Merge pull request #1391 from JohnTitor/new-awc

Release awc v2.0.0-alpha.1

.github/ISSUE_TEMPLATE/bug_report.md

@@ -0,0 +1,37 @@
+---
+name: bug report
+about: create a bug report
+---
+
+Your issue may already be reported!
+Please search on the [Actix Web issue tracker](https://github.com/actix/actix-web/issues) before creating one.
+
+## Expected Behavior
+<!--- If you're describing a bug, tell us what should happen -->
+<!--- If you're suggesting a change/improvement, tell us how it should work -->
+
+## Current Behavior
+<!--- If describing a bug, tell us what happens instead of the expected behavior -->
+<!--- If suggesting a change/improvement, explain the difference from current behavior -->
+
+## Possible Solution
+<!--- Not obligatory, but suggest a fix/reason for the bug, -->
+<!--- or ideas how to implement the addition or change -->
+
+## Steps to Reproduce (for bugs)
+<!--- Provide a link to a live example, or an unambiguous set of steps to -->
+<!--- reproduce this bug. Include code to reproduce, if relevant -->
+1.
+2.
+3.
+4.
+
+## Context
+<!--- How has this issue affected you? What are you trying to accomplish? -->
+<!--- Providing context helps us come up with a solution that is most useful in the real world -->
+
+## Your Environment
+<!--- Include as many relevant details about the environment you experienced the bug in -->
+
+* Rust Version (I.e, output of `rustc -V`):
+* Actix Web Version:

.github/workflows/bench.yml

@@ -0,0 +1,47 @@
+name: Benchmark (Linux)
+
+on: [push, pull_request]
+
+jobs:
+  check_benchmark:
+    runs-on: ubuntu-latest
+
+    steps:
+      - uses: actions/checkout@master
+
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: nightly
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with:
+          command: generate-lockfile
+      - name: Cache cargo registry
+        uses: actions/cache@v1
+        with:
+          path: ~/.cargo/registry
+          key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-registry-trimmed-${{ hashFiles('**/Cargo.lock') }}
+      - name: Cache cargo index
+        uses: actions/cache@v1
+        with:
+          path: ~/.cargo/git
+          key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-index-trimmed-${{ hashFiles('**/Cargo.lock') }}
+      - name: Cache cargo build
+        uses: actions/cache@v1
+        with:
+          path: target
+          key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-build-trimmed-${{ hashFiles('**/Cargo.lock') }}
+
+      - name: Check benchmark
+        uses: actions-rs/cargo@v1
+        with:
+          command: bench
+
+      - name: Clear the cargo caches
+        run: |
+          cargo install cargo-cache --no-default-features --features ci-autoclean
+          cargo-cache

.github/workflows/linux.yml

@@ -0,0 +1,90 @@
+name: CI (Linux)
+
+on: [push, pull_request]
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        version:
+          - 1.39.0 # MSRV
+          - stable
+          - nightly
+
+    name: ${{ matrix.version }} - x86_64-unknown-linux-gnu
+    runs-on: ubuntu-latest
+
+    steps:
+      - uses: actions/checkout@master
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-x86_64-unknown-linux-gnu
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with:
+          command: generate-lockfile
+      - name: Cache cargo registry
+        uses: actions/cache@v1
+        with:
+          path: ~/.cargo/registry
+          key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-registry-trimmed-${{ hashFiles('**/Cargo.lock') }}
+      - name: Cache cargo index
+        uses: actions/cache@v1
+        with:
+          path: ~/.cargo/git
+          key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-index-trimmed-${{ hashFiles('**/Cargo.lock') }}
+      - name: Cache cargo build
+        uses: actions/cache@v1
+        with:
+          path: target
+          key: ${{ matrix.version }}-x86_64-unknown-linux-gnu-cargo-build-trimmed-${{ hashFiles('**/Cargo.lock') }}
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --all --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --all --all-features --no-fail-fast -- --nocapture
+
+      - name: tests (actix-http)
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --package=actix-http --no-default-features --features=rustls -- --nocapture
+
+      - name: tests (awc)
+        uses: actions-rs/cargo@v1
+        timeout-minutes: 40
+        with:
+          command: test
+          args: --package=awc --no-default-features --features=rustls -- --nocapture
+
+      - name: Generate coverage file
+        if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
+        run: |
+          cargo install cargo-tarpaulin
+          cargo tarpaulin --out Xml
+      - name: Upload to Codecov
+        if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
+        uses: codecov/codecov-action@v1
+        with:
+          token: ${{ secrets.CODECOV_TOKEN }}
+          file: cobertura.xml
+
+      - name: Clear the cargo caches
+        run: |
+          cargo install cargo-cache --no-default-features --features ci-autoclean
+          cargo-cache

.github/workflows/macos.yml

@@ -0,0 +1,64 @@
+name: CI (macOS)
+
+on: [push, pull_request]
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        version:
+          - stable
+          - nightly
+
+    name: ${{ matrix.version }} - x86_64-apple-darwin
+    runs-on: macOS-latest
+
+    steps:
+      - uses: actions/checkout@master
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-x86_64-apple-darwin
+          profile: minimal
+          override: true
+
+      - name: Generate Cargo.lock
+        uses: actions-rs/cargo@v1
+        with:
+          command: generate-lockfile
+      - name: Cache cargo registry
+        uses: actions/cache@v1
+        with:
+          path: ~/.cargo/registry
+          key: ${{ matrix.version }}-x86_64-apple-darwin-cargo-registry-trimmed-${{ hashFiles('**/Cargo.lock') }}
+      - name: Cache cargo index
+        uses: actions/cache@v1
+        with:
+          path: ~/.cargo/git
+          key: ${{ matrix.version }}-x86_64-apple-darwin-cargo-index-trimmed-${{ hashFiles('**/Cargo.lock') }}
+      - name: Cache cargo build
+        uses: actions/cache@v1
+        with:
+          path: target
+          key: ${{ matrix.version }}-x86_64-apple-darwin-cargo-build-trimmed-${{ hashFiles('**/Cargo.lock') }}
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --all --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: test
+          args: --all --all-features --no-fail-fast -- --nocapture
+                --skip=test_h2_content_length
+                --skip=test_reading_deflate_encoding_large_random_rustls
+
+      - name: Clear the cargo caches
+        run: |
+          cargo install cargo-cache --no-default-features --features ci-autoclean
+          cargo-cache

.github/workflows/upload-doc.yml

@@ -0,0 +1,35 @@
+name: Upload documentation
+
+on:
+  push:
+    branches:
+      - master
+
+jobs:
+  build:
+    runs-on: ubuntu-latest
+    if: github.repository == 'actix/actix-web'
+
+    steps:
+      - uses: actions/checkout@master
+
+      - name: Install Rust
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: stable-x86_64-unknown-linux-gnu
+          profile: minimal
+          override: true
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: doc
+          args: --no-deps --all-features
+
+      - name: Tweak HTML
+        run: echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html
+
+      - name: Upload documentation
+        run: |
+          git clone https://github.com/davisp/ghp-import.git
+          ./ghp-import/ghp_import.py -n -p -f -m "Documentation upload" -r https://${{ secrets.GITHUB_TOKEN }}@github.com/"${{ github.repository }}.git" target/doc

.github/workflows/windows.yml

@@ -0,0 +1,59 @@
+name: CI (Windows)
+
+on: [push, pull_request]
+
+env:
+  VCPKGRS_DYNAMIC: 1
+
+jobs:
+  build_and_test:
+    strategy:
+      fail-fast: false
+      matrix:
+        version:
+          - stable
+          - nightly
+
+    name: ${{ matrix.version }} - x86_64-pc-windows-msvc
+    runs-on: windows-latest
+
+    steps:
+      - uses: actions/checkout@master
+
+      - name: Install ${{ matrix.version }}
+        uses: actions-rs/toolchain@v1
+        with:
+          toolchain: ${{ matrix.version }}-x86_64-pc-windows-msvc
+          profile: minimal
+          override: true
+
+      - name: Install OpenSSL
+        run: |
+          vcpkg integrate install
+          vcpkg install openssl:x64-windows
+          Copy-Item C:\vcpkg\installed\x64-windows\bin\libcrypto-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libcrypto.dll
+          Copy-Item C:\vcpkg\installed\x64-windows\bin\libssl-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libssl.dll
+          Get-ChildItem C:\vcpkg\installed\x64-windows\bin
+          Get-ChildItem C:\vcpkg\installed\x64-windows\lib
+
+      - name: check build
+        uses: actions-rs/cargo@v1
+        with:
+          command: check
+          args: --all --bins --examples --tests
+
+      - name: tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: test
+          args: --all --all-features --no-fail-fast -- --nocapture
+                --skip=test_h2_content_length
+                --skip=test_reading_deflate_encoding_large_random_rustls
+                --skip=test_params
+                --skip=test_simple
+                --skip=test_expect_continue
+                --skip=test_http10_keepalive
+                --skip=test_slow_request
+                --skip=test_connection_force_close
+                --skip=test_connection_server_close
+                --skip=test_connection_wait_queue_force_close

.travis.yml

@@ -1,56 +0,0 @@
-language: rust
-sudo: required
-dist: trusty
-
-cache:
-  cargo: true
-  apt: true
-
-matrix:
-  include:
-    - rust: stable
-    - rust: beta
-    - rust: nightly-2019-04-02
-  allow_failures:
-    - rust: nightly-2019-04-02
-
-env:
-  global:
-    # - RUSTFLAGS="-C link-dead-code"
-    - OPENSSL_VERSION=openssl-1.0.2
-
-before_install:
-  - sudo add-apt-repository -y ppa:0k53d-karl-f830m/openssl
-  - sudo apt-get update -qq
-  - sudo apt-get install -y openssl libssl-dev libelf-dev libdw-dev cmake gcc binutils-dev libiberty-dev
-
-before_cache: |
-  if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-04-02" ]]; then
-    RUSTFLAGS="--cfg procmacro2_semver_exempt" cargo install cargo-tarpaulin
-  fi
-
-# Add clippy
-before_script:
-  - export PATH=$PATH:~/.cargo/bin
-
-script:
-  - cargo update
-  - cargo check --all --no-default-features
-  - cargo test --all-features --all -- --nocapture
-
-# Upload docs
-after_success:
-  - |
-    if [[ "$TRAVIS_OS_NAME" == "linux" && "$TRAVIS_PULL_REQUEST" = "false" && "$TRAVIS_BRANCH" == "master" && "$TRAVIS_RUST_VERSION" == "stable" ]]; then
-      cargo doc --no-deps --all-features &&
-      echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html &&
-      git clone https://github.com/davisp/ghp-import.git &&
-      ./ghp-import/ghp_import.py -n -p -f -m "Documentation upload" -r https://"$GH_TOKEN"@github.com/"$TRAVIS_REPO_SLUG.git" target/doc &&
-      echo "Uploaded documentation"
-    fi
-  - |
-    if [[ "$TRAVIS_RUST_VERSION" ==  "nightly-2019-04-02" ]]; then
-        taskset -c 0 cargo tarpaulin --out Xml --all --all-features
-        bash <(curl -s https://codecov.io/bash)
-        echo "Uploaded code coverage"
-    fi

CHANGES.md

@@ -1,6 +1,175 @@
 # Changes
 
-## [1.0.3] - unreleased
+
+## [2.0.NEXT] - 2020-01-xx
+
+### Added
+
+* Add helper function for creating routes with `TRACE` method guard `web::trace()`
+
+### Changed
+
+* Use `sha-1` crate instead of unmaintained `sha1` crate
+* Skip empty chunks when returning response from a `Stream` #1308
+* Update the `time` dependency to 0.2.7
+* Update `actix-tls` dependency to 2.0.0-alpha.1
+* Update `rustls` dependency to 0.17
+
+## [2.0.0] - 2019-12-25
+
+### Changed
+
+* Rename `HttpServer::start()` to `HttpServer::run()`
+
+* Allow to gracefully stop test server via `TestServer::stop()`
+
+* Allow to specify multi-patterns for resources
+
+## [2.0.0-rc] - 2019-12-20
+
+### Changed
+
+* Move `BodyEncoding` to `dev` module #1220
+
+* Allow to set `peer_addr` for TestRequest #1074
+
+* Make web::Data deref to Arc<T> #1214
+
+* Rename `App::register_data()` to `App::app_data()`
+
+* `HttpRequest::app_data<T>()` returns `Option<&T>` instead of `Option<&Data<T>>`
+
+### Fixed
+
+* Fix `AppConfig::secure()` is always false. #1202
+
+
+## [2.0.0-alpha.6] - 2019-12-15
+
+### Fixed
+
+* Fixed compilation with default features off
+
+## [2.0.0-alpha.5] - 2019-12-13
+
+### Added
+
+* Add test server, `test::start()` and `test::start_with()`
+
+## [2.0.0-alpha.4] - 2019-12-08
+
+### Deleted
+
+* Delete HttpServer::run(), it is not useful witht async/await
+
+## [2.0.0-alpha.3] - 2019-12-07
+
+### Changed
+
+* Migrate to tokio 0.2
+
+
+## [2.0.0-alpha.1] - 2019-11-22
+
+### Changed
+
+* Migrated to `std::future`
+
+* Remove implementation of `Responder` for `()`. (#1167)
+
+
+## [1.0.9] - 2019-11-14
+
+### Added
+
+* Add `Payload::into_inner` method and make stored `def::Payload` public. (#1110)
+
+### Changed
+
+* Support `Host` guards when the `Host` header is unset (e.g. HTTP/2 requests) (#1129)
+
+
+## [1.0.8] - 2019-09-25
+
+### Added
+
+* Add `Scope::register_data` and `Resource::register_data` methods, parallel to
+  `App::register_data`.
+
+* Add `middleware::Condition` that conditionally enables another middleware
+
+* Allow to re-construct `ServiceRequest` from `HttpRequest` and `Payload`
+
+* Add `HttpServer::listen_uds` for ability to listen on UDS FD rather than path,
+  which is useful for example with systemd.
+
+### Changed
+
+* Make UrlEncodedError::Overflow more informativve
+
+* Use actix-testing for testing utils
+
+
+## [1.0.7] - 2019-08-29
+
+### Fixed
+
+* Request Extensions leak #1062
+
+
+## [1.0.6] - 2019-08-28
+
+### Added
+
+* Re-implement Host predicate (#989)
+
+* Form immplements Responder, returning a `application/x-www-form-urlencoded` response
+
+* Add `into_inner` to `Data`
+
+* Add `test::TestRequest::set_form()` convenience method to automatically serialize data and set
+  the header in test requests.
+
+### Changed
+
+* `Query` payload made `pub`. Allows user to pattern-match the payload.
+
+* Enable `rust-tls` feature for client #1045
+
+* Update serde_urlencoded to 0.6.1
+
+* Update url to 2.1
+
+
+## [1.0.5] - 2019-07-18
+
+### Added
+
+* Unix domain sockets (HttpServer::bind_uds) #92
+
+* Actix now logs errors resulting in "internal server error" responses always, with the `error`
+  logging level
+
+### Fixed
+
+* Restored logging of errors through the `Logger` middleware
+
+
+## [1.0.4] - 2019-07-17
+
+### Added
+
+* Add `Responder` impl for `(T, StatusCode) where T: Responder`
+
+* Allow to access app's resource map via
+  `ServiceRequest::resource_map()` and `HttpRequest::resource_map()` methods.
+
+### Changed
+
+* Upgrade `rand` dependency version to 0.7
+
+
+## [1.0.3] - 2019-06-28
 
 ### Added
 

Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-web"
-version = "1.0.2"
+version = "2.0.0"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Actix web is a simple, pragmatic and extremely fast web framework for Rust."
 readme = "README.md"
@@ -12,11 +12,10 @@ categories = ["network-programming", "asynchronous",
               "web-programming::http-server",
               "web-programming::websocket"]
 license = "MIT/Apache-2.0"
-exclude = [".gitignore", ".travis.yml", ".cargo/config", "appveyor.yml"]
 edition = "2018"
 
 [package.metadata.docs.rs]
-features = ["ssl", "brotli", "flate2-zlib", "secure-cookies", "client", "rust-tls"]
+features = ["openssl", "rustls", "compress", "secure-cookies"]
 
 [badges]
 travis-ci = { repository = "actix/actix-web", branch = "master" }
@@ -34,8 +33,8 @@ members = [
   "actix-cors",
   "actix-files",
   "actix-framed",
-  "actix-session",
-  "actix-identity",
+#  "actix-session",
+#  "actix-identity",
   "actix-multipart",
   "actix-web-actors",
   "actix-web-codegen",
@@ -43,74 +42,64 @@ members = [
 ]
 
 [features]
-default = ["brotli", "flate2-zlib", "client", "fail"]
+default = ["compress", "failure"]
 
-# http client
-client = ["awc"]
-
-# brotli encoding, requires c compiler
-brotli = ["actix-http/brotli"]
-
-# miniz-sys backend for flate2 crate
-flate2-zlib = ["actix-http/flate2-zlib"]
-
-# rust backend for flate2 crate
-flate2-rust = ["actix-http/flate2-rust"]
+# content-encoding support
+compress = ["actix-http/compress", "awc/compress"]
 
 # sessions feature, session require "ring" crate and c compiler
 secure-cookies = ["actix-http/secure-cookies"]
 
-fail = ["actix-http/fail"]
+failure = ["actix-http/failure"]
 
 # openssl
-ssl = ["openssl", "actix-server/ssl", "awc/ssl"]
+openssl = ["actix-tls/openssl", "awc/openssl", "open-ssl"]
 
 # rustls
-rust-tls = ["rustls", "actix-server/rust-tls"]
+rustls = ["actix-tls/rustls", "awc/rustls", "rust-tls"]
 
 [dependencies]
-actix-codec = "0.1.2"
-actix-service = "0.4.1"
-actix-utils = "0.4.1"
-actix-router = "0.1.5"
-actix-rt = "0.2.2"
-actix-web-codegen = "0.1.2"
-actix-http = "0.2.4"
-actix-server = "0.5.1"
-actix-server-config = "0.1.1"
-actix-threadpool = "0.1.1"
-awc = { version = "0.2.1", optional = true }
+actix-codec = "0.2.0"
+actix-service = "1.0.2"
+actix-utils = "1.0.6"
+actix-router = "0.2.4"
+actix-rt = "1.0.0"
+actix-server = "1.0.0"
+actix-testing = "1.0.0"
+actix-macros = "0.1.0"
+actix-threadpool = "0.3.1"
+actix-tls = "2.0.0-alpha.1"
 
-bytes = "0.4"
-derive_more = "0.15.0"
+actix-web-codegen = "0.2.0"
+actix-http = "2.0.0-alpha.2"
+awc = { version = "2.0.0-alpha.1", default-features = false }
+
+bytes = "0.5.3"
+derive_more = "0.99.2"
 encoding_rs = "0.8"
-futures = "0.1.25"
-hashbrown = "0.5.0"
+futures = "0.3.1"
+fxhash = "0.2.1"
 log = "0.4"
 mime = "0.3"
 net2 = "0.2.33"
-parking_lot = "0.8"
-regex = "1.0"
+pin-project = "0.4.6"
+regex = "1.3"
 serde = { version = "1.0", features=["derive"] }
 serde_json = "1.0"
-serde_urlencoded = "0.5.3"
-time = "0.1.42"
-url = { version="1.7", features=["query_encoding"] }
-
-# ssl support
-openssl = { version="0.10", optional = true }
-rustls = { version = "0.15", optional = true }
+serde_urlencoded = "0.6.1"
+time = { version = "0.2.7", default-features = false, features = ["std"] }
+url = "2.1"
+open-ssl = { version="0.10", package = "openssl", optional = true }
+rust-tls = { version = "0.17.0", package = "rustls", optional = true }
 
 [dev-dependencies]
-actix = { version = "0.8.3" }
-actix-http = { version = "0.2.4", features=["ssl", "brotli", "flate2-zlib"] }
-actix-http-test = { version = "0.2.2", features=["ssl"] }
-rand = "0.6"
+actix = "0.10.0-alpha.1"
+rand = "0.7"
 env_logger = "0.6"
 serde_derive = "1.0"
-tokio-timer = "0.2.8"
 brotli2 = "0.3.2"
-flate2 = "1.0.2"
+flate2 = "1.0.13"
+criterion = "0.3"
 
 [profile.release]
 lto = true
@@ -122,8 +111,17 @@ actix-web = { path = "." }
 actix-http = { path = "actix-http" }
 actix-http-test = { path = "test-server" }
 actix-web-codegen = { path = "actix-web-codegen" }
-actix-web-actors = { path = "actix-web-actors" }
+actix-cors = { path = "actix-cors" }
+actix-identity = { path = "actix-identity" }
 actix-session = { path = "actix-session" }
 actix-files = { path = "actix-files" }
 actix-multipart = { path = "actix-multipart" }
 awc = { path = "awc" }
+
+[[bench]]
+name = "server"
+harness = false
+
+[[bench]]
+name = "service"
+harness = false

MIGRATION.md

@@ -1,3 +1,59 @@
+## Unreleased
+
+* Setting a cookie's SameSite property, explicitly, to `SameSite::None` will now
+  result in `SameSite=None` being sent with the response Set-Cookie header.
+  To create a cookie without a SameSite attribute, remove any calls setting same_site.
+* actix-http support for Actors messages was moved to actix-http crate and is enabled 
+  with feature `actors`
+
+## 2.0.0
+
+* `HttpServer::start()` renamed to `HttpServer::run()`. It also possible to
+  `.await` on `run` method result, in that case it awaits server exit.
+
+* `App::register_data()` renamed to `App::app_data()` and accepts any type `T: 'static`.
+  Stored data is available via `HttpRequest::app_data()` method at runtime.
+
+* Extractor configuration must be registered with `App::app_data()` instead of `App::data()`
+
+* Sync handlers has been removed. `.to_async()` method has been renamed to `.to()`
+  replace `fn` with `async fn` to convert sync handler to async
+
+* `actix_http_test::TestServer` moved to `actix_web::test` module. To start
+  test server use `test::start()` or `test_start_with_config()` methods
+
+* `ResponseError` trait has been reafctored. `ResponseError::error_response()` renders
+  http response.
+
+* Feature `rust-tls` renamed to `rustls`
+
+  instead of
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["rust-tls"] }
+    ```
+
+  use
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["rustls"] }
+    ```
+
+* Feature `ssl` renamed to `openssl`
+
+  instead of
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["ssl"] }
+    ```
+
+  use
+
+    ```rust
+    actix-web = { version = "2.0.0", features = ["openssl"] }
+    ```
+* `Cors` builder now requires that you call `.finish()` to construct the middleware
+
 ## 1.0.1
 
 * Cors middleware has been moved to `actix-cors` crate
@@ -34,52 +90,52 @@
 * Extractor configuration. In version 1.0 this is handled with the new `Data` mechanism for both setting and retrieving the configuration
 
   instead of
-    
+
   ```rust
-    
+
   #[derive(Default)]
   struct ExtractorConfig {
      config: String,
   }
-    
+
   impl FromRequest for YourExtractor {
      type Config = ExtractorConfig;
      type Result = Result<YourExtractor, Error>;
-  
+
      fn from_request(req: &HttpRequest, cfg: &Self::Config) -> Self::Result {
          println!("use the config: {:?}", cfg.config);
          ...
      }
   }
-    
+
   App::new().resource("/route_with_config", |r| {
      r.post().with_config(handler_fn, |cfg| {
          cfg.0.config = "test".to_string();
      })
   })
-    
+
   ```
-    
+
   use the HttpRequest to get the configuration like any other `Data` with `req.app_data::<C>()` and set it with the `data()` method on the `resource`
-    
+
   ```rust
   #[derive(Default)]
   struct ExtractorConfig {
      config: String,
   }
-    
+
   impl FromRequest for YourExtractor {
      type Error = Error;
      type Future = Result<Self, Self::Error>;
      type Config = ExtractorConfig;
-    
+
      fn from_request(req: &HttpRequest, payload: &mut Payload) -> Self::Future {
          let cfg = req.app_data::<ExtractorConfig>();
          println!("config data?: {:?}", cfg.unwrap().role);
          ...
      }
   }
-    
+
   App::new().service(
      resource("/route_with_config")
          .data(ExtractorConfig {
@@ -88,7 +144,7 @@
          .route(post().to(handler_fn)),
   )
   ```
-  
+
 * Resource registration. 1.0 version uses generalized resource
   registration via `.service()` method.
 
@@ -379,9 +435,9 @@
 
 * `HttpRequest` does not implement `Stream` anymore. If you need to read request payload
   use `HttpMessage::payload()` method.
-  
+
   instead of
-  
+
     ```rust
     fn index(req: HttpRequest) -> impl Responder {
          req
@@ -407,8 +463,8 @@
   trait uses `&HttpRequest` instead of `&mut HttpRequest`.
 
 * Removed `Route::with2()` and `Route::with3()` use tuple of extractors instead.
-    
-    instead of 
+
+    instead of
 
     ```rust
     fn index(query: Query<..>, info: Json<MyStruct) -> impl Responder {}
@@ -424,7 +480,7 @@
 
 * `Handler::handle()` accepts reference to `HttpRequest<_>` instead of value
 
-* Removed deprecated `HttpServer::threads()`, use 
+* Removed deprecated `HttpServer::threads()`, use
   [HttpServer::workers()](https://actix.rs/actix-web/actix_web/server/struct.HttpServer.html#method.workers) instead.
 
 * Renamed `client::ClientConnectorError::Connector` to
@@ -433,7 +489,7 @@
 * `Route::with()` does not return `ExtractorConfig`, to configure
   extractor use `Route::with_config()`
 
-    instead of 
+    instead of
 
     ```rust
     fn main() {
@@ -444,11 +500,11 @@
          });
     }
     ```
-    
-    use 
-    
+
+    use
+
     ```rust
-  
+
     fn main() {
          let app = App::new().resource("/index.html", |r| {
              r.method(http::Method::GET)
@@ -478,12 +534,12 @@
 * `HttpRequest::extensions()` returns read only reference to the request's Extension
   `HttpRequest::extensions_mut()` returns mutable reference.
 
-* Instead of 
+* Instead of
 
    `use actix_web::middleware::{
         CookieSessionBackend, CookieSessionError, RequestSession,
         Session, SessionBackend, SessionImpl, SessionStorage};`
-                                
+
   use `actix_web::middleware::session`
 
    `use actix_web::middleware::session{CookieSessionBackend, CookieSessionError,

README.md

@@ -1,4 +1,28 @@
-# Actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+<div align="center">
+ <p><h1>Actix web</h1> </p>
+  <p><strong>Actix web is a small, pragmatic, and extremely fast rust web framework</strong> </p>
+  <p>
+
+[![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) 
+[![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) 
+[![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web)
+[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+[![Documentation](https://docs.rs/actix-web/badge.svg)](https://docs.rs/actix-web)
+[![Download](https://img.shields.io/crates/d/actix-web.svg)](https://crates.io/crates/actix-web)
+[![Version](https://img.shields.io/badge/rustc-1.39+-lightgray.svg)](https://blog.rust-lang.org/2019/11/07/Rust-1.39.0.html)
+![License](https://img.shields.io/crates/l/actix-web.svg)
+
+  </p>
+
+  <h3>
+    <a href="https://actix.rs">Website</a>
+    <span> | </span>
+    <a href="https://gitter.im/actix/actix">Chat</a>
+    <span> | </span>
+    <a href="https://github.com/actix/examples">Examples</a>
+  </h3>
+</div>
+<br>
 
 Actix web is a simple, pragmatic and extremely fast web framework for Rust.
 
@@ -15,30 +39,32 @@ Actix web is a simple, pragmatic and extremely fast web framework for Rust.
 * Includes an asynchronous [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
 * Supports [Actix actor framework](https://github.com/actix/actix)
 
-## Documentation & community resources
-
-* [User Guide](https://actix.rs/docs/)
-* [API Documentation (1.0)](https://docs.rs/actix-web/)
-* [API Documentation (0.7)](https://docs.rs/actix-web/0.7.19/actix_web/)
-* [Chat on gitter](https://gitter.im/actix/actix)
-* Cargo package: [actix-web](https://crates.io/crates/actix-web)
-* Minimum supported Rust version: 1.34 or later
-
 ## Example
 
-```rust
-use actix_web::{web, App, HttpServer, Responder};
+Dependencies:
 
-fn index(info: web::Path<(u32, String)>) -> impl Responder {
+```toml
+[dependencies]
+actix-web = "2"
+actix-rt = "1"
+```
+
+Code:
+
+```rust
+use actix_web::{get, web, App, HttpServer, Responder};
+
+#[get("/{id}/{name}/index.html")]
+async fn index(info: web::Path<(u32, String)>) -> impl Responder {
     format!("Hello {}! id:{}", info.1, info.0)
 }
 
-fn main() -> std::io::Result<()> {
-    HttpServer::new(
-        || App::new().service(
-              web::resource("/{id}/{name}/index.html").to(index)))
+#[actix_rt::main]
+async fn main() -> std::io::Result<()> {
+    HttpServer::new(|| App::new().service(index))
         .bind("127.0.0.1:8080")?
         .run()
+        .await
 }
 ```
 
@@ -49,10 +75,11 @@ fn main() -> std::io::Result<()> {
 * [Multipart streams](https://github.com/actix/examples/tree/master/multipart/)
 * [Simple websocket](https://github.com/actix/examples/tree/master/websocket/)
 * [Tera](https://github.com/actix/examples/tree/master/template_tera/) /
-  [Askama](https://github.com/actix/examples/tree/master/template_askama/) templates
+* [Askama](https://github.com/actix/examples/tree/master/template_askama/) templates
 * [Diesel integration](https://github.com/actix/examples/tree/master/diesel/)
 * [r2d2](https://github.com/actix/examples/tree/master/r2d2/)
-* [SSL / HTTP/2.0](https://github.com/actix/examples/tree/master/tls/)
+* [OpenSSL](https://github.com/actix/examples/tree/master/openssl/)
+* [Rustls](https://github.com/actix/examples/tree/master/rustls/)
 * [Tcp/Websocket chat](https://github.com/actix/examples/tree/master/websocket-chat/)
 * [Json](https://github.com/actix/examples/tree/master/json/)
 
@@ -61,7 +88,7 @@ You may consider checking out
 
 ## Benchmarks
 
-* [TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r16&hw=ph&test=plaintext)
+* [TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r18)
 
 ## License
 

actix-cors/CHANGES.md

@@ -1,8 +1,14 @@
 # Changes
 
-## [0.1.1] - unreleased
+## [0.2.0] - 2019-12-20
 
-* Bump `derive_more` crate version to 0.15.0
+* Release
+
+## [0.2.0-alpha.3] - 2019-12-07
+
+* Migrate to actix-web 2.0.0
+
+* Bump `derive_more` crate version to 0.99.0
 
 ## [0.1.0] - 2019-06-15
 

actix-cors/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-cors"
-version = "0.1.0"
+version = "0.2.0"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Cross-origin resource sharing (CORS) for Actix applications."
 readme = "README.md"
@@ -10,14 +10,17 @@ repository = "https://github.com/actix/actix-web.git"
 documentation = "https://docs.rs/actix-cors/"
 license = "MIT/Apache-2.0"
 edition = "2018"
-#workspace = ".."
+workspace = ".."
 
 [lib]
 name = "actix_cors"
 path = "src/lib.rs"
 
 [dependencies]
-actix-web = "1.0.0"
-actix-service = "0.4.0"
-derive_more = "0.15.0"
-futures = "0.1.25"
+actix-web = "2.0.0-rc"
+actix-service = "1.0.1"
+derive_more = "0.99.2"
+futures = "0.3.1"
+
+[dev-dependencies]
+actix-rt = "1.0.0"

actix-cors/README.md

@@ -1,9 +1,9 @@
-# Identity service for actix web framework [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-identity)](https://crates.io/crates/actix-identity) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+# Cors Middleware for actix web framework [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-cors)](https://crates.io/crates/actix-cors) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
 
 ## Documentation & community resources
 
 * [User Guide](https://actix.rs/docs/)
-* [API Documentation](https://docs.rs/actix-identity/)
+* [API Documentation](https://docs.rs/actix-cors/)
 * [Chat on gitter](https://gitter.im/actix/actix)
-* Cargo package: [actix-session](https://crates.io/crates/actix-identity)
+* Cargo package: [actix-cors](https://crates.io/crates/actix-cors)
 * Minimum supported Rust version: 1.34 or later

actix-cors/src/lib.rs

@@ -1,3 +1,4 @@
+#![allow(clippy::borrow_interior_mutable_const, clippy::type_complexity)]
 //! Cross-origin resource sharing (CORS) for Actix applications
 //!
 //! CORS middleware could be used with application and with resource.
@@ -10,7 +11,7 @@
 //! use actix_cors::Cors;
 //! use actix_web::{http, web, App, HttpRequest, HttpResponse, HttpServer};
 //!
-//! fn index(req: HttpRequest) -> &'static str {
+//! async fn index(req: HttpRequest) -> &'static str {
 //!     "Hello world"
 //! }
 //!
@@ -22,7 +23,8 @@
 //!               .allowed_methods(vec!["GET", "POST"])
 //!               .allowed_headers(vec![http::header::AUTHORIZATION, http::header::ACCEPT])
 //!               .allowed_header(http::header::CONTENT_TYPE)
-//!               .max_age(3600))
+//!               .max_age(3600)
+//!               .finish())
 //!         .service(
 //!             web::resource("/index.html")
 //!               .route(web::get().to(index))
@@ -38,18 +40,19 @@
 //!
 //! Cors middleware automatically handle *OPTIONS* preflight request.
 use std::collections::HashSet;
+use std::convert::TryFrom;
 use std::iter::FromIterator;
 use std::rc::Rc;
+use std::task::{Context, Poll};
 
-use actix_service::{IntoTransform, Service, Transform};
+use actix_service::{Service, Transform};
 use actix_web::dev::{RequestHead, ServiceRequest, ServiceResponse};
 use actix_web::error::{Error, ResponseError, Result};
 use actix_web::http::header::{self, HeaderName, HeaderValue};
-use actix_web::http::{self, HttpTryFrom, Method, StatusCode, Uri};
+use actix_web::http::{self, Error as HttpError, Method, StatusCode, Uri};
 use actix_web::HttpResponse;
 use derive_more::Display;
-use futures::future::{ok, Either, Future, FutureResult};
-use futures::Poll;
+use futures::future::{ok, Either, FutureExt, LocalBoxFuture, Ready};
 
 /// A set of errors that can occur during processing CORS
 #[derive(Debug, Display)]
@@ -91,6 +94,10 @@ pub enum CorsError {
 }
 
 impl ResponseError for CorsError {
+    fn status_code(&self) -> StatusCode {
+        StatusCode::BAD_REQUEST
+    }
+
     fn error_response(&self) -> HttpResponse {
         HttpResponse::with_body(StatusCode::BAD_REQUEST, format!("{}", self).into())
     }
@@ -162,6 +169,7 @@ impl<T> AllOrSome<T> {
 ///     .max_age(3600);
 /// # }
 /// ```
+#[derive(Default)]
 pub struct Cors {
     cors: Option<Inner>,
     methods: bool,
@@ -267,7 +275,8 @@ impl Cors {
     pub fn allowed_methods<U, M>(mut self, methods: U) -> Cors
     where
         U: IntoIterator<Item = M>,
-        Method: HttpTryFrom<M>,
+        Method: TryFrom<M>,
+        <Method as TryFrom<M>>::Error: Into<HttpError>,
     {
         self.methods = true;
         if let Some(cors) = cors(&mut self.cors, &self.error) {
@@ -289,7 +298,8 @@ impl Cors {
     /// Set an allowed header
     pub fn allowed_header<H>(mut self, header: H) -> Cors
     where
-        HeaderName: HttpTryFrom<H>,
+        HeaderName: TryFrom<H>,
+        <HeaderName as TryFrom<H>>::Error: Into<HttpError>,
     {
         if let Some(cors) = cors(&mut self.cors, &self.error) {
             match HeaderName::try_from(header) {
@@ -321,7 +331,8 @@ impl Cors {
     pub fn allowed_headers<U, H>(mut self, headers: U) -> Cors
     where
         U: IntoIterator<Item = H>,
-        HeaderName: HttpTryFrom<H>,
+        HeaderName: TryFrom<H>,
+        <HeaderName as TryFrom<H>>::Error: Into<HttpError>,
     {
         if let Some(cors) = cors(&mut self.cors, &self.error) {
             for h in headers {
@@ -355,7 +366,8 @@ impl Cors {
     pub fn expose_headers<U, H>(mut self, headers: U) -> Cors
     where
         U: IntoIterator<Item = H>,
-        HeaderName: HttpTryFrom<H>,
+        HeaderName: TryFrom<H>,
+        <HeaderName as TryFrom<H>>::Error: Into<HttpError>,
     {
         for h in headers {
             match HeaderName::try_from(h) {
@@ -454,25 +466,9 @@ impl Cors {
         }
         self
     }
-}
 
-fn cors<'a>(
-    parts: &'a mut Option<Inner>,
-    err: &Option<http::Error>,
-) -> Option<&'a mut Inner> {
-    if err.is_some() {
-        return None;
-    }
-    parts.as_mut()
-}
-
-impl<S, B> IntoTransform<CorsFactory, S> for Cors
-where
-    S: Service<Request = ServiceRequest, Response = ServiceResponse<B>, Error = Error>,
-    S::Future: 'static,
-    B: 'static,
-{
-    fn into_transform(self) -> CorsFactory {
+    /// Construct cors middleware
+    pub fn finish(self) -> CorsFactory {
         let mut slf = if !self.methods {
             self.allowed_methods(vec![
                 Method::GET,
@@ -519,6 +515,16 @@ where
     }
 }
 
+fn cors<'a>(
+    parts: &'a mut Option<Inner>,
+    err: &Option<http::Error>,
+) -> Option<&'a mut Inner> {
+    if err.is_some() {
+        return None;
+    }
+    parts.as_mut()
+}
+
 /// `Middleware` for Cross-origin resource sharing support
 ///
 /// The Cors struct contains the settings for CORS requests to be validated and
@@ -538,7 +544,7 @@ where
     type Error = Error;
     type InitError = ();
     type Transform = CorsMiddleware<S>;
-    type Future = FutureResult<Self::Transform, Self::InitError>;
+    type Future = Ready<Result<Self::Transform, Self::InitError>>;
 
     fn new_transform(&self, service: S) -> Self::Future {
         ok(CorsMiddleware {
@@ -585,10 +591,10 @@ impl Inner {
             }
             Err(CorsError::BadOrigin)
         } else {
-            return match self.origins {
+            match self.origins {
                 AllOrSome::All => Ok(()),
                 _ => Err(CorsError::MissingOrigin),
-            };
+            }
         }
     }
 
@@ -663,7 +669,7 @@ impl Inner {
                     }
                     Err(CorsError::BadRequestHeaders)
                 } else {
-                    return Ok(());
+                    Ok(())
                 }
             }
         }
@@ -680,12 +686,12 @@ where
     type Response = ServiceResponse<B>;
     type Error = Error;
     type Future = Either<
-        FutureResult<Self::Response, Error>,
-        Either<S::Future, Box<Future<Item = Self::Response, Error = Error>>>,
+        Ready<Result<Self::Response, Error>>,
+        LocalBoxFuture<'static, Result<Self::Response, Error>>,
     >;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        self.service.poll_ready()
+    fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
+        self.service.poll_ready(cx)
     }
 
     fn call(&mut self, req: ServiceRequest) -> Self::Future {
@@ -696,7 +702,7 @@ where
                 .and_then(|_| self.inner.validate_allowed_method(req.head()))
                 .and_then(|_| self.inner.validate_allowed_headers(req.head()))
             {
-                return Either::A(ok(req.error_response(e)));
+                return Either::Left(ok(req.error_response(e)));
             }
 
             // allowed headers
@@ -749,39 +755,50 @@ where
                 .finish()
                 .into_body();
 
-            Either::A(ok(req.into_response(res)))
-        } else if req.headers().contains_key(&header::ORIGIN) {
-            // Only check requests with a origin header.
-            if let Err(e) = self.inner.validate_origin(req.head()) {
-                return Either::A(ok(req.error_response(e)));
+            Either::Left(ok(req.into_response(res)))
+        } else {
+            if req.headers().contains_key(&header::ORIGIN) {
+                // Only check requests with a origin header.
+                if let Err(e) = self.inner.validate_origin(req.head()) {
+                    return Either::Left(ok(req.error_response(e)));
+                }
             }
 
             let inner = self.inner.clone();
+            let has_origin = req.headers().contains_key(&header::ORIGIN);
+            let fut = self.service.call(req);
 
-            Either::B(Either::B(Box::new(self.service.call(req).and_then(
-                move |mut res| {
-                    if let Some(origin) =
-                        inner.access_control_allow_origin(res.request().head())
-                    {
-                        res.headers_mut()
-                            .insert(header::ACCESS_CONTROL_ALLOW_ORIGIN, origin.clone());
-                    };
+            Either::Right(
+                async move {
+                    let res = fut.await;
 
-                    if let Some(ref expose) = inner.expose_hdrs {
-                        res.headers_mut().insert(
-                            header::ACCESS_CONTROL_EXPOSE_HEADERS,
-                            HeaderValue::try_from(expose.as_str()).unwrap(),
-                        );
-                    }
-                    if inner.supports_credentials {
-                        res.headers_mut().insert(
-                            header::ACCESS_CONTROL_ALLOW_CREDENTIALS,
-                            HeaderValue::from_static("true"),
-                        );
-                    }
-                    if inner.vary_header {
-                        let value =
-                            if let Some(hdr) = res.headers_mut().get(&header::VARY) {
+                    if has_origin {
+                        let mut res = res?;
+                        if let Some(origin) =
+                            inner.access_control_allow_origin(res.request().head())
+                        {
+                            res.headers_mut().insert(
+                                header::ACCESS_CONTROL_ALLOW_ORIGIN,
+                                origin.clone(),
+                            );
+                        };
+
+                        if let Some(ref expose) = inner.expose_hdrs {
+                            res.headers_mut().insert(
+                                header::ACCESS_CONTROL_EXPOSE_HEADERS,
+                                HeaderValue::try_from(expose.as_str()).unwrap(),
+                            );
+                        }
+                        if inner.supports_credentials {
+                            res.headers_mut().insert(
+                                header::ACCESS_CONTROL_ALLOW_CREDENTIALS,
+                                HeaderValue::from_static("true"),
+                            );
+                        }
+                        if inner.vary_header {
+                            let value = if let Some(hdr) =
+                                res.headers_mut().get(&header::VARY)
+                            {
                                 let mut val: Vec<u8> =
                                     Vec::with_capacity(hdr.as_bytes().len() + 8);
                                 val.extend(hdr.as_bytes());
@@ -790,83 +807,71 @@ where
                             } else {
                                 HeaderValue::from_static("Origin")
                             };
-                        res.headers_mut().insert(header::VARY, value);
+                            res.headers_mut().insert(header::VARY, value);
+                        }
+                        Ok(res)
+                    } else {
+                        res
                     }
-                    Ok(res)
-                },
-            ))))
-        } else {
-            Either::B(Either::A(self.service.call(req)))
+                }
+                .boxed_local(),
+            )
         }
     }
 }
 
 #[cfg(test)]
 mod tests {
-    use actix_service::{IntoService, Transform};
-    use actix_web::test::{self, block_on, TestRequest};
+    use actix_service::{fn_service, Transform};
+    use actix_web::test::{self, TestRequest};
 
     use super::*;
 
-    impl Cors {
-        fn finish<F, S, B>(self, srv: F) -> CorsMiddleware<S>
-        where
-            F: IntoService<S>,
-            S: Service<
-                    Request = ServiceRequest,
-                    Response = ServiceResponse<B>,
-                    Error = Error,
-                > + 'static,
-            S::Future: 'static,
-            B: 'static,
-        {
-            block_on(
-                IntoTransform::<CorsFactory, S>::into_transform(self)
-                    .new_transform(srv.into_service()),
-            )
-            .unwrap()
-        }
-    }
-
-    #[test]
+    #[actix_rt::test]
     #[should_panic(expected = "Credentials are allowed, but the Origin is set to")]
-    fn cors_validates_illegal_allow_credentials() {
-        let _cors = Cors::new()
-            .supports_credentials()
-            .send_wildcard()
-            .finish(test::ok_service());
+    async fn cors_validates_illegal_allow_credentials() {
+        let _cors = Cors::new().supports_credentials().send_wildcard().finish();
     }
 
-    #[test]
-    fn validate_origin_allows_all_origins() {
-        let mut cors = Cors::new().finish(test::ok_service());
+    #[actix_rt::test]
+    async fn validate_origin_allows_all_origins() {
+        let mut cors = Cors::new()
+            .finish()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
         let req = TestRequest::with_header("Origin", "https://www.example.com")
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(resp.status(), StatusCode::OK);
     }
 
-    #[test]
-    fn default() {
-        let mut cors =
-            block_on(Cors::default().new_transform(test::ok_service())).unwrap();
+    #[actix_rt::test]
+    async fn default() {
+        let mut cors = Cors::default()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
         let req = TestRequest::with_header("Origin", "https://www.example.com")
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(resp.status(), StatusCode::OK);
     }
 
-    #[test]
-    fn test_preflight() {
+    #[actix_rt::test]
+    async fn test_preflight() {
         let mut cors = Cors::new()
             .send_wildcard()
             .max_age(3600)
             .allowed_methods(vec![Method::GET, Method::OPTIONS, Method::POST])
             .allowed_headers(vec![header::AUTHORIZATION, header::ACCEPT])
             .allowed_header(header::CONTENT_TYPE)
-            .finish(test::ok_service());
+            .finish()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
 
         let req = TestRequest::with_header("Origin", "https://www.example.com")
             .method(Method::OPTIONS)
@@ -875,7 +880,7 @@ mod tests {
 
         assert!(cors.inner.validate_allowed_method(req.head()).is_err());
         assert!(cors.inner.validate_allowed_headers(req.head()).is_err());
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(resp.status(), StatusCode::BAD_REQUEST);
 
         let req = TestRequest::with_header("Origin", "https://www.example.com")
@@ -895,7 +900,7 @@ mod tests {
             .method(Method::OPTIONS)
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(
             &b"*"[..],
             resp.headers()
@@ -941,13 +946,13 @@ mod tests {
             .method(Method::OPTIONS)
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(resp.status(), StatusCode::OK);
     }
 
-    // #[test]
+    // #[actix_rt::test]
     // #[should_panic(expected = "MissingOrigin")]
-    // fn test_validate_missing_origin() {
+    // async fn test_validate_missing_origin() {
     //    let cors = Cors::build()
     //        .allowed_origin("https://www.example.com")
     //        .finish();
@@ -955,12 +960,15 @@ mod tests {
     //    cors.start(&req).unwrap();
     // }
 
-    #[test]
+    #[actix_rt::test]
     #[should_panic(expected = "OriginNotAllowed")]
-    fn test_validate_not_allowed_origin() {
+    async fn test_validate_not_allowed_origin() {
         let cors = Cors::new()
             .allowed_origin("https://www.example.com")
-            .finish(test::ok_service());
+            .finish()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
 
         let req = TestRequest::with_header("Origin", "https://www.unknown.com")
             .method(Method::GET)
@@ -970,26 +978,34 @@ mod tests {
         cors.inner.validate_allowed_headers(req.head()).unwrap();
     }
 
-    #[test]
-    fn test_validate_origin() {
+    #[actix_rt::test]
+    async fn test_validate_origin() {
         let mut cors = Cors::new()
             .allowed_origin("https://www.example.com")
-            .finish(test::ok_service());
+            .finish()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
 
         let req = TestRequest::with_header("Origin", "https://www.example.com")
             .method(Method::GET)
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(resp.status(), StatusCode::OK);
     }
 
-    #[test]
-    fn test_no_origin_response() {
-        let mut cors = Cors::new().disable_preflight().finish(test::ok_service());
+    #[actix_rt::test]
+    async fn test_no_origin_response() {
+        let mut cors = Cors::new()
+            .disable_preflight()
+            .finish()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
 
         let req = TestRequest::default().method(Method::GET).to_srv_request();
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert!(resp
             .headers()
             .get(header::ACCESS_CONTROL_ALLOW_ORIGIN)
@@ -998,7 +1014,7 @@ mod tests {
         let req = TestRequest::with_header("Origin", "https://www.example.com")
             .method(Method::OPTIONS)
             .to_srv_request();
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(
             &b"https://www.example.com"[..],
             resp.headers()
@@ -1008,8 +1024,8 @@ mod tests {
         );
     }
 
-    #[test]
-    fn test_response() {
+    #[actix_rt::test]
+    async fn test_response() {
         let exposed_headers = vec![header::AUTHORIZATION, header::ACCEPT];
         let mut cors = Cors::new()
             .send_wildcard()
@@ -1019,13 +1035,16 @@ mod tests {
             .allowed_headers(exposed_headers.clone())
             .expose_headers(exposed_headers.clone())
             .allowed_header(header::CONTENT_TYPE)
-            .finish(test::ok_service());
+            .finish()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
 
         let req = TestRequest::with_header("Origin", "https://www.example.com")
             .method(Method::OPTIONS)
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(
             &b"*"[..],
             resp.headers()
@@ -1063,15 +1082,18 @@ mod tests {
             .allowed_headers(exposed_headers.clone())
             .expose_headers(exposed_headers.clone())
             .allowed_header(header::CONTENT_TYPE)
-            .finish(|req: ServiceRequest| {
-                req.into_response(
+            .finish()
+            .new_transform(fn_service(|req: ServiceRequest| {
+                ok(req.into_response(
                     HttpResponse::Ok().header(header::VARY, "Accept").finish(),
-                )
-            });
+                ))
+            }))
+            .await
+            .unwrap();
         let req = TestRequest::with_header("Origin", "https://www.example.com")
             .method(Method::OPTIONS)
             .to_srv_request();
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(
             &b"Accept, Origin"[..],
             resp.headers().get(header::VARY).unwrap().as_bytes()
@@ -1081,13 +1103,16 @@ mod tests {
             .disable_vary_header()
             .allowed_origin("https://www.example.com")
             .allowed_origin("https://www.google.com")
-            .finish(test::ok_service());
+            .finish()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
 
         let req = TestRequest::with_header("Origin", "https://www.example.com")
             .method(Method::OPTIONS)
             .header(header::ACCESS_CONTROL_REQUEST_METHOD, "POST")
             .to_srv_request();
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
 
         let origins_str = resp
             .headers()
@@ -1099,19 +1124,22 @@ mod tests {
         assert_eq!("https://www.example.com", origins_str);
     }
 
-    #[test]
-    fn test_multiple_origins() {
+    #[actix_rt::test]
+    async fn test_multiple_origins() {
         let mut cors = Cors::new()
             .allowed_origin("https://example.com")
             .allowed_origin("https://example.org")
             .allowed_methods(vec![Method::GET])
-            .finish(test::ok_service());
+            .finish()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
 
         let req = TestRequest::with_header("Origin", "https://example.com")
             .method(Method::GET)
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(
             &b"https://example.com"[..],
             resp.headers()
@@ -1124,7 +1152,7 @@ mod tests {
             .method(Method::GET)
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(
             &b"https://example.org"[..],
             resp.headers()
@@ -1134,20 +1162,23 @@ mod tests {
         );
     }
 
-    #[test]
-    fn test_multiple_origins_preflight() {
+    #[actix_rt::test]
+    async fn test_multiple_origins_preflight() {
         let mut cors = Cors::new()
             .allowed_origin("https://example.com")
             .allowed_origin("https://example.org")
             .allowed_methods(vec![Method::GET])
-            .finish(test::ok_service());
+            .finish()
+            .new_transform(test::ok_service())
+            .await
+            .unwrap();
 
         let req = TestRequest::with_header("Origin", "https://example.com")
             .header(header::ACCESS_CONTROL_REQUEST_METHOD, "GET")
             .method(Method::OPTIONS)
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(
             &b"https://example.com"[..],
             resp.headers()
@@ -1161,7 +1192,7 @@ mod tests {
             .method(Method::OPTIONS)
             .to_srv_request();
 
-        let resp = test::call_service(&mut cors, req);
+        let resp = test::call_service(&mut cors, req).await;
         assert_eq!(
             &b"https://example.org"[..],
             resp.headers()

actix-files/CHANGES.md

@@ -1,10 +1,41 @@
 # Changes
 
+## [0.2.1] - 2019-12-22
+
+* Use the same format for file URLs regardless of platforms
+
+## [0.2.0] - 2019-12-20
+
+* Fix BodyEncoding trait import #1220
+
+## [0.2.0-alpha.1] - 2019-12-07
+
+* Migrate to `std::future`
+
+## [0.1.7] - 2019-11-06
+
+* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
+
+## [0.1.6] - 2019-10-14
+
+* Add option to redirect to a slash-ended path `Files` #1132
+
+## [0.1.5] - 2019-10-08
+
+* Bump up `mime_guess` crate version to 2.0.1
+
+* Bump up `percent-encoding` crate version to 2.1
+
+* Allow user defined request guards for `Files` #1113
+
+## [0.1.4] - 2019-07-20
+
+* Allow to disable `Content-Disposition` header #686
+
 ## [0.1.3] - 2019-06-28
 
 * Do not set `Content-Length` header, let actix-http set it #930
 
-
 ## [0.1.2] - 2019-06-13
 
 * Content-Length is 0 for NamedFile HEAD request #914

actix-files/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-files"
-version = "0.1.3"
+version = "0.2.1"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Static files support for actix web."
 readme = "README.md"
@@ -18,18 +18,19 @@ name = "actix_files"
 path = "src/lib.rs"
 
 [dependencies]
-actix-web = { version = "1.0.2", default-features = false }
-actix-http = "0.2.4"
-actix-service = "0.4.1"
+actix-web = { version = "2.0.0-rc", default-features = false }
+actix-http = "2.0.0-alpha.2"
+actix-service = "1.0.1"
 bitflags = "1"
-bytes = "0.4"
-futures = "0.1.25"
-derive_more = "0.15.0"
+bytes = "0.5.3"
+futures = "0.3.1"
+derive_more = "0.99.2"
 log = "0.4"
 mime = "0.3"
-mime_guess = "2.0.0-alpha"
-percent-encoding = "1.0"
+mime_guess = "2.0.1"
+percent-encoding = "2.1"
 v_htmlescape = "0.4"
 
 [dev-dependencies]
-actix-web = { version = "1.0.2", features=["ssl"] }
+actix-rt = "1.0.0"
+actix-web = { version = "2.0.0-rc", features=["openssl"] }

actix-files/src/error.rs

@@ -5,6 +5,7 @@ use derive_more::Display;
 #[derive(Display, Debug, PartialEq)]
 pub enum FilesError {
     /// Path is not a directory
+    #[allow(dead_code)]
     #[display(fmt = "Path is not a directory. Unable to serve static files")]
     IsNotDirectory,
 
@@ -35,7 +36,7 @@ pub enum UriSegmentError {
 
 /// Return `BadRequest` for `UriSegmentError`
 impl ResponseError for UriSegmentError {
-    fn error_response(&self) -> HttpResponse {
-        HttpResponse::new(StatusCode::BAD_REQUEST)
+    fn status_code(&self) -> StatusCode {
+        StatusCode::BAD_REQUEST
     }
 }

actix-files/src/named.rs

@@ -9,23 +9,25 @@ use std::os::unix::fs::MetadataExt;
 
 use bitflags::bitflags;
 use mime;
-use mime_guess::guess_mime_type;
+use mime_guess::from_path;
 
 use actix_http::body::SizedStream;
+use actix_web::dev::BodyEncoding;
 use actix_web::http::header::{
-    self, ContentDisposition, DispositionParam, DispositionType,
+    self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
 };
-use actix_web::http::{ContentEncoding, Method, StatusCode};
-use actix_web::middleware::BodyEncoding;
+use actix_web::http::{ContentEncoding, StatusCode};
 use actix_web::{Error, HttpMessage, HttpRequest, HttpResponse, Responder};
+use futures::future::{ready, Ready};
 
 use crate::range::HttpRange;
 use crate::ChunkedReadFile;
 
 bitflags! {
-    pub(crate) struct Flags: u32 {
-        const ETAG = 0b00000001;
-        const LAST_MD = 0b00000010;
+    pub(crate) struct Flags: u8 {
+        const ETAG = 0b0000_0001;
+        const LAST_MD = 0b0000_0010;
+        const CONTENT_DISPOSITION = 0b0000_0100;
     }
 }
 
@@ -40,13 +42,13 @@ impl Default for Flags {
 pub struct NamedFile {
     path: PathBuf,
     file: File,
+    modified: Option<SystemTime>,
+    pub(crate) md: Metadata,
+    pub(crate) flags: Flags,
+    pub(crate) status_code: StatusCode,
     pub(crate) content_type: mime::Mime,
     pub(crate) content_disposition: header::ContentDisposition,
-    pub(crate) md: Metadata,
-    modified: Option<SystemTime>,
     pub(crate) encoding: Option<ContentEncoding>,
-    pub(crate) status_code: StatusCode,
-    pub(crate) flags: Flags,
 }
 
 impl NamedFile {
@@ -87,14 +89,23 @@ impl NamedFile {
                 }
             };
 
-            let ct = guess_mime_type(&path);
+            let ct = from_path(&path).first_or_octet_stream();
             let disposition_type = match ct.type_() {
                 mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
                 _ => DispositionType::Attachment,
             };
+            let mut parameters =
+                vec![DispositionParam::Filename(String::from(filename.as_ref()))];
+            if !filename.is_ascii() {
+                parameters.push(DispositionParam::FilenameExt(ExtendedValue {
+                    charset: Charset::Ext(String::from("UTF-8")),
+                    language_tag: None,
+                    value: filename.into_owned().into_bytes(),
+                }))
+            }
             let cd = ContentDisposition {
                 disposition: disposition_type,
-                parameters: vec![DispositionParam::Filename(filename.into_owned())],
+                parameters: parameters,
             };
             (ct, cd)
         };
@@ -172,11 +183,21 @@ impl NamedFile {
     /// sent to the peer. By default the disposition is `inline` for text,
     /// image, and video content types, and `attachment` otherwise, and
     /// the filename is taken from the path provided in the `open` method
-    /// after converting it to UTF-8 using
+    /// after converting it to UTF-8 using.
     /// [to_string_lossy](https://doc.rust-lang.org/std/ffi/struct.OsStr.html#method.to_string_lossy).
     #[inline]
     pub fn set_content_disposition(mut self, cd: header::ContentDisposition) -> Self {
         self.content_disposition = cd;
+        self.flags.insert(Flags::CONTENT_DISPOSITION);
+        self
+    }
+
+    /// Disable `Content-Disposition` header.
+    ///
+    /// By default Content-Disposition` header is enabled.
+    #[inline]
+    pub fn disable_content_disposition(mut self) -> Self {
+        self.flags.remove(Flags::CONTENT_DISPOSITION);
         self
     }
 
@@ -235,69 +256,17 @@ impl NamedFile {
     pub(crate) fn last_modified(&self) -> Option<header::HttpDate> {
         self.modified.map(|mtime| mtime.into())
     }
-}
 
-impl Deref for NamedFile {
-    type Target = File;
-
-    fn deref(&self) -> &File {
-        &self.file
-    }
-}
-
-impl DerefMut for NamedFile {
-    fn deref_mut(&mut self) -> &mut File {
-        &mut self.file
-    }
-}
-
-/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
-fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
-    match req.get_header::<header::IfMatch>() {
-        None | Some(header::IfMatch::Any) => true,
-        Some(header::IfMatch::Items(ref items)) => {
-            if let Some(some_etag) = etag {
-                for item in items {
-                    if item.strong_eq(some_etag) {
-                        return true;
-                    }
-                }
-            }
-            false
-        }
-    }
-}
-
-/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
-fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
-    match req.get_header::<header::IfNoneMatch>() {
-        Some(header::IfNoneMatch::Any) => false,
-        Some(header::IfNoneMatch::Items(ref items)) => {
-            if let Some(some_etag) = etag {
-                for item in items {
-                    if item.weak_eq(some_etag) {
-                        return false;
-                    }
-                }
-            }
-            true
-        }
-        None => true,
-    }
-}
-
-impl Responder for NamedFile {
-    type Error = Error;
-    type Future = Result<HttpResponse, Error>;
-
-    fn respond_to(self, req: &HttpRequest) -> Self::Future {
+    pub fn into_response(self, req: &HttpRequest) -> Result<HttpResponse, Error> {
         if self.status_code != StatusCode::OK {
             let mut resp = HttpResponse::build(self.status_code);
             resp.set(header::ContentType(self.content_type.clone()))
-                .header(
-                    header::CONTENT_DISPOSITION,
-                    self.content_disposition.to_string(),
-                );
+                .if_true(self.flags.contains(Flags::CONTENT_DISPOSITION), |res| {
+                    res.header(
+                        header::CONTENT_DISPOSITION,
+                        self.content_disposition.to_string(),
+                    );
+                });
             if let Some(current_encoding) = self.encoding {
                 resp.encoding(current_encoding);
             }
@@ -311,16 +280,6 @@ impl Responder for NamedFile {
             return Ok(resp.streaming(reader));
         }
 
-        match req.method() {
-            &Method::HEAD | &Method::GET => (),
-            _ => {
-                return Ok(HttpResponse::MethodNotAllowed()
-                    .header(header::CONTENT_TYPE, "text/plain")
-                    .header(header::ALLOW, "GET, HEAD")
-                    .body("This resource only supports GET and HEAD."));
-            }
-        }
-
         let etag = if self.flags.contains(Flags::ETAG) {
             self.etag()
         } else {
@@ -368,10 +327,12 @@ impl Responder for NamedFile {
 
         let mut resp = HttpResponse::build(self.status_code);
         resp.set(header::ContentType(self.content_type.clone()))
-            .header(
-                header::CONTENT_DISPOSITION,
-                self.content_disposition.to_string(),
-            );
+            .if_true(self.flags.contains(Flags::CONTENT_DISPOSITION), |res| {
+                res.header(
+                    header::CONTENT_DISPOSITION,
+                    self.content_disposition.to_string(),
+                );
+            });
         // default compressing
         if let Some(current_encoding) = self.encoding {
             resp.encoding(current_encoding);
@@ -428,8 +389,67 @@ impl Responder for NamedFile {
             counter: 0,
         };
         if offset != 0 || length != self.md.len() {
-            return Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader));
-        };
-        Ok(resp.body(SizedStream::new(length, reader)))
+            Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader))
+        } else {
+            Ok(resp.body(SizedStream::new(length, reader)))
+        }
+    }
+}
+
+impl Deref for NamedFile {
+    type Target = File;
+
+    fn deref(&self) -> &File {
+        &self.file
+    }
+}
+
+impl DerefMut for NamedFile {
+    fn deref_mut(&mut self) -> &mut File {
+        &mut self.file
+    }
+}
+
+/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
+fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
+    match req.get_header::<header::IfMatch>() {
+        None | Some(header::IfMatch::Any) => true,
+        Some(header::IfMatch::Items(ref items)) => {
+            if let Some(some_etag) = etag {
+                for item in items {
+                    if item.strong_eq(some_etag) {
+                        return true;
+                    }
+                }
+            }
+            false
+        }
+    }
+}
+
+/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
+fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
+    match req.get_header::<header::IfNoneMatch>() {
+        Some(header::IfNoneMatch::Any) => false,
+        Some(header::IfNoneMatch::Items(ref items)) => {
+            if let Some(some_etag) = etag {
+                for item in items {
+                    if item.weak_eq(some_etag) {
+                        return false;
+                    }
+                }
+            }
+            true
+        }
+        None => true,
+    }
+}
+
+impl Responder for NamedFile {
+    type Error = Error;
+    type Future = Ready<Result<HttpResponse, Error>>;
+
+    fn respond_to(self, req: &HttpRequest) -> Self::Future {
+        ready(self.into_response(req))
     }
 }

actix-files/src/range.rs

@@ -5,7 +5,7 @@ pub struct HttpRange {
     pub length: u64,
 }
 
-static PREFIX: &'static str = "bytes=";
+static PREFIX: &str = "bytes=";
 const PREFIX_LEN: usize = 6;
 
 impl HttpRange {

actix-framed/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-framed"
-version = "0.2.0"
+version = "0.3.0"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Actix framed app server"
 readme = "README.md"
@@ -13,26 +13,25 @@ categories = ["network-programming", "asynchronous",
               "web-programming::websocket"]
 license = "MIT/Apache-2.0"
 edition = "2018"
-workspace =".."
 
 [lib]
 name = "actix_framed"
 path = "src/lib.rs"
 
 [dependencies]
-actix-codec = "0.1.2"
-actix-service = "0.4.0"
-actix-utils = "0.4.0"
-actix-router = "0.1.2"
-actix-rt = "0.2.2"
-actix-http = "0.2.0"
-actix-server-config = "0.1.1"
+actix-codec = "0.2.0"
+actix-service = "1.0.1"
+actix-router = "0.2.1"
+actix-rt = "1.0.0"
+actix-http = "2.0.0-alpha.2"
 
-bytes = "0.4"
-futures = "0.1.25"
+bytes = "0.5.3"
+futures = "0.3.1"
+pin-project = "0.4.6"
 log = "0.4"
 
 [dev-dependencies]
-actix-server = { version = "0.5.0", features=["ssl"] }
-actix-connect = { version = "0.2.0", features=["ssl"] }
-actix-http-test = { version = "0.2.0", features=["ssl"] }
+actix-server = "1.0.0"
+actix-connect = { version = "2.0.0-alpha.2", features=["openssl"] }
+actix-http-test = { version = "1.0.0", features=["openssl"] }
+actix-utils = "1.0.3"

actix-framed/changes.md

@@ -1,5 +1,14 @@
 # Changes
 
+## [0.3.0] - 2019-12-25
+
+* Migrate to actix-http 1.0
+
+## [0.2.1] - 2019-07-20
+
+* Remove unneeded actix-utils dependency
+
+
 ## [0.2.0] - 2019-05-12
 
 * Update dependencies

actix-framed/src/app.rs

@@ -1,22 +1,23 @@
+use std::future::Future;
+use std::pin::Pin;
 use std::rc::Rc;
+use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_http::h1::{Codec, SendResponse};
 use actix_http::{Error, Request, Response};
 use actix_router::{Path, Router, Url};
-use actix_server_config::ServerConfig;
-use actix_service::{IntoNewService, NewService, Service};
-use actix_utils::cloneable::CloneableService;
-use futures::{Async, Future, Poll};
+use actix_service::{IntoServiceFactory, Service, ServiceFactory};
+use futures::future::{ok, FutureExt, LocalBoxFuture};
 
 use crate::helpers::{BoxedHttpNewService, BoxedHttpService, HttpNewService};
 use crate::request::FramedRequest;
 use crate::state::State;
 
-type BoxedResponse = Box<Future<Item = (), Error = Error>>;
+type BoxedResponse = LocalBoxFuture<'static, Result<(), Error>>;
 
 pub trait HttpServiceFactory {
-    type Factory: NewService;
+    type Factory: ServiceFactory;
 
     fn path(&self) -> &str;
 
@@ -49,19 +50,19 @@ impl<T: 'static, S: 'static> FramedApp<T, S> {
     pub fn service<U>(mut self, factory: U) -> Self
     where
         U: HttpServiceFactory,
-        U::Factory: NewService<
+        U::Factory: ServiceFactory<
                 Config = (),
                 Request = FramedRequest<T, S>,
                 Response = (),
                 Error = Error,
                 InitError = (),
             > + 'static,
-        <U::Factory as NewService>::Future: 'static,
-        <U::Factory as NewService>::Service: Service<
+        <U::Factory as ServiceFactory>::Future: 'static,
+        <U::Factory as ServiceFactory>::Service: Service<
             Request = FramedRequest<T, S>,
             Response = (),
             Error = Error,
-            Future = Box<Future<Item = (), Error = Error>>,
+            Future = LocalBoxFuture<'static, Result<(), Error>>,
         >,
     {
         let path = factory.path().to_string();
@@ -71,12 +72,12 @@ impl<T: 'static, S: 'static> FramedApp<T, S> {
     }
 }
 
-impl<T, S> IntoNewService<FramedAppFactory<T, S>> for FramedApp<T, S>
+impl<T, S> IntoServiceFactory<FramedAppFactory<T, S>> for FramedApp<T, S>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     S: 'static,
 {
-    fn into_new_service(self) -> FramedAppFactory<T, S> {
+    fn into_factory(self) -> FramedAppFactory<T, S> {
         FramedAppFactory {
             state: self.state,
             services: Rc::new(self.services),
@@ -90,20 +91,20 @@ pub struct FramedAppFactory<T, S> {
     services: Rc<Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>>,
 }
 
-impl<T, S> NewService for FramedAppFactory<T, S>
+impl<T, S> ServiceFactory for FramedAppFactory<T, S>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     S: 'static,
 {
-    type Config = ServerConfig;
+    type Config = ();
     type Request = (Request, Framed<T, Codec>);
     type Response = ();
     type Error = Error;
     type InitError = ();
-    type Service = CloneableService<FramedAppService<T, S>>;
+    type Service = FramedAppService<T, S>;
     type Future = CreateService<T, S>;
 
-    fn new_service(&self, _: &ServerConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         CreateService {
             fut: self
                 .services
@@ -111,7 +112,7 @@ where
                 .map(|(path, service)| {
                     CreateServiceItem::Future(
                         Some(path.clone()),
-                        service.new_service(&()),
+                        service.new_service(()),
                     )
                 })
                 .collect(),
@@ -129,28 +130,30 @@ pub struct CreateService<T, S> {
 enum CreateServiceItem<T, S> {
     Future(
         Option<String>,
-        Box<Future<Item = BoxedHttpService<FramedRequest<T, S>>, Error = ()>>,
+        LocalBoxFuture<'static, Result<BoxedHttpService<FramedRequest<T, S>>, ()>>,
     ),
     Service(String, BoxedHttpService<FramedRequest<T, S>>),
 }
 
 impl<S: 'static, T: 'static> Future for CreateService<T, S>
 where
-    T: AsyncRead + AsyncWrite,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
-    type Item = CloneableService<FramedAppService<T, S>>;
-    type Error = ();
+    type Output = Result<FramedAppService<T, S>, ()>;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
         let mut done = true;
 
         // poll http services
         for item in &mut self.fut {
             let res = match item {
                 CreateServiceItem::Future(ref mut path, ref mut fut) => {
-                    match fut.poll()? {
-                        Async::Ready(service) => Some((path.take().unwrap(), service)),
-                        Async::NotReady => {
+                    match Pin::new(fut).poll(cx) {
+                        Poll::Ready(Ok(service)) => {
+                            Some((path.take().unwrap(), service))
+                        }
+                        Poll::Ready(Err(e)) => return Poll::Ready(Err(e)),
+                        Poll::Pending => {
                             done = false;
                             None
                         }
@@ -177,12 +180,12 @@ where
                     }
                     router
                 });
-            Ok(Async::Ready(CloneableService::new(FramedAppService {
+            Poll::Ready(Ok(FramedAppService {
                 router: router.finish(),
                 state: self.state.clone(),
-            })))
+            }))
         } else {
-            Ok(Async::NotReady)
+            Poll::Pending
         }
     }
 }
@@ -194,15 +197,15 @@ pub struct FramedAppService<T, S> {
 
 impl<S: 'static, T: 'static> Service for FramedAppService<T, S>
 where
-    T: AsyncRead + AsyncWrite,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
     type Request = (Request, Framed<T, Codec>);
     type Response = ();
     type Error = Error;
     type Future = BoxedResponse;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
+    fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
@@ -211,8 +214,8 @@ where
         if let Some((srv, _info)) = self.router.recognize_mut(&mut path) {
             return srv.call(FramedRequest::new(req, framed, path, self.state.clone()));
         }
-        Box::new(
-            SendResponse::new(framed, Response::NotFound().finish()).then(|_| Ok(())),
-        )
+        SendResponse::new(framed, Response::NotFound().finish())
+            .then(|_| ok(()))
+            .boxed_local()
     }
 }

actix-framed/src/helpers.rs

@@ -1,36 +1,38 @@
+use std::task::{Context, Poll};
+
 use actix_http::Error;
-use actix_service::{NewService, Service};
-use futures::{Future, Poll};
+use actix_service::{Service, ServiceFactory};
+use futures::future::{FutureExt, LocalBoxFuture};
 
 pub(crate) type BoxedHttpService<Req> = Box<
-    Service<
+    dyn Service<
         Request = Req,
         Response = (),
         Error = Error,
-        Future = Box<Future<Item = (), Error = Error>>,
+        Future = LocalBoxFuture<'static, Result<(), Error>>,
     >,
 >;
 
 pub(crate) type BoxedHttpNewService<Req> = Box<
-    NewService<
+    dyn ServiceFactory<
         Config = (),
         Request = Req,
         Response = (),
         Error = Error,
         InitError = (),
         Service = BoxedHttpService<Req>,
-        Future = Box<Future<Item = BoxedHttpService<Req>, Error = ()>>,
+        Future = LocalBoxFuture<'static, Result<BoxedHttpService<Req>, ()>>,
     >,
 >;
 
-pub(crate) struct HttpNewService<T: NewService>(T);
+pub(crate) struct HttpNewService<T: ServiceFactory>(T);
 
 impl<T> HttpNewService<T>
 where
-    T: NewService<Response = (), Error = Error>,
+    T: ServiceFactory<Response = (), Error = Error>,
     T::Response: 'static,
     T::Future: 'static,
-    T::Service: Service<Future = Box<Future<Item = (), Error = Error>>> + 'static,
+    T::Service: Service<Future = LocalBoxFuture<'static, Result<(), Error>>> + 'static,
     <T::Service as Service>::Future: 'static,
 {
     pub fn new(service: T) -> Self {
@@ -38,12 +40,12 @@ where
     }
 }
 
-impl<T> NewService for HttpNewService<T>
+impl<T> ServiceFactory for HttpNewService<T>
 where
-    T: NewService<Config = (), Response = (), Error = Error>,
+    T: ServiceFactory<Config = (), Response = (), Error = Error>,
     T::Request: 'static,
     T::Future: 'static,
-    T::Service: Service<Future = Box<Future<Item = (), Error = Error>>> + 'static,
+    T::Service: Service<Future = LocalBoxFuture<'static, Result<(), Error>>> + 'static,
     <T::Service as Service>::Future: 'static,
 {
     type Config = ();
@@ -52,13 +54,19 @@ where
     type Error = Error;
     type InitError = ();
     type Service = BoxedHttpService<T::Request>;
-    type Future = Box<Future<Item = Self::Service, Error = ()>>;
+    type Future = LocalBoxFuture<'static, Result<Self::Service, ()>>;
 
-    fn new_service(&self, _: &()) -> Self::Future {
-        Box::new(self.0.new_service(&()).map_err(|_| ()).and_then(|service| {
-            let service: BoxedHttpService<_> = Box::new(HttpServiceWrapper { service });
-            Ok(service)
-        }))
+    fn new_service(&self, _: ()) -> Self::Future {
+        let fut = self.0.new_service(());
+
+        async move {
+            fut.await.map_err(|_| ()).map(|service| {
+                let service: BoxedHttpService<_> =
+                    Box::new(HttpServiceWrapper { service });
+                service
+            })
+        }
+        .boxed_local()
     }
 }
 
@@ -70,7 +78,7 @@ impl<T> Service for HttpServiceWrapper<T>
 where
     T: Service<
         Response = (),
-        Future = Box<Future<Item = (), Error = Error>>,
+        Future = LocalBoxFuture<'static, Result<(), Error>>,
         Error = Error,
     >,
     T::Request: 'static,
@@ -78,10 +86,10 @@ where
     type Request = T::Request;
     type Response = ();
     type Error = Error;
-    type Future = Box<Future<Item = (), Error = Error>>;
+    type Future = LocalBoxFuture<'static, Result<(), Error>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        self.service.poll_ready()
+    fn poll_ready(&mut self, cx: &mut Context) -> Poll<Result<(), Self::Error>> {
+        self.service.poll_ready(cx)
     }
 
     fn call(&mut self, req: Self::Request) -> Self::Future {

actix-framed/src/lib.rs

@@ -1,3 +1,4 @@
+#![allow(clippy::type_complexity, clippy::new_without_default, dead_code)]
 mod app;
 mod helpers;
 mod request;

actix-framed/src/request.rs

@@ -123,7 +123,9 @@ impl<Io, S> FramedRequest<Io, S> {
 
 #[cfg(test)]
 mod tests {
-    use actix_http::http::{HeaderName, HeaderValue, HttpTryFrom};
+    use std::convert::TryFrom;
+
+    use actix_http::http::{HeaderName, HeaderValue};
     use actix_http::test::{TestBuffer, TestRequest};
 
     use super::*;

actix-framed/src/route.rs

@@ -1,11 +1,12 @@
 use std::fmt;
+use std::future::Future;
 use std::marker::PhantomData;
+use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite};
 use actix_http::{http::Method, Error};
-use actix_service::{NewService, Service};
-use futures::future::{ok, FutureResult};
-use futures::{Async, Future, IntoFuture, Poll};
+use actix_service::{Service, ServiceFactory};
+use futures::future::{ok, FutureExt, LocalBoxFuture, Ready};
 use log::error;
 
 use crate::app::HttpServiceFactory;
@@ -15,11 +16,11 @@ use crate::request::FramedRequest;
 ///
 /// Route uses builder-like pattern for configuration.
 /// If handler is not explicitly set, default *404 Not Found* handler is used.
-pub struct FramedRoute<Io, S, F = (), R = ()> {
+pub struct FramedRoute<Io, S, F = (), R = (), E = ()> {
     handler: F,
     pattern: String,
     methods: Vec<Method>,
-    state: PhantomData<(Io, S, R)>,
+    state: PhantomData<(Io, S, R, E)>,
 }
 
 impl<Io, S> FramedRoute<Io, S> {
@@ -53,12 +54,12 @@ impl<Io, S> FramedRoute<Io, S> {
         self
     }
 
-    pub fn to<F, R>(self, handler: F) -> FramedRoute<Io, S, F, R>
+    pub fn to<F, R, E>(self, handler: F) -> FramedRoute<Io, S, F, R, E>
     where
         F: FnMut(FramedRequest<Io, S>) -> R,
-        R: IntoFuture<Item = ()>,
-        R::Future: 'static,
-        R::Error: fmt::Debug,
+        R: Future<Output = Result<(), E>> + 'static,
+
+        E: fmt::Debug,
     {
         FramedRoute {
             handler,
@@ -69,15 +70,14 @@ impl<Io, S> FramedRoute<Io, S> {
     }
 }
 
-impl<Io, S, F, R> HttpServiceFactory for FramedRoute<Io, S, F, R>
+impl<Io, S, F, R, E> HttpServiceFactory for FramedRoute<Io, S, F, R, E>
 where
     Io: AsyncRead + AsyncWrite + 'static,
     F: FnMut(FramedRequest<Io, S>) -> R + Clone,
-    R: IntoFuture<Item = ()>,
-    R::Future: 'static,
-    R::Error: fmt::Display,
+    R: Future<Output = Result<(), E>> + 'static,
+    E: fmt::Display,
 {
-    type Factory = FramedRouteFactory<Io, S, F, R>;
+    type Factory = FramedRouteFactory<Io, S, F, R, E>;
 
     fn path(&self) -> &str {
         &self.pattern
@@ -92,29 +92,28 @@ where
     }
 }
 
-pub struct FramedRouteFactory<Io, S, F, R> {
+pub struct FramedRouteFactory<Io, S, F, R, E> {
     handler: F,
     methods: Vec<Method>,
-    _t: PhantomData<(Io, S, R)>,
+    _t: PhantomData<(Io, S, R, E)>,
 }
 
-impl<Io, S, F, R> NewService for FramedRouteFactory<Io, S, F, R>
+impl<Io, S, F, R, E> ServiceFactory for FramedRouteFactory<Io, S, F, R, E>
 where
     Io: AsyncRead + AsyncWrite + 'static,
     F: FnMut(FramedRequest<Io, S>) -> R + Clone,
-    R: IntoFuture<Item = ()>,
-    R::Future: 'static,
-    R::Error: fmt::Display,
+    R: Future<Output = Result<(), E>> + 'static,
+    E: fmt::Display,
 {
     type Config = ();
     type Request = FramedRequest<Io, S>;
     type Response = ();
     type Error = Error;
     type InitError = ();
-    type Service = FramedRouteService<Io, S, F, R>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
+    type Service = FramedRouteService<Io, S, F, R, E>;
+    type Future = Ready<Result<Self::Service, Self::InitError>>;
 
-    fn new_service(&self, _: &()) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         ok(FramedRouteService {
             handler: self.handler.clone(),
             methods: self.methods.clone(),
@@ -123,35 +122,38 @@ where
     }
 }
 
-pub struct FramedRouteService<Io, S, F, R> {
+pub struct FramedRouteService<Io, S, F, R, E> {
     handler: F,
     methods: Vec<Method>,
-    _t: PhantomData<(Io, S, R)>,
+    _t: PhantomData<(Io, S, R, E)>,
 }
 
-impl<Io, S, F, R> Service for FramedRouteService<Io, S, F, R>
+impl<Io, S, F, R, E> Service for FramedRouteService<Io, S, F, R, E>
 where
     Io: AsyncRead + AsyncWrite + 'static,
     F: FnMut(FramedRequest<Io, S>) -> R + Clone,
-    R: IntoFuture<Item = ()>,
-    R::Future: 'static,
-    R::Error: fmt::Display,
+    R: Future<Output = Result<(), E>> + 'static,
+    E: fmt::Display,
 {
     type Request = FramedRequest<Io, S>;
     type Response = ();
     type Error = Error;
-    type Future = Box<Future<Item = (), Error = Error>>;
+    type Future = LocalBoxFuture<'static, Result<(), Error>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
+    fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, req: FramedRequest<Io, S>) -> Self::Future {
-        Box::new((self.handler)(req).into_future().then(|res| {
+        let fut = (self.handler)(req);
+
+        async move {
+            let res = fut.await;
             if let Err(e) = res {
                 error!("Error in request handler: {}", e);
             }
             Ok(())
-        }))
+        }
+        .boxed_local()
     }
 }

actix-framed/src/service.rs

@@ -1,4 +1,6 @@
 use std::marker::PhantomData;
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use actix_http::body::BodySize;
@@ -6,9 +8,9 @@ use actix_http::error::ResponseError;
 use actix_http::h1::{Codec, Message};
 use actix_http::ws::{verify_handshake, HandshakeError};
 use actix_http::{Request, Response};
-use actix_service::{NewService, Service};
-use futures::future::{ok, Either, FutureResult};
-use futures::{Async, Future, IntoFuture, Poll, Sink};
+use actix_service::{Service, ServiceFactory};
+use futures::future::{err, ok, Either, Ready};
+use futures::Future;
 
 /// Service that verifies incoming request if it is valid websocket
 /// upgrade request. In case of error returns `HandshakeError`
@@ -22,16 +24,16 @@ impl<T, C> Default for VerifyWebSockets<T, C> {
     }
 }
 
-impl<T, C> NewService for VerifyWebSockets<T, C> {
+impl<T, C> ServiceFactory for VerifyWebSockets<T, C> {
     type Config = C;
     type Request = (Request, Framed<T, Codec>);
     type Response = (Request, Framed<T, Codec>);
     type Error = (HandshakeError, Framed<T, Codec>);
     type InitError = ();
     type Service = VerifyWebSockets<T, C>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
+    type Future = Ready<Result<Self::Service, Self::InitError>>;
 
-    fn new_service(&self, _: &C) -> Self::Future {
+    fn new_service(&self, _: C) -> Self::Future {
         ok(VerifyWebSockets { _t: PhantomData })
     }
 }
@@ -40,16 +42,16 @@ impl<T, C> Service for VerifyWebSockets<T, C> {
     type Request = (Request, Framed<T, Codec>);
     type Response = (Request, Framed<T, Codec>);
     type Error = (HandshakeError, Framed<T, Codec>);
-    type Future = FutureResult<Self::Response, Self::Error>;
+    type Future = Ready<Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
+    fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
         match verify_handshake(req.head()) {
-            Err(e) => Err((e, framed)).into_future(),
-            Ok(_) => Ok((req, framed)).into_future(),
+            Err(e) => err((e, framed)),
+            Ok(_) => ok((req, framed)),
         }
     }
 }
@@ -67,9 +69,9 @@ where
     }
 }
 
-impl<T, R, E, C> NewService for SendError<T, R, E, C>
+impl<T, R, E, C> ServiceFactory for SendError<T, R, E, C>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     R: 'static,
     E: ResponseError + 'static,
 {
@@ -79,34 +81,34 @@ where
     type Error = (E, Framed<T, Codec>);
     type InitError = ();
     type Service = SendError<T, R, E, C>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
+    type Future = Ready<Result<Self::Service, Self::InitError>>;
 
-    fn new_service(&self, _: &C) -> Self::Future {
+    fn new_service(&self, _: C) -> Self::Future {
         ok(SendError(PhantomData))
     }
 }
 
 impl<T, R, E, C> Service for SendError<T, R, E, C>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     R: 'static,
     E: ResponseError + 'static,
 {
     type Request = Result<R, (E, Framed<T, Codec>)>;
     type Response = R;
     type Error = (E, Framed<T, Codec>);
-    type Future = Either<FutureResult<R, (E, Framed<T, Codec>)>, SendErrorFut<T, R, E>>;
+    type Future = Either<Ready<Result<R, (E, Framed<T, Codec>)>>, SendErrorFut<T, R, E>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
+    fn poll_ready(&mut self, _: &mut Context) -> Poll<Result<(), Self::Error>> {
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, req: Result<R, (E, Framed<T, Codec>)>) -> Self::Future {
         match req {
-            Ok(r) => Either::A(ok(r)),
+            Ok(r) => Either::Left(ok(r)),
             Err((e, framed)) => {
                 let res = e.error_response().drop_body();
-                Either::B(SendErrorFut {
+                Either::Right(SendErrorFut {
                     framed: Some(framed),
                     res: Some((res, BodySize::Empty).into()),
                     err: Some(e),
@@ -117,6 +119,7 @@ where
     }
 }
 
+#[pin_project::pin_project]
 pub struct SendErrorFut<T, R, E> {
     res: Option<Message<(Response<()>, BodySize)>>,
     framed: Option<Framed<T, Codec>>,
@@ -127,23 +130,27 @@ pub struct SendErrorFut<T, R, E> {
 impl<T, R, E> Future for SendErrorFut<T, R, E>
 where
     E: ResponseError,
-    T: AsyncRead + AsyncWrite,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
-    type Item = R;
-    type Error = (E, Framed<T, Codec>);
+    type Output = Result<R, (E, Framed<T, Codec>)>;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context) -> Poll<Self::Output> {
         if let Some(res) = self.res.take() {
-            if self.framed.as_mut().unwrap().force_send(res).is_err() {
-                return Err((self.err.take().unwrap(), self.framed.take().unwrap()));
+            if self.framed.as_mut().unwrap().write(res).is_err() {
+                return Poll::Ready(Err((
+                    self.err.take().unwrap(),
+                    self.framed.take().unwrap(),
+                )));
             }
         }
-        match self.framed.as_mut().unwrap().poll_complete() {
-            Ok(Async::Ready(_)) => {
-                Err((self.err.take().unwrap(), self.framed.take().unwrap()))
+        match self.framed.as_mut().unwrap().flush(cx) {
+            Poll::Ready(Ok(_)) => {
+                Poll::Ready(Err((self.err.take().unwrap(), self.framed.take().unwrap())))
             }
-            Ok(Async::NotReady) => Ok(Async::NotReady),
-            Err(_) => Err((self.err.take().unwrap(), self.framed.take().unwrap())),
+            Poll::Ready(Err(_)) => {
+                Poll::Ready(Err((self.err.take().unwrap(), self.framed.take().unwrap())))
+            }
+            Poll::Pending => Poll::Pending,
         }
     }
 }

actix-framed/src/test.rs

@@ -1,12 +1,13 @@
 //! Various helpers for Actix applications to use during testing.
+use std::convert::TryFrom;
+use std::future::Future;
+
 use actix_codec::Framed;
 use actix_http::h1::Codec;
 use actix_http::http::header::{Header, HeaderName, IntoHeaderValue};
-use actix_http::http::{HttpTryFrom, Method, Uri, Version};
+use actix_http::http::{Error as HttpError, Method, Uri, Version};
 use actix_http::test::{TestBuffer, TestRequest as HttpTestRequest};
 use actix_router::{Path, Url};
-use actix_rt::Runtime;
-use futures::IntoFuture;
 
 use crate::{FramedRequest, State};
 
@@ -41,7 +42,8 @@ impl TestRequest<()> {
     /// Create TestRequest and set header
     pub fn with_header<K, V>(key: K, value: V) -> Self
     where
-        HeaderName: HttpTryFrom<K>,
+        HeaderName: TryFrom<K>,
+        <HeaderName as TryFrom<K>>::Error: Into<HttpError>,
         V: IntoHeaderValue,
     {
         Self::default().header(key, value)
@@ -96,7 +98,8 @@ impl<S> TestRequest<S> {
     /// Set a header
     pub fn header<K, V>(mut self, key: K, value: V) -> Self
     where
-        HeaderName: HttpTryFrom<K>,
+        HeaderName: TryFrom<K>,
+        <HeaderName as TryFrom<K>>::Error: Into<HttpError>,
         V: IntoHeaderValue,
     {
         self.req.header(key, value);
@@ -118,13 +121,12 @@ impl<S> TestRequest<S> {
     }
 
     /// This method generates `FramedRequest` instance and executes async handler
-    pub fn run<F, R, I, E>(self, f: F) -> Result<I, E>
+    pub async fn run<F, R, I, E>(self, f: F) -> Result<I, E>
     where
         F: FnOnce(FramedRequest<TestBuffer, S>) -> R,
-        R: IntoFuture<Item = I, Error = E>,
+        R: Future<Output = Result<I, E>>,
     {
-        let mut rt = Runtime::new().unwrap();
-        rt.block_on(f(self.finish()).into_future())
+        f(self.finish()).await
     }
 }
 

actix-framed/tests/test_server.rs

@@ -1,141 +1,161 @@
 use actix_codec::{AsyncRead, AsyncWrite};
 use actix_http::{body, http::StatusCode, ws, Error, HttpService, Response};
-use actix_http_test::TestServer;
-use actix_service::{IntoNewService, NewService};
-use actix_utils::framed::FramedTransport;
-use bytes::{Bytes, BytesMut};
-use futures::future::{self, ok};
-use futures::{Future, Sink, Stream};
+use actix_http_test::test_server;
+use actix_service::{pipeline_factory, IntoServiceFactory, ServiceFactory};
+use actix_utils::framed::Dispatcher;
+use bytes::Bytes;
+use futures::{future, SinkExt, StreamExt};
 
 use actix_framed::{FramedApp, FramedRequest, FramedRoute, SendError, VerifyWebSockets};
 
-fn ws_service<T: AsyncRead + AsyncWrite>(
+async fn ws_service<T: AsyncRead + AsyncWrite>(
     req: FramedRequest<T>,
-) -> impl Future<Item = (), Error = Error> {
-    let (req, framed, _) = req.into_parts();
+) -> Result<(), Error> {
+    let (req, mut framed, _) = req.into_parts();
     let res = ws::handshake(req.head()).unwrap().message_body(());
 
     framed
         .send((res, body::BodySize::None).into())
-        .map_err(|_| panic!())
-        .and_then(|framed| {
-            FramedTransport::new(framed.into_framed(ws::Codec::new()), service)
-                .map_err(|_| panic!())
-        })
+        .await
+        .unwrap();
+    Dispatcher::new(framed.into_framed(ws::Codec::new()), service)
+        .await
+        .unwrap();
+
+    Ok(())
 }
 
-fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> {
+async fn service(msg: ws::Frame) -> Result<ws::Message, Error> {
     let msg = match msg {
         ws::Frame::Ping(msg) => ws::Message::Pong(msg),
         ws::Frame::Text(text) => {
-            ws::Message::Text(String::from_utf8_lossy(&text.unwrap()).to_string())
+            ws::Message::Text(String::from_utf8_lossy(&text).to_string())
         }
-        ws::Frame::Binary(bin) => ws::Message::Binary(bin.unwrap().freeze()),
+        ws::Frame::Binary(bin) => ws::Message::Binary(bin),
         ws::Frame::Close(reason) => ws::Message::Close(reason),
         _ => panic!(),
     };
-    ok(msg)
+    Ok(msg)
 }
 
-#[test]
-fn test_simple() {
-    let mut srv = TestServer::new(|| {
+#[actix_rt::test]
+async fn test_simple() {
+    let mut srv = test_server(|| {
         HttpService::build()
             .upgrade(
                 FramedApp::new().service(FramedRoute::get("/index.html").to(ws_service)),
             )
             .finish(|_| future::ok::<_, Error>(Response::NotFound()))
-    });
+            .tcp()
+    })
+    .await;
 
-    assert!(srv.ws_at("/test").is_err());
+    assert!(srv.ws_at("/test").await.is_err());
 
     // client service
-    let framed = srv.ws_at("/index.html").unwrap();
-    let framed = srv
-        .block_on(framed.send(ws::Message::Text("text".to_string())))
+    let mut framed = srv.ws_at("/index.html").await.unwrap();
+    framed
+        .send(ws::Message::Text("text".to_string()))
+        .await
         .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Binary("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
+    let (item, mut framed) = framed.into_future().await;
     assert_eq!(
-        item,
-        Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
+        item.unwrap().unwrap(),
+        ws::Frame::Text(Bytes::from_static(b"text"))
     );
 
-    let framed = srv
-        .block_on(framed.send(ws::Message::Ping("text".into())))
+    framed
+        .send(ws::Message::Binary("text".into()))
+        .await
         .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
-        .unwrap();
-
-    let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
+    let (item, mut framed) = framed.into_future().await;
     assert_eq!(
-        item,
-        Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
+        item.unwrap().unwrap(),
+        ws::Frame::Binary(Bytes::from_static(b"text"))
+    );
+
+    framed.send(ws::Message::Ping("text".into())).await.unwrap();
+    let (item, mut framed) = framed.into_future().await;
+    assert_eq!(
+        item.unwrap().unwrap(),
+        ws::Frame::Pong("text".to_string().into())
+    );
+
+    framed
+        .send(ws::Message::Close(Some(ws::CloseCode::Normal.into())))
+        .await
+        .unwrap();
+
+    let (item, _) = framed.into_future().await;
+    assert_eq!(
+        item.unwrap().unwrap(),
+        ws::Frame::Close(Some(ws::CloseCode::Normal.into()))
     );
 }
 
-#[test]
-fn test_service() {
-    let mut srv = TestServer::new(|| {
-        actix_http::h1::OneRequest::new().map_err(|_| ()).and_then(
-            VerifyWebSockets::default()
-                .then(SendError::default())
-                .map_err(|_| ())
-                .and_then(
-                    FramedApp::new()
-                        .service(FramedRoute::get("/index.html").to(ws_service))
-                        .into_new_service()
-                        .map_err(|_| ()),
-                ),
+#[actix_rt::test]
+async fn test_service() {
+    let mut srv = test_server(|| {
+        pipeline_factory(actix_http::h1::OneRequest::new().map_err(|_| ())).and_then(
+            pipeline_factory(
+                pipeline_factory(VerifyWebSockets::default())
+                    .then(SendError::default())
+                    .map_err(|_| ()),
+            )
+            .and_then(
+                FramedApp::new()
+                    .service(FramedRoute::get("/index.html").to(ws_service))
+                    .into_factory()
+                    .map_err(|_| ()),
+            ),
         )
-    });
+    })
+    .await;
 
     // non ws request
-    let res = srv.block_on(srv.get("/index.html").send()).unwrap();
+    let res = srv.get("/index.html").send().await.unwrap();
     assert_eq!(res.status(), StatusCode::BAD_REQUEST);
 
     // not found
-    assert!(srv.ws_at("/test").is_err());
+    assert!(srv.ws_at("/test").await.is_err());
 
     // client service
-    let framed = srv.ws_at("/index.html").unwrap();
-    let framed = srv
-        .block_on(framed.send(ws::Message::Text("text".to_string())))
+    let mut framed = srv.ws_at("/index.html").await.unwrap();
+    framed
+        .send(ws::Message::Text("text".to_string()))
+        .await
         .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Binary("text".into())))
-        .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
+    let (item, mut framed) = framed.into_future().await;
     assert_eq!(
-        item,
-        Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
+        item.unwrap().unwrap(),
+        ws::Frame::Text(Bytes::from_static(b"text"))
     );
 
-    let framed = srv
-        .block_on(framed.send(ws::Message::Ping("text".into())))
+    framed
+        .send(ws::Message::Binary("text".into()))
+        .await
         .unwrap();
-    let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
-    assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
-
-    let framed = srv
-        .block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
-        .unwrap();
-
-    let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
+    let (item, mut framed) = framed.into_future().await;
     assert_eq!(
-        item,
-        Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
+        item.unwrap().unwrap(),
+        ws::Frame::Binary(Bytes::from_static(b"text"))
+    );
+
+    framed.send(ws::Message::Ping("text".into())).await.unwrap();
+    let (item, mut framed) = framed.into_future().await;
+    assert_eq!(
+        item.unwrap().unwrap(),
+        ws::Frame::Pong("text".to_string().into())
+    );
+
+    framed
+        .send(ws::Message::Close(Some(ws::CloseCode::Normal.into())))
+        .await
+        .unwrap();
+
+    let (item, _) = framed.into_future().await;
+    assert_eq!(
+        item.unwrap().unwrap(),
+        ws::Frame::Close(Some(ws::CloseCode::Normal.into()))
     );
 }

actix-http/CHANGES.md

@@ -1,10 +1,169 @@
 # Changes
 
-## [0.2.5] - unreleased
+## [2.0.0-alpha.2] - 2020-03-07
 
 ### Changed
 
-*  Use `encoding_rs` crate instead of unmaintained `encoding` crate
+* Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
+
+* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB respectively
+  to improve download speed for awc when downloading large objects. [#1394]
+
+* client::Connector accepts initial_window_size and initial_connection_window_size HTTP2 configuration. [#1394]
+
+* client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
+
+[#1394]: https://github.com/actix/actix-web/pull/1394
+[#1395]: https://github.com/actix/actix-web/pull/1395
+
+## [2.0.0-alpha.1] - 2020-02-27
+
+### Changed
+
+* Update the `time` dependency to 0.2.7.
+* Moved actors messages support from actix crate, enabled with feature `actors`.
+* Breaking change: trait MessageBody requires Unpin and accepting Pin<&mut Self> instead of &mut self in the poll_next().
+* MessageBody is not implemented for &'static [u8] anymore.
+
+### Fixed
+
+* Allow `SameSite=None` cookies to be sent in a response.
+
+## [1.0.1] - 2019-12-20
+
+### Fixed
+
+* Poll upgrade service's readiness from HTTP service handlers
+
+* Replace brotli with brotli2 #1224
+
+## [1.0.0] - 2019-12-13
+
+### Added
+
+* Add websockets continuation frame support
+
+### Changed
+
+* Replace `flate2-xxx` features with `compress`
+
+## [1.0.0-alpha.5] - 2019-12-09
+
+### Fixed
+
+* Check `Upgrade` service readiness before calling it
+
+* Fix buffer remaining capacity calcualtion
+
+### Changed
+
+* Websockets: Ping and Pong should have binary data #1049
+
+## [1.0.0-alpha.4] - 2019-12-08
+
+### Added
+
+* Add impl ResponseBuilder for Error
+
+### Changed
+
+* Use rust based brotli compression library
+
+## [1.0.0-alpha.3] - 2019-12-07
+
+### Changed
+
+* Migrate to tokio 0.2
+
+* Migrate to `std::future`
+
+
+## [0.2.11] - 2019-11-06
+
+### Added
+
+* Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
+
+* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
+
+* Allow to use `std::convert::Infallible` as `actix_http::error::Error`
+
+### Fixed
+
+* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain; charset=utf-8` header #1118
+
+
+## [0.2.10] - 2019-09-11
+
+### Added
+
+* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests with `RequestHead`
+
+### Fixed
+
+* h2 will use error response #1080
+
+* on_connect result isn't added to request extensions for http2 requests #1009
+
+
+## [0.2.9] - 2019-08-13
+
+### Changed
+
+* Dropped the `byteorder`-dependency in favor of `stdlib`-implementation
+
+* Update percent-encoding to 2.1
+
+* Update serde_urlencoded to 0.6.1
+
+### Fixed
+
+* Fixed a panic in the HTTP2 handshake in client HTTP requests (#1031)
+
+
+## [0.2.8] - 2019-08-01
+
+### Added
+
+* Add `rustls` support
+
+* Add `Clone` impl for `HeaderMap`
+
+### Fixed
+
+* awc client panic #1016
+
+* Invalid response with compression middleware enabled, but compression-related features disabled #997
+
+
+## [0.2.7] - 2019-07-18
+
+### Added
+
+* Add support for downcasting response errors #986
+
+
+## [0.2.6] - 2019-07-17
+
+### Changed
+
+* Replace `ClonableService` with local copy
+
+* Upgrade `rand` dependency version to 0.7
+
+
+## [0.2.5] - 2019-06-28
+
+### Added
+
+* Add `on-connect` callback, `HttpServiceBuilder::on_connect()` #946
+
+### Changed
+
+* Use `encoding_rs` crate instead of unmaintained `encoding` crate
+
+* Add `Copy` and `Clone` impls for `ws::Codec`
+
 
 ## [0.2.4] - 2019-06-16
 

actix-http/Cargo.toml

@@ -1,6 +1,6 @@
 [package]
 name = "actix-http"
-version = "0.2.4"
+version = "2.0.0-alpha.2"
 authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
 description = "Actix http primitives"
 readme = "README.md"
@@ -13,10 +13,9 @@ categories = ["network-programming", "asynchronous",
               "web-programming::websocket"]
 license = "MIT/Apache-2.0"
 edition = "2018"
-workspace = ".."
 
 [package.metadata.docs.rs]
-features = ["ssl", "fail", "brotli", "flate2-zlib", "secure-cookies"]
+features = ["openssl", "rustls", "failure", "compress", "secure-cookies","actors"]
 
 [lib]
 name = "actix_http"
@@ -26,81 +25,85 @@ path = "src/lib.rs"
 default = []
 
 # openssl
-ssl = ["openssl", "actix-connect/ssl"]
+openssl = ["actix-tls/openssl", "actix-connect/openssl"]
 
-# brotli encoding, requires c compiler
-brotli = ["brotli2"]
+# rustls support
+rustls = ["actix-tls/rustls", "actix-connect/rustls"]
 
-# miniz-sys backend for flate2 crate
-flate2-zlib = ["flate2/miniz-sys"]
-
-# rust backend for flate2 crate
-flate2-rust = ["flate2/rust_backend"]
+# enable compressison support
+compress = ["flate2", "brotli2"]
 
 # failure integration. actix does not use failure anymore
-fail = ["failure"]
+failure = ["fail-ure"]
 
 # support for secure cookies
 secure-cookies = ["ring"]
 
-[dependencies]
-actix-service = "0.4.0"
-actix-codec = "0.1.2"
-actix-connect = "0.2.0"
-actix-utils = "0.4.1"
-actix-server-config = "0.1.1"
-actix-threadpool = "0.1.0"
+# support for actix Actor messages
+actors = ["actix"]
 
-base64 = "0.10"
-bitflags = "1.0"
-bytes = "0.4"
-byteorder = "1.2"
-copyless = "0.1.2"
-derive_more = "0.15.0"
-either = "1.5.2"
+[dependencies]
+actix-service = "1.0.5"
+actix-codec = "0.2.0"
+actix-connect = "2.0.0-alpha.2"
+actix-utils = "1.0.6"
+actix-rt = "1.0.0"
+actix-threadpool = "0.3.1"
+actix-tls = { version = "2.0.0-alpha.1", optional = true }
+actix = { version = "0.10.0-alpha.1", optional = true }
+
+base64 = "0.11"
+bitflags = "1.2"
+bytes = "0.5.3"
+copyless = "0.1.4"
+derive_more = "0.99.2"
+either = "1.5.3"
 encoding_rs = "0.8"
-futures = "0.1.25"
-hashbrown = "0.5.0"
-h2 = "0.1.16"
-http = "0.1.17"
+futures-core = "0.3.1"
+futures-util = "0.3.1"
+futures-channel = "0.3.1"
+fxhash = "0.2.1"
+h2 = "0.2.1"
+http = "0.2.0"
 httparse = "1.3"
-indexmap = "1.0"
-lazy_static = "1.0"
+indexmap = "1.3"
+lazy_static = "1.4"
 language-tags = "0.2"
 log = "0.4"
 mime = "0.3"
-percent-encoding = "1.0"
-rand = "0.6"
-regex = "1.0"
+percent-encoding = "2.1"
+pin-project = "0.4.6"
+rand = "0.7"
+regex = "1.3"
 serde = "1.0"
 serde_json = "1.0"
-sha1 = "0.6"
+sha-1 = "0.8"
 slab = "0.4"
-serde_urlencoded = "0.5.5"
-time = "0.1.42"
-tokio-tcp = "0.1.3"
-tokio-timer = "0.2.8"
-tokio-current-thread = "0.1"
-trust-dns-resolver = { version="0.11.1", default-features = false }
+serde_urlencoded = "0.6.1"
+time = { version = "0.2.7", default-features = false, features = ["std"] }
 
 # for secure cookie
-ring = { version = "0.14.6", optional = true }
+ring = { version = "0.16.9", optional = true }
 
 # compression
 brotli2 = { version="0.3.2", optional = true }
-flate2 = { version="1.0.7", optional = true, default-features = false }
+flate2 = { version = "1.0.13", optional = true }
 
 # optional deps
-failure = { version = "0.1.5", optional = true }
-openssl = { version="0.10", optional = true }
-chrono = "0.4.6"
+fail-ure = { version = "0.1.5", package="failure", optional = true }
 
 [dev-dependencies]
-actix-rt = "0.2.2"
-actix-server = { version = "0.5.0", features=["ssl"] }
-actix-connect = { version = "0.2.0", features=["ssl"] }
-actix-http-test = { version = "0.2.0", features=["ssl"] }
-env_logger = "0.6"
+actix-server = "1.0.1"
+actix-connect = { version = "2.0.0-alpha.2", features=["openssl"] }
+actix-http-test = { version = "1.0.0", features=["openssl"] }
+actix-tls = { version = "2.0.0-alpha.1", features=["openssl"] }
+criterion = "0.3"
+futures = "0.3.1"
+env_logger = "0.7"
 serde_derive = "1.0"
-openssl = { version="0.10" }
-tokio-tcp = "0.1"
+open-ssl = { version="0.10", package = "openssl" }
+rust-tls = { version="0.17", package = "rustls" }
+
+[[bench]]
+name = "content-length"
+harness = false

actix-http/README.md

@@ -14,19 +14,34 @@ Actix http
 
 ```rust
 // see examples/framed_hello.rs for complete list of used crates.
-extern crate actix_http;
-use actix_http::{h1, Response, ServiceConfig};
+use std::{env, io};
 
-fn main() {
-    Server::new().bind("framed_hello", "127.0.0.1:8080", || {
-        IntoFramed::new(|| h1::Codec::new(ServiceConfig::default()))	// <- create h1 codec
-            .and_then(TakeItem::new().map_err(|_| ()))	                // <- read one request
-            .and_then(|(_req, _framed): (_, Framed<_, _>)| {	        // <- send response and close conn
-                SendResponse::send(_framed, Response::Ok().body("Hello world!"))
-                    .map_err(|_| ())
-                    .map(|_| ())
-            })
-    }).unwrap().run();
+use actix_http::{HttpService, Response};
+use actix_server::Server;
+use futures::future;
+use http::header::HeaderValue;
+use log::info;
+
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
+    env::set_var("RUST_LOG", "hello_world=info");
+    env_logger::init();
+
+    Server::build()
+        .bind("hello-world", "127.0.0.1:8080", || {
+            HttpService::build()
+                .client_timeout(1000)
+                .client_disconnect(1000)
+                .finish(|_req| {
+                    info!("{:?}", _req);
+                    let mut res = Response::Ok();
+                    res.header("x-head", HeaderValue::from_static("dummy value!"));
+                    future::ok::<_, ()>(res.body("Hello world!"))
+                })
+                .tcp()
+        })?
+        .run()
+        .await
 }
 ```
 

actix-http/benches/content-length.rs

@@ -0,0 +1,267 @@
+use criterion::{criterion_group, criterion_main, BenchmarkId, Criterion};
+
+use bytes::BytesMut;
+
+// benchmark sending all requests at the same time
+fn bench_write_content_length(c: &mut Criterion) {
+    let mut group = c.benchmark_group("write_content_length");
+
+    let sizes = [
+        0, 1, 11, 83, 101, 653, 1001, 6323, 10001, 56329, 100001, 123456, 98724245,
+        4294967202,
+    ];
+
+    for i in sizes.iter() {
+        group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _original::write_content_length(i, &mut b)
+            })
+        });
+
+        group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
+            b.iter(|| {
+                let mut b = BytesMut::with_capacity(35);
+                _new::write_content_length(i, &mut b)
+            })
+        });
+    }
+
+    group.finish();
+}
+
+criterion_group!(benches, bench_write_content_length);
+criterion_main!(benches);
+
+mod _new {
+    use bytes::{BufMut, BytesMut};
+
+    const DIGITS_START: u8 = b'0';
+
+    /// NOTE: bytes object has to contain enough space
+    pub fn write_content_length(n: usize, bytes: &mut BytesMut) {
+        if n == 0 {
+            bytes.put_slice(b"\r\ncontent-length: 0\r\n");
+            return;
+        }
+
+        bytes.put_slice(b"\r\ncontent-length: ");
+
+        if n < 10 {
+            bytes.put_u8(DIGITS_START + (n as u8));
+        } else if n < 100 {
+            let n = n as u8;
+
+            let d10 = n / 10;
+            let d1 = n % 10;
+
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else if n < 1000 {
+            let n = n as u16;
+
+            let d100 = (n / 100) as u8;
+            let d10 = ((n / 10) % 10) as u8;
+            let d1 = (n % 10) as u8;
+
+            bytes.put_u8(DIGITS_START + d100);
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else if n < 10_000 {
+            let n = n as u16;
+
+            let d1000 = (n / 1000) as u8;
+            let d100 = ((n / 100) % 10) as u8;
+            let d10 = ((n / 10) % 10) as u8;
+            let d1 = (n % 10) as u8;
+
+            bytes.put_u8(DIGITS_START + d1000);
+            bytes.put_u8(DIGITS_START + d100);
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else if n < 100_000 {
+            let n = n as u32;
+
+            let d10000 = (n / 10000) as u8;
+            let d1000 = ((n / 1000) % 10) as u8;
+            let d100 = ((n / 100) % 10) as u8;
+            let d10 = ((n / 10) % 10) as u8;
+            let d1 = (n % 10) as u8;
+
+            bytes.put_u8(DIGITS_START + d10000);
+            bytes.put_u8(DIGITS_START + d1000);
+            bytes.put_u8(DIGITS_START + d100);
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else if n < 1_000_000 {
+            let n = n as u32;
+
+            let d100000 = (n / 100000) as u8;
+            let d10000 = ((n / 10000) % 10) as u8;
+            let d1000 = ((n / 1000) % 10) as u8;
+            let d100 = ((n / 100) % 10) as u8;
+            let d10 = ((n / 10) % 10) as u8;
+            let d1 = (n % 10) as u8;
+
+            bytes.put_u8(DIGITS_START + d100000);
+            bytes.put_u8(DIGITS_START + d10000);
+            bytes.put_u8(DIGITS_START + d1000);
+            bytes.put_u8(DIGITS_START + d100);
+            bytes.put_u8(DIGITS_START + d10);
+            bytes.put_u8(DIGITS_START + d1);
+        } else {
+            write_usize(n, bytes);
+        }
+
+        bytes.put_slice(b"\r\n");
+    }
+
+    fn write_usize(n: usize, bytes: &mut BytesMut) {
+        let mut n = n;
+
+        // 20 chars is max length of a usize (2^64)
+        // digits will be added to the buffer from lsd to msd
+        let mut buf = BytesMut::with_capacity(20);
+
+        while n > 9 {
+            // "pop" the least-significant digit
+            let lsd = (n % 10) as u8;
+
+            // remove the lsd from n
+            n = n / 10;
+
+            buf.put_u8(DIGITS_START + lsd);
+        }
+
+        // put msd to result buffer
+        bytes.put_u8(DIGITS_START + (n as u8));
+
+        // put, in reverse (msd to lsd), remaining digits to buffer
+        for i in (0..buf.len()).rev() {
+            bytes.put_u8(buf[i]);
+        }
+    }
+}
+
+mod _original {
+    use std::{mem, ptr, slice};
+
+    use bytes::{BufMut, BytesMut};
+
+    const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
+          2021222324252627282930313233343536373839\
+          4041424344454647484950515253545556575859\
+          6061626364656667686970717273747576777879\
+          8081828384858687888990919293949596979899";
+
+    /// NOTE: bytes object has to contain enough space
+    pub fn write_content_length(mut n: usize, bytes: &mut BytesMut) {
+        if n < 10 {
+            let mut buf: [u8; 21] = [
+                b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
+                b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'\r', b'\n',
+            ];
+            buf[18] = (n as u8) + b'0';
+            bytes.put_slice(&buf);
+        } else if n < 100 {
+            let mut buf: [u8; 22] = [
+                b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
+                b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'\r', b'\n',
+            ];
+            let d1 = n << 1;
+            unsafe {
+                ptr::copy_nonoverlapping(
+                    DEC_DIGITS_LUT.as_ptr().add(d1),
+                    buf.as_mut_ptr().offset(18),
+                    2,
+                );
+            }
+            bytes.put_slice(&buf);
+        } else if n < 1000 {
+            let mut buf: [u8; 23] = [
+                b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
+                b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'0', b'\r',
+                b'\n',
+            ];
+            // decode 2 more chars, if > 2 chars
+            let d1 = (n % 100) << 1;
+            n /= 100;
+            unsafe {
+                ptr::copy_nonoverlapping(
+                    DEC_DIGITS_LUT.as_ptr().add(d1),
+                    buf.as_mut_ptr().offset(19),
+                    2,
+                )
+            };
+
+            // decode last 1
+            buf[18] = (n as u8) + b'0';
+
+            bytes.put_slice(&buf);
+        } else {
+            bytes.put_slice(b"\r\ncontent-length: ");
+            convert_usize(n, bytes);
+        }
+    }
+
+    pub(crate) fn convert_usize(mut n: usize, bytes: &mut BytesMut) {
+        let mut curr: isize = 39;
+        let mut buf: [u8; 41] = unsafe { mem::MaybeUninit::uninit().assume_init() };
+        buf[39] = b'\r';
+        buf[40] = b'\n';
+        let buf_ptr = buf.as_mut_ptr();
+        let lut_ptr = DEC_DIGITS_LUT.as_ptr();
+
+        // eagerly decode 4 characters at a time
+        while n >= 10_000 {
+            let rem = (n % 10_000) as isize;
+            n /= 10_000;
+
+            let d1 = (rem / 100) << 1;
+            let d2 = (rem % 100) << 1;
+            curr -= 4;
+            unsafe {
+                ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
+                ptr::copy_nonoverlapping(
+                    lut_ptr.offset(d2),
+                    buf_ptr.offset(curr + 2),
+                    2,
+                );
+            }
+        }
+
+        // if we reach here numbers are <= 9999, so at most 4 chars long
+        let mut n = n as isize; // possibly reduce 64bit math
+
+        // decode 2 more chars, if > 2 chars
+        if n >= 100 {
+            let d1 = (n % 100) << 1;
+            n /= 100;
+            curr -= 2;
+            unsafe {
+                ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
+            }
+        }
+
+        // decode last 1 or 2 chars
+        if n < 10 {
+            curr -= 1;
+            unsafe {
+                *buf_ptr.offset(curr) = (n as u8) + b'0';
+            }
+        } else {
+            let d1 = n << 1;
+            curr -= 2;
+            unsafe {
+                ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
+            }
+        }
+
+        unsafe {
+            bytes.extend_from_slice(slice::from_raw_parts(
+                buf_ptr.offset(curr),
+                41 - curr as usize,
+            ));
+        }
+    }
+}

actix-http/examples/echo.rs

@@ -1,13 +1,14 @@
 use std::{env, io};
 
-use actix_http::{error::PayloadError, HttpService, Request, Response};
+use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures::{Future, Stream};
+use futures::StreamExt;
 use http::header::HeaderValue;
 use log::info;
 
-fn main() -> io::Result<()> {
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
     env::set_var("RUST_LOG", "echo=info");
     env_logger::init();
 
@@ -16,22 +17,21 @@ fn main() -> io::Result<()> {
             HttpService::build()
                 .client_timeout(1000)
                 .client_disconnect(1000)
-                .finish(|mut req: Request| {
-                    req.take_payload()
-                        .fold(BytesMut::new(), move |mut body, chunk| {
-                            body.extend_from_slice(&chunk);
-                            Ok::<_, PayloadError>(body)
-                        })
-                        .and_then(|bytes| {
-                            info!("request body: {:?}", bytes);
-                            let mut res = Response::Ok();
-                            res.header(
-                                "x-head",
-                                HeaderValue::from_static("dummy value!"),
-                            );
-                            Ok(res.body(bytes))
-                        })
+                .finish(|mut req: Request| async move {
+                    let mut body = BytesMut::new();
+                    while let Some(item) = req.payload().next().await {
+                        body.extend_from_slice(&item?);
+                    }
+
+                    info!("request body: {:?}", body);
+                    Ok::<_, Error>(
+                        Response::Ok()
+                            .header("x-head", HeaderValue::from_static("dummy value!"))
+                            .body(body),
+                    )
                 })
+                .tcp()
         })?
         .run()
+        .await
 }

actix-http/examples/echo2.rs

@@ -1,34 +1,33 @@
 use std::{env, io};
 
 use actix_http::http::HeaderValue;
-use actix_http::{error::PayloadError, Error, HttpService, Request, Response};
+use actix_http::{Error, HttpService, Request, Response};
 use actix_server::Server;
 use bytes::BytesMut;
-use futures::{Future, Stream};
+use futures::StreamExt;
 use log::info;
 
-fn handle_request(mut req: Request) -> impl Future<Item = Response, Error = Error> {
-    req.take_payload()
-        .fold(BytesMut::new(), move |mut body, chunk| {
-            body.extend_from_slice(&chunk);
-            Ok::<_, PayloadError>(body)
-        })
-        .from_err()
-        .and_then(|bytes| {
-            info!("request body: {:?}", bytes);
-            let mut res = Response::Ok();
-            res.header("x-head", HeaderValue::from_static("dummy value!"));
-            Ok(res.body(bytes))
-        })
+async fn handle_request(mut req: Request) -> Result<Response, Error> {
+    let mut body = BytesMut::new();
+    while let Some(item) = req.payload().next().await {
+        body.extend_from_slice(&item?)
+    }
+
+    info!("request body: {:?}", body);
+    Ok(Response::Ok()
+        .header("x-head", HeaderValue::from_static("dummy value!"))
+        .body(body))
 }
 
-fn main() -> io::Result<()> {
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
     env::set_var("RUST_LOG", "echo=info");
     env_logger::init();
 
     Server::build()
         .bind("echo", "127.0.0.1:8080", || {
-            HttpService::build().finish(|_req: Request| handle_request(_req))
+            HttpService::build().finish(handle_request).tcp()
         })?
         .run()
+        .await
 }

actix-http/examples/hello-world.rs

@@ -6,7 +6,8 @@ use futures::future;
 use http::header::HeaderValue;
 use log::info;
 
-fn main() -> io::Result<()> {
+#[actix_rt::main]
+async fn main() -> io::Result<()> {
     env::set_var("RUST_LOG", "hello_world=info");
     env_logger::init();
 
@@ -21,6 +22,8 @@ fn main() -> io::Result<()> {
                     res.header("x-head", HeaderValue::from_static("dummy value!"));
                     future::ok::<_, ()>(res.body("Hello world!"))
                 })
+                .tcp()
         })?
         .run()
+        .await
 }

actix-http/src/body.rs

@@ -1,8 +1,12 @@
 use std::marker::PhantomData;
+use std::pin::Pin;
+use std::task::{Context, Poll};
 use std::{fmt, mem};
 
 use bytes::{Bytes, BytesMut};
-use futures::{Async, Poll, Stream};
+use futures_core::Stream;
+use futures_util::ready;
+use pin_project::{pin_project, project};
 
 use crate::error::Error;
 
@@ -32,32 +36,46 @@ impl BodySize {
 pub trait MessageBody {
     fn size(&self) -> BodySize;
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error>;
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>>;
+
+    downcast_get_type_id!();
 }
 
+downcast!(MessageBody);
+
 impl MessageBody for () {
     fn size(&self) -> BodySize {
         BodySize::Empty
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        Ok(Async::Ready(None))
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        Poll::Ready(None)
     }
 }
 
-impl<T: MessageBody> MessageBody for Box<T> {
+impl<T: MessageBody + Unpin> MessageBody for Box<T> {
     fn size(&self) -> BodySize {
         self.as_ref().size()
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        self.as_mut().poll_next()
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        Pin::new(self.get_mut().as_mut()).poll_next(cx)
     }
 }
 
+#[pin_project]
 pub enum ResponseBody<B> {
-    Body(B),
-    Other(Body),
+    Body(#[pin] B),
+    Other(#[pin] Body),
 }
 
 impl ResponseBody<Body> {
@@ -93,23 +111,36 @@ impl<B: MessageBody> MessageBody for ResponseBody<B> {
         }
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        match self {
-            ResponseBody::Body(ref mut body) => body.poll_next(),
-            ResponseBody::Other(ref mut body) => body.poll_next(),
+    #[project]
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        #[project]
+        match self.project() {
+            ResponseBody::Body(body) => body.poll_next(cx),
+            ResponseBody::Other(body) => body.poll_next(cx),
         }
     }
 }
 
 impl<B: MessageBody> Stream for ResponseBody<B> {
-    type Item = Bytes;
-    type Error = Error;
+    type Item = Result<Bytes, Error>;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
-        self.poll_next()
+    #[project]
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        #[project]
+        match self.project() {
+            ResponseBody::Body(body) => body.poll_next(cx),
+            ResponseBody::Other(body) => body.poll_next(cx),
+        }
     }
 }
 
+#[pin_project]
 /// Represents various types of http message body.
 pub enum Body {
     /// Empty response. `Content-Length` header is not set.
@@ -119,17 +150,17 @@ pub enum Body {
     /// Specific response body.
     Bytes(Bytes),
     /// Generic message body.
-    Message(Box<dyn MessageBody>),
+    Message(Box<dyn MessageBody + Unpin>),
 }
 
 impl Body {
     /// Create body from slice (copy)
     pub fn from_slice(s: &[u8]) -> Body {
-        Body::Bytes(Bytes::from(s))
+        Body::Bytes(Bytes::copy_from_slice(s))
     }
 
     /// Create body from generic message body.
-    pub fn from_message<B: MessageBody + 'static>(body: B) -> Body {
+    pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
         Body::Message(Box::new(body))
     }
 }
@@ -144,19 +175,24 @@ impl MessageBody for Body {
         }
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        match self {
-            Body::None => Ok(Async::Ready(None)),
-            Body::Empty => Ok(Async::Ready(None)),
+    #[project]
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        #[project]
+        match self.project() {
+            Body::None => Poll::Ready(None),
+            Body::Empty => Poll::Ready(None),
             Body::Bytes(ref mut bin) => {
                 let len = bin.len();
                 if len == 0 {
-                    Ok(Async::Ready(None))
+                    Poll::Ready(None)
                 } else {
-                    Ok(Async::Ready(Some(mem::replace(bin, Bytes::new()))))
+                    Poll::Ready(Some(Ok(mem::replace(bin, Bytes::new()))))
                 }
             }
-            Body::Message(ref mut body) => body.poll_next(),
+            Body::Message(ref mut body) => Pin::new(body.as_mut()).poll_next(cx),
         }
     }
 }
@@ -182,7 +218,7 @@ impl PartialEq for Body {
 }
 
 impl fmt::Debug for Body {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match *self {
             Body::None => write!(f, "Body::None"),
             Body::Empty => write!(f, "Body::Empty"),
@@ -218,7 +254,7 @@ impl From<String> for Body {
 
 impl<'a> From<&'a String> for Body {
     fn from(s: &'a String) -> Body {
-        Body::Bytes(Bytes::from(AsRef::<[u8]>::as_ref(&s)))
+        Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
     }
 }
 
@@ -234,9 +270,15 @@ impl From<BytesMut> for Body {
     }
 }
 
+impl From<serde_json::Value> for Body {
+    fn from(v: serde_json::Value) -> Body {
+        Body::Bytes(v.to_string().into())
+    }
+}
+
 impl<S> From<SizedStream<S>> for Body
 where
-    S: Stream<Item = Bytes, Error = Error> + 'static,
+    S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
 {
     fn from(s: SizedStream<S>) -> Body {
         Body::from_message(s)
@@ -245,7 +287,7 @@ where
 
 impl<S, E> From<BodyStream<S, E>> for Body
 where
-    S: Stream<Item = Bytes, Error = E> + 'static,
+    S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
     E: Into<Error> + 'static,
 {
     fn from(s: BodyStream<S, E>) -> Body {
@@ -258,11 +300,14 @@ impl MessageBody for Bytes {
         BodySize::Sized(self.len())
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(mem::replace(self, Bytes::new()))))
+            Poll::Ready(Some(Ok(mem::replace(self.get_mut(), Bytes::new()))))
         }
     }
 }
@@ -272,12 +317,15 @@ impl MessageBody for BytesMut {
         BodySize::Sized(self.len())
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(
-                mem::replace(self, BytesMut::new()).freeze(),
+            Poll::Ready(Some(Ok(
+                mem::replace(self.get_mut(), BytesMut::new()).freeze()
             )))
         }
     }
@@ -288,44 +336,34 @@ impl MessageBody for &'static str {
         BodySize::Sized(self.len())
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(Bytes::from_static(
-                mem::replace(self, "").as_ref(),
+            Poll::Ready(Some(Ok(Bytes::from_static(
+                mem::replace(self.get_mut(), "").as_ref(),
             ))))
         }
     }
 }
 
-impl MessageBody for &'static [u8] {
-    fn size(&self) -> BodySize {
-        BodySize::Sized(self.len())
-    }
-
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        if self.is_empty() {
-            Ok(Async::Ready(None))
-        } else {
-            Ok(Async::Ready(Some(Bytes::from_static(mem::replace(
-                self, b"",
-            )))))
-        }
-    }
-}
-
 impl MessageBody for Vec<u8> {
     fn size(&self) -> BodySize {
         BodySize::Sized(self.len())
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(Bytes::from(mem::replace(
-                self,
+            Poll::Ready(Some(Ok(Bytes::from(mem::replace(
+                self.get_mut(),
                 Vec::new(),
             )))))
         }
@@ -337,12 +375,15 @@ impl MessageBody for String {
         BodySize::Sized(self.len())
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
         if self.is_empty() {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
-            Ok(Async::Ready(Some(Bytes::from(
-                mem::replace(self, String::new()).into_bytes(),
+            Poll::Ready(Some(Ok(Bytes::from(
+                mem::replace(self.get_mut(), String::new()).into_bytes(),
             ))))
         }
     }
@@ -350,14 +391,16 @@ impl MessageBody for String {
 
 /// Type represent streaming body.
 /// Response does not contain `content-length` header and appropriate transfer encoding is used.
-pub struct BodyStream<S, E> {
+#[pin_project]
+pub struct BodyStream<S: Unpin, E> {
+    #[pin]
     stream: S,
     _t: PhantomData<E>,
 }
 
 impl<S, E> BodyStream<S, E>
 where
-    S: Stream<Item = Bytes, Error = E>,
+    S: Stream<Item = Result<Bytes, E>> + Unpin,
     E: Into<Error>,
 {
     pub fn new(stream: S) -> Self {
@@ -370,28 +413,45 @@ where
 
 impl<S, E> MessageBody for BodyStream<S, E>
 where
-    S: Stream<Item = Bytes, Error = E>,
+    S: Stream<Item = Result<Bytes, E>> + Unpin,
     E: Into<Error>,
 {
     fn size(&self) -> BodySize {
         BodySize::Stream
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        self.stream.poll().map_err(std::convert::Into::into)
+    /// Attempts to pull out the next value of the underlying [`Stream`].
+    ///
+    /// Empty values are skipped to prevent [`BodyStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        let mut stream = self.project().stream;
+        loop {
+            let stream = stream.as_mut();
+            return Poll::Ready(match ready!(stream.poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                opt => opt.map(|res| res.map_err(Into::into)),
+            });
+        }
     }
 }
 
 /// Type represent streaming body. This body implementation should be used
 /// if total size of stream is known. Data get sent as is without using transfer encoding.
-pub struct SizedStream<S> {
+#[pin_project]
+pub struct SizedStream<S: Unpin> {
     size: u64,
+    #[pin]
     stream: S,
 }
 
 impl<S> SizedStream<S>
 where
-    S: Stream<Item = Bytes, Error = Error>,
+    S: Stream<Item = Result<Bytes, Error>> + Unpin,
 {
     pub fn new(size: u64, stream: S) -> Self {
         SizedStream { size, stream }
@@ -400,20 +460,38 @@ where
 
 impl<S> MessageBody for SizedStream<S>
 where
-    S: Stream<Item = Bytes, Error = Error>,
+    S: Stream<Item = Result<Bytes, Error>> + Unpin,
 {
     fn size(&self) -> BodySize {
         BodySize::Sized64(self.size)
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
-        self.stream.poll()
+    /// Attempts to pull out the next value of the underlying [`Stream`].
+    ///
+    /// Empty values are skipped to prevent [`SizedStream`]'s transmission being
+    /// ended on a zero-length chunk, but rather proceed until the underlying
+    /// [`Stream`] ends.
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        let mut stream: Pin<&mut S> = self.project().stream;
+        loop {
+            let stream = stream.as_mut();
+            return Poll::Ready(match ready!(stream.poll_next(cx)) {
+                Some(Ok(ref bytes)) if bytes.is_empty() => continue,
+                val => val,
+            });
+        }
     }
 }
 
 #[cfg(test)]
 mod tests {
     use super::*;
+    use futures::stream;
+    use futures_util::future::poll_fn;
+    use futures_util::pin_mut;
 
     impl Body {
         pub(crate) fn get_ref(&self) -> &[u8] {
@@ -433,21 +511,24 @@ mod tests {
         }
     }
 
-    #[test]
-    fn test_static_str() {
+    #[actix_rt::test]
+    async fn test_static_str() {
         assert_eq!(Body::from("").size(), BodySize::Sized(0));
         assert_eq!(Body::from("test").size(), BodySize::Sized(4));
         assert_eq!(Body::from("test").get_ref(), b"test");
 
         assert_eq!("test".size(), BodySize::Sized(4));
         assert_eq!(
-            "test".poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_static_bytes() {
+    #[actix_rt::test]
+    async fn test_static_bytes() {
         assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
         assert_eq!(
@@ -455,82 +536,95 @@ mod tests {
             BodySize::Sized(4)
         );
         assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
+        let sb = Bytes::from(&b"test"[..]);
+        pin_mut!(sb);
 
-        assert_eq!((&b"test"[..]).size(), BodySize::Sized(4));
+        assert_eq!(sb.size(), BodySize::Sized(4));
         assert_eq!(
-            (&b"test"[..]).poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_vec() {
+    #[actix_rt::test]
+    async fn test_vec() {
         assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
         assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
+        let test_vec = Vec::from("test");
+        pin_mut!(test_vec);
 
-        assert_eq!(Vec::from("test").size(), BodySize::Sized(4));
+        assert_eq!(test_vec.size(), BodySize::Sized(4));
         assert_eq!(
-            Vec::from("test").poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| test_vec.as_mut().poll_next(cx))
+                .await
+                .unwrap()
+                .ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_bytes() {
-        let mut b = Bytes::from("test");
+    #[actix_rt::test]
+    async fn test_bytes() {
+        let b = Bytes::from("test");
         assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b.clone()).get_ref(), b"test");
+        pin_mut!(b);
 
         assert_eq!(b.size(), BodySize::Sized(4));
         assert_eq!(
-            b.poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_bytes_mut() {
-        let mut b = BytesMut::from("test");
+    #[actix_rt::test]
+    async fn test_bytes_mut() {
+        let b = BytesMut::from("test");
         assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b.clone()).get_ref(), b"test");
+        pin_mut!(b);
 
         assert_eq!(b.size(), BodySize::Sized(4));
         assert_eq!(
-            b.poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_string() {
-        let mut b = "test".to_owned();
+    #[actix_rt::test]
+    async fn test_string() {
+        let b = "test".to_owned();
         assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
         assert_eq!(Body::from(b.clone()).get_ref(), b"test");
         assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
         assert_eq!(Body::from(&b).get_ref(), b"test");
+        pin_mut!(b);
 
         assert_eq!(b.size(), BodySize::Sized(4));
         assert_eq!(
-            b.poll_next().unwrap(),
-            Async::Ready(Some(Bytes::from("test")))
+            poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
+            Some(Bytes::from("test"))
         );
     }
 
-    #[test]
-    fn test_unit() {
+    #[actix_rt::test]
+    async fn test_unit() {
         assert_eq!(().size(), BodySize::Empty);
-        assert_eq!(().poll_next().unwrap(), Async::Ready(None));
+        assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
+            .await
+            .is_none());
     }
 
-    #[test]
-    fn test_box() {
-        let mut val = Box::new(());
+    #[actix_rt::test]
+    async fn test_box() {
+        let val = Box::new(());
+        pin_mut!(val);
         assert_eq!(val.size(), BodySize::Empty);
-        assert_eq!(val.poll_next().unwrap(), Async::Ready(None));
+        assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
     }
 
-    #[test]
-    fn test_body_eq() {
+    #[actix_rt::test]
+    async fn test_body_eq() {
         assert!(Body::None == Body::None);
         assert!(Body::None != Body::Empty);
         assert!(Body::Empty == Body::Empty);
@@ -542,10 +636,116 @@ mod tests {
         assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
     }
 
-    #[test]
-    fn test_body_debug() {
+    #[actix_rt::test]
+    async fn test_body_debug() {
         assert!(format!("{:?}", Body::None).contains("Body::None"));
         assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
         assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains("1"));
     }
+
+    #[actix_rt::test]
+    async fn test_serde_json() {
+        use serde_json::json;
+        assert_eq!(
+            Body::from(serde_json::Value::String("test".into())).size(),
+            BodySize::Sized(6)
+        );
+        assert_eq!(
+            Body::from(json!({"test-key":"test-value"})).size(),
+            BodySize::Sized(25)
+        );
+    }
+
+    mod body_stream {
+        use super::*;
+        //use futures::task::noop_waker;
+        //use futures::stream::once;
+
+        #[actix_rt::test]
+        async fn skips_empty_chunks() {
+            let body = BodyStream::new(stream::iter(
+                ["1", "", "2"]
+                    .iter()
+                    .map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
+            ));
+            pin_mut!(body);
+
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("1")),
+            );
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("2")),
+            );
+        }
+
+        /* Now it does not compile as it should
+        #[actix_rt::test]
+        async fn move_pinned_pointer() {
+            let (sender, receiver) = futures::channel::oneshot::channel();
+            let mut body_stream = Ok(BodyStream::new(once(async {
+                let x = Box::new(0i32);
+                let y = &x;
+                receiver.await.unwrap();
+                let _z = **y;
+                Ok::<_, ()>(Bytes::new())
+            })));
+
+            let waker = noop_waker();
+            let mut context = Context::from_waker(&waker);
+            pin_mut!(body_stream);
+
+            let _ = body_stream.as_mut().unwrap().poll_next(&mut context);
+            sender.send(()).unwrap();
+            let _ = std::mem::replace(&mut body_stream, Err([0; 32])).unwrap().poll_next(&mut context);
+        }*/
+    }
+
+    mod sized_stream {
+        use super::*;
+
+        #[actix_rt::test]
+        async fn skips_empty_chunks() {
+            let body = SizedStream::new(
+                2,
+                stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
+            );
+            pin_mut!(body);
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("1")),
+            );
+            assert_eq!(
+                poll_fn(|cx| body.as_mut().poll_next(cx))
+                    .await
+                    .unwrap()
+                    .ok(),
+                Some(Bytes::from("2")),
+            );
+        }
+    }
+
+    #[actix_rt::test]
+    async fn test_body_casting() {
+        let mut body = String::from("hello cast");
+        let resp_body: &mut dyn MessageBody = &mut body;
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast");
+        let body = &mut resp_body.downcast_mut::<String>().unwrap();
+        body.push_str("!");
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast!");
+        let not_body = resp_body.downcast_ref::<()>();
+        assert!(not_body.is_none());
+    }
 }

actix-http/src/builder.rs

@@ -1,15 +1,16 @@
-use std::fmt;
 use std::marker::PhantomData;
+use std::rc::Rc;
+use std::{fmt, net};
 
 use actix_codec::Framed;
-use actix_server_config::ServerConfig as SrvConfig;
-use actix_service::{IntoNewService, NewService, Service};
+use actix_service::{IntoServiceFactory, Service, ServiceFactory};
 
 use crate::body::MessageBody;
 use crate::config::{KeepAlive, ServiceConfig};
 use crate::error::Error;
 use crate::h1::{Codec, ExpectHandler, H1Service, UpgradeHandler};
 use crate::h2::H2Service;
+use crate::helpers::{Data, DataFactory};
 use crate::request::Request;
 use crate::response::Response;
 use crate::service::HttpService;
@@ -22,16 +23,20 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
     keep_alive: KeepAlive,
     client_timeout: u64,
     client_disconnect: u64,
+    secure: bool,
+    local_addr: Option<net::SocketAddr>,
     expect: X,
     upgrade: Option<U>,
+    on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
     _t: PhantomData<(T, S)>,
 }
 
 impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler<T>>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
+    <S::Service as Service>::Future: 'static,
 {
     /// Create instance of `ServiceConfigBuilder`
     pub fn new() -> Self {
@@ -39,8 +44,11 @@ where
             keep_alive: KeepAlive::Timeout(5),
             client_timeout: 5000,
             client_disconnect: 0,
+            secure: false,
+            local_addr: None,
             expect: ExpectHandler,
             upgrade: None,
+            on_connect: None,
             _t: PhantomData,
         }
     }
@@ -48,19 +56,18 @@ where
 
 impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
-    X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+    <S::Service as Service>::Future: 'static,
+    X: ServiceFactory<Config = (), Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<
-        Config = SrvConfig,
-        Request = (Request, Framed<T, Codec>),
-        Response = (),
-    >,
+    <X::Service as Service>::Future: 'static,
+    U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
+    <U::Service as Service>::Future: 'static,
 {
     /// Set server keep-alive setting.
     ///
@@ -70,6 +77,18 @@ where
         self
     }
 
+    /// Set connection secure state
+    pub fn secure(mut self) -> Self {
+        self.secure = true;
+        self
+    }
+
+    /// Set the local address that this service is bound to.
+    pub fn local_addr(mut self, addr: net::SocketAddr) -> Self {
+        self.local_addr = Some(addr);
+        self
+    }
+
     /// Set server client timeout in milliseconds for first request.
     ///
     /// Defines a timeout for reading client request header. If a client does not transmit
@@ -104,17 +123,21 @@ where
     /// request will be forwarded to main service.
     pub fn expect<F, X1>(self, expect: F) -> HttpServiceBuilder<T, S, X1, U>
     where
-        F: IntoNewService<X1>,
-        X1: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+        F: IntoServiceFactory<X1>,
+        X1: ServiceFactory<Config = (), Request = Request, Response = Request>,
         X1::Error: Into<Error>,
         X1::InitError: fmt::Debug,
+        <X1::Service as Service>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
             client_timeout: self.client_timeout,
             client_disconnect: self.client_disconnect,
-            expect: expect.into_new_service(),
+            secure: self.secure,
+            local_addr: self.local_addr,
+            expect: expect.into_factory(),
             upgrade: self.upgrade,
+            on_connect: self.on_connect,
             _t: PhantomData,
         }
     }
@@ -125,30 +148,47 @@ where
     /// and this service get called with original request and framed object.
     pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
     where
-        F: IntoNewService<U1>,
-        U1: NewService<
-            Config = SrvConfig,
+        F: IntoServiceFactory<U1>,
+        U1: ServiceFactory<
+            Config = (),
             Request = (Request, Framed<T, Codec>),
             Response = (),
         >,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
+        <U1::Service as Service>::Future: 'static,
     {
         HttpServiceBuilder {
             keep_alive: self.keep_alive,
             client_timeout: self.client_timeout,
             client_disconnect: self.client_disconnect,
+            secure: self.secure,
+            local_addr: self.local_addr,
             expect: self.expect,
-            upgrade: Some(upgrade.into_new_service()),
+            upgrade: Some(upgrade.into_factory()),
+            on_connect: self.on_connect,
             _t: PhantomData,
         }
     }
 
-    /// Finish service configuration and create *http service* for HTTP/1 protocol.
-    pub fn h1<F, P, B>(self, service: F) -> H1Service<T, P, S, B, X, U>
+    /// Set on-connect callback.
+    ///
+    /// It get called once per connection and result of the call
+    /// get stored to the request's extensions.
+    pub fn on_connect<F, I>(mut self, f: F) -> Self
     where
-        B: MessageBody + 'static,
-        F: IntoNewService<S>,
+        F: Fn(&T) -> I + 'static,
+        I: Clone + 'static,
+    {
+        self.on_connect = Some(Rc::new(move |io| Box::new(Data(f(io)))));
+        self
+    }
+
+    /// Finish service configuration and create *http service* for HTTP/1 protocol.
+    pub fn h1<F, B>(self, service: F) -> H1Service<T, S, B, X, U>
+    where
+        B: MessageBody,
+        F: IntoServiceFactory<S>,
         S::Error: Into<Error>,
         S::InitError: fmt::Debug,
         S::Response: Into<Response<B>>,
@@ -157,47 +197,55 @@ where
             self.keep_alive,
             self.client_timeout,
             self.client_disconnect,
+            self.secure,
+            self.local_addr,
         );
-        H1Service::with_config(cfg, service.into_new_service())
+        H1Service::with_config(cfg, service.into_factory())
             .expect(self.expect)
             .upgrade(self.upgrade)
+            .on_connect(self.on_connect)
     }
 
     /// Finish service configuration and create *http service* for HTTP/2 protocol.
-    pub fn h2<F, P, B>(self, service: F) -> H2Service<T, P, S, B>
+    pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
     where
         B: MessageBody + 'static,
-        F: IntoNewService<S>,
-        S::Error: Into<Error>,
+        F: IntoServiceFactory<S>,
+        S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
-        S::Response: Into<Response<B>>,
+        S::Response: Into<Response<B>> + 'static,
         <S::Service as Service>::Future: 'static,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,
             self.client_timeout,
             self.client_disconnect,
+            self.secure,
+            self.local_addr,
         );
-        H2Service::with_config(cfg, service.into_new_service())
+        H2Service::with_config(cfg, service.into_factory()).on_connect(self.on_connect)
     }
 
     /// Finish service configuration and create `HttpService` instance.
-    pub fn finish<F, P, B>(self, service: F) -> HttpService<T, P, S, B, X, U>
+    pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
     where
         B: MessageBody + 'static,
-        F: IntoNewService<S>,
-        S::Error: Into<Error>,
+        F: IntoServiceFactory<S>,
+        S::Error: Into<Error> + 'static,
         S::InitError: fmt::Debug,
-        S::Response: Into<Response<B>>,
+        S::Response: Into<Response<B>> + 'static,
         <S::Service as Service>::Future: 'static,
     {
         let cfg = ServiceConfig::new(
             self.keep_alive,
             self.client_timeout,
             self.client_disconnect,
+            self.secure,
+            self.local_addr,
         );
-        HttpService::with_config(cfg, service.into_new_service())
+        HttpService::with_config(cfg, service.into_factory())
             .expect(self.expect)
             .upgrade(self.upgrade)
+            .on_connect(self.on_connect)
     }
 }

actix-http/src/client/config.rs

@@ -0,0 +1,39 @@
+use std::time::Duration;
+
+// These values are taken from hyper/src/proto/h2/client.rs
+const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2mb
+const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1mb
+
+/// Connector configuration
+#[derive(Clone)]
+pub(crate) struct ConnectorConfig {
+    pub(crate) timeout: Duration,
+    pub(crate) conn_lifetime: Duration,
+    pub(crate) conn_keep_alive: Duration,
+    pub(crate) disconnect_timeout: Option<Duration>,
+    pub(crate) limit: usize,
+    pub(crate) conn_window_size: u32,
+    pub(crate) stream_window_size: u32,
+}
+
+impl Default for ConnectorConfig {
+    fn default() -> Self {
+        Self {
+            timeout: Duration::from_secs(1),
+            conn_lifetime: Duration::from_secs(75),
+            conn_keep_alive: Duration::from_secs(15),
+            disconnect_timeout: Some(Duration::from_millis(3000)),
+            limit: 100,
+            conn_window_size: DEFAULT_H2_CONN_WINDOW,
+            stream_window_size: DEFAULT_H2_STREAM_WINDOW,
+        }
+    }
+}
+
+impl ConnectorConfig {
+    pub(crate) fn no_disconnect_timeout(&self) -> Self {
+        let mut res = self.clone();
+        res.disconnect_timeout = None;
+        res
+    }
+}

actix-http/src/client/connection.rs

@@ -1,14 +1,16 @@
-use std::{fmt, io, time};
+use std::pin::Pin;
+use std::task::{Context, Poll};
+use std::{fmt, io, mem, time};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
 use bytes::{Buf, Bytes};
-use futures::future::{err, Either, Future, FutureResult};
-use futures::Poll;
+use futures_util::future::{err, Either, Future, FutureExt, LocalBoxFuture, Ready};
 use h2::client::SendRequest;
+use pin_project::{pin_project, project};
 
 use crate::body::MessageBody;
 use crate::h1::ClientCodec;
-use crate::message::{RequestHead, ResponseHead};
+use crate::message::{RequestHeadType, ResponseHead};
 use crate::payload::Payload;
 
 use super::error::SendRequestError;
@@ -21,25 +23,24 @@ pub(crate) enum ConnectionType<Io> {
 }
 
 pub trait Connection {
-    type Io: AsyncRead + AsyncWrite;
-    type Future: Future<Item = (ResponseHead, Payload), Error = SendRequestError>;
+    type Io: AsyncRead + AsyncWrite + Unpin;
+    type Future: Future<Output = Result<(ResponseHead, Payload), SendRequestError>>;
 
     fn protocol(&self) -> Protocol;
 
     /// Send request and body
-    fn send_request<B: MessageBody + 'static>(
+    fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
         self,
-        head: RequestHead,
+        head: H,
         body: B,
     ) -> Self::Future;
 
     type TunnelFuture: Future<
-        Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
-        Error = SendRequestError,
+        Output = Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
     >;
 
     /// Send request, returns Response and Framed
-    fn open_tunnel(self, head: RequestHead) -> Self::TunnelFuture;
+    fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture;
 }
 
 pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
@@ -62,7 +63,7 @@ impl<T> fmt::Debug for IoConnection<T>
 where
     T: fmt::Debug,
 {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match self.io {
             Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
             Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
@@ -71,7 +72,7 @@ where
     }
 }
 
-impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
+impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
     pub(crate) fn new(
         io: ConnectionType<T>,
         created: time::Instant,
@@ -91,10 +92,11 @@ impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
 
 impl<T> Connection for IoConnection<T>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     type Io = T;
-    type Future = Box<Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
+    type Future =
+        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
 
     fn protocol(&self) -> Protocol {
         match self.io {
@@ -104,44 +106,36 @@ where
         }
     }
 
-    fn send_request<B: MessageBody + 'static>(
+    fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
         mut self,
-        head: RequestHead,
+        head: H,
         body: B,
     ) -> Self::Future {
         match self.io.take().unwrap() {
-            ConnectionType::H1(io) => Box::new(h1proto::send_request(
-                io,
-                head,
-                body,
-                self.created,
-                self.pool,
-            )),
-            ConnectionType::H2(io) => Box::new(h2proto::send_request(
-                io,
-                head,
-                body,
-                self.created,
-                self.pool,
-            )),
+            ConnectionType::H1(io) => {
+                h1proto::send_request(io, head.into(), body, self.created, self.pool)
+                    .boxed_local()
+            }
+            ConnectionType::H2(io) => {
+                h2proto::send_request(io, head.into(), body, self.created, self.pool)
+                    .boxed_local()
+            }
         }
     }
 
     type TunnelFuture = Either<
-        Box<
-            Future<
-                Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
-                Error = SendRequestError,
-            >,
+        LocalBoxFuture<
+            'static,
+            Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
         >,
-        FutureResult<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
+        Ready<Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>>,
     >;
 
     /// Send request, returns Response and Framed
-    fn open_tunnel(mut self, head: RequestHead) -> Self::TunnelFuture {
+    fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
         match self.io.take().unwrap() {
             ConnectionType::H1(io) => {
-                Either::A(Box::new(h1proto::open_tunnel(io, head)))
+                Either::Left(h1proto::open_tunnel(io, head.into()).boxed_local())
             }
             ConnectionType::H2(io) => {
                 if let Some(mut pool) = self.pool.take() {
@@ -151,7 +145,7 @@ where
                         None,
                     ));
                 }
-                Either::B(err(SendRequestError::TunnelNotSupported))
+                Either::Right(err(SendRequestError::TunnelNotSupported))
             }
         }
     }
@@ -165,11 +159,12 @@ pub(crate) enum EitherConnection<A, B> {
 
 impl<A, B> Connection for EitherConnection<A, B>
 where
-    A: AsyncRead + AsyncWrite + 'static,
-    B: AsyncRead + AsyncWrite + 'static,
+    A: AsyncRead + AsyncWrite + Unpin + 'static,
+    B: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     type Io = EitherIo<A, B>;
-    type Future = Box<Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
+    type Future =
+        LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
 
     fn protocol(&self) -> Protocol {
         match self {
@@ -178,9 +173,9 @@ where
         }
     }
 
-    fn send_request<RB: MessageBody + 'static>(
+    fn send_request<RB: MessageBody + 'static, H: Into<RequestHeadType>>(
         self,
-        head: RequestHead,
+        head: H,
         body: RB,
     ) -> Self::Future {
         match self {
@@ -189,44 +184,30 @@ where
         }
     }
 
-    type TunnelFuture = Box<
-        Future<
-            Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
-            Error = SendRequestError,
-        >,
+    type TunnelFuture = LocalBoxFuture<
+        'static,
+        Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
     >;
 
     /// Send request, returns Response and Framed
-    fn open_tunnel(self, head: RequestHead) -> Self::TunnelFuture {
+    fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
         match self {
-            EitherConnection::A(con) => Box::new(
-                con.open_tunnel(head)
-                    .map(|(head, framed)| (head, framed.map_io(EitherIo::A))),
-            ),
-            EitherConnection::B(con) => Box::new(
-                con.open_tunnel(head)
-                    .map(|(head, framed)| (head, framed.map_io(EitherIo::B))),
-            ),
+            EitherConnection::A(con) => con
+                .open_tunnel(head)
+                .map(|res| res.map(|(head, framed)| (head, framed.map_io(EitherIo::A))))
+                .boxed_local(),
+            EitherConnection::B(con) => con
+                .open_tunnel(head)
+                .map(|res| res.map(|(head, framed)| (head, framed.map_io(EitherIo::B))))
+                .boxed_local(),
         }
     }
 }
 
+#[pin_project]
 pub enum EitherIo<A, B> {
-    A(A),
-    B(B),
-}
-
-impl<A, B> io::Read for EitherIo<A, B>
-where
-    A: io::Read,
-    B: io::Read,
-{
-    fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
-        match self {
-            EitherIo::A(ref mut val) => val.read(buf),
-            EitherIo::B(ref mut val) => val.read(buf),
-        }
-    }
+    A(#[pin] A),
+    B(#[pin] B),
 }
 
 impl<A, B> AsyncRead for EitherIo<A, B>
@@ -234,7 +215,23 @@ where
     A: AsyncRead,
     B: AsyncRead,
 {
-    unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool {
+    #[project]
+    fn poll_read(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &mut [u8],
+    ) -> Poll<io::Result<usize>> {
+        #[project]
+        match self.project() {
+            EitherIo::A(val) => val.poll_read(cx, buf),
+            EitherIo::B(val) => val.poll_read(cx, buf),
+        }
+    }
+
+    unsafe fn prepare_uninitialized_buffer(
+        &self,
+        buf: &mut [mem::MaybeUninit<u8>],
+    ) -> bool {
         match self {
             EitherIo::A(ref val) => val.prepare_uninitialized_buffer(buf),
             EitherIo::B(ref val) => val.prepare_uninitialized_buffer(buf),
@@ -242,45 +239,58 @@ where
     }
 }
 
-impl<A, B> io::Write for EitherIo<A, B>
-where
-    A: io::Write,
-    B: io::Write,
-{
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        match self {
-            EitherIo::A(ref mut val) => val.write(buf),
-            EitherIo::B(ref mut val) => val.write(buf),
-        }
-    }
-
-    fn flush(&mut self) -> io::Result<()> {
-        match self {
-            EitherIo::A(ref mut val) => val.flush(),
-            EitherIo::B(ref mut val) => val.flush(),
-        }
-    }
-}
-
 impl<A, B> AsyncWrite for EitherIo<A, B>
 where
     A: AsyncWrite,
     B: AsyncWrite,
 {
-    fn shutdown(&mut self) -> Poll<(), io::Error> {
-        match self {
-            EitherIo::A(ref mut val) => val.shutdown(),
-            EitherIo::B(ref mut val) => val.shutdown(),
+    #[project]
+    fn poll_write(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &[u8],
+    ) -> Poll<io::Result<usize>> {
+        #[project]
+        match self.project() {
+            EitherIo::A(val) => val.poll_write(cx, buf),
+            EitherIo::B(val) => val.poll_write(cx, buf),
         }
     }
 
-    fn write_buf<U: Buf>(&mut self, buf: &mut U) -> Poll<usize, io::Error>
+    #[project]
+    fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
+        #[project]
+        match self.project() {
+            EitherIo::A(val) => val.poll_flush(cx),
+            EitherIo::B(val) => val.poll_flush(cx),
+        }
+    }
+
+    #[project]
+    fn poll_shutdown(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<io::Result<()>> {
+        #[project]
+        match self.project() {
+            EitherIo::A(val) => val.poll_shutdown(cx),
+            EitherIo::B(val) => val.poll_shutdown(cx),
+        }
+    }
+
+    #[project]
+    fn poll_write_buf<U: Buf>(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &mut U,
+    ) -> Poll<Result<usize, io::Error>>
     where
         Self: Sized,
     {
-        match self {
-            EitherIo::A(ref mut val) => val.write_buf(buf),
-            EitherIo::B(ref mut val) => val.write_buf(buf),
+        #[project]
+        match self.project() {
+            EitherIo::A(val) => val.poll_write_buf(cx, buf),
+            EitherIo::B(val) => val.poll_write_buf(cx, buf),
         }
     }
 }

actix-http/src/client/connector.rs

@@ -6,20 +6,33 @@ use actix_codec::{AsyncRead, AsyncWrite};
 use actix_connect::{
     default_connector, Connect as TcpConnect, Connection as TcpConnection,
 };
-use actix_service::{apply_fn, Service, ServiceExt};
+use actix_rt::net::TcpStream;
+use actix_service::{apply_fn, Service};
 use actix_utils::timeout::{TimeoutError, TimeoutService};
 use http::Uri;
-use tokio_tcp::TcpStream;
 
+use super::config::ConnectorConfig;
 use super::connection::Connection;
 use super::error::ConnectError;
 use super::pool::{ConnectionPool, Protocol};
 use super::Connect;
 
-#[cfg(feature = "ssl")]
-use openssl::ssl::SslConnector;
+#[cfg(feature = "openssl")]
+use actix_connect::ssl::openssl::SslConnector as OpensslConnector;
 
-#[cfg(not(feature = "ssl"))]
+#[cfg(feature = "rustls")]
+use actix_connect::ssl::rustls::ClientConfig;
+#[cfg(feature = "rustls")]
+use std::sync::Arc;
+
+#[cfg(any(feature = "openssl", feature = "rustls"))]
+enum SslConnector {
+    #[cfg(feature = "openssl")]
+    Openssl(OpensslConnector),
+    #[cfg(feature = "rustls")]
+    Rustls(Arc<ClientConfig>),
+}
+#[cfg(not(any(feature = "openssl", feature = "rustls")))]
 type SslConnector = ();
 
 /// Manages http client network connectivity
@@ -36,17 +49,17 @@ type SslConnector = ();
 /// ```
 pub struct Connector<T, U> {
     connector: T,
-    timeout: Duration,
-    conn_lifetime: Duration,
-    conn_keep_alive: Duration,
-    disconnect_timeout: Duration,
-    limit: usize,
+    config: ConnectorConfig,
     #[allow(dead_code)]
     ssl: SslConnector,
     _t: PhantomData<U>,
 }
 
+trait Io: AsyncRead + AsyncWrite + Unpin {}
+impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
+
 impl Connector<(), ()> {
+    #[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
     pub fn new() -> Connector<
         impl Service<
                 Request = TcpConnect<Uri>,
@@ -55,39 +68,54 @@ impl Connector<(), ()> {
             > + Clone,
         TcpStream,
     > {
-        let ssl = {
-            #[cfg(feature = "ssl")]
-            {
-                use openssl::ssl::SslMethod;
-
-                let mut ssl = SslConnector::builder(SslMethod::tls()).unwrap();
-                let _ = ssl
-                    .set_alpn_protos(b"\x02h2\x08http/1.1")
-                    .map_err(|e| error!("Can not set alpn protocol: {:?}", e));
-                ssl.build()
-            }
-            #[cfg(not(feature = "ssl"))]
-            {}
-        };
-
         Connector {
-            ssl,
+            ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
             connector: default_connector(),
-            timeout: Duration::from_secs(1),
-            conn_lifetime: Duration::from_secs(75),
-            conn_keep_alive: Duration::from_secs(15),
-            disconnect_timeout: Duration::from_millis(3000),
-            limit: 100,
+            config: ConnectorConfig::default(),
             _t: PhantomData,
         }
     }
+
+    // Build Ssl connector with openssl, based on supplied alpn protocols
+    #[cfg(feature = "openssl")]
+    fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
+        use actix_connect::ssl::openssl::SslMethod;
+        use bytes::{BufMut, BytesMut};
+
+        let mut alpn = BytesMut::with_capacity(20);
+        for proto in protocols.iter() {
+            alpn.put_u8(proto.len() as u8);
+            alpn.put(proto.as_slice());
+        }
+
+        let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
+        let _ = ssl
+            .set_alpn_protos(&alpn)
+            .map_err(|e| error!("Can not set alpn protocol: {:?}", e));
+        SslConnector::Openssl(ssl.build())
+    }
+
+    // Build Ssl connector with rustls, based on supplied alpn protocols
+    #[cfg(all(not(feature = "openssl"), feature = "rustls"))]
+    fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
+        let mut config = ClientConfig::new();
+        config.set_protocols(&protocols);
+        config
+            .root_store
+            .add_server_trust_anchors(&actix_tls::rustls::TLS_SERVER_ROOTS);
+        SslConnector::Rustls(Arc::new(config))
+    }
+
+    // ssl turned off, provides empty ssl connector
+    #[cfg(not(any(feature = "openssl", feature = "rustls")))]
+    fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
 }
 
 impl<T, U> Connector<T, U> {
     /// Use custom connector.
     pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
     where
-        U1: AsyncRead + AsyncWrite + fmt::Debug,
+        U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
         T1: Service<
                 Request = TcpConnect<Uri>,
                 Response = TcpConnection<Uri, U1>,
@@ -96,11 +124,7 @@ impl<T, U> Connector<T, U> {
     {
         Connector {
             connector,
-            timeout: self.timeout,
-            conn_lifetime: self.conn_lifetime,
-            conn_keep_alive: self.conn_keep_alive,
-            disconnect_timeout: self.disconnect_timeout,
-            limit: self.limit,
+            config: self.config,
             ssl: self.ssl,
             _t: PhantomData,
         }
@@ -109,7 +133,7 @@ impl<T, U> Connector<T, U> {
 
 impl<T, U> Connector<T, U>
 where
-    U: AsyncRead + AsyncWrite + fmt::Debug + 'static,
+    U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
     T: Service<
             Request = TcpConnect<Uri>,
             Response = TcpConnection<Uri, U>,
@@ -120,14 +144,52 @@ where
     /// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
     /// Set to 1 second by default.
     pub fn timeout(mut self, timeout: Duration) -> Self {
-        self.timeout = timeout;
+        self.config.timeout = timeout;
         self
     }
 
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     /// Use custom `SslConnector` instance.
-    pub fn ssl(mut self, connector: SslConnector) -> Self {
-        self.ssl = connector;
+    pub fn ssl(mut self, connector: OpensslConnector) -> Self {
+        self.ssl = SslConnector::Openssl(connector);
+        self
+    }
+
+    #[cfg(feature = "rustls")]
+    pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
+        self.ssl = SslConnector::Rustls(connector);
+        self
+    }
+
+    /// Maximum supported http major version
+    /// Supported versions http/1.1, http/2
+    pub fn max_http_version(mut self, val: http::Version) -> Self {
+        let versions = match val {
+            http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
+            http::Version::HTTP_2 => vec![b"h2".to_vec(), b"http/1.1".to_vec()],
+            _ => {
+                unimplemented!("actix-http:client: supported versions http/1.1, http/2")
+            }
+        };
+        self.ssl = Connector::build_ssl(versions);
+        self
+    }
+
+    /// Indicates the initial window size (in octets) for
+    /// HTTP2 stream-level flow control for received data.
+    ///
+    /// The default value is 65,535 and is good for APIs, but not for big objects.
+    pub fn initial_window_size(mut self, size: u32) -> Self {
+        self.config.stream_window_size = size;
+        self
+    }
+
+    /// Indicates the initial window size (in octets) for
+    /// HTTP2 connection-level flow control for received data.
+    ///
+    /// The default value is 65,535 and is good for APIs, but not for big objects.
+    pub fn initial_connection_window_size(mut self, size: u32) -> Self {
+        self.config.conn_window_size = size;
         self
     }
 
@@ -136,7 +198,7 @@ where
     /// If limit is 0, the connector has no limit.
     /// The default limit size is 100.
     pub fn limit(mut self, limit: usize) -> Self {
-        self.limit = limit;
+        self.config.limit = limit;
         self
     }
 
@@ -147,7 +209,7 @@ where
     /// exceeds this period, the connection is closed.
     /// Default keep-alive period is 15 seconds.
     pub fn conn_keep_alive(mut self, dur: Duration) -> Self {
-        self.conn_keep_alive = dur;
+        self.config.conn_keep_alive = dur;
         self
     }
 
@@ -157,7 +219,7 @@ where
     /// until it is closed regardless of keep-alive period.
     /// Default lifetime period is 75 seconds.
     pub fn conn_lifetime(mut self, dur: Duration) -> Self {
-        self.conn_lifetime = dur;
+        self.config.conn_lifetime = dur;
         self
     }
 
@@ -170,7 +232,7 @@ where
     ///
     /// By default disconnect timeout is set to 3000 milliseconds.
     pub fn disconnect_timeout(mut self, dur: Duration) -> Self {
-        self.disconnect_timeout = dur;
+        self.config.disconnect_timeout = Some(dur);
         self
     }
 
@@ -180,11 +242,11 @@ where
     pub fn finish(
         self,
     ) -> impl Service<Request = Connect, Response = impl Connection, Error = ConnectError>
-                 + Clone {
-        #[cfg(not(feature = "ssl"))]
+           + Clone {
+        #[cfg(not(any(feature = "openssl", feature = "rustls")))]
         {
             let connector = TimeoutService::new(
-                self.timeout,
+                self.config.timeout,
                 apply_fn(self.connector, |msg: Connect, srv| {
                     srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
                 })
@@ -199,42 +261,66 @@ where
             connect_impl::InnerConnector {
                 tcp_pool: ConnectionPool::new(
                     connector,
-                    self.conn_lifetime,
-                    self.conn_keep_alive,
-                    None,
-                    self.limit,
+                    self.config.no_disconnect_timeout(),
                 ),
             }
         }
-        #[cfg(feature = "ssl")]
+        #[cfg(any(feature = "openssl", feature = "rustls"))]
         {
             const H2: &[u8] = b"h2";
-            use actix_connect::ssl::OpensslConnector;
+            #[cfg(feature = "openssl")]
+            use actix_connect::ssl::openssl::OpensslConnector;
+            #[cfg(feature = "rustls")]
+            use actix_connect::ssl::rustls::{RustlsConnector, Session};
+            use actix_service::{boxed::service, pipeline};
 
             let ssl_service = TimeoutService::new(
-                self.timeout,
-                apply_fn(self.connector.clone(), |msg: Connect, srv| {
-                    srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
-                })
-                .map_err(ConnectError::from)
-                .and_then(
-                    OpensslConnector::service(self.ssl)
-                        .map_err(ConnectError::from)
-                        .map(|stream| {
-                            let sock = stream.into_parts().0;
-                            let h2 = sock
-                                .get_ref()
-                                .ssl()
-                                .selected_alpn_protocol()
-                                .map(|protos| protos.windows(2).any(|w| w == H2))
-                                .unwrap_or(false);
-                            if h2 {
-                                (sock, Protocol::Http2)
-                            } else {
-                                (sock, Protocol::Http1)
-                            }
-                        }),
-                ),
+                self.config.timeout,
+                pipeline(
+                    apply_fn(self.connector.clone(), |msg: Connect, srv| {
+                        srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
+                    })
+                    .map_err(ConnectError::from),
+                )
+                .and_then(match self.ssl {
+                    #[cfg(feature = "openssl")]
+                    SslConnector::Openssl(ssl) => service(
+                        OpensslConnector::service(ssl)
+                            .map(|stream| {
+                                let sock = stream.into_parts().0;
+                                let h2 = sock
+                                    .ssl()
+                                    .selected_alpn_protocol()
+                                    .map(|protos| protos.windows(2).any(|w| w == H2))
+                                    .unwrap_or(false);
+                                if h2 {
+                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
+                                } else {
+                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
+                                }
+                            })
+                            .map_err(ConnectError::from),
+                    ),
+                    #[cfg(feature = "rustls")]
+                    SslConnector::Rustls(ssl) => service(
+                        RustlsConnector::service(ssl)
+                            .map_err(ConnectError::from)
+                            .map(|stream| {
+                                let sock = stream.into_parts().0;
+                                let h2 = sock
+                                    .get_ref()
+                                    .1
+                                    .get_alpn_protocol()
+                                    .map(|protos| protos.windows(2).any(|w| w == H2))
+                                    .unwrap_or(false);
+                                if h2 {
+                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
+                                } else {
+                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
+                                }
+                            }),
+                    ),
+                }),
             )
             .map_err(|e| match e {
                 TimeoutError::Service(e) => e,
@@ -242,8 +328,8 @@ where
             });
 
             let tcp_service = TimeoutService::new(
-                self.timeout,
-                apply_fn(self.connector.clone(), |msg: Connect, srv| {
+                self.config.timeout,
+                apply_fn(self.connector, |msg: Connect, srv| {
                     srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
                 })
                 .map_err(ConnectError::from)
@@ -257,36 +343,27 @@ where
             connect_impl::InnerConnector {
                 tcp_pool: ConnectionPool::new(
                     tcp_service,
-                    self.conn_lifetime,
-                    self.conn_keep_alive,
-                    None,
-                    self.limit,
-                ),
-                ssl_pool: ConnectionPool::new(
-                    ssl_service,
-                    self.conn_lifetime,
-                    self.conn_keep_alive,
-                    Some(self.disconnect_timeout),
-                    self.limit,
+                    self.config.no_disconnect_timeout(),
                 ),
+                ssl_pool: ConnectionPool::new(ssl_service, self.config),
             }
         }
     }
 }
 
-#[cfg(not(feature = "ssl"))]
+#[cfg(not(any(feature = "openssl", feature = "rustls")))]
 mod connect_impl {
-    use futures::future::{err, Either, FutureResult};
-    use futures::Poll;
+    use std::task::{Context, Poll};
+
+    use futures_util::future::{err, Either, Ready};
 
     use super::*;
     use crate::client::connection::IoConnection;
 
     pub(crate) struct InnerConnector<T, Io>
     where
-        Io: AsyncRead + AsyncWrite + 'static,
+        Io: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         pub(crate) tcp_pool: ConnectionPool<T, Io>,
@@ -294,9 +371,8 @@ mod connect_impl {
 
     impl<T, Io> Clone for InnerConnector<T, Io>
     where
-        Io: AsyncRead + AsyncWrite + 'static,
+        Io: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         fn clone(&self) -> Self {
@@ -308,9 +384,8 @@ mod connect_impl {
 
     impl<T, Io> Service for InnerConnector<T, Io>
     where
-        Io: AsyncRead + AsyncWrite + 'static,
+        Io: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         type Request = Connect;
@@ -318,38 +393,41 @@ mod connect_impl {
         type Error = ConnectError;
         type Future = Either<
             <ConnectionPool<T, Io> as Service>::Future,
-            FutureResult<IoConnection<Io>, ConnectError>,
+            Ready<Result<IoConnection<Io>, ConnectError>>,
         >;
 
-        fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-            self.tcp_pool.poll_ready()
+        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+            self.tcp_pool.poll_ready(cx)
         }
 
         fn call(&mut self, req: Connect) -> Self::Future {
             match req.uri.scheme_str() {
                 Some("https") | Some("wss") => {
-                    Either::B(err(ConnectError::SslIsNotSupported))
+                    Either::Right(err(ConnectError::SslIsNotSupported))
                 }
-                _ => Either::A(self.tcp_pool.call(req)),
+                _ => Either::Left(self.tcp_pool.call(req)),
             }
         }
     }
 }
 
-#[cfg(feature = "ssl")]
+#[cfg(any(feature = "openssl", feature = "rustls"))]
 mod connect_impl {
+    use std::future::Future;
     use std::marker::PhantomData;
+    use std::pin::Pin;
+    use std::task::{Context, Poll};
 
-    use futures::future::{Either, FutureResult};
-    use futures::{Async, Future, Poll};
+    use futures_core::ready;
+    use futures_util::future::Either;
 
     use super::*;
     use crate::client::connection::EitherConnection;
 
     pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
         T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>,
         T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>,
     {
@@ -359,13 +437,11 @@ mod connect_impl {
 
     impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
         T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
         T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         fn clone(&self) -> Self {
@@ -378,53 +454,47 @@ mod connect_impl {
 
     impl<T1, T2, Io1, Io2> Service for InnerConnector<T1, T2, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
         T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
         T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
         type Request = Connect;
         type Response = EitherConnection<Io1, Io2>;
         type Error = ConnectError;
         type Future = Either<
-            FutureResult<Self::Response, Self::Error>,
-            Either<
-                InnerConnectorResponseA<T1, Io1, Io2>,
-                InnerConnectorResponseB<T2, Io1, Io2>,
-            >,
+            InnerConnectorResponseA<T1, Io1, Io2>,
+            InnerConnectorResponseB<T2, Io1, Io2>,
         >;
 
-        fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-            self.tcp_pool.poll_ready()
+        fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+            self.tcp_pool.poll_ready(cx)
         }
 
         fn call(&mut self, req: Connect) -> Self::Future {
             match req.uri.scheme_str() {
-                Some("https") | Some("wss") => {
-                    Either::B(Either::B(InnerConnectorResponseB {
-                        fut: self.ssl_pool.call(req),
-                        _t: PhantomData,
-                    }))
-                }
-                _ => Either::B(Either::A(InnerConnectorResponseA {
+                Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
+                    fut: self.ssl_pool.call(req),
+                    _t: PhantomData,
+                }),
+                _ => Either::Left(InnerConnectorResponseA {
                     fut: self.tcp_pool.call(req),
                     _t: PhantomData,
-                })),
+                }),
             }
         }
     }
 
+    #[pin_project::pin_project]
     pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
     where
-        Io1: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
+        #[pin]
         fut: <ConnectionPool<T, Io1> as Service>::Future,
         _t: PhantomData<Io2>,
     }
@@ -432,29 +502,28 @@ mod connect_impl {
     impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
     where
         T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
     {
-        type Item = EitherConnection<Io1, Io2>;
-        type Error = ConnectError;
+        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
 
-        fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-            match self.fut.poll()? {
-                Async::NotReady => Ok(Async::NotReady),
-                Async::Ready(res) => Ok(Async::Ready(EitherConnection::A(res))),
-            }
+        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+            Poll::Ready(
+                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
+                    .map(EitherConnection::A),
+            )
         }
     }
 
+    #[pin_project::pin_project]
     pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
     where
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
         T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
     {
+        #[pin]
         fut: <ConnectionPool<T, Io2> as Service>::Future,
         _t: PhantomData<Io1>,
     }
@@ -462,19 +531,17 @@ mod connect_impl {
     impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
     where
         T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
-            + Clone
             + 'static,
-        Io1: AsyncRead + AsyncWrite + 'static,
-        Io2: AsyncRead + AsyncWrite + 'static,
+        Io1: AsyncRead + AsyncWrite + Unpin + 'static,
+        Io2: AsyncRead + AsyncWrite + Unpin + 'static,
     {
-        type Item = EitherConnection<Io1, Io2>;
-        type Error = ConnectError;
+        type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
 
-        fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-            match self.fut.poll()? {
-                Async::NotReady => Ok(Async::NotReady),
-                Async::Ready(res) => Ok(Async::Ready(EitherConnection::B(res))),
-            }
+        fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+            Poll::Ready(
+                ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
+                    .map(EitherConnection::B),
+            )
         }
     }
 }

actix-http/src/client/error.rs

@@ -1,14 +1,13 @@
 use std::io;
 
+use actix_connect::resolver::ResolveError;
 use derive_more::{Display, From};
-use trust_dns_resolver::error::ResolveError;
 
-#[cfg(feature = "ssl")]
-use openssl::ssl::{Error as SslError, HandshakeError};
+#[cfg(feature = "openssl")]
+use actix_connect::ssl::openssl::{HandshakeError, SslError};
 
 use crate::error::{Error, ParseError, ResponseError};
-use crate::http::Error as HttpError;
-use crate::response::Response;
+use crate::http::{Error as HttpError, StatusCode};
 
 /// A set of errors that can occur while connecting to an HTTP host
 #[derive(Debug, Display, From)]
@@ -18,10 +17,15 @@ pub enum ConnectError {
     SslIsNotSupported,
 
     /// SSL error
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     #[display(fmt = "{}", _0)]
     SslError(SslError),
 
+    /// SSL Handshake error
+    #[cfg(feature = "openssl")]
+    #[display(fmt = "{}", _0)]
+    SslHandshakeError(String),
+
     /// Failed to resolve the hostname
     #[display(fmt = "Failed resolving hostname: {}", _0)]
     Resolver(ResolveError),
@@ -63,14 +67,10 @@ impl From<actix_connect::ConnectError> for ConnectError {
     }
 }
 
-#[cfg(feature = "ssl")]
-impl<T> From<HandshakeError<T>> for ConnectError {
+#[cfg(feature = "openssl")]
+impl<T: std::fmt::Debug> From<HandshakeError<T>> for ConnectError {
     fn from(err: HandshakeError<T>) -> ConnectError {
-        match err {
-            HandshakeError::SetupFailure(stack) => SslError::from(stack).into(),
-            HandshakeError::Failure(stream) => stream.into_error().into(),
-            HandshakeError::WouldBlock(stream) => stream.into_error().into(),
-        }
+        ConnectError::SslHandshakeError(format!("{:?}", err))
     }
 }
 
@@ -117,14 +117,33 @@ pub enum SendRequestError {
 
 /// Convert `SendRequestError` to a server `Response`
 impl ResponseError for SendRequestError {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
         match *self {
             SendRequestError::Connect(ConnectError::Timeout) => {
-                Response::GatewayTimeout()
+                StatusCode::GATEWAY_TIMEOUT
             }
-            SendRequestError::Connect(_) => Response::BadGateway(),
-            _ => Response::InternalServerError(),
+            SendRequestError::Connect(_) => StatusCode::BAD_REQUEST,
+            _ => StatusCode::INTERNAL_SERVER_ERROR,
+        }
+    }
+}
+
+/// A set of errors that can occur during freezing a request
+#[derive(Debug, Display, From)]
+pub enum FreezeRequestError {
+    /// Invalid URL
+    #[display(fmt = "Invalid URL: {}", _0)]
+    Url(InvalidUrl),
+    /// Http error
+    #[display(fmt = "{}", _0)]
+    Http(HttpError),
+}
+
+impl From<FreezeRequestError> for SendRequestError {
+    fn from(e: FreezeRequestError) -> Self {
+        match e {
+            FreezeRequestError::Url(e) => e.into(),
+            FreezeRequestError::Http(e) => e.into(),
         }
-        .into()
     }
 }

actix-http/src/client/h1proto.rs

@@ -1,15 +1,20 @@
 use std::io::Write;
-use std::{io, time};
+use std::pin::Pin;
+use std::task::{Context, Poll};
+use std::{io, mem, time};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use bytes::{BufMut, Bytes, BytesMut};
-use futures::future::{ok, Either};
-use futures::{Async, Future, Poll, Sink, Stream};
+use bytes::buf::BufMutExt;
+use bytes::{Bytes, BytesMut};
+use futures_core::Stream;
+use futures_util::future::poll_fn;
+use futures_util::{pin_mut, SinkExt, StreamExt};
 
 use crate::error::PayloadError;
 use crate::h1;
+use crate::header::HeaderMap;
 use crate::http::header::{IntoHeaderValue, HOST};
-use crate::message::{RequestHead, ResponseHead};
+use crate::message::{RequestHeadType, ResponseHead};
 use crate::payload::{Payload, PayloadStream};
 
 use super::connection::{ConnectionLifetime, ConnectionType, IoConnection};
@@ -17,34 +22,40 @@ use super::error::{ConnectError, SendRequestError};
 use super::pool::Acquired;
 use crate::body::{BodySize, MessageBody};
 
-pub(crate) fn send_request<T, B>(
+pub(crate) async fn send_request<T, B>(
     io: T,
-    mut head: RequestHead,
+    mut head: RequestHeadType,
     body: B,
     created: time::Instant,
     pool: Option<Acquired<T>>,
-) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
+) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     B: MessageBody,
 {
     // set request host header
-    if !head.headers.contains_key(HOST) {
-        if let Some(host) = head.uri.host() {
+    if !head.as_ref().headers.contains_key(HOST)
+        && !head.extra_headers().iter().any(|h| h.contains_key(HOST))
+    {
+        if let Some(host) = head.as_ref().uri.host() {
             let mut wrt = BytesMut::with_capacity(host.len() + 5).writer();
 
-            let _ = match head.uri.port_u16() {
+            let _ = match head.as_ref().uri.port_u16() {
                 None | Some(80) | Some(443) => write!(wrt, "{}", host),
                 Some(port) => write!(wrt, "{}:{}", host, port),
             };
 
-            match wrt.get_mut().take().freeze().try_into() {
-                Ok(value) => {
-                    head.headers.insert(HOST, value);
-                }
-                Err(e) => {
-                    log::error!("Can not set HOST header {}", e);
-                }
+            match wrt.get_mut().split().freeze().try_into() {
+                Ok(value) => match head {
+                    RequestHeadType::Owned(ref mut head) => {
+                        head.headers.insert(HOST, value)
+                    }
+                    RequestHeadType::Rc(_, ref mut extra_headers) => {
+                        let headers = extra_headers.get_or_insert(HeaderMap::new());
+                        headers.insert(HOST, value)
+                    }
+                },
+                Err(e) => log::error!("Can not set HOST header {}", e),
             }
         }
     }
@@ -55,68 +66,100 @@ where
         io: Some(io),
     };
 
-    let len = body.size();
+    // create Framed and send request
+    let mut framed = Framed::new(io, h1::ClientCodec::default());
+    framed.send((head, body.size()).into()).await?;
 
-    // create Framed and send reqest
-    Framed::new(io, h1::ClientCodec::default())
-        .send((head, len).into())
-        .from_err()
-        // send request body
-        .and_then(move |framed| match body.size() {
-            BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
-                Either::A(ok(framed))
-            }
-            _ => Either::B(SendBody::new(body, framed)),
-        })
-        // read response and init read body
-        .and_then(|framed| {
-            framed
-                .into_future()
-                .map_err(|(e, _)| SendRequestError::from(e))
-                .and_then(|(item, framed)| {
-                    if let Some(res) = item {
-                        match framed.get_codec().message_type() {
-                            h1::MessageType::None => {
-                                let force_close = !framed.get_codec().keepalive();
-                                release_connection(framed, force_close);
-                                Ok((res, Payload::None))
-                            }
-                            _ => {
-                                let pl: PayloadStream = Box::new(PlStream::new(framed));
-                                Ok((res, pl.into()))
-                            }
-                        }
-                    } else {
-                        Err(ConnectError::Disconnected.into())
-                    }
-                })
-        })
+    // send request body
+    match body.size() {
+        BodySize::None | BodySize::Empty | BodySize::Sized(0) => (),
+        _ => send_body(body, &mut framed).await?,
+    };
+
+    // read response and init read body
+    let res = framed.into_future().await;
+    let (head, framed) = if let (Some(result), framed) = res {
+        let item = result.map_err(SendRequestError::from)?;
+        (item, framed)
+    } else {
+        return Err(SendRequestError::from(ConnectError::Disconnected));
+    };
+
+    match framed.get_codec().message_type() {
+        h1::MessageType::None => {
+            let force_close = !framed.get_codec().keepalive();
+            release_connection(framed, force_close);
+            Ok((head, Payload::None))
+        }
+        _ => {
+            let pl: PayloadStream = PlStream::new(framed).boxed_local();
+            Ok((head, pl.into()))
+        }
+    }
 }
 
-pub(crate) fn open_tunnel<T>(
+pub(crate) async fn open_tunnel<T>(
     io: T,
-    head: RequestHead,
-) -> impl Future<Item = (ResponseHead, Framed<T, h1::ClientCodec>), Error = SendRequestError>
+    head: RequestHeadType,
+) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    // create Framed and send reqest
-    Framed::new(io, h1::ClientCodec::default())
-        .send((head, BodySize::None).into())
-        .from_err()
-        // read response
-        .and_then(|framed| {
-            framed
-                .into_future()
-                .map_err(|(e, _)| SendRequestError::from(e))
-                .and_then(|(head, framed)| {
-                    if let Some(head) = head {
-                        Ok((head, framed))
+    // create Framed and send request
+    let mut framed = Framed::new(io, h1::ClientCodec::default());
+    framed.send((head, BodySize::None).into()).await?;
+
+    // read response
+    if let (Some(result), framed) = framed.into_future().await {
+        let head = result.map_err(SendRequestError::from)?;
+        Ok((head, framed))
+    } else {
+        Err(SendRequestError::from(ConnectError::Disconnected))
+    }
+}
+
+/// send request body to the peer
+pub(crate) async fn send_body<I, B>(
+    body: B,
+    framed: &mut Framed<I, h1::ClientCodec>,
+) -> Result<(), SendRequestError>
+where
+    I: ConnectionLifetime,
+    B: MessageBody,
+{
+    let mut eof = false;
+    pin_mut!(body);
+    while !eof {
+        while !eof && !framed.is_write_buf_full() {
+            match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
+                Some(result) => {
+                    framed.write(h1::Message::Chunk(Some(result?)))?;
+                }
+                None => {
+                    eof = true;
+                    framed.write(h1::Message::Chunk(None))?;
+                }
+            }
+        }
+
+        if !framed.is_write_buf_empty() {
+            poll_fn(|cx| match framed.flush(cx) {
+                Poll::Ready(Ok(_)) => Poll::Ready(Ok(())),
+                Poll::Ready(Err(err)) => Poll::Ready(Err(err)),
+                Poll::Pending => {
+                    if !framed.is_write_buf_full() {
+                        Poll::Ready(Ok(()))
                     } else {
-                        Err(SendRequestError::from(ConnectError::Disconnected))
+                        Poll::Pending
                     }
-                })
-        })
+                }
+            })
+            .await?;
+        }
+    }
+
+    SinkExt::flush(framed).await?;
+    Ok(())
 }
 
 #[doc(hidden)]
@@ -127,7 +170,10 @@ pub struct H1Connection<T> {
     pool: Option<Acquired<T>>,
 }
 
-impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T> {
+impl<T> ConnectionLifetime for H1Connection<T>
+where
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
+{
     /// Close connection
     fn close(&mut self) {
         if let Some(mut pool) = self.pool.take() {
@@ -155,98 +201,44 @@ impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T>
     }
 }
 
-impl<T: AsyncRead + AsyncWrite + 'static> io::Read for H1Connection<T> {
-    fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
-        self.io.as_mut().unwrap().read(buf)
+impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
+    unsafe fn prepare_uninitialized_buffer(
+        &self,
+        buf: &mut [mem::MaybeUninit<u8>],
+    ) -> bool {
+        self.io.as_ref().unwrap().prepare_uninitialized_buffer(buf)
+    }
+
+    fn poll_read(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &mut [u8],
+    ) -> Poll<io::Result<usize>> {
+        Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
     }
 }
 
-impl<T: AsyncRead + AsyncWrite + 'static> AsyncRead for H1Connection<T> {}
-
-impl<T: AsyncRead + AsyncWrite + 'static> io::Write for H1Connection<T> {
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.io.as_mut().unwrap().write(buf)
+impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
+    fn poll_write(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+        buf: &[u8],
+    ) -> Poll<io::Result<usize>> {
+        Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
     }
 
-    fn flush(&mut self) -> io::Result<()> {
-        self.io.as_mut().unwrap().flush()
+    fn poll_flush(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<io::Result<()>> {
+        Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
     }
-}
 
-impl<T: AsyncRead + AsyncWrite + 'static> AsyncWrite for H1Connection<T> {
-    fn shutdown(&mut self) -> Poll<(), io::Error> {
-        self.io.as_mut().unwrap().shutdown()
-    }
-}
-
-/// Future responsible for sending request body to the peer
-pub(crate) struct SendBody<I, B> {
-    body: Option<B>,
-    framed: Option<Framed<I, h1::ClientCodec>>,
-    flushed: bool,
-}
-
-impl<I, B> SendBody<I, B>
-where
-    I: AsyncRead + AsyncWrite + 'static,
-    B: MessageBody,
-{
-    pub(crate) fn new(body: B, framed: Framed<I, h1::ClientCodec>) -> Self {
-        SendBody {
-            body: Some(body),
-            framed: Some(framed),
-            flushed: true,
-        }
-    }
-}
-
-impl<I, B> Future for SendBody<I, B>
-where
-    I: ConnectionLifetime,
-    B: MessageBody,
-{
-    type Item = Framed<I, h1::ClientCodec>;
-    type Error = SendRequestError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        let mut body_ready = true;
-        loop {
-            while body_ready
-                && self.body.is_some()
-                && !self.framed.as_ref().unwrap().is_write_buf_full()
-            {
-                match self.body.as_mut().unwrap().poll_next()? {
-                    Async::Ready(item) => {
-                        // check if body is done
-                        if item.is_none() {
-                            let _ = self.body.take();
-                        }
-                        self.flushed = false;
-                        self.framed
-                            .as_mut()
-                            .unwrap()
-                            .force_send(h1::Message::Chunk(item))?;
-                        break;
-                    }
-                    Async::NotReady => body_ready = false,
-                }
-            }
-
-            if !self.flushed {
-                match self.framed.as_mut().unwrap().poll_complete()? {
-                    Async::Ready(_) => {
-                        self.flushed = true;
-                        continue;
-                    }
-                    Async::NotReady => return Ok(Async::NotReady),
-                }
-            }
-
-            if self.body.is_none() {
-                return Ok(Async::Ready(self.framed.take().unwrap()));
-            }
-            return Ok(Async::NotReady);
-        }
+    fn poll_shutdown(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Result<(), io::Error>> {
+        Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
     }
 }
 
@@ -263,23 +255,27 @@ impl<Io: ConnectionLifetime> PlStream<Io> {
 }
 
 impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
-    type Item = Bytes;
-    type Error = PayloadError;
+    type Item = Result<Bytes, PayloadError>;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
-        match self.framed.as_mut().unwrap().poll()? {
-            Async::NotReady => Ok(Async::NotReady),
-            Async::Ready(Some(chunk)) => {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        let this = self.get_mut();
+
+        match this.framed.as_mut().unwrap().next_item(cx)? {
+            Poll::Pending => Poll::Pending,
+            Poll::Ready(Some(chunk)) => {
                 if let Some(chunk) = chunk {
-                    Ok(Async::Ready(Some(chunk)))
+                    Poll::Ready(Some(Ok(chunk)))
                 } else {
-                    let framed = self.framed.take().unwrap();
+                    let framed = this.framed.take().unwrap();
                     let force_close = !framed.get_codec().keepalive();
                     release_connection(framed, force_close);
-                    Ok(Async::Ready(None))
+                    Poll::Ready(None)
                 }
             }
-            Async::Ready(None) => Ok(Async::Ready(None)),
+            Poll::Ready(None) => Poll::Ready(None),
         }
     }
 }

actix-http/src/client/h2proto.rs

@@ -1,173 +1,182 @@
+use std::convert::TryFrom;
+use std::future::Future;
 use std::time;
 
 use actix_codec::{AsyncRead, AsyncWrite};
 use bytes::Bytes;
-use futures::future::{err, Either};
-use futures::{Async, Future, Poll};
-use h2::{client::SendRequest, SendStream};
+use futures_util::future::poll_fn;
+use futures_util::pin_mut;
+use h2::{
+    client::{Builder, Connection, SendRequest},
+    SendStream,
+};
 use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING};
-use http::{request::Request, HttpTryFrom, Method, Version};
+use http::{request::Request, Method, Version};
 
 use crate::body::{BodySize, MessageBody};
-use crate::message::{RequestHead, ResponseHead};
+use crate::header::HeaderMap;
+use crate::message::{RequestHeadType, ResponseHead};
 use crate::payload::Payload;
 
+use super::config::ConnectorConfig;
 use super::connection::{ConnectionType, IoConnection};
 use super::error::SendRequestError;
 use super::pool::Acquired;
 
-pub(crate) fn send_request<T, B>(
-    io: SendRequest<Bytes>,
-    head: RequestHead,
+pub(crate) async fn send_request<T, B>(
+    mut io: SendRequest<Bytes>,
+    head: RequestHeadType,
     body: B,
     created: time::Instant,
     pool: Option<Acquired<T>>,
-) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
+) -> Result<(ResponseHead, Payload), SendRequestError>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
     B: MessageBody,
 {
     trace!("Sending client request: {:?} {:?}", head, body.size());
-    let head_req = head.method == Method::HEAD;
+    let head_req = head.as_ref().method == Method::HEAD;
     let length = body.size();
     let eof = match length {
         BodySize::None | BodySize::Empty | BodySize::Sized(0) => true,
         _ => false,
     };
 
-    io.ready()
-        .map_err(SendRequestError::from)
-        .and_then(move |mut io| {
-            let mut req = Request::new(());
-            *req.uri_mut() = head.uri;
-            *req.method_mut() = head.method;
-            *req.version_mut() = Version::HTTP_2;
+    let mut req = Request::new(());
+    *req.uri_mut() = head.as_ref().uri.clone();
+    *req.method_mut() = head.as_ref().method.clone();
+    *req.version_mut() = Version::HTTP_2;
 
-            let mut skip_len = true;
-            // let mut has_date = false;
+    let mut skip_len = true;
+    // let mut has_date = false;
 
-            // Content length
-            let _ = match length {
-                BodySize::None => None,
-                BodySize::Stream => {
-                    skip_len = false;
-                    None
-                }
-                BodySize::Empty => req
-                    .headers_mut()
-                    .insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
-                BodySize::Sized(len) => req.headers_mut().insert(
-                    CONTENT_LENGTH,
-                    HeaderValue::try_from(format!("{}", len)).unwrap(),
-                ),
-                BodySize::Sized64(len) => req.headers_mut().insert(
-                    CONTENT_LENGTH,
-                    HeaderValue::try_from(format!("{}", len)).unwrap(),
-                ),
-            };
+    // Content length
+    let _ = match length {
+        BodySize::None => None,
+        BodySize::Stream => {
+            skip_len = false;
+            None
+        }
+        BodySize::Empty => req
+            .headers_mut()
+            .insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
+        BodySize::Sized(len) => req.headers_mut().insert(
+            CONTENT_LENGTH,
+            HeaderValue::try_from(format!("{}", len)).unwrap(),
+        ),
+        BodySize::Sized64(len) => req.headers_mut().insert(
+            CONTENT_LENGTH,
+            HeaderValue::try_from(format!("{}", len)).unwrap(),
+        ),
+    };
 
-            // copy headers
-            for (key, value) in head.headers.iter() {
-                match *key {
-                    CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
-                    CONTENT_LENGTH if skip_len => continue,
-                    // DATE => has_date = true,
-                    _ => (),
-                }
-                req.headers_mut().append(key, value.clone());
+    // Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
+    let (head, extra_headers) = match head {
+        RequestHeadType::Owned(head) => (RequestHeadType::Owned(head), HeaderMap::new()),
+        RequestHeadType::Rc(head, extra_headers) => (
+            RequestHeadType::Rc(head, None),
+            extra_headers.unwrap_or_else(HeaderMap::new),
+        ),
+    };
+
+    // merging headers from head and extra headers.
+    let headers = head
+        .as_ref()
+        .headers
+        .iter()
+        .filter(|(name, _)| !extra_headers.contains_key(*name))
+        .chain(extra_headers.iter());
+
+    // copy headers
+    for (key, value) in headers {
+        match *key {
+            CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
+            CONTENT_LENGTH if skip_len => continue,
+            // DATE => has_date = true,
+            _ => (),
+        }
+        req.headers_mut().append(key, value.clone());
+    }
+
+    let res = poll_fn(|cx| io.poll_ready(cx)).await;
+    if let Err(e) = res {
+        release(io, pool, created, e.is_io());
+        return Err(SendRequestError::from(e));
+    }
+
+    let resp = match io.send_request(req, eof) {
+        Ok((fut, send)) => {
+            release(io, pool, created, false);
+
+            if !eof {
+                send_body(body, send).await?;
             }
+            fut.await.map_err(SendRequestError::from)?
+        }
+        Err(e) => {
+            release(io, pool, created, e.is_io());
+            return Err(e.into());
+        }
+    };
 
-            match io.send_request(req, eof) {
-                Ok((res, send)) => {
-                    release(io, pool, created, false);
+    let (parts, body) = resp.into_parts();
+    let payload = if head_req { Payload::None } else { body.into() };
 
-                    if !eof {
-                        Either::A(Either::B(
-                            SendBody {
-                                body,
-                                send,
-                                buf: None,
-                            }
-                            .and_then(move |_| res.map_err(SendRequestError::from)),
-                        ))
-                    } else {
-                        Either::B(res.map_err(SendRequestError::from))
-                    }
-                }
-                Err(e) => {
-                    release(io, pool, created, e.is_io());
-                    Either::A(Either::A(err(e.into())))
-                }
-            }
-        })
-        .and_then(move |resp| {
-            let (parts, body) = resp.into_parts();
-            let payload = if head_req { Payload::None } else { body.into() };
-
-            let mut head = ResponseHead::new(parts.status);
-            head.version = parts.version;
-            head.headers = parts.headers.into();
-            Ok((head, payload))
-        })
-        .from_err()
+    let mut head = ResponseHead::new(parts.status);
+    head.version = parts.version;
+    head.headers = parts.headers.into();
+    Ok((head, payload))
 }
 
-struct SendBody<B: MessageBody> {
+async fn send_body<B: MessageBody>(
     body: B,
-    send: SendStream<Bytes>,
-    buf: Option<Bytes>,
-}
-
-impl<B: MessageBody> Future for SendBody<B> {
-    type Item = ();
-    type Error = SendRequestError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        loop {
-            if self.buf.is_none() {
-                match self.body.poll_next() {
-                    Ok(Async::Ready(Some(buf))) => {
-                        self.send.reserve_capacity(buf.len());
-                        self.buf = Some(buf);
-                    }
-                    Ok(Async::Ready(None)) => {
-                        if let Err(e) = self.send.send_data(Bytes::new(), true) {
-                            return Err(e.into());
-                        }
-                        self.send.reserve_capacity(0);
-                        return Ok(Async::Ready(()));
-                    }
-                    Ok(Async::NotReady) => return Ok(Async::NotReady),
-                    Err(e) => return Err(e.into()),
+    mut send: SendStream<Bytes>,
+) -> Result<(), SendRequestError> {
+    let mut buf = None;
+    pin_mut!(body);
+    loop {
+        if buf.is_none() {
+            match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
+                Some(Ok(b)) => {
+                    send.reserve_capacity(b.len());
+                    buf = Some(b);
                 }
-            }
-
-            match self.send.poll_capacity() {
-                Ok(Async::NotReady) => return Ok(Async::NotReady),
-                Ok(Async::Ready(None)) => return Ok(Async::Ready(())),
-                Ok(Async::Ready(Some(cap))) => {
-                    let mut buf = self.buf.take().unwrap();
-                    let len = buf.len();
-                    let bytes = buf.split_to(std::cmp::min(cap, len));
-
-                    if let Err(e) = self.send.send_data(bytes, false) {
+                Some(Err(e)) => return Err(e.into()),
+                None => {
+                    if let Err(e) = send.send_data(Bytes::new(), true) {
                         return Err(e.into());
-                    } else {
-                        if !buf.is_empty() {
-                            self.send.reserve_capacity(buf.len());
-                            self.buf = Some(buf);
-                        }
-                        continue;
                     }
+                    send.reserve_capacity(0);
+                    return Ok(());
                 }
-                Err(e) => return Err(e.into()),
             }
         }
+
+        match poll_fn(|cx| send.poll_capacity(cx)).await {
+            None => return Ok(()),
+            Some(Ok(cap)) => {
+                let b = buf.as_mut().unwrap();
+                let len = b.len();
+                let bytes = b.split_to(std::cmp::min(cap, len));
+
+                if let Err(e) = send.send_data(bytes, false) {
+                    return Err(e.into());
+                } else {
+                    if !b.is_empty() {
+                        send.reserve_capacity(b.len());
+                    } else {
+                        buf = None;
+                    }
+                    continue;
+                }
+            }
+            Some(Err(e)) => return Err(e.into()),
+        }
     }
 }
 
 // release SendRequest object
-fn release<T: AsyncRead + AsyncWrite + 'static>(
+fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
     io: SendRequest<Bytes>,
     pool: Option<Acquired<T>>,
     created: time::Instant,
@@ -181,3 +190,18 @@ fn release<T: AsyncRead + AsyncWrite + 'static>(
         }
     }
 }
+
+pub(crate) fn handshake<Io>(
+    io: Io,
+    config: &ConnectorConfig,
+) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
+where
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+{
+    let mut builder = Builder::new();
+    builder
+        .initial_window_size(config.stream_window_size)
+        .initial_connection_window_size(config.conn_window_size)
+        .enable_push(false);
+    builder.handshake(io)
+}

actix-http/src/client/mod.rs

@@ -1,6 +1,7 @@
 //! Http client api
 use http::Uri;
 
+mod config;
 mod connection;
 mod connector;
 mod error;
@@ -10,7 +11,7 @@ mod pool;
 
 pub use self::connection::Connection;
 pub use self::connector::Connector;
-pub use self::error::{ConnectError, InvalidUrl, SendRequestError};
+pub use self::error::{ConnectError, FreezeRequestError, InvalidUrl, SendRequestError};
 pub use self::pool::Protocol;
 
 #[derive(Clone)]

actix-http/src/client/pool.rs

@@ -1,25 +1,28 @@
 use std::cell::RefCell;
 use std::collections::VecDeque;
-use std::io;
+use std::future::Future;
+use std::pin::Pin;
 use std::rc::Rc;
+use std::task::{Context, Poll};
 use std::time::{Duration, Instant};
 
 use actix_codec::{AsyncRead, AsyncWrite};
+use actix_rt::time::{delay_for, Delay};
 use actix_service::Service;
+use actix_utils::{oneshot, task::LocalWaker};
 use bytes::Bytes;
-use futures::future::{err, ok, Either, FutureResult};
-use futures::task::AtomicTask;
-use futures::unsync::oneshot;
-use futures::{Async, Future, Poll};
-use h2::client::{handshake, Handshake};
-use hashbrown::HashMap;
+use futures_util::future::{poll_fn, FutureExt, LocalBoxFuture};
+use fxhash::FxHashMap;
+use h2::client::{Connection, SendRequest};
 use http::uri::Authority;
 use indexmap::IndexSet;
+use pin_project::pin_project;
 use slab::Slab;
-use tokio_timer::{sleep, Delay};
 
+use super::config::ConnectorConfig;
 use super::connection::{ConnectionType, IoConnection};
 use super::error::ConnectError;
+use super::h2proto::handshake;
 use super::Connect;
 
 #[derive(Clone, Copy, PartialEq)]
@@ -41,37 +44,24 @@ impl From<Authority> for Key {
 }
 
 /// Connections pool
-pub(crate) struct ConnectionPool<T, Io: AsyncRead + AsyncWrite + 'static>(
-    T,
-    Rc<RefCell<Inner<Io>>>,
-);
+pub(crate) struct ConnectionPool<T, Io: 'static>(Rc<RefCell<T>>, Rc<RefCell<Inner<Io>>>);
 
 impl<T, Io> ConnectionPool<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
     T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-        + Clone
         + 'static,
 {
-    pub(crate) fn new(
-        connector: T,
-        conn_lifetime: Duration,
-        conn_keep_alive: Duration,
-        disconnect_timeout: Option<Duration>,
-        limit: usize,
-    ) -> Self {
+    pub(crate) fn new(connector: T, config: ConnectorConfig) -> Self {
         ConnectionPool(
-            connector,
+            Rc::new(RefCell::new(connector)),
             Rc::new(RefCell::new(Inner {
-                conn_lifetime,
-                conn_keep_alive,
-                disconnect_timeout,
-                limit,
+                config,
                 acquired: 0,
                 waiters: Slab::new(),
                 waiters_queue: IndexSet::new(),
-                available: HashMap::new(),
-                task: None,
+                available: FxHashMap::default(),
+                waker: LocalWaker::new(),
             })),
         )
     }
@@ -79,8 +69,7 @@ where
 
 impl<T, Io> Clone for ConnectionPool<T, Io>
 where
-    T: Clone,
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: 'static,
 {
     fn clone(&self) -> Self {
         ConnectionPool(self.0.clone(), self.1.clone())
@@ -89,86 +78,118 @@ where
 
 impl<T, Io> Service for ConnectionPool<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
     T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
-        + Clone
         + 'static,
 {
     type Request = Connect;
     type Response = IoConnection<Io>;
     type Error = ConnectError;
-    type Future = Either<
-        FutureResult<Self::Response, Self::Error>,
-        Either<WaitForConnection<Io>, OpenConnection<T::Future, Io>>,
-    >;
+    type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        self.0.poll_ready()
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        self.0.poll_ready(cx)
     }
 
     fn call(&mut self, req: Connect) -> Self::Future {
-        let key = if let Some(authority) = req.uri.authority_part() {
-            authority.clone().into()
-        } else {
-            return Either::A(err(ConnectError::Unresolverd));
+        // start support future
+        actix_rt::spawn(ConnectorPoolSupport {
+            connector: self.0.clone(),
+            inner: self.1.clone(),
+        });
+
+        let mut connector = self.0.clone();
+        let inner = self.1.clone();
+
+        let fut = async move {
+            let key = if let Some(authority) = req.uri.authority() {
+                authority.clone().into()
+            } else {
+                return Err(ConnectError::Unresolverd);
+            };
+
+            // acquire connection
+            match poll_fn(|cx| Poll::Ready(inner.borrow_mut().acquire(&key, cx))).await {
+                Acquire::Acquired(io, created) => {
+                    // use existing connection
+                    return Ok(IoConnection::new(
+                        io,
+                        created,
+                        Some(Acquired(key, Some(inner))),
+                    ));
+                }
+                Acquire::Available => {
+                    // open tcp connection
+                    let (io, proto) = connector.call(req).await?;
+
+                    let config = inner.borrow().config.clone();
+
+                    let guard = OpenGuard::new(key, inner);
+
+                    if proto == Protocol::Http1 {
+                        Ok(IoConnection::new(
+                            ConnectionType::H1(io),
+                            Instant::now(),
+                            Some(guard.consume()),
+                        ))
+                    } else {
+                        let (snd, connection) = handshake(io, &config).await?;
+                        actix_rt::spawn(connection.map(|_| ()));
+                        Ok(IoConnection::new(
+                            ConnectionType::H2(snd),
+                            Instant::now(),
+                            Some(guard.consume()),
+                        ))
+                    }
+                }
+                _ => {
+                    // connection is not available, wait
+                    let (rx, token) = inner.borrow_mut().wait_for(req);
+
+                    let guard = WaiterGuard::new(key, token, inner);
+                    let res = match rx.await {
+                        Err(_) => Err(ConnectError::Disconnected),
+                        Ok(res) => res,
+                    };
+                    guard.consume();
+                    res
+                }
+            }
         };
 
-        // acquire connection
-        match self.1.as_ref().borrow_mut().acquire(&key) {
-            Acquire::Acquired(io, created) => {
-                // use existing connection
-                return Either::A(ok(IoConnection::new(
-                    io,
-                    created,
-                    Some(Acquired(key, Some(self.1.clone()))),
-                )));
-            }
-            Acquire::Available => {
-                // open new connection
-                return Either::B(Either::B(OpenConnection::new(
-                    key,
-                    self.1.clone(),
-                    self.0.call(req),
-                )));
-            }
-            _ => (),
-        }
-
-        // connection is not available, wait
-        let (rx, token, support) = self.1.as_ref().borrow_mut().wait_for(req);
-
-        // start support future
-        if !support {
-            self.1.as_ref().borrow_mut().task = Some(AtomicTask::new());
-            tokio_current_thread::spawn(ConnectorPoolSupport {
-                connector: self.0.clone(),
-                inner: self.1.clone(),
-            })
-        }
-
-        Either::B(Either::A(WaitForConnection {
-            rx,
-            key,
-            token,
-            inner: Some(self.1.clone()),
-        }))
+        fut.boxed_local()
     }
 }
 
-#[doc(hidden)]
-pub struct WaitForConnection<Io>
+struct WaiterGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     key: Key,
     token: usize,
-    rx: oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
     inner: Option<Rc<RefCell<Inner<Io>>>>,
 }
 
-impl<Io> Drop for WaitForConnection<Io>
+impl<Io> WaiterGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
+{
+    fn new(key: Key, token: usize, inner: Rc<RefCell<Inner<Io>>>) -> Self {
+        Self {
+            key,
+            token,
+            inner: Some(inner),
+        }
+    }
+
+    fn consume(mut self) {
+        let _ = self.inner.take();
+    }
+}
+
+impl<Io> Drop for WaiterGuard<Io>
+where
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     fn drop(&mut self) {
         if let Some(i) = self.inner.take() {
@@ -179,113 +200,43 @@ where
     }
 }
 
-impl<Io> Future for WaitForConnection<Io>
+struct OpenGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    type Item = IoConnection<Io>;
-    type Error = ConnectError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        match self.rx.poll() {
-            Ok(Async::Ready(item)) => match item {
-                Err(err) => Err(err),
-                Ok(conn) => {
-                    let _ = self.inner.take();
-                    Ok(Async::Ready(conn))
-                }
-            },
-            Ok(Async::NotReady) => Ok(Async::NotReady),
-            Err(_) => {
-                let _ = self.inner.take();
-                Err(ConnectError::Disconnected)
-            }
-        }
-    }
-}
-
-#[doc(hidden)]
-pub struct OpenConnection<F, Io>
-where
-    Io: AsyncRead + AsyncWrite + 'static,
-{
-    fut: F,
     key: Key,
-    h2: Option<Handshake<Io, Bytes>>,
     inner: Option<Rc<RefCell<Inner<Io>>>>,
 }
 
-impl<F, Io> OpenConnection<F, Io>
+impl<Io> OpenGuard<Io>
 where
-    F: Future<Item = (Io, Protocol), Error = ConnectError>,
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>, fut: F) -> Self {
-        OpenConnection {
+    fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>) -> Self {
+        Self {
             key,
-            fut,
             inner: Some(inner),
-            h2: None,
         }
     }
+
+    fn consume(mut self) -> Acquired<Io> {
+        Acquired(self.key.clone(), self.inner.take())
+    }
 }
 
-impl<F, Io> Drop for OpenConnection<F, Io>
+impl<Io> Drop for OpenGuard<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     fn drop(&mut self) {
-        if let Some(inner) = self.inner.take() {
-            let mut inner = inner.as_ref().borrow_mut();
+        if let Some(i) = self.inner.take() {
+            let mut inner = i.as_ref().borrow_mut();
             inner.release();
             inner.check_availibility();
         }
     }
 }
 
-impl<F, Io> Future for OpenConnection<F, Io>
-where
-    F: Future<Item = (Io, Protocol), Error = ConnectError>,
-    Io: AsyncRead + AsyncWrite,
-{
-    type Item = IoConnection<Io>;
-    type Error = ConnectError;
-
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        if let Some(ref mut h2) = self.h2 {
-            return match h2.poll() {
-                Ok(Async::Ready((snd, connection))) => {
-                    tokio_current_thread::spawn(connection.map_err(|_| ()));
-                    Ok(Async::Ready(IoConnection::new(
-                        ConnectionType::H2(snd),
-                        Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
-                    )))
-                }
-                Ok(Async::NotReady) => Ok(Async::NotReady),
-                Err(e) => Err(e.into()),
-            };
-        }
-
-        match self.fut.poll() {
-            Err(err) => Err(err),
-            Ok(Async::Ready((io, proto))) => {
-                if proto == Protocol::Http1 {
-                    Ok(Async::Ready(IoConnection::new(
-                        ConnectionType::H1(io),
-                        Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
-                    )))
-                } else {
-                    self.h2 = Some(handshake(io));
-                    self.poll()
-                }
-            }
-            Ok(Async::NotReady) => Ok(Async::NotReady),
-        }
-    }
-}
-
 enum Acquire<T> {
     Acquired(ConnectionType<T>, Instant),
     Available,
@@ -299,18 +250,17 @@ struct AvailableConnection<Io> {
 }
 
 pub(crate) struct Inner<Io> {
-    conn_lifetime: Duration,
-    conn_keep_alive: Duration,
-    disconnect_timeout: Option<Duration>,
-    limit: usize,
+    config: ConnectorConfig,
     acquired: usize,
-    available: HashMap<Key, VecDeque<AvailableConnection<Io>>>,
-    waiters: Slab<(
-        Connect,
-        oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
-    )>,
+    available: FxHashMap<Key, VecDeque<AvailableConnection<Io>>>,
+    waiters: Slab<
+        Option<(
+            Connect,
+            oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
+        )>,
+    >,
     waiters_queue: IndexSet<(Key, usize)>,
-    task: Option<AtomicTask>,
+    waker: LocalWaker,
 }
 
 impl<Io> Inner<Io> {
@@ -324,13 +274,13 @@ impl<Io> Inner<Io> {
 
     fn release_waiter(&mut self, key: &Key, token: usize) {
         self.waiters.remove(token);
-        self.waiters_queue.remove(&(key.clone(), token));
+        let _ = self.waiters_queue.shift_remove(&(key.clone(), token));
     }
 }
 
 impl<Io> Inner<Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     /// connection is not available, wait
     fn wait_for(
@@ -339,22 +289,21 @@ where
     ) -> (
         oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
         usize,
-        bool,
     ) {
         let (tx, rx) = oneshot::channel();
 
-        let key: Key = connect.uri.authority_part().unwrap().clone().into();
+        let key: Key = connect.uri.authority().unwrap().clone().into();
         let entry = self.waiters.vacant_entry();
         let token = entry.key();
-        entry.insert((connect, tx));
+        entry.insert(Some((connect, tx)));
         assert!(self.waiters_queue.insert((key, token)));
 
-        (rx, token, self.task.is_some())
+        (rx, token)
     }
 
-    fn acquire(&mut self, key: &Key) -> Acquire<Io> {
+    fn acquire(&mut self, key: &Key, cx: &mut Context<'_>) -> Acquire<Io> {
         // check limits
-        if self.limit > 0 && self.acquired >= self.limit {
+        if self.config.limit > 0 && self.acquired >= self.config.limit {
             return Acquire::NotAvailable;
         }
 
@@ -366,33 +315,31 @@ where
             let now = Instant::now();
             while let Some(conn) = connections.pop_back() {
                 // check if it still usable
-                if (now - conn.used) > self.conn_keep_alive
-                    || (now - conn.created) > self.conn_lifetime
+                if (now - conn.used) > self.config.conn_keep_alive
+                    || (now - conn.created) > self.config.conn_lifetime
                 {
-                    if let Some(timeout) = self.disconnect_timeout {
+                    if let Some(timeout) = self.config.disconnect_timeout {
                         if let ConnectionType::H1(io) = conn.io {
-                            tokio_current_thread::spawn(CloseConnection::new(
-                                io, timeout,
-                            ))
+                            actix_rt::spawn(CloseConnection::new(io, timeout))
                         }
                     }
                 } else {
                     let mut io = conn.io;
                     let mut buf = [0; 2];
                     if let ConnectionType::H1(ref mut s) = io {
-                        match s.read(&mut buf) {
-                            Err(ref e) if e.kind() == io::ErrorKind::WouldBlock => (),
-                            Ok(n) if n > 0 => {
-                                if let Some(timeout) = self.disconnect_timeout {
+                        match Pin::new(s).poll_read(cx, &mut buf) {
+                            Poll::Pending => (),
+                            Poll::Ready(Ok(n)) if n > 0 => {
+                                if let Some(timeout) = self.config.disconnect_timeout {
                                     if let ConnectionType::H1(io) = io {
-                                        tokio_current_thread::spawn(
-                                            CloseConnection::new(io, timeout),
-                                        )
+                                        actix_rt::spawn(CloseConnection::new(
+                                            io, timeout,
+                                        ))
                                     }
                                 }
                                 continue;
                             }
-                            Ok(_) | Err(_) => continue,
+                            _ => continue,
                         }
                     }
                     return Acquire::Acquired(io, conn.created);
@@ -417,17 +364,17 @@ where
 
     fn release_close(&mut self, io: ConnectionType<Io>) {
         self.acquired -= 1;
-        if let Some(timeout) = self.disconnect_timeout {
+        if let Some(timeout) = self.config.disconnect_timeout {
             if let ConnectionType::H1(io) = io {
-                tokio_current_thread::spawn(CloseConnection::new(io, timeout))
+                actix_rt::spawn(CloseConnection::new(io, timeout))
             }
         }
         self.check_availibility();
     }
 
     fn check_availibility(&self) {
-        if !self.waiters_queue.is_empty() && self.acquired < self.limit {
-            self.task.as_ref().map(|t| t.notify());
+        if !self.waiters_queue.is_empty() && self.acquired < self.config.limit {
+            self.waker.wake();
         }
     }
 }
@@ -439,37 +386,39 @@ struct CloseConnection<T> {
 
 impl<T> CloseConnection<T>
 where
-    T: AsyncWrite,
+    T: AsyncWrite + Unpin,
 {
     fn new(io: T, timeout: Duration) -> Self {
         CloseConnection {
             io,
-            timeout: sleep(timeout),
+            timeout: delay_for(timeout),
         }
     }
 }
 
 impl<T> Future for CloseConnection<T>
 where
-    T: AsyncWrite,
+    T: AsyncWrite + Unpin,
 {
-    type Item = ();
-    type Error = ();
+    type Output = ();
 
-    fn poll(&mut self) -> Poll<(), ()> {
-        match self.timeout.poll() {
-            Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
-            Ok(Async::NotReady) => match self.io.shutdown() {
-                Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
-                Ok(Async::NotReady) => Ok(Async::NotReady),
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<()> {
+        let this = self.get_mut();
+
+        match Pin::new(&mut this.timeout).poll(cx) {
+            Poll::Ready(_) => Poll::Ready(()),
+            Poll::Pending => match Pin::new(&mut this.io).poll_shutdown(cx) {
+                Poll::Ready(_) => Poll::Ready(()),
+                Poll::Pending => Poll::Pending,
             },
         }
     }
 }
 
+#[pin_project]
 struct ConnectorPoolSupport<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     connector: T,
     inner: Rc<RefCell<Inner<Io>>>,
@@ -477,16 +426,17 @@ where
 
 impl<T, Io> Future for ConnectorPoolSupport<T, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
     T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>,
     T::Future: 'static,
 {
-    type Item = ();
-    type Error = ();
+    type Output = ();
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        let mut inner = self.inner.as_ref().borrow_mut();
-        inner.task.as_ref().unwrap().register();
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let this = self.project();
+
+        let mut inner = this.inner.as_ref().borrow_mut();
+        inner.waker.register(cx.waker());
 
         // check waiters
         loop {
@@ -497,74 +447,91 @@ where
                     break;
                 }
             };
-            match inner.acquire(&key) {
+            if inner.waiters.get(token).unwrap().is_none() {
+                continue;
+            }
+
+            match inner.acquire(&key, cx) {
                 Acquire::NotAvailable => break,
                 Acquire::Acquired(io, created) => {
-                    let (_, tx) = inner.waiters.remove(token);
+                    let tx = inner.waiters.get_mut(token).unwrap().take().unwrap().1;
                     if let Err(conn) = tx.send(Ok(IoConnection::new(
                         io,
                         created,
-                        Some(Acquired(key.clone(), Some(self.inner.clone()))),
+                        Some(Acquired(key.clone(), Some(this.inner.clone()))),
                     ))) {
                         let (io, created) = conn.unwrap().into_inner();
                         inner.release_conn(&key, io, created);
                     }
                 }
                 Acquire::Available => {
-                    let (connect, tx) = inner.waiters.remove(token);
+                    let (connect, tx) =
+                        inner.waiters.get_mut(token).unwrap().take().unwrap();
                     OpenWaitingConnection::spawn(
                         key.clone(),
                         tx,
-                        self.inner.clone(),
-                        self.connector.call(connect),
+                        this.inner.clone(),
+                        this.connector.call(connect),
+                        inner.config.clone(),
                     );
                 }
             }
             let _ = inner.waiters_queue.swap_remove_index(0);
         }
 
-        Ok(Async::NotReady)
+        Poll::Pending
     }
 }
 
+#[pin_project::pin_project(PinnedDrop)]
 struct OpenWaitingConnection<F, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
+    #[pin]
     fut: F,
     key: Key,
-    h2: Option<Handshake<Io, Bytes>>,
+    h2: Option<
+        LocalBoxFuture<
+            'static,
+            Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>,
+        >,
+    >,
     rx: Option<oneshot::Sender<Result<IoConnection<Io>, ConnectError>>>,
     inner: Option<Rc<RefCell<Inner<Io>>>>,
+    config: ConnectorConfig,
 }
 
 impl<F, Io> OpenWaitingConnection<F, Io>
 where
-    F: Future<Item = (Io, Protocol), Error = ConnectError> + 'static,
-    Io: AsyncRead + AsyncWrite + 'static,
+    F: Future<Output = Result<(Io, Protocol), ConnectError>> + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     fn spawn(
         key: Key,
         rx: oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
         inner: Rc<RefCell<Inner<Io>>>,
         fut: F,
+        config: ConnectorConfig,
     ) {
-        tokio_current_thread::spawn(OpenWaitingConnection {
+        actix_rt::spawn(OpenWaitingConnection {
             key,
             fut,
             h2: None,
             rx: Some(rx),
             inner: Some(inner),
+            config,
         })
     }
 }
 
-impl<F, Io> Drop for OpenWaitingConnection<F, Io>
+#[pin_project::pinned_drop]
+impl<F, Io> PinnedDrop for OpenWaitingConnection<F, Io>
 where
-    Io: AsyncRead + AsyncWrite + 'static,
+    Io: AsyncRead + AsyncWrite + Unpin + 'static,
 {
-    fn drop(&mut self) {
-        if let Some(inner) = self.inner.take() {
+    fn drop(self: Pin<&mut Self>) {
+        if let Some(inner) = self.project().inner.take() {
             let mut inner = inner.as_ref().borrow_mut();
             inner.release();
             inner.check_availibility();
@@ -574,36 +541,60 @@ where
 
 impl<F, Io> Future for OpenWaitingConnection<F, Io>
 where
-    F: Future<Item = (Io, Protocol), Error = ConnectError>,
-    Io: AsyncRead + AsyncWrite,
+    F: Future<Output = Result<(Io, Protocol), ConnectError>>,
+    Io: AsyncRead + AsyncWrite + Unpin,
 {
-    type Item = ();
-    type Error = ();
+    type Output = ();
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        match self.fut.poll() {
-            Err(err) => {
-                let _ = self.inner.take();
-                if let Some(rx) = self.rx.take() {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let this = self.as_mut().project();
+
+        if let Some(ref mut h2) = this.h2 {
+            return match Pin::new(h2).poll(cx) {
+                Poll::Ready(Ok((snd, connection))) => {
+                    actix_rt::spawn(connection.map(|_| ()));
+                    let rx = this.rx.take().unwrap();
+                    let _ = rx.send(Ok(IoConnection::new(
+                        ConnectionType::H2(snd),
+                        Instant::now(),
+                        Some(Acquired(this.key.clone(), this.inner.take())),
+                    )));
+                    Poll::Ready(())
+                }
+                Poll::Pending => Poll::Pending,
+                Poll::Ready(Err(err)) => {
+                    let _ = this.inner.take();
+                    if let Some(rx) = this.rx.take() {
+                        let _ = rx.send(Err(ConnectError::H2(err)));
+                    }
+                    Poll::Ready(())
+                }
+            };
+        }
+
+        match this.fut.poll(cx) {
+            Poll::Ready(Err(err)) => {
+                let _ = this.inner.take();
+                if let Some(rx) = this.rx.take() {
                     let _ = rx.send(Err(err));
                 }
-                Err(())
+                Poll::Ready(())
             }
-            Ok(Async::Ready((io, proto))) => {
+            Poll::Ready(Ok((io, proto))) => {
                 if proto == Protocol::Http1 {
-                    let rx = self.rx.take().unwrap();
+                    let rx = this.rx.take().unwrap();
                     let _ = rx.send(Ok(IoConnection::new(
                         ConnectionType::H1(io),
                         Instant::now(),
-                        Some(Acquired(self.key.clone(), self.inner.take())),
+                        Some(Acquired(this.key.clone(), this.inner.take())),
                     )));
-                    Ok(Async::Ready(()))
+                    Poll::Ready(())
                 } else {
-                    self.h2 = Some(handshake(io));
-                    self.poll()
+                    *this.h2 = Some(handshake(io, this.config).boxed_local());
+                    self.poll(cx)
                 }
             }
-            Ok(Async::NotReady) => Ok(Async::NotReady),
+            Poll::Pending => Poll::Pending,
         }
     }
 }
@@ -612,7 +603,7 @@ pub(crate) struct Acquired<T>(Key, Option<Rc<RefCell<Inner<T>>>>);
 
 impl<T> Acquired<T>
 where
-    T: AsyncRead + AsyncWrite + 'static,
+    T: AsyncRead + AsyncWrite + Unpin + 'static,
 {
     pub(crate) fn close(&mut self, conn: IoConnection<T>) {
         if let Some(inner) = self.1.take() {

actix-http/src/cloneable.rs

@@ -0,0 +1,40 @@
+use std::cell::RefCell;
+use std::rc::Rc;
+use std::task::{Context, Poll};
+
+use actix_service::Service;
+
+#[doc(hidden)]
+/// Service that allows to turn non-clone service to a service with `Clone` impl
+///
+/// # Panics
+/// CloneableService might panic with some creative use of thread local storage.
+/// See https://github.com/actix/actix-web/issues/1295 for example
+pub(crate) struct CloneableService<T: Service>(Rc<RefCell<T>>);
+
+impl<T: Service> CloneableService<T> {
+    pub(crate) fn new(service: T) -> Self {
+        Self(Rc::new(RefCell::new(service)))
+    }
+}
+
+impl<T: Service> Clone for CloneableService<T> {
+    fn clone(&self) -> Self {
+        Self(self.0.clone())
+    }
+}
+
+impl<T: Service> Service for CloneableService<T> {
+    type Request = T::Request;
+    type Response = T::Response;
+    type Error = T::Error;
+    type Future = T::Future;
+
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        self.0.borrow_mut().poll_ready(cx)
+    }
+
+    fn call(&mut self, req: T::Request) -> Self::Future {
+        self.0.borrow_mut().call(req)
+    }
+}

actix-http/src/config.rs

@@ -1,13 +1,13 @@
-use std::cell::UnsafeCell;
-use std::fmt;
+use std::cell::Cell;
 use std::fmt::Write;
 use std::rc::Rc;
-use std::time::{Duration, Instant};
+use std::time::Duration;
+use std::{fmt, net};
 
+use actix_rt::time::{delay_for, delay_until, Delay, Instant};
 use bytes::BytesMut;
-use futures::{future, Future};
-use time;
-use tokio_timer::{sleep, Delay};
+use futures_util::{future, FutureExt};
+use time::OffsetDateTime;
 
 // "Sun, 06 Nov 1994 08:49:37 GMT".len()
 const DATE_VALUE_LENGTH: usize = 29;
@@ -47,6 +47,8 @@ struct Inner {
     client_timeout: u64,
     client_disconnect: u64,
     ka_enabled: bool,
+    secure: bool,
+    local_addr: Option<std::net::SocketAddr>,
     timer: DateService,
 }
 
@@ -58,7 +60,7 @@ impl Clone for ServiceConfig {
 
 impl Default for ServiceConfig {
     fn default() -> Self {
-        Self::new(KeepAlive::Timeout(5), 0, 0)
+        Self::new(KeepAlive::Timeout(5), 0, 0, false, None)
     }
 }
 
@@ -68,6 +70,8 @@ impl ServiceConfig {
         keep_alive: KeepAlive,
         client_timeout: u64,
         client_disconnect: u64,
+        secure: bool,
+        local_addr: Option<net::SocketAddr>,
     ) -> ServiceConfig {
         let (keep_alive, ka_enabled) = match keep_alive {
             KeepAlive::Timeout(val) => (val as u64, true),
@@ -85,10 +89,24 @@ impl ServiceConfig {
             ka_enabled,
             client_timeout,
             client_disconnect,
+            secure,
+            local_addr,
             timer: DateService::new(),
         }))
     }
 
+    #[inline]
+    /// Returns true if connection is secure(https)
+    pub fn secure(&self) -> bool {
+        self.0.secure
+    }
+
+    #[inline]
+    /// Returns the local address that this server is bound to.
+    pub fn local_addr(&self) -> Option<net::SocketAddr> {
+        self.0.local_addr
+    }
+
     #[inline]
     /// Keep alive duration if configured.
     pub fn keep_alive(&self) -> Option<Duration> {
@@ -104,10 +122,10 @@ impl ServiceConfig {
     #[inline]
     /// Client timeout for first request.
     pub fn client_timer(&self) -> Option<Delay> {
-        let delay = self.0.client_timeout;
-        if delay != 0 {
-            Some(Delay::new(
-                self.0.timer.now() + Duration::from_millis(delay),
+        let delay_time = self.0.client_timeout;
+        if delay_time != 0 {
+            Some(delay_until(
+                self.0.timer.now() + Duration::from_millis(delay_time),
             ))
         } else {
             None
@@ -138,7 +156,7 @@ impl ServiceConfig {
     /// Return keep-alive timer delay is configured.
     pub fn keep_alive_timer(&self) -> Option<Delay> {
         if let Some(ka) = self.0.keep_alive {
-            Some(Delay::new(self.0.timer.now() + ka))
+            Some(delay_until(self.0.timer.now() + ka))
         } else {
             None
         }
@@ -162,16 +180,21 @@ impl ServiceConfig {
     pub fn set_date(&self, dst: &mut BytesMut) {
         let mut buf: [u8; 39] = [0; 39];
         buf[..6].copy_from_slice(b"date: ");
-        buf[6..35].copy_from_slice(&self.0.timer.date().bytes);
+        self.0
+            .timer
+            .set_date(|date| buf[6..35].copy_from_slice(&date.bytes));
         buf[35..].copy_from_slice(b"\r\n\r\n");
         dst.extend_from_slice(&buf);
     }
 
     pub(crate) fn set_date_header(&self, dst: &mut BytesMut) {
-        dst.extend_from_slice(&self.0.timer.date().bytes);
+        self.0
+            .timer
+            .set_date(|date| dst.extend_from_slice(&date.bytes));
     }
 }
 
+#[derive(Copy, Clone)]
 struct Date {
     bytes: [u8; DATE_VALUE_LENGTH],
     pos: usize,
@@ -188,7 +211,12 @@ impl Date {
     }
     fn update(&mut self) {
         self.pos = 0;
-        write!(self, "{}", time::at_utc(time::get_time()).rfc822()).unwrap();
+        write!(
+            self,
+            "{}",
+            OffsetDateTime::now().format("%a, %d %b %Y %H:%M:%S GMT")
+        )
+        .unwrap();
     }
 }
 
@@ -205,28 +233,24 @@ impl fmt::Write for Date {
 struct DateService(Rc<DateServiceInner>);
 
 struct DateServiceInner {
-    current: UnsafeCell<Option<(Date, Instant)>>,
+    current: Cell<Option<(Date, Instant)>>,
 }
 
 impl DateServiceInner {
     fn new() -> Self {
         DateServiceInner {
-            current: UnsafeCell::new(None),
+            current: Cell::new(None),
         }
     }
 
-    fn get_ref(&self) -> &Option<(Date, Instant)> {
-        unsafe { &*self.current.get() }
-    }
-
     fn reset(&self) {
-        unsafe { (&mut *self.current.get()).take() };
+        self.current.take();
     }
 
     fn update(&self) {
         let now = Instant::now();
         let date = Date::new();
-        *(unsafe { &mut *self.current.get() }) = Some((date, now));
+        self.current.set(Some((date, now)));
     }
 }
 
@@ -236,56 +260,55 @@ impl DateService {
     }
 
     fn check_date(&self) {
-        if self.0.get_ref().is_none() {
+        if self.0.current.get().is_none() {
             self.0.update();
 
             // periodic date update
             let s = self.clone();
-            tokio_current_thread::spawn(sleep(Duration::from_millis(500)).then(
-                move |_| {
-                    s.0.reset();
-                    future::ok(())
-                },
-            ));
+            actix_rt::spawn(delay_for(Duration::from_millis(500)).then(move |_| {
+                s.0.reset();
+                future::ready(())
+            }));
         }
     }
 
     fn now(&self) -> Instant {
         self.check_date();
-        self.0.get_ref().as_ref().unwrap().1
+        self.0.current.get().unwrap().1
     }
 
-    fn date(&self) -> &Date {
+    fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
         self.check_date();
-
-        let item = self.0.get_ref().as_ref().unwrap();
-        &item.0
+        f(&self.0.current.get().unwrap().0);
     }
 }
 
 #[cfg(test)]
 mod tests {
     use super::*;
-    use actix_rt::System;
-    use futures::future;
+
+    // Test modifying the date from within the closure
+    // passed to `set_date`
+    #[test]
+    fn test_evil_date() {
+        let service = DateService::new();
+        // Make sure that `check_date` doesn't try to spawn a task
+        service.0.update();
+        service.set_date(|_| service.0.reset());
+    }
 
     #[test]
     fn test_date_len() {
         assert_eq!(DATE_VALUE_LENGTH, "Sun, 06 Nov 1994 08:49:37 GMT".len());
     }
 
-    #[test]
-    fn test_date() {
-        let mut rt = System::new("test");
-
-        let _ = rt.block_on(future::lazy(|| {
-            let settings = ServiceConfig::new(KeepAlive::Os, 0, 0);
-            let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
-            settings.set_date(&mut buf1);
-            let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
-            settings.set_date(&mut buf2);
-            assert_eq!(buf1, buf2);
-            future::ok::<_, ()>(())
-        }));
+    #[actix_rt::test]
+    async fn test_date() {
+        let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
+        let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
+        settings.set_date(&mut buf1);
+        let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
+        settings.set_date(&mut buf2);
+        assert_eq!(buf1, buf2);
     }
 }

actix-http/src/cookie/builder.rs

@@ -1,7 +1,6 @@
 use std::borrow::Cow;
 
-use chrono::Duration;
-use time::Tm;
+use time::{Duration, OffsetDateTime};
 
 use super::{Cookie, SameSite};
 
@@ -18,7 +17,6 @@ use super::{Cookie, SameSite};
 /// ```rust
 /// use actix_http::cookie::Cookie;
 ///
-/// # fn main() {
 /// let cookie: Cookie = Cookie::build("name", "value")
 ///     .domain("www.rust-lang.org")
 ///     .path("/")
@@ -26,7 +24,6 @@ use super::{Cookie, SameSite};
 ///     .http_only(true)
 ///     .max_age(84600)
 ///     .finish();
-/// # }
 /// ```
 #[derive(Debug, Clone)]
 pub struct CookieBuilder {
@@ -65,16 +62,14 @@ impl CookieBuilder {
     /// ```rust
     /// use actix_http::cookie::Cookie;
     ///
-    /// # fn main() {
     /// let c = Cookie::build("foo", "bar")
-    ///     .expires(time::now())
+    ///     .expires(time::OffsetDateTime::now())
     ///     .finish();
     ///
     /// assert!(c.expires().is_some());
-    /// # }
     /// ```
     #[inline]
-    pub fn expires(mut self, when: Tm) -> CookieBuilder {
+    pub fn expires(mut self, when: OffsetDateTime) -> CookieBuilder {
         self.cookie.set_expires(when);
         self
     }
@@ -86,13 +81,11 @@ impl CookieBuilder {
     /// ```rust
     /// use actix_http::cookie::Cookie;
     ///
-    /// # fn main() {
     /// let c = Cookie::build("foo", "bar")
     ///     .max_age(1800)
     ///     .finish();
     ///
     /// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
-    /// # }
     /// ```
     #[inline]
     pub fn max_age(self, seconds: i64) -> CookieBuilder {
@@ -106,17 +99,18 @@ impl CookieBuilder {
     /// ```rust
     /// use actix_http::cookie::Cookie;
     ///
-    /// # fn main() {
     /// let c = Cookie::build("foo", "bar")
     ///     .max_age_time(time::Duration::minutes(30))
     ///     .finish();
     ///
     /// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
-    /// # }
     /// ```
     #[inline]
     pub fn max_age_time(mut self, value: Duration) -> CookieBuilder {
-        self.cookie.set_max_age(value);
+        // Truncate any nanoseconds from the Duration, as they aren't represented within `Max-Age`
+        // and would cause two otherwise identical `Cookie` instances to not be equivalent to one another.
+        self.cookie
+            .set_max_age(Duration::seconds(value.whole_seconds()));
         self
     }
 
@@ -220,16 +214,14 @@ impl CookieBuilder {
     ///
     /// ```rust
     /// use actix_http::cookie::Cookie;
-    /// use chrono::Duration;
+    /// use time::Duration;
     ///
-    /// # fn main() {
     /// let c = Cookie::build("foo", "bar")
     ///     .permanent()
     ///     .finish();
     ///
     /// assert_eq!(c.max_age(), Some(Duration::days(365 * 20)));
     /// # assert!(c.expires().is_some());
-    /// # }
     /// ```
     #[inline]
     pub fn permanent(mut self) -> CookieBuilder {

actix-http/src/cookie/draft.rs

@@ -10,18 +10,26 @@ use std::fmt;
 /// attribute is "Strict", then the cookie is never sent in cross-site requests.
 /// If the `SameSite` attribute is "Lax", the cookie is only sent in cross-site
 /// requests with "safe" HTTP methods, i.e, `GET`, `HEAD`, `OPTIONS`, `TRACE`.
-/// If the `SameSite` attribute is not present (made explicit via the
-/// `SameSite::None` variant), then the cookie will be sent as normal.
+/// If the `SameSite` attribute is not present then the cookie will be sent as
+/// normal. In some browsers, this will implicitly handle the cookie as if "Lax"
+/// and in others, "None". It's best to explicitly set the `SameSite` attribute
+/// to avoid inconsistent behavior.
+///
+/// **Note:** Depending on browser, the `Secure` attribute may be required for
+/// `SameSite` "None" cookies to be accepted.
 ///
 /// **Note:** This cookie attribute is an HTTP draft! Its meaning and definition
 /// are subject to change.
+///
+/// More info about these draft changes can be found in the draft spec:
+/// - https://tools.ietf.org/html/draft-west-cookie-incrementalism-00
 #[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
 pub enum SameSite {
     /// The "Strict" `SameSite` attribute.
     Strict,
     /// The "Lax" `SameSite` attribute.
     Lax,
-    /// No `SameSite` attribute.
+    /// The "None" `SameSite` attribute.
     None,
 }
 
@@ -88,11 +96,11 @@ impl SameSite {
 }
 
 impl fmt::Display for SameSite {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match *self {
             SameSite::Strict => write!(f, "Strict"),
             SameSite::Lax => write!(f, "Lax"),
-            SameSite::None => Ok(()),
+            SameSite::None => write!(f, "None"),
         }
     }
 }

actix-http/src/cookie/jar.rs

@@ -1,7 +1,7 @@
 use std::collections::HashSet;
 use std::mem::replace;
 
-use chrono::Duration;
+use time::{Duration, OffsetDateTime};
 
 use super::delta::DeltaCookie;
 use super::Cookie;
@@ -188,9 +188,8 @@ impl CookieJar {
     ///
     /// ```rust
     /// use actix_http::cookie::{CookieJar, Cookie};
-    /// use chrono::Duration;
+    /// use time::Duration;
     ///
-    /// # fn main() {
     /// let mut jar = CookieJar::new();
     ///
     /// // Assume this cookie originally had a path of "/" and domain of "a.b".
@@ -203,8 +202,7 @@ impl CookieJar {
     /// let delta: Vec<_> = jar.delta().collect();
     /// assert_eq!(delta.len(), 1);
     /// assert_eq!(delta[0].name(), "name");
-    /// assert_eq!(delta[0].max_age(), Some(Duration::seconds(0)));
-    /// # }
+    /// assert_eq!(delta[0].max_age(), Some(Duration::zero()));
     /// ```
     ///
     /// Removing a new cookie does not result in a _removal_ cookie:
@@ -222,8 +220,8 @@ impl CookieJar {
     pub fn remove(&mut self, mut cookie: Cookie<'static>) {
         if self.original_cookies.contains(cookie.name()) {
             cookie.set_value("");
-            cookie.set_max_age(Duration::seconds(0));
-            cookie.set_expires(time::now() - Duration::days(365));
+            cookie.set_max_age(Duration::zero());
+            cookie.set_expires(OffsetDateTime::now() - Duration::days(365));
             self.delta_cookies.replace(DeltaCookie::removed(cookie));
         } else {
             self.delta_cookies.remove(cookie.name());
@@ -241,9 +239,8 @@ impl CookieJar {
     ///
     /// ```rust
     /// use actix_http::cookie::{CookieJar, Cookie};
-    /// use chrono::Duration;
+    /// use time::Duration;
     ///
-    /// # fn main() {
     /// let mut jar = CookieJar::new();
     ///
     /// // Add an original cookie and a new cookie.
@@ -261,7 +258,6 @@ impl CookieJar {
     /// jar.force_remove(Cookie::new("key", "value"));
     /// assert_eq!(jar.delta().count(), 0);
     /// assert_eq!(jar.iter().count(), 0);
-    /// # }
     /// ```
     pub fn force_remove<'a>(&mut self, cookie: Cookie<'a>) {
         self.original_cookies.remove(cookie.name());
@@ -307,7 +303,7 @@ impl CookieJar {
     /// // Delta contains two new cookies ("new", "yac") and a removal ("name").
     /// assert_eq!(jar.delta().count(), 3);
     /// ```
-    pub fn delta(&self) -> Delta {
+    pub fn delta(&self) -> Delta<'_> {
         Delta {
             iter: self.delta_cookies.iter(),
         }
@@ -343,7 +339,7 @@ impl CookieJar {
     ///     }
     /// }
     /// ```
-    pub fn iter(&self) -> Iter {
+    pub fn iter(&self) -> Iter<'_> {
         Iter {
             delta_cookies: self
                 .delta_cookies
@@ -386,7 +382,7 @@ impl CookieJar {
     /// assert!(jar.get("private").is_some());
     /// ```
     #[cfg(feature = "secure-cookies")]
-    pub fn private(&mut self, key: &Key) -> PrivateJar {
+    pub fn private(&mut self, key: &Key) -> PrivateJar<'_> {
         PrivateJar::new(self, key)
     }
 
@@ -424,7 +420,7 @@ impl CookieJar {
     /// assert!(jar.get("signed").is_some());
     /// ```
     #[cfg(feature = "secure-cookies")]
-    pub fn signed(&mut self, key: &Key) -> SignedJar {
+    pub fn signed(&mut self, key: &Key) -> SignedJar<'_> {
         SignedJar::new(self, key)
     }
 }
@@ -537,8 +533,8 @@ mod test {
     #[test]
     #[cfg(feature = "secure-cookies")]
     fn delta() {
-        use chrono::Duration;
         use std::collections::HashMap;
+        use time::Duration;
 
         let mut c = CookieJar::new();
 
@@ -560,7 +556,7 @@ mod test {
         assert!(names.get("test2").unwrap().is_none());
         assert!(names.get("test3").unwrap().is_none());
         assert!(names.get("test4").unwrap().is_none());
-        assert_eq!(names.get("original").unwrap(), &Some(Duration::seconds(0)));
+        assert_eq!(names.get("original").unwrap(), &Some(Duration::zero()));
     }
 
     #[test]

actix-http/src/cookie/mod.rs

@@ -47,7 +47,7 @@
 //! ```
 
 #![doc(html_root_url = "https://docs.rs/cookie/0.11")]
-#![deny(missing_docs)]
+#![warn(missing_docs)]
 
 mod builder;
 mod delta;
@@ -65,9 +65,8 @@ use std::borrow::Cow;
 use std::fmt;
 use std::str::FromStr;
 
-use chrono::Duration;
-use percent_encoding::{percent_encode, USERINFO_ENCODE_SET};
-use time::Tm;
+use percent_encoding::{percent_encode, AsciiSet, CONTROLS};
+use time::{Duration, OffsetDateTime};
 
 pub use self::builder::CookieBuilder;
 pub use self::draft::*;
@@ -75,6 +74,25 @@ pub use self::jar::{CookieJar, Delta, Iter};
 use self::parse::parse_cookie;
 pub use self::parse::ParseError;
 
+/// https://url.spec.whatwg.org/#fragment-percent-encode-set
+const FRAGMENT: &AsciiSet = &CONTROLS.add(b' ').add(b'"').add(b'<').add(b'>').add(b'`');
+
+/// https://url.spec.whatwg.org/#path-percent-encode-set
+const PATH: &AsciiSet = &FRAGMENT.add(b'#').add(b'?').add(b'{').add(b'}');
+
+/// https://url.spec.whatwg.org/#userinfo-percent-encode-set
+pub const USERINFO: &AsciiSet = &PATH
+    .add(b'/')
+    .add(b':')
+    .add(b';')
+    .add(b'=')
+    .add(b'@')
+    .add(b'[')
+    .add(b'\\')
+    .add(b']')
+    .add(b'^')
+    .add(b'|');
+
 #[derive(Debug, Clone)]
 enum CookieStr {
     /// An string derived from indexes (start, end).
@@ -91,7 +109,7 @@ impl CookieStr {
     /// # Panics
     ///
     /// Panics if `self` is an indexed string and `string` is None.
-    fn to_str<'s>(&'s self, string: Option<&'s Cow<str>>) -> &'s str {
+    fn to_str<'s>(&'s self, string: Option<&'s Cow<'_, str>>) -> &'s str {
         match *self {
             CookieStr::Indexed(i, j) => {
                 let s = string.expect(
@@ -104,6 +122,7 @@ impl CookieStr {
         }
     }
 
+    #[allow(clippy::ptr_arg)]
     fn to_raw_str<'s, 'c: 's>(&'s self, string: &'s Cow<'c, str>) -> Option<&'c str> {
         match *self {
             CookieStr::Indexed(i, j) => match *string {
@@ -152,7 +171,7 @@ pub struct Cookie<'c> {
     /// The cookie's value.
     value: CookieStr,
     /// The cookie's expiration, if any.
-    expires: Option<Tm>,
+    expires: Option<OffsetDateTime>,
     /// The cookie's maximum age, if any.
     max_age: Option<Duration>,
     /// The cookie's domain, if any.
@@ -459,7 +478,7 @@ impl<'c> Cookie<'c> {
     /// assert_eq!(c.max_age(), None);
     ///
     /// let c = Cookie::parse("name=value; Max-Age=3600").unwrap();
-    /// assert_eq!(c.max_age().map(|age| age.num_hours()), Some(1));
+    /// assert_eq!(c.max_age().map(|age| age.whole_hours()), Some(1));
     /// ```
     #[inline]
     pub fn max_age(&self) -> Option<Duration> {
@@ -524,10 +543,10 @@ impl<'c> Cookie<'c> {
     /// let expire_time = "Wed, 21 Oct 2017 07:28:00 GMT";
     /// let cookie_str = format!("name=value; Expires={}", expire_time);
     /// let c = Cookie::parse(cookie_str).unwrap();
-    /// assert_eq!(c.expires().map(|t| t.tm_year), Some(117));
+    /// assert_eq!(c.expires().map(|t| t.year()), Some(2017));
     /// ```
     #[inline]
-    pub fn expires(&self) -> Option<Tm> {
+    pub fn expires(&self) -> Option<OffsetDateTime> {
         self.expires
     }
 
@@ -625,15 +644,13 @@ impl<'c> Cookie<'c> {
     ///
     /// ```rust
     /// use actix_http::cookie::Cookie;
-    /// use chrono::Duration;
+    /// use time::Duration;
     ///
-    /// # fn main() {
     /// let mut c = Cookie::new("name", "value");
     /// assert_eq!(c.max_age(), None);
     ///
     /// c.set_max_age(Duration::hours(10));
     /// assert_eq!(c.max_age(), Some(Duration::hours(10)));
-    /// # }
     /// ```
     #[inline]
     pub fn set_max_age(&mut self, value: Duration) {
@@ -680,20 +697,19 @@ impl<'c> Cookie<'c> {
     ///
     /// ```rust
     /// use actix_http::cookie::Cookie;
+    /// use time::{Duration, OffsetDateTime};
     ///
-    /// # fn main() {
     /// let mut c = Cookie::new("name", "value");
     /// assert_eq!(c.expires(), None);
     ///
-    /// let mut now = time::now();
-    /// now.tm_year += 1;
+    /// let mut now = OffsetDateTime::now();
+    /// now += Duration::week();
     ///
     /// c.set_expires(now);
     /// assert!(c.expires().is_some())
-    /// # }
     /// ```
     #[inline]
-    pub fn set_expires(&mut self, time: Tm) {
+    pub fn set_expires(&mut self, time: OffsetDateTime) {
         self.expires = Some(time);
     }
 
@@ -704,9 +720,8 @@ impl<'c> Cookie<'c> {
     ///
     /// ```rust
     /// use actix_http::cookie::Cookie;
-    /// use chrono::Duration;
+    /// use time::Duration;
     ///
-    /// # fn main() {
     /// let mut c = Cookie::new("foo", "bar");
     /// assert!(c.expires().is_none());
     /// assert!(c.max_age().is_none());
@@ -714,15 +729,14 @@ impl<'c> Cookie<'c> {
     /// c.make_permanent();
     /// assert!(c.expires().is_some());
     /// assert_eq!(c.max_age(), Some(Duration::days(365 * 20)));
-    /// # }
     /// ```
     pub fn make_permanent(&mut self) {
         let twenty_years = Duration::days(365 * 20);
         self.set_max_age(twenty_years);
-        self.set_expires(time::now() + twenty_years);
+        self.set_expires(OffsetDateTime::now() + twenty_years);
     }
 
-    fn fmt_parameters(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt_parameters(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         if let Some(true) = self.http_only() {
             write!(f, "; HttpOnly")?;
         }
@@ -732,9 +746,7 @@ impl<'c> Cookie<'c> {
         }
 
         if let Some(same_site) = self.same_site() {
-            if !same_site.is_none() {
-                write!(f, "; SameSite={}", same_site)?;
-            }
+            write!(f, "; SameSite={}", same_site)?;
         }
 
         if let Some(path) = self.path() {
@@ -746,11 +758,11 @@ impl<'c> Cookie<'c> {
         }
 
         if let Some(max_age) = self.max_age() {
-            write!(f, "; Max-Age={}", max_age.num_seconds())?;
+            write!(f, "; Max-Age={}", max_age.whole_seconds())?;
         }
 
         if let Some(time) = self.expires() {
-            write!(f, "; Expires={}", time.rfc822())?;
+            write!(f, "; Expires={}", time.format("%a, %d %b %Y %H:%M:%S GMT"))?;
         }
 
         Ok(())
@@ -904,13 +916,13 @@ impl<'c> Cookie<'c> {
 /// let mut c = Cookie::new("my name", "this; value?");
 /// assert_eq!(&c.encoded().to_string(), "my%20name=this%3B%20value%3F");
 /// ```
-pub struct EncodedCookie<'a, 'c: 'a>(&'a Cookie<'c>);
+pub struct EncodedCookie<'a, 'c>(&'a Cookie<'c>);
 
 impl<'a, 'c: 'a> fmt::Display for EncodedCookie<'a, 'c> {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         // Percent-encode the name and value.
-        let name = percent_encode(self.0.name().as_bytes(), USERINFO_ENCODE_SET);
-        let value = percent_encode(self.0.value().as_bytes(), USERINFO_ENCODE_SET);
+        let name = percent_encode(self.0.name().as_bytes(), USERINFO);
+        let value = percent_encode(self.0.value().as_bytes(), USERINFO);
 
         // Write out the name/value pair and the cookie's parameters.
         write!(f, "{}={}", name, value)?;
@@ -932,7 +944,7 @@ impl<'c> fmt::Display for Cookie<'c> {
     ///
     /// assert_eq!(&cookie.to_string(), "foo=bar; Path=/");
     /// ```
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         write!(f, "{}={}", self.name(), self.value())?;
         self.fmt_parameters(f)
     }
@@ -978,7 +990,7 @@ impl<'a, 'b> PartialEq<Cookie<'b>> for Cookie<'a> {
 #[cfg(test)]
 mod tests {
     use super::{Cookie, SameSite};
-    use time::strptime;
+    use time::PrimitiveDateTime;
 
     #[test]
     fn format() {
@@ -1003,7 +1015,9 @@ mod tests {
         assert_eq!(&cookie.to_string(), "foo=bar; Domain=www.rust-lang.org");
 
         let time_str = "Wed, 21 Oct 2015 07:28:00 GMT";
-        let expires = strptime(time_str, "%a, %d %b %Y %H:%M:%S %Z").unwrap();
+        let expires = PrimitiveDateTime::parse(time_str, "%a, %d %b %Y %H:%M:%S")
+            .unwrap()
+            .assume_utc();
         let cookie = Cookie::build("foo", "bar").expires(expires).finish();
         assert_eq!(
             &cookie.to_string(),
@@ -1023,7 +1037,7 @@ mod tests {
         let cookie = Cookie::build("foo", "bar")
             .same_site(SameSite::None)
             .finish();
-        assert_eq!(&cookie.to_string(), "foo=bar");
+        assert_eq!(&cookie.to_string(), "foo=bar; SameSite=None");
     }
 
     #[test]

actix-http/src/cookie/parse.rs

@@ -5,11 +5,13 @@ use std::error::Error;
 use std::fmt;
 use std::str::Utf8Error;
 
-use chrono::Duration;
 use percent_encoding::percent_decode;
+use time::Duration;
 
 use super::{Cookie, CookieStr, SameSite};
 
+use crate::time_parser;
+
 /// Enum corresponding to a parsing error.
 #[derive(Debug, PartialEq, Eq, Clone, Copy)]
 pub enum ParseError {
@@ -40,7 +42,7 @@ impl ParseError {
 }
 
 impl fmt::Display for ParseError {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         write!(f, "{}", self.as_str())
     }
 }
@@ -51,11 +53,7 @@ impl From<Utf8Error> for ParseError {
     }
 }
 
-impl Error for ParseError {
-    fn description(&self) -> &str {
-        self.as_str()
-    }
-}
+impl Error for ParseError {}
 
 fn indexes_of(needle: &str, haystack: &str) -> Option<(usize, usize)> {
     let haystack_start = haystack.as_ptr() as usize;
@@ -151,7 +149,7 @@ fn parse_inner<'c>(s: &str, decode: bool) -> Result<Cookie<'c>, ParseError> {
                     Ok(val) => {
                         // Don't panic if the max age seconds is greater than what's supported by
                         // `Duration`.
-                        let val = cmp::min(val, Duration::max_value().num_seconds());
+                        let val = cmp::min(val, Duration::max_value().whole_seconds());
                         Some(Duration::seconds(val))
                     }
                     Err(_) => continue,
@@ -183,16 +181,14 @@ fn parse_inner<'c>(s: &str, decode: bool) -> Result<Cookie<'c>, ParseError> {
                 }
             }
             ("expires", Some(v)) => {
-                // Try strptime with three date formats according to
+                // Try parsing with three date formats according to
                 // http://tools.ietf.org/html/rfc2616#section-3.3.1. Try
                 // additional ones as encountered in the real world.
-                let tm = time::strptime(v, "%a, %d %b %Y %H:%M:%S %Z")
-                    .or_else(|_| time::strptime(v, "%A, %d-%b-%y %H:%M:%S %Z"))
-                    .or_else(|_| time::strptime(v, "%a, %d-%b-%Y %H:%M:%S %Z"))
-                    .or_else(|_| time::strptime(v, "%a %b %d %H:%M:%S %Y"));
+                let tm = time_parser::parse_http_date(v)
+                    .or_else(|| time::parse(v, "%a, %d-%b-%Y %H:%M:%S").ok());
 
-                if let Ok(time) = tm {
-                    cookie.expires = Some(time)
+                if let Some(time) = tm {
+                    cookie.expires = Some(time.assume_utc())
                 }
             }
             _ => {
@@ -220,8 +216,7 @@ where
 #[cfg(test)]
 mod tests {
     use super::{Cookie, SameSite};
-    use chrono::Duration;
-    use time::strptime;
+    use time::{Duration, PrimitiveDateTime};
 
     macro_rules! assert_eq_parse {
         ($string:expr, $expected:expr) => {
@@ -381,7 +376,9 @@ mod tests {
         );
 
         let time_str = "Wed, 21 Oct 2015 07:28:00 GMT";
-        let expires = strptime(time_str, "%a, %d %b %Y %H:%M:%S %Z").unwrap();
+        let expires = PrimitiveDateTime::parse(time_str, "%a, %d %b %Y %H:%M:%S")
+            .unwrap()
+            .assume_utc();
         expected.set_expires(expires);
         assert_eq_parse!(
             " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
@@ -390,7 +387,9 @@ mod tests {
         );
 
         unexpected.set_domain("foo.com");
-        let bad_expires = strptime(time_str, "%a, %d %b %Y %H:%S:%M %Z").unwrap();
+        let bad_expires = PrimitiveDateTime::parse(time_str, "%a, %d %b %Y %H:%S:%M")
+            .unwrap()
+            .assume_utc();
         expected.set_expires(bad_expires);
         assert_ne_parse!(
             " foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
@@ -418,8 +417,16 @@ mod tests {
 
     #[test]
     fn do_not_panic_on_large_max_ages() {
-        let max_seconds = Duration::max_value().num_seconds();
-        let expected = Cookie::build("foo", "bar").max_age(max_seconds).finish();
-        assert_eq_parse!(format!(" foo=bar; Max-Age={:?}", max_seconds + 1), expected);
+        let max_duration = Duration::max_value();
+        let expected = Cookie::build("foo", "bar")
+            .max_age_time(max_duration)
+            .finish();
+        let overflow_duration = max_duration
+            .checked_add(Duration::nanoseconds(1))
+            .unwrap_or(max_duration);
+        assert_eq_parse!(
+            format!(" foo=bar; Max-Age={:?}", overflow_duration.whole_seconds()),
+            expected
+        );
     }
 }

actix-http/src/cookie/secure/key.rs

@@ -1,13 +1,11 @@
-use ring::digest::{Algorithm, SHA256};
-use ring::hkdf::expand;
-use ring::hmac::SigningKey;
+use ring::hkdf::{Algorithm, KeyType, Prk, HKDF_SHA256};
 use ring::rand::{SecureRandom, SystemRandom};
 
 use super::private::KEY_LEN as PRIVATE_KEY_LEN;
 use super::signed::KEY_LEN as SIGNED_KEY_LEN;
 
-static HKDF_DIGEST: &'static Algorithm = &SHA256;
-const KEYS_INFO: &'static str = "COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM";
+static HKDF_DIGEST: Algorithm = HKDF_SHA256;
+const KEYS_INFO: &[&[u8]] = &[b"COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM"];
 
 /// A cryptographic master key for use with `Signed` and/or `Private` jars.
 ///
@@ -25,6 +23,13 @@ pub struct Key {
     encryption_key: [u8; PRIVATE_KEY_LEN],
 }
 
+impl KeyType for &Key {
+    #[inline]
+    fn len(&self) -> usize {
+        SIGNED_KEY_LEN + PRIVATE_KEY_LEN
+    }
+}
+
 impl Key {
     /// Derives new signing/encryption keys from a master key.
     ///
@@ -56,21 +61,26 @@ impl Key {
             );
         }
 
-        // Expand the user's key into two.
-        let prk = SigningKey::new(HKDF_DIGEST, key);
+        // An empty `Key` structure; will be filled in with HKDF derived keys.
+        let mut output_key = Key {
+            signing_key: [0; SIGNED_KEY_LEN],
+            encryption_key: [0; PRIVATE_KEY_LEN],
+        };
+
+        // Expand the master key into two HKDF generated keys.
         let mut both_keys = [0; SIGNED_KEY_LEN + PRIVATE_KEY_LEN];
-        expand(&prk, KEYS_INFO.as_bytes(), &mut both_keys);
+        let prk = Prk::new_less_safe(HKDF_DIGEST, key);
+        let okm = prk.expand(KEYS_INFO, &output_key).expect("okm expand");
+        okm.fill(&mut both_keys).expect("fill keys");
 
-        // Copy the keys into their respective arrays.
-        let mut signing_key = [0; SIGNED_KEY_LEN];
-        let mut encryption_key = [0; PRIVATE_KEY_LEN];
-        signing_key.copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
-        encryption_key.copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
-
-        Key {
-            signing_key,
-            encryption_key,
-        }
+        // Copy the key parts into their respective fields.
+        output_key
+            .signing_key
+            .copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
+        output_key
+            .encryption_key
+            .copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
+        output_key
     }
 
     /// Generates signing/encryption keys from a secure, random source. Keys are

actix-http/src/cookie/secure/private.rs

@@ -1,8 +1,8 @@
 use std::str;
 
 use log::warn;
-use ring::aead::{open_in_place, seal_in_place, Aad, Algorithm, Nonce, AES_256_GCM};
-use ring::aead::{OpeningKey, SealingKey};
+use ring::aead::{Aad, Algorithm, Nonce, AES_256_GCM};
+use ring::aead::{LessSafeKey, UnboundKey};
 use ring::rand::{SecureRandom, SystemRandom};
 
 use super::Key;
@@ -10,7 +10,7 @@ use crate::cookie::{Cookie, CookieJar};
 
 // Keep these in sync, and keep the key len synced with the `private` docs as
 // well as the `KEYS_INFO` const in secure::Key.
-static ALGO: &'static Algorithm = &AES_256_GCM;
+static ALGO: &Algorithm = &AES_256_GCM;
 const NONCE_LEN: usize = 12;
 pub const KEY_LEN: usize = 32;
 
@@ -53,11 +53,14 @@ impl<'a> PrivateJar<'a> {
         }
 
         let ad = Aad::from(name.as_bytes());
-        let key = OpeningKey::new(ALGO, &self.key).expect("opening key");
-        let (nonce, sealed) = data.split_at_mut(NONCE_LEN);
+        let key = LessSafeKey::new(
+            UnboundKey::new(&ALGO, &self.key).expect("matching key length"),
+        );
+        let (nonce, mut sealed) = data.split_at_mut(NONCE_LEN);
         let nonce =
             Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
-        let unsealed = open_in_place(&key, nonce, ad, 0, sealed)
+        let unsealed = key
+            .open_in_place(nonce, ad, &mut sealed)
             .map_err(|_| "invalid key/nonce/value: bad seal")?;
 
         if let Ok(unsealed_utf8) = str::from_utf8(unsealed) {
@@ -156,7 +159,7 @@ Please change it as soon as possible."
 
     /// Encrypts the cookie's value with
     /// authenticated encryption assuring confidentiality, integrity, and authenticity.
-    fn encrypt_cookie(&self, cookie: &mut Cookie) {
+    fn encrypt_cookie(&self, cookie: &mut Cookie<'_>) {
         let name = cookie.name().as_bytes();
         let value = cookie.value().as_bytes();
         let data = encrypt_name_value(name, value, &self.key);
@@ -196,30 +199,33 @@ Please change it as soon as possible."
 
 fn encrypt_name_value(name: &[u8], value: &[u8], key: &[u8]) -> Vec<u8> {
     // Create the `SealingKey` structure.
-    let key = SealingKey::new(ALGO, key).expect("sealing key creation");
+    let unbound = UnboundKey::new(&ALGO, key).expect("matching key length");
+    let key = LessSafeKey::new(unbound);
 
     // Create a vec to hold the [nonce | cookie value | overhead].
-    let overhead = ALGO.tag_len();
-    let mut data = vec![0; NONCE_LEN + value.len() + overhead];
+    let mut data = vec![0; NONCE_LEN + value.len() + ALGO.tag_len()];
 
     // Randomly generate the nonce, then copy the cookie value as input.
     let (nonce, in_out) = data.split_at_mut(NONCE_LEN);
+    let (in_out, tag) = in_out.split_at_mut(value.len());
+    in_out.copy_from_slice(value);
+
+    // Randomly generate the nonce into the nonce piece.
     SystemRandom::new()
         .fill(nonce)
         .expect("couldn't random fill nonce");
-    in_out[..value.len()].copy_from_slice(value);
-    let nonce =
-        Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
+    let nonce = Nonce::try_assume_unique_for_key(nonce).expect("invalid `nonce` length");
 
     // Use cookie's name as associated data to prevent value swapping.
     let ad = Aad::from(name);
+    let ad_tag = key
+        .seal_in_place_separate_tag(nonce, ad, in_out)
+        .expect("in-place seal");
 
-    // Perform the actual sealing operation and get the output length.
-    let output_len =
-        seal_in_place(&key, nonce, ad, in_out, overhead).expect("in-place seal");
+    // Copy the tag into the tag piece.
+    tag.copy_from_slice(ad_tag.as_ref());
 
     // Remove the overhead and return the sealed content.
-    data.truncate(NONCE_LEN + output_len);
     data
 }
 

actix-http/src/cookie/secure/signed.rs

@@ -1,12 +1,11 @@
-use ring::digest::{Algorithm, SHA256};
-use ring::hmac::{sign, verify_with_own_key as verify, SigningKey};
+use ring::hmac::{self, sign, verify};
 
 use super::Key;
 use crate::cookie::{Cookie, CookieJar};
 
 // Keep these in sync, and keep the key len synced with the `signed` docs as
 // well as the `KEYS_INFO` const in secure::Key.
-static HMAC_DIGEST: &'static Algorithm = &SHA256;
+static HMAC_DIGEST: hmac::Algorithm = hmac::HMAC_SHA256;
 const BASE64_DIGEST_LEN: usize = 44;
 pub const KEY_LEN: usize = 32;
 
@@ -21,7 +20,7 @@ pub const KEY_LEN: usize = 32;
 /// This type is only available when the `secure` feature is enabled.
 pub struct SignedJar<'a> {
     parent: &'a mut CookieJar,
-    key: SigningKey,
+    key: hmac::Key,
 }
 
 impl<'a> SignedJar<'a> {
@@ -32,7 +31,7 @@ impl<'a> SignedJar<'a> {
     pub fn new(parent: &'a mut CookieJar, key: &Key) -> SignedJar<'a> {
         SignedJar {
             parent,
-            key: SigningKey::new(HMAC_DIGEST, key.signing()),
+            key: hmac::Key::new(HMAC_DIGEST, key.signing()),
         }
     }
 
@@ -130,7 +129,7 @@ impl<'a> SignedJar<'a> {
     }
 
     /// Signs the cookie's value assuring integrity and authenticity.
-    fn sign_cookie(&self, cookie: &mut Cookie) {
+    fn sign_cookie(&self, cookie: &mut Cookie<'_>) {
         let digest = sign(&self.key, cookie.value().as_bytes());
         let mut new_value = base64::encode(digest.as_ref());
         new_value.push_str(cookie.value());

actix-http/src/encoding/decoder.rs

@@ -1,12 +1,13 @@
+use std::future::Future;
 use std::io::{self, Write};
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use actix_threadpool::{run, CpuFuture};
-#[cfg(feature = "brotli")]
 use brotli2::write::BrotliDecoder;
 use bytes::Bytes;
-#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
 use flate2::write::{GzDecoder, ZlibDecoder};
-use futures::{try_ready, Async, Future, Poll, Stream};
+use futures_core::{ready, Stream};
 
 use super::Writer;
 use crate::error::PayloadError;
@@ -23,21 +24,18 @@ pub struct Decoder<S> {
 
 impl<S> Decoder<S>
 where
-    S: Stream<Item = Bytes, Error = PayloadError>,
+    S: Stream<Item = Result<Bytes, PayloadError>>,
 {
     /// Construct a decoder.
     #[inline]
     pub fn new(stream: S, encoding: ContentEncoding) -> Decoder<S> {
         let decoder = match encoding {
-            #[cfg(feature = "brotli")]
             ContentEncoding::Br => Some(ContentDecoder::Br(Box::new(
                 BrotliDecoder::new(Writer::new()),
             ))),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Deflate => Some(ContentDecoder::Deflate(Box::new(
                 ZlibDecoder::new(Writer::new()),
             ))),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Gzip => Some(ContentDecoder::Gzip(Box::new(
                 GzDecoder::new(Writer::new()),
             ))),
@@ -71,34 +69,40 @@ where
 
 impl<S> Stream for Decoder<S>
 where
-    S: Stream<Item = Bytes, Error = PayloadError>,
+    S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
 {
-    type Item = Bytes;
-    type Error = PayloadError;
+    type Item = Result<Bytes, PayloadError>;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
+    fn poll_next(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
         loop {
             if let Some(ref mut fut) = self.fut {
-                let (chunk, decoder) = try_ready!(fut.poll());
+                let (chunk, decoder) = match ready!(Pin::new(fut).poll(cx)) {
+                    Ok(item) => item,
+                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
+                };
                 self.decoder = Some(decoder);
                 self.fut.take();
                 if let Some(chunk) = chunk {
-                    return Ok(Async::Ready(Some(chunk)));
+                    return Poll::Ready(Some(Ok(chunk)));
                 }
             }
 
             if self.eof {
-                return Ok(Async::Ready(None));
+                return Poll::Ready(None);
             }
 
-            match self.stream.poll()? {
-                Async::Ready(Some(chunk)) => {
+            match Pin::new(&mut self.stream).poll_next(cx) {
+                Poll::Ready(Some(Err(err))) => return Poll::Ready(Some(Err(err))),
+                Poll::Ready(Some(Ok(chunk))) => {
                     if let Some(mut decoder) = self.decoder.take() {
                         if chunk.len() < INPLACE {
                             let chunk = decoder.feed_data(chunk)?;
                             self.decoder = Some(decoder);
                             if let Some(chunk) = chunk {
-                                return Ok(Async::Ready(Some(chunk)));
+                                return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
                             self.fut = Some(run(move || {
@@ -108,41 +112,40 @@ where
                         }
                         continue;
                     } else {
-                        return Ok(Async::Ready(Some(chunk)));
+                        return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Async::Ready(None) => {
+                Poll::Ready(None) => {
                     self.eof = true;
                     return if let Some(mut decoder) = self.decoder.take() {
-                        Ok(Async::Ready(decoder.feed_eof()?))
+                        match decoder.feed_eof() {
+                            Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
+                            Ok(None) => Poll::Ready(None),
+                            Err(err) => Poll::Ready(Some(Err(err.into()))),
+                        }
                     } else {
-                        Ok(Async::Ready(None))
+                        Poll::Ready(None)
                     };
                 }
-                Async::NotReady => break,
+                Poll::Pending => break,
             }
         }
-        Ok(Async::NotReady)
+        Poll::Pending
     }
 }
 
 enum ContentDecoder {
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Deflate(Box<ZlibDecoder<Writer>>),
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Gzip(Box<GzDecoder<Writer>>),
-    #[cfg(feature = "brotli")]
     Br(Box<BrotliDecoder<Writer>>),
 }
 
 impl ContentDecoder {
-    #[allow(unreachable_patterns)]
     fn feed_eof(&mut self) -> io::Result<Option<Bytes>> {
         match self {
-            #[cfg(feature = "brotli")]
-            ContentDecoder::Br(ref mut decoder) => match decoder.finish() {
-                Ok(mut writer) => {
-                    let b = writer.take();
+            ContentDecoder::Br(ref mut decoder) => match decoder.flush() {
+                Ok(()) => {
+                    let b = decoder.get_mut().take();
                     if !b.is_empty() {
                         Ok(Some(b))
                     } else {
@@ -151,7 +154,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.try_finish() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
@@ -163,7 +165,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
                 Ok(_) => {
                     let b = decoder.get_mut().take();
@@ -175,14 +176,11 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            _ => Ok(None),
         }
     }
 
-    #[allow(unreachable_patterns)]
     fn feed_data(&mut self, data: Bytes) -> io::Result<Option<Bytes>> {
         match self {
-            #[cfg(feature = "brotli")]
             ContentDecoder::Br(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
@@ -195,7 +193,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Gzip(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
@@ -208,7 +205,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
                 Ok(_) => {
                     decoder.flush()?;
@@ -221,7 +217,6 @@ impl ContentDecoder {
                 }
                 Err(e) => Err(e),
             },
-            _ => Ok(Some(data)),
         }
     }
 }

actix-http/src/encoding/encoder.rs

@@ -1,25 +1,29 @@
 //! Stream encoder
+use std::future::Future;
 use std::io::{self, Write};
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use actix_threadpool::{run, CpuFuture};
-#[cfg(feature = "brotli")]
 use brotli2::write::BrotliEncoder;
 use bytes::Bytes;
-#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
 use flate2::write::{GzEncoder, ZlibEncoder};
-use futures::{Async, Future, Poll};
+use futures_core::ready;
+use pin_project::{pin_project, project};
 
 use crate::body::{Body, BodySize, MessageBody, ResponseBody};
 use crate::http::header::{ContentEncoding, CONTENT_ENCODING};
-use crate::http::{HeaderValue, HttpTryFrom, StatusCode};
+use crate::http::{HeaderValue, StatusCode};
 use crate::{Error, ResponseHead};
 
 use super::Writer;
 
-const INPLACE: usize = 2049;
+const INPLACE: usize = 1024;
 
+#[pin_project]
 pub struct Encoder<B> {
     eof: bool,
+    #[pin]
     body: EncoderBody<B>,
     encoder: Option<ContentEncoder>,
     fut: Option<CpuFuture<ContentEncoder, io::Error>>,
@@ -54,105 +58,131 @@ impl<B: MessageBody> Encoder<B> {
         };
 
         if can_encode {
-            update_head(encoding, head);
-            head.no_chunking(false);
-            ResponseBody::Body(Encoder {
-                body,
-                eof: false,
-                fut: None,
-                encoder: ContentEncoder::encoder(encoding),
-            })
-        } else {
-            ResponseBody::Body(Encoder {
-                body,
-                eof: false,
-                fut: None,
-                encoder: None,
-            })
+            // Modify response body only if encoder is not None
+            if let Some(enc) = ContentEncoder::encoder(encoding) {
+                update_head(encoding, head);
+                head.no_chunking(false);
+                return ResponseBody::Body(Encoder {
+                    body,
+                    eof: false,
+                    fut: None,
+                    encoder: Some(enc),
+                });
+            }
         }
+        ResponseBody::Body(Encoder {
+            body,
+            eof: false,
+            fut: None,
+            encoder: None,
+        })
     }
 }
 
+#[pin_project]
 enum EncoderBody<B> {
     Bytes(Bytes),
-    Stream(B),
-    BoxedStream(Box<dyn MessageBody>),
+    Stream(#[pin] B),
+    BoxedStream(Box<dyn MessageBody + Unpin>),
+}
+
+impl<B: MessageBody> MessageBody for EncoderBody<B> {
+    fn size(&self) -> BodySize {
+        match self {
+            EncoderBody::Bytes(ref b) => b.size(),
+            EncoderBody::Stream(ref b) => b.size(),
+            EncoderBody::BoxedStream(ref b) => b.size(),
+        }
+    }
+
+    #[project]
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        #[project]
+        match self.project() {
+            EncoderBody::Bytes(b) => {
+                if b.is_empty() {
+                    Poll::Ready(None)
+                } else {
+                    Poll::Ready(Some(Ok(std::mem::replace(b, Bytes::new()))))
+                }
+            }
+            EncoderBody::Stream(b) => b.poll_next(cx),
+            EncoderBody::BoxedStream(ref mut b) => Pin::new(b.as_mut()).poll_next(cx),
+        }
+    }
 }
 
 impl<B: MessageBody> MessageBody for Encoder<B> {
     fn size(&self) -> BodySize {
         if self.encoder.is_none() {
-            match self.body {
-                EncoderBody::Bytes(ref b) => b.size(),
-                EncoderBody::Stream(ref b) => b.size(),
-                EncoderBody::BoxedStream(ref b) => b.size(),
-            }
+            self.body.size()
         } else {
             BodySize::Stream
         }
     }
 
-    fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, Error>>> {
+        let mut this = self.project();
         loop {
-            if self.eof {
-                return Ok(Async::Ready(None));
+            if *this.eof {
+                return Poll::Ready(None);
             }
 
-            if let Some(ref mut fut) = self.fut {
-                let mut encoder = futures::try_ready!(fut.poll());
+            if let Some(ref mut fut) = this.fut {
+                let mut encoder = match ready!(Pin::new(fut).poll(cx)) {
+                    Ok(item) => item,
+                    Err(e) => return Poll::Ready(Some(Err(e.into()))),
+                };
                 let chunk = encoder.take();
-                self.encoder = Some(encoder);
-                self.fut.take();
+                *this.encoder = Some(encoder);
+                this.fut.take();
                 if !chunk.is_empty() {
-                    return Ok(Async::Ready(Some(chunk)));
+                    return Poll::Ready(Some(Ok(chunk)));
                 }
             }
 
-            let result = match self.body {
-                EncoderBody::Bytes(ref mut b) => {
-                    if b.is_empty() {
-                        Async::Ready(None)
-                    } else {
-                        Async::Ready(Some(std::mem::replace(b, Bytes::new())))
-                    }
-                }
-                EncoderBody::Stream(ref mut b) => b.poll_next()?,
-                EncoderBody::BoxedStream(ref mut b) => b.poll_next()?,
-            };
+            let result = this.body.as_mut().poll_next(cx);
+
             match result {
-                Async::NotReady => return Ok(Async::NotReady),
-                Async::Ready(Some(chunk)) => {
-                    if let Some(mut encoder) = self.encoder.take() {
+                Poll::Ready(Some(Ok(chunk))) => {
+                    if let Some(mut encoder) = this.encoder.take() {
                         if chunk.len() < INPLACE {
                             encoder.write(&chunk)?;
                             let chunk = encoder.take();
-                            self.encoder = Some(encoder);
+                            *this.encoder = Some(encoder);
                             if !chunk.is_empty() {
-                                return Ok(Async::Ready(Some(chunk)));
+                                return Poll::Ready(Some(Ok(chunk)));
                             }
                         } else {
-                            self.fut = Some(run(move || {
+                            *this.fut = Some(run(move || {
                                 encoder.write(&chunk)?;
                                 Ok(encoder)
                             }));
                         }
                     } else {
-                        return Ok(Async::Ready(Some(chunk)));
+                        return Poll::Ready(Some(Ok(chunk)));
                     }
                 }
-                Async::Ready(None) => {
-                    if let Some(encoder) = self.encoder.take() {
+                Poll::Ready(None) => {
+                    if let Some(encoder) = this.encoder.take() {
                         let chunk = encoder.finish()?;
                         if chunk.is_empty() {
-                            return Ok(Async::Ready(None));
+                            return Poll::Ready(None);
                         } else {
-                            self.eof = true;
-                            return Ok(Async::Ready(Some(chunk)));
+                            *this.eof = true;
+                            return Poll::Ready(Some(Ok(chunk)));
                         }
                     } else {
-                        return Ok(Async::Ready(None));
+                        return Poll::Ready(None);
                     }
                 }
+                val => return val,
             }
         }
     }
@@ -161,33 +191,27 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
 fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) {
     head.headers_mut().insert(
         CONTENT_ENCODING,
-        HeaderValue::try_from(Bytes::from_static(encoding.as_str().as_bytes())).unwrap(),
+        HeaderValue::from_static(encoding.as_str()),
     );
 }
 
 enum ContentEncoder {
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Deflate(ZlibEncoder<Writer>),
-    #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
     Gzip(GzEncoder<Writer>),
-    #[cfg(feature = "brotli")]
     Br(BrotliEncoder<Writer>),
 }
 
 impl ContentEncoder {
     fn encoder(encoding: ContentEncoding) -> Option<Self> {
         match encoding {
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Deflate => Some(ContentEncoder::Deflate(ZlibEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoding::Gzip => Some(ContentEncoder::Gzip(GzEncoder::new(
                 Writer::new(),
                 flate2::Compression::fast(),
             ))),
-            #[cfg(feature = "brotli")]
             ContentEncoding::Br => {
                 Some(ContentEncoder::Br(BrotliEncoder::new(Writer::new(), 3)))
             }
@@ -198,28 +222,22 @@ impl ContentEncoder {
     #[inline]
     pub(crate) fn take(&mut self) -> Bytes {
         match *self {
-            #[cfg(feature = "brotli")]
             ContentEncoder::Br(ref mut encoder) => encoder.get_mut().take(),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Deflate(ref mut encoder) => encoder.get_mut().take(),
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Gzip(ref mut encoder) => encoder.get_mut().take(),
         }
     }
 
     fn finish(self) -> Result<Bytes, io::Error> {
         match self {
-            #[cfg(feature = "brotli")]
             ContentEncoder::Br(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Gzip(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Deflate(encoder) => match encoder.finish() {
                 Ok(writer) => Ok(writer.buf.freeze()),
                 Err(err) => Err(err),
@@ -229,7 +247,6 @@ impl ContentEncoder {
 
     fn write(&mut self, data: &[u8]) -> Result<(), io::Error> {
         match *self {
-            #[cfg(feature = "brotli")]
             ContentEncoder::Br(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -237,7 +254,6 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Gzip(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {
@@ -245,7 +261,6 @@ impl ContentEncoder {
                     Err(err)
                 }
             },
-            #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
             ContentEncoder::Deflate(ref mut encoder) => match encoder.write_all(data) {
                 Ok(_) => Ok(()),
                 Err(err) => {

actix-http/src/encoding/mod.rs

@@ -19,8 +19,9 @@ impl Writer {
             buf: BytesMut::with_capacity(8192),
         }
     }
+
     fn take(&mut self) -> Bytes {
-        self.buf.take().freeze()
+        self.buf.split().freeze()
     }
 }
 
@@ -29,6 +30,7 @@ impl io::Write for Writer {
         self.buf.extend_from_slice(buf);
         Ok(buf.len())
     }
+
     fn flush(&mut self) -> io::Result<()> {
         Ok(())
     }

actix-http/src/error.rs

@@ -5,24 +5,24 @@ use std::str::Utf8Error;
 use std::string::FromUtf8Error;
 use std::{fmt, io, result};
 
+use actix_codec::{Decoder, Encoder};
 pub use actix_threadpool::BlockingError;
+use actix_utils::framed::DispatcherError as FramedDispatcherError;
 use actix_utils::timeout::TimeoutError;
 use bytes::BytesMut;
 use derive_more::{Display, From};
-use futures::Canceled;
+pub use futures_channel::oneshot::Canceled;
 use http::uri::InvalidUri;
 use http::{header, Error as HttpError, StatusCode};
-use httparse;
 use serde::de::value::Error as DeError;
 use serde_json::error::Error as JsonError;
 use serde_urlencoded::ser::Error as FormError;
-use tokio_timer::Error as TimerError;
 
 // re-export for convinience
 use crate::body::Body;
 pub use crate::cookie::ParseError as CookieParseError;
 use crate::helpers::Writer;
-use crate::response::Response;
+use crate::response::{Response, ResponseBuilder};
 
 /// A specialized [`Result`](https://doc.rust-lang.org/std/result/enum.Result.html)
 /// for actix web operations
@@ -43,47 +43,68 @@ pub type Result<T, E = Error> = result::Result<T, E>;
 /// if you have access to an actix `Error` you can always get a
 /// `ResponseError` reference from it.
 pub struct Error {
-    cause: Box<ResponseError>,
+    cause: Box<dyn ResponseError>,
 }
 
 impl Error {
     /// Returns the reference to the underlying `ResponseError`.
-    pub fn as_response_error(&self) -> &ResponseError {
+    pub fn as_response_error(&self) -> &dyn ResponseError {
         self.cause.as_ref()
     }
+
+    /// Similar to `as_response_error` but downcasts.
+    pub fn as_error<T: ResponseError + 'static>(&self) -> Option<&T> {
+        ResponseError::downcast_ref(self.cause.as_ref())
+    }
 }
 
 /// Error that can be converted to `Response`
 pub trait ResponseError: fmt::Debug + fmt::Display {
+    /// Response's status code
+    ///
+    /// Internal server error is generated by default.
+    fn status_code(&self) -> StatusCode {
+        StatusCode::INTERNAL_SERVER_ERROR
+    }
+
     /// Create response for error
     ///
     /// Internal server error is generated by default.
     fn error_response(&self) -> Response {
-        Response::new(StatusCode::INTERNAL_SERVER_ERROR)
-    }
-
-    /// Constructs an error response
-    fn render_response(&self) -> Response {
-        let mut resp = self.error_response();
+        let mut resp = Response::new(self.status_code());
         let mut buf = BytesMut::new();
         let _ = write!(Writer(&mut buf), "{}", self);
         resp.headers_mut().insert(
             header::CONTENT_TYPE,
-            header::HeaderValue::from_static("text/plain"),
+            header::HeaderValue::from_static("text/plain; charset=utf-8"),
         );
         resp.set_body(Body::from(buf))
     }
+
+    downcast_get_type_id!();
 }
 
+downcast!(ResponseError);
+
 impl fmt::Display for Error {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt::Display::fmt(&self.cause, f)
     }
 }
 
 impl fmt::Debug for Error {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
-        writeln!(f, "{:?}", &self.cause)
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        write!(f, "{:?}", &self.cause)
+    }
+}
+
+impl std::error::Error for Error {
+    fn cause(&self) -> Option<&dyn std::error::Error> {
+        None
+    }
+
+    fn source(&self) -> Option<&(dyn std::error::Error + 'static)> {
+        None
     }
 }
 
@@ -93,17 +114,11 @@ impl From<()> for Error {
     }
 }
 
-impl std::error::Error for Error {
-    fn description(&self) -> &str {
-        "actix-http::Error"
-    }
-
-    fn cause(&self) -> Option<&dyn std::error::Error> {
-        None
-    }
-
-    fn source(&self) -> Option<&(dyn std::error::Error + 'static)> {
-        None
+impl From<std::convert::Infallible> for Error {
+    fn from(_: std::convert::Infallible) -> Self {
+        // `std::convert::Infallible` indicates an error
+        // that will never happen
+        unreachable!()
     }
 }
 
@@ -123,12 +138,26 @@ impl<T: ResponseError + 'static> From<T> for Error {
     }
 }
 
+/// Convert Response to a Error
+impl From<Response> for Error {
+    fn from(res: Response) -> Error {
+        InternalError::from_response("", res).into()
+    }
+}
+
+/// Convert ResponseBuilder to a Error
+impl From<ResponseBuilder> for Error {
+    fn from(mut res: ResponseBuilder) -> Error {
+        InternalError::from_response("", res.finish()).into()
+    }
+}
+
 /// Return `GATEWAY_TIMEOUT` for `TimeoutError`
 impl<E: ResponseError> ResponseError for TimeoutError<E> {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
         match self {
-            TimeoutError::Service(e) => e.error_response(),
-            TimeoutError::Timeout => Response::new(StatusCode::GATEWAY_TIMEOUT),
+            TimeoutError::Service(e) => e.status_code(),
+            TimeoutError::Timeout => StatusCode::GATEWAY_TIMEOUT,
         }
     }
 }
@@ -146,31 +175,31 @@ impl ResponseError for JsonError {}
 /// `InternalServerError` for `FormError`
 impl ResponseError for FormError {}
 
-/// `InternalServerError` for `TimerError`
-impl ResponseError for TimerError {}
-
-#[cfg(feature = "ssl")]
+#[cfg(feature = "openssl")]
 /// `InternalServerError` for `openssl::ssl::Error`
-impl ResponseError for openssl::ssl::Error {}
+impl ResponseError for actix_connect::ssl::openssl::SslError {}
 
-#[cfg(feature = "ssl")]
+#[cfg(feature = "openssl")]
 /// `InternalServerError` for `openssl::ssl::HandshakeError`
-impl ResponseError for openssl::ssl::HandshakeError<tokio_tcp::TcpStream> {}
+impl<T: std::fmt::Debug> ResponseError for actix_tls::openssl::HandshakeError<T> {}
 
 /// Return `BAD_REQUEST` for `de::value::Error`
 impl ResponseError for DeError {
-    fn error_response(&self) -> Response {
-        Response::new(StatusCode::BAD_REQUEST)
+    fn status_code(&self) -> StatusCode {
+        StatusCode::BAD_REQUEST
     }
 }
 
+/// `InternalServerError` for `Canceled`
+impl ResponseError for Canceled {}
+
 /// `InternalServerError` for `BlockingError`
 impl<E: fmt::Debug> ResponseError for BlockingError<E> {}
 
 /// Return `BAD_REQUEST` for `Utf8Error`
 impl ResponseError for Utf8Error {
-    fn error_response(&self) -> Response {
-        Response::new(StatusCode::BAD_REQUEST)
+    fn status_code(&self) -> StatusCode {
+        StatusCode::BAD_REQUEST
     }
 }
 
@@ -180,32 +209,22 @@ impl ResponseError for HttpError {}
 
 /// Return `InternalServerError` for `io::Error`
 impl ResponseError for io::Error {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
         match self.kind() {
-            io::ErrorKind::NotFound => Response::new(StatusCode::NOT_FOUND),
-            io::ErrorKind::PermissionDenied => Response::new(StatusCode::FORBIDDEN),
-            _ => Response::new(StatusCode::INTERNAL_SERVER_ERROR),
+            io::ErrorKind::NotFound => StatusCode::NOT_FOUND,
+            io::ErrorKind::PermissionDenied => StatusCode::FORBIDDEN,
+            _ => StatusCode::INTERNAL_SERVER_ERROR,
         }
     }
 }
 
 /// `BadRequest` for `InvalidHeaderValue`
 impl ResponseError for header::InvalidHeaderValue {
-    fn error_response(&self) -> Response {
-        Response::new(StatusCode::BAD_REQUEST)
+    fn status_code(&self) -> StatusCode {
+        StatusCode::BAD_REQUEST
     }
 }
 
-/// `BadRequest` for `InvalidHeaderValue`
-impl ResponseError for header::InvalidHeaderValueBytes {
-    fn error_response(&self) -> Response {
-        Response::new(StatusCode::BAD_REQUEST)
-    }
-}
-
-/// `InternalServerError` for `futures::Canceled`
-impl ResponseError for Canceled {}
-
 /// A set of errors that can occur during parsing HTTP streams
 #[derive(Debug, Display)]
 pub enum ParseError {
@@ -245,8 +264,8 @@ pub enum ParseError {
 
 /// Return `BadRequest` for `ParseError`
 impl ResponseError for ParseError {
-    fn error_response(&self) -> Response {
-        Response::new(StatusCode::BAD_REQUEST)
+    fn status_code(&self) -> StatusCode {
+        StatusCode::BAD_REQUEST
     }
 }
 
@@ -338,7 +357,7 @@ impl From<BlockingError<io::Error>> for PayloadError {
             BlockingError::Error(e) => PayloadError::Io(e),
             BlockingError::Canceled => PayloadError::Io(io::Error::new(
                 io::ErrorKind::Other,
-                "Thread pool is gone",
+                "Operation is canceled",
             )),
         }
     }
@@ -349,18 +368,18 @@ impl From<BlockingError<io::Error>> for PayloadError {
 /// - `Overflow` returns `PayloadTooLarge`
 /// - Other errors returns `BadRequest`
 impl ResponseError for PayloadError {
-    fn error_response(&self) -> Response {
+    fn status_code(&self) -> StatusCode {
         match *self {
-            PayloadError::Overflow => Response::new(StatusCode::PAYLOAD_TOO_LARGE),
-            _ => Response::new(StatusCode::BAD_REQUEST),
+            PayloadError::Overflow => StatusCode::PAYLOAD_TOO_LARGE,
+            _ => StatusCode::BAD_REQUEST,
         }
     }
 }
 
 /// Return `BadRequest` for `cookie::ParseError`
 impl ResponseError for crate::cookie::ParseError {
-    fn error_response(&self) -> Response {
-        Response::new(StatusCode::BAD_REQUEST)
+    fn status_code(&self) -> StatusCode {
+        StatusCode::BAD_REQUEST
     }
 }
 
@@ -424,11 +443,19 @@ pub enum ContentTypeError {
 
 /// Return `BadRequest` for `ContentTypeError`
 impl ResponseError for ContentTypeError {
-    fn error_response(&self) -> Response {
-        Response::new(StatusCode::BAD_REQUEST)
+    fn status_code(&self) -> StatusCode {
+        StatusCode::BAD_REQUEST
     }
 }
 
+impl<E, U: Encoder + Decoder> ResponseError for FramedDispatcherError<E, U>
+where
+    E: fmt::Debug + fmt::Display,
+    <U as Encoder>::Error: fmt::Debug,
+    <U as Decoder>::Error: fmt::Debug,
+{
+}
+
 /// Helper type that can wrap any error and generate custom response.
 ///
 /// In following example any `io::Error` will be converted into "BAD REQUEST"
@@ -436,14 +463,12 @@ impl ResponseError for ContentTypeError {
 /// default.
 ///
 /// ```rust
-/// # extern crate actix_http;
 /// # use std::io;
 /// # use actix_http::*;
 ///
 /// fn index(req: Request) -> Result<&'static str> {
 ///     Err(error::ErrorBadRequest(io::Error::new(io::ErrorKind::Other, "error")))
 /// }
-/// # fn main() {}
 /// ```
 pub struct InternalError<T> {
     cause: T,
@@ -477,7 +502,7 @@ impl<T> fmt::Debug for InternalError<T>
 where
     T: fmt::Debug + 'static,
 {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt::Debug::fmt(&self.cause, f)
     }
 }
@@ -486,7 +511,7 @@ impl<T> fmt::Display for InternalError<T>
 where
     T: fmt::Display + 'static,
 {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt::Display::fmt(&self.cause, f)
     }
 }
@@ -495,6 +520,19 @@ impl<T> ResponseError for InternalError<T>
 where
     T: fmt::Debug + fmt::Display + 'static,
 {
+    fn status_code(&self) -> StatusCode {
+        match self.status {
+            InternalErrorType::Status(st) => st,
+            InternalErrorType::Response(ref resp) => {
+                if let Some(resp) = resp.borrow().as_ref() {
+                    resp.head().status
+                } else {
+                    StatusCode::INTERNAL_SERVER_ERROR
+                }
+            }
+        }
+    }
+
     fn error_response(&self) -> Response {
         match self.status {
             InternalErrorType::Status(st) => {
@@ -503,7 +541,7 @@ where
                 let _ = write!(Writer(&mut buf), "{}", self);
                 res.headers_mut().insert(
                     header::CONTENT_TYPE,
-                    header::HeaderValue::from_static("text/plain"),
+                    header::HeaderValue::from_static("text/plain; charset=utf-8"),
                 );
                 res.set_body(Body::from(buf))
             }
@@ -516,18 +554,6 @@ where
             }
         }
     }
-
-    /// Constructs an error response
-    fn render_response(&self) -> Response {
-        self.error_response()
-    }
-}
-
-/// Convert Response to a Error
-impl From<Response> for Error {
-    fn from(res: Response) -> Error {
-        InternalError::from_response("", res).into()
-    }
 }
 
 /// Helper function that creates wrapper of any error and generate *BAD
@@ -920,24 +946,25 @@ where
     InternalError::new(err, StatusCode::NETWORK_AUTHENTICATION_REQUIRED).into()
 }
 
-#[cfg(feature = "fail")]
-mod failure_integration {
-    use super::*;
+#[cfg(feature = "failure")]
+/// Compatibility for `failure::Error`
+impl ResponseError for fail_ure::Error {}
 
-    /// Compatibility for `failure::Error`
-    impl ResponseError for failure::Error {
-        fn error_response(&self) -> Response {
-            Response::new(StatusCode::INTERNAL_SERVER_ERROR)
-        }
-    }
-}
+#[cfg(feature = "actors")]
+/// `InternalServerError` for `actix::MailboxError`
+/// This is supported on feature=`actors` only
+impl ResponseError for actix::MailboxError {}
+
+#[cfg(feature = "actors")]
+/// `InternalServerError` for `actix::ResolverError`
+/// This is supported on feature=`actors` only
+impl ResponseError for actix::actors::resolver::ResolverError {}
 
 #[cfg(test)]
 mod tests {
     use super::*;
     use http::{Error as HttpError, StatusCode};
     use httparse;
-    use std::error::Error as StdError;
     use std::io;
 
     #[test]
@@ -966,7 +993,7 @@ mod tests {
     #[test]
     fn test_error_cause() {
         let orig = io::Error::new(io::ErrorKind::Other, "other");
-        let desc = orig.description().to_owned();
+        let desc = orig.to_string();
         let e = Error::from(orig);
         assert_eq!(format!("{}", e.as_response_error()), desc);
     }
@@ -974,7 +1001,7 @@ mod tests {
     #[test]
     fn test_error_display() {
         let orig = io::Error::new(io::ErrorKind::Other, "other");
-        let desc = orig.description().to_owned();
+        let desc = orig.to_string();
         let e = Error::from(orig);
         assert_eq!(format!("{}", e), desc);
     }
@@ -1016,7 +1043,7 @@ mod tests {
             match ParseError::from($from) {
                 e @ $error => {
                     let desc = format!("{}", e);
-                    assert_eq!(desc, format!("IO error: {}", $from.description()));
+                    assert_eq!(desc, format!("IO error: {}", $from));
                 }
                 _ => unreachable!("{:?}", $from),
             }
@@ -1044,6 +1071,16 @@ mod tests {
         assert_eq!(resp.status(), StatusCode::OK);
     }
 
+    #[test]
+    fn test_error_casting() {
+        let err = PayloadError::Overflow;
+        let resp_err: &dyn ResponseError = &err;
+        let err = resp_err.downcast_ref::<PayloadError>().unwrap();
+        assert_eq!(err.to_string(), "A payload reached size limit.");
+        let not_err = resp_err.downcast_ref::<ContentTypeError>();
+        assert!(not_err.is_none());
+    }
+
     #[test]
     fn test_error_helpers() {
         let r: Response = ErrorBadRequest("err").into();

actix-http/src/extensions.rs

@@ -1,12 +1,12 @@
 use std::any::{Any, TypeId};
 use std::fmt;
 
-use hashbrown::HashMap;
+use fxhash::FxHashMap;
 
 #[derive(Default)]
 /// A type map of request extensions.
 pub struct Extensions {
-    map: HashMap<TypeId, Box<Any>>,
+    map: FxHashMap<TypeId, Box<dyn Any>>,
 }
 
 impl Extensions {
@@ -14,7 +14,7 @@ impl Extensions {
     #[inline]
     pub fn new() -> Extensions {
         Extensions {
-            map: HashMap::default(),
+            map: FxHashMap::default(),
         }
     }
 
@@ -28,33 +28,30 @@ impl Extensions {
 
     /// Check if container contains entry
     pub fn contains<T: 'static>(&self) -> bool {
-        self.map.get(&TypeId::of::<T>()).is_some()
+        self.map.contains_key(&TypeId::of::<T>())
     }
 
     /// Get a reference to a type previously inserted on this `Extensions`.
     pub fn get<T: 'static>(&self) -> Option<&T> {
         self.map
             .get(&TypeId::of::<T>())
-            .and_then(|boxed| (&**boxed as &(Any + 'static)).downcast_ref())
+            .and_then(|boxed| boxed.downcast_ref())
     }
 
     /// Get a mutable reference to a type previously inserted on this `Extensions`.
     pub fn get_mut<T: 'static>(&mut self) -> Option<&mut T> {
         self.map
             .get_mut(&TypeId::of::<T>())
-            .and_then(|boxed| (&mut **boxed as &mut (Any + 'static)).downcast_mut())
+            .and_then(|boxed| boxed.downcast_mut())
     }
 
     /// Remove a type from this `Extensions`.
     ///
     /// If a extension of this type existed, it will be returned.
     pub fn remove<T: 'static>(&mut self) -> Option<T> {
-        self.map.remove(&TypeId::of::<T>()).and_then(|boxed| {
-            (boxed as Box<Any + 'static>)
-                .downcast()
-                .ok()
-                .map(|boxed| *boxed)
-        })
+        self.map
+            .remove(&TypeId::of::<T>())
+            .and_then(|boxed| boxed.downcast().ok().map(|boxed| *boxed))
     }
 
     /// Clear the `Extensions` of all inserted extensions.
@@ -65,11 +62,97 @@ impl Extensions {
 }
 
 impl fmt::Debug for Extensions {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         f.debug_struct("Extensions").finish()
     }
 }
 
+#[test]
+fn test_remove() {
+    let mut map = Extensions::new();
+
+    map.insert::<i8>(123);
+    assert!(map.get::<i8>().is_some());
+
+    map.remove::<i8>();
+    assert!(map.get::<i8>().is_none());
+}
+
+#[test]
+fn test_clear() {
+    let mut map = Extensions::new();
+
+    map.insert::<i8>(8);
+    map.insert::<i16>(16);
+    map.insert::<i32>(32);
+
+    assert!(map.contains::<i8>());
+    assert!(map.contains::<i16>());
+    assert!(map.contains::<i32>());
+
+    map.clear();
+
+    assert!(!map.contains::<i8>());
+    assert!(!map.contains::<i16>());
+    assert!(!map.contains::<i32>());
+
+    map.insert::<i8>(10);
+    assert_eq!(*map.get::<i8>().unwrap(), 10);
+}
+
+#[test]
+fn test_integers() {
+    let mut map = Extensions::new();
+
+    map.insert::<i8>(8);
+    map.insert::<i16>(16);
+    map.insert::<i32>(32);
+    map.insert::<i64>(64);
+    map.insert::<i128>(128);
+    map.insert::<u8>(8);
+    map.insert::<u16>(16);
+    map.insert::<u32>(32);
+    map.insert::<u64>(64);
+    map.insert::<u128>(128);
+    assert!(map.get::<i8>().is_some());
+    assert!(map.get::<i16>().is_some());
+    assert!(map.get::<i32>().is_some());
+    assert!(map.get::<i64>().is_some());
+    assert!(map.get::<i128>().is_some());
+    assert!(map.get::<u8>().is_some());
+    assert!(map.get::<u16>().is_some());
+    assert!(map.get::<u32>().is_some());
+    assert!(map.get::<u64>().is_some());
+    assert!(map.get::<u128>().is_some());
+}
+
+#[test]
+fn test_composition() {
+    struct Magi<T>(pub T);
+
+    struct Madoka {
+        pub god: bool,
+    }
+
+    struct Homura {
+        pub attempts: usize,
+    }
+
+    struct Mami {
+        pub guns: usize,
+    }
+
+    let mut map = Extensions::new();
+
+    map.insert(Magi(Madoka { god: false }));
+    map.insert(Magi(Homura { attempts: 0 }));
+    map.insert(Magi(Mami { guns: 999 }));
+
+    assert!(!map.get::<Magi<Madoka>>().unwrap().0.god);
+    assert_eq!(0, map.get::<Magi<Homura>>().unwrap().0.attempts);
+    assert_eq!(999, map.get::<Magi<Mami>>().unwrap().0.guns);
+}
+
 #[test]
 fn test_extensions() {
     #[derive(Debug, PartialEq)]

actix-http/src/h1/client.rs

@@ -1,12 +1,8 @@
-#![allow(unused_imports, unused_variables, dead_code)]
-use std::io::{self, Write};
+use std::io;
 
 use actix_codec::{Decoder, Encoder};
 use bitflags::bitflags;
-use bytes::{BufMut, Bytes, BytesMut};
-use http::header::{
-    HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING, UPGRADE,
-};
+use bytes::{Bytes, BytesMut};
 use http::{Method, Version};
 
 use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
@@ -15,8 +11,7 @@ use super::{Message, MessageType};
 use crate::body::BodySize;
 use crate::config::ServiceConfig;
 use crate::error::{ParseError, PayloadError};
-use crate::helpers;
-use crate::message::{ConnectionType, Head, MessagePool, RequestHead, ResponseHead};
+use crate::message::{ConnectionType, RequestHeadType, ResponseHead};
 
 bitflags! {
     struct Flags: u8 {
@@ -26,8 +21,6 @@ bitflags! {
     }
 }
 
-const AVERAGE_HEADER_SIZE: usize = 30;
-
 /// HTTP/1 Codec
 pub struct ClientCodec {
     inner: ClientCodecInner,
@@ -47,8 +40,7 @@ struct ClientCodecInner {
 
     // encoder part
     flags: Flags,
-    headers_size: u32,
-    encoder: encoder::MessageEncoder<RequestHead>,
+    encoder: encoder::MessageEncoder<RequestHeadType>,
 }
 
 impl Default for ClientCodec {
@@ -76,7 +68,6 @@ impl ClientCodec {
                 ctype: ConnectionType::Close,
 
                 flags,
-                headers_size: 0,
                 encoder: encoder::MessageEncoder::default(),
             },
         }
@@ -183,7 +174,7 @@ impl Decoder for ClientPayloadCodec {
 }
 
 impl Encoder for ClientCodec {
-    type Item = Message<(RequestHead, BodySize)>;
+    type Item = Message<(RequestHeadType, BodySize)>;
     type Error = io::Error;
 
     fn encode(
@@ -192,13 +183,15 @@ impl Encoder for ClientCodec {
         dst: &mut BytesMut,
     ) -> Result<(), Self::Error> {
         match item {
-            Message::Item((mut msg, length)) => {
+            Message::Item((mut head, length)) => {
                 let inner = &mut self.inner;
-                inner.version = msg.version;
-                inner.flags.set(Flags::HEAD, msg.method == Method::HEAD);
+                inner.version = head.as_ref().version;
+                inner
+                    .flags
+                    .set(Flags::HEAD, head.as_ref().method == Method::HEAD);
 
                 // connection status
-                inner.ctype = match msg.connection_type() {
+                inner.ctype = match head.as_ref().connection_type() {
                     ConnectionType::KeepAlive => {
                         if inner.flags.contains(Flags::KEEPALIVE_ENABLED) {
                             ConnectionType::KeepAlive
@@ -212,7 +205,7 @@ impl Encoder for ClientCodec {
 
                 inner.encoder.encode(
                     dst,
-                    &mut msg,
+                    &mut head,
                     false,
                     false,
                     inner.version,

actix-http/src/h1/codec.rs

@@ -1,12 +1,9 @@
-#![allow(unused_imports, unused_variables, dead_code)]
-use std::io::Write;
-use std::{fmt, io, net};
+use std::{fmt, io};
 
 use actix_codec::{Decoder, Encoder};
 use bitflags::bitflags;
-use bytes::{BufMut, Bytes, BytesMut};
-use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
-use http::{Method, StatusCode, Version};
+use bytes::BytesMut;
+use http::{Method, Version};
 
 use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
 use super::{decoder, encoder};
@@ -14,8 +11,7 @@ use super::{Message, MessageType};
 use crate::body::BodySize;
 use crate::config::ServiceConfig;
 use crate::error::ParseError;
-use crate::helpers;
-use crate::message::{ConnectionType, Head, ResponseHead};
+use crate::message::ConnectionType;
 use crate::request::Request;
 use crate::response::Response;
 
@@ -27,8 +23,6 @@ bitflags! {
     }
 }
 
-const AVERAGE_HEADER_SIZE: usize = 30;
-
 /// HTTP/1 Codec
 pub struct Codec {
     config: ServiceConfig,
@@ -49,7 +43,7 @@ impl Default for Codec {
 }
 
 impl fmt::Debug for Codec {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         write!(f, "h1::Codec({:?})", self.flags)
     }
 }
@@ -176,7 +170,6 @@ impl Encoder for Codec {
                 };
 
                 // encode message
-                let len = dst.len();
                 self.encoder.encode(
                     dst,
                     &mut res,
@@ -202,17 +195,11 @@ impl Encoder for Codec {
 
 #[cfg(test)]
 mod tests {
-    use std::{cmp, io};
-
-    use actix_codec::{AsyncRead, AsyncWrite};
-    use bytes::{Buf, Bytes, BytesMut};
-    use http::{Method, Version};
+    use bytes::BytesMut;
+    use http::Method;
 
     use super::*;
-    use crate::error::ParseError;
-    use crate::h1::Message;
     use crate::httpmessage::HttpMessage;
-    use crate::request::Request;
 
     #[test]
     fn test_http_request_chunked_payload_and_next_message() {

actix-http/src/h1/decoder.rs

@@ -1,12 +1,13 @@
+use std::convert::TryFrom;
+use std::io;
 use std::marker::PhantomData;
-use std::{io, mem};
+use std::mem::MaybeUninit;
+use std::task::Poll;
 
 use actix_codec::Decoder;
-use bytes::{Bytes, BytesMut};
-use futures::{Async, Poll};
+use bytes::{Buf, Bytes, BytesMut};
 use http::header::{HeaderName, HeaderValue};
-use http::{header, HttpTryFrom, Method, StatusCode, Uri, Version};
-use httparse;
+use http::{header, Method, StatusCode, Uri, Version};
 use log::{debug, error, trace};
 
 use crate::error::ParseError;
@@ -78,8 +79,8 @@ pub(crate) trait MessageType: Sized {
 
                 // Unsafe: httparse check header value for valid utf-8
                 let value = unsafe {
-                    HeaderValue::from_shared_unchecked(
-                        slice.slice(idx.value.0, idx.value.1),
+                    HeaderValue::from_maybe_shared_unchecked(
+                        slice.slice(idx.value.0..idx.value.1),
                     )
                 };
                 match name {
@@ -183,14 +184,16 @@ impl MessageType for Request {
         &mut self.head_mut().headers
     }
 
+    #[allow(clippy::uninit_assumed_init)]
     fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
         // Unsafe: we read only this data only after httparse parses headers into.
         // performance bump for pipeline benchmarks.
-        let mut headers: [HeaderIndex; MAX_HEADERS] = unsafe { mem::uninitialized() };
+        let mut headers: [HeaderIndex; MAX_HEADERS] =
+            unsafe { MaybeUninit::uninit().assume_init() };
 
         let (len, method, uri, ver, h_len) = {
-            let mut parsed: [httparse::Header; MAX_HEADERS] =
-                unsafe { mem::uninitialized() };
+            let mut parsed: [httparse::Header<'_>; MAX_HEADERS] =
+                unsafe { MaybeUninit::uninit().assume_init() };
 
             let mut req = httparse::Request::new(&mut parsed);
             match req.parse(src)? {
@@ -257,14 +260,16 @@ impl MessageType for ResponseHead {
         &mut self.headers
     }
 
+    #[allow(clippy::uninit_assumed_init)]
     fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
         // Unsafe: we read only this data only after httparse parses headers into.
         // performance bump for pipeline benchmarks.
-        let mut headers: [HeaderIndex; MAX_HEADERS] = unsafe { mem::uninitialized() };
+        let mut headers: [HeaderIndex; MAX_HEADERS] =
+            unsafe { MaybeUninit::uninit().assume_init() };
 
         let (len, ver, status, h_len) = {
-            let mut parsed: [httparse::Header; MAX_HEADERS] =
-                unsafe { mem::uninitialized() };
+            let mut parsed: [httparse::Header<'_>; MAX_HEADERS] =
+                unsafe { MaybeUninit::uninit().assume_init() };
 
             let mut res = httparse::Response::new(&mut parsed);
             match res.parse(src)? {
@@ -322,7 +327,7 @@ pub(crate) struct HeaderIndex {
 impl HeaderIndex {
     pub(crate) fn record(
         bytes: &[u8],
-        headers: &[httparse::Header],
+        headers: &[httparse::Header<'_>],
         indices: &mut [HeaderIndex],
     ) {
         let bytes_ptr = bytes.as_ptr() as usize;
@@ -425,7 +430,7 @@ impl Decoder for PayloadDecoder {
                     let len = src.len() as u64;
                     let buf;
                     if *remaining > len {
-                        buf = src.take().freeze();
+                        buf = src.split().freeze();
                         *remaining -= len;
                     } else {
                         buf = src.split_to(*remaining as usize).freeze();
@@ -439,9 +444,10 @@ impl Decoder for PayloadDecoder {
                 loop {
                     let mut buf = None;
                     // advances the chunked state
-                    *state = match state.step(src, size, &mut buf)? {
-                        Async::NotReady => return Ok(None),
-                        Async::Ready(state) => state,
+                    *state = match state.step(src, size, &mut buf) {
+                        Poll::Pending => return Ok(None),
+                        Poll::Ready(Ok(state)) => state,
+                        Poll::Ready(Err(e)) => return Err(e),
                     };
                     if *state == ChunkedState::End {
                         trace!("End of chunked stream");
@@ -459,7 +465,7 @@ impl Decoder for PayloadDecoder {
                 if src.is_empty() {
                     Ok(None)
                 } else {
-                    Ok(Some(PayloadItem::Chunk(src.take().freeze())))
+                    Ok(Some(PayloadItem::Chunk(src.split().freeze())))
                 }
             }
         }
@@ -470,10 +476,10 @@ macro_rules! byte (
     ($rdr:ident) => ({
         if $rdr.len() > 0 {
             let b = $rdr[0];
-            $rdr.split_to(1);
+            $rdr.advance(1);
             b
         } else {
-            return Ok(Async::NotReady)
+            return Poll::Pending
         }
     })
 );
@@ -484,7 +490,7 @@ impl ChunkedState {
         body: &mut BytesMut,
         size: &mut u64,
         buf: &mut Option<Bytes>,
-    ) -> Poll<ChunkedState, io::Error> {
+    ) -> Poll<Result<ChunkedState, io::Error>> {
         use self::ChunkedState::*;
         match *self {
             Size => ChunkedState::read_size(body, size),
@@ -496,66 +502,71 @@ impl ChunkedState {
             BodyLf => ChunkedState::read_body_lf(body),
             EndCr => ChunkedState::read_end_cr(body),
             EndLf => ChunkedState::read_end_lf(body),
-            End => Ok(Async::Ready(ChunkedState::End)),
+            End => Poll::Ready(Ok(ChunkedState::End)),
         }
     }
-    fn read_size(rdr: &mut BytesMut, size: &mut u64) -> Poll<ChunkedState, io::Error> {
+
+    fn read_size(
+        rdr: &mut BytesMut,
+        size: &mut u64,
+    ) -> Poll<Result<ChunkedState, io::Error>> {
         let radix = 16;
         match byte!(rdr) {
-            b @ b'0'...b'9' => {
+            b @ b'0'..=b'9' => {
                 *size *= radix;
                 *size += u64::from(b - b'0');
             }
-            b @ b'a'...b'f' => {
+            b @ b'a'..=b'f' => {
                 *size *= radix;
                 *size += u64::from(b + 10 - b'a');
             }
-            b @ b'A'...b'F' => {
+            b @ b'A'..=b'F' => {
                 *size *= radix;
                 *size += u64::from(b + 10 - b'A');
             }
-            b'\t' | b' ' => return Ok(Async::Ready(ChunkedState::SizeLws)),
-            b';' => return Ok(Async::Ready(ChunkedState::Extension)),
-            b'\r' => return Ok(Async::Ready(ChunkedState::SizeLf)),
+            b'\t' | b' ' => return Poll::Ready(Ok(ChunkedState::SizeLws)),
+            b';' => return Poll::Ready(Ok(ChunkedState::Extension)),
+            b'\r' => return Poll::Ready(Ok(ChunkedState::SizeLf)),
             _ => {
-                return Err(io::Error::new(
+                return Poll::Ready(Err(io::Error::new(
                     io::ErrorKind::InvalidInput,
                     "Invalid chunk size line: Invalid Size",
-                ));
+                )));
             }
         }
-        Ok(Async::Ready(ChunkedState::Size))
+        Poll::Ready(Ok(ChunkedState::Size))
     }
-    fn read_size_lws(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+
+    fn read_size_lws(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         trace!("read_size_lws");
         match byte!(rdr) {
             // LWS can follow the chunk size, but no more digits can come
-            b'\t' | b' ' => Ok(Async::Ready(ChunkedState::SizeLws)),
-            b';' => Ok(Async::Ready(ChunkedState::Extension)),
-            b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)),
-            _ => Err(io::Error::new(
+            b'\t' | b' ' => Poll::Ready(Ok(ChunkedState::SizeLws)),
+            b';' => Poll::Ready(Ok(ChunkedState::Extension)),
+            b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk size linear white space",
-            )),
+            ))),
         }
     }
-    fn read_extension(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_extension(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)),
-            _ => Ok(Async::Ready(ChunkedState::Extension)), // no supported extensions
+            b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
+            _ => Poll::Ready(Ok(ChunkedState::Extension)), // no supported extensions
         }
     }
     fn read_size_lf(
         rdr: &mut BytesMut,
         size: &mut u64,
-    ) -> Poll<ChunkedState, io::Error> {
+    ) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\n' if *size > 0 => Ok(Async::Ready(ChunkedState::Body)),
-            b'\n' if *size == 0 => Ok(Async::Ready(ChunkedState::EndCr)),
-            _ => Err(io::Error::new(
+            b'\n' if *size > 0 => Poll::Ready(Ok(ChunkedState::Body)),
+            b'\n' if *size == 0 => Poll::Ready(Ok(ChunkedState::EndCr)),
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk size LF",
-            )),
+            ))),
         }
     }
 
@@ -563,16 +574,16 @@ impl ChunkedState {
         rdr: &mut BytesMut,
         rem: &mut u64,
         buf: &mut Option<Bytes>,
-    ) -> Poll<ChunkedState, io::Error> {
+    ) -> Poll<Result<ChunkedState, io::Error>> {
         trace!("Chunked read, remaining={:?}", rem);
 
         let len = rdr.len() as u64;
         if len == 0 {
-            Ok(Async::Ready(ChunkedState::Body))
+            Poll::Ready(Ok(ChunkedState::Body))
         } else {
             let slice;
             if *rem > len {
-                slice = rdr.take().freeze();
+                slice = rdr.split().freeze();
                 *rem -= len;
             } else {
                 slice = rdr.split_to(*rem as usize).freeze();
@@ -580,47 +591,47 @@ impl ChunkedState {
             }
             *buf = Some(slice);
             if *rem > 0 {
-                Ok(Async::Ready(ChunkedState::Body))
+                Poll::Ready(Ok(ChunkedState::Body))
             } else {
-                Ok(Async::Ready(ChunkedState::BodyCr))
+                Poll::Ready(Ok(ChunkedState::BodyCr))
             }
         }
     }
 
-    fn read_body_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_body_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\r' => Ok(Async::Ready(ChunkedState::BodyLf)),
-            _ => Err(io::Error::new(
+            b'\r' => Poll::Ready(Ok(ChunkedState::BodyLf)),
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk body CR",
-            )),
+            ))),
         }
     }
-    fn read_body_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_body_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\n' => Ok(Async::Ready(ChunkedState::Size)),
-            _ => Err(io::Error::new(
+            b'\n' => Poll::Ready(Ok(ChunkedState::Size)),
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk body LF",
-            )),
+            ))),
         }
     }
-    fn read_end_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_end_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\r' => Ok(Async::Ready(ChunkedState::EndLf)),
-            _ => Err(io::Error::new(
+            b'\r' => Poll::Ready(Ok(ChunkedState::EndLf)),
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk end CR",
-            )),
+            ))),
         }
     }
-    fn read_end_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
+    fn read_end_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
         match byte!(rdr) {
-            b'\n' => Ok(Async::Ready(ChunkedState::End)),
-            _ => Err(io::Error::new(
+            b'\n' => Poll::Ready(Ok(ChunkedState::End)),
+            _ => Poll::Ready(Err(io::Error::new(
                 io::ErrorKind::InvalidInput,
                 "Invalid chunk end LF",
-            )),
+            ))),
         }
     }
 }

actix-http/src/h1/encoder.rs

@@ -1,22 +1,18 @@
-#![allow(unused_imports, unused_variables, dead_code)]
-use std::fmt::Write as FmtWrite;
 use std::io::Write;
 use std::marker::PhantomData;
-use std::str::FromStr;
-use std::{cmp, fmt, io, mem};
+use std::ptr::copy_nonoverlapping;
+use std::slice::from_raw_parts_mut;
+use std::{cmp, io};
 
-use bytes::{BufMut, Bytes, BytesMut};
+use bytes::{buf::BufMutExt, BufMut, BytesMut};
 
 use crate::body::BodySize;
 use crate::config::ServiceConfig;
-use crate::header::{map, ContentEncoding};
+use crate::header::map;
 use crate::helpers;
-use crate::http::header::{
-    HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING,
-};
-use crate::http::{HeaderMap, Method, StatusCode, Version};
-use crate::message::{ConnectionType, Head, RequestHead, ResponseHead};
-use crate::request::Request;
+use crate::http::header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
+use crate::http::{HeaderMap, StatusCode, Version};
+use crate::message::{ConnectionType, RequestHeadType};
 use crate::response::Response;
 
 const AVERAGE_HEADER_SIZE: usize = 30;
@@ -43,6 +39,8 @@ pub(crate) trait MessageType: Sized {
 
     fn headers(&self) -> &HeaderMap;
 
+    fn extra_headers(&self) -> Option<&HeaderMap>;
+
     fn camel_case(&self) -> bool {
         false
     }
@@ -103,6 +101,7 @@ pub(crate) trait MessageType: Sized {
                 } else {
                     dst.put_slice(b"\r\ncontent-length: ");
                 }
+                #[allow(clippy::write_with_newline)]
                 write!(dst.writer(), "{}\r\n", len)?;
             }
             BodySize::None => dst.put_slice(b"\r\n"),
@@ -128,12 +127,22 @@ pub(crate) trait MessageType: Sized {
             _ => (),
         }
 
+        // merging headers from head and extra headers. HeaderMap::new() does not allocate.
+        let empty_headers = HeaderMap::new();
+        let extra_headers = self.extra_headers().unwrap_or(&empty_headers);
+        let headers = self
+            .headers()
+            .inner
+            .iter()
+            .filter(|(name, _)| !extra_headers.contains_key(*name))
+            .chain(extra_headers.inner.iter());
+
         // write headers
         let mut pos = 0;
         let mut has_date = false;
-        let mut remaining = dst.remaining_mut();
-        let mut buf = unsafe { &mut *(dst.bytes_mut() as *mut [u8]) };
-        for (key, value) in self.headers().inner.iter() {
+        let mut remaining = dst.capacity() - dst.len();
+        let mut buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
+        for (key, value) in headers {
             match *key {
                 CONNECTION => continue,
                 TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => continue,
@@ -146,61 +155,67 @@ pub(crate) trait MessageType: Sized {
             match value {
                 map::Value::One(ref val) => {
                     let v = val.as_ref();
-                    let len = k.len() + v.len() + 4;
+                    let v_len = v.len();
+                    let k_len = k.len();
+                    let len = k_len + v_len + 4;
                     if len > remaining {
                         unsafe {
                             dst.advance_mut(pos);
                         }
                         pos = 0;
                         dst.reserve(len * 2);
-                        remaining = dst.remaining_mut();
-                        unsafe {
-                            buf = &mut *(dst.bytes_mut() as *mut _);
-                        }
+                        remaining = dst.capacity() - dst.len();
+                        buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
                     }
                     // use upper Camel-Case
-                    if camel_case {
-                        write_camel_case(k, &mut buf[pos..pos + k.len()]);
-                    } else {
-                        buf[pos..pos + k.len()].copy_from_slice(k);
+                    unsafe {
+                        if camel_case {
+                            write_camel_case(k, from_raw_parts_mut(buf, k_len))
+                        } else {
+                            write_data(k, buf, k_len)
+                        }
+                        buf = buf.add(k_len);
+                        write_data(b": ", buf, 2);
+                        buf = buf.add(2);
+                        write_data(v, buf, v_len);
+                        buf = buf.add(v_len);
+                        write_data(b"\r\n", buf, 2);
+                        buf = buf.add(2);
+                        pos += len;
+                        remaining -= len;
                     }
-                    pos += k.len();
-                    buf[pos..pos + 2].copy_from_slice(b": ");
-                    pos += 2;
-                    buf[pos..pos + v.len()].copy_from_slice(v);
-                    pos += v.len();
-                    buf[pos..pos + 2].copy_from_slice(b"\r\n");
-                    pos += 2;
-                    remaining -= len;
                 }
                 map::Value::Multi(ref vec) => {
                     for val in vec {
                         let v = val.as_ref();
-                        let len = k.len() + v.len() + 4;
+                        let v_len = v.len();
+                        let k_len = k.len();
+                        let len = k_len + v_len + 4;
                         if len > remaining {
                             unsafe {
                                 dst.advance_mut(pos);
                             }
                             pos = 0;
                             dst.reserve(len * 2);
-                            remaining = dst.remaining_mut();
-                            unsafe {
-                                buf = &mut *(dst.bytes_mut() as *mut _);
-                            }
+                            remaining = dst.capacity() - dst.len();
+                            buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
                         }
                         // use upper Camel-Case
-                        if camel_case {
-                            write_camel_case(k, &mut buf[pos..pos + k.len()]);
-                        } else {
-                            buf[pos..pos + k.len()].copy_from_slice(k);
-                        }
-                        pos += k.len();
-                        buf[pos..pos + 2].copy_from_slice(b": ");
-                        pos += 2;
-                        buf[pos..pos + v.len()].copy_from_slice(v);
-                        pos += v.len();
-                        buf[pos..pos + 2].copy_from_slice(b"\r\n");
-                        pos += 2;
+                        unsafe {
+                            if camel_case {
+                                write_camel_case(k, from_raw_parts_mut(buf, k_len));
+                            } else {
+                                write_data(k, buf, k_len);
+                            }
+                            buf = buf.add(k_len);
+                            write_data(b": ", buf, 2);
+                            buf = buf.add(2);
+                            write_data(v, buf, v_len);
+                            buf = buf.add(v_len);
+                            write_data(b"\r\n", buf, 2);
+                            buf = buf.add(2);
+                        };
+                        pos += len;
                         remaining -= len;
                     }
                 }
@@ -235,6 +250,10 @@ impl MessageType for Response<()> {
         &self.head().headers
     }
 
+    fn extra_headers(&self) -> Option<&HeaderMap> {
+        None
+    }
+
     fn encode_status(&mut self, dst: &mut BytesMut) -> io::Result<()> {
         let head = self.head();
         let reason = head.reason().as_bytes();
@@ -247,35 +266,46 @@ impl MessageType for Response<()> {
     }
 }
 
-impl MessageType for RequestHead {
+impl MessageType for RequestHeadType {
     fn status(&self) -> Option<StatusCode> {
         None
     }
 
     fn chunked(&self) -> bool {
-        self.chunked()
+        self.as_ref().chunked()
     }
 
     fn camel_case(&self) -> bool {
-        RequestHead::camel_case_headers(self)
+        self.as_ref().camel_case_headers()
     }
 
     fn headers(&self) -> &HeaderMap {
-        &self.headers
+        self.as_ref().headers()
+    }
+
+    fn extra_headers(&self) -> Option<&HeaderMap> {
+        self.extra_headers()
     }
 
     fn encode_status(&mut self, dst: &mut BytesMut) -> io::Result<()> {
-        dst.reserve(256 + self.headers.len() * AVERAGE_HEADER_SIZE);
+        let head = self.as_ref();
+        dst.reserve(256 + head.headers.len() * AVERAGE_HEADER_SIZE);
         write!(
             Writer(dst),
             "{} {} {}",
-            self.method,
-            self.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
-            match self.version {
+            head.method,
+            head.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
+            match head.version {
                 Version::HTTP_09 => "HTTP/0.9",
                 Version::HTTP_10 => "HTTP/1.0",
                 Version::HTTP_11 => "HTTP/1.1",
                 Version::HTTP_2 => "HTTP/2.0",
+                Version::HTTP_3 => "HTTP/3.0",
+                _ =>
+                    return Err(io::Error::new(
+                        io::ErrorKind::Other,
+                        "unsupported version"
+                    )),
             }
         )
         .map_err(|e| io::Error::new(io::ErrorKind::Other, e))
@@ -457,6 +487,10 @@ impl<'a> io::Write for Writer<'a> {
     }
 }
 
+unsafe fn write_data(value: &[u8], buf: *mut u8, len: usize) {
+    copy_nonoverlapping(value.as_ptr(), buf, len);
+}
+
 fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
     let mut index = 0;
     let key = value;
@@ -487,10 +521,14 @@ fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
 
 #[cfg(test)]
 mod tests {
+    use std::rc::Rc;
+
     use bytes::Bytes;
+    use http::header::AUTHORIZATION;
 
     use super::*;
     use crate::http::header::{HeaderValue, CONTENT_TYPE};
+    use crate::RequestHead;
 
     #[test]
     fn test_chunked_te() {
@@ -501,7 +539,7 @@ mod tests {
             assert!(enc.encode(b"", &mut bytes).ok().unwrap());
         }
         assert_eq!(
-            bytes.take().freeze(),
+            bytes.split().freeze(),
             Bytes::from_static(b"4\r\ntest\r\n0\r\n\r\n")
         );
     }
@@ -515,6 +553,8 @@ mod tests {
         head.headers
             .insert(CONTENT_TYPE, HeaderValue::from_static("plain/text"));
 
+        let mut head = RequestHeadType::Owned(head);
+
         let _ = head.encode_headers(
             &mut bytes,
             Version::HTTP_11,
@@ -522,10 +562,12 @@ mod tests {
             ConnectionType::Close,
             &ServiceConfig::default(),
         );
-        assert_eq!(
-            bytes.take().freeze(),
-            Bytes::from_static(b"\r\nContent-Length: 0\r\nConnection: close\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n")
-        );
+        let data =
+            String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
+        assert!(data.contains("Content-Length: 0\r\n"));
+        assert!(data.contains("Connection: close\r\n"));
+        assert!(data.contains("Content-Type: plain/text\r\n"));
+        assert!(data.contains("Date: date\r\n"));
 
         let _ = head.encode_headers(
             &mut bytes,
@@ -534,10 +576,11 @@ mod tests {
             ConnectionType::KeepAlive,
             &ServiceConfig::default(),
         );
-        assert_eq!(
-            bytes.take().freeze(),
-            Bytes::from_static(b"\r\nTransfer-Encoding: chunked\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n")
-        );
+        let data =
+            String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
+        assert!(data.contains("Transfer-Encoding: chunked\r\n"));
+        assert!(data.contains("Content-Type: plain/text\r\n"));
+        assert!(data.contains("Date: date\r\n"));
 
         let _ = head.encode_headers(
             &mut bytes,
@@ -546,13 +589,21 @@ mod tests {
             ConnectionType::KeepAlive,
             &ServiceConfig::default(),
         );
-        assert_eq!(
-            bytes.take().freeze(),
-            Bytes::from_static(b"\r\nContent-Length: 100\r\nDate: date\r\nContent-Type: plain/text\r\n\r\n")
-        );
+        let data =
+            String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
+        assert!(data.contains("Content-Length: 100\r\n"));
+        assert!(data.contains("Content-Type: plain/text\r\n"));
+        assert!(data.contains("Date: date\r\n"));
 
+        let mut head = RequestHead::default();
+        head.set_camel_case_headers(false);
+        head.headers.insert(DATE, HeaderValue::from_static("date"));
+        head.headers
+            .insert(CONTENT_TYPE, HeaderValue::from_static("plain/text"));
         head.headers
             .append(CONTENT_TYPE, HeaderValue::from_static("xml"));
+
+        let mut head = RequestHeadType::Owned(head);
         let _ = head.encode_headers(
             &mut bytes,
             Version::HTTP_11,
@@ -560,22 +611,45 @@ mod tests {
             ConnectionType::KeepAlive,
             &ServiceConfig::default(),
         );
-        assert_eq!(
-            bytes.take().freeze(),
-            Bytes::from_static(b"\r\nTransfer-Encoding: chunked\r\nDate: date\r\nContent-Type: xml\r\nContent-Type: plain/text\r\n\r\n")
+        let data =
+            String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
+        assert!(data.contains("transfer-encoding: chunked\r\n"));
+        assert!(data.contains("content-type: xml\r\n"));
+        assert!(data.contains("content-type: plain/text\r\n"));
+        assert!(data.contains("date: date\r\n"));
+    }
+
+    #[test]
+    fn test_extra_headers() {
+        let mut bytes = BytesMut::with_capacity(2048);
+
+        let mut head = RequestHead::default();
+        head.headers.insert(
+            AUTHORIZATION,
+            HeaderValue::from_static("some authorization"),
         );
 
-        head.set_camel_case_headers(false);
+        let mut extra_headers = HeaderMap::new();
+        extra_headers.insert(
+            AUTHORIZATION,
+            HeaderValue::from_static("another authorization"),
+        );
+        extra_headers.insert(DATE, HeaderValue::from_static("date"));
+
+        let mut head = RequestHeadType::Rc(Rc::new(head), Some(extra_headers));
+
         let _ = head.encode_headers(
             &mut bytes,
             Version::HTTP_11,
-            BodySize::Stream,
-            ConnectionType::KeepAlive,
+            BodySize::Empty,
+            ConnectionType::Close,
             &ServiceConfig::default(),
         );
-        assert_eq!(
-            bytes.take().freeze(),
-            Bytes::from_static(b"\r\ntransfer-encoding: chunked\r\ndate: date\r\ncontent-type: xml\r\ncontent-type: plain/text\r\n\r\n")
-        );
+        let data =
+            String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
+        assert!(data.contains("content-length: 0\r\n"));
+        assert!(data.contains("connection: close\r\n"));
+        assert!(data.contains("authorization: another authorization\r\n"));
+        assert!(data.contains("date: date\r\n"));
     }
 }

actix-http/src/h1/expect.rs

@@ -1,23 +1,23 @@
-use actix_server_config::ServerConfig;
-use actix_service::{NewService, Service};
-use futures::future::{ok, FutureResult};
-use futures::{Async, Poll};
+use std::task::{Context, Poll};
+
+use actix_service::{Service, ServiceFactory};
+use futures_util::future::{ok, Ready};
 
 use crate::error::Error;
 use crate::request::Request;
 
 pub struct ExpectHandler;
 
-impl NewService for ExpectHandler {
-    type Config = ServerConfig;
+impl ServiceFactory for ExpectHandler {
+    type Config = ();
     type Request = Request;
     type Response = Request;
     type Error = Error;
     type Service = ExpectHandler;
     type InitError = Error;
-    type Future = FutureResult<Self::Service, Self::InitError>;
+    type Future = Ready<Result<Self::Service, Self::InitError>>;
 
-    fn new_service(&self, _: &ServerConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         ok(ExpectHandler)
     }
 }
@@ -26,10 +26,10 @@ impl Service for ExpectHandler {
     type Request = Request;
     type Response = Request;
     type Error = Error;
-    type Future = FutureResult<Self::Response, Self::Error>;
+    type Future = Ready<Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
+    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, req: Request) -> Self::Future {

actix-http/src/h1/payload.rs

@@ -1,12 +1,13 @@
 //! Payload stream
 use std::cell::RefCell;
 use std::collections::VecDeque;
+use std::pin::Pin;
 use std::rc::{Rc, Weak};
+use std::task::{Context, Poll};
 
+use actix_utils::task::LocalWaker;
 use bytes::Bytes;
-use futures::task::current as current_task;
-use futures::task::Task;
-use futures::{Async, Poll, Stream};
+use futures_core::Stream;
 
 use crate::error::PayloadError;
 
@@ -77,15 +78,24 @@ impl Payload {
     pub fn unread_data(&mut self, data: Bytes) {
         self.inner.borrow_mut().unread_data(data);
     }
+
+    #[inline]
+    pub fn readany(
+        &mut self,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, PayloadError>>> {
+        self.inner.borrow_mut().readany(cx)
+    }
 }
 
 impl Stream for Payload {
-    type Item = Bytes;
-    type Error = PayloadError;
+    type Item = Result<Bytes, PayloadError>;
 
-    #[inline]
-    fn poll(&mut self) -> Poll<Option<Bytes>, PayloadError> {
-        self.inner.borrow_mut().readany()
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, PayloadError>>> {
+        self.inner.borrow_mut().readany(cx)
     }
 }
 
@@ -117,19 +127,14 @@ impl PayloadSender {
     }
 
     #[inline]
-    pub fn need_read(&self) -> PayloadStatus {
+    pub fn need_read(&self, cx: &mut Context<'_>) -> PayloadStatus {
         // we check need_read only if Payload (other side) is alive,
         // otherwise always return true (consume payload)
         if let Some(shared) = self.inner.upgrade() {
             if shared.borrow().need_read {
                 PayloadStatus::Read
             } else {
-                #[cfg(not(test))]
-                {
-                    if shared.borrow_mut().io_task.is_none() {
-                        shared.borrow_mut().io_task = Some(current_task());
-                    }
-                }
+                shared.borrow_mut().io_task.register(cx.waker());
                 PayloadStatus::Pause
             }
         } else {
@@ -145,8 +150,8 @@ struct Inner {
     err: Option<PayloadError>,
     need_read: bool,
     items: VecDeque<Bytes>,
-    task: Option<Task>,
-    io_task: Option<Task>,
+    task: LocalWaker,
+    io_task: LocalWaker,
 }
 
 impl Inner {
@@ -157,8 +162,8 @@ impl Inner {
             err: None,
             items: VecDeque::new(),
             need_read: true,
-            task: None,
-            io_task: None,
+            task: LocalWaker::new(),
+            io_task: LocalWaker::new(),
         }
     }
 
@@ -178,7 +183,7 @@ impl Inner {
         self.items.push_back(data);
         self.need_read = self.len < MAX_BUFFER_SIZE;
         if let Some(task) = self.task.take() {
-            task.notify()
+            task.wake()
         }
     }
 
@@ -187,34 +192,28 @@ impl Inner {
         self.len
     }
 
-    fn readany(&mut self) -> Poll<Option<Bytes>, PayloadError> {
+    fn readany(
+        &mut self,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Result<Bytes, PayloadError>>> {
         if let Some(data) = self.items.pop_front() {
             self.len -= data.len();
             self.need_read = self.len < MAX_BUFFER_SIZE;
 
-            if self.need_read && self.task.is_none() && !self.eof {
-                self.task = Some(current_task());
+            if self.need_read && !self.eof {
+                self.task.register(cx.waker());
             }
-            if let Some(task) = self.io_task.take() {
-                task.notify()
-            }
-            Ok(Async::Ready(Some(data)))
+            self.io_task.wake();
+            Poll::Ready(Some(Ok(data)))
         } else if let Some(err) = self.err.take() {
-            Err(err)
+            Poll::Ready(Some(Err(err)))
         } else if self.eof {
-            Ok(Async::Ready(None))
+            Poll::Ready(None)
         } else {
             self.need_read = true;
-            #[cfg(not(test))]
-            {
-                if self.task.is_none() {
-                    self.task = Some(current_task());
-                }
-                if let Some(task) = self.io_task.take() {
-                    task.notify()
-                }
-            }
-            Ok(Async::NotReady)
+            self.task.register(cx.waker());
+            self.io_task.wake();
+            Poll::Pending
         }
     }
 
@@ -227,28 +226,19 @@ impl Inner {
 #[cfg(test)]
 mod tests {
     use super::*;
-    use actix_rt::Runtime;
-    use futures::future::{lazy, result};
+    use futures_util::future::poll_fn;
 
-    #[test]
-    fn test_unread_data() {
-        Runtime::new()
-            .unwrap()
-            .block_on(lazy(|| {
-                let (_, mut payload) = Payload::create(false);
+    #[actix_rt::test]
+    async fn test_unread_data() {
+        let (_, mut payload) = Payload::create(false);
 
-                payload.unread_data(Bytes::from("data"));
-                assert!(!payload.is_empty());
-                assert_eq!(payload.len(), 4);
+        payload.unread_data(Bytes::from("data"));
+        assert!(!payload.is_empty());
+        assert_eq!(payload.len(), 4);
 
-                assert_eq!(
-                    Async::Ready(Some(Bytes::from("data"))),
-                    payload.poll().ok().unwrap()
-                );
-
-                let res: Result<(), ()> = Ok(());
-                result(res)
-            }))
-            .unwrap();
+        assert_eq!(
+            Bytes::from("data"),
+            poll_fn(|cx| payload.readany(cx)).await.unwrap().unwrap()
+        );
     }
 }

actix-http/src/h1/service.rs

@@ -1,16 +1,21 @@
-use std::fmt;
+use std::future::Future;
 use std::marker::PhantomData;
+use std::pin::Pin;
+use std::rc::Rc;
+use std::task::{Context, Poll};
+use std::{fmt, net};
 
-use actix_codec::Framed;
-use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig};
-use actix_service::{IntoNewService, NewService, Service};
-use actix_utils::cloneable::CloneableService;
-use futures::future::{ok, FutureResult};
-use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream};
+use actix_codec::{AsyncRead, AsyncWrite, Framed};
+use actix_rt::net::TcpStream;
+use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
+use futures_core::ready;
+use futures_util::future::{ok, Ready};
 
 use crate::body::MessageBody;
-use crate::config::{KeepAlive, ServiceConfig};
+use crate::cloneable::CloneableService;
+use crate::config::ServiceConfig;
 use crate::error::{DispatchError, Error, ParseError};
+use crate::helpers::DataFactory;
 use crate::request::Request;
 use crate::response::Response;
 
@@ -18,59 +23,187 @@ use super::codec::Codec;
 use super::dispatcher::Dispatcher;
 use super::{ExpectHandler, Message, UpgradeHandler};
 
-/// `NewService` implementation for HTTP1 transport
-pub struct H1Service<T, P, S, B, X = ExpectHandler, U = UpgradeHandler<T>> {
+/// `ServiceFactory` implementation for HTTP1 transport
+pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler<T>> {
     srv: S,
     cfg: ServiceConfig,
     expect: X,
     upgrade: Option<U>,
-    _t: PhantomData<(T, P, B)>,
+    on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B> H1Service<T, P, S, B>
+impl<T, S, B> H1Service<T, S, B>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S: ServiceFactory<Config = (), Request = Request>,
     S::Error: Into<Error>,
     S::InitError: fmt::Debug,
     S::Response: Into<Response<B>>,
     B: MessageBody,
 {
-    /// Create new `HttpService` instance with default config.
-    pub fn new<F: IntoNewService<S>>(service: F) -> Self {
-        let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
-
-        H1Service {
-            cfg,
-            srv: service.into_new_service(),
-            expect: ExpectHandler,
-            upgrade: None,
-            _t: PhantomData,
-        }
-    }
-
     /// Create new `HttpService` instance with config.
-    pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self {
+    pub(crate) fn with_config<F: IntoServiceFactory<S>>(
+        cfg: ServiceConfig,
+        service: F,
+    ) -> Self {
         H1Service {
             cfg,
-            srv: service.into_new_service(),
+            srv: service.into_factory(),
             expect: ExpectHandler,
             upgrade: None,
+            on_connect: None,
             _t: PhantomData,
         }
     }
 }
 
-impl<T, P, S, B, X, U> H1Service<T, P, S, B, X, U>
+impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error>,
+    S::InitError: fmt::Debug,
+    S::Response: Into<Response<B>>,
+    B: MessageBody,
+    X: ServiceFactory<Config = (), Request = Request, Response = Request>,
+    X::Error: Into<Error>,
+    X::InitError: fmt::Debug,
+    U: ServiceFactory<
+        Config = (),
+        Request = (Request, Framed<TcpStream, Codec>),
+        Response = (),
+    >,
+    U::Error: fmt::Display + Into<Error>,
+    U::InitError: fmt::Debug,
+{
+    /// Create simple tcp stream service
+    pub fn tcp(
+        self,
+    ) -> impl ServiceFactory<
+        Config = (),
+        Request = TcpStream,
+        Response = (),
+        Error = DispatchError,
+        InitError = (),
+    > {
+        pipeline_factory(|io: TcpStream| {
+            let peer_addr = io.peer_addr().ok();
+            ok((io, peer_addr))
+        })
+        .and_then(self)
+    }
+}
+
+#[cfg(feature = "openssl")]
+mod openssl {
+    use super::*;
+
+    use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
+    use actix_tls::{openssl::HandshakeError, SslError};
+
+    impl<S, B, X, U> H1Service<SslStream<TcpStream>, S, B, X, U>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error>,
+        S::InitError: fmt::Debug,
+        S::Response: Into<Response<B>>,
+        B: MessageBody,
+        X: ServiceFactory<Config = (), Request = Request, Response = Request>,
+        X::Error: Into<Error>,
+        X::InitError: fmt::Debug,
+        U: ServiceFactory<
+            Config = (),
+            Request = (Request, Framed<SslStream<TcpStream>, Codec>),
+            Response = (),
+        >,
+        U::Error: fmt::Display + Into<Error>,
+        U::InitError: fmt::Debug,
+    {
+        /// Create openssl based service
+        pub fn openssl(
+            self,
+            acceptor: SslAcceptor,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = SslError<HandshakeError<TcpStream>, DispatchError>,
+            InitError = (),
+        > {
+            pipeline_factory(
+                Acceptor::new(acceptor)
+                    .map_err(SslError::Ssl)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(|io: SslStream<TcpStream>| {
+                let peer_addr = io.get_ref().peer_addr().ok();
+                ok((io, peer_addr))
+            })
+            .and_then(self.map_err(SslError::Service))
+        }
+    }
+}
+
+#[cfg(feature = "rustls")]
+mod rustls {
+    use super::*;
+    use actix_tls::rustls::{Acceptor, ServerConfig, TlsStream};
+    use actix_tls::SslError;
+    use std::{fmt, io};
+
+    impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error>,
+        S::InitError: fmt::Debug,
+        S::Response: Into<Response<B>>,
+        B: MessageBody,
+        X: ServiceFactory<Config = (), Request = Request, Response = Request>,
+        X::Error: Into<Error>,
+        X::InitError: fmt::Debug,
+        U: ServiceFactory<
+            Config = (),
+            Request = (Request, Framed<TlsStream<TcpStream>, Codec>),
+            Response = (),
+        >,
+        U::Error: fmt::Display + Into<Error>,
+        U::InitError: fmt::Debug,
+    {
+        /// Create rustls based service
+        pub fn rustls(
+            self,
+            config: ServerConfig,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = SslError<io::Error, DispatchError>,
+            InitError = (),
+        > {
+            pipeline_factory(
+                Acceptor::new(config)
+                    .map_err(SslError::Ssl)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(|io: TlsStream<TcpStream>| {
+                let peer_addr = io.get_ref().0.peer_addr().ok();
+                ok((io, peer_addr))
+            })
+            .and_then(self.map_err(SslError::Service))
+        }
+    }
+}
+
+impl<T, S, B, X, U> H1Service<T, S, B, X, U>
+where
+    S: ServiceFactory<Config = (), Request = Request>,
     S::Error: Into<Error>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
     B: MessageBody,
 {
-    pub fn expect<X1>(self, expect: X1) -> H1Service<T, P, S, B, X1, U>
+    pub fn expect<X1>(self, expect: X1) -> H1Service<T, S, B, X1, U>
     where
-        X1: NewService<Request = Request, Response = Request>,
+        X1: ServiceFactory<Request = Request, Response = Request>,
         X1::Error: Into<Error>,
         X1::InitError: fmt::Debug,
     {
@@ -79,13 +212,14 @@ where
             cfg: self.cfg,
             srv: self.srv,
             upgrade: self.upgrade,
+            on_connect: self.on_connect,
             _t: PhantomData,
         }
     }
 
-    pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, P, S, B, X, U1>
+    pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, S, B, X, U1>
     where
-        U1: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
+        U1: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
     {
@@ -94,45 +228,52 @@ where
             cfg: self.cfg,
             srv: self.srv,
             expect: self.expect,
+            on_connect: self.on_connect,
             _t: PhantomData,
         }
     }
+
+    /// Set on connect callback.
+    pub(crate) fn on_connect(
+        mut self,
+        f: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    ) -> Self {
+        self.on_connect = f;
+        self
+    }
 }
 
-impl<T, P, S, B, X, U> NewService for H1Service<T, P, S, B, X, U>
+impl<T, S, B, X, U> ServiceFactory for H1Service<T, S, B, X, U>
 where
-    T: IoStream,
-    S: NewService<Config = SrvConfig, Request = Request>,
+    T: AsyncRead + AsyncWrite + Unpin,
+    S: ServiceFactory<Config = (), Request = Request>,
     S::Error: Into<Error>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
     B: MessageBody,
-    X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+    X: ServiceFactory<Config = (), Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<
-        Config = SrvConfig,
-        Request = (Request, Framed<T, Codec>),
-        Response = (),
-    >,
-    U::Error: fmt::Display,
+    U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
+    U::Error: fmt::Display + Into<Error>,
     U::InitError: fmt::Debug,
 {
-    type Config = SrvConfig;
-    type Request = Io<T, P>;
+    type Config = ();
+    type Request = (T, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type InitError = ();
-    type Service = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
-    type Future = H1ServiceResponse<T, P, S, B, X, U>;
+    type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
+    type Future = H1ServiceResponse<T, S, B, X, U>;
 
-    fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         H1ServiceResponse {
-            fut: self.srv.new_service(cfg).into_future(),
-            fut_ex: Some(self.expect.new_service(cfg)),
-            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(cfg)),
+            fut: self.srv.new_service(()),
+            fut_ex: Some(self.expect.new_service(())),
+            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
             expect: None,
             upgrade: None,
+            on_connect: self.on_connect.clone(),
             cfg: Some(self.cfg.clone()),
             _t: PhantomData,
         }
@@ -140,85 +281,99 @@ where
 }
 
 #[doc(hidden)]
-pub struct H1ServiceResponse<T, P, S, B, X, U>
+#[pin_project::pin_project]
+pub struct H1ServiceResponse<T, S, B, X, U>
 where
-    S: NewService<Request = Request>,
+    S: ServiceFactory<Request = Request>,
     S::Error: Into<Error>,
     S::InitError: fmt::Debug,
-    X: NewService<Request = Request, Response = Request>,
+    X: ServiceFactory<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
+    U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
 {
+    #[pin]
     fut: S::Future,
+    #[pin]
     fut_ex: Option<X::Future>,
+    #[pin]
     fut_upg: Option<U::Future>,
     expect: Option<X::Service>,
     upgrade: Option<U::Service>,
+    on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
     cfg: Option<ServiceConfig>,
-    _t: PhantomData<(T, P, B)>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B, X, U> Future for H1ServiceResponse<T, P, S, B, X, U>
+impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
 where
-    T: IoStream,
-    S: NewService<Request = Request>,
+    T: AsyncRead + AsyncWrite + Unpin,
+    S: ServiceFactory<Request = Request>,
     S::Error: Into<Error>,
     S::Response: Into<Response<B>>,
     S::InitError: fmt::Debug,
     B: MessageBody,
-    X: NewService<Request = Request, Response = Request>,
+    X: ServiceFactory<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
+    U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
 {
-    type Item = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
-    type Error = ();
+    type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        if let Some(ref mut fut) = self.fut_ex {
-            let expect = try_ready!(fut
-                .poll()
-                .map_err(|e| log::error!("Init http service error: {:?}", e)));
-            self.expect = Some(expect);
-            self.fut_ex.take();
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let mut this = self.as_mut().project();
+
+        if let Some(fut) = this.fut_ex.as_pin_mut() {
+            let expect = ready!(fut
+                .poll(cx)
+                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
+            this = self.as_mut().project();
+            *this.expect = Some(expect);
+            this.fut_ex.set(None);
         }
 
-        if let Some(ref mut fut) = self.fut_upg {
-            let upgrade = try_ready!(fut
-                .poll()
-                .map_err(|e| log::error!("Init http service error: {:?}", e)));
-            self.upgrade = Some(upgrade);
-            self.fut_ex.take();
+        if let Some(fut) = this.fut_upg.as_pin_mut() {
+            let upgrade = ready!(fut
+                .poll(cx)
+                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
+            this = self.as_mut().project();
+            *this.upgrade = Some(upgrade);
+            this.fut_ex.set(None);
         }
 
-        let service = try_ready!(self
+        let result = ready!(this
             .fut
-            .poll()
+            .poll(cx)
             .map_err(|e| log::error!("Init http service error: {:?}", e)));
-        Ok(Async::Ready(H1ServiceHandler::new(
-            self.cfg.take().unwrap(),
-            service,
-            self.expect.take().unwrap(),
-            self.upgrade.take(),
-        )))
+
+        Poll::Ready(result.map(|service| {
+            let this = self.as_mut().project();
+            H1ServiceHandler::new(
+                this.cfg.take().unwrap(),
+                service,
+                this.expect.take().unwrap(),
+                this.upgrade.take(),
+                this.on_connect.clone(),
+            )
+        }))
     }
 }
 
 /// `Service` implementation for HTTP1 transport
-pub struct H1ServiceHandler<T, P, S, B, X, U> {
+pub struct H1ServiceHandler<T, S: Service, B, X: Service, U: Service> {
     srv: CloneableService<S>,
     expect: CloneableService<X>,
     upgrade: Option<CloneableService<U>>,
+    on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
     cfg: ServiceConfig,
-    _t: PhantomData<(T, P, B)>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B, X, U> H1ServiceHandler<T, P, S, B, X, U>
+impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
 where
     S: Service<Request = Request>,
     S::Error: Into<Error>,
@@ -234,20 +389,22 @@ where
         srv: S,
         expect: X,
         upgrade: Option<U>,
-    ) -> H1ServiceHandler<T, P, S, B, X, U> {
+        on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    ) -> H1ServiceHandler<T, S, B, X, U> {
         H1ServiceHandler {
             srv: CloneableService::new(srv),
             expect: CloneableService::new(expect),
-            upgrade: upgrade.map(|s| CloneableService::new(s)),
+            upgrade: upgrade.map(CloneableService::new),
             cfg,
+            on_connect,
             _t: PhantomData,
         }
     }
 }
 
-impl<T, P, S, B, X, U> Service for H1ServiceHandler<T, P, S, B, X, U>
+impl<T, S, B, X, U> Service for H1ServiceHandler<T, S, B, X, U>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
     S::Error: Into<Error>,
     S::Response: Into<Response<B>>,
@@ -255,17 +412,17 @@ where
     X: Service<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     U: Service<Request = (Request, Framed<T, Codec>), Response = ()>,
-    U::Error: fmt::Display,
+    U::Error: fmt::Display + Into<Error>,
 {
-    type Request = Io<T, P>;
+    type Request = (T, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type Future = Dispatcher<T, S, B, X, U>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
         let ready = self
             .expect
-            .poll_ready()
+            .poll_ready(cx)
             .map_err(|e| {
                 let e = e.into();
                 log::error!("Http service readiness error: {:?}", e);
@@ -275,7 +432,7 @@ where
 
         let ready = self
             .srv
-            .poll_ready()
+            .poll_ready(cx)
             .map_err(|e| {
                 let e = e.into();
                 log::error!("Http service readiness error: {:?}", e);
@@ -284,34 +441,55 @@ where
             .is_ready()
             && ready;
 
-        if ready {
-            Ok(Async::Ready(()))
+        let ready = if let Some(ref mut upg) = self.upgrade {
+            upg.poll_ready(cx)
+                .map_err(|e| {
+                    let e = e.into();
+                    log::error!("Http service readiness error: {:?}", e);
+                    DispatchError::Service(e)
+                })?
+                .is_ready()
+                && ready
         } else {
-            Ok(Async::NotReady)
+            ready
+        };
+
+        if ready {
+            Poll::Ready(Ok(()))
+        } else {
+            Poll::Pending
         }
     }
 
-    fn call(&mut self, req: Self::Request) -> Self::Future {
+    fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
+        let on_connect = if let Some(ref on_connect) = self.on_connect {
+            Some(on_connect(&io))
+        } else {
+            None
+        };
+
         Dispatcher::new(
-            req.into_parts().0,
+            io,
             self.cfg.clone(),
             self.srv.clone(),
             self.expect.clone(),
             self.upgrade.clone(),
+            on_connect,
+            addr,
         )
     }
 }
 
-/// `NewService` implementation for `OneRequestService` service
+/// `ServiceFactory` implementation for `OneRequestService` service
 #[derive(Default)]
-pub struct OneRequest<T, P> {
+pub struct OneRequest<T> {
     config: ServiceConfig,
-    _t: PhantomData<(T, P)>,
+    _t: PhantomData<T>,
 }
 
-impl<T, P> OneRequest<T, P>
+impl<T> OneRequest<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
     /// Create new `H1SimpleService` instance.
     pub fn new() -> Self {
@@ -322,52 +500,49 @@ where
     }
 }
 
-impl<T, P> NewService for OneRequest<T, P>
+impl<T> ServiceFactory for OneRequest<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
-    type Config = SrvConfig;
-    type Request = Io<T, P>;
+    type Config = ();
+    type Request = T;
     type Response = (Request, Framed<T, Codec>);
     type Error = ParseError;
     type InitError = ();
-    type Service = OneRequestService<T, P>;
-    type Future = FutureResult<Self::Service, Self::InitError>;
+    type Service = OneRequestService<T>;
+    type Future = Ready<Result<Self::Service, Self::InitError>>;
 
-    fn new_service(&self, _: &SrvConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         ok(OneRequestService {
-            config: self.config.clone(),
             _t: PhantomData,
+            config: self.config.clone(),
         })
     }
 }
 
 /// `Service` implementation for HTTP1 transport. Reads one request and returns
 /// request and framed object.
-pub struct OneRequestService<T, P> {
+pub struct OneRequestService<T> {
+    _t: PhantomData<T>,
     config: ServiceConfig,
-    _t: PhantomData<(T, P)>,
 }
 
-impl<T, P> Service for OneRequestService<T, P>
+impl<T> Service for OneRequestService<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
-    type Request = Io<T, P>;
+    type Request = T;
     type Response = (Request, Framed<T, Codec>);
     type Error = ParseError;
     type Future = OneRequestServiceResponse<T>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
+    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, req: Self::Request) -> Self::Future {
         OneRequestServiceResponse {
-            framed: Some(Framed::new(
-                req.into_parts().0,
-                Codec::new(self.config.clone()),
-            )),
+            framed: Some(Framed::new(req, Codec::new(self.config.clone()))),
         }
     }
 }
@@ -375,28 +550,28 @@ where
 #[doc(hidden)]
 pub struct OneRequestServiceResponse<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
     framed: Option<Framed<T, Codec>>,
 }
 
 impl<T> Future for OneRequestServiceResponse<T>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
 {
-    type Item = (Request, Framed<T, Codec>);
-    type Error = ParseError;
+    type Output = Result<(Request, Framed<T, Codec>), ParseError>;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        match self.framed.as_mut().unwrap().poll()? {
-            Async::Ready(Some(req)) => match req {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        match self.framed.as_mut().unwrap().next_item(cx) {
+            Poll::Ready(Some(Ok(req))) => match req {
                 Message::Item(req) => {
-                    Ok(Async::Ready((req, self.framed.take().unwrap())))
+                    Poll::Ready(Ok((req, self.framed.take().unwrap())))
                 }
                 Message::Chunk(_) => unreachable!("Something is wrong"),
             },
-            Async::Ready(None) => Err(ParseError::Incomplete),
-            Async::NotReady => Ok(Async::NotReady),
+            Poll::Ready(Some(Err(err))) => Poll::Ready(Err(err)),
+            Poll::Ready(None) => Poll::Ready(Err(ParseError::Incomplete)),
+            Poll::Pending => Poll::Pending,
         }
     }
 }

actix-http/src/h1/upgrade.rs

@@ -1,10 +1,9 @@
 use std::marker::PhantomData;
+use std::task::{Context, Poll};
 
 use actix_codec::Framed;
-use actix_server_config::ServerConfig;
-use actix_service::{NewService, Service};
-use futures::future::FutureResult;
-use futures::{Async, Poll};
+use actix_service::{Service, ServiceFactory};
+use futures_util::future::Ready;
 
 use crate::error::Error;
 use crate::h1::Codec;
@@ -12,16 +11,16 @@ use crate::request::Request;
 
 pub struct UpgradeHandler<T>(PhantomData<T>);
 
-impl<T> NewService for UpgradeHandler<T> {
-    type Config = ServerConfig;
+impl<T> ServiceFactory for UpgradeHandler<T> {
+    type Config = ();
     type Request = (Request, Framed<T, Codec>);
     type Response = ();
     type Error = Error;
     type Service = UpgradeHandler<T>;
     type InitError = Error;
-    type Future = FutureResult<Self::Service, Self::InitError>;
+    type Future = Ready<Result<Self::Service, Self::InitError>>;
 
-    fn new_service(&self, _: &ServerConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         unimplemented!()
     }
 }
@@ -30,10 +29,10 @@ impl<T> Service for UpgradeHandler<T> {
     type Request = (Request, Framed<T, Codec>);
     type Response = ();
     type Error = Error;
-    type Future = FutureResult<Self::Response, Self::Error>;
+    type Future = Ready<Result<Self::Response, Self::Error>>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        Ok(Async::Ready(()))
+    fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        Poll::Ready(Ok(()))
     }
 
     fn call(&mut self, _: Self::Request) -> Self::Future {

actix-http/src/h1/utils.rs

@@ -1,5 +1,8 @@
+use std::future::Future;
+use std::pin::Pin;
+use std::task::{Context, Poll};
+
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use futures::{Async, Future, Poll, Sink};
 
 use crate::body::{BodySize, MessageBody, ResponseBody};
 use crate::error::Error;
@@ -7,8 +10,10 @@ use crate::h1::{Codec, Message};
 use crate::response::Response;
 
 /// Send http/1 response
+#[pin_project::pin_project]
 pub struct SendResponse<T, B> {
     res: Option<Message<(Response<()>, BodySize)>>,
+    #[pin]
     body: Option<ResponseBody<B>>,
     framed: Option<Framed<T, Codec>>,
 }
@@ -31,62 +36,66 @@ where
 impl<T, B> Future for SendResponse<T, B>
 where
     T: AsyncRead + AsyncWrite,
-    B: MessageBody,
+    B: MessageBody + Unpin,
 {
-    type Item = Framed<T, Codec>;
-    type Error = Error;
+    type Output = Result<Framed<T, Codec>, Error>;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    // TODO: rethink if we need loops in polls
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let mut this = self.project();
+
+        let mut body_done = this.body.is_none();
         loop {
-            let mut body_ready = self.body.is_some();
-            let framed = self.framed.as_mut().unwrap();
+            let mut body_ready = !body_done;
+            let framed = this.framed.as_mut().unwrap();
 
             // send body
-            if self.res.is_none() && self.body.is_some() {
-                while body_ready && self.body.is_some() && !framed.is_write_buf_full() {
-                    match self.body.as_mut().unwrap().poll_next()? {
-                        Async::Ready(item) => {
-                            // body is done
-                            if item.is_none() {
-                                let _ = self.body.take();
+            if this.res.is_none() && body_ready {
+                while body_ready && !body_done && !framed.is_write_buf_full() {
+                    match this.body.as_mut().as_pin_mut().unwrap().poll_next(cx)? {
+                        Poll::Ready(item) => {
+                            // body is done when item is None
+                            body_done = item.is_none();
+                            if body_done {
+                                let _ = this.body.take();
                             }
-                            framed.force_send(Message::Chunk(item))?;
+                            framed.write(Message::Chunk(item))?;
                         }
-                        Async::NotReady => body_ready = false,
+                        Poll::Pending => body_ready = false,
                     }
                 }
             }
 
             // flush write buffer
             if !framed.is_write_buf_empty() {
-                match framed.poll_complete()? {
-                    Async::Ready(_) => {
+                match framed.flush(cx)? {
+                    Poll::Ready(_) => {
                         if body_ready {
                             continue;
                         } else {
-                            return Ok(Async::NotReady);
+                            return Poll::Pending;
                         }
                     }
-                    Async::NotReady => return Ok(Async::NotReady),
+                    Poll::Pending => return Poll::Pending,
                 }
             }
 
             // send response
-            if let Some(res) = self.res.take() {
-                framed.force_send(res)?;
+            if let Some(res) = this.res.take() {
+                framed.write(res)?;
                 continue;
             }
 
-            if self.body.is_some() {
+            if !body_done {
                 if body_ready {
                     continue;
                 } else {
-                    return Ok(Async::NotReady);
+                    return Poll::Pending;
                 }
             } else {
                 break;
             }
         }
-        Ok(Async::Ready(self.framed.take().unwrap()))
+        Poll::Ready(Ok(this.framed.take().unwrap()))
     }
 }

actix-http/src/h2/dispatcher.rs

@@ -1,27 +1,25 @@
-use std::collections::VecDeque;
+use std::convert::TryFrom;
+use std::future::Future;
 use std::marker::PhantomData;
-use std::time::Instant;
-use std::{fmt, mem, net};
+use std::net;
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite};
-use actix_server_config::IoStream;
+use actix_rt::time::{Delay, Instant};
 use actix_service::Service;
-use actix_utils::cloneable::CloneableService;
-use bitflags::bitflags;
 use bytes::{Bytes, BytesMut};
-use futures::{try_ready, Async, Future, Poll, Sink, Stream};
 use h2::server::{Connection, SendResponse};
-use h2::{RecvStream, SendStream};
-use http::header::{
-    HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING,
-};
-use http::HttpTryFrom;
-use log::{debug, error, trace};
-use tokio_timer::Delay;
+use h2::SendStream;
+use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
+use log::{error, trace};
 
-use crate::body::{Body, BodySize, MessageBody, ResponseBody};
+use crate::body::{BodySize, MessageBody, ResponseBody};
+use crate::cloneable::CloneableService;
 use crate::config::ServiceConfig;
-use crate::error::{DispatchError, Error, ParseError, PayloadError, ResponseError};
+use crate::error::{DispatchError, Error};
+use crate::helpers::DataFactory;
+use crate::httpmessage::HttpMessage;
 use crate::message::ResponseHead;
 use crate::payload::Payload;
 use crate::request::Request;
@@ -30,9 +28,14 @@ use crate::response::Response;
 const CHUNK_SIZE: usize = 16_384;
 
 /// Dispatcher for HTTP/2 protocol
-pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody> {
+#[pin_project::pin_project]
+pub struct Dispatcher<T, S: Service<Request = Request>, B: MessageBody>
+where
+    T: AsyncRead + AsyncWrite + Unpin,
+{
     service: CloneableService<S>,
     connection: Connection<T, Bytes>,
+    on_connect: Option<Box<dyn DataFactory>>,
     config: ServiceConfig,
     peer_addr: Option<net::SocketAddr>,
     ka_expire: Instant,
@@ -42,16 +45,17 @@ pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody
 
 impl<T, S, B> Dispatcher<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
     S::Error: Into<Error>,
-    S::Future: 'static,
+    // S::Future: 'static,
     S::Response: Into<Response<B>>,
-    B: MessageBody + 'static,
+    B: MessageBody,
 {
-    pub fn new(
+    pub(crate) fn new(
         service: CloneableService<S>,
         connection: Connection<T, Bytes>,
+        on_connect: Option<Box<dyn DataFactory>>,
         config: ServiceConfig,
         timeout: Option<Delay>,
         peer_addr: Option<net::SocketAddr>,
@@ -77,6 +81,7 @@ where
             config,
             peer_addr,
             connection,
+            on_connect,
             ka_expire,
             ka_timer,
             _t: PhantomData,
@@ -86,70 +91,92 @@ where
 
 impl<T, S, B> Future for Dispatcher<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
 {
-    type Item = ();
-    type Error = DispatchError;
+    type Output = Result<(), DispatchError>;
 
     #[inline]
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let this = self.get_mut();
+
         loop {
-            match self.connection.poll()? {
-                Async::Ready(None) => return Ok(Async::Ready(())),
-                Async::Ready(Some((req, res))) => {
+            match Pin::new(&mut this.connection).poll_accept(cx) {
+                Poll::Ready(None) => return Poll::Ready(Ok(())),
+                Poll::Ready(Some(Err(err))) => return Poll::Ready(Err(err.into())),
+                Poll::Ready(Some(Ok((req, res)))) => {
                     // update keep-alive expire
-                    if self.ka_timer.is_some() {
-                        if let Some(expire) = self.config.keep_alive_expire() {
-                            self.ka_expire = expire;
+                    if this.ka_timer.is_some() {
+                        if let Some(expire) = this.config.keep_alive_expire() {
+                            this.ka_expire = expire;
                         }
                     }
 
                     let (parts, body) = req.into_parts();
-                    let mut req = Request::with_payload(body.into());
+                    let mut req = Request::with_payload(Payload::<
+                        crate::payload::PayloadStream,
+                    >::H2(
+                        crate::h2::Payload::new(body)
+                    ));
 
                     let head = &mut req.head_mut();
                     head.uri = parts.uri;
                     head.method = parts.method;
                     head.version = parts.version;
                     head.headers = parts.headers.into();
-                    head.peer_addr = self.peer_addr;
-                    tokio_current_thread::spawn(ServiceResponse::<S::Future, B> {
+                    head.peer_addr = this.peer_addr;
+
+                    // set on_connect data
+                    if let Some(ref on_connect) = this.on_connect {
+                        on_connect.set(&mut req.extensions_mut());
+                    }
+
+                    actix_rt::spawn(ServiceResponse::<
+                        S::Future,
+                        S::Response,
+                        S::Error,
+                        B,
+                    > {
                         state: ServiceResponseState::ServiceCall(
-                            self.service.call(req),
+                            this.service.call(req),
                             Some(res),
                         ),
-                        config: self.config.clone(),
+                        config: this.config.clone(),
                         buffer: None,
-                    })
+                        _t: PhantomData,
+                    });
                 }
-                Async::NotReady => return Ok(Async::NotReady),
+                Poll::Pending => return Poll::Pending,
             }
         }
     }
 }
 
-struct ServiceResponse<F, B> {
+#[pin_project::pin_project]
+struct ServiceResponse<F, I, E, B> {
+    #[pin]
     state: ServiceResponseState<F, B>,
     config: ServiceConfig,
     buffer: Option<Bytes>,
+    _t: PhantomData<(I, E)>,
 }
 
+#[pin_project::pin_project]
 enum ServiceResponseState<F, B> {
-    ServiceCall(F, Option<SendResponse<Bytes>>),
-    SendPayload(SendStream<Bytes>, ResponseBody<B>),
+    ServiceCall(#[pin] F, Option<SendResponse<Bytes>>),
+    SendPayload(SendStream<Bytes>, #[pin] ResponseBody<B>),
 }
 
-impl<F, B> ServiceResponse<F, B>
+impl<F, I, E, B> ServiceResponse<F, I, E, B>
 where
-    F: Future,
-    F::Error: Into<Error>,
-    F::Item: Into<Response<B>>,
-    B: MessageBody + 'static,
+    F: Future<Output = Result<I, E>>,
+    E: Into<Error>,
+    I: Into<Response<B>>,
+    B: MessageBody,
 {
     fn prepare_response(
         &self,
@@ -204,117 +231,128 @@ where
         if !has_date {
             let mut bytes = BytesMut::with_capacity(29);
             self.config.set_date_header(&mut bytes);
-            res.headers_mut()
-                .insert(DATE, HeaderValue::try_from(bytes.freeze()).unwrap());
+            res.headers_mut().insert(DATE, unsafe {
+                HeaderValue::from_maybe_shared_unchecked(bytes.freeze())
+            });
         }
 
         res
     }
 }
 
-impl<F, B> Future for ServiceResponse<F, B>
+impl<F, I, E, B> Future for ServiceResponse<F, I, E, B>
 where
-    F: Future,
-    F::Error: Into<Error>,
-    F::Item: Into<Response<B>>,
-    B: MessageBody + 'static,
+    F: Future<Output = Result<I, E>>,
+    E: Into<Error>,
+    I: Into<Response<B>>,
+    B: MessageBody,
 {
-    type Item = ();
-    type Error = ();
+    type Output = ();
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        match self.state {
-            ServiceResponseState::ServiceCall(ref mut call, ref mut send) => {
-                match call.poll() {
-                    Ok(Async::Ready(res)) => {
-                        let (res, body) = res.into().replace_body(());
+    #[pin_project::project]
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let mut this = self.as_mut().project();
 
-                        let mut send = send.take().unwrap();
-                        let mut size = body.size();
-                        let h2_res = self.prepare_response(res.head(), &mut size);
+        #[project]
+        match this.state.project() {
+            ServiceResponseState::ServiceCall(call, send) => match call.poll(cx) {
+                Poll::Ready(Ok(res)) => {
+                    let (res, body) = res.into().replace_body(());
 
-                        let stream =
-                            send.send_response(h2_res, size.is_eof()).map_err(|e| {
-                                trace!("Error sending h2 response: {:?}", e);
-                            })?;
+                    let mut send = send.take().unwrap();
+                    let mut size = body.size();
+                    let h2_res = self.as_mut().prepare_response(res.head(), &mut size);
+                    this = self.as_mut().project();
 
-                        if size.is_eof() {
-                            Ok(Async::Ready(()))
-                        } else {
-                            self.state = ServiceResponseState::SendPayload(stream, body);
-                            self.poll()
+                    let stream = match send.send_response(h2_res, size.is_eof()) {
+                        Err(e) => {
+                            trace!("Error sending h2 response: {:?}", e);
+                            return Poll::Ready(());
                         }
-                    }
-                    Ok(Async::NotReady) => Ok(Async::NotReady),
-                    Err(_e) => {
-                        let res: Response = Response::InternalServerError().finish();
-                        let (res, body) = res.replace_body(());
+                        Ok(stream) => stream,
+                    };
 
-                        let mut send = send.take().unwrap();
-                        let mut size = body.size();
-                        let h2_res = self.prepare_response(res.head(), &mut size);
-
-                        let stream =
-                            send.send_response(h2_res, size.is_eof()).map_err(|e| {
-                                trace!("Error sending h2 response: {:?}", e);
-                            })?;
-
-                        if size.is_eof() {
-                            Ok(Async::Ready(()))
-                        } else {
-                            self.state = ServiceResponseState::SendPayload(
-                                stream,
-                                body.into_body(),
-                            );
-                            self.poll()
-                        }
+                    if size.is_eof() {
+                        Poll::Ready(())
+                    } else {
+                        this.state
+                            .set(ServiceResponseState::SendPayload(stream, body));
+                        self.poll(cx)
                     }
                 }
-            }
+                Poll::Pending => Poll::Pending,
+                Poll::Ready(Err(e)) => {
+                    let res: Response = e.into().into();
+                    let (res, body) = res.replace_body(());
+
+                    let mut send = send.take().unwrap();
+                    let mut size = body.size();
+                    let h2_res = self.as_mut().prepare_response(res.head(), &mut size);
+                    this = self.as_mut().project();
+
+                    let stream = match send.send_response(h2_res, size.is_eof()) {
+                        Err(e) => {
+                            trace!("Error sending h2 response: {:?}", e);
+                            return Poll::Ready(());
+                        }
+                        Ok(stream) => stream,
+                    };
+
+                    if size.is_eof() {
+                        Poll::Ready(())
+                    } else {
+                        this.state.set(ServiceResponseState::SendPayload(
+                            stream,
+                            body.into_body(),
+                        ));
+                        self.poll(cx)
+                    }
+                }
+            },
             ServiceResponseState::SendPayload(ref mut stream, ref mut body) => loop {
                 loop {
-                    if let Some(ref mut buffer) = self.buffer {
-                        match stream.poll_capacity().map_err(|e| warn!("{:?}", e))? {
-                            Async::NotReady => return Ok(Async::NotReady),
-                            Async::Ready(None) => return Ok(Async::Ready(())),
-                            Async::Ready(Some(cap)) => {
+                    if let Some(ref mut buffer) = this.buffer {
+                        match stream.poll_capacity(cx) {
+                            Poll::Pending => return Poll::Pending,
+                            Poll::Ready(None) => return Poll::Ready(()),
+                            Poll::Ready(Some(Ok(cap))) => {
                                 let len = buffer.len();
                                 let bytes = buffer.split_to(std::cmp::min(cap, len));
 
                                 if let Err(e) = stream.send_data(bytes, false) {
                                     warn!("{:?}", e);
-                                    return Err(());
+                                    return Poll::Ready(());
                                 } else if !buffer.is_empty() {
                                     let cap = std::cmp::min(buffer.len(), CHUNK_SIZE);
                                     stream.reserve_capacity(cap);
                                 } else {
-                                    self.buffer.take();
+                                    this.buffer.take();
                                 }
                             }
+                            Poll::Ready(Some(Err(e))) => {
+                                warn!("{:?}", e);
+                                return Poll::Ready(());
+                            }
                         }
                     } else {
-                        match body.poll_next() {
-                            Ok(Async::NotReady) => {
-                                return Ok(Async::NotReady);
-                            }
-                            Ok(Async::Ready(None)) => {
+                        match body.as_mut().poll_next(cx) {
+                            Poll::Pending => return Poll::Pending,
+                            Poll::Ready(None) => {
                                 if let Err(e) = stream.send_data(Bytes::new(), true) {
                                     warn!("{:?}", e);
-                                    return Err(());
-                                } else {
-                                    return Ok(Async::Ready(()));
                                 }
+                                return Poll::Ready(());
                             }
-                            Ok(Async::Ready(Some(chunk))) => {
+                            Poll::Ready(Some(Ok(chunk))) => {
                                 stream.reserve_capacity(std::cmp::min(
                                     chunk.len(),
                                     CHUNK_SIZE,
                                 ));
-                                self.buffer = Some(chunk);
+                                *this.buffer = Some(chunk);
                             }
-                            Err(e) => {
+                            Poll::Ready(Some(Err(e))) => {
                                 error!("Response payload stream error: {:?}", e);
-                                return Err(());
+                                return Poll::Ready(());
                             }
                         }
                     }

actix-http/src/h2/mod.rs

@@ -1,9 +1,9 @@
-#![allow(dead_code, unused_imports)]
-
-use std::fmt;
+//! HTTP/2 implementation
+use std::pin::Pin;
+use std::task::{Context, Poll};
 
 use bytes::Bytes;
-use futures::{Async, Poll, Stream};
+use futures_core::Stream;
 use h2::RecvStream;
 
 mod dispatcher;
@@ -25,22 +25,26 @@ impl Payload {
 }
 
 impl Stream for Payload {
-    type Item = Bytes;
-    type Error = PayloadError;
+    type Item = Result<Bytes, PayloadError>;
 
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
-        match self.pl.poll() {
-            Ok(Async::Ready(Some(chunk))) => {
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        let this = self.get_mut();
+
+        match Pin::new(&mut this.pl).poll_data(cx) {
+            Poll::Ready(Some(Ok(chunk))) => {
                 let len = chunk.len();
-                if let Err(err) = self.pl.release_capacity().release_capacity(len) {
-                    Err(err.into())
+                if let Err(err) = this.pl.flow_control().release_capacity(len) {
+                    Poll::Ready(Some(Err(err.into())))
                 } else {
-                    Ok(Async::Ready(Some(chunk)))
+                    Poll::Ready(Some(Ok(chunk)))
                 }
             }
-            Ok(Async::Ready(None)) => Ok(Async::Ready(None)),
-            Ok(Async::NotReady) => Ok(Async::NotReady),
-            Err(err) => Err(err.into()),
+            Poll::Ready(Some(Err(err))) => Poll::Ready(Some(Err(err.into()))),
+            Poll::Pending => Poll::Pending,
+            Poll::Ready(None) => Poll::Ready(None),
         }
     }
 }

actix-http/src/h2/service.rs

@@ -1,179 +1,322 @@
-use std::fmt::Debug;
+use std::future::Future;
 use std::marker::PhantomData;
-use std::{io, net};
+use std::pin::Pin;
+use std::task::{Context, Poll};
+use std::{net, rc};
 
-use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig};
-use actix_service::{IntoNewService, NewService, Service};
-use actix_utils::cloneable::CloneableService;
+use actix_codec::{AsyncRead, AsyncWrite};
+use actix_rt::net::TcpStream;
+use actix_service::{
+    fn_factory, fn_service, pipeline_factory, IntoServiceFactory, Service,
+    ServiceFactory,
+};
 use bytes::Bytes;
-use futures::future::{ok, FutureResult};
-use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream};
-use h2::server::{self, Connection, Handshake};
-use h2::RecvStream;
+use futures_core::ready;
+use futures_util::future::ok;
+use h2::server::{self, Handshake};
 use log::error;
 
 use crate::body::MessageBody;
-use crate::config::{KeepAlive, ServiceConfig};
-use crate::error::{DispatchError, Error, ParseError, ResponseError};
-use crate::payload::Payload;
+use crate::cloneable::CloneableService;
+use crate::config::ServiceConfig;
+use crate::error::{DispatchError, Error};
+use crate::helpers::DataFactory;
 use crate::request::Request;
 use crate::response::Response;
 
 use super::dispatcher::Dispatcher;
 
-/// `NewService` implementation for HTTP2 transport
-pub struct H2Service<T, P, S, B> {
+/// `ServiceFactory` implementation for HTTP2 transport
+pub struct H2Service<T, S, B> {
     srv: S,
     cfg: ServiceConfig,
-    _t: PhantomData<(T, P, B)>,
+    on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B> H2Service<T, P, S, B>
+impl<T, S, B> H2Service<T, S, B>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
-    S::Response: Into<Response<B>>,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
+    S::Response: Into<Response<B>> + 'static,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
 {
-    /// Create new `HttpService` instance.
-    pub fn new<F: IntoNewService<S>>(service: F) -> Self {
-        let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
-
-        H2Service {
-            cfg,
-            srv: service.into_new_service(),
-            _t: PhantomData,
-        }
-    }
-
     /// Create new `HttpService` instance with config.
-    pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self {
+    pub(crate) fn with_config<F: IntoServiceFactory<S>>(
+        cfg: ServiceConfig,
+        service: F,
+    ) -> Self {
         H2Service {
             cfg,
-            srv: service.into_new_service(),
+            on_connect: None,
+            srv: service.into_factory(),
             _t: PhantomData,
         }
     }
+
+    /// Set on connect callback.
+    pub(crate) fn on_connect(
+        mut self,
+        f: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    ) -> Self {
+        self.on_connect = f;
+        self
+    }
+}
+
+impl<S, B> H2Service<TcpStream, S, B>
+where
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
+    S::Response: Into<Response<B>> + 'static,
+    <S::Service as Service>::Future: 'static,
+    B: MessageBody + 'static,
+{
+    /// Create simple tcp based service
+    pub fn tcp(
+        self,
+    ) -> impl ServiceFactory<
+        Config = (),
+        Request = TcpStream,
+        Response = (),
+        Error = DispatchError,
+        InitError = S::InitError,
+    > {
+        pipeline_factory(fn_factory(|| async {
+            Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
+                let peer_addr = io.peer_addr().ok();
+                ok::<_, DispatchError>((io, peer_addr))
+            }))
+        }))
+        .and_then(self)
+    }
+}
+
+#[cfg(feature = "openssl")]
+mod openssl {
+    use actix_service::{fn_factory, fn_service};
+    use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
+    use actix_tls::{openssl::HandshakeError, SslError};
+
+    use super::*;
+
+    impl<S, B> H2Service<SslStream<TcpStream>, S, B>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error> + 'static,
+        S::Response: Into<Response<B>> + 'static,
+        <S::Service as Service>::Future: 'static,
+        B: MessageBody + 'static,
+    {
+        /// Create ssl based service
+        pub fn openssl(
+            self,
+            acceptor: SslAcceptor,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = SslError<HandshakeError<TcpStream>, DispatchError>,
+            InitError = S::InitError,
+        > {
+            pipeline_factory(
+                Acceptor::new(acceptor)
+                    .map_err(SslError::Ssl)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(fn_factory(|| {
+                ok::<_, S::InitError>(fn_service(|io: SslStream<TcpStream>| {
+                    let peer_addr = io.get_ref().peer_addr().ok();
+                    ok((io, peer_addr))
+                }))
+            }))
+            .and_then(self.map_err(SslError::Service))
+        }
+    }
 }
 
-impl<T, P, S, B> NewService for H2Service<T, P, S, B>
+#[cfg(feature = "rustls")]
+mod rustls {
+    use super::*;
+    use actix_tls::rustls::{Acceptor, ServerConfig, TlsStream};
+    use actix_tls::SslError;
+    use std::io;
+
+    impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error> + 'static,
+        S::Response: Into<Response<B>> + 'static,
+        <S::Service as Service>::Future: 'static,
+        B: MessageBody + 'static,
+    {
+        /// Create openssl based service
+        pub fn rustls(
+            self,
+            mut config: ServerConfig,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = SslError<io::Error, DispatchError>,
+            InitError = S::InitError,
+        > {
+            let protos = vec!["h2".to_string().into()];
+            config.set_protocols(&protos);
+
+            pipeline_factory(
+                Acceptor::new(config)
+                    .map_err(SslError::Ssl)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(fn_factory(|| {
+                ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
+                    let peer_addr = io.get_ref().0.peer_addr().ok();
+                    ok((io, peer_addr))
+                }))
+            }))
+            .and_then(self.map_err(SslError::Service))
+        }
+    }
+}
+
+impl<T, S, B> ServiceFactory for H2Service<T, S, B>
 where
-    T: IoStream,
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
-    S::Response: Into<Response<B>>,
+    T: AsyncRead + AsyncWrite + Unpin,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
+    S::Response: Into<Response<B>> + 'static,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
 {
-    type Config = SrvConfig;
-    type Request = Io<T, P>;
+    type Config = ();
+    type Request = (T, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type InitError = S::InitError;
-    type Service = H2ServiceHandler<T, P, S::Service, B>;
-    type Future = H2ServiceResponse<T, P, S, B>;
+    type Service = H2ServiceHandler<T, S::Service, B>;
+    type Future = H2ServiceResponse<T, S, B>;
 
-    fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         H2ServiceResponse {
-            fut: self.srv.new_service(cfg).into_future(),
+            fut: self.srv.new_service(()),
             cfg: Some(self.cfg.clone()),
+            on_connect: self.on_connect.clone(),
             _t: PhantomData,
         }
     }
 }
 
 #[doc(hidden)]
-pub struct H2ServiceResponse<T, P, S: NewService, B> {
-    fut: <S::Future as IntoFuture>::Future,
+#[pin_project::pin_project]
+pub struct H2ServiceResponse<T, S: ServiceFactory, B> {
+    #[pin]
+    fut: S::Future,
     cfg: Option<ServiceConfig>,
-    _t: PhantomData<(T, P, B)>,
+    on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B> Future for H2ServiceResponse<T, P, S, B>
+impl<T, S, B> Future for H2ServiceResponse<T, S, B>
 where
-    T: IoStream,
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
-    S::Response: Into<Response<B>>,
+    T: AsyncRead + AsyncWrite + Unpin,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
+    S::Response: Into<Response<B>> + 'static,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
 {
-    type Item = H2ServiceHandler<T, P, S::Service, B>;
-    type Error = S::InitError;
+    type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        let service = try_ready!(self.fut.poll());
-        Ok(Async::Ready(H2ServiceHandler::new(
-            self.cfg.take().unwrap(),
-            service,
-        )))
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let this = self.as_mut().project();
+
+        Poll::Ready(ready!(this.fut.poll(cx)).map(|service| {
+            let this = self.as_mut().project();
+            H2ServiceHandler::new(
+                this.cfg.take().unwrap(),
+                this.on_connect.clone(),
+                service,
+            )
+        }))
     }
 }
 
 /// `Service` implementation for http/2 transport
-pub struct H2ServiceHandler<T, P, S, B> {
+pub struct H2ServiceHandler<T, S: Service, B> {
     srv: CloneableService<S>,
     cfg: ServiceConfig,
-    _t: PhantomData<(T, P, B)>,
+    on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B> H2ServiceHandler<T, P, S, B>
+impl<T, S, B> H2ServiceHandler<T, S, B>
 where
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
 {
-    fn new(cfg: ServiceConfig, srv: S) -> H2ServiceHandler<T, P, S, B> {
+    fn new(
+        cfg: ServiceConfig,
+        on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+        srv: S,
+    ) -> H2ServiceHandler<T, S, B> {
         H2ServiceHandler {
             cfg,
+            on_connect,
             srv: CloneableService::new(srv),
             _t: PhantomData,
         }
     }
 }
 
-impl<T, P, S, B> Service for H2ServiceHandler<T, P, S, B>
+impl<T, S, B> Service for H2ServiceHandler<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
 {
-    type Request = Io<T, P>;
+    type Request = (T, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type Future = H2ServiceHandlerResponse<T, S, B>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
-        self.srv.poll_ready().map_err(|e| {
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
+        self.srv.poll_ready(cx).map_err(|e| {
             let e = e.into();
             error!("Service readiness error: {:?}", e);
             DispatchError::Service(e)
         })
     }
 
-    fn call(&mut self, req: Self::Request) -> Self::Future {
-        let io = req.into_parts().0;
-        let peer_addr = io.peer_addr();
+    fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
+        let on_connect = if let Some(ref on_connect) = self.on_connect {
+            Some(on_connect(&io))
+        } else {
+            None
+        };
+
         H2ServiceHandlerResponse {
             state: State::Handshake(
                 Some(self.srv.clone()),
                 Some(self.cfg.clone()),
-                peer_addr,
+                addr,
+                on_connect,
                 server::handshake(io),
             ),
         }
     }
 }
 
-enum State<T: IoStream, S: Service<Request = Request>, B: MessageBody>
+enum State<T, S: Service<Request = Request>, B: MessageBody>
 where
+    T: AsyncRead + AsyncWrite + Unpin,
     S::Future: 'static,
 {
     Incoming(Dispatcher<T, S, B>),
@@ -181,17 +324,18 @@ where
         Option<CloneableService<S>>,
         Option<ServiceConfig>,
         Option<net::SocketAddr>,
+        Option<Box<dyn DataFactory>>,
         Handshake<T, Bytes>,
     ),
 }
 
 pub struct H2ServiceHandlerResponse<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
 {
     state: State<T, S, B>,
@@ -199,40 +343,41 @@ where
 
 impl<T, S, B> Future for H2ServiceHandlerResponse<T, S, B>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody,
 {
-    type Item = ();
-    type Error = DispatchError;
+    type Output = Result<(), DispatchError>;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
         match self.state {
-            State::Incoming(ref mut disp) => disp.poll(),
+            State::Incoming(ref mut disp) => Pin::new(disp).poll(cx),
             State::Handshake(
                 ref mut srv,
                 ref mut config,
                 ref peer_addr,
+                ref mut on_connect,
                 ref mut handshake,
-            ) => match handshake.poll() {
-                Ok(Async::Ready(conn)) => {
+            ) => match Pin::new(handshake).poll(cx) {
+                Poll::Ready(Ok(conn)) => {
                     self.state = State::Incoming(Dispatcher::new(
                         srv.take().unwrap(),
                         conn,
+                        on_connect.take(),
                         config.take().unwrap(),
                         None,
-                        peer_addr.clone(),
+                        *peer_addr,
                     ));
-                    self.poll()
+                    self.poll(cx)
                 }
-                Ok(Async::NotReady) => Ok(Async::NotReady),
-                Err(err) => {
+                Poll::Ready(Err(err)) => {
                     trace!("H2 handshake error: {}", err);
-                    Err(err.into())
+                    Poll::Ready(Err(err.into()))
                 }
+                Poll::Pending => Poll::Pending,
             },
         }
     }

actix-http/src/header/common/accept_charset.rs

@@ -63,7 +63,7 @@ header! {
     (AcceptCharset, ACCEPT_CHARSET) => (QualityItem<Charset>)+
 
     test_accept_charset {
-        /// Test case from RFC
+        // Test case from RFC
         test_header!(test1, vec![b"iso-8859-5, unicode-1-1;q=0.8"]);
     }
 }

actix-http/src/header/common/cache_control.rs

@@ -74,18 +74,18 @@ impl Header for CacheControl {
 }
 
 impl fmt::Display for CacheControl {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt_comma_delimited(f, &self[..])
     }
 }
 
 impl IntoHeaderValue for CacheControl {
-    type Error = header::InvalidHeaderValueBytes;
+    type Error = header::InvalidHeaderValue;
 
     fn try_into(self) -> Result<header::HeaderValue, Self::Error> {
         let mut writer = Writer::new();
         let _ = write!(&mut writer, "{}", self);
-        header::HeaderValue::from_shared(writer.take())
+        header::HeaderValue::from_maybe_shared(writer.take())
     }
 }
 
@@ -126,7 +126,7 @@ pub enum CacheDirective {
 }
 
 impl fmt::Display for CacheDirective {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         use self::CacheDirective::*;
         fmt::Display::fmt(
             match *self {

actix-http/src/header/common/content_disposition.rs

@@ -70,11 +70,17 @@ impl<'a> From<&'a str> for DispositionType {
 /// assert_eq!(param.as_filename().unwrap(), "sample.txt");
 /// ```
 #[derive(Clone, Debug, PartialEq)]
+#[allow(clippy::large_enum_variant)]
 pub enum DispositionParam {
     /// For [`DispositionType::FormData`] (i.e. *multipart/form-data*), the name of an field from
     /// the form.
     Name(String),
     /// A plain file name.
+    ///
+    /// It is [not supposed](https://tools.ietf.org/html/rfc6266#appendix-D) to contain any
+    /// non-ASCII characters when used in a *Content-Disposition* HTTP response header, where
+    /// [`FilenameExt`](DispositionParam::FilenameExt) with charset UTF-8 may be used instead
+    /// in case there are Unicode characters in file names.
     Filename(String),
     /// An extended file name. It must not exist for `ContentType::Formdata` according to
     /// [RFC7578 Section 4.2](https://tools.ietf.org/html/rfc7578#section-4.2).
@@ -219,7 +225,16 @@ impl DispositionParam {
 /// ext-token           = <the characters in token, followed by "*">
 /// ```
 ///
-/// **Note**: filename* [must not](https://tools.ietf.org/html/rfc7578#section-4.2) be used within
+/// # Note
+///
+/// filename is [not supposed](https://tools.ietf.org/html/rfc6266#appendix-D) to contain any
+/// non-ASCII characters when used in a *Content-Disposition* HTTP response header, where
+/// filename* with charset UTF-8 may be used instead in case there are Unicode characters in file
+/// names.
+/// filename is [acceptable](https://tools.ietf.org/html/rfc7578#section-4.2) to be UTF-8 encoded
+/// directly in a *Content-Disposition* header for *multipart/form-data*, though.
+///
+/// filename* [must not](https://tools.ietf.org/html/rfc7578#section-4.2) be used within
 /// *multipart/form-data*.
 ///
 /// # Example
@@ -250,6 +265,22 @@ impl DispositionParam {
 /// };
 /// assert_eq!(cd2.get_name(), Some("file")); // field name
 /// assert_eq!(cd2.get_filename(), Some("bill.odt"));
+///
+/// // HTTP response header with Unicode characters in file names
+/// let cd3 = ContentDisposition {
+///     disposition: DispositionType::Attachment,
+///     parameters: vec![
+///         DispositionParam::FilenameExt(ExtendedValue {
+///             charset: Charset::Ext(String::from("UTF-8")),
+///             language_tag: None,
+///             value: String::from("\u{1f600}.svg").into_bytes(),
+///         }),
+///         // fallback for better compatibility
+///         DispositionParam::Filename(String::from("Grinning-Face-Emoji.svg"))
+///     ],
+/// };
+/// assert_eq!(cd3.get_filename_ext().map(|ev| ev.value.as_ref()),
+///            Some("\u{1f600}.svg".as_bytes()));
 /// ```
 ///
 /// # WARN
@@ -332,15 +363,17 @@ impl ContentDisposition {
                     // token: won't contains semicolon according to RFC 2616 Section 2.2
                     let (token, new_left) = split_once_and_trim(left, ';');
                     left = new_left;
+                    if token.is_empty() {
+                        // quoted-string can be empty, but token cannot be empty
+                        return Err(crate::error::ParseError::Header);
+                    }
                     token.to_owned()
                 };
-                if value.is_empty() {
-                    return Err(crate::error::ParseError::Header);
-                }
 
                 let param = if param_name.eq_ignore_ascii_case("name") {
                     DispositionParam::Name(value)
                 } else if param_name.eq_ignore_ascii_case("filename") {
+                    // See also comments in test_from_raw_uncessary_percent_decode.
                     DispositionParam::Filename(value)
                 } else {
                     DispositionParam::Unknown(param_name.to_owned(), value)
@@ -390,7 +423,7 @@ impl ContentDisposition {
 
     /// Return the value of *name* if exists.
     pub fn get_name(&self) -> Option<&str> {
-        self.parameters.iter().filter_map(|p| p.as_name()).nth(0)
+        self.parameters.iter().filter_map(|p| p.as_name()).next()
     }
 
     /// Return the value of *filename* if exists.
@@ -398,7 +431,7 @@ impl ContentDisposition {
         self.parameters
             .iter()
             .filter_map(|p| p.as_filename())
-            .nth(0)
+            .next()
     }
 
     /// Return the value of *filename\** if exists.
@@ -406,7 +439,7 @@ impl ContentDisposition {
         self.parameters
             .iter()
             .filter_map(|p| p.as_filename_ext())
-            .nth(0)
+            .next()
     }
 
     /// Return the value of the parameter which the `name` matches.
@@ -415,7 +448,7 @@ impl ContentDisposition {
         self.parameters
             .iter()
             .filter_map(|p| p.as_unknown(name))
-            .nth(0)
+            .next()
     }
 
     /// Return the value of the extended parameter which the `name` matches.
@@ -424,17 +457,17 @@ impl ContentDisposition {
         self.parameters
             .iter()
             .filter_map(|p| p.as_unknown_ext(name))
-            .nth(0)
+            .next()
     }
 }
 
 impl IntoHeaderValue for ContentDisposition {
-    type Error = header::InvalidHeaderValueBytes;
+    type Error = header::InvalidHeaderValue;
 
     fn try_into(self) -> Result<header::HeaderValue, Self::Error> {
         let mut writer = Writer::new();
         let _ = write!(&mut writer, "{}", self);
-        header::HeaderValue::from_shared(writer.take())
+        header::HeaderValue::from_maybe_shared(writer.take())
     }
 }
 
@@ -453,7 +486,7 @@ impl Header for ContentDisposition {
 }
 
 impl fmt::Display for DispositionType {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match self {
             DispositionType::Inline => write!(f, "inline"),
             DispositionType::Attachment => write!(f, "attachment"),
@@ -464,12 +497,41 @@ impl fmt::Display for DispositionType {
 }
 
 impl fmt::Display for DispositionParam {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
-        // All ASCII control charaters (0-30, 127) excepting horizontal tab, double quote, and
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        // All ASCII control characters (0-30, 127) including horizontal tab, double quote, and
         // backslash should be escaped in quoted-string (i.e. "foobar").
-        // Ref: RFC6266 S4.1 -> RFC2616 S2.2; RFC 7578 S4.2 -> RFC2183 S2 -> ... .
+        // Ref: RFC6266 S4.1 -> RFC2616 S3.6
+        // filename-parm  = "filename" "=" value
+        // value          = token | quoted-string
+        // quoted-string  = ( <"> *(qdtext | quoted-pair ) <"> )
+        // qdtext         = <any TEXT except <">>
+        // quoted-pair    = "\" CHAR
+        // TEXT           = <any OCTET except CTLs,
+        //                  but including LWS>
+        // LWS            = [CRLF] 1*( SP | HT )
+        // OCTET          = <any 8-bit sequence of data>
+        // CHAR           = <any US-ASCII character (octets 0 - 127)>
+        // CTL            = <any US-ASCII control character
+        //                  (octets 0 - 31) and DEL (127)>
+        //
+        // Ref: RFC7578 S4.2 -> RFC2183 S2 -> RFC2045 S5.1
+        // parameter := attribute "=" value
+        // attribute := token
+        //              ; Matching of attributes
+        //              ; is ALWAYS case-insensitive.
+        // value := token / quoted-string
+        // token := 1*<any (US-ASCII) CHAR except SPACE, CTLs,
+        //             or tspecials>
+        // tspecials :=  "(" / ")" / "<" / ">" / "@" /
+        //               "," / ";" / ":" / "\" / <">
+        //               "/" / "[" / "]" / "?" / "="
+        //               ; Must be in quoted-string,
+        //               ; to use within parameter values
+        //
+        //
+        // See also comments in test_from_raw_uncessary_percent_decode.
         lazy_static! {
-            static ref RE: Regex = Regex::new("[\x01-\x08\x10\x1F\x7F\"\\\\]").unwrap();
+            static ref RE: Regex = Regex::new("[\x00-\x08\x10-\x1F\x7F\"\\\\]").unwrap();
         }
         match self {
             DispositionParam::Name(ref value) => write!(f, "name={}", value),
@@ -493,7 +555,7 @@ impl fmt::Display for DispositionParam {
 }
 
 impl fmt::Display for ContentDisposition {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         write!(f, "{}", self.disposition)?;
         self.parameters
             .iter()
@@ -706,9 +768,8 @@ mod tests {
         Mainstream browsers like Firefox (gecko) and Chrome use UTF-8 directly as above.
         (And now, only UTF-8 is handled by this implementation.)
         */
-        let a =
-            HeaderValue::from_str("form-data; name=upload; filename=\"文件.webp\"")
-                .unwrap();
+        let a = HeaderValue::from_str("form-data; name=upload; filename=\"文件.webp\"")
+            .unwrap();
         let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
         let b = ContentDisposition {
             disposition: DispositionType::FormData,
@@ -719,8 +780,10 @@ mod tests {
         };
         assert_eq!(a, b);
 
-        let a =
-            HeaderValue::from_str("form-data; name=upload; filename=\"余固知謇謇之為患兮，忍而不能舍也.pptx\"").unwrap();
+        let a = HeaderValue::from_str(
+            "form-data; name=upload; filename=\"余固知謇謇之為患兮，忍而不能舍也.pptx\"",
+        )
+        .unwrap();
         let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
         let b = ContentDisposition {
             disposition: DispositionType::FormData,
@@ -771,8 +834,18 @@ mod tests {
 
     #[test]
     fn test_from_raw_uncessary_percent_decode() {
+        // In fact, RFC7578 (multipart/form-data) Section 2 and 4.2 suggests that filename with
+        // non-ASCII characters MAY be percent-encoded.
+        // On the contrary, RFC6266 or other RFCs related to Content-Disposition response header
+        // do not mention such percent-encoding.
+        // So, it appears to be undecidable whether to percent-decode or not without
+        // knowing the usage scenario (multipart/form-data v.s. HTTP response header) and
+        // inevitable to unnecessarily percent-decode filename with %XX in the former scenario.
+        // Fortunately, it seems that almost all mainstream browsers just send UTF-8 encoded file
+        // names in quoted-string format (tested on Edge, IE11, Chrome and Firefox) without
+        // percent-encoding. So we do not bother to attempt to percent-decode.
         let a = HeaderValue::from_static(
-            "form-data; name=photo; filename=\"%74%65%73%74%2e%70%6e%67\"", // Should not be decoded!
+            "form-data; name=photo; filename=\"%74%65%73%74%2e%70%6e%67\"",
         );
         let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
         let b = ContentDisposition {
@@ -808,6 +881,13 @@ mod tests {
 
         let a = HeaderValue::from_static("inline; filename=  ");
         assert!(ContentDisposition::from_raw(&a).is_err());
+
+        let a = HeaderValue::from_static("inline; filename=\"\"");
+        assert!(ContentDisposition::from_raw(&a)
+            .expect("parse cd")
+            .get_filename()
+            .expect("filename")
+            .is_empty());
     }
 
     #[test]

actix-http/src/header/common/content_range.rs

@@ -3,7 +3,7 @@ use std::str::FromStr;
 
 use crate::error::ParseError;
 use crate::header::{
-    HeaderValue, IntoHeaderValue, InvalidHeaderValueBytes, Writer, CONTENT_RANGE,
+    HeaderValue, IntoHeaderValue, InvalidHeaderValue, Writer, CONTENT_RANGE,
 };
 
 header! {
@@ -166,7 +166,7 @@ impl FromStr for ContentRangeSpec {
 }
 
 impl Display for ContentRangeSpec {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match *self {
             ContentRangeSpec::Bytes {
                 range,
@@ -198,11 +198,11 @@ impl Display for ContentRangeSpec {
 }
 
 impl IntoHeaderValue for ContentRangeSpec {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
         let mut writer = Writer::new();
         let _ = write!(&mut writer, "{}", self);
-        HeaderValue::from_shared(writer.take())
+        HeaderValue::from_maybe_shared(writer.take())
     }
 }

actix-http/src/header/common/if_range.rs

@@ -3,7 +3,7 @@ use std::fmt::{self, Display, Write};
 use crate::error::ParseError;
 use crate::header::{
     self, from_one_raw_str, EntityTag, Header, HeaderName, HeaderValue, HttpDate,
-    IntoHeaderValue, InvalidHeaderValueBytes, Writer,
+    IntoHeaderValue, InvalidHeaderValue, Writer,
 };
 use crate::httpmessage::HttpMessage;
 
@@ -87,7 +87,7 @@ impl Header for IfRange {
 }
 
 impl Display for IfRange {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         match *self {
             IfRange::EntityTag(ref x) => Display::fmt(x, f),
             IfRange::Date(ref x) => Display::fmt(x, f),
@@ -96,12 +96,12 @@ impl Display for IfRange {
 }
 
 impl IntoHeaderValue for IfRange {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
         let mut writer = Writer::new();
         let _ = write!(&mut writer, "{}", self);
-        HeaderValue::from_shared(writer.take())
+        HeaderValue::from_maybe_shared(writer.take())
     }
 }
 

actix-http/src/header/common/mod.rs

@@ -159,18 +159,18 @@ macro_rules! header {
         }
         impl std::fmt::Display for $id {
             #[inline]
-            fn fmt(&self, f: &mut std::fmt::Formatter) -> ::std::fmt::Result {
+            fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> ::std::fmt::Result {
                 $crate::http::header::fmt_comma_delimited(f, &self.0[..])
             }
         }
         impl $crate::http::header::IntoHeaderValue for $id {
-            type Error = $crate::http::header::InvalidHeaderValueBytes;
+            type Error = $crate::http::header::InvalidHeaderValue;
 
             fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
                 use std::fmt::Write;
                 let mut writer = $crate::http::header::Writer::new();
                 let _ = write!(&mut writer, "{}", self);
-                $crate::http::header::HeaderValue::from_shared(writer.take())
+                $crate::http::header::HeaderValue::from_maybe_shared(writer.take())
             }
         }
     };
@@ -195,18 +195,18 @@ macro_rules! header {
         }
         impl std::fmt::Display for $id {
             #[inline]
-            fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
+            fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
                 $crate::http::header::fmt_comma_delimited(f, &self.0[..])
             }
         }
         impl $crate::http::header::IntoHeaderValue for $id {
-            type Error = $crate::http::header::InvalidHeaderValueBytes;
+            type Error = $crate::http::header::InvalidHeaderValue;
 
             fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
                 use std::fmt::Write;
                 let mut writer = $crate::http::header::Writer::new();
                 let _ = write!(&mut writer, "{}", self);
-                $crate::http::header::HeaderValue::from_shared(writer.take())
+                $crate::http::header::HeaderValue::from_maybe_shared(writer.take())
             }
         }
     };
@@ -231,12 +231,12 @@ macro_rules! header {
         }
         impl std::fmt::Display for $id {
             #[inline]
-            fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
+            fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
                 std::fmt::Display::fmt(&self.0, f)
             }
         }
         impl $crate::http::header::IntoHeaderValue for $id {
-            type Error = $crate::http::header::InvalidHeaderValueBytes;
+            type Error = $crate::http::header::InvalidHeaderValue;
 
             fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
                 self.0.try_into()
@@ -276,7 +276,7 @@ macro_rules! header {
         }
         impl std::fmt::Display for $id {
             #[inline]
-            fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
+            fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
                 match *self {
                     $id::Any => f.write_str("*"),
                     $id::Items(ref fields) => $crate::http::header::fmt_comma_delimited(
@@ -285,13 +285,13 @@ macro_rules! header {
             }
         }
         impl $crate::http::header::IntoHeaderValue for $id {
-            type Error = $crate::http::header::InvalidHeaderValueBytes;
+            type Error = $crate::http::header::InvalidHeaderValue;
 
             fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
                 use std::fmt::Write;
                 let mut writer = $crate::http::header::Writer::new();
                 let _ = write!(&mut writer, "{}", self);
-                $crate::http::header::HeaderValue::from_shared(writer.take())
+                $crate::http::header::HeaderValue::from_maybe_shared(writer.take())
             }
         }
     };

actix-http/src/header/map.rs

@@ -1,20 +1,21 @@
+use std::collections::hash_map::{self, Entry};
+use std::convert::TryFrom;
+
 use either::Either;
-use hashbrown::hash_map::{self, Entry};
-use hashbrown::HashMap;
+use fxhash::FxHashMap;
 use http::header::{HeaderName, HeaderValue};
-use http::HttpTryFrom;
 
 /// A set of HTTP headers
 ///
 /// `HeaderMap` is an multimap of [`HeaderName`] to values.
 ///
 /// [`HeaderName`]: struct.HeaderName.html
-#[derive(Debug)]
+#[derive(Debug, Clone)]
 pub struct HeaderMap {
-    pub(crate) inner: HashMap<HeaderName, Value>,
+    pub(crate) inner: FxHashMap<HeaderName, Value>,
 }
 
-#[derive(Debug)]
+#[derive(Debug, Clone)]
 pub(crate) enum Value {
     One(HeaderValue),
     Multi(Vec<HeaderValue>),
@@ -56,7 +57,7 @@ impl HeaderMap {
     /// allocate.
     pub fn new() -> Self {
         HeaderMap {
-            inner: HashMap::new(),
+            inner: FxHashMap::default(),
         }
     }
 
@@ -70,7 +71,7 @@ impl HeaderMap {
     /// More capacity than requested may be allocated.
     pub fn with_capacity(capacity: usize) -> HeaderMap {
         HeaderMap {
-            inner: HashMap::with_capacity(capacity),
+            inner: FxHashMap::with_capacity_and_hasher(capacity, Default::default()),
         }
     }
 
@@ -142,7 +143,7 @@ impl HeaderMap {
     /// Returns `None` if there are no values associated with the key.
     ///
     /// [`GetAll`]: struct.GetAll.html
-    pub fn get_all<N: AsName>(&self, name: N) -> GetAll {
+    pub fn get_all<N: AsName>(&self, name: N) -> GetAll<'_> {
         GetAll {
             idx: 0,
             item: self.get2(name),
@@ -186,7 +187,7 @@ impl HeaderMap {
     /// The iteration order is arbitrary, but consistent across platforms for
     /// the same crate version. Each key will be yielded once per associated
     /// value. So, if a key has 3 associated values, it will be yielded 3 times.
-    pub fn iter(&self) -> Iter {
+    pub fn iter(&self) -> Iter<'_> {
         Iter::new(self.inner.iter())
     }
 
@@ -195,7 +196,7 @@ impl HeaderMap {
     /// The iteration order is arbitrary, but consistent across platforms for
     /// the same crate version. Each key will be yielded only once even if it
     /// has multiple associated values.
-    pub fn keys(&self) -> Keys {
+    pub fn keys(&self) -> Keys<'_> {
         Keys(self.inner.keys())
     }
 

actix-http/src/header/mod.rs

@@ -1,11 +1,13 @@
 //! Various http headers
 // This is mostly copy of [hyper](https://github.com/hyperium/hyper/tree/master/src/header)
 
+use std::convert::TryFrom;
 use std::{fmt, str::FromStr};
 
 use bytes::{Bytes, BytesMut};
 use http::Error as HttpError;
 use mime::Mime;
+use percent_encoding::{AsciiSet, CONTROLS};
 
 pub use http::header::*;
 
@@ -15,7 +17,6 @@ use crate::httpmessage::HttpMessage;
 mod common;
 pub(crate) mod map;
 mod shared;
-#[doc(hidden)]
 pub use self::common::*;
 #[doc(hidden)]
 pub use self::shared::*;
@@ -73,58 +74,58 @@ impl<'a> IntoHeaderValue for &'a [u8] {
 }
 
 impl IntoHeaderValue for Bytes {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     #[inline]
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::from_shared(self)
+        HeaderValue::from_maybe_shared(self)
     }
 }
 
 impl IntoHeaderValue for Vec<u8> {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     #[inline]
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::from_shared(Bytes::from(self))
+        HeaderValue::try_from(self)
     }
 }
 
 impl IntoHeaderValue for String {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     #[inline]
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::from_shared(Bytes::from(self))
+        HeaderValue::try_from(self)
     }
 }
 
 impl IntoHeaderValue for usize {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     #[inline]
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
         let s = format!("{}", self);
-        HeaderValue::from_shared(Bytes::from(s))
+        HeaderValue::try_from(s)
     }
 }
 
 impl IntoHeaderValue for u64 {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     #[inline]
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
         let s = format!("{}", self);
-        HeaderValue::from_shared(Bytes::from(s))
+        HeaderValue::try_from(s)
     }
 }
 
 impl IntoHeaderValue for Mime {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     #[inline]
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
-        HeaderValue::from_shared(Bytes::from(format!("{}", self)))
+        HeaderValue::try_from(format!("{}", self))
     }
 }
 
@@ -204,7 +205,7 @@ impl Writer {
         }
     }
     fn take(&mut self) -> Bytes {
-        self.buf.take().freeze()
+        self.buf.split().freeze()
     }
 }
 
@@ -216,7 +217,7 @@ impl fmt::Write for Writer {
     }
 
     #[inline]
-    fn write_fmt(&mut self, args: fmt::Arguments) -> fmt::Result {
+    fn write_fmt(&mut self, args: fmt::Arguments<'_>) -> fmt::Result {
         fmt::write(self, args)
     }
 }
@@ -258,7 +259,7 @@ pub fn from_one_raw_str<T: FromStr>(val: Option<&HeaderValue>) -> Result<T, Pars
 #[inline]
 #[doc(hidden)]
 /// Format an array into a comma-delimited string.
-pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter, parts: &[T]) -> fmt::Result
+pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter<'_>, parts: &[T]) -> fmt::Result
 where
     T: fmt::Display,
 {
@@ -360,11 +361,9 @@ pub fn parse_extended_value(
 }
 
 impl fmt::Display for ExtendedValue {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
-        let encoded_value = percent_encoding::percent_encode(
-            &self.value[..],
-            self::percent_encoding_http::HTTP_VALUE,
-        );
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        let encoded_value =
+            percent_encoding::percent_encode(&self.value[..], HTTP_VALUE);
         if let Some(ref lang) = self.language_tag {
             write!(f, "{}'{}'{}", self.charset, lang, encoded_value)
         } else {
@@ -377,9 +376,8 @@ impl fmt::Display for ExtendedValue {
 /// [https://tools.ietf.org/html/rfc5987#section-3.2][url]
 ///
 /// [url]: https://tools.ietf.org/html/rfc5987#section-3.2
-pub fn http_percent_encode(f: &mut fmt::Formatter, bytes: &[u8]) -> fmt::Result {
-    let encoded =
-        percent_encoding::percent_encode(bytes, self::percent_encoding_http::HTTP_VALUE);
+pub fn http_percent_encode(f: &mut fmt::Formatter<'_>, bytes: &[u8]) -> fmt::Result {
+    let encoded = percent_encoding::percent_encode(bytes, HTTP_VALUE);
     fmt::Display::fmt(&encoded, f)
 }
 
@@ -394,20 +392,29 @@ impl From<http::HeaderMap> for HeaderMap {
     }
 }
 
-mod percent_encoding_http {
-    use percent_encoding::{self, define_encode_set};
-
-    // internal module because macro is hard-coded to make a public item
-    // but we don't want to public export this item
-    define_encode_set! {
-        // This encode set is used for HTTP header values and is defined at
-        // https://tools.ietf.org/html/rfc5987#section-3.2
-        pub HTTP_VALUE = [percent_encoding::SIMPLE_ENCODE_SET] | {
-            ' ', '"', '%', '\'', '(', ')', '*', ',', '/', ':', ';', '<', '-', '>', '?',
-            '[', '\\', ']', '{', '}'
-        }
-    }
-}
+// This encode set is used for HTTP header values and is defined at
+// https://tools.ietf.org/html/rfc5987#section-3.2
+pub(crate) const HTTP_VALUE: &AsciiSet = &CONTROLS
+    .add(b' ')
+    .add(b'"')
+    .add(b'%')
+    .add(b'\'')
+    .add(b'(')
+    .add(b')')
+    .add(b'*')
+    .add(b',')
+    .add(b'/')
+    .add(b':')
+    .add(b';')
+    .add(b'<')
+    .add(b'-')
+    .add(b'>')
+    .add(b'?')
+    .add(b'[')
+    .add(b'\\')
+    .add(b']')
+    .add(b'{')
+    .add(b'}');
 
 #[cfg(test)]
 mod tests {

actix-http/src/header/shared/charset.rs

@@ -98,7 +98,7 @@ impl Charset {
 }
 
 impl Display for Charset {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         f.write_str(self.label())
     }
 }

actix-http/src/header/shared/encoding.rs

@@ -27,7 +27,7 @@ pub enum Encoding {
 }
 
 impl fmt::Display for Encoding {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         f.write_str(match *self {
             Chunked => "chunked",
             Brotli => "br",

actix-http/src/header/shared/entity.rs

@@ -1,7 +1,7 @@
 use std::fmt::{self, Display, Write};
 use std::str::FromStr;
 
-use crate::header::{HeaderValue, IntoHeaderValue, InvalidHeaderValueBytes, Writer};
+use crate::header::{HeaderValue, IntoHeaderValue, InvalidHeaderValue, Writer};
 
 /// check that each char in the slice is either:
 /// 1. `%x21`, or
@@ -113,7 +113,7 @@ impl EntityTag {
 }
 
 impl Display for EntityTag {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         if self.weak {
             write!(f, "W/\"{}\"", self.tag)
         } else {
@@ -157,12 +157,12 @@ impl FromStr for EntityTag {
 }
 
 impl IntoHeaderValue for EntityTag {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
         let mut wrt = Writer::new();
         write!(wrt, "{}", self).unwrap();
-        HeaderValue::from_shared(wrt.take())
+        HeaderValue::from_maybe_shared(wrt.take())
     }
 }
 

actix-http/src/header/shared/httpdate.rs

@@ -1,117 +1,99 @@
 use std::fmt::{self, Display};
 use std::io::Write;
 use std::str::FromStr;
-use std::time::{Duration, SystemTime, UNIX_EPOCH};
+use std::time::{SystemTime, UNIX_EPOCH};
 
-use bytes::{BufMut, BytesMut};
-use http::header::{HeaderValue, InvalidHeaderValueBytes};
+use bytes::{buf::BufMutExt, BytesMut};
+use http::header::{HeaderValue, InvalidHeaderValue};
+use time::{offset, OffsetDateTime, PrimitiveDateTime};
 
 use crate::error::ParseError;
 use crate::header::IntoHeaderValue;
+use crate::time_parser;
 
 /// A timestamp with HTTP formatting and parsing
 #[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord)]
-pub struct HttpDate(time::Tm);
+pub struct HttpDate(OffsetDateTime);
 
 impl FromStr for HttpDate {
     type Err = ParseError;
 
     fn from_str(s: &str) -> Result<HttpDate, ParseError> {
-        match time::strptime(s, "%a, %d %b %Y %T %Z")
-            .or_else(|_| time::strptime(s, "%A, %d-%b-%y %T %Z"))
-            .or_else(|_| time::strptime(s, "%c"))
-        {
-            Ok(t) => Ok(HttpDate(t)),
-            Err(_) => Err(ParseError::Header),
+        match time_parser::parse_http_date(s) {
+            Some(t) => Ok(HttpDate(t.assume_utc())),
+            None => Err(ParseError::Header),
         }
     }
 }
 
 impl Display for HttpDate {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
-        fmt::Display::fmt(&self.0.to_utc().rfc822(), f)
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        fmt::Display::fmt(&self.0.format("%a, %d %b %Y %H:%M:%S GMT"), f)
     }
 }
 
-impl From<time::Tm> for HttpDate {
-    fn from(tm: time::Tm) -> HttpDate {
-        HttpDate(tm)
+impl From<OffsetDateTime> for HttpDate {
+    fn from(dt: OffsetDateTime) -> HttpDate {
+        HttpDate(dt)
     }
 }
 
 impl From<SystemTime> for HttpDate {
     fn from(sys: SystemTime) -> HttpDate {
-        let tmspec = match sys.duration_since(UNIX_EPOCH) {
-            Ok(dur) => {
-                time::Timespec::new(dur.as_secs() as i64, dur.subsec_nanos() as i32)
-            }
-            Err(err) => {
-                let neg = err.duration();
-                time::Timespec::new(
-                    -(neg.as_secs() as i64),
-                    -(neg.subsec_nanos() as i32),
-                )
-            }
-        };
-        HttpDate(time::at_utc(tmspec))
+        HttpDate(PrimitiveDateTime::from(sys).assume_utc())
     }
 }
 
 impl IntoHeaderValue for HttpDate {
-    type Error = InvalidHeaderValueBytes;
+    type Error = InvalidHeaderValue;
 
     fn try_into(self) -> Result<HeaderValue, Self::Error> {
         let mut wrt = BytesMut::with_capacity(29).writer();
-        write!(wrt, "{}", self.0.rfc822()).unwrap();
-        HeaderValue::from_shared(wrt.get_mut().take().freeze())
+        write!(
+            wrt,
+            "{}",
+            self.0
+                .to_offset(offset!(UTC))
+                .format("%a, %d %b %Y %H:%M:%S GMT")
+        )
+        .unwrap();
+        HeaderValue::from_maybe_shared(wrt.get_mut().split().freeze())
     }
 }
 
 impl From<HttpDate> for SystemTime {
     fn from(date: HttpDate) -> SystemTime {
-        let spec = date.0.to_timespec();
-        if spec.sec >= 0 {
-            UNIX_EPOCH + Duration::new(spec.sec as u64, spec.nsec as u32)
-        } else {
-            UNIX_EPOCH - Duration::new(spec.sec as u64, spec.nsec as u32)
-        }
+        let dt = date.0;
+        let epoch = OffsetDateTime::unix_epoch();
+
+        UNIX_EPOCH + (dt - epoch)
     }
 }
 
 #[cfg(test)]
 mod tests {
     use super::HttpDate;
-    use time::Tm;
-
-    const NOV_07: HttpDate = HttpDate(Tm {
-        tm_nsec: 0,
-        tm_sec: 37,
-        tm_min: 48,
-        tm_hour: 8,
-        tm_mday: 7,
-        tm_mon: 10,
-        tm_year: 94,
-        tm_wday: 0,
-        tm_isdst: 0,
-        tm_yday: 0,
-        tm_utcoff: 0,
-    });
+    use time::{date, time, PrimitiveDateTime};
 
     #[test]
     fn test_date() {
+        let nov_07 = HttpDate(
+            PrimitiveDateTime::new(date!(1994 - 11 - 07), time!(8:48:37)).assume_utc(),
+        );
+
         assert_eq!(
             "Sun, 07 Nov 1994 08:48:37 GMT".parse::<HttpDate>().unwrap(),
-            NOV_07
+            nov_07
         );
         assert_eq!(
             "Sunday, 07-Nov-94 08:48:37 GMT"
                 .parse::<HttpDate>()
                 .unwrap(),
-            NOV_07
+            nov_07
         );
         assert_eq!(
             "Sun Nov  7 08:48:37 1994".parse::<HttpDate>().unwrap(),
-            NOV_07
+            nov_07
         );
         assert!("this-is-no-date".parse::<HttpDate>().is_err());
     }

actix-http/src/header/shared/quality_item.rs

@@ -53,7 +53,7 @@ impl<T: PartialEq> cmp::PartialOrd for QualityItem<T> {
 }
 
 impl<T: fmt::Display> fmt::Display for QualityItem<T> {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         fmt::Display::fmt(&self.item, f)?;
         match self.quality.0 {
             1000 => Ok(()),

actix-http/src/helpers.rs

@@ -1,8 +1,10 @@
-use std::{io, mem, ptr, slice};
+use std::{io, ptr};
 
 use bytes::{BufMut, BytesMut};
 use http::Version;
 
+use crate::extensions::Extensions;
+
 const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
       2021222324252627282930313233343536373839\
       4041424344454647484950515253545556575859\
@@ -12,9 +14,7 @@ const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
 pub(crate) const STATUS_LINE_BUF_SIZE: usize = 13;
 
 pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesMut) {
-    let mut buf: [u8; STATUS_LINE_BUF_SIZE] = [
-        b'H', b'T', b'T', b'P', b'/', b'1', b'.', b'1', b' ', b' ', b' ', b' ', b' ',
-    ];
+    let mut buf: [u8; STATUS_LINE_BUF_SIZE] = *b"HTTP/1.1     ";
     match version {
         Version::HTTP_2 => buf[5] = b'2',
         Version::HTTP_10 => buf[7] = b'0',
@@ -58,113 +58,108 @@ pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesM
 
     bytes.put_slice(&buf);
     if four {
-        bytes.put(b' ');
+        bytes.put_u8(b' ');
     }
 }
 
+const DIGITS_START: u8 = b'0';
+
 /// NOTE: bytes object has to contain enough space
-pub fn write_content_length(mut n: usize, bytes: &mut BytesMut) {
+pub fn write_content_length(n: usize, bytes: &mut BytesMut) {
+    bytes.put_slice(b"\r\ncontent-length: ");
+
     if n < 10 {
-        let mut buf: [u8; 21] = [
-            b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l', b'e',
-            b'n', b'g', b't', b'h', b':', b' ', b'0', b'\r', b'\n',
-        ];
-        buf[18] = (n as u8) + b'0';
-        bytes.put_slice(&buf);
+        bytes.put_u8(DIGITS_START + (n as u8));
     } else if n < 100 {
-        let mut buf: [u8; 22] = [
-            b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l', b'e',
-            b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'\r', b'\n',
-        ];
-        let d1 = n << 1;
-        unsafe {
-            ptr::copy_nonoverlapping(
-                DEC_DIGITS_LUT.as_ptr().add(d1),
-                buf.as_mut_ptr().offset(18),
-                2,
-            );
-        }
-        bytes.put_slice(&buf);
+        let n = n as u8;
+
+        let d10 = n / 10;
+        let d1 = n % 10;
+
+        bytes.put_u8(DIGITS_START + d10);
+        bytes.put_u8(DIGITS_START + d1);
     } else if n < 1000 {
-        let mut buf: [u8; 23] = [
-            b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l', b'e',
-            b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'0', b'\r', b'\n',
-        ];
-        // decode 2 more chars, if > 2 chars
-        let d1 = (n % 100) << 1;
-        n /= 100;
-        unsafe {
-            ptr::copy_nonoverlapping(
-                DEC_DIGITS_LUT.as_ptr().add(d1),
-                buf.as_mut_ptr().offset(19),
-                2,
-            )
-        };
+        let n = n as u16;
 
-        // decode last 1
-        buf[18] = (n as u8) + b'0';
+        let d100 = (n / 100) as u8;
+        let d10 = ((n / 10) % 10) as u8;
+        let d1 = (n % 10) as u8;
 
-        bytes.put_slice(&buf);
+        bytes.put_u8(DIGITS_START + d100);
+        bytes.put_u8(DIGITS_START + d10);
+        bytes.put_u8(DIGITS_START + d1);
+    } else if n < 10_000 {
+        let n = n as u16;
+
+        let d1000 = (n / 1000) as u8;
+        let d100 = ((n / 100) % 10) as u8;
+        let d10 = ((n / 10) % 10) as u8;
+        let d1 = (n % 10) as u8;
+
+        bytes.put_u8(DIGITS_START + d1000);
+        bytes.put_u8(DIGITS_START + d100);
+        bytes.put_u8(DIGITS_START + d10);
+        bytes.put_u8(DIGITS_START + d1);
+    } else if n < 100_000 {
+        let n = n as u32;
+
+        let d10000 = (n / 10000) as u8;
+        let d1000 = ((n / 1000) % 10) as u8;
+        let d100 = ((n / 100) % 10) as u8;
+        let d10 = ((n / 10) % 10) as u8;
+        let d1 = (n % 10) as u8;
+
+        bytes.put_u8(DIGITS_START + d10000);
+        bytes.put_u8(DIGITS_START + d1000);
+        bytes.put_u8(DIGITS_START + d100);
+        bytes.put_u8(DIGITS_START + d10);
+        bytes.put_u8(DIGITS_START + d1);
+    } else if n < 1_000_000 {
+        let n = n as u32;
+
+        let d100000 = (n / 100_000) as u8;
+        let d10000 = ((n / 10000) % 10) as u8;
+        let d1000 = ((n / 1000) % 10) as u8;
+        let d100 = ((n / 100) % 10) as u8;
+        let d10 = ((n / 10) % 10) as u8;
+        let d1 = (n % 10) as u8;
+
+        bytes.put_u8(DIGITS_START + d100000);
+        bytes.put_u8(DIGITS_START + d10000);
+        bytes.put_u8(DIGITS_START + d1000);
+        bytes.put_u8(DIGITS_START + d100);
+        bytes.put_u8(DIGITS_START + d10);
+        bytes.put_u8(DIGITS_START + d1);
     } else {
-        bytes.put_slice(b"\r\ncontent-length: ");
-        convert_usize(n, bytes);
+        write_usize(n, bytes);
     }
+
+    bytes.put_slice(b"\r\n");
 }
 
-pub(crate) fn convert_usize(mut n: usize, bytes: &mut BytesMut) {
-    let mut curr: isize = 39;
-    let mut buf: [u8; 41] = unsafe { mem::uninitialized() };
-    buf[39] = b'\r';
-    buf[40] = b'\n';
-    let buf_ptr = buf.as_mut_ptr();
-    let lut_ptr = DEC_DIGITS_LUT.as_ptr();
+pub(crate) fn write_usize(n: usize, bytes: &mut BytesMut) {
+    let mut n = n;
 
-    // eagerly decode 4 characters at a time
-    while n >= 10_000 {
-        let rem = (n % 10_000) as isize;
-        n /= 10_000;
+    // 20 chars is max length of a usize (2^64)
+    // digits will be added to the buffer from lsd to msd
+    let mut buf = BytesMut::with_capacity(20);
 
-        let d1 = (rem / 100) << 1;
-        let d2 = (rem % 100) << 1;
-        curr -= 4;
-        unsafe {
-            ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
-            ptr::copy_nonoverlapping(lut_ptr.offset(d2), buf_ptr.offset(curr + 2), 2);
-        }
+    while n > 9 {
+        // "pop" the least-significant digit
+        let lsd = (n % 10) as u8;
+
+        // remove the lsd from n
+        n /= 10;
+
+        buf.put_u8(DIGITS_START + lsd);
     }
 
-    // if we reach here numbers are <= 9999, so at most 4 chars long
-    let mut n = n as isize; // possibly reduce 64bit math
+    // put msd to result buffer
+    bytes.put_u8(DIGITS_START + (n as u8));
 
-    // decode 2 more chars, if > 2 chars
-    if n >= 100 {
-        let d1 = (n % 100) << 1;
-        n /= 100;
-        curr -= 2;
-        unsafe {
-            ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
-        }
-    }
-
-    // decode last 1 or 2 chars
-    if n < 10 {
-        curr -= 1;
-        unsafe {
-            *buf_ptr.offset(curr) = (n as u8) + b'0';
-        }
-    } else {
-        let d1 = n << 1;
-        curr -= 2;
-        unsafe {
-            ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
-        }
-    }
-
-    unsafe {
-        bytes.extend_from_slice(slice::from_raw_parts(
-            buf_ptr.offset(curr),
-            41 - curr as usize,
-        ));
+    // put, in reverse (msd to lsd), remaining digits to buffer
+    for i in (0..buf.len()).rev() {
+        bytes.put_u8(buf[i]);
     }
 }
 
@@ -180,6 +175,18 @@ impl<'a> io::Write for Writer<'a> {
     }
 }
 
+pub(crate) trait DataFactory {
+    fn set(&self, ext: &mut Extensions);
+}
+
+pub(crate) struct Data<T>(pub(crate) T);
+
+impl<T: Clone + 'static> DataFactory for Data<T> {
+    fn set(&self, ext: &mut Extensions) {
+        ext.insert(self.0.clone())
+    }
+}
+
 #[cfg(test)]
 mod tests {
     use super::*;
@@ -189,33 +196,76 @@ mod tests {
         let mut bytes = BytesMut::new();
         bytes.reserve(50);
         write_content_length(0, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 0\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 0\r\n"[..]);
         bytes.reserve(50);
         write_content_length(9, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 9\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 9\r\n"[..]);
         bytes.reserve(50);
         write_content_length(10, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 10\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 10\r\n"[..]);
         bytes.reserve(50);
         write_content_length(99, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 99\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 99\r\n"[..]);
         bytes.reserve(50);
         write_content_length(100, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 100\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 100\r\n"[..]);
         bytes.reserve(50);
         write_content_length(101, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 101\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 101\r\n"[..]);
         bytes.reserve(50);
         write_content_length(998, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 998\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 998\r\n"[..]);
         bytes.reserve(50);
         write_content_length(1000, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 1000\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 1000\r\n"[..]);
         bytes.reserve(50);
         write_content_length(1001, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 1001\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 1001\r\n"[..]);
         bytes.reserve(50);
         write_content_length(5909, &mut bytes);
-        assert_eq!(bytes.take().freeze(), b"\r\ncontent-length: 5909\r\n"[..]);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 5909\r\n"[..]);
+        bytes.reserve(50);
+        write_content_length(9999, &mut bytes);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 9999\r\n"[..]);
+        bytes.reserve(50);
+        write_content_length(10001, &mut bytes);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 10001\r\n"[..]);
+        bytes.reserve(50);
+        write_content_length(59094, &mut bytes);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 59094\r\n"[..]);
+        bytes.reserve(50);
+        write_content_length(99999, &mut bytes);
+        assert_eq!(bytes.split().freeze(), b"\r\ncontent-length: 99999\r\n"[..]);
+
+        bytes.reserve(50);
+        write_content_length(590947, &mut bytes);
+        assert_eq!(
+            bytes.split().freeze(),
+            b"\r\ncontent-length: 590947\r\n"[..]
+        );
+        bytes.reserve(50);
+        write_content_length(999999, &mut bytes);
+        assert_eq!(
+            bytes.split().freeze(),
+            b"\r\ncontent-length: 999999\r\n"[..]
+        );
+        bytes.reserve(50);
+        write_content_length(5909471, &mut bytes);
+        assert_eq!(
+            bytes.split().freeze(),
+            b"\r\ncontent-length: 5909471\r\n"[..]
+        );
+        bytes.reserve(50);
+        write_content_length(59094718, &mut bytes);
+        assert_eq!(
+            bytes.split().freeze(),
+            b"\r\ncontent-length: 59094718\r\n"[..]
+        );
+        bytes.reserve(50);
+        write_content_length(4294973728, &mut bytes);
+        assert_eq!(
+            bytes.split().freeze(),
+            b"\r\ncontent-length: 4294973728\r\n"[..]
+        );
     }
 }

actix-http/src/httpcodes.rs

@@ -29,7 +29,6 @@ impl Response {
     STATIC_RESP!(AlreadyReported, StatusCode::ALREADY_REPORTED);
 
     STATIC_RESP!(MultipleChoices, StatusCode::MULTIPLE_CHOICES);
-    STATIC_RESP!(MovedPermanenty, StatusCode::MOVED_PERMANENTLY);
     STATIC_RESP!(MovedPermanently, StatusCode::MOVED_PERMANENTLY);
     STATIC_RESP!(Found, StatusCode::FOUND);
     STATIC_RESP!(SeeOther, StatusCode::SEE_OTHER);

actix-http/src/httpmessage.rs

@@ -25,10 +25,10 @@ pub trait HttpMessage: Sized {
     fn take_payload(&mut self) -> Payload<Self::Stream>;
 
     /// Request's extensions container
-    fn extensions(&self) -> Ref<Extensions>;
+    fn extensions(&self) -> Ref<'_, Extensions>;
 
     /// Mutable reference to a the request's extensions container
-    fn extensions_mut(&self) -> RefMut<Extensions>;
+    fn extensions_mut(&self) -> RefMut<'_, Extensions>;
 
     #[doc(hidden)]
     /// Get a header
@@ -105,7 +105,7 @@ pub trait HttpMessage: Sized {
 
     /// Load request cookies.
     #[inline]
-    fn cookies(&self) -> Result<Ref<Vec<Cookie<'static>>>, CookieParseError> {
+    fn cookies(&self) -> Result<Ref<'_, Vec<Cookie<'static>>>, CookieParseError> {
         if self.extensions().get::<Cookies>().is_none() {
             let mut cookies = Vec::new();
             for hdr in self.headers().get_all(header::COOKIE) {
@@ -153,12 +153,12 @@ where
     }
 
     /// Request's extensions container
-    fn extensions(&self) -> Ref<Extensions> {
+    fn extensions(&self) -> Ref<'_, Extensions> {
         (**self).extensions()
     }
 
     /// Mutable reference to a the request's extensions container
-    fn extensions_mut(&self) -> RefMut<Extensions> {
+    fn extensions_mut(&self) -> RefMut<'_, Extensions> {
         (**self).extensions_mut()
     }
 }

actix-http/src/lib.rs

@@ -1,6 +1,8 @@
 //! Basic http primitives for actix-net framework.
+#![warn(rust_2018_idioms, warnings)]
 #![allow(
     clippy::type_complexity,
+    clippy::too_many_arguments,
     clippy::new_without_default,
     clippy::borrow_interior_mutable_const
 )]
@@ -8,10 +10,15 @@
 #[macro_use]
 extern crate log;
 
+#[macro_use]
+mod macros;
+
 pub mod body;
 mod builder;
 pub mod client;
+mod cloneable;
 mod config;
+#[cfg(feature = "compress")]
 pub mod encoding;
 mod extensions;
 mod header;
@@ -23,6 +30,7 @@ mod payload;
 mod request;
 mod response;
 mod service;
+mod time_parser;
 
 pub mod cookie;
 pub mod error;
@@ -36,7 +44,7 @@ pub use self::config::{KeepAlive, ServiceConfig};
 pub use self::error::{Error, ResponseError, Result};
 pub use self::extensions::Extensions;
 pub use self::httpmessage::HttpMessage;
-pub use self::message::{Message, RequestHead, ResponseHead};
+pub use self::message::{Message, RequestHead, RequestHeadType, ResponseHead};
 pub use self::payload::{Payload, PayloadStream};
 pub use self::request::Request;
 pub use self::response::{Response, ResponseBuilder};
@@ -48,7 +56,7 @@ pub mod http {
     // re-exports
     pub use http::header::{HeaderName, HeaderValue};
     pub use http::uri::PathAndQuery;
-    pub use http::{uri, Error, HttpTryFrom, Uri};
+    pub use http::{uri, Error, Uri};
     pub use http::{Method, StatusCode, Version};
 
     pub use crate::cookie::{Cookie, CookieBuilder};
@@ -61,3 +69,10 @@ pub mod http {
     pub use crate::header::ContentEncoding;
     pub use crate::message::ConnectionType;
 }
+
+/// Http protocol
+#[derive(Copy, Clone, Debug, PartialEq, Eq, Hash)]
+pub enum Protocol {
+    Http1,
+    Http2,
+}

actix-http/src/macros.rs

@@ -0,0 +1,95 @@
+#[macro_export]
+macro_rules! downcast_get_type_id {
+    () => {
+        /// A helper method to get the type ID of the type
+        /// this trait is implemented on.
+        /// This method is unsafe to *implement*, since `downcast_ref` relies
+        /// on the returned `TypeId` to perform a cast.
+        ///
+        /// Unfortunately, Rust has no notion of a trait method that is
+        /// unsafe to implement (marking it as `unsafe` makes it unsafe
+        /// to *call*). As a workaround, we require this method
+        /// to return a private type along with the `TypeId`. This
+        /// private type (`PrivateHelper`) has a private constructor,
+        /// making it impossible for safe code to construct outside of
+        /// this module. This ensures that safe code cannot violate
+        /// type-safety by implementing this method.
+        #[doc(hidden)]
+        fn __private_get_type_id__(&self) -> (std::any::TypeId, PrivateHelper)
+        where
+            Self: 'static,
+        {
+            (std::any::TypeId::of::<Self>(), PrivateHelper(()))
+        }
+    };
+}
+
+//Generate implementation for dyn $name
+#[macro_export]
+macro_rules! downcast {
+    ($name:ident) => {
+        /// A struct with a private constructor, for use with
+        /// `__private_get_type_id__`. Its single field is private,
+        /// ensuring that it can only be constructed from this module
+        #[doc(hidden)]
+        pub struct PrivateHelper(());
+
+        impl dyn $name + 'static {
+            /// Downcasts generic body to a specific type.
+            pub fn downcast_ref<T: $name + 'static>(&self) -> Option<&T> {
+                if self.__private_get_type_id__().0 == std::any::TypeId::of::<T>() {
+                    // Safety: external crates cannot override the default
+                    // implementation of `__private_get_type_id__`, since
+                    // it requires returning a private type. We can therefore
+                    // rely on the returned `TypeId`, which ensures that this
+                    // case is correct.
+                    unsafe { Some(&*(self as *const dyn $name as *const T)) }
+                } else {
+                    None
+                }
+            }
+            /// Downcasts a generic body to a mutable specific type.
+            pub fn downcast_mut<T: $name + 'static>(&mut self) -> Option<&mut T> {
+                if self.__private_get_type_id__().0 == std::any::TypeId::of::<T>() {
+                    // Safety: external crates cannot override the default
+                    // implementation of `__private_get_type_id__`, since
+                    // it requires returning a private type. We can therefore
+                    // rely on the returned `TypeId`, which ensures that this
+                    // case is correct.
+                    unsafe {
+                        Some(&mut *(self as *const dyn $name as *const T as *mut T))
+                    }
+                } else {
+                    None
+                }
+            }
+        }
+    };
+}
+
+#[cfg(test)]
+mod tests {
+
+    trait MB {
+        downcast_get_type_id!();
+    }
+
+    downcast!(MB);
+
+    impl MB for String {}
+    impl MB for () {}
+
+    #[actix_rt::test]
+    async fn test_any_casting() {
+        let mut body = String::from("hello cast");
+        let resp_body: &mut dyn MB = &mut body;
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast");
+        let body = &mut resp_body.downcast_mut::<String>().unwrap();
+        body.push_str("!");
+        let body = resp_body.downcast_ref::<String>().unwrap();
+        assert_eq!(body, "hello cast!");
+        let not_body = resp_body.downcast_ref::<()>();
+        assert!(not_body.is_none());
+    }
+}

actix-http/src/message.rs

@@ -78,13 +78,13 @@ impl Head for RequestHead {
 impl RequestHead {
     /// Message extensions
     #[inline]
-    pub fn extensions(&self) -> Ref<Extensions> {
+    pub fn extensions(&self) -> Ref<'_, Extensions> {
         self.extensions.borrow()
     }
 
     /// Mutable reference to a the message's extensions
     #[inline]
-    pub fn extensions_mut(&self) -> RefMut<Extensions> {
+    pub fn extensions_mut(&self) -> RefMut<'_, Extensions> {
         self.extensions.borrow_mut()
     }
 
@@ -181,6 +181,36 @@ impl RequestHead {
     }
 }
 
+#[derive(Debug)]
+pub enum RequestHeadType {
+    Owned(RequestHead),
+    Rc(Rc<RequestHead>, Option<HeaderMap>),
+}
+
+impl RequestHeadType {
+    pub fn extra_headers(&self) -> Option<&HeaderMap> {
+        match self {
+            RequestHeadType::Owned(_) => None,
+            RequestHeadType::Rc(_, headers) => headers.as_ref(),
+        }
+    }
+}
+
+impl AsRef<RequestHead> for RequestHeadType {
+    fn as_ref(&self) -> &RequestHead {
+        match self {
+            RequestHeadType::Owned(head) => &head,
+            RequestHeadType::Rc(head, _) => head.as_ref(),
+        }
+    }
+}
+
+impl From<RequestHead> for RequestHeadType {
+    fn from(head: RequestHead) -> Self {
+        RequestHeadType::Owned(head)
+    }
+}
+
 #[derive(Debug)]
 pub struct ResponseHead {
     pub version: Version,
@@ -207,13 +237,13 @@ impl ResponseHead {
 
     /// Message extensions
     #[inline]
-    pub fn extensions(&self) -> Ref<Extensions> {
+    pub fn extensions(&self) -> Ref<'_, Extensions> {
         self.extensions.borrow()
     }
 
     /// Mutable reference to a the message's extensions
     #[inline]
-    pub fn extensions_mut(&self) -> RefMut<Extensions> {
+    pub fn extensions_mut(&self) -> RefMut<'_, Extensions> {
         self.extensions.borrow_mut()
     }
 
@@ -358,6 +388,12 @@ impl BoxedResponseHead {
     pub fn new(status: StatusCode) -> Self {
         RESPONSE_POOL.with(|p| p.get_message(status))
     }
+
+    pub(crate) fn take(&mut self) -> Self {
+        BoxedResponseHead {
+            head: self.head.take(),
+        }
+    }
 }
 
 impl std::ops::Deref for BoxedResponseHead {
@@ -376,7 +412,9 @@ impl std::ops::DerefMut for BoxedResponseHead {
 
 impl Drop for BoxedResponseHead {
     fn drop(&mut self) {
-        RESPONSE_POOL.with(|p| p.release(self.head.take().unwrap()))
+        if let Some(head) = self.head.take() {
+            RESPONSE_POOL.with(move |p| p.release(head))
+        }
     }
 }
 
@@ -385,6 +423,7 @@ impl Drop for BoxedResponseHead {
 pub struct MessagePool<T: Head>(RefCell<Vec<Rc<T>>>);
 
 #[doc(hidden)]
+#[allow(clippy::vec_box)]
 /// Request's objects pool
 pub struct BoxedResponsePool(RefCell<Vec<Box<ResponseHead>>>);
 

actix-http/src/payload.rs

@@ -1,11 +1,14 @@
+use std::pin::Pin;
+use std::task::{Context, Poll};
+
 use bytes::Bytes;
-use futures::{Async, Poll, Stream};
+use futures_core::Stream;
 use h2::RecvStream;
 
 use crate::error::PayloadError;
 
 /// Type represent boxed payload
-pub type PayloadStream = Box<dyn Stream<Item = Bytes, Error = PayloadError>>;
+pub type PayloadStream = Pin<Box<dyn Stream<Item = Result<Bytes, PayloadError>>>>;
 
 /// Type represent streaming payload
 pub enum Payload<S = PayloadStream> {
@@ -48,18 +51,20 @@ impl<S> Payload<S> {
 
 impl<S> Stream for Payload<S>
 where
-    S: Stream<Item = Bytes, Error = PayloadError>,
+    S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
 {
-    type Item = Bytes;
-    type Error = PayloadError;
+    type Item = Result<Bytes, PayloadError>;
 
     #[inline]
-    fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
-        match self {
-            Payload::None => Ok(Async::Ready(None)),
-            Payload::H1(ref mut pl) => pl.poll(),
-            Payload::H2(ref mut pl) => pl.poll(),
-            Payload::Stream(ref mut pl) => pl.poll(),
+    fn poll_next(
+        self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Option<Self::Item>> {
+        match self.get_mut() {
+            Payload::None => Poll::Ready(None),
+            Payload::H1(ref mut pl) => pl.readany(cx),
+            Payload::H2(ref mut pl) => Pin::new(pl).poll_next(cx),
+            Payload::Stream(ref mut pl) => Pin::new(pl).poll_next(cx),
         }
     }
 }

actix-http/src/request.rs

@@ -25,13 +25,13 @@ impl<P> HttpMessage for Request<P> {
 
     /// Request extensions
     #[inline]
-    fn extensions(&self) -> Ref<Extensions> {
+    fn extensions(&self) -> Ref<'_, Extensions> {
         self.head.extensions()
     }
 
     /// Mutable reference to a the request's extensions
     #[inline]
-    fn extensions_mut(&self) -> RefMut<Extensions> {
+    fn extensions_mut(&self) -> RefMut<'_, Extensions> {
         self.head.extensions_mut()
     }
 
@@ -80,6 +80,11 @@ impl<P> Request<P> {
         )
     }
 
+    /// Get request's payload
+    pub fn payload(&mut self) -> &mut Payload<P> {
+        &mut self.payload
+    }
+
     /// Get request's payload
     pub fn take_payload(&mut self) -> Payload<P> {
         std::mem::replace(&mut self.payload, Payload::None)
@@ -160,7 +165,7 @@ impl<P> Request<P> {
 }
 
 impl<P> fmt::Debug for Request<P> {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         writeln!(
             f,
             "\nRequest {:?} {}:{}",
@@ -182,7 +187,7 @@ impl<P> fmt::Debug for Request<P> {
 #[cfg(test)]
 mod tests {
     use super::*;
-    use http::HttpTryFrom;
+    use std::convert::TryFrom;
 
     #[test]
     fn test_basics() {
@@ -199,7 +204,6 @@ mod tests {
         assert_eq!(req.uri().query(), Some("q=1"));
 
         let s = format!("{:?}", req);
-        println!("T: {:?}", s);
         assert!(s.contains("Request HTTP/1.1 GET:/index.html"));
     }
 }

actix-http/src/response.rs

@@ -1,13 +1,14 @@
 //! Http response
 use std::cell::{Ref, RefMut};
-use std::io::Write;
+use std::convert::TryFrom;
+use std::future::Future;
+use std::pin::Pin;
+use std::task::{Context, Poll};
 use std::{fmt, str};
 
-use bytes::{BufMut, Bytes, BytesMut};
-use futures::future::{ok, FutureResult, IntoFuture};
-use futures::Stream;
+use bytes::{Bytes, BytesMut};
+use futures_core::Stream;
 use serde::Serialize;
-use serde_json;
 
 use crate::body::{Body, BodyStream, MessageBody, ResponseBody};
 use crate::cookie::{Cookie, CookieJar};
@@ -15,7 +16,7 @@ use crate::error::Error;
 use crate::extensions::Extensions;
 use crate::header::{Header, IntoHeaderValue};
 use crate::http::header::{self, HeaderName, HeaderValue};
-use crate::http::{Error as HttpError, HeaderMap, HttpTryFrom, StatusCode};
+use crate::http::{Error as HttpError, HeaderMap, StatusCode};
 use crate::message::{BoxedResponseHead, ConnectionType, ResponseHead};
 
 /// An HTTP Response
@@ -51,7 +52,10 @@ impl Response<Body> {
     /// Constructs an error response
     #[inline]
     pub fn from_error(error: Error) -> Response {
-        let mut resp = error.as_response_error().render_response();
+        let mut resp = error.as_response_error().error_response();
+        if resp.head.status == StatusCode::INTERNAL_SERVER_ERROR {
+            error!("Internal Server Error: {:?}", error);
+        }
         resp.error = Some(error);
         resp
     }
@@ -125,7 +129,7 @@ impl<B> Response<B> {
 
     /// Get an iterator for the cookies set by this response
     #[inline]
-    pub fn cookies(&self) -> CookieIter {
+    pub fn cookies(&self) -> CookieIter<'_> {
         CookieIter {
             iter: self.head.headers.get_all(header::SET_COOKIE),
         }
@@ -133,7 +137,7 @@ impl<B> Response<B> {
 
     /// Add a cookie to this response
     #[inline]
-    pub fn add_cookie(&mut self, cookie: &Cookie) -> Result<(), HttpError> {
+    pub fn add_cookie(&mut self, cookie: &Cookie<'_>) -> Result<(), HttpError> {
         let h = &mut self.head.headers;
         HeaderValue::from_str(&cookie.to_string())
             .map(|c| {
@@ -181,17 +185,17 @@ impl<B> Response<B> {
 
     /// Responses extensions
     #[inline]
-    pub fn extensions(&self) -> Ref<Extensions> {
+    pub fn extensions(&self) -> Ref<'_, Extensions> {
         self.head.extensions.borrow()
     }
 
     /// Mutable reference to a the response's extensions
     #[inline]
-    pub fn extensions_mut(&mut self) -> RefMut<Extensions> {
+    pub fn extensions_mut(&mut self) -> RefMut<'_, Extensions> {
         self.head.extensions.borrow_mut()
     }
 
-    /// Get body os this response
+    /// Get body of this response
     #[inline]
     pub fn body(&self) -> &ResponseBody<B> {
         &self.body
@@ -260,7 +264,7 @@ impl<B> Response<B> {
 }
 
 impl<B: MessageBody> fmt::Debug for Response<B> {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         let res = writeln!(
             f,
             "\nResponse {:?} {}{}",
@@ -277,13 +281,15 @@ impl<B: MessageBody> fmt::Debug for Response<B> {
     }
 }
 
-impl IntoFuture for Response {
-    type Item = Response;
-    type Error = Error;
-    type Future = FutureResult<Response, Error>;
+impl Future for Response {
+    type Output = Result<Response, Error>;
 
-    fn into_future(self) -> Self::Future {
-        ok(self)
+    fn poll(mut self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<Self::Output> {
+        Poll::Ready(Ok(Response {
+            head: self.head.take(),
+            body: self.body.take_body(),
+            error: self.error.take(),
+        }))
     }
 }
 
@@ -347,7 +353,6 @@ impl ResponseBuilder {
     ///         ))
     ///         .finish())
     /// }
-    /// fn main() {}
     /// ```
     #[doc(hidden)]
     pub fn set<H: Header>(&mut self, hdr: H) -> &mut Self {
@@ -373,11 +378,11 @@ impl ResponseBuilder {
     ///         .header(http::header::CONTENT_TYPE, "application/json")
     ///         .finish()
     /// }
-    /// fn main() {}
     /// ```
     pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self
     where
-        HeaderName: HttpTryFrom<K>,
+        HeaderName: TryFrom<K>,
+        <HeaderName as TryFrom<K>>::Error: Into<HttpError>,
         V: IntoHeaderValue,
     {
         if let Some(parts) = parts(&mut self.head, &self.err) {
@@ -405,11 +410,11 @@ impl ResponseBuilder {
     ///         .set_header(http::header::CONTENT_TYPE, "application/json")
     ///         .finish()
     /// }
-    /// fn main() {}
     /// ```
     pub fn set_header<K, V>(&mut self, key: K, value: V) -> &mut Self
     where
-        HeaderName: HttpTryFrom<K>,
+        HeaderName: TryFrom<K>,
+        <HeaderName as TryFrom<K>>::Error: Into<HttpError>,
         V: IntoHeaderValue,
     {
         if let Some(parts) = parts(&mut self.head, &self.err) {
@@ -478,7 +483,8 @@ impl ResponseBuilder {
     #[inline]
     pub fn content_type<V>(&mut self, value: V) -> &mut Self
     where
-        HeaderValue: HttpTryFrom<V>,
+        HeaderValue: TryFrom<V>,
+        <HeaderValue as TryFrom<V>>::Error: Into<HttpError>,
     {
         if let Some(parts) = parts(&mut self.head, &self.err) {
             match HeaderValue::try_from(value) {
@@ -494,9 +500,7 @@ impl ResponseBuilder {
     /// Set content length
     #[inline]
     pub fn content_length(&mut self, len: u64) -> &mut Self {
-        let mut wrt = BytesMut::new().writer();
-        let _ = write!(wrt, "{}", len);
-        self.header(header::CONTENT_LENGTH, wrt.get_mut().take().freeze())
+        self.header(header::CONTENT_LENGTH, len)
     }
 
     /// Set a cookie
@@ -580,14 +584,14 @@ impl ResponseBuilder {
 
     /// Responses extensions
     #[inline]
-    pub fn extensions(&self) -> Ref<Extensions> {
+    pub fn extensions(&self) -> Ref<'_, Extensions> {
         let head = self.head.as_ref().expect("cannot reuse response builder");
         head.extensions.borrow()
     }
 
     /// Mutable reference to a the response's extensions
     #[inline]
-    pub fn extensions_mut(&mut self) -> RefMut<Extensions> {
+    pub fn extensions_mut(&mut self) -> RefMut<'_, Extensions> {
         let head = self.head.as_ref().expect("cannot reuse response builder");
         head.extensions.borrow_mut()
     }
@@ -632,7 +636,7 @@ impl ResponseBuilder {
     /// `ResponseBuilder` can not be used after this call.
     pub fn streaming<S, E>(&mut self, stream: S) -> Response
     where
-        S: Stream<Item = Bytes, Error = E> + 'static,
+        S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
         E: Into<Error> + 'static,
     {
         self.body(Body::from_message(BodyStream::new(stream)))
@@ -754,18 +758,16 @@ impl<'a> From<&'a ResponseHead> for ResponseBuilder {
     }
 }
 
-impl IntoFuture for ResponseBuilder {
-    type Item = Response;
-    type Error = Error;
-    type Future = FutureResult<Response, Error>;
+impl Future for ResponseBuilder {
+    type Output = Result<Response, Error>;
 
-    fn into_future(mut self) -> Self::Future {
-        ok(self.finish())
+    fn poll(mut self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<Self::Output> {
+        Poll::Ready(Ok(self.finish()))
     }
 }
 
 impl fmt::Debug for ResponseBuilder {
-    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
         let head = self.head.as_ref().unwrap();
 
         let res = writeln!(
@@ -989,6 +991,14 @@ mod tests {
         assert_eq!(resp.body().get_ref(), b"[\"v1\",\"v2\",\"v3\"]");
     }
 
+    #[test]
+    fn test_serde_json_in_body() {
+        use serde_json::json;
+        let resp =
+            Response::build(StatusCode::OK).body(json!({"test-key":"test-value"}));
+        assert_eq!(resp.body().get_ref(), br#"{"test-key":"test-value"}"#);
+    }
+
     #[test]
     fn test_into_response() {
         let resp: Response = "test".into();

actix-http/src/service.rs

@@ -1,39 +1,43 @@
 use std::marker::PhantomData;
-use std::{fmt, io, net};
+use std::pin::Pin;
+use std::task::{Context, Poll};
+use std::{fmt, net, rc};
 
 use actix_codec::{AsyncRead, AsyncWrite, Framed};
-use actix_server_config::{
-    Io as ServerIo, IoStream, Protocol, ServerConfig as SrvConfig,
-};
-use actix_service::{IntoNewService, NewService, Service};
-use actix_utils::cloneable::CloneableService;
-use bytes::{Buf, BufMut, Bytes, BytesMut};
-use futures::{try_ready, Async, Future, IntoFuture, Poll};
+use actix_rt::net::TcpStream;
+use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
+use bytes::Bytes;
+use futures_core::{ready, Future};
+use futures_util::future::ok;
 use h2::server::{self, Handshake};
+use pin_project::{pin_project, project};
 
 use crate::body::MessageBody;
 use crate::builder::HttpServiceBuilder;
+use crate::cloneable::CloneableService;
 use crate::config::{KeepAlive, ServiceConfig};
 use crate::error::{DispatchError, Error};
+use crate::helpers::DataFactory;
 use crate::request::Request;
 use crate::response::Response;
-use crate::{h1, h2::Dispatcher};
+use crate::{h1, h2::Dispatcher, Protocol};
 
-/// `NewService` HTTP1.1/HTTP2 transport implementation
-pub struct HttpService<T, P, S, B, X = h1::ExpectHandler, U = h1::UpgradeHandler<T>> {
+/// `ServiceFactory` HTTP1.1/HTTP2 transport implementation
+pub struct HttpService<T, S, B, X = h1::ExpectHandler, U = h1::UpgradeHandler<T>> {
     srv: S,
     cfg: ServiceConfig,
     expect: X,
     upgrade: Option<U>,
-    _t: PhantomData<(T, P, B)>,
+    on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, S, B> HttpService<T, (), S, B>
+impl<T, S, B> HttpService<T, S, B>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
 {
@@ -43,49 +47,52 @@ where
     }
 }
 
-impl<T, P, S, B> HttpService<T, P, S, B>
+impl<T, S, B> HttpService<T, S, B>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
 {
     /// Create new `HttpService` instance.
-    pub fn new<F: IntoNewService<S>>(service: F) -> Self {
-        let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
+    pub fn new<F: IntoServiceFactory<S>>(service: F) -> Self {
+        let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0, false, None);
 
         HttpService {
             cfg,
-            srv: service.into_new_service(),
+            srv: service.into_factory(),
             expect: h1::ExpectHandler,
             upgrade: None,
+            on_connect: None,
             _t: PhantomData,
         }
     }
 
     /// Create new `HttpService` instance with config.
-    pub(crate) fn with_config<F: IntoNewService<S>>(
+    pub(crate) fn with_config<F: IntoServiceFactory<S>>(
         cfg: ServiceConfig,
         service: F,
     ) -> Self {
         HttpService {
             cfg,
-            srv: service.into_new_service(),
+            srv: service.into_factory(),
             expect: h1::ExpectHandler,
             upgrade: None,
+            on_connect: None,
             _t: PhantomData,
         }
     }
 }
 
-impl<T, P, S, B, X, U> HttpService<T, P, S, B, X, U>
+impl<T, S, B, X, U> HttpService<T, S, B, X, U>
 where
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
+    <S::Service as Service>::Future: 'static,
     B: MessageBody,
 {
     /// Provide service for `EXPECT: 100-Continue` support.
@@ -93,17 +100,19 @@ where
     /// Service get called with request that contains `EXPECT` header.
     /// Service must return request in case of success, in that case
     /// request will be forwarded to main service.
-    pub fn expect<X1>(self, expect: X1) -> HttpService<T, P, S, B, X1, U>
+    pub fn expect<X1>(self, expect: X1) -> HttpService<T, S, B, X1, U>
     where
-        X1: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+        X1: ServiceFactory<Config = (), Request = Request, Response = Request>,
         X1::Error: Into<Error>,
         X1::InitError: fmt::Debug,
+        <X1::Service as Service>::Future: 'static,
     {
         HttpService {
             expect,
             cfg: self.cfg,
             srv: self.srv,
             upgrade: self.upgrade,
+            on_connect: self.on_connect,
             _t: PhantomData,
         }
     }
@@ -112,142 +121,343 @@ where
     ///
     /// If service is provided then normal requests handling get halted
     /// and this service get called with original request and framed object.
-    pub fn upgrade<U1>(self, upgrade: Option<U1>) -> HttpService<T, P, S, B, X, U1>
+    pub fn upgrade<U1>(self, upgrade: Option<U1>) -> HttpService<T, S, B, X, U1>
     where
-        U1: NewService<
-            Config = SrvConfig,
+        U1: ServiceFactory<
+            Config = (),
             Request = (Request, Framed<T, h1::Codec>),
             Response = (),
         >,
         U1::Error: fmt::Display,
         U1::InitError: fmt::Debug,
+        <U1::Service as Service>::Future: 'static,
     {
         HttpService {
             upgrade,
             cfg: self.cfg,
             srv: self.srv,
             expect: self.expect,
+            on_connect: self.on_connect,
             _t: PhantomData,
         }
     }
+
+    /// Set on connect callback.
+    pub(crate) fn on_connect(
+        mut self,
+        f: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    ) -> Self {
+        self.on_connect = f;
+        self
+    }
+}
+
+impl<S, B, X, U> HttpService<TcpStream, S, B, X, U>
+where
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
+    S::InitError: fmt::Debug,
+    S::Response: Into<Response<B>> + 'static,
+    <S::Service as Service>::Future: 'static,
+    B: MessageBody + 'static,
+    X: ServiceFactory<Config = (), Request = Request, Response = Request>,
+    X::Error: Into<Error>,
+    X::InitError: fmt::Debug,
+    <X::Service as Service>::Future: 'static,
+    U: ServiceFactory<
+        Config = (),
+        Request = (Request, Framed<TcpStream, h1::Codec>),
+        Response = (),
+    >,
+    U::Error: fmt::Display + Into<Error>,
+    U::InitError: fmt::Debug,
+    <U::Service as Service>::Future: 'static,
+{
+    /// Create simple tcp stream service
+    pub fn tcp(
+        self,
+    ) -> impl ServiceFactory<
+        Config = (),
+        Request = TcpStream,
+        Response = (),
+        Error = DispatchError,
+        InitError = (),
+    > {
+        pipeline_factory(|io: TcpStream| {
+            let peer_addr = io.peer_addr().ok();
+            ok((io, Protocol::Http1, peer_addr))
+        })
+        .and_then(self)
+    }
+}
+
+#[cfg(feature = "openssl")]
+mod openssl {
+    use super::*;
+    use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
+    use actix_tls::{openssl::HandshakeError, SslError};
+
+    impl<S, B, X, U> HttpService<SslStream<TcpStream>, S, B, X, U>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error> + 'static,
+        S::InitError: fmt::Debug,
+        S::Response: Into<Response<B>> + 'static,
+        <S::Service as Service>::Future: 'static,
+        B: MessageBody + 'static,
+        X: ServiceFactory<Config = (), Request = Request, Response = Request>,
+        X::Error: Into<Error>,
+        X::InitError: fmt::Debug,
+        <X::Service as Service>::Future: 'static,
+        U: ServiceFactory<
+            Config = (),
+            Request = (Request, Framed<SslStream<TcpStream>, h1::Codec>),
+            Response = (),
+        >,
+        U::Error: fmt::Display + Into<Error>,
+        U::InitError: fmt::Debug,
+        <U::Service as Service>::Future: 'static,
+    {
+        /// Create openssl based service
+        pub fn openssl(
+            self,
+            acceptor: SslAcceptor,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = SslError<HandshakeError<TcpStream>, DispatchError>,
+            InitError = (),
+        > {
+            pipeline_factory(
+                Acceptor::new(acceptor)
+                    .map_err(SslError::Ssl)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(|io: SslStream<TcpStream>| {
+                let proto = if let Some(protos) = io.ssl().selected_alpn_protocol() {
+                    if protos.windows(2).any(|window| window == b"h2") {
+                        Protocol::Http2
+                    } else {
+                        Protocol::Http1
+                    }
+                } else {
+                    Protocol::Http1
+                };
+                let peer_addr = io.get_ref().peer_addr().ok();
+                ok((io, proto, peer_addr))
+            })
+            .and_then(self.map_err(SslError::Service))
+        }
+    }
 }
 
-impl<T, P, S, B, X, U> NewService for HttpService<T, P, S, B, X, U>
+#[cfg(feature = "rustls")]
+mod rustls {
+    use super::*;
+    use actix_tls::rustls::{Acceptor, ServerConfig, Session, TlsStream};
+    use actix_tls::SslError;
+    use std::io;
+
+    impl<S, B, X, U> HttpService<TlsStream<TcpStream>, S, B, X, U>
+    where
+        S: ServiceFactory<Config = (), Request = Request>,
+        S::Error: Into<Error> + 'static,
+        S::InitError: fmt::Debug,
+        S::Response: Into<Response<B>> + 'static,
+        <S::Service as Service>::Future: 'static,
+        B: MessageBody + 'static,
+        X: ServiceFactory<Config = (), Request = Request, Response = Request>,
+        X::Error: Into<Error>,
+        X::InitError: fmt::Debug,
+        <X::Service as Service>::Future: 'static,
+        U: ServiceFactory<
+            Config = (),
+            Request = (Request, Framed<TlsStream<TcpStream>, h1::Codec>),
+            Response = (),
+        >,
+        U::Error: fmt::Display + Into<Error>,
+        U::InitError: fmt::Debug,
+        <U::Service as Service>::Future: 'static,
+    {
+        /// Create openssl based service
+        pub fn rustls(
+            self,
+            mut config: ServerConfig,
+        ) -> impl ServiceFactory<
+            Config = (),
+            Request = TcpStream,
+            Response = (),
+            Error = SslError<io::Error, DispatchError>,
+            InitError = (),
+        > {
+            let protos = vec!["h2".to_string().into(), "http/1.1".to_string().into()];
+            config.set_protocols(&protos);
+
+            pipeline_factory(
+                Acceptor::new(config)
+                    .map_err(SslError::Ssl)
+                    .map_init_err(|_| panic!()),
+            )
+            .and_then(|io: TlsStream<TcpStream>| {
+                let proto = if let Some(protos) = io.get_ref().1.get_alpn_protocol() {
+                    if protos.windows(2).any(|window| window == b"h2") {
+                        Protocol::Http2
+                    } else {
+                        Protocol::Http1
+                    }
+                } else {
+                    Protocol::Http1
+                };
+                let peer_addr = io.get_ref().0.peer_addr().ok();
+                ok((io, proto, peer_addr))
+            })
+            .and_then(self.map_err(SslError::Service))
+        }
+    }
+}
+
+impl<T, S, B, X, U> ServiceFactory for HttpService<T, S, B, X, U>
 where
-    T: IoStream,
-    S: NewService<Config = SrvConfig, Request = Request>,
-    S::Error: Into<Error>,
+    T: AsyncRead + AsyncWrite + Unpin,
+    S: ServiceFactory<Config = (), Request = Request>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
-    X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
+    X: ServiceFactory<Config = (), Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<
-        Config = SrvConfig,
+    <X::Service as Service>::Future: 'static,
+    U: ServiceFactory<
+        Config = (),
         Request = (Request, Framed<T, h1::Codec>),
         Response = (),
     >,
-    U::Error: fmt::Display,
+    U::Error: fmt::Display + Into<Error>,
     U::InitError: fmt::Debug,
+    <U::Service as Service>::Future: 'static,
 {
-    type Config = SrvConfig;
-    type Request = ServerIo<T, P>;
+    type Config = ();
+    type Request = (T, Protocol, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type InitError = ();
-    type Service = HttpServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
-    type Future = HttpServiceResponse<T, P, S, B, X, U>;
+    type Service = HttpServiceHandler<T, S::Service, B, X::Service, U::Service>;
+    type Future = HttpServiceResponse<T, S, B, X, U>;
 
-    fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
+    fn new_service(&self, _: ()) -> Self::Future {
         HttpServiceResponse {
-            fut: self.srv.new_service(cfg).into_future(),
-            fut_ex: Some(self.expect.new_service(cfg)),
-            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(cfg)),
+            fut: self.srv.new_service(()),
+            fut_ex: Some(self.expect.new_service(())),
+            fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
             expect: None,
             upgrade: None,
-            cfg: Some(self.cfg.clone()),
+            on_connect: self.on_connect.clone(),
+            cfg: self.cfg.clone(),
             _t: PhantomData,
         }
     }
 }
 
 #[doc(hidden)]
-pub struct HttpServiceResponse<T, P, S: NewService, B, X: NewService, U: NewService> {
+#[pin_project]
+pub struct HttpServiceResponse<
+    T,
+    S: ServiceFactory,
+    B,
+    X: ServiceFactory,
+    U: ServiceFactory,
+> {
+    #[pin]
     fut: S::Future,
+    #[pin]
     fut_ex: Option<X::Future>,
+    #[pin]
     fut_upg: Option<U::Future>,
     expect: Option<X::Service>,
     upgrade: Option<U::Service>,
-    cfg: Option<ServiceConfig>,
-    _t: PhantomData<(T, P, B)>,
+    on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    cfg: ServiceConfig,
+    _t: PhantomData<(T, B)>,
 }
 
-impl<T, P, S, B, X, U> Future for HttpServiceResponse<T, P, S, B, X, U>
+impl<T, S, B, X, U> Future for HttpServiceResponse<T, S, B, X, U>
 where
-    T: IoStream,
-    S: NewService<Request = Request>,
-    S::Error: Into<Error>,
+    T: AsyncRead + AsyncWrite + Unpin,
+    S: ServiceFactory<Request = Request>,
+    S::Error: Into<Error> + 'static,
     S::InitError: fmt::Debug,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     <S::Service as Service>::Future: 'static,
     B: MessageBody + 'static,
-    X: NewService<Request = Request, Response = Request>,
+    X: ServiceFactory<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     X::InitError: fmt::Debug,
-    U: NewService<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
+    <X::Service as Service>::Future: 'static,
+    U: ServiceFactory<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
     U::Error: fmt::Display,
     U::InitError: fmt::Debug,
+    <U::Service as Service>::Future: 'static,
 {
-    type Item = HttpServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
-    type Error = ();
+    type Output =
+        Result<HttpServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        if let Some(ref mut fut) = self.fut_ex {
-            let expect = try_ready!(fut
-                .poll()
-                .map_err(|e| log::error!("Init http service error: {:?}", e)));
-            self.expect = Some(expect);
-            self.fut_ex.take();
+    fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let mut this = self.as_mut().project();
+
+        if let Some(fut) = this.fut_ex.as_pin_mut() {
+            let expect = ready!(fut
+                .poll(cx)
+                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
+            this = self.as_mut().project();
+            *this.expect = Some(expect);
+            this.fut_ex.set(None);
         }
 
-        if let Some(ref mut fut) = self.fut_upg {
-            let upgrade = try_ready!(fut
-                .poll()
-                .map_err(|e| log::error!("Init http service error: {:?}", e)));
-            self.upgrade = Some(upgrade);
-            self.fut_ex.take();
+        if let Some(fut) = this.fut_upg.as_pin_mut() {
+            let upgrade = ready!(fut
+                .poll(cx)
+                .map_err(|e| log::error!("Init http service error: {:?}", e)))?;
+            this = self.as_mut().project();
+            *this.upgrade = Some(upgrade);
+            this.fut_ex.set(None);
         }
 
-        let service = try_ready!(self
+        let result = ready!(this
             .fut
-            .poll()
+            .poll(cx)
             .map_err(|e| log::error!("Init http service error: {:?}", e)));
-        Ok(Async::Ready(HttpServiceHandler::new(
-            self.cfg.take().unwrap(),
-            service,
-            self.expect.take().unwrap(),
-            self.upgrade.take(),
-        )))
+        Poll::Ready(result.map(|service| {
+            let this = self.as_mut().project();
+            HttpServiceHandler::new(
+                this.cfg.clone(),
+                service,
+                this.expect.take().unwrap(),
+                this.upgrade.take(),
+                this.on_connect.clone(),
+            )
+        }))
     }
 }
 
 /// `Service` implementation for http transport
-pub struct HttpServiceHandler<T, P, S, B, X, U> {
+pub struct HttpServiceHandler<T, S: Service, B, X: Service, U: Service> {
     srv: CloneableService<S>,
     expect: CloneableService<X>,
     upgrade: Option<CloneableService<U>>,
     cfg: ServiceConfig,
-    _t: PhantomData<(T, P, B, X)>,
+    on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    _t: PhantomData<(T, B, X)>,
 }
 
-impl<T, P, S, B, X, U> HttpServiceHandler<T, P, S, B, X, U>
+impl<T, S, B, X, U> HttpServiceHandler<T, S, B, X, U>
 where
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
     X: Service<Request = Request, Response = Request>,
     X::Error: Into<Error>,
@@ -259,39 +469,41 @@ where
         srv: S,
         expect: X,
         upgrade: Option<U>,
-    ) -> HttpServiceHandler<T, P, S, B, X, U> {
+        on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
+    ) -> HttpServiceHandler<T, S, B, X, U> {
         HttpServiceHandler {
             cfg,
+            on_connect,
             srv: CloneableService::new(srv),
             expect: CloneableService::new(expect),
-            upgrade: upgrade.map(|s| CloneableService::new(s)),
+            upgrade: upgrade.map(CloneableService::new),
             _t: PhantomData,
         }
     }
 }
 
-impl<T, P, S, B, X, U> Service for HttpServiceHandler<T, P, S, B, X, U>
+impl<T, S, B, X, U> Service for HttpServiceHandler<T, S, B, X, U>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
     X: Service<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
-    U::Error: fmt::Display,
+    U::Error: fmt::Display + Into<Error>,
 {
-    type Request = ServerIo<T, P>;
+    type Request = (T, Protocol, Option<net::SocketAddr>);
     type Response = ();
     type Error = DispatchError;
     type Future = HttpServiceHandlerResponse<T, S, B, X, U>;
 
-    fn poll_ready(&mut self) -> Poll<(), Self::Error> {
+    fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
         let ready = self
             .expect
-            .poll_ready()
+            .poll_ready(cx)
             .map_err(|e| {
                 let e = e.into();
                 log::error!("Http service readiness error: {:?}", e);
@@ -301,7 +513,7 @@ where
 
         let ready = self
             .srv
-            .poll_ready()
+            .poll_ready(cx)
             .map_err(|e| {
                 let e = e.into();
                 log::error!("Http service readiness error: {:?}", e);
@@ -310,256 +522,162 @@ where
             .is_ready()
             && ready;
 
-        if ready {
-            Ok(Async::Ready(()))
+        let ready = if let Some(ref mut upg) = self.upgrade {
+            upg.poll_ready(cx)
+                .map_err(|e| {
+                    let e = e.into();
+                    log::error!("Http service readiness error: {:?}", e);
+                    DispatchError::Service(e)
+                })?
+                .is_ready()
+                && ready
         } else {
-            Ok(Async::NotReady)
+            ready
+        };
+
+        if ready {
+            Poll::Ready(Ok(()))
+        } else {
+            Poll::Pending
         }
     }
 
-    fn call(&mut self, req: Self::Request) -> Self::Future {
-        let (io, _, proto) = req.into_parts();
+    fn call(&mut self, (io, proto, peer_addr): Self::Request) -> Self::Future {
+        let on_connect = if let Some(ref on_connect) = self.on_connect {
+            Some(on_connect(&io))
+        } else {
+            None
+        };
+
         match proto {
-            Protocol::Http2 => {
-                let peer_addr = io.peer_addr();
-                let io = Io {
-                    inner: io,
-                    unread: None,
-                };
-                HttpServiceHandlerResponse {
-                    state: State::Handshake(Some((
-                        server::handshake(io),
-                        self.cfg.clone(),
-                        self.srv.clone(),
-                        peer_addr,
-                    ))),
-                }
-            }
-            Protocol::Http10 | Protocol::Http11 => HttpServiceHandlerResponse {
+            Protocol::Http2 => HttpServiceHandlerResponse {
+                state: State::H2Handshake(Some((
+                    server::handshake(io),
+                    self.cfg.clone(),
+                    self.srv.clone(),
+                    on_connect,
+                    peer_addr,
+                ))),
+            },
+            Protocol::Http1 => HttpServiceHandlerResponse {
                 state: State::H1(h1::Dispatcher::new(
                     io,
                     self.cfg.clone(),
                     self.srv.clone(),
                     self.expect.clone(),
                     self.upgrade.clone(),
+                    on_connect,
+                    peer_addr,
                 )),
             },
-            _ => HttpServiceHandlerResponse {
-                state: State::Unknown(Some((
-                    io,
-                    BytesMut::with_capacity(14),
-                    self.cfg.clone(),
-                    self.srv.clone(),
-                    self.expect.clone(),
-                    self.upgrade.clone(),
-                ))),
-            },
         }
     }
 }
 
+#[pin_project]
 enum State<T, S, B, X, U>
 where
     S: Service<Request = Request>,
     S::Future: 'static,
     S::Error: Into<Error>,
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     B: MessageBody,
     X: Service<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
     U::Error: fmt::Display,
 {
-    H1(h1::Dispatcher<T, S, B, X, U>),
-    H2(Dispatcher<Io<T>, S, B>),
-    Unknown(
+    H1(#[pin] h1::Dispatcher<T, S, B, X, U>),
+    H2(#[pin] Dispatcher<T, S, B>),
+    H2Handshake(
         Option<(
-            T,
-            BytesMut,
-            ServiceConfig,
-            CloneableService<S>,
-            CloneableService<X>,
-            Option<CloneableService<U>>,
-        )>,
-    ),
-    Handshake(
-        Option<(
-            Handshake<Io<T>, Bytes>,
+            Handshake<T, Bytes>,
             ServiceConfig,
             CloneableService<S>,
+            Option<Box<dyn DataFactory>>,
             Option<net::SocketAddr>,
         )>,
     ),
 }
 
+#[pin_project]
 pub struct HttpServiceHandlerResponse<T, S, B, X, U>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody + 'static,
     X: Service<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
     U::Error: fmt::Display,
 {
+    #[pin]
     state: State<T, S, B, X, U>,
 }
 
-const HTTP2_PREFACE: [u8; 14] = *b"PRI * HTTP/2.0";
-
 impl<T, S, B, X, U> Future for HttpServiceHandlerResponse<T, S, B, X, U>
 where
-    T: IoStream,
+    T: AsyncRead + AsyncWrite + Unpin,
     S: Service<Request = Request>,
-    S::Error: Into<Error>,
+    S::Error: Into<Error> + 'static,
     S::Future: 'static,
-    S::Response: Into<Response<B>>,
+    S::Response: Into<Response<B>> + 'static,
     B: MessageBody,
     X: Service<Request = Request, Response = Request>,
     X::Error: Into<Error>,
     U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
     U::Error: fmt::Display,
 {
-    type Item = ();
-    type Error = DispatchError;
+    type Output = Result<(), DispatchError>;
 
-    fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
-        match self.state {
-            State::H1(ref mut disp) => disp.poll(),
-            State::H2(ref mut disp) => disp.poll(),
-            State::Unknown(ref mut data) => {
-                if let Some(ref mut item) = data {
-                    loop {
-                        unsafe {
-                            let b = item.1.bytes_mut();
-                            let n = try_ready!(item.0.poll_read(b));
-                            if n == 0 {
-                                return Ok(Async::Ready(()));
-                            }
-                            item.1.advance_mut(n);
-                            if item.1.len() >= HTTP2_PREFACE.len() {
-                                break;
-                            }
-                        }
-                    }
-                } else {
-                    panic!()
-                }
-                let (io, buf, cfg, srv, expect, upgrade) = data.take().unwrap();
-                if buf[..14] == HTTP2_PREFACE[..] {
-                    let peer_addr = io.peer_addr();
-                    let io = Io {
-                        inner: io,
-                        unread: Some(buf),
-                    };
-                    self.state = State::Handshake(Some((
-                        server::handshake(io),
-                        cfg,
-                        srv,
-                        peer_addr,
-                    )));
-                } else {
-                    self.state = State::H1(h1::Dispatcher::with_timeout(
-                        io,
-                        h1::Codec::new(cfg.clone()),
-                        cfg,
-                        buf,
-                        None,
-                        srv,
-                        expect,
-                        upgrade,
-                    ))
-                }
-                self.poll()
-            }
-            State::Handshake(ref mut data) => {
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        self.project().state.poll(cx)
+    }
+}
+
+impl<T, S, B, X, U> State<T, S, B, X, U>
+where
+    T: AsyncRead + AsyncWrite + Unpin,
+    S: Service<Request = Request>,
+    S::Error: Into<Error> + 'static,
+    S::Response: Into<Response<B>> + 'static,
+    B: MessageBody + 'static,
+    X: Service<Request = Request, Response = Request>,
+    X::Error: Into<Error>,
+    U: Service<Request = (Request, Framed<T, h1::Codec>), Response = ()>,
+    U::Error: fmt::Display,
+{
+    #[project]
+    fn poll(
+        mut self: Pin<&mut Self>,
+        cx: &mut Context<'_>,
+    ) -> Poll<Result<(), DispatchError>> {
+        #[project]
+        match self.as_mut().project() {
+            State::H1(disp) => disp.poll(cx),
+            State::H2(disp) => disp.poll(cx),
+            State::H2Handshake(ref mut data) => {
                 let conn = if let Some(ref mut item) = data {
-                    match item.0.poll() {
-                        Ok(Async::Ready(conn)) => conn,
-                        Ok(Async::NotReady) => return Ok(Async::NotReady),
-                        Err(err) => {
+                    match Pin::new(&mut item.0).poll(cx) {
+                        Poll::Ready(Ok(conn)) => conn,
+                        Poll::Ready(Err(err)) => {
                             trace!("H2 handshake error: {}", err);
-                            return Err(err.into());
+                            return Poll::Ready(Err(err.into()));
                         }
+                        Poll::Pending => return Poll::Pending,
                     }
                 } else {
                     panic!()
                 };
-                let (_, cfg, srv, peer_addr) = data.take().unwrap();
-                self.state = State::H2(Dispatcher::new(srv, conn, cfg, None, peer_addr));
-                self.poll()
+                let (_, cfg, srv, on_connect, peer_addr) = data.take().unwrap();
+                self.set(State::H2(Dispatcher::new(
+                    srv, conn, on_connect, cfg, None, peer_addr,
+                )));
+                self.poll(cx)
             }
         }
     }
 }
-
-/// Wrapper for `AsyncRead + AsyncWrite` types
-struct Io<T> {
-    unread: Option<BytesMut>,
-    inner: T,
-}
-
-impl<T: io::Read> io::Read for Io<T> {
-    fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
-        if let Some(mut bytes) = self.unread.take() {
-            let size = std::cmp::min(buf.len(), bytes.len());
-            buf[..size].copy_from_slice(&bytes[..size]);
-            if bytes.len() > size {
-                bytes.split_to(size);
-                self.unread = Some(bytes);
-            }
-            Ok(size)
-        } else {
-            self.inner.read(buf)
-        }
-    }
-}
-
-impl<T: io::Write> io::Write for Io<T> {
-    fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
-        self.inner.write(buf)
-    }
-    fn flush(&mut self) -> io::Result<()> {
-        self.inner.flush()
-    }
-}
-
-impl<T: AsyncRead> AsyncRead for Io<T> {
-    unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool {
-        self.inner.prepare_uninitialized_buffer(buf)
-    }
-}
-
-impl<T: AsyncWrite> AsyncWrite for Io<T> {
-    fn shutdown(&mut self) -> Poll<(), io::Error> {
-        self.inner.shutdown()
-    }
-    fn write_buf<B: Buf>(&mut self, buf: &mut B) -> Poll<usize, io::Error> {
-        self.inner.write_buf(buf)
-    }
-}
-
-impl<T: IoStream> IoStream for Io<T> {
-    #[inline]
-    fn peer_addr(&self) -> Option<net::SocketAddr> {
-        self.inner.peer_addr()
-    }
-
-    #[inline]
-    fn set_nodelay(&mut self, nodelay: bool) -> io::Result<()> {
-        self.inner.set_nodelay(nodelay)
-    }
-
-    #[inline]
-    fn set_linger(&mut self, dur: Option<std::time::Duration>) -> io::Result<()> {
-        self.inner.set_linger(dur)
-    }
-
-    #[inline]
-    fn set_keepalive(&mut self, dur: Option<std::time::Duration>) -> io::Result<()> {
-        self.inner.set_keepalive(dur)
-    }
-}

actix-http/src/test.rs

@@ -1,17 +1,18 @@
 //! Test Various helpers for Actix applications to use during testing.
+use std::convert::TryFrom;
 use std::fmt::Write as FmtWrite;
-use std::io;
+use std::io::{self, Read, Write};
+use std::pin::Pin;
 use std::str::FromStr;
+use std::task::{Context, Poll};
 
 use actix_codec::{AsyncRead, AsyncWrite};
-use actix_server_config::IoStream;
-use bytes::{Buf, Bytes, BytesMut};
-use futures::{Async, Poll};
+use bytes::{Bytes, BytesMut};
 use http::header::{self, HeaderName, HeaderValue};
-use http::{HttpTryFrom, Method, Uri, Version};
-use percent_encoding::{percent_encode, USERINFO_ENCODE_SET};
+use http::{Error as HttpError, Method, Uri, Version};
+use percent_encoding::percent_encode;
 
-use crate::cookie::{Cookie, CookieJar};
+use crate::cookie::{Cookie, CookieJar, USERINFO};
 use crate::header::HeaderMap;
 use crate::header::{Header, IntoHeaderValue};
 use crate::payload::Payload;
@@ -20,8 +21,6 @@ use crate::Request;
 /// Test `Request` builder
 ///
 /// ```rust,ignore
-/// # extern crate http;
-/// # extern crate actix_web;
 /// # use http::{header, StatusCode};
 /// # use actix_web::*;
 /// use actix_web::test::TestRequest;
@@ -34,15 +33,13 @@ use crate::Request;
 ///     }
 /// }
 ///
-/// fn main() {
-///     let resp = TestRequest::with_header("content-type", "text/plain")
-///         .run(&index)
-///         .unwrap();
-///     assert_eq!(resp.status(), StatusCode::OK);
+/// let resp = TestRequest::with_header("content-type", "text/plain")
+///     .run(&index)
+///     .unwrap();
+/// assert_eq!(resp.status(), StatusCode::OK);
 ///
-///     let resp = TestRequest::default().run(&index).unwrap();
-///     assert_eq!(resp.status(), StatusCode::BAD_REQUEST);
-/// }
+/// let resp = TestRequest::default().run(&index).unwrap();
+/// assert_eq!(resp.status(), StatusCode::BAD_REQUEST);
 /// ```
 pub struct TestRequest(Option<Inner>);
 
@@ -82,7 +79,8 @@ impl TestRequest {
     /// Create TestRequest and set header
     pub fn with_header<K, V>(key: K, value: V) -> TestRequest
     where
-        HeaderName: HttpTryFrom<K>,
+        HeaderName: TryFrom<K>,
+        <HeaderName as TryFrom<K>>::Error: Into<HttpError>,
         V: IntoHeaderValue,
     {
         TestRequest::default().header(key, value).take()
@@ -118,7 +116,8 @@ impl TestRequest {
     /// Set a header
     pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self
     where
-        HeaderName: HttpTryFrom<K>,
+        HeaderName: TryFrom<K>,
+        <HeaderName as TryFrom<K>>::Error: Into<HttpError>,
         V: IntoHeaderValue,
     {
         if let Ok(key) = HeaderName::try_from(key) {
@@ -150,7 +149,7 @@ impl TestRequest {
 
     /// Complete request creation and generate `Request` instance
     pub fn finish(&mut self) -> Request {
-        let inner = self.0.take().expect("cannot reuse test request builder");;
+        let inner = self.0.take().expect("cannot reuse test request builder");
 
         let mut req = if let Some(pl) = inner.payload {
             Request::with_payload(pl)
@@ -166,8 +165,8 @@ impl TestRequest {
 
         let mut cookie = String::new();
         for c in inner.cookies.delta() {
-            let name = percent_encode(c.name().as_bytes(), USERINFO_ENCODE_SET);
-            let value = percent_encode(c.value().as_bytes(), USERINFO_ENCODE_SET);
+            let name = percent_encode(c.name().as_bytes(), USERINFO);
+            let value = percent_encode(c.value().as_bytes(), USERINFO);
             let _ = write!(&mut cookie, "; {}={}", name, value);
         }
         if !cookie.is_empty() {
@@ -244,27 +243,30 @@ impl io::Write for TestBuffer {
     }
 }
 
-impl AsyncRead for TestBuffer {}
+impl AsyncRead for TestBuffer {
+    fn poll_read(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+        buf: &mut [u8],
+    ) -> Poll<io::Result<usize>> {
+        Poll::Ready(self.get_mut().read(buf))
+    }
+}
 
 impl AsyncWrite for TestBuffer {
-    fn shutdown(&mut self) -> Poll<(), io::Error> {
-        Ok(Async::Ready(()))
+    fn poll_write(
+        self: Pin<&mut Self>,
+        _: &mut Context<'_>,
+        buf: &[u8],
+    ) -> Poll<io::Result<usize>> {
+        Poll::Ready(self.get_mut().write(buf))
     }
-    fn write_buf<B: Buf>(&mut self, _: &mut B) -> Poll<usize, io::Error> {
-        Ok(Async::NotReady)
-    }
-}
-
-impl IoStream for TestBuffer {
-    fn set_nodelay(&mut self, _nodelay: bool) -> io::Result<()> {
-        Ok(())
-    }
-
-    fn set_linger(&mut self, _dur: Option<std::time::Duration>) -> io::Result<()> {
-        Ok(())
-    }
-
-    fn set_keepalive(&mut self, _dur: Option<std::time::Duration>) -> io::Result<()> {
-        Ok(())
+
+    fn poll_flush(self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<io::Result<()>> {
+        Poll::Ready(Ok(()))
+    }
+
+    fn poll_shutdown(self: Pin<&mut Self>, _: &mut Context<'_>) -> Poll<io::Result<()>> {
+        Poll::Ready(Ok(()))
     }
 }