in version numbers.
-    #[doc(hidden)]
-    __Nonexhasutive,
-}
-
-impl ParseError {
-    /// Returns a description of this error as a string
-    pub fn as_str(&self) -> &'static str {
-        match *self {
-            ParseError::MissingPair => "the cookie is missing a name/value pair",
-            ParseError::EmptyName => "the cookie's name is empty",
-            ParseError::Utf8Error(_) => {
-                "decoding the cookie's name or value resulted in invalid UTF-8"
-            }
-            ParseError::__Nonexhasutive => unreachable!("__Nonexhasutive ParseError"),
-        }
-    }
-}
-
-impl fmt::Display for ParseError {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
-        write!(f, "{}", self.as_str())
-    }
-}
-
-impl From<Utf8Error> for ParseError {
-    fn from(error: Utf8Error) -> ParseError {
-        ParseError::Utf8Error(error)
-    }
-}
-
-impl Error for ParseError {
-    fn description(&self) -> &str {
-        self.as_str()
-    }
-}
-
-fn indexes_of(needle: &str, haystack: &str) -> Option<(usize, usize)> {
-    let haystack_start = haystack.as_ptr() as usize;
-    let needle_start = needle.as_ptr() as usize;
-
-    if needle_start < haystack_start {
-        return None;
-    }
-
-    if (needle_start + needle.len()) > (haystack_start + haystack.len()) {
-        return None;
-    }
-
-    let start = needle_start - haystack_start;
-    let end = start + needle.len();
-    Some((start, end))
-}
-
-fn name_val_decoded(
-    name: &str,
-    val: &str,
-) -> Result<(CookieStr, CookieStr), ParseError> {
-    let decoded_name = percent_decode(name.as_bytes()).decode_utf8()?;
-    let decoded_value = percent_decode(val.as_bytes()).decode_utf8()?;
-    let name = CookieStr::Concrete(Cow::Owned(decoded_name.into_owned()));
-    let val = CookieStr::Concrete(Cow::Owned(decoded_value.into_owned()));
-
-    Ok((name, val))
-}
-
-// This function does the real parsing but _does not_ set the `cookie_string` in
-// the returned cookie object. This only exists so that the borrow to `s` is
-// returned at the end of the call, allowing the `cookie_string` field to be
-// set in the outer `parse` function.
-fn parse_inner<'c>(s: &str, decode: bool) -> Result<Cookie<'c>, ParseError> {
-    let mut attributes = s.split(';');
-    let key_value = match attributes.next() {
-        Some(s) => s,
-        _ => panic!(),
-    };
-
-    // Determine the name = val.
-    let (name, value) = match key_value.find('=') {
-        Some(i) => (key_value[..i].trim(), key_value[(i + 1)..].trim()),
-        None => return Err(ParseError::MissingPair),
-    };
-
-    if name.is_empty() {
-        return Err(ParseError::EmptyName);
-    }
-
-    // Create a cookie with all of the defaults. We'll fill things in while we
-    // iterate through the parameters below.
-    let (name, value) = if decode {
-        name_val_decoded(name, value)?
-    } else {
-        let name_indexes = indexes_of(name, s).expect("name sub");
-        let value_indexes = indexes_of(value, s).expect("value sub");
-        let name = CookieStr::Indexed(name_indexes.0, name_indexes.1);
-        let value = CookieStr::Indexed(value_indexes.0, value_indexes.1);
-
-        (name, value)
-    };
-
-    let mut cookie = Cookie {
-        name,
-        value,
-        cookie_string: None,
-        expires: None,
-        max_age: None,
-        domain: None,
-        path: None,
-        secure: None,
-        http_only: None,
-        same_site: None,
-    };
-
-    for attr in attributes {
-        let (key, value) = match attr.find('=') {
-            Some(i) => (attr[..i].trim(), Some(attr[(i + 1)..].trim())),
-            None => (attr.trim(), None),
-        };
-
-        match (&*key.to_ascii_lowercase(), value) {
-            ("secure", _) => cookie.secure = Some(true),
-            ("httponly", _) => cookie.http_only = Some(true),
-            ("max-age", Some(v)) => {
-                // See RFC 6265 Section 5.2.2, negative values indicate that the
-                // earliest possible expiration time should be used, so set the
-                // max age as 0 seconds.
-                cookie.max_age = match v.parse() {
-                    Ok(val) if val <= 0 => Some(Duration::zero()),
-                    Ok(val) => {
-                        // Don't panic if the max age seconds is greater than what's supported by
-                        // `Duration`.
-                        let val = cmp::min(val, Duration::max_value().num_seconds());
-                        Some(Duration::seconds(val))
-                    }
-                    Err(_) => continue,
-                };
-            }
-            ("domain", Some(mut domain)) if !domain.is_empty() => {
-                if domain.starts_with('.') {
-                    domain = &domain[1..];
-                }
-
-                let (i, j) = indexes_of(domain, s).expect("domain sub");
-                cookie.domain = Some(CookieStr::Indexed(i, j));
-            }
-            ("path", Some(v)) => {
-                let (i, j) = indexes_of(v, s).expect("path sub");
-                cookie.path = Some(CookieStr::Indexed(i, j));
-            }
-            ("samesite", Some(v)) => {
-                if v.eq_ignore_ascii_case("strict") {
-                    cookie.same_site = Some(SameSite::Strict);
-                } else if v.eq_ignore_ascii_case("lax") {
-                    cookie.same_site = Some(SameSite::Lax);
-                } else {
-                    // We do nothing here, for now. When/if the `SameSite`
-                    // attribute becomes standard, the spec says that we should
-                    // ignore this cookie, i.e, fail to parse it, when an
-                    // invalid value is passed in. The draft is at
-                    // http://httpwg.org/http-extensions/draft-ietf-httpbis-cookie-same-site.html.
-                }
-            }
-            ("expires", Some(v)) => {
-                // Try strptime with three date formats according to
-                // http://tools.ietf.org/html/rfc2616#section-3.3.1. Try
-                // additional ones as encountered in the real world.
-                let tm = time::strptime(v, "%a, %d %b %Y %H:%M:%S %Z")
-                    .or_else(|_| time::strptime(v, "%A, %d-%b-%y %H:%M:%S %Z"))
-                    .or_else(|_| time::strptime(v, "%a, %d-%b-%Y %H:%M:%S %Z"))
-                    .or_else(|_| time::strptime(v, "%a %b %d %H:%M:%S %Y"));
-
-                if let Ok(time) = tm {
-                    cookie.expires = Some(time)
-                }
-            }
-            _ => {
-                // We're going to be permissive here. If we have no idea what
-                // this is, then it's something nonstandard. We're not going to
-                // store it (because it's not compliant), but we're also not
-                // going to emit an error.
-            }
-        }
-    }
-
-    Ok(cookie)
-}
-
-pub fn parse_cookie<'c, S>(cow: S, decode: bool) -> Result<Cookie<'c>, ParseError>
-where
-    S: Into<Cow<'c, str>>,
-{
-    let s = cow.into();
-    let mut cookie = parse_inner(&s, decode)?;
-    cookie.cookie_string = Some(s);
-    Ok(cookie)
-}
-
-#[cfg(test)]
-mod tests {
-    use super::{Cookie, SameSite};
-    use chrono::Duration;
-    use time::strptime;
-
-    macro_rules! assert_eq_parse {
-        ($string:expr, $expected:expr) => {
-            let cookie = match Cookie::parse($string) {
-                Ok(cookie) => cookie,
-                Err(e) => panic!("Failed to parse {:?}: {:?}", $string, e),
-            };
-
-            assert_eq!(cookie, $expected);
-        };
-    }
-
-    macro_rules! assert_ne_parse {
-        ($string:expr, $expected:expr) => {
-            let cookie = match Cookie::parse($string) {
-                Ok(cookie) => cookie,
-                Err(e) => panic!("Failed to parse {:?}: {:?}", $string, e),
-            };
-
-            assert_ne!(cookie, $expected);
-        };
-    }
-
-    #[test]
-    fn parse_same_site() {
-        let expected = Cookie::build("foo", "bar")
-            .same_site(SameSite::Lax)
-            .finish();
-
-        assert_eq_parse!("foo=bar; SameSite=Lax", expected);
-        assert_eq_parse!("foo=bar; SameSite=lax", expected);
-        assert_eq_parse!("foo=bar; SameSite=LAX", expected);
-        assert_eq_parse!("foo=bar; samesite=Lax", expected);
-        assert_eq_parse!("foo=bar; SAMESITE=Lax", expected);
-
-        let expected = Cookie::build("foo", "bar")
-            .same_site(SameSite::Strict)
-            .finish();
-
-        assert_eq_parse!("foo=bar; SameSite=Strict", expected);
-        assert_eq_parse!("foo=bar; SameSITE=Strict", expected);
-        assert_eq_parse!("foo=bar; SameSite=strict", expected);
-        assert_eq_parse!("foo=bar; SameSite=STrICT", expected);
-        assert_eq_parse!("foo=bar; SameSite=STRICT", expected);
-    }
-
-    #[test]
-    fn parse() {
-        assert!(Cookie::parse("bar").is_err());
-        assert!(Cookie::parse("=bar").is_err());
-        assert!(Cookie::parse(" =bar").is_err());
-        assert!(Cookie::parse("foo=").is_ok());
-
-        let expected = Cookie::build("foo", "bar=baz").finish();
-        assert_eq_parse!("foo=bar=baz", expected);
-
-        let mut expected = Cookie::build("foo", "bar").finish();
-        assert_eq_parse!("foo=bar", expected);
-        assert_eq_parse!("foo = bar", expected);
-        assert_eq_parse!(" foo=bar ", expected);
-        assert_eq_parse!(" foo=bar ;Domain=", expected);
-        assert_eq_parse!(" foo=bar ;Domain= ", expected);
-        assert_eq_parse!(" foo=bar ;Ignored", expected);
-
-        let mut unexpected = Cookie::build("foo", "bar").http_only(false).finish();
-        assert_ne_parse!(" foo=bar ;HttpOnly", unexpected);
-        assert_ne_parse!(" foo=bar; httponly", unexpected);
-
-        expected.set_http_only(true);
-        assert_eq_parse!(" foo=bar ;HttpOnly", expected);
-        assert_eq_parse!(" foo=bar ;httponly", expected);
-        assert_eq_parse!(" foo=bar ;HTTPONLY=whatever", expected);
-        assert_eq_parse!(" foo=bar ; sekure; HTTPONLY", expected);
-
-        expected.set_secure(true);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure=aaaa", expected);
-
-        unexpected.set_http_only(true);
-        unexpected.set_secure(true);
-        assert_ne_parse!(" foo=bar ;HttpOnly; skeure", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; =secure", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly;", unexpected);
-
-        unexpected.set_secure(false);
-        assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
-
-        expected.set_max_age(Duration::zero());
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=0", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 0 ", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=-1", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = -1 ", expected);
-
-        expected.set_max_age(Duration::minutes(1));
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=60", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age =   60 ", expected);
-
-        expected.set_max_age(Duration::seconds(4));
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=4", expected);
-        assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 4 ", expected);
-
-        unexpected.set_secure(true);
-        unexpected.set_max_age(Duration::minutes(1));
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=122", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 38 ", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=51", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = -1 ", unexpected);
-        assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 0", unexpected);
-
-        expected.set_path("/");
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/", expected);
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/", expected);
-
-        expected.set_path("/foo");
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/foo", expected);
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/foo", expected);
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;path=/foo", expected);
-        assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;path = /foo", expected);
-
-        unexpected.set_max_age(Duration::seconds(4));
-        unexpected.set_path("/bar");
-        assert_ne_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/foo", unexpected);
-        assert_ne_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/baz", unexpected);
-
-        expected.set_domain("www.foo.com");
-        assert_eq_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=www.foo.com",
-            expected
-        );
-
-        expected.set_domain("foo.com");
-        assert_eq_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=foo.com",
-            expected
-        );
-        assert_eq_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=FOO.COM",
-            expected
-        );
-
-        unexpected.set_path("/foo");
-        unexpected.set_domain("bar.com");
-        assert_ne_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=foo.com",
-            unexpected
-        );
-        assert_ne_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=FOO.COM",
-            unexpected
-        );
-
-        let time_str = "Wed, 21 Oct 2015 07:28:00 GMT";
-        let expires = strptime(time_str, "%a, %d %b %Y %H:%M:%S %Z").unwrap();
-        expected.set_expires(expires);
-        assert_eq_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=foo.com; Expires=Wed, 21 Oct 2015 07:28:00 GMT",
-            expected
-        );
-
-        unexpected.set_domain("foo.com");
-        let bad_expires = strptime(time_str, "%a, %d %b %Y %H:%S:%M %Z").unwrap();
-        expected.set_expires(bad_expires);
-        assert_ne_parse!(
-            " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
-             Domain=foo.com; Expires=Wed, 21 Oct 2015 07:28:00 GMT",
-            unexpected
-        );
-    }
-
-    #[test]
-    fn odd_characters() {
-        let expected = Cookie::new("foo", "b%2Fr");
-        assert_eq_parse!("foo=b%2Fr", expected);
-    }
-
-    #[test]
-    fn odd_characters_encoded() {
-        let expected = Cookie::new("foo", "b/r");
-        let cookie = match Cookie::parse_encoded("foo=b%2Fr") {
-            Ok(cookie) => cookie,
-            Err(e) => panic!("Failed to parse: {:?}", e),
-        };
-
-        assert_eq!(cookie, expected);
-    }
-
-    #[test]
-    fn do_not_panic_on_large_max_ages() {
-        let max_seconds = Duration::max_value().num_seconds();
-        let expected = Cookie::build("foo", "bar").max_age(max_seconds).finish();
-        assert_eq_parse!(format!(" foo=bar; Max-Age={:?}", max_seconds + 1), expected);
-    }
-}

actix-http/src/cookie/secure/key.rs

@@ -1,180 +0,0 @@
-use ring::digest::{Algorithm, SHA256};
-use ring::hkdf::expand;
-use ring::hmac::SigningKey;
-use ring::rand::{SecureRandom, SystemRandom};
-
-use super::private::KEY_LEN as PRIVATE_KEY_LEN;
-use super::signed::KEY_LEN as SIGNED_KEY_LEN;
-
-static HKDF_DIGEST: &Algorithm = &SHA256;
-const KEYS_INFO: &str = "COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM";
-
-/// A cryptographic master key for use with `Signed` and/or `Private` jars.
-///
-/// This structure encapsulates secure, cryptographic keys for use with both
-/// [PrivateJar](struct.PrivateJar.html) and [SignedJar](struct.SignedJar.html).
-/// It can be derived from a single master key via
-/// [from_master](#method.from_master) or generated from a secure random source
-/// via [generate](#method.generate). A single instance of `Key` can be used for
-/// both a `PrivateJar` and a `SignedJar`.
-///
-/// This type is only available when the `secure` feature is enabled.
-#[derive(Clone)]
-pub struct Key {
-    signing_key: [u8; SIGNED_KEY_LEN],
-    encryption_key: [u8; PRIVATE_KEY_LEN],
-}
-
-impl Key {
-    /// Derives new signing/encryption keys from a master key.
-    ///
-    /// The master key must be at least 256-bits (32 bytes). For security, the
-    /// master key _must_ be cryptographically random. The keys are derived
-    /// deterministically from the master key.
-    ///
-    /// # Panics
-    ///
-    /// Panics if `key` is less than 32 bytes in length.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// # /*
-    /// let master_key = { /* a cryptographically random key >= 32 bytes */ };
-    /// # */
-    /// # let master_key: &Vec<u8> = &(0..32).collect();
-    ///
-    /// let key = Key::from_master(master_key);
-    /// ```
-    pub fn from_master(key: &[u8]) -> Key {
-        if key.len() < 32 {
-            panic!(
-                "bad master key length: expected at least 32 bytes, found {}",
-                key.len()
-            );
-        }
-
-        // Expand the user's key into two.
-        let prk = SigningKey::new(HKDF_DIGEST, key);
-        let mut both_keys = [0; SIGNED_KEY_LEN + PRIVATE_KEY_LEN];
-        expand(&prk, KEYS_INFO.as_bytes(), &mut both_keys);
-
-        // Copy the keys into their respective arrays.
-        let mut signing_key = [0; SIGNED_KEY_LEN];
-        let mut encryption_key = [0; PRIVATE_KEY_LEN];
-        signing_key.copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
-        encryption_key.copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
-
-        Key {
-            signing_key,
-            encryption_key,
-        }
-    }
-
-    /// Generates signing/encryption keys from a secure, random source. Keys are
-    /// generated nondeterministically.
-    ///
-    /// # Panics
-    ///
-    /// Panics if randomness cannot be retrieved from the operating system. See
-    /// [try_generate](#method.try_generate) for a non-panicking version.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// let key = Key::generate();
-    /// ```
-    pub fn generate() -> Key {
-        Self::try_generate().expect("failed to generate `Key` from randomness")
-    }
-
-    /// Attempts to generate signing/encryption keys from a secure, random
-    /// source. Keys are generated nondeterministically. If randomness cannot be
-    /// retrieved from the underlying operating system, returns `None`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// let key = Key::try_generate();
-    /// ```
-    pub fn try_generate() -> Option<Key> {
-        let mut sign_key = [0; SIGNED_KEY_LEN];
-        let mut enc_key = [0; PRIVATE_KEY_LEN];
-
-        let rng = SystemRandom::new();
-        if rng.fill(&mut sign_key).is_err() || rng.fill(&mut enc_key).is_err() {
-            return None;
-        }
-
-        Some(Key {
-            signing_key: sign_key,
-            encryption_key: enc_key,
-        })
-    }
-
-    /// Returns the raw bytes of a key suitable for signing cookies.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// let key = Key::generate();
-    /// let signing_key = key.signing();
-    /// ```
-    pub fn signing(&self) -> &[u8] {
-        &self.signing_key[..]
-    }
-
-    /// Returns the raw bytes of a key suitable for encrypting cookies.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::Key;
-    ///
-    /// let key = Key::generate();
-    /// let encryption_key = key.encryption();
-    /// ```
-    pub fn encryption(&self) -> &[u8] {
-        &self.encryption_key[..]
-    }
-}
-
-#[cfg(test)]
-mod test {
-    use super::Key;
-
-    #[test]
-    fn deterministic_from_master() {
-        let master_key: Vec<u8> = (0..32).collect();
-
-        let key_a = Key::from_master(&master_key);
-        let key_b = Key::from_master(&master_key);
-
-        assert_eq!(key_a.signing(), key_b.signing());
-        assert_eq!(key_a.encryption(), key_b.encryption());
-        assert_ne!(key_a.encryption(), key_a.signing());
-
-        let master_key_2: Vec<u8> = (32..64).collect();
-        let key_2 = Key::from_master(&master_key_2);
-
-        assert_ne!(key_2.signing(), key_a.signing());
-        assert_ne!(key_2.encryption(), key_a.encryption());
-    }
-
-    #[test]
-    fn non_deterministic_generate() {
-        let key_a = Key::generate();
-        let key_b = Key::generate();
-
-        assert_ne!(key_a.signing(), key_b.signing());
-        assert_ne!(key_a.encryption(), key_b.encryption());
-    }
-}

actix-http/src/cookie/secure/macros.rs

@@ -1,40 +0,0 @@
-#[cfg(test)]
-macro_rules! assert_simple_behaviour {
-    ($clear:expr, $secure:expr) => {{
-        assert_eq!($clear.iter().count(), 0);
-
-        $secure.add(Cookie::new("name", "val"));
-        assert_eq!($clear.iter().count(), 1);
-        assert_eq!($secure.get("name").unwrap().value(), "val");
-        assert_ne!($clear.get("name").unwrap().value(), "val");
-
-        $secure.add(Cookie::new("another", "two"));
-        assert_eq!($clear.iter().count(), 2);
-
-        $clear.remove(Cookie::named("another"));
-        assert_eq!($clear.iter().count(), 1);
-
-        $secure.remove(Cookie::named("name"));
-        assert_eq!($clear.iter().count(), 0);
-    }};
-}
-
-#[cfg(test)]
-macro_rules! assert_secure_behaviour {
-    ($clear:expr, $secure:expr) => {{
-        $secure.add(Cookie::new("secure", "secure"));
-        assert!($clear.get("secure").unwrap().value() != "secure");
-        assert!($secure.get("secure").unwrap().value() == "secure");
-
-        let mut cookie = $clear.get("secure").unwrap().clone();
-        let new_val = format!("{}l", cookie.value());
-        cookie.set_value(new_val);
-        $clear.add(cookie);
-        assert!($secure.get("secure").is_none());
-
-        let mut cookie = $clear.get("secure").unwrap().clone();
-        cookie.set_value("foobar");
-        $clear.add(cookie);
-        assert!($secure.get("secure").is_none());
-    }};
-}

actix-http/src/cookie/secure/mod.rs

@@ -1,10 +0,0 @@
-//! Fork of https://github.com/alexcrichton/cookie-rs
-#[macro_use]
-mod macros;
-mod key;
-mod private;
-mod signed;
-
-pub use self::key::*;
-pub use self::private::*;
-pub use self::signed::*;

actix-http/src/cookie/secure/private.rs

@@ -1,269 +0,0 @@
-use std::str;
-
-use log::warn;
-use ring::aead::{open_in_place, seal_in_place, Aad, Algorithm, Nonce, AES_256_GCM};
-use ring::aead::{OpeningKey, SealingKey};
-use ring::rand::{SecureRandom, SystemRandom};
-
-use super::Key;
-use crate::cookie::{Cookie, CookieJar};
-
-// Keep these in sync, and keep the key len synced with the `private` docs as
-// well as the `KEYS_INFO` const in secure::Key.
-static ALGO: &Algorithm = &AES_256_GCM;
-const NONCE_LEN: usize = 12;
-pub const KEY_LEN: usize = 32;
-
-/// A child cookie jar that provides authenticated encryption for its cookies.
-///
-/// A _private_ child jar signs and encrypts all the cookies added to it and
-/// verifies and decrypts cookies retrieved from it. Any cookies stored in a
-/// `PrivateJar` are simultaneously assured confidentiality, integrity, and
-/// authenticity. In other words, clients cannot discover nor tamper with the
-/// contents of a cookie, nor can they fabricate cookie data.
-///
-/// This type is only available when the `secure` feature is enabled.
-pub struct PrivateJar<'a> {
-    parent: &'a mut CookieJar,
-    key: [u8; KEY_LEN],
-}
-
-impl<'a> PrivateJar<'a> {
-    /// Creates a new child `PrivateJar` with parent `parent` and key `key`.
-    /// This method is typically called indirectly via the `signed` method of
-    /// `CookieJar`.
-    #[doc(hidden)]
-    pub fn new(parent: &'a mut CookieJar, key: &Key) -> PrivateJar<'a> {
-        let mut key_array = [0u8; KEY_LEN];
-        key_array.copy_from_slice(key.encryption());
-        PrivateJar {
-            parent,
-            key: key_array,
-        }
-    }
-
-    /// Given a sealed value `str` and a key name `name`, where the nonce is
-    /// prepended to the original value and then both are Base64 encoded,
-    /// verifies and decrypts the sealed value and returns it. If there's a
-    /// problem, returns an `Err` with a string describing the issue.
-    fn unseal(&self, name: &str, value: &str) -> Result<String, &'static str> {
-        let mut data = base64::decode(value).map_err(|_| "bad base64 value")?;
-        if data.len() <= NONCE_LEN {
-            return Err("length of decoded data is <= NONCE_LEN");
-        }
-
-        let ad = Aad::from(name.as_bytes());
-        let key = OpeningKey::new(ALGO, &self.key).expect("opening key");
-        let (nonce, sealed) = data.split_at_mut(NONCE_LEN);
-        let nonce =
-            Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
-        let unsealed = open_in_place(&key, nonce, ad, 0, sealed)
-            .map_err(|_| "invalid key/nonce/value: bad seal")?;
-
-        if let Ok(unsealed_utf8) = str::from_utf8(unsealed) {
-            Ok(unsealed_utf8.to_string())
-        } else {
-            warn!(
-                "Private cookie does not have utf8 content!
-It is likely the secret key used to encrypt them has been leaked.
-Please change it as soon as possible."
-            );
-            Err("bad unsealed utf8")
-        }
-    }
-
-    /// Returns a reference to the `Cookie` inside this jar with the name `name`
-    /// and authenticates and decrypts the cookie's value, returning a `Cookie`
-    /// with the decrypted value. If the cookie cannot be found, or the cookie
-    /// fails to authenticate or decrypt, `None` is returned.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// let mut private_jar = jar.private(&key);
-    /// assert!(private_jar.get("name").is_none());
-    ///
-    /// private_jar.add(Cookie::new("name", "value"));
-    /// assert_eq!(private_jar.get("name").unwrap().value(), "value");
-    /// ```
-    pub fn get(&self, name: &str) -> Option<Cookie<'static>> {
-        if let Some(cookie_ref) = self.parent.get(name) {
-            let mut cookie = cookie_ref.clone();
-            if let Ok(value) = self.unseal(name, cookie.value()) {
-                cookie.set_value(value);
-                return Some(cookie);
-            }
-        }
-
-        None
-    }
-
-    /// Adds `cookie` to the parent jar. The cookie's value is encrypted with
-    /// authenticated encryption assuring confidentiality, integrity, and
-    /// authenticity.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// jar.private(&key).add(Cookie::new("name", "value"));
-    ///
-    /// assert_ne!(jar.get("name").unwrap().value(), "value");
-    /// assert_eq!(jar.private(&key).get("name").unwrap().value(), "value");
-    /// ```
-    pub fn add(&mut self, mut cookie: Cookie<'static>) {
-        self.encrypt_cookie(&mut cookie);
-
-        // Add the sealed cookie to the parent.
-        self.parent.add(cookie);
-    }
-
-    /// Adds an "original" `cookie` to parent jar. The cookie's value is
-    /// encrypted with authenticated encryption assuring confidentiality,
-    /// integrity, and authenticity. Adding an original cookie does not affect
-    /// the [`CookieJar::delta()`](struct.CookieJar.html#method.delta)
-    /// computation. This method is intended to be used to seed the cookie jar
-    /// with cookies received from a client's HTTP message.
-    ///
-    /// For accurate `delta` computations, this method should not be called
-    /// after calling `remove`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// jar.private(&key).add_original(Cookie::new("name", "value"));
-    ///
-    /// assert_eq!(jar.iter().count(), 1);
-    /// assert_eq!(jar.delta().count(), 0);
-    /// ```
-    pub fn add_original(&mut self, mut cookie: Cookie<'static>) {
-        self.encrypt_cookie(&mut cookie);
-
-        // Add the sealed cookie to the parent.
-        self.parent.add_original(cookie);
-    }
-
-    /// Encrypts the cookie's value with
-    /// authenticated encryption assuring confidentiality, integrity, and authenticity.
-    fn encrypt_cookie(&self, cookie: &mut Cookie) {
-        let name = cookie.name().as_bytes();
-        let value = cookie.value().as_bytes();
-        let data = encrypt_name_value(name, value, &self.key);
-
-        // Base64 encode the nonce and encrypted value.
-        let sealed_value = base64::encode(&data);
-        cookie.set_value(sealed_value);
-    }
-
-    /// Removes `cookie` from the parent jar.
-    ///
-    /// For correct removal, the passed in `cookie` must contain the same `path`
-    /// and `domain` as the cookie that was initially set.
-    ///
-    /// See [CookieJar::remove](struct.CookieJar.html#method.remove) for more
-    /// details.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// let mut private_jar = jar.private(&key);
-    ///
-    /// private_jar.add(Cookie::new("name", "value"));
-    /// assert!(private_jar.get("name").is_some());
-    ///
-    /// private_jar.remove(Cookie::named("name"));
-    /// assert!(private_jar.get("name").is_none());
-    /// ```
-    pub fn remove(&mut self, cookie: Cookie<'static>) {
-        self.parent.remove(cookie);
-    }
-}
-
-fn encrypt_name_value(name: &[u8], value: &[u8], key: &[u8]) -> Vec<u8> {
-    // Create the `SealingKey` structure.
-    let key = SealingKey::new(ALGO, key).expect("sealing key creation");
-
-    // Create a vec to hold the [nonce | cookie value | overhead].
-    let overhead = ALGO.tag_len();
-    let mut data = vec![0; NONCE_LEN + value.len() + overhead];
-
-    // Randomly generate the nonce, then copy the cookie value as input.
-    let (nonce, in_out) = data.split_at_mut(NONCE_LEN);
-    SystemRandom::new()
-        .fill(nonce)
-        .expect("couldn't random fill nonce");
-    in_out[..value.len()].copy_from_slice(value);
-    let nonce =
-        Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
-
-    // Use cookie's name as associated data to prevent value swapping.
-    let ad = Aad::from(name);
-
-    // Perform the actual sealing operation and get the output length.
-    let output_len =
-        seal_in_place(&key, nonce, ad, in_out, overhead).expect("in-place seal");
-
-    // Remove the overhead and return the sealed content.
-    data.truncate(NONCE_LEN + output_len);
-    data
-}
-
-#[cfg(test)]
-mod test {
-    use super::{encrypt_name_value, Cookie, CookieJar, Key};
-
-    #[test]
-    fn simple() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-        assert_simple_behaviour!(jar, jar.private(&key));
-    }
-
-    #[test]
-    fn private() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-        assert_secure_behaviour!(jar, jar.private(&key));
-    }
-
-    #[test]
-    fn non_utf8() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-
-        let name = "malicious";
-        let mut assert_non_utf8 = |value: &[u8]| {
-            let sealed = encrypt_name_value(name.as_bytes(), value, &key.encryption());
-            let encoded = base64::encode(&sealed);
-            assert_eq!(
-                jar.private(&key).unseal(name, &encoded),
-                Err("bad unsealed utf8")
-            );
-            jar.add(Cookie::new(name, encoded));
-            assert_eq!(jar.private(&key).get(name), None);
-        };
-
-        assert_non_utf8(&[0x72, 0xfb, 0xdf, 0x74]); // rûst in ISO/IEC 8859-1
-
-        let mut malicious =
-            String::from(r#"{"id":"abc123??%X","admin":true}"#).into_bytes();
-        malicious[8] |= 0b1100_0000;
-        malicious[9] |= 0b1100_0000;
-        assert_non_utf8(&malicious);
-    }
-}

actix-http/src/cookie/secure/signed.rs

@@ -1,185 +0,0 @@
-use ring::digest::{Algorithm, SHA256};
-use ring::hmac::{sign, verify_with_own_key as verify, SigningKey};
-
-use super::Key;
-use crate::cookie::{Cookie, CookieJar};
-
-// Keep these in sync, and keep the key len synced with the `signed` docs as
-// well as the `KEYS_INFO` const in secure::Key.
-static HMAC_DIGEST: &Algorithm = &SHA256;
-const BASE64_DIGEST_LEN: usize = 44;
-pub const KEY_LEN: usize = 32;
-
-/// A child cookie jar that authenticates its cookies.
-///
-/// A _signed_ child jar signs all the cookies added to it and verifies cookies
-/// retrieved from it. Any cookies stored in a `SignedJar` are assured integrity
-/// and authenticity. In other words, clients cannot tamper with the contents of
-/// a cookie nor can they fabricate cookie values, but the data is visible in
-/// plaintext.
-///
-/// This type is only available when the `secure` feature is enabled.
-pub struct SignedJar<'a> {
-    parent: &'a mut CookieJar,
-    key: SigningKey,
-}
-
-impl<'a> SignedJar<'a> {
-    /// Creates a new child `SignedJar` with parent `parent` and key `key`. This
-    /// method is typically called indirectly via the `signed` method of
-    /// `CookieJar`.
-    #[doc(hidden)]
-    pub fn new(parent: &'a mut CookieJar, key: &Key) -> SignedJar<'a> {
-        SignedJar {
-            parent,
-            key: SigningKey::new(HMAC_DIGEST, key.signing()),
-        }
-    }
-
-    /// Given a signed value `str` where the signature is prepended to `value`,
-    /// verifies the signed value and returns it. If there's a problem, returns
-    /// an `Err` with a string describing the issue.
-    fn verify(&self, cookie_value: &str) -> Result<String, &'static str> {
-        if cookie_value.len() < BASE64_DIGEST_LEN {
-            return Err("length of value is <= BASE64_DIGEST_LEN");
-        }
-
-        let (digest_str, value) = cookie_value.split_at(BASE64_DIGEST_LEN);
-        let sig = base64::decode(digest_str).map_err(|_| "bad base64 digest")?;
-
-        verify(&self.key, value.as_bytes(), &sig)
-            .map(|_| value.to_string())
-            .map_err(|_| "value did not verify")
-    }
-
-    /// Returns a reference to the `Cookie` inside this jar with the name `name`
-    /// and verifies the authenticity and integrity of the cookie's value,
-    /// returning a `Cookie` with the authenticated value. If the cookie cannot
-    /// be found, or the cookie fails to verify, `None` is returned.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// let mut signed_jar = jar.signed(&key);
-    /// assert!(signed_jar.get("name").is_none());
-    ///
-    /// signed_jar.add(Cookie::new("name", "value"));
-    /// assert_eq!(signed_jar.get("name").unwrap().value(), "value");
-    /// ```
-    pub fn get(&self, name: &str) -> Option<Cookie<'static>> {
-        if let Some(cookie_ref) = self.parent.get(name) {
-            let mut cookie = cookie_ref.clone();
-            if let Ok(value) = self.verify(cookie.value()) {
-                cookie.set_value(value);
-                return Some(cookie);
-            }
-        }
-
-        None
-    }
-
-    /// Adds `cookie` to the parent jar. The cookie's value is signed assuring
-    /// integrity and authenticity.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// jar.signed(&key).add(Cookie::new("name", "value"));
-    ///
-    /// assert_ne!(jar.get("name").unwrap().value(), "value");
-    /// assert!(jar.get("name").unwrap().value().contains("value"));
-    /// assert_eq!(jar.signed(&key).get("name").unwrap().value(), "value");
-    /// ```
-    pub fn add(&mut self, mut cookie: Cookie<'static>) {
-        self.sign_cookie(&mut cookie);
-        self.parent.add(cookie);
-    }
-
-    /// Adds an "original" `cookie` to this jar. The cookie's value is signed
-    /// assuring integrity and authenticity. Adding an original cookie does not
-    /// affect the [`CookieJar::delta()`](struct.CookieJar.html#method.delta)
-    /// computation. This method is intended to be used to seed the cookie jar
-    /// with cookies received from a client's HTTP message.
-    ///
-    /// For accurate `delta` computations, this method should not be called
-    /// after calling `remove`.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// jar.signed(&key).add_original(Cookie::new("name", "value"));
-    ///
-    /// assert_eq!(jar.iter().count(), 1);
-    /// assert_eq!(jar.delta().count(), 0);
-    /// ```
-    pub fn add_original(&mut self, mut cookie: Cookie<'static>) {
-        self.sign_cookie(&mut cookie);
-        self.parent.add_original(cookie);
-    }
-
-    /// Signs the cookie's value assuring integrity and authenticity.
-    fn sign_cookie(&self, cookie: &mut Cookie) {
-        let digest = sign(&self.key, cookie.value().as_bytes());
-        let mut new_value = base64::encode(digest.as_ref());
-        new_value.push_str(cookie.value());
-        cookie.set_value(new_value);
-    }
-
-    /// Removes `cookie` from the parent jar.
-    ///
-    /// For correct removal, the passed in `cookie` must contain the same `path`
-    /// and `domain` as the cookie that was initially set.
-    ///
-    /// See [CookieJar::remove](struct.CookieJar.html#method.remove) for more
-    /// details.
-    ///
-    /// # Example
-    ///
-    /// ```rust
-    /// use actix_http::cookie::{CookieJar, Cookie, Key};
-    ///
-    /// let key = Key::generate();
-    /// let mut jar = CookieJar::new();
-    /// let mut signed_jar = jar.signed(&key);
-    ///
-    /// signed_jar.add(Cookie::new("name", "value"));
-    /// assert!(signed_jar.get("name").is_some());
-    ///
-    /// signed_jar.remove(Cookie::named("name"));
-    /// assert!(signed_jar.get("name").is_none());
-    /// ```
-    pub fn remove(&mut self, cookie: Cookie<'static>) {
-        self.parent.remove(cookie);
-    }
-}
-
-#[cfg(test)]
-mod test {
-    use super::{Cookie, CookieJar, Key};
-
-    #[test]
-    fn simple() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-        assert_simple_behaviour!(jar, jar.signed(&key));
-    }
-
-    #[test]
-    fn private() {
-        let key = Key::generate();
-        let mut jar = CookieJar::new();
-        assert_secure_behaviour!(jar, jar.signed(&key));
-    }
-}

actix-http/src/encoding/decoder.rs

@@ -1,12 +1,13 @@
+use std::future::Future;
 use std::io::{self, Write};
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use actix_threadpool::{run, CpuFuture};
-#[cfg(feature = "brotli")]
 use brotli2::write::BrotliDecoder;
 use bytes::Bytes;
-#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
 use flate2::write::{GzDecoder, ZlibDecoder};
-use futures::{try_ready, Async, Future, Poll, Stream};
+use futures_core::{ready, Stream};
 
 use super::Writer;
 use crate::error::PayloadError;
@@ -23,21 +24,18 @@ pub struct Decoder<S> {
 
 impl<S> Decoder<S>
 where
-    S: Stream<Item = Bytes, Error = PayloadError>,
+    S: Stream<Item = Result<Bytes, PayloadError>>,
 {
     /// Construct a decoder.
     #[inline]
     pub fn new(stream: S, encoding: ContentEncoding) -> Decoder<S> {
         let decoder = match encoding {
-            #[cfg(feature = "brotli")]
             ContentEncoding::Br => Some(ContentDecoder::Br(Box::new(
                 BrotliDecoder::new(Writer::new()),
             ))),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Deflate => Some(ContentDecoder::Deflate(Box::new(
                 ZlibDecoder::new(Writer::new()),
             ))),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Gzip => Some(ContentDecoder::Gzip(Box::new(
                 GzDecoder::new(Writer::new()),
             ))),
@@ -71,34 +69,40 @@ where
 
 impl<S> Stream for Decoder<S>
 where
-    S: Stream<Item = Bytes, Error = PayloadError>,
+    S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
 {
-    type Item = Bytes;
-    type Error = PayloadError;
+    type Item = Result<Bytes, PayloadError>;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
         loop {
             if let Some(ref mut fut) = self.fut {
-                let (chunk, decoder) = try_ready!(fut.poll());
+                let (chunk, decoder) = match ready!(Pin::new(fut).poll(cx)) {
+                    Ok(item) => item,
+                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
+                };
                 self.decoder = Some(decoder);
                 self.fut.take();
                 if let Some(chunk) = chunk {
-                    return Ok(Async::Ready(Some(chunk)));
+                    return Poll::Ready(Some(Ok(chunk)));
                 }
             }
 
             if self.eof {
-                return Ok(Async::Ready(None));
+                return Poll::Ready(None);
             }
 
-            match self.stream.poll()? {
-                Async::Ready(Some(chunk)) => {
+            match Pin::new(&mut self.stream).poll_next(cx) {
+                Poll::Ready(Some(Err(err))) => return Poll::Ready(Some(Err(err))),
+                Poll::Ready(Some(Ok(chunk))) => {
                     if let Some(mut decoder) = self.decoder.take() {
                         if chunk.len() < INPLACE {
                             let chunk = decoder.feed_data(chunk)?;
                             self.decoder = Some(decoder);
                             if let Some(chunk) = chunk {
-                                return Ok(Async::Ready(Some(chunk)));
+                                return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
                             self.fut = Some(run(move || {
@@ -108,41 +112,40 @@ where
                         }
                         continue;
                     } else {
-                        return Ok(Async::Ready(Some(chunk)));
+                        return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Async::Ready(None) => {
+                Poll::Ready(None) => {
                     self.eof = true;
                     return if let Some(mut decoder) = self.decoder.take() {
-                        Ok(Async::Ready(decoder.feed_eof()?))
+                        match decoder.feed_eof() {
+                            Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
+                            Ok(None) => Poll::Ready(None),
+                            Err(err) => Poll::Ready(Some(Err(err.into()))),
+                        }
                     } else {
-                        Ok(Async::Ready(None))
+                        Poll::Ready(None)
                     };
                 }
-                Async::NotReady => break,
+                Poll::Pending => break,
             }
         }
-        Ok(Async::NotReady)
+        Poll::Pending
     }
 }
 
 enum ContentDecoder {
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Deflate(Box<ZlibDecoder<Writer>>),
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Gzip(Box<GzDecoder<Writer>>),
-    #[cfg(feature = "brotli")]
     Br(Box<BrotliDecoder<Writer>>),
 }
 
 impl ContentDecoder {
-    #[allow(unreachable_patterns)]
     fn feed_eof(&mut self) -> io::Result<Option<Bytes>> {
         match self {
-            #[cfg(feature = "brotli")]
-            ContentDecoder::Br(ref mut decoder) => match decoder.finish() {
-                Ok(mut writer) => {
-                    let b = writer.take();
+            ContentDecoder::Br(ref mut decoder) => match decoder.flush() {
+                Ok(()) => {
+                    let b = decoder.get_mut().take();
                     if !b.is_empty() {
                         Ok(Some(b))
                     } else {
@@ -151,7 +154,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.try_finish() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
@@ -163,7 +165,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
@@ -175,14 +176,11 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            _ => Ok(None),
         }
     }
 
-    #[allow(unreachable_patterns)]
     fn feed_data(&mut self, data: Bytes) -> io::Result<Option<Bytes>> {
         match self {
-            #[cfg(feature = "brotli")]
             ContentDecoder::Br(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
@@ -195,7 +193,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
@@ -208,7 +205,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
@@ -221,7 +217,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            _ => Ok(Some(data)),
         }
     }
 }

actix-http/src/encoding/encoder.rs

@@ -1,25 +1,29 @@
 //! Stream encoder
+use std::future::Future;
 use std::io::{self, Write};
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use actix_threadpool::{run, CpuFuture};
-#[cfg(feature = "brotli")]
 use brotli2::write::BrotliEncoder;
 use bytes::Bytes;
-#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
 use flate2::write::{GzEncoder, ZlibEncoder};
-use futures::{Async, Future, Poll};
+use futures_core::ready;
+use pin_project::pin_project;
 
 use crate::body::{Body, BodySize, MessageBody, ResponseBody};
 use crate::http::header::{ContentEncoding, CONTENT_ENCODING};
-use crate::http::{HeaderValue, HttpTryFrom, StatusCode};
+use crate::http::{HeaderValue, StatusCode};
 use crate::{Error, ResponseHead};
 
 use super::Writer;
 
-const INPLACE: usize = 2049;
+const INPLACE: usize = 1024;
 
+#[pin_project]
 pub struct Encoder<B> {
     eof: bool,
+    #[pin]
     body: EncoderBody<B>,
     encoder: Option<ContentEncoder>,
     fut: Option<CpuFuture<ContentEncoder, io::Error>>,
@@ -75,86 +79,110 @@ impl<B: MessageBody> Encoder<B> {
     }
 }
 
+#[pin_project(project = EncoderBodyProj)]
 enum EncoderBody<B> {
     Bytes(Bytes),
-    Stream(B),
-    BoxedStream(Box<dyn MessageBody>),
+    Stream(#[pin] B),
+    BoxedStream(Box<dyn MessageBody + Unpin>),
+}
+
+impl<B: MessageBody> MessageBody for EncoderBody<B> {
+    fn size(&self) -> BodySize {
+        match self {
+            EncoderBody::Bytes(ref b) => b.size(),
+            EncoderBody::Stream(ref b) => b.size(),
+            EncoderBody::BoxedStream(ref b) => b.size(),
+        }
+    }
+
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        match self.project() {
+            EncoderBodyProj::Bytes(b) => {
+                if b.is_empty() {
+                    Poll::Ready(None)
+                } else {
+                    Poll::Ready(Some(Ok(std::mem::take(b))))
+                }
+            }
+            EncoderBodyProj::Stream(b) => b.poll_next(cx),
+            EncoderBodyProj::BoxedStream(ref mut b) => {
+                Pin::new(b.as_mut()).poll_next(cx)
+            }
+        }
+    }
 }
 
 impl<B: MessageBody> MessageBody for Encoder<B> {
     fn size(&self) -> BodySize {
         if self.encoder.is_none() {
-            match self.body {
-                EncoderBody::Bytes(ref b) => b.size(),
-                EncoderBody::Stream(ref b) => b.size(),
-                EncoderBody::BoxedStream(ref b) => b.size(),
-            }
+            self.body.size()
         } else {
             BodySize::Stream
         }
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        let mut this = self.project();
         loop {
-            if self.eof {
-                return Ok(Async::Ready(None));
+            if *this.eof {
+                return Poll::Ready(None);
             }
 
-            if let Some(ref mut fut) = self.fut {
-                let mut encoder = futures::try_ready!(fut.poll());
+            if let Some(ref mut fut) = this.fut {
+                let mut encoder = match ready!(Pin::new(fut).poll(cx)) {
+                    Ok(item) => item,
+                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
+                };
                 let chunk = encoder.take();
-                self.encoder = Some(encoder);
-                self.fut.take();
+                *this.encoder = Some(encoder);
+                this.fut.take();
                 if !chunk.is_empty() {
-                    return Ok(Async::Ready(Some(chunk)));
+                    return Poll::Ready(Some(Ok(chunk)));
                 }
             }
 
-            let result = match self.body {
-                EncoderBody::Bytes(ref mut b) => {
-                    if b.is_empty() {
-                        Async::Ready(None)
-                    } else {
-                        Async::Ready(Some(std::mem::replace(b, Bytes::new())))
-                    }
-                }
-                EncoderBody::Stream(ref mut b) => b.poll_next()?,
-                EncoderBody::BoxedStream(ref mut b) => b.poll_next()?,
-            };
+            let result = this.body.as_mut().poll_next(cx);
+
             match result {
-                Async::NotReady => return Ok(Async::NotReady),
-                Async::Ready(Some(chunk)) => {
-                    if let Some(mut encoder) = self.encoder.take() {
+                Poll::Ready(Some(Ok(chunk))) => {
+                    if let Some(mut encoder) = this.encoder.take() {
                         if chunk.len() < INPLACE {
                             encoder.write(&chunk)?;
                             let chunk = encoder.take();
-                            self.encoder = Some(encoder);
+                            *this.encoder = Some(encoder);
                             if !chunk.is_empty() {
-                                return Ok(Async::Ready(Some(chunk)));
+                                return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
-                            self.fut = Some(run(move || {
+                            *this.fut = Some(run(move || {
                                 encoder.write(&chunk)?;
                                 Ok(encoder)
                             }));
                         }
                     } else {
-                        return Ok(Async::Ready(Some(chunk)));
+                        return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Async::Ready(None) => {
-                    if let Some(encoder) = self.encoder.take() {
+                Poll::Ready(None) => {
+                    if let Some(encoder) = this.encoder.take() {
                         let chunk = encoder.finish()?;
                         if chunk.is_empty() {
-                            return Ok(Async::Ready(None));
+                            return Poll::Ready(None);
                         } else {
-                            self.eof = true;
-                            return Ok(Async::Ready(Some(chunk)));
+                            *this.eof = true;
+                            return Poll::Ready(Some(Ok(chunk)));
                         }
                     } else {
-                        return Ok(Async::Ready(None));
+                        return Poll::Ready(None);
                     }
                 }
+                val => return val,
             }
         }
     }
@@ -163,33 +191,27 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
 fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) {
     head.headers_mut().insert(
         CONTENT_ENCODING,
-        HeaderValue::try_from(Bytes::from_static(encoding.as_str().as_bytes())).unwrap(),
+        HeaderValue::from_static(encoding.as_str()),
     );
 }
 
 enum ContentEncoder {
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Deflate(ZlibEncoder<Writer>),
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Gzip(GzEncoder<Writer>),
-    #[cfg(feature = "brotli")]
     Br(BrotliEncoder<Writer>),
 }
 
 impl ContentEncoder {
     fn encoder(encoding: ContentEncoding) -> Option<Self> {
         match encoding {
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Deflate => Some(ContentEncoder::Deflate(ZlibEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Gzip => Some(ContentEncoder::Gzip(GzEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
-            #[cfg(feature = "brotli")]
             ContentEncoding::Br => {
                 Some(ContentEncoder::Br(BrotliEncoder::new(Writer::new(), 3)))
             }
@@ -200,28 +222,22 @@ impl ContentEncoder {
     #[inline]
     pub(crate) fn take(&mut self) -> Bytes {
         match *self {
-            #[cfg(feature = "brotli")]
             ContentEncoder::Br(ref mut encoder) => encoder.get_mut().take(),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Deflate(ref mut encoder) => encoder.get_mut().take(),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Gzip(ref mut encoder) => encoder.get_mut().take(),
         }
     }
 
     fn finish(self) -> Result<Bytes, io::Error> {
         match self {
-            #[cfg(feature = "brotli")]
             ContentEncoder::Br(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Gzip(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Deflate(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
@@ -231,7 +247,6 @@ impl ContentEncoder {
 
     fn write(&mut self, data: &[u8]) -> Result<(), io::Error> {
         match *self {
-            #[cfg(feature = "brotli")]
             ContentEncoder::Br(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -239,7 +254,6 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Gzip(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -247,7 +261,6 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Deflate(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {

actix-http/src/encoding/mod.rs

@@ -19,8 +19,9 @@ impl Writer {
             buf: BytesMut::with_capacity(8192),
         }
     }
+
     fn take(&mut self) -> Bytes {
-        self.buf.take().freeze()
+        self.buf.split().freeze()
     }
 }
 
@@ -29,6 +30,7 @@ impl io::Write for Writer {
         self.buf.extend_from_slice(buf);
         Ok(buf.len())
     }
+
     fn flush(&mut self) -> io::Result<()> {
         Ok(())
     }