1
0
mirror of https://github.com/fafhrd91/actix-web synced 2025-07-16 06:35:46 +02:00

Compare commits

..

418 Commits

Author SHA1 Message Date
Yuki Okushi
59ad1738e9 web: Bump up to 3.0.0-beta.2 (#1636) 2020-08-17 11:32:38 +01:00
Yuki Okushi
aa2bd6fbfb http: Bump up to 2.0.0-beta.3 (#1630) 2020-08-14 19:42:14 +09:00
William Myers
5aad8e24c7 Re-export all error types from awc (#1621) 2020-08-14 01:24:35 +01:00
Yuki Okushi
6e97bc09f8 Use action to upload docs 2020-08-13 16:04:50 +09:00
fakeshadow
160995b8d4 fix awc pool leak (#1626) 2020-08-09 21:49:43 +01:00
Rob Ede
187646b2f9 match HttpRequest app_data behavior in ServiceRequest (#1618) 2020-08-09 15:51:38 +01:00
Rob Ede
46627be36f add dep graph dot graphs (#1601) 2020-08-09 13:54:35 +01:00
Rob Ede
a78380739e require rustls feature for client example (#1625) 2020-08-09 13:32:37 +01:00
Rob Ede
cf1c8abe62 prepare release http & awc (#1617) 2020-07-22 01:13:10 +01:00
Yuki Okushi
92b5bcd13f Check format and tweak CI config (#1619) 2020-07-22 00:28:33 +01:00
masnagam
701bdacfa2 Fix illegal chunked encoding (#1615)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2020-07-21 17:24:56 +01:00
Rob Ede
6dc47c4093 fix soundness concern in h1 decoder (#1614)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-07-21 16:25:33 +01:00
Rob Ede
0ec335a39c bump MSRV to 1.42 (#1616) 2020-07-21 16:40:30 +09:00
Jonas Platte
f8d5ad6b53 Make web::Path a tuple struct with a public inner value (#1594)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2020-07-21 00:54:26 +01:00
Rob Ede
43c362779d also try extracting payload config as Data<T> (#1610) 2020-07-20 17:40:58 +01:00
Rob Ede
971ba3eee1 fix continous growth of app data in pooled requests (#1609)
fixes #1606
fixes #1607
2020-07-18 16:17:00 +01:00
Rob Ede
2fd96c03e5 prepare beta.1 release for multipart/files/actors (#1605) 2020-07-16 11:38:57 +01:00
Rob Ede
ad7c6d2633 prepare actix-web v3.0.0-beta.1 release (#1600) 2020-07-15 00:44:44 +01:00
Yuki Okushi
3362a3d61b Merge pull request #1603 from JohnTitor/license
Avoid using deprecated `/` in license field
2020-07-14 15:25:48 +09:00
Yuki Okushi
769ea6bd5b Merge pull request #1602 from actix/release/awc-beta-1
prepare awc v2.0.0-beta.1 release
2020-07-14 13:33:05 +09:00
Yuki Okushi
1382094c15 Avoid using deprecated / in license field 2020-07-14 11:19:56 +09:00
Rob Ede
78594a72bd prepare awc v2.0.0-beta.1 release 2020-07-14 03:16:26 +01:00
Rob Ede
327e472e44 prepare http-2.0.0-beta.1 release (#1596) 2020-07-13 15:35:30 +01:00
Patrick Tescher
e10eb648d9 Fix leaks with actix_http's client (#1580) 2020-07-10 22:35:22 +01:00
Rob Ede
a2662b928b Update PULL_REQUEST_TEMPLATE.md 2020-07-10 14:55:56 +01:00
Yuki Okushi
84583799be Merge pull request #1592 from JohnTitor/fix-tarpaulin
Use tarpaulin 0.13 to avoid failure
2020-07-07 05:11:09 +09:00
Yuki Okushi
08f9a34075 Use tarpaulin 0.13 to avoid failure 2020-07-07 04:00:18 +09:00
Rob Ede
056803d534 revamp readme and root doc page (#1590) 2020-07-05 01:16:53 +01:00
Yuki Okushi
deab634247 actix-http: Update sha-1 to 0.9 (#1586) 2020-07-03 01:08:24 +01:00
Yuki Okushi
0b641a2db2 Merge pull request #1585 from JohnTitor/v-htmlescape
Update `v_htmlescape` to 0.10
2020-07-03 07:46:26 +09:00
Yuki Okushi
f2d641b772 Update v_htmlescape to 0.10 2020-07-02 17:52:42 +09:00
Takashi Idobe
23c8191cca add method to extract matched resource name (#1577)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2020-06-27 16:22:16 +01:00
Rob Ede
487f90be5b move pull request template (#1578) 2020-06-23 14:26:07 +09:00
Rob Ede
fa28175a74 add method to extract matched resource pattern (#1566) 2020-06-23 00:58:20 +01:00
Rob Ede
a70e599ff5 re-export rt in web and add main macro (#1575) 2020-06-22 20:09:48 +01:00
Rob Ede
c11052f826 add PR template for bugs and features (#1570)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-06-22 18:28:06 +09:00
Yuki Okushi
73ec01e83b Merge pull request #1576 from b4skyx/patch-1
Update benchmark url in README.md
2020-06-22 16:48:49 +09:00
Abhishek Yadav
a7c8533291 Update benchmark url in README.md
Updated benchmark url from r18 to the latest r19.
2020-06-22 04:14:48 +00:00
Rob Ede
eb0eda69c6 migrate cookie handling to cookie crate (#1558) 2020-06-19 14:34:14 +01:00
Rob Ede
dc74db1f2f re-export actix_rt::main macro (#1559) 2020-06-18 15:45:30 +01:00
Rob Ede
0ba73fc44c exclude default -web features on -actors (#1562) 2020-06-18 11:23:36 +01:00
Fabianstelmach
9af07d66ae Fix NormalizePath trailing slash behavior (#1548) 2020-06-17 10:54:20 +01:00
Andrew
e72ee28232 Enforce HW_BUFFER_SIZE inside h1::dispatcher (#1550) 2020-06-17 08:58:23 +01:00
Yuki Okushi
4f9a1ac3b7 Merge pull request #1553 from taiki-e/pin-project
Remove uses of pin_project::project attribute
2020-06-07 02:00:01 +09:00
Taiki Endo
6c5c4ea230 Remove uses of pin_project::project attribute
pin-project will deprecate the project attribute due to some unfixable
limitations.

Refs: https://github.com/taiki-e/pin-project/issues/225
2020-06-06 06:44:14 +09:00
Yuki Okushi
a79450482c Merge pull request #1547 from JohnTitor/appveyor
Remove AppVeyor config
2020-06-03 10:43:01 +09:00
Yuki Okushi
5286b8aed7 Remove AppVeyor config 2020-06-03 03:39:35 +09:00
Stephen Stack
621ebec01a Fix typo in timeout error display (#1552) 2020-06-02 18:04:49 +01:00
Yuki Okushi
5e5c8b1c83 Merge pull request #1544 from JohnTitor/remove-framed
Remove actix-framed from workspace
2020-05-31 16:10:46 +09:00
Yuki Okushi
322e7c15d1 Remove actix-framed from workspace 2020-05-31 05:50:32 +09:00
Yuki Okushi
7aa757ad5a Merge pull request #1540 from JohnTitor/next-multipart
multipart: Bump up to 0.3.0-alpha.1
2020-05-25 22:04:07 +09:00
Yuki Okushi
482f74e409 multipart: Bump up to 0.3.0-alpha.1 2020-05-25 19:12:20 +09:00
Yuki Okushi
19967c41cc Merge pull request #1538 from JohnTitor/codegen-meta
Tweak codegen metadata
2020-05-25 17:37:58 +09:00
Yuki Okushi
8a106c07b4 Tweak codegen metadata 2020-05-25 16:45:34 +09:00
Yuki Okushi
11a9fdad95 Merge pull request #1535 from JohnTitor/next-files
files: Bump up to 0.3.0-alpha.1
2020-05-24 11:52:19 +09:00
Yuki Okushi
75a34dc8bc files: Bump up to 0.3.0-alpha.1 2020-05-23 18:47:08 +09:00
Yuki Okushi
5b60ee8cfd Merge pull request #1534 from JohnTitor/next-codegen
codegen: Bump up to 0.2.2
2020-05-23 18:08:36 +09:00
Yuki Okushi
bb89d04080 codegen: Bump up to 0.2.2 2020-05-23 17:22:30 +09:00
Yuki Okushi
f57b5659da Merge pull request #1533 from JohnTitor/next-test-server
http-test: Bump up to 2.0.0-alpha.1
2020-05-23 15:22:40 +09:00
Yuki Okushi
4a955c425d Update actix-http-test dependency to 2.0.0-alpha.1 2020-05-23 12:14:17 +09:00
Yuki Okushi
905f86b540 http-test: Bump up to 2.0.0-alpha.1 2020-05-23 12:13:43 +09:00
Yuki Okushi
0348114ad8 Merge pull request #1532 from JohnTitor/issue-template
Add links to Gitter on the issue template
2020-05-23 12:11:59 +09:00
Yuki Okushi
9c5a2d6580 Add links to Gitter on the issue template 2020-05-22 13:14:01 +09:00
Yuki Okushi
2550f00702 Merge pull request #1530 from NickKolpinskiy/itoa
Use `itoa` in the content-length helper
2020-05-22 13:03:50 +09:00
Nick Kolpinskiy
7d8fb631a0 Use itoa in the content-length helper 2020-05-21 22:25:34 +03:00
Yuki Okushi
b9e268e95f Merge pull request #1529 from JohnTitor/next-web
web: Bump up to 3.0.0-alpha.3
2020-05-21 19:32:24 +09:00
Yuki Okushi
6dd78d9355 Run rustfmt 2020-05-21 17:56:53 +09:00
Yuki Okushi
fe89ba7027 Update actix-web dependency to 3.0.0-alpha.3 2020-05-21 17:32:36 +09:00
Yuki Okushi
5d39110470 web: Bump up to 3.0.0-alpha.3 2020-05-21 17:31:22 +09:00
Yuki Okushi
5bde4e2529 Merge pull request #1528 from JohnTitor/next-awc
awc: Bump up to 2.0.0-alpha.2
2020-05-21 17:25:37 +09:00
Yuki Okushi
9b72d33b79 Update awc to 2.0.0-alpha.2 2020-05-21 16:48:20 +09:00
Yuki Okushi
0f826fd11a awc: Bump up to 2.0.0-alpha.2 2020-05-21 16:47:16 +09:00
Yuki Okushi
cf92cfa777 Merge pull request #1527 from JohnTitor/next-http
http: Bump up to 2.0.0-alpha.4
2020-05-21 16:35:34 +09:00
Yuki Okushi
9cfb32c780 Update actix-http to 2.0.0-alpha.4 2020-05-21 15:22:42 +09:00
Yuki Okushi
48fa78e182 http: Bump up to 2.0.0-alpha.4 2020-05-21 15:22:07 +09:00
Yuki Okushi
184683a698 Merge pull request #1525 from JohnTitor/deps
Update dependencies
2020-05-21 11:58:59 +09:00
Yuki Okushi
6c78f57a70 test-server: Update dependencies 2020-05-21 09:52:15 +09:00
Yuki Okushi
603973dede awc: Update base64 to 0.12 2020-05-21 09:51:58 +09:00
Yuki Okushi
8391427905 http: Update base64 to 0.12 2020-05-21 09:51:32 +09:00
Yuki Okushi
2314dc30b5 Merge pull request #1519 from JohnTitor/sample-size
bench: Reduce sample count to remove warning
2020-05-21 01:49:17 +09:00
Yuki Okushi
864fc489ce CI: Reduce sample size 2020-05-20 22:33:25 +09:00
Yuki Okushi
c48af0c822 Merge pull request #1522 from actix/only-server-bench
CI: Only run the server benchmark to avoid SIGKILL
2020-05-20 15:22:13 +09:00
Yuki Okushi
50adbdecbe CI: Only run the server benchmark to avoid SIGKILL 2020-05-20 13:12:08 +09:00
Yuki Okushi
f8f5a82f40 Merge pull request #1518 from JohnTitor/replace-net2
Replace deprecated `net2` crate with `socket2`
2020-05-19 10:25:22 +09:00
Yuki Okushi
9a7f93610a web: Replace net2 crate with socket2 2020-05-19 09:34:37 +09:00
Yuki Okushi
2dac9afc4e test-server: Replace net2 crate with socket2 2020-05-19 09:25:51 +09:00
Yuki Okushi
74491dca59 Merge pull request #1515 from JohnTitor/minimize-futures
Minimize `futures` dependencies
2020-05-19 09:18:07 +09:00
Yuki Okushi
81b0c32062 test-server: Minimize futures dependencies 2020-05-19 08:29:12 +09:00
Yuki Okushi
a98e53ecb8 web: Minimize futures dependencies 2020-05-19 08:29:12 +09:00
Yuki Okushi
d7abbff3b0 awc: Minimize futures dependencies 2020-05-19 08:29:12 +09:00
Yuki Okushi
24372467d9 codegen: Minimize futures dependencies 2020-05-19 08:29:11 +09:00
Yuki Okushi
fc8e07b947 actors: Minimize futures dependencies 2020-05-19 08:29:11 +09:00
Yuki Okushi
ab4d8704f1 multipart: Minimize futures dependencies 2020-05-19 08:29:11 +09:00
Yuki Okushi
292af145cb http: Minimize futures dependencies 2020-05-19 08:29:11 +09:00
Yuki Okushi
9bd6407730 framed: Minimize futures dependencies 2020-05-19 08:24:34 +09:00
Yuki Okushi
245dd471dd files: Minimize futures dependencies 2020-05-19 08:24:34 +09:00
Omid Rad
32a37b7282 Remove content_length from ResponseBuilder (#1491)
* Remove content_length since it'll be overwritten by the response body. FIXES #1439

* Add setting of Content-Length to the no_chunking function

* Add changes and migration documentations

* Update MIGRATION.md

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>

Co-authored-by: Rob Ede <robjtede@icloud.com>
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-05-19 07:46:31 +09:00
Yuki Okushi
426a9b5d4d Merge pull request #1514 from actix/remove/sized64
remove needless BodySize::Sized64 variant
2020-05-18 10:40:01 +09:00
Rob Ede
7e8ea44d5c remove needless BodySize::Sized64 variant 2020-05-18 00:42:51 +01:00
Omid Rad
b0866a8a0f Actix-files will always send SizedStream (#1496)
* Fixes #1384

* There is no need to set no_chunking

* Test content-length for static files

* Update the tests

* Add Changelog

* Try to simply fix Windows test issues!

Co-authored-by: Rob Ede <robjtede@icloud.com>
2020-05-18 06:54:42 +09:00
Yuki Okushi
7fe426f626 Merge pull request #1512 from JohnTitor/remove-outdated-members
Remove outdated members
2020-05-17 12:30:03 +09:00
Yuki Okushi
433a4563cf Remove outdated members 2020-05-17 10:56:06 +09:00
Rob Ede
f3b0233477 use mem::take where possible (#1507) 2020-05-17 10:54:42 +09:00
Sven Allers
201090d7a2 Provide impl<T> From<Arc<T>> for Data<T> (#1509) 2020-05-16 00:27:03 +01:00
pando85
4fc99d4a6f Fix audit issue logging by default peer address (#1485)
* Fix audit issue logging by default peer address

By default log format include remote address that is taken from headers.
This is very easy to replace making log untrusted.

Changing default log format value `%a` to peer address we are getting
this trusted data always. Also, remote address option is maintianed and
relegated to `%{r}a` value.

Related  kanidm/kanidm#191.

* Rename peer/remote to remote_addr/realip_remote_addr

Change names to avoid naming confusions. I choose this accord to Nginx
variables and
[ngx_http_realip_module](https://nginx.org/en/docs/http/ngx_http_realip_module.html).

Add more specific documentation about security concerns of using Real IP
in logger.

* Rename security advertise header in doc

* Add fix audit issue logging by default peer adress to changelog

Co-authored-by: Rob Ede <robjtede@icloud.com>
2020-05-15 09:07:27 +09:00
Yuki Okushi
92ce975d87 Merge pull request #1506 from actix/chore/bump-140
bump msrv to 1.40
2020-05-13 23:46:13 +09:00
Rob Ede
996f1d7eae bump msrv in ci and readme 2020-05-13 01:57:37 +01:00
Takeru Sato
63864ecf9e support parsing of SameSite=None (#1503) 2020-05-12 17:48:35 +01:00
Yuki Okushi
bbd4d19830 Merge pull request #1486 from actix/feat/data-cascade
allow parent data containers to be accessed from child scopes
2020-05-09 09:40:25 +09:00
Rob Ede
879cad9422 allow parent data containers to be accessed from child scopes 2020-05-09 00:31:26 +01:00
Yuki Okushi
6e8ff5c905 Merge pull request #1495 from JohnTitor/new-web
actix-web: Bump up to 3.0.0-alpha.2
2020-05-08 07:28:18 +09:00
Yuki Okushi
b66c3083a5 Update the actix-web dependency to 3.0.0-alpha.2 2020-05-08 06:46:42 +09:00
Yuki Okushi
b6b3481c6f web: Bump up to 3.0.0-alpha.2 2020-05-08 06:46:13 +09:00
Yuki Okushi
574714d156 Merge pull request #1494 from JohnTitor/new-actors
actors: Bump up to 3.0.0-alpha.1
2020-05-08 06:17:15 +09:00
Yuki Okushi
54abf356d4 actors: Bump up to 3.0.0-alpha.1 2020-05-08 03:33:29 +09:00
Yuki Okushi
9cb3b0ef58 Merge pull request #1493 from JohnTitor/http-next
http: Bump up to 2.0.0-alpha.3
2020-05-08 03:09:52 +09:00
Yuki Okushi
9d0c80b6ce Update actix-http deps 2020-05-08 02:35:45 +09:00
Yuki Okushi
0bc4a5e703 http: Bump up to 2.0.0-alpha.3 2020-05-08 02:35:45 +09:00
Rob Ede
9d94fb91b2 correct spelling of ConnectError::Unresolved (#1487)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-05-08 02:26:48 +09:00
Quentin de Quelen
9164ed1f0c add resource middleware on actix-web-codegen (#1467)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-05-07 18:31:12 +09:00
Rob Ede
b521e9b221 conditional test compilation [range, charset] (#1483)
* conditionally compile range and charset tests

* remove deprecated try macros

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-05-03 22:33:29 +09:00
Rob Ede
f37cb6dd0b refactor h1 status line helper to remove unsafe usage (#1484)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-05-03 17:37:40 +09:00
Mikail Bagishov
d5ceae2074 Replace deprecated now with now_utc (#1481)
* Replace deprecated now with now_utc

* Update doctest
2020-05-02 10:14:50 +01:00
Rob Ede
c27d3fad8e clarify resource/scope app data overriding (#1476)
* relocate FnDataFactory

* clarify app data overriding in Scope and Resource

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-04-30 02:20:47 +09:00
Rob Ede
bb17280f51 simplify data factory future polling (#1473)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-04-29 15:38:53 +09:00
Huston Bokinsky
b047413b39 Small ws codec fix (#1465)
* Small ws codec fix

* Update actix-http/Changes.md

Co-authored-by: Huston Bokinsky <huston@deepgram.com>
2020-04-29 11:13:09 +09:00
Huy
ce24630d31 Fix typos in MIGRATION.md (#1470)
* Fix typos in MIGRATION.md

Those are `crate` not `create`

* Update MIGRATION.md
2020-04-23 03:39:09 +09:00
Yuki Okushi
751253f23e Merge pull request #1463 from actix/fix/doc-typos
fix spelling errors in doc comments
2020-04-21 13:47:03 +09:00
Rob Ede
5b0f7fff69 fix spelling errors in doc comments 2020-04-21 04:09:35 +01:00
Yuki Okushi
54619cb680 actix-http: Remove failure support (#1449) 2020-04-16 06:54:34 +09:00
Yuki Okushi
5b36381cb0 Merge pull request #1452 from actix/fix/default-service-data
set data container on default service calls
2020-04-16 06:01:56 +09:00
Rob Ede
45e2e40140 set data container on default service calls
closes #1450
2020-04-14 02:33:19 +01:00
Yuki Okushi
df3f722589 Merge pull request #1451 from actix/cache
Remove cache config from GHA workflows
2020-04-13 06:06:45 +09:00
Yuki Okushi
e7ba871bbf Remove cache config from GHA workflows 2020-04-13 03:42:44 +09:00
Yuki Okushi
ebc2e67015 Merge pull request #1442 from JohnTitor/workspace-doc
Deploy all the workspace crates' docs
2020-04-09 00:48:08 +09:00
Yuki Okushi
74ddc852c8 Tweak README 2020-04-08 04:48:01 +09:00
Yuki Okushi
dfaa330a94 Deploy all the workspace crates' docs 2020-04-08 04:42:38 +09:00
Tore Pettersen
0ad02ee0e0 Add convenience functions for testing (#1401)
* Add convenience functions for testing

* Fix remarks from PR and add tests

* Add unpin to read_json_body

* Update changelog
2020-04-06 04:12:44 +09:00
Stephen Eckels
aaff68bf05 Change NormalizePath to append trailing slash (#1433)
* Change NormalizePath to append trailing slash

* add tests

* Update CHANGES.md

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-04-05 03:26:40 +09:00
Yuki Okushi
fcb1dec235 Merge pull request #1431 from OSSystems/topic/explicit-features-requirements
Add explicit feature requirements for examples and tests
2020-03-28 10:58:00 +09:00
Otavio Salvador
7b7daa75a4 Add explicit feature requirements for examples and tests
This allow us to build 'actix-web' without default features and run all
tests.

Signed-off-by: Otavio Salvador <otavio@ossystems.com.br>
2020-03-25 23:49:24 -03:00
Ivan Tham
2067331884 Refactor actix-codegen duplicate code (#1423)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-03-20 04:40:42 +09:00
Yuki Okushi
bf630d9475 Merge pull request #1422 from OSSystems/topic/impl-error-more-types
Implement `std::error::Error` for our custom errors
2020-03-19 05:05:57 +09:00
Otavio Salvador
146ae4da18 Implement std::error::Error for our custom errors
For allowing a more ergonomic use and better integration on the
ecosystem, this adds the `std::error::Error` `impl` for our custom
errors.

We intent to drop this hand made code once `derive_more` finishes the
addition of the Error derive support[1]. Until that is available, we
need to live with that.

1. https://github.com/JelteF/derive_more/issues/92

Signed-off-by: Otavio Salvador <otavio@ossystems.com.br>
2020-03-18 00:22:18 -03:00
Yuki Okushi
52c5755d56 Merge pull request #1421 from actix/JohnTitor-patch-1
Upload coverage on PRs
2020-03-18 06:16:41 +09:00
Yuki Okushi
5548c57a09 Upload coverage on PRs 2020-03-18 05:04:30 +09:00
Stig Johan Berggren
0d958fabd7 📝 Improve the code example for JsonConfig (#1418)
* 📝 Improve the code example for JsonConfig

* Remove a redundant comment
2020-03-17 08:23:54 +09:00
Oleg Nosov
c67e4c1fe8 Refactored macros (#1333)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-03-15 07:23:28 +09:00
Yuki Okushi
4875dfbec7 Merge pull request #1416 from JohnTitor/fix-doc
Fix `read_body` doc
2020-03-13 07:06:57 +09:00
Yuki Okushi
d602a7e386 Fix read_body doc 2020-03-13 05:52:58 +09:00
Yuki Okushi
9f196fe5a5 Merge pull request #1413 from OSSystems/topic/fix-warnings
Fix clippy warnings
2020-03-12 16:24:44 +09:00
Yuki Okushi
e4adcd1935 Merge pull request #1411 from JohnTitor/patch
Clean-up metadata
2020-03-12 16:21:34 +09:00
Otavio Salvador
7e0d898d5a Fix clippy warnings
Signed-off-by: Otavio Salvador <otavio@ossystems.com.br>
2020-03-12 00:52:21 -03:00
Yuki Okushi
51518721e5 Add notes to READMEs 2020-03-12 07:57:38 +09:00
Yuki Okushi
c02d3e205b Clean-up metadata 2020-03-12 07:57:20 +09:00
Yuki Okushi
a253d7d3ce Merge pull request #1410 from JohnTitor/new-web
Release actix-web 3.0.0-alpha.1
2020-03-12 05:12:54 +09:00
Yuki Okushi
0152cedc5d Update changelog 2020-03-12 03:24:15 +09:00
Yuki Okushi
a6a47b95ee Exclude actix-cors 2020-03-12 03:04:31 +09:00
Yuki Okushi
1b28a5d48b Update actix-web dependency to 3.0.0-alpha.1 2020-03-12 03:03:50 +09:00
Yuki Okushi
c147b94832 Bump up to 3.0.0-alpha.1 2020-03-12 03:03:22 +09:00
Yuki Okushi
95f9a12a5e dev-deps: Update env_logger to 0.7 2020-03-12 02:58:22 +09:00
Yuki Okushi
73eeab0e90 Merge pull request #1391 from JohnTitor/new-awc
Release awc v2.0.0-alpha.1
2020-03-11 21:15:48 +09:00
Yuki Okushi
ce1e996b41 Update release date 2020-03-11 20:42:45 +09:00
Yuki Okushi
e718f65121 Update tests 2020-03-08 16:42:45 +09:00
Yuki Okushi
a9a475d555 Make test_server async fn 2020-03-08 16:42:26 +09:00
Yuki Okushi
b93e1555ec Update actix-connect to 2.0.0-alpha.2 2020-03-08 15:27:40 +09:00
Yuki Okushi
6f33b7ea42 Update awc dependency 2020-03-08 15:27:40 +09:00
Yuki Okushi
294523a32f Bump up to 2.0.0-alpha.1 2020-03-08 15:27:39 +09:00
Yuki Okushi
6b626c7d77 dev-deps: Update env_logger to 0.7 2020-03-08 03:07:53 +09:00
Yuki Okushi
5da9e277a2 Merge pull request #1399 from JohnTitor/new-http
Release actix-http 2.0.0-alpha.2
2020-03-08 01:47:40 +09:00
Yuki Okushi
0d5646a8b6 Run rustfmt 2020-03-08 00:52:39 +09:00
Yuki Okushi
7941594f94 Update actix-http dependency 2020-03-08 00:50:20 +09:00
Yuki Okushi
6f63acaf01 Bump up to 2.0.0-alpha.2 2020-03-08 00:48:45 +09:00
Yuki Okushi
7172885beb Update changelog 2020-03-08 00:43:17 +09:00
Yuki Okushi
cf721c5fff Update README example 2020-03-08 00:43:01 +09:00
Maxim Vorobjov
10e3e72595 Http2 client configuration to improve performance (#1394)
* add defaults for http2 client configuration

* fix spaces

* Add changes text for extended H2 defaults buffers

* client: configurable H2 window sizes and max_http_version

* add H2 window size configuration and max_http_version to awc::ClientBuilder

* add awc::ClientBuilder H2 window sizes and max_http_version

* add test for H2 window size settings

* cleanup comment

* Apply code review fixes

* Code review fix for awc ClientBuilder

* Remove unnecessary comments on code review

* pin quote version to resolve build issue

* max_http_version to accept http::Version

* revert fix for quote broken build
2020-03-07 11:09:31 +09:00
Yuki Okushi
a7d805aab7 Merge pull request #1396 from Aaron1011/fix/reapply-dispatcher
Re-apply commit 2cf7b3ad20
2020-03-05 02:48:20 +09:00
Aaron Hill
e90950fee1 Re-apply commit 2cf7b3ad20
This ended up getting reverted by #1367, which re-introduced an unsound
use of `Pin::new_unchecked`

See my original PR #1374 for the reasoning behind this change.
2020-03-04 11:27:58 -05:00
Yuki Okushi
c8f0672ef7 Merge pull request #1395 from JohnTitor/rustls
Update `rustls` to 0.17
2020-03-04 15:56:27 +09:00
Yuki Okushi
9d661dc4f3 Update changelog 2020-03-04 15:20:14 +09:00
Yuki Okushi
687dc609dd Update rustls to 0.17 2020-03-04 15:11:31 +09:00
Yuki Okushi
b9b52079e0 Update actix-tls to 2.0.0-alpha.1 2020-03-04 15:10:23 +09:00
Yuki Okushi
117d28f7ba Update actix-connect to 2.0.0-alpha.1 2020-03-04 15:09:31 +09:00
Yuki Okushi
795a575fc5 Merge pull request #1386 from JohnTitor/deny-to-warn
Demote lint level to warn
2020-02-28 14:17:11 +09:00
Yuki Okushi
b4d63667df Demote lint level to warn 2020-02-27 22:39:11 +09:00
__JM_Joy__
3dc859af58 Fix missing std::error::Error implement for MultipartError. (#1382)
* Fix missing `std::error::Error` implement for `MultipartError`.

* Update actix-multipart CHANGES.md.
2020-02-27 22:34:06 +09:00
Yuki Okushi
1fa02b5f1c Merge pull request #1385 from JohnTitor/http-2-alpha
Release actix-http 2.0.0-alpha.1
2020-02-27 14:47:32 +09:00
Yuki Okushi
c9fdcc596d Update actix to 0.10.0-alpha.1 2020-02-27 12:46:29 +09:00
Yuki Okushi
6cc83dbb67 Allow clippy lint for compatibility 2020-02-27 12:45:11 +09:00
Yuki Okushi
3b675c9125 Update actix-http to 2.0.0-alpha.1 2020-02-27 12:39:04 +09:00
Yuki Okushi
15a2587887 Bump up to 2.0.0-alpha.1 2020-02-27 12:39:04 +09:00
Yuki Okushi
0173f99726 Update changelog 2020-02-27 12:39:04 +09:00
Yuki Okushi
f27dd19093 Fix Clippy warnings 2020-02-27 12:39:04 +09:00
Yuki Okushi
7ba14fd113 Run rustfmt 2020-02-27 11:10:55 +09:00
Yuki Okushi
903ae47baa dev-deps: Update env_logger to 0.7 2020-02-27 11:08:45 +09:00
Yuki Okushi
95c18dbdf3 Merge pull request #1367 from actix/msg-body
Merge `MessageBody` improvements
2020-02-27 10:42:14 +09:00
Yuki Okushi
d3ccf46e92 Clean-up metadata 2020-02-27 09:53:27 +09:00
Yuki Okushi
cd1765035c Avoid re-definition 2020-02-27 09:42:32 +09:00
Maksym Vorobiov
ea28219d0f reenable actix-http test-ws 2020-02-27 09:42:32 +09:00
Maksym Vorobiov
77058ef779 adopt MessageBody Pin changes to actix-web root 2020-02-27 09:42:32 +09:00
Maksym Vorobiov
e5f2feec45 reenable actix-http from local path 2020-02-27 09:42:32 +09:00
Maksym Vorobiov
0a86907dd2 use mem::replace instead of mem::take rust 1.40+ 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
78749a4b7e rollback actix-http version change 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
de815dd99c Fixed condition for finishing transfer of response 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
e6078bf792 Fix EncoderBody enum to align with Body::Message 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
a84b37199a Add Unpin to Body to get rid of unsafe in MessageBody 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
c05f9475c5 refactor dispatcher to avoid possible UB with DispatcherState Pin 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
69dab0063c Get rid of one more unsafe 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
ec5c779732 unlink MessageBody from Unpin 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
2e2ea7ab80 remove extra whitespaces and Unpins 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
eeebc653fd change actix-http version to alpha 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
835a00599c rollback missed dependencies and CHANGES in crates except actix-http 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
d9c415e540 disable weird poll test until actix-web based on actix-http:2 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
09a391a3ca rollback changes to actix-web, awc and test-server for now 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
62aba424e2 Rollback actix-http-test dependency to show the issue 2020-02-27 09:37:05 +09:00
Maksym Vorobiov
9d04b250f9 This is a squashed commit:
- Convert MessageBody to accept Pin in poll_next

- add CHANGES and increase versions aligned to semver

- update crates to accomodate MessageBody Pin change

- fix tests and dependencies
2020-02-27 09:37:05 +09:00
Maksym Vorobiov
a4148de226 add test crashing with segfault according to #1321 2020-02-27 09:36:30 +09:00
Maxim Vorobjov
48ef4d7a26 Add actix-http support for actix error messages (#1379)
* Moved actix-http for actix from actix crate

* remove resolver feature

* renamed actix feature to actor

* fixed doc attr for actors, add documentation
2020-02-27 09:34:49 +09:00
Aaron Hill
71c4bd1b30 Remove uses of Pin::new_unchecked in h1 Dispatcher (#1374)
This removes the last uses of unsafe `Pin` functions in actix-web.

This PR adds a `Pin<Box<_>>` wrapper to `DispatcherState::Upgrade`,
`State::ExpectCall`, and `State::ServiceCall`.

The previous uses of the futures `State::ExpectCall` and `State::ServiceCall`
were Undefined Behavior - a future was obtained from `self.expect.call`
or `self.service.call`, pinned on the stack, and then immediately
returned from `handle_request`. The only alternative to using `Box::pin`
would be to refactor `handle_request` to write the futures directly into
their final location, or avoid polling them before they are returned.

The previous use of `DispatcherState::Upgrade` doesn't seem to be
unsound. However, having data pinned inside an enum that we
`std::mem::replace` would require some careful `unsafe` code to ensure
that we never call `std::mem::replace` when the active variant contains
pinned data. By using `Box::pin`, we any possibility of future
refactoring accidentally introducing undefined behavior.

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-02-26 08:21:05 +09:00
Yuki Okushi
de1d6ad5cb Merge pull request #1344 from actix/replace-unsafe-content-length-helper
Replace unsafe content length helper
2020-02-25 17:02:22 +09:00
Yuki Okushi
2a72e8d119 Merge branch 'master' into replace-unsafe-content-length-helper 2020-02-25 14:30:04 +09:00
Yuki Okushi
2a8e5fdc73 Merge pull request #1370 from mattgathu/feat/helper-function-for-trace-method
Create helper function for HTTP Trace Method
2020-02-25 14:24:09 +09:00
Yuki Okushi
b213c07799 Merge branch 'master' into feat/helper-function-for-trace-method 2020-02-25 12:36:20 +09:00
Yuki Okushi
3d6b8686ad Merge pull request #1373 from JohnTitor/new-codegen
Release `actix-web-codegen` v0.2.1
2020-02-25 09:32:48 +09:00
Yuki Okushi
a4f87a53da Update CHANGES.md 2020-02-25 08:42:39 +09:00
Yuki Okushi
08f172a0aa Merge branch 'master' into new-codegen 2020-02-25 08:29:31 +09:00
Yuki Okushi
7792eaa16e Merge pull request #1378 from JohnTitor/fix-doc
Fix doc comment
2020-02-25 08:29:14 +09:00
Yuki Okushi
845ce3cf34 Fix doc comment 2020-02-25 07:46:03 +09:00
Yuki Okushi
7daef22e24 Merge branch 'master' into new-codegen 2020-02-25 06:58:49 +09:00
Yuki Okushi
1249262c35 Merge pull request #1372 from JohnTitor/time-0.2.7
Update `time` to 0.2.7
2020-02-25 06:58:33 +09:00
Rob Ede
94da08f506 increase content-length fast path to responses up to 1MB 2020-02-24 20:58:41 +00:00
Matt Gathu
d143c44130 Update the ChangeLog 2020-02-23 09:33:28 +01:00
Matt Gathu
8ec8ccf4fb Create helper function for HTTP Trace Method
Create *route* with `TRACE` method guard.
2020-02-23 09:25:55 +01:00
Yuki Okushi
c8ccc69b93 actix-http: update time to 0.2.7 2020-02-23 07:09:00 +09:00
Yuki Okushi
f9f9fb4c84 actix-http-test: update time to 0.2.7 2020-02-23 07:08:50 +09:00
Yuki Okushi
1b77963aac actix-web: update time to 0.2.7 2020-02-23 07:08:22 +09:00
Yuki Okushi
036ffd43f9 Prepare for new release 2020-02-23 06:40:02 +09:00
Yuki Okushi
bdccccd536 Merge pull request #1368 from mattgathu/add-missing-docs-attr-to-codegen-structs
Add`#[allow(missing_docs)]` attribute to generated structs
2020-02-23 06:26:42 +09:00
Matt Gathu
060c392c67 Add missing_docs attribute to generated structs 2020-02-22 10:32:12 +01:00
Daniel YU
245f96868a impl downcast_ref for MessageBody (#1287)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-02-21 13:31:51 +09:00
Yuki Okushi
b3f1071aaf Merge pull request #1361 from Aaron1011/fix/connector-pool-support
Use #[pin_project] with `ConnectorPoolSupport`
2020-02-21 06:01:26 +09:00
Aaron Hill
e6811e8818 Use #[pin_project] with ConnectorPoolSupport
This removes a use of `Pin::get_unchecked_mut`
2020-02-19 21:42:53 -05:00
Elliot Jackson
809930d36e Add dependencies to docs example (#1343)
* Add dependencies to docs example

* Change codeblock type to toml

* Clarify the need for actix-rt

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-02-20 05:13:10 +09:00
Rob Ede
f266b44cb0 replace unsafe blocks in write_usize helper 2020-02-16 15:20:25 +00:00
Rob Ede
31a3515e90 add safe vs unsafe benchmarks 2020-02-16 14:31:06 +00:00
Rob Ede
82b2786d6b replace unsafe content length implementation 2020-02-16 14:31:05 +00:00
Masayuki Nagamachi
6ab7cfa2be Remove descriptions about undefined uds feature from docs (#1356) 2020-02-16 04:18:31 +09:00
Yuki Okushi
9b3f7248a8 Merge pull request #1354 from actix/JohnTitor-patch-1
Disable coverage for PRs
2020-02-14 08:18:09 +09:00
Yuki Okushi
a1835d6510 Disable coverage for PRs 2020-02-14 07:31:29 +09:00
Yuki Okushi
4484b3f66e Merge pull request #1347 from actix/bye-travis
Use Actions fully
2020-02-12 05:54:32 +09:00
Yuki Okushi
cde3ae5f61 Remove Travis config 2020-02-08 05:36:11 +09:00
Yuki Okushi
7d40b66300 Add some Actions workflows 2020-02-08 04:28:34 +09:00
Yuki Okushi
63730c1f73 Merge pull request #1345 from JohnTitor/fix-warnings
Fix warnings
2020-02-08 04:17:04 +09:00
Yuki Okushi
53ff3ad099 More ignore test causes timeout 2020-02-08 02:20:01 +09:00
Yuki Okushi
6406f56ca2 Fix/suppress warnings 2020-02-08 02:20:01 +09:00
zero-systems
728b944360 Extensions module improvement and tests. (#1297)
* replace get.is_some to contains_key

* Add tests

* remove unnecessary box cast

* fix missing uints

* asserts fix

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-02-07 16:08:25 +09:00
Levi Notik
3851a377df Fix minor grammatical errors (#1341) 2020-02-07 03:00:22 +09:00
Aaron Hill
fe13789345 Use Pin<Box<S>> in BodyStream and SizedStream (#1328)
Fixes #1321

A better fix would be to change `MessageBody` to take a `Pin<&mut
Self>`, rather than a `Pin<&mut Self>`. This will avoid requiring the
use of `Box` for all consumers by allowing the caller to determine how
to pin the `MessageBody` implementation (e.g. via stack pinning).

However, doing so is a breaking change that will affect every user of
`MessageBody`. By pinning the inner stream ourselves, we can fix the
undefined behavior without breaking the API.

I've included @sebzim4500's reproduction case as a new test case.
However, due to the nature of undefined behavior, this could pass (and
not segfault) even if underlying issue were to regress.

Unfortunately, until rust-lang/unsafe-code-guidelines#148 is resolved,
it's not even possible to write a Miri test that will pass when the bug
is fixed.

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-31 09:39:34 +09:00
Aaron Hill
3033f187d2 Enforce safety of downcast_ref at compile time. (#1326)
* Enforce safety of `downcast_ref` at compile time.

The safety of `downcast_ref` requires that `__private_get_type_id__` not
be overriden by callers, since the returned `TypeId` is used to check if
the cast is safe. However, all trait methods in Rust are public, so
users can override `__private_get_type_id__` despite it being
`#[doc(hidden)]`.

This commit makes `__private_get_type_id__` return a type with a private
constructor, ensuring that the only possible implementation is the
default implementation. A more detailed explanation is provided in the
comments added to the file.

Note that the standard library was affected by this type of issue with
the `Error::type_id` function: see https://blog.rust-lang.org/2019/05/14/Rust-1.34.2.html#whats-in-1.34.2-stable

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-30 23:43:35 +09:00
Aaron Hill
276a5a3ee4 Replace UnsafeCell with Cell in DateServiceInner (#1325)
* Replace `UnsafeCell` with `Cell` in `DateServiceInner`

This ensures that it's impossible to cause undefined behavior by
accidentally violating Rust's aliasing rules (e.g. passing a closure to
`set_date` which ends up invoking `reset` or `update` on the inner
`DateServiceInner`).

There might be a tiny amount of overhead from copying the `Option<(Date,
Instant)>` rather than taking a reference, but it shouldn't be
measurable.

Since the wrapped type is `Copy`, a `Cell` can be used, avoiding the
runtime overhead of a `RefCell`.

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-29 21:05:08 +09:00
Andrey Kutejko
664f9a8b2d Long lasting auto-prolonged session (#1292)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-29 10:26:39 +09:00
Yuki Okushi
c73c2dc12c Don't use cache in Windows CI (#1327) 2020-01-29 09:00:04 +09:00
kevinpoitra
e634e64847 Upgrade time to 0.2.5 (#1254)
* Use `OffsetDateTime` instead of `PrimitiveDateTime`

* Parse time strings with `PrimitiveDateTime::parse` instead of `OffsetDateTime::parse`

* Remove unused `time` dependency from actix-multipart

* Fix a few errors with time related tests from the `time` upgrade

* Implement logic to convert a RFC 850 two-digit year into a full length year, and organize time parsing related functions

* Upgrade `time` to 0.2.2

* Correctly parse C's asctime time format using time 0.2's new format patterns

* Update CHANGES.md

* Use `time` without any of its deprecated functions

* Enforce a UTC time offset when converting an `OffsetDateTime` into a Header value

* Use the more readable version of `Duration::seconds(0)`, `Duration::zero()`

* Remove unneeded conversion of time::Duration to std::time::Duration

* Use `OffsetDateTime::as_seconds_f64` instead of manually calculating the amount of seconds from nanoseconds

* Replace a few additional instances of `Duration::seconds(0)` with `Duration::zero()`

* Truncate any nanoseconds from a supplied `Duration` within `Cookie::set_max_age` to ensure two Cookies with the same amount whole seconds equate to one another

* Fix the actix-http:🍪:do_not_panic_on_large_max_ages test

* Convert `Cookie::max_age` and `Cookie::expires` examples to `time` 0.2

Mainly minor  changes. Type inference can be used alongside the new
`time::parse` method, such that the type doesn't need to be specified.
This will be useful if a refactoring takes place that changes the type.
There are also new macros, which are used where possible.

One change that is not immediately obvious, in `HttpDate`, there was an
unnecessary conditional. As the time crate allows for negative durations
(and can perform arithmetic with such), the if/else can be removed
entirely.

Time v0.2.3 also has some bug fixes, which is why I am not using a more
general v0.2 in Cargo.toml.

v0.2.3 has been yanked, as it was backwards imcompatible. This version
reverts the breaking change, while still supporting rustc back to
1.34.0.

* Add missing `time::offset` macro import

* Fix type confusion when using `time::parse` followed by `using_offset`

* Update `time` to 0.2.5

* Update CHANGES.md

Co-authored-by: Jacob Pratt <the.z.cuber@gmail.com>
2020-01-28 20:44:22 +09:00
Kai Ren
cdba30d45f Skip empty chucks for BodyStream and SizedStream (#1308)
* Skip empty chucks for BodyStream and SizedStream when streaming response (#1267)

* Fix tests to fail on previous implementation

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-28 18:28:09 +09:00
Aaron Hill
74dcc7366d Remove several uses of Pin::new_unchecked (#1294)
Most of the relevant struct already had a `#[pin_project]` attribute,
but it wasn't being used.

The remaining uses of `Pin::new_unchecked` all involve going from a
`&mut T` to a `Pin<&mut T>`, without directly observing a `Pin<&mut T>`
first. As such, they cannot be replaced by `pin_project`

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-28 12:35:51 +09:00
Aaron Hill
d137a8635b Replace Pin::new_unchecked with #[pin_project] in tuple_from_req! (#1293)
Using some module trickery, we can generate a tuple struct for each
invocation of the macro. This allows us to use `pin_project` to project
through to the tuple fields, removing the need to use
`Pin::new_unchecked`

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-28 10:45:25 +09:00
Yuki Okushi
a2d4ff157e Update call_service documentation (#1302)
Co-authored-by: Christian Battaglia <christian.d.battaglia@gmail.com>
2020-01-28 08:09:46 +09:00
Andrey Torsunov
71d11644a7 Add ability to name a handler function as 'config' (#1290)
* eliminate handler naming restrictions #1277

* Update actix-web-codegen/CHANGES.md

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-26 07:22:40 +09:00
Maxim Vorobjov
8888520d83 Add benchmark for full stack request lifecycle (#1298)
* add benchmark for full stack request lifecycle

* add direct service benchmarks

* fix newline

* add cloneable service benchmarks

* remove cloneable bench experiments + cargo fmt

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-25 08:05:25 +09:00
Yuki Okushi
cf3577550c Tweak caches (#1319)
* Try to use `cargo-cache`

* Tweak issue template
2020-01-25 02:27:13 +09:00
Maxim Vorobjov
58844874a0 Fixing #1295 convert UnsafeCell to RefCell in CloneableService (#1303)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-24 14:51:38 +09:00
cetra3
78f24dda03 Initial Issue template (#1311)
* Initial Issue template

* First round of changes for the bug report

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-24 07:32:34 +09:00
godofdream
e17b3accb9 Remove codecoverage for tests and examples (#1299)
* Ignore Tests & Examples for CodeCoverage

Ignore Tests & Examples for CodeCoverage
2020-01-24 05:10:02 +09:00
Yuki Okushi
c6fa007e72 Fix vcpkg cache (#1312) 2020-01-23 11:27:34 +09:00
Rob Ede
a3287948d1 allow explicit SameSite=None cookies (#1282)
fixes #1035
2020-01-23 10:08:23 +09:00
Yuki Okushi
2e9ab0625e Tweak actions (#1305)
* Add benchmark action

* Fix Windows build
2020-01-23 06:23:53 +09:00
Yuki Okushi
3a5b62b550 Add dependencies instruction (#1281) 2020-01-16 23:17:17 +09:00
Adam Kewley
412e54ce10 Fixed documentation typo for actix-files (#1278) 2020-01-15 11:09:58 -08:00
Peter Hall
bca41f8d40 Changes to Cors builder (#1266)
Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-11 04:53:17 +09:00
Jacob Brown
7c974ee668 Update doc comment for HttpRequest::app_data (#1265)
* update doc comment for `HttpRequest::app_data`

* add `no_run` to doc comment

* add `ignore` to doc comment

* Update src/request.rs

Co-Authored-By: Yuki Okushi <huyuumi.dev@gmail.com>

Co-authored-by: Yuki Okushi <huyuumi.dev@gmail.com>
2020-01-11 03:55:20 +09:00
linkmauve
abb462ef85 Replace sha1 dependency with sha-1 (#1258)
* Replace sha1 dependency with sha-1

This other crate is being maintained, and it offers better performances
when using the `asm` feature (especially [on
AArch64](https://github.com/RustCrypto/hashes/pull/97)).

* Update CHANGES.md with the sha-1 migration

* Add a test for hash_key()
2020-01-11 02:34:31 +09:00
Nikolay Kim
e66312b664 add extra constraints 2020-01-10 11:36:59 +06:00
Nikolay Kim
39f4b2b39e Merge branch 'master' of github.com:actix/actix-web 2020-01-10 11:28:58 +06:00
Nikolay Kim
f6ff056b8a Fix panic with already borrowed: BorrowMutError #1263 2020-01-10 11:26:54 +06:00
Yuki Okushi
51ab4fb73d Tweak actions to use cache and not to be stuck on the way (#1264) 2020-01-10 03:30:45 +09:00
linkmauve
f5fd6bc49f Fix actix-http examples (#1259)
Fix actix-http examples
2020-01-07 00:15:04 +09:00
Jeremy Wright
2803fcbe22 Small grammaritical update to lib.rs (#1248) 2020-01-03 08:45:17 +06:00
Nikolay Kim
67793c5d92 add ssl feature migration 2019-12-30 21:22:04 +06:00
Jonathan Brookins
bcb5086c91 Added 2.0.0 rustls feature name change (#1244) 2019-12-30 21:16:04 +06:00
wojciechkepka
7bd2270290 Fix link to example in readme.md (#1236)
* Fix link to example in readme.md

* Add links to openssl and rustls examples

* Rustls should be uppercase
2019-12-26 19:42:07 +09:00
Nikolay Kim
a4ad5e6b69 update timeouts for test server 2019-12-25 20:52:20 +04:00
Nikolay Kim
6db909a3e7 update migration 2019-12-25 20:27:30 +04:00
Nikolay Kim
642ae161c0 prep actix-web release 2019-12-25 20:21:00 +04:00
Nikolay Kim
7b3c99b933 prep actix-framed release 2019-12-25 20:17:22 +04:00
Nikolay Kim
f86ce0390e allow to specify multi pattern for resources 2019-12-25 20:14:44 +04:00
Nikolay Kim
7882f545e5 Allow to gracefully stop test server via TestServer::stop() 2019-12-25 12:10:48 +04:00
Nikolay Kim
1c75e6876b update migration 2019-12-22 17:16:07 +04:00
Nikolay Kim
6a0cd2dced Rename HttpServer::start() to HttpServer::run() 2019-12-22 17:12:22 +04:00
Nikolay Kim
c7f3915779 update actix-service dep 2019-12-22 16:39:25 +04:00
Yuki Okushi
f45db1f909 Enable GitHub Actions and fix file URL behavior (#1232)
* Use GitHub Actions

* Fix unused imports on Windows

* Fix test for Windows

* Stop to run CI for i686-pc-windows-msvc for now

* Use `/` instead of `\` on Windows

* Add entry to changelog

* Prepare actix-files release
2019-12-22 16:43:41 +09:00
Darin
3751a4018e fixed test::init_service api docs (missing await) (#1230) 2019-12-21 08:47:18 +06:00
Nikolay Kim
0cb1b0642f add test server data test 2019-12-20 23:18:59 +06:00
Nikolay Kim
48476362a3 update changes 2019-12-20 17:59:34 +06:00
Nikolay Kim
2b4256baab add links to configs 2019-12-20 17:49:05 +06:00
Nikolay Kim
e5a50f423d Make web::Data deref to Arc<T> #1214 2019-12-20 17:45:35 +06:00
Nikolay Kim
8b8a9a995d bump ver 2019-12-20 17:36:48 +06:00
Nikolay Kim
74fa4060c2 fix awc tests 2019-12-20 17:27:32 +06:00
Nikolay Kim
c877840c07 rename App::register_data to App::app_data and HttpRequest::app_data returns Option<&T> instead of Option<&Data<T>> 2019-12-20 17:13:09 +06:00
Nikolay Kim
20248daeda Allow to set peer_addr for TestRequest #1074 2019-12-20 16:11:51 +06:00
Nikolay Kim
a08d8dab70 AppConfig::secure() is always false. #1202 2019-12-20 16:04:51 +06:00
tglman
fbbb4a86e9 feat: add access to the session also from immutable references (#1225) 2019-12-20 13:59:07 +06:00
Nikolay Kim
1d12ba9d5f Replace brotli with brotli2 #1224 2019-12-20 13:50:07 +06:00
Nikolay Kim
8c54054844 Use .advance() intead of .split_to() 2019-12-19 09:56:14 +06:00
Nikolay Kim
1732ae8c79 fix Bodyencoding trait usage 2019-12-18 09:30:14 +06:00
Rajasekharan Vengalil
3b860ebdc7 Fix poll_ready call for WebSockets upgrade (#1219)
* Fix poll_ready call for WebSockets upgrade

* Poll upgrade service from H1ServiceHandler too
2019-12-17 13:34:25 +06:00
Nikolay Kim
29ac6463e1 Merge branch 'master' of github.com:actix/actix-web 2019-12-16 17:22:49 +06:00
Nikolay Kim
01613f334b Move BodyEncoding to dev module #1220 2019-12-16 17:22:26 +06:00
Andrii Radyk
30dcaf9da0 fix deprecated Error::description (#1218) 2019-12-16 07:43:19 +06:00
Nikolay Kim
b0aa9395da prep actix-web alpha.6 release 2019-12-15 22:51:14 +06:00
Nikolay Kim
a153374b61 migrate actix-web-actors 2019-12-15 22:45:38 +06:00
Nikolay Kim
a791aab418 prep awc release 2019-12-15 13:36:05 +06:00
Nikolay Kim
cb705317b8 compile with default-features off 2019-12-15 13:28:54 +06:00
Nikolay Kim
e8e0f98f96 fix docs.rs features list 2019-12-13 12:41:48 +06:00
Nikolay Kim
c878f66d05 fix docs.rs features list 2019-12-13 12:40:22 +06:00
Nikolay Kim
fac6dec3c9 update deps 2019-12-13 12:36:15 +06:00
Nikolay Kim
232f71b3b5 update changes 2019-12-13 12:18:30 +06:00
Nikolay Kim
8881c13e60 update changes 2019-12-13 12:16:43 +06:00
Nikolay Kim
d006a7b31f update changes 2019-12-13 12:10:45 +06:00
Nikolay Kim
3d64d565d9 fix warnings 2019-12-13 11:46:02 +06:00
Nikolay Kim
c1deaaeb2f cleanup imports 2019-12-13 11:24:57 +06:00
Nikolay Kim
b81417c2fa fix warnings 2019-12-13 10:59:02 +06:00
Nikolay Kim
4937c9f9c2 refactor http-test server 2019-12-12 23:08:38 +06:00
Nikolay Kim
db1d6b7963 refactor test server impl 2019-12-12 22:28:47 +06:00
Nikolay Kim
fa07415721 Replace flate2-xxx features with compress 2019-12-12 15:08:08 +06:00
Nikolay Kim
b4b3350b3e Add websockets continuation frame support 2019-12-12 14:06:54 +06:00
Jonathan Speiser
4a1695f719 fixes missing import in example (#1210) 2019-12-12 07:06:22 +06:00
0x1793d1
1b8d747937 Fix extra line feed (#1209) 2019-12-12 07:05:39 +06:00
Emilio González
a43a005f59 Log path if it is not a directory (#1208) 2019-12-12 07:04:53 +06:00
Alexander Larsson
a612b74aeb actix-multipart: Fix multipart boundary reading (#1205)
* actix-multipart: Fix multipart boundary reading

If we're not ready to read the first line after the multipart field
(which should be a "\r\n" line) then return Pending instead of Ready(None)
so that we will get called again to read that line.

Without this I was getting MultipartError::Boundary from read_boundary()
because it got the "\r\n" line instead of the boundary.

Also tweaks the test_stream test to test partial reads.

This is a forward port of #1189 from 1.0

* actix-multipart: Update changes for boundary fix
2019-12-12 07:03:44 +06:00
Nikolay Kim
131c897099 upgrade to actix-net release 2019-12-11 19:20:20 +06:00
Nikolay Kim
ef3a33b9d6 use std mutext instead of parking_lot 2019-12-10 09:00:51 +06:00
Nikolay Kim
5132257b0d Fix buffer remaining capacity calcualtion 2019-12-09 21:55:22 +06:00
Nikolay Kim
0c1f5f9edc Check Upgrade service readiness before calling it 2019-12-09 17:40:15 +06:00
Sameer Dhar
e4382e4fc1 Fix broken docs (#1204)
Fixed un escaped brackets in lib.rs, and reflowed links to ConnectionInfo in app, config, and server.rs
2019-12-09 10:02:43 +06:00
Nikolay Kim
a3ce371312 ws ping and pong uses bytes #1049 2019-12-09 07:01:22 +06:00
Nikolay Kim
42258ee289 deps 2019-12-08 20:22:39 +06:00
Nikolay Kim
b92eafb839 prepare actix-http release 2019-12-08 20:15:51 +06:00
Nikolay Kim
3b2e78db47 add link to chat 2019-12-08 19:27:06 +06:00
Nikolay Kim
63da1a5560 Merge branch 'master' of github.com:actix/actix-web 2019-12-08 19:26:12 +06:00
Nikolay Kim
1f3ffe38e8 update actix-service dep 2019-12-08 19:25:24 +06:00
krircc
c23b6b3879 Merge pull request #1192 from krircc/master
Add rich project metadata
2019-12-08 16:03:39 +08:00
Yuki Okushi
909c7c8b5b Merge branch 'master' into master 2019-12-08 16:26:35 +09:00
Nikolay Kim
4a8a9ef405 update tests and clippy warnings 2019-12-08 12:31:16 +06:00
Nikolay Kim
6c9f9fff73 clippy warnings 2019-12-08 00:46:51 +06:00
Nikolay Kim
8df33f7a81 remove HttpServer::run() as it is not useful with async/await 2019-12-08 00:06:04 +06:00
Nikolay Kim
7ec5ca88a1 update changes 2019-12-07 22:01:55 +06:00
daxpedda
e5f3d88a4e Switch brotli compressor to rust. (#1197)
* Switch to a rustified version of brotli.

* Some memory optimizations.

* Make brotli not optional anymore.
2019-12-07 21:55:41 +06:00
Nikolay Kim
0ba125444a Add impl ResponseBuilder for Error 2019-12-07 21:41:34 +06:00
Nikolay Kim
6c226e47bd prepare actix-web-actors release 2019-12-07 20:10:36 +06:00
Vlad Frolov
8c3f58db9d Allow comma-separated websocket subprotocols without spaces (#1172)
* Allow comma-separated websocket subprotocols without spaces

* [CHANGES] Added an entry to CHANGES.md
2019-12-07 20:08:06 +06:00
daxpedda
4921243add Fix rustls build. (#1195) 2019-12-07 16:14:09 +06:00
daxpedda
91b3fcf85c Fix dependency features. (#1196) 2019-12-07 16:13:26 +06:00
Nikolay Kim
1729a52f8b prepare alpha.3 release 2019-12-07 13:00:03 +06:00
Nikolay Kim
ed2f3fe80d use actix-net alpha.3 release 2019-12-07 12:28:26 +06:00
Yuki Okushi
f2ba389496 Merge branch 'master' into master 2019-12-06 16:57:42 +09:00
krircc
439f02b6b1 Update README.md 2019-12-06 14:59:11 +08:00
krircc
e32da08a26 Update README.md 2019-12-06 14:34:14 +08:00
krircc
82110e0927 Update README.md 2019-12-06 14:29:10 +08:00
krircc
7b3354a9ad Update README.md 2019-12-06 14:26:23 +08:00
krircc
5243e8baca Update README.md 2019-12-06 14:23:28 +08:00
krircc
98903028c7 Update README.md 2019-12-06 14:22:29 +08:00
Nikolay Kim
7dd676439c update changes for actix-session 2019-12-06 11:24:25 +06:00
tglman
fbead137f0 feat: add access to UserSession from RequestHead (#1164)
* feat: add access to UserSession from RequestHead

* add test case for session from RequestHead and changes entry for the new feature
2019-12-06 11:21:43 +06:00
Nikolay Kim
205a964d8f upgrade to tokio 0.2 2019-12-05 23:35:43 +06:00
Nikolay Kim
b45c6cd66b replace hashbrown with std hashmap 2019-12-04 18:33:43 +06:00
Nikolay Kim
0015a204aa update version 2019-12-03 19:03:53 +06:00
Nikolay Kim
c7ed6d3428 update version 2019-12-03 16:35:31 +06:00
Nikolay Kim
cf30eafb49 update md 2019-12-03 00:49:12 +06:00
Nikolay Kim
14075ebf7f use released versions of actix-net 2019-12-02 23:33:39 +06:00
Nikolay Kim
068f047dd5 update service factory config 2019-12-02 21:37:13 +06:00
Nikolay Kim
f4c01384ec update to latest actix-net 2019-12-02 17:33:11 +06:00
krircc
b7d44d6c4c Merge pull request #1 from actix/master
git pull
2019-12-01 16:56:42 +08:00
Yuki Okushi
33574403b5 Remove rustls from package.metadata.docs.rs (#1182) 2019-11-28 06:25:21 +06:00
Nikolay Kim
dcc6efa3e6 Merge branch 'master' of github.com:actix/actix-web 2019-11-27 21:08:13 +06:00
Nikolay Kim
56b9f11c98 disable rustls 2019-11-27 21:07:49 +06:00
Folyd
f43a706364 Set name for each generated resource 2019-11-26 19:25:28 +06:00
Nikolay Kim
f2b3dc5625 update examples 2019-11-26 17:16:33 +06:00
Nikolay Kim
f73f97353b refactor ResponseError trait 2019-11-26 16:07:39 +06:00
Nikolay Kim
4dc31aac93 use actix_rt::test for test setup 2019-11-26 11:25:50 +06:00
Nikolay Kim
c1c44a7dd6 upgrade derive_more 2019-11-25 17:59:14 +06:00
Jim Blandy
c5907747ad Remove implementation of Responder for (). Fixes #1108.
Rationale:

- In Rust, one can omit a semicolon after a function's final expression to make
  its value the function's return value. It's common for people to include a
  semicolon after the last expression by mistake - common enough that the Rust
  compiler suggests removing the semicolon when there's a type mismatch between
  the function's signature and body. By implementing Responder for (), Actix makes
  this common mistake a silent error in handler functions.

- Functions returning an empty body should return HTTP status 204 ("No Content"),
  so the current Responder impl for (), which returns status 200 ("OK"), is not
  really what one wants anyway.

- It's not much of a burden to ask handlers to explicitly return
  `HttpResponse::Ok()` if that is what they want; all the examples in the
  documentation do this already.
2019-11-23 21:10:02 +06:00
Martell Malone
525c22de15 fix typos from updating to futures 0.3 2019-11-22 13:25:55 +06:00
Nikolay Kim
57981ca04a update tests to async handlers 2019-11-22 11:49:35 +06:00
Nikolay Kim
e668acc596 update travis config 2019-11-22 10:13:32 +06:00
Nikolay Kim
512dd2be63 disable rustls support 2019-11-22 07:01:05 +06:00
Nikolay Kim
8683ba8bb0 rename .to_async() to .to() 2019-11-21 21:36:35 +06:00
Nikolay Kim
0b9e3d381b add test with custom connector 2019-11-21 17:36:18 +06:00
Nikolay Kim
1f0577f8d5 cleanup api doc examples 2019-11-21 16:02:17 +06:00
Nikolay Kim
53c5151692 use response instead of result for asyn c handlers 2019-11-21 16:02:17 +06:00
Nikolay Kim
55698f2524 migrade rest of middlewares 2019-11-21 16:02:17 +06:00
Nikolay Kim
471f82f0e0 migrate actix-multipart 2019-11-21 16:02:17 +06:00
Nikolay Kim
60ada97b3d migrate actix-session 2019-11-21 16:02:17 +06:00
Nikolay Kim
0de101bc4d update actix-web-codegen tests 2019-11-21 16:02:17 +06:00
Nikolay Kim
95e2a0ef2e migrate actix-framed 2019-11-21 16:02:17 +06:00
Nikolay Kim
69cadcdedb migrate actix-files 2019-11-21 16:02:17 +06:00
Nikolay Kim
6ac4ac66b9 migrate actix-cors 2019-11-21 16:02:17 +06:00
Nikolay Kim
3646725cf6 migrate actix-identity 2019-11-21 16:02:17 +06:00
Nikolay Kim
ff62facc0d disable unmigrated crates 2019-11-21 16:02:17 +06:00
Nikolay Kim
b510527a9f update awc tests 2019-11-21 16:02:17 +06:00
Nikolay Kim
3127dd4db6 migrate actix-web to std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
d081e57316 fix h2 client send body 2019-11-21 16:02:17 +06:00
Nikolay Kim
1ffa7d18d3 drop unpin constraint 2019-11-21 16:02:17 +06:00
Nikolay Kim
687884fb94 update test-server tests 2019-11-21 16:02:17 +06:00
Nikolay Kim
5ab29b2e62 migrate awc and test-server to std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
a6a2d2f444 update ssl impls 2019-11-21 16:02:17 +06:00
Nikolay Kim
9e95efcc16 migrate client to std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
8cba1170e6 make actix-http compile with std::future 2019-11-21 16:02:17 +06:00
Nikolay Kim
5cb2d500d1 update actix-web-actors 2019-11-14 08:58:24 +06:00
236 changed files with 14902 additions and 18716 deletions

View File

@@ -1,41 +0,0 @@
environment:
global:
PROJECT_NAME: actix-web
matrix:
# Stable channel
- TARGET: i686-pc-windows-msvc
CHANNEL: stable
- TARGET: x86_64-pc-windows-gnu
CHANNEL: stable
- TARGET: x86_64-pc-windows-msvc
CHANNEL: stable
# Nightly channel
- TARGET: i686-pc-windows-msvc
CHANNEL: nightly
- TARGET: x86_64-pc-windows-gnu
CHANNEL: nightly
- TARGET: x86_64-pc-windows-msvc
CHANNEL: nightly
# Install Rust and Cargo
# (Based on from https://github.com/rust-lang/libc/blob/master/appveyor.yml)
install:
- ps: >-
If ($Env:TARGET -eq 'x86_64-pc-windows-gnu') {
$Env:PATH += ';C:\msys64\mingw64\bin'
} ElseIf ($Env:TARGET -eq 'i686-pc-windows-gnu') {
$Env:PATH += ';C:\MinGW\bin'
}
- curl -sSf -o rustup-init.exe https://win.rustup.rs
- rustup-init.exe --default-host %TARGET% --default-toolchain %CHANNEL% -y
- set PATH=%PATH%;C:\Users\appveyor\.cargo\bin
- rustc -Vv
- cargo -V
# 'cargo test' takes care of building for us, so disable Appveyor's build stage.
build: false
# Equivalent to Travis' `script` phase
test_script:
- cargo clean
- cargo test --no-default-features --features="flate2-rust"

37
.github/ISSUE_TEMPLATE/bug_report.md vendored Normal file
View File

@@ -0,0 +1,37 @@
---
name: Bug Report
about: Create a bug report.
---
Your issue may already be reported!
Please search on the [Actix Web issue tracker](https://github.com/actix/actix-web/issues) before creating one.
## Expected Behavior
<!--- If you're describing a bug, tell us what should happen -->
<!--- If you're suggesting a change/improvement, tell us how it should work -->
## Current Behavior
<!--- If describing a bug, tell us what happens instead of the expected behavior -->
<!--- If suggesting a change/improvement, explain the difference from current behavior -->
## Possible Solution
<!--- Not obligatory, but suggest a fix/reason for the bug, -->
<!--- or ideas how to implement the addition or change -->
## Steps to Reproduce (for bugs)
<!--- Provide a link to a live example, or an unambiguous set of steps to -->
<!--- reproduce this bug. Include code to reproduce, if relevant -->
1.
2.
3.
4.
## Context
<!--- How has this issue affected you? What are you trying to accomplish? -->
<!--- Providing context helps us come up with a solution that is most useful in the real world -->
## Your Environment
<!--- Include as many relevant details about the environment you experienced the bug in -->
* Rust Version (I.e, output of `rustc -V`):
* Actix Web Version:

8
.github/ISSUE_TEMPLATE/config.yml vendored Normal file
View File

@@ -0,0 +1,8 @@
blank_issues_enabled: true
contact_links:
- name: Gitter channel (actix-web)
url: https://gitter.im/actix/actix-web
about: Please ask and answer questions about the actix-web here.
- name: Gitter channel (actix)
url: https://gitter.im/actix/actix
about: Please ask and answer questions about the actix here.

27
.github/PULL_REQUEST_TEMPLATE.md vendored Normal file
View File

@@ -0,0 +1,27 @@
<!-- Thanks for considering contributing actix! -->
<!-- Please fill out the following to make our reviews easy. -->
## PR Type
<!-- What kind of change does this PR make? -->
<!-- Bug Fix / Feature / Refactor / Code Style / Other -->
INSERT_PR_TYPE
## PR Checklist
Check your PR fulfills the following:
<!-- For draft PRs check the boxes as you complete them. -->
- [ ] Tests for the changes have been added / updated.
- [ ] Documentation comments have been added / updated.
- [ ] A changelog entry has been made for the appropriate packages.
- [ ] Format code with the latest stable rustfmt
## Overview
<!-- Describe the current and new behavior. -->
<!-- Emphasize any breaking changes. -->
<!-- If this PR fixes or closes an issue, reference it here. -->
<!-- Closes #000 -->

28
.github/workflows/bench.yml vendored Normal file
View File

@@ -0,0 +1,28 @@
name: Benchmark (Linux)
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches:
- master
jobs:
check_benchmark:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: nightly
profile: minimal
override: true
- name: Check benchmark
uses: actions-rs/cargo@v1
with:
command: bench
args: --bench=server -- --sample-size=15

32
.github/workflows/clippy-fmt.yml vendored Normal file
View File

@@ -0,0 +1,32 @@
on:
pull_request:
types: [opened, synchronize, reopened]
name: Clippy and rustfmt Check
jobs:
clippy_check:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- uses: actions-rs/toolchain@v1
with:
toolchain: stable
components: rustfmt
override: true
- name: Check with rustfmt
uses: actions-rs/cargo@v1
with:
command: fmt
args: --all -- --check
- uses: actions-rs/toolchain@v1
with:
toolchain: nightly
components: clippy
override: true
- name: Check with Clippy
uses: actions-rs/clippy-check@v1
with:
token: ${{ secrets.GITHUB_TOKEN }}
args: --all-features --all --tests

69
.github/workflows/linux.yml vendored Normal file
View File

@@ -0,0 +1,69 @@
name: CI (Linux)
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches:
- master
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
version:
- 1.42.0 # MSRV
- stable
- nightly
name: ${{ matrix.version }} - x86_64-unknown-linux-gnu
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-x86_64-unknown-linux-gnu
profile: minimal
override: true
- name: check build
uses: actions-rs/cargo@v1
with:
command: check
args: --all --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --all --all-features --no-fail-fast -- --nocapture
- name: tests (actix-http)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=actix-http --no-default-features --features=rustls -- --nocapture
- name: tests (awc)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=awc --no-default-features --features=rustls -- --nocapture
- name: Generate coverage file
if: matrix.version == 'stable' && (github.ref == 'refs/heads/master' || github.event_name == 'pull_request')
run: |
cargo install cargo-tarpaulin --vers "^0.13"
cargo tarpaulin --out Xml
- name: Upload to Codecov
if: matrix.version == 'stable' && (github.ref == 'refs/heads/master' || github.event_name == 'pull_request')
uses: codecov/codecov-action@v1
with:
file: cobertura.xml

44
.github/workflows/macos.yml vendored Normal file
View File

@@ -0,0 +1,44 @@
name: CI (macOS)
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches:
- master
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
version:
- stable
- nightly
name: ${{ matrix.version }} - x86_64-apple-darwin
runs-on: macOS-latest
steps:
- uses: actions/checkout@v2
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-x86_64-apple-darwin
profile: minimal
override: true
- name: check build
uses: actions-rs/cargo@v1
with:
command: check
args: --all --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
with:
command: test
args: --all --all-features --no-fail-fast -- --nocapture
--skip=test_h2_content_length
--skip=test_reading_deflate_encoding_large_random_rustls

37
.github/workflows/upload-doc.yml vendored Normal file
View File

@@ -0,0 +1,37 @@
name: Upload documentation
on:
push:
branches:
- master
jobs:
build:
runs-on: ubuntu-latest
if: github.repository == 'actix/actix-web'
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: stable-x86_64-unknown-linux-gnu
profile: minimal
override: true
- name: check build
uses: actions-rs/cargo@v1
with:
command: doc
args: --no-deps --workspace --all-features
- name: Tweak HTML
run: echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html
- name: Deploy to GitHub Pages
uses: JamesIves/github-pages-deploy-action@3.5.8
with:
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
BRANCH: gh-pages
FOLDER: target/doc

64
.github/workflows/windows.yml vendored Normal file
View File

@@ -0,0 +1,64 @@
name: CI (Windows)
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches:
- master
env:
VCPKGRS_DYNAMIC: 1
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
version:
- stable
- nightly
name: ${{ matrix.version }} - x86_64-pc-windows-msvc
runs-on: windows-latest
steps:
- uses: actions/checkout@v2
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-x86_64-pc-windows-msvc
profile: minimal
override: true
- name: Install OpenSSL
run: |
vcpkg integrate install
vcpkg install openssl:x64-windows
Copy-Item C:\vcpkg\installed\x64-windows\bin\libcrypto-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libcrypto.dll
Copy-Item C:\vcpkg\installed\x64-windows\bin\libssl-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libssl.dll
Get-ChildItem C:\vcpkg\installed\x64-windows\bin
Get-ChildItem C:\vcpkg\installed\x64-windows\lib
- name: check build
uses: actions-rs/cargo@v1
with:
command: check
args: --all --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
with:
command: test
args: --all --all-features --no-fail-fast -- --nocapture
--skip=test_h2_content_length
--skip=test_reading_deflate_encoding_large_random_rustls
--skip=test_params
--skip=test_simple
--skip=test_expect_continue
--skip=test_http10_keepalive
--skip=test_slow_request
--skip=test_connection_force_close
--skip=test_connection_server_close
--skip=test_connection_wait_queue_force_close

1
.gitignore vendored
View File

@@ -9,6 +9,7 @@ guide/build/
*.pid
*.sock
*~
.DS_Store
# These are backup files generated by rustfmt
**/*.rs.bk

View File

@@ -1,58 +0,0 @@
language: rust
sudo: required
dist: trusty
cache:
# cargo: true
apt: true
matrix:
include:
- rust: stable
- rust: beta
- rust: nightly-2019-08-10
allow_failures:
- rust: nightly-2019-08-10
env:
global:
# - RUSTFLAGS="-C link-dead-code"
- OPENSSL_VERSION=openssl-1.0.2
before_install:
- sudo add-apt-repository -y ppa:0k53d-karl-f830m/openssl
- sudo apt-get update -qq
- sudo apt-get install -y openssl libssl-dev libelf-dev libdw-dev cmake gcc binutils-dev libiberty-dev
before_cache: |
if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-08-10" ]]; then
RUSTFLAGS="--cfg procmacro2_semver_exempt" cargo install --version 0.6.11 cargo-tarpaulin
fi
# Add clippy
before_script:
- export PATH=$PATH:~/.cargo/bin
script:
- cargo update
- cargo check --all --no-default-features
- cargo test --all-features --all -- --nocapture
- cd actix-http; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd ..
- cd awc; cargo test --no-default-features --features="rust-tls" -- --nocapture; cd ..
# Upload docs
after_success:
- |
if [[ "$TRAVIS_OS_NAME" == "linux" && "$TRAVIS_PULL_REQUEST" = "false" && "$TRAVIS_BRANCH" == "master" && "$TRAVIS_RUST_VERSION" == "stable" ]]; then
cargo doc --no-deps --all-features &&
echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html &&
git clone https://github.com/davisp/ghp-import.git &&
./ghp-import/ghp_import.py -n -p -f -m "Documentation upload" -r https://"$GH_TOKEN"@github.com/"$TRAVIS_REPO_SLUG.git" target/doc &&
echo "Uploaded documentation"
fi
- |
if [[ "$TRAVIS_RUST_VERSION" == "nightly-2019-08-10" ]]; then
taskset -c 0 cargo tarpaulin --out Xml --all --all-features
bash <(curl -s https://codecov.io/bash)
echo "Uploaded code coverage"
fi

View File

@@ -1,5 +1,153 @@
# Changes
## Unreleased
## 3.0.0-beta.2 - 2020-08-17
### Changed
* `PayloadConfig` is now also considered in `Bytes` and `String` extractors when set
using `App::data`. [#1610]
* `web::Path` now has a public representation: `web::Path(pub T)` that enables
destructuring. [#1594]
* `ServiceRequest::app_data` allows retrieval of non-Data data without splitting into parts to
access `HttpRequest` which already allows this. [#1618]
* Re-export all error types from `awc`. [#1621]
* MSRV is now 1.42.0.
### Fixed
* Memory leak of app data in pooled requests. [#1609]
[#1594]: https://github.com/actix/actix-web/pull/1594
[#1609]: https://github.com/actix/actix-web/pull/1609
[#1610]: https://github.com/actix/actix-web/pull/1610
[#1618]: https://github.com/actix/actix-web/pull/1618
[#1621]: https://github.com/actix/actix-web/pull/1621
## 3.0.0-beta.1 - 2020-07-13
### Added
* Re-export `actix_rt::main` as `actix_web::main`.
* `HttpRequest::match_pattern` and `ServiceRequest::match_pattern` for extracting the matched
resource pattern.
* `HttpRequest::match_name` and `ServiceRequest::match_name` for extracting matched resource name.
### Changed
* Fix actix_http::h1::dispatcher so it returns when HW_BUFFER_SIZE is reached. Should reduce peak memory consumption during large uploads. [#1550]
* Migrate cookie handling to `cookie` crate. Actix-web no longer requires `ring` dependency.
* MSRV is now 1.41.1
### Fixed
* `NormalizePath` improved consistency when path needs slashes added _and_ removed.
## 3.0.0-alpha.3 - 2020-05-21
### Added
* Add option to create `Data<T>` from `Arc<T>` [#1509]
### Changed
* Resources and Scopes can now access non-overridden data types set on App (or containing scopes) when setting their own data. [#1486]
* Fix audit issue logging by default peer address [#1485]
* Bump minimum supported Rust version to 1.40
* Replace deprecated `net2` crate with `socket2`
[#1485]: https://github.com/actix/actix-web/pull/1485
[#1509]: https://github.com/actix/actix-web/pull/1509
## [3.0.0-alpha.2] - 2020-05-08
### Changed
* `{Resource,Scope}::default_service(f)` handlers now support app data extraction. [#1452]
* Implement `std::error::Error` for our custom errors [#1422]
* NormalizePath middleware now appends trailing / so that routes of form /example/ respond to /example requests. [#1433]
* Remove the `failure` feature and support.
[#1422]: https://github.com/actix/actix-web/pull/1422
[#1433]: https://github.com/actix/actix-web/pull/1433
[#1452]: https://github.com/actix/actix-web/pull/1452
[#1486]: https://github.com/actix/actix-web/pull/1486
## [3.0.0-alpha.1] - 2020-03-11
### Added
* Add helper function for creating routes with `TRACE` method guard `web::trace()`
* Add convenience functions `test::read_body_json()` and `test::TestRequest::send_request()` for testing.
### Changed
* Use `sha-1` crate instead of unmaintained `sha1` crate
* Skip empty chunks when returning response from a `Stream` [#1308]
* Update the `time` dependency to 0.2.7
* Update `actix-tls` dependency to 2.0.0-alpha.1
* Update `rustls` dependency to 0.17
[#1308]: https://github.com/actix/actix-web/pull/1308
## [2.0.0] - 2019-12-25
### Changed
* Rename `HttpServer::start()` to `HttpServer::run()`
* Allow to gracefully stop test server via `TestServer::stop()`
* Allow to specify multi-patterns for resources
## [2.0.0-rc] - 2019-12-20
### Changed
* Move `BodyEncoding` to `dev` module #1220
* Allow to set `peer_addr` for TestRequest #1074
* Make web::Data deref to Arc<T> #1214
* Rename `App::register_data()` to `App::app_data()`
* `HttpRequest::app_data<T>()` returns `Option<&T>` instead of `Option<&Data<T>>`
### Fixed
* Fix `AppConfig::secure()` is always false. #1202
## [2.0.0-alpha.6] - 2019-12-15
### Fixed
* Fixed compilation with default features off
## [2.0.0-alpha.5] - 2019-12-13
### Added
* Add test server, `test::start()` and `test::start_with()`
## [2.0.0-alpha.4] - 2019-12-08
### Deleted
* Delete HttpServer::run(), it is not useful witht async/await
## [2.0.0-alpha.3] - 2019-12-07
### Changed
* Migrate to tokio 0.2
## [2.0.0-alpha.1] - 2019-11-22
### Changed
* Migrated to `std::future`
* Remove implementation of `Responder` for `()`. (#1167)
## [1.0.9] - 2019-11-14
### Added

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-web"
version = "1.0.9"
version = "3.0.0-beta.2"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix web is a simple, pragmatic and extremely fast web framework for Rust."
readme = "README.md"
@@ -11,12 +11,11 @@ documentation = "https://docs.rs/actix-web/"
categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT/Apache-2.0"
exclude = [".gitignore", ".travis.yml", ".cargo/config", "appveyor.yml"]
license = "MIT OR Apache-2.0"
edition = "2018"
[package.metadata.docs.rs]
features = ["ssl", "brotli", "flate2-zlib", "secure-cookies", "client", "rust-tls", "uds"]
features = ["openssl", "rustls", "compress", "secure-cookies"]
[badges]
travis-ci = { repository = "actix/actix-web", branch = "master" }
@@ -31,11 +30,7 @@ members = [
".",
"awc",
"actix-http",
"actix-cors",
"actix-files",
"actix-framed",
"actix-session",
"actix-identity",
"actix-multipart",
"actix-web-actors",
"actix-web-codegen",
@@ -43,78 +38,77 @@ members = [
]
[features]
default = ["brotli", "flate2-zlib", "client", "fail"]
default = ["compress"]
# http client
client = ["awc"]
# content-encoding support
compress = ["actix-http/compress", "awc/compress"]
# brotli encoding, requires c compiler
brotli = ["actix-http/brotli"]
# miniz-sys backend for flate2 crate
flate2-zlib = ["actix-http/flate2-zlib"]
# rust backend for flate2 crate
flate2-rust = ["actix-http/flate2-rust"]
# sessions feature, session require "ring" crate and c compiler
# sessions feature
secure-cookies = ["actix-http/secure-cookies"]
fail = ["actix-http/fail"]
# openssl
ssl = ["openssl", "actix-server/ssl", "awc/ssl"]
openssl = ["actix-tls/openssl", "awc/openssl", "open-ssl"]
# rustls
rust-tls = ["rustls", "actix-server/rust-tls", "awc/rust-tls"]
rustls = ["actix-tls/rustls", "awc/rustls", "rust-tls"]
# unix domain sockets support
uds = ["actix-server/uds"]
[[example]]
name = "basic"
required-features = ["compress"]
[[example]]
name = "uds"
required-features = ["compress"]
[[test]]
name = "test_server"
required-features = ["compress"]
[dependencies]
actix-codec = "0.1.2"
actix-service = "0.4.1"
actix-utils = "0.4.4"
actix-router = "0.1.5"
actix-rt = "0.2.4"
actix-web-codegen = "0.1.2"
actix-http = "0.2.11"
actix-server = "0.6.1"
actix-server-config = "0.1.2"
actix-testing = "0.1.0"
actix-threadpool = "0.1.1"
awc = { version = "0.2.7", optional = true }
actix-codec = "0.2.0"
actix-service = "1.0.2"
actix-utils = "1.0.6"
actix-router = "0.2.4"
actix-rt = "1.1.1"
actix-server = "1.0.0"
actix-testing = "1.0.0"
actix-macros = "0.1.0"
actix-threadpool = "0.3.1"
actix-tls = "2.0.0-alpha.1"
bytes = "0.4"
derive_more = "0.15.0"
actix-web-codegen = "0.3.0-beta.1"
actix-http = "2.0.0-beta.3"
awc = { version = "2.0.0-beta.1", default-features = false }
bytes = "0.5.3"
derive_more = "0.99.2"
encoding_rs = "0.8"
futures = "0.1.25"
hashbrown = "0.6.3"
futures-channel = { version = "0.3.5", default-features = false }
futures-core = { version = "0.3.5", default-features = false }
futures-util = { version = "0.3.5", default-features = false }
fxhash = "0.2.1"
log = "0.4"
mime = "0.3"
net2 = "0.2.33"
parking_lot = "0.9"
regex = "1.0"
socket2 = "0.3"
pin-project = "0.4.17"
regex = "1.3"
serde = { version = "1.0", features=["derive"] }
serde_json = "1.0"
serde_urlencoded = "0.6.1"
time = "0.1.42"
time = { version = "0.2.7", default-features = false, features = ["std"] }
url = "2.1"
# ssl support
openssl = { version="0.10", optional = true }
rustls = { version = "0.15", optional = true }
open-ssl = { package = "openssl", version = "0.10", optional = true }
rust-tls = { package = "rustls", version = "0.17.0", optional = true }
tinyvec = { version = "0.3", features = ["alloc"] }
[dev-dependencies]
actix = "0.8.3"
actix-connect = "0.2.2"
actix-http-test = "0.2.4"
actix = "0.10.0-alpha.1"
rand = "0.7"
env_logger = "0.6"
env_logger = "0.7"
serde_derive = "1.0"
tokio-timer = "0.2.8"
brotli2 = "0.3.2"
flate2 = "1.0.2"
flate2 = "1.0.13"
criterion = "0.3"
[profile.release]
lto = true
@@ -126,8 +120,18 @@ actix-web = { path = "." }
actix-http = { path = "actix-http" }
actix-http-test = { path = "test-server" }
actix-web-codegen = { path = "actix-web-codegen" }
actix-web-actors = { path = "actix-web-actors" }
actix-session = { path = "actix-session" }
actix-files = { path = "actix-files" }
actix-multipart = { path = "actix-multipart" }
awc = { path = "awc" }
[[example]]
name = "client"
required-features = ["rustls"]
[[bench]]
name = "server"
harness = false
[[bench]]
name = "service"
harness = false

View File

@@ -1,3 +1,85 @@
## Unreleased
* Setting a cookie's SameSite property, explicitly, to `SameSite::None` will now
result in `SameSite=None` being sent with the response Set-Cookie header.
To create a cookie without a SameSite attribute, remove any calls setting same_site.
* actix-http support for Actors messages was moved to actix-http crate and is enabled
with feature `actors`
* content_length function is removed from actix-http.
You can set Content-Length by normally setting the response body or calling no_chunking function.
* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
`u64` instead of a `usize`.
* Code that was using `path.<index>` to access a `web::Path<(A, B, C)>`s elements now needs to use
destructuring or `.into_inner()`. For example:
```rust
// Previously:
async fn some_route(path: web::Path<(String, String)>) -> String {
format!("Hello, {} {}", path.0, path.1)
}
// Now (this also worked before):
async fn some_route(path: web::Path<(String, String)>) -> String {
let (first_name, last_name) = path.into_inner();
format!("Hello, {} {}", first_name, last_name)
}
// Or (this wasn't previously supported):
async fn some_route(web::Path((first_name, last_name)): web::Path<(String, String)>) -> String {
format!("Hello, {} {}", first_name, last_name)
}
```
## 2.0.0
* `HttpServer::start()` renamed to `HttpServer::run()`. It also possible to
`.await` on `run` method result, in that case it awaits server exit.
* `App::register_data()` renamed to `App::app_data()` and accepts any type `T: 'static`.
Stored data is available via `HttpRequest::app_data()` method at runtime.
* Extractor configuration must be registered with `App::app_data()` instead of `App::data()`
* Sync handlers has been removed. `.to_async()` method has been renamed to `.to()`
replace `fn` with `async fn` to convert sync handler to async
* `actix_http_test::TestServer` moved to `actix_web::test` module. To start
test server use `test::start()` or `test_start_with_config()` methods
* `ResponseError` trait has been reafctored. `ResponseError::error_response()` renders
http response.
* Feature `rust-tls` renamed to `rustls`
instead of
```rust
actix-web = { version = "2.0.0", features = ["rust-tls"] }
```
use
```rust
actix-web = { version = "2.0.0", features = ["rustls"] }
```
* Feature `ssl` renamed to `openssl`
instead of
```rust
actix-web = { version = "2.0.0", features = ["ssl"] }
```
use
```rust
actix-web = { version = "2.0.0", features = ["openssl"] }
```
* `Cors` builder now requires that you call `.finish()` to construct the middleware
## 1.0.1
* Cors middleware has been moved to `actix-cors` crate
@@ -34,52 +116,52 @@
* Extractor configuration. In version 1.0 this is handled with the new `Data` mechanism for both setting and retrieving the configuration
instead of
```rust
#[derive(Default)]
struct ExtractorConfig {
config: String,
}
impl FromRequest for YourExtractor {
type Config = ExtractorConfig;
type Result = Result<YourExtractor, Error>;
fn from_request(req: &HttpRequest, cfg: &Self::Config) -> Self::Result {
println!("use the config: {:?}", cfg.config);
...
}
}
App::new().resource("/route_with_config", |r| {
r.post().with_config(handler_fn, |cfg| {
cfg.0.config = "test".to_string();
})
})
```
use the HttpRequest to get the configuration like any other `Data` with `req.app_data::<C>()` and set it with the `data()` method on the `resource`
```rust
#[derive(Default)]
struct ExtractorConfig {
config: String,
}
impl FromRequest for YourExtractor {
type Error = Error;
type Future = Result<Self, Self::Error>;
type Config = ExtractorConfig;
fn from_request(req: &HttpRequest, payload: &mut Payload) -> Self::Future {
let cfg = req.app_data::<ExtractorConfig>();
println!("config data?: {:?}", cfg.unwrap().role);
...
}
}
App::new().service(
resource("/route_with_config")
.data(ExtractorConfig {
@@ -88,7 +170,7 @@
.route(post().to(handler_fn)),
)
```
* Resource registration. 1.0 version uses generalized resource
registration via `.service()` method.
@@ -304,7 +386,7 @@
* `actix_web::server` module has been removed. To start http server use `actix_web::HttpServer` type
* StaticFiles and NamedFile has been move to separate create.
* StaticFiles and NamedFile have been moved to a separate crate.
instead of `use actix_web::fs::StaticFile`
@@ -314,7 +396,7 @@
use `use actix_files::NamedFile`
* Multipart has been move to separate create.
* Multipart has been moved to a separate crate.
instead of `use actix_web::multipart::Multipart`
@@ -379,9 +461,9 @@
* `HttpRequest` does not implement `Stream` anymore. If you need to read request payload
use `HttpMessage::payload()` method.
instead of
```rust
fn index(req: HttpRequest) -> impl Responder {
req
@@ -407,8 +489,8 @@
trait uses `&HttpRequest` instead of `&mut HttpRequest`.
* Removed `Route::with2()` and `Route::with3()` use tuple of extractors instead.
instead of
instead of
```rust
fn index(query: Query<..>, info: Json<MyStruct) -> impl Responder {}
@@ -424,7 +506,7 @@
* `Handler::handle()` accepts reference to `HttpRequest<_>` instead of value
* Removed deprecated `HttpServer::threads()`, use
* Removed deprecated `HttpServer::threads()`, use
[HttpServer::workers()](https://actix.rs/actix-web/actix_web/server/struct.HttpServer.html#method.workers) instead.
* Renamed `client::ClientConnectorError::Connector` to
@@ -433,7 +515,7 @@
* `Route::with()` does not return `ExtractorConfig`, to configure
extractor use `Route::with_config()`
instead of
instead of
```rust
fn main() {
@@ -444,11 +526,11 @@
});
}
```
use
use
```rust
fn main() {
let app = App::new().resource("/index.html", |r| {
r.method(http::Method::GET)
@@ -478,12 +560,12 @@
* `HttpRequest::extensions()` returns read only reference to the request's Extension
`HttpRequest::extensions_mut()` returns mutable reference.
* Instead of
* Instead of
`use actix_web::middleware::{
CookieSessionBackend, CookieSessionError, RequestSession,
Session, SessionBackend, SessionImpl, SessionStorage};`
use `actix_web::middleware::session`
`use actix_web::middleware::session{CookieSessionBackend, CookieSessionError,

111
README.md
View File

@@ -1,79 +1,114 @@
# Actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
<div align="center">
<h1>Actix web</h1>
<p>
<strong>Actix web is a powerful, pragmatic, and extremely fast web framework for Rust</strong>
</p>
<p>
Actix web is a simple, pragmatic and extremely fast web framework for Rust.
[![crates.io](https://meritbadge.herokuapp.com/actix-web)](https://crates.io/crates/actix-web)
[![Documentation](https://docs.rs/actix-web/badge.svg)](https://docs.rs/actix-web)
[![Version](https://img.shields.io/badge/rustc-1.42+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.42.html)
![License](https://img.shields.io/crates/l/actix-web.svg)
<br />
[![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web)
[![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web)
[![Download](https://img.shields.io/crates/d/actix-web.svg)](https://crates.io/crates/actix-web)
[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
* Supported *HTTP/1.x* and *HTTP/2.0* protocols
</p>
</div>
## Features
* Supports *HTTP/1.x* and *HTTP/2*
* Streaming and pipelining
* Keep-alive and slow requests handling
* Client/server [WebSockets](https://actix.rs/docs/websockets/) support
* Transparent content compression/decompression (br, gzip, deflate)
* Configurable [request routing](https://actix.rs/docs/url-dispatch/)
* Powerful [request routing](https://actix.rs/docs/url-dispatch/)
* Multipart streams
* Static assets
* SSL support with OpenSSL or Rustls
* SSL support using OpenSSL or Rustls
* Middlewares ([Logger, Session, CORS, etc](https://actix.rs/docs/middleware/))
* Includes an asynchronous [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
* Includes an async [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
* Supports [Actix actor framework](https://github.com/actix/actix)
* Runs on stable Rust 1.42+
## Documentation & community resources
## Documentation
* [User Guide](https://actix.rs/docs/)
* [API Documentation (1.0)](https://docs.rs/actix-web/)
* [API Documentation (0.7)](https://docs.rs/actix-web/0.7.19/actix_web/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-web](https://crates.io/crates/actix-web)
* Minimum supported Rust version: 1.36 or later
* [Website & User Guide](https://actix.rs)
* [Examples Repository](https://actix.rs/actix-web/actix_web)
* [API Documentation](https://docs.rs/actix-web)
* [API Documentation (master branch)](https://actix.rs/actix-web/actix_web)
## Example
```rust
use actix_web::{web, App, HttpServer, Responder};
<h2>
WARNING: This example is for the master branch which is currently in beta stages for v3. For
Actix web v2 see the <a href="https://actix.rs/docs/getting-started/">getting started guide</a>.
</h2>
fn index(info: web::Path<(u32, String)>) -> impl Responder {
format!("Hello {}! id:{}", info.1, info.0)
Dependencies:
```toml
[dependencies]
actix-web = "3"
```
Code:
```rust
use actix_web::{get, web, App, HttpServer, Responder};
#[get("/{id}/{name}/index.html")]
async fn index(web::Path((id, name)): web::Path<(u32, String)>) -> impl Responder {
format!("Hello {}! id:{}", name, id)
}
fn main() -> std::io::Result<()> {
HttpServer::new(
|| App::new().service(
web::resource("/{id}/{name}/index.html").to(index)))
#[actix_web::main]
async fn main() -> std::io::Result<()> {
HttpServer::new(|| App::new().service(index))
.bind("127.0.0.1:8080")?
.run()
.await
}
```
### More examples
* [Basics](https://github.com/actix/examples/tree/master/basics/)
* [Stateful](https://github.com/actix/examples/tree/master/state/)
* [Multipart streams](https://github.com/actix/examples/tree/master/multipart/)
* [Simple websocket](https://github.com/actix/examples/tree/master/websocket/)
* [Tera](https://github.com/actix/examples/tree/master/template_tera/) /
[Askama](https://github.com/actix/examples/tree/master/template_askama/) templates
* [Diesel integration](https://github.com/actix/examples/tree/master/diesel/)
* [r2d2](https://github.com/actix/examples/tree/master/r2d2/)
* [SSL / HTTP/2.0](https://github.com/actix/examples/tree/master/tls/)
* [Tcp/Websocket chat](https://github.com/actix/examples/tree/master/websocket-chat/)
* [Json](https://github.com/actix/examples/tree/master/json/)
* [Basic Setup](https://github.com/actix/examples/tree/master/basics/)
* [Application State](https://github.com/actix/examples/tree/master/state/)
* [JSON Handling](https://github.com/actix/examples/tree/master/json/)
* [Multipart Streams](https://github.com/actix/examples/tree/master/multipart/)
* [Diesel Integration](https://github.com/actix/examples/tree/master/diesel/)
* [r2d2 Integration](https://github.com/actix/examples/tree/master/r2d2/)
* [Simple WebSocket](https://github.com/actix/examples/tree/master/websocket/)
* [Tera Templates](https://github.com/actix/examples/tree/master/template_tera/)
* [Askama Templates](https://github.com/actix/examples/tree/master/template_askama/)
* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/rustls/)
* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/openssl/)
* [WebSocket Chat](https://github.com/actix/examples/tree/master/websocket-chat/)
You may consider checking out
[this directory](https://github.com/actix/examples/tree/master/) for more examples.
## Benchmarks
* [TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r18)
One of the fastest web frameworks available according to the
[TechEmpower Framework Benchmark](https://www.techempower.com/benchmarks/#section=data-r19).
## License
This project is licensed under either of
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or [http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
* MIT license ([LICENSE-MIT](LICENSE-MIT) or [http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or
[http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
* MIT license ([LICENSE-MIT](LICENSE-MIT) or
[http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
at your option.
## Code of Conduct
Contribution to the actix-web crate is organized under the terms of the
Contributor Covenant, the maintainer of actix-web, @fafhrd91, promises to
intervene to uphold that code of conduct.
Contribution to the actix-web crate is organized under the terms of the Contributor Covenant, the
maintainers of Actix web, promises to intervene to uphold that code of conduct.

View File

@@ -1,9 +0,0 @@
# Changes
## [0.1.1] - unreleased
* Bump `derive_more` crate version to 0.15.0
## [0.1.0] - 2019-06-15
* Move cors middleware to separate crate

View File

@@ -1,23 +0,0 @@
[package]
name = "actix-cors"
version = "0.1.0"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Cross-origin resource sharing (CORS) for Actix applications."
readme = "README.md"
keywords = ["web", "framework"]
homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-cors/"
license = "MIT/Apache-2.0"
edition = "2018"
#workspace = ".."
[lib]
name = "actix_cors"
path = "src/lib.rs"
[dependencies]
actix-web = "1.0.0"
actix-service = "0.4.0"
derive_more = "0.15.0"
futures = "0.1.25"

View File

@@ -1 +0,0 @@
../LICENSE-APACHE

View File

@@ -1 +0,0 @@
../LICENSE-MIT

View File

@@ -1,5 +1,7 @@
# Cors Middleware for actix web framework [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-cors)](https://crates.io/crates/actix-cors) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
**This crate moved to https://github.com/actix/actix-extras.**
## Documentation & community resources
* [User Guide](https://actix.rs/docs/)

File diff suppressed because it is too large Load Diff

View File

@@ -1,5 +1,31 @@
# Changes
## [Unreleased] - 2020-xx-xx
## [0.3.0-beta.1] - 2020-07-15
* Update `v_htmlescape` to 0.10
* Update `actix-web` and `actix-http` dependencies to beta.1
## [0.3.0-alpha.1] - 2020-05-23
* Update `actix-web` and `actix-http` dependencies to alpha
* Fix some typos in the docs
* Bump minimum supported Rust version to 1.40
* Support sending Content-Length when Content-Range is specified [#1384]
[#1384]: https://github.com/actix/actix-web/pull/1384
## [0.2.1] - 2019-12-22
* Use the same format for file URLs regardless of platforms
## [0.2.0] - 2019-12-20
* Fix BodyEncoding trait import #1220
## [0.2.0-alpha.1] - 2019-12-07
* Migrate to `std::future`
## [0.1.7] - 2019-11-06
* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-files"
version = "0.1.7"
version = "0.3.0-beta.1"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Static files support for actix web."
readme = "README.md"
@@ -9,27 +9,28 @@ homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-files/"
categories = ["asynchronous", "web-programming::http-server"]
license = "MIT/Apache-2.0"
license = "MIT OR Apache-2.0"
edition = "2018"
workspace = ".."
[lib]
name = "actix_files"
path = "src/lib.rs"
[dependencies]
actix-web = { version = "1.0.8", default-features = false }
actix-http = "0.2.11"
actix-service = "0.4.1"
actix-web = { version = "3.0.0-beta.2", default-features = false }
actix-http = "2.0.0-beta.3"
actix-service = "1.0.1"
bitflags = "1"
bytes = "0.4"
futures = "0.1.25"
derive_more = "0.15.0"
bytes = "0.5.3"
futures-core = { version = "0.3.5", default-features = false }
futures-util = { version = "0.3.5", default-features = false }
derive_more = "0.99.2"
log = "0.4"
mime = "0.3"
mime_guess = "2.0.1"
percent-encoding = "2.1"
v_htmlescape = "0.4"
v_htmlescape = "0.10"
[dev-dependencies]
actix-web = { version = "1.0.8", features=["ssl"] }
actix-rt = "1.0.0"
actix-web = { version = "3.0.0-beta.2", features = ["openssl"] }

View File

@@ -6,4 +6,4 @@
* [API Documentation](https://docs.rs/actix-files/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-files](https://crates.io/crates/actix-files)
* Minimum supported Rust version: 1.33 or later
* Minimum supported Rust version: 1.40 or later

View File

@@ -5,6 +5,7 @@ use derive_more::Display;
#[derive(Display, Debug, PartialEq)]
pub enum FilesError {
/// Path is not a directory
#[allow(dead_code)]
#[display(fmt = "Path is not a directory. Unable to serve static files")]
IsNotDirectory,
@@ -35,7 +36,7 @@ pub enum UriSegmentError {
/// Return `BadRequest` for `UriSegmentError`
impl ResponseError for UriSegmentError {
fn error_response(&self) -> HttpResponse {
HttpResponse::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -8,16 +8,16 @@ use std::time::{SystemTime, UNIX_EPOCH};
use std::os::unix::fs::MetadataExt;
use bitflags::bitflags;
use mime;
use mime_guess::from_path;
use actix_http::body::SizedStream;
use actix_web::dev::BodyEncoding;
use actix_web::http::header::{
self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
};
use actix_web::http::{ContentEncoding, StatusCode};
use actix_web::middleware::BodyEncoding;
use actix_web::{Error, HttpMessage, HttpRequest, HttpResponse, Responder};
use futures_util::future::{ready, Ready};
use crate::range::HttpRange;
use crate::ChunkedReadFile;
@@ -89,7 +89,7 @@ impl NamedFile {
};
let ct = from_path(&path).first_or_octet_stream();
let disposition_type = match ct.type_() {
let disposition = match ct.type_() {
mime::IMAGE | mime::TEXT | mime::VIDEO => DispositionType::Inline,
_ => DispositionType::Attachment,
};
@@ -103,8 +103,8 @@ impl NamedFile {
}))
}
let cd = ContentDisposition {
disposition: disposition_type,
parameters: parameters,
disposition,
parameters,
};
(ct, cd)
};
@@ -255,62 +255,8 @@ impl NamedFile {
pub(crate) fn last_modified(&self) -> Option<header::HttpDate> {
self.modified.map(|mtime| mtime.into())
}
}
impl Deref for NamedFile {
type Target = File;
fn deref(&self) -> &File {
&self.file
}
}
impl DerefMut for NamedFile {
fn deref_mut(&mut self) -> &mut File {
&mut self.file
}
}
/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfMatch>() {
None | Some(header::IfMatch::Any) => true,
Some(header::IfMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.strong_eq(some_etag) {
return true;
}
}
}
false
}
}
}
/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfNoneMatch>() {
Some(header::IfNoneMatch::Any) => false,
Some(header::IfNoneMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.weak_eq(some_etag) {
return false;
}
}
}
true
}
None => true,
}
}
impl Responder for NamedFile {
type Error = Error;
type Future = Result<HttpResponse, Error>;
fn respond_to(self, req: &HttpRequest) -> Self::Future {
pub fn into_response(self, req: &HttpRequest) -> Result<HttpResponse, Error> {
if self.status_code != StatusCode::OK {
let mut resp = HttpResponse::build(self.status_code);
resp.set(header::ContentType(self.content_type.clone()))
@@ -441,9 +387,69 @@ impl Responder for NamedFile {
fut: None,
counter: 0,
};
if offset != 0 || length != self.md.len() {
return Ok(resp.status(StatusCode::PARTIAL_CONTENT).streaming(reader));
};
resp.status(StatusCode::PARTIAL_CONTENT);
}
Ok(resp.body(SizedStream::new(length, reader)))
}
}
impl Deref for NamedFile {
type Target = File;
fn deref(&self) -> &File {
&self.file
}
}
impl DerefMut for NamedFile {
fn deref_mut(&mut self) -> &mut File {
&mut self.file
}
}
/// Returns true if `req` has no `If-Match` header or one which matches `etag`.
fn any_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfMatch>() {
None | Some(header::IfMatch::Any) => true,
Some(header::IfMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.strong_eq(some_etag) {
return true;
}
}
}
false
}
}
}
/// Returns true if `req` doesn't have an `If-None-Match` header matching `req`.
fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
match req.get_header::<header::IfNoneMatch>() {
Some(header::IfNoneMatch::Any) => false,
Some(header::IfNoneMatch::Items(ref items)) => {
if let Some(some_etag) = etag {
for item in items {
if item.weak_eq(some_etag) {
return false;
}
}
}
true
}
None => true,
}
}
impl Responder for NamedFile {
type Error = Error;
type Future = Ready<Result<HttpResponse, Error>>;
fn respond_to(self, req: &HttpRequest) -> Self::Future {
ready(self.into_response(req))
}
}

View File

@@ -1,38 +0,0 @@
[package]
name = "actix-framed"
version = "0.2.1"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix framed app server"
readme = "README.md"
keywords = ["http", "web", "framework", "async", "futures"]
homepage = "https://actix.rs"
repository = "https://github.com/actix/actix-web.git"
documentation = "https://docs.rs/actix-framed/"
categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT/Apache-2.0"
edition = "2018"
workspace =".."
[lib]
name = "actix_framed"
path = "src/lib.rs"
[dependencies]
actix-codec = "0.1.2"
actix-service = "0.4.1"
actix-router = "0.1.2"
actix-rt = "0.2.2"
actix-http = "0.2.7"
actix-server-config = "0.1.2"
bytes = "0.4"
futures = "0.1.25"
log = "0.4"
[dev-dependencies]
actix-server = { version = "0.6.0", features=["ssl"] }
actix-connect = { version = "0.2.0", features=["ssl"] }
actix-http-test = { version = "0.2.4", features=["ssl"] }
actix-utils = "0.4.4"

View File

@@ -1,201 +0,0 @@
Apache License
Version 2.0, January 2004
http://www.apache.org/licenses/
TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
1. Definitions.
"License" shall mean the terms and conditions for use, reproduction,
and distribution as defined by Sections 1 through 9 of this document.
"Licensor" shall mean the copyright owner or entity authorized by
the copyright owner that is granting the License.
"Legal Entity" shall mean the union of the acting entity and all
other entities that control, are controlled by, or are under common
control with that entity. For the purposes of this definition,
"control" means (i) the power, direct or indirect, to cause the
direction or management of such entity, whether by contract or
otherwise, or (ii) ownership of fifty percent (50%) or more of the
outstanding shares, or (iii) beneficial ownership of such entity.
"You" (or "Your") shall mean an individual or Legal Entity
exercising permissions granted by this License.
"Source" form shall mean the preferred form for making modifications,
including but not limited to software source code, documentation
source, and configuration files.
"Object" form shall mean any form resulting from mechanical
transformation or translation of a Source form, including but
not limited to compiled object code, generated documentation,
and conversions to other media types.
"Work" shall mean the work of authorship, whether in Source or
Object form, made available under the License, as indicated by a
copyright notice that is included in or attached to the work
(an example is provided in the Appendix below).
"Derivative Works" shall mean any work, whether in Source or Object
form, that is based on (or derived from) the Work and for which the
editorial revisions, annotations, elaborations, or other modifications
represent, as a whole, an original work of authorship. For the purposes
of this License, Derivative Works shall not include works that remain
separable from, or merely link (or bind by name) to the interfaces of,
the Work and Derivative Works thereof.
"Contribution" shall mean any work of authorship, including
the original version of the Work and any modifications or additions
to that Work or Derivative Works thereof, that is intentionally
submitted to Licensor for inclusion in the Work by the copyright owner
or by an individual or Legal Entity authorized to submit on behalf of
the copyright owner. For the purposes of this definition, "submitted"
means any form of electronic, verbal, or written communication sent
to the Licensor or its representatives, including but not limited to
communication on electronic mailing lists, source code control systems,
and issue tracking systems that are managed by, or on behalf of, the
Licensor for the purpose of discussing and improving the Work, but
excluding communication that is conspicuously marked or otherwise
designated in writing by the copyright owner as "Not a Contribution."
"Contributor" shall mean Licensor and any individual or Legal Entity
on behalf of whom a Contribution has been received by Licensor and
subsequently incorporated within the Work.
2. Grant of Copyright License. Subject to the terms and conditions of
this License, each Contributor hereby grants to You a perpetual,
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
copyright license to reproduce, prepare Derivative Works of,
publicly display, publicly perform, sublicense, and distribute the
Work and such Derivative Works in Source or Object form.
3. Grant of Patent License. Subject to the terms and conditions of
this License, each Contributor hereby grants to You a perpetual,
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
(except as stated in this section) patent license to make, have made,
use, offer to sell, sell, import, and otherwise transfer the Work,
where such license applies only to those patent claims licensable
by such Contributor that are necessarily infringed by their
Contribution(s) alone or by combination of their Contribution(s)
with the Work to which such Contribution(s) was submitted. If You
institute patent litigation against any entity (including a
cross-claim or counterclaim in a lawsuit) alleging that the Work
or a Contribution incorporated within the Work constitutes direct
or contributory patent infringement, then any patent licenses
granted to You under this License for that Work shall terminate
as of the date such litigation is filed.
4. Redistribution. You may reproduce and distribute copies of the
Work or Derivative Works thereof in any medium, with or without
modifications, and in Source or Object form, provided that You
meet the following conditions:
(a) You must give any other recipients of the Work or
Derivative Works a copy of this License; and
(b) You must cause any modified files to carry prominent notices
stating that You changed the files; and
(c) You must retain, in the Source form of any Derivative Works
that You distribute, all copyright, patent, trademark, and
attribution notices from the Source form of the Work,
excluding those notices that do not pertain to any part of
the Derivative Works; and
(d) If the Work includes a "NOTICE" text file as part of its
distribution, then any Derivative Works that You distribute must
include a readable copy of the attribution notices contained
within such NOTICE file, excluding those notices that do not
pertain to any part of the Derivative Works, in at least one
of the following places: within a NOTICE text file distributed
as part of the Derivative Works; within the Source form or
documentation, if provided along with the Derivative Works; or,
within a display generated by the Derivative Works, if and
wherever such third-party notices normally appear. The contents
of the NOTICE file are for informational purposes only and
do not modify the License. You may add Your own attribution
notices within Derivative Works that You distribute, alongside
or as an addendum to the NOTICE text from the Work, provided
that such additional attribution notices cannot be construed
as modifying the License.
You may add Your own copyright statement to Your modifications and
may provide additional or different license terms and conditions
for use, reproduction, or distribution of Your modifications, or
for any such Derivative Works as a whole, provided Your use,
reproduction, and distribution of the Work otherwise complies with
the conditions stated in this License.
5. Submission of Contributions. Unless You explicitly state otherwise,
any Contribution intentionally submitted for inclusion in the Work
by You to the Licensor shall be under the terms and conditions of
this License, without any additional terms or conditions.
Notwithstanding the above, nothing herein shall supersede or modify
the terms of any separate license agreement you may have executed
with Licensor regarding such Contributions.
6. Trademarks. This License does not grant permission to use the trade
names, trademarks, service marks, or product names of the Licensor,
except as required for reasonable and customary use in describing the
origin of the Work and reproducing the content of the NOTICE file.
7. Disclaimer of Warranty. Unless required by applicable law or
agreed to in writing, Licensor provides the Work (and each
Contributor provides its Contributions) on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
implied, including, without limitation, any warranties or conditions
of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
PARTICULAR PURPOSE. You are solely responsible for determining the
appropriateness of using or redistributing the Work and assume any
risks associated with Your exercise of permissions under this License.
8. Limitation of Liability. In no event and under no legal theory,
whether in tort (including negligence), contract, or otherwise,
unless required by applicable law (such as deliberate and grossly
negligent acts) or agreed to in writing, shall any Contributor be
liable to You for damages, including any direct, indirect, special,
incidental, or consequential damages of any character arising as a
result of this License or out of the use or inability to use the
Work (including but not limited to damages for loss of goodwill,
work stoppage, computer failure or malfunction, or any and all
other commercial damages or losses), even if such Contributor
has been advised of the possibility of such damages.
9. Accepting Warranty or Additional Liability. While redistributing
the Work or Derivative Works thereof, You may choose to offer,
and charge a fee for, acceptance of support, warranty, indemnity,
or other liability obligations and/or rights consistent with this
License. However, in accepting such obligations, You may act only
on Your own behalf and on Your sole responsibility, not on behalf
of any other Contributor, and only if You agree to indemnify,
defend, and hold each Contributor harmless for any liability
incurred by, or claims asserted against, such Contributor by reason
of your accepting any such warranty or additional liability.
END OF TERMS AND CONDITIONS
APPENDIX: How to apply the Apache License to your work.
To apply the Apache License to your work, attach the following
boilerplate notice, with the fields enclosed by brackets "{}"
replaced with your own identifying information. (Don't include
the brackets!) The text should be enclosed in the appropriate
comment syntax for the file format. We also recommend that a
file or class name and description of purpose be included on the
same "printed page" as the copyright notice for easier
identification within third-party archives.
Copyright 2017-NOW Nikolay Kim
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.

View File

@@ -1,25 +0,0 @@
Copyright (c) 2017 Nikolay Kim
Permission is hereby granted, free of charge, to any
person obtaining a copy of this software and associated
documentation files (the "Software"), to deal in the
Software without restriction, including without
limitation the rights to use, copy, modify, merge,
publish, distribute, sublicense, and/or sell copies of
the Software, and to permit persons to whom the Software
is furnished to do so, subject to the following
conditions:
The above copyright notice and this permission notice
shall be included in all copies or substantial portions
of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF
ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED
TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A
PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT
SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR
IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
DEALINGS IN THE SOFTWARE.

View File

@@ -1,8 +1,3 @@
# Framed app for actix web [![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web) [![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web) [![crates.io](https://meritbadge.herokuapp.com/actix-framed)](https://crates.io/crates/actix-framed) [![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
# Framed app for actix web
## Documentation & community resources
* [API Documentation](https://docs.rs/actix-framed/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-framed](https://crates.io/crates/actix-framed)
* Minimum supported Rust version: 1.33 or later
**This crate has been deprecated and removed.**

View File

@@ -1,20 +0,0 @@
# Changes
## [0.2.1] - 2019-07-20
* Remove unneeded actix-utils dependency
## [0.2.0] - 2019-05-12
* Update dependencies
## [0.1.0] - 2019-04-16
* Update tests
## [0.1.0-alpha.1] - 2019-04-12
* Initial release

View File

@@ -1,217 +0,0 @@
use std::rc::Rc;
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_http::h1::{Codec, SendResponse};
use actix_http::{Error, Request, Response};
use actix_router::{Path, Router, Url};
use actix_server_config::ServerConfig;
use actix_service::{IntoNewService, NewService, Service};
use futures::{Async, Future, Poll};
use crate::helpers::{BoxedHttpNewService, BoxedHttpService, HttpNewService};
use crate::request::FramedRequest;
use crate::state::State;
type BoxedResponse = Box<dyn Future<Item = (), Error = Error>>;
pub trait HttpServiceFactory {
type Factory: NewService;
fn path(&self) -> &str;
fn create(self) -> Self::Factory;
}
/// Application builder
pub struct FramedApp<T, S = ()> {
state: State<S>,
services: Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>,
}
impl<T: 'static> FramedApp<T, ()> {
pub fn new() -> Self {
FramedApp {
state: State::new(()),
services: Vec::new(),
}
}
}
impl<T: 'static, S: 'static> FramedApp<T, S> {
pub fn with(state: S) -> FramedApp<T, S> {
FramedApp {
services: Vec::new(),
state: State::new(state),
}
}
pub fn service<U>(mut self, factory: U) -> Self
where
U: HttpServiceFactory,
U::Factory: NewService<
Config = (),
Request = FramedRequest<T, S>,
Response = (),
Error = Error,
InitError = (),
> + 'static,
<U::Factory as NewService>::Future: 'static,
<U::Factory as NewService>::Service: Service<
Request = FramedRequest<T, S>,
Response = (),
Error = Error,
Future = Box<dyn Future<Item = (), Error = Error>>,
>,
{
let path = factory.path().to_string();
self.services
.push((path, Box::new(HttpNewService::new(factory.create()))));
self
}
}
impl<T, S> IntoNewService<FramedAppFactory<T, S>> for FramedApp<T, S>
where
T: AsyncRead + AsyncWrite + 'static,
S: 'static,
{
fn into_new_service(self) -> FramedAppFactory<T, S> {
FramedAppFactory {
state: self.state,
services: Rc::new(self.services),
}
}
}
#[derive(Clone)]
pub struct FramedAppFactory<T, S> {
state: State<S>,
services: Rc<Vec<(String, BoxedHttpNewService<FramedRequest<T, S>>)>>,
}
impl<T, S> NewService for FramedAppFactory<T, S>
where
T: AsyncRead + AsyncWrite + 'static,
S: 'static,
{
type Config = ServerConfig;
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type InitError = ();
type Service = FramedAppService<T, S>;
type Future = CreateService<T, S>;
fn new_service(&self, _: &ServerConfig) -> Self::Future {
CreateService {
fut: self
.services
.iter()
.map(|(path, service)| {
CreateServiceItem::Future(
Some(path.clone()),
service.new_service(&()),
)
})
.collect(),
state: self.state.clone(),
}
}
}
#[doc(hidden)]
pub struct CreateService<T, S> {
fut: Vec<CreateServiceItem<T, S>>,
state: State<S>,
}
enum CreateServiceItem<T, S> {
Future(
Option<String>,
Box<dyn Future<Item = BoxedHttpService<FramedRequest<T, S>>, Error = ()>>,
),
Service(String, BoxedHttpService<FramedRequest<T, S>>),
}
impl<S: 'static, T: 'static> Future for CreateService<T, S>
where
T: AsyncRead + AsyncWrite,
{
type Item = FramedAppService<T, S>;
type Error = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let mut done = true;
// poll http services
for item in &mut self.fut {
let res = match item {
CreateServiceItem::Future(ref mut path, ref mut fut) => {
match fut.poll()? {
Async::Ready(service) => Some((path.take().unwrap(), service)),
Async::NotReady => {
done = false;
None
}
}
}
CreateServiceItem::Service(_, _) => continue,
};
if let Some((path, service)) = res {
*item = CreateServiceItem::Service(path, service);
}
}
if done {
let router = self
.fut
.drain(..)
.fold(Router::build(), |mut router, item| {
match item {
CreateServiceItem::Service(path, service) => {
router.path(&path, service);
}
CreateServiceItem::Future(_, _) => unreachable!(),
}
router
});
Ok(Async::Ready(FramedAppService {
router: router.finish(),
state: self.state.clone(),
}))
} else {
Ok(Async::NotReady)
}
}
}
pub struct FramedAppService<T, S> {
state: State<S>,
router: Router<BoxedHttpService<FramedRequest<T, S>>>,
}
impl<S: 'static, T: 'static> Service for FramedAppService<T, S>
where
T: AsyncRead + AsyncWrite,
{
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type Future = BoxedResponse;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
}
fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
let mut path = Path::new(Url::new(req.uri().clone()));
if let Some((srv, _info)) = self.router.recognize_mut(&mut path) {
return srv.call(FramedRequest::new(req, framed, path, self.state.clone()));
}
Box::new(
SendResponse::new(framed, Response::NotFound().finish()).then(|_| Ok(())),
)
}
}

View File

@@ -1,90 +0,0 @@
use actix_http::Error;
use actix_service::{NewService, Service};
use futures::{Future, Poll};
pub(crate) type BoxedHttpService<Req> = Box<
dyn Service<
Request = Req,
Response = (),
Error = Error,
Future = Box<dyn Future<Item = (), Error = Error>>,
>,
>;
pub(crate) type BoxedHttpNewService<Req> = Box<
dyn NewService<
Config = (),
Request = Req,
Response = (),
Error = Error,
InitError = (),
Service = BoxedHttpService<Req>,
Future = Box<dyn Future<Item = BoxedHttpService<Req>, Error = ()>>,
>,
>;
pub(crate) struct HttpNewService<T: NewService>(T);
impl<T> HttpNewService<T>
where
T: NewService<Response = (), Error = Error>,
T::Response: 'static,
T::Future: 'static,
T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static,
<T::Service as Service>::Future: 'static,
{
pub fn new(service: T) -> Self {
HttpNewService(service)
}
}
impl<T> NewService for HttpNewService<T>
where
T: NewService<Config = (), Response = (), Error = Error>,
T::Request: 'static,
T::Future: 'static,
T::Service: Service<Future = Box<dyn Future<Item = (), Error = Error>>> + 'static,
<T::Service as Service>::Future: 'static,
{
type Config = ();
type Request = T::Request;
type Response = ();
type Error = Error;
type InitError = ();
type Service = BoxedHttpService<T::Request>;
type Future = Box<dyn Future<Item = Self::Service, Error = ()>>;
fn new_service(&self, _: &()) -> Self::Future {
Box::new(self.0.new_service(&()).map_err(|_| ()).and_then(|service| {
let service: BoxedHttpService<_> = Box::new(HttpServiceWrapper { service });
Ok(service)
}))
}
}
struct HttpServiceWrapper<T: Service> {
service: T,
}
impl<T> Service for HttpServiceWrapper<T>
where
T: Service<
Response = (),
Future = Box<dyn Future<Item = (), Error = Error>>,
Error = Error,
>,
T::Request: 'static,
{
type Request = T::Request;
type Response = ();
type Error = Error;
type Future = Box<dyn Future<Item = (), Error = Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.service.poll_ready()
}
fn call(&mut self, req: Self::Request) -> Self::Future {
self.service.call(req)
}
}

View File

@@ -1,17 +0,0 @@
#![allow(clippy::type_complexity, clippy::new_without_default, dead_code)]
mod app;
mod helpers;
mod request;
mod route;
mod service;
mod state;
pub mod test;
// re-export for convinience
pub use actix_http::{http, Error, HttpMessage, Response, ResponseError};
pub use self::app::{FramedApp, FramedAppService};
pub use self::request::FramedRequest;
pub use self::route::FramedRoute;
pub use self::service::{SendError, VerifyWebSockets};
pub use self::state::State;

View File

@@ -1,170 +0,0 @@
use std::cell::{Ref, RefMut};
use actix_codec::Framed;
use actix_http::http::{HeaderMap, Method, Uri, Version};
use actix_http::{h1::Codec, Extensions, Request, RequestHead};
use actix_router::{Path, Url};
use crate::state::State;
pub struct FramedRequest<Io, S = ()> {
req: Request,
framed: Framed<Io, Codec>,
state: State<S>,
pub(crate) path: Path<Url>,
}
impl<Io, S> FramedRequest<Io, S> {
pub fn new(
req: Request,
framed: Framed<Io, Codec>,
path: Path<Url>,
state: State<S>,
) -> Self {
Self {
req,
framed,
state,
path,
}
}
}
impl<Io, S> FramedRequest<Io, S> {
/// Split request into a parts
pub fn into_parts(self) -> (Request, Framed<Io, Codec>, State<S>) {
(self.req, self.framed, self.state)
}
/// This method returns reference to the request head
#[inline]
pub fn head(&self) -> &RequestHead {
self.req.head()
}
/// This method returns muttable reference to the request head.
/// panics if multiple references of http request exists.
#[inline]
pub fn head_mut(&mut self) -> &mut RequestHead {
self.req.head_mut()
}
/// Shared application state
#[inline]
pub fn state(&self) -> &S {
self.state.get_ref()
}
/// Request's uri.
#[inline]
pub fn uri(&self) -> &Uri {
&self.head().uri
}
/// Read the Request method.
#[inline]
pub fn method(&self) -> &Method {
&self.head().method
}
/// Read the Request Version.
#[inline]
pub fn version(&self) -> Version {
self.head().version
}
#[inline]
/// Returns request's headers.
pub fn headers(&self) -> &HeaderMap {
&self.head().headers
}
/// The target path of this Request.
#[inline]
pub fn path(&self) -> &str {
self.head().uri.path()
}
/// The query string in the URL.
///
/// E.g., id=10
#[inline]
pub fn query_string(&self) -> &str {
if let Some(query) = self.uri().query().as_ref() {
query
} else {
""
}
}
/// Get a reference to the Path parameters.
///
/// Params is a container for url parameters.
/// A variable segment is specified in the form `{identifier}`,
/// where the identifier can be used later in a request handler to
/// access the matched value for that segment.
#[inline]
pub fn match_info(&self) -> &Path<Url> {
&self.path
}
/// Request extensions
#[inline]
pub fn extensions(&self) -> Ref<Extensions> {
self.head().extensions()
}
/// Mutable reference to a the request's extensions
#[inline]
pub fn extensions_mut(&self) -> RefMut<Extensions> {
self.head().extensions_mut()
}
}
#[cfg(test)]
mod tests {
use actix_http::http::{HeaderName, HeaderValue, HttpTryFrom};
use actix_http::test::{TestBuffer, TestRequest};
use super::*;
#[test]
fn test_reqest() {
let buf = TestBuffer::empty();
let framed = Framed::new(buf, Codec::default());
let req = TestRequest::with_uri("/index.html?q=1")
.header("content-type", "test")
.finish();
let path = Path::new(Url::new(req.uri().clone()));
let mut freq = FramedRequest::new(req, framed, path, State::new(10u8));
assert_eq!(*freq.state(), 10);
assert_eq!(freq.version(), Version::HTTP_11);
assert_eq!(freq.method(), Method::GET);
assert_eq!(freq.path(), "/index.html");
assert_eq!(freq.query_string(), "q=1");
assert_eq!(
freq.headers()
.get("content-type")
.unwrap()
.to_str()
.unwrap(),
"test"
);
freq.head_mut().headers.insert(
HeaderName::try_from("x-hdr").unwrap(),
HeaderValue::from_static("test"),
);
assert_eq!(
freq.headers().get("x-hdr").unwrap().to_str().unwrap(),
"test"
);
freq.extensions_mut().insert(100usize);
assert_eq!(*freq.extensions().get::<usize>().unwrap(), 100usize);
let (_, _, state) = freq.into_parts();
assert_eq!(*state, 10);
}
}

View File

@@ -1,157 +0,0 @@
use std::fmt;
use std::marker::PhantomData;
use actix_codec::{AsyncRead, AsyncWrite};
use actix_http::{http::Method, Error};
use actix_service::{NewService, Service};
use futures::future::{ok, FutureResult};
use futures::{Async, Future, IntoFuture, Poll};
use log::error;
use crate::app::HttpServiceFactory;
use crate::request::FramedRequest;
/// Resource route definition
///
/// Route uses builder-like pattern for configuration.
/// If handler is not explicitly set, default *404 Not Found* handler is used.
pub struct FramedRoute<Io, S, F = (), R = ()> {
handler: F,
pattern: String,
methods: Vec<Method>,
state: PhantomData<(Io, S, R)>,
}
impl<Io, S> FramedRoute<Io, S> {
pub fn new(pattern: &str) -> Self {
FramedRoute {
handler: (),
pattern: pattern.to_string(),
methods: Vec::new(),
state: PhantomData,
}
}
pub fn get(path: &str) -> FramedRoute<Io, S> {
FramedRoute::new(path).method(Method::GET)
}
pub fn post(path: &str) -> FramedRoute<Io, S> {
FramedRoute::new(path).method(Method::POST)
}
pub fn put(path: &str) -> FramedRoute<Io, S> {
FramedRoute::new(path).method(Method::PUT)
}
pub fn delete(path: &str) -> FramedRoute<Io, S> {
FramedRoute::new(path).method(Method::DELETE)
}
pub fn method(mut self, method: Method) -> Self {
self.methods.push(method);
self
}
pub fn to<F, R>(self, handler: F) -> FramedRoute<Io, S, F, R>
where
F: FnMut(FramedRequest<Io, S>) -> R,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Debug,
{
FramedRoute {
handler,
pattern: self.pattern,
methods: self.methods,
state: PhantomData,
}
}
}
impl<Io, S, F, R> HttpServiceFactory for FramedRoute<Io, S, F, R>
where
Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Display,
{
type Factory = FramedRouteFactory<Io, S, F, R>;
fn path(&self) -> &str {
&self.pattern
}
fn create(self) -> Self::Factory {
FramedRouteFactory {
handler: self.handler,
methods: self.methods,
_t: PhantomData,
}
}
}
pub struct FramedRouteFactory<Io, S, F, R> {
handler: F,
methods: Vec<Method>,
_t: PhantomData<(Io, S, R)>,
}
impl<Io, S, F, R> NewService for FramedRouteFactory<Io, S, F, R>
where
Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Display,
{
type Config = ();
type Request = FramedRequest<Io, S>;
type Response = ();
type Error = Error;
type InitError = ();
type Service = FramedRouteService<Io, S, F, R>;
type Future = FutureResult<Self::Service, Self::InitError>;
fn new_service(&self, _: &()) -> Self::Future {
ok(FramedRouteService {
handler: self.handler.clone(),
methods: self.methods.clone(),
_t: PhantomData,
})
}
}
pub struct FramedRouteService<Io, S, F, R> {
handler: F,
methods: Vec<Method>,
_t: PhantomData<(Io, S, R)>,
}
impl<Io, S, F, R> Service for FramedRouteService<Io, S, F, R>
where
Io: AsyncRead + AsyncWrite + 'static,
F: FnMut(FramedRequest<Io, S>) -> R + Clone,
R: IntoFuture<Item = ()>,
R::Future: 'static,
R::Error: fmt::Display,
{
type Request = FramedRequest<Io, S>;
type Response = ();
type Error = Error;
type Future = Box<dyn Future<Item = (), Error = Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
}
fn call(&mut self, req: FramedRequest<Io, S>) -> Self::Future {
Box::new((self.handler)(req).into_future().then(|res| {
if let Err(e) = res {
error!("Error in request handler: {}", e);
}
Ok(())
}))
}
}

View File

@@ -1,149 +0,0 @@
use std::marker::PhantomData;
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_http::body::BodySize;
use actix_http::error::ResponseError;
use actix_http::h1::{Codec, Message};
use actix_http::ws::{verify_handshake, HandshakeError};
use actix_http::{Request, Response};
use actix_service::{NewService, Service};
use futures::future::{ok, Either, FutureResult};
use futures::{Async, Future, IntoFuture, Poll, Sink};
/// Service that verifies incoming request if it is valid websocket
/// upgrade request. In case of error returns `HandshakeError`
pub struct VerifyWebSockets<T, C> {
_t: PhantomData<(T, C)>,
}
impl<T, C> Default for VerifyWebSockets<T, C> {
fn default() -> Self {
VerifyWebSockets { _t: PhantomData }
}
}
impl<T, C> NewService for VerifyWebSockets<T, C> {
type Config = C;
type Request = (Request, Framed<T, Codec>);
type Response = (Request, Framed<T, Codec>);
type Error = (HandshakeError, Framed<T, Codec>);
type InitError = ();
type Service = VerifyWebSockets<T, C>;
type Future = FutureResult<Self::Service, Self::InitError>;
fn new_service(&self, _: &C) -> Self::Future {
ok(VerifyWebSockets { _t: PhantomData })
}
}
impl<T, C> Service for VerifyWebSockets<T, C> {
type Request = (Request, Framed<T, Codec>);
type Response = (Request, Framed<T, Codec>);
type Error = (HandshakeError, Framed<T, Codec>);
type Future = FutureResult<Self::Response, Self::Error>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
}
fn call(&mut self, (req, framed): (Request, Framed<T, Codec>)) -> Self::Future {
match verify_handshake(req.head()) {
Err(e) => Err((e, framed)).into_future(),
Ok(_) => Ok((req, framed)).into_future(),
}
}
}
/// Send http/1 error response
pub struct SendError<T, R, E, C>(PhantomData<(T, R, E, C)>);
impl<T, R, E, C> Default for SendError<T, R, E, C>
where
T: AsyncRead + AsyncWrite,
E: ResponseError,
{
fn default() -> Self {
SendError(PhantomData)
}
}
impl<T, R, E, C> NewService for SendError<T, R, E, C>
where
T: AsyncRead + AsyncWrite + 'static,
R: 'static,
E: ResponseError + 'static,
{
type Config = C;
type Request = Result<R, (E, Framed<T, Codec>)>;
type Response = R;
type Error = (E, Framed<T, Codec>);
type InitError = ();
type Service = SendError<T, R, E, C>;
type Future = FutureResult<Self::Service, Self::InitError>;
fn new_service(&self, _: &C) -> Self::Future {
ok(SendError(PhantomData))
}
}
impl<T, R, E, C> Service for SendError<T, R, E, C>
where
T: AsyncRead + AsyncWrite + 'static,
R: 'static,
E: ResponseError + 'static,
{
type Request = Result<R, (E, Framed<T, Codec>)>;
type Response = R;
type Error = (E, Framed<T, Codec>);
type Future = Either<FutureResult<R, (E, Framed<T, Codec>)>, SendErrorFut<T, R, E>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
}
fn call(&mut self, req: Result<R, (E, Framed<T, Codec>)>) -> Self::Future {
match req {
Ok(r) => Either::A(ok(r)),
Err((e, framed)) => {
let res = e.error_response().drop_body();
Either::B(SendErrorFut {
framed: Some(framed),
res: Some((res, BodySize::Empty).into()),
err: Some(e),
_t: PhantomData,
})
}
}
}
}
pub struct SendErrorFut<T, R, E> {
res: Option<Message<(Response<()>, BodySize)>>,
framed: Option<Framed<T, Codec>>,
err: Option<E>,
_t: PhantomData<R>,
}
impl<T, R, E> Future for SendErrorFut<T, R, E>
where
E: ResponseError,
T: AsyncRead + AsyncWrite,
{
type Item = R;
type Error = (E, Framed<T, Codec>);
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
if let Some(res) = self.res.take() {
if self.framed.as_mut().unwrap().force_send(res).is_err() {
return Err((self.err.take().unwrap(), self.framed.take().unwrap()));
}
}
match self.framed.as_mut().unwrap().poll_complete() {
Ok(Async::Ready(_)) => {
Err((self.err.take().unwrap(), self.framed.take().unwrap()))
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(_) => Err((self.err.take().unwrap(), self.framed.take().unwrap())),
}
}
}

View File

@@ -1,29 +0,0 @@
use std::ops::Deref;
use std::sync::Arc;
/// Application state
pub struct State<S>(Arc<S>);
impl<S> State<S> {
pub fn new(state: S) -> State<S> {
State(Arc::new(state))
}
pub fn get_ref(&self) -> &S {
self.0.as_ref()
}
}
impl<S> Deref for State<S> {
type Target = S;
fn deref(&self) -> &S {
self.0.as_ref()
}
}
impl<S> Clone for State<S> {
fn clone(&self) -> State<S> {
State(self.0.clone())
}
}

View File

@@ -1,153 +0,0 @@
//! Various helpers for Actix applications to use during testing.
use actix_codec::Framed;
use actix_http::h1::Codec;
use actix_http::http::header::{Header, HeaderName, IntoHeaderValue};
use actix_http::http::{HttpTryFrom, Method, Uri, Version};
use actix_http::test::{TestBuffer, TestRequest as HttpTestRequest};
use actix_router::{Path, Url};
use actix_rt::Runtime;
use futures::IntoFuture;
use crate::{FramedRequest, State};
/// Test `Request` builder.
pub struct TestRequest<S = ()> {
req: HttpTestRequest,
path: Path<Url>,
state: State<S>,
}
impl Default for TestRequest<()> {
fn default() -> TestRequest {
TestRequest {
req: HttpTestRequest::default(),
path: Path::new(Url::new(Uri::default())),
state: State::new(()),
}
}
}
impl TestRequest<()> {
/// Create TestRequest and set request uri
pub fn with_uri(path: &str) -> Self {
Self::get().uri(path)
}
/// Create TestRequest and set header
pub fn with_hdr<H: Header>(hdr: H) -> Self {
Self::default().set(hdr)
}
/// Create TestRequest and set header
pub fn with_header<K, V>(key: K, value: V) -> Self
where
HeaderName: HttpTryFrom<K>,
V: IntoHeaderValue,
{
Self::default().header(key, value)
}
/// Create TestRequest and set method to `Method::GET`
pub fn get() -> Self {
Self::default().method(Method::GET)
}
/// Create TestRequest and set method to `Method::POST`
pub fn post() -> Self {
Self::default().method(Method::POST)
}
}
impl<S> TestRequest<S> {
/// Create TestRequest and set request uri
pub fn with_state(state: S) -> TestRequest<S> {
let req = TestRequest::get();
TestRequest {
state: State::new(state),
req: req.req,
path: req.path,
}
}
/// Set HTTP version of this request
pub fn version(mut self, ver: Version) -> Self {
self.req.version(ver);
self
}
/// Set HTTP method of this request
pub fn method(mut self, meth: Method) -> Self {
self.req.method(meth);
self
}
/// Set HTTP Uri of this request
pub fn uri(mut self, path: &str) -> Self {
self.req.uri(path);
self
}
/// Set a header
pub fn set<H: Header>(mut self, hdr: H) -> Self {
self.req.set(hdr);
self
}
/// Set a header
pub fn header<K, V>(mut self, key: K, value: V) -> Self
where
HeaderName: HttpTryFrom<K>,
V: IntoHeaderValue,
{
self.req.header(key, value);
self
}
/// Set request path pattern parameter
pub fn param(mut self, name: &'static str, value: &'static str) -> Self {
self.path.add_static(name, value);
self
}
/// Complete request creation and generate `Request` instance
pub fn finish(mut self) -> FramedRequest<TestBuffer, S> {
let req = self.req.finish();
self.path.get_mut().update(req.uri());
let framed = Framed::new(TestBuffer::empty(), Codec::default());
FramedRequest::new(req, framed, self.path, self.state)
}
/// This method generates `FramedRequest` instance and executes async handler
pub fn run<F, R, I, E>(self, f: F) -> Result<I, E>
where
F: FnOnce(FramedRequest<TestBuffer, S>) -> R,
R: IntoFuture<Item = I, Error = E>,
{
let mut rt = Runtime::new().unwrap();
rt.block_on(f(self.finish()).into_future())
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test() {
let req = TestRequest::with_uri("/index.html")
.header("x-test", "test")
.param("test", "123")
.finish();
assert_eq!(*req.state(), ());
assert_eq!(req.version(), Version::HTTP_11);
assert_eq!(req.method(), Method::GET);
assert_eq!(req.path(), "/index.html");
assert_eq!(req.query_string(), "");
assert_eq!(
req.headers().get("x-test").unwrap().to_str().unwrap(),
"test"
);
assert_eq!(&req.match_info()["test"], "123");
}
}

View File

@@ -1,141 +0,0 @@
use actix_codec::{AsyncRead, AsyncWrite};
use actix_http::{body, http::StatusCode, ws, Error, HttpService, Response};
use actix_http_test::TestServer;
use actix_service::{IntoNewService, NewService};
use actix_utils::framed::FramedTransport;
use bytes::{Bytes, BytesMut};
use futures::future::{self, ok};
use futures::{Future, Sink, Stream};
use actix_framed::{FramedApp, FramedRequest, FramedRoute, SendError, VerifyWebSockets};
fn ws_service<T: AsyncRead + AsyncWrite>(
req: FramedRequest<T>,
) -> impl Future<Item = (), Error = Error> {
let (req, framed, _) = req.into_parts();
let res = ws::handshake(req.head()).unwrap().message_body(());
framed
.send((res, body::BodySize::None).into())
.map_err(|_| panic!())
.and_then(|framed| {
FramedTransport::new(framed.into_framed(ws::Codec::new()), service)
.map_err(|_| panic!())
})
}
fn service(msg: ws::Frame) -> impl Future<Item = ws::Message, Error = Error> {
let msg = match msg {
ws::Frame::Ping(msg) => ws::Message::Pong(msg),
ws::Frame::Text(text) => {
ws::Message::Text(String::from_utf8_lossy(&text.unwrap()).to_string())
}
ws::Frame::Binary(bin) => ws::Message::Binary(bin.unwrap().freeze()),
ws::Frame::Close(reason) => ws::Message::Close(reason),
_ => panic!(),
};
ok(msg)
}
#[test]
fn test_simple() {
let mut srv = TestServer::new(|| {
HttpService::build()
.upgrade(
FramedApp::new().service(FramedRoute::get("/index.html").to(ws_service)),
)
.finish(|_| future::ok::<_, Error>(Response::NotFound()))
});
assert!(srv.ws_at("/test").is_err());
// client service
let framed = srv.ws_at("/index.html").unwrap();
let framed = srv
.block_on(framed.send(ws::Message::Text("text".to_string())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
let framed = srv
.block_on(framed.send(ws::Message::Binary("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(
item,
Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
);
let framed = srv
.block_on(framed.send(ws::Message::Ping("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
let framed = srv
.block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
.unwrap();
let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(
item,
Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
);
}
#[test]
fn test_service() {
let mut srv = TestServer::new(|| {
actix_http::h1::OneRequest::new().map_err(|_| ()).and_then(
VerifyWebSockets::default()
.then(SendError::default())
.map_err(|_| ())
.and_then(
FramedApp::new()
.service(FramedRoute::get("/index.html").to(ws_service))
.into_new_service()
.map_err(|_| ()),
),
)
});
// non ws request
let res = srv.block_on(srv.get("/index.html").send()).unwrap();
assert_eq!(res.status(), StatusCode::BAD_REQUEST);
// not found
assert!(srv.ws_at("/test").is_err());
// client service
let framed = srv.ws_at("/index.html").unwrap();
let framed = srv
.block_on(framed.send(ws::Message::Text("text".to_string())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Text(Some(BytesMut::from("text")))));
let framed = srv
.block_on(framed.send(ws::Message::Binary("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(
item,
Some(ws::Frame::Binary(Some(Bytes::from_static(b"text").into())))
);
let framed = srv
.block_on(framed.send(ws::Message::Ping("text".into())))
.unwrap();
let (item, framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(item, Some(ws::Frame::Pong("text".to_string().into())));
let framed = srv
.block_on(framed.send(ws::Message::Close(Some(ws::CloseCode::Normal.into()))))
.unwrap();
let (item, _framed) = srv.block_on(framed.into_future()).map_err(|_| ()).unwrap();
assert_eq!(
item,
Some(ws::Frame::Close(Some(ws::CloseCode::Normal.into())))
);
}

View File

@@ -1,41 +0,0 @@
environment:
global:
PROJECT_NAME: actix-http
matrix:
# Stable channel
- TARGET: i686-pc-windows-msvc
CHANNEL: stable
- TARGET: x86_64-pc-windows-gnu
CHANNEL: stable
- TARGET: x86_64-pc-windows-msvc
CHANNEL: stable
# Nightly channel
- TARGET: i686-pc-windows-msvc
CHANNEL: nightly
- TARGET: x86_64-pc-windows-gnu
CHANNEL: nightly
- TARGET: x86_64-pc-windows-msvc
CHANNEL: nightly
# Install Rust and Cargo
# (Based on from https://github.com/rust-lang/libc/blob/master/appveyor.yml)
install:
- ps: >-
If ($Env:TARGET -eq 'x86_64-pc-windows-gnu') {
$Env:PATH += ';C:\msys64\mingw64\bin'
} ElseIf ($Env:TARGET -eq 'i686-pc-windows-gnu') {
$Env:PATH += ';C:\MinGW\bin'
}
- curl -sSf -o rustup-init.exe https://win.rustup.rs
- rustup-init.exe --default-host %TARGET% --default-toolchain %CHANNEL% -y
- set PATH=%PATH%;C:\Users\appveyor\.cargo\bin
- rustc -Vv
- cargo -V
# 'cargo test' takes care of building for us, so disable Appveyor's build stage.
build: false
# Equivalent to Travis' `script` phase
test_script:
- cargo clean
- cargo test

View File

@@ -1,5 +1,149 @@
# Changes
## [2.0.0-beta.3] - 2020-08-14
### Fixed
* Memory leak of `client::pool::ConnectorPoolSupport`. [#1626]
[#1626]: https://github.com/actix/actix-web/pull/1626
## [2.0.0-beta.2] - 2020-07-21
### Fixed
* Potential UB in h1 decoder using uninitialized memory. [#1614]
### Changed
* Fix illegal chunked encoding. [#1615]
[#1614]: https://github.com/actix/actix-web/pull/1614
[#1615]: https://github.com/actix/actix-web/pull/1615
## [2.0.0-beta.1] - 2020-07-11
### Changed
* Migrate cookie handling to `cookie` crate. [#1558]
* Update `sha-1` to 0.9. [#1586]
* Fix leak in client pool. [#1580]
* MSRV is now 1.41.1.
[#1558]: https://github.com/actix/actix-web/pull/1558
[#1586]: https://github.com/actix/actix-web/pull/1586
[#1580]: https://github.com/actix/actix-web/pull/1580
## [2.0.0-alpha.4] - 2020-05-21
### Changed
* Bump minimum supported Rust version to 1.40
* content_length function is removed, and you can set Content-Length by calling no_chunking function [#1439]
* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
`u64` instead of a `usize`.
* Update `base64` dependency to 0.12
### Fixed
* Support parsing of `SameSite=None` [#1503]
[#1439]: https://github.com/actix/actix-web/pull/1439
[#1503]: https://github.com/actix/actix-web/pull/1503
## [2.0.0-alpha.3] - 2020-05-08
### Fixed
* Correct spelling of ConnectError::Unresolved [#1487]
* Fix a mistake in the encoding of websocket continuation messages wherein
Item::FirstText and Item::FirstBinary are each encoded as the other.
### Changed
* Implement `std::error::Error` for our custom errors [#1422]
* Remove `failure` support for `ResponseError` since that crate
will be deprecated in the near future.
[#1422]: https://github.com/actix/actix-web/pull/1422
[#1487]: https://github.com/actix/actix-web/pull/1487
## [2.0.0-alpha.2] - 2020-03-07
### Changed
* Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB respectively
to improve download speed for awc when downloading large objects. [#1394]
* client::Connector accepts initial_window_size and initial_connection_window_size HTTP2 configuration. [#1394]
* client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
[#1394]: https://github.com/actix/actix-web/pull/1394
[#1395]: https://github.com/actix/actix-web/pull/1395
## [2.0.0-alpha.1] - 2020-02-27
### Changed
* Update the `time` dependency to 0.2.7.
* Moved actors messages support from actix crate, enabled with feature `actors`.
* Breaking change: trait MessageBody requires Unpin and accepting Pin<&mut Self> instead of &mut self in the poll_next().
* MessageBody is not implemented for &'static [u8] anymore.
### Fixed
* Allow `SameSite=None` cookies to be sent in a response.
## [1.0.1] - 2019-12-20
### Fixed
* Poll upgrade service's readiness from HTTP service handlers
* Replace brotli with brotli2 #1224
## [1.0.0] - 2019-12-13
### Added
* Add websockets continuation frame support
### Changed
* Replace `flate2-xxx` features with `compress`
## [1.0.0-alpha.5] - 2019-12-09
### Fixed
* Check `Upgrade` service readiness before calling it
* Fix buffer remaining capacity calcualtion
### Changed
* Websockets: Ping and Pong should have binary data #1049
## [1.0.0-alpha.4] - 2019-12-08
### Added
* Add impl ResponseBuilder for Error
### Changed
* Use rust based brotli compression library
## [1.0.0-alpha.3] - 2019-12-07
### Changed
* Migrate to tokio 0.2
* Migrate to `std::future`
## [0.2.11] - 2019-11-06
### Added

View File

@@ -1,8 +1,8 @@
[package]
name = "actix-http"
version = "0.2.11"
version = "2.0.0-beta.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix http primitives"
description = "Actix HTTP primitives"
readme = "README.md"
keywords = ["actix", "http", "framework", "async", "futures"]
homepage = "https://actix.rs"
@@ -11,12 +11,11 @@ documentation = "https://docs.rs/actix-http/"
categories = ["network-programming", "asynchronous",
"web-programming::http-server",
"web-programming::websocket"]
license = "MIT/Apache-2.0"
license = "MIT OR Apache-2.0"
edition = "2018"
workspace = ".."
[package.metadata.docs.rs]
features = ["ssl", "fail", "brotli", "flate2-zlib", "secure-cookies"]
features = ["openssl", "rustls", "compress", "secure-cookies", "actors"]
[lib]
name = "actix_http"
@@ -26,85 +25,85 @@ path = "src/lib.rs"
default = []
# openssl
ssl = ["openssl", "actix-connect/ssl"]
openssl = ["actix-tls/openssl", "actix-connect/openssl"]
# rustls support
rust-tls = ["rustls", "webpki-roots", "actix-connect/rust-tls"]
rustls = ["actix-tls/rustls", "actix-connect/rustls"]
# brotli encoding, requires c compiler
brotli = ["brotli2"]
# miniz-sys backend for flate2 crate
flate2-zlib = ["flate2/miniz-sys"]
# rust backend for flate2 crate
flate2-rust = ["flate2/rust_backend"]
# failure integration. actix does not use failure anymore
fail = ["failure"]
# enable compressison support
compress = ["flate2", "brotli2"]
# support for secure cookies
secure-cookies = ["ring"]
secure-cookies = ["cookie/secure"]
# support for actix Actor messages
actors = ["actix"]
[dependencies]
actix-service = "0.4.1"
actix-codec = "0.1.2"
actix-connect = "0.2.4"
actix-utils = "0.4.4"
actix-server-config = "0.1.2"
actix-threadpool = "0.1.1"
actix-service = "1.0.5"
actix-codec = "0.2.0"
actix-connect = "2.0.0-alpha.3"
actix-utils = "1.0.6"
actix-rt = "1.0.0"
actix-threadpool = "0.3.1"
actix-tls = { version = "2.0.0-alpha.1", optional = true }
actix = { version = "0.10.0-alpha.1", optional = true }
base64 = "0.10"
bitflags = "1.0"
bytes = "0.4"
base64 = "0.12"
bitflags = "1.2"
bytes = "0.5.3"
cookie = { version = "0.14.1", features = ["percent-encode"] }
copyless = "0.1.4"
derive_more = "0.15.0"
either = "1.5.2"
derive_more = "0.99.2"
either = "1.5.3"
encoding_rs = "0.8"
futures = "0.1.25"
hashbrown = "0.6.3"
h2 = "0.1.16"
http = "0.1.17"
futures-channel = { version = "0.3.5", default-features = false }
futures-core = { version = "0.3.5", default-features = false }
futures-util = { version = "0.3.5", default-features = false }
fxhash = "0.2.1"
h2 = "0.2.1"
http = "0.2.0"
httparse = "1.3"
indexmap = "1.2"
lazy_static = "1.0"
indexmap = "1.3"
itoa = "0.4"
lazy_static = "1.4"
language-tags = "0.2"
log = "0.4"
mime = "0.3"
percent-encoding = "2.1"
pin-project = "0.4.17"
rand = "0.7"
regex = "1.0"
regex = "1.3"
serde = "1.0"
serde_json = "1.0"
sha1 = "0.6"
sha-1 = "0.9"
slab = "0.4"
serde_urlencoded = "0.6.1"
time = "0.1.42"
tokio-tcp = "0.1.3"
tokio-timer = "0.2.8"
tokio-current-thread = "0.1"
trust-dns-resolver = { version="0.11.1", default-features = false }
# for secure cookie
ring = { version = "0.14.6", optional = true }
time = { version = "0.2.7", default-features = false, features = ["std"] }
# compression
brotli2 = { version="0.3.2", optional = true }
flate2 = { version="1.0.7", optional = true, default-features = false }
# optional deps
failure = { version = "0.1.5", optional = true }
openssl = { version="0.10", optional = true }
rustls = { version = "0.15.2", optional = true }
webpki-roots = { version = "0.16", optional = true }
chrono = "0.4.6"
flate2 = { version = "1.0.13", optional = true }
[dev-dependencies]
actix-rt = "0.2.2"
actix-server = { version = "0.6.0", features=["ssl", "rust-tls"] }
actix-connect = { version = "0.2.0", features=["ssl"] }
actix-http-test = { version = "0.2.4", features=["ssl"] }
env_logger = "0.6"
actix-server = "1.0.1"
actix-connect = { version = "2.0.0-alpha.2", features = ["openssl"] }
actix-http-test = { version = "2.0.0-alpha.1", features = ["openssl"] }
actix-tls = { version = "2.0.0-alpha.1", features = ["openssl"] }
criterion = "0.3"
env_logger = "0.7"
serde_derive = "1.0"
openssl = { version="0.10" }
tokio-tcp = "0.1"
open-ssl = { version="0.10", package = "openssl" }
rust-tls = { version="0.17", package = "rustls" }
[[bench]]
name = "content-length"
harness = false
[[bench]]
name = "status-line"
harness = false
[[bench]]
name = "uninit-headers"
harness = false

View File

@@ -8,25 +8,40 @@ Actix http
* [API Documentation](https://docs.rs/actix-http/)
* [Chat on gitter](https://gitter.im/actix/actix)
* Cargo package: [actix-http](https://crates.io/crates/actix-http)
* Minimum supported Rust version: 1.31 or later
* Minimum supported Rust version: 1.40 or later
## Example
```rust
// see examples/framed_hello.rs for complete list of used crates.
extern crate actix_http;
use actix_http::{h1, Response, ServiceConfig};
use std::{env, io};
fn main() {
Server::new().bind("framed_hello", "127.0.0.1:8080", || {
IntoFramed::new(|| h1::Codec::new(ServiceConfig::default())) // <- create h1 codec
.and_then(TakeItem::new().map_err(|_| ())) // <- read one request
.and_then(|(_req, _framed): (_, Framed<_, _>)| { // <- send response and close conn
SendResponse::send(_framed, Response::Ok().body("Hello world!"))
.map_err(|_| ())
.map(|_| ())
})
}).unwrap().run();
use actix_http::{HttpService, Response};
use actix_server::Server;
use futures::future;
use http::header::HeaderValue;
use log::info;
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "hello_world=info");
env_logger::init();
Server::build()
.bind("hello-world", "127.0.0.1:8080", || {
HttpService::build()
.client_timeout(1000)
.client_disconnect(1000)
.finish(|_req| {
info!("{:?}", _req);
let mut res = Response::Ok();
res.header("x-head", HeaderValue::from_static("dummy value!"));
future::ok::<_, ()>(res.body("Hello world!"))
})
.tcp()
})?
.run()
.await
}
```

View File

@@ -0,0 +1,291 @@
use criterion::{criterion_group, criterion_main, BenchmarkId, Criterion};
use bytes::BytesMut;
// benchmark sending all requests at the same time
fn bench_write_content_length(c: &mut Criterion) {
let mut group = c.benchmark_group("write_content_length");
let sizes = [
0, 1, 11, 83, 101, 653, 1001, 6323, 10001, 56329, 100001, 123456, 98724245,
4294967202,
];
for i in sizes.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_content_length(i, &mut b)
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_content_length(i, &mut b)
})
});
group.bench_with_input(BenchmarkId::new("itoa", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_itoa::write_content_length(i, &mut b)
})
});
}
group.finish();
}
criterion_group!(benches, bench_write_content_length);
criterion_main!(benches);
mod _itoa {
use bytes::{BufMut, BytesMut};
pub fn write_content_length(n: usize, bytes: &mut BytesMut) {
if n == 0 {
bytes.put_slice(b"\r\ncontent-length: 0\r\n");
return;
}
let mut buf = itoa::Buffer::new();
bytes.put_slice(b"\r\ncontent-length: ");
bytes.put_slice(buf.format(n).as_bytes());
bytes.put_slice(b"\r\n");
}
}
mod _new {
use bytes::{BufMut, BytesMut};
const DIGITS_START: u8 = b'0';
/// NOTE: bytes object has to contain enough space
pub fn write_content_length(n: usize, bytes: &mut BytesMut) {
if n == 0 {
bytes.put_slice(b"\r\ncontent-length: 0\r\n");
return;
}
bytes.put_slice(b"\r\ncontent-length: ");
if n < 10 {
bytes.put_u8(DIGITS_START + (n as u8));
} else if n < 100 {
let n = n as u8;
let d10 = n / 10;
let d1 = n % 10;
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 1000 {
let n = n as u16;
let d100 = (n / 100) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 10_000 {
let n = n as u16;
let d1000 = (n / 1000) as u8;
let d100 = ((n / 100) % 10) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d1000);
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 100_000 {
let n = n as u32;
let d10000 = (n / 10000) as u8;
let d1000 = ((n / 1000) % 10) as u8;
let d100 = ((n / 100) % 10) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d10000);
bytes.put_u8(DIGITS_START + d1000);
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else if n < 1_000_000 {
let n = n as u32;
let d100000 = (n / 100000) as u8;
let d10000 = ((n / 10000) % 10) as u8;
let d1000 = ((n / 1000) % 10) as u8;
let d100 = ((n / 100) % 10) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100000);
bytes.put_u8(DIGITS_START + d10000);
bytes.put_u8(DIGITS_START + d1000);
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
} else {
write_usize(n, bytes);
}
bytes.put_slice(b"\r\n");
}
fn write_usize(n: usize, bytes: &mut BytesMut) {
let mut n = n;
// 20 chars is max length of a usize (2^64)
// digits will be added to the buffer from lsd to msd
let mut buf = BytesMut::with_capacity(20);
while n > 9 {
// "pop" the least-significant digit
let lsd = (n % 10) as u8;
// remove the lsd from n
n = n / 10;
buf.put_u8(DIGITS_START + lsd);
}
// put msd to result buffer
bytes.put_u8(DIGITS_START + (n as u8));
// put, in reverse (msd to lsd), remaining digits to buffer
for i in (0..buf.len()).rev() {
bytes.put_u8(buf[i]);
}
}
}
mod _original {
use std::{mem, ptr, slice};
use bytes::{BufMut, BytesMut};
const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
2021222324252627282930313233343536373839\
4041424344454647484950515253545556575859\
6061626364656667686970717273747576777879\
8081828384858687888990919293949596979899";
/// NOTE: bytes object has to contain enough space
pub fn write_content_length(mut n: usize, bytes: &mut BytesMut) {
if n < 10 {
let mut buf: [u8; 21] = [
b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'\r', b'\n',
];
buf[18] = (n as u8) + b'0';
bytes.put_slice(&buf);
} else if n < 100 {
let mut buf: [u8; 22] = [
b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'\r', b'\n',
];
let d1 = n << 1;
unsafe {
ptr::copy_nonoverlapping(
DEC_DIGITS_LUT.as_ptr().add(d1),
buf.as_mut_ptr().offset(18),
2,
);
}
bytes.put_slice(&buf);
} else if n < 1000 {
let mut buf: [u8; 23] = [
b'\r', b'\n', b'c', b'o', b'n', b't', b'e', b'n', b't', b'-', b'l',
b'e', b'n', b'g', b't', b'h', b':', b' ', b'0', b'0', b'0', b'\r',
b'\n',
];
// decode 2 more chars, if > 2 chars
let d1 = (n % 100) << 1;
n /= 100;
unsafe {
ptr::copy_nonoverlapping(
DEC_DIGITS_LUT.as_ptr().add(d1),
buf.as_mut_ptr().offset(19),
2,
)
};
// decode last 1
buf[18] = (n as u8) + b'0';
bytes.put_slice(&buf);
} else {
bytes.put_slice(b"\r\ncontent-length: ");
convert_usize(n, bytes);
}
}
pub(crate) fn convert_usize(mut n: usize, bytes: &mut BytesMut) {
let mut curr: isize = 39;
let mut buf: [u8; 41] = unsafe { mem::MaybeUninit::uninit().assume_init() };
buf[39] = b'\r';
buf[40] = b'\n';
let buf_ptr = buf.as_mut_ptr();
let lut_ptr = DEC_DIGITS_LUT.as_ptr();
// eagerly decode 4 characters at a time
while n >= 10_000 {
let rem = (n % 10_000) as isize;
n /= 10_000;
let d1 = (rem / 100) << 1;
let d2 = (rem % 100) << 1;
curr -= 4;
unsafe {
ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
ptr::copy_nonoverlapping(
lut_ptr.offset(d2),
buf_ptr.offset(curr + 2),
2,
);
}
}
// if we reach here numbers are <= 9999, so at most 4 chars long
let mut n = n as isize; // possibly reduce 64bit math
// decode 2 more chars, if > 2 chars
if n >= 100 {
let d1 = (n % 100) << 1;
n /= 100;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
}
}
// decode last 1 or 2 chars
if n < 10 {
curr -= 1;
unsafe {
*buf_ptr.offset(curr) = (n as u8) + b'0';
}
} else {
let d1 = n << 1;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(lut_ptr.offset(d1), buf_ptr.offset(curr), 2);
}
}
unsafe {
bytes.extend_from_slice(slice::from_raw_parts(
buf_ptr.offset(curr),
41 - curr as usize,
));
}
}
}

View File

@@ -0,0 +1,222 @@
use criterion::{criterion_group, criterion_main, BenchmarkId, Criterion};
use bytes::BytesMut;
use http::Version;
const CODES: &[u16] = &[201, 303, 404, 515];
fn bench_write_status_line_11(c: &mut Criterion) {
let mut group = c.benchmark_group("write_status_line v1.1");
let version = Version::HTTP_11;
for i in CODES.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_naive::write_status_line(version, i, &mut b);
})
});
}
group.finish();
}
fn bench_write_status_line_10(c: &mut Criterion) {
let mut group = c.benchmark_group("write_status_line v1.0");
let version = Version::HTTP_10;
for i in CODES.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_naive::write_status_line(version, i, &mut b);
})
});
}
group.finish();
}
fn bench_write_status_line_09(c: &mut Criterion) {
let mut group = c.benchmark_group("write_status_line v0.9");
let version = Version::HTTP_09;
for i in CODES.iter() {
group.bench_with_input(BenchmarkId::new("Original (unsafe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_original::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("New (safe)", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_new::write_status_line(version, i, &mut b);
})
});
group.bench_with_input(BenchmarkId::new("Naive", i), i, |b, &i| {
b.iter(|| {
let mut b = BytesMut::with_capacity(35);
_naive::write_status_line(version, i, &mut b);
})
});
}
group.finish();
}
criterion_group!(
benches,
bench_write_status_line_11,
bench_write_status_line_10,
bench_write_status_line_09
);
criterion_main!(benches);
mod _naive {
use bytes::{BufMut, BytesMut};
use http::Version;
pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
match version {
Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
_ => {
// other HTTP version handlers do not use this method
}
}
bytes.put_slice(n.to_string().as_bytes());
}
}
mod _new {
use bytes::{BufMut, BytesMut};
use http::Version;
const DIGITS_START: u8 = b'0';
pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
match version {
Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
_ => {
// other HTTP version handlers do not use this method
}
}
let d100 = (n / 100) as u8;
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
bytes.put_u8(b' ');
}
}
mod _original {
use std::ptr;
use bytes::{BufMut, BytesMut};
use http::Version;
const DEC_DIGITS_LUT: &[u8] = b"0001020304050607080910111213141516171819\
2021222324252627282930313233343536373839\
4041424344454647484950515253545556575859\
6061626364656667686970717273747576777879\
8081828384858687888990919293949596979899";
pub(crate) const STATUS_LINE_BUF_SIZE: usize = 13;
pub(crate) fn write_status_line(version: Version, mut n: u16, bytes: &mut BytesMut) {
let mut buf: [u8; STATUS_LINE_BUF_SIZE] = *b"HTTP/1.1 ";
match version {
Version::HTTP_2 => buf[5] = b'2',
Version::HTTP_10 => buf[7] = b'0',
Version::HTTP_09 => {
buf[5] = b'0';
buf[7] = b'9';
}
_ => (),
}
let mut curr: isize = 12;
let buf_ptr = buf.as_mut_ptr();
let lut_ptr = DEC_DIGITS_LUT.as_ptr();
let four = n > 999;
// decode 2 more chars, if > 2 chars
let d1 = (n % 100) << 1;
n /= 100;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(
lut_ptr.offset(d1 as isize),
buf_ptr.offset(curr),
2,
);
}
// decode last 1 or 2 chars
if n < 10 {
curr -= 1;
unsafe {
*buf_ptr.offset(curr) = (n as u8) + b'0';
}
} else {
let d1 = n << 1;
curr -= 2;
unsafe {
ptr::copy_nonoverlapping(
lut_ptr.offset(d1 as isize),
buf_ptr.offset(curr),
2,
);
}
}
bytes.put_slice(&buf);
if four {
bytes.put_u8(b' ');
}
}
}

View File

@@ -0,0 +1,137 @@
use criterion::{criterion_group, criterion_main, Criterion};
use bytes::BytesMut;
// A Miri run detects UB, seen on this playground:
// https://play.rust-lang.org/?version=stable&mode=debug&edition=2018&gist=f5d9aa166aa48df8dca05fce2b6c3915
fn bench_header_parsing(c: &mut Criterion) {
c.bench_function("Original (Unsound) [short]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ_SHORT);
_original::parse_headers(&mut buf);
})
});
c.bench_function("New (safe) [short]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ_SHORT);
_new::parse_headers(&mut buf);
})
});
c.bench_function("Original (Unsound) [realistic]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ);
_original::parse_headers(&mut buf);
})
});
c.bench_function("New (safe) [realistic]", |b| {
b.iter(|| {
let mut buf = BytesMut::from(REQ);
_new::parse_headers(&mut buf);
})
});
}
criterion_group!(benches, bench_header_parsing);
criterion_main!(benches);
const MAX_HEADERS: usize = 96;
const EMPTY_HEADER_ARRAY: [httparse::Header<'static>; MAX_HEADERS] =
[httparse::EMPTY_HEADER; MAX_HEADERS];
#[derive(Clone, Copy)]
struct HeaderIndex {
name: (usize, usize),
value: (usize, usize),
}
const EMPTY_HEADER_INDEX: HeaderIndex = HeaderIndex {
name: (0, 0),
value: (0, 0),
};
const EMPTY_HEADER_INDEX_ARRAY: [HeaderIndex; MAX_HEADERS] =
[EMPTY_HEADER_INDEX; MAX_HEADERS];
impl HeaderIndex {
fn record(
bytes: &[u8],
headers: &[httparse::Header<'_>],
indices: &mut [HeaderIndex],
) {
let bytes_ptr = bytes.as_ptr() as usize;
for (header, indices) in headers.iter().zip(indices.iter_mut()) {
let name_start = header.name.as_ptr() as usize - bytes_ptr;
let name_end = name_start + header.name.len();
indices.name = (name_start, name_end);
let value_start = header.value.as_ptr() as usize - bytes_ptr;
let value_end = value_start + header.value.len();
indices.value = (value_start, value_end);
}
}
}
// test cases taken from:
// https://github.com/seanmonstar/httparse/blob/master/benches/parse.rs
const REQ_SHORT: &'static [u8] = b"\
GET / HTTP/1.0\r\n\
Host: example.com\r\n\
Cookie: session=60; user_id=1\r\n\r\n";
const REQ: &'static [u8] = b"\
GET /wp-content/uploads/2010/03/hello-kitty-darth-vader-pink.jpg HTTP/1.1\r\n\
Host: www.kittyhell.com\r\n\
User-Agent: Mozilla/5.0 (Macintosh; U; Intel Mac OS X 10.6; ja-JP-mac; rv:1.9.2.3) Gecko/20100401 Firefox/3.6.3 Pathtraq/0.9\r\n\
Accept: text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8\r\n\
Accept-Language: ja,en-us;q=0.7,en;q=0.3\r\n\
Accept-Encoding: gzip,deflate\r\n\
Accept-Charset: Shift_JIS,utf-8;q=0.7,*;q=0.7\r\n\
Keep-Alive: 115\r\n\
Connection: keep-alive\r\n\
Cookie: wp_ozh_wsa_visits=2; wp_ozh_wsa_visit_lasttime=xxxxxxxxxx; __utma=xxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.xxxxxxxxxx.x; __utmz=xxxxxxxxx.xxxxxxxxxx.x.x.utmccn=(referral)|utmcsr=reader.livedoor.com|utmcct=/reader/|utmcmd=referral|padding=under256\r\n\r\n";
mod _new {
use super::*;
pub fn parse_headers(src: &mut BytesMut) -> usize {
let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
let mut req = httparse::Request::new(&mut parsed);
match req.parse(src).unwrap() {
httparse::Status::Complete(_len) => {
HeaderIndex::record(src, req.headers, &mut headers);
req.headers.len()
}
_ => unreachable!(),
}
}
}
mod _original {
use super::*;
use std::mem::MaybeUninit;
pub fn parse_headers(src: &mut BytesMut) -> usize {
let mut headers: [HeaderIndex; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut req = httparse::Request::new(&mut parsed);
match req.parse(src).unwrap() {
httparse::Status::Complete(_len) => {
HeaderIndex::record(src, req.headers, &mut headers);
req.headers.len()
}
_ => unreachable!(),
}
}
}

View File

@@ -1,13 +1,14 @@
use std::{env, io};
use actix_http::{error::PayloadError, HttpService, Request, Response};
use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures::{Future, Stream};
use futures_util::StreamExt;
use http::header::HeaderValue;
use log::info;
fn main() -> io::Result<()> {
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "echo=info");
env_logger::init();
@@ -16,22 +17,21 @@ fn main() -> io::Result<()> {
HttpService::build()
.client_timeout(1000)
.client_disconnect(1000)
.finish(|mut req: Request| {
req.take_payload()
.fold(BytesMut::new(), move |mut body, chunk| {
body.extend_from_slice(&chunk);
Ok::<_, PayloadError>(body)
})
.and_then(|bytes| {
info!("request body: {:?}", bytes);
let mut res = Response::Ok();
res.header(
"x-head",
HeaderValue::from_static("dummy value!"),
);
Ok(res.body(bytes))
})
.finish(|mut req: Request| async move {
let mut body = BytesMut::new();
while let Some(item) = req.payload().next().await {
body.extend_from_slice(&item?);
}
info!("request body: {:?}", body);
Ok::<_, Error>(
Response::Ok()
.header("x-head", HeaderValue::from_static("dummy value!"))
.body(body),
)
})
.tcp()
})?
.run()
.await
}

View File

@@ -1,34 +1,33 @@
use std::{env, io};
use actix_http::http::HeaderValue;
use actix_http::{error::PayloadError, Error, HttpService, Request, Response};
use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures::{Future, Stream};
use futures_util::StreamExt;
use log::info;
fn handle_request(mut req: Request) -> impl Future<Item = Response, Error = Error> {
req.take_payload()
.fold(BytesMut::new(), move |mut body, chunk| {
body.extend_from_slice(&chunk);
Ok::<_, PayloadError>(body)
})
.from_err()
.and_then(|bytes| {
info!("request body: {:?}", bytes);
let mut res = Response::Ok();
res.header("x-head", HeaderValue::from_static("dummy value!"));
Ok(res.body(bytes))
})
async fn handle_request(mut req: Request) -> Result<Response, Error> {
let mut body = BytesMut::new();
while let Some(item) = req.payload().next().await {
body.extend_from_slice(&item?)
}
info!("request body: {:?}", body);
Ok(Response::Ok()
.header("x-head", HeaderValue::from_static("dummy value!"))
.body(body))
}
fn main() -> io::Result<()> {
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "echo=info");
env_logger::init();
Server::build()
.bind("echo", "127.0.0.1:8080", || {
HttpService::build().finish(|_req: Request| handle_request(_req))
HttpService::build().finish(handle_request).tcp()
})?
.run()
.await
}

View File

@@ -2,11 +2,12 @@ use std::{env, io};
use actix_http::{HttpService, Response};
use actix_server::Server;
use futures::future;
use futures_util::future;
use http::header::HeaderValue;
use log::info;
fn main() -> io::Result<()> {
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "hello_world=info");
env_logger::init();
@@ -21,6 +22,8 @@ fn main() -> io::Result<()> {
res.header("x-head", HeaderValue::from_static("dummy value!"));
future::ok::<_, ()>(res.body("Hello world!"))
})
.tcp()
})?
.run()
.await
}

View File

@@ -1,8 +1,12 @@
use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, mem};
use bytes::{Bytes, BytesMut};
use futures::{Async, Poll, Stream};
use futures_core::Stream;
use futures_util::ready;
use pin_project::pin_project;
use crate::error::Error;
@@ -11,20 +15,13 @@ use crate::error::Error;
pub enum BodySize {
None,
Empty,
Sized(usize),
Sized64(u64),
Sized(u64),
Stream,
}
impl BodySize {
pub fn is_eof(&self) -> bool {
match self {
BodySize::None
| BodySize::Empty
| BodySize::Sized(0)
| BodySize::Sized64(0) => true,
_ => false,
}
matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
}
}
@@ -32,32 +29,46 @@ impl BodySize {
pub trait MessageBody {
fn size(&self) -> BodySize;
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error>;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>>;
downcast_get_type_id!();
}
downcast!(MessageBody);
impl MessageBody for () {
fn size(&self) -> BodySize {
BodySize::Empty
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
Ok(Async::Ready(None))
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Poll::Ready(None)
}
}
impl<T: MessageBody> MessageBody for Box<T> {
impl<T: MessageBody + Unpin> MessageBody for Box<T> {
fn size(&self) -> BodySize {
self.as_ref().size()
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
self.as_mut().poll_next()
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Pin::new(self.get_mut().as_mut()).poll_next(cx)
}
}
#[pin_project(project = ResponseBodyProj)]
pub enum ResponseBody<B> {
Body(B),
Other(Body),
Body(#[pin] B),
Other(#[pin] Body),
}
impl ResponseBody<Body> {
@@ -93,23 +104,32 @@ impl<B: MessageBody> MessageBody for ResponseBody<B> {
}
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
match self {
ResponseBody::Body(ref mut body) => body.poll_next(),
ResponseBody::Other(ref mut body) => body.poll_next(),
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => body.poll_next(cx),
}
}
}
impl<B: MessageBody> Stream for ResponseBody<B> {
type Item = Bytes;
type Error = Error;
type Item = Result<Bytes, Error>;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
self.poll_next()
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => body.poll_next(cx),
}
}
}
#[pin_project(project = BodyProj)]
/// Represents various types of http message body.
pub enum Body {
/// Empty response. `Content-Length` header is not set.
@@ -119,17 +139,17 @@ pub enum Body {
/// Specific response body.
Bytes(Bytes),
/// Generic message body.
Message(Box<dyn MessageBody>),
Message(Box<dyn MessageBody + Unpin>),
}
impl Body {
/// Create body from slice (copy)
pub fn from_slice(s: &[u8]) -> Body {
Body::Bytes(Bytes::from(s))
Body::Bytes(Bytes::copy_from_slice(s))
}
/// Create body from generic message body.
pub fn from_message<B: MessageBody + 'static>(body: B) -> Body {
pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
Body::Message(Box::new(body))
}
}
@@ -139,24 +159,27 @@ impl MessageBody for Body {
match self {
Body::None => BodySize::None,
Body::Empty => BodySize::Empty,
Body::Bytes(ref bin) => BodySize::Sized(bin.len()),
Body::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
Body::Message(ref body) => body.size(),
}
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
match self {
Body::None => Ok(Async::Ready(None)),
Body::Empty => Ok(Async::Ready(None)),
Body::Bytes(ref mut bin) => {
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.project() {
BodyProj::None => Poll::Ready(None),
BodyProj::Empty => Poll::Ready(None),
BodyProj::Bytes(ref mut bin) => {
let len = bin.len();
if len == 0 {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(mem::replace(bin, Bytes::new()))))
Poll::Ready(Some(Ok(mem::take(bin))))
}
}
Body::Message(ref mut body) => body.poll_next(),
BodyProj::Message(ref mut body) => Pin::new(body.as_mut()).poll_next(cx),
}
}
}
@@ -164,14 +187,8 @@ impl MessageBody for Body {
impl PartialEq for Body {
fn eq(&self, other: &Body) -> bool {
match *self {
Body::None => match *other {
Body::None => true,
_ => false,
},
Body::Empty => match *other {
Body::Empty => true,
_ => false,
},
Body::None => matches!(*other, Body::None),
Body::Empty => matches!(*other, Body::Empty),
Body::Bytes(ref b) => match *other {
Body::Bytes(ref b2) => b == b2,
_ => false,
@@ -182,7 +199,7 @@ impl PartialEq for Body {
}
impl fmt::Debug for Body {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
Body::None => write!(f, "Body::None"),
Body::Empty => write!(f, "Body::Empty"),
@@ -218,7 +235,7 @@ impl From<String> for Body {
impl<'a> From<&'a String> for Body {
fn from(s: &'a String) -> Body {
Body::Bytes(Bytes::from(AsRef::<[u8]>::as_ref(&s)))
Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
}
}
@@ -242,7 +259,7 @@ impl From<serde_json::Value> for Body {
impl<S> From<SizedStream<S>> for Body
where
S: Stream<Item = Bytes, Error = Error> + 'static,
S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
{
fn from(s: SizedStream<S>) -> Body {
Body::from_message(s)
@@ -251,7 +268,7 @@ where
impl<S, E> From<BodyStream<S, E>> for Body
where
S: Stream<Item = Bytes, Error = E> + 'static,
S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
E: Into<Error> + 'static,
{
fn from(s: BodyStream<S, E>) -> Body {
@@ -261,94 +278,88 @@ where
impl MessageBody for Bytes {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
BodySize::Sized(self.len() as u64)
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(mem::replace(self, Bytes::new()))))
Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
}
}
}
impl MessageBody for BytesMut {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
BodySize::Sized(self.len() as u64)
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(
mem::replace(self, BytesMut::new()).freeze(),
)))
Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
}
}
}
impl MessageBody for &'static str {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
BodySize::Sized(self.len() as u64)
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(Bytes::from_static(
mem::replace(self, "").as_ref(),
Poll::Ready(Some(Ok(Bytes::from_static(
mem::take(self.get_mut()).as_ref(),
))))
}
}
}
impl MessageBody for &'static [u8] {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
if self.is_empty() {
Ok(Async::Ready(None))
} else {
Ok(Async::Ready(Some(Bytes::from_static(mem::replace(
self, b"",
)))))
}
}
}
impl MessageBody for Vec<u8> {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
BodySize::Sized(self.len() as u64)
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(Bytes::from(mem::replace(
self,
Vec::new(),
)))))
Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
}
}
}
impl MessageBody for String {
fn size(&self) -> BodySize {
BodySize::Sized(self.len())
BodySize::Sized(self.len() as u64)
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
Ok(Async::Ready(Some(Bytes::from(
mem::replace(self, String::new()).into_bytes(),
Poll::Ready(Some(Ok(Bytes::from(
mem::take(self.get_mut()).into_bytes(),
))))
}
}
@@ -356,14 +367,16 @@ impl MessageBody for String {
/// Type represent streaming body.
/// Response does not contain `content-length` header and appropriate transfer encoding is used.
pub struct BodyStream<S, E> {
#[pin_project]
pub struct BodyStream<S: Unpin, E> {
#[pin]
stream: S,
_t: PhantomData<E>,
}
impl<S, E> BodyStream<S, E>
where
S: Stream<Item = Bytes, Error = E>,
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
pub fn new(stream: S) -> Self {
@@ -376,28 +389,45 @@ where
impl<S, E> MessageBody for BodyStream<S, E>
where
S: Stream<Item = Bytes, Error = E>,
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
fn size(&self) -> BodySize {
BodySize::Stream
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
self.stream.poll().map_err(std::convert::Into::into)
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`BodyStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
let mut stream = self.project().stream;
loop {
let stream = stream.as_mut();
return Poll::Ready(match ready!(stream.poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
opt => opt.map(|res| res.map_err(Into::into)),
});
}
}
}
/// Type represent streaming body. This body implementation should be used
/// if total size of stream is known. Data get sent as is without using transfer encoding.
pub struct SizedStream<S> {
#[pin_project]
pub struct SizedStream<S: Unpin> {
size: u64,
#[pin]
stream: S,
}
impl<S> SizedStream<S>
where
S: Stream<Item = Bytes, Error = Error>,
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
pub fn new(size: u64, stream: S) -> Self {
SizedStream { size, stream }
@@ -406,20 +436,38 @@ where
impl<S> MessageBody for SizedStream<S>
where
S: Stream<Item = Bytes, Error = Error>,
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
fn size(&self) -> BodySize {
BodySize::Sized64(self.size)
BodySize::Sized(self.size as u64)
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
self.stream.poll()
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`SizedStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
let mut stream: Pin<&mut S> = self.project().stream;
loop {
let stream = stream.as_mut();
return Poll::Ready(match ready!(stream.poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
val => val,
});
}
}
}
#[cfg(test)]
mod tests {
use super::*;
use futures_util::future::poll_fn;
use futures_util::pin_mut;
use futures_util::stream;
impl Body {
pub(crate) fn get_ref(&self) -> &[u8] {
@@ -439,21 +487,24 @@ mod tests {
}
}
#[test]
fn test_static_str() {
#[actix_rt::test]
async fn test_static_str() {
assert_eq!(Body::from("").size(), BodySize::Sized(0));
assert_eq!(Body::from("test").size(), BodySize::Sized(4));
assert_eq!(Body::from("test").get_ref(), b"test");
assert_eq!("test".size(), BodySize::Sized(4));
assert_eq!(
"test".poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_static_bytes() {
#[actix_rt::test]
async fn test_static_bytes() {
assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
assert_eq!(
@@ -461,86 +512,95 @@ mod tests {
BodySize::Sized(4)
);
assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
let sb = Bytes::from(&b"test"[..]);
pin_mut!(sb);
assert_eq!((&b"test"[..]).size(), BodySize::Sized(4));
assert_eq!(sb.size(), BodySize::Sized(4));
assert_eq!(
(&b"test"[..]).poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_vec() {
#[actix_rt::test]
async fn test_vec() {
assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
let test_vec = Vec::from("test");
pin_mut!(test_vec);
assert_eq!(Vec::from("test").size(), BodySize::Sized(4));
assert_eq!(test_vec.size(), BodySize::Sized(4));
assert_eq!(
Vec::from("test").poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| test_vec.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_bytes() {
let mut b = Bytes::from("test");
#[actix_rt::test]
async fn test_bytes() {
let b = Bytes::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin_mut!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
b.poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_bytes_mut() {
let mut b = BytesMut::from("test");
#[actix_rt::test]
async fn test_bytes_mut() {
let b = BytesMut::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin_mut!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
b.poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_string() {
let mut b = "test".to_owned();
#[actix_rt::test]
async fn test_string() {
let b = "test".to_owned();
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
assert_eq!(Body::from(&b).get_ref(), b"test");
pin_mut!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
b.poll_next().unwrap(),
Async::Ready(Some(Bytes::from("test")))
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[test]
fn test_unit() {
#[actix_rt::test]
async fn test_unit() {
assert_eq!(().size(), BodySize::Empty);
assert_eq!(().poll_next().unwrap(), Async::Ready(None));
assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
.await
.is_none());
}
#[test]
fn test_box() {
let mut val = Box::new(());
#[actix_rt::test]
async fn test_box() {
let val = Box::new(());
pin_mut!(val);
assert_eq!(val.size(), BodySize::Empty);
assert_eq!(val.poll_next().unwrap(), Async::Ready(None));
assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
}
#[test]
fn test_body_eq() {
assert!(Body::None == Body::None);
assert!(Body::None != Body::Empty);
assert!(Body::Empty == Body::Empty);
assert!(Body::Empty != Body::None);
#[actix_rt::test]
async fn test_body_eq() {
assert!(
Body::Bytes(Bytes::from_static(b"1"))
== Body::Bytes(Bytes::from_static(b"1"))
@@ -548,15 +608,15 @@ mod tests {
assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
}
#[test]
fn test_body_debug() {
#[actix_rt::test]
async fn test_body_debug() {
assert!(format!("{:?}", Body::None).contains("Body::None"));
assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains("1"));
assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
}
#[test]
fn test_serde_json() {
#[actix_rt::test]
async fn test_serde_json() {
use serde_json::json;
assert_eq!(
Body::from(serde_json::Value::String("test".into())).size(),
@@ -567,4 +627,97 @@ mod tests {
BodySize::Sized(25)
);
}
mod body_stream {
use super::*;
//use futures::task::noop_waker;
//use futures::stream::once;
#[actix_rt::test]
async fn skips_empty_chunks() {
let body = BodyStream::new(stream::iter(
["1", "", "2"]
.iter()
.map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
));
pin_mut!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
/* Now it does not compile as it should
#[actix_rt::test]
async fn move_pinned_pointer() {
let (sender, receiver) = futures::channel::oneshot::channel();
let mut body_stream = Ok(BodyStream::new(once(async {
let x = Box::new(0i32);
let y = &x;
receiver.await.unwrap();
let _z = **y;
Ok::<_, ()>(Bytes::new())
})));
let waker = noop_waker();
let mut context = Context::from_waker(&waker);
pin_mut!(body_stream);
let _ = body_stream.as_mut().unwrap().poll_next(&mut context);
sender.send(()).unwrap();
let _ = std::mem::replace(&mut body_stream, Err([0; 32])).unwrap().poll_next(&mut context);
}*/
}
mod sized_stream {
use super::*;
#[actix_rt::test]
async fn skips_empty_chunks() {
let body = SizedStream::new(
2,
stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
);
pin_mut!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
}
#[actix_rt::test]
async fn test_body_casting() {
let mut body = String::from("hello cast");
let resp_body: &mut dyn MessageBody = &mut body;
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast");
let body = &mut resp_body.downcast_mut::<String>().unwrap();
body.push_str("!");
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast!");
let not_body = resp_body.downcast_ref::<()>();
assert!(not_body.is_none());
}
}

View File

@@ -1,10 +1,9 @@
use std::fmt;
use std::marker::PhantomData;
use std::rc::Rc;
use std::{fmt, net};
use actix_codec::Framed;
use actix_server_config::ServerConfig as SrvConfig;
use actix_service::{IntoNewService, NewService, Service};
use actix_service::{IntoServiceFactory, Service, ServiceFactory};
use crate::body::MessageBody;
use crate::config::{KeepAlive, ServiceConfig};
@@ -24,6 +23,8 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
keep_alive: KeepAlive,
client_timeout: u64,
client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
expect: X,
upgrade: Option<U>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
@@ -32,9 +33,10 @@ pub struct HttpServiceBuilder<T, S, X = ExpectHandler, U = UpgradeHandler<T>> {
impl<T, S> HttpServiceBuilder<T, S, ExpectHandler, UpgradeHandler<T>>
where
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
<S::Service as Service>::Future: 'static,
{
/// Create instance of `ServiceConfigBuilder`
pub fn new() -> Self {
@@ -42,6 +44,8 @@ where
keep_alive: KeepAlive::Timeout(5),
client_timeout: 5000,
client_disconnect: 0,
secure: false,
local_addr: None,
expect: ExpectHandler,
upgrade: None,
on_connect: None,
@@ -52,19 +56,18 @@ where
impl<T, S, X, U> HttpServiceBuilder<T, S, X, U>
where
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
<S::Service as Service>::Future: 'static,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<
Config = SrvConfig,
Request = (Request, Framed<T, Codec>),
Response = (),
>,
<X::Service as Service>::Future: 'static,
U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service>::Future: 'static,
{
/// Set server keep-alive setting.
///
@@ -74,6 +77,18 @@ where
self
}
/// Set connection secure state
pub fn secure(mut self) -> Self {
self.secure = true;
self
}
/// Set the local address that this service is bound to.
pub fn local_addr(mut self, addr: net::SocketAddr) -> Self {
self.local_addr = Some(addr);
self
}
/// Set server client timeout in milliseconds for first request.
///
/// Defines a timeout for reading client request header. If a client does not transmit
@@ -108,16 +123,19 @@ where
/// request will be forwarded to main service.
pub fn expect<F, X1>(self, expect: F) -> HttpServiceBuilder<T, S, X1, U>
where
F: IntoNewService<X1>,
X1: NewService<Config = SrvConfig, Request = Request, Response = Request>,
F: IntoServiceFactory<X1>,
X1: ServiceFactory<Config = (), Request = Request, Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
<X1::Service as Service>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect,
expect: expect.into_new_service(),
secure: self.secure,
local_addr: self.local_addr,
expect: expect.into_factory(),
upgrade: self.upgrade,
on_connect: self.on_connect,
_t: PhantomData,
@@ -130,21 +148,24 @@ where
/// and this service get called with original request and framed object.
pub fn upgrade<F, U1>(self, upgrade: F) -> HttpServiceBuilder<T, S, X, U1>
where
F: IntoNewService<U1>,
U1: NewService<
Config = SrvConfig,
F: IntoServiceFactory<U1>,
U1: ServiceFactory<
Config = (),
Request = (Request, Framed<T, Codec>),
Response = (),
>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
<U1::Service as Service>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
client_timeout: self.client_timeout,
client_disconnect: self.client_disconnect,
secure: self.secure,
local_addr: self.local_addr,
expect: self.expect,
upgrade: Some(upgrade.into_new_service()),
upgrade: Some(upgrade.into_factory()),
on_connect: self.on_connect,
_t: PhantomData,
}
@@ -164,10 +185,10 @@ where
}
/// Finish service configuration and create *http service* for HTTP/1 protocol.
pub fn h1<F, P, B>(self, service: F) -> H1Service<T, P, S, B, X, U>
pub fn h1<F, B>(self, service: F) -> H1Service<T, S, B, X, U>
where
B: MessageBody + 'static,
F: IntoNewService<S>,
B: MessageBody,
F: IntoServiceFactory<S>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
@@ -176,48 +197,53 @@ where
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
H1Service::with_config(cfg, service.into_new_service())
H1Service::with_config(cfg, service.into_factory())
.expect(self.expect)
.upgrade(self.upgrade)
.on_connect(self.on_connect)
}
/// Finish service configuration and create *http service* for HTTP/2 protocol.
pub fn h2<F, P, B>(self, service: F) -> H2Service<T, P, S, B>
pub fn h2<F, B>(self, service: F) -> H2Service<T, S, B>
where
B: MessageBody + 'static,
F: IntoNewService<S>,
S::Error: Into<Error>,
F: IntoServiceFactory<S>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
H2Service::with_config(cfg, service.into_new_service())
.on_connect(self.on_connect)
H2Service::with_config(cfg, service.into_factory()).on_connect(self.on_connect)
}
/// Finish service configuration and create `HttpService` instance.
pub fn finish<F, P, B>(self, service: F) -> HttpService<T, P, S, B, X, U>
pub fn finish<F, B>(self, service: F) -> HttpService<T, S, B, X, U>
where
B: MessageBody + 'static,
F: IntoNewService<S>,
S::Error: Into<Error>,
F: IntoServiceFactory<S>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,
self.client_timeout,
self.client_disconnect,
self.secure,
self.local_addr,
);
HttpService::with_config(cfg, service.into_new_service())
HttpService::with_config(cfg, service.into_factory())
.expect(self.expect)
.upgrade(self.upgrade)
.on_connect(self.on_connect)

View File

@@ -0,0 +1,39 @@
use std::time::Duration;
// These values are taken from hyper/src/proto/h2/client.rs
const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2mb
const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1mb
/// Connector configuration
#[derive(Clone)]
pub(crate) struct ConnectorConfig {
pub(crate) timeout: Duration,
pub(crate) conn_lifetime: Duration,
pub(crate) conn_keep_alive: Duration,
pub(crate) disconnect_timeout: Option<Duration>,
pub(crate) limit: usize,
pub(crate) conn_window_size: u32,
pub(crate) stream_window_size: u32,
}
impl Default for ConnectorConfig {
fn default() -> Self {
Self {
timeout: Duration::from_secs(1),
conn_lifetime: Duration::from_secs(75),
conn_keep_alive: Duration::from_secs(15),
disconnect_timeout: Some(Duration::from_millis(3000)),
limit: 100,
conn_window_size: DEFAULT_H2_CONN_WINDOW,
stream_window_size: DEFAULT_H2_STREAM_WINDOW,
}
}
}
impl ConnectorConfig {
pub(crate) fn no_disconnect_timeout(&self) -> Self {
let mut res = self.clone();
res.disconnect_timeout = None;
res
}
}

View File

@@ -1,10 +1,13 @@
use std::{fmt, io, time};
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, io, mem, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use bytes::{Buf, Bytes};
use futures::future::{err, Either, Future, FutureResult};
use futures::Poll;
use futures_util::future::{err, Either, FutureExt, LocalBoxFuture, Ready};
use h2::client::SendRequest;
use pin_project::pin_project;
use crate::body::MessageBody;
use crate::h1::ClientCodec;
@@ -21,8 +24,8 @@ pub(crate) enum ConnectionType<Io> {
}
pub trait Connection {
type Io: AsyncRead + AsyncWrite;
type Future: Future<Item = (ResponseHead, Payload), Error = SendRequestError>;
type Io: AsyncRead + AsyncWrite + Unpin;
type Future: Future<Output = Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol;
@@ -34,8 +37,7 @@ pub trait Connection {
) -> Self::Future;
type TunnelFuture: Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
Error = SendRequestError,
Output = Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>;
/// Send request, returns Response and Framed
@@ -62,7 +64,7 @@ impl<T> fmt::Debug for IoConnection<T>
where
T: fmt::Debug,
{
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match self.io {
Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
@@ -71,7 +73,7 @@ where
}
}
impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
pub(crate) fn new(
io: ConnectionType<T>,
created: time::Instant,
@@ -91,11 +93,11 @@ impl<T: AsyncRead + AsyncWrite> IoConnection<T> {
impl<T> Connection for IoConnection<T>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Io = T;
type Future =
Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol {
match self.io {
@@ -111,38 +113,30 @@ where
body: B,
) -> Self::Future {
match self.io.take().unwrap() {
ConnectionType::H1(io) => Box::new(h1proto::send_request(
io,
head.into(),
body,
self.created,
self.pool,
)),
ConnectionType::H2(io) => Box::new(h2proto::send_request(
io,
head.into(),
body,
self.created,
self.pool,
)),
ConnectionType::H1(io) => {
h1proto::send_request(io, head.into(), body, self.created, self.pool)
.boxed_local()
}
ConnectionType::H2(io) => {
h2proto::send_request(io, head.into(), body, self.created, self.pool)
.boxed_local()
}
}
}
type TunnelFuture = Either<
Box<
dyn Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
Error = SendRequestError,
>,
LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>,
FutureResult<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
Ready<Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>>,
>;
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
match self.io.take().unwrap() {
ConnectionType::H1(io) => {
Either::A(Box::new(h1proto::open_tunnel(io, head.into())))
Either::Left(h1proto::open_tunnel(io, head.into()).boxed_local())
}
ConnectionType::H2(io) => {
if let Some(mut pool) = self.pool.take() {
@@ -152,7 +146,7 @@ where
None,
));
}
Either::B(err(SendRequestError::TunnelNotSupported))
Either::Right(err(SendRequestError::TunnelNotSupported))
}
}
}
@@ -166,12 +160,12 @@ pub(crate) enum EitherConnection<A, B> {
impl<A, B> Connection for EitherConnection<A, B>
where
A: AsyncRead + AsyncWrite + 'static,
B: AsyncRead + AsyncWrite + 'static,
A: AsyncRead + AsyncWrite + Unpin + 'static,
B: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Io = EitherIo<A, B>;
type Future =
Box<dyn Future<Item = (ResponseHead, Payload), Error = SendRequestError>>;
LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol {
match self {
@@ -191,44 +185,30 @@ where
}
}
type TunnelFuture = Box<
dyn Future<
Item = (ResponseHead, Framed<Self::Io, ClientCodec>),
Error = SendRequestError,
>,
type TunnelFuture = LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>;
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
match self {
EitherConnection::A(con) => Box::new(
con.open_tunnel(head)
.map(|(head, framed)| (head, framed.map_io(EitherIo::A))),
),
EitherConnection::B(con) => Box::new(
con.open_tunnel(head)
.map(|(head, framed)| (head, framed.map_io(EitherIo::B))),
),
EitherConnection::A(con) => con
.open_tunnel(head)
.map(|res| res.map(|(head, framed)| (head, framed.map_io(EitherIo::A))))
.boxed_local(),
EitherConnection::B(con) => con
.open_tunnel(head)
.map(|res| res.map(|(head, framed)| (head, framed.map_io(EitherIo::B))))
.boxed_local(),
}
}
}
#[pin_project(project = EitherIoProj)]
pub enum EitherIo<A, B> {
A(A),
B(B),
}
impl<A, B> io::Read for EitherIo<A, B>
where
A: io::Read,
B: io::Read,
{
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
match self {
EitherIo::A(ref mut val) => val.read(buf),
EitherIo::B(ref mut val) => val.read(buf),
}
}
A(#[pin] A),
B(#[pin] B),
}
impl<A, B> AsyncRead for EitherIo<A, B>
@@ -236,7 +216,21 @@ where
A: AsyncRead,
B: AsyncRead,
{
unsafe fn prepare_uninitialized_buffer(&self, buf: &mut [u8]) -> bool {
fn poll_read(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut [u8],
) -> Poll<io::Result<usize>> {
match self.project() {
EitherIoProj::A(val) => val.poll_read(cx, buf),
EitherIoProj::B(val) => val.poll_read(cx, buf),
}
}
unsafe fn prepare_uninitialized_buffer(
&self,
buf: &mut [mem::MaybeUninit<u8>],
) -> bool {
match self {
EitherIo::A(ref val) => val.prepare_uninitialized_buffer(buf),
EitherIo::B(ref val) => val.prepare_uninitialized_buffer(buf),
@@ -244,45 +238,50 @@ where
}
}
impl<A, B> io::Write for EitherIo<A, B>
where
A: io::Write,
B: io::Write,
{
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
match self {
EitherIo::A(ref mut val) => val.write(buf),
EitherIo::B(ref mut val) => val.write(buf),
}
}
fn flush(&mut self) -> io::Result<()> {
match self {
EitherIo::A(ref mut val) => val.flush(),
EitherIo::B(ref mut val) => val.flush(),
}
}
}
impl<A, B> AsyncWrite for EitherIo<A, B>
where
A: AsyncWrite,
B: AsyncWrite,
{
fn shutdown(&mut self) -> Poll<(), io::Error> {
match self {
EitherIo::A(ref mut val) => val.shutdown(),
EitherIo::B(ref mut val) => val.shutdown(),
fn poll_write(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
match self.project() {
EitherIoProj::A(val) => val.poll_write(cx, buf),
EitherIoProj::B(val) => val.poll_write(cx, buf),
}
}
fn write_buf<U: Buf>(&mut self, buf: &mut U) -> Poll<usize, io::Error>
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_flush(cx),
EitherIoProj::B(val) => val.poll_flush(cx),
}
}
fn poll_shutdown(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_shutdown(cx),
EitherIoProj::B(val) => val.poll_shutdown(cx),
}
}
fn poll_write_buf<U: Buf>(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut U,
) -> Poll<Result<usize, io::Error>>
where
Self: Sized,
{
match self {
EitherIo::A(ref mut val) => val.write_buf(buf),
EitherIo::B(ref mut val) => val.write_buf(buf),
match self.project() {
EitherIoProj::A(val) => val.poll_write_buf(cx, buf),
EitherIoProj::B(val) => val.poll_write_buf(cx, buf),
}
}
}

View File

@@ -6,32 +6,33 @@ use actix_codec::{AsyncRead, AsyncWrite};
use actix_connect::{
default_connector, Connect as TcpConnect, Connection as TcpConnection,
};
use actix_service::{apply_fn, Service, ServiceExt};
use actix_rt::net::TcpStream;
use actix_service::{apply_fn, Service};
use actix_utils::timeout::{TimeoutError, TimeoutService};
use http::Uri;
use tokio_tcp::TcpStream;
use super::config::ConnectorConfig;
use super::connection::Connection;
use super::error::ConnectError;
use super::pool::{ConnectionPool, Protocol};
use super::Connect;
#[cfg(feature = "ssl")]
use openssl::ssl::SslConnector as OpensslConnector;
#[cfg(feature = "openssl")]
use actix_connect::ssl::openssl::SslConnector as OpensslConnector;
#[cfg(feature = "rust-tls")]
use rustls::ClientConfig;
#[cfg(feature = "rust-tls")]
#[cfg(feature = "rustls")]
use actix_connect::ssl::rustls::ClientConfig;
#[cfg(feature = "rustls")]
use std::sync::Arc;
#[cfg(any(feature = "ssl", feature = "rust-tls"))]
#[cfg(any(feature = "openssl", feature = "rustls"))]
enum SslConnector {
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
Openssl(OpensslConnector),
#[cfg(feature = "rust-tls")]
#[cfg(feature = "rustls")]
Rustls(Arc<ClientConfig>),
}
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
type SslConnector = ();
/// Manages http client network connectivity
@@ -48,21 +49,17 @@ type SslConnector = ();
/// ```
pub struct Connector<T, U> {
connector: T,
timeout: Duration,
conn_lifetime: Duration,
conn_keep_alive: Duration,
disconnect_timeout: Duration,
limit: usize,
config: ConnectorConfig,
#[allow(dead_code)]
ssl: SslConnector,
_t: PhantomData<U>,
}
trait Io: AsyncRead + AsyncWrite {}
impl<T: AsyncRead + AsyncWrite> Io for T {}
trait Io: AsyncRead + AsyncWrite + Unpin {}
impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
impl Connector<(), ()> {
#[allow(clippy::new_ret_no_self)]
#[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
pub fn new() -> Connector<
impl Service<
Request = TcpConnect<Uri>,
@@ -71,49 +68,54 @@ impl Connector<(), ()> {
> + Clone,
TcpStream,
> {
let ssl = {
#[cfg(feature = "ssl")]
{
use openssl::ssl::SslMethod;
let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
let _ = ssl
.set_alpn_protos(b"\x02h2\x08http/1.1")
.map_err(|e| error!("Can not set alpn protocol: {:?}", e));
SslConnector::Openssl(ssl.build())
}
#[cfg(all(not(feature = "ssl"), feature = "rust-tls"))]
{
let protos = vec![b"h2".to_vec(), b"http/1.1".to_vec()];
let mut config = ClientConfig::new();
config.set_protocols(&protos);
config
.root_store
.add_server_trust_anchors(&webpki_roots::TLS_SERVER_ROOTS);
SslConnector::Rustls(Arc::new(config))
}
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
{}
};
Connector {
ssl,
ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
connector: default_connector(),
timeout: Duration::from_secs(1),
conn_lifetime: Duration::from_secs(75),
conn_keep_alive: Duration::from_secs(15),
disconnect_timeout: Duration::from_millis(3000),
limit: 100,
config: ConnectorConfig::default(),
_t: PhantomData,
}
}
// Build Ssl connector with openssl, based on supplied alpn protocols
#[cfg(feature = "openssl")]
fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
use actix_connect::ssl::openssl::SslMethod;
use bytes::{BufMut, BytesMut};
let mut alpn = BytesMut::with_capacity(20);
for proto in protocols.iter() {
alpn.put_u8(proto.len() as u8);
alpn.put(proto.as_slice());
}
let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
let _ = ssl
.set_alpn_protos(&alpn)
.map_err(|e| error!("Can not set alpn protocol: {:?}", e));
SslConnector::Openssl(ssl.build())
}
// Build Ssl connector with rustls, based on supplied alpn protocols
#[cfg(all(not(feature = "openssl"), feature = "rustls"))]
fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
let mut config = ClientConfig::new();
config.set_protocols(&protocols);
config
.root_store
.add_server_trust_anchors(&actix_tls::rustls::TLS_SERVER_ROOTS);
SslConnector::Rustls(Arc::new(config))
}
// ssl turned off, provides empty ssl connector
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
}
impl<T, U> Connector<T, U> {
/// Use custom connector.
pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
where
U1: AsyncRead + AsyncWrite + fmt::Debug,
U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
T1: Service<
Request = TcpConnect<Uri>,
Response = TcpConnection<Uri, U1>,
@@ -122,11 +124,7 @@ impl<T, U> Connector<T, U> {
{
Connector {
connector,
timeout: self.timeout,
conn_lifetime: self.conn_lifetime,
conn_keep_alive: self.conn_keep_alive,
disconnect_timeout: self.disconnect_timeout,
limit: self.limit,
config: self.config,
ssl: self.ssl,
_t: PhantomData,
}
@@ -135,7 +133,7 @@ impl<T, U> Connector<T, U> {
impl<T, U> Connector<T, U>
where
U: AsyncRead + AsyncWrite + fmt::Debug + 'static,
U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
T: Service<
Request = TcpConnect<Uri>,
Response = TcpConnection<Uri, U>,
@@ -146,29 +144,61 @@ where
/// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
/// Set to 1 second by default.
pub fn timeout(mut self, timeout: Duration) -> Self {
self.timeout = timeout;
self.config.timeout = timeout;
self
}
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
/// Use custom `SslConnector` instance.
pub fn ssl(mut self, connector: OpensslConnector) -> Self {
self.ssl = SslConnector::Openssl(connector);
self
}
#[cfg(feature = "rust-tls")]
#[cfg(feature = "rustls")]
pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
self.ssl = SslConnector::Rustls(connector);
self
}
/// Maximum supported http major version
/// Supported versions http/1.1, http/2
pub fn max_http_version(mut self, val: http::Version) -> Self {
let versions = match val {
http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
http::Version::HTTP_2 => vec![b"h2".to_vec(), b"http/1.1".to_vec()],
_ => {
unimplemented!("actix-http:client: supported versions http/1.1, http/2")
}
};
self.ssl = Connector::build_ssl(versions);
self
}
/// Indicates the initial window size (in octets) for
/// HTTP2 stream-level flow control for received data.
///
/// The default value is 65,535 and is good for APIs, but not for big objects.
pub fn initial_window_size(mut self, size: u32) -> Self {
self.config.stream_window_size = size;
self
}
/// Indicates the initial window size (in octets) for
/// HTTP2 connection-level flow control for received data.
///
/// The default value is 65,535 and is good for APIs, but not for big objects.
pub fn initial_connection_window_size(mut self, size: u32) -> Self {
self.config.conn_window_size = size;
self
}
/// Set total number of simultaneous connections per type of scheme.
///
/// If limit is 0, the connector has no limit.
/// The default limit size is 100.
pub fn limit(mut self, limit: usize) -> Self {
self.limit = limit;
self.config.limit = limit;
self
}
@@ -179,7 +209,7 @@ where
/// exceeds this period, the connection is closed.
/// Default keep-alive period is 15 seconds.
pub fn conn_keep_alive(mut self, dur: Duration) -> Self {
self.conn_keep_alive = dur;
self.config.conn_keep_alive = dur;
self
}
@@ -189,7 +219,7 @@ where
/// until it is closed regardless of keep-alive period.
/// Default lifetime period is 75 seconds.
pub fn conn_lifetime(mut self, dur: Duration) -> Self {
self.conn_lifetime = dur;
self.config.conn_lifetime = dur;
self
}
@@ -202,7 +232,7 @@ where
///
/// By default disconnect timeout is set to 3000 milliseconds.
pub fn disconnect_timeout(mut self, dur: Duration) -> Self {
self.disconnect_timeout = dur;
self.config.disconnect_timeout = Some(dur);
self
}
@@ -212,11 +242,11 @@ where
pub fn finish(
self,
) -> impl Service<Request = Connect, Response = impl Connection, Error = ConnectError>
+ Clone {
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+ Clone {
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
{
let connector = TimeoutService::new(
self.timeout,
self.config.timeout,
apply_fn(self.connector, |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
@@ -231,39 +261,34 @@ where
connect_impl::InnerConnector {
tcp_pool: ConnectionPool::new(
connector,
self.conn_lifetime,
self.conn_keep_alive,
None,
self.limit,
self.config.no_disconnect_timeout(),
),
}
}
#[cfg(any(feature = "ssl", feature = "rust-tls"))]
#[cfg(any(feature = "openssl", feature = "rustls"))]
{
const H2: &[u8] = b"h2";
#[cfg(feature = "ssl")]
use actix_connect::ssl::OpensslConnector;
#[cfg(feature = "rust-tls")]
use actix_connect::ssl::RustlsConnector;
use actix_service::boxed::service;
#[cfg(feature = "rust-tls")]
use rustls::Session;
#[cfg(feature = "openssl")]
use actix_connect::ssl::openssl::OpensslConnector;
#[cfg(feature = "rustls")]
use actix_connect::ssl::rustls::{RustlsConnector, Session};
use actix_service::{boxed::service, pipeline};
let ssl_service = TimeoutService::new(
self.timeout,
apply_fn(self.connector.clone(), |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from)
self.config.timeout,
pipeline(
apply_fn(self.connector.clone(), |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from),
)
.and_then(match self.ssl {
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
SslConnector::Openssl(ssl) => service(
OpensslConnector::service(ssl)
.map_err(ConnectError::from)
.map(|stream| {
let sock = stream.into_parts().0;
let h2 = sock
.get_ref()
.ssl()
.selected_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
@@ -273,9 +298,10 @@ where
} else {
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
}
}),
})
.map_err(ConnectError::from),
),
#[cfg(feature = "rust-tls")]
#[cfg(feature = "rustls")]
SslConnector::Rustls(ssl) => service(
RustlsConnector::service(ssl)
.map_err(ConnectError::from)
@@ -302,8 +328,8 @@ where
});
let tcp_service = TimeoutService::new(
self.timeout,
apply_fn(self.connector.clone(), |msg: Connect, srv| {
self.config.timeout,
apply_fn(self.connector, |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from)
@@ -317,36 +343,27 @@ where
connect_impl::InnerConnector {
tcp_pool: ConnectionPool::new(
tcp_service,
self.conn_lifetime,
self.conn_keep_alive,
None,
self.limit,
),
ssl_pool: ConnectionPool::new(
ssl_service,
self.conn_lifetime,
self.conn_keep_alive,
Some(self.disconnect_timeout),
self.limit,
self.config.no_disconnect_timeout(),
),
ssl_pool: ConnectionPool::new(ssl_service, self.config),
}
}
}
}
#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
mod connect_impl {
use futures::future::{err, Either, FutureResult};
use futures::Poll;
use std::task::{Context, Poll};
use futures_util::future::{err, Either, Ready};
use super::*;
use crate::client::connection::IoConnection;
pub(crate) struct InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
pub(crate) tcp_pool: ConnectionPool<T, Io>,
@@ -354,9 +371,8 @@ mod connect_impl {
impl<T, Io> Clone for InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
fn clone(&self) -> Self {
@@ -368,9 +384,8 @@ mod connect_impl {
impl<T, Io> Service for InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
type Request = Connect;
@@ -378,38 +393,41 @@ mod connect_impl {
type Error = ConnectError;
type Future = Either<
<ConnectionPool<T, Io> as Service>::Future,
FutureResult<IoConnection<Io>, ConnectError>,
Ready<Result<IoConnection<Io>, ConnectError>>,
>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.tcp_pool.poll_ready()
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready(cx)
}
fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => {
Either::B(err(ConnectError::SslIsNotSupported))
Either::Right(err(ConnectError::SslIsNotSupported))
}
_ => Either::A(self.tcp_pool.call(req)),
_ => Either::Left(self.tcp_pool.call(req)),
}
}
}
}
#[cfg(any(feature = "ssl", feature = "rust-tls"))]
#[cfg(any(feature = "openssl", feature = "rustls"))]
mod connect_impl {
use std::future::Future;
use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use futures::future::{Either, FutureResult};
use futures::{Async, Future, Poll};
use futures_core::ready;
use futures_util::future::Either;
use super::*;
use crate::client::connection::EitherConnection;
pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>,
{
@@ -419,13 +437,11 @@ mod connect_impl {
impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
fn clone(&self) -> Self {
@@ -438,53 +454,47 @@ mod connect_impl {
impl<T1, T2, Io1, Io2> Service for InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
T2: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
type Request = Connect;
type Response = EitherConnection<Io1, Io2>;
type Error = ConnectError;
type Future = Either<
FutureResult<Self::Response, Self::Error>,
Either<
InnerConnectorResponseA<T1, Io1, Io2>,
InnerConnectorResponseB<T2, Io1, Io2>,
>,
InnerConnectorResponseA<T1, Io1, Io2>,
InnerConnectorResponseB<T2, Io1, Io2>,
>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.tcp_pool.poll_ready()
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready(cx)
}
fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => {
Either::B(Either::B(InnerConnectorResponseB {
fut: self.ssl_pool.call(req),
_t: PhantomData,
}))
}
_ => Either::B(Either::A(InnerConnectorResponseA {
Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
fut: self.ssl_pool.call(req),
_t: PhantomData,
}),
_ => Either::Left(InnerConnectorResponseA {
fut: self.tcp_pool.call(req),
_t: PhantomData,
})),
}),
}
}
}
#[pin_project::pin_project]
pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
#[pin]
fut: <ConnectionPool<T, Io1> as Service>::Future,
_t: PhantomData<Io2>,
}
@@ -492,29 +502,28 @@ mod connect_impl {
impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
where
T: Service<Request = Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Item = EitherConnection<Io1, Io2>;
type Error = ConnectError;
type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.fut.poll()? {
Async::NotReady => Ok(Async::NotReady),
Async::Ready(res) => Ok(Async::Ready(EitherConnection::A(res))),
}
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
Poll::Ready(
ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
.map(EitherConnection::A),
)
}
}
#[pin_project::pin_project]
pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
where
Io2: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
#[pin]
fut: <ConnectionPool<T, Io2> as Service>::Future,
_t: PhantomData<Io1>,
}
@@ -522,19 +531,17 @@ mod connect_impl {
impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
where
T: Service<Request = Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
Io1: AsyncRead + AsyncWrite + 'static,
Io2: AsyncRead + AsyncWrite + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Item = EitherConnection<Io1, Io2>;
type Error = ConnectError;
type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.fut.poll()? {
Async::NotReady => Ok(Async::NotReady),
Async::Ready(res) => Ok(Async::Ready(EitherConnection::B(res))),
}
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
Poll::Ready(
ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
.map(EitherConnection::B),
)
}
}
}

View File

@@ -1,14 +1,13 @@
use std::io;
use actix_connect::resolver::ResolveError;
use derive_more::{Display, From};
use trust_dns_resolver::error::ResolveError;
#[cfg(feature = "ssl")]
use openssl::ssl::{Error as SslError, HandshakeError};
#[cfg(feature = "openssl")]
use actix_connect::ssl::openssl::{HandshakeError, SslError};
use crate::error::{Error, ParseError, ResponseError};
use crate::http::Error as HttpError;
use crate::response::Response;
use crate::http::{Error as HttpError, StatusCode};
/// A set of errors that can occur while connecting to an HTTP host
#[derive(Debug, Display, From)]
@@ -18,10 +17,15 @@ pub enum ConnectError {
SslIsNotSupported,
/// SSL error
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
#[display(fmt = "{}", _0)]
SslError(SslError),
/// SSL Handshake error
#[cfg(feature = "openssl")]
#[display(fmt = "{}", _0)]
SslHandshakeError(String),
/// Failed to resolve the hostname
#[display(fmt = "Failed resolving hostname: {}", _0)]
Resolver(ResolveError),
@@ -35,7 +39,7 @@ pub enum ConnectError {
H2(h2::Error),
/// Connecting took too long
#[display(fmt = "Timeout out while establishing connection")]
#[display(fmt = "Timeout while establishing connection")]
Timeout,
/// Connector has been disconnected
@@ -44,33 +48,31 @@ pub enum ConnectError {
/// Unresolved host name
#[display(fmt = "Connector received `Connect` method with unresolved host")]
Unresolverd,
Unresolved,
/// Connection io error
#[display(fmt = "{}", _0)]
Io(io::Error),
}
impl std::error::Error for ConnectError {}
impl From<actix_connect::ConnectError> for ConnectError {
fn from(err: actix_connect::ConnectError) -> ConnectError {
match err {
actix_connect::ConnectError::Resolver(e) => ConnectError::Resolver(e),
actix_connect::ConnectError::NoRecords => ConnectError::NoRecords,
actix_connect::ConnectError::InvalidInput => panic!(),
actix_connect::ConnectError::Unresolverd => ConnectError::Unresolverd,
actix_connect::ConnectError::Unresolved => ConnectError::Unresolved,
actix_connect::ConnectError::Io(e) => ConnectError::Io(e),
}
}
}
#[cfg(feature = "ssl")]
impl<T> From<HandshakeError<T>> for ConnectError {
#[cfg(feature = "openssl")]
impl<T: std::fmt::Debug> From<HandshakeError<T>> for ConnectError {
fn from(err: HandshakeError<T>) -> ConnectError {
match err {
HandshakeError::SetupFailure(stack) => SslError::from(stack).into(),
HandshakeError::Failure(stream) => stream.into_error().into(),
HandshakeError::WouldBlock(stream) => stream.into_error().into(),
}
ConnectError::SslHandshakeError(format!("{:?}", err))
}
}
@@ -86,6 +88,8 @@ pub enum InvalidUrl {
HttpError(http::Error),
}
impl std::error::Error for InvalidUrl {}
/// A set of errors that can occur during request sending and response reading
#[derive(Debug, Display, From)]
pub enum SendRequestError {
@@ -106,7 +110,7 @@ pub enum SendRequestError {
#[display(fmt = "{}", _0)]
H2(h2::Error),
/// Response took too long
#[display(fmt = "Timeout out while waiting for response")]
#[display(fmt = "Timeout while waiting for response")]
Timeout,
/// Tunnels are not supported for http2 connection
#[display(fmt = "Tunnels are not supported for http2 connection")]
@@ -115,17 +119,18 @@ pub enum SendRequestError {
Body(Error),
}
impl std::error::Error for SendRequestError {}
/// Convert `SendRequestError` to a server `Response`
impl ResponseError for SendRequestError {
fn error_response(&self) -> Response {
fn status_code(&self) -> StatusCode {
match *self {
SendRequestError::Connect(ConnectError::Timeout) => {
Response::GatewayTimeout()
StatusCode::GATEWAY_TIMEOUT
}
SendRequestError::Connect(_) => Response::BadGateway(),
_ => Response::InternalServerError(),
SendRequestError::Connect(_) => StatusCode::BAD_REQUEST,
_ => StatusCode::INTERNAL_SERVER_ERROR,
}
.into()
}
}
@@ -140,6 +145,8 @@ pub enum FreezeRequestError {
Http(HttpError),
}
impl std::error::Error for FreezeRequestError {}
impl From<FreezeRequestError> for SendRequestError {
fn from(e: FreezeRequestError) -> Self {
match e {

View File

@@ -1,10 +1,14 @@
use std::io::Write;
use std::{io, time};
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{io, mem, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use bytes::{BufMut, Bytes, BytesMut};
use futures::future::{ok, Either};
use futures::{Async, Future, Poll, Sink, Stream};
use bytes::buf::BufMutExt;
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use futures_util::future::poll_fn;
use futures_util::{pin_mut, SinkExt, StreamExt};
use crate::error::PayloadError;
use crate::h1;
@@ -18,15 +22,15 @@ use super::error::{ConnectError, SendRequestError};
use super::pool::Acquired;
use crate::body::{BodySize, MessageBody};
pub(crate) fn send_request<T, B>(
pub(crate) async fn send_request<T, B>(
io: T,
mut head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
) -> Result<(ResponseHead, Payload), SendRequestError>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
B: MessageBody,
{
// set request host header
@@ -41,7 +45,7 @@ where
Some(port) => write!(wrt, "{}:{}", host, port),
};
match wrt.get_mut().take().freeze().try_into() {
match wrt.get_mut().split().freeze().try_into() {
Ok(value) => match head {
RequestHeadType::Owned(ref mut head) => {
head.headers.insert(HOST, value)
@@ -62,68 +66,100 @@ where
io: Some(io),
};
let len = body.size();
// create Framed and send request
Framed::new(io, h1::ClientCodec::default())
.send((head, len).into())
.from_err()
// send request body
.and_then(move |framed| match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
Either::A(ok(framed))
}
_ => Either::B(SendBody::new(body, framed)),
})
// read response and init read body
.and_then(|framed| {
framed
.into_future()
.map_err(|(e, _)| SendRequestError::from(e))
.and_then(|(item, framed)| {
if let Some(res) = item {
match framed.get_codec().message_type() {
h1::MessageType::None => {
let force_close = !framed.get_codec().keepalive();
release_connection(framed, force_close);
Ok((res, Payload::None))
}
_ => {
let pl: PayloadStream = Box::new(PlStream::new(framed));
Ok((res, pl.into()))
}
}
} else {
Err(ConnectError::Disconnected.into())
}
})
})
let mut framed = Framed::new(io, h1::ClientCodec::default());
framed.send((head, body.size()).into()).await?;
// send request body
match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => (),
_ => send_body(body, &mut framed).await?,
};
// read response and init read body
let res = framed.into_future().await;
let (head, framed) = if let (Some(result), framed) = res {
let item = result.map_err(SendRequestError::from)?;
(item, framed)
} else {
return Err(SendRequestError::from(ConnectError::Disconnected));
};
match framed.get_codec().message_type() {
h1::MessageType::None => {
let force_close = !framed.get_codec().keepalive();
release_connection(framed, force_close);
Ok((head, Payload::None))
}
_ => {
let pl: PayloadStream = PlStream::new(framed).boxed_local();
Ok((head, pl.into()))
}
}
}
pub(crate) fn open_tunnel<T>(
pub(crate) async fn open_tunnel<T>(
io: T,
head: RequestHeadType,
) -> impl Future<Item = (ResponseHead, Framed<T, h1::ClientCodec>), Error = SendRequestError>
) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
// create Framed and send request
Framed::new(io, h1::ClientCodec::default())
.send((head, BodySize::None).into())
.from_err()
// read response
.and_then(|framed| {
framed
.into_future()
.map_err(|(e, _)| SendRequestError::from(e))
.and_then(|(head, framed)| {
if let Some(head) = head {
Ok((head, framed))
let mut framed = Framed::new(io, h1::ClientCodec::default());
framed.send((head, BodySize::None).into()).await?;
// read response
if let (Some(result), framed) = framed.into_future().await {
let head = result.map_err(SendRequestError::from)?;
Ok((head, framed))
} else {
Err(SendRequestError::from(ConnectError::Disconnected))
}
}
/// send request body to the peer
pub(crate) async fn send_body<I, B>(
body: B,
framed: &mut Framed<I, h1::ClientCodec>,
) -> Result<(), SendRequestError>
where
I: ConnectionLifetime,
B: MessageBody,
{
let mut eof = false;
pin_mut!(body);
while !eof {
while !eof && !framed.is_write_buf_full() {
match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
Some(result) => {
framed.write(h1::Message::Chunk(Some(result?)))?;
}
None => {
eof = true;
framed.write(h1::Message::Chunk(None))?;
}
}
}
if !framed.is_write_buf_empty() {
poll_fn(|cx| match framed.flush(cx) {
Poll::Ready(Ok(_)) => Poll::Ready(Ok(())),
Poll::Ready(Err(err)) => Poll::Ready(Err(err)),
Poll::Pending => {
if !framed.is_write_buf_full() {
Poll::Ready(Ok(()))
} else {
Err(SendRequestError::from(ConnectError::Disconnected))
Poll::Pending
}
})
})
}
})
.await?;
}
}
SinkExt::flush(framed).await?;
Ok(())
}
#[doc(hidden)]
@@ -134,7 +170,10 @@ pub struct H1Connection<T> {
pool: Option<Acquired<T>>,
}
impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T> {
impl<T> ConnectionLifetime for H1Connection<T>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
/// Close connection
fn close(&mut self) {
if let Some(mut pool) = self.pool.take() {
@@ -162,98 +201,44 @@ impl<T: AsyncRead + AsyncWrite + 'static> ConnectionLifetime for H1Connection<T>
}
}
impl<T: AsyncRead + AsyncWrite + 'static> io::Read for H1Connection<T> {
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
self.io.as_mut().unwrap().read(buf)
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
unsafe fn prepare_uninitialized_buffer(
&self,
buf: &mut [mem::MaybeUninit<u8>],
) -> bool {
self.io.as_ref().unwrap().prepare_uninitialized_buffer(buf)
}
fn poll_read(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut [u8],
) -> Poll<io::Result<usize>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
}
}
impl<T: AsyncRead + AsyncWrite + 'static> AsyncRead for H1Connection<T> {}
impl<T: AsyncRead + AsyncWrite + 'static> io::Write for H1Connection<T> {
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
self.io.as_mut().unwrap().write(buf)
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
fn poll_write(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
}
fn flush(&mut self) -> io::Result<()> {
self.io.as_mut().unwrap().flush()
fn poll_flush(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
}
}
impl<T: AsyncRead + AsyncWrite + 'static> AsyncWrite for H1Connection<T> {
fn shutdown(&mut self) -> Poll<(), io::Error> {
self.io.as_mut().unwrap().shutdown()
}
}
/// Future responsible for sending request body to the peer
pub(crate) struct SendBody<I, B> {
body: Option<B>,
framed: Option<Framed<I, h1::ClientCodec>>,
flushed: bool,
}
impl<I, B> SendBody<I, B>
where
I: AsyncRead + AsyncWrite + 'static,
B: MessageBody,
{
pub(crate) fn new(body: B, framed: Framed<I, h1::ClientCodec>) -> Self {
SendBody {
body: Some(body),
framed: Some(framed),
flushed: true,
}
}
}
impl<I, B> Future for SendBody<I, B>
where
I: ConnectionLifetime,
B: MessageBody,
{
type Item = Framed<I, h1::ClientCodec>;
type Error = SendRequestError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let mut body_ready = true;
loop {
while body_ready
&& self.body.is_some()
&& !self.framed.as_ref().unwrap().is_write_buf_full()
{
match self.body.as_mut().unwrap().poll_next()? {
Async::Ready(item) => {
// check if body is done
if item.is_none() {
let _ = self.body.take();
}
self.flushed = false;
self.framed
.as_mut()
.unwrap()
.force_send(h1::Message::Chunk(item))?;
break;
}
Async::NotReady => body_ready = false,
}
}
if !self.flushed {
match self.framed.as_mut().unwrap().poll_complete()? {
Async::Ready(_) => {
self.flushed = true;
continue;
}
Async::NotReady => return Ok(Async::NotReady),
}
}
if self.body.is_none() {
return Ok(Async::Ready(self.framed.take().unwrap()));
}
return Ok(Async::NotReady);
}
fn poll_shutdown(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Result<(), io::Error>> {
Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
}
}
@@ -270,23 +255,27 @@ impl<Io: ConnectionLifetime> PlStream<Io> {
}
impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
type Item = Bytes;
type Error = PayloadError;
type Item = Result<Bytes, PayloadError>;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
match self.framed.as_mut().unwrap().poll()? {
Async::NotReady => Ok(Async::NotReady),
Async::Ready(Some(chunk)) => {
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
let this = self.get_mut();
match this.framed.as_mut().unwrap().next_item(cx)? {
Poll::Pending => Poll::Pending,
Poll::Ready(Some(chunk)) => {
if let Some(chunk) = chunk {
Ok(Async::Ready(Some(chunk)))
Poll::Ready(Some(Ok(chunk)))
} else {
let framed = self.framed.take().unwrap();
let framed = this.framed.take().unwrap();
let force_close = !framed.get_codec().keepalive();
release_connection(framed, force_close);
Ok(Async::Ready(None))
Poll::Ready(None)
}
}
Async::Ready(None) => Ok(Async::Ready(None)),
Poll::Ready(None) => Poll::Ready(None),
}
}
}

View File

@@ -1,193 +1,178 @@
use std::convert::TryFrom;
use std::future::Future;
use std::time;
use actix_codec::{AsyncRead, AsyncWrite};
use bytes::Bytes;
use futures::future::{err, Either};
use futures::{Async, Future, Poll};
use h2::{client::SendRequest, SendStream};
use futures_util::future::poll_fn;
use futures_util::pin_mut;
use h2::{
client::{Builder, Connection, SendRequest},
SendStream,
};
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, TRANSFER_ENCODING};
use http::{request::Request, HttpTryFrom, Method, Version};
use http::{request::Request, Method, Version};
use crate::body::{BodySize, MessageBody};
use crate::header::HeaderMap;
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::Payload;
use super::config::ConnectorConfig;
use super::connection::{ConnectionType, IoConnection};
use super::error::SendRequestError;
use super::pool::Acquired;
pub(crate) fn send_request<T, B>(
io: SendRequest<Bytes>,
pub(crate) async fn send_request<T, B>(
mut io: SendRequest<Bytes>,
head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> impl Future<Item = (ResponseHead, Payload), Error = SendRequestError>
) -> Result<(ResponseHead, Payload), SendRequestError>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
B: MessageBody,
{
trace!("Sending client request: {:?} {:?}", head, body.size());
let head_req = head.as_ref().method == Method::HEAD;
let length = body.size();
let eof = match length {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => true,
_ => false,
let eof = matches!(
length,
BodySize::None | BodySize::Empty | BodySize::Sized(0)
);
let mut req = Request::new(());
*req.uri_mut() = head.as_ref().uri.clone();
*req.method_mut() = head.as_ref().method.clone();
*req.version_mut() = Version::HTTP_2;
let mut skip_len = true;
// let mut has_date = false;
// Content length
let _ = match length {
BodySize::None => None,
BodySize::Stream => {
skip_len = false;
None
}
BodySize::Empty => req
.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
BodySize::Sized(len) => req.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::try_from(format!("{}", len)).unwrap(),
),
};
io.ready()
.map_err(SendRequestError::from)
.and_then(move |mut io| {
let mut req = Request::new(());
*req.uri_mut() = head.as_ref().uri.clone();
*req.method_mut() = head.as_ref().method.clone();
*req.version_mut() = Version::HTTP_2;
// Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
let (head, extra_headers) = match head {
RequestHeadType::Owned(head) => (RequestHeadType::Owned(head), HeaderMap::new()),
RequestHeadType::Rc(head, extra_headers) => (
RequestHeadType::Rc(head, None),
extra_headers.unwrap_or_else(HeaderMap::new),
),
};
let mut skip_len = true;
// let mut has_date = false;
// merging headers from head and extra headers.
let headers = head
.as_ref()
.headers
.iter()
.filter(|(name, _)| !extra_headers.contains_key(*name))
.chain(extra_headers.iter());
// Content length
let _ = match length {
BodySize::None => None,
BodySize::Stream => {
skip_len = false;
None
}
BodySize::Empty => req
.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
BodySize::Sized(len) => req.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::try_from(format!("{}", len)).unwrap(),
),
BodySize::Sized64(len) => req.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::try_from(format!("{}", len)).unwrap(),
),
};
// copy headers
for (key, value) in headers {
match *key {
CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
CONTENT_LENGTH if skip_len => continue,
// DATE => has_date = true,
_ => (),
}
req.headers_mut().append(key, value.clone());
}
// Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
let (head, extra_headers) = match head {
RequestHeadType::Owned(head) => {
(RequestHeadType::Owned(head), HeaderMap::new())
}
RequestHeadType::Rc(head, extra_headers) => (
RequestHeadType::Rc(head, None),
extra_headers.unwrap_or_else(HeaderMap::new),
),
};
let res = poll_fn(|cx| io.poll_ready(cx)).await;
if let Err(e) = res {
release(io, pool, created, e.is_io());
return Err(SendRequestError::from(e));
}
// merging headers from head and extra headers.
let headers = head
.as_ref()
.headers
.iter()
.filter(|(name, _)| !extra_headers.contains_key(*name))
.chain(extra_headers.iter());
let resp = match io.send_request(req, eof) {
Ok((fut, send)) => {
release(io, pool, created, false);
// copy headers
for (key, value) in headers {
match *key {
CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
CONTENT_LENGTH if skip_len => continue,
// DATE => has_date = true,
_ => (),
}
req.headers_mut().append(key, value.clone());
if !eof {
send_body(body, send).await?;
}
fut.await.map_err(SendRequestError::from)?
}
Err(e) => {
release(io, pool, created, e.is_io());
return Err(e.into());
}
};
match io.send_request(req, eof) {
Ok((res, send)) => {
release(io, pool, created, false);
let (parts, body) = resp.into_parts();
let payload = if head_req { Payload::None } else { body.into() };
if !eof {
Either::A(Either::B(
SendBody {
body,
send,
buf: None,
}
.and_then(move |_| res.map_err(SendRequestError::from)),
))
} else {
Either::B(res.map_err(SendRequestError::from))
}
}
Err(e) => {
release(io, pool, created, e.is_io());
Either::A(Either::A(err(e.into())))
}
}
})
.and_then(move |resp| {
let (parts, body) = resp.into_parts();
let payload = if head_req { Payload::None } else { body.into() };
let mut head = ResponseHead::new(parts.status);
head.version = parts.version;
head.headers = parts.headers.into();
Ok((head, payload))
})
.from_err()
let mut head = ResponseHead::new(parts.status);
head.version = parts.version;
head.headers = parts.headers.into();
Ok((head, payload))
}
struct SendBody<B: MessageBody> {
async fn send_body<B: MessageBody>(
body: B,
send: SendStream<Bytes>,
buf: Option<Bytes>,
}
impl<B: MessageBody> Future for SendBody<B> {
type Item = ();
type Error = SendRequestError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
loop {
if self.buf.is_none() {
match self.body.poll_next() {
Ok(Async::Ready(Some(buf))) => {
self.send.reserve_capacity(buf.len());
self.buf = Some(buf);
}
Ok(Async::Ready(None)) => {
if let Err(e) = self.send.send_data(Bytes::new(), true) {
return Err(e.into());
}
self.send.reserve_capacity(0);
return Ok(Async::Ready(()));
}
Ok(Async::NotReady) => return Ok(Async::NotReady),
Err(e) => return Err(e.into()),
mut send: SendStream<Bytes>,
) -> Result<(), SendRequestError> {
let mut buf = None;
pin_mut!(body);
loop {
if buf.is_none() {
match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
Some(Ok(b)) => {
send.reserve_capacity(b.len());
buf = Some(b);
}
}
match self.send.poll_capacity() {
Ok(Async::NotReady) => return Ok(Async::NotReady),
Ok(Async::Ready(None)) => return Ok(Async::Ready(())),
Ok(Async::Ready(Some(cap))) => {
let mut buf = self.buf.take().unwrap();
let len = buf.len();
let bytes = buf.split_to(std::cmp::min(cap, len));
if let Err(e) = self.send.send_data(bytes, false) {
Some(Err(e)) => return Err(e.into()),
None => {
if let Err(e) = send.send_data(Bytes::new(), true) {
return Err(e.into());
} else {
if !buf.is_empty() {
self.send.reserve_capacity(buf.len());
self.buf = Some(buf);
}
continue;
}
send.reserve_capacity(0);
return Ok(());
}
Err(e) => return Err(e.into()),
}
}
match poll_fn(|cx| send.poll_capacity(cx)).await {
None => return Ok(()),
Some(Ok(cap)) => {
let b = buf.as_mut().unwrap();
let len = b.len();
let bytes = b.split_to(std::cmp::min(cap, len));
if let Err(e) = send.send_data(bytes, false) {
return Err(e.into());
} else {
if !b.is_empty() {
send.reserve_capacity(b.len());
} else {
buf = None;
}
continue;
}
}
Some(Err(e)) => return Err(e.into()),
}
}
}
// release SendRequest object
fn release<T: AsyncRead + AsyncWrite + 'static>(
fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
io: SendRequest<Bytes>,
pool: Option<Acquired<T>>,
created: time::Instant,
@@ -201,3 +186,18 @@ fn release<T: AsyncRead + AsyncWrite + 'static>(
}
}
}
pub(crate) fn handshake<Io>(
io: Io,
config: &ConnectorConfig,
) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
let mut builder = Builder::new();
builder
.initial_window_size(config.stream_window_size)
.initial_connection_window_size(config.conn_window_size)
.enable_push(false);
builder.handshake(io)
}

View File

@@ -1,6 +1,7 @@
//! Http client api
use http::Uri;
mod config;
mod connection;
mod connector;
mod error;

View File

@@ -1,25 +1,28 @@
use std::cell::RefCell;
use std::collections::VecDeque;
use std::io;
use std::future::Future;
use std::pin::Pin;
use std::rc::Rc;
use std::task::{Context, Poll};
use std::time::{Duration, Instant};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::time::{delay_for, Delay};
use actix_service::Service;
use actix_utils::{oneshot, task::LocalWaker};
use bytes::Bytes;
use futures::future::{err, ok, Either, FutureResult};
use futures::task::AtomicTask;
use futures::unsync::oneshot;
use futures::{Async, Future, Poll};
use h2::client::{handshake, Handshake};
use hashbrown::HashMap;
use futures_util::future::{poll_fn, FutureExt, LocalBoxFuture};
use fxhash::FxHashMap;
use h2::client::{Connection, SendRequest};
use http::uri::Authority;
use indexmap::IndexSet;
use pin_project::pin_project;
use slab::Slab;
use tokio_timer::{sleep, Delay};
use super::config::ConnectorConfig;
use super::connection::{ConnectionType, IoConnection};
use super::error::ConnectError;
use super::h2proto::handshake;
use super::Connect;
#[derive(Clone, Copy, PartialEq)]
@@ -41,247 +44,202 @@ impl From<Authority> for Key {
}
/// Connections pool
pub(crate) struct ConnectionPool<T, Io: AsyncRead + AsyncWrite + 'static>(
T,
Rc<RefCell<Inner<Io>>>,
);
pub(crate) struct ConnectionPool<T, Io: 'static>(Rc<RefCell<T>>, Rc<RefCell<Inner<Io>>>);
impl<T, Io> ConnectionPool<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
pub(crate) fn new(
connector: T,
conn_lifetime: Duration,
conn_keep_alive: Duration,
disconnect_timeout: Option<Duration>,
limit: usize,
) -> Self {
ConnectionPool(
connector,
Rc::new(RefCell::new(Inner {
conn_lifetime,
conn_keep_alive,
disconnect_timeout,
limit,
acquired: 0,
waiters: Slab::new(),
waiters_queue: IndexSet::new(),
available: HashMap::new(),
task: None,
})),
)
pub(crate) fn new(connector: T, config: ConnectorConfig) -> Self {
let connector_rc = Rc::new(RefCell::new(connector));
let inner_rc = Rc::new(RefCell::new(Inner {
config,
acquired: 0,
waiters: Slab::new(),
waiters_queue: IndexSet::new(),
available: FxHashMap::default(),
waker: LocalWaker::new(),
}));
// start support future
actix_rt::spawn(ConnectorPoolSupport {
connector: Rc::clone(&connector_rc),
inner: Rc::clone(&inner_rc),
});
ConnectionPool(connector_rc, inner_rc)
}
}
impl<T, Io> Clone for ConnectionPool<T, Io>
where
T: Clone,
Io: AsyncRead + AsyncWrite + 'static,
Io: 'static,
{
fn clone(&self) -> Self {
ConnectionPool(self.0.clone(), self.1.clone())
}
}
impl<T, Io> Drop for ConnectionPool<T, Io> {
fn drop(&mut self) {
// wake up the ConnectorPoolSupport when dropping so it can exit properly.
self.1.borrow().waker.wake();
}
}
impl<T, Io> Service for ConnectionPool<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>
+ Clone
+ 'static,
{
type Request = Connect;
type Response = IoConnection<Io>;
type Error = ConnectError;
type Future = Either<
FutureResult<Self::Response, Self::Error>,
Either<WaitForConnection<Io>, OpenConnection<T::Future, Io>>,
>;
type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.0.poll_ready()
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.0.poll_ready(cx)
}
fn call(&mut self, req: Connect) -> Self::Future {
let key = if let Some(authority) = req.uri.authority_part() {
authority.clone().into()
} else {
return Either::A(err(ConnectError::Unresolverd));
let mut connector = self.0.clone();
let inner = self.1.clone();
let fut = async move {
let key = if let Some(authority) = req.uri.authority() {
authority.clone().into()
} else {
return Err(ConnectError::Unresolved);
};
// acquire connection
match poll_fn(|cx| Poll::Ready(inner.borrow_mut().acquire(&key, cx))).await {
Acquire::Acquired(io, created) => {
// use existing connection
return Ok(IoConnection::new(
io,
created,
Some(Acquired(key, Some(inner))),
));
}
Acquire::Available => {
// open tcp connection
let (io, proto) = connector.call(req).await?;
let config = inner.borrow().config.clone();
let guard = OpenGuard::new(key, inner);
if proto == Protocol::Http1 {
Ok(IoConnection::new(
ConnectionType::H1(io),
Instant::now(),
Some(guard.consume()),
))
} else {
let (snd, connection) = handshake(io, &config).await?;
actix_rt::spawn(connection.map(|_| ()));
Ok(IoConnection::new(
ConnectionType::H2(snd),
Instant::now(),
Some(guard.consume()),
))
}
}
_ => {
// connection is not available, wait
let (rx, token) = inner.borrow_mut().wait_for(req);
let guard = WaiterGuard::new(key, token, inner);
let res = match rx.await {
Err(_) => Err(ConnectError::Disconnected),
Ok(res) => res,
};
guard.consume();
res
}
}
};
// acquire connection
match self.1.as_ref().borrow_mut().acquire(&key) {
Acquire::Acquired(io, created) => {
// use existing connection
return Either::A(ok(IoConnection::new(
io,
created,
Some(Acquired(key, Some(self.1.clone()))),
)));
}
Acquire::Available => {
// open new connection
return Either::B(Either::B(OpenConnection::new(
key,
self.1.clone(),
self.0.call(req),
)));
}
_ => (),
}
// connection is not available, wait
let (rx, token, support) = self.1.as_ref().borrow_mut().wait_for(req);
// start support future
if !support {
self.1.as_ref().borrow_mut().task = Some(AtomicTask::new());
tokio_current_thread::spawn(ConnectorPoolSupport {
connector: self.0.clone(),
inner: self.1.clone(),
})
}
Either::B(Either::A(WaitForConnection {
rx,
key,
token,
inner: Some(self.1.clone()),
}))
fut.boxed_local()
}
}
#[doc(hidden)]
pub struct WaitForConnection<Io>
struct WaiterGuard<Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
key: Key,
token: usize,
rx: oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
inner: Option<Rc<RefCell<Inner<Io>>>>,
}
impl<Io> Drop for WaitForConnection<Io>
impl<Io> WaiterGuard<Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn new(key: Key, token: usize, inner: Rc<RefCell<Inner<Io>>>) -> Self {
Self {
key,
token,
inner: Some(inner),
}
}
fn consume(mut self) {
let _ = self.inner.take();
}
}
impl<Io> Drop for WaiterGuard<Io>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn drop(&mut self) {
if let Some(i) = self.inner.take() {
let mut inner = i.as_ref().borrow_mut();
inner.release_waiter(&self.key, self.token);
inner.check_availibility();
inner.check_availability();
}
}
}
impl<Io> Future for WaitForConnection<Io>
struct OpenGuard<Io>
where
Io: AsyncRead + AsyncWrite,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Item = IoConnection<Io>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.rx.poll() {
Ok(Async::Ready(item)) => match item {
Err(err) => Err(err),
Ok(conn) => {
let _ = self.inner.take();
Ok(Async::Ready(conn))
}
},
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(_) => {
let _ = self.inner.take();
Err(ConnectError::Disconnected)
}
}
}
}
#[doc(hidden)]
pub struct OpenConnection<F, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
{
fut: F,
key: Key,
h2: Option<Handshake<Io, Bytes>>,
inner: Option<Rc<RefCell<Inner<Io>>>>,
}
impl<F, Io> OpenConnection<F, Io>
impl<Io> OpenGuard<Io>
where
F: Future<Item = (Io, Protocol), Error = ConnectError>,
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>, fut: F) -> Self {
OpenConnection {
fn new(key: Key, inner: Rc<RefCell<Inner<Io>>>) -> Self {
Self {
key,
fut,
inner: Some(inner),
h2: None,
}
}
fn consume(mut self) -> Acquired<Io> {
Acquired(self.key.clone(), self.inner.take())
}
}
impl<F, Io> Drop for OpenConnection<F, Io>
impl<Io> Drop for OpenGuard<Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn drop(&mut self) {
if let Some(inner) = self.inner.take() {
let mut inner = inner.as_ref().borrow_mut();
if let Some(i) = self.inner.take() {
let mut inner = i.as_ref().borrow_mut();
inner.release();
inner.check_availibility();
}
}
}
impl<F, Io> Future for OpenConnection<F, Io>
where
F: Future<Item = (Io, Protocol), Error = ConnectError>,
Io: AsyncRead + AsyncWrite,
{
type Item = IoConnection<Io>;
type Error = ConnectError;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
if let Some(ref mut h2) = self.h2 {
return match h2.poll() {
Ok(Async::Ready((snd, connection))) => {
tokio_current_thread::spawn(connection.map_err(|_| ()));
Ok(Async::Ready(IoConnection::new(
ConnectionType::H2(snd),
Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())),
)))
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(e) => Err(e.into()),
};
}
match self.fut.poll() {
Err(err) => Err(err),
Ok(Async::Ready((io, proto))) => {
if proto == Protocol::Http1 {
Ok(Async::Ready(IoConnection::new(
ConnectionType::H1(io),
Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())),
)))
} else {
self.h2 = Some(handshake(io));
self.poll()
}
}
Ok(Async::NotReady) => Ok(Async::NotReady),
inner.check_availability();
}
}
}
@@ -299,12 +257,9 @@ struct AvailableConnection<Io> {
}
pub(crate) struct Inner<Io> {
conn_lifetime: Duration,
conn_keep_alive: Duration,
disconnect_timeout: Option<Duration>,
limit: usize,
config: ConnectorConfig,
acquired: usize,
available: HashMap<Key, VecDeque<AvailableConnection<Io>>>,
available: FxHashMap<Key, VecDeque<AvailableConnection<Io>>>,
waiters: Slab<
Option<(
Connect,
@@ -312,7 +267,7 @@ pub(crate) struct Inner<Io> {
)>,
>,
waiters_queue: IndexSet<(Key, usize)>,
task: Option<AtomicTask>,
waker: LocalWaker,
}
impl<Io> Inner<Io> {
@@ -332,7 +287,7 @@ impl<Io> Inner<Io> {
impl<Io> Inner<Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
/// connection is not available, wait
fn wait_for(
@@ -341,22 +296,21 @@ where
) -> (
oneshot::Receiver<Result<IoConnection<Io>, ConnectError>>,
usize,
bool,
) {
let (tx, rx) = oneshot::channel();
let key: Key = connect.uri.authority_part().unwrap().clone().into();
let key: Key = connect.uri.authority().unwrap().clone().into();
let entry = self.waiters.vacant_entry();
let token = entry.key();
entry.insert(Some((connect, tx)));
assert!(self.waiters_queue.insert((key, token)));
(rx, token, self.task.is_some())
(rx, token)
}
fn acquire(&mut self, key: &Key) -> Acquire<Io> {
fn acquire(&mut self, key: &Key, cx: &mut Context<'_>) -> Acquire<Io> {
// check limits
if self.limit > 0 && self.acquired >= self.limit {
if self.config.limit > 0 && self.acquired >= self.config.limit {
return Acquire::NotAvailable;
}
@@ -368,33 +322,31 @@ where
let now = Instant::now();
while let Some(conn) = connections.pop_back() {
// check if it still usable
if (now - conn.used) > self.conn_keep_alive
|| (now - conn.created) > self.conn_lifetime
if (now - conn.used) > self.config.conn_keep_alive
|| (now - conn.created) > self.config.conn_lifetime
{
if let Some(timeout) = self.disconnect_timeout {
if let Some(timeout) = self.config.disconnect_timeout {
if let ConnectionType::H1(io) = conn.io {
tokio_current_thread::spawn(CloseConnection::new(
io, timeout,
))
actix_rt::spawn(CloseConnection::new(io, timeout))
}
}
} else {
let mut io = conn.io;
let mut buf = [0; 2];
if let ConnectionType::H1(ref mut s) = io {
match s.read(&mut buf) {
Err(ref e) if e.kind() == io::ErrorKind::WouldBlock => (),
Ok(n) if n > 0 => {
if let Some(timeout) = self.disconnect_timeout {
match Pin::new(s).poll_read(cx, &mut buf) {
Poll::Pending => (),
Poll::Ready(Ok(n)) if n > 0 => {
if let Some(timeout) = self.config.disconnect_timeout {
if let ConnectionType::H1(io) = io {
tokio_current_thread::spawn(
CloseConnection::new(io, timeout),
)
actix_rt::spawn(CloseConnection::new(
io, timeout,
))
}
}
continue;
}
Ok(_) | Err(_) => continue,
_ => continue,
}
}
return Acquire::Acquired(io, conn.created);
@@ -414,24 +366,22 @@ where
created,
used: Instant::now(),
});
self.check_availibility();
self.check_availability();
}
fn release_close(&mut self, io: ConnectionType<Io>) {
self.acquired -= 1;
if let Some(timeout) = self.disconnect_timeout {
if let Some(timeout) = self.config.disconnect_timeout {
if let ConnectionType::H1(io) = io {
tokio_current_thread::spawn(CloseConnection::new(io, timeout))
actix_rt::spawn(CloseConnection::new(io, timeout))
}
}
self.check_availibility();
self.check_availability();
}
fn check_availibility(&self) {
if !self.waiters_queue.is_empty() && self.acquired < self.limit {
if let Some(t) = self.task.as_ref() {
t.notify()
}
fn check_availability(&self) {
if !self.waiters_queue.is_empty() && self.acquired < self.config.limit {
self.waker.wake();
}
}
}
@@ -443,37 +393,39 @@ struct CloseConnection<T> {
impl<T> CloseConnection<T>
where
T: AsyncWrite,
T: AsyncWrite + Unpin,
{
fn new(io: T, timeout: Duration) -> Self {
CloseConnection {
io,
timeout: sleep(timeout),
timeout: delay_for(timeout),
}
}
}
impl<T> Future for CloseConnection<T>
where
T: AsyncWrite,
T: AsyncWrite + Unpin,
{
type Item = ();
type Error = ();
type Output = ();
fn poll(&mut self) -> Poll<(), ()> {
match self.timeout.poll() {
Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
Ok(Async::NotReady) => match self.io.shutdown() {
Ok(Async::Ready(_)) | Err(_) => Ok(Async::Ready(())),
Ok(Async::NotReady) => Ok(Async::NotReady),
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<()> {
let this = self.get_mut();
match Pin::new(&mut this.timeout).poll(cx) {
Poll::Ready(_) => Poll::Ready(()),
Poll::Pending => match Pin::new(&mut this.io).poll_shutdown(cx) {
Poll::Ready(_) => Poll::Ready(()),
Poll::Pending => Poll::Pending,
},
}
}
}
#[pin_project]
struct ConnectorPoolSupport<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
connector: T,
inner: Rc<RefCell<Inner<Io>>>,
@@ -481,16 +433,23 @@ where
impl<T, Io> Future for ConnectorPoolSupport<T, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Request = Connect, Response = (Io, Protocol), Error = ConnectError>,
T::Future: 'static,
{
type Item = ();
type Error = ();
type Output = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let mut inner = self.inner.as_ref().borrow_mut();
inner.task.as_ref().unwrap().register();
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.project();
if Rc::strong_count(this.inner) == 1 {
// If we are last copy of Inner<Io> it means the ConnectionPool is already gone
// and we are safe to exit.
return Poll::Ready(());
}
let mut inner = this.inner.borrow_mut();
inner.waker.register(cx.waker());
// check waiters
loop {
@@ -505,14 +464,14 @@ where
continue;
}
match inner.acquire(&key) {
match inner.acquire(&key, cx) {
Acquire::NotAvailable => break,
Acquire::Acquired(io, created) => {
let tx = inner.waiters.get_mut(token).unwrap().take().unwrap().1;
if let Err(conn) = tx.send(Ok(IoConnection::new(
io,
created,
Some(Acquired(key.clone(), Some(self.inner.clone()))),
Some(Acquired(key.clone(), Some(this.inner.clone()))),
))) {
let (io, created) = conn.unwrap().into_inner();
inner.release_conn(&key, io, created);
@@ -524,118 +483,131 @@ where
OpenWaitingConnection::spawn(
key.clone(),
tx,
self.inner.clone(),
self.connector.call(connect),
this.inner.clone(),
this.connector.call(connect),
inner.config.clone(),
);
}
}
let _ = inner.waiters_queue.swap_remove_index(0);
}
Ok(Async::NotReady)
Poll::Pending
}
}
#[pin_project::pin_project(PinnedDrop)]
struct OpenWaitingConnection<F, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
#[pin]
fut: F,
key: Key,
h2: Option<Handshake<Io, Bytes>>,
h2: Option<
LocalBoxFuture<
'static,
Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>,
>,
>,
rx: Option<oneshot::Sender<Result<IoConnection<Io>, ConnectError>>>,
inner: Option<Rc<RefCell<Inner<Io>>>>,
config: ConnectorConfig,
}
impl<F, Io> OpenWaitingConnection<F, Io>
where
F: Future<Item = (Io, Protocol), Error = ConnectError> + 'static,
Io: AsyncRead + AsyncWrite + 'static,
F: Future<Output = Result<(Io, Protocol), ConnectError>> + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn spawn(
key: Key,
rx: oneshot::Sender<Result<IoConnection<Io>, ConnectError>>,
inner: Rc<RefCell<Inner<Io>>>,
fut: F,
config: ConnectorConfig,
) {
tokio_current_thread::spawn(OpenWaitingConnection {
actix_rt::spawn(OpenWaitingConnection {
key,
fut,
h2: None,
rx: Some(rx),
inner: Some(inner),
config,
})
}
}
impl<F, Io> Drop for OpenWaitingConnection<F, Io>
#[pin_project::pinned_drop]
impl<F, Io> PinnedDrop for OpenWaitingConnection<F, Io>
where
Io: AsyncRead + AsyncWrite + 'static,
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
fn drop(&mut self) {
if let Some(inner) = self.inner.take() {
fn drop(self: Pin<&mut Self>) {
if let Some(inner) = self.project().inner.take() {
let mut inner = inner.as_ref().borrow_mut();
inner.release();
inner.check_availibility();
inner.check_availability();
}
}
}
impl<F, Io> Future for OpenWaitingConnection<F, Io>
where
F: Future<Item = (Io, Protocol), Error = ConnectError>,
Io: AsyncRead + AsyncWrite,
F: Future<Output = Result<(Io, Protocol), ConnectError>>,
Io: AsyncRead + AsyncWrite + Unpin,
{
type Item = ();
type Error = ();
type Output = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
if let Some(ref mut h2) = self.h2 {
return match h2.poll() {
Ok(Async::Ready((snd, connection))) => {
tokio_current_thread::spawn(connection.map_err(|_| ()));
let rx = self.rx.take().unwrap();
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.as_mut().project();
if let Some(ref mut h2) = this.h2 {
return match Pin::new(h2).poll(cx) {
Poll::Ready(Ok((snd, connection))) => {
actix_rt::spawn(connection.map(|_| ()));
let rx = this.rx.take().unwrap();
let _ = rx.send(Ok(IoConnection::new(
ConnectionType::H2(snd),
Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())),
Some(Acquired(this.key.clone(), this.inner.take())),
)));
Ok(Async::Ready(()))
Poll::Ready(())
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(err) => {
let _ = self.inner.take();
if let Some(rx) = self.rx.take() {
Poll::Pending => Poll::Pending,
Poll::Ready(Err(err)) => {
let _ = this.inner.take();
if let Some(rx) = this.rx.take() {
let _ = rx.send(Err(ConnectError::H2(err)));
}
Err(())
Poll::Ready(())
}
};
}
match self.fut.poll() {
Err(err) => {
let _ = self.inner.take();
if let Some(rx) = self.rx.take() {
match this.fut.poll(cx) {
Poll::Ready(Err(err)) => {
let _ = this.inner.take();
if let Some(rx) = this.rx.take() {
let _ = rx.send(Err(err));
}
Err(())
Poll::Ready(())
}
Ok(Async::Ready((io, proto))) => {
Poll::Ready(Ok((io, proto))) => {
if proto == Protocol::Http1 {
let rx = self.rx.take().unwrap();
let rx = this.rx.take().unwrap();
let _ = rx.send(Ok(IoConnection::new(
ConnectionType::H1(io),
Instant::now(),
Some(Acquired(self.key.clone(), self.inner.take())),
Some(Acquired(this.key.clone(), this.inner.take())),
)));
Ok(Async::Ready(()))
Poll::Ready(())
} else {
self.h2 = Some(handshake(io));
self.poll()
*this.h2 = Some(handshake(io, this.config).boxed_local());
self.poll(cx)
}
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Poll::Pending => Poll::Pending,
}
}
}
@@ -644,7 +616,7 @@ pub(crate) struct Acquired<T>(Key, Option<Rc<RefCell<Inner<T>>>>);
impl<T> Acquired<T>
where
T: AsyncRead + AsyncWrite + 'static,
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
pub(crate) fn close(&mut self, conn: IoConnection<T>) {
if let Some(inner) = self.1.take() {

View File

@@ -1,42 +1,40 @@
use std::cell::UnsafeCell;
use std::cell::RefCell;
use std::rc::Rc;
use std::task::{Context, Poll};
use actix_service::Service;
use futures::Poll;
#[doc(hidden)]
/// Service that allows to turn non-clone service to a service with `Clone` impl
pub(crate) struct CloneableService<T>(Rc<UnsafeCell<T>>);
///
/// # Panics
/// CloneableService might panic with some creative use of thread local storage.
/// See https://github.com/actix/actix-web/issues/1295 for example
pub(crate) struct CloneableService<T: Service>(Rc<RefCell<T>>);
impl<T> CloneableService<T> {
pub(crate) fn new(service: T) -> Self
where
T: Service,
{
Self(Rc::new(UnsafeCell::new(service)))
impl<T: Service> CloneableService<T> {
pub(crate) fn new(service: T) -> Self {
Self(Rc::new(RefCell::new(service)))
}
}
impl<T> Clone for CloneableService<T> {
impl<T: Service> Clone for CloneableService<T> {
fn clone(&self) -> Self {
Self(self.0.clone())
}
}
impl<T> Service for CloneableService<T>
where
T: Service,
{
impl<T: Service> Service for CloneableService<T> {
type Request = T::Request;
type Response = T::Response;
type Error = T::Error;
type Future = T::Future;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
unsafe { &mut *self.0.as_ref().get() }.poll_ready()
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.0.borrow_mut().poll_ready(cx)
}
fn call(&mut self, req: T::Request) -> Self::Future {
unsafe { &mut *self.0.as_ref().get() }.call(req)
self.0.borrow_mut().call(req)
}
}

View File

@@ -1,13 +1,13 @@
use std::cell::UnsafeCell;
use std::fmt;
use std::cell::Cell;
use std::fmt::Write;
use std::rc::Rc;
use std::time::{Duration, Instant};
use std::time::Duration;
use std::{fmt, net};
use actix_rt::time::{delay_for, delay_until, Delay, Instant};
use bytes::BytesMut;
use futures::{future, Future};
use time;
use tokio_timer::{sleep, Delay};
use futures_util::{future, FutureExt};
use time::OffsetDateTime;
// "Sun, 06 Nov 1994 08:49:37 GMT".len()
const DATE_VALUE_LENGTH: usize = 29;
@@ -47,6 +47,8 @@ struct Inner {
client_timeout: u64,
client_disconnect: u64,
ka_enabled: bool,
secure: bool,
local_addr: Option<std::net::SocketAddr>,
timer: DateService,
}
@@ -58,7 +60,7 @@ impl Clone for ServiceConfig {
impl Default for ServiceConfig {
fn default() -> Self {
Self::new(KeepAlive::Timeout(5), 0, 0)
Self::new(KeepAlive::Timeout(5), 0, 0, false, None)
}
}
@@ -68,6 +70,8 @@ impl ServiceConfig {
keep_alive: KeepAlive,
client_timeout: u64,
client_disconnect: u64,
secure: bool,
local_addr: Option<net::SocketAddr>,
) -> ServiceConfig {
let (keep_alive, ka_enabled) = match keep_alive {
KeepAlive::Timeout(val) => (val as u64, true),
@@ -85,10 +89,24 @@ impl ServiceConfig {
ka_enabled,
client_timeout,
client_disconnect,
secure,
local_addr,
timer: DateService::new(),
}))
}
#[inline]
/// Returns true if connection is secure(https)
pub fn secure(&self) -> bool {
self.0.secure
}
#[inline]
/// Returns the local address that this server is bound to.
pub fn local_addr(&self) -> Option<net::SocketAddr> {
self.0.local_addr
}
#[inline]
/// Keep alive duration if configured.
pub fn keep_alive(&self) -> Option<Duration> {
@@ -96,7 +114,7 @@ impl ServiceConfig {
}
#[inline]
/// Return state of connection keep-alive funcitonality
/// Return state of connection keep-alive functionality
pub fn keep_alive_enabled(&self) -> bool {
self.0.ka_enabled
}
@@ -104,10 +122,10 @@ impl ServiceConfig {
#[inline]
/// Client timeout for first request.
pub fn client_timer(&self) -> Option<Delay> {
let delay = self.0.client_timeout;
if delay != 0 {
Some(Delay::new(
self.0.timer.now() + Duration::from_millis(delay),
let delay_time = self.0.client_timeout;
if delay_time != 0 {
Some(delay_until(
self.0.timer.now() + Duration::from_millis(delay_time),
))
} else {
None
@@ -138,7 +156,7 @@ impl ServiceConfig {
/// Return keep-alive timer delay is configured.
pub fn keep_alive_timer(&self) -> Option<Delay> {
if let Some(ka) = self.0.keep_alive {
Some(Delay::new(self.0.timer.now() + ka))
Some(delay_until(self.0.timer.now() + ka))
} else {
None
}
@@ -193,7 +211,12 @@ impl Date {
}
fn update(&mut self) {
self.pos = 0;
write!(self, "{}", time::at_utc(time::get_time()).rfc822()).unwrap();
write!(
self,
"{}",
OffsetDateTime::now_utc().format("%a, %d %b %Y %H:%M:%S GMT")
)
.unwrap();
}
}
@@ -210,24 +233,24 @@ impl fmt::Write for Date {
struct DateService(Rc<DateServiceInner>);
struct DateServiceInner {
current: UnsafeCell<Option<(Date, Instant)>>,
current: Cell<Option<(Date, Instant)>>,
}
impl DateServiceInner {
fn new() -> Self {
DateServiceInner {
current: UnsafeCell::new(None),
current: Cell::new(None),
}
}
fn reset(&self) {
unsafe { (&mut *self.current.get()).take() };
self.current.take();
}
fn update(&self) {
let now = Instant::now();
let date = Date::new();
*(unsafe { &mut *self.current.get() }) = Some((date, now));
self.current.set(Some((date, now)));
}
}
@@ -237,54 +260,55 @@ impl DateService {
}
fn check_date(&self) {
if unsafe { (&*self.0.current.get()).is_none() } {
if self.0.current.get().is_none() {
self.0.update();
// periodic date update
let s = self.clone();
tokio_current_thread::spawn(sleep(Duration::from_millis(500)).then(
move |_| {
s.0.reset();
future::ok(())
},
));
actix_rt::spawn(delay_for(Duration::from_millis(500)).then(move |_| {
s.0.reset();
future::ready(())
}));
}
}
fn now(&self) -> Instant {
self.check_date();
unsafe { (&*self.0.current.get()).as_ref().unwrap().1 }
self.0.current.get().unwrap().1
}
fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
self.check_date();
f(&unsafe { (&*self.0.current.get()).as_ref().unwrap().0 })
f(&self.0.current.get().unwrap().0);
}
}
#[cfg(test)]
mod tests {
use super::*;
use actix_rt::System;
use futures::future;
// Test modifying the date from within the closure
// passed to `set_date`
#[test]
fn test_evil_date() {
let service = DateService::new();
// Make sure that `check_date` doesn't try to spawn a task
service.0.update();
service.set_date(|_| service.0.reset());
}
#[test]
fn test_date_len() {
assert_eq!(DATE_VALUE_LENGTH, "Sun, 06 Nov 1994 08:49:37 GMT".len());
}
#[test]
fn test_date() {
let mut rt = System::new("test");
let _ = rt.block_on(future::lazy(|| {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0);
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1);
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2);
assert_eq!(buf1, buf2);
future::ok::<_, ()>(())
}));
#[actix_rt::test]
async fn test_date() {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1);
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2);
assert_eq!(buf1, buf2);
}
}

View File

@@ -1,260 +0,0 @@
use std::borrow::Cow;
use chrono::Duration;
use time::Tm;
use super::{Cookie, SameSite};
/// Structure that follows the builder pattern for building `Cookie` structs.
///
/// To construct a cookie:
///
/// 1. Call [`Cookie::build`](struct.Cookie.html#method.build) to start building.
/// 2. Use any of the builder methods to set fields in the cookie.
/// 3. Call [finish](#method.finish) to retrieve the built cookie.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let cookie: Cookie = Cookie::build("name", "value")
/// .domain("www.rust-lang.org")
/// .path("/")
/// .secure(true)
/// .http_only(true)
/// .max_age(84600)
/// .finish();
/// # }
/// ```
#[derive(Debug, Clone)]
pub struct CookieBuilder {
/// The cookie being built.
cookie: Cookie<'static>,
}
impl CookieBuilder {
/// Creates a new `CookieBuilder` instance from the given name and value.
///
/// This method is typically called indirectly via
/// [Cookie::build](struct.Cookie.html#method.build).
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar").finish();
/// assert_eq!(c.name_value(), ("foo", "bar"));
/// ```
pub fn new<N, V>(name: N, value: V) -> CookieBuilder
where
N: Into<Cow<'static, str>>,
V: Into<Cow<'static, str>>,
{
CookieBuilder {
cookie: Cookie::new(name, value),
}
}
/// Sets the `expires` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .expires(time::now())
/// .finish();
///
/// assert!(c.expires().is_some());
/// # }
/// ```
#[inline]
pub fn expires(mut self, when: Tm) -> CookieBuilder {
self.cookie.set_expires(when);
self
}
/// Sets the `max_age` field in seconds in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .max_age(1800)
/// .finish();
///
/// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
/// # }
/// ```
#[inline]
pub fn max_age(self, seconds: i64) -> CookieBuilder {
self.max_age_time(Duration::seconds(seconds))
}
/// Sets the `max_age` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .max_age_time(time::Duration::minutes(30))
/// .finish();
///
/// assert_eq!(c.max_age(), Some(time::Duration::seconds(30 * 60)));
/// # }
/// ```
#[inline]
pub fn max_age_time(mut self, value: Duration) -> CookieBuilder {
self.cookie.set_max_age(value);
self
}
/// Sets the `domain` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .domain("www.rust-lang.org")
/// .finish();
///
/// assert_eq!(c.domain(), Some("www.rust-lang.org"));
/// ```
pub fn domain<D: Into<Cow<'static, str>>>(mut self, value: D) -> CookieBuilder {
self.cookie.set_domain(value);
self
}
/// Sets the `path` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .path("/")
/// .finish();
///
/// assert_eq!(c.path(), Some("/"));
/// ```
pub fn path<P: Into<Cow<'static, str>>>(mut self, path: P) -> CookieBuilder {
self.cookie.set_path(path);
self
}
/// Sets the `secure` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .secure(true)
/// .finish();
///
/// assert_eq!(c.secure(), Some(true));
/// ```
#[inline]
pub fn secure(mut self, value: bool) -> CookieBuilder {
self.cookie.set_secure(value);
self
}
/// Sets the `http_only` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .http_only(true)
/// .finish();
///
/// assert_eq!(c.http_only(), Some(true));
/// ```
#[inline]
pub fn http_only(mut self, value: bool) -> CookieBuilder {
self.cookie.set_http_only(value);
self
}
/// Sets the `same_site` field in the cookie being built.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{Cookie, SameSite};
///
/// let c = Cookie::build("foo", "bar")
/// .same_site(SameSite::Strict)
/// .finish();
///
/// assert_eq!(c.same_site(), Some(SameSite::Strict));
/// ```
#[inline]
pub fn same_site(mut self, value: SameSite) -> CookieBuilder {
self.cookie.set_same_site(value);
self
}
/// Makes the cookie being built 'permanent' by extending its expiration and
/// max age 20 years into the future.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
/// use chrono::Duration;
///
/// # fn main() {
/// let c = Cookie::build("foo", "bar")
/// .permanent()
/// .finish();
///
/// assert_eq!(c.max_age(), Some(Duration::days(365 * 20)));
/// # assert!(c.expires().is_some());
/// # }
/// ```
#[inline]
pub fn permanent(mut self) -> CookieBuilder {
self.cookie.make_permanent();
self
}
/// Finishes building and returns the built `Cookie`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Cookie;
///
/// let c = Cookie::build("foo", "bar")
/// .domain("crates.io")
/// .path("/")
/// .finish();
///
/// assert_eq!(c.name_value(), ("foo", "bar"));
/// assert_eq!(c.domain(), Some("crates.io"));
/// assert_eq!(c.path(), Some("/"));
/// ```
#[inline]
pub fn finish(self) -> Cookie<'static> {
self.cookie
}
}

View File

@@ -1,71 +0,0 @@
use std::borrow::Borrow;
use std::hash::{Hash, Hasher};
use std::ops::{Deref, DerefMut};
use super::Cookie;
/// A `DeltaCookie` is a helper structure used in a cookie jar. It wraps a
/// `Cookie` so that it can be hashed and compared purely by name. It further
/// records whether the wrapped cookie is a "removal" cookie, that is, a cookie
/// that when sent to the client removes the named cookie on the client's
/// machine.
#[derive(Clone, Debug)]
pub struct DeltaCookie {
pub cookie: Cookie<'static>,
pub removed: bool,
}
impl DeltaCookie {
/// Create a new `DeltaCookie` that is being added to a jar.
#[inline]
pub fn added(cookie: Cookie<'static>) -> DeltaCookie {
DeltaCookie {
cookie,
removed: false,
}
}
/// Create a new `DeltaCookie` that is being removed from a jar. The
/// `cookie` should be a "removal" cookie.
#[inline]
pub fn removed(cookie: Cookie<'static>) -> DeltaCookie {
DeltaCookie {
cookie,
removed: true,
}
}
}
impl Deref for DeltaCookie {
type Target = Cookie<'static>;
fn deref(&self) -> &Cookie<'static> {
&self.cookie
}
}
impl DerefMut for DeltaCookie {
fn deref_mut(&mut self) -> &mut Cookie<'static> {
&mut self.cookie
}
}
impl PartialEq for DeltaCookie {
fn eq(&self, other: &DeltaCookie) -> bool {
self.name() == other.name()
}
}
impl Eq for DeltaCookie {}
impl Hash for DeltaCookie {
fn hash<H: Hasher>(&self, state: &mut H) {
self.name().hash(state);
}
}
impl Borrow<str> for DeltaCookie {
fn borrow(&self) -> &str {
self.name()
}
}

View File

@@ -1,98 +0,0 @@
//! This module contains types that represent cookie properties that are not yet
//! standardized. That is, _draft_ features.
use std::fmt;
/// The `SameSite` cookie attribute.
///
/// A cookie with a `SameSite` attribute is imposed restrictions on when it is
/// sent to the origin server in a cross-site request. If the `SameSite`
/// attribute is "Strict", then the cookie is never sent in cross-site requests.
/// If the `SameSite` attribute is "Lax", the cookie is only sent in cross-site
/// requests with "safe" HTTP methods, i.e, `GET`, `HEAD`, `OPTIONS`, `TRACE`.
/// If the `SameSite` attribute is not present (made explicit via the
/// `SameSite::None` variant), then the cookie will be sent as normal.
///
/// **Note:** This cookie attribute is an HTTP draft! Its meaning and definition
/// are subject to change.
#[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)]
pub enum SameSite {
/// The "Strict" `SameSite` attribute.
Strict,
/// The "Lax" `SameSite` attribute.
Lax,
/// No `SameSite` attribute.
None,
}
impl SameSite {
/// Returns `true` if `self` is `SameSite::Strict` and `false` otherwise.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::SameSite;
///
/// let strict = SameSite::Strict;
/// assert!(strict.is_strict());
/// assert!(!strict.is_lax());
/// assert!(!strict.is_none());
/// ```
#[inline]
pub fn is_strict(self) -> bool {
match self {
SameSite::Strict => true,
SameSite::Lax | SameSite::None => false,
}
}
/// Returns `true` if `self` is `SameSite::Lax` and `false` otherwise.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::SameSite;
///
/// let lax = SameSite::Lax;
/// assert!(lax.is_lax());
/// assert!(!lax.is_strict());
/// assert!(!lax.is_none());
/// ```
#[inline]
pub fn is_lax(self) -> bool {
match self {
SameSite::Lax => true,
SameSite::Strict | SameSite::None => false,
}
}
/// Returns `true` if `self` is `SameSite::None` and `false` otherwise.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::SameSite;
///
/// let none = SameSite::None;
/// assert!(none.is_none());
/// assert!(!none.is_lax());
/// assert!(!none.is_strict());
/// ```
#[inline]
pub fn is_none(self) -> bool {
match self {
SameSite::None => true,
SameSite::Lax | SameSite::Strict => false,
}
}
}
impl fmt::Display for SameSite {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
match *self {
SameSite::Strict => write!(f, "Strict"),
SameSite::Lax => write!(f, "Lax"),
SameSite::None => Ok(()),
}
}
}

View File

@@ -1,655 +0,0 @@
use std::collections::HashSet;
use std::mem::replace;
use chrono::Duration;
use super::delta::DeltaCookie;
use super::Cookie;
#[cfg(feature = "secure-cookies")]
use super::secure::{Key, PrivateJar, SignedJar};
/// A collection of cookies that tracks its modifications.
///
/// A `CookieJar` provides storage for any number of cookies. Any changes made
/// to the jar are tracked; the changes can be retrieved via the
/// [delta](#method.delta) method which returns an interator over the changes.
///
/// # Usage
///
/// A jar's life begins via [new](#method.new) and calls to
/// [`add_original`](#method.add_original):
///
/// ```rust
/// use actix_http::cookie::{Cookie, CookieJar};
///
/// let mut jar = CookieJar::new();
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add_original(Cookie::new("second", "another"));
/// ```
///
/// Cookies can be added via [add](#method.add) and removed via
/// [remove](#method.remove). Finally, cookies can be looked up via
/// [get](#method.get):
///
/// ```rust
/// # use actix_http::cookie::{Cookie, CookieJar};
/// let mut jar = CookieJar::new();
/// jar.add(Cookie::new("a", "one"));
/// jar.add(Cookie::new("b", "two"));
///
/// assert_eq!(jar.get("a").map(|c| c.value()), Some("one"));
/// assert_eq!(jar.get("b").map(|c| c.value()), Some("two"));
///
/// jar.remove(Cookie::named("b"));
/// assert!(jar.get("b").is_none());
/// ```
///
/// # Deltas
///
/// A jar keeps track of any modifications made to it over time. The
/// modifications are recorded as cookies. The modifications can be retrieved
/// via [delta](#method.delta). Any new `Cookie` added to a jar via `add`
/// results in the same `Cookie` appearing in the `delta`; cookies added via
/// `add_original` do not count towards the delta. Any _original_ cookie that is
/// removed from a jar results in a "removal" cookie appearing in the delta. A
/// "removal" cookie is a cookie that a server sends so that the cookie is
/// removed from the client's machine.
///
/// Deltas are typically used to create `Set-Cookie` headers corresponding to
/// the changes made to a cookie jar over a period of time.
///
/// ```rust
/// # use actix_http::cookie::{Cookie, CookieJar};
/// let mut jar = CookieJar::new();
///
/// // original cookies don't affect the delta
/// jar.add_original(Cookie::new("original", "value"));
/// assert_eq!(jar.delta().count(), 0);
///
/// // new cookies result in an equivalent `Cookie` in the delta
/// jar.add(Cookie::new("a", "one"));
/// jar.add(Cookie::new("b", "two"));
/// assert_eq!(jar.delta().count(), 2);
///
/// // removing an original cookie adds a "removal" cookie to the delta
/// jar.remove(Cookie::named("original"));
/// assert_eq!(jar.delta().count(), 3);
///
/// // removing a new cookie that was added removes that `Cookie` from the delta
/// jar.remove(Cookie::named("a"));
/// assert_eq!(jar.delta().count(), 2);
/// ```
#[derive(Default, Debug, Clone)]
pub struct CookieJar {
original_cookies: HashSet<DeltaCookie>,
delta_cookies: HashSet<DeltaCookie>,
}
impl CookieJar {
/// Creates an empty cookie jar.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::CookieJar;
///
/// let jar = CookieJar::new();
/// assert_eq!(jar.iter().count(), 0);
/// ```
pub fn new() -> CookieJar {
CookieJar::default()
}
/// Returns a reference to the `Cookie` inside this jar with the name
/// `name`. If no such cookie exists, returns `None`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// assert!(jar.get("name").is_none());
///
/// jar.add(Cookie::new("name", "value"));
/// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
/// ```
pub fn get(&self, name: &str) -> Option<&Cookie<'static>> {
self.delta_cookies
.get(name)
.or_else(|| self.original_cookies.get(name))
.and_then(|c| if !c.removed { Some(&c.cookie) } else { None })
}
/// Adds an "original" `cookie` to this jar. If an original cookie with the
/// same name already exists, it is replaced with `cookie`. Cookies added
/// with `add` take precedence and are not replaced by this method.
///
/// Adding an original cookie does not affect the [delta](#method.delta)
/// computation. This method is intended to be used to seed the cookie jar
/// with cookies received from a client's HTTP message.
///
/// For accurate `delta` computations, this method should not be called
/// after calling `remove`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add_original(Cookie::new("second", "two"));
///
/// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
/// assert_eq!(jar.get("second").map(|c| c.value()), Some("two"));
/// assert_eq!(jar.iter().count(), 2);
/// assert_eq!(jar.delta().count(), 0);
/// ```
pub fn add_original(&mut self, cookie: Cookie<'static>) {
self.original_cookies.replace(DeltaCookie::added(cookie));
}
/// Adds `cookie` to this jar. If a cookie with the same name already
/// exists, it is replaced with `cookie`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// jar.add(Cookie::new("name", "value"));
/// jar.add(Cookie::new("second", "two"));
///
/// assert_eq!(jar.get("name").map(|c| c.value()), Some("value"));
/// assert_eq!(jar.get("second").map(|c| c.value()), Some("two"));
/// assert_eq!(jar.iter().count(), 2);
/// assert_eq!(jar.delta().count(), 2);
/// ```
pub fn add(&mut self, cookie: Cookie<'static>) {
self.delta_cookies.replace(DeltaCookie::added(cookie));
}
/// Removes `cookie` from this jar. If an _original_ cookie with the same
/// name as `cookie` is present in the jar, a _removal_ cookie will be
/// present in the `delta` computation. To properly generate the removal
/// cookie, `cookie` must contain the same `path` and `domain` as the cookie
/// that was initially set.
///
/// A "removal" cookie is a cookie that has the same name as the original
/// cookie but has an empty value, a max-age of 0, and an expiration date
/// far in the past.
///
/// # Example
///
/// Removing an _original_ cookie results in a _removal_ cookie:
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
/// use chrono::Duration;
///
/// # fn main() {
/// let mut jar = CookieJar::new();
///
/// // Assume this cookie originally had a path of "/" and domain of "a.b".
/// jar.add_original(Cookie::new("name", "value"));
///
/// // If the path and domain were set, they must be provided to `remove`.
/// jar.remove(Cookie::build("name", "").path("/").domain("a.b").finish());
///
/// // The delta will contain the removal cookie.
/// let delta: Vec<_> = jar.delta().collect();
/// assert_eq!(delta.len(), 1);
/// assert_eq!(delta[0].name(), "name");
/// assert_eq!(delta[0].max_age(), Some(Duration::seconds(0)));
/// # }
/// ```
///
/// Removing a new cookie does not result in a _removal_ cookie:
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// jar.add(Cookie::new("name", "value"));
/// assert_eq!(jar.delta().count(), 1);
///
/// jar.remove(Cookie::named("name"));
/// assert_eq!(jar.delta().count(), 0);
/// ```
pub fn remove(&mut self, mut cookie: Cookie<'static>) {
if self.original_cookies.contains(cookie.name()) {
cookie.set_value("");
cookie.set_max_age(Duration::seconds(0));
cookie.set_expires(time::now() - Duration::days(365));
self.delta_cookies.replace(DeltaCookie::removed(cookie));
} else {
self.delta_cookies.remove(cookie.name());
}
}
/// Removes `cookie` from this jar completely. This method differs from
/// `remove` in that no delta cookie is created under any condition. Neither
/// the `delta` nor `iter` methods will return a cookie that is removed
/// using this method.
///
/// # Example
///
/// Removing an _original_ cookie; no _removal_ cookie is generated:
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
/// use chrono::Duration;
///
/// # fn main() {
/// let mut jar = CookieJar::new();
///
/// // Add an original cookie and a new cookie.
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add(Cookie::new("key", "value"));
/// assert_eq!(jar.delta().count(), 1);
/// assert_eq!(jar.iter().count(), 2);
///
/// // Now force remove the original cookie.
/// jar.force_remove(Cookie::new("name", "value"));
/// assert_eq!(jar.delta().count(), 1);
/// assert_eq!(jar.iter().count(), 1);
///
/// // Now force remove the new cookie.
/// jar.force_remove(Cookie::new("key", "value"));
/// assert_eq!(jar.delta().count(), 0);
/// assert_eq!(jar.iter().count(), 0);
/// # }
/// ```
pub fn force_remove<'a>(&mut self, cookie: Cookie<'a>) {
self.original_cookies.remove(cookie.name());
self.delta_cookies.remove(cookie.name());
}
/// Removes all cookies from this cookie jar.
#[deprecated(
since = "0.7.0",
note = "calling this method may not remove \
all cookies since the path and domain are not specified; use \
`remove` instead"
)]
pub fn clear(&mut self) {
self.delta_cookies.clear();
for delta in replace(&mut self.original_cookies, HashSet::new()) {
self.remove(delta.cookie);
}
}
/// Returns an iterator over cookies that represent the changes to this jar
/// over time. These cookies can be rendered directly as `Set-Cookie` header
/// values to affect the changes made to this jar on the client.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add_original(Cookie::new("second", "two"));
///
/// // Add new cookies.
/// jar.add(Cookie::new("new", "third"));
/// jar.add(Cookie::new("another", "fourth"));
/// jar.add(Cookie::new("yac", "fifth"));
///
/// // Remove some cookies.
/// jar.remove(Cookie::named("name"));
/// jar.remove(Cookie::named("another"));
///
/// // Delta contains two new cookies ("new", "yac") and a removal ("name").
/// assert_eq!(jar.delta().count(), 3);
/// ```
pub fn delta(&self) -> Delta {
Delta {
iter: self.delta_cookies.iter(),
}
}
/// Returns an iterator over all of the cookies present in this jar.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie};
///
/// let mut jar = CookieJar::new();
///
/// jar.add_original(Cookie::new("name", "value"));
/// jar.add_original(Cookie::new("second", "two"));
///
/// jar.add(Cookie::new("new", "third"));
/// jar.add(Cookie::new("another", "fourth"));
/// jar.add(Cookie::new("yac", "fifth"));
///
/// jar.remove(Cookie::named("name"));
/// jar.remove(Cookie::named("another"));
///
/// // There are three cookies in the jar: "second", "new", and "yac".
/// # assert_eq!(jar.iter().count(), 3);
/// for cookie in jar.iter() {
/// match cookie.name() {
/// "second" => assert_eq!(cookie.value(), "two"),
/// "new" => assert_eq!(cookie.value(), "third"),
/// "yac" => assert_eq!(cookie.value(), "fifth"),
/// _ => unreachable!("there are only three cookies in the jar")
/// }
/// }
/// ```
pub fn iter(&self) -> Iter {
Iter {
delta_cookies: self
.delta_cookies
.iter()
.chain(self.original_cookies.difference(&self.delta_cookies)),
}
}
/// Returns a `PrivateJar` with `self` as its parent jar using the key `key`
/// to sign/encrypt and verify/decrypt cookies added/retrieved from the
/// child jar.
///
/// Any modifications to the child jar will be reflected on the parent jar,
/// and any retrievals from the child jar will be made from the parent jar.
///
/// This method is only available when the `secure` feature is enabled.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{Cookie, CookieJar, Key};
///
/// // Generate a secure key.
/// let key = Key::generate();
///
/// // Add a private (signed + encrypted) cookie.
/// let mut jar = CookieJar::new();
/// jar.private(&key).add(Cookie::new("private", "text"));
///
/// // The cookie's contents are encrypted.
/// assert_ne!(jar.get("private").unwrap().value(), "text");
///
/// // They can be decrypted and verified through the child jar.
/// assert_eq!(jar.private(&key).get("private").unwrap().value(), "text");
///
/// // A tampered with cookie does not validate but still exists.
/// let mut cookie = jar.get("private").unwrap().clone();
/// jar.add(Cookie::new("private", cookie.value().to_string() + "!"));
/// assert!(jar.private(&key).get("private").is_none());
/// assert!(jar.get("private").is_some());
/// ```
#[cfg(feature = "secure-cookies")]
pub fn private(&mut self, key: &Key) -> PrivateJar {
PrivateJar::new(self, key)
}
/// Returns a `SignedJar` with `self` as its parent jar using the key `key`
/// to sign/verify cookies added/retrieved from the child jar.
///
/// Any modifications to the child jar will be reflected on the parent jar,
/// and any retrievals from the child jar will be made from the parent jar.
///
/// This method is only available when the `secure` feature is enabled.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{Cookie, CookieJar, Key};
///
/// // Generate a secure key.
/// let key = Key::generate();
///
/// // Add a signed cookie.
/// let mut jar = CookieJar::new();
/// jar.signed(&key).add(Cookie::new("signed", "text"));
///
/// // The cookie's contents are signed but still in plaintext.
/// assert_ne!(jar.get("signed").unwrap().value(), "text");
/// assert!(jar.get("signed").unwrap().value().contains("text"));
///
/// // They can be verified through the child jar.
/// assert_eq!(jar.signed(&key).get("signed").unwrap().value(), "text");
///
/// // A tampered with cookie does not validate but still exists.
/// let mut cookie = jar.get("signed").unwrap().clone();
/// jar.add(Cookie::new("signed", cookie.value().to_string() + "!"));
/// assert!(jar.signed(&key).get("signed").is_none());
/// assert!(jar.get("signed").is_some());
/// ```
#[cfg(feature = "secure-cookies")]
pub fn signed(&mut self, key: &Key) -> SignedJar {
SignedJar::new(self, key)
}
}
use std::collections::hash_set::Iter as HashSetIter;
/// Iterator over the changes to a cookie jar.
pub struct Delta<'a> {
iter: HashSetIter<'a, DeltaCookie>,
}
impl<'a> Iterator for Delta<'a> {
type Item = &'a Cookie<'static>;
fn next(&mut self) -> Option<&'a Cookie<'static>> {
self.iter.next().map(|c| &c.cookie)
}
}
use std::collections::hash_map::RandomState;
use std::collections::hash_set::Difference;
use std::iter::Chain;
/// Iterator over all of the cookies in a jar.
pub struct Iter<'a> {
delta_cookies:
Chain<HashSetIter<'a, DeltaCookie>, Difference<'a, DeltaCookie, RandomState>>,
}
impl<'a> Iterator for Iter<'a> {
type Item = &'a Cookie<'static>;
fn next(&mut self) -> Option<&'a Cookie<'static>> {
for cookie in self.delta_cookies.by_ref() {
if !cookie.removed {
return Some(&*cookie);
}
}
None
}
}
#[cfg(test)]
mod test {
#[cfg(feature = "secure-cookies")]
use super::Key;
use super::{Cookie, CookieJar};
#[test]
#[allow(deprecated)]
fn simple() {
let mut c = CookieJar::new();
c.add(Cookie::new("test", ""));
c.add(Cookie::new("test2", ""));
c.remove(Cookie::named("test"));
assert!(c.get("test").is_none());
assert!(c.get("test2").is_some());
c.add(Cookie::new("test3", ""));
c.clear();
assert!(c.get("test").is_none());
assert!(c.get("test2").is_none());
assert!(c.get("test3").is_none());
}
#[test]
fn jar_is_send() {
fn is_send<T: Send>(_: T) -> bool {
true
}
assert!(is_send(CookieJar::new()))
}
#[test]
#[cfg(feature = "secure-cookies")]
fn iter() {
let key = Key::generate();
let mut c = CookieJar::new();
c.add_original(Cookie::new("original", "original"));
c.add(Cookie::new("test", "test"));
c.add(Cookie::new("test2", "test2"));
c.add(Cookie::new("test3", "test3"));
assert_eq!(c.iter().count(), 4);
c.signed(&key).add(Cookie::new("signed", "signed"));
c.private(&key).add(Cookie::new("encrypted", "encrypted"));
assert_eq!(c.iter().count(), 6);
c.remove(Cookie::named("test"));
assert_eq!(c.iter().count(), 5);
c.remove(Cookie::named("signed"));
c.remove(Cookie::named("test2"));
assert_eq!(c.iter().count(), 3);
c.add(Cookie::new("test2", "test2"));
assert_eq!(c.iter().count(), 4);
c.remove(Cookie::named("test2"));
assert_eq!(c.iter().count(), 3);
}
#[test]
#[cfg(feature = "secure-cookies")]
fn delta() {
use chrono::Duration;
use std::collections::HashMap;
let mut c = CookieJar::new();
c.add_original(Cookie::new("original", "original"));
c.add_original(Cookie::new("original1", "original1"));
c.add(Cookie::new("test", "test"));
c.add(Cookie::new("test2", "test2"));
c.add(Cookie::new("test3", "test3"));
c.add(Cookie::new("test4", "test4"));
c.remove(Cookie::named("test"));
c.remove(Cookie::named("original"));
assert_eq!(c.delta().count(), 4);
let names: HashMap<_, _> = c.delta().map(|c| (c.name(), c.max_age())).collect();
assert!(names.get("test2").unwrap().is_none());
assert!(names.get("test3").unwrap().is_none());
assert!(names.get("test4").unwrap().is_none());
assert_eq!(names.get("original").unwrap(), &Some(Duration::seconds(0)));
}
#[test]
fn replace_original() {
let mut jar = CookieJar::new();
jar.add_original(Cookie::new("original_a", "a"));
jar.add_original(Cookie::new("original_b", "b"));
assert_eq!(jar.get("original_a").unwrap().value(), "a");
jar.add(Cookie::new("original_a", "av2"));
assert_eq!(jar.get("original_a").unwrap().value(), "av2");
}
#[test]
fn empty_delta() {
let mut jar = CookieJar::new();
jar.add(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().count(), 0);
jar.add_original(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 0);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().count(), 1);
jar.add(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().count(), 1);
}
#[test]
fn add_remove_add() {
let mut jar = CookieJar::new();
jar.add_original(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 0);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
// The cookie's been deleted. Another original doesn't change that.
jar.add_original(Cookie::new("name", "val"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
jar.add(Cookie::new("name", "val"));
assert_eq!(jar.delta().filter(|c| !c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().count(), 1);
}
#[test]
fn replace_remove() {
let mut jar = CookieJar::new();
jar.add_original(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 0);
jar.add(Cookie::new("name", "val"));
assert_eq!(jar.delta().count(), 1);
assert_eq!(jar.delta().filter(|c| !c.value().is_empty()).count(), 1);
jar.remove(Cookie::named("name"));
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
}
#[test]
fn remove_with_path() {
let mut jar = CookieJar::new();
jar.add_original(Cookie::build("name", "val").finish());
assert_eq!(jar.iter().count(), 1);
assert_eq!(jar.delta().count(), 0);
assert_eq!(jar.iter().filter(|c| c.path().is_none()).count(), 1);
jar.remove(Cookie::build("name", "").path("/").finish());
assert_eq!(jar.iter().count(), 0);
assert_eq!(jar.delta().count(), 1);
assert_eq!(jar.delta().filter(|c| c.value().is_empty()).count(), 1);
assert_eq!(jar.delta().filter(|c| c.path() == Some("/")).count(), 1);
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -1,425 +0,0 @@
use std::borrow::Cow;
use std::cmp;
use std::convert::From;
use std::error::Error;
use std::fmt;
use std::str::Utf8Error;
use chrono::Duration;
use percent_encoding::percent_decode;
use super::{Cookie, CookieStr, SameSite};
/// Enum corresponding to a parsing error.
#[derive(Debug, PartialEq, Eq, Clone, Copy)]
pub enum ParseError {
/// The cookie did not contain a name/value pair.
MissingPair,
/// The cookie's name was empty.
EmptyName,
/// Decoding the cookie's name or value resulted in invalid UTF-8.
Utf8Error(Utf8Error),
/// It is discouraged to exhaustively match on this enum as its variants may
/// grow without a breaking-change bump in version numbers.
#[doc(hidden)]
__Nonexhasutive,
}
impl ParseError {
/// Returns a description of this error as a string
pub fn as_str(&self) -> &'static str {
match *self {
ParseError::MissingPair => "the cookie is missing a name/value pair",
ParseError::EmptyName => "the cookie's name is empty",
ParseError::Utf8Error(_) => {
"decoding the cookie's name or value resulted in invalid UTF-8"
}
ParseError::__Nonexhasutive => unreachable!("__Nonexhasutive ParseError"),
}
}
}
impl fmt::Display for ParseError {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
write!(f, "{}", self.as_str())
}
}
impl From<Utf8Error> for ParseError {
fn from(error: Utf8Error) -> ParseError {
ParseError::Utf8Error(error)
}
}
impl Error for ParseError {
fn description(&self) -> &str {
self.as_str()
}
}
fn indexes_of(needle: &str, haystack: &str) -> Option<(usize, usize)> {
let haystack_start = haystack.as_ptr() as usize;
let needle_start = needle.as_ptr() as usize;
if needle_start < haystack_start {
return None;
}
if (needle_start + needle.len()) > (haystack_start + haystack.len()) {
return None;
}
let start = needle_start - haystack_start;
let end = start + needle.len();
Some((start, end))
}
fn name_val_decoded(
name: &str,
val: &str,
) -> Result<(CookieStr, CookieStr), ParseError> {
let decoded_name = percent_decode(name.as_bytes()).decode_utf8()?;
let decoded_value = percent_decode(val.as_bytes()).decode_utf8()?;
let name = CookieStr::Concrete(Cow::Owned(decoded_name.into_owned()));
let val = CookieStr::Concrete(Cow::Owned(decoded_value.into_owned()));
Ok((name, val))
}
// This function does the real parsing but _does not_ set the `cookie_string` in
// the returned cookie object. This only exists so that the borrow to `s` is
// returned at the end of the call, allowing the `cookie_string` field to be
// set in the outer `parse` function.
fn parse_inner<'c>(s: &str, decode: bool) -> Result<Cookie<'c>, ParseError> {
let mut attributes = s.split(';');
let key_value = match attributes.next() {
Some(s) => s,
_ => panic!(),
};
// Determine the name = val.
let (name, value) = match key_value.find('=') {
Some(i) => (key_value[..i].trim(), key_value[(i + 1)..].trim()),
None => return Err(ParseError::MissingPair),
};
if name.is_empty() {
return Err(ParseError::EmptyName);
}
// Create a cookie with all of the defaults. We'll fill things in while we
// iterate through the parameters below.
let (name, value) = if decode {
name_val_decoded(name, value)?
} else {
let name_indexes = indexes_of(name, s).expect("name sub");
let value_indexes = indexes_of(value, s).expect("value sub");
let name = CookieStr::Indexed(name_indexes.0, name_indexes.1);
let value = CookieStr::Indexed(value_indexes.0, value_indexes.1);
(name, value)
};
let mut cookie = Cookie {
name,
value,
cookie_string: None,
expires: None,
max_age: None,
domain: None,
path: None,
secure: None,
http_only: None,
same_site: None,
};
for attr in attributes {
let (key, value) = match attr.find('=') {
Some(i) => (attr[..i].trim(), Some(attr[(i + 1)..].trim())),
None => (attr.trim(), None),
};
match (&*key.to_ascii_lowercase(), value) {
("secure", _) => cookie.secure = Some(true),
("httponly", _) => cookie.http_only = Some(true),
("max-age", Some(v)) => {
// See RFC 6265 Section 5.2.2, negative values indicate that the
// earliest possible expiration time should be used, so set the
// max age as 0 seconds.
cookie.max_age = match v.parse() {
Ok(val) if val <= 0 => Some(Duration::zero()),
Ok(val) => {
// Don't panic if the max age seconds is greater than what's supported by
// `Duration`.
let val = cmp::min(val, Duration::max_value().num_seconds());
Some(Duration::seconds(val))
}
Err(_) => continue,
};
}
("domain", Some(mut domain)) if !domain.is_empty() => {
if domain.starts_with('.') {
domain = &domain[1..];
}
let (i, j) = indexes_of(domain, s).expect("domain sub");
cookie.domain = Some(CookieStr::Indexed(i, j));
}
("path", Some(v)) => {
let (i, j) = indexes_of(v, s).expect("path sub");
cookie.path = Some(CookieStr::Indexed(i, j));
}
("samesite", Some(v)) => {
if v.eq_ignore_ascii_case("strict") {
cookie.same_site = Some(SameSite::Strict);
} else if v.eq_ignore_ascii_case("lax") {
cookie.same_site = Some(SameSite::Lax);
} else {
// We do nothing here, for now. When/if the `SameSite`
// attribute becomes standard, the spec says that we should
// ignore this cookie, i.e, fail to parse it, when an
// invalid value is passed in. The draft is at
// http://httpwg.org/http-extensions/draft-ietf-httpbis-cookie-same-site.html.
}
}
("expires", Some(v)) => {
// Try strptime with three date formats according to
// http://tools.ietf.org/html/rfc2616#section-3.3.1. Try
// additional ones as encountered in the real world.
let tm = time::strptime(v, "%a, %d %b %Y %H:%M:%S %Z")
.or_else(|_| time::strptime(v, "%A, %d-%b-%y %H:%M:%S %Z"))
.or_else(|_| time::strptime(v, "%a, %d-%b-%Y %H:%M:%S %Z"))
.or_else(|_| time::strptime(v, "%a %b %d %H:%M:%S %Y"));
if let Ok(time) = tm {
cookie.expires = Some(time)
}
}
_ => {
// We're going to be permissive here. If we have no idea what
// this is, then it's something nonstandard. We're not going to
// store it (because it's not compliant), but we're also not
// going to emit an error.
}
}
}
Ok(cookie)
}
pub fn parse_cookie<'c, S>(cow: S, decode: bool) -> Result<Cookie<'c>, ParseError>
where
S: Into<Cow<'c, str>>,
{
let s = cow.into();
let mut cookie = parse_inner(&s, decode)?;
cookie.cookie_string = Some(s);
Ok(cookie)
}
#[cfg(test)]
mod tests {
use super::{Cookie, SameSite};
use chrono::Duration;
use time::strptime;
macro_rules! assert_eq_parse {
($string:expr, $expected:expr) => {
let cookie = match Cookie::parse($string) {
Ok(cookie) => cookie,
Err(e) => panic!("Failed to parse {:?}: {:?}", $string, e),
};
assert_eq!(cookie, $expected);
};
}
macro_rules! assert_ne_parse {
($string:expr, $expected:expr) => {
let cookie = match Cookie::parse($string) {
Ok(cookie) => cookie,
Err(e) => panic!("Failed to parse {:?}: {:?}", $string, e),
};
assert_ne!(cookie, $expected);
};
}
#[test]
fn parse_same_site() {
let expected = Cookie::build("foo", "bar")
.same_site(SameSite::Lax)
.finish();
assert_eq_parse!("foo=bar; SameSite=Lax", expected);
assert_eq_parse!("foo=bar; SameSite=lax", expected);
assert_eq_parse!("foo=bar; SameSite=LAX", expected);
assert_eq_parse!("foo=bar; samesite=Lax", expected);
assert_eq_parse!("foo=bar; SAMESITE=Lax", expected);
let expected = Cookie::build("foo", "bar")
.same_site(SameSite::Strict)
.finish();
assert_eq_parse!("foo=bar; SameSite=Strict", expected);
assert_eq_parse!("foo=bar; SameSITE=Strict", expected);
assert_eq_parse!("foo=bar; SameSite=strict", expected);
assert_eq_parse!("foo=bar; SameSite=STrICT", expected);
assert_eq_parse!("foo=bar; SameSite=STRICT", expected);
}
#[test]
fn parse() {
assert!(Cookie::parse("bar").is_err());
assert!(Cookie::parse("=bar").is_err());
assert!(Cookie::parse(" =bar").is_err());
assert!(Cookie::parse("foo=").is_ok());
let expected = Cookie::build("foo", "bar=baz").finish();
assert_eq_parse!("foo=bar=baz", expected);
let mut expected = Cookie::build("foo", "bar").finish();
assert_eq_parse!("foo=bar", expected);
assert_eq_parse!("foo = bar", expected);
assert_eq_parse!(" foo=bar ", expected);
assert_eq_parse!(" foo=bar ;Domain=", expected);
assert_eq_parse!(" foo=bar ;Domain= ", expected);
assert_eq_parse!(" foo=bar ;Ignored", expected);
let mut unexpected = Cookie::build("foo", "bar").http_only(false).finish();
assert_ne_parse!(" foo=bar ;HttpOnly", unexpected);
assert_ne_parse!(" foo=bar; httponly", unexpected);
expected.set_http_only(true);
assert_eq_parse!(" foo=bar ;HttpOnly", expected);
assert_eq_parse!(" foo=bar ;httponly", expected);
assert_eq_parse!(" foo=bar ;HTTPONLY=whatever", expected);
assert_eq_parse!(" foo=bar ; sekure; HTTPONLY", expected);
expected.set_secure(true);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure=aaaa", expected);
unexpected.set_http_only(true);
unexpected.set_secure(true);
assert_ne_parse!(" foo=bar ;HttpOnly; skeure", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; =secure", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly;", unexpected);
unexpected.set_secure(false);
assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; secure", unexpected);
expected.set_max_age(Duration::zero());
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=0", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 0 ", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=-1", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = -1 ", expected);
expected.set_max_age(Duration::minutes(1));
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=60", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 60 ", expected);
expected.set_max_age(Duration::seconds(4));
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=4", expected);
assert_eq_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 4 ", expected);
unexpected.set_secure(true);
unexpected.set_max_age(Duration::minutes(1));
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=122", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 38 ", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age=51", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = -1 ", unexpected);
assert_ne_parse!(" foo=bar ;HttpOnly; Secure; Max-Age = 0", unexpected);
expected.set_path("/");
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/", expected);
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/", expected);
expected.set_path("/foo");
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/foo", expected);
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/foo", expected);
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;path=/foo", expected);
assert_eq_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;path = /foo", expected);
unexpected.set_max_age(Duration::seconds(4));
unexpected.set_path("/bar");
assert_ne_parse!("foo=bar;HttpOnly; Secure; Max-Age=4; Path=/foo", unexpected);
assert_ne_parse!("foo=bar;HttpOnly; Secure; Max-Age=4;Path=/baz", unexpected);
expected.set_domain("www.foo.com");
assert_eq_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=www.foo.com",
expected
);
expected.set_domain("foo.com");
assert_eq_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=foo.com",
expected
);
assert_eq_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=FOO.COM",
expected
);
unexpected.set_path("/foo");
unexpected.set_domain("bar.com");
assert_ne_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=foo.com",
unexpected
);
assert_ne_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=FOO.COM",
unexpected
);
let time_str = "Wed, 21 Oct 2015 07:28:00 GMT";
let expires = strptime(time_str, "%a, %d %b %Y %H:%M:%S %Z").unwrap();
expected.set_expires(expires);
assert_eq_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=foo.com; Expires=Wed, 21 Oct 2015 07:28:00 GMT",
expected
);
unexpected.set_domain("foo.com");
let bad_expires = strptime(time_str, "%a, %d %b %Y %H:%S:%M %Z").unwrap();
expected.set_expires(bad_expires);
assert_ne_parse!(
" foo=bar ;HttpOnly; Secure; Max-Age=4; Path=/foo; \
Domain=foo.com; Expires=Wed, 21 Oct 2015 07:28:00 GMT",
unexpected
);
}
#[test]
fn odd_characters() {
let expected = Cookie::new("foo", "b%2Fr");
assert_eq_parse!("foo=b%2Fr", expected);
}
#[test]
fn odd_characters_encoded() {
let expected = Cookie::new("foo", "b/r");
let cookie = match Cookie::parse_encoded("foo=b%2Fr") {
Ok(cookie) => cookie,
Err(e) => panic!("Failed to parse: {:?}", e),
};
assert_eq!(cookie, expected);
}
#[test]
fn do_not_panic_on_large_max_ages() {
let max_seconds = Duration::max_value().num_seconds();
let expected = Cookie::build("foo", "bar").max_age(max_seconds).finish();
assert_eq_parse!(format!(" foo=bar; Max-Age={:?}", max_seconds + 1), expected);
}
}

View File

@@ -1,180 +0,0 @@
use ring::digest::{Algorithm, SHA256};
use ring::hkdf::expand;
use ring::hmac::SigningKey;
use ring::rand::{SecureRandom, SystemRandom};
use super::private::KEY_LEN as PRIVATE_KEY_LEN;
use super::signed::KEY_LEN as SIGNED_KEY_LEN;
static HKDF_DIGEST: &Algorithm = &SHA256;
const KEYS_INFO: &str = "COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM";
/// A cryptographic master key for use with `Signed` and/or `Private` jars.
///
/// This structure encapsulates secure, cryptographic keys for use with both
/// [PrivateJar](struct.PrivateJar.html) and [SignedJar](struct.SignedJar.html).
/// It can be derived from a single master key via
/// [from_master](#method.from_master) or generated from a secure random source
/// via [generate](#method.generate). A single instance of `Key` can be used for
/// both a `PrivateJar` and a `SignedJar`.
///
/// This type is only available when the `secure` feature is enabled.
#[derive(Clone)]
pub struct Key {
signing_key: [u8; SIGNED_KEY_LEN],
encryption_key: [u8; PRIVATE_KEY_LEN],
}
impl Key {
/// Derives new signing/encryption keys from a master key.
///
/// The master key must be at least 256-bits (32 bytes). For security, the
/// master key _must_ be cryptographically random. The keys are derived
/// deterministically from the master key.
///
/// # Panics
///
/// Panics if `key` is less than 32 bytes in length.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// # /*
/// let master_key = { /* a cryptographically random key >= 32 bytes */ };
/// # */
/// # let master_key: &Vec<u8> = &(0..32).collect();
///
/// let key = Key::from_master(master_key);
/// ```
pub fn from_master(key: &[u8]) -> Key {
if key.len() < 32 {
panic!(
"bad master key length: expected at least 32 bytes, found {}",
key.len()
);
}
// Expand the user's key into two.
let prk = SigningKey::new(HKDF_DIGEST, key);
let mut both_keys = [0; SIGNED_KEY_LEN + PRIVATE_KEY_LEN];
expand(&prk, KEYS_INFO.as_bytes(), &mut both_keys);
// Copy the keys into their respective arrays.
let mut signing_key = [0; SIGNED_KEY_LEN];
let mut encryption_key = [0; PRIVATE_KEY_LEN];
signing_key.copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
encryption_key.copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
Key {
signing_key,
encryption_key,
}
}
/// Generates signing/encryption keys from a secure, random source. Keys are
/// generated nondeterministically.
///
/// # Panics
///
/// Panics if randomness cannot be retrieved from the operating system. See
/// [try_generate](#method.try_generate) for a non-panicking version.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// let key = Key::generate();
/// ```
pub fn generate() -> Key {
Self::try_generate().expect("failed to generate `Key` from randomness")
}
/// Attempts to generate signing/encryption keys from a secure, random
/// source. Keys are generated nondeterministically. If randomness cannot be
/// retrieved from the underlying operating system, returns `None`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// let key = Key::try_generate();
/// ```
pub fn try_generate() -> Option<Key> {
let mut sign_key = [0; SIGNED_KEY_LEN];
let mut enc_key = [0; PRIVATE_KEY_LEN];
let rng = SystemRandom::new();
if rng.fill(&mut sign_key).is_err() || rng.fill(&mut enc_key).is_err() {
return None;
}
Some(Key {
signing_key: sign_key,
encryption_key: enc_key,
})
}
/// Returns the raw bytes of a key suitable for signing cookies.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// let key = Key::generate();
/// let signing_key = key.signing();
/// ```
pub fn signing(&self) -> &[u8] {
&self.signing_key[..]
}
/// Returns the raw bytes of a key suitable for encrypting cookies.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::Key;
///
/// let key = Key::generate();
/// let encryption_key = key.encryption();
/// ```
pub fn encryption(&self) -> &[u8] {
&self.encryption_key[..]
}
}
#[cfg(test)]
mod test {
use super::Key;
#[test]
fn deterministic_from_master() {
let master_key: Vec<u8> = (0..32).collect();
let key_a = Key::from_master(&master_key);
let key_b = Key::from_master(&master_key);
assert_eq!(key_a.signing(), key_b.signing());
assert_eq!(key_a.encryption(), key_b.encryption());
assert_ne!(key_a.encryption(), key_a.signing());
let master_key_2: Vec<u8> = (32..64).collect();
let key_2 = Key::from_master(&master_key_2);
assert_ne!(key_2.signing(), key_a.signing());
assert_ne!(key_2.encryption(), key_a.encryption());
}
#[test]
fn non_deterministic_generate() {
let key_a = Key::generate();
let key_b = Key::generate();
assert_ne!(key_a.signing(), key_b.signing());
assert_ne!(key_a.encryption(), key_b.encryption());
}
}

View File

@@ -1,40 +0,0 @@
#[cfg(test)]
macro_rules! assert_simple_behaviour {
($clear:expr, $secure:expr) => {{
assert_eq!($clear.iter().count(), 0);
$secure.add(Cookie::new("name", "val"));
assert_eq!($clear.iter().count(), 1);
assert_eq!($secure.get("name").unwrap().value(), "val");
assert_ne!($clear.get("name").unwrap().value(), "val");
$secure.add(Cookie::new("another", "two"));
assert_eq!($clear.iter().count(), 2);
$clear.remove(Cookie::named("another"));
assert_eq!($clear.iter().count(), 1);
$secure.remove(Cookie::named("name"));
assert_eq!($clear.iter().count(), 0);
}};
}
#[cfg(test)]
macro_rules! assert_secure_behaviour {
($clear:expr, $secure:expr) => {{
$secure.add(Cookie::new("secure", "secure"));
assert!($clear.get("secure").unwrap().value() != "secure");
assert!($secure.get("secure").unwrap().value() == "secure");
let mut cookie = $clear.get("secure").unwrap().clone();
let new_val = format!("{}l", cookie.value());
cookie.set_value(new_val);
$clear.add(cookie);
assert!($secure.get("secure").is_none());
let mut cookie = $clear.get("secure").unwrap().clone();
cookie.set_value("foobar");
$clear.add(cookie);
assert!($secure.get("secure").is_none());
}};
}

View File

@@ -1,10 +0,0 @@
//! Fork of https://github.com/alexcrichton/cookie-rs
#[macro_use]
mod macros;
mod key;
mod private;
mod signed;
pub use self::key::*;
pub use self::private::*;
pub use self::signed::*;

View File

@@ -1,269 +0,0 @@
use std::str;
use log::warn;
use ring::aead::{open_in_place, seal_in_place, Aad, Algorithm, Nonce, AES_256_GCM};
use ring::aead::{OpeningKey, SealingKey};
use ring::rand::{SecureRandom, SystemRandom};
use super::Key;
use crate::cookie::{Cookie, CookieJar};
// Keep these in sync, and keep the key len synced with the `private` docs as
// well as the `KEYS_INFO` const in secure::Key.
static ALGO: &Algorithm = &AES_256_GCM;
const NONCE_LEN: usize = 12;
pub const KEY_LEN: usize = 32;
/// A child cookie jar that provides authenticated encryption for its cookies.
///
/// A _private_ child jar signs and encrypts all the cookies added to it and
/// verifies and decrypts cookies retrieved from it. Any cookies stored in a
/// `PrivateJar` are simultaneously assured confidentiality, integrity, and
/// authenticity. In other words, clients cannot discover nor tamper with the
/// contents of a cookie, nor can they fabricate cookie data.
///
/// This type is only available when the `secure` feature is enabled.
pub struct PrivateJar<'a> {
parent: &'a mut CookieJar,
key: [u8; KEY_LEN],
}
impl<'a> PrivateJar<'a> {
/// Creates a new child `PrivateJar` with parent `parent` and key `key`.
/// This method is typically called indirectly via the `signed` method of
/// `CookieJar`.
#[doc(hidden)]
pub fn new(parent: &'a mut CookieJar, key: &Key) -> PrivateJar<'a> {
let mut key_array = [0u8; KEY_LEN];
key_array.copy_from_slice(key.encryption());
PrivateJar {
parent,
key: key_array,
}
}
/// Given a sealed value `str` and a key name `name`, where the nonce is
/// prepended to the original value and then both are Base64 encoded,
/// verifies and decrypts the sealed value and returns it. If there's a
/// problem, returns an `Err` with a string describing the issue.
fn unseal(&self, name: &str, value: &str) -> Result<String, &'static str> {
let mut data = base64::decode(value).map_err(|_| "bad base64 value")?;
if data.len() <= NONCE_LEN {
return Err("length of decoded data is <= NONCE_LEN");
}
let ad = Aad::from(name.as_bytes());
let key = OpeningKey::new(ALGO, &self.key).expect("opening key");
let (nonce, sealed) = data.split_at_mut(NONCE_LEN);
let nonce =
Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
let unsealed = open_in_place(&key, nonce, ad, 0, sealed)
.map_err(|_| "invalid key/nonce/value: bad seal")?;
if let Ok(unsealed_utf8) = str::from_utf8(unsealed) {
Ok(unsealed_utf8.to_string())
} else {
warn!(
"Private cookie does not have utf8 content!
It is likely the secret key used to encrypt them has been leaked.
Please change it as soon as possible."
);
Err("bad unsealed utf8")
}
}
/// Returns a reference to the `Cookie` inside this jar with the name `name`
/// and authenticates and decrypts the cookie's value, returning a `Cookie`
/// with the decrypted value. If the cookie cannot be found, or the cookie
/// fails to authenticate or decrypt, `None` is returned.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie, Key};
///
/// let key = Key::generate();
/// let mut jar = CookieJar::new();
/// let mut private_jar = jar.private(&key);
/// assert!(private_jar.get("name").is_none());
///
/// private_jar.add(Cookie::new("name", "value"));
/// assert_eq!(private_jar.get("name").unwrap().value(), "value");
/// ```
pub fn get(&self, name: &str) -> Option<Cookie<'static>> {
if let Some(cookie_ref) = self.parent.get(name) {
let mut cookie = cookie_ref.clone();
if let Ok(value) = self.unseal(name, cookie.value()) {
cookie.set_value(value);
return Some(cookie);
}
}
None
}
/// Adds `cookie` to the parent jar. The cookie's value is encrypted with
/// authenticated encryption assuring confidentiality, integrity, and
/// authenticity.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie, Key};
///
/// let key = Key::generate();
/// let mut jar = CookieJar::new();
/// jar.private(&key).add(Cookie::new("name", "value"));
///
/// assert_ne!(jar.get("name").unwrap().value(), "value");
/// assert_eq!(jar.private(&key).get("name").unwrap().value(), "value");
/// ```
pub fn add(&mut self, mut cookie: Cookie<'static>) {
self.encrypt_cookie(&mut cookie);
// Add the sealed cookie to the parent.
self.parent.add(cookie);
}
/// Adds an "original" `cookie` to parent jar. The cookie's value is
/// encrypted with authenticated encryption assuring confidentiality,
/// integrity, and authenticity. Adding an original cookie does not affect
/// the [`CookieJar::delta()`](struct.CookieJar.html#method.delta)
/// computation. This method is intended to be used to seed the cookie jar
/// with cookies received from a client's HTTP message.
///
/// For accurate `delta` computations, this method should not be called
/// after calling `remove`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie, Key};
///
/// let key = Key::generate();
/// let mut jar = CookieJar::new();
/// jar.private(&key).add_original(Cookie::new("name", "value"));
///
/// assert_eq!(jar.iter().count(), 1);
/// assert_eq!(jar.delta().count(), 0);
/// ```
pub fn add_original(&mut self, mut cookie: Cookie<'static>) {
self.encrypt_cookie(&mut cookie);
// Add the sealed cookie to the parent.
self.parent.add_original(cookie);
}
/// Encrypts the cookie's value with
/// authenticated encryption assuring confidentiality, integrity, and authenticity.
fn encrypt_cookie(&self, cookie: &mut Cookie) {
let name = cookie.name().as_bytes();
let value = cookie.value().as_bytes();
let data = encrypt_name_value(name, value, &self.key);
// Base64 encode the nonce and encrypted value.
let sealed_value = base64::encode(&data);
cookie.set_value(sealed_value);
}
/// Removes `cookie` from the parent jar.
///
/// For correct removal, the passed in `cookie` must contain the same `path`
/// and `domain` as the cookie that was initially set.
///
/// See [CookieJar::remove](struct.CookieJar.html#method.remove) for more
/// details.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie, Key};
///
/// let key = Key::generate();
/// let mut jar = CookieJar::new();
/// let mut private_jar = jar.private(&key);
///
/// private_jar.add(Cookie::new("name", "value"));
/// assert!(private_jar.get("name").is_some());
///
/// private_jar.remove(Cookie::named("name"));
/// assert!(private_jar.get("name").is_none());
/// ```
pub fn remove(&mut self, cookie: Cookie<'static>) {
self.parent.remove(cookie);
}
}
fn encrypt_name_value(name: &[u8], value: &[u8], key: &[u8]) -> Vec<u8> {
// Create the `SealingKey` structure.
let key = SealingKey::new(ALGO, key).expect("sealing key creation");
// Create a vec to hold the [nonce | cookie value | overhead].
let overhead = ALGO.tag_len();
let mut data = vec![0; NONCE_LEN + value.len() + overhead];
// Randomly generate the nonce, then copy the cookie value as input.
let (nonce, in_out) = data.split_at_mut(NONCE_LEN);
SystemRandom::new()
.fill(nonce)
.expect("couldn't random fill nonce");
in_out[..value.len()].copy_from_slice(value);
let nonce =
Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
// Use cookie's name as associated data to prevent value swapping.
let ad = Aad::from(name);
// Perform the actual sealing operation and get the output length.
let output_len =
seal_in_place(&key, nonce, ad, in_out, overhead).expect("in-place seal");
// Remove the overhead and return the sealed content.
data.truncate(NONCE_LEN + output_len);
data
}
#[cfg(test)]
mod test {
use super::{encrypt_name_value, Cookie, CookieJar, Key};
#[test]
fn simple() {
let key = Key::generate();
let mut jar = CookieJar::new();
assert_simple_behaviour!(jar, jar.private(&key));
}
#[test]
fn private() {
let key = Key::generate();
let mut jar = CookieJar::new();
assert_secure_behaviour!(jar, jar.private(&key));
}
#[test]
fn non_utf8() {
let key = Key::generate();
let mut jar = CookieJar::new();
let name = "malicious";
let mut assert_non_utf8 = |value: &[u8]| {
let sealed = encrypt_name_value(name.as_bytes(), value, &key.encryption());
let encoded = base64::encode(&sealed);
assert_eq!(
jar.private(&key).unseal(name, &encoded),
Err("bad unsealed utf8")
);
jar.add(Cookie::new(name, encoded));
assert_eq!(jar.private(&key).get(name), None);
};
assert_non_utf8(&[0x72, 0xfb, 0xdf, 0x74]); // rûst in ISO/IEC 8859-1
let mut malicious =
String::from(r#"{"id":"abc123??%X","admin":true}"#).into_bytes();
malicious[8] |= 0b1100_0000;
malicious[9] |= 0b1100_0000;
assert_non_utf8(&malicious);
}
}

View File

@@ -1,185 +0,0 @@
use ring::digest::{Algorithm, SHA256};
use ring::hmac::{sign, verify_with_own_key as verify, SigningKey};
use super::Key;
use crate::cookie::{Cookie, CookieJar};
// Keep these in sync, and keep the key len synced with the `signed` docs as
// well as the `KEYS_INFO` const in secure::Key.
static HMAC_DIGEST: &Algorithm = &SHA256;
const BASE64_DIGEST_LEN: usize = 44;
pub const KEY_LEN: usize = 32;
/// A child cookie jar that authenticates its cookies.
///
/// A _signed_ child jar signs all the cookies added to it and verifies cookies
/// retrieved from it. Any cookies stored in a `SignedJar` are assured integrity
/// and authenticity. In other words, clients cannot tamper with the contents of
/// a cookie nor can they fabricate cookie values, but the data is visible in
/// plaintext.
///
/// This type is only available when the `secure` feature is enabled.
pub struct SignedJar<'a> {
parent: &'a mut CookieJar,
key: SigningKey,
}
impl<'a> SignedJar<'a> {
/// Creates a new child `SignedJar` with parent `parent` and key `key`. This
/// method is typically called indirectly via the `signed` method of
/// `CookieJar`.
#[doc(hidden)]
pub fn new(parent: &'a mut CookieJar, key: &Key) -> SignedJar<'a> {
SignedJar {
parent,
key: SigningKey::new(HMAC_DIGEST, key.signing()),
}
}
/// Given a signed value `str` where the signature is prepended to `value`,
/// verifies the signed value and returns it. If there's a problem, returns
/// an `Err` with a string describing the issue.
fn verify(&self, cookie_value: &str) -> Result<String, &'static str> {
if cookie_value.len() < BASE64_DIGEST_LEN {
return Err("length of value is <= BASE64_DIGEST_LEN");
}
let (digest_str, value) = cookie_value.split_at(BASE64_DIGEST_LEN);
let sig = base64::decode(digest_str).map_err(|_| "bad base64 digest")?;
verify(&self.key, value.as_bytes(), &sig)
.map(|_| value.to_string())
.map_err(|_| "value did not verify")
}
/// Returns a reference to the `Cookie` inside this jar with the name `name`
/// and verifies the authenticity and integrity of the cookie's value,
/// returning a `Cookie` with the authenticated value. If the cookie cannot
/// be found, or the cookie fails to verify, `None` is returned.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie, Key};
///
/// let key = Key::generate();
/// let mut jar = CookieJar::new();
/// let mut signed_jar = jar.signed(&key);
/// assert!(signed_jar.get("name").is_none());
///
/// signed_jar.add(Cookie::new("name", "value"));
/// assert_eq!(signed_jar.get("name").unwrap().value(), "value");
/// ```
pub fn get(&self, name: &str) -> Option<Cookie<'static>> {
if let Some(cookie_ref) = self.parent.get(name) {
let mut cookie = cookie_ref.clone();
if let Ok(value) = self.verify(cookie.value()) {
cookie.set_value(value);
return Some(cookie);
}
}
None
}
/// Adds `cookie` to the parent jar. The cookie's value is signed assuring
/// integrity and authenticity.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie, Key};
///
/// let key = Key::generate();
/// let mut jar = CookieJar::new();
/// jar.signed(&key).add(Cookie::new("name", "value"));
///
/// assert_ne!(jar.get("name").unwrap().value(), "value");
/// assert!(jar.get("name").unwrap().value().contains("value"));
/// assert_eq!(jar.signed(&key).get("name").unwrap().value(), "value");
/// ```
pub fn add(&mut self, mut cookie: Cookie<'static>) {
self.sign_cookie(&mut cookie);
self.parent.add(cookie);
}
/// Adds an "original" `cookie` to this jar. The cookie's value is signed
/// assuring integrity and authenticity. Adding an original cookie does not
/// affect the [`CookieJar::delta()`](struct.CookieJar.html#method.delta)
/// computation. This method is intended to be used to seed the cookie jar
/// with cookies received from a client's HTTP message.
///
/// For accurate `delta` computations, this method should not be called
/// after calling `remove`.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie, Key};
///
/// let key = Key::generate();
/// let mut jar = CookieJar::new();
/// jar.signed(&key).add_original(Cookie::new("name", "value"));
///
/// assert_eq!(jar.iter().count(), 1);
/// assert_eq!(jar.delta().count(), 0);
/// ```
pub fn add_original(&mut self, mut cookie: Cookie<'static>) {
self.sign_cookie(&mut cookie);
self.parent.add_original(cookie);
}
/// Signs the cookie's value assuring integrity and authenticity.
fn sign_cookie(&self, cookie: &mut Cookie) {
let digest = sign(&self.key, cookie.value().as_bytes());
let mut new_value = base64::encode(digest.as_ref());
new_value.push_str(cookie.value());
cookie.set_value(new_value);
}
/// Removes `cookie` from the parent jar.
///
/// For correct removal, the passed in `cookie` must contain the same `path`
/// and `domain` as the cookie that was initially set.
///
/// See [CookieJar::remove](struct.CookieJar.html#method.remove) for more
/// details.
///
/// # Example
///
/// ```rust
/// use actix_http::cookie::{CookieJar, Cookie, Key};
///
/// let key = Key::generate();
/// let mut jar = CookieJar::new();
/// let mut signed_jar = jar.signed(&key);
///
/// signed_jar.add(Cookie::new("name", "value"));
/// assert!(signed_jar.get("name").is_some());
///
/// signed_jar.remove(Cookie::named("name"));
/// assert!(signed_jar.get("name").is_none());
/// ```
pub fn remove(&mut self, cookie: Cookie<'static>) {
self.parent.remove(cookie);
}
}
#[cfg(test)]
mod test {
use super::{Cookie, CookieJar, Key};
#[test]
fn simple() {
let key = Key::generate();
let mut jar = CookieJar::new();
assert_simple_behaviour!(jar, jar.signed(&key));
}
#[test]
fn private() {
let key = Key::generate();
let mut jar = CookieJar::new();
assert_secure_behaviour!(jar, jar.signed(&key));
}
}

View File

@@ -1,12 +1,13 @@
use std::future::Future;
use std::io::{self, Write};
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_threadpool::{run, CpuFuture};
#[cfg(feature = "brotli")]
use brotli2::write::BrotliDecoder;
use bytes::Bytes;
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
use flate2::write::{GzDecoder, ZlibDecoder};
use futures::{try_ready, Async, Future, Poll, Stream};
use futures_core::{ready, Stream};
use super::Writer;
use crate::error::PayloadError;
@@ -23,21 +24,18 @@ pub struct Decoder<S> {
impl<S> Decoder<S>
where
S: Stream<Item = Bytes, Error = PayloadError>,
S: Stream<Item = Result<Bytes, PayloadError>>,
{
/// Construct a decoder.
#[inline]
pub fn new(stream: S, encoding: ContentEncoding) -> Decoder<S> {
let decoder = match encoding {
#[cfg(feature = "brotli")]
ContentEncoding::Br => Some(ContentDecoder::Br(Box::new(
BrotliDecoder::new(Writer::new()),
))),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoding::Deflate => Some(ContentDecoder::Deflate(Box::new(
ZlibDecoder::new(Writer::new()),
))),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoding::Gzip => Some(ContentDecoder::Gzip(Box::new(
GzDecoder::new(Writer::new()),
))),
@@ -71,34 +69,40 @@ where
impl<S> Stream for Decoder<S>
where
S: Stream<Item = Bytes, Error = PayloadError>,
S: Stream<Item = Result<Bytes, PayloadError>> + Unpin,
{
type Item = Bytes;
type Error = PayloadError;
type Item = Result<Bytes, PayloadError>;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
loop {
if let Some(ref mut fut) = self.fut {
let (chunk, decoder) = try_ready!(fut.poll());
let (chunk, decoder) = match ready!(Pin::new(fut).poll(cx)) {
Ok(item) => item,
Err(e) => return Poll::Ready(Some(Err(e.into()))),
};
self.decoder = Some(decoder);
self.fut.take();
if let Some(chunk) = chunk {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
}
if self.eof {
return Ok(Async::Ready(None));
return Poll::Ready(None);
}
match self.stream.poll()? {
Async::Ready(Some(chunk)) => {
match Pin::new(&mut self.stream).poll_next(cx) {
Poll::Ready(Some(Err(err))) => return Poll::Ready(Some(Err(err))),
Poll::Ready(Some(Ok(chunk))) => {
if let Some(mut decoder) = self.decoder.take() {
if chunk.len() < INPLACE {
let chunk = decoder.feed_data(chunk)?;
self.decoder = Some(decoder);
if let Some(chunk) = chunk {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
} else {
self.fut = Some(run(move || {
@@ -108,41 +112,40 @@ where
}
continue;
} else {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
}
Async::Ready(None) => {
Poll::Ready(None) => {
self.eof = true;
return if let Some(mut decoder) = self.decoder.take() {
Ok(Async::Ready(decoder.feed_eof()?))
match decoder.feed_eof() {
Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
Ok(None) => Poll::Ready(None),
Err(err) => Poll::Ready(Some(Err(err.into()))),
}
} else {
Ok(Async::Ready(None))
Poll::Ready(None)
};
}
Async::NotReady => break,
Poll::Pending => break,
}
}
Ok(Async::NotReady)
Poll::Pending
}
}
enum ContentDecoder {
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
Deflate(Box<ZlibDecoder<Writer>>),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
Gzip(Box<GzDecoder<Writer>>),
#[cfg(feature = "brotli")]
Br(Box<BrotliDecoder<Writer>>),
}
impl ContentDecoder {
#[allow(unreachable_patterns)]
fn feed_eof(&mut self) -> io::Result<Option<Bytes>> {
match self {
#[cfg(feature = "brotli")]
ContentDecoder::Br(ref mut decoder) => match decoder.finish() {
Ok(mut writer) => {
let b = writer.take();
ContentDecoder::Br(ref mut decoder) => match decoder.flush() {
Ok(()) => {
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
@@ -151,7 +154,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentDecoder::Gzip(ref mut decoder) => match decoder.try_finish() {
Ok(_) => {
let b = decoder.get_mut().take();
@@ -163,7 +165,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
Ok(_) => {
let b = decoder.get_mut().take();
@@ -175,14 +176,11 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
_ => Ok(None),
}
}
#[allow(unreachable_patterns)]
fn feed_data(&mut self, data: Bytes) -> io::Result<Option<Bytes>> {
match self {
#[cfg(feature = "brotli")]
ContentDecoder::Br(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
@@ -195,7 +193,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentDecoder::Gzip(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
@@ -208,7 +205,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
@@ -221,7 +217,6 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
_ => Ok(Some(data)),
}
}
}

View File

@@ -1,25 +1,29 @@
//! Stream encoder
use std::future::Future;
use std::io::{self, Write};
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_threadpool::{run, CpuFuture};
#[cfg(feature = "brotli")]
use brotli2::write::BrotliEncoder;
use bytes::Bytes;
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
use flate2::write::{GzEncoder, ZlibEncoder};
use futures::{Async, Future, Poll};
use futures_core::ready;
use pin_project::pin_project;
use crate::body::{Body, BodySize, MessageBody, ResponseBody};
use crate::http::header::{ContentEncoding, CONTENT_ENCODING};
use crate::http::{HeaderValue, HttpTryFrom, StatusCode};
use crate::http::{HeaderValue, StatusCode};
use crate::{Error, ResponseHead};
use super::Writer;
const INPLACE: usize = 2049;
const INPLACE: usize = 1024;
#[pin_project]
pub struct Encoder<B> {
eof: bool,
#[pin]
body: EncoderBody<B>,
encoder: Option<ContentEncoder>,
fut: Option<CpuFuture<ContentEncoder, io::Error>>,
@@ -75,86 +79,110 @@ impl<B: MessageBody> Encoder<B> {
}
}
#[pin_project(project = EncoderBodyProj)]
enum EncoderBody<B> {
Bytes(Bytes),
Stream(B),
BoxedStream(Box<dyn MessageBody>),
Stream(#[pin] B),
BoxedStream(Box<dyn MessageBody + Unpin>),
}
impl<B: MessageBody> MessageBody for EncoderBody<B> {
fn size(&self) -> BodySize {
match self {
EncoderBody::Bytes(ref b) => b.size(),
EncoderBody::Stream(ref b) => b.size(),
EncoderBody::BoxedStream(ref b) => b.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.project() {
EncoderBodyProj::Bytes(b) => {
if b.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(std::mem::take(b))))
}
}
EncoderBodyProj::Stream(b) => b.poll_next(cx),
EncoderBodyProj::BoxedStream(ref mut b) => {
Pin::new(b.as_mut()).poll_next(cx)
}
}
}
}
impl<B: MessageBody> MessageBody for Encoder<B> {
fn size(&self) -> BodySize {
if self.encoder.is_none() {
match self.body {
EncoderBody::Bytes(ref b) => b.size(),
EncoderBody::Stream(ref b) => b.size(),
EncoderBody::BoxedStream(ref b) => b.size(),
}
self.body.size()
} else {
BodySize::Stream
}
}
fn poll_next(&mut self) -> Poll<Option<Bytes>, Error> {
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
let mut this = self.project();
loop {
if self.eof {
return Ok(Async::Ready(None));
if *this.eof {
return Poll::Ready(None);
}
if let Some(ref mut fut) = self.fut {
let mut encoder = futures::try_ready!(fut.poll());
if let Some(ref mut fut) = this.fut {
let mut encoder = match ready!(Pin::new(fut).poll(cx)) {
Ok(item) => item,
Err(e) => return Poll::Ready(Some(Err(e.into()))),
};
let chunk = encoder.take();
self.encoder = Some(encoder);
self.fut.take();
*this.encoder = Some(encoder);
this.fut.take();
if !chunk.is_empty() {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
}
let result = match self.body {
EncoderBody::Bytes(ref mut b) => {
if b.is_empty() {
Async::Ready(None)
} else {
Async::Ready(Some(std::mem::replace(b, Bytes::new())))
}
}
EncoderBody::Stream(ref mut b) => b.poll_next()?,
EncoderBody::BoxedStream(ref mut b) => b.poll_next()?,
};
let result = this.body.as_mut().poll_next(cx);
match result {
Async::NotReady => return Ok(Async::NotReady),
Async::Ready(Some(chunk)) => {
if let Some(mut encoder) = self.encoder.take() {
Poll::Ready(Some(Ok(chunk))) => {
if let Some(mut encoder) = this.encoder.take() {
if chunk.len() < INPLACE {
encoder.write(&chunk)?;
let chunk = encoder.take();
self.encoder = Some(encoder);
*this.encoder = Some(encoder);
if !chunk.is_empty() {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
} else {
self.fut = Some(run(move || {
*this.fut = Some(run(move || {
encoder.write(&chunk)?;
Ok(encoder)
}));
}
} else {
return Ok(Async::Ready(Some(chunk)));
return Poll::Ready(Some(Ok(chunk)));
}
}
Async::Ready(None) => {
if let Some(encoder) = self.encoder.take() {
Poll::Ready(None) => {
if let Some(encoder) = this.encoder.take() {
let chunk = encoder.finish()?;
if chunk.is_empty() {
return Ok(Async::Ready(None));
return Poll::Ready(None);
} else {
self.eof = true;
return Ok(Async::Ready(Some(chunk)));
*this.eof = true;
return Poll::Ready(Some(Ok(chunk)));
}
} else {
return Ok(Async::Ready(None));
return Poll::Ready(None);
}
}
val => return val,
}
}
}
@@ -163,33 +191,27 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
fn update_head(encoding: ContentEncoding, head: &mut ResponseHead) {
head.headers_mut().insert(
CONTENT_ENCODING,
HeaderValue::try_from(Bytes::from_static(encoding.as_str().as_bytes())).unwrap(),
HeaderValue::from_static(encoding.as_str()),
);
}
enum ContentEncoder {
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
Deflate(ZlibEncoder<Writer>),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
Gzip(GzEncoder<Writer>),
#[cfg(feature = "brotli")]
Br(BrotliEncoder<Writer>),
}
impl ContentEncoder {
fn encoder(encoding: ContentEncoding) -> Option<Self> {
match encoding {
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoding::Deflate => Some(ContentEncoder::Deflate(ZlibEncoder::new(
Writer::new(),
flate2::Compression::fast(),
))),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoding::Gzip => Some(ContentEncoder::Gzip(GzEncoder::new(
Writer::new(),
flate2::Compression::fast(),
))),
#[cfg(feature = "brotli")]
ContentEncoding::Br => {
Some(ContentEncoder::Br(BrotliEncoder::new(Writer::new(), 3)))
}
@@ -200,28 +222,22 @@ impl ContentEncoder {
#[inline]
pub(crate) fn take(&mut self) -> Bytes {
match *self {
#[cfg(feature = "brotli")]
ContentEncoder::Br(ref mut encoder) => encoder.get_mut().take(),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Deflate(ref mut encoder) => encoder.get_mut().take(),
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Gzip(ref mut encoder) => encoder.get_mut().take(),
}
}
fn finish(self) -> Result<Bytes, io::Error> {
match self {
#[cfg(feature = "brotli")]
ContentEncoder::Br(encoder) => match encoder.finish() {
Ok(writer) => Ok(writer.buf.freeze()),
Err(err) => Err(err),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Gzip(encoder) => match encoder.finish() {
Ok(writer) => Ok(writer.buf.freeze()),
Err(err) => Err(err),
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Deflate(encoder) => match encoder.finish() {
Ok(writer) => Ok(writer.buf.freeze()),
Err(err) => Err(err),
@@ -231,7 +247,6 @@ impl ContentEncoder {
fn write(&mut self, data: &[u8]) -> Result<(), io::Error> {
match *self {
#[cfg(feature = "brotli")]
ContentEncoder::Br(ref mut encoder) => match encoder.write_all(data) {
Ok(_) => Ok(()),
Err(err) => {
@@ -239,7 +254,6 @@ impl ContentEncoder {
Err(err)
}
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Gzip(ref mut encoder) => match encoder.write_all(data) {
Ok(_) => Ok(()),
Err(err) => {
@@ -247,7 +261,6 @@ impl ContentEncoder {
Err(err)
}
},
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
ContentEncoder::Deflate(ref mut encoder) => match encoder.write_all(data) {
Ok(_) => Ok(()),
Err(err) => {

View File

@@ -19,8 +19,9 @@ impl Writer {
buf: BytesMut::with_capacity(8192),
}
}
fn take(&mut self) -> Bytes {
self.buf.take().freeze()
self.buf.split().freeze()
}
}
@@ -29,6 +30,7 @@ impl io::Write for Writer {
self.buf.extend_from_slice(buf);
Ok(buf.len())
}
fn flush(&mut self) -> io::Result<()> {
Ok(())
}

View File

@@ -1,29 +1,28 @@
//! Error and Result module
use std::any::TypeId;
use std::cell::RefCell;
use std::io::Write;
use std::str::Utf8Error;
use std::string::FromUtf8Error;
use std::{fmt, io, result};
use actix_codec::{Decoder, Encoder};
pub use actix_threadpool::BlockingError;
use actix_utils::framed::DispatcherError as FramedDispatcherError;
use actix_utils::timeout::TimeoutError;
use bytes::BytesMut;
use derive_more::{Display, From};
use futures::Canceled;
pub use futures_channel::oneshot::Canceled;
use http::uri::InvalidUri;
use http::{header, Error as HttpError, StatusCode};
use httparse;
use serde::de::value::Error as DeError;
use serde_json::error::Error as JsonError;
use serde_urlencoded::ser::Error as FormError;
use tokio_timer::Error as TimerError;
// re-export for convinience
// re-export for convenience
use crate::body::Body;
pub use crate::cookie::ParseError as CookieParseError;
use crate::helpers::Writer;
use crate::response::Response;
use crate::response::{Response, ResponseBuilder};
/// A specialized [`Result`](https://doc.rust-lang.org/std/result/enum.Result.html)
/// for actix web operations
@@ -35,7 +34,7 @@ pub type Result<T, E = Error> = result::Result<T, E>;
/// General purpose actix web error.
///
/// An actix web error is used to carry errors from `failure` or `std::error`
/// An actix web error is used to carry errors from `std::error`
/// through actix in a convenient way. It can be created through
/// converting errors with `into()`.
///
@@ -61,16 +60,18 @@ impl Error {
/// Error that can be converted to `Response`
pub trait ResponseError: fmt::Debug + fmt::Display {
/// Response's status code
///
/// Internal server error is generated by default.
fn status_code(&self) -> StatusCode {
StatusCode::INTERNAL_SERVER_ERROR
}
/// Create response for error
///
/// Internal server error is generated by default.
fn error_response(&self) -> Response {
Response::new(StatusCode::INTERNAL_SERVER_ERROR)
}
/// Constructs an error response
fn render_response(&self) -> Response {
let mut resp = self.error_response();
let mut resp = Response::new(self.status_code());
let mut buf = BytesMut::new();
let _ = write!(Writer(&mut buf), "{}", self);
resp.headers_mut().insert(
@@ -80,49 +81,24 @@ pub trait ResponseError: fmt::Debug + fmt::Display {
resp.set_body(Body::from(buf))
}
#[doc(hidden)]
fn __private_get_type_id__(&self) -> TypeId
where
Self: 'static,
{
TypeId::of::<Self>()
}
downcast_get_type_id!();
}
impl dyn ResponseError + 'static {
/// Downcasts a response error to a specific type.
pub fn downcast_ref<T: ResponseError + 'static>(&self) -> Option<&T> {
if self.__private_get_type_id__() == TypeId::of::<T>() {
unsafe { Some(&*(self as *const dyn ResponseError as *const T)) }
} else {
None
}
}
}
downcast!(ResponseError);
impl fmt::Display for Error {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt::Display::fmt(&self.cause, f)
}
}
impl fmt::Debug for Error {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
writeln!(f, "{:?}", &self.cause)
}
}
impl From<()> for Error {
fn from(_: ()) -> Self {
Error::from(UnitError)
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "{:?}", &self.cause)
}
}
impl std::error::Error for Error {
fn description(&self) -> &str {
"actix-http::Error"
}
fn cause(&self) -> Option<&dyn std::error::Error> {
None
}
@@ -132,6 +108,12 @@ impl std::error::Error for Error {
}
}
impl From<()> for Error {
fn from(_: ()) -> Self {
Error::from(UnitError)
}
}
impl From<std::convert::Infallible> for Error {
fn from(_: std::convert::Infallible) -> Self {
// `std::convert::Infallible` indicates an error
@@ -156,12 +138,26 @@ impl<T: ResponseError + 'static> From<T> for Error {
}
}
/// Convert Response to a Error
impl From<Response> for Error {
fn from(res: Response) -> Error {
InternalError::from_response("", res).into()
}
}
/// Convert ResponseBuilder to a Error
impl From<ResponseBuilder> for Error {
fn from(mut res: ResponseBuilder) -> Error {
InternalError::from_response("", res.finish()).into()
}
}
/// Return `GATEWAY_TIMEOUT` for `TimeoutError`
impl<E: ResponseError> ResponseError for TimeoutError<E> {
fn error_response(&self) -> Response {
fn status_code(&self) -> StatusCode {
match self {
TimeoutError::Service(e) => e.error_response(),
TimeoutError::Timeout => Response::new(StatusCode::GATEWAY_TIMEOUT),
TimeoutError::Service(e) => e.status_code(),
TimeoutError::Timeout => StatusCode::GATEWAY_TIMEOUT,
}
}
}
@@ -179,31 +175,31 @@ impl ResponseError for JsonError {}
/// `InternalServerError` for `FormError`
impl ResponseError for FormError {}
/// `InternalServerError` for `TimerError`
impl ResponseError for TimerError {}
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
/// `InternalServerError` for `openssl::ssl::Error`
impl ResponseError for openssl::ssl::Error {}
impl ResponseError for actix_connect::ssl::openssl::SslError {}
#[cfg(feature = "ssl")]
#[cfg(feature = "openssl")]
/// `InternalServerError` for `openssl::ssl::HandshakeError`
impl ResponseError for openssl::ssl::HandshakeError<tokio_tcp::TcpStream> {}
impl<T: std::fmt::Debug> ResponseError for actix_tls::openssl::HandshakeError<T> {}
/// Return `BAD_REQUEST` for `de::value::Error`
impl ResponseError for DeError {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
/// `InternalServerError` for `Canceled`
impl ResponseError for Canceled {}
/// `InternalServerError` for `BlockingError`
impl<E: fmt::Debug> ResponseError for BlockingError<E> {}
/// Return `BAD_REQUEST` for `Utf8Error`
impl ResponseError for Utf8Error {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
@@ -213,32 +209,22 @@ impl ResponseError for HttpError {}
/// Return `InternalServerError` for `io::Error`
impl ResponseError for io::Error {
fn error_response(&self) -> Response {
fn status_code(&self) -> StatusCode {
match self.kind() {
io::ErrorKind::NotFound => Response::new(StatusCode::NOT_FOUND),
io::ErrorKind::PermissionDenied => Response::new(StatusCode::FORBIDDEN),
_ => Response::new(StatusCode::INTERNAL_SERVER_ERROR),
io::ErrorKind::NotFound => StatusCode::NOT_FOUND,
io::ErrorKind::PermissionDenied => StatusCode::FORBIDDEN,
_ => StatusCode::INTERNAL_SERVER_ERROR,
}
}
}
/// `BadRequest` for `InvalidHeaderValue`
impl ResponseError for header::InvalidHeaderValue {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
/// `BadRequest` for `InvalidHeaderValue`
impl ResponseError for header::InvalidHeaderValueBytes {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
}
}
/// `InternalServerError` for `futures::Canceled`
impl ResponseError for Canceled {}
/// A set of errors that can occur during parsing HTTP streams
#[derive(Debug, Display)]
pub enum ParseError {
@@ -278,8 +264,8 @@ pub enum ParseError {
/// Return `BadRequest` for `ParseError`
impl ResponseError for ParseError {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
@@ -347,6 +333,8 @@ pub enum PayloadError {
Io(io::Error),
}
impl std::error::Error for PayloadError {}
impl From<h2::Error> for PayloadError {
fn from(err: h2::Error) -> Self {
PayloadError::Http2Payload(err)
@@ -371,7 +359,7 @@ impl From<BlockingError<io::Error>> for PayloadError {
BlockingError::Error(e) => PayloadError::Io(e),
BlockingError::Canceled => PayloadError::Io(io::Error::new(
io::ErrorKind::Other,
"Thread pool is gone",
"Operation is canceled",
)),
}
}
@@ -382,18 +370,18 @@ impl From<BlockingError<io::Error>> for PayloadError {
/// - `Overflow` returns `PayloadTooLarge`
/// - Other errors returns `BadRequest`
impl ResponseError for PayloadError {
fn error_response(&self) -> Response {
fn status_code(&self) -> StatusCode {
match *self {
PayloadError::Overflow => Response::new(StatusCode::PAYLOAD_TOO_LARGE),
_ => Response::new(StatusCode::BAD_REQUEST),
PayloadError::Overflow => StatusCode::PAYLOAD_TOO_LARGE,
_ => StatusCode::BAD_REQUEST,
}
}
}
/// Return `BadRequest` for `cookie::ParseError`
impl ResponseError for crate::cookie::ParseError {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
@@ -444,7 +432,7 @@ pub enum DispatchError {
Unknown,
}
/// A set of error that can occure during parsing content type
/// A set of error that can occur during parsing content type
#[derive(PartialEq, Debug, Display)]
pub enum ContentTypeError {
/// Can not parse content type
@@ -455,13 +443,23 @@ pub enum ContentTypeError {
UnknownEncoding,
}
impl std::error::Error for ContentTypeError {}
/// Return `BadRequest` for `ContentTypeError`
impl ResponseError for ContentTypeError {
fn error_response(&self) -> Response {
Response::new(StatusCode::BAD_REQUEST)
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
impl<E, U: Encoder + Decoder> ResponseError for FramedDispatcherError<E, U>
where
E: fmt::Debug + fmt::Display,
<U as Encoder>::Error: fmt::Debug,
<U as Decoder>::Error: fmt::Debug,
{
}
/// Helper type that can wrap any error and generate custom response.
///
/// In following example any `io::Error` will be converted into "BAD REQUEST"
@@ -469,14 +467,12 @@ impl ResponseError for ContentTypeError {
/// default.
///
/// ```rust
/// # extern crate actix_http;
/// # use std::io;
/// # use actix_http::*;
///
/// fn index(req: Request) -> Result<&'static str> {
/// Err(error::ErrorBadRequest(io::Error::new(io::ErrorKind::Other, "error")))
/// }
/// # fn main() {}
/// ```
pub struct InternalError<T> {
cause: T,
@@ -510,7 +506,7 @@ impl<T> fmt::Debug for InternalError<T>
where
T: fmt::Debug + 'static,
{
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt::Debug::fmt(&self.cause, f)
}
}
@@ -519,7 +515,7 @@ impl<T> fmt::Display for InternalError<T>
where
T: fmt::Display + 'static,
{
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt::Display::fmt(&self.cause, f)
}
}
@@ -528,6 +524,19 @@ impl<T> ResponseError for InternalError<T>
where
T: fmt::Debug + fmt::Display + 'static,
{
fn status_code(&self) -> StatusCode {
match self.status {
InternalErrorType::Status(st) => st,
InternalErrorType::Response(ref resp) => {
if let Some(resp) = resp.borrow().as_ref() {
resp.head().status
} else {
StatusCode::INTERNAL_SERVER_ERROR
}
}
}
}
fn error_response(&self) -> Response {
match self.status {
InternalErrorType::Status(st) => {
@@ -549,18 +558,6 @@ where
}
}
}
/// Constructs an error response
fn render_response(&self) -> Response {
self.error_response()
}
}
/// Convert Response to a Error
impl From<Response> for Error {
fn from(res: Response) -> Error {
InternalError::from_response("", res).into()
}
}
/// Helper function that creates wrapper of any error and generate *BAD
@@ -953,24 +950,20 @@ where
InternalError::new(err, StatusCode::NETWORK_AUTHENTICATION_REQUIRED).into()
}
#[cfg(feature = "fail")]
mod failure_integration {
use super::*;
#[cfg(feature = "actors")]
/// `InternalServerError` for `actix::MailboxError`
/// This is supported on feature=`actors` only
impl ResponseError for actix::MailboxError {}
/// Compatibility for `failure::Error`
impl ResponseError for failure::Error {
fn error_response(&self) -> Response {
Response::new(StatusCode::INTERNAL_SERVER_ERROR)
}
}
}
#[cfg(feature = "actors")]
/// `InternalServerError` for `actix::ResolverError`
/// This is supported on feature=`actors` only
impl ResponseError for actix::actors::resolver::ResolverError {}
#[cfg(test)]
mod tests {
use super::*;
use http::{Error as HttpError, StatusCode};
use httparse;
use std::error::Error as StdError;
use std::io;
#[test]
@@ -999,7 +992,7 @@ mod tests {
#[test]
fn test_error_cause() {
let orig = io::Error::new(io::ErrorKind::Other, "other");
let desc = orig.description().to_owned();
let desc = orig.to_string();
let e = Error::from(orig);
assert_eq!(format!("{}", e.as_response_error()), desc);
}
@@ -1007,7 +1000,7 @@ mod tests {
#[test]
fn test_error_display() {
let orig = io::Error::new(io::ErrorKind::Other, "other");
let desc = orig.description().to_owned();
let desc = orig.to_string();
let e = Error::from(orig);
assert_eq!(format!("{}", e), desc);
}
@@ -1049,7 +1042,7 @@ mod tests {
match ParseError::from($from) {
e @ $error => {
let desc = format!("{}", e);
assert_eq!(desc, format!("IO error: {}", $from.description()));
assert_eq!(desc, format!("IO error: {}", $from));
}
_ => unreachable!("{:?}", $from),
}

View File

@@ -1,12 +1,14 @@
use std::any::{Any, TypeId};
use std::fmt;
use hashbrown::HashMap;
use fxhash::FxHashMap;
#[derive(Default)]
/// A type map of request extensions.
pub struct Extensions {
map: HashMap<TypeId, Box<dyn Any>>,
/// Use FxHasher with a std HashMap with for faster
/// lookups on the small `TypeId` (u64 equivalent) keys.
map: FxHashMap<TypeId, Box<dyn Any>>,
}
impl Extensions {
@@ -14,7 +16,7 @@ impl Extensions {
#[inline]
pub fn new() -> Extensions {
Extensions {
map: HashMap::default(),
map: FxHashMap::default(),
}
}
@@ -28,33 +30,30 @@ impl Extensions {
/// Check if container contains entry
pub fn contains<T: 'static>(&self) -> bool {
self.map.get(&TypeId::of::<T>()).is_some()
self.map.contains_key(&TypeId::of::<T>())
}
/// Get a reference to a type previously inserted on this `Extensions`.
pub fn get<T: 'static>(&self) -> Option<&T> {
self.map
.get(&TypeId::of::<T>())
.and_then(|boxed| (&**boxed as &(dyn Any + 'static)).downcast_ref())
.and_then(|boxed| boxed.downcast_ref())
}
/// Get a mutable reference to a type previously inserted on this `Extensions`.
pub fn get_mut<T: 'static>(&mut self) -> Option<&mut T> {
self.map
.get_mut(&TypeId::of::<T>())
.and_then(|boxed| (&mut **boxed as &mut (dyn Any + 'static)).downcast_mut())
.and_then(|boxed| boxed.downcast_mut())
}
/// Remove a type from this `Extensions`.
///
/// If a extension of this type existed, it will be returned.
pub fn remove<T: 'static>(&mut self) -> Option<T> {
self.map.remove(&TypeId::of::<T>()).and_then(|boxed| {
(boxed as Box<dyn Any + 'static>)
.downcast()
.ok()
.map(|boxed| *boxed)
})
self.map
.remove(&TypeId::of::<T>())
.and_then(|boxed| boxed.downcast().ok().map(|boxed| *boxed))
}
/// Clear the `Extensions` of all inserted extensions.
@@ -65,27 +64,118 @@ impl Extensions {
}
impl fmt::Debug for Extensions {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
f.debug_struct("Extensions").finish()
}
}
#[test]
fn test_extensions() {
#[derive(Debug, PartialEq)]
struct MyType(i32);
#[cfg(test)]
mod tests {
use super::*;
let mut extensions = Extensions::new();
#[test]
fn test_remove() {
let mut map = Extensions::new();
extensions.insert(5i32);
extensions.insert(MyType(10));
map.insert::<i8>(123);
assert!(map.get::<i8>().is_some());
assert_eq!(extensions.get(), Some(&5i32));
assert_eq!(extensions.get_mut(), Some(&mut 5i32));
map.remove::<i8>();
assert!(map.get::<i8>().is_none());
}
assert_eq!(extensions.remove::<i32>(), Some(5i32));
assert!(extensions.get::<i32>().is_none());
#[test]
fn test_clear() {
let mut map = Extensions::new();
assert_eq!(extensions.get::<bool>(), None);
assert_eq!(extensions.get(), Some(&MyType(10)));
map.insert::<i8>(8);
map.insert::<i16>(16);
map.insert::<i32>(32);
assert!(map.contains::<i8>());
assert!(map.contains::<i16>());
assert!(map.contains::<i32>());
map.clear();
assert!(!map.contains::<i8>());
assert!(!map.contains::<i16>());
assert!(!map.contains::<i32>());
map.insert::<i8>(10);
assert_eq!(*map.get::<i8>().unwrap(), 10);
}
#[test]
fn test_integers() {
let mut map = Extensions::new();
map.insert::<i8>(8);
map.insert::<i16>(16);
map.insert::<i32>(32);
map.insert::<i64>(64);
map.insert::<i128>(128);
map.insert::<u8>(8);
map.insert::<u16>(16);
map.insert::<u32>(32);
map.insert::<u64>(64);
map.insert::<u128>(128);
assert!(map.get::<i8>().is_some());
assert!(map.get::<i16>().is_some());
assert!(map.get::<i32>().is_some());
assert!(map.get::<i64>().is_some());
assert!(map.get::<i128>().is_some());
assert!(map.get::<u8>().is_some());
assert!(map.get::<u16>().is_some());
assert!(map.get::<u32>().is_some());
assert!(map.get::<u64>().is_some());
assert!(map.get::<u128>().is_some());
}
#[test]
fn test_composition() {
struct Magi<T>(pub T);
struct Madoka {
pub god: bool,
}
struct Homura {
pub attempts: usize,
}
struct Mami {
pub guns: usize,
}
let mut map = Extensions::new();
map.insert(Magi(Madoka { god: false }));
map.insert(Magi(Homura { attempts: 0 }));
map.insert(Magi(Mami { guns: 999 }));
assert!(!map.get::<Magi<Madoka>>().unwrap().0.god);
assert_eq!(0, map.get::<Magi<Homura>>().unwrap().0.attempts);
assert_eq!(999, map.get::<Magi<Mami>>().unwrap().0.guns);
}
#[test]
fn test_extensions() {
#[derive(Debug, PartialEq)]
struct MyType(i32);
let mut extensions = Extensions::new();
extensions.insert(5i32);
extensions.insert(MyType(10));
assert_eq!(extensions.get(), Some(&5i32));
assert_eq!(extensions.get_mut(), Some(&mut 5i32));
assert_eq!(extensions.remove::<i32>(), Some(5i32));
assert!(extensions.get::<i32>().is_none());
assert_eq!(extensions.get::<bool>(), None);
assert_eq!(extensions.get(), Some(&MyType(10)));
}
}

View File

@@ -1,13 +1,8 @@
#![allow(unused_imports, unused_variables, dead_code)]
use std::io::{self, Write};
use std::rc::Rc;
use std::io;
use actix_codec::{Decoder, Encoder};
use bitflags::bitflags;
use bytes::{BufMut, Bytes, BytesMut};
use http::header::{
HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING, UPGRADE,
};
use bytes::{Bytes, BytesMut};
use http::{Method, Version};
use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
@@ -16,11 +11,7 @@ use super::{Message, MessageType};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::error::{ParseError, PayloadError};
use crate::header::HeaderMap;
use crate::helpers;
use crate::message::{
ConnectionType, Head, MessagePool, RequestHead, RequestHeadType, ResponseHead,
};
use crate::message::{ConnectionType, RequestHeadType, ResponseHead};
bitflags! {
struct Flags: u8 {
@@ -30,8 +21,6 @@ bitflags! {
}
}
const AVERAGE_HEADER_SIZE: usize = 30;
/// HTTP/1 Codec
pub struct ClientCodec {
inner: ClientCodecInner,
@@ -51,7 +40,6 @@ struct ClientCodecInner {
// encoder part
flags: Flags,
headers_size: u32,
encoder: encoder::MessageEncoder<RequestHeadType>,
}
@@ -80,7 +68,6 @@ impl ClientCodec {
ctype: ConnectionType::Close,
flags,
headers_size: 0,
encoder: encoder::MessageEncoder::default(),
},
}

View File

@@ -1,12 +1,9 @@
#![allow(unused_imports, unused_variables, dead_code)]
use std::io::Write;
use std::{fmt, io, net};
use std::{fmt, io};
use actix_codec::{Decoder, Encoder};
use bitflags::bitflags;
use bytes::{BufMut, Bytes, BytesMut};
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use http::{Method, StatusCode, Version};
use bytes::BytesMut;
use http::{Method, Version};
use super::decoder::{PayloadDecoder, PayloadItem, PayloadType};
use super::{decoder, encoder};
@@ -14,8 +11,7 @@ use super::{Message, MessageType};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::error::ParseError;
use crate::helpers;
use crate::message::{ConnectionType, Head, ResponseHead};
use crate::message::ConnectionType;
use crate::request::Request;
use crate::response::Response;
@@ -27,8 +23,6 @@ bitflags! {
}
}
const AVERAGE_HEADER_SIZE: usize = 30;
/// HTTP/1 Codec
pub struct Codec {
config: ServiceConfig,
@@ -49,7 +43,7 @@ impl Default for Codec {
}
impl fmt::Debug for Codec {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "h1::Codec({:?})", self.flags)
}
}
@@ -176,7 +170,6 @@ impl Encoder for Codec {
};
// encode message
let len = dst.len();
self.encoder.encode(
dst,
&mut res,
@@ -202,17 +195,11 @@ impl Encoder for Codec {
#[cfg(test)]
mod tests {
use std::{cmp, io};
use actix_codec::{AsyncRead, AsyncWrite};
use bytes::{Buf, Bytes, BytesMut};
use http::{Method, Version};
use bytes::BytesMut;
use http::Method;
use super::*;
use crate::error::ParseError;
use crate::h1::Message;
use crate::httpmessage::HttpMessage;
use crate::request::Request;
#[test]
fn test_http_request_chunked_payload_and_next_message() {

View File

@@ -1,13 +1,12 @@
use std::convert::TryFrom;
use std::io;
use std::marker::PhantomData;
use std::mem::MaybeUninit;
use std::task::Poll;
use actix_codec::Decoder;
use bytes::{Bytes, BytesMut};
use futures::{Async, Poll};
use bytes::{Buf, Bytes, BytesMut};
use http::header::{HeaderName, HeaderValue};
use http::{header, HttpTryFrom, Method, StatusCode, Uri, Version};
use httparse;
use http::{header, Method, StatusCode, Uri, Version};
use log::{debug, error, trace};
use crate::error::ParseError;
@@ -18,7 +17,7 @@ use crate::request::Request;
const MAX_BUFFER_SIZE: usize = 131_072;
const MAX_HEADERS: usize = 96;
/// Incoming messagd decoder
/// Incoming message decoder
pub(crate) struct MessageDecoder<T: MessageType>(PhantomData<T>);
#[derive(Debug)]
@@ -46,7 +45,7 @@ impl<T: MessageType> Decoder for MessageDecoder<T> {
pub(crate) enum PayloadLength {
Payload(PayloadType),
Upgrade,
UpgradeWebSocket,
None,
}
@@ -65,7 +64,7 @@ pub(crate) trait MessageType: Sized {
raw_headers: &[HeaderIndex],
) -> Result<PayloadLength, ParseError> {
let mut ka = None;
let mut has_upgrade = false;
let mut has_upgrade_websocket = false;
let mut expect = false;
let mut chunked = false;
let mut content_length = None;
@@ -77,10 +76,10 @@ pub(crate) trait MessageType: Sized {
let name =
HeaderName::from_bytes(&slice[idx.name.0..idx.name.1]).unwrap();
// Unsafe: httparse check header value for valid utf-8
// SAFETY: httparse checks header value is valid UTF-8
let value = unsafe {
HeaderValue::from_shared_unchecked(
slice.slice(idx.value.0, idx.value.1),
HeaderValue::from_maybe_shared_unchecked(
slice.slice(idx.value.0..idx.value.1),
)
};
match name {
@@ -124,12 +123,9 @@ pub(crate) trait MessageType: Sized {
};
}
header::UPGRADE => {
has_upgrade = true;
// check content-length, some clients (dart)
// sends "content-length: 0" with websocket upgrade
if let Ok(val) = value.to_str().map(|val| val.trim()) {
if val.eq_ignore_ascii_case("websocket") {
content_length = None;
has_upgrade_websocket = true;
}
}
}
@@ -156,13 +152,13 @@ pub(crate) trait MessageType: Sized {
Ok(PayloadLength::Payload(PayloadType::Payload(
PayloadDecoder::chunked(),
)))
} else if has_upgrade_websocket {
Ok(PayloadLength::UpgradeWebSocket)
} else if let Some(len) = content_length {
// Content-Length
Ok(PayloadLength::Payload(PayloadType::Payload(
PayloadDecoder::length(len),
)))
} else if has_upgrade {
Ok(PayloadLength::Upgrade)
} else {
Ok(PayloadLength::None)
}
@@ -185,14 +181,10 @@ impl MessageType for Request {
}
fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
// Unsafe: we read only this data only after httparse parses headers into.
// performance bump for pipeline benchmarks.
let mut headers: [HeaderIndex; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
let (len, method, uri, ver, h_len) = {
let mut parsed: [httparse::Header; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
let mut req = httparse::Request::new(&mut parsed);
match req.parse(src)? {
@@ -221,7 +213,7 @@ impl MessageType for Request {
// payload decoder
let decoder = match length {
PayloadLength::Payload(pl) => pl,
PayloadLength::Upgrade => {
PayloadLength::UpgradeWebSocket => {
// upgrade(websocket)
PayloadType::Stream(PayloadDecoder::eof())
}
@@ -260,14 +252,10 @@ impl MessageType for ResponseHead {
}
fn decode(src: &mut BytesMut) -> Result<Option<(Self, PayloadType)>, ParseError> {
// Unsafe: we read only this data only after httparse parses headers into.
// performance bump for pipeline benchmarks.
let mut headers: [HeaderIndex; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut headers: [HeaderIndex; MAX_HEADERS] = EMPTY_HEADER_INDEX_ARRAY;
let (len, ver, status, h_len) = {
let mut parsed: [httparse::Header; MAX_HEADERS] =
unsafe { MaybeUninit::uninit().assume_init() };
let mut parsed: [httparse::Header<'_>; MAX_HEADERS] = EMPTY_HEADER_ARRAY;
let mut res = httparse::Response::new(&mut parsed);
match res.parse(src)? {
@@ -322,10 +310,21 @@ pub(crate) struct HeaderIndex {
pub(crate) value: (usize, usize),
}
pub(crate) const EMPTY_HEADER_INDEX: HeaderIndex = HeaderIndex {
name: (0, 0),
value: (0, 0),
};
pub(crate) const EMPTY_HEADER_INDEX_ARRAY: [HeaderIndex; MAX_HEADERS] =
[EMPTY_HEADER_INDEX; MAX_HEADERS];
pub(crate) const EMPTY_HEADER_ARRAY: [httparse::Header<'static>; MAX_HEADERS] =
[httparse::EMPTY_HEADER; MAX_HEADERS];
impl HeaderIndex {
pub(crate) fn record(
bytes: &[u8],
headers: &[httparse::Header],
headers: &[httparse::Header<'_>],
indices: &mut [HeaderIndex],
) {
let bytes_ptr = bytes.as_ptr() as usize;
@@ -428,7 +427,7 @@ impl Decoder for PayloadDecoder {
let len = src.len() as u64;
let buf;
if *remaining > len {
buf = src.take().freeze();
buf = src.split().freeze();
*remaining -= len;
} else {
buf = src.split_to(*remaining as usize).freeze();
@@ -442,9 +441,10 @@ impl Decoder for PayloadDecoder {
loop {
let mut buf = None;
// advances the chunked state
*state = match state.step(src, size, &mut buf)? {
Async::NotReady => return Ok(None),
Async::Ready(state) => state,
*state = match state.step(src, size, &mut buf) {
Poll::Pending => return Ok(None),
Poll::Ready(Ok(state)) => state,
Poll::Ready(Err(e)) => return Err(e),
};
if *state == ChunkedState::End {
trace!("End of chunked stream");
@@ -462,7 +462,7 @@ impl Decoder for PayloadDecoder {
if src.is_empty() {
Ok(None)
} else {
Ok(Some(PayloadItem::Chunk(src.take().freeze())))
Ok(Some(PayloadItem::Chunk(src.split().freeze())))
}
}
}
@@ -473,10 +473,10 @@ macro_rules! byte (
($rdr:ident) => ({
if $rdr.len() > 0 {
let b = $rdr[0];
$rdr.split_to(1);
$rdr.advance(1);
b
} else {
return Ok(Async::NotReady)
return Poll::Pending
}
})
);
@@ -487,7 +487,7 @@ impl ChunkedState {
body: &mut BytesMut,
size: &mut u64,
buf: &mut Option<Bytes>,
) -> Poll<ChunkedState, io::Error> {
) -> Poll<Result<ChunkedState, io::Error>> {
use self::ChunkedState::*;
match *self {
Size => ChunkedState::read_size(body, size),
@@ -499,10 +499,14 @@ impl ChunkedState {
BodyLf => ChunkedState::read_body_lf(body),
EndCr => ChunkedState::read_end_cr(body),
EndLf => ChunkedState::read_end_lf(body),
End => Ok(Async::Ready(ChunkedState::End)),
End => Poll::Ready(Ok(ChunkedState::End)),
}
}
fn read_size(rdr: &mut BytesMut, size: &mut u64) -> Poll<ChunkedState, io::Error> {
fn read_size(
rdr: &mut BytesMut,
size: &mut u64,
) -> Poll<Result<ChunkedState, io::Error>> {
let radix = 16;
match byte!(rdr) {
b @ b'0'..=b'9' => {
@@ -517,48 +521,49 @@ impl ChunkedState {
*size *= radix;
*size += u64::from(b + 10 - b'A');
}
b'\t' | b' ' => return Ok(Async::Ready(ChunkedState::SizeLws)),
b';' => return Ok(Async::Ready(ChunkedState::Extension)),
b'\r' => return Ok(Async::Ready(ChunkedState::SizeLf)),
b'\t' | b' ' => return Poll::Ready(Ok(ChunkedState::SizeLws)),
b';' => return Poll::Ready(Ok(ChunkedState::Extension)),
b'\r' => return Poll::Ready(Ok(ChunkedState::SizeLf)),
_ => {
return Err(io::Error::new(
return Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk size line: Invalid Size",
));
)));
}
}
Ok(Async::Ready(ChunkedState::Size))
Poll::Ready(Ok(ChunkedState::Size))
}
fn read_size_lws(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_size_lws(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
trace!("read_size_lws");
match byte!(rdr) {
// LWS can follow the chunk size, but no more digits can come
b'\t' | b' ' => Ok(Async::Ready(ChunkedState::SizeLws)),
b';' => Ok(Async::Ready(ChunkedState::Extension)),
b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)),
_ => Err(io::Error::new(
b'\t' | b' ' => Poll::Ready(Ok(ChunkedState::SizeLws)),
b';' => Poll::Ready(Ok(ChunkedState::Extension)),
b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk size linear white space",
)),
))),
}
}
fn read_extension(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_extension(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\r' => Ok(Async::Ready(ChunkedState::SizeLf)),
_ => Ok(Async::Ready(ChunkedState::Extension)), // no supported extensions
b'\r' => Poll::Ready(Ok(ChunkedState::SizeLf)),
_ => Poll::Ready(Ok(ChunkedState::Extension)), // no supported extensions
}
}
fn read_size_lf(
rdr: &mut BytesMut,
size: &mut u64,
) -> Poll<ChunkedState, io::Error> {
) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\n' if *size > 0 => Ok(Async::Ready(ChunkedState::Body)),
b'\n' if *size == 0 => Ok(Async::Ready(ChunkedState::EndCr)),
_ => Err(io::Error::new(
b'\n' if *size > 0 => Poll::Ready(Ok(ChunkedState::Body)),
b'\n' if *size == 0 => Poll::Ready(Ok(ChunkedState::EndCr)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk size LF",
)),
))),
}
}
@@ -566,16 +571,16 @@ impl ChunkedState {
rdr: &mut BytesMut,
rem: &mut u64,
buf: &mut Option<Bytes>,
) -> Poll<ChunkedState, io::Error> {
) -> Poll<Result<ChunkedState, io::Error>> {
trace!("Chunked read, remaining={:?}", rem);
let len = rdr.len() as u64;
if len == 0 {
Ok(Async::Ready(ChunkedState::Body))
Poll::Ready(Ok(ChunkedState::Body))
} else {
let slice;
if *rem > len {
slice = rdr.take().freeze();
slice = rdr.split().freeze();
*rem -= len;
} else {
slice = rdr.split_to(*rem as usize).freeze();
@@ -583,47 +588,47 @@ impl ChunkedState {
}
*buf = Some(slice);
if *rem > 0 {
Ok(Async::Ready(ChunkedState::Body))
Poll::Ready(Ok(ChunkedState::Body))
} else {
Ok(Async::Ready(ChunkedState::BodyCr))
Poll::Ready(Ok(ChunkedState::BodyCr))
}
}
}
fn read_body_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_body_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\r' => Ok(Async::Ready(ChunkedState::BodyLf)),
_ => Err(io::Error::new(
b'\r' => Poll::Ready(Ok(ChunkedState::BodyLf)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk body CR",
)),
))),
}
}
fn read_body_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_body_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\n' => Ok(Async::Ready(ChunkedState::Size)),
_ => Err(io::Error::new(
b'\n' => Poll::Ready(Ok(ChunkedState::Size)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk body LF",
)),
))),
}
}
fn read_end_cr(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_end_cr(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\r' => Ok(Async::Ready(ChunkedState::EndLf)),
_ => Err(io::Error::new(
b'\r' => Poll::Ready(Ok(ChunkedState::EndLf)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk end CR",
)),
))),
}
}
fn read_end_lf(rdr: &mut BytesMut) -> Poll<ChunkedState, io::Error> {
fn read_end_lf(rdr: &mut BytesMut) -> Poll<Result<ChunkedState, io::Error>> {
match byte!(rdr) {
b'\n' => Ok(Async::Ready(ChunkedState::End)),
_ => Err(io::Error::new(
b'\n' => Poll::Ready(Ok(ChunkedState::End)),
_ => Poll::Ready(Err(io::Error::new(
io::ErrorKind::InvalidInput,
"Invalid chunk end LF",
)),
))),
}
}
}
@@ -647,10 +652,7 @@ mod tests {
}
fn is_unhandled(&self) -> bool {
match self {
PayloadType::Stream(_) => true,
_ => false,
}
matches!(self, PayloadType::Stream(_))
}
}
@@ -662,10 +664,7 @@ mod tests {
}
}
fn eof(&self) -> bool {
match *self {
PayloadItem::Eof => true,
_ => false,
}
matches!(*self, PayloadItem::Eof)
}
}
@@ -971,7 +970,7 @@ mod tests {
unreachable!("Error");
}
// type in chunked
// intentional typo in "chunked"
let mut buf = BytesMut::from(
"GET /test HTTP/1.1\r\n\
transfer-encoding: chnked\r\n\r\n",
@@ -1032,7 +1031,7 @@ mod tests {
}
#[test]
fn test_http_request_upgrade() {
fn test_http_request_upgrade_websocket() {
let mut buf = BytesMut::from(
"GET /test HTTP/1.1\r\n\
connection: upgrade\r\n\
@@ -1046,6 +1045,26 @@ mod tests {
assert!(pl.is_unhandled());
}
#[test]
fn test_http_request_upgrade_h2c() {
let mut buf = BytesMut::from(
"GET /test HTTP/1.1\r\n\
connection: upgrade, http2-settings\r\n\
upgrade: h2c\r\n\
http2-settings: dummy\r\n\r\n",
);
let mut reader = MessageDecoder::<Request>::default();
let (req, pl) = reader.decode(&mut buf).unwrap().unwrap();
// `connection: upgrade, http2-settings` doesn't work properly..
// see MessageType::set_headers().
//
// The line below should be:
// assert_eq!(req.head().connection_type(), ConnectionType::Upgrade);
assert_eq!(req.head().connection_type(), ConnectionType::KeepAlive);
assert!(req.upgrade());
assert!(!pl.is_unhandled());
}
#[test]
fn test_http_request_parser_utf8() {
let mut buf = BytesMut::from(

File diff suppressed because it is too large Load Diff

View File

@@ -1,23 +1,18 @@
#![allow(unused_imports, unused_variables, dead_code)]
use std::fmt::Write as FmtWrite;
use std::io::Write;
use std::marker::PhantomData;
use std::rc::Rc;
use std::str::FromStr;
use std::{cmp, fmt, io, mem};
use std::ptr::copy_nonoverlapping;
use std::slice::from_raw_parts_mut;
use std::{cmp, io};
use bytes::{BufMut, Bytes, BytesMut};
use bytes::{BufMut, BytesMut};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::header::{map, ContentEncoding};
use crate::header::map;
use crate::helpers;
use crate::http::header::{
HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING,
};
use crate::http::{HeaderMap, Method, StatusCode, Version};
use crate::message::{ConnectionType, Head, RequestHead, RequestHeadType, ResponseHead};
use crate::request::Request;
use crate::http::header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use crate::http::{HeaderMap, StatusCode, Version};
use crate::message::{ConnectionType, RequestHeadType};
use crate::response::Response;
const AVERAGE_HEADER_SIZE: usize = 30;
@@ -100,14 +95,6 @@ pub(crate) trait MessageType: Sized {
}
}
BodySize::Sized(len) => helpers::write_content_length(len, dst),
BodySize::Sized64(len) => {
if camel_case {
dst.put_slice(b"\r\nContent-Length: ");
} else {
dst.put_slice(b"\r\ncontent-length: ");
}
write!(dst.writer(), "{}\r\n", len)?;
}
BodySize::None => dst.put_slice(b"\r\n"),
}
@@ -144,8 +131,8 @@ pub(crate) trait MessageType: Sized {
// write headers
let mut pos = 0;
let mut has_date = false;
let mut remaining = dst.remaining_mut();
let mut buf = unsafe { &mut *(dst.bytes_mut() as *mut [u8]) };
let mut remaining = dst.capacity() - dst.len();
let mut buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
for (key, value) in headers {
match *key {
CONNECTION => continue,
@@ -159,61 +146,67 @@ pub(crate) trait MessageType: Sized {
match value {
map::Value::One(ref val) => {
let v = val.as_ref();
let len = k.len() + v.len() + 4;
let v_len = v.len();
let k_len = k.len();
let len = k_len + v_len + 4;
if len > remaining {
unsafe {
dst.advance_mut(pos);
}
pos = 0;
dst.reserve(len * 2);
remaining = dst.remaining_mut();
unsafe {
buf = &mut *(dst.bytes_mut() as *mut _);
}
remaining = dst.capacity() - dst.len();
buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
}
// use upper Camel-Case
if camel_case {
write_camel_case(k, &mut buf[pos..pos + k.len()]);
} else {
buf[pos..pos + k.len()].copy_from_slice(k);
unsafe {
if camel_case {
write_camel_case(k, from_raw_parts_mut(buf, k_len))
} else {
write_data(k, buf, k_len)
}
buf = buf.add(k_len);
write_data(b": ", buf, 2);
buf = buf.add(2);
write_data(v, buf, v_len);
buf = buf.add(v_len);
write_data(b"\r\n", buf, 2);
buf = buf.add(2);
pos += len;
remaining -= len;
}
pos += k.len();
buf[pos..pos + 2].copy_from_slice(b": ");
pos += 2;
buf[pos..pos + v.len()].copy_from_slice(v);
pos += v.len();
buf[pos..pos + 2].copy_from_slice(b"\r\n");
pos += 2;
remaining -= len;
}
map::Value::Multi(ref vec) => {
for val in vec {
let v = val.as_ref();
let len = k.len() + v.len() + 4;
let v_len = v.len();
let k_len = k.len();
let len = k_len + v_len + 4;
if len > remaining {
unsafe {
dst.advance_mut(pos);
}
pos = 0;
dst.reserve(len * 2);
remaining = dst.remaining_mut();
unsafe {
buf = &mut *(dst.bytes_mut() as *mut _);
}
remaining = dst.capacity() - dst.len();
buf = dst.bytes_mut().as_mut_ptr() as *mut u8;
}
// use upper Camel-Case
if camel_case {
write_camel_case(k, &mut buf[pos..pos + k.len()]);
} else {
buf[pos..pos + k.len()].copy_from_slice(k);
}
pos += k.len();
buf[pos..pos + 2].copy_from_slice(b": ");
pos += 2;
buf[pos..pos + v.len()].copy_from_slice(v);
pos += v.len();
buf[pos..pos + 2].copy_from_slice(b"\r\n");
pos += 2;
unsafe {
if camel_case {
write_camel_case(k, from_raw_parts_mut(buf, k_len));
} else {
write_data(k, buf, k_len);
}
buf = buf.add(k_len);
write_data(b": ", buf, 2);
buf = buf.add(2);
write_data(v, buf, v_len);
buf = buf.add(v_len);
write_data(b"\r\n", buf, 2);
buf = buf.add(2);
};
pos += len;
remaining -= len;
}
}
@@ -298,6 +291,12 @@ impl MessageType for RequestHeadType {
Version::HTTP_10 => "HTTP/1.0",
Version::HTTP_11 => "HTTP/1.1",
Version::HTTP_2 => "HTTP/2.0",
Version::HTTP_3 => "HTTP/3.0",
_ =>
return Err(io::Error::new(
io::ErrorKind::Other,
"unsupported version"
)),
}
)
.map_err(|e| io::Error::new(io::ErrorKind::Other, e))
@@ -330,8 +329,7 @@ impl<T: MessageType> MessageEncoder<T> {
if !head {
self.te = match length {
BodySize::Empty => TransferEncoding::empty(),
BodySize::Sized(len) => TransferEncoding::length(len as u64),
BodySize::Sized64(len) => TransferEncoding::length(len),
BodySize::Sized(len) => TransferEncoding::length(len),
BodySize::Stream => {
if message.chunked() && !stream {
TransferEncoding::chunked()
@@ -479,6 +477,10 @@ impl<'a> io::Write for Writer<'a> {
}
}
unsafe fn write_data(value: &[u8], buf: *mut u8, len: usize) {
copy_nonoverlapping(value.as_ptr(), buf, len);
}
fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
let mut index = 0;
let key = value;
@@ -509,12 +511,14 @@ fn write_camel_case(value: &[u8], buffer: &mut [u8]) {
#[cfg(test)]
mod tests {
use std::rc::Rc;
use bytes::Bytes;
//use std::rc::Rc;
use http::header::AUTHORIZATION;
use super::*;
use crate::http::header::{HeaderValue, CONTENT_TYPE};
use http::header::AUTHORIZATION;
use crate::RequestHead;
#[test]
fn test_chunked_te() {
@@ -525,7 +529,7 @@ mod tests {
assert!(enc.encode(b"", &mut bytes).ok().unwrap());
}
assert_eq!(
bytes.take().freeze(),
bytes.split().freeze(),
Bytes::from_static(b"4\r\ntest\r\n0\r\n\r\n")
);
}
@@ -548,7 +552,8 @@ mod tests {
ConnectionType::Close,
&ServiceConfig::default(),
);
let data = String::from_utf8(Vec::from(bytes.take().freeze().as_ref())).unwrap();
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("Content-Length: 0\r\n"));
assert!(data.contains("Connection: close\r\n"));
assert!(data.contains("Content-Type: plain/text\r\n"));
@@ -561,23 +566,12 @@ mod tests {
ConnectionType::KeepAlive,
&ServiceConfig::default(),
);
let data = String::from_utf8(Vec::from(bytes.take().freeze().as_ref())).unwrap();
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("Transfer-Encoding: chunked\r\n"));
assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let _ = head.encode_headers(
&mut bytes,
Version::HTTP_11,
BodySize::Sized64(100),
ConnectionType::KeepAlive,
&ServiceConfig::default(),
);
let data = String::from_utf8(Vec::from(bytes.take().freeze().as_ref())).unwrap();
assert!(data.contains("Content-Length: 100\r\n"));
assert!(data.contains("Content-Type: plain/text\r\n"));
assert!(data.contains("Date: date\r\n"));
let mut head = RequestHead::default();
head.set_camel_case_headers(false);
head.headers.insert(DATE, HeaderValue::from_static("date"));
@@ -594,7 +588,8 @@ mod tests {
ConnectionType::KeepAlive,
&ServiceConfig::default(),
);
let data = String::from_utf8(Vec::from(bytes.take().freeze().as_ref())).unwrap();
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("transfer-encoding: chunked\r\n"));
assert!(data.contains("content-type: xml\r\n"));
assert!(data.contains("content-type: plain/text\r\n"));
@@ -627,7 +622,8 @@ mod tests {
ConnectionType::Close,
&ServiceConfig::default(),
);
let data = String::from_utf8(Vec::from(bytes.take().freeze().as_ref())).unwrap();
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
assert!(data.contains("content-length: 0\r\n"));
assert!(data.contains("connection: close\r\n"));
assert!(data.contains("authorization: another authorization\r\n"));

View File

@@ -1,23 +1,23 @@
use actix_server_config::ServerConfig;
use actix_service::{NewService, Service};
use futures::future::{ok, FutureResult};
use futures::{Async, Poll};
use std::task::{Context, Poll};
use actix_service::{Service, ServiceFactory};
use futures_util::future::{ok, Ready};
use crate::error::Error;
use crate::request::Request;
pub struct ExpectHandler;
impl NewService for ExpectHandler {
type Config = ServerConfig;
impl ServiceFactory for ExpectHandler {
type Config = ();
type Request = Request;
type Response = Request;
type Error = Error;
type Service = ExpectHandler;
type InitError = Error;
type Future = FutureResult<Self::Service, Self::InitError>;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &ServerConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
ok(ExpectHandler)
}
}
@@ -26,10 +26,10 @@ impl Service for ExpectHandler {
type Request = Request;
type Response = Request;
type Error = Error;
type Future = FutureResult<Self::Response, Self::Error>;
type Future = Ready<Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, req: Request) -> Self::Future {

View File

@@ -1,12 +1,13 @@
//! Payload stream
use std::cell::RefCell;
use std::collections::VecDeque;
use std::pin::Pin;
use std::rc::{Rc, Weak};
use std::task::{Context, Poll};
use actix_utils::task::LocalWaker;
use bytes::Bytes;
use futures::task::current as current_task;
use futures::task::Task;
use futures::{Async, Poll, Stream};
use futures_core::Stream;
use crate::error::PayloadError;
@@ -77,15 +78,24 @@ impl Payload {
pub fn unread_data(&mut self, data: Bytes) {
self.inner.borrow_mut().unread_data(data);
}
#[inline]
pub fn readany(
&mut self,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
self.inner.borrow_mut().readany(cx)
}
}
impl Stream for Payload {
type Item = Bytes;
type Error = PayloadError;
type Item = Result<Bytes, PayloadError>;
#[inline]
fn poll(&mut self) -> Poll<Option<Bytes>, PayloadError> {
self.inner.borrow_mut().readany()
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
self.inner.borrow_mut().readany(cx)
}
}
@@ -117,19 +127,14 @@ impl PayloadSender {
}
#[inline]
pub fn need_read(&self) -> PayloadStatus {
pub fn need_read(&self, cx: &mut Context<'_>) -> PayloadStatus {
// we check need_read only if Payload (other side) is alive,
// otherwise always return true (consume payload)
if let Some(shared) = self.inner.upgrade() {
if shared.borrow().need_read {
PayloadStatus::Read
} else {
#[cfg(not(test))]
{
if shared.borrow_mut().io_task.is_none() {
shared.borrow_mut().io_task = Some(current_task());
}
}
shared.borrow_mut().io_task.register(cx.waker());
PayloadStatus::Pause
}
} else {
@@ -145,8 +150,8 @@ struct Inner {
err: Option<PayloadError>,
need_read: bool,
items: VecDeque<Bytes>,
task: Option<Task>,
io_task: Option<Task>,
task: LocalWaker,
io_task: LocalWaker,
}
impl Inner {
@@ -157,8 +162,8 @@ impl Inner {
err: None,
items: VecDeque::new(),
need_read: true,
task: None,
io_task: None,
task: LocalWaker::new(),
io_task: LocalWaker::new(),
}
}
@@ -178,7 +183,7 @@ impl Inner {
self.items.push_back(data);
self.need_read = self.len < MAX_BUFFER_SIZE;
if let Some(task) = self.task.take() {
task.notify()
task.wake()
}
}
@@ -187,34 +192,28 @@ impl Inner {
self.len
}
fn readany(&mut self) -> Poll<Option<Bytes>, PayloadError> {
fn readany(
&mut self,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, PayloadError>>> {
if let Some(data) = self.items.pop_front() {
self.len -= data.len();
self.need_read = self.len < MAX_BUFFER_SIZE;
if self.need_read && self.task.is_none() && !self.eof {
self.task = Some(current_task());
if self.need_read && !self.eof {
self.task.register(cx.waker());
}
if let Some(task) = self.io_task.take() {
task.notify()
}
Ok(Async::Ready(Some(data)))
self.io_task.wake();
Poll::Ready(Some(Ok(data)))
} else if let Some(err) = self.err.take() {
Err(err)
Poll::Ready(Some(Err(err)))
} else if self.eof {
Ok(Async::Ready(None))
Poll::Ready(None)
} else {
self.need_read = true;
#[cfg(not(test))]
{
if self.task.is_none() {
self.task = Some(current_task());
}
if let Some(task) = self.io_task.take() {
task.notify()
}
}
Ok(Async::NotReady)
self.task.register(cx.waker());
self.io_task.wake();
Poll::Pending
}
}
@@ -227,28 +226,19 @@ impl Inner {
#[cfg(test)]
mod tests {
use super::*;
use actix_rt::Runtime;
use futures::future::{lazy, result};
use futures_util::future::poll_fn;
#[test]
fn test_unread_data() {
Runtime::new()
.unwrap()
.block_on(lazy(|| {
let (_, mut payload) = Payload::create(false);
#[actix_rt::test]
async fn test_unread_data() {
let (_, mut payload) = Payload::create(false);
payload.unread_data(Bytes::from("data"));
assert!(!payload.is_empty());
assert_eq!(payload.len(), 4);
payload.unread_data(Bytes::from("data"));
assert!(!payload.is_empty());
assert_eq!(payload.len(), 4);
assert_eq!(
Async::Ready(Some(Bytes::from("data"))),
payload.poll().ok().unwrap()
);
let res: Result<(), ()> = Ok(());
result(res)
}))
.unwrap();
assert_eq!(
Bytes::from("data"),
poll_fn(|cx| payload.readany(cx)).await.unwrap().unwrap()
);
}
}

View File

@@ -1,16 +1,19 @@
use std::fmt;
use std::future::Future;
use std::marker::PhantomData;
use std::pin::Pin;
use std::rc::Rc;
use std::task::{Context, Poll};
use std::{fmt, net};
use actix_codec::Framed;
use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig};
use actix_service::{IntoNewService, NewService, Service};
use futures::future::{ok, FutureResult};
use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_rt::net::TcpStream;
use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
use futures_core::ready;
use futures_util::future::{ok, Ready};
use crate::body::MessageBody;
use crate::cloneable::CloneableService;
use crate::config::{KeepAlive, ServiceConfig};
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error, ParseError};
use crate::helpers::DataFactory;
use crate::request::Request;
@@ -20,43 +23,32 @@ use super::codec::Codec;
use super::dispatcher::Dispatcher;
use super::{ExpectHandler, Message, UpgradeHandler};
/// `NewService` implementation for HTTP1 transport
pub struct H1Service<T, P, S, B, X = ExpectHandler, U = UpgradeHandler<T>> {
/// `ServiceFactory` implementation for HTTP1 transport
pub struct H1Service<T, S, B, X = ExpectHandler, U = UpgradeHandler<T>> {
srv: S,
cfg: ServiceConfig,
expect: X,
upgrade: Option<U>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B> H1Service<T, P, S, B>
impl<T, S, B> H1Service<T, S, B>
where
S: NewService<Config = SrvConfig, Request = Request>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
{
/// Create new `HttpService` instance with default config.
pub fn new<F: IntoNewService<S>>(service: F) -> Self {
let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
H1Service {
cfg,
srv: service.into_new_service(),
expect: ExpectHandler,
upgrade: None,
on_connect: None,
_t: PhantomData,
}
}
/// Create new `HttpService` instance with config.
pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self {
pub(crate) fn with_config<F: IntoServiceFactory<S>>(
cfg: ServiceConfig,
service: F,
) -> Self {
H1Service {
cfg,
srv: service.into_new_service(),
srv: service.into_factory(),
expect: ExpectHandler,
upgrade: None,
on_connect: None,
@@ -65,17 +57,153 @@ where
}
}
impl<T, P, S, B, X, U> H1Service<T, P, S, B, X, U>
impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
where
S: NewService<Config = SrvConfig, Request = Request>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<TcpStream, Codec>),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
/// Create simple tcp stream service
pub fn tcp(
self,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = DispatchError,
InitError = (),
> {
pipeline_factory(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok((io, peer_addr))
})
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use super::*;
use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
use actix_tls::{openssl::HandshakeError, SslError};
impl<S, B, X, U> H1Service<SslStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<SslStream<TcpStream>, Codec>),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
/// Create openssl based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<HandshakeError<TcpStream>, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: SslStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_tls::rustls::{Acceptor, ServerConfig, TlsStream};
use actix_tls::SslError;
use std::{fmt, io};
impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
Config = (),
Request = (Request, Framed<TlsStream<TcpStream>, Codec>),
Response = (),
>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
/// Create rustls based service
pub fn rustls(
self,
config: ServerConfig,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<io::Error, DispatchError>,
InitError = (),
> {
pipeline_factory(
Acceptor::new(config)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, peer_addr))
})
.and_then(self.map_err(SslError::Service))
}
}
}
impl<T, S, B, X, U> H1Service<T, S, B, X, U>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
{
pub fn expect<X1>(self, expect: X1) -> H1Service<T, P, S, B, X1, U>
pub fn expect<X1>(self, expect: X1) -> H1Service<T, S, B, X1, U>
where
X1: NewService<Request = Request, Response = Request>,
X1: ServiceFactory<Request = Request, Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
{
@@ -89,9 +217,9 @@ where
}
}
pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, P, S, B, X, U1>
pub fn upgrade<U1>(self, upgrade: Option<U1>) -> H1Service<T, S, B, X, U1>
where
U1: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
U1: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
{
@@ -115,38 +243,34 @@ where
}
}
impl<T, P, S, B, X, U> NewService for H1Service<T, P, S, B, X, U>
impl<T, S, B, X, U> ServiceFactory for H1Service<T, S, B, X, U>
where
T: IoStream,
S: NewService<Config = SrvConfig, Request = Request>,
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
X: NewService<Config = SrvConfig, Request = Request, Response = Request>,
X: ServiceFactory<Config = (), Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<
Config = SrvConfig,
Request = (Request, Framed<T, Codec>),
Response = (),
>,
U::Error: fmt::Display,
U: ServiceFactory<Config = (), Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
type Config = SrvConfig;
type Request = Io<T, P>;
type Config = ();
type Request = (T, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type InitError = ();
type Service = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
type Future = H1ServiceResponse<T, P, S, B, X, U>;
type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
type Future = H1ServiceResponse<T, S, B, X, U>;
fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
H1ServiceResponse {
fut: self.srv.new_service(cfg).into_future(),
fut_ex: Some(self.expect.new_service(cfg)),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(cfg)),
fut: self.srv.new_service(()),
fut_ex: Some(self.expect.new_service(())),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
expect: None,
upgrade: None,
on_connect: self.on_connect.clone(),
@@ -157,88 +281,99 @@ where
}
#[doc(hidden)]
pub struct H1ServiceResponse<T, P, S, B, X, U>
#[pin_project::pin_project]
pub struct H1ServiceResponse<T, S, B, X, U>
where
S: NewService<Request = Request>,
S: ServiceFactory<Request = Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
X: NewService<Request = Request, Response = Request>,
X: ServiceFactory<Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
#[pin]
fut: S::Future,
#[pin]
fut_ex: Option<X::Future>,
#[pin]
fut_upg: Option<U::Future>,
expect: Option<X::Service>,
upgrade: Option<U::Service>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
cfg: Option<ServiceConfig>,
_t: PhantomData<(T, P, B)>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B, X, U> Future for H1ServiceResponse<T, P, S, B, X, U>
impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
where
T: IoStream,
S: NewService<Request = Request>,
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
X: NewService<Request = Request, Response = Request>,
X: ServiceFactory<Request = Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: NewService<Request = (Request, Framed<T, Codec>), Response = ()>,
U: ServiceFactory<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
type Item = H1ServiceHandler<T, P, S::Service, B, X::Service, U::Service>;
type Error = ();
type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
if let Some(ref mut fut) = self.fut_ex {
let expect = try_ready!(fut
.poll()
.map_err(|e| log::error!("Init http service error: {:?}", e)));
self.expect = Some(expect);
self.fut_ex.take();
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
if let Some(fut) = this.fut_ex.as_pin_mut() {
let expect = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.expect = Some(expect);
this.fut_ex.set(None);
}
if let Some(ref mut fut) = self.fut_upg {
let upgrade = try_ready!(fut
.poll()
.map_err(|e| log::error!("Init http service error: {:?}", e)));
self.upgrade = Some(upgrade);
self.fut_ex.take();
if let Some(fut) = this.fut_upg.as_pin_mut() {
let upgrade = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.upgrade = Some(upgrade);
this.fut_ex.set(None);
}
let service = try_ready!(self
let result = ready!(this
.fut
.poll()
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)));
Ok(Async::Ready(H1ServiceHandler::new(
self.cfg.take().unwrap(),
service,
self.expect.take().unwrap(),
self.upgrade.take(),
self.on_connect.clone(),
)))
Poll::Ready(result.map(|service| {
let this = self.as_mut().project();
H1ServiceHandler::new(
this.cfg.take().unwrap(),
service,
this.expect.take().unwrap(),
this.upgrade.take(),
this.on_connect.clone(),
)
}))
}
}
/// `Service` implementation for HTTP1 transport
pub struct H1ServiceHandler<T, P, S, B, X, U> {
pub struct H1ServiceHandler<T, S: Service, B, X: Service, U: Service> {
srv: CloneableService<S>,
expect: CloneableService<X>,
upgrade: Option<CloneableService<U>>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
cfg: ServiceConfig,
_t: PhantomData<(T, P, B)>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B, X, U> H1ServiceHandler<T, P, S, B, X, U>
impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
where
S: Service<Request = Request>,
S::Error: Into<Error>,
@@ -255,7 +390,7 @@ where
expect: X,
upgrade: Option<U>,
on_connect: Option<Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
) -> H1ServiceHandler<T, P, S, B, X, U> {
) -> H1ServiceHandler<T, S, B, X, U> {
H1ServiceHandler {
srv: CloneableService::new(srv),
expect: CloneableService::new(expect),
@@ -267,9 +402,9 @@ where
}
}
impl<T, P, S, B, X, U> Service for H1ServiceHandler<T, P, S, B, X, U>
impl<T, S, B, X, U> Service for H1ServiceHandler<T, S, B, X, U>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
@@ -277,17 +412,17 @@ where
X: Service<Request = Request, Response = Request>,
X::Error: Into<Error>,
U: Service<Request = (Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::Error: fmt::Display + Into<Error>,
{
type Request = Io<T, P>;
type Request = (T, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type Future = Dispatcher<T, S, B, X, U>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
let ready = self
.expect
.poll_ready()
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
@@ -297,7 +432,7 @@ where
let ready = self
.srv
.poll_ready()
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
@@ -306,16 +441,27 @@ where
.is_ready()
&& ready;
if ready {
Ok(Async::Ready(()))
let ready = if let Some(ref mut upg) = self.upgrade {
upg.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready()
&& ready
} else {
Ok(Async::NotReady)
ready
};
if ready {
Poll::Ready(Ok(()))
} else {
Poll::Pending
}
}
fn call(&mut self, req: Self::Request) -> Self::Future {
let io = req.into_parts().0;
fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
let on_connect = if let Some(ref on_connect) = self.on_connect {
Some(on_connect(&io))
} else {
@@ -329,20 +475,21 @@ where
self.expect.clone(),
self.upgrade.clone(),
on_connect,
addr,
)
}
}
/// `NewService` implementation for `OneRequestService` service
/// `ServiceFactory` implementation for `OneRequestService` service
#[derive(Default)]
pub struct OneRequest<T, P> {
pub struct OneRequest<T> {
config: ServiceConfig,
_t: PhantomData<(T, P)>,
_t: PhantomData<T>,
}
impl<T, P> OneRequest<T, P>
impl<T> OneRequest<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
/// Create new `H1SimpleService` instance.
pub fn new() -> Self {
@@ -353,52 +500,49 @@ where
}
}
impl<T, P> NewService for OneRequest<T, P>
impl<T> ServiceFactory for OneRequest<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
type Config = SrvConfig;
type Request = Io<T, P>;
type Config = ();
type Request = T;
type Response = (Request, Framed<T, Codec>);
type Error = ParseError;
type InitError = ();
type Service = OneRequestService<T, P>;
type Future = FutureResult<Self::Service, Self::InitError>;
type Service = OneRequestService<T>;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &SrvConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
ok(OneRequestService {
config: self.config.clone(),
_t: PhantomData,
config: self.config.clone(),
})
}
}
/// `Service` implementation for HTTP1 transport. Reads one request and returns
/// request and framed object.
pub struct OneRequestService<T, P> {
pub struct OneRequestService<T> {
_t: PhantomData<T>,
config: ServiceConfig,
_t: PhantomData<(T, P)>,
}
impl<T, P> Service for OneRequestService<T, P>
impl<T> Service for OneRequestService<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
type Request = Io<T, P>;
type Request = T;
type Response = (Request, Framed<T, Codec>);
type Error = ParseError;
type Future = OneRequestServiceResponse<T>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, req: Self::Request) -> Self::Future {
OneRequestServiceResponse {
framed: Some(Framed::new(
req.into_parts().0,
Codec::new(self.config.clone()),
)),
framed: Some(Framed::new(req, Codec::new(self.config.clone()))),
}
}
}
@@ -406,28 +550,28 @@ where
#[doc(hidden)]
pub struct OneRequestServiceResponse<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
framed: Option<Framed<T, Codec>>,
}
impl<T> Future for OneRequestServiceResponse<T>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
{
type Item = (Request, Framed<T, Codec>);
type Error = ParseError;
type Output = Result<(Request, Framed<T, Codec>), ParseError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.framed.as_mut().unwrap().poll()? {
Async::Ready(Some(req)) => match req {
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
match self.framed.as_mut().unwrap().next_item(cx) {
Poll::Ready(Some(Ok(req))) => match req {
Message::Item(req) => {
Ok(Async::Ready((req, self.framed.take().unwrap())))
Poll::Ready(Ok((req, self.framed.take().unwrap())))
}
Message::Chunk(_) => unreachable!("Something is wrong"),
},
Async::Ready(None) => Err(ParseError::Incomplete),
Async::NotReady => Ok(Async::NotReady),
Poll::Ready(Some(Err(err))) => Poll::Ready(Err(err)),
Poll::Ready(None) => Poll::Ready(Err(ParseError::Incomplete)),
Poll::Pending => Poll::Pending,
}
}
}

View File

@@ -1,10 +1,9 @@
use std::marker::PhantomData;
use std::task::{Context, Poll};
use actix_codec::Framed;
use actix_server_config::ServerConfig;
use actix_service::{NewService, Service};
use futures::future::FutureResult;
use futures::{Async, Poll};
use actix_service::{Service, ServiceFactory};
use futures_util::future::Ready;
use crate::error::Error;
use crate::h1::Codec;
@@ -12,16 +11,16 @@ use crate::request::Request;
pub struct UpgradeHandler<T>(PhantomData<T>);
impl<T> NewService for UpgradeHandler<T> {
type Config = ServerConfig;
impl<T> ServiceFactory for UpgradeHandler<T> {
type Config = ();
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type Service = UpgradeHandler<T>;
type InitError = Error;
type Future = FutureResult<Self::Service, Self::InitError>;
type Future = Ready<Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: &ServerConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
unimplemented!()
}
}
@@ -30,10 +29,10 @@ impl<T> Service for UpgradeHandler<T> {
type Request = (Request, Framed<T, Codec>);
type Response = ();
type Error = Error;
type Future = FutureResult<Self::Response, Self::Error>;
type Future = Ready<Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
Ok(Async::Ready(()))
fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
fn call(&mut self, _: Self::Request) -> Self::Future {

View File

@@ -1,5 +1,8 @@
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use futures::{Async, Future, Poll, Sink};
use crate::body::{BodySize, MessageBody, ResponseBody};
use crate::error::Error;
@@ -7,8 +10,10 @@ use crate::h1::{Codec, Message};
use crate::response::Response;
/// Send http/1 response
#[pin_project::pin_project]
pub struct SendResponse<T, B> {
res: Option<Message<(Response<()>, BodySize)>>,
#[pin]
body: Option<ResponseBody<B>>,
framed: Option<Framed<T, Codec>>,
}
@@ -31,62 +36,66 @@ where
impl<T, B> Future for SendResponse<T, B>
where
T: AsyncRead + AsyncWrite,
B: MessageBody,
B: MessageBody + Unpin,
{
type Item = Framed<T, Codec>;
type Error = Error;
type Output = Result<Framed<T, Codec>, Error>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
// TODO: rethink if we need loops in polls
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.project();
let mut body_done = this.body.is_none();
loop {
let mut body_ready = self.body.is_some();
let framed = self.framed.as_mut().unwrap();
let mut body_ready = !body_done;
let framed = this.framed.as_mut().unwrap();
// send body
if self.res.is_none() && self.body.is_some() {
while body_ready && self.body.is_some() && !framed.is_write_buf_full() {
match self.body.as_mut().unwrap().poll_next()? {
Async::Ready(item) => {
// body is done
if item.is_none() {
let _ = self.body.take();
if this.res.is_none() && body_ready {
while body_ready && !body_done && !framed.is_write_buf_full() {
match this.body.as_mut().as_pin_mut().unwrap().poll_next(cx)? {
Poll::Ready(item) => {
// body is done when item is None
body_done = item.is_none();
if body_done {
let _ = this.body.take();
}
framed.force_send(Message::Chunk(item))?;
framed.write(Message::Chunk(item))?;
}
Async::NotReady => body_ready = false,
Poll::Pending => body_ready = false,
}
}
}
// flush write buffer
if !framed.is_write_buf_empty() {
match framed.poll_complete()? {
Async::Ready(_) => {
match framed.flush(cx)? {
Poll::Ready(_) => {
if body_ready {
continue;
} else {
return Ok(Async::NotReady);
return Poll::Pending;
}
}
Async::NotReady => return Ok(Async::NotReady),
Poll::Pending => return Poll::Pending,
}
}
// send response
if let Some(res) = self.res.take() {
framed.force_send(res)?;
if let Some(res) = this.res.take() {
framed.write(res)?;
continue;
}
if self.body.is_some() {
if !body_done {
if body_ready {
continue;
} else {
return Ok(Async::NotReady);
return Poll::Pending;
}
} else {
break;
}
}
Ok(Async::Ready(self.framed.take().unwrap()))
Poll::Ready(Ok(this.framed.take().unwrap()))
}
}

View File

@@ -1,27 +1,23 @@
use std::collections::VecDeque;
use std::convert::TryFrom;
use std::future::Future;
use std::marker::PhantomData;
use std::time::Instant;
use std::{fmt, mem, net};
use std::net;
use std::pin::Pin;
use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_server_config::IoStream;
use actix_rt::time::{Delay, Instant};
use actix_service::Service;
use bitflags::bitflags;
use bytes::{Bytes, BytesMut};
use futures::{try_ready, Async, Future, Poll, Sink, Stream};
use h2::server::{Connection, SendResponse};
use h2::{RecvStream, SendStream};
use http::header::{
HeaderValue, ACCEPT_ENCODING, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING,
};
use http::HttpTryFrom;
use log::{debug, error, trace};
use tokio_timer::Delay;
use h2::SendStream;
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use log::{error, trace};
use crate::body::{Body, BodySize, MessageBody, ResponseBody};
use crate::body::{BodySize, MessageBody, ResponseBody};
use crate::cloneable::CloneableService;
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error, ParseError, PayloadError, ResponseError};
use crate::error::{DispatchError, Error};
use crate::helpers::DataFactory;
use crate::httpmessage::HttpMessage;
use crate::message::ResponseHead;
@@ -32,7 +28,11 @@ use crate::response::Response;
const CHUNK_SIZE: usize = 16_384;
/// Dispatcher for HTTP/2 protocol
pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody> {
#[pin_project::pin_project]
pub struct Dispatcher<T, S: Service<Request = Request>, B: MessageBody>
where
T: AsyncRead + AsyncWrite + Unpin,
{
service: CloneableService<S>,
connection: Connection<T, Bytes>,
on_connect: Option<Box<dyn DataFactory>>,
@@ -45,12 +45,12 @@ pub struct Dispatcher<T: IoStream, S: Service<Request = Request>, B: MessageBody
impl<T, S, B> Dispatcher<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Future: 'static,
// S::Future: 'static,
S::Response: Into<Response<B>>,
B: MessageBody + 'static,
B: MessageBody,
{
pub(crate) fn new(
service: CloneableService<S>,
@@ -91,76 +91,92 @@ where
impl<T, S, B> Future for Dispatcher<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
type Item = ();
type Error = DispatchError;
type Output = Result<(), DispatchError>;
#[inline]
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.get_mut();
loop {
match self.connection.poll()? {
Async::Ready(None) => return Ok(Async::Ready(())),
Async::Ready(Some((req, res))) => {
match Pin::new(&mut this.connection).poll_accept(cx) {
Poll::Ready(None) => return Poll::Ready(Ok(())),
Poll::Ready(Some(Err(err))) => return Poll::Ready(Err(err.into())),
Poll::Ready(Some(Ok((req, res)))) => {
// update keep-alive expire
if self.ka_timer.is_some() {
if let Some(expire) = self.config.keep_alive_expire() {
self.ka_expire = expire;
if this.ka_timer.is_some() {
if let Some(expire) = this.config.keep_alive_expire() {
this.ka_expire = expire;
}
}
let (parts, body) = req.into_parts();
let mut req = Request::with_payload(body.into());
let mut req = Request::with_payload(Payload::<
crate::payload::PayloadStream,
>::H2(
crate::h2::Payload::new(body)
));
let head = &mut req.head_mut();
head.uri = parts.uri;
head.method = parts.method;
head.version = parts.version;
head.headers = parts.headers.into();
head.peer_addr = self.peer_addr;
head.peer_addr = this.peer_addr;
// set on_connect data
if let Some(ref on_connect) = self.on_connect {
if let Some(ref on_connect) = this.on_connect {
on_connect.set(&mut req.extensions_mut());
}
tokio_current_thread::spawn(ServiceResponse::<S::Future, B> {
actix_rt::spawn(ServiceResponse::<
S::Future,
S::Response,
S::Error,
B,
> {
state: ServiceResponseState::ServiceCall(
self.service.call(req),
this.service.call(req),
Some(res),
),
config: self.config.clone(),
config: this.config.clone(),
buffer: None,
})
_t: PhantomData,
});
}
Async::NotReady => return Ok(Async::NotReady),
Poll::Pending => return Poll::Pending,
}
}
}
}
struct ServiceResponse<F, B> {
#[pin_project::pin_project]
struct ServiceResponse<F, I, E, B> {
#[pin]
state: ServiceResponseState<F, B>,
config: ServiceConfig,
buffer: Option<Bytes>,
_t: PhantomData<(I, E)>,
}
#[pin_project::pin_project(project = ServiceResponseStateProj)]
enum ServiceResponseState<F, B> {
ServiceCall(F, Option<SendResponse<Bytes>>),
SendPayload(SendStream<Bytes>, ResponseBody<B>),
ServiceCall(#[pin] F, Option<SendResponse<Bytes>>),
SendPayload(SendStream<Bytes>, #[pin] ResponseBody<B>),
}
impl<F, B> ServiceResponse<F, B>
impl<F, I, E, B> ServiceResponse<F, I, E, B>
where
F: Future,
F::Error: Into<Error>,
F::Item: Into<Response<B>>,
B: MessageBody + 'static,
F: Future<Output = Result<I, E>>,
E: Into<Error>,
I: Into<Response<B>>,
B: MessageBody,
{
fn prepare_response(
&self,
@@ -194,10 +210,6 @@ where
CONTENT_LENGTH,
HeaderValue::try_from(format!("{}", len)).unwrap(),
),
BodySize::Sized64(len) => res.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::try_from(format!("{}", len)).unwrap(),
),
};
// copy headers
@@ -215,122 +227,135 @@ where
if !has_date {
let mut bytes = BytesMut::with_capacity(29);
self.config.set_date_header(&mut bytes);
res.headers_mut()
.insert(DATE, HeaderValue::try_from(bytes.freeze()).unwrap());
res.headers_mut().insert(DATE, unsafe {
HeaderValue::from_maybe_shared_unchecked(bytes.freeze())
});
}
res
}
}
impl<F, B> Future for ServiceResponse<F, B>
impl<F, I, E, B> Future for ServiceResponse<F, I, E, B>
where
F: Future,
F::Error: Into<Error>,
F::Item: Into<Response<B>>,
B: MessageBody + 'static,
F: Future<Output = Result<I, E>>,
E: Into<Error>,
I: Into<Response<B>>,
B: MessageBody,
{
type Item = ();
type Error = ();
type Output = ();
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
match self.state {
ServiceResponseState::ServiceCall(ref mut call, ref mut send) => {
match call.poll() {
Ok(Async::Ready(res)) => {
let (res, body) = res.into().replace_body(());
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
let mut send = send.take().unwrap();
let mut size = body.size();
let h2_res = self.prepare_response(res.head(), &mut size);
match this.state.project() {
ServiceResponseStateProj::ServiceCall(call, send) => match call.poll(cx) {
Poll::Ready(Ok(res)) => {
let (res, body) = res.into().replace_body(());
let stream =
send.send_response(h2_res, size.is_eof()).map_err(|e| {
trace!("Error sending h2 response: {:?}", e);
})?;
let mut send = send.take().unwrap();
let mut size = body.size();
let h2_res = self.as_mut().prepare_response(res.head(), &mut size);
this = self.as_mut().project();
if size.is_eof() {
Ok(Async::Ready(()))
} else {
self.state = ServiceResponseState::SendPayload(stream, body);
self.poll()
let stream = match send.send_response(h2_res, size.is_eof()) {
Err(e) => {
trace!("Error sending h2 response: {:?}", e);
return Poll::Ready(());
}
Ok(stream) => stream,
};
if size.is_eof() {
Poll::Ready(())
} else {
this.state
.set(ServiceResponseState::SendPayload(stream, body));
self.poll(cx)
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(e) => {
let res: Response = e.into().into();
let (res, body) = res.replace_body(());
}
Poll::Pending => Poll::Pending,
Poll::Ready(Err(e)) => {
let res: Response = e.into().into();
let (res, body) = res.replace_body(());
let mut send = send.take().unwrap();
let mut size = body.size();
let h2_res = self.prepare_response(res.head(), &mut size);
let mut send = send.take().unwrap();
let mut size = body.size();
let h2_res = self.as_mut().prepare_response(res.head(), &mut size);
this = self.as_mut().project();
let stream =
send.send_response(h2_res, size.is_eof()).map_err(|e| {
trace!("Error sending h2 response: {:?}", e);
})?;
let stream = match send.send_response(h2_res, size.is_eof()) {
Err(e) => {
trace!("Error sending h2 response: {:?}", e);
return Poll::Ready(());
}
Ok(stream) => stream,
};
if size.is_eof() {
Ok(Async::Ready(()))
if size.is_eof() {
Poll::Ready(())
} else {
this.state.set(ServiceResponseState::SendPayload(
stream,
body.into_body(),
));
self.poll(cx)
}
}
},
ServiceResponseStateProj::SendPayload(ref mut stream, ref mut body) => {
loop {
loop {
if let Some(ref mut buffer) = this.buffer {
match stream.poll_capacity(cx) {
Poll::Pending => return Poll::Pending,
Poll::Ready(None) => return Poll::Ready(()),
Poll::Ready(Some(Ok(cap))) => {
let len = buffer.len();
let bytes = buffer.split_to(std::cmp::min(cap, len));
if let Err(e) = stream.send_data(bytes, false) {
warn!("{:?}", e);
return Poll::Ready(());
} else if !buffer.is_empty() {
let cap =
std::cmp::min(buffer.len(), CHUNK_SIZE);
stream.reserve_capacity(cap);
} else {
this.buffer.take();
}
}
Poll::Ready(Some(Err(e))) => {
warn!("{:?}", e);
return Poll::Ready(());
}
}
} else {
self.state = ServiceResponseState::SendPayload(
stream,
body.into_body(),
);
self.poll()
match body.as_mut().poll_next(cx) {
Poll::Pending => return Poll::Pending,
Poll::Ready(None) => {
if let Err(e) = stream.send_data(Bytes::new(), true)
{
warn!("{:?}", e);
}
return Poll::Ready(());
}
Poll::Ready(Some(Ok(chunk))) => {
stream.reserve_capacity(std::cmp::min(
chunk.len(),
CHUNK_SIZE,
));
*this.buffer = Some(chunk);
}
Poll::Ready(Some(Err(e))) => {
error!("Response payload stream error: {:?}", e);
return Poll::Ready(());
}
}
}
}
}
}
ServiceResponseState::SendPayload(ref mut stream, ref mut body) => loop {
loop {
if let Some(ref mut buffer) = self.buffer {
match stream.poll_capacity().map_err(|e| warn!("{:?}", e))? {
Async::NotReady => return Ok(Async::NotReady),
Async::Ready(None) => return Ok(Async::Ready(())),
Async::Ready(Some(cap)) => {
let len = buffer.len();
let bytes = buffer.split_to(std::cmp::min(cap, len));
if let Err(e) = stream.send_data(bytes, false) {
warn!("{:?}", e);
return Err(());
} else if !buffer.is_empty() {
let cap = std::cmp::min(buffer.len(), CHUNK_SIZE);
stream.reserve_capacity(cap);
} else {
self.buffer.take();
}
}
}
} else {
match body.poll_next() {
Ok(Async::NotReady) => {
return Ok(Async::NotReady);
}
Ok(Async::Ready(None)) => {
if let Err(e) = stream.send_data(Bytes::new(), true) {
warn!("{:?}", e);
return Err(());
} else {
return Ok(Async::Ready(()));
}
}
Ok(Async::Ready(Some(chunk))) => {
stream.reserve_capacity(std::cmp::min(
chunk.len(),
CHUNK_SIZE,
));
self.buffer = Some(chunk);
}
Err(e) => {
error!("Response payload stream error: {:?}", e);
return Err(());
}
}
}
}
},
}
}
}

View File

@@ -1,9 +1,9 @@
#![allow(dead_code, unused_imports)]
use std::fmt;
//! HTTP/2 implementation
use std::pin::Pin;
use std::task::{Context, Poll};
use bytes::Bytes;
use futures::{Async, Poll, Stream};
use futures_core::Stream;
use h2::RecvStream;
mod dispatcher;
@@ -25,22 +25,26 @@ impl Payload {
}
impl Stream for Payload {
type Item = Bytes;
type Error = PayloadError;
type Item = Result<Bytes, PayloadError>;
fn poll(&mut self) -> Poll<Option<Self::Item>, Self::Error> {
match self.pl.poll() {
Ok(Async::Ready(Some(chunk))) => {
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
let this = self.get_mut();
match Pin::new(&mut this.pl).poll_data(cx) {
Poll::Ready(Some(Ok(chunk))) => {
let len = chunk.len();
if let Err(err) = self.pl.release_capacity().release_capacity(len) {
Err(err.into())
if let Err(err) = this.pl.flow_control().release_capacity(len) {
Poll::Ready(Some(Err(err.into())))
} else {
Ok(Async::Ready(Some(chunk)))
Poll::Ready(Some(Ok(chunk)))
}
}
Ok(Async::Ready(None)) => Ok(Async::Ready(None)),
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(err) => Err(err.into()),
Poll::Ready(Some(Err(err))) => Poll::Ready(Some(Err(err.into()))),
Poll::Pending => Poll::Pending,
Poll::Ready(None) => Poll::Ready(None),
}
}
}

View File

@@ -1,62 +1,56 @@
use std::fmt::Debug;
use std::future::Future;
use std::marker::PhantomData;
use std::{io, net, rc};
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{net, rc};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_server_config::{Io, IoStream, ServerConfig as SrvConfig};
use actix_service::{IntoNewService, NewService, Service};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::net::TcpStream;
use actix_service::{
fn_factory, fn_service, pipeline_factory, IntoServiceFactory, Service,
ServiceFactory,
};
use bytes::Bytes;
use futures::future::{ok, FutureResult};
use futures::{try_ready, Async, Future, IntoFuture, Poll, Stream};
use h2::server::{self, Connection, Handshake};
use h2::RecvStream;
use futures_core::ready;
use futures_util::future::ok;
use h2::server::{self, Handshake};
use log::error;
use crate::body::MessageBody;
use crate::cloneable::CloneableService;
use crate::config::{KeepAlive, ServiceConfig};
use crate::error::{DispatchError, Error, ParseError, ResponseError};
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error};
use crate::helpers::DataFactory;
use crate::payload::Payload;
use crate::request::Request;
use crate::response::Response;
use super::dispatcher::Dispatcher;
/// `NewService` implementation for HTTP2 transport
pub struct H2Service<T, P, S, B> {
/// `ServiceFactory` implementation for HTTP2 transport
pub struct H2Service<T, S, B> {
srv: S,
cfg: ServiceConfig,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B> H2Service<T, P, S, B>
impl<T, S, B> H2Service<T, S, B>
where
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
/// Create new `HttpService` instance.
pub fn new<F: IntoNewService<S>>(service: F) -> Self {
let cfg = ServiceConfig::new(KeepAlive::Timeout(5), 5000, 0);
H2Service {
cfg,
on_connect: None,
srv: service.into_new_service(),
_t: PhantomData,
}
}
/// Create new `HttpService` instance with config.
pub fn with_config<F: IntoNewService<S>>(cfg: ServiceConfig, service: F) -> Self {
pub(crate) fn with_config<F: IntoServiceFactory<S>>(
cfg: ServiceConfig,
service: F,
) -> Self {
H2Service {
cfg,
on_connect: None,
srv: service.into_new_service(),
srv: service.into_factory(),
_t: PhantomData,
}
}
@@ -71,26 +65,142 @@ where
}
}
impl<T, P, S, B> NewService for H2Service<T, P, S, B>
impl<S, B> H2Service<TcpStream, S, B>
where
T: IoStream,
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
type Config = SrvConfig;
type Request = Io<T, P>;
/// Create simple tcp based service
pub fn tcp(
self,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = DispatchError,
InitError = S::InitError,
> {
pipeline_factory(fn_factory(|| async {
Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok::<_, DispatchError>((io, peer_addr))
}))
}))
.and_then(self)
}
}
#[cfg(feature = "openssl")]
mod openssl {
use actix_service::{fn_factory, fn_service};
use actix_tls::openssl::{Acceptor, SslAcceptor, SslStream};
use actix_tls::{openssl::HandshakeError, SslError};
use super::*;
impl<S, B> H2Service<SslStream<TcpStream>, S, B>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
/// Create ssl based service
pub fn openssl(
self,
acceptor: SslAcceptor,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<HandshakeError<TcpStream>, DispatchError>,
InitError = S::InitError,
> {
pipeline_factory(
Acceptor::new(acceptor)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(fn_factory(|| {
ok::<_, S::InitError>(fn_service(|io: SslStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, peer_addr))
}))
}))
.and_then(self.map_err(SslError::Service))
}
}
}
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use actix_tls::rustls::{Acceptor, ServerConfig, TlsStream};
use actix_tls::SslError;
use std::io;
impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
where
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
/// Create openssl based service
pub fn rustls(
self,
mut config: ServerConfig,
) -> impl ServiceFactory<
Config = (),
Request = TcpStream,
Response = (),
Error = SslError<io::Error, DispatchError>,
InitError = S::InitError,
> {
let protos = vec!["h2".to_string().into()];
config.set_protocols(&protos);
pipeline_factory(
Acceptor::new(config)
.map_err(SslError::Ssl)
.map_init_err(|_| panic!()),
)
.and_then(fn_factory(|| {
ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, peer_addr))
}))
}))
.and_then(self.map_err(SslError::Service))
}
}
}
impl<T, S, B> ServiceFactory for H2Service<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
type Config = ();
type Request = (T, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type InitError = S::InitError;
type Service = H2ServiceHandler<T, P, S::Service, B>;
type Future = H2ServiceResponse<T, P, S, B>;
type Service = H2ServiceHandler<T, S::Service, B>;
type Future = H2ServiceResponse<T, S, B>;
fn new_service(&self, cfg: &SrvConfig) -> Self::Future {
fn new_service(&self, _: ()) -> Self::Future {
H2ServiceResponse {
fut: self.srv.new_service(cfg).into_future(),
fut: self.srv.new_service(()),
cfg: Some(self.cfg.clone()),
on_connect: self.on_connect.clone(),
_t: PhantomData,
@@ -99,56 +209,61 @@ where
}
#[doc(hidden)]
pub struct H2ServiceResponse<T, P, S: NewService, B> {
fut: <S::Future as IntoFuture>::Future,
#[pin_project::pin_project]
pub struct H2ServiceResponse<T, S: ServiceFactory, B> {
#[pin]
fut: S::Future,
cfg: Option<ServiceConfig>,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B> Future for H2ServiceResponse<T, P, S, B>
impl<T, S, B> Future for H2ServiceResponse<T, S, B>
where
T: IoStream,
S: NewService<Config = SrvConfig, Request = Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Config = (), Request = Request>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service>::Future: 'static,
B: MessageBody + 'static,
{
type Item = H2ServiceHandler<T, P, S::Service, B>;
type Error = S::InitError;
type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
let service = try_ready!(self.fut.poll());
Ok(Async::Ready(H2ServiceHandler::new(
self.cfg.take().unwrap(),
self.on_connect.clone(),
service,
)))
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.as_mut().project();
Poll::Ready(ready!(this.fut.poll(cx)).map(|service| {
let this = self.as_mut().project();
H2ServiceHandler::new(
this.cfg.take().unwrap(),
this.on_connect.clone(),
service,
)
}))
}
}
/// `Service` implementation for http/2 transport
pub struct H2ServiceHandler<T, P, S, B> {
pub struct H2ServiceHandler<T, S: Service, B> {
srv: CloneableService<S>,
cfg: ServiceConfig,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
_t: PhantomData<(T, P, B)>,
_t: PhantomData<(T, B)>,
}
impl<T, P, S, B> H2ServiceHandler<T, P, S, B>
impl<T, S, B> H2ServiceHandler<T, S, B>
where
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
fn new(
cfg: ServiceConfig,
on_connect: Option<rc::Rc<dyn Fn(&T) -> Box<dyn DataFactory>>>,
srv: S,
) -> H2ServiceHandler<T, P, S, B> {
) -> H2ServiceHandler<T, S, B> {
H2ServiceHandler {
cfg,
on_connect,
@@ -158,31 +273,29 @@ where
}
}
impl<T, P, S, B> Service for H2ServiceHandler<T, P, S, B>
impl<T, S, B> Service for H2ServiceHandler<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
type Request = Io<T, P>;
type Request = (T, Option<net::SocketAddr>);
type Response = ();
type Error = DispatchError;
type Future = H2ServiceHandlerResponse<T, S, B>;
fn poll_ready(&mut self) -> Poll<(), Self::Error> {
self.srv.poll_ready().map_err(|e| {
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.srv.poll_ready(cx).map_err(|e| {
let e = e.into();
error!("Service readiness error: {:?}", e);
DispatchError::Service(e)
})
}
fn call(&mut self, req: Self::Request) -> Self::Future {
let io = req.into_parts().0;
let peer_addr = io.peer_addr();
fn call(&mut self, (io, addr): Self::Request) -> Self::Future {
let on_connect = if let Some(ref on_connect) = self.on_connect {
Some(on_connect(&io))
} else {
@@ -193,7 +306,7 @@ where
state: State::Handshake(
Some(self.srv.clone()),
Some(self.cfg.clone()),
peer_addr,
addr,
on_connect,
server::handshake(io),
),
@@ -201,8 +314,9 @@ where
}
}
enum State<T: IoStream, S: Service<Request = Request>, B: MessageBody>
enum State<T, S: Service<Request = Request>, B: MessageBody>
where
T: AsyncRead + AsyncWrite + Unpin,
S::Future: 'static,
{
Incoming(Dispatcher<T, S, B>),
@@ -217,11 +331,11 @@ where
pub struct H2ServiceHandlerResponse<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
{
state: State<T, S, B>,
@@ -229,27 +343,26 @@ where
impl<T, S, B> Future for H2ServiceHandlerResponse<T, S, B>
where
T: IoStream,
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request = Request>,
S::Error: Into<Error>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>>,
S::Response: Into<Response<B>> + 'static,
B: MessageBody,
{
type Item = ();
type Error = DispatchError;
type Output = Result<(), DispatchError>;
fn poll(&mut self) -> Poll<Self::Item, Self::Error> {
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
match self.state {
State::Incoming(ref mut disp) => disp.poll(),
State::Incoming(ref mut disp) => Pin::new(disp).poll(cx),
State::Handshake(
ref mut srv,
ref mut config,
ref peer_addr,
ref mut on_connect,
ref mut handshake,
) => match handshake.poll() {
Ok(Async::Ready(conn)) => {
) => match Pin::new(handshake).poll(cx) {
Poll::Ready(Ok(conn)) => {
self.state = State::Incoming(Dispatcher::new(
srv.take().unwrap(),
conn,
@@ -258,13 +371,13 @@ where
None,
*peer_addr,
));
self.poll()
self.poll(cx)
}
Ok(Async::NotReady) => Ok(Async::NotReady),
Err(err) => {
Poll::Ready(Err(err)) => {
trace!("H2 handshake error: {}", err);
Err(err.into())
Poll::Ready(Err(err.into()))
}
Poll::Pending => Poll::Pending,
},
}
}

View File

@@ -63,7 +63,7 @@ header! {
(AcceptCharset, ACCEPT_CHARSET) => (QualityItem<Charset>)+
test_accept_charset {
/// Test case from RFC
// Test case from RFC
test_header!(test1, vec![b"iso-8859-5, unicode-1-1;q=0.8"]);
}
}

View File

@@ -1,5 +1,5 @@
use http::Method;
use http::header;
use http::Method;
header! {
/// `Allow` header, defined in [RFC7231](http://tools.ietf.org/html/rfc7231#section-7.4.1)

View File

@@ -74,18 +74,18 @@ impl Header for CacheControl {
}
impl fmt::Display for CacheControl {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt_comma_delimited(f, &self[..])
}
}
impl IntoHeaderValue for CacheControl {
type Error = header::InvalidHeaderValueBytes;
type Error = header::InvalidHeaderValue;
fn try_into(self) -> Result<header::HeaderValue, Self::Error> {
let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self);
header::HeaderValue::from_shared(writer.take())
header::HeaderValue::from_maybe_shared(writer.take())
}
}
@@ -126,7 +126,7 @@ pub enum CacheDirective {
}
impl fmt::Display for CacheDirective {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
use self::CacheDirective::*;
fmt::Display::fmt(
match *self {

View File

@@ -90,40 +90,40 @@ pub enum DispositionParam {
/// [RFC6266](https://tools.ietf.org/html/rfc6266) as *token "=" value*. Recipients should
/// ignore unrecognizable parameters.
Unknown(String, String),
/// An unrecognized extended paramater as defined in
/// An unrecognized extended parameter as defined in
/// [RFC5987](https://tools.ietf.org/html/rfc5987) as *ext-parameter*, in
/// [RFC6266](https://tools.ietf.org/html/rfc6266) as *ext-token "=" ext-value*. The single
/// trailling asterisk is not included. Recipients should ignore unrecognizable parameters.
/// trailing asterisk is not included. Recipients should ignore unrecognizable parameters.
UnknownExt(String, ExtendedValue),
}
impl DispositionParam {
/// Returns `true` if the paramater is [`Name`](DispositionParam::Name).
/// Returns `true` if the parameter is [`Name`](DispositionParam::Name).
#[inline]
pub fn is_name(&self) -> bool {
self.as_name().is_some()
}
/// Returns `true` if the paramater is [`Filename`](DispositionParam::Filename).
/// Returns `true` if the parameter is [`Filename`](DispositionParam::Filename).
#[inline]
pub fn is_filename(&self) -> bool {
self.as_filename().is_some()
}
/// Returns `true` if the paramater is [`FilenameExt`](DispositionParam::FilenameExt).
/// Returns `true` if the parameter is [`FilenameExt`](DispositionParam::FilenameExt).
#[inline]
pub fn is_filename_ext(&self) -> bool {
self.as_filename_ext().is_some()
}
/// Returns `true` if the paramater is [`Unknown`](DispositionParam::Unknown) and the `name`
/// Returns `true` if the parameter is [`Unknown`](DispositionParam::Unknown) and the `name`
#[inline]
/// matches.
pub fn is_unknown<T: AsRef<str>>(&self, name: T) -> bool {
self.as_unknown(name).is_some()
}
/// Returns `true` if the paramater is [`UnknownExt`](DispositionParam::UnknownExt) and the
/// Returns `true` if the parameter is [`UnknownExt`](DispositionParam::UnknownExt) and the
/// `name` matches.
#[inline]
pub fn is_unknown_ext<T: AsRef<str>>(&self, name: T) -> bool {
@@ -373,7 +373,7 @@ impl ContentDisposition {
let param = if param_name.eq_ignore_ascii_case("name") {
DispositionParam::Name(value)
} else if param_name.eq_ignore_ascii_case("filename") {
// See also comments in test_from_raw_uncessary_percent_decode.
// See also comments in test_from_raw_unnecessary_percent_decode.
DispositionParam::Filename(value)
} else {
DispositionParam::Unknown(param_name.to_owned(), value)
@@ -387,26 +387,17 @@ impl ContentDisposition {
/// Returns `true` if it is [`Inline`](DispositionType::Inline).
pub fn is_inline(&self) -> bool {
match self.disposition {
DispositionType::Inline => true,
_ => false,
}
matches!(self.disposition, DispositionType::Inline)
}
/// Returns `true` if it is [`Attachment`](DispositionType::Attachment).
pub fn is_attachment(&self) -> bool {
match self.disposition {
DispositionType::Attachment => true,
_ => false,
}
matches!(self.disposition, DispositionType::Attachment)
}
/// Returns `true` if it is [`FormData`](DispositionType::FormData).
pub fn is_form_data(&self) -> bool {
match self.disposition {
DispositionType::FormData => true,
_ => false,
}
matches!(self.disposition, DispositionType::FormData)
}
/// Returns `true` if it is [`Ext`](DispositionType::Ext) and the `disp_type` matches.
@@ -423,7 +414,7 @@ impl ContentDisposition {
/// Return the value of *name* if exists.
pub fn get_name(&self) -> Option<&str> {
self.parameters.iter().filter_map(|p| p.as_name()).nth(0)
self.parameters.iter().filter_map(|p| p.as_name()).next()
}
/// Return the value of *filename* if exists.
@@ -431,7 +422,7 @@ impl ContentDisposition {
self.parameters
.iter()
.filter_map(|p| p.as_filename())
.nth(0)
.next()
}
/// Return the value of *filename\** if exists.
@@ -439,7 +430,7 @@ impl ContentDisposition {
self.parameters
.iter()
.filter_map(|p| p.as_filename_ext())
.nth(0)
.next()
}
/// Return the value of the parameter which the `name` matches.
@@ -448,7 +439,7 @@ impl ContentDisposition {
self.parameters
.iter()
.filter_map(|p| p.as_unknown(name))
.nth(0)
.next()
}
/// Return the value of the extended parameter which the `name` matches.
@@ -457,17 +448,17 @@ impl ContentDisposition {
self.parameters
.iter()
.filter_map(|p| p.as_unknown_ext(name))
.nth(0)
.next()
}
}
impl IntoHeaderValue for ContentDisposition {
type Error = header::InvalidHeaderValueBytes;
type Error = header::InvalidHeaderValue;
fn try_into(self) -> Result<header::HeaderValue, Self::Error> {
let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self);
header::HeaderValue::from_shared(writer.take())
header::HeaderValue::from_maybe_shared(writer.take())
}
}
@@ -486,7 +477,7 @@ impl Header for ContentDisposition {
}
impl fmt::Display for DispositionType {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match self {
DispositionType::Inline => write!(f, "inline"),
DispositionType::Attachment => write!(f, "attachment"),
@@ -497,7 +488,7 @@ impl fmt::Display for DispositionType {
}
impl fmt::Display for DispositionParam {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
// All ASCII control characters (0-30, 127) including horizontal tab, double quote, and
// backslash should be escaped in quoted-string (i.e. "foobar").
// Ref: RFC6266 S4.1 -> RFC2616 S3.6
@@ -529,7 +520,7 @@ impl fmt::Display for DispositionParam {
// ; to use within parameter values
//
//
// See also comments in test_from_raw_uncessary_percent_decode.
// See also comments in test_from_raw_unnecessary_percent_decode.
lazy_static! {
static ref RE: Regex = Regex::new("[\x00-\x08\x10-\x1F\x7F\"\\\\]").unwrap();
}
@@ -555,7 +546,7 @@ impl fmt::Display for DispositionParam {
}
impl fmt::Display for ContentDisposition {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
write!(f, "{}", self.disposition)?;
self.parameters
.iter()
@@ -676,7 +667,7 @@ mod tests {
fn test_from_raw_unordered() {
let a = HeaderValue::from_static(
"form-data; dummy=3; filename=\"sample.png\" ; name=upload;",
// Actually, a trailling semolocon is not compliant. But it is fine to accept.
// Actually, a trailing semicolon is not compliant. But it is fine to accept.
);
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
@@ -768,9 +759,8 @@ mod tests {
Mainstream browsers like Firefox (gecko) and Chrome use UTF-8 directly as above.
(And now, only UTF-8 is handled by this implementation.)
*/
let a =
HeaderValue::from_str("form-data; name=upload; filename=\"文件.webp\"")
.unwrap();
let a = HeaderValue::from_str("form-data; name=upload; filename=\"文件.webp\"")
.unwrap();
let a: ContentDisposition = ContentDisposition::from_raw(&a).unwrap();
let b = ContentDisposition {
disposition: DispositionType::FormData,
@@ -834,7 +824,7 @@ mod tests {
}
#[test]
fn test_from_raw_uncessary_percent_decode() {
fn test_from_raw_unnecessary_percent_decode() {
// In fact, RFC7578 (multipart/form-data) Section 2 and 4.2 suggests that filename with
// non-ASCII characters MAY be percent-encoded.
// On the contrary, RFC6266 or other RFCs related to Content-Disposition response header
@@ -884,7 +874,11 @@ mod tests {
assert!(ContentDisposition::from_raw(&a).is_err());
let a = HeaderValue::from_static("inline; filename=\"\"");
assert!(ContentDisposition::from_raw(&a).expect("parse cd").get_filename().expect("filename").is_empty());
assert!(ContentDisposition::from_raw(&a)
.expect("parse cd")
.get_filename()
.expect("filename")
.is_empty());
}
#[test]

View File

@@ -3,7 +3,7 @@ use std::str::FromStr;
use crate::error::ParseError;
use crate::header::{
HeaderValue, IntoHeaderValue, InvalidHeaderValueBytes, Writer, CONTENT_RANGE,
HeaderValue, IntoHeaderValue, InvalidHeaderValue, Writer, CONTENT_RANGE,
};
header! {
@@ -166,7 +166,7 @@ impl FromStr for ContentRangeSpec {
}
impl Display for ContentRangeSpec {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
ContentRangeSpec::Bytes {
range,
@@ -198,11 +198,11 @@ impl Display for ContentRangeSpec {
}
impl IntoHeaderValue for ContentRangeSpec {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self);
HeaderValue::from_shared(writer.take())
HeaderValue::from_maybe_shared(writer.take())
}
}

View File

@@ -3,7 +3,7 @@ use std::fmt::{self, Display, Write};
use crate::error::ParseError;
use crate::header::{
self, from_one_raw_str, EntityTag, Header, HeaderName, HeaderValue, HttpDate,
IntoHeaderValue, InvalidHeaderValueBytes, Writer,
IntoHeaderValue, InvalidHeaderValue, Writer,
};
use crate::httpmessage::HttpMessage;
@@ -87,7 +87,7 @@ impl Header for IfRange {
}
impl Display for IfRange {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
IfRange::EntityTag(ref x) => Display::fmt(x, f),
IfRange::Date(ref x) => Display::fmt(x, f),
@@ -96,12 +96,12 @@ impl Display for IfRange {
}
impl IntoHeaderValue for IfRange {
type Error = InvalidHeaderValueBytes;
type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let mut writer = Writer::new();
let _ = write!(&mut writer, "{}", self);
HeaderValue::from_shared(writer.take())
HeaderValue::from_maybe_shared(writer.take())
}
}

View File

@@ -9,11 +9,13 @@
pub use self::accept_charset::AcceptCharset;
//pub use self::accept_encoding::AcceptEncoding;
pub use self::accept_language::AcceptLanguage;
pub use self::accept::Accept;
pub use self::accept_language::AcceptLanguage;
pub use self::allow::Allow;
pub use self::cache_control::{CacheControl, CacheDirective};
pub use self::content_disposition::{ContentDisposition, DispositionType, DispositionParam};
pub use self::content_disposition::{
ContentDisposition, DispositionParam, DispositionType,
};
pub use self::content_language::ContentLanguage;
pub use self::content_range::{ContentRange, ContentRangeSpec};
pub use self::content_type::ContentType;
@@ -47,7 +49,7 @@ macro_rules! __hyper__deref {
&mut self.0
}
}
}
};
}
#[doc(hidden)]
@@ -74,8 +76,8 @@ macro_rules! test_header {
($id:ident, $raw:expr) => {
#[test]
fn $id() {
use $crate::test;
use super::*;
use $crate::test;
let raw = $raw;
let a: Vec<Vec<u8>> = raw.iter().map(|x| x.to_vec()).collect();
@@ -118,7 +120,7 @@ macro_rules! test_header {
// Test formatting
if typed.is_some() {
let raw = &($raw)[..];
let mut iter = raw.iter().map(|b|str::from_utf8(&b[..]).unwrap());
let mut iter = raw.iter().map(|b| str::from_utf8(&b[..]).unwrap());
let mut joined = String::new();
joined.push_str(iter.next().unwrap());
for s in iter {
@@ -128,7 +130,7 @@ macro_rules! test_header {
assert_eq!(format!("{}", typed.unwrap()), joined);
}
}
}
};
}
#[macro_export]
@@ -159,18 +161,18 @@ macro_rules! header {
}
impl std::fmt::Display for $id {
#[inline]
fn fmt(&self, f: &mut std::fmt::Formatter) -> ::std::fmt::Result {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> ::std::fmt::Result {
$crate::http::header::fmt_comma_delimited(f, &self.0[..])
}
}
impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes;
type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
use std::fmt::Write;
let mut writer = $crate::http::header::Writer::new();
let _ = write!(&mut writer, "{}", self);
$crate::http::header::HeaderValue::from_shared(writer.take())
$crate::http::header::HeaderValue::from_maybe_shared(writer.take())
}
}
};
@@ -195,18 +197,18 @@ macro_rules! header {
}
impl std::fmt::Display for $id {
#[inline]
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
$crate::http::header::fmt_comma_delimited(f, &self.0[..])
}
}
impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes;
type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
use std::fmt::Write;
let mut writer = $crate::http::header::Writer::new();
let _ = write!(&mut writer, "{}", self);
$crate::http::header::HeaderValue::from_shared(writer.take())
$crate::http::header::HeaderValue::from_maybe_shared(writer.take())
}
}
};
@@ -231,12 +233,12 @@ macro_rules! header {
}
impl std::fmt::Display for $id {
#[inline]
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
std::fmt::Display::fmt(&self.0, f)
}
}
impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes;
type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
self.0.try_into()
@@ -276,7 +278,7 @@ macro_rules! header {
}
impl std::fmt::Display for $id {
#[inline]
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
match *self {
$id::Any => f.write_str("*"),
$id::Items(ref fields) => $crate::http::header::fmt_comma_delimited(
@@ -285,13 +287,13 @@ macro_rules! header {
}
}
impl $crate::http::header::IntoHeaderValue for $id {
type Error = $crate::http::header::InvalidHeaderValueBytes;
type Error = $crate::http::header::InvalidHeaderValue;
fn try_into(self) -> Result<$crate::http::header::HeaderValue, Self::Error> {
use std::fmt::Write;
let mut writer = $crate::http::header::Writer::new();
let _ = write!(&mut writer, "{}", self);
$crate::http::header::HeaderValue::from_shared(writer.take())
$crate::http::header::HeaderValue::from_maybe_shared(writer.take())
}
}
};
@@ -330,11 +332,10 @@ macro_rules! header {
};
}
mod accept_charset;
//mod accept_encoding;
mod accept_language;
mod accept;
mod accept_language;
mod allow;
mod cache_control;
mod content_disposition;

Some files were not shown because too many files have changed in this diff Show More