1
0
mirror of https://github.com/fafhrd91/actix-web synced 2025-07-30 03:56:47 +02:00

Compare commits

..

161 Commits

Author SHA1 Message Date
Rob Ede
a32151525c prepare awc release 3.0.0-beta.4 2021-04-02 09:40:36 +01:00
Rob Ede
546e7c5da4 prepare web release 4.0.0-beta.5 2021-04-02 09:37:51 +01:00
Rob Ede
6fb06a720a prepare http release 3.0.0-beta.5 2021-04-02 09:27:11 +01:00
Rob Ede
c54a0713de migrate integration testing to new crate (#2112) 2021-04-02 08:26:59 +01:00
Ibraheem Ahmed
50dc13f280 move typed headers and implement FromRequest (#2094)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-04-01 16:42:18 +01:00
Rob Ede
c8ed8dd1a4 migrate to -utils beta 4 (#2127) 2021-04-01 15:26:13 +01:00
Michał Pokrywka
a807d33600 added TestServer::client_headers (#2097)
Co-authored-by: fakeshadow <24548779@qq.com>
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-04-01 06:40:10 +01:00
fakeshadow
1f1be6fd3d add Client::headers (#2114) 2021-03-31 11:43:56 +01:00
fakeshadow
c49fe79207 Simplify lifetime annotation in HttpServiceBuilder. Simplify PlStream (#2129) 2021-03-30 15:46:09 +01:00
Rob Ede
f66774e30b remove From<OffsetDateTime> impl from HttpDate
fully removes time crate from public api of -http
2021-03-30 03:32:22 +01:00
fakeshadow
1281a748d0 merge H1ServiceHandler requests into HttpServiceHandler (#2126) 2021-03-30 03:06:16 +01:00
fakeshadow
222acfd070 Fix build for next actix-tls-beta release (#2122) 2021-03-29 13:45:48 +01:00
Rob Ede
980ecc5f07 fix openssl windows ci 2021-03-29 13:01:37 +01:00
Rob Ede
e8ce73b496 update dep docs 2021-03-29 11:52:59 +01:00
Daniel Egger
f954a30c34 Fix typo in CHANGES.md (#2124) 2021-03-29 10:18:05 +01:00
fakeshadow
60f9cfbb2a Refactor actix_http::h2::service module. Reduce loc. (#2118) 2021-03-26 18:24:51 +00:00
fakeshadow
6822bf2f58 Refactor actix_http::h1::service (#2117) 2021-03-26 16:15:04 +00:00
fakeshadow
2f7f1fa97a fix broken pipe for h2 when client is instantly dropped (#2113) 2021-03-26 00:05:31 +00:00
fakeshadow
8c2ce2dedb fix awc compress feature (#2116) 2021-03-25 22:47:37 +00:00
Rob Ede
3188ef5731 don't use rust annotation on code doc blocks 2021-03-25 08:45:52 +00:00
fakeshadow
9704beddf8 Relax MessageBody limit to 2048kb (#2110)
* relax MessageBody limit to 2048kb

* fix clippy

* Update awc/src/response.rs

Co-authored-by: Rob Ede <robjtede@icloud.com>

* fix default body limit

Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-03-24 04:44:03 -07:00
Ibraheem Ahmed
1be54efbeb Simplify service factory macro (#2108) 2021-03-23 13:42:46 +00:00
fakeshadow
746d983849 handle header error with CustomResponder (#2093) 2021-03-20 05:18:06 +00:00
Ibraheem Ahmed
8d9de76826 Simplify handler factory macro (#2086) 2021-03-19 16:30:53 +00:00
Thomas de Zeeuw
9488757c29 Update to socket2 v0.4 (#2092) 2021-03-19 12:17:06 +00:00
fakeshadow
351286486c fix clippy warning on nightly (#2088)
* fix clippy warning on nightly
2021-03-19 19:25:35 +08:00
Ibraheem Ahmed
78fcd0237a Format extract macro (#2087) 2021-03-19 04:08:23 +00:00
Rob Ede
81942d31d6 fix new dyn trait lint 2021-03-19 02:03:09 +00:00
fakeshadow
b75b5114c3 refactor actix_http connection types and connector services (#2081) 2021-03-18 17:53:22 +00:00
obayemi
abcb444dd9 fix routes in Path documentation (#2084) 2021-03-18 13:21:44 +00:00
Rob Ede
983b6904a7 unvendor openssl 2021-03-17 00:38:54 +00:00
Rob Ede
3dc2d145ef import some traits as _ 2021-03-17 00:38:54 +00:00
fakeshadow
c8f6d37290 rename client io trait. reduce duplicate code (#2079) 2021-03-16 16:31:14 +00:00
fakeshadow
69dd1a9bd6 Remove ConnectionLifetime trait. Simplify Acquired handling (#2072) 2021-03-16 02:56:23 +00:00
fakeshadow
d93314a683 fix awc readme example (#2076) 2021-03-15 10:59:42 +00:00
fakeshadow
a55e87faaa refactor actix_http::helpers to generic over bufmut trait (#2069) 2021-03-15 02:33:51 +00:00
fakeshadow
515d0e3fb4 change behavior of default upgrade handler (#2071) 2021-03-13 22:20:18 +00:00
Ilya Averyanov
22dcc31193 Fix logger middleware properly escape %% (#2067) 2021-03-11 14:12:42 +00:00
Rob Ede
909ef0344b document client mod removal
closes #2064
2021-03-11 00:43:03 +00:00
fakeshadow
a2b0e86632 simplify connector generic type (#2063) 2021-03-10 23:57:32 +00:00
fakeshadow
d0c1f1a84c remove actix_http::client::pool::Protocol (#2061) 2021-03-10 01:31:50 +00:00
Rob Ede
b62da7e86b prepare actix-web-actors release 4.0.0-beta.3 2021-03-09 23:44:26 +00:00
Rob Ede
5e9a3eb6ae prepare actix-multipart release 0.4.0-beta.3 2021-03-09 23:40:50 +00:00
Rob Ede
3451d6874f prepare actix-files release 0.6.0-beta.3 2021-03-09 23:39:40 +00:00
Rob Ede
18c3783a1c prepare actix-http-test release 3.0.0-beta.3 2021-03-09 23:35:42 +00:00
Rob Ede
4b46351d36 prepare actix-web release 4.0.0-beta.4 2021-03-09 23:31:44 +00:00
Rob Ede
b7c406637d prepare actix-web-codegen release 0.5.0-beta.2 2021-03-09 23:27:38 +00:00
Rob Ede
c4e5651215 update docs 2021-03-08 23:49:12 +00:00
Rob Ede
23b0e64199 prepare awc release 3.0.0-beta.3 2021-03-08 23:15:53 +00:00
Rob Ede
fc31b091e4 prepare http release 3.0.0-beta.4 2021-03-08 23:07:40 +00:00
Rob Ede
effacf8fc8 fix ssl test 2021-03-08 20:51:50 +00:00
Rob Ede
95130fcfd0 address clippy warnings 2021-03-08 20:32:19 +00:00
fakeshadow
5e81105317 remove ka timer from h2 dispatcher (#2057) 2021-03-08 20:00:20 +00:00
fakeshadow
5b4105e1e6 Refactor/client builder (#2053) 2021-03-07 23:57:32 +00:00
Rob Ede
2d3a0d6038 json method receives plain serialize (#2052) 2021-03-07 22:11:39 +00:00
fakeshadow
fe0b3f459f remove localwaker from h1::payload (#2051) 2021-03-07 21:23:42 +00:00
Rob Ede
ca69b6577e use iota for more content-length insertions (#2050) 2021-03-07 19:29:02 +00:00
fakeshadow
880b863f95 fix h1 client for handling expect header request (#2049) 2021-03-07 18:33:16 +00:00
fakeshadow
78384c3ff5 make actix_http::ws::Codec::new const (#2043) 2021-03-04 19:19:01 +00:00
Rob Ede
c1c4400c4a fix h2 tests (#2034) 2021-03-04 13:27:54 +00:00
Richard Chien
fc6f974617 Add "name" attribute to route macro (#1934) 2021-03-04 12:38:47 +00:00
fakeshadow
14b249b804 update to actix-0.11.0-beta.3 for actix-web-actors (#2042) 2021-03-04 11:39:29 +00:00
Rob Ede
0195824794 Update codecov.yml 2021-03-02 13:18:16 +00:00
Florian Dreschner
fb019f15b4 test(files): Fix test and remove outdated case (#2037)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-02-28 23:01:59 +00:00
Daniel T. Rodrigues
abc7fd374b update example links (#2036)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-02-28 21:41:07 +00:00
Rob Ede
cd652dca75 refactor websocket key hashing (#2035) 2021-02-28 19:55:34 +00:00
fakeshadow
c836de44af add client middleware (#2013) 2021-02-28 18:17:08 +00:00
fakeshadow
badae2f8fd add local_address bind for client builder (#2024) 2021-02-27 22:31:14 +00:00
fboulnois
1f34718ecd Use once_cell instead of lazy_static (#2029) 2021-02-27 21:55:50 +00:00
fakeshadow
ebda60fd6b refactor boxed route (#2033) 2021-02-27 21:00:36 +00:00
Rob Ede
d242f57758 fix tests for codecov 2021-02-27 20:58:44 +00:00
Rob Ede
b95e1dda34 pin h2 to 0.3.0 2021-02-27 19:57:09 +00:00
Daniel T. Rodrigues
8f2a97c6e3 Update README example links (#2027)
The examples repo went through a folder restructuring. More info: https://github.com/actix/examples/pull/411
2021-02-26 01:21:56 +00:00
Baran Demirbaş
ebaf25d55a Fix typos in CHANGES.md (#2025)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-02-24 16:19:40 +00:00
Erik Johnston
42711c23d7 Port over doc comments in route macros. (#2022)
Co-authored-by: Jonas Platte <jplatte@users.noreply.github.com>
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-02-24 12:26:56 +00:00
Rob Ede
f6393728c7 remove usage of actix_utils::mpsc (#2023) 2021-02-24 09:08:56 +00:00
Ibraheem Ahmed
d92ab7e8e0 add msrv to clippy config (#1862) 2021-02-22 15:39:31 +00:00
Alex Rebert
5845b3965c actix-http-test: minimize features of dependencies (#2019) 2021-02-22 12:00:08 +00:00
fakeshadow
aacec30ad1 reduce duplicate code (#2020) 2021-02-22 11:15:12 +00:00
Adam Chalmers
2dbdf61c37 Inner field of web::Query is public again (#2016) (#2017)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-02-20 17:59:09 +00:00
Dávid Szabó
83365058ce Fix HTTP client link (#2011) 2021-02-18 21:56:24 +00:00
Richard Janis Goldschmidt
3b93c62e23 Fix Json extractor to be 32kB by default (#2010) 2021-02-18 15:20:20 +00:00
fakeshadow
946cccaa1a refactor awc::ClientBuilder (#2008) 2021-02-18 12:30:09 +00:00
fakeshadow
1838d9cd0f remove unused method. reduce leaf future type (#2009) 2021-02-18 11:24:10 +00:00
fakeshadow
f62a982a51 simplify the match on h1 message type (#2006) 2021-02-18 10:38:27 +00:00
fakeshadow
dfd9dc40ea remove awc::connect::connect trait. (#2004) 2021-02-17 17:10:46 +00:00
fakeshadow
5efea652e3 add ClientResponse::timeout (#1931) 2021-02-17 11:55:11 +00:00
fakeshadow
dfa795ff9d return poll in poll_flush (#2005) 2021-02-17 11:18:31 +00:00
Luka Zakrajšek
2cc6b47fcf Use http-range library for HttpRange (#2003) 2021-02-16 18:48:16 +00:00
fakeshadow
117025a96b simplify client::connection::Connection trait (#1998) 2021-02-16 14:10:22 +00:00
Rob Ede
3e0a9b99ff update rust-cache action 2021-02-16 09:28:14 +00:00
Rob Ede
17b3e7e225 pool doc nits (#1999) 2021-02-16 09:08:30 +00:00
fakeshadow
c065729468 rework client connection pool (#1994) 2021-02-16 08:27:14 +00:00
Rob Ede
55db3ec65c split up http body module 2021-02-15 12:20:43 +00:00
Rob Ede
0404b78b54 improve body size docs 2021-02-15 11:24:46 +00:00
fakeshadow
68d1bd88b1 remove unused flag upgrade (#1992) 2021-02-14 18:13:05 +00:00
fakeshadow
308b70b039 fix potential over read (#1991) 2021-02-14 17:36:18 +00:00
Rob Ede
7fa6333a0c use rcgen for tls key generation (#1989) 2021-02-13 17:16:36 +00:00
Rob Ede
3279070f9f optional cookies features (#1981) 2021-02-13 15:08:43 +00:00
fakeshadow
b37669cb3b fix notify on drop (#1987) 2021-02-13 04:23:37 +00:00
Rob Ede
1e538bf73e rework ci (#1982) 2021-02-12 21:53:21 +00:00
fakeshadow
366c032c36 refactor DateService (#1983) 2021-02-12 21:52:58 +00:00
fakeshadow
95113ad12f do not self wake up when have a payload (#1984) 2021-02-12 20:33:13 +00:00
fakeshadow
ce9b2770e2 remove unused Dispatcher::new_timeout (#1985) 2021-02-12 10:37:28 +00:00
Rob Ede
4fc7d76759 s/websocket/WebSocket in docs 2021-02-12 00:27:20 +00:00
Rob Ede
81bef93e5e add time parser year shift tests 2021-02-12 00:15:25 +00:00
Rob Ede
31d9ed81c5 change rustfmt line width to 96 2021-02-11 23:03:17 +00:00
Rob Ede
c1af5089b9 add 431 and 451 status codes 2021-02-11 22:58:40 +00:00
Rob Ede
77efc09362 hide httpmessage mod 2021-02-11 22:58:40 +00:00
Rob Ede
871ca5e4ae stop claiming actor support 2021-02-11 22:58:40 +00:00
fakeshadow
ceace26ed4 remove unused flag POLLED (#1980) 2021-02-11 14:19:14 -08:00
fakeshadow
75a9a72e78 clean up poll_response. add comments (#1978) 2021-02-11 14:54:42 +00:00
fakeshadow
d9d0d1d1a2 reduce unsafe (#1972) 2021-02-10 23:11:12 +00:00
Rob Ede
ea5ce3befb prepare actix-http 3.0.0-beta.3 release 2021-02-10 18:36:14 +00:00
Rob Ede
e18464b274 bump actix web versions in deps 2021-02-10 12:57:13 +00:00
Rob Ede
bd26083f33 prepare codegen 0.5.0-beta.1 release 2021-02-10 12:45:46 +00:00
Rob Ede
991363a104 consistent case s/web/Web 2021-02-10 12:12:03 +00:00
Rob Ede
a290e58982 prepare beta 2 release set (#1975) 2021-02-10 12:10:03 +00:00
fakeshadow
dcad9724bc ensure poll_flush on h1 connection disconnect (#1974) 2021-02-10 10:11:53 +00:00
Rob Ede
949d14ae2b clean up header map (#1964) 2021-02-09 22:59:17 +00:00
fakeshadow
a6ed4aee84 add poll_flush after a non blocked write to h1 dispatcher (#1971) 2021-02-09 22:32:46 +00:00
fakeshadow
519d7f2b8a add trust-dns optional feature for actix-http and awc (#1969) 2021-02-09 10:41:20 +00:00
fakeshadow
dddb623a11 add services register for tuple and vec of services (#1933) 2021-02-07 23:47:51 +00:00
fakeshadow
266cf0622c reduce branch.remove deadcode for h1 dispatcher (#1962) 2021-02-07 22:48:27 +00:00
Rob Ede
9604e249c9 use stable clippy (#1963) 2021-02-07 20:33:53 +00:00
fakeshadow
dbc47c9122 optimize actix-http messages (#1914) 2021-02-07 20:19:10 +00:00
fakeshadow
4c243cbf89 simplify methods of awc::connect::Connect trait (#1941) 2021-02-07 18:56:39 +00:00
Alexander Jackson
deafb7c8b8 Improve impl ResponseError documentation (#1939)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-02-07 04:54:41 +00:00
Jens Reidel
50309aa295 Use askama-escape for html escaping (#1953) 2021-02-07 04:50:23 +00:00
Rob Ede
9eaea6a2fd tweak feature flags 2021-02-07 03:54:58 +00:00
fakeshadow
830fb2cdb2 properly drop h2 connection (#1926) 2021-02-07 03:51:36 +00:00
fakeshadow
7cfed73be8 fix memory usage for h1 and read bug on buffer size. (#1929) 2021-02-07 03:20:35 +00:00
fakeshadow
41bc04b1c4 Use immutable reference of service state. Update awc dns resolver. (#1905) 2021-02-07 01:00:40 +00:00
fakeshadow
20cf0094e5 fix master branch build. change web::block output type. (#1957) 2021-02-06 16:23:59 +00:00
fakeshadow
83fb4978ad fix awc test_client test (#1960) 2021-02-06 16:05:33 +00:00
fakeshadow
51e54dac8b fix limit not working on HttpMessageBody::limit (#1938) 2021-01-27 10:49:57 +00:00
Jonas Platte
c201c15f8c Improve documentation for PayloadConfig (#1923) 2021-01-24 00:32:10 +00:00
Logan Magee
0c8196f8b0 Remove HttpResponseBuilder::json2() (#1903)
It's not necessary to keep both json() and json2() around since the
former reduces the ownership of its parameter to a borrow only to pass
the reference to the latter. Users can instead borrow themselves when
passing an owned value: there doesn't need to be two separate functions.

This change also makes HttpResponseBuilder::json() take T: Deref so it
can accept both references and web extractors like web::Json.
2021-01-18 12:14:29 +00:00
Rob Ede
ee10148444 revive commented out tests (#1912) 2021-01-17 05:19:32 +00:00
fakeshadow
1c95fc2654 Refactor poll_keepalive for readability (#1901) 2021-01-16 00:15:06 +00:00
Rob Ede
da69bb4d12 implement App::data as App::app_data(Data::new(T))) (#1906) 2021-01-15 23:37:33 +00:00
Rob Ede
0a506bf2e9 cleanup top level doc comments 2021-01-15 05:38:50 +00:00
Rob Ede
b2a9ba2ee4 Update PULL_REQUEST_TEMPLATE.md 2021-01-15 04:54:23 +00:00
Rob Ede
f976150b67 return option item from Extensions::insert (#1904) 2021-01-15 04:22:42 +00:00
Rob Ede
b1dd8d28bc response header rework (#1869) 2021-01-15 02:11:10 +00:00
fakeshadow
4edeb5ce47 optimize ErrorHandler middleware (#1902) 2021-01-14 01:43:44 +00:00
fakeshadow
d34a8689e5 Refactor h1 encoder (#1900) 2021-01-12 14:38:53 +00:00
Robin Schoonover
a919d2de56 actix-files: Fix If-(Un)Modified to not consider sub-seconds (#1887) 2021-01-11 18:18:23 +00:00
fakeshadow
46a8f28b74 fix actix-files doc about thread pool (#1898) 2021-01-11 17:27:33 +00:00
fakeshadow
57398c6df1 Refactor/service request (#1893) 2021-01-11 01:29:16 +00:00
fakeshadow
7affc6878e simplify h1 dispatcher (#1899)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-01-11 00:13:56 +00:00
fakeshadow
46b2f7eaaf use a non leak pool for HttpRequestInner (#1889)
Co-authored-by: Rob Ede <robjtede@icloud.com>
2021-01-10 22:59:44 +00:00
fakeshadow
9e401b6ef7 refactor Scope (#1895) 2021-01-09 18:06:49 +00:00
fakeshadow
fe392abeb4 remove actix-threadpool.use actix_rt::task::spawn_blocking (#1878) 2021-01-09 16:04:19 +00:00
fakeshadow
f6cc829758 remove leaked box in REQUEST_POOL and RESPONSE_POOL (#1896) 2021-01-09 15:40:20 +00:00
Rob Ede
6575ee93f2 big clean up and docs improvmenet of types mod (#1894) 2021-01-09 13:17:19 +00:00
fakeshadow
530d03791d refactor Resource (#1883) 2021-01-09 03:36:58 +00:00
fakeshadow
d40ae8c8ca use sync method on Responder trait (#1891) 2021-01-08 22:17:19 +00:00
Rob Ede
2204614134 don't run awc doctests that rely on external public endpoints (#1888) 2021-01-08 12:00:58 +00:00
fakeshadow
188ee44f81 remove copyless dependency (#1884) 2021-01-07 21:55:00 +00:00
fakeshadow
a4c9aaf337 fix extra branch in h1 dispatcher timer (#1882) 2021-01-07 20:42:09 +00:00
236 changed files with 13652 additions and 11171 deletions

3
.cargo/config.toml Normal file
View File

@@ -0,0 +1,3 @@
[alias]
chk = "hack check --workspace --all-features --tests --examples"
lint = "hack --clean-per-run clippy --workspace --tests --examples"

View File

@@ -1,21 +1,21 @@
<!-- Thanks for considering contributing actix! -->
<!-- Please fill out the following to make our reviews easy. -->
<!-- Please fill out the following to get your PR reviewed quicker. -->
## PR Type
<!-- What kind of change does this PR make? -->
<!-- Bug Fix / Feature / Refactor / Code Style / Other -->
INSERT_PR_TYPE
PR_TYPE
## PR Checklist
Check your PR fulfills the following:
<!-- Check your PR fulfills the following items. ->>
<!-- For draft PRs check the boxes as you complete them. -->
- [ ] Tests for the changes have been added / updated.
- [ ] Documentation comments have been added / updated.
- [ ] A changelog entry has been made for the appropriate packages.
- [ ] Format code with the latest stable rustfmt
- [ ] Format code with the latest stable rustfmt.
- [ ] (Team) Label with affected crates and semver status.
## Overview

View File

@@ -1,4 +1,4 @@
name: Benchmark (Linux)
name: Benchmark
on:
pull_request:

127
.github/workflows/ci.yml vendored Normal file
View File

@@ -0,0 +1,127 @@
name: CI
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches: [master]
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
target:
- { name: Linux, os: ubuntu-latest, triple: x86_64-unknown-linux-gnu }
- { name: macOS, os: macos-latest, triple: x86_64-apple-darwin }
- { name: Windows, os: windows-latest, triple: x86_64-pc-windows-msvc }
version:
- 1.46.0 # MSRV
- stable
- nightly
name: ${{ matrix.target.name }} / ${{ matrix.version }}
runs-on: ${{ matrix.target.os }}
env:
VCPKGRS_DYNAMIC: 1
steps:
- uses: actions/checkout@v2
# install OpenSSL on Windows
- name: Set vcpkg root
if: matrix.target.triple == 'x86_64-pc-windows-msvc'
run: echo "VCPKG_ROOT=$env:VCPKG_INSTALLATION_ROOT" | Out-File -FilePath $env:GITHUB_ENV -Append
- name: Install OpenSSL
if: matrix.target.triple == 'x86_64-pc-windows-msvc'
run: vcpkg install openssl:x64-windows
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-${{ matrix.target.triple }}
profile: minimal
override: true
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-${{ matrix.target.triple }}
profile: minimal
override: true
- name: Generate Cargo.lock
uses: actions-rs/cargo@v1
with:
command: generate-lockfile
- name: Cache Dependencies
uses: Swatinem/rust-cache@v1.2.0
- name: Install cargo-hack
uses: actions-rs/cargo@v1
with:
command: install
args: cargo-hack
- name: check minimal
uses: actions-rs/cargo@v1
with:
command: hack
args: check --workspace --no-default-features
- name: check minimal + tests
uses: actions-rs/cargo@v1
with:
command: hack
args: check --workspace --no-default-features --tests --examples
- name: check full
uses: actions-rs/cargo@v1
with:
command: check
args: --workspace --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
with:
command: test
args: -v --workspace --all-features --no-fail-fast -- --nocapture
--skip=test_h2_content_length
--skip=test_reading_deflate_encoding_large_random_rustls
- name: tests (actix-http)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=actix-http --no-default-features --features=rustls -- --nocapture
- name: tests (awc)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=awc --no-default-features --features=rustls -- --nocapture
- name: Generate coverage file
if: >
matrix.target.os == 'ubuntu-latest'
&& matrix.version == 'stable'
&& github.ref == 'refs/heads/master'
run: |
cargo install cargo-tarpaulin --vers "^0.13"
cargo tarpaulin --out Xml --verbose
- name: Upload to Codecov
if: >
matrix.target.os == 'ubuntu-latest'
&& matrix.version == 'stable'
&& github.ref == 'refs/heads/master'
uses: codecov/codecov-action@v1
with:
file: cobertura.xml
- name: Clear the cargo caches
run: |
cargo install cargo-cache --no-default-features --features ci-autoclean
cargo-cache

View File

@@ -1,32 +1,39 @@
name: Lint
on:
pull_request:
types: [opened, synchronize, reopened]
name: Clippy and rustfmt Check
jobs:
clippy_check:
fmt:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- uses: actions-rs/toolchain@v1
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: stable
components: rustfmt
override: true
- name: Check with rustfmt
uses: actions-rs/cargo@v1
with:
command: fmt
args: --all -- --check
- uses: actions-rs/toolchain@v1
clippy:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install Rust
uses: actions-rs/toolchain@v1
with:
toolchain: nightly
toolchain: stable
components: clippy
override: true
- name: Check with Clippy
uses: actions-rs/clippy-check@v1
with:
token: ${{ secrets.GITHUB_TOKEN }}
args: --all-features --all --tests
args: --workspace --tests --all-features

View File

@@ -1,81 +0,0 @@
name: CI (Linux)
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches:
- master
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
version:
- 1.46.0 # MSRV
- stable
- nightly
name: ${{ matrix.version }} - x86_64-unknown-linux-gnu
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v2
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-x86_64-unknown-linux-gnu
profile: minimal
override: true
- name: Generate Cargo.lock
uses: actions-rs/cargo@v1
with:
command: generate-lockfile
- name: Cache Dependencies
uses: Swatinem/rust-cache@v1.0.1
- name: check build
uses: actions-rs/cargo@v1
with:
command: check
args: --all --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --all --all-features --no-fail-fast -- --nocapture
- name: tests (actix-http)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=actix-http --no-default-features --features=rustls -- --nocapture
- name: tests (awc)
uses: actions-rs/cargo@v1
timeout-minutes: 40
with:
command: test
args: --package=awc --no-default-features --features=rustls -- --nocapture
- name: Generate coverage file
if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
run: |
cargo install cargo-tarpaulin --vers "^0.13"
cargo tarpaulin --out Xml
- name: Upload to Codecov
if: matrix.version == 'stable' && github.ref == 'refs/heads/master'
uses: codecov/codecov-action@v1
with:
file: cobertura.xml
- name: Clear the cargo caches
run: |
cargo install cargo-cache --no-default-features --features ci-autoclean
cargo-cache

View File

@@ -1,56 +0,0 @@
name: CI (macOS)
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches:
- master
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
version:
- stable
- nightly
name: ${{ matrix.version }} - x86_64-apple-darwin
runs-on: macOS-latest
steps:
- uses: actions/checkout@v2
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-x86_64-apple-darwin
profile: minimal
override: true
- name: Generate Cargo.lock
uses: actions-rs/cargo@v1
with:
command: generate-lockfile
- name: Cache Dependencies
uses: Swatinem/rust-cache@v1.0.1
- name: check build
uses: actions-rs/cargo@v1
with:
command: check
args: --all --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
with:
command: test
args: --all --all-features --no-fail-fast -- --nocapture
--skip=test_h2_content_length
--skip=test_reading_deflate_encoding_large_random_rustls
- name: Clear the cargo caches
run: |
cargo install cargo-cache --no-default-features --features ci-autoclean
cargo-cache

View File

@@ -1,14 +1,12 @@
name: Upload documentation
name: Upload Documentation
on:
push:
branches:
- master
branches: [master]
jobs:
build:
runs-on: ubuntu-latest
if: github.repository == 'actix/actix-web'
steps:
- uses: actions/checkout@v2
@@ -20,14 +18,14 @@ jobs:
profile: minimal
override: true
- name: check build
- name: Build Docs
uses: actions-rs/cargo@v1
with:
command: doc
args: --no-deps --workspace --all-features
args: --workspace --all-features --no-deps
- name: Tweak HTML
run: echo "<meta http-equiv=refresh content=0;url=os_balloon/index.html>" > target/doc/index.html
run: echo '<meta http-equiv="refresh" content="0;url=actix_web/index.html">' > target/doc/index.html
- name: Deploy to GitHub Pages
uses: JamesIves/github-pages-deploy-action@3.7.1

View File

@@ -1,76 +0,0 @@
name: CI (Windows)
on:
pull_request:
types: [opened, synchronize, reopened]
push:
branches:
- master
env:
VCPKGRS_DYNAMIC: 1
jobs:
build_and_test:
strategy:
fail-fast: false
matrix:
version:
- stable
- nightly
name: ${{ matrix.version }} - x86_64-pc-windows-msvc
runs-on: windows-latest
steps:
- uses: actions/checkout@v2
- name: Install ${{ matrix.version }}
uses: actions-rs/toolchain@v1
with:
toolchain: ${{ matrix.version }}-x86_64-pc-windows-msvc
profile: minimal
override: true
- name: Install OpenSSL
run: |
vcpkg integrate install
vcpkg install openssl:x64-windows
Copy-Item C:\vcpkg\installed\x64-windows\bin\libcrypto-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libcrypto.dll
Copy-Item C:\vcpkg\installed\x64-windows\bin\libssl-1_1-x64.dll C:\vcpkg\installed\x64-windows\bin\libssl.dll
Get-ChildItem C:\vcpkg\installed\x64-windows\bin
Get-ChildItem C:\vcpkg\installed\x64-windows\lib
- name: Generate Cargo.lock
uses: actions-rs/cargo@v1
with:
command: generate-lockfile
- name: Cache Dependencies
uses: Swatinem/rust-cache@v1.0.1
- name: check build
uses: actions-rs/cargo@v1
with:
command: check
args: --all --bins --examples --tests
- name: tests
uses: actions-rs/cargo@v1
with:
command: test
args: --all --all-features --no-fail-fast -- --nocapture
--skip=test_h2_content_length
--skip=test_reading_deflate_encoding_large_random_rustls
--skip=test_params
--skip=test_simple
--skip=test_expect_continue
--skip=test_http10_keepalive
--skip=test_slow_request
--skip=test_connection_force_close
--skip=test_connection_server_close
--skip=test_connection_wait_queue_force_close
- name: Clear the cargo caches
run: |
cargo install cargo-cache --no-default-features --features ci-autoclean
cargo-cache

View File

@@ -3,6 +3,85 @@
## Unreleased - 2021-xx-xx
## 4.0.0-beta.5 - 2021-04-02
### Added
* `Header` extractor for extracting common HTTP headers in handlers. [#2094]
* Added `TestServer::client_headers` method. [#2097]
### Fixed
* Double ampersand in Logger format is escaped correctly. [#2067]
### Changed
* `CustomResponder` would return error as `HttpResponse` when `CustomResponder::with_header` failed
instead of skipping. (Only the first error is kept when multiple error occur) [#2093]
### Removed
* The `client` mod was removed. Clients should now use `awc` directly.
[871ca5e4](https://github.com/actix/actix-web/commit/871ca5e4ae2bdc22d1ea02701c2992fa8d04aed7)
* Integration testing was moved to new `actix-test` crate. Namely these items from the `test`
module: `TestServer`, `TestServerConfig`, `start`, `start_with`, and `unused_addr`. [#2112]
[#2067]: https://github.com/actix/actix-web/pull/2067
[#2093]: https://github.com/actix/actix-web/pull/2093
[#2094]: https://github.com/actix/actix-web/pull/2094
[#2097]: https://github.com/actix/actix-web/pull/2097
[#2112]: https://github.com/actix/actix-web/pull/2112
## 4.0.0-beta.4 - 2021-03-09
### Changed
* Feature `cookies` is now optional and enabled by default. [#1981]
* `JsonBody::new` returns a default limit of 32kB to be consistent with `JsonConfig` and the default
behaviour of the `web::Json<T>` extractor. [#2010]
[#1981]: https://github.com/actix/actix-web/pull/1981
[#2010]: https://github.com/actix/actix-web/pull/2010
## 4.0.0-beta.3 - 2021-02-10
* Update `actix-web-codegen` to `0.5.0-beta.1`.
## 4.0.0-beta.2 - 2021-02-10
### Added
* The method `Either<web::Json<T>, web::Form<T>>::into_inner()` which returns the inner type for
whichever variant was created. Also works for `Either<web::Form<T>, web::Json<T>>`. [#1894]
* Add `services!` macro for helping register multiple services to `App`. [#1933]
* Enable registering a vec of services of the same type to `App` [#1933]
### Changed
* Rework `Responder` trait to be sync and returns `Response`/`HttpResponse` directly.
Making it simpler and more performant. [#1891]
* `ServiceRequest::into_parts` and `ServiceRequest::from_parts` can no longer fail. [#1893]
* `ServiceRequest::from_request` can no longer fail. [#1893]
* Our `Either` type now uses `Left`/`Right` variants (instead of `A`/`B`) [#1894]
* `test::{call_service, read_response, read_response_json, send_request}` take `&Service`
in argument [#1905]
* `App::wrap_fn`, `Resource::wrap_fn` and `Scope::wrap_fn` provide `&Service` in closure
argument. [#1905]
* `web::block` no longer requires the output is a Result. [#1957]
### Fixed
* Multiple calls to `App::data` with the same type now keeps the latest call's data. [#1906]
### Removed
* Public field of `web::Path` has been made private. [#1894]
* Public field of `web::Query` has been made private. [#1894]
* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
* `AppService::set_service_data`; for custom HTTP service factories adding application data, use the
layered data model by calling `ServiceRequest::add_data_container` when handling
requests instead. [#1906]
[#1891]: https://github.com/actix/actix-web/pull/1891
[#1893]: https://github.com/actix/actix-web/pull/1893
[#1894]: https://github.com/actix/actix-web/pull/1894
[#1869]: https://github.com/actix/actix-web/pull/1869
[#1905]: https://github.com/actix/actix-web/pull/1905
[#1906]: https://github.com/actix/actix-web/pull/1906
[#1933]: https://github.com/actix/actix-web/pull/1933
[#1957]: https://github.com/actix/actix-web/pull/1957
## 4.0.0-beta.1 - 2021-01-07
### Added
* `Compat` middleware enabling generic response body/error type of middlewares like `Logger` and
@@ -24,13 +103,15 @@
### Removed
* Public modules `middleware::{normalize, err_handlers}`. All necessary middleware structs are now
exposed directly by the `middleware` module.
* Remove `actix-threadpool` as dependency. `actix_threadpool::BlockingError` error type can be imported
from `actix_web::error` module. [#1878]
[#1812]: https://github.com/actix/actix-web/pull/1812
[#1813]: https://github.com/actix/actix-web/pull/1813
[#1852]: https://github.com/actix/actix-web/pull/1852
[#1865]: https://github.com/actix/actix-web/pull/1865
[#1875]: https://github.com/actix/actix-web/pull/1875
[#1878]: https://github.com/actix/actix-web/pull/1878
## 3.3.2 - 2020-12-01
### Fixed
@@ -115,7 +196,7 @@
## 3.0.0-beta.4 - 2020-09-09
### Added
* `middleware::NormalizePath` now has configurable behaviour for either always having a trailing
* `middleware::NormalizePath` now has configurable behavior for either always having a trailing
slash, or as the new addition, always trimming trailing slashes. [#1639]
### Changed
@@ -443,7 +524,7 @@
## [1.0.0-rc] - 2019-05-18
### Add
### Added
* Add `Query<T>::from_query()` to extract parameters from a query string. #846
* `QueryConfig`, similar to `JsonConfig` for customizing error handling of query extractors.
@@ -459,7 +540,7 @@
## [1.0.0-beta.4] - 2019-05-12
### Add
### Added
* Allow to set/override app data on scope level
@@ -485,7 +566,7 @@
* CORS handling without headers #702
* Allow to construct `Data` instances to avoid double `Arc` for `Send + Sync` types.
* Allow constructing `Data` instances to avoid double `Arc` for `Send + Sync` types.
### Fixed
@@ -549,7 +630,7 @@
### Changed
* Allow to use any service as default service.
* Allow using any service as default service.
* Remove generic type for request payload, always use default.
@@ -612,13 +693,13 @@
### Added
* rustls support
* Rustls support
### Changed
* use forked cookie
* Use forked cookie
* multipart::Field renamed to MultipartField
* Multipart::Field renamed to MultipartField
## [1.0.0-alpha.1] - 2019-03-28

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-web"
version = "4.0.0-beta.1"
version = "4.0.0-beta.5"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust"
readme = "README.md"
@@ -15,6 +15,7 @@ license = "MIT OR Apache-2.0"
edition = "2018"
[package.metadata.docs.rs]
# features that docs.rs will build with
features = ["openssl", "rustls", "compress", "secure-cookies"]
[badges]
@@ -35,22 +36,26 @@ members = [
"actix-web-actors",
"actix-web-codegen",
"actix-http-test",
"actix-test",
]
[features]
default = ["compress"]
default = ["compress", "cookies"]
# content-encoding support
compress = ["actix-http/compress", "awc/compress"]
compress = ["actix-http/compress"]
# sessions feature
# support for cookies
cookies = ["actix-http/cookies"]
# secure cookies feature
secure-cookies = ["actix-http/secure-cookies"]
# openssl
openssl = ["actix-tls/accept", "actix-tls/openssl", "awc/openssl", "open-ssl"]
openssl = ["actix-http/openssl", "actix-tls/accept", "actix-tls/openssl"]
# rustls
rustls = ["actix-tls/accept", "actix-tls/rustls", "awc/rustls", "rust-tls"]
rustls = ["actix-http/rustls", "actix-tls/accept", "actix-tls/rustls"]
[[example]]
name = "basic"
@@ -62,60 +67,59 @@ required-features = ["compress"]
[[test]]
name = "test_server"
required-features = ["compress"]
required-features = ["compress", "cookies"]
[[example]]
name = "on_connect"
required-features = []
[[example]]
name = "client"
required-features = ["rustls"]
[dependencies]
actix-codec = "0.4.0-beta.1"
actix-macros = "0.1.0"
actix-router = "0.2.4"
actix-rt = "2.0.0-beta.1"
actix-server = "2.0.0-beta.2"
actix-service = "2.0.0-beta.2"
actix-utils = "3.0.0-beta.1"
actix-threadpool = "0.3.1"
actix-tls = { version = "3.0.0-beta.2", default-features = false, optional = true }
actix-macros = "0.2.0"
actix-router = "0.2.7"
actix-rt = "2.2"
actix-server = "2.0.0-beta.3"
actix-service = "2.0.0-beta.4"
actix-utils = "3.0.0-beta.4"
actix-tls = { version = "3.0.0-beta.5", default-features = false, optional = true }
actix-web-codegen = "0.4.0"
actix-http = "3.0.0-beta.1"
awc = { version = "3.0.0-beta.1", default-features = false }
actix-web-codegen = "0.5.0-beta.2"
actix-http = "3.0.0-beta.5"
ahash = "0.6"
ahash = "0.7"
bytes = "1"
derive_more = "0.99.5"
either = "1.5.3"
encoding_rs = "0.8"
futures-core = { version = "0.3.7", default-features = false }
futures-util = { version = "0.3.7", default-features = false }
language-tags = "0.2"
once_cell = "1.5"
log = "0.4"
mime = "0.3"
socket2 = "0.3.16"
pin-project = "1.0.0"
regex = "1.4"
serde = { version = "1.0", features = ["derive"] }
serde_json = "1.0"
serde_urlencoded = "0.7"
time = { version = "0.2.7", default-features = false, features = ["std"] }
url = "2.1"
open-ssl = { package = "openssl", version = "0.10", optional = true }
rust-tls = { package = "rustls", version = "0.19.0", optional = true }
smallvec = "1.6"
socket2 = "0.4.0"
time = { version = "0.2.23", default-features = false, features = ["std"] }
url = "2.1"
[dev-dependencies]
actix = "0.11.0-beta.1"
actix-http = { version = "3.0.0-beta.1", features = ["actors"] }
rand = "0.8"
env_logger = "0.8"
serde_derive = "1.0"
actix-test = { version = "0.0.1", features = ["openssl", "rustls"] }
awc = { version = "3.0.0-beta.4", features = ["openssl"] }
brotli2 = "0.3.2"
flate2 = "1.0.13"
criterion = "0.3"
env_logger = "0.8"
flate2 = "1.0.13"
rand = "0.8"
rcgen = "0.8"
serde_derive = "1.0"
tls-openssl = { package = "openssl", version = "0.10.9" }
tls-rustls = { package = "rustls", version = "0.19.0" }
[profile.release]
lto = true
@@ -123,13 +127,14 @@ opt-level = 3
codegen-units = 1
[patch.crates-io]
actix-web = { path = "." }
actix-files = { path = "actix-files" }
actix-http = { path = "actix-http" }
actix-http-test = { path = "actix-http-test" }
actix-multipart = { path = "actix-multipart" }
actix-test = { path = "actix-test" }
actix-web = { path = "." }
actix-web-actors = { path = "actix-web-actors" }
actix-web-codegen = { path = "actix-web-codegen" }
actix-multipart = { path = "actix-multipart" }
actix-files = { path = "actix-files" }
awc = { path = "awc" }
[[bench]]
@@ -139,3 +144,7 @@ harness = false
[[bench]]
name = "service"
harness = false
[[bench]]
name = "responder"
harness = false

View File

@@ -1,20 +1,19 @@
<div align="center">
<h1>Actix web</h1>
<h1>Actix Web</h1>
<p>
<strong>Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust</strong>
</p>
<p>
[![crates.io](https://img.shields.io/crates/v/actix-web?label=latest)](https://crates.io/crates/actix-web)
[![Documentation](https://docs.rs/actix-web/badge.svg?version=3.3.2)](https://docs.rs/actix-web/3.3.2)
[![Documentation](https://docs.rs/actix-web/badge.svg?version=4.0.0-beta.5)](https://docs.rs/actix-web/4.0.0-beta.5)
[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
![License](https://img.shields.io/crates/l/actix-web.svg)
[![Dependency Status](https://deps.rs/crate/actix-web/3.3.2/status.svg)](https://deps.rs/crate/actix-web/3.3.2)
![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-web.svg)
[![Dependency Status](https://deps.rs/crate/actix-web/4.0.0-beta.5/status.svg)](https://deps.rs/crate/actix-web/4.0.0-beta.5)
<br />
[![Build Status](https://travis-ci.org/actix/actix-web.svg?branch=master)](https://travis-ci.org/actix/actix-web)
[![build status](https://github.com/actix/actix-web/workflows/CI%20%28Linux%29/badge.svg?branch=master&event=push)](https://github.com/actix/actix-web/actions)
[![codecov](https://codecov.io/gh/actix/actix-web/branch/master/graph/badge.svg)](https://codecov.io/gh/actix/actix-web)
[![Download](https://img.shields.io/crates/d/actix-web.svg)](https://crates.io/crates/actix-web)
[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
![downloads](https://img.shields.io/crates/d/actix-web.svg)
[![Chat on Discord](https://img.shields.io/discord/771444961383153695?label=chat&logo=discord)](https://discord.gg/NWpN5mmg3x)
</p>
@@ -32,8 +31,7 @@
* Static assets
* SSL support using OpenSSL or Rustls
* Middlewares ([Logger, Session, CORS, etc](https://actix.rs/docs/middleware/))
* Includes an async [HTTP client](https://actix.rs/actix-web/actix_web/client/index.html)
* Supports [Actix actor framework](https://github.com/actix/actix)
* Includes an async [HTTP client](https://docs.rs/actix-web/latest/actix_web/client/index.html)
* Runs on stable Rust 1.46+
## Documentation
@@ -73,18 +71,18 @@ async fn main() -> std::io::Result<()> {
### More examples
* [Basic Setup](https://github.com/actix/examples/tree/master/basics/)
* [Application State](https://github.com/actix/examples/tree/master/state/)
* [JSON Handling](https://github.com/actix/examples/tree/master/json/)
* [Multipart Streams](https://github.com/actix/examples/tree/master/multipart/)
* [Diesel Integration](https://github.com/actix/examples/tree/master/diesel/)
* [r2d2 Integration](https://github.com/actix/examples/tree/master/r2d2/)
* [Simple WebSocket](https://github.com/actix/examples/tree/master/websocket/)
* [Tera Templates](https://github.com/actix/examples/tree/master/template_tera/)
* [Askama Templates](https://github.com/actix/examples/tree/master/template_askama/)
* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/rustls/)
* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/openssl/)
* [WebSocket Chat](https://github.com/actix/examples/tree/master/websocket-chat/)
* [Basic Setup](https://github.com/actix/examples/tree/master/basics/basics/)
* [Application State](https://github.com/actix/examples/tree/master/basics/state/)
* [JSON Handling](https://github.com/actix/examples/tree/master/json/json/)
* [Multipart Streams](https://github.com/actix/examples/tree/master/forms/multipart/)
* [Diesel Integration](https://github.com/actix/examples/tree/master/database_interactions/diesel/)
* [r2d2 Integration](https://github.com/actix/examples/tree/master/database_interactions/r2d2/)
* [Simple WebSocket](https://github.com/actix/examples/tree/master/websockets/websocket/)
* [Tera Templates](https://github.com/actix/examples/tree/master/template_engines/tera/)
* [Askama Templates](https://github.com/actix/examples/tree/master/template_engines/askama/)
* [HTTPS using Rustls](https://github.com/actix/examples/tree/master/security/rustls/)
* [HTTPS using OpenSSL](https://github.com/actix/examples/tree/master/security/openssl/)
* [WebSocket Chat](https://github.com/actix/examples/tree/master/websockets/chat/)
You may consider checking out
[this directory](https://github.com/actix/examples/tree/master/) for more examples.
@@ -99,9 +97,9 @@ One of the fastest web frameworks available according to the
This project is licensed under either of
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or
[http://www.apache.org/licenses/LICENSE-2.0](http://www.apache.org/licenses/LICENSE-2.0))
[http://www.apache.org/licenses/LICENSE-2.0])
* MIT license ([LICENSE-MIT](LICENSE-MIT) or
[http://opensource.org/licenses/MIT](http://opensource.org/licenses/MIT))
[http://opensource.org/licenses/MIT])
at your option.

View File

@@ -3,6 +3,18 @@
## Unreleased - 2021-xx-xx
## 0.6.0-beta.3 - 2021-03-09
* No notable changes.
## 0.6.0-beta.2 - 2021-02-10
* Fix If-Modified-Since and If-Unmodified-Since to not compare using sub-second timestamps. [#1887]
* Replace `v_htmlescape` with `askama_escape`. [#1953]
[#1887]: https://github.com/actix/actix-web/pull/1887
[#1953]: https://github.com/actix/actix-web/pull/1953
## 0.6.0-beta.1 - 2021-01-07
* `HttpRange::parse` now has its own error type.
* Update `bytes` to `1.0`. [#1813]

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-files"
version = "0.6.0-beta.1"
version = "0.6.0-beta.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Static file serving for Actix Web"
readme = "README.md"
@@ -17,19 +17,22 @@ name = "actix_files"
path = "src/lib.rs"
[dependencies]
actix-web = { version = "4.0.0-beta.1", default-features = false }
actix-service = "2.0.0-beta.2"
actix-web = { version = "4.0.0-beta.5", default-features = false }
actix-service = "2.0.0-beta.4"
actix-utils = "3.0.0-beta.4"
askama_escape = "0.10"
bitflags = "1"
bytes = "1"
futures-core = { version = "0.3.7", default-features = false }
futures-util = { version = "0.3.7", default-features = false }
futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
http-range = "0.1.4"
derive_more = "0.99.5"
log = "0.4"
mime = "0.3"
mime_guess = "2.0.1"
percent-encoding = "2.1"
v_htmlescape = "0.12"
[dev-dependencies]
actix-rt = "2.0.0-beta.1"
actix-web = "4.0.0-beta.1"
actix-rt = "2.2"
actix-web = "4.0.0-beta.5"
actix-test = "0.0.1"

View File

@@ -3,17 +3,17 @@
> Static file serving for Actix Web
[![crates.io](https://img.shields.io/crates/v/actix-files?label=latest)](https://crates.io/crates/actix-files)
[![Documentation](https://docs.rs/actix-files/badge.svg?version=0.5.0)](https://docs.rs/actix-files/0.5.0)
[![Documentation](https://docs.rs/actix-files/badge.svg?version=0.6.0-beta.3)](https://docs.rs/actix-files/0.6.0-beta.3)
[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
![License](https://img.shields.io/crates/l/actix-files.svg)
<br />
[![dependency status](https://deps.rs/crate/actix-files/0.5.0/status.svg)](https://deps.rs/crate/actix-files/0.5.0)
[![dependency status](https://deps.rs/crate/actix-files/0.6.0-beta.3/status.svg)](https://deps.rs/crate/actix-files/0.6.0-beta.3)
[![Download](https://img.shields.io/crates/d/actix-files.svg)](https://crates.io/crates/actix-files)
[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & Resources
- [API Documentation](https://docs.rs/actix-files/)
- [Example Project](https://github.com/actix/examples/tree/master/static_index)
- [Example Project](https://github.com/actix/examples/tree/master/basics/static_index)
- [Chat on Gitter](https://gitter.im/actix/actix-web)
- Minimum supported Rust version: 1.46 or later

View File

@@ -9,26 +9,35 @@ use std::{
use actix_web::{
error::{BlockingError, Error},
web,
rt::task::{spawn_blocking, JoinHandle},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
use futures_util::future::{FutureExt, LocalBoxFuture};
use crate::handle_error;
type ChunkedBoxFuture =
LocalBoxFuture<'static, Result<(File, Bytes), BlockingError<io::Error>>>;
#[doc(hidden)]
/// A helper created from a `std::fs::File` which reads the file
/// chunk-by-chunk on a `ThreadPool`.
pub struct ChunkedReadFile {
pub(crate) size: u64,
pub(crate) offset: u64,
pub(crate) file: Option<File>,
pub(crate) fut: Option<ChunkedBoxFuture>,
pub(crate) counter: u64,
size: u64,
offset: u64,
state: ChunkedReadFileState,
counter: u64,
}
enum ChunkedReadFileState {
File(Option<File>),
Future(JoinHandle<Result<(File, Bytes), io::Error>>),
}
impl ChunkedReadFile {
pub(crate) fn new(size: u64, offset: u64, file: File) -> Self {
Self {
size,
offset,
state: ChunkedReadFileState::File(Some(file)),
counter: 0,
}
}
}
impl fmt::Debug for ChunkedReadFile {
@@ -40,55 +49,50 @@ impl fmt::Debug for ChunkedReadFile {
impl Stream for ChunkedReadFile {
type Item = Result<Bytes, Error>;
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
if let Some(ref mut fut) = self.fut {
return match ready!(Pin::new(fut).poll(cx)) {
Ok((file, bytes)) => {
self.fut.take();
self.file = Some(file);
fn poll_next(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Option<Self::Item>> {
let this = self.as_mut().get_mut();
match this.state {
ChunkedReadFileState::File(ref mut file) => {
let size = this.size;
let offset = this.offset;
let counter = this.counter;
self.offset += bytes.len() as u64;
self.counter += bytes.len() as u64;
if size == counter {
Poll::Ready(None)
} else {
let mut file = file
.take()
.expect("ChunkedReadFile polled after completion");
Poll::Ready(Some(Ok(bytes)))
let fut = spawn_blocking(move || {
let max_bytes = cmp::min(size.saturating_sub(counter), 65_536) as usize;
let mut buf = Vec::with_capacity(max_bytes);
file.seek(io::SeekFrom::Start(offset))?;
let n_bytes =
file.by_ref().take(max_bytes as u64).read_to_end(&mut buf)?;
if n_bytes == 0 {
return Err(io::ErrorKind::UnexpectedEof.into());
}
Ok((file, Bytes::from(buf)))
});
this.state = ChunkedReadFileState::Future(fut);
self.poll_next(cx)
}
Err(e) => Poll::Ready(Some(Err(handle_error(e)))),
};
}
}
ChunkedReadFileState::Future(ref mut fut) => {
let (file, bytes) =
ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
this.state = ChunkedReadFileState::File(Some(file));
let size = self.size;
let offset = self.offset;
let counter = self.counter;
this.offset += bytes.len() as u64;
this.counter += bytes.len() as u64;
if size == counter {
Poll::Ready(None)
} else {
let mut file = self.file.take().expect("Use after completion");
self.fut = Some(
web::block(move || {
let max_bytes =
cmp::min(size.saturating_sub(counter), 65_536) as usize;
let mut buf = Vec::with_capacity(max_bytes);
file.seek(io::SeekFrom::Start(offset))?;
let n_bytes =
file.by_ref().take(max_bytes as u64).read_to_end(&mut buf)?;
if n_bytes == 0 {
return Err(io::ErrorKind::UnexpectedEof.into());
}
Ok((file, Bytes::from(buf)))
})
.boxed_local(),
);
self.poll_next(cx)
Poll::Ready(Some(Ok(bytes)))
}
}
}
}

View File

@@ -1,8 +1,8 @@
use std::{fmt::Write, fs::DirEntry, io, path::Path, path::PathBuf};
use actix_web::{dev::ServiceResponse, HttpRequest, HttpResponse};
use askama_escape::{escape as escape_html_entity, Html};
use percent_encoding::{utf8_percent_encode, CONTROLS};
use v_htmlescape::escape as escape_html_entity;
/// A directory; responds with the generated directory listing.
#[derive(Debug)]
@@ -50,7 +50,7 @@ macro_rules! encode_file_url {
// " -- &quot; & -- &amp; ' -- &#x27; < -- &lt; > -- &gt; / -- &#x2f;
macro_rules! encode_file_name {
($entry:ident) => {
escape_html_entity(&$entry.file_name().to_string_lossy())
escape_html_entity(&$entry.file_name().to_string_lossy(), Html)
};
}
@@ -66,9 +66,7 @@ pub(crate) fn directory_listing(
if dir.is_visible(&entry) {
let entry = entry.unwrap();
let p = match entry.path().strip_prefix(&dir.path) {
Ok(p) if cfg!(windows) => {
base.join(p).to_string_lossy().replace("\\", "/")
}
Ok(p) if cfg!(windows) => base.join(p).to_string_lossy().replace("\\", "/"),
Ok(p) => base.join(p).to_string_lossy().into_owned(),
Err(_) => continue,
};

View File

@@ -1,27 +1,26 @@
use std::{cell::RefCell, fmt, io, path::PathBuf, rc::Rc};
use actix_service::{boxed, IntoServiceFactory, ServiceFactory, ServiceFactoryExt};
use actix_utils::future::ok;
use actix_web::{
dev::{
AppService, HttpServiceFactory, ResourceDef, ServiceRequest, ServiceResponse,
},
dev::{AppService, HttpServiceFactory, ResourceDef, ServiceRequest, ServiceResponse},
error::Error,
guard::Guard,
http::header::DispositionType,
HttpRequest,
};
use futures_util::future::{ok, FutureExt, LocalBoxFuture};
use futures_core::future::LocalBoxFuture;
use crate::{
directory_listing, named, Directory, DirectoryRenderer, FilesService,
HttpNewService, MimeOverride,
directory_listing, named, Directory, DirectoryRenderer, FilesService, HttpNewService,
MimeOverride,
};
/// Static files handling service.
///
/// `Files` service must be registered with `App::service()` method.
///
/// ```rust
/// ```
/// use actix_web::App;
/// use actix_files::Files;
///
@@ -82,8 +81,9 @@ impl Files {
/// be inaccessible. Register more specific handlers and services first.
///
/// `Files` uses a threadpool for blocking filesystem operations. By default, the pool uses a
/// number of threads equal to 5x the number of available logical CPUs. Pool size can be changed
/// by setting ACTIX_THREADPOOL environment variable.
/// max number of threads equal to `512 * HttpServer::worker`. Real time thread count are
/// adjusted with work load. More threads would spawn when need and threads goes idle for a
/// period of time would be de-spawned.
pub fn new<T: Into<PathBuf>>(mount_path: &str, serve_from: T) -> Files {
let orig_dir = serve_from.into();
let dir = match orig_dir.canonicalize() {
@@ -128,8 +128,8 @@ impl Files {
/// Set custom directory renderer
pub fn files_listing_renderer<F>(mut self, f: F) -> Self
where
for<'r, 's> F: Fn(&'r Directory, &'s HttpRequest) -> Result<ServiceResponse, io::Error>
+ 'static,
for<'r, 's> F:
Fn(&'r Directory, &'s HttpRequest) -> Result<ServiceResponse, io::Error> + 'static,
{
self.renderer = Rc::new(f);
self
@@ -264,18 +264,18 @@ impl ServiceFactory<ServiceRequest> for Files {
};
if let Some(ref default) = *self.default.borrow() {
default
.new_service(())
.map(move |result| match result {
let fut = default.new_service(());
Box::pin(async {
match fut.await {
Ok(default) => {
srv.default = Some(default);
Ok(srv)
}
Err(_) => Err(()),
})
.boxed_local()
}
})
} else {
ok(srv).boxed_local()
Box::pin(ok(srv))
}
}
}

View File

@@ -3,7 +3,7 @@
//! Provides a non-blocking service for serving static files from disk.
//!
//! # Example
//! ```rust
//! ```
//! use actix_web::App;
//! use actix_files::Files;
//!
@@ -14,12 +14,10 @@
#![deny(rust_2018_idioms)]
#![warn(missing_docs, missing_debug_implementations)]
use std::io;
use actix_service::boxed::{BoxService, BoxServiceFactory};
use actix_web::{
dev::{ServiceRequest, ServiceResponse},
error::{BlockingError, Error, ErrorInternalServerError},
error::Error,
http::header::DispositionType,
};
use mime_guess::from_ext;
@@ -56,13 +54,6 @@ pub fn file_extension_to_mime(ext: &str) -> mime::Mime {
from_ext(ext).first_or_octet_stream()
}
pub(crate) fn handle_error(err: BlockingError<io::Error>) -> Error {
match err {
BlockingError::Error(err) => err.into(),
BlockingError::Canceled => ErrorInternalServerError("Unexpected error"),
}
}
type MimeOverride = dyn Fn(&mime::Name<'_>) -> DispositionType;
#[cfg(test)]
@@ -74,6 +65,7 @@ mod tests {
};
use actix_service::ServiceFactory;
use actix_utils::future::ok;
use actix_web::{
guard,
http::{
@@ -82,9 +74,9 @@ mod tests {
},
middleware::Compress,
test::{self, TestRequest},
web, App, HttpResponse, Responder,
web::{self, Bytes},
App, HttpResponse, Responder,
};
use futures_util::future::ok;
use super::*;
@@ -106,11 +98,22 @@ mod tests {
#[actix_rt::test]
async fn test_if_modified_since_without_if_none_match() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since =
header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
let since = header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
let req = TestRequest::default()
.header(header::IF_MODIFIED_SINCE, since)
.insert_header((header::IF_MODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(resp.status(), StatusCode::NOT_MODIFIED);
}
#[actix_rt::test]
async fn test_if_modified_since_without_if_none_match_same() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since = file.last_modified().unwrap();
let req = TestRequest::default()
.insert_header((header::IF_MODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(resp.status(), StatusCode::NOT_MODIFIED);
@@ -119,17 +122,40 @@ mod tests {
#[actix_rt::test]
async fn test_if_modified_since_with_if_none_match() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since =
header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
let since = header::HttpDate::from(SystemTime::now().add(Duration::from_secs(60)));
let req = TestRequest::default()
.header(header::IF_NONE_MATCH, "miss_etag")
.header(header::IF_MODIFIED_SINCE, since)
.insert_header((header::IF_NONE_MATCH, "miss_etag"))
.insert_header((header::IF_MODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_ne!(resp.status(), StatusCode::NOT_MODIFIED);
}
#[actix_rt::test]
async fn test_if_unmodified_since() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since = file.last_modified().unwrap();
let req = TestRequest::default()
.insert_header((header::IF_UNMODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(resp.status(), StatusCode::OK);
}
#[actix_rt::test]
async fn test_if_unmodified_since_failed() {
let file = NamedFile::open("Cargo.toml").unwrap();
let since = header::HttpDate::from(SystemTime::UNIX_EPOCH);
let req = TestRequest::default()
.insert_header((header::IF_UNMODIFIED_SINCE, since))
.to_http_request();
let resp = file.respond_to(&req).await.unwrap();
assert_eq!(resp.status(), StatusCode::PRECONDITION_FAILED);
}
#[actix_rt::test]
async fn test_named_file_text() {
assert!(NamedFile::open("test--").is_err());
@@ -184,8 +210,7 @@ mod tests {
#[actix_rt::test]
async fn test_named_file_non_ascii_file_name() {
let mut file =
NamedFile::from_file(File::open("Cargo.toml").unwrap(), "貨物.toml")
.unwrap();
NamedFile::from_file(File::open("Cargo.toml").unwrap(), "貨物.toml").unwrap();
{
file.file();
let _f: &File = &file;
@@ -338,7 +363,7 @@ mod tests {
DispositionType::Attachment
}
let mut srv = test::init_service(
let srv = test::init_service(
App::new().service(
Files::new("/", ".")
.mime_override(all_attachment)
@@ -348,7 +373,7 @@ mod tests {
.await;
let request = TestRequest::get().uri("/").to_request();
let response = test::call_service(&mut srv, request).await;
let response = test::call_service(&srv, request).await;
assert_eq!(response.status(), StatusCode::OK);
let content_disposition = response
@@ -363,7 +388,7 @@ mod tests {
#[actix_rt::test]
async fn test_named_file_ranges_status_code() {
let mut srv = test::init_service(
let srv = test::init_service(
App::new().service(Files::new("/test", ".").index_file("Cargo.toml")),
)
.await;
@@ -371,29 +396,29 @@ mod tests {
// Valid range header
let request = TestRequest::get()
.uri("/t%65st/Cargo.toml")
.header(header::RANGE, "bytes=10-20")
.insert_header((header::RANGE, "bytes=10-20"))
.to_request();
let response = test::call_service(&mut srv, request).await;
let response = test::call_service(&srv, request).await;
assert_eq!(response.status(), StatusCode::PARTIAL_CONTENT);
// Invalid range header
let request = TestRequest::get()
.uri("/t%65st/Cargo.toml")
.header(header::RANGE, "bytes=1-0")
.insert_header((header::RANGE, "bytes=1-0"))
.to_request();
let response = test::call_service(&mut srv, request).await;
let response = test::call_service(&srv, request).await;
assert_eq!(response.status(), StatusCode::RANGE_NOT_SATISFIABLE);
}
#[actix_rt::test]
async fn test_named_file_content_range_headers() {
let srv = test::start(|| App::new().service(Files::new("/", ".")));
let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
// Valid range header
let response = srv
.get("/tests/test.binary")
.header(header::RANGE, "bytes=10-20")
.insert_header((header::RANGE, "bytes=10-20"))
.send()
.await
.unwrap();
@@ -403,7 +428,7 @@ mod tests {
// Invalid range header
let response = srv
.get("/tests/test.binary")
.header(header::RANGE, "bytes=10-5")
.insert_header((header::RANGE, "bytes=10-5"))
.send()
.await
.unwrap();
@@ -413,12 +438,12 @@ mod tests {
#[actix_rt::test]
async fn test_named_file_content_length_headers() {
let srv = test::start(|| App::new().service(Files::new("/", ".")));
let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
// Valid range header
let response = srv
.get("/tests/test.binary")
.header(header::RANGE, "bytes=10-20")
.insert_header((header::RANGE, "bytes=10-20"))
.send()
.await
.unwrap();
@@ -428,7 +453,7 @@ mod tests {
// Valid range header, starting from 0
let response = srv
.get("/tests/test.binary")
.header(header::RANGE, "bytes=0-20")
.insert_header((header::RANGE, "bytes=0-20"))
.send()
.await
.unwrap();
@@ -452,7 +477,7 @@ mod tests {
#[actix_rt::test]
async fn test_head_content_length_headers() {
let srv = test::start(|| App::new().service(Files::new("/", ".")));
let srv = actix_test::start(|| App::new().service(Files::new("/", ".")));
let response = srv.head("/tests/test.binary").send().await.unwrap();
@@ -468,14 +493,14 @@ mod tests {
#[actix_rt::test]
async fn test_static_files_with_spaces() {
let mut srv = test::init_service(
let srv = test::init_service(
App::new().service(Files::new("/", ".").index_file("Cargo.toml")),
)
.await;
let request = TestRequest::get()
.uri("/tests/test%20space.binary")
.to_request();
let response = test::call_service(&mut srv, request).await;
let response = test::call_service(&srv, request).await;
assert_eq!(response.status(), StatusCode::OK);
let bytes = test::read_body(response).await;
@@ -485,28 +510,28 @@ mod tests {
#[actix_rt::test]
async fn test_files_not_allowed() {
let mut srv = test::init_service(App::new().service(Files::new("/", "."))).await;
let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
let req = TestRequest::default()
.uri("/Cargo.toml")
.method(Method::POST)
.to_request();
let resp = test::call_service(&mut srv, req).await;
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::METHOD_NOT_ALLOWED);
let mut srv = test::init_service(App::new().service(Files::new("/", "."))).await;
let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
let req = TestRequest::default()
.method(Method::PUT)
.uri("/Cargo.toml")
.to_request();
let resp = test::call_service(&mut srv, req).await;
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::METHOD_NOT_ALLOWED);
}
#[actix_rt::test]
async fn test_files_guards() {
let mut srv = test::init_service(
let srv = test::init_service(
App::new().service(Files::new("/", ".").use_guards(guard::Post())),
)
.await;
@@ -516,13 +541,13 @@ mod tests {
.method(Method::POST)
.to_request();
let resp = test::call_service(&mut srv, req).await;
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::OK);
}
#[actix_rt::test]
async fn test_named_file_content_encoding() {
let mut srv = test::init_service(App::new().wrap(Compress::default()).service(
let srv = test::init_service(App::new().wrap(Compress::default()).service(
web::resource("/").to(|| async {
NamedFile::open("Cargo.toml")
.unwrap()
@@ -533,16 +558,16 @@ mod tests {
let request = TestRequest::get()
.uri("/")
.header(header::ACCEPT_ENCODING, "gzip")
.insert_header((header::ACCEPT_ENCODING, "gzip"))
.to_request();
let res = test::call_service(&mut srv, request).await;
let res = test::call_service(&srv, request).await;
assert_eq!(res.status(), StatusCode::OK);
assert!(!res.headers().contains_key(header::CONTENT_ENCODING));
}
#[actix_rt::test]
async fn test_named_file_content_encoding_gzip() {
let mut srv = test::init_service(App::new().wrap(Compress::default()).service(
let srv = test::init_service(App::new().wrap(Compress::default()).service(
web::resource("/").to(|| async {
NamedFile::open("Cargo.toml")
.unwrap()
@@ -553,9 +578,9 @@ mod tests {
let request = TestRequest::get()
.uri("/")
.header(header::ACCEPT_ENCODING, "gzip")
.insert_header((header::ACCEPT_ENCODING, "gzip"))
.to_request();
let res = test::call_service(&mut srv, request).await;
let res = test::call_service(&srv, request).await;
assert_eq!(res.status(), StatusCode::OK);
assert_eq!(
res.headers()
@@ -577,27 +602,25 @@ mod tests {
#[actix_rt::test]
async fn test_static_files() {
let mut srv = test::init_service(
App::new().service(Files::new("/", ".").show_files_listing()),
)
.await;
let srv =
test::init_service(App::new().service(Files::new("/", ".").show_files_listing()))
.await;
let req = TestRequest::with_uri("/missing").to_request();
let resp = test::call_service(&mut srv, req).await;
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
let mut srv = test::init_service(App::new().service(Files::new("/", "."))).await;
let srv = test::init_service(App::new().service(Files::new("/", "."))).await;
let req = TestRequest::default().to_request();
let resp = test::call_service(&mut srv, req).await;
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
let mut srv = test::init_service(
App::new().service(Files::new("/", ".").show_files_listing()),
)
.await;
let srv =
test::init_service(App::new().service(Files::new("/", ".").show_files_listing()))
.await;
let req = TestRequest::with_uri("/tests").to_request();
let resp = test::call_service(&mut srv, req).await;
let resp = test::call_service(&srv, req).await;
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"text/html; charset=utf-8"
@@ -610,16 +633,16 @@ mod tests {
#[actix_rt::test]
async fn test_redirect_to_slash_directory() {
// should not redirect if no index
let mut srv = test::init_service(
let srv = test::init_service(
App::new().service(Files::new("/", ".").redirect_to_slash_directory()),
)
.await;
let req = TestRequest::with_uri("/tests").to_request();
let resp = test::call_service(&mut srv, req).await;
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
// should redirect if index present
let mut srv = test::init_service(
let srv = test::init_service(
App::new().service(
Files::new("/", ".")
.index_file("test.png")
@@ -628,24 +651,28 @@ mod tests {
)
.await;
let req = TestRequest::with_uri("/tests").to_request();
let resp = test::call_service(&mut srv, req).await;
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::FOUND);
// should not redirect if the path is wrong
let req = TestRequest::with_uri("/not_existing").to_request();
let resp = test::call_service(&mut srv, req).await;
let resp = test::call_service(&srv, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
}
#[actix_rt::test]
async fn test_static_files_bad_directory() {
let _st: Files = Files::new("/", "missing");
let _st: Files = Files::new("/", "Cargo.toml");
let service = Files::new("/", "./missing").new_service(()).await.unwrap();
let req = TestRequest::with_uri("/").to_srv_request();
let resp = test::call_service(&service, req).await;
assert_eq!(resp.status(), StatusCode::NOT_FOUND);
}
#[actix_rt::test]
async fn test_default_handler_file_missing() {
let mut st = Files::new("/", ".")
let st = Files::new("/", ".")
.default_handler(|req: ServiceRequest| {
ok(req.into_response(HttpResponse::Ok().body("default content")))
})
@@ -653,124 +680,78 @@ mod tests {
.await
.unwrap();
let req = TestRequest::with_uri("/missing").to_srv_request();
let resp = test::call_service(&st, req).await;
let resp = test::call_service(&mut st, req).await;
assert_eq!(resp.status(), StatusCode::OK);
let bytes = test::read_body(resp).await;
assert_eq!(bytes, web::Bytes::from_static(b"default content"));
}
// #[actix_rt::test]
// async fn test_serve_index() {
// let st = Files::new(".").index_file("test.binary");
// let req = TestRequest::default().uri("/tests").finish();
#[actix_rt::test]
async fn test_serve_index_nested() {
let service = Files::new(".", ".")
.index_file("lib.rs")
.new_service(())
.await
.unwrap();
// let resp = st.handle(&req).respond_to(&req).unwrap();
// let resp = resp.as_msg();
// assert_eq!(resp.status(), StatusCode::OK);
// assert_eq!(
// resp.headers()
// .get(header::CONTENT_TYPE)
// .expect("content type"),
// "application/octet-stream"
// );
// assert_eq!(
// resp.headers()
// .get(header::CONTENT_DISPOSITION)
// .expect("content disposition"),
// "attachment; filename=\"test.binary\""
// );
let req = TestRequest::default().uri("/src").to_srv_request();
let resp = test::call_service(&service, req).await;
// let req = TestRequest::default().uri("/tests/").finish();
// let resp = st.handle(&req).respond_to(&req).unwrap();
// let resp = resp.as_msg();
// assert_eq!(resp.status(), StatusCode::OK);
// assert_eq!(
// resp.headers().get(header::CONTENT_TYPE).unwrap(),
// "application/octet-stream"
// );
// assert_eq!(
// resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
// "attachment; filename=\"test.binary\""
// );
assert_eq!(resp.status(), StatusCode::OK);
assert_eq!(
resp.headers().get(header::CONTENT_TYPE).unwrap(),
"text/x-rust"
);
assert_eq!(
resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
"inline; filename=\"lib.rs\""
);
}
// // nonexistent index file
// let req = TestRequest::default().uri("/tests/unknown").finish();
// let resp = st.handle(&req).respond_to(&req).unwrap();
// let resp = resp.as_msg();
// assert_eq!(resp.status(), StatusCode::NOT_FOUND);
#[actix_rt::test]
async fn integration_serve_index() {
let srv = test::init_service(
App::new().service(Files::new("test", ".").index_file("Cargo.toml")),
)
.await;
// let req = TestRequest::default().uri("/tests/unknown/").finish();
// let resp = st.handle(&req).respond_to(&req).unwrap();
// let resp = resp.as_msg();
// assert_eq!(resp.status(), StatusCode::NOT_FOUND);
// }
let req = TestRequest::get().uri("/test").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
// #[actix_rt::test]
// async fn test_serve_index_nested() {
// let st = Files::new(".").index_file("mod.rs");
// let req = TestRequest::default().uri("/src/client").finish();
// let resp = st.handle(&req).respond_to(&req).unwrap();
// let resp = resp.as_msg();
// assert_eq!(resp.status(), StatusCode::OK);
// assert_eq!(
// resp.headers().get(header::CONTENT_TYPE).unwrap(),
// "text/x-rust"
// );
// assert_eq!(
// resp.headers().get(header::CONTENT_DISPOSITION).unwrap(),
// "inline; filename=\"mod.rs\""
// );
// }
let bytes = test::read_body(res).await;
// #[actix_rt::test]
// fn integration_serve_index() {
// let mut srv = test::TestServer::with_factory(|| {
// App::new().handler(
// "test",
// Files::new(".").index_file("Cargo.toml"),
// )
// });
let data = Bytes::from(fs::read("Cargo.toml").unwrap());
assert_eq!(bytes, data);
// let request = srv.get().uri(srv.url("/test")).finish().unwrap();
// let response = srv.execute(request.send()).unwrap();
// assert_eq!(response.status(), StatusCode::OK);
// let bytes = srv.execute(response.body()).unwrap();
// let data = Bytes::from(fs::read("Cargo.toml").unwrap());
// assert_eq!(bytes, data);
let req = TestRequest::get().uri("/test/").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
// let request = srv.get().uri(srv.url("/test/")).finish().unwrap();
// let response = srv.execute(request.send()).unwrap();
// assert_eq!(response.status(), StatusCode::OK);
// let bytes = srv.execute(response.body()).unwrap();
// let data = Bytes::from(fs::read("Cargo.toml").unwrap());
// assert_eq!(bytes, data);
let bytes = test::read_body(res).await;
let data = Bytes::from(fs::read("Cargo.toml").unwrap());
assert_eq!(bytes, data);
// // nonexistent index file
// let request = srv.get().uri(srv.url("/test/unknown")).finish().unwrap();
// let response = srv.execute(request.send()).unwrap();
// assert_eq!(response.status(), StatusCode::NOT_FOUND);
// nonexistent index file
let req = TestRequest::get().uri("/test/unknown").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::NOT_FOUND);
// let request = srv.get().uri(srv.url("/test/unknown/")).finish().unwrap();
// let response = srv.execute(request.send()).unwrap();
// assert_eq!(response.status(), StatusCode::NOT_FOUND);
// }
let req = TestRequest::get().uri("/test/unknown/").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::NOT_FOUND);
}
// #[actix_rt::test]
// fn integration_percent_encoded() {
// let mut srv = test::TestServer::with_factory(|| {
// App::new().handler(
// "test",
// Files::new(".").index_file("Cargo.toml"),
// )
// });
#[actix_rt::test]
async fn integration_percent_encoded() {
let srv = test::init_service(
App::new().service(Files::new("test", ".").index_file("Cargo.toml")),
)
.await;
// let request = srv
// .get()
// .uri(srv.url("/test/%43argo.toml"))
// .finish()
// .unwrap();
// let response = srv.execute(request.send()).unwrap();
// assert_eq!(response.status(), StatusCode::OK);
// }
let req = TestRequest::get().uri("/test/%43argo.toml").to_request();
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
}
}

View File

@@ -11,15 +11,13 @@ use actix_web::{
dev::{BodyEncoding, SizedStream},
http::{
header::{
self, Charset, ContentDisposition, DispositionParam, DispositionType,
ExtendedValue,
self, Charset, ContentDisposition, DispositionParam, DispositionType, ExtendedValue,
},
ContentEncoding, StatusCode,
},
Error, HttpMessage, HttpRequest, HttpResponse, Responder,
HttpMessage, HttpRequest, HttpResponse, Responder,
};
use bitflags::bitflags;
use futures_util::future::{ready, Ready};
use mime_guess::from_path;
use crate::ChunkedReadFile;
@@ -62,7 +60,7 @@ impl NamedFile {
///
/// # Examples
///
/// ```rust
/// ```
/// use actix_files::NamedFile;
/// use std::io::{self, Write};
/// use std::env;
@@ -139,7 +137,7 @@ impl NamedFile {
///
/// # Examples
///
/// ```rust
/// ```
/// use actix_files::NamedFile;
///
/// let file = NamedFile::open("foo.txt");
@@ -158,7 +156,7 @@ impl NamedFile {
///
/// # Examples
///
/// ```rust
/// ```
/// # use std::io;
/// use actix_files::NamedFile;
///
@@ -277,37 +275,31 @@ impl NamedFile {
}
/// Creates an `HttpResponse` with file as a streaming body.
pub fn into_response(self, req: &HttpRequest) -> Result<HttpResponse, Error> {
pub fn into_response(self, req: &HttpRequest) -> HttpResponse {
if self.status_code != StatusCode::OK {
let mut res = HttpResponse::build(self.status_code);
if self.flags.contains(Flags::PREFER_UTF8) {
let ct = equiv_utf8_text(self.content_type.clone());
res.header(header::CONTENT_TYPE, ct.to_string());
res.insert_header((header::CONTENT_TYPE, ct.to_string()));
} else {
res.header(header::CONTENT_TYPE, self.content_type.to_string());
res.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
}
if self.flags.contains(Flags::CONTENT_DISPOSITION) {
res.header(
res.insert_header((
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
);
));
}
if let Some(current_encoding) = self.encoding {
res.encoding(current_encoding);
}
let reader = ChunkedReadFile {
size: self.md.len(),
offset: 0,
file: Some(self.file),
fut: None,
counter: 0,
};
let reader = ChunkedReadFile::new(self.md.len(), 0, self.file);
return Ok(res.streaming(reader));
return res.streaming(reader);
}
let etag = if self.flags.contains(Flags::ETAG) {
@@ -332,7 +324,7 @@ impl NamedFile {
let t2: SystemTime = since.clone().into();
match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
(Ok(t1), Ok(t2)) => t1 > t2,
(Ok(t1), Ok(t2)) => t1.as_secs() > t2.as_secs(),
_ => false,
}
} else {
@@ -351,7 +343,7 @@ impl NamedFile {
let t2: SystemTime = since.clone().into();
match (t1.duration_since(UNIX_EPOCH), t2.duration_since(UNIX_EPOCH)) {
(Ok(t1), Ok(t2)) => t1 <= t2,
(Ok(t1), Ok(t2)) => t1.as_secs() <= t2.as_secs(),
_ => false,
}
} else {
@@ -362,16 +354,16 @@ impl NamedFile {
if self.flags.contains(Flags::PREFER_UTF8) {
let ct = equiv_utf8_text(self.content_type.clone());
resp.header(header::CONTENT_TYPE, ct.to_string());
resp.insert_header((header::CONTENT_TYPE, ct.to_string()));
} else {
resp.header(header::CONTENT_TYPE, self.content_type.to_string());
resp.insert_header((header::CONTENT_TYPE, self.content_type.to_string()));
}
if self.flags.contains(Flags::CONTENT_DISPOSITION) {
resp.header(
resp.insert_header((
header::CONTENT_DISPOSITION,
self.content_disposition.to_string(),
);
));
}
// default compressing
@@ -380,14 +372,14 @@ impl NamedFile {
}
if let Some(lm) = last_modified {
resp.header(header::LAST_MODIFIED, lm.to_string());
resp.insert_header((header::LAST_MODIFIED, lm.to_string()));
}
if let Some(etag) = etag {
resp.header(header::ETAG, etag.to_string());
resp.insert_header((header::ETAG, etag.to_string()));
}
resp.header(header::ACCEPT_RANGES, "bytes");
resp.insert_header((header::ACCEPT_RANGES, "bytes"));
let mut length = self.md.len();
let mut offset = 0;
@@ -400,43 +392,32 @@ impl NamedFile {
offset = ranges[0].start;
resp.encoding(ContentEncoding::Identity);
resp.header(
resp.insert_header((
header::CONTENT_RANGE,
format!(
"bytes {}-{}/{}",
offset,
offset + length - 1,
self.md.len()
),
);
format!("bytes {}-{}/{}", offset, offset + length - 1, self.md.len()),
));
} else {
resp.header(header::CONTENT_RANGE, format!("bytes */{}", length));
return Ok(resp.status(StatusCode::RANGE_NOT_SATISFIABLE).finish());
resp.insert_header((header::CONTENT_RANGE, format!("bytes */{}", length)));
return resp.status(StatusCode::RANGE_NOT_SATISFIABLE).finish();
};
} else {
return Ok(resp.status(StatusCode::BAD_REQUEST).finish());
return resp.status(StatusCode::BAD_REQUEST).finish();
};
};
if precondition_failed {
return Ok(resp.status(StatusCode::PRECONDITION_FAILED).finish());
return resp.status(StatusCode::PRECONDITION_FAILED).finish();
} else if not_modified {
return Ok(resp.status(StatusCode::NOT_MODIFIED).finish());
return resp.status(StatusCode::NOT_MODIFIED).finish();
}
let reader = ChunkedReadFile {
offset,
size: length,
file: Some(self.file),
fut: None,
counter: 0,
};
let reader = ChunkedReadFile::new(length, offset, self.file);
if offset != 0 || length != self.md.len() {
resp.status(StatusCode::PARTIAL_CONTENT);
}
Ok(resp.body(SizedStream::new(length, reader)))
resp.body(SizedStream::new(length, reader))
}
}
@@ -495,10 +476,7 @@ fn none_match(etag: Option<&header::EntityTag>, req: &HttpRequest) -> bool {
}
impl Responder for NamedFile {
type Error = Error;
type Future = Ready<Result<HttpResponse, Error>>;
fn respond_to(self, req: &HttpRequest) -> Self::Future {
ready(self.into_response(req))
fn respond_to(self, req: &HttpRequest) -> HttpResponse {
self.into_response(req)
}
}

View File

@@ -3,8 +3,8 @@ use std::{
str::FromStr,
};
use actix_utils::future::{ready, Ready};
use actix_web::{dev::Payload, FromRequest, HttpRequest};
use futures_util::future::{ready, Ready};
use crate::error::UriSegmentError;

View File

@@ -10,9 +10,6 @@ pub struct HttpRange {
pub length: u64,
}
const PREFIX: &str = "bytes=";
const PREFIX_LEN: usize = 6;
#[derive(Debug, Clone, Display, Error)]
#[display(fmt = "Parse HTTP Range failed")]
pub struct ParseRangeErr(#[error(not(source))] ());
@@ -23,84 +20,16 @@ impl HttpRange {
/// `header` is HTTP Range header (e.g. `bytes=bytes=0-9`).
/// `size` is full size of response (file).
pub fn parse(header: &str, size: u64) -> Result<Vec<HttpRange>, ParseRangeErr> {
if header.is_empty() {
return Ok(Vec::new());
match http_range::HttpRange::parse(header, size) {
Ok(ranges) => Ok(ranges
.iter()
.map(|range| HttpRange {
start: range.start,
length: range.length,
})
.collect()),
Err(_) => Err(ParseRangeErr(())),
}
if !header.starts_with(PREFIX) {
return Err(ParseRangeErr(()));
}
let size_sig = size as i64;
let mut no_overlap = false;
let all_ranges: Vec<Option<HttpRange>> = header[PREFIX_LEN..]
.split(',')
.map(|x| x.trim())
.filter(|x| !x.is_empty())
.map(|ra| {
let mut start_end_iter = ra.split('-');
let start_str = start_end_iter.next().ok_or(ParseRangeErr(()))?.trim();
let end_str = start_end_iter.next().ok_or(ParseRangeErr(()))?.trim();
if start_str.is_empty() {
// If no start is specified, end specifies the
// range start relative to the end of the file.
let mut length: i64 =
end_str.parse().map_err(|_| ParseRangeErr(()))?;
if length > size_sig {
length = size_sig;
}
Ok(Some(HttpRange {
start: (size_sig - length) as u64,
length: length as u64,
}))
} else {
let start: i64 = start_str.parse().map_err(|_| ParseRangeErr(()))?;
if start < 0 {
return Err(ParseRangeErr(()));
}
if start >= size_sig {
no_overlap = true;
return Ok(None);
}
let length = if end_str.is_empty() {
// If no end is specified, range extends to end of the file.
size_sig - start
} else {
let mut end: i64 =
end_str.parse().map_err(|_| ParseRangeErr(()))?;
if start > end {
return Err(ParseRangeErr(()));
}
if end >= size_sig {
end = size_sig - 1;
}
end - start + 1
};
Ok(Some(HttpRange {
start: start as u64,
length: length as u64,
}))
}
})
.collect::<Result<_, _>>()?;
let ranges: Vec<HttpRange> = all_ranges.into_iter().filter_map(|x| x).collect();
if no_overlap && ranges.is_empty() {
return Err(ParseRangeErr(()));
}
Ok(ranges)
}
}

View File

@@ -1,11 +1,7 @@
use std::{
fmt, io,
path::PathBuf,
rc::Rc,
task::{Context, Poll},
};
use std::{fmt, io, path::PathBuf, rc::Rc};
use actix_service::Service;
use actix_utils::future::ok;
use actix_web::{
dev::{ServiceRequest, ServiceResponse},
error::Error,
@@ -13,11 +9,11 @@ use actix_web::{
http::{header, Method},
HttpResponse,
};
use futures_util::future::{ok, Either, LocalBoxFuture, Ready};
use futures_core::future::LocalBoxFuture;
use crate::{
named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride,
NamedFile, PathBufWrap,
named, Directory, DirectoryRenderer, FilesError, HttpService, MimeOverride, NamedFile,
PathBufWrap,
};
/// Assembled file serving service.
@@ -34,19 +30,18 @@ pub struct FilesService {
pub(crate) hidden_files: bool,
}
type FilesServiceFuture = Either<
Ready<Result<ServiceResponse, Error>>,
LocalBoxFuture<'static, Result<ServiceResponse, Error>>,
>;
impl FilesService {
fn handle_err(&mut self, e: io::Error, req: ServiceRequest) -> FilesServiceFuture {
log::debug!("Failed to handle {}: {}", req.path(), e);
fn handle_err(
&self,
err: io::Error,
req: ServiceRequest,
) -> LocalBoxFuture<'static, Result<ServiceResponse, Error>> {
log::debug!("error handling {}: {}", req.path(), err);
if let Some(ref mut default) = self.default {
Either::Right(default.call(req))
if let Some(ref default) = self.default {
Box::pin(default.call(req))
} else {
Either::Left(ok(req.error_response(e)))
Box::pin(ok(req.error_response(err)))
}
}
}
@@ -60,13 +55,11 @@ impl fmt::Debug for FilesService {
impl Service<ServiceRequest> for FilesService {
type Response = ServiceResponse;
type Error = Error;
type Future = FilesServiceFuture;
type Future = LocalBoxFuture<'static, Result<ServiceResponse, Error>>;
fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
actix_service::always_ready!();
fn call(&mut self, req: ServiceRequest) -> Self::Future {
fn call(&self, req: ServiceRequest) -> Self::Future {
let is_method_valid = if let Some(guard) = &self.guards {
// execute user defined guards
(**guard).check(req.head())
@@ -76,9 +69,9 @@ impl Service<ServiceRequest> for FilesService {
};
if !is_method_valid {
return Either::Left(ok(req.into_response(
return Box::pin(ok(req.into_response(
actix_web::HttpResponse::MethodNotAllowed()
.header(header::CONTENT_TYPE, "text/plain")
.insert_header(header::ContentType(mime::TEXT_PLAIN_UTF_8))
.body("Request did not meet this resource's requirements."),
)));
}
@@ -86,13 +79,13 @@ impl Service<ServiceRequest> for FilesService {
let real_path =
match PathBufWrap::parse_path(req.match_info().path(), self.hidden_files) {
Ok(item) => item,
Err(e) => return Either::Left(ok(req.error_response(e))),
Err(e) => return Box::pin(ok(req.error_response(e))),
};
// full file path
let path = match self.directory.join(&real_path).canonicalize() {
Ok(path) => path,
Err(e) => return self.handle_err(e, req),
Err(err) => return Box::pin(self.handle_err(err, req)),
};
if path.is_dir() {
@@ -100,9 +93,9 @@ impl Service<ServiceRequest> for FilesService {
if self.redirect_to_slash && !req.path().ends_with('/') {
let redirect_to = format!("{}/", req.path());
return Either::Left(ok(req.into_response(
return Box::pin(ok(req.into_response(
HttpResponse::Found()
.header(header::LOCATION, redirect_to)
.insert_header((header::LOCATION, redirect_to))
.body("")
.into_body(),
)));
@@ -120,12 +113,10 @@ impl Service<ServiceRequest> for FilesService {
named_file.flags = self.file_flags;
let (req, _) = req.into_parts();
Either::Left(ok(match named_file.into_response(&req) {
Ok(item) => ServiceResponse::new(req, item),
Err(e) => ServiceResponse::from_err(e, req),
}))
let res = named_file.into_response(&req);
Box::pin(ok(ServiceResponse::new(req, res)))
}
Err(e) => self.handle_err(e, req),
Err(err) => self.handle_err(err, req),
}
} else if self.show_index {
let dir = Directory::new(self.directory.clone(), path);
@@ -133,12 +124,12 @@ impl Service<ServiceRequest> for FilesService {
let (req, _) = req.into_parts();
let x = (self.renderer)(&dir, &req);
match x {
Ok(resp) => Either::Left(ok(resp)),
Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
}
Box::pin(match x {
Ok(resp) => ok(resp),
Err(err) => ok(ServiceResponse::from_err(err, req)),
})
} else {
Either::Left(ok(ServiceResponse::from_err(
Box::pin(ok(ServiceResponse::from_err(
FilesError::IsDirectory,
req.into_parts().0,
)))
@@ -147,21 +138,16 @@ impl Service<ServiceRequest> for FilesService {
match NamedFile::open(path) {
Ok(mut named_file) => {
if let Some(ref mime_override) = self.mime_override {
let new_disposition =
mime_override(&named_file.content_type.type_());
let new_disposition = mime_override(&named_file.content_type.type_());
named_file.content_disposition.disposition = new_disposition;
}
named_file.flags = self.file_flags;
let (req, _) = req.into_parts();
match named_file.into_response(&req) {
Ok(item) => {
Either::Left(ok(ServiceResponse::new(req.clone(), item)))
}
Err(e) => Either::Left(ok(ServiceResponse::from_err(e, req))),
}
let res = named_file.into_response(&req);
Box::pin(ok(ServiceResponse::new(req, res)))
}
Err(e) => self.handle_err(e, req),
Err(err) => self.handle_err(err, req),
}
}
}

View File

@@ -11,11 +11,10 @@ use actix_web::{
#[actix_rt::test]
async fn test_utf8_file_contents() {
// use default ISO-8859-1 encoding
let mut srv =
test::init_service(App::new().service(Files::new("/", "./tests"))).await;
let srv = test::init_service(App::new().service(Files::new("/", "./tests"))).await;
let req = TestRequest::with_uri("/utf8.txt").to_request();
let res = test::call_service(&mut srv, req).await;
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
assert_eq!(
@@ -24,13 +23,12 @@ async fn test_utf8_file_contents() {
);
// prefer UTF-8 encoding
let mut srv = test::init_service(
App::new().service(Files::new("/", "./tests").prefer_utf8(true)),
)
.await;
let srv =
test::init_service(App::new().service(Files::new("/", "./tests").prefer_utf8(true)))
.await;
let req = TestRequest::with_uri("/utf8.txt").to_request();
let res = test::call_service(&mut srv, req).await;
let res = test::call_service(&srv, req).await;
assert_eq!(res.status(), StatusCode::OK);
assert_eq!(

View File

@@ -1,6 +1,15 @@
# Changes
## Unreleased - 2021-xx-xx
### Added
* Added `TestServer::client_headers` method. [#2097]
## 3.0.0-beta.3 - 2021-03-09
* No notable changes.
## 3.0.0-beta.2 - 2021-02-10
* No notable changes.
## 3.0.0-beta.1 - 2021-01-07

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-http-test"
version = "3.0.0-beta.1"
version = "3.0.0-beta.3"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "Various helpers for Actix applications to use during testing"
readme = "README.md"
@@ -26,30 +26,30 @@ path = "src/lib.rs"
default = []
# openssl
openssl = ["open-ssl", "awc/openssl"]
openssl = ["tls-openssl", "awc/openssl"]
[dependencies]
actix-service = "2.0.0-beta.2"
actix-service = "2.0.0-beta.4"
actix-codec = "0.4.0-beta.1"
actix-tls = "3.0.0-beta.2"
actix-utils = "3.0.0-beta.1"
actix-rt = "2.0.0-beta.1"
actix-server = "2.0.0-beta.2"
awc = "3.0.0-beta.1"
actix-tls = "3.0.0-beta.5"
actix-utils = "3.0.0-beta.4"
actix-rt = "2.2"
actix-server = "2.0.0-beta.3"
awc = { version = "3.0.0-beta.4", default-features = false }
base64 = "0.13"
bytes = "1"
futures-core = { version = "0.3.7", default-features = false }
http = "0.2.2"
log = "0.4"
socket2 = "0.3"
socket2 = "0.4"
serde = "1.0"
serde_json = "1.0"
slab = "0.4"
serde_urlencoded = "0.7"
time = { version = "0.2.7", default-features = false, features = ["std"] }
open-ssl = { version = "0.10", package = "openssl", optional = true }
time = { version = "0.2.23", default-features = false, features = ["std"] }
tls-openssl = { version = "0.10.9", package = "openssl", optional = true }
[dev-dependencies]
actix-web = "4.0.0-beta.1"
actix-http = "3.0.0-beta.1"
actix-web = { version = "4.0.0-beta.5", default-features = false, features = ["cookies"] }
actix-http = "3.0.0-beta.5"

View File

@@ -3,9 +3,9 @@
> Various helpers for Actix applications to use during testing.
[![crates.io](https://img.shields.io/crates/v/actix-http-test?label=latest)](https://crates.io/crates/actix-http-test)
[![Documentation](https://docs.rs/actix-http-test/badge.svg?version=2.1.0)](https://docs.rs/actix-http-test/2.1.0)
![Apache 2.0 or MIT licensed](https://img.shields.io/crates/l/actix-http-test)
[![Dependency Status](https://deps.rs/crate/actix-http-test/2.1.0/status.svg)](https://deps.rs/crate/actix-http-test/2.1.0)
[![Documentation](https://docs.rs/actix-http-test/badge.svg?version=3.0.0-beta.3)](https://docs.rs/actix-http-test/3.0.0-beta.3)
![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http-test)
[![Dependency Status](https://deps.rs/crate/actix-http-test/3.0.0-beta.3/status.svg)](https://deps.rs/crate/actix-http-test/3.0.0-beta.3)
[![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & Resources

View File

@@ -4,13 +4,18 @@
#![doc(html_logo_url = "https://actix.rs/img/logo.png")]
#![doc(html_favicon_url = "https://actix.rs/favicon.ico")]
#[cfg(feature = "openssl")]
extern crate tls_openssl as openssl;
use std::sync::mpsc;
use std::{net, thread, time};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_rt::{net::TcpStream, System};
use actix_server::{Server, ServiceFactory};
use awc::{error::PayloadError, ws, Client, ClientRequest, ClientResponse, Connector};
use awc::{
error::PayloadError, http::HeaderMap, ws, Client, ClientRequest, ClientResponse, Connector,
};
use bytes::Bytes;
use futures_core::stream::Stream;
use http::Method;
@@ -23,7 +28,7 @@ use socket2::{Domain, Protocol, Socket, Type};
///
/// # Examples
///
/// ```rust
/// ```
/// use actix_http::HttpService;
/// use actix_http_test::TestServer;
/// use actix_web::{web, App, HttpResponse, Error};
@@ -60,7 +65,7 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
// run server in separate thread
thread::spawn(move || {
let sys = System::new("actix-test-server");
let sys = System::new();
let local_addr = tcp.local_addr().unwrap();
let srv = Server::build()
@@ -69,7 +74,7 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
.disable_signals();
sys.block_on(async {
srv.start();
srv.run();
tx.send((System::current(), local_addr)).unwrap();
});
@@ -82,7 +87,7 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
let connector = {
#[cfg(feature = "openssl")]
{
use open_ssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
use openssl::ssl::{SslConnector, SslMethod, SslVerifyMode};
let mut builder = SslConnector::builder(SslMethod::tls()).unwrap();
builder.set_verify(SslVerifyMode::NONE);
@@ -93,20 +98,17 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
.conn_lifetime(time::Duration::from_secs(0))
.timeout(time::Duration::from_millis(30000))
.ssl(builder.build())
.finish()
}
#[cfg(not(feature = "openssl"))]
{
Connector::new()
.conn_lifetime(time::Duration::from_secs(0))
.timeout(time::Duration::from_millis(30000))
.finish()
}
};
Client::builder().connector(connector).finish()
};
actix_tls::connect::start_default_resolver().await.unwrap();
TestServer {
addr,
@@ -115,17 +117,6 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
}
}
/// Get first available unused address
pub fn unused_addr() -> net::SocketAddr {
let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
let socket =
Socket::new(Domain::ipv4(), Type::stream(), Some(Protocol::tcp())).unwrap();
socket.bind(&addr.into()).unwrap();
socket.set_reuse_address(true).unwrap();
let tcp = socket.into_tcp_listener();
tcp.local_addr().unwrap()
}
/// Test server controller
pub struct TestServer {
addr: net::SocketAddr,
@@ -148,7 +139,7 @@ impl TestServer {
}
}
/// Construct test https server url
/// Construct test HTTPS server URL.
pub fn surl(&self, uri: &str) -> String {
if uri.starts_with('/') {
format!("https://localhost:{}{}", self.addr.port(), uri)
@@ -162,7 +153,7 @@ impl TestServer {
self.client.get(self.url(path.as_ref()).as_str())
}
/// Create https `GET` request
/// Create HTTPS `GET` request
pub fn sget<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.get(self.surl(path.as_ref()).as_str())
}
@@ -172,7 +163,7 @@ impl TestServer {
self.client.post(self.url(path.as_ref()).as_str())
}
/// Create https `POST` request
/// Create HTTPS `POST` request
pub fn spost<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.post(self.surl(path.as_ref()).as_str())
}
@@ -182,7 +173,7 @@ impl TestServer {
self.client.head(self.url(path.as_ref()).as_str())
}
/// Create https `HEAD` request
/// Create HTTPS `HEAD` request
pub fn shead<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.head(self.surl(path.as_ref()).as_str())
}
@@ -192,7 +183,7 @@ impl TestServer {
self.client.put(self.url(path.as_ref()).as_str())
}
/// Create https `PUT` request
/// Create HTTPS `PUT` request
pub fn sput<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.put(self.surl(path.as_ref()).as_str())
}
@@ -202,7 +193,7 @@ impl TestServer {
self.client.patch(self.url(path.as_ref()).as_str())
}
/// Create https `PATCH` request
/// Create HTTPS `PATCH` request
pub fn spatch<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.patch(self.surl(path.as_ref()).as_str())
}
@@ -212,7 +203,7 @@ impl TestServer {
self.client.delete(self.url(path.as_ref()).as_str())
}
/// Create https `DELETE` request
/// Create HTTPS `DELETE` request
pub fn sdelete<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.delete(self.surl(path.as_ref()).as_str())
}
@@ -222,12 +213,12 @@ impl TestServer {
self.client.options(self.url(path.as_ref()).as_str())
}
/// Create https `OPTIONS` request
/// Create HTTPS `OPTIONS` request
pub fn soptions<S: AsRef<str>>(&self, path: S) -> ClientRequest {
self.client.options(self.surl(path.as_ref()).as_str())
}
/// Connect to test http server
/// Connect to test HTTP server
pub fn request<S: AsRef<str>>(&self, method: Method, path: S) -> ClientRequest {
self.client.request(method, path.as_ref())
}
@@ -242,26 +233,32 @@ impl TestServer {
response.body().limit(10_485_760).await
}
/// Connect to websocket server at a given path
/// Connect to WebSocket server at a given path.
pub async fn ws_at(
&mut self,
path: &str,
) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError>
{
) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
let url = self.url(path);
let connect = self.client.ws(url).connect();
connect.await.map(|(_, framed)| framed)
}
/// Connect to a websocket server
/// Connect to a WebSocket server.
pub async fn ws(
&mut self,
) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError>
{
) -> Result<Framed<impl AsyncRead + AsyncWrite, ws::Codec>, awc::error::WsClientError> {
self.ws_at("/").await
}
/// Stop http server
/// Get default HeaderMap of Client.
///
/// Returns Some(&mut HeaderMap) when Client object is unique
/// (No other clone of client exists at the same time).
pub fn client_headers(&mut self) -> Option<&mut HeaderMap> {
self.client.headers()
}
/// Stop HTTP server
fn stop(&mut self) {
self.system.stop();
}
@@ -272,3 +269,13 @@ impl Drop for TestServer {
self.stop()
}
}
/// Get a localhost socket address with random, unused port.
pub fn unused_addr() -> net::SocketAddr {
let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
let socket = Socket::new(Domain::IPV4, Type::STREAM, Some(Protocol::TCP)).unwrap();
socket.bind(&addr.into()).unwrap();
socket.set_reuse_address(true).unwrap();
let tcp = net::TcpListener::from(socket);
tcp.local_addr().unwrap()
}

View File

@@ -3,6 +3,96 @@
## Unreleased - 2021-xx-xx
## 3.0.0-beta.5 - 2021-04-02
### Added
* `client::Connector::handshake_timeout` method for customizing TLS connection handshake timeout. [#2081]
* `client::ConnectorService` as `client::Connector::finish` method's return type [#2081]
* `client::ConnectionIo` trait alias [#2081]
### Changed
* `client::Connector` type now only have one generic type for `actix_service::Service`. [#2063]
### Removed
* Common typed HTTP headers were moved to actix-web. [2094]
* `ResponseError` impl for `actix_utils::timeout::TimeoutError`. [#2127]
[#2063]: https://github.com/actix/actix-web/pull/2063
[#2081]: https://github.com/actix/actix-web/pull/2081
[#2094]: https://github.com/actix/actix-web/pull/2094
[#2127]: https://github.com/actix/actix-web/pull/2127
## 3.0.0-beta.4 - 2021-03-08
### Changed
* Feature `cookies` is now optional and disabled by default. [#1981]
* `ws::hash_key` now returns array. [#2035]
* `ResponseBuilder::json` now takes `impl Serialize`. [#2052]
### Removed
* Re-export of `futures_channel::oneshot::Canceled` is removed from `error` mod. [#1994]
* `ResponseError` impl for `futures_channel::oneshot::Canceled` is removed. [#1994]
[#1981]: https://github.com/actix/actix-web/pull/1981
[#1994]: https://github.com/actix/actix-web/pull/1994
[#2035]: https://github.com/actix/actix-web/pull/2035
[#2052]: https://github.com/actix/actix-web/pull/2052
## 3.0.0-beta.3 - 2021-02-10
* No notable changes.
## 3.0.0-beta.2 - 2021-02-10
### Added
* `IntoHeaderPair` trait that allows using typed and untyped headers in the same methods. [#1869]
* `ResponseBuilder::insert_header` method which allows using typed headers. [#1869]
* `ResponseBuilder::append_header` method which allows using typed headers. [#1869]
* `TestRequest::insert_header` method which allows using typed headers. [#1869]
* `ContentEncoding` implements all necessary header traits. [#1912]
* `HeaderMap::len_keys` has the behavior of the old `len` method. [#1964]
* `HeaderMap::drain` as an efficient draining iterator. [#1964]
* Implement `IntoIterator` for owned `HeaderMap`. [#1964]
* `trust-dns` optional feature to enable `trust-dns-resolver` as client dns resolver. [#1969]
### Changed
* `ResponseBuilder::content_type` now takes an `impl IntoHeaderValue` to support using typed
`mime` types. [#1894]
* Renamed `IntoHeaderValue::{try_into => try_into_value}` to avoid ambiguity with std
`TryInto` trait. [#1894]
* `Extensions::insert` returns Option of replaced item. [#1904]
* Remove `HttpResponseBuilder::json2()`. [#1903]
* Enable `HttpResponseBuilder::json()` to receive data by value and reference. [#1903]
* `client::error::ConnectError` Resolver variant contains `Box<dyn std::error::Error>` type. [#1905]
* `client::ConnectorConfig` default timeout changed to 5 seconds. [#1905]
* Simplify `BlockingError` type to a unit struct. It's now only triggered when blocking thread pool
is dead. [#1957]
* `HeaderMap::len` now returns number of values instead of number of keys. [#1964]
* `HeaderMap::insert` now returns iterator of removed values. [#1964]
* `HeaderMap::remove` now returns iterator of removed values. [#1964]
### Removed
* `ResponseBuilder::set`; use `ResponseBuilder::insert_header`. [#1869]
* `ResponseBuilder::set_header`; use `ResponseBuilder::insert_header`. [#1869]
* `ResponseBuilder::header`; use `ResponseBuilder::append_header`. [#1869]
* `TestRequest::with_hdr`; use `TestRequest::default().insert_header()`. [#1869]
* `TestRequest::with_header`; use `TestRequest::default().insert_header()`. [#1869]
* `actors` optional feature. [#1969]
* `ResponseError` impl for `actix::MailboxError`. [#1969]
### Documentation
* Vastly improve docs and add examples for `HeaderMap`. [#1964]
[#1869]: https://github.com/actix/actix-web/pull/1869
[#1894]: https://github.com/actix/actix-web/pull/1894
[#1903]: https://github.com/actix/actix-web/pull/1903
[#1904]: https://github.com/actix/actix-web/pull/1904
[#1905]: https://github.com/actix/actix-web/pull/1905
[#1912]: https://github.com/actix/actix-web/pull/1912
[#1957]: https://github.com/actix/actix-web/pull/1957
[#1964]: https://github.com/actix/actix-web/pull/1964
[#1969]: https://github.com/actix/actix-web/pull/1969
## 3.0.0-beta.1 - 2021-01-07
### Added
* Add `Http3` to `Protocol` enum for future compatibility and also mark `#[non_exhaustive]`.
@@ -22,10 +112,14 @@
* Remove `ConnectError::SslHandshakeError` and re-export of `HandshakeError`.
due to the removal of this type from `tokio-openssl` crate. openssl handshake
error would return as `ConnectError::SslError`. [#1813]
* Remove `actix-threadpool` dependency. Use `actix_rt::task::spawn_blocking`.
Due to this change `actix_threadpool::BlockingError` type is moved into
`actix_http::error` module. [#1878]
[#1813]: https://github.com/actix/actix-web/pull/1813
[#1857]: https://github.com/actix/actix-web/pull/1857
[#1864]: https://github.com/actix/actix-web/pull/1864
[#1878]: https://github.com/actix/actix-web/pull/1878
## 2.2.0 - 2020-11-25
@@ -72,15 +166,14 @@
* Update actix-connect and actix-tls dependencies.
## [2.0.0-beta.3] - 2020-08-14
## 2.0.0-beta.3 - 2020-08-14
### Fixed
* Memory leak of `client::pool::ConnectorPoolSupport`. [#1626]
[#1626]: https://github.com/actix/actix-web/pull/1626
## [2.0.0-beta.2] - 2020-07-21
## 2.0.0-beta.2 - 2020-07-21
### Fixed
* Potential UB in h1 decoder using uninitialized memory. [#1614]
@@ -91,10 +184,8 @@
[#1615]: https://github.com/actix/actix-web/pull/1615
## [2.0.0-beta.1] - 2020-07-11
## 2.0.0-beta.1 - 2020-07-11
### Changed
* Migrate cookie handling to `cookie` crate. [#1558]
* Update `sha-1` to 0.9. [#1586]
* Fix leak in client pool. [#1580]
@@ -104,33 +195,30 @@
[#1586]: https://github.com/actix/actix-web/pull/1586
[#1580]: https://github.com/actix/actix-web/pull/1580
## [2.0.0-alpha.4] - 2020-05-21
## 2.0.0-alpha.4 - 2020-05-21
### Changed
* Bump minimum supported Rust version to 1.40
* content_length function is removed, and you can set Content-Length by calling no_chunking function [#1439]
* content_length function is removed, and you can set Content-Length by calling
no_chunking function [#1439]
* `BodySize::Sized64` variant has been removed. `BodySize::Sized` now receives a
`u64` instead of a `usize`.
* Update `base64` dependency to 0.12
### Fixed
* Support parsing of `SameSite=None` [#1503]
[#1439]: https://github.com/actix/actix-web/pull/1439
[#1503]: https://github.com/actix/actix-web/pull/1503
## [2.0.0-alpha.3] - 2020-05-08
## 2.0.0-alpha.3 - 2020-05-08
### Fixed
* Correct spelling of ConnectError::Unresolved [#1487]
* Fix a mistake in the encoding of websocket continuation messages wherein
Item::FirstText and Item::FirstBinary are each encoded as the other.
### Changed
* Implement `std::error::Error` for our custom errors [#1422]
* Remove `failure` support for `ResponseError` since that crate
will be deprecated in the near future.
@@ -138,338 +226,247 @@
[#1422]: https://github.com/actix/actix-web/pull/1422
[#1487]: https://github.com/actix/actix-web/pull/1487
## [2.0.0-alpha.2] - 2020-03-07
## 2.0.0-alpha.2 - 2020-03-07
### Changed
* Update `actix-connect` and `actix-tls` dependency to 2.0.0-alpha.1. [#1395]
* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB respectively
to improve download speed for awc when downloading large objects. [#1394]
* client::Connector accepts initial_window_size and initial_connection_window_size HTTP2 configuration. [#1394]
* Change default initial window size and connection window size for HTTP2 to 2MB and 1MB
respectively to improve download speed for awc when downloading large objects. [#1394]
* client::Connector accepts initial_window_size and initial_connection_window_size
HTTP2 configuration. [#1394]
* client::Connector allowing to set max_http_version to limit HTTP version to be used. [#1394]
[#1394]: https://github.com/actix/actix-web/pull/1394
[#1395]: https://github.com/actix/actix-web/pull/1395
## [2.0.0-alpha.1] - 2020-02-27
## 2.0.0-alpha.1 - 2020-02-27
### Changed
* Update the `time` dependency to 0.2.7.
* Moved actors messages support from actix crate, enabled with feature `actors`.
* Breaking change: trait MessageBody requires Unpin and accepting Pin<&mut Self> instead of &mut self in the poll_next().
* Breaking change: trait MessageBody requires Unpin and accepting `Pin<&mut Self>` instead of
`&mut self` in the poll_next().
* MessageBody is not implemented for &'static [u8] anymore.
### Fixed
* Allow `SameSite=None` cookies to be sent in a response.
## [1.0.1] - 2019-12-20
## 1.0.1 - 2019-12-20
### Fixed
* Poll upgrade service's readiness from HTTP service handlers
* Replace brotli with brotli2 #1224
## [1.0.0] - 2019-12-13
## 1.0.0 - 2019-12-13
### Added
* Add websockets continuation frame support
### Changed
* Replace `flate2-xxx` features with `compress`
## [1.0.0-alpha.5] - 2019-12-09
## 1.0.0-alpha.5 - 2019-12-09
### Fixed
* Check `Upgrade` service readiness before calling it
* Fix buffer remaining capacity calcualtion
* Fix buffer remaining capacity calculation
### Changed
* Websockets: Ping and Pong should have binary data #1049
## [1.0.0-alpha.4] - 2019-12-08
## 1.0.0-alpha.4 - 2019-12-08
### Added
* Add impl ResponseBuilder for Error
### Changed
* Use rust based brotli compression library
## [1.0.0-alpha.3] - 2019-12-07
## 1.0.0-alpha.3 - 2019-12-07
### Changed
* Migrate to tokio 0.2
* Migrate to `std::future`
## [0.2.11] - 2019-11-06
## 0.2.11 - 2019-11-06
### Added
* Add support for serde_json::Value to be passed as argument to ResponseBuilder.body()
* Add an additional `filename*` param in the `Content-Disposition` header of `actix_files::NamedFile` to be more compatible. (#1151)
* Add an additional `filename*` param in the `Content-Disposition` header of
`actix_files::NamedFile` to be more compatible. (#1151)
* Allow to use `std::convert::Infallible` as `actix_http::error::Error`
### Fixed
* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain;
charset=utf-8` header [#1118]
* To be compatible with non-English error responses, `ResponseError` rendered with `text/plain; charset=utf-8` header #1118
[#1878]: https://github.com/actix/actix-web/pull/1878
## [0.2.10] - 2019-09-11
## 0.2.10 - 2019-09-11
### Added
* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests with `RequestHead`
* Add support for sending HTTP requests with `Rc<RequestHead>` in addition to sending HTTP requests
with `RequestHead`
### Fixed
* h2 will use error response #1080
* on_connect result isn't added to request extensions for http2 requests #1009
## [0.2.9] - 2019-08-13
## 0.2.9 - 2019-08-13
### Changed
* Dropped the `byteorder`-dependency in favor of `stdlib`-implementation
* Update percent-encoding to 2.1
* Update serde_urlencoded to 0.6.1
### Fixed
* Fixed a panic in the HTTP2 handshake in client HTTP requests (#1031)
## [0.2.8] - 2019-08-01
## 0.2.8 - 2019-08-01
### Added
* Add `rustls` support
* Add `Clone` impl for `HeaderMap`
### Fixed
* awc client panic #1016
* Invalid response with compression middleware enabled, but compression-related features disabled #997
* Invalid response with compression middleware enabled, but compression-related features
disabled #997
## [0.2.7] - 2019-07-18
## 0.2.7 - 2019-07-18
### Added
* Add support for downcasting response errors #986
## [0.2.6] - 2019-07-17
## 0.2.6 - 2019-07-17
### Changed
* Replace `ClonableService` with local copy
* Upgrade `rand` dependency version to 0.7
## [0.2.5] - 2019-06-28
## 0.2.5 - 2019-06-28
### Added
* Add `on-connect` callback, `HttpServiceBuilder::on_connect()` #946
### Changed
* Use `encoding_rs` crate instead of unmaintained `encoding` crate
* Add `Copy` and `Clone` impls for `ws::Codec`
## [0.2.4] - 2019-06-16
## 0.2.4 - 2019-06-16
### Fixed
* Do not compress NoContent (204) responses #918
## [0.2.3] - 2019-06-02
## 0.2.3 - 2019-06-02
### Added
* Debug impl for ResponseBuilder
* From SizedStream and BodyStream for Body
### Changed
* SizedStream uses u64
## [0.2.2] - 2019-05-29
## 0.2.2 - 2019-05-29
### Fixed
* Parse incoming stream before closing stream on disconnect #868
## [0.2.1] - 2019-05-25
## 0.2.1 - 2019-05-25
### Fixed
* Handle socket read disconnect
## [0.2.0] - 2019-05-12
## 0.2.0 - 2019-05-12
### Changed
* Update actix-service to 0.4
* Expect and upgrade services accept `ServerConfig` config.
### Deleted
* `OneRequest` service
## [0.1.5] - 2019-05-04
## 0.1.5 - 2019-05-04
### Fixed
* Clean up response extensions in response pool #817
## [0.1.4] - 2019-04-24
## 0.1.4 - 2019-04-24
### Added
* Allow to render h1 request headers in `Camel-Case`
### Fixed
* Read until eof for http/1.0 responses #771
## [0.1.3] - 2019-04-23
## 0.1.3 - 2019-04-23
### Fixed
* Fix http client pool management
* Fix http client wait queue management #794
## [0.1.2] - 2019-04-23
## 0.1.2 - 2019-04-23
### Fixed
* Fix BorrowMutError panic in client connector #793
## [0.1.1] - 2019-04-19
## 0.1.1 - 2019-04-19
### Changed
* Cookie::max_age() accepts value in seconds
* Cookie::max_age_time() accepts value in time::Duration
* Allow to specify server address for client connector
## [0.1.0] - 2019-04-16
## 0.1.0 - 2019-04-16
### Added
* Expose peer addr via `Request::peer_addr()` and `RequestHead::peer_addr`
### Changed
* `actix_http::encoding` always available
* use trust-dns-resolver 0.11.0
## [0.1.0-alpha.5] - 2019-04-12
## 0.1.0-alpha.5 - 2019-04-12
### Added
* Allow to use custom service for upgrade requests
* Added `h1::SendResponse` future.
### Changed
* MessageBody::length() renamed to MessageBody::size() for consistency
* ws handshake verification functions take RequestHead instead of Request
## [0.1.0-alpha.4] - 2019-04-08
## 0.1.0-alpha.4 - 2019-04-08
### Added
* Allow to use custom `Expect` handler
* Add minimal `std::error::Error` impl for `Error`
### Changed
* Export IntoHeaderValue
* Render error and return as response body
* Use thread pool for response body comression
* Use thread pool for response body compression
### Deleted
* Removed PayloadBuffer
## [0.1.0-alpha.3] - 2019-04-02
## 0.1.0-alpha.3 - 2019-04-02
### Added
* Warn when an unsealed private cookie isn't valid UTF-8
### Fixed
* Rust 1.31.0 compatibility
* Preallocate read buffer for h1 codec
* Detect socket disconnection during protocol selection
## [0.1.0-alpha.2] - 2019-03-29
## 0.1.0-alpha.2 - 2019-03-29
### Added
* Added ws::Message::Nop, no-op websockets message
### Changed
* Do not use thread pool for decomression if chunk size is smaller than 2048.
* Do not use thread pool for decompression if chunk size is smaller than 2048.
## [0.1.0-alpha.1] - 2019-03-28
## 0.1.0-alpha.1 - 2019-03-28
* Initial impl

View File

@@ -1,6 +1,6 @@
[package]
name = "actix-http"
version = "3.0.0-beta.1"
version = "3.0.0-beta.5"
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
description = "HTTP primitives for the Actix ecosystem"
readme = "README.md"
@@ -15,7 +15,8 @@ license = "MIT OR Apache-2.0"
edition = "2018"
[package.metadata.docs.rs]
features = ["openssl", "rustls", "compress", "secure-cookies", "actors"]
# features that docs.rs will build with
features = ["openssl", "rustls", "compress", "cookies", "secure-cookies"]
[lib]
name = "actix_http"
@@ -30,70 +31,77 @@ openssl = ["actix-tls/openssl"]
# rustls support
rustls = ["actix-tls/rustls"]
# enable compressison support
# enable compression support
compress = ["flate2", "brotli2"]
# support for secure cookies
secure-cookies = ["cookie/secure"]
# support for cookies
cookies = ["cookie"]
# support for actix Actor messages
actors = ["actix"]
# support for secure cookies
secure-cookies = ["cookies", "cookie/secure"]
# trust-dns as client dns resolver
trust-dns = ["trust-dns-resolver"]
[dependencies]
actix-service = "2.0.0-beta.2"
actix-service = "2.0.0-beta.4"
actix-codec = "0.4.0-beta.1"
actix-utils = "3.0.0-beta.1"
actix-rt = "2.0.0-beta.1"
actix-threadpool = "0.3.1"
actix-tls = "3.0.0-beta.2"
actix = { version = "0.11.0-beta.1", optional = true }
actix-utils = "3.0.0-beta.4"
actix-rt = "2.2"
actix-tls = { version = "3.0.0-beta.5", features = ["accept", "connect"] }
ahash = "0.7"
base64 = "0.13"
bitflags = "1.2"
bytes = "1"
bytestring = "1"
cookie = { version = "0.14.1", features = ["percent-encode"] }
copyless = "0.1.4"
cookie = { version = "0.14.1", features = ["percent-encode"], optional = true }
derive_more = "0.99.5"
either = "1.5.3"
encoding_rs = "0.8"
futures-channel = { version = "0.3.7", default-features = false }
futures-core = { version = "0.3.7", default-features = false }
futures-util = { version = "0.3.7", default-features = false, features = ["sink"] }
fxhash = "0.2.1"
h2 = "0.3.0"
futures-core = { version = "0.3.7", default-features = false, features = ["alloc"] }
futures-util = { version = "0.3.7", default-features = false, features = ["alloc", "sink"] }
h2 = "0.3.1"
http = "0.2.2"
httparse = "1.3"
indexmap = "1.3"
itoa = "0.4"
lazy_static = "1.4"
language-tags = "0.2"
local-channel = "0.1"
once_cell = "1.5"
log = "0.4"
mime = "0.3"
percent-encoding = "2.1"
pin-project = "1.0.0"
pin-project-lite = "0.2"
rand = "0.8"
regex = "1.3"
serde = "1.0"
serde_json = "1.0"
sha-1 = "0.9"
slab = "0.4"
serde_urlencoded = "0.7"
time = { version = "0.2.7", default-features = false, features = ["std"] }
sha-1 = "0.9"
smallvec = "1.6"
time = { version = "0.2.23", default-features = false, features = ["std"] }
tokio = { version = "1.2", features = ["sync"] }
# compression
brotli2 = { version="0.3.2", optional = true }
flate2 = { version = "1.0.13", optional = true }
trust-dns-resolver = { version = "0.20.0", optional = true }
[dev-dependencies]
actix-server = "2.0.0-beta.2"
actix-http-test = { version = "3.0.0-beta.1", features = ["openssl"] }
actix-tls = { version = "3.0.0-beta.2", features = ["openssl"] }
actix-server = "2.0.0-beta.3"
actix-http-test = { version = "3.0.0-beta.3", features = ["openssl"] }
actix-tls = { version = "3.0.0-beta.5", features = ["openssl"] }
criterion = "0.3"
env_logger = "0.7"
env_logger = "0.8"
rcgen = "0.8"
serde_derive = "1.0"
open-ssl = { version="0.10", package = "openssl" }
rust-tls = { version="0.19", package = "rustls" }
tls-openssl = { version = "0.10", package = "openssl" }
tls-rustls = { version = "0.19", package = "rustls" }
[[example]]
name = "ws"
required-features = ["rustls"]
[[bench]]
name = "write-camel-case"

View File

@@ -3,10 +3,13 @@
> HTTP primitives for the Actix ecosystem.
[![crates.io](https://img.shields.io/crates/v/actix-http?label=latest)](https://crates.io/crates/actix-http)
[![Documentation](https://docs.rs/actix-http/badge.svg?version=2.2.0)](https://docs.rs/actix-http/2.2.0)
![Apache 2.0 or MIT licensed](https://img.shields.io/crates/l/actix-http)
[![Dependency Status](https://deps.rs/crate/actix-http/2.2.0/status.svg)](https://deps.rs/crate/actix-http/2.2.0)
[![Join the chat at https://gitter.im/actix/actix-web](https://badges.gitter.im/actix/actix-web.svg)](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
[![Documentation](https://docs.rs/actix-http/badge.svg?version=3.0.0-beta.5)](https://docs.rs/actix-http/3.0.0-beta.5)
[![Version](https://img.shields.io/badge/rustc-1.46+-ab6000.svg)](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
![MIT or Apache 2.0 licensed](https://img.shields.io/crates/l/actix-http.svg)
<br />
[![dependency status](https://deps.rs/crate/actix-http/3.0.0-beta.5/status.svg)](https://deps.rs/crate/actix-http/3.0.0-beta.5)
[![Download](https://img.shields.io/crates/d/actix-http.svg)](https://crates.io/crates/actix-http)
[![Join the chat at https://gitter.im/actix/actix](https://badges.gitter.im/actix/actix.svg)](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
## Documentation & Resources

View File

@@ -3,7 +3,7 @@ use std::{env, io};
use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures_util::StreamExt;
use futures_util::StreamExt as _;
use http::header::HeaderValue;
use log::info;
@@ -26,7 +26,10 @@ async fn main() -> io::Result<()> {
info!("request body: {:?}", body);
Ok::<_, Error>(
Response::Ok()
.header("x-head", HeaderValue::from_static("dummy value!"))
.insert_header((
"x-head",
HeaderValue::from_static("dummy value!"),
))
.body(body),
)
})

View File

@@ -4,7 +4,7 @@ use actix_http::http::HeaderValue;
use actix_http::{Error, HttpService, Request, Response};
use actix_server::Server;
use bytes::BytesMut;
use futures_util::StreamExt;
use futures_util::StreamExt as _;
use log::info;
async fn handle_request(mut req: Request) -> Result<Response, Error> {
@@ -15,7 +15,7 @@ async fn handle_request(mut req: Request) -> Result<Response, Error> {
info!("request body: {:?}", body);
Ok(Response::Ok()
.header("x-head", HeaderValue::from_static("dummy value!"))
.insert_header(("x-head", HeaderValue::from_static("dummy value!")))
.body(body))
}

View File

@@ -2,7 +2,7 @@ use std::{env, io};
use actix_http::{HttpService, Response};
use actix_server::Server;
use futures_util::future;
use actix_utils::future;
use http::header::HeaderValue;
use log::info;
@@ -19,7 +19,10 @@ async fn main() -> io::Result<()> {
.finish(|_req| {
info!("{:?}", _req);
let mut res = Response::Ok();
res.header("x-head", HeaderValue::from_static("dummy value!"));
res.insert_header((
"x-head",
HeaderValue::from_static("dummy value!"),
));
future::ok::<_, ()>(res.body("Hello world!"))
})
.tcp()

107
actix-http/examples/ws.rs Normal file
View File

@@ -0,0 +1,107 @@
//! Sets up a WebSocket server over TCP and TLS.
//! Sends a heartbeat message every 4 seconds but does not respond to any incoming frames.
extern crate tls_rustls as rustls;
use std::{
env, io,
pin::Pin,
task::{Context, Poll},
time::Duration,
};
use actix_codec::Encoder;
use actix_http::{error::Error, ws, HttpService, Request, Response};
use actix_rt::time::{interval, Interval};
use actix_server::Server;
use bytes::{Bytes, BytesMut};
use bytestring::ByteString;
use futures_core::{ready, Stream};
#[actix_rt::main]
async fn main() -> io::Result<()> {
env::set_var("RUST_LOG", "actix=info,h2_ws=info");
env_logger::init();
Server::build()
.bind("tcp", ("127.0.0.1", 8080), || {
HttpService::build().h1(handler).tcp()
})?
.bind("tls", ("127.0.0.1", 8443), || {
HttpService::build().finish(handler).rustls(tls_config())
})?
.run()
.await
}
async fn handler(req: Request) -> Result<Response, Error> {
log::info!("handshaking");
let mut res = ws::handshake(req.head())?;
// handshake will always fail under HTTP/2
log::info!("responding");
Ok(res.streaming(Heartbeat::new(ws::Codec::new())))
}
struct Heartbeat {
codec: ws::Codec,
interval: Interval,
}
impl Heartbeat {
fn new(codec: ws::Codec) -> Self {
Self {
codec,
interval: interval(Duration::from_secs(4)),
}
}
}
impl Stream for Heartbeat {
type Item = Result<Bytes, Error>;
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
log::trace!("poll");
ready!(self.as_mut().interval.poll_tick(cx));
let mut buffer = BytesMut::new();
self.as_mut()
.codec
.encode(
ws::Message::Text(ByteString::from_static("hello world")),
&mut buffer,
)
.unwrap();
Poll::Ready(Some(Ok(buffer.freeze())))
}
}
fn tls_config() -> rustls::ServerConfig {
use std::io::BufReader;
use rustls::{
internal::pemfile::{certs, pkcs8_private_keys},
NoClientAuth, ServerConfig,
};
let cert = rcgen::generate_simple_self_signed(vec!["localhost".to_owned()]).unwrap();
let cert_file = cert.serialize_pem().unwrap();
let key_file = cert.serialize_private_key_pem();
let mut config = ServerConfig::new(NoClientAuth::new());
let cert_file = &mut BufReader::new(cert_file.as_bytes());
let key_file = &mut BufReader::new(key_file.as_bytes());
let cert_chain = certs(cert_file).unwrap();
let mut keys = pkcs8_private_keys(key_file).unwrap();
config.set_single_cert(cert_chain, keys.remove(0)).unwrap();
config
}

View File

@@ -1,710 +0,0 @@
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, mem};
use bytes::{Bytes, BytesMut};
use futures_core::{ready, Stream};
use pin_project::pin_project;
use crate::error::Error;
#[derive(Debug, PartialEq, Copy, Clone)]
/// Body size hint
pub enum BodySize {
None,
Empty,
Sized(u64),
Stream,
}
impl BodySize {
pub fn is_eof(&self) -> bool {
matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
}
}
/// Type that provides this trait can be streamed to a peer.
pub trait MessageBody {
fn size(&self) -> BodySize;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>>;
downcast_get_type_id!();
}
downcast!(MessageBody);
impl MessageBody for () {
fn size(&self) -> BodySize {
BodySize::Empty
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Poll::Ready(None)
}
}
impl<T: MessageBody + Unpin> MessageBody for Box<T> {
fn size(&self) -> BodySize {
self.as_ref().size()
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Pin::new(self.get_mut().as_mut()).poll_next(cx)
}
}
#[pin_project(project = ResponseBodyProj)]
pub enum ResponseBody<B> {
Body(#[pin] B),
Other(Body),
}
impl ResponseBody<Body> {
pub fn into_body<B>(self) -> ResponseBody<B> {
match self {
ResponseBody::Body(b) => ResponseBody::Other(b),
ResponseBody::Other(b) => ResponseBody::Other(b),
}
}
}
impl<B> ResponseBody<B> {
pub fn take_body(&mut self) -> ResponseBody<B> {
std::mem::replace(self, ResponseBody::Other(Body::None))
}
}
impl<B: MessageBody> ResponseBody<B> {
pub fn as_ref(&self) -> Option<&B> {
if let ResponseBody::Body(ref b) = self {
Some(b)
} else {
None
}
}
}
impl<B: MessageBody> MessageBody for ResponseBody<B> {
fn size(&self) -> BodySize {
match self {
ResponseBody::Body(ref body) => body.size(),
ResponseBody::Other(ref body) => body.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
}
}
}
impl<B: MessageBody> Stream for ResponseBody<B> {
type Item = Result<Bytes, Error>;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
}
}
}
/// Represents various types of http message body.
pub enum Body {
/// Empty response. `Content-Length` header is not set.
None,
/// Zero sized response body. `Content-Length` header is set to `0`.
Empty,
/// Specific response body.
Bytes(Bytes),
/// Generic message body.
Message(Box<dyn MessageBody + Unpin>),
}
impl Body {
/// Create body from slice (copy)
pub fn from_slice(s: &[u8]) -> Body {
Body::Bytes(Bytes::copy_from_slice(s))
}
/// Create body from generic message body.
pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
Body::Message(Box::new(body))
}
}
impl MessageBody for Body {
fn size(&self) -> BodySize {
match self {
Body::None => BodySize::None,
Body::Empty => BodySize::Empty,
Body::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
Body::Message(ref body) => body.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.get_mut() {
Body::None => Poll::Ready(None),
Body::Empty => Poll::Ready(None),
Body::Bytes(ref mut bin) => {
let len = bin.len();
if len == 0 {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(bin))))
}
}
Body::Message(body) => Pin::new(&mut **body).poll_next(cx),
}
}
}
impl PartialEq for Body {
fn eq(&self, other: &Body) -> bool {
match *self {
Body::None => matches!(*other, Body::None),
Body::Empty => matches!(*other, Body::Empty),
Body::Bytes(ref b) => match *other {
Body::Bytes(ref b2) => b == b2,
_ => false,
},
Body::Message(_) => false,
}
}
}
impl fmt::Debug for Body {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
Body::None => write!(f, "Body::None"),
Body::Empty => write!(f, "Body::Empty"),
Body::Bytes(ref b) => write!(f, "Body::Bytes({:?})", b),
Body::Message(_) => write!(f, "Body::Message(_)"),
}
}
}
impl From<&'static str> for Body {
fn from(s: &'static str) -> Body {
Body::Bytes(Bytes::from_static(s.as_ref()))
}
}
impl From<&'static [u8]> for Body {
fn from(s: &'static [u8]) -> Body {
Body::Bytes(Bytes::from_static(s))
}
}
impl From<Vec<u8>> for Body {
fn from(vec: Vec<u8>) -> Body {
Body::Bytes(Bytes::from(vec))
}
}
impl From<String> for Body {
fn from(s: String) -> Body {
s.into_bytes().into()
}
}
impl<'a> From<&'a String> for Body {
fn from(s: &'a String) -> Body {
Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
}
}
impl From<Bytes> for Body {
fn from(s: Bytes) -> Body {
Body::Bytes(s)
}
}
impl From<BytesMut> for Body {
fn from(s: BytesMut) -> Body {
Body::Bytes(s.freeze())
}
}
impl From<serde_json::Value> for Body {
fn from(v: serde_json::Value) -> Body {
Body::Bytes(v.to_string().into())
}
}
impl<S> From<SizedStream<S>> for Body
where
S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
{
fn from(s: SizedStream<S>) -> Body {
Body::from_message(s)
}
}
impl<S, E> From<BodyStream<S>> for Body
where
S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
E: Into<Error> + 'static,
{
fn from(s: BodyStream<S>) -> Body {
Body::from_message(s)
}
}
impl MessageBody for Bytes {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
}
}
}
impl MessageBody for BytesMut {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
}
}
}
impl MessageBody for &'static str {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from_static(
mem::take(self.get_mut()).as_ref(),
))))
}
}
}
impl MessageBody for Vec<u8> {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
}
}
}
impl MessageBody for String {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from(
mem::take(self.get_mut()).into_bytes(),
))))
}
}
}
/// Type represent streaming body.
/// Response does not contain `content-length` header and appropriate transfer encoding is used.
pub struct BodyStream<S: Unpin> {
stream: S,
}
impl<S, E> BodyStream<S>
where
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
pub fn new(stream: S) -> Self {
BodyStream { stream }
}
}
impl<S, E> MessageBody for BodyStream<S>
where
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
fn size(&self) -> BodySize {
BodySize::Stream
}
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`BodyStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
loop {
let stream = &mut self.as_mut().stream;
return Poll::Ready(match ready!(Pin::new(stream).poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
opt => opt.map(|res| res.map_err(Into::into)),
});
}
}
}
/// Type represent streaming body. This body implementation should be used
/// if total size of stream is known. Data get sent as is without using transfer encoding.
pub struct SizedStream<S: Unpin> {
size: u64,
stream: S,
}
impl<S> SizedStream<S>
where
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
pub fn new(size: u64, stream: S) -> Self {
SizedStream { size, stream }
}
}
impl<S> MessageBody for SizedStream<S>
where
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
fn size(&self) -> BodySize {
BodySize::Sized(self.size as u64)
}
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`SizedStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
loop {
let stream = &mut self.as_mut().stream;
return Poll::Ready(match ready!(Pin::new(stream).poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
val => val,
});
}
}
}
#[cfg(test)]
mod tests {
use super::*;
use futures_util::future::poll_fn;
use futures_util::pin_mut;
use futures_util::stream;
impl Body {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
Body::Bytes(ref bin) => &bin,
_ => panic!(),
}
}
}
impl ResponseBody<Body> {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
ResponseBody::Body(ref b) => b.get_ref(),
ResponseBody::Other(ref b) => b.get_ref(),
}
}
}
#[actix_rt::test]
async fn test_static_str() {
assert_eq!(Body::from("").size(), BodySize::Sized(0));
assert_eq!(Body::from("test").size(), BodySize::Sized(4));
assert_eq!(Body::from("test").get_ref(), b"test");
assert_eq!("test".size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_static_bytes() {
assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
assert_eq!(
Body::from_slice(b"test".as_ref()).size(),
BodySize::Sized(4)
);
assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
let sb = Bytes::from(&b"test"[..]);
pin_mut!(sb);
assert_eq!(sb.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_vec() {
assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
let test_vec = Vec::from("test");
pin_mut!(test_vec);
assert_eq!(test_vec.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| test_vec.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_bytes() {
let b = Bytes::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin_mut!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_bytes_mut() {
let b = BytesMut::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin_mut!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_string() {
let b = "test".to_owned();
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
assert_eq!(Body::from(&b).get_ref(), b"test");
pin_mut!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_unit() {
assert_eq!(().size(), BodySize::Empty);
assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
.await
.is_none());
}
#[actix_rt::test]
async fn test_box() {
let val = Box::new(());
pin_mut!(val);
assert_eq!(val.size(), BodySize::Empty);
assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
}
#[actix_rt::test]
async fn test_body_eq() {
assert!(
Body::Bytes(Bytes::from_static(b"1"))
== Body::Bytes(Bytes::from_static(b"1"))
);
assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
}
#[actix_rt::test]
async fn test_body_debug() {
assert!(format!("{:?}", Body::None).contains("Body::None"));
assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
}
#[actix_rt::test]
async fn test_serde_json() {
use serde_json::json;
assert_eq!(
Body::from(serde_json::Value::String("test".into())).size(),
BodySize::Sized(6)
);
assert_eq!(
Body::from(json!({"test-key":"test-value"})).size(),
BodySize::Sized(25)
);
}
mod body_stream {
use super::*;
//use futures::task::noop_waker;
//use futures::stream::once;
#[actix_rt::test]
async fn skips_empty_chunks() {
let body = BodyStream::new(stream::iter(
["1", "", "2"]
.iter()
.map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
));
pin_mut!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
/* Now it does not compile as it should
#[actix_rt::test]
async fn move_pinned_pointer() {
let (sender, receiver) = futures::channel::oneshot::channel();
let mut body_stream = Ok(BodyStream::new(once(async {
let x = Box::new(0i32);
let y = &x;
receiver.await.unwrap();
let _z = **y;
Ok::<_, ()>(Bytes::new())
})));
let waker = noop_waker();
let mut context = Context::from_waker(&waker);
pin_mut!(body_stream);
let _ = body_stream.as_mut().unwrap().poll_next(&mut context);
sender.send(()).unwrap();
let _ = std::mem::replace(&mut body_stream, Err([0; 32])).unwrap().poll_next(&mut context);
}*/
}
mod sized_stream {
use super::*;
#[actix_rt::test]
async fn skips_empty_chunks() {
let body = SizedStream::new(
2,
stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
);
pin_mut!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
}
#[actix_rt::test]
async fn test_body_casting() {
let mut body = String::from("hello cast");
let resp_body: &mut dyn MessageBody = &mut body;
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast");
let body = &mut resp_body.downcast_mut::<String>().unwrap();
body.push('!');
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast!");
let not_body = resp_body.downcast_ref::<()>();
assert!(not_body.is_none());
}
}

158
actix-http/src/body/body.rs Normal file
View File

@@ -0,0 +1,158 @@
use std::{
fmt, mem,
pin::Pin,
task::{Context, Poll},
};
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use crate::error::Error;
use super::{BodySize, BodyStream, MessageBody, SizedStream};
/// Represents various types of HTTP message body.
pub enum Body {
/// Empty response. `Content-Length` header is not set.
None,
/// Zero sized response body. `Content-Length` header is set to `0`.
Empty,
/// Specific response body.
Bytes(Bytes),
/// Generic message body.
Message(Box<dyn MessageBody + Unpin>),
}
impl Body {
/// Create body from slice (copy)
pub fn from_slice(s: &[u8]) -> Body {
Body::Bytes(Bytes::copy_from_slice(s))
}
/// Create body from generic message body.
pub fn from_message<B: MessageBody + Unpin + 'static>(body: B) -> Body {
Body::Message(Box::new(body))
}
}
impl MessageBody for Body {
fn size(&self) -> BodySize {
match self {
Body::None => BodySize::None,
Body::Empty => BodySize::Empty,
Body::Bytes(ref bin) => BodySize::Sized(bin.len() as u64),
Body::Message(ref body) => body.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.get_mut() {
Body::None => Poll::Ready(None),
Body::Empty => Poll::Ready(None),
Body::Bytes(ref mut bin) => {
let len = bin.len();
if len == 0 {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(bin))))
}
}
Body::Message(body) => Pin::new(&mut **body).poll_next(cx),
}
}
}
impl PartialEq for Body {
fn eq(&self, other: &Body) -> bool {
match *self {
Body::None => matches!(*other, Body::None),
Body::Empty => matches!(*other, Body::Empty),
Body::Bytes(ref b) => match *other {
Body::Bytes(ref b2) => b == b2,
_ => false,
},
Body::Message(_) => false,
}
}
}
impl fmt::Debug for Body {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
Body::None => write!(f, "Body::None"),
Body::Empty => write!(f, "Body::Empty"),
Body::Bytes(ref b) => write!(f, "Body::Bytes({:?})", b),
Body::Message(_) => write!(f, "Body::Message(_)"),
}
}
}
impl From<&'static str> for Body {
fn from(s: &'static str) -> Body {
Body::Bytes(Bytes::from_static(s.as_ref()))
}
}
impl From<&'static [u8]> for Body {
fn from(s: &'static [u8]) -> Body {
Body::Bytes(Bytes::from_static(s))
}
}
impl From<Vec<u8>> for Body {
fn from(vec: Vec<u8>) -> Body {
Body::Bytes(Bytes::from(vec))
}
}
impl From<String> for Body {
fn from(s: String) -> Body {
s.into_bytes().into()
}
}
impl<'a> From<&'a String> for Body {
fn from(s: &'a String) -> Body {
Body::Bytes(Bytes::copy_from_slice(AsRef::<[u8]>::as_ref(&s)))
}
}
impl From<Bytes> for Body {
fn from(s: Bytes) -> Body {
Body::Bytes(s)
}
}
impl From<BytesMut> for Body {
fn from(s: BytesMut) -> Body {
Body::Bytes(s.freeze())
}
}
impl From<serde_json::Value> for Body {
fn from(v: serde_json::Value) -> Body {
Body::Bytes(v.to_string().into())
}
}
impl<S> From<SizedStream<S>> for Body
where
S: Stream<Item = Result<Bytes, Error>> + Unpin + 'static,
{
fn from(s: SizedStream<S>) -> Body {
Body::from_message(s)
}
}
impl<S, E> From<BodyStream<S>> for Body
where
S: Stream<Item = Result<Bytes, E>> + Unpin + 'static,
E: Into<Error> + 'static,
{
fn from(s: BodyStream<S>) -> Body {
Body::from_message(s)
}
}

View File

@@ -0,0 +1,59 @@
use std::{
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
use crate::error::Error;
use super::{BodySize, MessageBody};
/// Streaming response wrapper.
///
/// Response does not contain `Content-Length` header and appropriate transfer encoding is used.
pub struct BodyStream<S: Unpin> {
stream: S,
}
impl<S, E> BodyStream<S>
where
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
pub fn new(stream: S) -> Self {
BodyStream { stream }
}
}
impl<S, E> MessageBody for BodyStream<S>
where
S: Stream<Item = Result<Bytes, E>> + Unpin,
E: Into<Error>,
{
fn size(&self) -> BodySize {
BodySize::Stream
}
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`BodyStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
loop {
let stream = &mut self.as_mut().stream;
let chunk = match ready!(Pin::new(stream).poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
opt => opt.map(|res| res.map_err(Into::into)),
};
return Poll::Ready(chunk);
}
}
}

View File

@@ -0,0 +1,142 @@
//! [`MessageBody`] trait and foreign implementations.
use std::{
mem,
pin::Pin,
task::{Context, Poll},
};
use bytes::{Bytes, BytesMut};
use crate::error::Error;
use super::BodySize;
/// Type that implement this trait can be streamed to a peer.
pub trait MessageBody {
fn size(&self) -> BodySize;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>>;
downcast_get_type_id!();
}
downcast!(MessageBody);
impl MessageBody for () {
fn size(&self) -> BodySize {
BodySize::Empty
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Poll::Ready(None)
}
}
impl<T: MessageBody + Unpin> MessageBody for Box<T> {
fn size(&self) -> BodySize {
self.as_ref().size()
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
Pin::new(self.get_mut().as_mut()).poll_next(cx)
}
}
impl MessageBody for Bytes {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(self.get_mut()))))
}
}
}
impl MessageBody for BytesMut {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(mem::take(self.get_mut()).freeze())))
}
}
}
impl MessageBody for &'static str {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from_static(
mem::take(self.get_mut()).as_ref(),
))))
}
}
}
impl MessageBody for Vec<u8> {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from(mem::take(self.get_mut())))))
}
}
}
impl MessageBody for String {
fn size(&self) -> BodySize {
BodySize::Sized(self.len() as u64)
}
fn poll_next(
self: Pin<&mut Self>,
_: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
if self.is_empty() {
Poll::Ready(None)
} else {
Poll::Ready(Some(Ok(Bytes::from(
mem::take(self.get_mut()).into_bytes(),
))))
}
}
}

253
actix-http/src/body/mod.rs Normal file
View File

@@ -0,0 +1,253 @@
//! Traits and structures to aid consuming and writing HTTP payloads.
#[allow(clippy::module_inception)]
mod body;
mod body_stream;
mod message_body;
mod response_body;
mod size;
mod sized_stream;
pub use self::body::Body;
pub use self::body_stream::BodyStream;
pub use self::message_body::MessageBody;
pub use self::response_body::ResponseBody;
pub use self::size::BodySize;
pub use self::sized_stream::SizedStream;
#[cfg(test)]
mod tests {
use std::pin::Pin;
use actix_rt::pin;
use actix_utils::future::poll_fn;
use bytes::{Bytes, BytesMut};
use futures_util::stream;
use super::*;
impl Body {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
Body::Bytes(ref bin) => &bin,
_ => panic!(),
}
}
}
impl ResponseBody<Body> {
pub(crate) fn get_ref(&self) -> &[u8] {
match *self {
ResponseBody::Body(ref b) => b.get_ref(),
ResponseBody::Other(ref b) => b.get_ref(),
}
}
}
#[actix_rt::test]
async fn test_static_str() {
assert_eq!(Body::from("").size(), BodySize::Sized(0));
assert_eq!(Body::from("test").size(), BodySize::Sized(4));
assert_eq!(Body::from("test").get_ref(), b"test");
assert_eq!("test".size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| Pin::new(&mut "test").poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_static_bytes() {
assert_eq!(Body::from(b"test".as_ref()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b"test".as_ref()).get_ref(), b"test");
assert_eq!(
Body::from_slice(b"test".as_ref()).size(),
BodySize::Sized(4)
);
assert_eq!(Body::from_slice(b"test".as_ref()).get_ref(), b"test");
let sb = Bytes::from(&b"test"[..]);
pin!(sb);
assert_eq!(sb.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| sb.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_vec() {
assert_eq!(Body::from(Vec::from("test")).size(), BodySize::Sized(4));
assert_eq!(Body::from(Vec::from("test")).get_ref(), b"test");
let test_vec = Vec::from("test");
pin!(test_vec);
assert_eq!(test_vec.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| test_vec.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_bytes() {
let b = Bytes::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_bytes_mut() {
let b = BytesMut::from("test");
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
pin!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_string() {
let b = "test".to_owned();
assert_eq!(Body::from(b.clone()).size(), BodySize::Sized(4));
assert_eq!(Body::from(b.clone()).get_ref(), b"test");
assert_eq!(Body::from(&b).size(), BodySize::Sized(4));
assert_eq!(Body::from(&b).get_ref(), b"test");
pin!(b);
assert_eq!(b.size(), BodySize::Sized(4));
assert_eq!(
poll_fn(|cx| b.as_mut().poll_next(cx)).await.unwrap().ok(),
Some(Bytes::from("test"))
);
}
#[actix_rt::test]
async fn test_unit() {
assert_eq!(().size(), BodySize::Empty);
assert!(poll_fn(|cx| Pin::new(&mut ()).poll_next(cx))
.await
.is_none());
}
#[actix_rt::test]
async fn test_box() {
let val = Box::new(());
pin!(val);
assert_eq!(val.size(), BodySize::Empty);
assert!(poll_fn(|cx| val.as_mut().poll_next(cx)).await.is_none());
}
#[actix_rt::test]
async fn test_body_eq() {
assert!(
Body::Bytes(Bytes::from_static(b"1"))
== Body::Bytes(Bytes::from_static(b"1"))
);
assert!(Body::Bytes(Bytes::from_static(b"1")) != Body::None);
}
#[actix_rt::test]
async fn test_body_debug() {
assert!(format!("{:?}", Body::None).contains("Body::None"));
assert!(format!("{:?}", Body::Empty).contains("Body::Empty"));
assert!(format!("{:?}", Body::Bytes(Bytes::from_static(b"1"))).contains('1'));
}
#[actix_rt::test]
async fn test_serde_json() {
use serde_json::json;
assert_eq!(
Body::from(serde_json::Value::String("test".into())).size(),
BodySize::Sized(6)
);
assert_eq!(
Body::from(json!({"test-key":"test-value"})).size(),
BodySize::Sized(25)
);
}
#[actix_rt::test]
async fn body_stream_skips_empty_chunks() {
let body = BodyStream::new(stream::iter(
["1", "", "2"]
.iter()
.map(|&v| Ok(Bytes::from(v)) as Result<Bytes, ()>),
));
pin!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
mod sized_stream {
use super::*;
#[actix_rt::test]
async fn skips_empty_chunks() {
let body = SizedStream::new(
2,
stream::iter(["1", "", "2"].iter().map(|&v| Ok(Bytes::from(v)))),
);
pin!(body);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("1")),
);
assert_eq!(
poll_fn(|cx| body.as_mut().poll_next(cx))
.await
.unwrap()
.ok(),
Some(Bytes::from("2")),
);
}
}
#[actix_rt::test]
async fn test_body_casting() {
let mut body = String::from("hello cast");
let resp_body: &mut dyn MessageBody = &mut body;
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast");
let body = &mut resp_body.downcast_mut::<String>().unwrap();
body.push('!');
let body = resp_body.downcast_ref::<String>().unwrap();
assert_eq!(body, "hello cast!");
let not_body = resp_body.downcast_ref::<()>();
assert!(not_body.is_none());
}
}

View File

@@ -0,0 +1,77 @@
use std::{
mem,
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::Stream;
use pin_project::pin_project;
use crate::error::Error;
use super::{Body, BodySize, MessageBody};
#[pin_project(project = ResponseBodyProj)]
pub enum ResponseBody<B> {
Body(#[pin] B),
Other(Body),
}
impl ResponseBody<Body> {
pub fn into_body<B>(self) -> ResponseBody<B> {
match self {
ResponseBody::Body(b) => ResponseBody::Other(b),
ResponseBody::Other(b) => ResponseBody::Other(b),
}
}
}
impl<B> ResponseBody<B> {
pub fn take_body(&mut self) -> ResponseBody<B> {
mem::replace(self, ResponseBody::Other(Body::None))
}
}
impl<B: MessageBody> ResponseBody<B> {
pub fn as_ref(&self) -> Option<&B> {
if let ResponseBody::Body(ref b) = self {
Some(b)
} else {
None
}
}
}
impl<B: MessageBody> MessageBody for ResponseBody<B> {
fn size(&self) -> BodySize {
match self {
ResponseBody::Body(ref body) => body.size(),
ResponseBody::Other(ref body) => body.size(),
}
}
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
}
}
}
impl<B: MessageBody> Stream for ResponseBody<B> {
type Item = Result<Bytes, Error>;
fn poll_next(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Self::Item>> {
match self.project() {
ResponseBodyProj::Body(body) => body.poll_next(cx),
ResponseBodyProj::Other(body) => Pin::new(body).poll_next(cx),
}
}
}

View File

@@ -0,0 +1,40 @@
/// Body size hint.
#[derive(Debug, Clone, Copy, PartialEq)]
pub enum BodySize {
/// Absence of body can be assumed from method or status code.
///
/// Will skip writing Content-Length header.
None,
/// Zero size body.
///
/// Will write `Content-Length: 0` header.
Empty,
/// Known size body.
///
/// Will write `Content-Length: N` header. `Sized(0)` is treated the same as `Empty`.
Sized(u64),
/// Unknown size body.
///
/// Will not write Content-Length header. Can be used with chunked Transfer-Encoding.
Stream,
}
impl BodySize {
/// Returns true if size hint indicates no or empty body.
///
/// ```
/// # use actix_http::body::BodySize;
/// assert!(BodySize::None.is_eof());
/// assert!(BodySize::Empty.is_eof());
/// assert!(BodySize::Sized(0).is_eof());
///
/// assert!(!BodySize::Sized(64).is_eof());
/// assert!(!BodySize::Stream.is_eof());
/// ```
pub fn is_eof(&self) -> bool {
matches!(self, BodySize::None | BodySize::Empty | BodySize::Sized(0))
}
}

View File

@@ -0,0 +1,59 @@
use std::{
pin::Pin,
task::{Context, Poll},
};
use bytes::Bytes;
use futures_core::{ready, Stream};
use crate::error::Error;
use super::{BodySize, MessageBody};
/// Known sized streaming response wrapper.
///
/// This body implementation should be used if total size of stream is known. Data get sent as is
/// without using transfer encoding.
pub struct SizedStream<S: Unpin> {
size: u64,
stream: S,
}
impl<S> SizedStream<S>
where
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
pub fn new(size: u64, stream: S) -> Self {
SizedStream { size, stream }
}
}
impl<S> MessageBody for SizedStream<S>
where
S: Stream<Item = Result<Bytes, Error>> + Unpin,
{
fn size(&self) -> BodySize {
BodySize::Sized(self.size as u64)
}
/// Attempts to pull out the next value of the underlying [`Stream`].
///
/// Empty values are skipped to prevent [`SizedStream`]'s transmission being
/// ended on a zero-length chunk, but rather proceed until the underlying
/// [`Stream`] ends.
fn poll_next(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Option<Result<Bytes, Error>>> {
loop {
let stream = &mut self.as_mut().stream;
let chunk = match ready!(Pin::new(stream).poll_next(cx)) {
Some(Ok(ref bytes)) if bytes.is_empty() => continue,
val => val,
};
return Poll::Ready(chunk);
}
}
}

View File

@@ -63,11 +63,9 @@ where
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service<Request>>::Future: 'static,
U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
{
/// Set server keep-alive setting.
///
@@ -127,7 +125,6 @@ where
X1: ServiceFactory<Request, Config = (), Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
<X1::Service as Service<Request>>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
@@ -152,7 +149,6 @@ where
U1: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
<U1::Service as Service<(Request, Framed<T, Codec>)>>::Future: 'static,
{
HttpServiceBuilder {
keep_alive: self.keep_alive,
@@ -211,7 +207,6 @@ where
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,
@@ -233,7 +228,6 @@ where
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
{
let cfg = ServiceConfig::new(
self.keep_alive,

View File

@@ -1,31 +1,35 @@
use std::net::IpAddr;
use std::time::Duration;
// These values are taken from hyper/src/proto/h2/client.rs
const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2mb
const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1mb
const DEFAULT_H2_CONN_WINDOW: u32 = 1024 * 1024 * 2; // 2MB
const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1MB
/// Connector configuration
#[derive(Clone)]
pub(crate) struct ConnectorConfig {
pub(crate) timeout: Duration,
pub(crate) handshake_timeout: Duration,
pub(crate) conn_lifetime: Duration,
pub(crate) conn_keep_alive: Duration,
pub(crate) disconnect_timeout: Option<Duration>,
pub(crate) limit: usize,
pub(crate) conn_window_size: u32,
pub(crate) stream_window_size: u32,
pub(crate) local_address: Option<IpAddr>,
}
impl Default for ConnectorConfig {
fn default() -> Self {
Self {
timeout: Duration::from_secs(1),
timeout: Duration::from_secs(5),
handshake_timeout: Duration::from_secs(5),
conn_lifetime: Duration::from_secs(75),
conn_keep_alive: Duration::from_secs(15),
disconnect_timeout: Some(Duration::from_millis(3000)),
limit: 100,
conn_window_size: DEFAULT_H2_CONN_WINDOW,
stream_window_size: DEFAULT_H2_STREAM_WINDOW,
local_address: None,
}
}
}

View File

@@ -1,13 +1,16 @@
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, io, time};
use std::{
io,
ops::{Deref, DerefMut},
pin::Pin,
task::{Context, Poll},
time,
};
use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
use actix_rt::task::JoinHandle;
use bytes::Bytes;
use futures_util::future::{err, Either, FutureExt, LocalBoxFuture, Ready};
use futures_core::future::LocalBoxFuture;
use h2::client::SendRequest;
use pin_project::pin_project;
use crate::body::MessageBody;
use crate::h1::ClientCodec;
@@ -15,243 +18,347 @@ use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::Payload;
use super::error::SendRequestError;
use super::pool::{Acquired, Protocol};
use super::pool::Acquired;
use super::{h1proto, h2proto};
pub(crate) enum ConnectionType<Io> {
H1(Io),
H2(SendRequest<Bytes>),
}
/// Trait alias for types impl [tokio::io::AsyncRead] and [tokio::io::AsyncWrite].
pub trait ConnectionIo: AsyncRead + AsyncWrite + Unpin + 'static {}
pub trait Connection {
type Io: AsyncRead + AsyncWrite + Unpin;
type Future: Future<Output = Result<(ResponseHead, Payload), SendRequestError>>;
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> ConnectionIo for T {}
fn protocol(&self) -> Protocol;
/// Send request and body
fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
self,
head: H,
body: B,
) -> Self::Future;
type TunnelFuture: Future<
Output = Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>;
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture;
}
pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
/// Close connection
fn close(self: Pin<&mut Self>);
/// Release connection to the connection pool
fn release(self: Pin<&mut Self>);
}
#[doc(hidden)]
/// HTTP client connection
pub struct IoConnection<T> {
io: Option<ConnectionType<T>>,
pub struct H1Connection<Io: ConnectionIo> {
io: Option<Io>,
created: time::Instant,
pool: Option<Acquired<T>>,
acquired: Acquired<Io>,
}
impl<T> fmt::Debug for IoConnection<T>
where
T: fmt::Debug,
{
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
match self.io {
Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
None => write!(f, "Connection(Empty)"),
impl<Io: ConnectionIo> H1Connection<Io> {
/// close or release the connection to pool based on flag input
pub(super) fn on_release(&mut self, keep_alive: bool) {
if keep_alive {
self.release();
} else {
self.close();
}
}
/// Close connection
fn close(&mut self) {
let io = self.io.take().unwrap();
self.acquired.close(ConnectionInnerType::H1(io));
}
/// Release this connection to the connection pool
fn release(&mut self) {
let io = self.io.take().unwrap();
self.acquired
.release(ConnectionInnerType::H1(io), self.created);
}
fn io_pin_mut(self: Pin<&mut Self>) -> Pin<&mut Io> {
Pin::new(self.get_mut().io.as_mut().unwrap())
}
}
impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
pub(crate) fn new(
io: ConnectionType<T>,
created: time::Instant,
pool: Option<Acquired<T>>,
impl<Io: ConnectionIo> AsyncRead for H1Connection<Io> {
fn poll_read(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut ReadBuf<'_>,
) -> Poll<io::Result<()>> {
self.io_pin_mut().poll_read(cx, buf)
}
}
impl<Io: ConnectionIo> AsyncWrite for H1Connection<Io> {
fn poll_write(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
self.io_pin_mut().poll_write(cx, buf)
}
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
self.io_pin_mut().poll_flush(cx)
}
fn poll_shutdown(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Result<(), io::Error>> {
self.io_pin_mut().poll_shutdown(cx)
}
fn poll_write_vectored(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
bufs: &[io::IoSlice<'_>],
) -> Poll<io::Result<usize>> {
self.io_pin_mut().poll_write_vectored(cx, bufs)
}
fn is_write_vectored(&self) -> bool {
self.io.as_ref().unwrap().is_write_vectored()
}
}
/// HTTP2 client connection
pub struct H2Connection<Io: ConnectionIo> {
io: Option<H2ConnectionInner>,
created: time::Instant,
acquired: Acquired<Io>,
}
impl<Io: ConnectionIo> Deref for H2Connection<Io> {
type Target = SendRequest<Bytes>;
fn deref(&self) -> &Self::Target {
&self.io.as_ref().unwrap().sender
}
}
impl<Io: ConnectionIo> DerefMut for H2Connection<Io> {
fn deref_mut(&mut self) -> &mut Self::Target {
&mut self.io.as_mut().unwrap().sender
}
}
impl<Io: ConnectionIo> H2Connection<Io> {
/// close or release the connection to pool based on flag input
pub(super) fn on_release(&mut self, close: bool) {
if close {
self.close();
} else {
self.release();
}
}
/// Close connection
fn close(&mut self) {
let io = self.io.take().unwrap();
self.acquired.close(ConnectionInnerType::H2(io));
}
/// Release this connection to the connection pool
fn release(&mut self) {
let io = self.io.take().unwrap();
self.acquired
.release(ConnectionInnerType::H2(io), self.created);
}
}
/// `H2ConnectionInner` has two parts: `SendRequest` and `Connection`.
///
/// `Connection` is spawned as an async task on runtime and `H2ConnectionInner` holds a handle
/// for this task. Therefore, it can wake up and quit the task when SendRequest is dropped.
pub(super) struct H2ConnectionInner {
handle: JoinHandle<()>,
sender: SendRequest<Bytes>,
}
impl H2ConnectionInner {
pub(super) fn new<Io: ConnectionIo>(
sender: SendRequest<Bytes>,
connection: h2::client::Connection<Io>,
) -> Self {
IoConnection {
pool,
created,
io: Some(io),
}
}
let handle = actix_rt::spawn(async move {
let _ = connection.await;
});
pub(crate) fn into_inner(self) -> (ConnectionType<T>, time::Instant) {
(self.io.unwrap(), self.created)
Self { handle, sender }
}
}
impl<T> Connection for IoConnection<T>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Io = T;
type Future =
LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
fn protocol(&self) -> Protocol {
match self.io {
Some(ConnectionType::H1(_)) => Protocol::Http1,
Some(ConnectionType::H2(_)) => Protocol::Http2,
None => Protocol::Http1,
}
}
fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
mut self,
head: H,
body: B,
) -> Self::Future {
match self.io.take().unwrap() {
ConnectionType::H1(io) => {
h1proto::send_request(io, head.into(), body, self.created, self.pool)
.boxed_local()
}
ConnectionType::H2(io) => {
h2proto::send_request(io, head.into(), body, self.created, self.pool)
.boxed_local()
}
}
}
type TunnelFuture = Either<
LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>,
Ready<Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>>,
>;
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType>>(mut self, head: H) -> Self::TunnelFuture {
match self.io.take().unwrap() {
ConnectionType::H1(io) => {
Either::Left(h1proto::open_tunnel(io, head.into()).boxed_local())
}
ConnectionType::H2(io) => {
if let Some(mut pool) = self.pool.take() {
pool.release(IoConnection::new(
ConnectionType::H2(io),
self.created,
None,
));
}
Either::Right(err(SendRequestError::TunnelNotSupported))
}
/// Cancel spawned connection task on drop.
impl Drop for H2ConnectionInner {
fn drop(&mut self) {
if self
.sender
.send_request(http::Request::new(()), true)
.is_err()
{
self.handle.abort();
}
}
}
#[allow(dead_code)]
pub(crate) enum EitherConnection<A, B> {
A(IoConnection<A>),
B(IoConnection<B>),
/// Unified connection type cover Http1 Plain/Tls and Http2 protocols
pub enum Connection<A, B = Box<dyn ConnectionIo>>
where
A: ConnectionIo,
B: ConnectionIo,
{
Tcp(ConnectionType<A>),
Tls(ConnectionType<B>),
}
impl<A, B> Connection for EitherConnection<A, B>
where
A: AsyncRead + AsyncWrite + Unpin + 'static,
B: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Io = EitherIo<A, B>;
type Future =
LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>;
/// Unified connection type cover Http1/2 protocols
pub enum ConnectionType<Io: ConnectionIo> {
H1(H1Connection<Io>),
H2(H2Connection<Io>),
}
fn protocol(&self) -> Protocol {
match self {
EitherConnection::A(con) => con.protocol(),
EitherConnection::B(con) => con.protocol(),
/// Helper type for storing connection types in pool.
pub(super) enum ConnectionInnerType<Io> {
H1(Io),
H2(H2ConnectionInner),
}
impl<Io: ConnectionIo> ConnectionType<Io> {
pub(super) fn from_pool(
inner: ConnectionInnerType<Io>,
created: time::Instant,
acquired: Acquired<Io>,
) -> Self {
match inner {
ConnectionInnerType::H1(io) => Self::from_h1(io, created, acquired),
ConnectionInnerType::H2(io) => Self::from_h2(io, created, acquired),
}
}
fn send_request<RB: MessageBody + 'static, H: Into<RequestHeadType>>(
pub(super) fn from_h1(
io: Io,
created: time::Instant,
acquired: Acquired<Io>,
) -> Self {
Self::H1(H1Connection {
io: Some(io),
created,
acquired,
})
}
pub(super) fn from_h2(
io: H2ConnectionInner,
created: time::Instant,
acquired: Acquired<Io>,
) -> Self {
Self::H2(H2Connection {
io: Some(io),
created,
acquired,
})
}
}
impl<A, B> Connection<A, B>
where
A: ConnectionIo,
B: ConnectionIo,
{
/// Send a request through connection.
pub fn send_request<RB, H>(
self,
head: H,
body: RB,
) -> Self::Future {
match self {
EitherConnection::A(con) => con.send_request(head, body),
EitherConnection::B(con) => con.send_request(head, body),
}
) -> LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>
where
RB: MessageBody + 'static,
H: Into<RequestHeadType> + 'static,
{
Box::pin(async move {
match self {
Connection::Tcp(ConnectionType::H1(conn)) => {
h1proto::send_request(conn, head.into(), body).await
}
Connection::Tls(ConnectionType::H1(conn)) => {
h1proto::send_request(conn, head.into(), body).await
}
Connection::Tls(ConnectionType::H2(conn)) => {
h2proto::send_request(conn, head.into(), body).await
}
_ => unreachable!(
"Plain Tcp connection can be used only in Http1 protocol"
),
}
})
}
type TunnelFuture = LocalBoxFuture<
/// Send request, returns Response and Framed tunnel.
pub fn open_tunnel<H: Into<RequestHeadType> + 'static>(
self,
head: H,
) -> LocalBoxFuture<
'static,
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
>;
/// Send request, returns Response and Framed
fn open_tunnel<H: Into<RequestHeadType>>(self, head: H) -> Self::TunnelFuture {
match self {
EitherConnection::A(con) => con
.open_tunnel(head)
.map(|res| {
res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::A)))
})
.boxed_local(),
EitherConnection::B(con) => con
.open_tunnel(head)
.map(|res| {
res.map(|(head, framed)| (head, framed.into_map_io(EitherIo::B)))
})
.boxed_local(),
}
Result<(ResponseHead, Framed<Connection<A, B>, ClientCodec>), SendRequestError>,
> {
Box::pin(async move {
match self {
Connection::Tcp(ConnectionType::H1(ref _conn)) => {
let (head, framed) = h1proto::open_tunnel(self, head.into()).await?;
Ok((head, framed))
}
Connection::Tls(ConnectionType::H1(ref _conn)) => {
let (head, framed) = h1proto::open_tunnel(self, head.into()).await?;
Ok((head, framed))
}
Connection::Tls(ConnectionType::H2(mut conn)) => {
conn.release();
Err(SendRequestError::TunnelNotSupported)
}
Connection::Tcp(ConnectionType::H2(_)) => {
unreachable!(
"Plain Tcp connection can be used only in Http1 protocol"
)
}
}
})
}
}
#[pin_project(project = EitherIoProj)]
pub enum EitherIo<A, B> {
A(#[pin] A),
B(#[pin] B),
}
impl<A, B> AsyncRead for EitherIo<A, B>
impl<A, B> AsyncRead for Connection<A, B>
where
A: AsyncRead,
B: AsyncRead,
A: ConnectionIo,
B: ConnectionIo,
{
fn poll_read(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut ReadBuf<'_>,
) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_read(cx, buf),
EitherIoProj::B(val) => val.poll_read(cx, buf),
match self.get_mut() {
Connection::Tcp(ConnectionType::H1(conn)) => {
Pin::new(conn).poll_read(cx, buf)
}
Connection::Tls(ConnectionType::H1(conn)) => {
Pin::new(conn).poll_read(cx, buf)
}
_ => unreachable!("H2Connection can not impl AsyncRead trait"),
}
}
}
impl<A, B> AsyncWrite for EitherIo<A, B>
const H2_UNREACHABLE_WRITE: &str = "H2Connection can not impl AsyncWrite trait";
impl<A, B> AsyncWrite for Connection<A, B>
where
A: AsyncWrite,
B: AsyncWrite,
A: ConnectionIo,
B: ConnectionIo,
{
fn poll_write(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
match self.project() {
EitherIoProj::A(val) => val.poll_write(cx, buf),
EitherIoProj::B(val) => val.poll_write(cx, buf),
match self.get_mut() {
Connection::Tcp(ConnectionType::H1(conn)) => {
Pin::new(conn).poll_write(cx, buf)
}
Connection::Tls(ConnectionType::H1(conn)) => {
Pin::new(conn).poll_write(cx, buf)
}
_ => unreachable!(H2_UNREACHABLE_WRITE),
}
}
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_flush(cx),
EitherIoProj::B(val) => val.poll_flush(cx),
match self.get_mut() {
Connection::Tcp(ConnectionType::H1(conn)) => Pin::new(conn).poll_flush(cx),
Connection::Tls(ConnectionType::H1(conn)) => Pin::new(conn).poll_flush(cx),
_ => unreachable!(H2_UNREACHABLE_WRITE),
}
}
@@ -259,9 +366,109 @@ where
self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
match self.project() {
EitherIoProj::A(val) => val.poll_shutdown(cx),
EitherIoProj::B(val) => val.poll_shutdown(cx),
match self.get_mut() {
Connection::Tcp(ConnectionType::H1(conn)) => {
Pin::new(conn).poll_shutdown(cx)
}
Connection::Tls(ConnectionType::H1(conn)) => {
Pin::new(conn).poll_shutdown(cx)
}
_ => unreachable!(H2_UNREACHABLE_WRITE),
}
}
fn poll_write_vectored(
self: Pin<&mut Self>,
cx: &mut Context<'_>,
bufs: &[io::IoSlice<'_>],
) -> Poll<io::Result<usize>> {
match self.get_mut() {
Connection::Tcp(ConnectionType::H1(conn)) => {
Pin::new(conn).poll_write_vectored(cx, bufs)
}
Connection::Tls(ConnectionType::H1(conn)) => {
Pin::new(conn).poll_write_vectored(cx, bufs)
}
_ => unreachable!(H2_UNREACHABLE_WRITE),
}
}
fn is_write_vectored(&self) -> bool {
match *self {
Connection::Tcp(ConnectionType::H1(ref conn)) => conn.is_write_vectored(),
Connection::Tls(ConnectionType::H1(ref conn)) => conn.is_write_vectored(),
_ => unreachable!(H2_UNREACHABLE_WRITE),
}
}
}
#[cfg(test)]
mod test {
use std::{
future::Future,
net,
pin::Pin,
task::{Context, Poll},
time::{Duration, Instant},
};
use actix_rt::{
net::TcpStream,
time::{interval, Interval},
};
use super::*;
#[actix_rt::test]
async fn test_h2_connection_drop() {
let addr = "127.0.0.1:0".parse::<net::SocketAddr>().unwrap();
let listener = net::TcpListener::bind(addr).unwrap();
let local = listener.local_addr().unwrap();
std::thread::spawn(move || while listener.accept().is_ok() {});
let tcp = TcpStream::connect(local).await.unwrap();
let (sender, connection) = h2::client::handshake(tcp).await.unwrap();
let conn = H2ConnectionInner::new(sender.clone(), connection);
assert!(sender.clone().ready().await.is_ok());
assert!(h2::client::SendRequest::clone(&conn.sender)
.ready()
.await
.is_ok());
drop(conn);
struct DropCheck {
sender: h2::client::SendRequest<Bytes>,
interval: Interval,
start_from: Instant,
}
impl Future for DropCheck {
type Output = ();
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.get_mut();
match futures_core::ready!(this.sender.poll_ready(cx)) {
Ok(()) => {
if this.start_from.elapsed() > Duration::from_secs(10) {
panic!("connection should be gone and can not be ready");
} else {
let _ = this.interval.poll_tick(cx);
Poll::Pending
}
}
Err(_) => Poll::Ready(()),
}
}
}
DropCheck {
sender,
interval: interval(Duration::from_millis(100)),
start_from: Instant::now(),
}
.await;
}
}

View File

@@ -1,45 +1,53 @@
use std::fmt;
use std::marker::PhantomData;
use std::time::Duration;
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::net::TcpStream;
use actix_service::{apply_fn, Service, ServiceExt};
use actix_tls::connect::{
default_connector, Connect as TcpConnect, Connection as TcpConnection,
use std::{
fmt,
future::Future,
net::IpAddr,
pin::Pin,
rc::Rc,
task::{Context, Poll},
time::Duration,
};
use actix_utils::timeout::{TimeoutError, TimeoutService};
use actix_rt::{
net::{ActixStream, TcpStream},
time::{sleep, Sleep},
};
use actix_service::Service;
use actix_tls::connect::{
new_connector, Connect as TcpConnect, ConnectError as TcpConnectError,
Connection as TcpConnection, Resolver,
};
use futures_core::{future::LocalBoxFuture, ready};
use http::Uri;
use pin_project::pin_project;
use super::config::ConnectorConfig;
use super::connection::Connection;
use super::connection::{Connection, ConnectionIo};
use super::error::ConnectError;
use super::pool::{ConnectionPool, Protocol};
use super::pool::ConnectionPool;
use super::Connect;
use super::Protocol;
#[cfg(feature = "openssl")]
use actix_tls::connect::ssl::openssl::SslConnector as OpensslConnector;
#[cfg(feature = "rustls")]
use actix_tls::connect::ssl::rustls::ClientConfig;
#[cfg(feature = "rustls")]
use std::sync::Arc;
#[cfg(any(feature = "openssl", feature = "rustls"))]
enum SslConnector {
#[allow(dead_code)]
None,
#[cfg(feature = "openssl")]
Openssl(OpensslConnector),
#[cfg(feature = "rustls")]
Rustls(Arc<ClientConfig>),
Rustls(std::sync::Arc<ClientConfig>),
}
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
type SslConnector = ();
/// Manages http client network connectivity
/// Manages HTTP client network connectivity.
///
/// The `Connector` type uses a builder-like combinator pattern for service
/// construction that finishes by calling the `.finish()` method.
///
/// ```rust,ignore
/// ```ignore
/// use std::time::Duration;
/// use actix_http::client::Connector;
///
@@ -47,18 +55,14 @@ type SslConnector = ();
/// .timeout(Duration::from_secs(5))
/// .finish();
/// ```
pub struct Connector<T, U> {
pub struct Connector<T> {
connector: T,
config: ConnectorConfig,
#[allow(dead_code)]
ssl: SslConnector,
_phantom: PhantomData<U>,
}
trait Io: AsyncRead + AsyncWrite + Unpin {}
impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
impl Connector<(), ()> {
impl Connector<()> {
#[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
pub fn new() -> Connector<
impl Service<
@@ -66,13 +70,11 @@ impl Connector<(), ()> {
Response = TcpConnection<Uri, TcpStream>,
Error = actix_tls::connect::ConnectError,
> + Clone,
TcpStream,
> {
Connector {
ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
connector: default_connector(),
connector: new_connector(resolver::resolver()),
config: ConnectorConfig::default(),
_phantom: PhantomData,
}
}
@@ -100,54 +102,69 @@ impl Connector<(), ()> {
fn build_ssl(protocols: Vec<Vec<u8>>) -> SslConnector {
let mut config = ClientConfig::new();
config.set_protocols(&protocols);
config
.root_store
.add_server_trust_anchors(&actix_tls::accept::rustls::TLS_SERVER_ROOTS);
SslConnector::Rustls(Arc::new(config))
config.root_store.add_server_trust_anchors(
&actix_tls::connect::ssl::rustls::TLS_SERVER_ROOTS,
);
SslConnector::Rustls(std::sync::Arc::new(config))
}
// ssl turned off, provides empty ssl connector
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {
SslConnector::None
}
}
impl<T, U> Connector<T, U> {
impl<S> Connector<S> {
/// Use custom connector.
pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
pub fn connector<S1, Io1>(self, connector: S1) -> Connector<S1>
where
U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
T1: Service<
Io1: ActixStream + fmt::Debug + 'static,
S1: Service<
TcpConnect<Uri>,
Response = TcpConnection<Uri, U1>,
Error = actix_tls::connect::ConnectError,
Response = TcpConnection<Uri, Io1>,
Error = TcpConnectError,
> + Clone,
{
Connector {
connector,
config: self.config,
ssl: self.ssl,
_phantom: PhantomData,
}
}
}
impl<T, U> Connector<T, U>
impl<S, Io> Connector<S>
where
U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
T: Service<
// Note:
// Input Io type is bound to ActixStream trait but internally in client module they
// are bound to ConnectionIo trait alias. And latter is the trait exposed to public
// in the form of Box<dyn ConnectionIo> type.
//
// This remap is to hide ActixStream's trait methods. They are not meant to be called
// from user code.
Io: ActixStream + fmt::Debug + 'static,
S: Service<
TcpConnect<Uri>,
Response = TcpConnection<Uri, U>,
Error = actix_tls::connect::ConnectError,
Response = TcpConnection<Uri, Io>,
Error = TcpConnectError,
> + Clone
+ 'static,
{
/// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
/// Set to 1 second by default.
/// Tcp connection timeout, i.e. max time to connect to remote host including dns name
/// resolution. Set to 5 second by default.
pub fn timeout(mut self, timeout: Duration) -> Self {
self.config.timeout = timeout;
self
}
/// Tls handshake timeout, i.e. max time to do tls handshake with remote host after tcp
/// connection established. Set to 5 second by default.
pub fn handshake_timeout(mut self, timeout: Duration) -> Self {
self.config.handshake_timeout = timeout;
self
}
#[cfg(feature = "openssl")]
/// Use custom `SslConnector` instance.
pub fn ssl(mut self, connector: OpensslConnector) -> Self {
@@ -156,13 +173,15 @@ where
}
#[cfg(feature = "rustls")]
pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
/// Use custom `SslConnector` instance.
pub fn rustls(mut self, connector: std::sync::Arc<ClientConfig>) -> Self {
self.ssl = SslConnector::Rustls(connector);
self
}
/// Maximum supported http major version
/// Supported versions http/1.1, http/2
/// Maximum supported HTTP major version.
///
/// Supported versions are HTTP/1.1 and HTTP/2.
pub fn max_http_version(mut self, val: http::Version) -> Self {
let versions = match val {
http::Version::HTTP_11 => vec![b"http/1.1".to_vec()],
@@ -236,299 +255,512 @@ where
self
}
/// Set local IP Address the connector would use for establishing connection.
pub fn local_address(mut self, addr: IpAddr) -> Self {
self.config.local_address = Some(addr);
self
}
/// Finish configuration process and create connector service.
/// The Connector builder always concludes by calling `finish()` last in
/// its combinator chain.
pub fn finish(
self,
) -> impl Service<Connect, Response = impl Connection, Error = ConnectError> + Clone
{
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
{
let connector = TimeoutService::new(
self.config.timeout,
apply_fn(self.connector, |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from)
.map(|stream| (stream.into_parts().0, Protocol::Http1)),
)
.map_err(|e| match e {
TimeoutError::Service(e) => e,
TimeoutError::Timeout => ConnectError::Timeout,
});
pub fn finish(self) -> ConnectorService<S, Io> {
let local_address = self.config.local_address;
let timeout = self.config.timeout;
connect_impl::InnerConnector {
tcp_pool: ConnectionPool::new(
connector,
self.config.no_disconnect_timeout(),
),
}
}
#[cfg(any(feature = "openssl", feature = "rustls"))]
{
const H2: &[u8] = b"h2";
use actix_service::{boxed::service, pipeline};
let tcp_service_inner =
TcpConnectorInnerService::new(self.connector, timeout, local_address);
#[allow(clippy::redundant_clone)]
let tcp_service = TcpConnectorService {
service: tcp_service_inner.clone(),
};
let tls_service = match self.ssl {
SslConnector::None => None,
#[cfg(feature = "openssl")]
use actix_tls::connect::ssl::openssl::OpensslConnector;
#[cfg(feature = "rustls")]
use actix_tls::connect::ssl::rustls::{RustlsConnector, Session};
SslConnector::Openssl(tls) => {
const H2: &[u8] = b"h2";
let ssl_service = TimeoutService::new(
self.config.timeout,
pipeline(
apply_fn(self.connector.clone(), |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from),
)
.and_then(match self.ssl {
#[cfg(feature = "openssl")]
SslConnector::Openssl(ssl) => service(
OpensslConnector::service(ssl)
.map(|stream| {
let sock = stream.into_parts().0;
let h2 = sock
.ssl()
.selected_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
.unwrap_or(false);
if h2 {
(Box::new(sock) as Box<dyn Io>, Protocol::Http2)
} else {
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
}
})
.map_err(ConnectError::from),
),
#[cfg(feature = "rustls")]
SslConnector::Rustls(ssl) => service(
RustlsConnector::service(ssl)
.map_err(ConnectError::from)
.map(|stream| {
let sock = stream.into_parts().0;
let h2 = sock
.get_ref()
.1
.get_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
.unwrap_or(false);
if h2 {
(Box::new(sock) as Box<dyn Io>, Protocol::Http2)
} else {
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
}
}),
),
}),
)
.map_err(|e| match e {
TimeoutError::Service(e) => e,
TimeoutError::Timeout => ConnectError::Timeout,
});
use actix_tls::connect::ssl::openssl::{OpensslConnector, SslStream};
let tcp_service = TimeoutService::new(
self.config.timeout,
apply_fn(self.connector, |msg: Connect, srv| {
srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
})
.map_err(ConnectError::from)
.map(|stream| (stream.into_parts().0, Protocol::Http1)),
)
.map_err(|e| match e {
TimeoutError::Service(e) => e,
TimeoutError::Timeout => ConnectError::Timeout,
});
connect_impl::InnerConnector {
tcp_pool: ConnectionPool::new(
tcp_service,
self.config.no_disconnect_timeout(),
),
ssl_pool: ConnectionPool::new(ssl_service, self.config),
}
}
}
}
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
mod connect_impl {
use std::task::{Context, Poll};
use futures_util::future::{err, Either, Ready};
use super::*;
use crate::client::connection::IoConnection;
pub(crate) struct InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
{
pub(crate) tcp_pool: ConnectionPool<T, Io>,
}
impl<T, Io> Clone for InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
{
fn clone(&self) -> Self {
InnerConnector {
tcp_pool: self.tcp_pool.clone(),
}
}
}
impl<T, Io> Service<Connect> for InnerConnector<T, Io>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
{
type Response = IoConnection<Io>;
type Error = ConnectError;
type Future = Either<
<ConnectionPool<T, Io> as Service<Connect>>::Future,
Ready<Result<IoConnection<Io>, ConnectError>>,
>;
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready(cx)
}
fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => {
Either::Right(err(ConnectError::SslIsNotSupported))
impl<Io: ConnectionIo> IntoConnectionIo for TcpConnection<Uri, SslStream<Io>> {
fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol) {
let sock = self.into_parts().0;
let h2 = sock
.ssl()
.selected_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
.unwrap_or(false);
if h2 {
(Box::new(sock), Protocol::Http2)
} else {
(Box::new(sock), Protocol::Http1)
}
}
}
_ => Either::Left(self.tcp_pool.call(req)),
let handshake_timeout = self.config.handshake_timeout;
let tls_service = TlsConnectorService {
tcp_service: tcp_service_inner,
tls_service: OpensslConnector::service(tls),
timeout: handshake_timeout,
};
Some(actix_service::boxed::rc_service(tls_service))
}
#[cfg(feature = "rustls")]
SslConnector::Rustls(tls) => {
const H2: &[u8] = b"h2";
use actix_tls::connect::ssl::rustls::{
RustlsConnector, Session, TlsStream,
};
impl<Io: ConnectionIo> IntoConnectionIo for TcpConnection<Uri, TlsStream<Io>> {
fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol) {
let sock = self.into_parts().0;
let h2 = sock
.get_ref()
.1
.get_alpn_protocol()
.map(|protos| protos.windows(2).any(|w| w == H2))
.unwrap_or(false);
if h2 {
(Box::new(sock), Protocol::Http2)
} else {
(Box::new(sock), Protocol::Http1)
}
}
}
let handshake_timeout = self.config.handshake_timeout;
let tls_service = TlsConnectorService {
tcp_service: tcp_service_inner,
tls_service: RustlsConnector::service(tls),
timeout: handshake_timeout,
};
Some(actix_service::boxed::rc_service(tls_service))
}
};
let tcp_config = self.config.no_disconnect_timeout();
let tcp_pool = ConnectionPool::new(tcp_service, tcp_config);
let tls_config = self.config;
let tls_pool = tls_service
.map(move |tls_service| ConnectionPool::new(tls_service, tls_config));
ConnectorServicePriv { tcp_pool, tls_pool }
}
}
/// tcp service for map `TcpConnection<Uri, Io>` type to `(Io, Protocol)`
#[derive(Clone)]
pub struct TcpConnectorService<S: Clone> {
service: S,
}
impl<S, Io> Service<Connect> for TcpConnectorService<S>
where
S: Service<Connect, Response = TcpConnection<Uri, Io>, Error = ConnectError>
+ Clone
+ 'static,
{
type Response = (Io, Protocol);
type Error = ConnectError;
type Future = TcpConnectorFuture<S::Future>;
actix_service::forward_ready!(service);
fn call(&self, req: Connect) -> Self::Future {
TcpConnectorFuture {
fut: self.service.call(req),
}
}
}
#[pin_project]
pub struct TcpConnectorFuture<Fut> {
#[pin]
fut: Fut,
}
impl<Fut, Io> Future for TcpConnectorFuture<Fut>
where
Fut: Future<Output = Result<TcpConnection<Uri, Io>, ConnectError>>,
{
type Output = Result<(Io, Protocol), ConnectError>;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
self.project()
.fut
.poll(cx)
.map_ok(|res| (res.into_parts().0, Protocol::Http1))
}
}
/// service for establish tcp connection and do client tls handshake.
/// operation is canceled when timeout limit reached.
struct TlsConnectorService<S, St> {
/// tcp connection is canceled on `TcpConnectorInnerService`'s timeout setting.
tcp_service: S,
/// tls connection is canceled on `TlsConnectorService`'s timeout setting.
tls_service: St,
timeout: Duration,
}
impl<S, St, Io> Service<Connect> for TlsConnectorService<S, St>
where
S: Service<Connect, Response = TcpConnection<Uri, Io>, Error = ConnectError>
+ Clone
+ 'static,
St: Service<TcpConnection<Uri, Io>, Error = std::io::Error> + Clone + 'static,
Io: ConnectionIo,
St::Response: IntoConnectionIo,
{
type Response = (Box<dyn ConnectionIo>, Protocol);
type Error = ConnectError;
type Future = TlsConnectorFuture<St, S::Future, St::Future>;
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
ready!(self.tcp_service.poll_ready(cx))?;
ready!(self.tls_service.poll_ready(cx))?;
Poll::Ready(Ok(()))
}
fn call(&self, req: Connect) -> Self::Future {
let fut = self.tcp_service.call(req);
let tls_service = self.tls_service.clone();
let timeout = self.timeout;
TlsConnectorFuture::TcpConnect {
fut,
tls_service: Some(tls_service),
timeout,
}
}
}
#[pin_project(project = TlsConnectorProj)]
#[allow(clippy::large_enum_variant)]
enum TlsConnectorFuture<S, Fut1, Fut2> {
TcpConnect {
#[pin]
fut: Fut1,
tls_service: Option<S>,
timeout: Duration,
},
TlsConnect {
#[pin]
fut: Fut2,
#[pin]
timeout: Sleep,
},
}
/// helper trait for generic over different TlsStream types between tls crates.
trait IntoConnectionIo {
fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol);
}
impl<S, Io, Fut1, Fut2, Res> Future for TlsConnectorFuture<S, Fut1, Fut2>
where
S: Service<
TcpConnection<Uri, Io>,
Response = Res,
Error = std::io::Error,
Future = Fut2,
>,
S::Response: IntoConnectionIo,
Fut1: Future<Output = Result<TcpConnection<Uri, Io>, ConnectError>>,
Fut2: Future<Output = Result<S::Response, S::Error>>,
Io: ConnectionIo,
{
type Output = Result<(Box<dyn ConnectionIo>, Protocol), ConnectError>;
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
match self.as_mut().project() {
TlsConnectorProj::TcpConnect {
fut,
tls_service,
timeout,
} => {
let res = ready!(fut.poll(cx))?;
let fut = tls_service
.take()
.expect("TlsConnectorFuture polled after complete")
.call(res);
let timeout = sleep(*timeout);
self.set(TlsConnectorFuture::TlsConnect { fut, timeout });
self.poll(cx)
}
TlsConnectorProj::TlsConnect { fut, timeout } => match fut.poll(cx)? {
Poll::Ready(res) => Poll::Ready(Ok(res.into_connection_io())),
Poll::Pending => timeout.poll(cx).map(|_| Err(ConnectError::Timeout)),
},
}
}
}
/// service for establish tcp connection.
/// operation is canceled when timeout limit reached.
#[derive(Clone)]
pub struct TcpConnectorInnerService<S: Clone> {
service: S,
timeout: Duration,
local_address: Option<std::net::IpAddr>,
}
impl<S: Clone> TcpConnectorInnerService<S> {
fn new(
service: S,
timeout: Duration,
local_address: Option<std::net::IpAddr>,
) -> Self {
Self {
service,
timeout,
local_address,
}
}
}
impl<S, Io> Service<Connect> for TcpConnectorInnerService<S>
where
S: Service<
TcpConnect<Uri>,
Response = TcpConnection<Uri, Io>,
Error = TcpConnectError,
> + Clone
+ 'static,
{
type Response = S::Response;
type Error = ConnectError;
type Future = TcpConnectorInnerFuture<S::Future>;
actix_service::forward_ready!(service);
fn call(&self, req: Connect) -> Self::Future {
let mut req = TcpConnect::new(req.uri).set_addr(req.addr);
if let Some(local_addr) = self.local_address {
req = req.set_local_addr(local_addr);
}
TcpConnectorInnerFuture {
fut: self.service.call(req),
timeout: sleep(self.timeout),
}
}
}
#[pin_project]
pub struct TcpConnectorInnerFuture<Fut> {
#[pin]
fut: Fut,
#[pin]
timeout: Sleep,
}
impl<Fut, Io> Future for TcpConnectorInnerFuture<Fut>
where
Fut: Future<Output = Result<TcpConnection<Uri, Io>, TcpConnectError>>,
{
type Output = Result<TcpConnection<Uri, Io>, ConnectError>;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.project();
match this.fut.poll(cx) {
Poll::Ready(res) => Poll::Ready(res.map_err(ConnectError::from)),
Poll::Pending => this.timeout.poll(cx).map(|_| Err(ConnectError::Timeout)),
}
}
}
/// Connector service for pooled Plain/Tls Tcp connections.
pub type ConnectorService<S, Io> = ConnectorServicePriv<
TcpConnectorService<TcpConnectorInnerService<S>>,
Rc<
dyn Service<
Connect,
Response = (Box<dyn ConnectionIo>, Protocol),
Error = ConnectError,
Future = LocalBoxFuture<
'static,
Result<(Box<dyn ConnectionIo>, Protocol), ConnectError>,
>,
>,
>,
Io,
Box<dyn ConnectionIo>,
>;
pub struct ConnectorServicePriv<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>,
Io1: ConnectionIo,
Io2: ConnectionIo,
{
tcp_pool: ConnectionPool<S1, Io1>,
tls_pool: Option<ConnectionPool<S2, Io2>>,
}
impl<S1, S2, Io1, Io2> Service<Connect> for ConnectorServicePriv<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
Io1: ConnectionIo,
Io2: ConnectionIo,
{
type Response = Connection<Io1, Io2>;
type Error = ConnectError;
type Future = ConnectorServiceFuture<S1, S2, Io1, Io2>;
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
ready!(self.tcp_pool.poll_ready(cx))?;
if let Some(ref tls_pool) = self.tls_pool {
ready!(tls_pool.poll_ready(cx))?;
}
Poll::Ready(Ok(()))
}
fn call(&self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => match self.tls_pool {
None => ConnectorServiceFuture::SslIsNotSupported,
Some(ref pool) => ConnectorServiceFuture::Tls(pool.call(req)),
},
_ => ConnectorServiceFuture::Tcp(self.tcp_pool.call(req)),
}
}
}
#[pin_project(project = ConnectorServiceProj)]
pub enum ConnectorServiceFuture<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
Io1: ConnectionIo,
Io2: ConnectionIo,
{
Tcp(#[pin] <ConnectionPool<S1, Io1> as Service<Connect>>::Future),
Tls(#[pin] <ConnectionPool<S2, Io2> as Service<Connect>>::Future),
SslIsNotSupported,
}
impl<S1, S2, Io1, Io2> Future for ConnectorServiceFuture<S1, S2, Io1, Io2>
where
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
+ Clone
+ 'static,
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
+ Clone
+ 'static,
Io1: ConnectionIo,
Io2: ConnectionIo,
{
type Output = Result<Connection<Io1, Io2>, ConnectError>;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
match self.project() {
ConnectorServiceProj::Tcp(fut) => fut.poll(cx).map_ok(Connection::Tcp),
ConnectorServiceProj::Tls(fut) => fut.poll(cx).map_ok(Connection::Tls),
ConnectorServiceProj::SslIsNotSupported => {
Poll::Ready(Err(ConnectError::SslIsNotSupported))
}
}
}
}
#[cfg(any(feature = "openssl", feature = "rustls"))]
mod connect_impl {
use std::future::Future;
use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
#[cfg(not(feature = "trust-dns"))]
mod resolver {
use super::*;
use futures_core::ready;
use futures_util::future::Either;
pub(super) fn resolver() -> Resolver {
Resolver::Default
}
}
#[cfg(feature = "trust-dns")]
mod resolver {
use std::{cell::RefCell, net::SocketAddr};
use actix_tls::connect::Resolve;
use futures_core::future::LocalBoxFuture;
use trust_dns_resolver::{
config::{ResolverConfig, ResolverOpts},
system_conf::read_system_conf,
TokioAsyncResolver,
};
use super::*;
use crate::client::connection::EitherConnection;
pub(crate) struct InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>,
T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>,
{
pub(crate) tcp_pool: ConnectionPool<T1, Io1>,
pub(crate) ssl_pool: ConnectionPool<T2, Io2>,
}
pub(super) fn resolver() -> Resolver {
// new type for impl Resolve trait for TokioAsyncResolver.
struct TrustDnsResolver(TokioAsyncResolver);
impl<T1, T2, Io1, Io2> Clone for InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
{
fn clone(&self) -> Self {
InnerConnector {
tcp_pool: self.tcp_pool.clone(),
ssl_pool: self.ssl_pool.clone(),
impl Resolve for TrustDnsResolver {
fn lookup<'a>(
&'a self,
host: &'a str,
port: u16,
) -> LocalBoxFuture<'a, Result<Vec<SocketAddr>, Box<dyn std::error::Error>>>
{
Box::pin(async move {
let res = self
.0
.lookup_ip(host)
.await?
.iter()
.map(|ip| SocketAddr::new(ip, port))
.collect();
Ok(res)
})
}
}
}
impl<T1, T2, Io1, Io2> Service<Connect> for InnerConnector<T1, T2, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
T2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
{
type Response = EitherConnection<Io1, Io2>;
type Error = ConnectError;
type Future = Either<
InnerConnectorResponseA<T1, Io1, Io2>,
InnerConnectorResponseB<T2, Io1, Io2>,
>;
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.tcp_pool.poll_ready(cx)
// dns struct is cached in thread local.
// so new client constructor can reuse the existing dns resolver.
thread_local! {
static TRUST_DNS_RESOLVER: RefCell<Option<Resolver>> = RefCell::new(None);
}
fn call(&mut self, req: Connect) -> Self::Future {
match req.uri.scheme_str() {
Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
fut: self.ssl_pool.call(req),
_phantom: PhantomData,
}),
_ => Either::Left(InnerConnectorResponseA {
fut: self.tcp_pool.call(req),
_phantom: PhantomData,
}),
// get from thread local or construct a new trust-dns resolver.
TRUST_DNS_RESOLVER.with(|local| {
let resolver = local.borrow().as_ref().map(Clone::clone);
match resolver {
Some(resolver) => resolver,
None => {
let (cfg, opts) = match read_system_conf() {
Ok((cfg, opts)) => (cfg, opts),
Err(e) => {
log::error!("TRust-DNS can not load system config: {}", e);
(ResolverConfig::default(), ResolverOpts::default())
}
};
let resolver = TokioAsyncResolver::tokio(cfg, opts).unwrap();
// box trust dns resolver and put it in thread local.
let resolver = Resolver::new_custom(TrustDnsResolver(resolver));
*local.borrow_mut() = Some(resolver.clone());
resolver
}
}
}
}
#[pin_project::pin_project]
pub(crate) struct InnerConnectorResponseA<T, Io1, Io2>
where
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
{
#[pin]
fut: <ConnectionPool<T, Io1> as Service<Connect>>::Future,
_phantom: PhantomData<Io2>,
}
impl<T, Io1, Io2> Future for InnerConnectorResponseA<T, Io1, Io2>
where
T: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
Poll::Ready(
ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
.map(EitherConnection::A),
)
}
}
#[pin_project::pin_project]
pub(crate) struct InnerConnectorResponseB<T, Io1, Io2>
where
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
T: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
{
#[pin]
fut: <ConnectionPool<T, Io2> as Service<Connect>>::Future,
_phantom: PhantomData<Io1>,
}
impl<T, Io1, Io2> Future for InnerConnectorResponseB<T, Io1, Io2>
where
T: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
{
type Output = Result<EitherConnection<Io1, Io2>, ConnectError>;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
Poll::Ready(
ready!(Pin::new(&mut self.get_mut().fut).poll(cx))
.map(EitherConnection::B),
)
}
})
}
}

View File

@@ -1,6 +1,5 @@
use std::io;
use actix_tls::connect::resolver::ResolveError;
use derive_more::{Display, From};
#[cfg(feature = "openssl")]
@@ -23,10 +22,10 @@ pub enum ConnectError {
/// Failed to resolve the hostname
#[display(fmt = "Failed resolving hostname: {}", _0)]
Resolver(ResolveError),
Resolver(Box<dyn std::error::Error>),
/// No dns records
#[display(fmt = "No dns records found for the input")]
#[display(fmt = "No DNS records found for the input")]
NoRecords,
/// Http2 error
@@ -66,13 +65,16 @@ impl From<actix_tls::connect::ConnectError> for ConnectError {
#[derive(Debug, Display, From)]
pub enum InvalidUrl {
#[display(fmt = "Missing url scheme")]
#[display(fmt = "Missing URL scheme")]
MissingScheme,
#[display(fmt = "Unknown url scheme")]
#[display(fmt = "Unknown URL scheme")]
UnknownScheme,
#[display(fmt = "Missing host name")]
MissingHost,
#[display(fmt = "Url parse error: {}", _0)]
#[display(fmt = "URL parse error: {}", _0)]
HttpError(http::Error),
}
@@ -84,25 +86,33 @@ pub enum SendRequestError {
/// Invalid URL
#[display(fmt = "Invalid URL: {}", _0)]
Url(InvalidUrl),
/// Failed to connect to host
#[display(fmt = "Failed to connect to host: {}", _0)]
Connect(ConnectError),
/// Error sending request
Send(io::Error),
/// Error parsing response
Response(ParseError),
/// Http error
#[display(fmt = "{}", _0)]
Http(HttpError),
/// Http2 error
#[display(fmt = "{}", _0)]
H2(h2::Error),
/// Response took too long
#[display(fmt = "Timeout while waiting for response")]
Timeout,
/// Tunnels are not supported for http2 connection
/// Tunnels are not supported for HTTP/2 connection
#[display(fmt = "Tunnels are not supported for http2 connection")]
TunnelNotSupported,
/// Error sending request body
Body(Error),
}
@@ -128,7 +138,8 @@ pub enum FreezeRequestError {
/// Invalid URL
#[display(fmt = "Invalid URL: {}", _0)]
Url(InvalidUrl),
/// Http error
/// HTTP error
#[display(fmt = "{}", _0)]
Http(HttpError),
}

View File

@@ -1,36 +1,36 @@
use std::io::Write;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{io, time};
use std::{
io::Write,
pin::Pin,
task::{Context, Poll},
};
use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
use actix_codec::Framed;
use actix_utils::future::poll_fn;
use bytes::buf::BufMut;
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use futures_util::future::poll_fn;
use futures_util::{pin_mut, SinkExt, StreamExt};
use futures_core::{ready, Stream};
use futures_util::SinkExt as _;
use crate::error::PayloadError;
use crate::h1;
use crate::header::HeaderMap;
use crate::http::header::{IntoHeaderValue, HOST};
use crate::http::{
header::{HeaderMap, IntoHeaderValue, EXPECT, HOST},
StatusCode,
};
use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::{Payload, PayloadStream};
use crate::payload::Payload;
use super::connection::{ConnectionLifetime, ConnectionType, IoConnection};
use super::connection::{ConnectionIo, H1Connection};
use super::error::{ConnectError, SendRequestError};
use super::pool::Acquired;
use crate::body::{BodySize, MessageBody};
pub(crate) async fn send_request<T, B>(
io: T,
pub(crate) async fn send_request<Io, B>(
io: H1Connection<Io>,
mut head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> Result<(ResponseHead, Payload), SendRequestError>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
Io: ConnectionIo,
B: MessageBody,
{
// set request host header
@@ -40,19 +40,19 @@ where
if let Some(host) = head.as_ref().uri.host() {
let mut wrt = BytesMut::with_capacity(host.len() + 5).writer();
let _ = match head.as_ref().uri.port_u16() {
None | Some(80) | Some(443) => write!(wrt, "{}", host),
Some(port) => write!(wrt, "{}:{}", host, port),
match head.as_ref().uri.port_u16() {
None | Some(80) | Some(443) => write!(wrt, "{}", host)?,
Some(port) => write!(wrt, "{}:{}", host, port)?,
};
match wrt.get_mut().split().freeze().try_into() {
match wrt.get_mut().split().freeze().try_into_value() {
Ok(value) => match head {
RequestHeadType::Owned(ref mut head) => {
head.headers.insert(HOST, value)
head.headers.insert(HOST, value);
}
RequestHeadType::Rc(_, ref mut extra_headers) => {
let headers = extra_headers.get_or_insert(HeaderMap::new());
headers.insert(HOST, value)
headers.insert(HOST, value);
}
},
Err(e) => log::error!("Can not set HOST header {}", e),
@@ -60,74 +60,102 @@ where
}
}
let io = H1Connection {
created,
pool,
io: Some(io),
};
// create Framed and prepare sending request
let mut framed = Framed::new(io, h1::ClientCodec::default());
// create Framed and send request
let mut framed_inner = Framed::new(io, h1::ClientCodec::default());
framed_inner.send((head, body.size()).into()).await?;
// Check EXPECT header and enable expect handle flag accordingly.
//
// RFC: https://tools.ietf.org/html/rfc7231#section-5.1.1
let is_expect = if head.as_ref().headers.contains_key(EXPECT) {
match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
let keep_alive = framed.codec_ref().keepalive();
framed.io_mut().on_release(keep_alive);
// send request body
match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {}
_ => send_body(body, Pin::new(&mut framed_inner)).await?,
};
// read response and init read body
let res = Pin::new(&mut framed_inner).into_future().await;
let (head, framed) = if let (Some(result), framed) = res {
let item = result.map_err(SendRequestError::from)?;
(item, framed)
// TODO: use a new variant or a new type better describing error violate
// `Requirements for clients` session of above RFC
return Err(SendRequestError::Connect(ConnectError::Disconnected));
}
_ => true,
}
} else {
return Err(SendRequestError::from(ConnectError::Disconnected));
false
};
match framed.codec_ref().message_type() {
framed.send((head, body.size()).into()).await?;
let mut pin_framed = Pin::new(&mut framed);
// special handle for EXPECT request.
let (do_send, mut res_head) = if is_expect {
let head = poll_fn(|cx| pin_framed.as_mut().poll_next(cx))
.await
.ok_or(ConnectError::Disconnected)??;
// return response head in case status code is not continue
// and current head would be used as final response head.
(head.status == StatusCode::CONTINUE, Some(head))
} else {
(true, None)
};
if do_send {
// send request body
match body.size() {
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {}
_ => send_body(body, pin_framed.as_mut()).await?,
};
// read response and init read body
let head = poll_fn(|cx| pin_framed.as_mut().poll_next(cx))
.await
.ok_or(ConnectError::Disconnected)??;
res_head = Some(head);
}
let head = res_head.unwrap();
match pin_framed.codec_ref().message_type() {
h1::MessageType::None => {
let force_close = !framed.codec_ref().keepalive();
release_connection(framed, force_close);
let keep_alive = pin_framed.codec_ref().keepalive();
pin_framed.io_mut().on_release(keep_alive);
Ok((head, Payload::None))
}
_ => {
let pl: PayloadStream = PlStream::new(framed_inner).boxed_local();
Ok((head, pl.into()))
}
_ => Ok((head, Payload::Stream(Box::pin(PlStream::new(framed))))),
}
}
pub(crate) async fn open_tunnel<T>(
io: T,
pub(crate) async fn open_tunnel<Io>(
io: Io,
head: RequestHeadType,
) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
) -> Result<(ResponseHead, Framed<Io, h1::ClientCodec>), SendRequestError>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
Io: ConnectionIo,
{
// create Framed and send request
// create Framed and send request.
let mut framed = Framed::new(io, h1::ClientCodec::default());
framed.send((head, BodySize::None).into()).await?;
// read response
if let (Some(result), framed) = framed.into_future().await {
let head = result.map_err(SendRequestError::from)?;
Ok((head, framed))
} else {
Err(SendRequestError::from(ConnectError::Disconnected))
}
// read response head.
let head = poll_fn(|cx| Pin::new(&mut framed).poll_next(cx))
.await
.ok_or(ConnectError::Disconnected)??;
Ok((head, framed))
}
/// send request body to the peer
pub(crate) async fn send_body<T, B>(
pub(crate) async fn send_body<Io, B>(
body: B,
mut framed: Pin<&mut Framed<T, h1::ClientCodec>>,
mut framed: Pin<&mut Framed<Io, h1::ClientCodec>>,
) -> Result<(), SendRequestError>
where
T: ConnectionLifetime + Unpin,
Io: ConnectionIo,
B: MessageBody,
{
pin_mut!(body);
actix_rt::pin!(body);
let mut eof = false;
while !eof {
@@ -159,101 +187,25 @@ where
}
}
SinkExt::flush(Pin::into_inner(framed)).await?;
framed.get_mut().flush().await?;
Ok(())
}
#[doc(hidden)]
/// HTTP client connection
pub struct H1Connection<T> {
/// T should be `Unpin`
io: Option<T>,
created: time::Instant,
pool: Option<Acquired<T>>,
}
impl<T> ConnectionLifetime for H1Connection<T>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
{
/// Close connection
fn close(mut self: Pin<&mut Self>) {
if let Some(mut pool) = self.pool.take() {
if let Some(io) = self.io.take() {
pool.close(IoConnection::new(
ConnectionType::H1(io),
self.created,
None,
));
}
}
}
/// Release this connection to the connection pool
fn release(mut self: Pin<&mut Self>) {
if let Some(mut pool) = self.pool.take() {
if let Some(io) = self.io.take() {
pool.release(IoConnection::new(
ConnectionType::H1(io),
self.created,
None,
));
}
}
}
}
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
fn poll_read(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &mut ReadBuf<'_>,
) -> Poll<io::Result<()>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
}
}
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
fn poll_write(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
buf: &[u8],
) -> Poll<io::Result<usize>> {
Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
}
fn poll_flush(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<io::Result<()>> {
Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
}
fn poll_shutdown(
mut self: Pin<&mut Self>,
cx: &mut Context<'_>,
) -> Poll<Result<(), io::Error>> {
Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
}
}
#[pin_project::pin_project]
pub(crate) struct PlStream<Io> {
pub(crate) struct PlStream<Io: ConnectionIo> {
#[pin]
framed: Option<Framed<Io, h1::ClientPayloadCodec>>,
framed: Framed<H1Connection<Io>, h1::ClientPayloadCodec>,
}
impl<Io: ConnectionLifetime> PlStream<Io> {
fn new(framed: Framed<Io, h1::ClientCodec>) -> Self {
impl<Io: ConnectionIo> PlStream<Io> {
fn new(framed: Framed<H1Connection<Io>, h1::ClientCodec>) -> Self {
let framed = framed.into_map_codec(|codec| codec.into_payload_codec());
PlStream {
framed: Some(framed),
}
PlStream { framed }
}
}
impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
impl<Io: ConnectionIo> Stream for PlStream<Io> {
type Item = Result<Bytes, PayloadError>;
fn poll_next(
@@ -262,30 +214,14 @@ impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
) -> Poll<Option<Self::Item>> {
let mut this = self.project();
match this.framed.as_mut().as_pin_mut().unwrap().next_item(cx)? {
Poll::Pending => Poll::Pending,
Poll::Ready(Some(chunk)) => {
if let Some(chunk) = chunk {
Poll::Ready(Some(Ok(chunk)))
} else {
let framed = this.framed.as_mut().as_pin_mut().unwrap();
let force_close = !framed.codec_ref().keepalive();
release_connection(framed, force_close);
Poll::Ready(None)
}
match ready!(this.framed.as_mut().next_item(cx)?) {
Some(Some(chunk)) => Poll::Ready(Some(Ok(chunk))),
Some(None) => {
let keep_alive = this.framed.codec_ref().keepalive();
this.framed.io_mut().on_release(keep_alive);
Poll::Ready(None)
}
Poll::Ready(None) => Poll::Ready(None),
None => Poll::Ready(None),
}
}
}
fn release_connection<T, U>(framed: Pin<&mut Framed<T, U>>, force_close: bool)
where
T: ConnectionLifetime,
{
if !force_close && framed.is_read_buf_empty() && framed.is_write_buf_empty() {
framed.io_pin().release()
} else {
framed.io_pin().close()
}
}

View File

@@ -1,11 +1,7 @@
use std::convert::TryFrom;
use std::future::Future;
use std::time;
use actix_codec::{AsyncRead, AsyncWrite};
use actix_utils::future::poll_fn;
use bytes::Bytes;
use futures_util::future::poll_fn;
use futures_util::pin_mut;
use h2::{
client::{Builder, Connection, SendRequest},
SendStream,
@@ -19,22 +15,20 @@ use crate::message::{RequestHeadType, ResponseHead};
use crate::payload::Payload;
use super::config::ConnectorConfig;
use super::connection::{ConnectionType, IoConnection};
use super::connection::{ConnectionIo, H2Connection};
use super::error::SendRequestError;
use super::pool::Acquired;
pub(crate) async fn send_request<T, B>(
mut io: SendRequest<Bytes>,
pub(crate) async fn send_request<Io, B>(
mut io: H2Connection<Io>,
head: RequestHeadType,
body: B,
created: time::Instant,
pool: Option<Acquired<T>>,
) -> Result<(ResponseHead, Payload), SendRequestError>
where
T: AsyncRead + AsyncWrite + Unpin + 'static,
Io: ConnectionIo,
B: MessageBody,
{
trace!("Sending client request: {:?} {:?}", head, body.size());
let head_req = head.as_ref().method == Method::HEAD;
let length = body.size();
let eof = matches!(
@@ -60,10 +54,14 @@ where
BodySize::Empty => req
.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
BodySize::Sized(len) => req.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::try_from(format!("{}", len)).unwrap(),
),
BodySize::Sized(len) => {
let mut buf = itoa::Buffer::new();
req.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::from_str(buf.format(len)).unwrap(),
)
}
};
// Extracting extra headers from RequestHeadType. HeaderMap::new() does not allocate.
@@ -86,7 +84,10 @@ where
// copy headers
for (key, value) in headers {
match *key {
CONNECTION | TRANSFER_ENCODING => continue, // http2 specific
// TODO: consider skipping other headers according to:
// https://tools.ietf.org/html/rfc7540#section-8.1.2.2
// omit HTTP/1.x only headers
CONNECTION | TRANSFER_ENCODING => continue,
CONTENT_LENGTH if skip_len => continue,
// DATE => has_date = true,
_ => {}
@@ -96,13 +97,13 @@ where
let res = poll_fn(|cx| io.poll_ready(cx)).await;
if let Err(e) = res {
release(io, pool, created, e.is_io());
io.on_release(e.is_io());
return Err(SendRequestError::from(e));
}
let resp = match io.send_request(req, eof) {
Ok((fut, send)) => {
release(io, pool, created, false);
io.on_release(false);
if !eof {
send_body(body, send).await?;
@@ -110,7 +111,7 @@ where
fut.await.map_err(SendRequestError::from)?
}
Err(e) => {
release(io, pool, created, e.is_io());
io.on_release(e.is_io());
return Err(e.into());
}
};
@@ -129,7 +130,7 @@ async fn send_body<B: MessageBody>(
mut send: SendStream<Bytes>,
) -> Result<(), SendRequestError> {
let mut buf = None;
pin_mut!(body);
actix_rt::pin!(body);
loop {
if buf.is_none() {
match poll_fn(|cx| body.as_mut().poll_next(cx)).await {
@@ -171,28 +172,10 @@ async fn send_body<B: MessageBody>(
}
}
// release SendRequest object
fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
io: SendRequest<Bytes>,
pool: Option<Acquired<T>>,
created: time::Instant,
close: bool,
) {
if let Some(mut pool) = pool {
if close {
pool.close(IoConnection::new(ConnectionType::H2(io), created, None));
} else {
pool.release(IoConnection::new(ConnectionType::H2(io), created, None));
}
}
}
pub(crate) fn handshake<Io>(
pub(crate) fn handshake<Io: ConnectionIo>(
io: Io,
config: &ConnectorConfig,
) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
where
Io: AsyncRead + AsyncWrite + Unpin + 'static,
{
let mut builder = Builder::new();
builder

View File

@@ -1,4 +1,5 @@
//! Http client api
//! HTTP client.
use http::Uri;
mod config;
@@ -9,10 +10,14 @@ mod h1proto;
mod h2proto;
mod pool;
pub use self::connection::Connection;
pub use self::connector::Connector;
pub use actix_tls::connect::{
Connect as TcpConnect, ConnectError as TcpConnectError, Connection as TcpConnection,
};
pub use self::connection::{Connection, ConnectionIo};
pub use self::connector::{Connector, ConnectorService};
pub use self::error::{ConnectError, FreezeRequestError, InvalidUrl, SendRequestError};
pub use self::pool::Protocol;
pub use crate::Protocol;
#[derive(Clone)]
pub struct Connect {

File diff suppressed because it is too large Load Diff

View File

@@ -4,12 +4,14 @@ use std::rc::Rc;
use std::time::Duration;
use std::{fmt, net};
use actix_rt::time::{sleep, sleep_until, Instant, Sleep};
use actix_rt::{
task::JoinHandle,
time::{interval, sleep_until, Instant, Sleep},
};
use bytes::BytesMut;
use futures_util::{future, FutureExt};
use time::OffsetDateTime;
// "Sun, 06 Nov 1994 08:49:37 GMT".len()
/// "Sun, 06 Nov 1994 08:49:37 GMT".len()
const DATE_VALUE_LENGTH: usize = 29;
#[derive(Debug, PartialEq, Clone, Copy)]
@@ -49,7 +51,7 @@ struct Inner {
ka_enabled: bool,
secure: bool,
local_addr: Option<std::net::SocketAddr>,
timer: DateService,
date_service: DateService,
}
impl Clone for ServiceConfig {
@@ -91,42 +93,40 @@ impl ServiceConfig {
client_disconnect,
secure,
local_addr,
timer: DateService::new(),
date_service: DateService::new(),
}))
}
/// Returns true if connection is secure (HTTPS)
#[inline]
/// Returns true if connection is secure(https)
pub fn secure(&self) -> bool {
self.0.secure
}
#[inline]
/// Returns the local address that this server is bound to.
#[inline]
pub fn local_addr(&self) -> Option<net::SocketAddr> {
self.0.local_addr
}
#[inline]
/// Keep alive duration if configured.
#[inline]
pub fn keep_alive(&self) -> Option<Duration> {
self.0.keep_alive
}
#[inline]
/// Return state of connection keep-alive functionality
#[inline]
pub fn keep_alive_enabled(&self) -> bool {
self.0.ka_enabled
}
#[inline]
/// Client timeout for first request.
#[inline]
pub fn client_timer(&self) -> Option<Sleep> {
let delay_time = self.0.client_timeout;
if delay_time != 0 {
Some(sleep_until(
self.0.timer.now() + Duration::from_millis(delay_time),
))
Some(sleep_until(self.now() + Duration::from_millis(delay_time)))
} else {
None
}
@@ -136,7 +136,7 @@ impl ServiceConfig {
pub fn client_timer_expire(&self) -> Option<Instant> {
let delay = self.0.client_timeout;
if delay != 0 {
Some(self.0.timer.now() + Duration::from_millis(delay))
Some(self.now() + Duration::from_millis(delay))
} else {
None
}
@@ -146,7 +146,7 @@ impl ServiceConfig {
pub fn client_disconnect_timer(&self) -> Option<Instant> {
let delay = self.0.client_disconnect;
if delay != 0 {
Some(self.0.timer.now() + Duration::from_millis(delay))
Some(self.now() + Duration::from_millis(delay))
} else {
None
}
@@ -155,25 +155,17 @@ impl ServiceConfig {
#[inline]
/// Return keep-alive timer delay is configured.
pub fn keep_alive_timer(&self) -> Option<Sleep> {
if let Some(ka) = self.0.keep_alive {
Some(sleep_until(self.0.timer.now() + ka))
} else {
None
}
self.keep_alive().map(|ka| sleep_until(self.now() + ka))
}
/// Keep-alive expire time
pub fn keep_alive_expire(&self) -> Option<Instant> {
if let Some(ka) = self.0.keep_alive {
Some(self.0.timer.now() + ka)
} else {
None
}
self.keep_alive().map(|ka| self.now() + ka)
}
#[inline]
pub(crate) fn now(&self) -> Instant {
self.0.timer.now()
self.0.date_service.now()
}
#[doc(hidden)]
@@ -181,7 +173,7 @@ impl ServiceConfig {
let mut buf: [u8; 39] = [0; 39];
buf[..6].copy_from_slice(b"date: ");
self.0
.timer
.date_service
.set_date(|date| buf[6..35].copy_from_slice(&date.bytes));
buf[35..].copy_from_slice(b"\r\n\r\n");
dst.extend_from_slice(&buf);
@@ -189,7 +181,7 @@ impl ServiceConfig {
pub(crate) fn set_date_header(&self, dst: &mut BytesMut) {
self.0
.timer
.date_service
.set_date(|date| dst.extend_from_slice(&date.bytes));
}
}
@@ -230,57 +222,103 @@ impl fmt::Write for Date {
}
}
#[derive(Clone)]
struct DateService(Rc<DateServiceInner>);
struct DateServiceInner {
current: Cell<Option<(Date, Instant)>>,
/// Service for update Date and Instant periodically at 500 millis interval.
struct DateService {
current: Rc<Cell<(Date, Instant)>>,
handle: JoinHandle<()>,
}
impl DateServiceInner {
fn new() -> Self {
DateServiceInner {
current: Cell::new(None),
}
}
fn reset(&self) {
self.current.take();
}
fn update(&self) {
let now = Instant::now();
let date = Date::new();
self.current.set(Some((date, now)));
impl Drop for DateService {
fn drop(&mut self) {
// stop the timer update async task on drop.
self.handle.abort();
}
}
impl DateService {
fn new() -> Self {
DateService(Rc::new(DateServiceInner::new()))
}
// shared date and timer for DateService and update async task.
let current = Rc::new(Cell::new((Date::new(), Instant::now())));
let current_clone = Rc::clone(&current);
// spawn an async task sleep for 500 milli and update current date/timer in a loop.
// handle is used to stop the task on DateService drop.
let handle = actix_rt::spawn(async move {
#[cfg(test)]
let _notify = notify_on_drop::NotifyOnDrop::new();
fn check_date(&self) {
if self.0.current.get().is_none() {
self.0.update();
let mut interval = interval(Duration::from_millis(500));
loop {
let now = interval.tick().await;
let date = Date::new();
current_clone.set((date, now));
}
});
// periodic date update
let s = self.clone();
actix_rt::spawn(sleep(Duration::from_millis(500)).then(move |_| {
s.0.reset();
future::ready(())
}));
}
DateService { current, handle }
}
fn now(&self) -> Instant {
self.check_date();
self.0.current.get().unwrap().1
self.current.get().1
}
fn set_date<F: FnMut(&Date)>(&self, mut f: F) {
self.check_date();
f(&self.0.current.get().unwrap().0);
f(&self.current.get().0);
}
}
// TODO: move to a util module for testing all spawn handle drop style tasks.
#[cfg(test)]
/// Test Module for checking the drop state of certain async tasks that are spawned
/// with `actix_rt::spawn`
///
/// The target task must explicitly generate `NotifyOnDrop` when spawn the task
mod notify_on_drop {
use std::cell::RefCell;
thread_local! {
static NOTIFY_DROPPED: RefCell<Option<bool>> = RefCell::new(None);
}
/// Check if the spawned task is dropped.
///
/// # Panic:
///
/// When there was no `NotifyOnDrop` instance on current thread
pub(crate) fn is_dropped() -> bool {
NOTIFY_DROPPED.with(|bool| {
bool.borrow()
.expect("No NotifyOnDrop existed on current thread")
})
}
pub(crate) struct NotifyOnDrop;
impl NotifyOnDrop {
/// # Panic:
///
/// When construct multiple instances on any given thread.
pub(crate) fn new() -> Self {
NOTIFY_DROPPED.with(|bool| {
let mut bool = bool.borrow_mut();
if bool.is_some() {
panic!("NotifyOnDrop existed on current thread");
} else {
*bool = Some(false);
}
});
NotifyOnDrop
}
}
impl Drop for NotifyOnDrop {
fn drop(&mut self) {
NOTIFY_DROPPED.with(|bool| {
if let Some(b) = bool.borrow_mut().as_mut() {
*b = true;
}
});
}
}
}
@@ -288,14 +326,53 @@ impl DateService {
mod tests {
use super::*;
// Test modifying the date from within the closure
// passed to `set_date`
#[test]
fn test_evil_date() {
let service = DateService::new();
// Make sure that `check_date` doesn't try to spawn a task
service.0.update();
service.set_date(|_| service.0.reset());
use actix_rt::task::yield_now;
#[actix_rt::test]
async fn test_date_service_update() {
let settings = ServiceConfig::new(KeepAlive::Os, 0, 0, false, None);
yield_now().await;
let mut buf1 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf1);
let now1 = settings.now();
sleep_until(Instant::now() + Duration::from_secs(2)).await;
yield_now().await;
let now2 = settings.now();
let mut buf2 = BytesMut::with_capacity(DATE_VALUE_LENGTH + 10);
settings.set_date(&mut buf2);
assert_ne!(now1, now2);
assert_ne!(buf1, buf2);
drop(settings);
assert!(notify_on_drop::is_dropped());
}
#[actix_rt::test]
async fn test_date_service_drop() {
let service = Rc::new(DateService::new());
// yield so date service have a chance to register the spawned timer update task.
yield_now().await;
let clone1 = service.clone();
let clone2 = service.clone();
let clone3 = service.clone();
drop(clone1);
assert_eq!(false, notify_on_drop::is_dropped());
drop(clone2);
assert_eq!(false, notify_on_drop::is_dropped());
drop(clone3);
assert_eq!(false, notify_on_drop::is_dropped());
drop(service);
assert!(notify_on_drop::is_dropped());
}
#[test]

View File

@@ -1,25 +1,31 @@
use std::future::Future;
use std::io::{self, Write};
use std::pin::Pin;
use std::task::{Context, Poll};
//! Stream decoders.
use actix_threadpool::{run, CpuFuture};
use std::{
future::Future,
io::{self, Write as _},
pin::Pin,
task::{Context, Poll},
};
use actix_rt::task::{spawn_blocking, JoinHandle};
use brotli2::write::BrotliDecoder;
use bytes::Bytes;
use flate2::write::{GzDecoder, ZlibDecoder};
use futures_core::{ready, Stream};
use super::Writer;
use crate::error::PayloadError;
use crate::http::header::{ContentEncoding, HeaderMap, CONTENT_ENCODING};
use crate::{
encoding::Writer,
error::{BlockingError, PayloadError},
http::header::{ContentEncoding, HeaderMap, CONTENT_ENCODING},
};
const INPLACE: usize = 2049;
const MAX_CHUNK_SIZE_DECODE_IN_PLACE: usize = 2049;
pub struct Decoder<S> {
decoder: Option<ContentDecoder>,
stream: S,
eof: bool,
fut: Option<CpuFuture<(Option<Bytes>, ContentDecoder), io::Error>>,
fut: Option<JoinHandle<Result<(Option<Bytes>, ContentDecoder), io::Error>>>,
}
impl<S> Decoder<S>
@@ -41,6 +47,7 @@ where
))),
_ => None,
};
Decoder {
decoder,
stream,
@@ -53,15 +60,11 @@ where
#[inline]
pub fn from_headers(stream: S, headers: &HeaderMap) -> Decoder<S> {
// check content-encoding
let encoding = if let Some(enc) = headers.get(&CONTENT_ENCODING) {
if let Ok(enc) = enc.to_str() {
ContentEncoding::from(enc)
} else {
ContentEncoding::Identity
}
} else {
ContentEncoding::Identity
};
let encoding = headers
.get(&CONTENT_ENCODING)
.and_then(|val| val.to_str().ok())
.map(ContentEncoding::from)
.unwrap_or(ContentEncoding::Identity);
Self::new(stream, encoding)
}
@@ -79,12 +82,12 @@ where
) -> Poll<Option<Self::Item>> {
loop {
if let Some(ref mut fut) = self.fut {
let (chunk, decoder) = match ready!(Pin::new(fut).poll(cx)) {
Ok(item) => item,
Err(e) => return Poll::Ready(Some(Err(e.into()))),
};
let (chunk, decoder) =
ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
self.decoder = Some(decoder);
self.fut.take();
if let Some(chunk) = chunk {
return Poll::Ready(Some(Ok(chunk)));
}
@@ -94,29 +97,34 @@ where
return Poll::Ready(None);
}
match Pin::new(&mut self.stream).poll_next(cx) {
Poll::Ready(Some(Err(err))) => return Poll::Ready(Some(Err(err))),
Poll::Ready(Some(Ok(chunk))) => {
match ready!(Pin::new(&mut self.stream).poll_next(cx)) {
Some(Err(err)) => return Poll::Ready(Some(Err(err))),
Some(Ok(chunk)) => {
if let Some(mut decoder) = self.decoder.take() {
if chunk.len() < INPLACE {
if chunk.len() < MAX_CHUNK_SIZE_DECODE_IN_PLACE {
let chunk = decoder.feed_data(chunk)?;
self.decoder = Some(decoder);
if let Some(chunk) = chunk {
return Poll::Ready(Some(Ok(chunk)));
}
} else {
self.fut = Some(run(move || {
self.fut = Some(spawn_blocking(move || {
let chunk = decoder.feed_data(chunk)?;
Ok((chunk, decoder))
}));
}
continue;
} else {
return Poll::Ready(Some(Ok(chunk)));
}
}
Poll::Ready(None) => {
None => {
self.eof = true;
return if let Some(mut decoder) = self.decoder.take() {
match decoder.feed_eof() {
Ok(Some(res)) => Poll::Ready(Some(Ok(res))),
@@ -127,10 +135,8 @@ where
Poll::Ready(None)
};
}
Poll::Pending => break,
}
}
Poll::Pending
}
}
@@ -146,6 +152,7 @@ impl ContentDecoder {
ContentDecoder::Br(ref mut decoder) => match decoder.flush() {
Ok(()) => {
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
@@ -154,9 +161,11 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
ContentDecoder::Gzip(ref mut decoder) => match decoder.try_finish() {
Ok(_) => {
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
@@ -165,6 +174,7 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
ContentDecoder::Deflate(ref mut decoder) => match decoder.try_finish() {
Ok(_) => {
let b = decoder.get_mut().take();
@@ -185,6 +195,7 @@ impl ContentDecoder {
Ok(_) => {
decoder.flush()?;
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
@@ -193,10 +204,12 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
ContentDecoder::Gzip(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))
} else {
@@ -205,9 +218,11 @@ impl ContentDecoder {
}
Err(e) => Err(e),
},
ContentDecoder::Deflate(ref mut decoder) => match decoder.write_all(&data) {
Ok(_) => {
decoder.flush()?;
let b = decoder.get_mut().take();
if !b.is_empty() {
Ok(Some(b))

View File

@@ -1,24 +1,32 @@
//! Stream encoder
use std::future::Future;
use std::io::{self, Write};
use std::pin::Pin;
use std::task::{Context, Poll};
//! Stream encoders.
use actix_threadpool::{run, CpuFuture};
use std::{
future::Future,
io::{self, Write as _},
pin::Pin,
task::{Context, Poll},
};
use actix_rt::task::{spawn_blocking, JoinHandle};
use brotli2::write::BrotliEncoder;
use bytes::Bytes;
use flate2::write::{GzEncoder, ZlibEncoder};
use futures_core::ready;
use pin_project::pin_project;
use crate::body::{Body, BodySize, MessageBody, ResponseBody};
use crate::http::header::{ContentEncoding, CONTENT_ENCODING};
use crate::http::{HeaderValue, StatusCode};
use crate::{Error, ResponseHead};
use crate::{
body::{Body, BodySize, MessageBody, ResponseBody},
http::{
header::{ContentEncoding, CONTENT_ENCODING},
HeaderValue, StatusCode,
},
Error, ResponseHead,
};
use super::Writer;
use crate::error::BlockingError;
const INPLACE: usize = 1024;
const MAX_CHUNK_SIZE_ENCODE_IN_PLACE: usize = 1024;
#[pin_project]
pub struct Encoder<B> {
@@ -26,7 +34,7 @@ pub struct Encoder<B> {
#[pin]
body: EncoderBody<B>,
encoder: Option<ContentEncoder>,
fut: Option<CpuFuture<ContentEncoder, io::Error>>,
fut: Option<JoinHandle<Result<ContentEncoder, io::Error>>>,
}
impl<B: MessageBody> Encoder<B> {
@@ -70,6 +78,7 @@ impl<B: MessageBody> Encoder<B> {
});
}
}
ResponseBody::Body(Encoder {
body,
eof: false,
@@ -135,32 +144,35 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
}
if let Some(ref mut fut) = this.fut {
let mut encoder = match ready!(Pin::new(fut).poll(cx)) {
Ok(item) => item,
Err(e) => return Poll::Ready(Some(Err(e.into()))),
};
let mut encoder =
ready!(Pin::new(fut).poll(cx)).map_err(|_| BlockingError)??;
let chunk = encoder.take();
*this.encoder = Some(encoder);
this.fut.take();
if !chunk.is_empty() {
return Poll::Ready(Some(Ok(chunk)));
}
}
let result = this.body.as_mut().poll_next(cx);
let result = ready!(this.body.as_mut().poll_next(cx));
match result {
Poll::Ready(Some(Ok(chunk))) => {
Some(Err(err)) => return Poll::Ready(Some(Err(err))),
Some(Ok(chunk)) => {
if let Some(mut encoder) = this.encoder.take() {
if chunk.len() < INPLACE {
if chunk.len() < MAX_CHUNK_SIZE_ENCODE_IN_PLACE {
encoder.write(&chunk)?;
let chunk = encoder.take();
*this.encoder = Some(encoder);
if !chunk.is_empty() {
return Poll::Ready(Some(Ok(chunk)));
}
} else {
*this.fut = Some(run(move || {
*this.fut = Some(spawn_blocking(move || {
encoder.write(&chunk)?;
Ok(encoder)
}));
@@ -169,7 +181,8 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
return Poll::Ready(Some(Ok(chunk)));
}
}
Poll::Ready(None) => {
None => {
if let Some(encoder) = this.encoder.take() {
let chunk = encoder.finish()?;
if chunk.is_empty() {
@@ -182,7 +195,6 @@ impl<B: MessageBody> MessageBody for Encoder<B> {
return Poll::Ready(None);
}
}
val => return val,
}
}
}

View File

@@ -1,4 +1,5 @@
//! Content-Encoding support
//! Content-Encoding support.
use std::io;
use bytes::{Bytes, BytesMut};

View File

@@ -6,25 +6,21 @@ use std::str::Utf8Error;
use std::string::FromUtf8Error;
use std::{fmt, io, result};
use actix_codec::{Decoder, Encoder};
pub use actix_threadpool::BlockingError;
use actix_utils::dispatcher::DispatcherError as FramedDispatcherError;
use actix_utils::timeout::TimeoutError;
use bytes::BytesMut;
use derive_more::{Display, From};
pub use futures_channel::oneshot::Canceled;
use http::uri::InvalidUri;
use http::{header, Error as HttpError, StatusCode};
use serde::de::value::Error as DeError;
use serde_json::error::Error as JsonError;
use serde_urlencoded::ser::Error as FormError;
// re-export for convenience
use crate::body::Body;
pub use crate::cookie::ParseError as CookieParseError;
use crate::helpers::Writer;
use crate::response::{Response, ResponseBuilder};
#[cfg(feature = "cookies")]
pub use crate::cookie::ParseError as CookieParseError;
/// A specialized [`std::result::Result`]
/// for actix web operations
///
@@ -40,7 +36,7 @@ pub type Result<T, E = Error> = result::Result<T, E>;
/// converting errors with `into()`.
///
/// Whenever it is created from an external object a response error is created
/// for it that can be used to create an http response from it this means that
/// for it that can be used to create an HTTP response from it this means that
/// if you have access to an actix `Error` you can always get a
/// `ResponseError` reference from it.
pub struct Error {
@@ -55,7 +51,7 @@ impl Error {
/// Similar to `as_response_error` but downcasts.
pub fn as_error<T: ResponseError + 'static>(&self) -> Option<&T> {
ResponseError::downcast_ref(self.cause.as_ref())
<dyn ResponseError>::downcast_ref(self.cause.as_ref())
}
}
@@ -100,10 +96,6 @@ impl fmt::Debug for Error {
}
impl std::error::Error for Error {
fn cause(&self) -> Option<&dyn std::error::Error> {
None
}
fn source(&self) -> Option<&(dyn std::error::Error + 'static)> {
None
}
@@ -153,58 +145,45 @@ impl From<ResponseBuilder> for Error {
}
}
/// Return `GATEWAY_TIMEOUT` for `TimeoutError`
impl<E: ResponseError> ResponseError for TimeoutError<E> {
fn status_code(&self) -> StatusCode {
match self {
TimeoutError::Service(e) => e.status_code(),
TimeoutError::Timeout => StatusCode::GATEWAY_TIMEOUT,
}
}
}
#[derive(Debug, Display)]
#[display(fmt = "UnknownError")]
struct UnitError;
/// `InternalServerError` for `UnitError`
/// Returns [`StatusCode::INTERNAL_SERVER_ERROR`] for [`UnitError`].
impl ResponseError for UnitError {}
/// `InternalServerError` for `JsonError`
/// Returns [`StatusCode::INTERNAL_SERVER_ERROR`] for [`JsonError`].
impl ResponseError for JsonError {}
/// `InternalServerError` for `FormError`
/// Returns [`StatusCode::INTERNAL_SERVER_ERROR`] for [`FormError`].
impl ResponseError for FormError {}
#[cfg(feature = "openssl")]
/// `InternalServerError` for `openssl::ssl::Error`
/// Returns [`StatusCode::INTERNAL_SERVER_ERROR`] for [`actix_tls::accept::openssl::SslError`].
impl ResponseError for actix_tls::accept::openssl::SslError {}
/// Return `BAD_REQUEST` for `de::value::Error`
/// Returns [`StatusCode::BAD_REQUEST`] for [`DeError`].
impl ResponseError for DeError {
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
/// `InternalServerError` for `Canceled`
impl ResponseError for Canceled {}
/// `InternalServerError` for `BlockingError`
impl<E: fmt::Debug> ResponseError for BlockingError<E> {}
/// Return `BAD_REQUEST` for `Utf8Error`
/// Returns [`StatusCode::BAD_REQUEST`] for [`Utf8Error`].
impl ResponseError for Utf8Error {
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
}
}
/// Return `InternalServerError` for `HttpError`,
/// Response generation can return `HttpError`, so it is internal error
/// Returns [`StatusCode::INTERNAL_SERVER_ERROR`] for [`HttpError`].
impl ResponseError for HttpError {}
/// Return `InternalServerError` for `io::Error`
/// Inspects the underlying [`io::ErrorKind`] and returns an appropriate status code.
///
/// If the error is [`io::ErrorKind::NotFound`], [`StatusCode::NOT_FOUND`] is returned. If the
/// error is [`io::ErrorKind::PermissionDenied`], [`StatusCode::FORBIDDEN`] is returned. Otherwise,
/// [`StatusCode::INTERNAL_SERVER_ERROR`] is returned.
impl ResponseError for io::Error {
fn status_code(&self) -> StatusCode {
match self.kind() {
@@ -215,7 +194,7 @@ impl ResponseError for io::Error {
}
}
/// `BadRequest` for `InvalidHeaderValue`
/// Returns [`StatusCode::BAD_REQUEST`] for [`header::InvalidHeaderValue`].
impl ResponseError for header::InvalidHeaderValue {
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
@@ -304,33 +283,60 @@ impl From<httparse::Error> for ParseError {
}
}
/// A set of errors that can occur running blocking tasks in thread pool.
#[derive(Debug, Display)]
#[display(fmt = "Blocking thread pool is gone")]
pub struct BlockingError;
impl std::error::Error for BlockingError {}
/// `InternalServerError` for `BlockingError`
impl ResponseError for BlockingError {}
#[derive(Display, Debug)]
/// A set of errors that can occur during payload parsing
pub enum PayloadError {
/// A payload reached EOF, but is not complete.
#[display(
fmt = "A payload reached EOF, but is not complete. With error: {:?}",
fmt = "A payload reached EOF, but is not complete. Inner error: {:?}",
_0
)]
Incomplete(Option<io::Error>),
/// Content encoding stream corruption
/// Content encoding stream corruption.
#[display(fmt = "Can not decode content-encoding.")]
EncodingCorrupted,
/// A payload reached size limit.
#[display(fmt = "A payload reached size limit.")]
/// Payload reached size limit.
#[display(fmt = "Payload reached size limit.")]
Overflow,
/// A payload length is unknown.
#[display(fmt = "A payload length is unknown.")]
/// Payload length is unknown.
#[display(fmt = "Payload length is unknown.")]
UnknownLength,
/// Http2 payload error
/// HTTP/2 payload error.
#[display(fmt = "{}", _0)]
Http2Payload(h2::Error),
/// Io error
/// Generic I/O error.
#[display(fmt = "{}", _0)]
Io(io::Error),
}
impl std::error::Error for PayloadError {}
impl std::error::Error for PayloadError {
fn source(&self) -> Option<&(dyn std::error::Error + 'static)> {
match self {
PayloadError::Incomplete(None) => None,
PayloadError::Incomplete(Some(err)) => Some(err as &dyn std::error::Error),
PayloadError::EncodingCorrupted => None,
PayloadError::Overflow => None,
PayloadError::UnknownLength => None,
PayloadError::Http2Payload(err) => Some(err as &dyn std::error::Error),
PayloadError::Io(err) => Some(err as &dyn std::error::Error),
}
}
}
impl From<h2::Error> for PayloadError {
fn from(err: h2::Error) -> Self {
@@ -350,15 +356,12 @@ impl From<io::Error> for PayloadError {
}
}
impl From<BlockingError<io::Error>> for PayloadError {
fn from(err: BlockingError<io::Error>) -> Self {
match err {
BlockingError::Error(e) => PayloadError::Io(e),
BlockingError::Canceled => PayloadError::Io(io::Error::new(
io::ErrorKind::Other,
"Operation is canceled",
)),
}
impl From<BlockingError> for PayloadError {
fn from(_: BlockingError) -> Self {
PayloadError::Io(io::Error::new(
io::ErrorKind::Other,
"Operation is canceled",
))
}
}
@@ -376,6 +379,7 @@ impl ResponseError for PayloadError {
}
/// Return `BadRequest` for `cookie::ParseError`
#[cfg(feature = "cookies")]
impl ResponseError for crate::cookie::ParseError {
fn status_code(&self) -> StatusCode {
StatusCode::BAD_REQUEST
@@ -383,7 +387,7 @@ impl ResponseError for crate::cookie::ParseError {
}
#[derive(Debug, Display, From)]
/// A set of errors that can occur during dispatching http requests
/// A set of errors that can occur during dispatching HTTP requests
pub enum DispatchError {
/// Service error
Service(Error),
@@ -449,21 +453,13 @@ impl ResponseError for ContentTypeError {
}
}
impl<E, U: Encoder<I> + Decoder, I> ResponseError for FramedDispatcherError<E, U, I>
where
E: fmt::Debug + fmt::Display,
<U as Encoder<I>>::Error: fmt::Debug,
<U as Decoder>::Error: fmt::Debug,
{
}
/// Helper type that can wrap any error and generate custom response.
///
/// In following example any `io::Error` will be converted into "BAD REQUEST"
/// response as opposite to *INTERNAL SERVER ERROR* which is defined by
/// default.
///
/// ```rust
/// ```
/// # use std::io;
/// # use actix_http::*;
///
@@ -947,11 +943,6 @@ where
InternalError::new(err, StatusCode::NETWORK_AUTHENTICATION_REQUIRED).into()
}
#[cfg(feature = "actors")]
/// `InternalServerError` for `actix::MailboxError`
/// This is supported on feature=`actors` only
impl ResponseError for actix::MailboxError {}
#[cfg(test)]
mod tests {
use super::*;
@@ -968,6 +959,7 @@ mod tests {
assert_eq!(resp.status(), StatusCode::INTERNAL_SERVER_ERROR);
}
#[cfg(feature = "cookies")]
#[test]
fn test_cookie_parse() {
let resp: Response = CookieParseError::EmptyName.error_response();
@@ -1009,22 +1001,22 @@ mod tests {
fn test_payload_error() {
let err: PayloadError =
io::Error::new(io::ErrorKind::Other, "ParseError").into();
assert!(format!("{}", err).contains("ParseError"));
assert!(err.to_string().contains("ParseError"));
let err = PayloadError::Incomplete(None);
assert_eq!(
format!("{}", err),
"A payload reached EOF, but is not complete. With error: None"
err.to_string(),
"A payload reached EOF, but is not complete. Inner error: None"
);
}
macro_rules! from {
($from:expr => $error:pat) => {
match ParseError::from($from) {
e @ $error => {
assert!(format!("{}", e).len() >= 5);
err @ $error => {
assert!(err.to_string().len() >= 5);
}
e => unreachable!("{:?}", e),
err => unreachable!("{:?}", err),
}
};
}
@@ -1067,7 +1059,7 @@ mod tests {
let err = PayloadError::Overflow;
let resp_err: &dyn ResponseError = &err;
let err = resp_err.downcast_ref::<PayloadError>().unwrap();
assert_eq!(err.to_string(), "A payload reached size limit.");
assert_eq!(err.to_string(), "Payload reached size limit.");
let not_err = resp_err.downcast_ref::<ContentTypeError>();
assert!(not_err.is_none());
}

View File

@@ -1,62 +1,119 @@
use std::any::{Any, TypeId};
use std::{fmt, mem};
use std::{
any::{Any, TypeId},
fmt, mem,
};
use fxhash::FxHashMap;
use ahash::AHashMap;
/// A type map of request extensions.
/// A type map for request extensions.
///
/// All entries into this map must be owned types (or static references).
#[derive(Default)]
pub struct Extensions {
/// Use FxHasher with a std HashMap with for faster
/// lookups on the small `TypeId` (u64 equivalent) keys.
map: FxHashMap<TypeId, Box<dyn Any>>,
map: AHashMap<TypeId, Box<dyn Any>>,
}
impl Extensions {
/// Create an empty `Extensions`.
/// Creates an empty `Extensions`.
#[inline]
pub fn new() -> Extensions {
Extensions {
map: FxHashMap::default(),
map: AHashMap::default(),
}
}
/// Insert a type into this `Extensions`.
/// Insert an item into the map.
///
/// If a extension of this type already existed, it will
/// be returned.
pub fn insert<T: 'static>(&mut self, val: T) {
self.map.insert(TypeId::of::<T>(), Box::new(val));
/// If an item of this type was already stored, it will be replaced and returned.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
/// assert_eq!(map.insert(""), None);
/// assert_eq!(map.insert(1u32), None);
/// assert_eq!(map.insert(2u32), Some(1u32));
/// assert_eq!(*map.get::<u32>().unwrap(), 2u32);
/// ```
pub fn insert<T: 'static>(&mut self, val: T) -> Option<T> {
self.map
.insert(TypeId::of::<T>(), Box::new(val))
.and_then(downcast_owned)
}
/// Check if container contains entry
/// Check if map contains an item of a given type.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
/// assert!(!map.contains::<u32>());
///
/// assert_eq!(map.insert(1u32), None);
/// assert!(map.contains::<u32>());
/// ```
pub fn contains<T: 'static>(&self) -> bool {
self.map.contains_key(&TypeId::of::<T>())
}
/// Get a reference to a type previously inserted on this `Extensions`.
/// Get a reference to an item of a given type.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
/// map.insert(1u32);
/// assert_eq!(map.get::<u32>(), Some(&1u32));
/// ```
pub fn get<T: 'static>(&self) -> Option<&T> {
self.map
.get(&TypeId::of::<T>())
.and_then(|boxed| boxed.downcast_ref())
}
/// Get a mutable reference to a type previously inserted on this `Extensions`.
/// Get a mutable reference to an item of a given type.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
/// map.insert(1u32);
/// assert_eq!(map.get_mut::<u32>(), Some(&mut 1u32));
/// ```
pub fn get_mut<T: 'static>(&mut self) -> Option<&mut T> {
self.map
.get_mut(&TypeId::of::<T>())
.and_then(|boxed| boxed.downcast_mut())
}
/// Remove a type from this `Extensions`.
/// Remove an item from the map of a given type.
///
/// If a extension of this type existed, it will be returned.
/// If an item of this type was already stored, it will be returned.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
///
/// map.insert(1u32);
/// assert_eq!(map.get::<u32>(), Some(&1u32));
///
/// assert_eq!(map.remove::<u32>(), Some(1u32));
/// assert!(!map.contains::<u32>());
/// ```
pub fn remove<T: 'static>(&mut self) -> Option<T> {
self.map
.remove(&TypeId::of::<T>())
.and_then(|boxed| boxed.downcast().ok().map(|boxed| *boxed))
self.map.remove(&TypeId::of::<T>()).and_then(downcast_owned)
}
/// Clear the `Extensions` of all inserted extensions.
///
/// ```
/// # use actix_http::Extensions;
/// let mut map = Extensions::new();
///
/// map.insert(1u32);
/// assert!(map.contains::<u32>());
///
/// map.clear();
/// assert!(!map.contains::<u32>());
/// ```
#[inline]
pub fn clear(&mut self) {
self.map.clear();
@@ -79,6 +136,10 @@ impl fmt::Debug for Extensions {
}
}
fn downcast_owned<T: 'static>(boxed: Box<dyn Any>) -> Option<T> {
boxed.downcast().ok().map(|boxed| *boxed)
}
#[cfg(test)]
mod tests {
use super::*;

View File

@@ -223,15 +223,3 @@ impl Encoder<Message<(RequestHeadType, BodySize)>> for ClientCodec {
Ok(())
}
}
pub struct Writer<'a>(pub &'a mut BytesMut);
impl<'a> io::Write for Writer<'a> {
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
self.0.extend_from_slice(buf);
Ok(buf.len())
}
fn flush(&mut self) -> io::Result<()> {
Ok(())
}
}

View File

@@ -199,10 +199,10 @@ mod tests {
use http::Method;
use super::*;
use crate::httpmessage::HttpMessage;
use crate::HttpMessage;
#[test]
fn test_http_request_chunked_payload_and_next_message() {
#[actix_rt::test]
async fn test_http_request_chunked_payload_and_next_message() {
let mut codec = Codec::default();
let mut buf = BytesMut::from(

View File

@@ -14,7 +14,7 @@ use crate::header::HeaderMap;
use crate::message::{ConnectionType, ResponseHead};
use crate::request::Request;
const MAX_BUFFER_SIZE: usize = 131_072;
pub(crate) const MAX_BUFFER_SIZE: usize = 131_072;
const MAX_HEADERS: usize = 96;
/// Incoming message decoder
@@ -203,7 +203,15 @@ impl MessageType for Request {
(len, method, uri, version, req.headers.len())
}
httparse::Status::Partial => return Ok(None),
httparse::Status::Partial => {
return if src.len() >= MAX_BUFFER_SIZE {
trace!("MAX_BUFFER_SIZE unprocessed data reached, closing");
Err(ParseError::TooLarge)
} else {
// Return None to notify more read are needed for parsing request
Ok(None)
};
}
}
};
@@ -216,15 +224,12 @@ impl MessageType for Request {
let decoder = match length {
PayloadLength::Payload(pl) => pl,
PayloadLength::UpgradeWebSocket => {
// upgrade(websocket)
// upgrade (WebSocket)
PayloadType::Stream(PayloadDecoder::eof())
}
PayloadLength::None => {
if method == Method::CONNECT {
PayloadType::Stream(PayloadDecoder::eof())
} else if src.len() >= MAX_BUFFER_SIZE {
trace!("MAX_BUFFER_SIZE unprocessed data reached, closing");
return Err(ParseError::TooLarge);
} else {
PayloadType::None
}
@@ -273,7 +278,14 @@ impl MessageType for ResponseHead {
(len, version, status, res.headers.len())
}
httparse::Status::Partial => return Ok(None),
httparse::Status::Partial => {
return if src.len() >= MAX_BUFFER_SIZE {
error!("MAX_BUFFER_SIZE unprocessed data reached, closing");
Err(ParseError::TooLarge)
} else {
Ok(None)
}
}
}
};
@@ -289,9 +301,6 @@ impl MessageType for ResponseHead {
} else if status == StatusCode::SWITCHING_PROTOCOLS {
// switching protocol or connect
PayloadType::Stream(PayloadDecoder::eof())
} else if src.len() >= MAX_BUFFER_SIZE {
error!("MAX_BUFFER_SIZE unprocessed data reached, closing");
return Err(ParseError::TooLarge);
} else {
// for HTTP/1.0 read to eof and close connection
if msg.version == Version::HTTP_10 {
@@ -643,7 +652,7 @@ mod tests {
use super::*;
use crate::error::ParseError;
use crate::http::header::{HeaderName, SET_COOKIE};
use crate::httpmessage::HttpMessage;
use crate::HttpMessage;
impl PayloadType {
fn unwrap(self) -> PayloadDecoder {
@@ -821,8 +830,8 @@ mod tests {
.get_all(SET_COOKIE)
.map(|v| v.to_str().unwrap().to_owned())
.collect();
assert_eq!(val[1], "c1=cookie1");
assert_eq!(val[0], "c2=cookie2");
assert_eq!(val[0], "c1=cookie1");
assert_eq!(val[1], "c2=cookie2");
}
#[test]

File diff suppressed because it is too large Load Diff

View File

@@ -8,7 +8,7 @@ use bytes::{BufMut, BytesMut};
use crate::body::BodySize;
use crate::config::ServiceConfig;
use crate::header::map;
use crate::header::{map::Value, HeaderName};
use crate::helpers;
use crate::http::header::{CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use crate::http::{HeaderMap, StatusCode, Version};
@@ -121,21 +121,11 @@ pub(crate) trait MessageType: Sized {
_ => {}
}
// merging headers from head and extra headers. HeaderMap::new() does not allocate.
let empty_headers = HeaderMap::new();
let extra_headers = self.extra_headers().unwrap_or(&empty_headers);
let headers = self
.headers()
.inner
.iter()
.filter(|(name, _)| !extra_headers.contains_key(*name))
.chain(extra_headers.inner.iter());
// write headers
let mut has_date = false;
let mut buf = dst.chunk_mut().as_mut_ptr() as *mut u8;
let mut buf = dst.chunk_mut().as_mut_ptr();
let mut remaining = dst.capacity() - dst.len();
// tracks bytes written since last buffer resize
@@ -143,10 +133,10 @@ pub(crate) trait MessageType: Sized {
// container's knowledge, this is used to sync the containers cursor after data is written
let mut pos = 0;
for (key, value) in headers {
self.write_headers(|key, value| {
match *key {
CONNECTION => continue,
TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => continue,
CONNECTION => return,
TRANSFER_ENCODING | CONTENT_LENGTH if skip_len => return,
DATE => has_date = true,
_ => {}
}
@@ -154,106 +144,56 @@ pub(crate) trait MessageType: Sized {
let k = key.as_str().as_bytes();
let k_len = k.len();
match value {
map::Value::One(ref val) => {
let v = val.as_ref();
let v_len = v.len();
// TODO: drain?
for val in value.iter() {
let v = val.as_ref();
let v_len = v.len();
// key length + value length + colon + space + \r\n
let len = k_len + v_len + 4;
// key length + value length + colon + space + \r\n
let len = k_len + v_len + 4;
if len > remaining {
// not enough room in buffer for this header; reserve more space
// SAFETY: all the bytes written up to position "pos" are initialized
// the written byte count and pointer advancement are kept in sync
unsafe {
dst.advance_mut(pos);
}
pos = 0;
dst.reserve(len * 2);
remaining = dst.capacity() - dst.len();
// re-assign buf raw pointer since it's possible that the buffer was
// reallocated and/or resized
buf = dst.chunk_mut().as_mut_ptr() as *mut u8;
}
// SAFETY: on each write, it is enough to ensure that the advancement of the
// cursor matches the number of bytes written
if len > remaining {
// SAFETY: all the bytes written up to position "pos" are initialized
// the written byte count and pointer advancement are kept in sync
unsafe {
// use upper Camel-Case
if camel_case {
write_camel_case(k, from_raw_parts_mut(buf, k_len))
} else {
write_data(k, buf, k_len)
}
buf = buf.add(k_len);
write_data(b": ", buf, 2);
buf = buf.add(2);
write_data(v, buf, v_len);
buf = buf.add(v_len);
write_data(b"\r\n", buf, 2);
buf = buf.add(2);
dst.advance_mut(pos);
}
pos += len;
remaining -= len;
pos = 0;
dst.reserve(len * 2);
remaining = dst.capacity() - dst.len();
// re-assign buf raw pointer since it's possible that the buffer was
// reallocated and/or resized
buf = dst.chunk_mut().as_mut_ptr();
}
map::Value::Multi(ref vec) => {
for val in vec {
let v = val.as_ref();
let v_len = v.len();
let len = k_len + v_len + 4;
if len > remaining {
// SAFETY: all the bytes written up to position "pos" are initialized
// the written byte count and pointer advancement are kept in sync
unsafe {
dst.advance_mut(pos);
}
pos = 0;
dst.reserve(len * 2);
remaining = dst.capacity() - dst.len();
// re-assign buf raw pointer since it's possible that the buffer was
// reallocated and/or resized
buf = dst.chunk_mut().as_mut_ptr() as *mut u8;
}
// SAFETY: on each write, it is enough to ensure that the advancement of
// the cursor matches the number of bytes written
unsafe {
if camel_case {
write_camel_case(k, from_raw_parts_mut(buf, k_len));
} else {
write_data(k, buf, k_len);
}
buf = buf.add(k_len);
write_data(b": ", buf, 2);
buf = buf.add(2);
write_data(v, buf, v_len);
buf = buf.add(v_len);
write_data(b"\r\n", buf, 2);
buf = buf.add(2);
};
pos += len;
remaining -= len;
// SAFETY: on each write, it is enough to ensure that the advancement of
// the cursor matches the number of bytes written
unsafe {
if camel_case {
// use Camel-Case headers
write_camel_case(k, from_raw_parts_mut(buf, k_len));
} else {
write_data(k, buf, k_len);
}
}
buf = buf.add(k_len);
write_data(b": ", buf, 2);
buf = buf.add(2);
write_data(v, buf, v_len);
buf = buf.add(v_len);
write_data(b"\r\n", buf, 2);
buf = buf.add(2);
};
pos += len;
remaining -= len;
}
}
});
// final cursor synchronization with the bytes container
//
@@ -273,6 +213,24 @@ pub(crate) trait MessageType: Sized {
Ok(())
}
fn write_headers<F>(&mut self, mut f: F)
where
F: FnMut(&HeaderName, &Value),
{
match self.extra_headers() {
Some(headers) => {
// merging headers from head and extra headers.
self.headers()
.inner
.iter()
.filter(|(name, _)| !headers.contains_key(*name))
.chain(headers.inner.iter())
.for_each(|(k, v)| f(k, v))
}
None => self.headers().inner.iter().for_each(|(k, v)| f(k, v)),
}
}
}
impl MessageType for Response<()> {
@@ -329,7 +287,7 @@ impl MessageType for RequestHeadType {
let head = self.as_ref();
dst.reserve(256 + head.headers.len() * AVERAGE_HEADER_SIZE);
write!(
Writer(dst),
helpers::Writer(dst),
"{} {} {}",
head.method,
head.uri.path_and_query().map(|u| u.as_str()).unwrap_or("/"),
@@ -462,7 +420,7 @@ impl TransferEncoding {
*eof = true;
buf.extend_from_slice(b"0\r\n\r\n");
} else {
writeln!(Writer(buf), "{:X}\r", msg.len())
writeln!(helpers::Writer(buf), "{:X}\r", msg.len())
.map_err(|e| io::Error::new(io::ErrorKind::Other, e))?;
buf.reserve(msg.len() + 2);
@@ -512,18 +470,6 @@ impl TransferEncoding {
}
}
struct Writer<'a>(pub &'a mut BytesMut);
impl<'a> io::Write for Writer<'a> {
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
self.0.extend_from_slice(buf);
Ok(buf.len())
}
fn flush(&mut self) -> io::Result<()> {
Ok(())
}
}
/// # Safety
/// Callers must ensure that the given length matches given value length.
unsafe fn write_data(value: &[u8], buf: *mut u8, len: usize) {
@@ -583,8 +529,8 @@ mod tests {
);
}
#[test]
fn test_camel_case() {
#[actix_rt::test]
async fn test_camel_case() {
let mut bytes = BytesMut::with_capacity(2048);
let mut head = RequestHead::default();
head.set_camel_case_headers(true);
@@ -603,7 +549,6 @@ mod tests {
);
let data =
String::from_utf8(Vec::from(bytes.split().freeze().as_ref())).unwrap();
eprintln!("{}", &data);
assert!(data.contains("Content-Length: 0\r\n"));
assert!(data.contains("Connection: close\r\n"));
@@ -647,8 +592,8 @@ mod tests {
assert!(data.contains("date: date\r\n"));
}
#[test]
fn test_extra_headers() {
#[actix_rt::test]
async fn test_extra_headers() {
let mut bytes = BytesMut::with_capacity(2048);
let mut head = RequestHead::default();
@@ -681,16 +626,15 @@ mod tests {
assert!(data.contains("date: date\r\n"));
}
#[test]
fn test_no_content_length() {
#[actix_rt::test]
async fn test_no_content_length() {
let mut bytes = BytesMut::with_capacity(2048);
let mut res: Response<()> =
Response::new(StatusCode::SWITCHING_PROTOCOLS).into_body::<()>();
res.headers_mut().insert(DATE, HeaderValue::from_static(""));
res.headers_mut()
.insert(DATE, HeaderValue::from_static(&""));
res.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static(&"0"));
.insert(CONTENT_LENGTH, HeaderValue::from_static("0"));
let _ = res.encode_headers(
&mut bytes,

View File

@@ -1,7 +1,5 @@
use std::task::{Context, Poll};
use actix_service::{Service, ServiceFactory};
use futures_util::future::{ready, Ready};
use actix_utils::future::{ready, Ready};
use crate::error::Error;
use crate::request::Request;
@@ -26,11 +24,9 @@ impl Service<Request> for ExpectHandler {
type Error = Error;
type Future = Ready<Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
actix_service::always_ready!();
fn call(&mut self, req: Request) -> Self::Future {
fn call(&self, req: Request) -> Self::Future {
ready(Ok(req))
// TODO: add some way to trigger error
// Err(error::ErrorExpectationFailed("test"))

View File

@@ -1,4 +1,4 @@
//! HTTP/1 implementation
//! HTTP/1 protocol implementation.
use bytes::{Bytes, BytesMut};
mod client;

View File

@@ -3,9 +3,8 @@ use std::cell::RefCell;
use std::collections::VecDeque;
use std::pin::Pin;
use std::rc::{Rc, Weak};
use std::task::{Context, Poll};
use std::task::{Context, Poll, Waker};
use actix_utils::task::LocalWaker;
use bytes::Bytes;
use futures_core::Stream;
@@ -134,7 +133,7 @@ impl PayloadSender {
if shared.borrow().need_read {
PayloadStatus::Read
} else {
shared.borrow_mut().io_task.register(cx.waker());
shared.borrow_mut().register_io(cx);
PayloadStatus::Pause
}
} else {
@@ -150,8 +149,8 @@ struct Inner {
err: Option<PayloadError>,
need_read: bool,
items: VecDeque<Bytes>,
task: LocalWaker,
io_task: LocalWaker,
task: Option<Waker>,
io_task: Option<Waker>,
}
impl Inner {
@@ -162,8 +161,48 @@ impl Inner {
err: None,
items: VecDeque::new(),
need_read: true,
task: LocalWaker::new(),
io_task: LocalWaker::new(),
task: None,
io_task: None,
}
}
/// Wake up future waiting for payload data to be available.
fn wake(&mut self) {
if let Some(waker) = self.task.take() {
waker.wake();
}
}
/// Wake up future feeding data to Payload.
fn wake_io(&mut self) {
if let Some(waker) = self.io_task.take() {
waker.wake();
}
}
/// Register future waiting data from payload.
/// Waker would be used in `Inner::wake`
fn register(&mut self, cx: &mut Context<'_>) {
if self
.task
.as_ref()
.map(|w| !cx.waker().will_wake(w))
.unwrap_or(true)
{
self.task = Some(cx.waker().clone());
}
}
// Register future feeding data to payload.
/// Waker would be used in `Inner::wake_io`
fn register_io(&mut self, cx: &mut Context<'_>) {
if self
.io_task
.as_ref()
.map(|w| !cx.waker().will_wake(w))
.unwrap_or(true)
{
self.io_task = Some(cx.waker().clone());
}
}
@@ -182,7 +221,7 @@ impl Inner {
self.len += data.len();
self.items.push_back(data);
self.need_read = self.len < MAX_BUFFER_SIZE;
self.task.wake();
self.wake();
}
#[cfg(test)]
@@ -199,9 +238,9 @@ impl Inner {
self.need_read = self.len < MAX_BUFFER_SIZE;
if self.need_read && !self.eof {
self.task.register(cx.waker());
self.register(cx);
}
self.io_task.wake();
self.wake_io();
Poll::Ready(Some(Ok(data)))
} else if let Some(err) = self.err.take() {
Poll::Ready(Some(Err(err)))
@@ -209,8 +248,8 @@ impl Inner {
Poll::Ready(None)
} else {
self.need_read = true;
self.task.register(cx.waker());
self.io_task.wake();
self.register(cx);
self.wake_io();
Poll::Pending
}
}
@@ -224,7 +263,7 @@ impl Inner {
#[cfg(test)]
mod tests {
use super::*;
use futures_util::future::poll_fn;
use actix_utils::future::poll_fn;
#[actix_rt::test]
async fn test_unread_data() {

View File

@@ -1,7 +1,4 @@
use std::cell::RefCell;
use std::future::Future;
use std::marker::PhantomData;
use std::pin::Pin;
use std::rc::Rc;
use std::task::{Context, Poll};
use std::{fmt, net};
@@ -9,15 +6,15 @@ use std::{fmt, net};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_rt::net::TcpStream;
use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
use futures_core::ready;
use futures_util::future::ready;
use actix_utils::future::ready;
use futures_core::future::LocalBoxFuture;
use crate::body::MessageBody;
use crate::config::ServiceConfig;
use crate::error::{DispatchError, Error};
use crate::request::Request;
use crate::response::Response;
use crate::service::HttpFlow;
use crate::service::HttpServiceHandler;
use crate::{ConnectCallback, OnConnectData};
use super::codec::Codec;
@@ -61,14 +58,17 @@ where
impl<S, B, X, U> H1Service<TcpStream, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Future: 'static,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<(Request, Framed<TcpStream, Codec>), Config = (), Response = ()>,
U::Future: 'static,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
@@ -95,24 +95,29 @@ mod openssl {
use super::*;
use actix_service::ServiceFactoryExt;
use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, SslStream};
use actix_tls::accept::TlsError;
use actix_tls::accept::{
openssl::{Acceptor, SslAcceptor, SslError, TlsStream},
TlsError,
};
impl<S, B, X, U> H1Service<SslStream<TcpStream>, S, B, X, U>
impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Future: 'static,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
(Request, Framed<SslStream<TcpStream>, Codec>),
(Request, Framed<TlsStream<TcpStream>, Codec>),
Config = (),
Response = (),
>,
U::Future: 'static,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
@@ -132,7 +137,7 @@ mod openssl {
.map_err(TlsError::Tls)
.map_init_err(|_| panic!()),
)
.and_then(|io: SslStream<TcpStream>| {
.and_then(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ready(Ok((io, peer_addr)))
})
@@ -144,19 +149,25 @@ mod openssl {
#[cfg(feature = "rustls")]
mod rustls {
use super::*;
use std::io;
use actix_service::ServiceFactoryExt;
use actix_tls::accept::rustls::{Acceptor, ServerConfig, TlsStream};
use actix_tls::accept::TlsError;
use std::{fmt, io};
use actix_tls::accept::{
rustls::{Acceptor, ServerConfig, TlsStream},
TlsError,
};
impl<S, B, X, U> H1Service<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>>,
B: MessageBody,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Future: 'static,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<
@@ -164,6 +175,7 @@ mod rustls {
Config = (),
Response = (),
>,
U::Future: 'static,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
@@ -242,16 +254,19 @@ where
impl<T, S, B, X, U> ServiceFactory<(T, Option<net::SocketAddr>)>
for H1Service<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
T: AsyncRead + AsyncWrite + Unpin + 'static,
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Future: 'static,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<(Request, Framed<T, Codec>), Config = (), Response = ()>,
U::Future: 'static,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
{
@@ -260,148 +275,50 @@ where
type Config = ();
type Service = H1ServiceHandler<T, S::Service, B, X::Service, U::Service>;
type InitError = ();
type Future = H1ServiceResponse<T, S, B, X, U>;
type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: ()) -> Self::Future {
H1ServiceResponse {
fut: self.srv.new_service(()),
fut_ex: Some(self.expect.new_service(())),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
expect: None,
upgrade: None,
on_connect_ext: self.on_connect_ext.clone(),
cfg: Some(self.cfg.clone()),
_phantom: PhantomData,
}
}
}
let service = self.srv.new_service(());
let expect = self.expect.new_service(());
let upgrade = self.upgrade.as_ref().map(|s| s.new_service(()));
let on_connect_ext = self.on_connect_ext.clone();
let cfg = self.cfg.clone();
#[doc(hidden)]
#[pin_project::pin_project]
pub struct H1ServiceResponse<T, S, B, X, U>
where
S: ServiceFactory<Request>,
S::Error: Into<Error>,
S::InitError: fmt::Debug,
X: ServiceFactory<Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
#[pin]
fut: S::Future,
#[pin]
fut_ex: Option<X::Future>,
#[pin]
fut_upg: Option<U::Future>,
expect: Option<X::Service>,
upgrade: Option<U::Service>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
cfg: Option<ServiceConfig>,
_phantom: PhantomData<B>,
}
Box::pin(async move {
let expect = expect
.await
.map_err(|e| log::error!("Init http expect service error: {:?}", e))?;
impl<T, S, B, X, U> Future for H1ServiceResponse<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
S::InitError: fmt::Debug,
B: MessageBody,
X: ServiceFactory<Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
U: ServiceFactory<(Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
{
type Output = Result<H1ServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
let upgrade = match upgrade {
Some(upgrade) => {
let upgrade = upgrade.await.map_err(|e| {
log::error!("Init http upgrade service error: {:?}", e)
})?;
Some(upgrade)
}
None => None,
};
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
let service = service
.await
.map_err(|e| log::error!("Init http service error: {:?}", e))?;
if let Some(fut) = this.fut_ex.as_pin_mut() {
let expect = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.expect = Some(expect);
this.fut_ex.set(None);
}
if let Some(fut) = this.fut_upg.as_pin_mut() {
let upgrade = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.upgrade = Some(upgrade);
this.fut_upg.set(None);
}
let result = ready!(this
.fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)));
Poll::Ready(result.map(|service| {
let this = self.as_mut().project();
H1ServiceHandler::new(
this.cfg.take().unwrap(),
Ok(H1ServiceHandler::new(
cfg,
service,
this.expect.take().unwrap(),
this.upgrade.take(),
this.on_connect_ext.clone(),
)
}))
expect,
upgrade,
on_connect_ext,
))
})
}
}
/// `Service` implementation for HTTP/1 transport
pub struct H1ServiceHandler<T, S, B, X, U>
where
S: Service<Request>,
X: Service<Request>,
U: Service<(Request, Framed<T, Codec>)>,
{
flow: Rc<RefCell<HttpFlow<S, X, U>>>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
cfg: ServiceConfig,
_phantom: PhantomData<B>,
}
impl<T, S, B, X, U> H1ServiceHandler<T, S, B, X, U>
where
S: Service<Request>,
S::Error: Into<Error>,
S::Response: Into<Response<B>>,
B: MessageBody,
X: Service<Request, Response = Request>,
X::Error: Into<Error>,
U: Service<(Request, Framed<T, Codec>), Response = ()>,
U::Error: fmt::Display,
{
fn new(
cfg: ServiceConfig,
service: S,
expect: X,
upgrade: Option<U>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
) -> H1ServiceHandler<T, S, B, X, U> {
H1ServiceHandler {
flow: HttpFlow::new(service, expect, upgrade),
cfg,
on_connect_ext,
_phantom: PhantomData,
}
}
}
pub type H1ServiceHandler<T, S, B, X, U> = HttpServiceHandler<T, S, B, X, U>;
impl<T, S, B, X, U> Service<(T, Option<net::SocketAddr>)>
for H1ServiceHandler<T, S, B, X, U>
for HttpServiceHandler<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: Service<Request>,
@@ -417,50 +334,14 @@ where
type Error = DispatchError;
type Future = Dispatcher<T, S, B, X, U>;
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
let mut flow = self.flow.borrow_mut();
let ready = flow
.expect
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready();
let ready = flow
.service
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready()
&& ready;
let ready = if let Some(ref mut upg) = flow.upgrade {
upg.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready()
&& ready
} else {
ready
};
if ready {
Poll::Ready(Ok(()))
} else {
Poll::Pending
}
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self._poll_ready(cx).map_err(|e| {
log::error!("HTTP/1 service readiness error: {:?}", e);
DispatchError::Service(e)
})
}
fn call(&mut self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
fn call(&self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
let on_connect_data =
OnConnectData::from_io(&io, self.on_connect_ext.as_deref());

View File

@@ -1,8 +1,6 @@
use std::task::{Context, Poll};
use actix_codec::Framed;
use actix_service::{Service, ServiceFactory};
use futures_util::future::{ready, Ready};
use futures_core::future::LocalBoxFuture;
use crate::error::Error;
use crate::h1::Codec;
@@ -16,7 +14,7 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
type Config = ();
type Service = UpgradeHandler;
type InitError = Error;
type Future = Ready<Result<Self::Service, Self::InitError>>;
type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: ()) -> Self::Future {
unimplemented!()
@@ -26,13 +24,11 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
impl<T> Service<(Request, Framed<T, Codec>)> for UpgradeHandler {
type Response = ();
type Error = Error;
type Future = Ready<Result<Self::Response, Self::Error>>;
type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
fn poll_ready(&mut self, _: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
Poll::Ready(Ok(()))
}
actix_service::always_ready!();
fn call(&mut self, _: (Request, Framed<T, Codec>)) -> Self::Future {
ready(Ok(()))
fn call(&self, _: (Request, Framed<T, Codec>)) -> Self::Future {
unimplemented!()
}
}

View File

@@ -1,19 +1,14 @@
use std::cell::RefCell;
use std::future::Future;
use std::marker::PhantomData;
use std::net;
use std::pin::Pin;
use std::rc::Rc;
use std::task::{Context, Poll};
use std::{cmp, convert::TryFrom};
use std::{cmp, future::Future, marker::PhantomData, net, pin::Pin, rc::Rc};
use actix_codec::{AsyncRead, AsyncWrite};
use actix_rt::time::{Instant, Sleep};
use actix_service::Service;
use bytes::{Bytes, BytesMut};
use futures_core::ready;
use h2::server::{Connection, SendResponse};
use h2::SendStream;
use h2::{
server::{Connection, SendResponse},
SendStream,
};
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
use log::{error, trace};
@@ -37,13 +32,11 @@ where
S: Service<Request>,
B: MessageBody,
{
flow: Rc<RefCell<HttpFlow<S, X, U>>>,
flow: Rc<HttpFlow<S, X, U>>,
connection: Connection<T, Bytes>,
on_connect_data: OnConnectData,
config: ServiceConfig,
peer_addr: Option<net::SocketAddr>,
ka_expire: Instant,
ka_timer: Option<Sleep>,
_phantom: PhantomData<B>,
}
@@ -56,37 +49,18 @@ where
B: MessageBody,
{
pub(crate) fn new(
services: Rc<RefCell<HttpFlow<S, X, U>>>,
flow: Rc<HttpFlow<S, X, U>>,
connection: Connection<T, Bytes>,
on_connect_data: OnConnectData,
config: ServiceConfig,
timeout: Option<Sleep>,
peer_addr: Option<net::SocketAddr>,
) -> Self {
// let keepalive = config.keep_alive_enabled();
// let flags = if keepalive {
// Flags::KEEPALIVE | Flags::KEEPALIVE_ENABLED
// } else {
// Flags::empty()
// };
// keep-alive timer
let (ka_expire, ka_timer) = if let Some(delay) = timeout {
(delay.deadline(), Some(delay))
} else if let Some(delay) = config.keep_alive_timer() {
(delay.deadline(), Some(delay))
} else {
(config.now(), None)
};
Dispatcher {
flow: services,
flow,
config,
peer_addr,
connection,
on_connect_data,
ka_expire,
ka_timer,
_phantom: PhantomData,
}
}
@@ -114,19 +88,12 @@ where
Some(Err(err)) => return Poll::Ready(Err(err.into())),
Some(Ok((req, res))) => {
// update keep-alive expire
if this.ka_timer.is_some() {
if let Some(expire) = this.config.keep_alive_expire() {
this.ka_expire = expire;
}
}
let (parts, body) = req.into_parts();
let pl = crate::h2::Payload::new(body);
let pl = Payload::<crate::payload::PayloadStream>::H2(pl);
let mut req = Request::with_payload(pl);
let head = &mut req.head_mut();
let head = req.head_mut();
head.uri = parts.uri;
head.method = parts.method;
head.version = parts.version;
@@ -136,9 +103,9 @@ where
// merge on_connect_ext data into request extensions
this.on_connect_data.merge_into(&mut req);
let svc = ServiceResponse::<S::Future, S::Response, S::Error, B> {
let svc = ServiceResponse {
state: ServiceResponseState::ServiceCall(
this.flow.borrow_mut().service.call(req),
this.flow.service.call(req),
Some(res),
),
config: this.config.clone(),
@@ -204,16 +171,22 @@ where
BodySize::Empty => res
.headers_mut()
.insert(CONTENT_LENGTH, HeaderValue::from_static("0")),
BodySize::Sized(len) => res.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::try_from(format!("{}", len)).unwrap(),
),
BodySize::Sized(len) => {
let mut buf = itoa::Buffer::new();
res.headers_mut().insert(
CONTENT_LENGTH,
HeaderValue::from_str(buf.format(*len)).unwrap(),
)
}
};
// copy headers
for (key, value) in head.headers.iter() {
match *key {
// omit HTTP/1 only headers
// TODO: consider skipping other headers according to:
// https://tools.ietf.org/html/rfc7540#section-8.1.2.2
// omit HTTP/1.x only headers
CONNECTION | TRANSFER_ENCODING => continue,
CONTENT_LENGTH if skip_len => continue,
DATE => has_date = true,
@@ -312,57 +285,50 @@ where
ServiceResponseStateProj::SendPayload(ref mut stream, ref mut body) => {
loop {
loop {
match this.buffer {
Some(ref mut buffer) => {
match ready!(stream.poll_capacity(cx)) {
None => return Poll::Ready(()),
match this.buffer {
Some(ref mut buffer) => match ready!(stream.poll_capacity(cx)) {
None => return Poll::Ready(()),
Some(Ok(cap)) => {
let len = buffer.len();
let bytes = buffer.split_to(cmp::min(cap, len));
Some(Ok(cap)) => {
let len = buffer.len();
let bytes = buffer.split_to(cmp::min(cap, len));
if let Err(e) = stream.send_data(bytes, false) {
warn!("{:?}", e);
return Poll::Ready(());
} else if !buffer.is_empty() {
let cap = cmp::min(buffer.len(), CHUNK_SIZE);
stream.reserve_capacity(cap);
} else {
this.buffer.take();
}
}
Some(Err(e)) => {
warn!("{:?}", e);
return Poll::Ready(());
}
if let Err(e) = stream.send_data(bytes, false) {
warn!("{:?}", e);
return Poll::Ready(());
} else if !buffer.is_empty() {
let cap = cmp::min(buffer.len(), CHUNK_SIZE);
stream.reserve_capacity(cap);
} else {
this.buffer.take();
}
}
None => match ready!(body.as_mut().poll_next(cx)) {
None => {
if let Err(e) = stream.send_data(Bytes::new(), true)
{
warn!("{:?}", e);
}
return Poll::Ready(());
}
Some(Err(e)) => {
warn!("{:?}", e);
return Poll::Ready(());
}
},
Some(Ok(chunk)) => {
stream.reserve_capacity(cmp::min(
chunk.len(),
CHUNK_SIZE,
));
*this.buffer = Some(chunk);
None => match ready!(body.as_mut().poll_next(cx)) {
None => {
if let Err(e) = stream.send_data(Bytes::new(), true) {
warn!("{:?}", e);
}
return Poll::Ready(());
}
Some(Err(e)) => {
error!("Response payload stream error: {:?}", e);
return Poll::Ready(());
}
},
}
Some(Ok(chunk)) => {
stream
.reserve_capacity(cmp::min(chunk.len(), CHUNK_SIZE));
*this.buffer = Some(chunk);
}
Some(Err(e)) => {
error!("Response payload stream error: {:?}", e);
return Poll::Ready(());
}
},
}
}
}

View File

@@ -1,4 +1,4 @@
//! HTTP/2 implementation.
//! HTTP/2 protocol.
use std::{
pin::Pin,

View File

@@ -1,4 +1,3 @@
use std::cell::RefCell;
use std::future::Future;
use std::marker::PhantomData;
use std::pin::Pin;
@@ -11,10 +10,10 @@ use actix_service::{
fn_factory, fn_service, pipeline_factory, IntoServiceFactory, Service,
ServiceFactory,
};
use actix_utils::future::ready;
use bytes::Bytes;
use futures_core::ready;
use futures_util::future::ok;
use h2::server::{self, Handshake};
use futures_core::{future::LocalBoxFuture, ready};
use h2::server::{handshake, Handshake};
use log::error;
use crate::body::MessageBody;
@@ -66,6 +65,7 @@ where
impl<S, B> H2Service<TcpStream, S, B>
where
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
@@ -81,11 +81,11 @@ where
Error = DispatchError,
InitError = S::InitError,
> {
pipeline_factory(fn_factory(|| async {
Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
pipeline_factory(fn_factory(|| {
ready(Ok::<_, S::InitError>(fn_service(|io: TcpStream| {
let peer_addr = io.peer_addr().ok();
ok::<_, DispatchError>((io, peer_addr))
}))
ready(Ok::<_, DispatchError>((io, peer_addr)))
})))
}))
.and_then(self)
}
@@ -94,14 +94,15 @@ where
#[cfg(feature = "openssl")]
mod openssl {
use actix_service::{fn_factory, fn_service, ServiceFactoryExt};
use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, SslStream};
use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, TlsStream};
use actix_tls::accept::TlsError;
use super::*;
impl<S, B> H2Service<SslStream<TcpStream>, S, B>
impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
where
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
@@ -124,10 +125,12 @@ mod openssl {
.map_init_err(|_| panic!()),
)
.and_then(fn_factory(|| {
ok::<_, S::InitError>(fn_service(|io: SslStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ok((io, peer_addr))
}))
ready(Ok::<_, S::InitError>(fn_service(
|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().peer_addr().ok();
ready(Ok((io, peer_addr)))
},
)))
}))
.and_then(self.map_err(TlsError::Service))
}
@@ -145,6 +148,7 @@ mod rustls {
impl<S, B> H2Service<TlsStream<TcpStream>, S, B>
where
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
@@ -170,10 +174,12 @@ mod rustls {
.map_init_err(|_| panic!()),
)
.and_then(fn_factory(|| {
ok::<_, S::InitError>(fn_service(|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ok((io, peer_addr))
}))
ready(Ok::<_, S::InitError>(fn_service(
|io: TlsStream<TcpStream>| {
let peer_addr = io.get_ref().0.peer_addr().ok();
ready(Ok((io, peer_addr)))
},
)))
}))
.and_then(self.map_err(TlsError::Service))
}
@@ -182,8 +188,9 @@ mod rustls {
impl<T, S, B> ServiceFactory<(T, Option<net::SocketAddr>)> for H2Service<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
T: AsyncRead + AsyncWrite + Unpin + 'static,
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
@@ -194,62 +201,26 @@ where
type Config = ();
type Service = H2ServiceHandler<T, S::Service, B>;
type InitError = S::InitError;
type Future = H2ServiceResponse<T, S, B>;
type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: ()) -> Self::Future {
H2ServiceResponse {
fut: self.srv.new_service(()),
cfg: Some(self.cfg.clone()),
on_connect_ext: self.on_connect_ext.clone(),
_phantom: PhantomData,
}
}
}
let service = self.srv.new_service(());
let cfg = self.cfg.clone();
let on_connect_ext = self.on_connect_ext.clone();
#[doc(hidden)]
#[pin_project::pin_project]
pub struct H2ServiceResponse<T, S, B>
where
S: ServiceFactory<Request>,
{
#[pin]
fut: S::Future,
cfg: Option<ServiceConfig>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
_phantom: PhantomData<B>,
}
impl<T, S, B> Future for H2ServiceResponse<T, S, B>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request, Config = ()>,
S::Error: Into<Error> + 'static,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
{
type Output = Result<H2ServiceHandler<T, S::Service, B>, S::InitError>;
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let this = self.as_mut().project();
this.fut.poll(cx).map_ok(|service| {
let this = self.as_mut().project();
H2ServiceHandler::new(
this.cfg.take().unwrap(),
this.on_connect_ext.clone(),
service,
)
Box::pin(async move {
let service = service.await?;
Ok(H2ServiceHandler::new(cfg, on_connect_ext, service))
})
}
}
/// `Service` implementation for http/2 transport
/// `Service` implementation for HTTP/2 transport
pub struct H2ServiceHandler<T, S, B>
where
S: Service<Request>,
{
flow: Rc<RefCell<HttpFlow<S, (), ()>>>,
flow: Rc<HttpFlow<S, (), ()>>,
cfg: ServiceConfig,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
_phantom: PhantomData<B>,
@@ -290,15 +261,15 @@ where
type Error = DispatchError;
type Future = H2ServiceHandlerResponse<T, S, B>;
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.flow.borrow_mut().service.poll_ready(cx).map_err(|e| {
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self.flow.service.poll_ready(cx).map_err(|e| {
let e = e.into();
error!("Service readiness error: {:?}", e);
DispatchError::Service(e)
})
}
fn call(&mut self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
fn call(&self, (io, addr): (T, Option<net::SocketAddr>)) -> Self::Future {
let on_connect_data =
OnConnectData::from_io(&io, self.on_connect_ext.as_deref());
@@ -308,7 +279,7 @@ where
Some(self.cfg.clone()),
addr,
on_connect_data,
server::handshake(io),
handshake(io),
),
}
}
@@ -321,7 +292,7 @@ where
{
Incoming(Dispatcher<T, S, B, (), ()>),
Handshake(
Option<Rc<RefCell<HttpFlow<S, (), ()>>>>,
Option<Rc<HttpFlow<S, (), ()>>>,
Option<ServiceConfig>,
Option<net::SocketAddr>,
OnConnectData,
@@ -369,7 +340,6 @@ where
conn,
on_connect_data,
config.take().unwrap(),
None,
*peer_addr,
));
self.poll(cx)

View File

@@ -0,0 +1,48 @@
//! Helper trait for types that can be effectively borrowed as a [HeaderValue].
//!
//! [HeaderValue]: crate::http::HeaderValue
use std::{borrow::Cow, str::FromStr};
use http::header::{HeaderName, InvalidHeaderName};
pub trait AsHeaderName: Sealed {}
pub trait Sealed {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName>;
}
impl Sealed for HeaderName {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
Ok(Cow::Borrowed(self))
}
}
impl AsHeaderName for HeaderName {}
impl Sealed for &HeaderName {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
Ok(Cow::Borrowed(*self))
}
}
impl AsHeaderName for &HeaderName {}
impl Sealed for &str {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
HeaderName::from_str(self).map(Cow::Owned)
}
}
impl AsHeaderName for &str {}
impl Sealed for String {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
HeaderName::from_str(self).map(Cow::Owned)
}
}
impl AsHeaderName for String {}
impl Sealed for &String {
fn try_as_name(&self) -> Result<Cow<'_, HeaderName>, InvalidHeaderName> {
HeaderName::from_str(self).map(Cow::Owned)
}
}
impl AsHeaderName for &String {}

View File

@@ -0,0 +1,117 @@
use std::convert::TryFrom;
use http::{
header::{HeaderName, InvalidHeaderName, InvalidHeaderValue},
Error as HttpError, HeaderValue,
};
use super::{Header, IntoHeaderValue};
/// Transforms structures into header K/V pairs for inserting into `HeaderMap`s.
pub trait IntoHeaderPair: Sized {
type Error: Into<HttpError>;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error>;
}
#[derive(Debug)]
pub enum InvalidHeaderPart {
Name(InvalidHeaderName),
Value(InvalidHeaderValue),
}
impl From<InvalidHeaderPart> for HttpError {
fn from(part_err: InvalidHeaderPart) -> Self {
match part_err {
InvalidHeaderPart::Name(err) => err.into(),
InvalidHeaderPart::Value(err) => err.into(),
}
}
}
impl<V> IntoHeaderPair for (HeaderName, V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
let value = value
.try_into_value()
.map_err(|err| InvalidHeaderPart::Value(err.into()))?;
Ok((name, value))
}
}
impl<V> IntoHeaderPair for (&HeaderName, V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
let value = value
.try_into_value()
.map_err(|err| InvalidHeaderPart::Value(err.into()))?;
Ok((name.clone(), value))
}
}
impl<V> IntoHeaderPair for (&[u8], V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
let name = HeaderName::try_from(name).map_err(InvalidHeaderPart::Name)?;
let value = value
.try_into_value()
.map_err(|err| InvalidHeaderPart::Value(err.into()))?;
Ok((name, value))
}
}
impl<V> IntoHeaderPair for (&str, V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
let name = HeaderName::try_from(name).map_err(InvalidHeaderPart::Name)?;
let value = value
.try_into_value()
.map_err(|err| InvalidHeaderPart::Value(err.into()))?;
Ok((name, value))
}
}
impl<V> IntoHeaderPair for (String, V)
where
V: IntoHeaderValue,
V::Error: Into<InvalidHeaderValue>,
{
type Error = InvalidHeaderPart;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
let (name, value) = self;
(name.as_str(), value).try_into_header_pair()
}
}
impl<T: Header> IntoHeaderPair for T {
type Error = <T as IntoHeaderValue>::Error;
fn try_into_header_pair(self) -> Result<(HeaderName, HeaderValue), Self::Error> {
Ok((T::name(), self.try_into_value()?))
}
}

View File

@@ -0,0 +1,131 @@
use std::convert::TryFrom;
use bytes::Bytes;
use http::{header::InvalidHeaderValue, Error as HttpError, HeaderValue};
use mime::Mime;
/// A trait for any object that can be Converted to a `HeaderValue`
pub trait IntoHeaderValue: Sized {
/// The type returned in the event of a conversion error.
type Error: Into<HttpError>;
/// Try to convert value to a HeaderValue.
fn try_into_value(self) -> Result<HeaderValue, Self::Error>;
}
impl IntoHeaderValue for HeaderValue {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
Ok(self)
}
}
impl IntoHeaderValue for &HeaderValue {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
Ok(self.clone())
}
}
impl IntoHeaderValue for &str {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
self.parse()
}
}
impl IntoHeaderValue for &[u8] {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_bytes(self)
}
}
impl IntoHeaderValue for Bytes {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_maybe_shared(self)
}
}
impl IntoHeaderValue for Vec<u8> {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self)
}
}
impl IntoHeaderValue for String {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self)
}
}
impl IntoHeaderValue for usize {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for i64 {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for u64 {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for i32 {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for u32 {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self.to_string())
}
}
impl IntoHeaderValue for Mime {
type Error = InvalidHeaderValue;
#[inline]
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_str(self.as_ref())
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -1,35 +1,34 @@
//! Various http headers
// This is mostly copy of [hyper](https://github.com/hyperium/hyper/tree/master/src/header)
//! Typed HTTP headers, pre-defined `HeaderName`s, traits for parsing and conversion, and other
//! header utility methods.
use std::convert::TryFrom;
use std::{fmt, str::FromStr};
use bytes::{Bytes, BytesMut};
use http::Error as HttpError;
use mime::Mime;
use percent_encoding::{AsciiSet, CONTROLS};
pub use http::header::*;
use crate::error::ParseError;
use crate::httpmessage::HttpMessage;
use crate::HttpMessage;
mod as_name;
mod into_pair;
mod into_value;
mod utils;
mod common;
pub(crate) mod map;
mod shared;
pub use self::common::*;
#[doc(hidden)]
pub use self::shared::*;
pub use self::as_name::AsHeaderName;
pub use self::into_pair::IntoHeaderPair;
pub use self::into_value::IntoHeaderValue;
#[doc(hidden)]
pub use self::map::GetAll;
pub use self::map::HeaderMap;
pub use self::utils::*;
/// A trait for any object that will represent a header field and value.
pub trait Header
where
Self: IntoHeaderValue,
{
/// A trait for any object that already represents a valid header field and value.
pub trait Header: IntoHeaderValue {
/// Returns the name of the header field
fn name() -> HeaderName;
@@ -37,358 +36,15 @@ where
fn parse<T: HttpMessage>(msg: &T) -> Result<Self, ParseError>;
}
/// A trait for any object that can be Converted to a `HeaderValue`
pub trait IntoHeaderValue: Sized {
/// The type returned in the event of a conversion error.
type Error: Into<HttpError>;
/// Try to convert value to a Header value.
fn try_into(self) -> Result<HeaderValue, Self::Error>;
}
impl IntoHeaderValue for HeaderValue {
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
Ok(self)
}
}
impl<'a> IntoHeaderValue for &'a str {
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
self.parse()
}
}
impl<'a> IntoHeaderValue for &'a [u8] {
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_bytes(self)
}
}
impl IntoHeaderValue for Bytes {
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::from_maybe_shared(self)
}
}
impl IntoHeaderValue for Vec<u8> {
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self)
}
}
impl IntoHeaderValue for String {
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(self)
}
}
impl IntoHeaderValue for usize {
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let s = format!("{}", self);
HeaderValue::try_from(s)
}
}
impl IntoHeaderValue for u64 {
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
let s = format!("{}", self);
HeaderValue::try_from(s)
}
}
impl IntoHeaderValue for Mime {
type Error = InvalidHeaderValue;
#[inline]
fn try_into(self) -> Result<HeaderValue, Self::Error> {
HeaderValue::try_from(format!("{}", self))
}
}
/// Represents supported types of content encodings
#[derive(Copy, Clone, PartialEq, Debug)]
pub enum ContentEncoding {
/// Automatically select encoding based on encoding negotiation
Auto,
/// A format using the Brotli algorithm
Br,
/// A format using the zlib structure with deflate algorithm
Deflate,
/// Gzip algorithm
Gzip,
/// Indicates the identity function (i.e. no compression, nor modification)
Identity,
}
impl ContentEncoding {
#[inline]
/// Is the content compressed?
pub fn is_compression(self) -> bool {
matches!(self, ContentEncoding::Identity | ContentEncoding::Auto)
}
#[inline]
/// Convert content encoding to string
pub fn as_str(self) -> &'static str {
match self {
ContentEncoding::Br => "br",
ContentEncoding::Gzip => "gzip",
ContentEncoding::Deflate => "deflate",
ContentEncoding::Identity | ContentEncoding::Auto => "identity",
}
}
#[inline]
/// default quality value
pub fn quality(self) -> f64 {
match self {
ContentEncoding::Br => 1.1,
ContentEncoding::Gzip => 1.0,
ContentEncoding::Deflate => 0.9,
ContentEncoding::Identity | ContentEncoding::Auto => 0.1,
}
}
}
impl<'a> From<&'a str> for ContentEncoding {
fn from(s: &'a str) -> ContentEncoding {
let s = s.trim();
if s.eq_ignore_ascii_case("br") {
ContentEncoding::Br
} else if s.eq_ignore_ascii_case("gzip") {
ContentEncoding::Gzip
} else if s.eq_ignore_ascii_case("deflate") {
ContentEncoding::Deflate
} else {
ContentEncoding::Identity
}
}
}
#[doc(hidden)]
pub(crate) struct Writer {
buf: BytesMut,
}
impl Writer {
fn new() -> Writer {
Writer {
buf: BytesMut::new(),
}
}
fn take(&mut self) -> Bytes {
self.buf.split().freeze()
}
}
impl fmt::Write for Writer {
#[inline]
fn write_str(&mut self, s: &str) -> fmt::Result {
self.buf.extend_from_slice(s.as_bytes());
Ok(())
}
#[inline]
fn write_fmt(&mut self, args: fmt::Arguments<'_>) -> fmt::Result {
fmt::write(self, args)
}
}
#[inline]
#[doc(hidden)]
/// Reads a comma-delimited raw header into a Vec.
pub fn from_comma_delimited<'a, I: Iterator<Item = &'a HeaderValue> + 'a, T: FromStr>(
all: I,
) -> Result<Vec<T>, ParseError> {
let mut result = Vec::new();
for h in all {
let s = h.to_str().map_err(|_| ParseError::Header)?;
result.extend(
s.split(',')
.filter_map(|x| match x.trim() {
"" => None,
y => Some(y),
})
.filter_map(|x| x.trim().parse().ok()),
)
}
Ok(result)
}
#[inline]
#[doc(hidden)]
/// Reads a single string when parsing a header.
pub fn from_one_raw_str<T: FromStr>(val: Option<&HeaderValue>) -> Result<T, ParseError> {
if let Some(line) = val {
let line = line.to_str().map_err(|_| ParseError::Header)?;
if !line.is_empty() {
return T::from_str(line).or(Err(ParseError::Header));
}
}
Err(ParseError::Header)
}
#[inline]
#[doc(hidden)]
/// Format an array into a comma-delimited string.
pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter<'_>, parts: &[T]) -> fmt::Result
where
T: fmt::Display,
{
let mut iter = parts.iter();
if let Some(part) = iter.next() {
fmt::Display::fmt(part, f)?;
}
for part in iter {
f.write_str(", ")?;
fmt::Display::fmt(part, f)?;
}
Ok(())
}
// From hyper v0.11.27 src/header/parsing.rs
/// The value part of an extended parameter consisting of three parts:
/// the REQUIRED character set name (`charset`), the OPTIONAL language information (`language_tag`),
/// and a character sequence representing the actual value (`value`), separated by single quote
/// characters. It is defined in [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
#[derive(Clone, Debug, PartialEq)]
pub struct ExtendedValue {
/// The character set that is used to encode the `value` to a string.
pub charset: Charset,
/// The human language details of the `value`, if available.
pub language_tag: Option<LanguageTag>,
/// The parameter value, as expressed in octets.
pub value: Vec<u8>,
}
/// Parses extended header parameter values (`ext-value`), as defined in
/// [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
///
/// Extended values are denoted by parameter names that end with `*`.
///
/// ## ABNF
///
/// ```text
/// ext-value = charset "'" [ language ] "'" value-chars
/// ; like RFC 2231's <extended-initial-value>
/// ; (see [RFC2231], Section 7)
///
/// charset = "UTF-8" / "ISO-8859-1" / mime-charset
///
/// mime-charset = 1*mime-charsetc
/// mime-charsetc = ALPHA / DIGIT
/// / "!" / "#" / "$" / "%" / "&"
/// / "+" / "-" / "^" / "_" / "`"
/// / "{" / "}" / "~"
/// ; as <mime-charset> in Section 2.3 of [RFC2978]
/// ; except that the single quote is not included
/// ; SHOULD be registered in the IANA charset registry
///
/// language = <Language-Tag, defined in [RFC5646], Section 2.1>
///
/// value-chars = *( pct-encoded / attr-char )
///
/// pct-encoded = "%" HEXDIG HEXDIG
/// ; see [RFC3986], Section 2.1
///
/// attr-char = ALPHA / DIGIT
/// / "!" / "#" / "$" / "&" / "+" / "-" / "."
/// / "^" / "_" / "`" / "|" / "~"
/// ; token except ( "*" / "'" / "%" )
/// ```
pub fn parse_extended_value(
val: &str,
) -> Result<ExtendedValue, crate::error::ParseError> {
// Break into three pieces separated by the single-quote character
let mut parts = val.splitn(3, '\'');
// Interpret the first piece as a Charset
let charset: Charset = match parts.next() {
None => return Err(crate::error::ParseError::Header),
Some(n) => FromStr::from_str(n).map_err(|_| crate::error::ParseError::Header)?,
};
// Interpret the second piece as a language tag
let language_tag: Option<LanguageTag> = match parts.next() {
None => return Err(crate::error::ParseError::Header),
Some("") => None,
Some(s) => match s.parse() {
Ok(lt) => Some(lt),
Err(_) => return Err(crate::error::ParseError::Header),
},
};
// Interpret the third piece as a sequence of value characters
let value: Vec<u8> = match parts.next() {
None => return Err(crate::error::ParseError::Header),
Some(v) => percent_encoding::percent_decode(v.as_bytes()).collect(),
};
Ok(ExtendedValue {
value,
charset,
language_tag,
})
}
impl fmt::Display for ExtendedValue {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
let encoded_value =
percent_encoding::percent_encode(&self.value[..], HTTP_VALUE);
if let Some(ref lang) = self.language_tag {
write!(f, "{}'{}'{}", self.charset, lang, encoded_value)
} else {
write!(f, "{}''{}", self.charset, encoded_value)
}
}
}
/// Percent encode a sequence of bytes with a character set defined in
/// <https://tools.ietf.org/html/rfc5987#section-3.2>
pub fn http_percent_encode(f: &mut fmt::Formatter<'_>, bytes: &[u8]) -> fmt::Result {
let encoded = percent_encoding::percent_encode(bytes, HTTP_VALUE);
fmt::Display::fmt(&encoded, f)
}
/// Convert http::HeaderMap to a HeaderMap
/// Convert `http::HeaderMap` to our `HeaderMap`.
impl From<http::HeaderMap> for HeaderMap {
fn from(map: http::HeaderMap) -> HeaderMap {
let mut new_map = HeaderMap::with_capacity(map.capacity());
for (h, v) in map.iter() {
new_map.append(h.clone(), v.clone());
}
new_map
fn from(mut map: http::HeaderMap) -> HeaderMap {
HeaderMap::from_drain(map.drain())
}
}
// This encode set is used for HTTP header values and is defined at
// https://tools.ietf.org/html/rfc5987#section-3.2
/// This encode set is used for HTTP header values and is defined at
/// https://tools.ietf.org/html/rfc5987#section-3.2.
pub(crate) const HTTP_VALUE: &AsciiSet = &CONTROLS
.add(b' ')
.add(b'"')
@@ -410,91 +66,3 @@ pub(crate) const HTTP_VALUE: &AsciiSet = &CONTROLS
.add(b']')
.add(b'{')
.add(b'}');
#[cfg(test)]
mod tests {
use super::shared::Charset;
use super::{parse_extended_value, ExtendedValue};
use language_tags::LanguageTag;
#[test]
fn test_parse_extended_value_with_encoding_and_language_tag() {
let expected_language_tag = "en".parse::<LanguageTag>().unwrap();
// RFC 5987, Section 3.2.2
// Extended notation, using the Unicode character U+00A3 (POUND SIGN)
let result = parse_extended_value("iso-8859-1'en'%A3%20rates");
assert!(result.is_ok());
let extended_value = result.unwrap();
assert_eq!(Charset::Iso_8859_1, extended_value.charset);
assert!(extended_value.language_tag.is_some());
assert_eq!(expected_language_tag, extended_value.language_tag.unwrap());
assert_eq!(
vec![163, b' ', b'r', b'a', b't', b'e', b's'],
extended_value.value
);
}
#[test]
fn test_parse_extended_value_with_encoding() {
// RFC 5987, Section 3.2.2
// Extended notation, using the Unicode characters U+00A3 (POUND SIGN)
// and U+20AC (EURO SIGN)
let result = parse_extended_value("UTF-8''%c2%a3%20and%20%e2%82%ac%20rates");
assert!(result.is_ok());
let extended_value = result.unwrap();
assert_eq!(Charset::Ext("UTF-8".to_string()), extended_value.charset);
assert!(extended_value.language_tag.is_none());
assert_eq!(
vec![
194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
b't', b'e', b's',
],
extended_value.value
);
}
#[test]
fn test_parse_extended_value_missing_language_tag_and_encoding() {
// From: https://greenbytes.de/tech/tc2231/#attwithfn2231quot2
let result = parse_extended_value("foo%20bar.html");
assert!(result.is_err());
}
#[test]
fn test_parse_extended_value_partially_formatted() {
let result = parse_extended_value("UTF-8'missing third part");
assert!(result.is_err());
}
#[test]
fn test_parse_extended_value_partially_formatted_blank() {
let result = parse_extended_value("blank second part'");
assert!(result.is_err());
}
#[test]
fn test_fmt_extended_value_with_encoding_and_language_tag() {
let extended_value = ExtendedValue {
charset: Charset::Iso_8859_1,
language_tag: Some("en".parse().expect("Could not parse language tag")),
value: vec![163, b' ', b'r', b'a', b't', b'e', b's'],
};
assert_eq!("ISO-8859-1'en'%A3%20rates", format!("{}", extended_value));
}
#[test]
fn test_fmt_extended_value_with_encoding() {
let extended_value = ExtendedValue {
charset: Charset::Ext("UTF-8".to_string()),
language_tag: None,
value: vec![
194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
b't', b'e', b's',
],
};
assert_eq!(
"UTF-8''%C2%A3%20and%20%E2%82%AC%20rates",
format!("{}", extended_value)
);
}
}

View File

@@ -0,0 +1,106 @@
use std::{convert::Infallible, str::FromStr};
use http::header::InvalidHeaderValue;
use crate::{
error::ParseError,
header::{self, from_one_raw_str, Header, HeaderName, HeaderValue, IntoHeaderValue},
HttpMessage,
};
/// Represents a supported content encoding.
#[derive(Copy, Clone, PartialEq, Debug)]
pub enum ContentEncoding {
/// Automatically select encoding based on encoding negotiation.
Auto,
/// A format using the Brotli algorithm.
Br,
/// A format using the zlib structure with deflate algorithm.
Deflate,
/// Gzip algorithm.
Gzip,
/// Indicates the identity function (i.e. no compression, nor modification).
Identity,
}
impl ContentEncoding {
/// Is the content compressed?
#[inline]
pub fn is_compression(self) -> bool {
matches!(self, ContentEncoding::Identity | ContentEncoding::Auto)
}
/// Convert content encoding to string
#[inline]
pub fn as_str(self) -> &'static str {
match self {
ContentEncoding::Br => "br",
ContentEncoding::Gzip => "gzip",
ContentEncoding::Deflate => "deflate",
ContentEncoding::Identity | ContentEncoding::Auto => "identity",
}
}
/// Default Q-factor (quality) value.
#[inline]
pub fn quality(self) -> f64 {
match self {
ContentEncoding::Br => 1.1,
ContentEncoding::Gzip => 1.0,
ContentEncoding::Deflate => 0.9,
ContentEncoding::Identity | ContentEncoding::Auto => 0.1,
}
}
}
impl Default for ContentEncoding {
fn default() -> Self {
Self::Identity
}
}
impl FromStr for ContentEncoding {
type Err = Infallible;
fn from_str(val: &str) -> Result<Self, Self::Err> {
Ok(Self::from(val))
}
}
impl From<&str> for ContentEncoding {
fn from(val: &str) -> ContentEncoding {
let val = val.trim();
if val.eq_ignore_ascii_case("br") {
ContentEncoding::Br
} else if val.eq_ignore_ascii_case("gzip") {
ContentEncoding::Gzip
} else if val.eq_ignore_ascii_case("deflate") {
ContentEncoding::Deflate
} else {
ContentEncoding::default()
}
}
}
impl IntoHeaderValue for ContentEncoding {
type Error = InvalidHeaderValue;
fn try_into_value(self) -> Result<http::HeaderValue, Self::Error> {
Ok(HeaderValue::from_static(self.as_str()))
}
}
impl Header for ContentEncoding {
fn name() -> HeaderName {
header::CONTENT_ENCODING
}
fn parse<T: HttpMessage>(msg: &T) -> Result<Self, ParseError> {
from_one_raw_str(msg.headers().get(Self::name()))
}
}

View File

@@ -0,0 +1,193 @@
use std::{fmt, str::FromStr};
use language_tags::LanguageTag;
use crate::header::{Charset, HTTP_VALUE};
// From hyper v0.11.27 src/header/parsing.rs
/// The value part of an extended parameter consisting of three parts:
/// - The REQUIRED character set name (`charset`).
/// - The OPTIONAL language information (`language_tag`).
/// - A character sequence representing the actual value (`value`), separated by single quotes.
///
/// It is defined in [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
#[derive(Clone, Debug, PartialEq)]
pub struct ExtendedValue {
/// The character set that is used to encode the `value` to a string.
pub charset: Charset,
/// The human language details of the `value`, if available.
pub language_tag: Option<LanguageTag>,
/// The parameter value, as expressed in octets.
pub value: Vec<u8>,
}
/// Parses extended header parameter values (`ext-value`), as defined in
/// [RFC 5987](https://tools.ietf.org/html/rfc5987#section-3.2).
///
/// Extended values are denoted by parameter names that end with `*`.
///
/// ## ABNF
///
/// ```text
/// ext-value = charset "'" [ language ] "'" value-chars
/// ; like RFC 2231's <extended-initial-value>
/// ; (see [RFC2231], Section 7)
///
/// charset = "UTF-8" / "ISO-8859-1" / mime-charset
///
/// mime-charset = 1*mime-charsetc
/// mime-charsetc = ALPHA / DIGIT
/// / "!" / "#" / "$" / "%" / "&"
/// / "+" / "-" / "^" / "_" / "`"
/// / "{" / "}" / "~"
/// ; as <mime-charset> in Section 2.3 of [RFC2978]
/// ; except that the single quote is not included
/// ; SHOULD be registered in the IANA charset registry
///
/// language = <Language-Tag, defined in [RFC5646], Section 2.1>
///
/// value-chars = *( pct-encoded / attr-char )
///
/// pct-encoded = "%" HEXDIG HEXDIG
/// ; see [RFC3986], Section 2.1
///
/// attr-char = ALPHA / DIGIT
/// / "!" / "#" / "$" / "&" / "+" / "-" / "."
/// / "^" / "_" / "`" / "|" / "~"
/// ; token except ( "*" / "'" / "%" )
/// ```
pub fn parse_extended_value(
val: &str,
) -> Result<ExtendedValue, crate::error::ParseError> {
// Break into three pieces separated by the single-quote character
let mut parts = val.splitn(3, '\'');
// Interpret the first piece as a Charset
let charset: Charset = match parts.next() {
None => return Err(crate::error::ParseError::Header),
Some(n) => FromStr::from_str(n).map_err(|_| crate::error::ParseError::Header)?,
};
// Interpret the second piece as a language tag
let language_tag: Option<LanguageTag> = match parts.next() {
None => return Err(crate::error::ParseError::Header),
Some("") => None,
Some(s) => match s.parse() {
Ok(lt) => Some(lt),
Err(_) => return Err(crate::error::ParseError::Header),
},
};
// Interpret the third piece as a sequence of value characters
let value: Vec<u8> = match parts.next() {
None => return Err(crate::error::ParseError::Header),
Some(v) => percent_encoding::percent_decode(v.as_bytes()).collect(),
};
Ok(ExtendedValue {
charset,
language_tag,
value,
})
}
impl fmt::Display for ExtendedValue {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
let encoded_value =
percent_encoding::percent_encode(&self.value[..], HTTP_VALUE);
if let Some(ref lang) = self.language_tag {
write!(f, "{}'{}'{}", self.charset, lang, encoded_value)
} else {
write!(f, "{}''{}", self.charset, encoded_value)
}
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_parse_extended_value_with_encoding_and_language_tag() {
let expected_language_tag = "en".parse::<LanguageTag>().unwrap();
// RFC 5987, Section 3.2.2
// Extended notation, using the Unicode character U+00A3 (POUND SIGN)
let result = parse_extended_value("iso-8859-1'en'%A3%20rates");
assert!(result.is_ok());
let extended_value = result.unwrap();
assert_eq!(Charset::Iso_8859_1, extended_value.charset);
assert!(extended_value.language_tag.is_some());
assert_eq!(expected_language_tag, extended_value.language_tag.unwrap());
assert_eq!(
vec![163, b' ', b'r', b'a', b't', b'e', b's'],
extended_value.value
);
}
#[test]
fn test_parse_extended_value_with_encoding() {
// RFC 5987, Section 3.2.2
// Extended notation, using the Unicode characters U+00A3 (POUND SIGN)
// and U+20AC (EURO SIGN)
let result = parse_extended_value("UTF-8''%c2%a3%20and%20%e2%82%ac%20rates");
assert!(result.is_ok());
let extended_value = result.unwrap();
assert_eq!(Charset::Ext("UTF-8".to_string()), extended_value.charset);
assert!(extended_value.language_tag.is_none());
assert_eq!(
vec![
194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
b't', b'e', b's',
],
extended_value.value
);
}
#[test]
fn test_parse_extended_value_missing_language_tag_and_encoding() {
// From: https://greenbytes.de/tech/tc2231/#attwithfn2231quot2
let result = parse_extended_value("foo%20bar.html");
assert!(result.is_err());
}
#[test]
fn test_parse_extended_value_partially_formatted() {
let result = parse_extended_value("UTF-8'missing third part");
assert!(result.is_err());
}
#[test]
fn test_parse_extended_value_partially_formatted_blank() {
let result = parse_extended_value("blank second part'");
assert!(result.is_err());
}
#[test]
fn test_fmt_extended_value_with_encoding_and_language_tag() {
let extended_value = ExtendedValue {
charset: Charset::Iso_8859_1,
language_tag: Some("en".parse().expect("Could not parse language tag")),
value: vec![163, b' ', b'r', b'a', b't', b'e', b's'],
};
assert_eq!("ISO-8859-1'en'%A3%20rates", format!("{}", extended_value));
}
#[test]
fn test_fmt_extended_value_with_encoding() {
let extended_value = ExtendedValue {
charset: Charset::Ext("UTF-8".to_string()),
language_tag: None,
value: vec![
194, 163, b' ', b'a', b'n', b'd', b' ', 226, 130, 172, b' ', b'r', b'a',
b't', b'e', b's',
],
};
assert_eq!(
"UTF-8''%C2%A3%20and%20%E2%82%AC%20rates",
format!("{}", extended_value)
);
}
}

View File

@@ -1,18 +1,20 @@
use std::fmt::{self, Display};
use std::io::Write;
use std::str::FromStr;
use std::time::{SystemTime, UNIX_EPOCH};
use std::{
fmt,
io::Write,
str::FromStr,
time::{SystemTime, UNIX_EPOCH},
};
use bytes::buf::BufMut;
use bytes::BytesMut;
use http::header::{HeaderValue, InvalidHeaderValue};
use time::{offset, OffsetDateTime, PrimitiveDateTime};
use time::{OffsetDateTime, PrimitiveDateTime, UtcOffset};
use crate::error::ParseError;
use crate::header::IntoHeaderValue;
use crate::time_parser;
/// A timestamp with HTTP formatting and parsing
/// A timestamp with HTTP formatting and parsing.
#[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord)]
pub struct HttpDate(OffsetDateTime);
@@ -27,18 +29,12 @@ impl FromStr for HttpDate {
}
}
impl Display for HttpDate {
impl fmt::Display for HttpDate {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
fmt::Display::fmt(&self.0.format("%a, %d %b %Y %H:%M:%S GMT"), f)
}
}
impl From<OffsetDateTime> for HttpDate {
fn from(dt: OffsetDateTime) -> HttpDate {
HttpDate(dt)
}
}
impl From<SystemTime> for HttpDate {
fn from(sys: SystemTime) -> HttpDate {
HttpDate(PrimitiveDateTime::from(sys).assume_utc())
@@ -48,13 +44,13 @@ impl From<SystemTime> for HttpDate {
impl IntoHeaderValue for HttpDate {
type Error = InvalidHeaderValue;
fn try_into(self) -> Result<HeaderValue, Self::Error> {
fn try_into_value(self) -> Result<HeaderValue, Self::Error> {
let mut wrt = BytesMut::with_capacity(29).writer();
write!(
wrt,
"{}",
self.0
.to_offset(offset!(UTC))
.to_offset(UtcOffset::UTC)
.format("%a, %d %b %Y %H:%M:%S GMT")
)
.unwrap();

View File

@@ -1,14 +1,14 @@
//! Copied for `hyper::header::shared`;
//! Originally taken from `hyper::header::shared`.
mod charset;
mod content_encoding;
mod extended;
mod httpdate;
mod quality_item;
pub use self::charset::Charset;
pub use self::encoding::Encoding;
pub use self::entity::EntityTag;
pub use self::content_encoding::ContentEncoding;
pub use self::extended::{parse_extended_value, ExtendedValue};
pub use self::httpdate::HttpDate;
pub use self::quality_item::{q, qitem, Quality, QualityItem};
pub use language_tags::LanguageTag;
mod charset;
mod encoding;
mod entity;
mod httpdate;
mod quality_item;

View File

@@ -193,21 +193,69 @@ where
#[cfg(test)]
mod tests {
use super::super::encoding::*;
use super::*;
// copy of encoding from actix-web headers
#[derive(Clone, PartialEq, Debug)]
pub enum Encoding {
Chunked,
Brotli,
Gzip,
Deflate,
Compress,
Identity,
Trailers,
EncodingExt(String),
}
impl fmt::Display for Encoding {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
use Encoding::*;
f.write_str(match *self {
Chunked => "chunked",
Brotli => "br",
Gzip => "gzip",
Deflate => "deflate",
Compress => "compress",
Identity => "identity",
Trailers => "trailers",
EncodingExt(ref s) => s.as_ref(),
})
}
}
impl str::FromStr for Encoding {
type Err = crate::error::ParseError;
fn from_str(s: &str) -> Result<Encoding, crate::error::ParseError> {
use Encoding::*;
match s {
"chunked" => Ok(Chunked),
"br" => Ok(Brotli),
"deflate" => Ok(Deflate),
"gzip" => Ok(Gzip),
"compress" => Ok(Compress),
"identity" => Ok(Identity),
"trailers" => Ok(Trailers),
_ => Ok(EncodingExt(s.to_owned())),
}
}
}
#[test]
fn test_quality_item_fmt_q_1() {
use Encoding::*;
let x = qitem(Chunked);
assert_eq!(format!("{}", x), "chunked");
}
#[test]
fn test_quality_item_fmt_q_0001() {
use Encoding::*;
let x = QualityItem::new(Chunked, Quality(1));
assert_eq!(format!("{}", x), "chunked; q=0.001");
}
#[test]
fn test_quality_item_fmt_q_05() {
use Encoding::*;
// Custom value
let x = QualityItem {
item: EncodingExt("identity".to_owned()),
@@ -218,6 +266,7 @@ mod tests {
#[test]
fn test_quality_item_fmt_q_0() {
use Encoding::*;
// Custom value
let x = QualityItem {
item: EncodingExt("identity".to_owned()),
@@ -228,6 +277,7 @@ mod tests {
#[test]
fn test_quality_item_from_str1() {
use Encoding::*;
let x: Result<QualityItem<Encoding>, _> = "chunked".parse();
assert_eq!(
x.unwrap(),
@@ -237,8 +287,10 @@ mod tests {
}
);
}
#[test]
fn test_quality_item_from_str2() {
use Encoding::*;
let x: Result<QualityItem<Encoding>, _> = "chunked; q=1".parse();
assert_eq!(
x.unwrap(),
@@ -248,8 +300,10 @@ mod tests {
}
);
}
#[test]
fn test_quality_item_from_str3() {
use Encoding::*;
let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.5".parse();
assert_eq!(
x.unwrap(),
@@ -259,8 +313,10 @@ mod tests {
}
);
}
#[test]
fn test_quality_item_from_str4() {
use Encoding::*;
let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.273".parse();
assert_eq!(
x.unwrap(),
@@ -270,16 +326,19 @@ mod tests {
}
);
}
#[test]
fn test_quality_item_from_str5() {
let x: Result<QualityItem<Encoding>, _> = "gzip; q=0.2739999".parse();
assert!(x.is_err());
}
#[test]
fn test_quality_item_from_str6() {
let x: Result<QualityItem<Encoding>, _> = "gzip; q=2".parse();
assert!(x.is_err());
}
#[test]
fn test_quality_item_ordering() {
let x: QualityItem<Encoding> = "gzip; q=0.5".parse().ok().unwrap();

View File

@@ -0,0 +1,62 @@
use std::{fmt, str::FromStr};
use super::HeaderValue;
use crate::{error::ParseError, header::HTTP_VALUE};
/// Reads a comma-delimited raw header into a Vec.
#[inline]
pub fn from_comma_delimited<'a, I, T>(all: I) -> Result<Vec<T>, ParseError>
where
I: Iterator<Item = &'a HeaderValue> + 'a,
T: FromStr,
{
let mut result = Vec::new();
for h in all {
let s = h.to_str().map_err(|_| ParseError::Header)?;
result.extend(
s.split(',')
.filter_map(|x| match x.trim() {
"" => None,
y => Some(y),
})
.filter_map(|x| x.trim().parse().ok()),
)
}
Ok(result)
}
/// Reads a single string when parsing a header.
#[inline]
pub fn from_one_raw_str<T: FromStr>(val: Option<&HeaderValue>) -> Result<T, ParseError> {
if let Some(line) = val {
let line = line.to_str().map_err(|_| ParseError::Header)?;
if !line.is_empty() {
return T::from_str(line).or(Err(ParseError::Header));
}
}
Err(ParseError::Header)
}
/// Format an array into a comma-delimited string.
#[inline]
pub fn fmt_comma_delimited<T>(f: &mut fmt::Formatter<'_>, parts: &[T]) -> fmt::Result
where
T: fmt::Display,
{
let mut iter = parts.iter();
if let Some(part) = iter.next() {
fmt::Display::fmt(part, f)?;
}
for part in iter {
f.write_str(", ")?;
fmt::Display::fmt(part, f)?;
}
Ok(())
}
/// Percent encode a sequence of bytes with a character set defined in
/// <https://tools.ietf.org/html/rfc5987#section-3.2>
pub fn http_percent_encode(f: &mut fmt::Formatter<'_>, bytes: &[u8]) -> fmt::Result {
let encoded = percent_encoding::percent_encode(bytes, HTTP_VALUE);
fmt::Display::fmt(&encoded, f)
}

View File

@@ -1,15 +1,15 @@
use std::io;
use bytes::{BufMut, BytesMut};
use bytes::BufMut;
use http::Version;
const DIGITS_START: u8 = b'0';
pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
pub(crate) fn write_status_line<B: BufMut>(version: Version, n: u16, buf: &mut B) {
match version {
Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
Version::HTTP_11 => buf.put_slice(b"HTTP/1.1 "),
Version::HTTP_10 => buf.put_slice(b"HTTP/1.0 "),
Version::HTTP_09 => buf.put_slice(b"HTTP/0.9 "),
_ => {
// other HTTP version handlers do not use this method
}
@@ -19,33 +19,36 @@ pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut)
let d10 = ((n / 10) % 10) as u8;
let d1 = (n % 10) as u8;
bytes.put_u8(DIGITS_START + d100);
bytes.put_u8(DIGITS_START + d10);
bytes.put_u8(DIGITS_START + d1);
buf.put_u8(DIGITS_START + d100);
buf.put_u8(DIGITS_START + d10);
buf.put_u8(DIGITS_START + d1);
// trailing space before reason
bytes.put_u8(b' ');
buf.put_u8(b' ');
}
/// NOTE: bytes object has to contain enough space
pub fn write_content_length(n: u64, bytes: &mut BytesMut) {
pub fn write_content_length<B: BufMut>(n: u64, buf: &mut B) {
if n == 0 {
bytes.put_slice(b"\r\ncontent-length: 0\r\n");
buf.put_slice(b"\r\ncontent-length: 0\r\n");
return;
}
let mut buf = itoa::Buffer::new();
let mut buffer = itoa::Buffer::new();
bytes.put_slice(b"\r\ncontent-length: ");
bytes.put_slice(buf.format(n).as_bytes());
bytes.put_slice(b"\r\n");
buf.put_slice(b"\r\ncontent-length: ");
buf.put_slice(buffer.format(n).as_bytes());
buf.put_slice(b"\r\n");
}
pub(crate) struct Writer<'a>(pub &'a mut BytesMut);
pub(crate) struct Writer<'a, B>(pub &'a mut B);
impl<'a> io::Write for Writer<'a> {
impl<'a, B> io::Write for Writer<'a, B>
where
B: BufMut,
{
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
self.0.extend_from_slice(buf);
self.0.put_slice(buf);
Ok(buf.len())
}
@@ -58,6 +61,8 @@ impl<'a> io::Write for Writer<'a> {
mod tests {
use std::str::from_utf8;
use bytes::BytesMut;
use super::*;
#[test]

View File

@@ -67,6 +67,14 @@ impl Response {
static_resp!(ExpectationFailed, StatusCode::EXPECTATION_FAILED);
static_resp!(UnprocessableEntity, StatusCode::UNPROCESSABLE_ENTITY);
static_resp!(TooManyRequests, StatusCode::TOO_MANY_REQUESTS);
static_resp!(
RequestHeaderFieldsTooLarge,
StatusCode::REQUEST_HEADER_FIELDS_TOO_LARGE
);
static_resp!(
UnavailableForLegalReasons,
StatusCode::UNAVAILABLE_FOR_LEGAL_REASONS
);
static_resp!(InternalServerError, StatusCode::INTERNAL_SERVER_ERROR);
static_resp!(NotImplemented, StatusCode::NOT_IMPLEMENTED);

View File

@@ -5,15 +5,17 @@ use encoding_rs::{Encoding, UTF_8};
use http::header;
use mime::Mime;
use crate::cookie::Cookie;
use crate::error::{ContentTypeError, CookieParseError, ParseError};
use crate::error::{ContentTypeError, ParseError};
use crate::extensions::Extensions;
use crate::header::{Header, HeaderMap};
use crate::payload::Payload;
#[cfg(feature = "cookies")]
use crate::{cookie::Cookie, error::CookieParseError};
#[cfg(feature = "cookies")]
struct Cookies(Vec<Cookie<'static>>);
/// Trait that implements general purpose operations on http messages
/// Trait that implements general purpose operations on HTTP messages.
pub trait HttpMessage: Sized {
/// Type of message payload stream
type Stream;
@@ -30,8 +32,8 @@ pub trait HttpMessage: Sized {
/// Mutable reference to a the request's extensions container
fn extensions_mut(&self) -> RefMut<'_, Extensions>;
/// Get a header.
#[doc(hidden)]
/// Get a header
fn get_header<H: Header>(&self) -> Option<H>
where
Self: Sized,
@@ -43,8 +45,8 @@ pub trait HttpMessage: Sized {
}
}
/// Read the request content type. If request does not contain
/// *Content-Type* header, empty str get returned.
/// Read the request content type. If request did not contain a *Content-Type* header, an empty
/// string is returned.
fn content_type(&self) -> &str {
if let Some(content_type) = self.headers().get(header::CONTENT_TYPE) {
if let Ok(content_type) = content_type.to_str() {
@@ -90,7 +92,7 @@ pub trait HttpMessage: Sized {
Ok(None)
}
/// Check if request has chunked transfer encoding
/// Check if request has chunked transfer encoding.
fn chunked(&self) -> Result<bool, ParseError> {
if let Some(encodings) = self.headers().get(header::TRANSFER_ENCODING) {
if let Ok(s) = encodings.to_str() {
@@ -104,7 +106,7 @@ pub trait HttpMessage: Sized {
}
/// Load request cookies.
#[inline]
#[cfg(feature = "cookies")]
fn cookies(&self) -> Result<Ref<'_, Vec<Cookie<'static>>>, CookieParseError> {
if self.extensions().get::<Cookies>().is_none() {
let mut cookies = Vec::new();
@@ -119,12 +121,14 @@ pub trait HttpMessage: Sized {
}
self.extensions_mut().insert(Cookies(cookies));
}
Ok(Ref::map(self.extensions(), |ext| {
&ext.get::<Cookies>().unwrap().0
}))
}
/// Return request cookie.
#[cfg(feature = "cookies")]
fn cookie(&self, name: &str) -> Option<Cookie<'static>> {
if let Ok(cookies) = self.cookies() {
for cookie in cookies.iter() {
@@ -173,11 +177,13 @@ mod tests {
#[test]
fn test_content_type() {
let req = TestRequest::with_header("content-type", "text/plain").finish();
let req = TestRequest::default()
.insert_header(("content-type", "text/plain"))
.finish();
assert_eq!(req.content_type(), "text/plain");
let req =
TestRequest::with_header("content-type", "application/json; charset=utf=8")
.finish();
let req = TestRequest::default()
.insert_header(("content-type", "application/json; charset=utf=8"))
.finish();
assert_eq!(req.content_type(), "application/json");
let req = TestRequest::default().finish();
assert_eq!(req.content_type(), "");
@@ -185,13 +191,15 @@ mod tests {
#[test]
fn test_mime_type() {
let req = TestRequest::with_header("content-type", "application/json").finish();
let req = TestRequest::default()
.insert_header(("content-type", "application/json"))
.finish();
assert_eq!(req.mime_type().unwrap(), Some(mime::APPLICATION_JSON));
let req = TestRequest::default().finish();
assert_eq!(req.mime_type().unwrap(), None);
let req =
TestRequest::with_header("content-type", "application/json; charset=utf-8")
.finish();
let req = TestRequest::default()
.insert_header(("content-type", "application/json; charset=utf-8"))
.finish();
let mt = req.mime_type().unwrap().unwrap();
assert_eq!(mt.get_param(mime::CHARSET), Some(mime::UTF_8));
assert_eq!(mt.type_(), mime::APPLICATION);
@@ -200,11 +208,9 @@ mod tests {
#[test]
fn test_mime_type_error() {
let req = TestRequest::with_header(
"content-type",
"applicationadfadsfasdflknadsfklnadsfjson",
)
.finish();
let req = TestRequest::default()
.insert_header(("content-type", "applicationadfadsfasdflknadsfklnadsfjson"))
.finish();
assert_eq!(Err(ContentTypeError::ParseError), req.mime_type());
}
@@ -213,27 +219,27 @@ mod tests {
let req = TestRequest::default().finish();
assert_eq!(UTF_8.name(), req.encoding().unwrap().name());
let req = TestRequest::with_header("content-type", "application/json").finish();
let req = TestRequest::default()
.insert_header(("content-type", "application/json"))
.finish();
assert_eq!(UTF_8.name(), req.encoding().unwrap().name());
let req = TestRequest::with_header(
"content-type",
"application/json; charset=ISO-8859-2",
)
.finish();
let req = TestRequest::default()
.insert_header(("content-type", "application/json; charset=ISO-8859-2"))
.finish();
assert_eq!(ISO_8859_2, req.encoding().unwrap());
}
#[test]
fn test_encoding_error() {
let req = TestRequest::with_header("content-type", "applicatjson").finish();
let req = TestRequest::default()
.insert_header(("content-type", "applicatjson"))
.finish();
assert_eq!(Some(ContentTypeError::ParseError), req.encoding().err());
let req = TestRequest::with_header(
"content-type",
"application/json; charset=kkkttktk",
)
.finish();
let req = TestRequest::default()
.insert_header(("content-type", "application/json; charset=kkkttktk"))
.finish();
assert_eq!(
Some(ContentTypeError::UnknownEncoding),
req.encoding().err()
@@ -245,15 +251,16 @@ mod tests {
let req = TestRequest::default().finish();
assert!(!req.chunked().unwrap());
let req =
TestRequest::with_header(header::TRANSFER_ENCODING, "chunked").finish();
let req = TestRequest::default()
.insert_header((header::TRANSFER_ENCODING, "chunked"))
.finish();
assert!(req.chunked().unwrap());
let req = TestRequest::default()
.header(
.insert_header((
header::TRANSFER_ENCODING,
Bytes::from_static(b"some va\xadscc\xacas0xsdasdlue"),
)
))
.finish();
assert!(req.chunked().is_err());
}

View File

@@ -1,6 +1,21 @@
//! HTTP primitives for the Actix ecosystem.
//!
//! ## Crate Features
//! | Feature | Functionality |
//! | ---------------- | ----------------------------------------------------- |
//! | `openssl` | TLS support via [OpenSSL]. |
//! | `rustls` | TLS support via [rustls]. |
//! | `compress` | Payload compression support. (Deflate, Gzip & Brotli) |
//! | `cookies` | Support for cookies backed by the [cookie] crate. |
//! | `secure-cookies` | Adds for secure cookies. Enables `cookies` feature. |
//! | `trust-dns` | Use [trust-dns] as the client DNS resolver. |
//!
//! [OpenSSL]: https://crates.io/crates/openssl
//! [rustls]: https://crates.io/crates/rustls
//! [cookie]: https://crates.io/crates/cookie
//! [trust-dns]: https://crates.io/crates/trust-dns
#![deny(rust_2018_idioms)]
#![deny(rust_2018_idioms, nonstandard_style)]
#![allow(
clippy::type_complexity,
clippy::too_many_arguments,
@@ -25,8 +40,8 @@ pub mod encoding;
mod extensions;
mod header;
mod helpers;
mod httpcodes;
pub mod httpmessage;
mod http_codes;
mod http_message;
mod message;
mod payload;
mod request;
@@ -34,18 +49,20 @@ mod response;
mod service;
mod time_parser;
pub use cookie;
pub mod error;
pub mod h1;
pub mod h2;
pub mod test;
pub mod ws;
#[cfg(feature = "cookies")]
pub use cookie;
pub use self::builder::HttpServiceBuilder;
pub use self::config::{KeepAlive, ServiceConfig};
pub use self::error::{Error, ResponseError, Result};
pub use self::extensions::Extensions;
pub use self::httpmessage::HttpMessage;
pub use self::http_message::HttpMessage;
pub use self::message::{Message, RequestHead, RequestHeadType, ResponseHead};
pub use self::payload::{Payload, PayloadStream};
pub use self::request::Request;
@@ -53,7 +70,7 @@ pub use self::response::{Response, ResponseBuilder};
pub use self::service::HttpService;
pub mod http {
//! Various HTTP related types
//! Various HTTP related types.
// re-exports
pub use http::header::{HeaderName, HeaderValue};
@@ -61,10 +78,11 @@ pub mod http {
pub use http::{uri, Error, Uri};
pub use http::{Method, StatusCode, Version};
#[cfg(feature = "cookies")]
pub use crate::cookie::{Cookie, CookieBuilder};
pub use crate::header::HeaderMap;
/// Various http headers
/// A collection of HTTP headers and helpers.
pub mod header {
pub use crate::header::*;
}

View File

@@ -3,7 +3,6 @@ use std::net;
use std::rc::Rc;
use bitflags::bitflags;
use copyless::BoxHelper;
use crate::extensions::Extensions;
use crate::header::HeaderMap;
@@ -14,8 +13,10 @@ use crate::http::{header, Method, StatusCode, Uri, Version};
pub enum ConnectionType {
/// Close connection after response
Close,
/// Keep connection alive after response
KeepAlive,
/// Connection is upgraded to different type
Upgrade,
}
@@ -35,7 +36,9 @@ bitflags! {
pub trait Head: Default + 'static {
fn clear(&mut self);
fn pool() -> &'static MessagePool<Self>;
fn with_pool<F, R>(f: F) -> R
where
F: FnOnce(&MessagePool<Self>) -> R;
}
#[derive(Debug)]
@@ -70,8 +73,11 @@ impl Head for RequestHead {
self.extensions.get_mut().clear();
}
fn pool() -> &'static MessagePool<Self> {
REQUEST_POOL.with(|p| *p)
fn with_pool<F, R>(f: F) -> R
where
F: FnOnce(&MessagePool<Self>) -> R,
{
REQUEST_POOL.with(|p| f(p))
}
}
@@ -339,21 +345,15 @@ impl ResponseHead {
}
pub struct Message<T: Head> {
// Rc here should not be cloned by anyone.
// It's used to reuse allocation of T and no shared ownership is allowed.
head: Rc<T>,
}
impl<T: Head> Message<T> {
/// Get new message from the pool of objects
pub fn new() -> Self {
T::pool().get_message()
}
}
impl<T: Head> Clone for Message<T> {
fn clone(&self) -> Self {
Message {
head: self.head.clone(),
}
T::with_pool(|p| p.get_message())
}
}
@@ -373,9 +373,7 @@ impl<T: Head> std::ops::DerefMut for Message<T> {
impl<T: Head> Drop for Message<T> {
fn drop(&mut self) {
if Rc::strong_count(&self.head) == 1 {
T::pool().release(self.head.clone());
}
T::with_pool(|p| p.release(self.head.clone()))
}
}
@@ -427,18 +425,17 @@ pub struct MessagePool<T: Head>(RefCell<Vec<Rc<T>>>);
/// Request's objects pool
pub struct BoxedResponsePool(RefCell<Vec<Box<ResponseHead>>>);
thread_local!(static REQUEST_POOL: &'static MessagePool<RequestHead> = MessagePool::<RequestHead>::create());
thread_local!(static RESPONSE_POOL: &'static BoxedResponsePool = BoxedResponsePool::create());
thread_local!(static REQUEST_POOL: MessagePool<RequestHead> = MessagePool::<RequestHead>::create());
thread_local!(static RESPONSE_POOL: BoxedResponsePool = BoxedResponsePool::create());
impl<T: Head> MessagePool<T> {
fn create() -> &'static MessagePool<T> {
let pool = MessagePool(RefCell::new(Vec::with_capacity(128)));
Box::leak(Box::new(pool))
fn create() -> MessagePool<T> {
MessagePool(RefCell::new(Vec::with_capacity(128)))
}
/// Get message from the pool
#[inline]
fn get_message(&'static self) -> Message<T> {
fn get_message(&self) -> Message<T> {
if let Some(mut msg) = self.0.borrow_mut().pop() {
// Message is put in pool only when it's the last copy.
// which means it's guaranteed to be unique when popped out.
@@ -464,14 +461,13 @@ impl<T: Head> MessagePool<T> {
}
impl BoxedResponsePool {
fn create() -> &'static BoxedResponsePool {
let pool = BoxedResponsePool(RefCell::new(Vec::with_capacity(128)));
Box::leak(Box::new(pool))
fn create() -> BoxedResponsePool {
BoxedResponsePool(RefCell::new(Vec::with_capacity(128)))
}
/// Get message from the pool
#[inline]
fn get_message(&'static self, status: StatusCode) -> BoxedResponseHead {
fn get_message(&self, status: StatusCode) -> BoxedResponseHead {
if let Some(mut head) = self.0.borrow_mut().pop() {
head.reason = None;
head.status = status;
@@ -480,17 +476,17 @@ impl BoxedResponsePool {
BoxedResponseHead { head: Some(head) }
} else {
BoxedResponseHead {
head: Some(Box::alloc().init(ResponseHead::new(status))),
head: Some(Box::new(ResponseHead::new(status))),
}
}
}
#[inline]
/// Release request instance
fn release(&self, msg: Box<ResponseHead>) {
fn release(&self, mut msg: Box<ResponseHead>) {
let v = &mut self.0.borrow_mut();
if v.len() < 128 {
msg.extensions.borrow_mut().clear();
msg.extensions.get_mut().clear();
v.push(msg);
}
}

View File

@@ -1,13 +1,17 @@
use std::cell::{Ref, RefMut};
use std::{fmt, net};
//! HTTP requests.
use std::{
cell::{Ref, RefMut},
fmt, net,
};
use http::{header, Method, Uri, Version};
use crate::extensions::Extensions;
use crate::header::HeaderMap;
use crate::httpmessage::HttpMessage;
use crate::message::{Message, RequestHead};
use crate::payload::{Payload, PayloadStream};
use crate::HttpMessage;
/// Request
pub struct Request<P = PayloadStream> {
@@ -103,7 +107,7 @@ impl<P> Request<P> {
#[inline]
#[doc(hidden)]
/// Mutable reference to a http message part of the request
/// Mutable reference to a HTTP message part of the request
pub fn head_mut(&mut self) -> &mut RequestHead {
&mut *self.head
}
@@ -154,10 +158,12 @@ impl<P> Request<P> {
self.head().method == Method::CONNECT
}
/// Peer socket address
/// Peer socket address.
///
/// Peer address is actual socket address, if proxy is used in front of
/// actix http server, then peer address would be address of this proxy.
/// Peer address is the directly connected peer's socket address. If a proxy is used in front of
/// the Actix Web server, then it would be address of this proxy.
///
/// Will only return None when called in unit tests.
#[inline]
pub fn peer_addr(&self) -> Option<net::SocketAddr> {
self.head().peer_addr
@@ -173,13 +179,17 @@ impl<P> fmt::Debug for Request<P> {
self.method(),
self.path()
)?;
if let Some(q) = self.uri().query().as_ref() {
writeln!(f, " query: ?{:?}", q)?;
}
writeln!(f, " headers:")?;
for (key, val) in self.headers() {
for (key, val) in self.headers().iter() {
writeln!(f, " {:?}: {:?}", key, val)?;
}
Ok(())
}
}

View File

@@ -1,23 +1,31 @@
//! Http response
use std::cell::{Ref, RefMut};
use std::convert::TryFrom;
use std::future::Future;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, str};
//! HTTP responses.
use std::{
cell::{Ref, RefMut},
convert::TryInto,
fmt,
future::Future,
pin::Pin,
str,
task::{Context, Poll},
};
use bytes::{Bytes, BytesMut};
use futures_core::Stream;
use serde::Serialize;
use crate::body::{Body, BodyStream, MessageBody, ResponseBody};
use crate::cookie::{Cookie, CookieJar};
use crate::error::Error;
use crate::extensions::Extensions;
use crate::header::{Header, IntoHeaderValue};
use crate::http::header::{self, HeaderName, HeaderValue};
use crate::header::{IntoHeaderPair, IntoHeaderValue};
use crate::http::header::{self, HeaderName};
use crate::http::{Error as HttpError, HeaderMap, StatusCode};
use crate::message::{BoxedResponseHead, ConnectionType, ResponseHead};
#[cfg(feature = "cookies")]
use crate::{
cookie::{Cookie, CookieJar},
http::header::HeaderValue,
};
/// An HTTP Response
pub struct Response<B = Body> {
@@ -27,13 +35,13 @@ pub struct Response<B = Body> {
}
impl Response<Body> {
/// Create http response builder with specific status.
/// Create HTTP response builder with specific status.
#[inline]
pub fn build(status: StatusCode) -> ResponseBuilder {
ResponseBuilder::new(status)
}
/// Create http response builder
/// Create HTTP response builder
#[inline]
pub fn build_from<T: Into<ResponseBuilder>>(source: T) -> ResponseBuilder {
source.into()
@@ -92,7 +100,7 @@ impl<B> Response<B> {
}
#[inline]
/// Mutable reference to a http message part of the response
/// Mutable reference to a HTTP message part of the response
pub fn head_mut(&mut self) -> &mut ResponseHead {
&mut *self.head
}
@@ -128,6 +136,7 @@ impl<B> Response<B> {
}
/// Get an iterator for the cookies set by this response
#[cfg(feature = "cookies")]
#[inline]
pub fn cookies(&self) -> CookieIter<'_> {
CookieIter {
@@ -136,6 +145,7 @@ impl<B> Response<B> {
}
/// Add a cookie to this response
#[cfg(feature = "cookies")]
#[inline]
pub fn add_cookie(&mut self, cookie: &Cookie<'_>) -> Result<(), HttpError> {
let h = &mut self.head.headers;
@@ -148,6 +158,7 @@ impl<B> Response<B> {
/// Remove all cookies with the given name from this response. Returns
/// the number of cookies removed.
#[cfg(feature = "cookies")]
#[inline]
pub fn del_cookie(&mut self, name: &str) -> usize {
let h = &mut self.head.headers;
@@ -293,10 +304,12 @@ impl Future for Response {
}
}
#[cfg(feature = "cookies")]
pub struct CookieIter<'a> {
iter: header::GetAll<'a>,
}
#[cfg(feature = "cookies")]
impl<'a> Iterator for CookieIter<'a> {
type Item = Cookie<'a>;
@@ -311,13 +324,13 @@ impl<'a> Iterator for CookieIter<'a> {
}
}
/// An HTTP response builder
/// An HTTP response builder.
///
/// This type can be used to construct an instance of `Response` through a
/// builder-like pattern.
/// This type can be used to construct an instance of `Response` through a builder-like pattern.
pub struct ResponseBuilder {
head: Option<BoxedResponseHead>,
err: Option<HttpError>,
#[cfg(feature = "cookies")]
cookies: Option<CookieJar>,
}
@@ -328,6 +341,7 @@ impl ResponseBuilder {
ResponseBuilder {
head: Some(BoxedResponseHead::new(status)),
err: None,
#[cfg(feature = "cookies")]
cookies: None,
}
}
@@ -341,93 +355,98 @@ impl ResponseBuilder {
self
}
/// Set a header.
/// Insert a header, replacing any that were set with an equivalent field name.
///
/// ```rust
/// use actix_http::{http, Request, Response, Result};
///
/// fn index(req: Request) -> Result<Response> {
/// Ok(Response::Ok()
/// .set(http::header::IfModifiedSince(
/// "Sun, 07 Nov 1994 08:48:37 GMT".parse()?,
/// ))
/// .finish())
/// }
/// ```
#[doc(hidden)]
pub fn set<H: Header>(&mut self, hdr: H) -> &mut Self {
/// # use actix_http::Response;
/// use actix_http::http::header;
///
/// Response::Ok()
/// .insert_header((header::CONTENT_TYPE, mime::APPLICATION_JSON))
/// .insert_header(("X-TEST", "value"))
/// .finish();
/// ```
pub fn insert_header<H>(&mut self, header: H) -> &mut Self
where
H: IntoHeaderPair,
{
if let Some(parts) = parts(&mut self.head, &self.err) {
match hdr.try_into() {
Ok(value) => {
parts.headers.append(H::name(), value);
match header.try_into_header_pair() {
Ok((key, value)) => {
parts.headers.insert(key, value);
}
Err(e) => self.err = Some(e.into()),
}
};
}
self
}
/// Append a header to existing headers.
/// Append a header, keeping any that were set with an equivalent field name.
///
/// ```rust
/// use actix_http::{http, Request, Response};
///
/// fn index(req: Request) -> Response {
/// Response::Ok()
/// .header("X-TEST", "value")
/// .header(http::header::CONTENT_TYPE, "application/json")
/// .finish()
/// }
/// ```
pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self
/// # use actix_http::Response;
/// use actix_http::http::header;
///
/// Response::Ok()
/// .append_header((header::CONTENT_TYPE, mime::APPLICATION_JSON))
/// .append_header(("X-TEST", "value1"))
/// .append_header(("X-TEST", "value2"))
/// .finish();
/// ```
pub fn append_header<H>(&mut self, header: H) -> &mut Self
where
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue,
H: IntoHeaderPair,
{
if let Some(parts) = parts(&mut self.head, &self.err) {
match HeaderName::try_from(key) {
Ok(key) => match value.try_into() {
Ok(value) => {
parts.headers.append(key, value);
}
Err(e) => self.err = Some(e.into()),
},
match header.try_into_header_pair() {
Ok((key, value)) => parts.headers.append(key, value),
Err(e) => self.err = Some(e.into()),
};
}
self
}
/// Set a header.
///
/// ```rust
/// use actix_http::{http, Request, Response};
///
/// fn index(req: Request) -> Response {
/// Response::Ok()
/// .set_header("X-TEST", "value")
/// .set_header(http::header::CONTENT_TYPE, "application/json")
/// .finish()
/// }
/// ```
/// Replaced with [`Self::insert_header()`].
#[deprecated = "Replaced with `insert_header((key, value))`."]
pub fn set_header<K, V>(&mut self, key: K, value: V) -> &mut Self
where
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
K: TryInto<HeaderName>,
K::Error: Into<HttpError>,
V: IntoHeaderValue,
{
if let Some(parts) = parts(&mut self.head, &self.err) {
match HeaderName::try_from(key) {
Ok(key) => match value.try_into() {
Ok(value) => {
parts.headers.insert(key, value);
}
Err(e) => self.err = Some(e.into()),
},
Err(e) => self.err = Some(e.into()),
};
if self.err.is_some() {
return self;
}
match (key.try_into(), value.try_into_value()) {
(Ok(name), Ok(value)) => return self.insert_header((name, value)),
(Err(err), _) => self.err = Some(err.into()),
(_, Err(err)) => self.err = Some(err.into()),
}
self
}
/// Replaced with [`Self::append_header()`].
#[deprecated = "Replaced with `append_header((key, value))`."]
pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self
where
K: TryInto<HeaderName>,
K::Error: Into<HttpError>,
V: IntoHeaderValue,
{
if self.err.is_some() {
return self;
}
match (key.try_into(), value.try_into_value()) {
(Ok(name), Ok(value)) => return self.append_header((name, value)),
(Err(err), _) => self.err = Some(err.into()),
(_, Err(err)) => self.err = Some(err.into()),
}
self
}
@@ -458,7 +477,12 @@ impl ResponseBuilder {
if let Some(parts) = parts(&mut self.head, &self.err) {
parts.set_connection_type(ConnectionType::Upgrade);
}
self.set_header(header::UPGRADE, value)
if let Ok(value) = value.try_into_value() {
self.insert_header((header::UPGRADE, value));
}
self
}
/// Force close connection, even if it is marked as keep-alive
@@ -473,7 +497,8 @@ impl ResponseBuilder {
/// Disable chunked transfer encoding for HTTP/1.1 streaming responses.
#[inline]
pub fn no_chunking(&mut self, len: u64) -> &mut Self {
self.header(header::CONTENT_LENGTH, len);
let mut buf = itoa::Buffer::new();
self.insert_header((header::CONTENT_LENGTH, buf.format(len)));
if let Some(parts) = parts(&mut self.head, &self.err) {
parts.no_chunking(true);
@@ -481,15 +506,14 @@ impl ResponseBuilder {
self
}
/// Set response content type
/// Set response content type.
#[inline]
pub fn content_type<V>(&mut self, value: V) -> &mut Self
where
HeaderValue: TryFrom<V>,
<HeaderValue as TryFrom<V>>::Error: Into<HttpError>,
V: IntoHeaderValue,
{
if let Some(parts) = parts(&mut self.head, &self.err) {
match HeaderValue::try_from(value) {
match value.try_into_value() {
Ok(value) => {
parts.headers.insert(header::CONTENT_TYPE, value);
}
@@ -501,7 +525,7 @@ impl ResponseBuilder {
/// Set a cookie
///
/// ```rust
/// ```
/// use actix_http::{http, Request, Response};
///
/// fn index(req: Request) -> Response {
@@ -517,6 +541,7 @@ impl ResponseBuilder {
/// .finish()
/// }
/// ```
#[cfg(feature = "cookies")]
pub fn cookie<'c>(&mut self, cookie: Cookie<'c>) -> &mut Self {
if self.cookies.is_none() {
let mut jar = CookieJar::new();
@@ -530,7 +555,7 @@ impl ResponseBuilder {
/// Remove cookie
///
/// ```rust
/// ```
/// use actix_http::{http, Request, Response, HttpMessage};
///
/// fn index(req: Request) -> Response {
@@ -543,6 +568,7 @@ impl ResponseBuilder {
/// builder.finish()
/// }
/// ```
#[cfg(feature = "cookies")]
pub fn del_cookie<'a>(&mut self, cookie: &Cookie<'a>) -> &mut Self {
if self.cookies.is_none() {
self.cookies = Some(CookieJar::new())
@@ -610,8 +636,11 @@ impl ResponseBuilder {
return Response::from(Error::from(e)).into_body();
}
// allow unused mut when cookies feature is disabled
#[allow(unused_mut)]
let mut response = self.head.take().expect("cannot reuse response builder");
#[cfg(feature = "cookies")]
if let Some(ref jar) = self.cookies {
for cookie in jar.delta() {
match HeaderValue::from_str(&cookie.to_string()) {
@@ -640,27 +669,20 @@ impl ResponseBuilder {
self.body(Body::from_message(BodyStream::new(stream)))
}
#[inline]
/// Set a json body and generate `Response`
///
/// `ResponseBuilder` can not be used after this call.
pub fn json<T: Serialize>(&mut self, value: T) -> Response {
self.json2(&value)
}
/// Set a json body and generate `Response`
///
/// `ResponseBuilder` can not be used after this call.
pub fn json2<T: Serialize>(&mut self, value: &T) -> Response {
match serde_json::to_string(value) {
pub fn json(&mut self, value: impl Serialize) -> Response {
match serde_json::to_string(&value) {
Ok(body) => {
let contains = if let Some(parts) = parts(&mut self.head, &self.err) {
parts.headers.contains_key(header::CONTENT_TYPE)
} else {
true
};
if !contains {
self.header(header::CONTENT_TYPE, "application/json");
self.insert_header((header::CONTENT_TYPE, mime::APPLICATION_JSON));
}
self.body(Body::from(body))
@@ -682,6 +704,7 @@ impl ResponseBuilder {
ResponseBuilder {
head: self.head.take(),
err: self.err.take(),
#[cfg(feature = "cookies")]
cookies: self.cookies.take(),
}
}
@@ -701,21 +724,28 @@ fn parts<'a>(
/// Convert `Response` to a `ResponseBuilder`. Body get dropped.
impl<B> From<Response<B>> for ResponseBuilder {
fn from(res: Response<B>) -> ResponseBuilder {
// If this response has cookies, load them into a jar
let mut jar: Option<CookieJar> = None;
for c in res.cookies() {
if let Some(ref mut j) = jar {
j.add_original(c.into_owned());
} else {
let mut j = CookieJar::new();
j.add_original(c.into_owned());
jar = Some(j);
#[cfg(feature = "cookies")]
let jar = {
// If this response has cookies, load them into a jar
let mut jar: Option<CookieJar> = None;
for c in res.cookies() {
if let Some(ref mut j) = jar {
j.add_original(c.into_owned());
} else {
let mut j = CookieJar::new();
j.add_original(c.into_owned());
jar = Some(j);
}
}
}
jar
};
ResponseBuilder {
head: Some(res.head),
err: None,
#[cfg(feature = "cookies")]
cookies: jar,
}
}
@@ -724,33 +754,42 @@ impl<B> From<Response<B>> for ResponseBuilder {
/// Convert `ResponseHead` to a `ResponseBuilder`
impl<'a> From<&'a ResponseHead> for ResponseBuilder {
fn from(head: &'a ResponseHead) -> ResponseBuilder {
// If this response has cookies, load them into a jar
let mut jar: Option<CookieJar> = None;
let cookies = CookieIter {
iter: head.headers.get_all(header::SET_COOKIE),
};
for c in cookies {
if let Some(ref mut j) = jar {
j.add_original(c.into_owned());
} else {
let mut j = CookieJar::new();
j.add_original(c.into_owned());
jar = Some(j);
}
}
let mut msg = BoxedResponseHead::new(head.status);
msg.version = head.version;
msg.reason = head.reason;
for (k, v) in &head.headers {
for (k, v) in head.headers.iter() {
msg.headers.append(k.clone(), v.clone());
}
msg.no_chunking(!head.chunked());
#[cfg(feature = "cookies")]
let jar = {
// If this response has cookies, load them into a jar
let mut jar: Option<CookieJar> = None;
let cookies = CookieIter {
iter: head.headers.get_all(header::SET_COOKIE),
};
for c in cookies {
if let Some(ref mut j) = jar {
j.add_original(c.into_owned());
} else {
let mut j = CookieJar::new();
j.add_original(c.into_owned());
jar = Some(j);
}
}
jar
};
ResponseBuilder {
head: Some(msg),
err: None,
#[cfg(feature = "cookies")]
cookies: jar,
}
}
@@ -802,7 +841,7 @@ impl From<ResponseBuilder> for Response {
impl From<&'static str> for Response {
fn from(val: &'static str) -> Self {
Response::Ok()
.content_type("text/plain; charset=utf-8")
.content_type(mime::TEXT_PLAIN_UTF_8)
.body(val)
}
}
@@ -810,7 +849,7 @@ impl From<&'static str> for Response {
impl From<&'static [u8]> for Response {
fn from(val: &'static [u8]) -> Self {
Response::Ok()
.content_type("application/octet-stream")
.content_type(mime::APPLICATION_OCTET_STREAM)
.body(val)
}
}
@@ -818,7 +857,7 @@ impl From<&'static [u8]> for Response {
impl From<String> for Response {
fn from(val: String) -> Self {
Response::Ok()
.content_type("text/plain; charset=utf-8")
.content_type(mime::TEXT_PLAIN_UTF_8)
.body(val)
}
}
@@ -826,7 +865,7 @@ impl From<String> for Response {
impl<'a> From<&'a String> for Response {
fn from(val: &'a String) -> Self {
Response::Ok()
.content_type("text/plain; charset=utf-8")
.content_type(mime::TEXT_PLAIN_UTF_8)
.body(val)
}
}
@@ -834,7 +873,7 @@ impl<'a> From<&'a String> for Response {
impl From<Bytes> for Response {
fn from(val: Bytes) -> Self {
Response::Ok()
.content_type("application/octet-stream")
.content_type(mime::APPLICATION_OCTET_STREAM)
.body(val)
}
}
@@ -842,34 +881,37 @@ impl From<Bytes> for Response {
impl From<BytesMut> for Response {
fn from(val: BytesMut) -> Self {
Response::Ok()
.content_type("application/octet-stream")
.content_type(mime::APPLICATION_OCTET_STREAM)
.body(val)
}
}
#[cfg(test)]
mod tests {
use serde_json::json;
use super::*;
use crate::body::Body;
use crate::http::header::{HeaderValue, CONTENT_TYPE, COOKIE, SET_COOKIE};
use crate::http::header::{HeaderValue, CONTENT_TYPE, COOKIE};
#[cfg(feature = "cookies")]
use crate::{http::header::SET_COOKIE, HttpMessage};
#[test]
fn test_debug() {
let resp = Response::Ok()
.header(COOKIE, HeaderValue::from_static("cookie1=value1; "))
.header(COOKIE, HeaderValue::from_static("cookie2=value2; "))
.append_header((COOKIE, HeaderValue::from_static("cookie1=value1; ")))
.append_header((COOKIE, HeaderValue::from_static("cookie2=value2; ")))
.finish();
let dbg = format!("{:?}", resp);
assert!(dbg.contains("Response"));
}
#[cfg(feature = "cookies")]
#[test]
fn test_response_cookies() {
use crate::httpmessage::HttpMessage;
let req = crate::test::TestRequest::default()
.header(COOKIE, "cookie1=value1")
.header(COOKIE, "cookie2=value2")
.append_header((COOKIE, "cookie1=value1"))
.append_header((COOKIE, "cookie2=value2"))
.finish();
let cookies = req.cookies().unwrap();
@@ -882,22 +924,27 @@ mod tests {
.max_age(time::Duration::days(1))
.finish(),
)
.del_cookie(&cookies[1])
.del_cookie(&cookies[0])
.finish();
let mut val: Vec<_> = resp
let mut val = resp
.headers()
.get_all(SET_COOKIE)
.map(|v| v.to_str().unwrap().to_owned())
.collect();
.collect::<Vec<_>>();
val.sort();
// the .del_cookie call
assert!(val[0].starts_with("cookie1=; Max-Age=0;"));
// the .cookie call
assert_eq!(
val[1],
"name=value; HttpOnly; Path=/test; Domain=www.rust-lang.org; Max-Age=86400"
);
}
#[cfg(feature = "cookies")]
#[test]
fn test_update_response_cookies() {
let mut r = Response::Ok()
@@ -916,14 +963,14 @@ mod tests {
let mut iter = r.cookies();
let v = iter.next().unwrap();
assert_eq!((v.name(), v.value()), ("cookie3", "val300"));
let v = iter.next().unwrap();
assert_eq!((v.name(), v.value()), ("original", "val100"));
let v = iter.next().unwrap();
assert_eq!((v.name(), v.value()), ("cookie3", "val300"));
}
#[test]
fn test_basic_builder() {
let resp = Response::Ok().header("X-TEST", "value").finish();
let resp = Response::Ok().insert_header(("X-TEST", "value")).finish();
assert_eq!(resp.status(), StatusCode::OK);
}
@@ -955,7 +1002,12 @@ mod tests {
#[test]
fn test_json() {
let resp = Response::build(StatusCode::OK).json(vec!["v1", "v2", "v3"]);
let resp = Response::Ok().json(vec!["v1", "v2", "v3"]);
let ct = resp.headers().get(CONTENT_TYPE).unwrap();
assert_eq!(ct, HeaderValue::from_static("application/json"));
assert_eq!(resp.body().get_ref(), b"[\"v1\",\"v2\",\"v3\"]");
let resp = Response::Ok().json(&["v1", "v2", "v3"]);
let ct = resp.headers().get(CONTENT_TYPE).unwrap();
assert_eq!(ct, HeaderValue::from_static("application/json"));
assert_eq!(resp.body().get_ref(), b"[\"v1\",\"v2\",\"v3\"]");
@@ -964,26 +1016,8 @@ mod tests {
#[test]
fn test_json_ct() {
let resp = Response::build(StatusCode::OK)
.header(CONTENT_TYPE, "text/json")
.json(vec!["v1", "v2", "v3"]);
let ct = resp.headers().get(CONTENT_TYPE).unwrap();
assert_eq!(ct, HeaderValue::from_static("text/json"));
assert_eq!(resp.body().get_ref(), b"[\"v1\",\"v2\",\"v3\"]");
}
#[test]
fn test_json2() {
let resp = Response::build(StatusCode::OK).json2(&vec!["v1", "v2", "v3"]);
let ct = resp.headers().get(CONTENT_TYPE).unwrap();
assert_eq!(ct, HeaderValue::from_static("application/json"));
assert_eq!(resp.body().get_ref(), b"[\"v1\",\"v2\",\"v3\"]");
}
#[test]
fn test_json2_ct() {
let resp = Response::build(StatusCode::OK)
.header(CONTENT_TYPE, "text/json")
.json2(&vec!["v1", "v2", "v3"]);
.insert_header((CONTENT_TYPE, "text/json"))
.json(&vec!["v1", "v2", "v3"]);
let ct = resp.headers().get(CONTENT_TYPE).unwrap();
assert_eq!(ct, HeaderValue::from_static("text/json"));
assert_eq!(resp.body().get_ref(), b"[\"v1\",\"v2\",\"v3\"]");
@@ -1067,6 +1101,7 @@ mod tests {
assert_eq!(resp.body().get_ref(), b"test");
}
#[cfg(feature = "cookies")]
#[test]
fn test_into_builder() {
let mut resp: Response = "test".into();
@@ -1082,4 +1117,54 @@ mod tests {
let cookie = resp.cookies().next().unwrap();
assert_eq!((cookie.name(), cookie.value()), ("cookie1", "val100"));
}
#[test]
fn response_builder_header_insert_kv() {
let mut res = Response::Ok();
res.insert_header(("Content-Type", "application/octet-stream"));
let res = res.finish();
assert_eq!(
res.headers().get("Content-Type"),
Some(&HeaderValue::from_static("application/octet-stream"))
);
}
#[test]
fn response_builder_header_insert_typed() {
let mut res = Response::Ok();
res.insert_header((header::CONTENT_TYPE, mime::APPLICATION_OCTET_STREAM));
let res = res.finish();
assert_eq!(
res.headers().get("Content-Type"),
Some(&HeaderValue::from_static("application/octet-stream"))
);
}
#[test]
fn response_builder_header_append_kv() {
let mut res = Response::Ok();
res.append_header(("Content-Type", "application/octet-stream"));
res.append_header(("Content-Type", "application/json"));
let res = res.finish();
let headers: Vec<_> = res.headers().get_all("Content-Type").cloned().collect();
assert_eq!(headers.len(), 2);
assert!(headers.contains(&HeaderValue::from_static("application/octet-stream")));
assert!(headers.contains(&HeaderValue::from_static("application/json")));
}
#[test]
fn response_builder_header_append_typed() {
let mut res = Response::Ok();
res.append_header((header::CONTENT_TYPE, mime::APPLICATION_OCTET_STREAM));
res.append_header((header::CONTENT_TYPE, mime::APPLICATION_JSON));
let res = res.finish();
let headers: Vec<_> = res.headers().get_all("Content-Type").cloned().collect();
assert_eq!(headers.len(), 2);
assert!(headers.contains(&HeaderValue::from_static("application/octet-stream")));
assert!(headers.contains(&HeaderValue::from_static("application/json")));
}
}

View File

@@ -1,15 +1,19 @@
use std::cell::RefCell;
use std::marker::PhantomData;
use std::pin::Pin;
use std::task::{Context, Poll};
use std::{fmt, net, rc::Rc};
use std::{
fmt,
future::Future,
marker::PhantomData,
net,
pin::Pin,
rc::Rc,
task::{Context, Poll},
};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_rt::net::TcpStream;
use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
use bytes::Bytes;
use futures_core::{ready, Future};
use h2::server::{self, Handshake};
use futures_core::{future::LocalBoxFuture, ready};
use h2::server::{handshake, Handshake};
use pin_project::pin_project;
use crate::body::MessageBody;
@@ -103,7 +107,6 @@ where
X1: ServiceFactory<Request, Config = (), Response = Request>,
X1::Error: Into<Error>,
X1::InitError: fmt::Debug,
<X1::Service as Service<Request>>::Future: 'static,
{
HttpService {
expect,
@@ -124,7 +127,6 @@ where
U1: ServiceFactory<(Request, Framed<T, h1::Codec>), Config = (), Response = ()>,
U1::Error: fmt::Display,
U1::InitError: fmt::Debug,
<U1::Service as Service<(Request, Framed<T, h1::Codec>)>>::Future: 'static,
{
HttpService {
upgrade,
@@ -146,23 +148,27 @@ where
impl<S, B, X, U> HttpService<TcpStream, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Future: 'static,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service<Request>>::Future: 'static,
U: ServiceFactory<
(Request, Framed<TcpStream, h1::Codec>),
Config = (),
Response = (),
>,
U::Future: 'static,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
<U::Service as Service<(Request, Framed<TcpStream, h1::Codec>)>>::Future: 'static,
{
/// Create simple tcp stream service
pub fn tcp(
@@ -184,31 +190,36 @@ where
#[cfg(feature = "openssl")]
mod openssl {
use super::*;
use actix_service::ServiceFactoryExt;
use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, SslStream};
use actix_tls::accept::openssl::{Acceptor, SslAcceptor, SslError, TlsStream};
use actix_tls::accept::TlsError;
impl<S, B, X, U> HttpService<SslStream<TcpStream>, S, B, X, U>
use super::*;
impl<S, B, X, U> HttpService<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Future: 'static,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service<Request>>::Future: 'static,
U: ServiceFactory<
(Request, Framed<SslStream<TcpStream>, h1::Codec>),
(Request, Framed<TlsStream<TcpStream>, h1::Codec>),
Config = (),
Response = (),
>,
U::Future: 'static,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
<U::Service as Service<(Request, Framed<SslStream<TcpStream>, h1::Codec>)>>::Future: 'static,
{
/// Create openssl based service
pub fn openssl(
@@ -226,7 +237,7 @@ mod openssl {
.map_err(TlsError::Tls)
.map_init_err(|_| panic!()),
)
.and_then(|io: SslStream<TcpStream>| async {
.and_then(|io: TlsStream<TcpStream>| async {
let proto = if let Some(protos) = io.ssl().selected_alpn_protocol() {
if protos.windows(2).any(|window| window == b"h2") {
Protocol::Http2
@@ -257,25 +268,29 @@ mod rustls {
impl<S, B, X, U> HttpService<TlsStream<TcpStream>, S, B, X, U>
where
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Future: 'static,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service<Request>>::Future: 'static,
U: ServiceFactory<
(Request, Framed<TlsStream<TcpStream>, h1::Codec>),
Config = (),
Response = (),
>,
U::Future: 'static,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
<U::Service as Service<(Request, Framed<TlsStream<TcpStream>, h1::Codec>)>>::Future: 'static,
{
/// Create openssl based service
/// Create rustls based service
pub fn rustls(
self,
mut config: ServerConfig,
@@ -315,167 +330,94 @@ mod rustls {
impl<T, S, B, X, U> ServiceFactory<(T, Protocol, Option<net::SocketAddr>)>
for HttpService<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
T: AsyncRead + AsyncWrite + Unpin + 'static,
S: ServiceFactory<Request, Config = ()>,
S::Future: 'static,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Request, Config = (), Response = Request>,
X::Future: 'static,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service<Request>>::Future: 'static,
U: ServiceFactory<(Request, Framed<T, h1::Codec>), Config = (), Response = ()>,
U::Future: 'static,
U::Error: fmt::Display + Into<Error>,
U::InitError: fmt::Debug,
<U::Service as Service<(Request, Framed<T, h1::Codec>)>>::Future: 'static,
{
type Response = ();
type Error = DispatchError;
type Config = ();
type Service = HttpServiceHandler<T, S::Service, B, X::Service, U::Service>;
type InitError = ();
type Future = HttpServiceResponse<T, S, B, X, U>;
type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
fn new_service(&self, _: ()) -> Self::Future {
HttpServiceResponse {
fut: self.srv.new_service(()),
fut_ex: Some(self.expect.new_service(())),
fut_upg: self.upgrade.as_ref().map(|f| f.new_service(())),
expect: None,
upgrade: None,
on_connect_ext: self.on_connect_ext.clone(),
cfg: self.cfg.clone(),
_phantom: PhantomData,
}
}
}
let service = self.srv.new_service(());
let expect = self.expect.new_service(());
let upgrade = self.upgrade.as_ref().map(|s| s.new_service(()));
let on_connect_ext = self.on_connect_ext.clone();
let cfg = self.cfg.clone();
#[doc(hidden)]
#[pin_project]
pub struct HttpServiceResponse<T, S, B, X, U>
where
S: ServiceFactory<Request>,
X: ServiceFactory<Request>,
U: ServiceFactory<(Request, Framed<T, h1::Codec>)>,
{
#[pin]
fut: S::Future,
#[pin]
fut_ex: Option<X::Future>,
#[pin]
fut_upg: Option<U::Future>,
expect: Option<X::Service>,
upgrade: Option<U::Service>,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
cfg: ServiceConfig,
_phantom: PhantomData<B>,
}
Box::pin(async move {
let expect = expect
.await
.map_err(|e| log::error!("Init http expect service error: {:?}", e))?;
impl<T, S, B, X, U> Future for HttpServiceResponse<T, S, B, X, U>
where
T: AsyncRead + AsyncWrite + Unpin,
S: ServiceFactory<Request>,
S::Error: Into<Error> + 'static,
S::InitError: fmt::Debug,
S::Response: Into<Response<B>> + 'static,
<S::Service as Service<Request>>::Future: 'static,
B: MessageBody + 'static,
X: ServiceFactory<Request, Response = Request>,
X::Error: Into<Error>,
X::InitError: fmt::Debug,
<X::Service as Service<Request>>::Future: 'static,
U: ServiceFactory<(Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display,
U::InitError: fmt::Debug,
<U::Service as Service<(Request, Framed<T, h1::Codec>)>>::Future: 'static,
{
type Output =
Result<HttpServiceHandler<T, S::Service, B, X::Service, U::Service>, ()>;
let upgrade = match upgrade {
Some(upgrade) => {
let upgrade = upgrade.await.map_err(|e| {
log::error!("Init http upgrade service error: {:?}", e)
})?;
Some(upgrade)
}
None => None,
};
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
let mut this = self.as_mut().project();
let service = service
.await
.map_err(|e| log::error!("Init http service error: {:?}", e))?;
if let Some(fut) = this.fut_ex.as_pin_mut() {
let expect = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.expect = Some(expect);
this.fut_ex.set(None);
}
if let Some(fut) = this.fut_upg.as_pin_mut() {
let upgrade = ready!(fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)))?;
this = self.as_mut().project();
*this.upgrade = Some(upgrade);
this.fut_upg.set(None);
}
let result = ready!(this
.fut
.poll(cx)
.map_err(|e| log::error!("Init http service error: {:?}", e)));
Poll::Ready(result.map(|service| {
let this = self.as_mut().project();
HttpServiceHandler::new(
this.cfg.clone(),
Ok(HttpServiceHandler::new(
cfg,
service,
this.expect.take().unwrap(),
this.upgrade.take(),
this.on_connect_ext.clone(),
)
}))
expect,
upgrade,
on_connect_ext,
))
})
}
}
/// `Service` implementation for http transport
/// `Service` implementation for HTTP/1 and HTTP/2 transport
pub struct HttpServiceHandler<T, S, B, X, U>
where
S: Service<Request>,
X: Service<Request>,
U: Service<(Request, Framed<T, h1::Codec>)>,
{
flow: Rc<RefCell<HttpFlow<S, X, U>>>,
cfg: ServiceConfig,
on_connect_ext: Option<Rc<ConnectCallback<T>>>,
pub(super) flow: Rc<HttpFlow<S, X, U>>,
pub(super) cfg: ServiceConfig,
pub(super) on_connect_ext: Option<Rc<ConnectCallback<T>>>,
_phantom: PhantomData<B>,
}
/// A collection of services that describe an HTTP request flow.
pub(super) struct HttpFlow<S, X, U> {
pub(super) service: S,
pub(super) expect: X,
pub(super) upgrade: Option<U>,
}
impl<S, X, U> HttpFlow<S, X, U> {
pub(super) fn new(service: S, expect: X, upgrade: Option<U>) -> Rc<RefCell<Self>> {
Rc::new(RefCell::new(Self {
service,
expect,
upgrade,
}))
}
}
impl<T, S, B, X, U> HttpServiceHandler<T, S, B, X, U>
where
S: Service<Request>,
S::Error: Into<Error> + 'static,
S::Future: 'static,
S::Response: Into<Response<B>> + 'static,
B: MessageBody + 'static,
X: Service<Request, Response = Request>,
S::Error: Into<Error>,
X: Service<Request>,
X::Error: Into<Error>,
U: Service<(Request, Framed<T, h1::Codec>), Response = ()>,
U::Error: fmt::Display,
U: Service<(Request, Framed<T, h1::Codec>)>,
U::Error: Into<Error>,
{
fn new(
pub(super) fn new(
cfg: ServiceConfig,
service: S,
expect: X,
@@ -489,6 +431,35 @@ where
_phantom: PhantomData,
}
}
pub(super) fn _poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Error>> {
ready!(self.flow.expect.poll_ready(cx).map_err(Into::into))?;
ready!(self.flow.service.poll_ready(cx).map_err(Into::into))?;
if let Some(ref upg) = self.flow.upgrade {
ready!(upg.poll_ready(cx).map_err(Into::into))?;
};
Poll::Ready(Ok(()))
}
}
/// A collection of services that describe an HTTP request flow.
pub(super) struct HttpFlow<S, X, U> {
pub(super) service: S,
pub(super) expect: X,
pub(super) upgrade: Option<U>,
}
impl<S, X, U> HttpFlow<S, X, U> {
pub(super) fn new(service: S, expect: X, upgrade: Option<U>) -> Rc<Self> {
Rc::new(Self {
service,
expect,
upgrade,
})
}
}
impl<T, S, B, X, U> Service<(T, Protocol, Option<net::SocketAddr>)>
@@ -509,51 +480,15 @@ where
type Error = DispatchError;
type Future = HttpServiceHandlerResponse<T, S, B, X, U>;
fn poll_ready(&mut self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
let mut flow = self.flow.borrow_mut();
let ready = flow
.expect
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready();
let ready = flow
.service
.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready()
&& ready;
let ready = if let Some(ref mut upg) = flow.upgrade {
upg.poll_ready(cx)
.map_err(|e| {
let e = e.into();
log::error!("Http service readiness error: {:?}", e);
DispatchError::Service(e)
})?
.is_ready()
&& ready
} else {
ready
};
if ready {
Poll::Ready(Ok(()))
} else {
Poll::Pending
}
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
self._poll_ready(cx).map_err(|e| {
log::error!("HTTP service readiness error: {:?}", e);
DispatchError::Service(e)
})
}
fn call(
&mut self,
&self,
(io, proto, peer_addr): (T, Protocol, Option<net::SocketAddr>),
) -> Self::Future {
let on_connect_data =
@@ -562,7 +497,7 @@ where
match proto {
Protocol::Http2 => HttpServiceHandlerResponse {
state: State::H2Handshake(Some((
server::handshake(io),
handshake(io),
self.cfg.clone(),
self.flow.clone(),
on_connect_data,
@@ -604,7 +539,7 @@ where
Option<(
Handshake<T, Bytes>,
ServiceConfig,
Rc<RefCell<HttpFlow<S, X, U>>>,
Rc<HttpFlow<S, X, U>>,
OnConnectData,
Option<net::SocketAddr>,
)>,
@@ -658,7 +593,6 @@ where
conn,
on_connect_data,
cfg,
None,
peer_addr,
)));
self.poll(cx)

View File

@@ -2,7 +2,6 @@
use std::{
cell::{Ref, RefCell},
convert::TryFrom,
io::{self, Read, Write},
pin::Pin,
rc::Rc,
@@ -12,18 +11,22 @@ use std::{
use actix_codec::{AsyncRead, AsyncWrite, ReadBuf};
use bytes::{Bytes, BytesMut};
use http::header::{self, HeaderName, HeaderValue};
use http::{Error as HttpError, Method, Uri, Version};
use http::{Method, Uri, Version};
use crate::cookie::{Cookie, CookieJar};
use crate::header::HeaderMap;
use crate::header::{Header, IntoHeaderValue};
use crate::payload::Payload;
use crate::Request;
#[cfg(feature = "cookies")]
use crate::{
cookie::{Cookie, CookieJar},
header::{self, HeaderValue},
};
use crate::{
header::{HeaderMap, IntoHeaderPair},
payload::Payload,
Request,
};
/// Test `Request` builder
///
/// ```rust,ignore
/// ```ignore
/// # use http::{header, StatusCode};
/// # use actix_web::*;
/// use actix_web::test::TestRequest;
@@ -36,7 +39,7 @@ use crate::Request;
/// }
/// }
///
/// let resp = TestRequest::with_header("content-type", "text/plain")
/// let resp = TestRequest::default().insert_header("content-type", "text/plain")
/// .run(&index)
/// .unwrap();
/// assert_eq!(resp.status(), StatusCode::OK);
@@ -51,6 +54,7 @@ struct Inner {
method: Method,
uri: Uri,
headers: HeaderMap,
#[cfg(feature = "cookies")]
cookies: CookieJar,
payload: Option<Payload>,
}
@@ -62,6 +66,7 @@ impl Default for TestRequest {
uri: Uri::from_str("/").unwrap(),
version: Version::HTTP_11,
headers: HeaderMap::new(),
#[cfg(feature = "cookies")]
cookies: CookieJar::new(),
payload: None,
}))
@@ -69,76 +74,74 @@ impl Default for TestRequest {
}
impl TestRequest {
/// Create TestRequest and set request uri
/// Create a default TestRequest and then set its URI.
pub fn with_uri(path: &str) -> TestRequest {
TestRequest::default().uri(path).take()
}
/// Create TestRequest and set header
pub fn with_hdr<H: Header>(hdr: H) -> TestRequest {
TestRequest::default().set(hdr).take()
}
/// Create TestRequest and set header
pub fn with_header<K, V>(key: K, value: V) -> TestRequest
where
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue,
{
TestRequest::default().header(key, value).take()
}
/// Set HTTP version of this request
/// Set HTTP version of this request.
pub fn version(&mut self, ver: Version) -> &mut Self {
parts(&mut self.0).version = ver;
self
}
/// Set HTTP method of this request
/// Set HTTP method of this request.
pub fn method(&mut self, meth: Method) -> &mut Self {
parts(&mut self.0).method = meth;
self
}
/// Set HTTP Uri of this request
/// Set URI of this request.
///
/// # Panics
/// If provided URI is invalid.
pub fn uri(&mut self, path: &str) -> &mut Self {
parts(&mut self.0).uri = Uri::from_str(path).unwrap();
self
}
/// Set a header
pub fn set<H: Header>(&mut self, hdr: H) -> &mut Self {
if let Ok(value) = hdr.try_into() {
parts(&mut self.0).headers.append(H::name(), value);
return self;
}
panic!("Can not set header");
}
/// Set a header
pub fn header<K, V>(&mut self, key: K, value: V) -> &mut Self
/// Insert a header, replacing any that were set with an equivalent field name.
pub fn insert_header<H>(&mut self, header: H) -> &mut Self
where
HeaderName: TryFrom<K>,
<HeaderName as TryFrom<K>>::Error: Into<HttpError>,
V: IntoHeaderValue,
H: IntoHeaderPair,
{
if let Ok(key) = HeaderName::try_from(key) {
if let Ok(value) = value.try_into() {
parts(&mut self.0).headers.append(key, value);
return self;
match header.try_into_header_pair() {
Ok((key, value)) => {
parts(&mut self.0).headers.insert(key, value);
}
Err(err) => {
panic!("Error inserting test header: {}.", err.into());
}
}
panic!("Can not create header");
self
}
/// Set cookie for this request
/// Append a header, keeping any that were set with an equivalent field name.
pub fn append_header<H>(&mut self, header: H) -> &mut Self
where
H: IntoHeaderPair,
{
match header.try_into_header_pair() {
Ok((key, value)) => {
parts(&mut self.0).headers.append(key, value);
}
Err(err) => {
panic!("Error inserting test header: {}.", err.into());
}
}
self
}
/// Set cookie for this request.
#[cfg(feature = "cookies")]
pub fn cookie<'a>(&mut self, cookie: Cookie<'a>) -> &mut Self {
parts(&mut self.0).cookies.add(cookie.into_owned());
self
}
/// Set request payload
/// Set request payload.
pub fn set_payload<B: Into<Bytes>>(&mut self, data: B) -> &mut Self {
let mut payload = crate::h1::Payload::empty();
payload.unread_data(data.into());
@@ -150,7 +153,7 @@ impl TestRequest {
TestRequest(self.0.take())
}
/// Complete request creation and generate `Request` instance
/// Complete request creation and generate `Request` instance.
pub fn finish(&mut self) -> Request {
let inner = self.0.take().expect("cannot reuse test request builder");
@@ -166,17 +169,20 @@ impl TestRequest {
head.version = inner.version;
head.headers = inner.headers;
let cookie: String = inner
.cookies
.delta()
// ensure only name=value is written to cookie header
.map(|c| Cookie::new(c.name(), c.value()).encoded().to_string())
.collect::<Vec<_>>()
.join("; ");
#[cfg(feature = "cookies")]
{
let cookie: String = inner
.cookies
.delta()
// ensure only name=value is written to cookie header
.map(|c| Cookie::new(c.name(), c.value()).encoded().to_string())
.collect::<Vec<_>>()
.join("; ");
if !cookie.is_empty() {
head.headers
.insert(header::COOKIE, HeaderValue::from_str(&cookie).unwrap());
if !cookie.is_empty() {
head.headers
.insert(header::COOKIE, HeaderValue::from_str(&cookie).unwrap());
}
}
req

View File

@@ -1,42 +1,72 @@
use time::{Date, OffsetDateTime, PrimitiveDateTime};
/// Attempt to parse a `time` string as one of either RFC 1123, RFC 850, or asctime.
pub fn parse_http_date(time: &str) -> Option<PrimitiveDateTime> {
pub(crate) fn parse_http_date(time: &str) -> Option<PrimitiveDateTime> {
try_parse_rfc_1123(time)
.or_else(|| try_parse_rfc_850(time))
.or_else(|| try_parse_asctime(time))
}
/// Attempt to parse a `time` string as a RFC 1123 formatted date time string.
///
/// Eg: `Fri, 12 Feb 2021 00:14:29 GMT`
fn try_parse_rfc_1123(time: &str) -> Option<PrimitiveDateTime> {
time::parse(time, "%a, %d %b %Y %H:%M:%S").ok()
}
/// Attempt to parse a `time` string as a RFC 850 formatted date time string.
///
/// Eg: `Wednesday, 11-Jan-21 13:37:41 UTC`
fn try_parse_rfc_850(time: &str) -> Option<PrimitiveDateTime> {
match PrimitiveDateTime::parse(time, "%A, %d-%b-%y %H:%M:%S") {
Ok(dt) => {
// If the `time` string contains a two-digit year, then as per RFC 2616 § 19.3,
// we consider the year as part of this century if it's within the next 50 years,
// otherwise we consider as part of the previous century.
let now = OffsetDateTime::now_utc();
let century_start_year = (now.year() / 100) * 100;
let mut expanded_year = century_start_year + dt.year();
let dt = PrimitiveDateTime::parse(time, "%A, %d-%b-%y %H:%M:%S").ok()?;
if expanded_year > now.year() + 50 {
expanded_year -= 100;
}
// If the `time` string contains a two-digit year, then as per RFC 2616 § 19.3,
// we consider the year as part of this century if it's within the next 50 years,
// otherwise we consider as part of the previous century.
match Date::try_from_ymd(expanded_year, dt.month(), dt.day()) {
Ok(date) => Some(PrimitiveDateTime::new(date, dt.time())),
Err(_) => None,
}
}
Err(_) => None,
let now = OffsetDateTime::now_utc();
let century_start_year = (now.year() / 100) * 100;
let mut expanded_year = century_start_year + dt.year();
if expanded_year > now.year() + 50 {
expanded_year -= 100;
}
let date = Date::try_from_ymd(expanded_year, dt.month(), dt.day()).ok()?;
Some(PrimitiveDateTime::new(date, dt.time()))
}
/// Attempt to parse a `time` string using ANSI C's `asctime` format.
///
/// Eg: `Wed Feb 13 15:46:11 2013`
fn try_parse_asctime(time: &str) -> Option<PrimitiveDateTime> {
time::parse(time, "%a %b %_d %H:%M:%S %Y").ok()
}
#[cfg(test)]
mod tests {
use time::{date, time};
use super::*;
#[test]
fn test_rfc_850_year_shift() {
let date = try_parse_rfc_850("Friday, 19-Nov-82 16:14:55 EST").unwrap();
assert_eq!(date, date!(1982 - 11 - 19).with_time(time!(16:14:55)));
let date = try_parse_rfc_850("Wednesday, 11-Jan-62 13:37:41 EST").unwrap();
assert_eq!(date, date!(2062 - 01 - 11).with_time(time!(13:37:41)));
let date = try_parse_rfc_850("Wednesday, 11-Jan-21 13:37:41 EST").unwrap();
assert_eq!(date, date!(2021 - 01 - 11).with_time(time!(13:37:41)));
let date = try_parse_rfc_850("Wednesday, 11-Jan-23 13:37:41 EST").unwrap();
assert_eq!(date, date!(2023 - 01 - 11).with_time(time!(13:37:41)));
let date = try_parse_rfc_850("Wednesday, 11-Jan-99 13:37:41 EST").unwrap();
assert_eq!(date, date!(1999 - 01 - 11).with_time(time!(13:37:41)));
let date = try_parse_rfc_850("Wednesday, 11-Jan-00 13:37:41 EST").unwrap();
assert_eq!(date, date!(2000 - 01 - 11).with_time(time!(13:37:41)));
}
}

View File

@@ -54,7 +54,7 @@ pub enum Frame {
Close(Option<CloseReason>),
}
/// A `WebSocket` continuation item.
/// A WebSocket continuation item.
#[derive(Debug, PartialEq)]
pub enum Item {
FirstText(Bytes),
@@ -79,8 +79,8 @@ bitflags! {
}
impl Codec {
/// Create new websocket frames decoder.
pub fn new() -> Codec {
/// Create new WebSocket frames decoder.
pub const fn new() -> Codec {
Codec {
max_size: 65_536,
flags: Flags::SERVER,
@@ -89,7 +89,7 @@ impl Codec {
/// Set max frame size.
///
/// By default max size is set to 64kb.
/// By default max size is set to 64kB.
pub fn max_size(mut self, size: usize) -> Self {
self.max_size = size;
self

View File

@@ -4,7 +4,6 @@ use std::task::{Context, Poll};
use actix_codec::{AsyncRead, AsyncWrite, Framed};
use actix_service::{IntoService, Service};
use actix_utils::dispatcher::{Dispatcher as InnerDispatcher, DispatcherError};
use super::{Codec, Frame, Message};
@@ -15,7 +14,7 @@ where
T: AsyncRead + AsyncWrite,
{
#[pin]
inner: InnerDispatcher<S, T, Codec, Message>,
inner: inner::Dispatcher<S, T, Codec, Message>,
}
impl<S, T> Dispatcher<S, T>
@@ -27,13 +26,13 @@ where
{
pub fn new<F: IntoService<S, Frame>>(io: T, service: F) -> Self {
Dispatcher {
inner: InnerDispatcher::new(Framed::new(io, Codec::new()), service),
inner: inner::Dispatcher::new(Framed::new(io, Codec::new()), service),
}
}
pub fn with<F: IntoService<S, Frame>>(framed: Framed<T, Codec>, service: F) -> Self {
Dispatcher {
inner: InnerDispatcher::new(framed, service),
inner: inner::Dispatcher::new(framed, service),
}
}
}
@@ -45,9 +44,393 @@ where
S::Future: 'static,
S::Error: 'static,
{
type Output = Result<(), DispatcherError<S::Error, Codec, Message>>;
type Output = Result<(), inner::DispatcherError<S::Error, Codec, Message>>;
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
self.project().inner.poll(cx)
}
}
/// Framed dispatcher service and related utilities.
mod inner {
// allow dead code since this mod was ripped from actix-utils
#![allow(dead_code)]
use core::{
fmt,
future::Future,
mem,
pin::Pin,
task::{Context, Poll},
};
use actix_service::{IntoService, Service};
use futures_core::stream::Stream;
use local_channel::mpsc;
use log::debug;
use pin_project_lite::pin_project;
use actix_codec::{AsyncRead, AsyncWrite, Decoder, Encoder, Framed};
use crate::ResponseError;
/// Framed transport errors
pub enum DispatcherError<E, U, I>
where
U: Encoder<I> + Decoder,
{
/// Inner service error.
Service(E),
/// Frame encoding error.
Encoder(<U as Encoder<I>>::Error),
/// Frame decoding error.
Decoder(<U as Decoder>::Error),
}
impl<E, U, I> From<E> for DispatcherError<E, U, I>
where
U: Encoder<I> + Decoder,
{
fn from(err: E) -> Self {
DispatcherError::Service(err)
}
}
impl<E, U, I> fmt::Debug for DispatcherError<E, U, I>
where
E: fmt::Debug,
U: Encoder<I> + Decoder,
<U as Encoder<I>>::Error: fmt::Debug,
<U as Decoder>::Error: fmt::Debug,
{
fn fmt(&self, fmt: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
DispatcherError::Service(ref e) => {
write!(fmt, "DispatcherError::Service({:?})", e)
}
DispatcherError::Encoder(ref e) => {
write!(fmt, "DispatcherError::Encoder({:?})", e)
}
DispatcherError::Decoder(ref e) => {
write!(fmt, "DispatcherError::Decoder({:?})", e)
}
}
}
}
impl<E, U, I> fmt::Display for DispatcherError<E, U, I>
where
E: fmt::Display,
U: Encoder<I> + Decoder,
<U as Encoder<I>>::Error: fmt::Debug,
<U as Decoder>::Error: fmt::Debug,
{
fn fmt(&self, fmt: &mut fmt::Formatter<'_>) -> fmt::Result {
match *self {
DispatcherError::Service(ref e) => write!(fmt, "{}", e),
DispatcherError::Encoder(ref e) => write!(fmt, "{:?}", e),
DispatcherError::Decoder(ref e) => write!(fmt, "{:?}", e),
}
}
}
impl<E, U, I> ResponseError for DispatcherError<E, U, I>
where
E: fmt::Debug + fmt::Display,
U: Encoder<I> + Decoder,
<U as Encoder<I>>::Error: fmt::Debug,
<U as Decoder>::Error: fmt::Debug,
{
}
/// Message type wrapper for signalling end of message stream.
pub enum Message<T> {
/// Message item.
Item(T),
/// Signal from service to flush all messages and stop processing.
Close,
}
pin_project! {
/// A future that reads frames from a [`Framed`] object and passes them to a [`Service`].
pub struct Dispatcher<S, T, U, I>
where
S: Service<<U as Decoder>::Item, Response = I>,
S::Error: 'static,
S::Future: 'static,
T: AsyncRead,
T: AsyncWrite,
U: Encoder<I>,
U: Decoder,
I: 'static,
<U as Encoder<I>>::Error: fmt::Debug,
{
service: S,
state: State<S, U, I>,
#[pin]
framed: Framed<T, U>,
rx: mpsc::Receiver<Result<Message<I>, S::Error>>,
tx: mpsc::Sender<Result<Message<I>, S::Error>>,
}
}
enum State<S, U, I>
where
S: Service<<U as Decoder>::Item>,
U: Encoder<I> + Decoder,
{
Processing,
Error(DispatcherError<S::Error, U, I>),
FramedError(DispatcherError<S::Error, U, I>),
FlushAndStop,
Stopping,
}
impl<S, U, I> State<S, U, I>
where
S: Service<<U as Decoder>::Item>,
U: Encoder<I> + Decoder,
{
fn take_error(&mut self) -> DispatcherError<S::Error, U, I> {
match mem::replace(self, State::Processing) {
State::Error(err) => err,
_ => panic!(),
}
}
fn take_framed_error(&mut self) -> DispatcherError<S::Error, U, I> {
match mem::replace(self, State::Processing) {
State::FramedError(err) => err,
_ => panic!(),
}
}
}
impl<S, T, U, I> Dispatcher<S, T, U, I>
where
S: Service<<U as Decoder>::Item, Response = I>,
S::Error: 'static,
S::Future: 'static,
T: AsyncRead + AsyncWrite,
U: Decoder + Encoder<I>,
I: 'static,
<U as Decoder>::Error: fmt::Debug,
<U as Encoder<I>>::Error: fmt::Debug,
{
/// Create new `Dispatcher`.
pub fn new<F>(framed: Framed<T, U>, service: F) -> Self
where
F: IntoService<S, <U as Decoder>::Item>,
{
let (tx, rx) = mpsc::channel();
Dispatcher {
framed,
rx,
tx,
service: service.into_service(),
state: State::Processing,
}
}
/// Construct new `Dispatcher` instance with customer `mpsc::Receiver`
pub fn with_rx<F>(
framed: Framed<T, U>,
service: F,
rx: mpsc::Receiver<Result<Message<I>, S::Error>>,
) -> Self
where
F: IntoService<S, <U as Decoder>::Item>,
{
let tx = rx.sender();
Dispatcher {
framed,
rx,
tx,
service: service.into_service(),
state: State::Processing,
}
}
/// Get sender handle.
pub fn tx(&self) -> mpsc::Sender<Result<Message<I>, S::Error>> {
self.tx.clone()
}
/// Get reference to a service wrapped by `Dispatcher` instance.
pub fn service(&self) -> &S {
&self.service
}
/// Get mutable reference to a service wrapped by `Dispatcher` instance.
pub fn service_mut(&mut self) -> &mut S {
&mut self.service
}
/// Get reference to a framed instance wrapped by `Dispatcher` instance.
pub fn framed(&self) -> &Framed<T, U> {
&self.framed
}
/// Get mutable reference to a framed instance wrapped by `Dispatcher` instance.
pub fn framed_mut(&mut self) -> &mut Framed<T, U> {
&mut self.framed
}
/// Read from framed object.
fn poll_read(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> bool
where
S: Service<<U as Decoder>::Item, Response = I>,
S::Error: 'static,
S::Future: 'static,
T: AsyncRead + AsyncWrite,
U: Decoder + Encoder<I>,
I: 'static,
<U as Encoder<I>>::Error: fmt::Debug,
{
loop {
let this = self.as_mut().project();
match this.service.poll_ready(cx) {
Poll::Ready(Ok(_)) => {
let item = match this.framed.next_item(cx) {
Poll::Ready(Some(Ok(el))) => el,
Poll::Ready(Some(Err(err))) => {
*this.state =
State::FramedError(DispatcherError::Decoder(err));
return true;
}
Poll::Pending => return false,
Poll::Ready(None) => {
*this.state = State::Stopping;
return true;
}
};
let tx = this.tx.clone();
let fut = this.service.call(item);
actix_rt::spawn(async move {
let item = fut.await;
let _ = tx.send(item.map(Message::Item));
});
}
Poll::Pending => return false,
Poll::Ready(Err(err)) => {
*this.state = State::Error(DispatcherError::Service(err));
return true;
}
}
}
}
/// Write to framed object.
fn poll_write(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> bool
where
S: Service<<U as Decoder>::Item, Response = I>,
S::Error: 'static,
S::Future: 'static,
T: AsyncRead + AsyncWrite,
U: Decoder + Encoder<I>,
I: 'static,
<U as Encoder<I>>::Error: fmt::Debug,
{
loop {
let mut this = self.as_mut().project();
while !this.framed.is_write_buf_full() {
match Pin::new(&mut this.rx).poll_next(cx) {
Poll::Ready(Some(Ok(Message::Item(msg)))) => {
if let Err(err) = this.framed.as_mut().write(msg) {
*this.state =
State::FramedError(DispatcherError::Encoder(err));
return true;
}
}
Poll::Ready(Some(Ok(Message::Close))) => {
*this.state = State::FlushAndStop;
return true;
}
Poll::Ready(Some(Err(err))) => {
*this.state = State::Error(DispatcherError::Service(err));
return true;
}
Poll::Ready(None) | Poll::Pending => break,
}
}
if !this.framed.is_write_buf_empty() {
match this.framed.flush(cx) {
Poll::Pending => break,
Poll::Ready(Ok(_)) => {}
Poll::Ready(Err(err)) => {
debug!("Error sending data: {:?}", err);
*this.state =
State::FramedError(DispatcherError::Encoder(err));
return true;
}
}
} else {
break;
}
}
false
}
}
impl<S, T, U, I> Future for Dispatcher<S, T, U, I>
where
S: Service<<U as Decoder>::Item, Response = I>,
S::Error: 'static,
S::Future: 'static,
T: AsyncRead + AsyncWrite,
U: Decoder + Encoder<I>,
I: 'static,
<U as Encoder<I>>::Error: fmt::Debug,
<U as Decoder>::Error: fmt::Debug,
{
type Output = Result<(), DispatcherError<S::Error, U, I>>;
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
loop {
let this = self.as_mut().project();
return match this.state {
State::Processing => {
if self.as_mut().poll_read(cx) || self.as_mut().poll_write(cx) {
continue;
} else {
Poll::Pending
}
}
State::Error(_) => {
// flush write buffer
if !this.framed.is_write_buf_empty()
&& this.framed.flush(cx).is_pending()
{
return Poll::Pending;
}
Poll::Ready(Err(this.state.take_error()))
}
State::FlushAndStop => {
if !this.framed.is_write_buf_empty() {
this.framed.flush(cx).map(|res| {
if let Err(err) = res {
debug!("Error sending data: {:?}", err);
}
Ok(())
})
} else {
Poll::Ready(Ok(()))
}
}
State::FramedError(_) => {
Poll::Ready(Err(this.state.take_framed_error()))
}
State::Stopping => Poll::Ready(Ok(())),
};
}
}
}
}

View File

@@ -7,7 +7,7 @@ use crate::ws::mask::apply_mask;
use crate::ws::proto::{CloseCode, CloseReason, OpCode};
use crate::ws::ProtocolError;
/// A struct representing a `WebSocket` frame.
/// A struct representing a WebSocket frame.
#[derive(Debug)]
pub struct Parser;
@@ -16,7 +16,8 @@ impl Parser {
src: &[u8],
server: bool,
max_size: usize,
) -> Result<Option<(usize, bool, OpCode, usize, Option<u32>)>, ProtocolError> {
) -> Result<Option<(usize, bool, OpCode, usize, Option<[u8; 4]>)>, ProtocolError>
{
let chunk_len = src.len();
let mut idx = 2;
@@ -77,9 +78,10 @@ impl Parser {
return Ok(None);
}
let mask =
u32::from_le_bytes(TryFrom::try_from(&src[idx..idx + 4]).unwrap());
let mask = TryFrom::try_from(&src[idx..idx + 4]).unwrap();
idx += 4;
Some(mask)
} else {
None
@@ -187,8 +189,8 @@ impl Parser {
};
if mask {
let mask = rand::random::<u32>();
dst.put_u32_le(mask);
let mask = rand::random::<[u8; 4]>();
dst.put_slice(mask.as_ref());
dst.put_slice(payload.as_ref());
let pos = dst.len() - payload_len;
apply_mask(&mut dst[pos..], mask);

View File

@@ -1,134 +1,57 @@
//! This is code from [Tungstenite project](https://github.com/snapview/tungstenite-rs)
#![allow(clippy::cast_ptr_alignment)]
use std::ptr::copy_nonoverlapping;
use std::slice;
// Holds a slice guaranteed to be shorter than 8 bytes
struct ShortSlice<'a> {
inner: &'a mut [u8],
}
impl<'a> ShortSlice<'a> {
/// # Safety
/// Given slice must be shorter than 8 bytes.
unsafe fn new(slice: &'a mut [u8]) -> Self {
// Sanity check for debug builds
debug_assert!(slice.len() < 8);
ShortSlice { inner: slice }
}
fn len(&self) -> usize {
self.inner.len()
}
}
/// Faster version of `apply_mask()` which operates on 8-byte blocks.
/// Mask/unmask a frame.
#[inline]
#[allow(clippy::cast_lossless)]
pub(crate) fn apply_mask(buf: &mut [u8], mask_u32: u32) {
// Extend the mask to 64 bits
let mut mask_u64 = ((mask_u32 as u64) << 32) | (mask_u32 as u64);
// Split the buffer into three segments
let (head, mid, tail) = align_buf(buf);
pub fn apply_mask(buf: &mut [u8], mask: [u8; 4]) {
apply_mask_fast32(buf, mask)
}
// Initial unaligned segment
let head_len = head.len();
if head_len > 0 {
xor_short(head, mask_u64);
/// A safe unoptimized mask application.
#[inline]
fn apply_mask_fallback(buf: &mut [u8], mask: [u8; 4]) {
for (i, byte) in buf.iter_mut().enumerate() {
*byte ^= mask[i & 3];
}
}
/// Faster version of `apply_mask()` which operates on 4-byte blocks.
#[inline]
pub fn apply_mask_fast32(buf: &mut [u8], mask: [u8; 4]) {
let mask_u32 = u32::from_ne_bytes(mask);
// SAFETY:
//
// buf is a valid slice borrowed mutably from bytes::BytesMut.
//
// un aligned prefix and suffix would be mask/unmask per byte.
// proper aligned middle slice goes into fast path and operates on 4-byte blocks.
let (mut prefix, words, mut suffix) = unsafe { buf.align_to_mut::<u32>() };
apply_mask_fallback(&mut prefix, mask);
let head = prefix.len() & 3;
let mask_u32 = if head > 0 {
if cfg!(target_endian = "big") {
mask_u64 = mask_u64.rotate_left(8 * head_len as u32);
mask_u32.rotate_left(8 * head as u32)
} else {
mask_u64 = mask_u64.rotate_right(8 * head_len as u32);
}
}
// Aligned segment
for v in mid {
*v ^= mask_u64;
}
// Final unaligned segment
if tail.len() > 0 {
xor_short(tail, mask_u64);
}
}
// TODO: copy_nonoverlapping here compiles to call memcpy. While it is not so
// inefficient, it could be done better. The compiler does not understand that
// a `ShortSlice` must be smaller than a u64.
#[inline]
#[allow(clippy::needless_pass_by_value)]
fn xor_short(buf: ShortSlice<'_>, mask: u64) {
// SAFETY: we know that a `ShortSlice` fits in a u64
unsafe {
let (ptr, len) = (buf.inner.as_mut_ptr(), buf.len());
let mut b: u64 = 0;
#[allow(trivial_casts)]
copy_nonoverlapping(ptr, &mut b as *mut _ as *mut u8, len);
b ^= mask;
#[allow(trivial_casts)]
copy_nonoverlapping(&b as *const _ as *const u8, ptr, len);
}
}
/// # Safety
/// Caller must ensure the buffer has the correct size and alignment.
#[inline]
unsafe fn cast_slice(buf: &mut [u8]) -> &mut [u64] {
// Assert correct size and alignment in debug builds
debug_assert!(buf.len().trailing_zeros() >= 3);
debug_assert!((buf.as_ptr() as usize).trailing_zeros() >= 3);
slice::from_raw_parts_mut(buf.as_mut_ptr() as *mut u64, buf.len() >> 3)
}
// Splits a slice into three parts: an unaligned short head and tail, plus an aligned
// u64 mid section.
#[inline]
fn align_buf(buf: &mut [u8]) -> (ShortSlice<'_>, &mut [u64], ShortSlice<'_>) {
let start_ptr = buf.as_ptr() as usize;
let end_ptr = start_ptr + buf.len();
// Round *up* to next aligned boundary for start
let start_aligned = (start_ptr + 7) & !0x7;
// Round *down* to last aligned boundary for end
let end_aligned = end_ptr & !0x7;
if end_aligned >= start_aligned {
// We have our three segments (head, mid, tail)
let (tmp, tail) = buf.split_at_mut(end_aligned - start_ptr);
let (head, mid) = tmp.split_at_mut(start_aligned - start_ptr);
// SAFETY: we know the middle section is correctly aligned, and the outer
// sections are smaller than 8 bytes
unsafe {
(
ShortSlice::new(head),
cast_slice(mid),
ShortSlice::new(tail),
)
mask_u32.rotate_right(8 * head as u32)
}
} else {
// We didn't cross even one aligned boundary!
// SAFETY: The outer sections are smaller than 8 bytes
unsafe { (ShortSlice::new(buf), &mut [], ShortSlice::new(&mut [])) }
mask_u32
};
for word in words.iter_mut() {
*word ^= mask_u32;
}
apply_mask_fallback(&mut suffix, mask_u32.to_ne_bytes());
}
#[cfg(test)]
mod tests {
use super::apply_mask;
/// A safe unoptimized mask application.
fn apply_mask_fallback(buf: &mut [u8], mask: &[u8; 4]) {
for (i, byte) in buf.iter_mut().enumerate() {
*byte ^= mask[i & 3];
}
}
use super::*;
// legacy test from old apply mask test. kept for now for back compat test.
// TODO: remove it and favor the other test.
#[test]
fn test_apply_mask() {
fn test_apply_mask_legacy() {
let mask = [0x6d, 0xb6, 0xb2, 0x80];
let mask_u32 = u32::from_le_bytes(mask);
let unmasked = vec![
0xf3, 0x00, 0x01, 0x02, 0x03, 0x80, 0x81, 0x82, 0xff, 0xfe, 0x00, 0x17,
@@ -138,10 +61,10 @@ mod tests {
// Check masking with proper alignment.
{
let mut masked = unmasked.clone();
apply_mask_fallback(&mut masked, &mask);
apply_mask_fallback(&mut masked, mask);
let mut masked_fast = unmasked.clone();
apply_mask(&mut masked_fast, mask_u32);
apply_mask(&mut masked_fast, mask);
assert_eq!(masked, masked_fast);
}
@@ -149,12 +72,38 @@ mod tests {
// Check masking without alignment.
{
let mut masked = unmasked.clone();
apply_mask_fallback(&mut masked[1..], &mask);
apply_mask_fallback(&mut masked[1..], mask);
let mut masked_fast = unmasked;
apply_mask(&mut masked_fast[1..], mask_u32);
apply_mask(&mut masked_fast[1..], mask);
assert_eq!(masked, masked_fast);
}
}
#[test]
fn test_apply_mask() {
let mask = [0x6d, 0xb6, 0xb2, 0x80];
let unmasked = vec![
0xf3, 0x00, 0x01, 0x02, 0x03, 0x80, 0x81, 0x82, 0xff, 0xfe, 0x00, 0x17,
0x74, 0xf9, 0x12, 0x03,
];
for data_len in 0..=unmasked.len() {
let unmasked = &unmasked[0..data_len];
// Check masking with different alignment.
for off in 0..=3 {
if unmasked.len() < off {
continue;
}
let mut masked = unmasked.to_vec();
apply_mask_fallback(&mut masked[off..], mask);
let mut masked_fast = unmasked.to_vec();
apply_mask_fast32(&mut masked_fast[off..], mask);
assert_eq!(masked, masked_fast);
}
}
}
}

View File

@@ -1,6 +1,6 @@
//! WebSocket protocol support.
//! WebSocket protocol implementation.
//!
//! To setup a WebSocket, first do web socket handshake then on success convert `Payload` into a
//! To setup a WebSocket, first perform the WebSocket handshake then on success convert `Payload` into a
//! `WsStream` stream and then use `WsWriter` to communicate with the peer.
use std::io;
@@ -8,9 +8,12 @@ use std::io;
use derive_more::{Display, Error, From};
use http::{header, Method, StatusCode};
use crate::error::ResponseError;
use crate::message::RequestHead;
use crate::response::{Response, ResponseBuilder};
use crate::{
error::ResponseError,
header::HeaderValue,
message::RequestHead,
response::{Response, ResponseBuilder},
};
mod codec;
mod dispatcher;
@@ -76,7 +79,7 @@ pub enum HandshakeError {
#[display(fmt = "Method not allowed.")]
GetMethodRequired,
/// Upgrade header if not set to websocket.
/// Upgrade header if not set to WebSocket.
#[display(fmt = "WebSocket upgrade is expected.")]
NoWebsocketUpgrade,
@@ -88,8 +91,8 @@ pub enum HandshakeError {
#[display(fmt = "WebSocket version header is required.")]
NoVersionHeader,
/// Unsupported websocket version.
#[display(fmt = "Unsupported version.")]
/// Unsupported WebSocket version.
#[display(fmt = "Unsupported WebSocket version.")]
UnsupportedVersion,
/// WebSocket key is not set or wrong.
@@ -101,23 +104,23 @@ impl ResponseError for HandshakeError {
fn error_response(&self) -> Response {
match self {
HandshakeError::GetMethodRequired => Response::MethodNotAllowed()
.header(header::ALLOW, "GET")
.insert_header((header::ALLOW, "GET"))
.finish(),
HandshakeError::NoWebsocketUpgrade => Response::BadRequest()
.reason("No WebSocket UPGRADE header found")
.reason("No WebSocket Upgrade header found")
.finish(),
HandshakeError::NoConnectionUpgrade => Response::BadRequest()
.reason("No CONNECTION upgrade")
.reason("No Connection upgrade")
.finish(),
HandshakeError::NoVersionHeader => Response::BadRequest()
.reason("Websocket version header is required")
.reason("WebSocket version header is required")
.finish(),
HandshakeError::UnsupportedVersion => Response::BadRequest()
.reason("Unsupported version")
.reason("Unsupported WebSocket version")
.finish(),
HandshakeError::BadWebsocketKey => {
@@ -127,26 +130,20 @@ impl ResponseError for HandshakeError {
}
}
/// Verify `WebSocket` handshake request and create handshake response.
// /// `protocols` is a sequence of known protocols. On successful handshake,
// /// the returned response headers contain the first protocol in this list
// /// which the server also knows.
/// Verify WebSocket handshake request and create handshake response.
pub fn handshake(req: &RequestHead) -> Result<ResponseBuilder, HandshakeError> {
verify_handshake(req)?;
Ok(handshake_response(req))
}
/// Verify `WebSocket` handshake request.
// /// `protocols` is a sequence of known protocols. On successful handshake,
// /// the returned response headers contain the first protocol in this list
// /// which the server also knows.
/// Verify WebSocket handshake request.
pub fn verify_handshake(req: &RequestHead) -> Result<(), HandshakeError> {
// WebSocket accepts only GET
if req.method != Method::GET {
return Err(HandshakeError::GetMethodRequired);
}
// Check for "UPGRADE" to websocket header
// Check for "UPGRADE" to WebSocket header
let has_hdr = if let Some(hdr) = req.headers().get(header::UPGRADE) {
if let Ok(s) = hdr.to_str() {
s.to_ascii_lowercase().contains("websocket")
@@ -187,7 +184,7 @@ pub fn verify_handshake(req: &RequestHead) -> Result<(), HandshakeError> {
Ok(())
}
/// Create websocket handshake response
/// Create WebSocket handshake response.
///
/// This function returns handshake `Response`, ready to send to peer.
pub fn handshake_response(req: &RequestHead) -> ResponseBuilder {
@@ -198,8 +195,12 @@ pub fn handshake_response(req: &RequestHead) -> ResponseBuilder {
Response::build(StatusCode::SWITCHING_PROTOCOLS)
.upgrade("websocket")
.header(header::TRANSFER_ENCODING, "chunked")
.header(header::SEC_WEBSOCKET_ACCEPT, key.as_str())
.insert_header((header::TRANSFER_ENCODING, "chunked"))
.insert_header((
header::SEC_WEBSOCKET_ACCEPT,
// key is known to be header value safe ascii
HeaderValue::from_bytes(&key).unwrap(),
))
.take()
}
@@ -224,7 +225,7 @@ mod tests {
);
let req = TestRequest::default()
.header(header::UPGRADE, header::HeaderValue::from_static("test"))
.insert_header((header::UPGRADE, header::HeaderValue::from_static("test")))
.finish();
assert_eq!(
HandshakeError::NoWebsocketUpgrade,
@@ -232,10 +233,10 @@ mod tests {
);
let req = TestRequest::default()
.header(
.insert_header((
header::UPGRADE,
header::HeaderValue::from_static("websocket"),
)
))
.finish();
assert_eq!(
HandshakeError::NoConnectionUpgrade,
@@ -243,14 +244,14 @@ mod tests {
);
let req = TestRequest::default()
.header(
.insert_header((
header::UPGRADE,
header::HeaderValue::from_static("websocket"),
)
.header(
))
.insert_header((
header::CONNECTION,
header::HeaderValue::from_static("upgrade"),
)
))
.finish();
assert_eq!(
HandshakeError::NoVersionHeader,
@@ -258,18 +259,18 @@ mod tests {
);
let req = TestRequest::default()
.header(
.insert_header((
header::UPGRADE,
header::HeaderValue::from_static("websocket"),
)
.header(
))
.insert_header((
header::CONNECTION,
header::HeaderValue::from_static("upgrade"),
)
.header(
))
.insert_header((
header::SEC_WEBSOCKET_VERSION,
header::HeaderValue::from_static("5"),
)
))
.finish();
assert_eq!(
HandshakeError::UnsupportedVersion,
@@ -277,18 +278,18 @@ mod tests {
);
let req = TestRequest::default()
.header(
.insert_header((
header::UPGRADE,
header::HeaderValue::from_static("websocket"),
)
.header(
))
.insert_header((
header::CONNECTION,
header::HeaderValue::from_static("upgrade"),
)
.header(
))
.insert_header((
header::SEC_WEBSOCKET_VERSION,
header::HeaderValue::from_static("13"),
)
))
.finish();
assert_eq!(
HandshakeError::BadWebsocketKey,
@@ -296,22 +297,22 @@ mod tests {
);
let req = TestRequest::default()
.header(
.insert_header((
header::UPGRADE,
header::HeaderValue::from_static("websocket"),
)
.header(
))
.insert_header((
header::CONNECTION,
header::HeaderValue::from_static("upgrade"),
)
.header(
))
.insert_header((
header::SEC_WEBSOCKET_VERSION,
header::HeaderValue::from_static("13"),
)
.header(
))
.insert_header((
header::SEC_WEBSOCKET_KEY,
header::HeaderValue::from_static("13"),
)
))
.finish();
assert_eq!(
StatusCode::SWITCHING_PROTOCOLS,

View File

@@ -1,5 +1,7 @@
use std::convert::{From, Into};
use std::fmt;
use std::{
convert::{From, Into},
fmt,
};
/// Operation codes as part of RFC6455.
#[derive(Debug, Eq, PartialEq, Clone, Copy)]
@@ -28,8 +30,9 @@ pub enum OpCode {
impl fmt::Display for OpCode {
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
use self::OpCode::*;
match *self {
use OpCode::*;
match self {
Continue => write!(f, "CONTINUE"),
Text => write!(f, "TEXT"),
Binary => write!(f, "BINARY"),
@@ -44,6 +47,7 @@ impl fmt::Display for OpCode {
impl From<OpCode> for u8 {
fn from(op: OpCode) -> u8 {
use self::OpCode::*;
match op {
Continue => 0,
Text => 1,
@@ -62,6 +66,7 @@ impl From<OpCode> for u8 {
impl From<u8> for OpCode {
fn from(byte: u8) -> OpCode {
use self::OpCode::*;
match byte {
0 => Continue,
1 => Text,
@@ -74,67 +79,69 @@ impl From<u8> for OpCode {
}
}
/// Status code used to indicate why an endpoint is closing the `WebSocket`
/// connection.
/// Status code used to indicate why an endpoint is closing the WebSocket connection.
#[derive(Debug, Eq, PartialEq, Clone, Copy)]
pub enum CloseCode {
/// Indicates a normal closure, meaning that the purpose for
/// which the connection was established has been fulfilled.
/// Indicates a normal closure, meaning that the purpose for which the connection was
/// established has been fulfilled.
Normal,
/// Indicates that an endpoint is "going away", such as a server
/// going down or a browser having navigated away from a page.
/// Indicates that an endpoint is "going away", such as a server going down or a browser having
/// navigated away from a page.
Away,
/// Indicates that an endpoint is terminating the connection due
/// to a protocol error.
/// Indicates that an endpoint is terminating the connection due to a protocol error.
Protocol,
/// Indicates that an endpoint is terminating the connection
/// because it has received a type of data it cannot accept (e.g., an
/// endpoint that understands only text data MAY send this if it
/// Indicates that an endpoint is terminating the connection because it has received a type of
/// data it cannot accept (e.g., an endpoint that understands only text data MAY send this if it
/// receives a binary message).
Unsupported,
/// Indicates an abnormal closure. If the abnormal closure was due to an
/// error, this close code will not be used. Instead, the `on_error` method
/// of the handler will be called with the error. However, if the connection
/// is simply dropped, without an error, this close code will be sent to the
/// handler.
/// Indicates an abnormal closure. If the abnormal closure was due to an error, this close code
/// will not be used. Instead, the `on_error` method of the handler will be called with
/// the error. However, if the connection is simply dropped, without an error, this close code
/// will be sent to the handler.
Abnormal,
/// Indicates that an endpoint is terminating the connection
/// because it has received data within a message that was not
/// consistent with the type of the message (e.g., non-UTF-8 \[RFC3629\]
/// Indicates that an endpoint is terminating the connection because it has received data within
/// a message that was not consistent with the type of the message (e.g., non-UTF-8 \[RFC3629\]
/// data within a text message).
Invalid,
/// Indicates that an endpoint is terminating the connection
/// because it has received a message that violates its policy. This
/// is a generic status code that can be returned when there is no
/// other more suitable status code (e.g., Unsupported or Size) or if there
/// is a need to hide specific details about the policy.
/// Indicates that an endpoint is terminating the connection because it has received a message
/// that violates its policy. This is a generic status code that can be returned when there is
/// no other more suitable status code (e.g., Unsupported or Size) or if there is a need to hide
/// specific details about the policy.
Policy,
/// Indicates that an endpoint is terminating the connection
/// because it has received a message that is too big for it to
/// process.
/// Indicates that an endpoint is terminating the connection because it has received a message
/// that is too big for it to process.
Size,
/// Indicates that an endpoint (client) is terminating the
/// connection because it has expected the server to negotiate one or
/// more extension, but the server didn't return them in the response
/// message of the WebSocket handshake. The list of extensions that
/// are needed should be given as the reason for closing.
/// Note that this status code is not used by the server, because it
/// can fail the WebSocket handshake instead.
/// Indicates that an endpoint (client) is terminating the connection because it has expected
/// the server to negotiate one or more extension, but the server didn't return them in the
/// response message of the WebSocket handshake. The list of extensions that are needed should
/// be given as the reason for closing. Note that this status code is not used by the server,
/// because it can fail the WebSocket handshake instead.
Extension,
/// Indicates that a server is terminating the connection because
/// it encountered an unexpected condition that prevented it from
/// fulfilling the request.
/// Indicates that a server is terminating the connection because it encountered an unexpected
/// condition that prevented it from fulfilling the request.
Error,
/// Indicates that the server is restarting. A client may choose to
/// reconnect, and if it does, it should use a randomized delay of 5-30
/// seconds between attempts.
/// Indicates that the server is restarting. A client may choose to reconnect, and if it does,
/// it should use a randomized delay of 5-30 seconds between attempts.
Restart,
/// Indicates that the server is overloaded and the client should either
/// connect to a different IP (when multiple targets exist), or
/// reconnect to the same IP when a user has performed an action.
/// Indicates that the server is overloaded and the client should either connect to a different
/// IP (when multiple targets exist), or reconnect to the same IP when a user has performed
/// an action.
Again,
#[doc(hidden)]
Tls,
#[doc(hidden)]
Other(u16),
}
@@ -142,6 +149,7 @@ pub enum CloseCode {
impl From<CloseCode> for u16 {
fn from(code: CloseCode) -> u16 {
use self::CloseCode::*;
match code {
Normal => 1000,
Away => 1001,
@@ -164,6 +172,7 @@ impl From<CloseCode> for u16 {
impl From<u16> for CloseCode {
fn from(code: u16) -> CloseCode {
use self::CloseCode::*;
match code {
1000 => Normal,
1001 => Away,
@@ -211,17 +220,29 @@ impl<T: Into<String>> From<(CloseCode, T)> for CloseReason {
}
}
static WS_GUID: &str = "258EAFA5-E914-47DA-95CA-C5AB0DC85B11";
/// The WebSocket GUID as stated in the spec. See https://tools.ietf.org/html/rfc6455#section-1.3.
static WS_GUID: &[u8] = b"258EAFA5-E914-47DA-95CA-C5AB0DC85B11";
// TODO: hash is always same size, we don't need String
pub fn hash_key(key: &[u8]) -> String {
use sha1::Digest;
let mut hasher = sha1::Sha1::new();
/// Hashes the `Sec-WebSocket-Key` header according to the WebSocket spec.
///
/// Result is a Base64 encoded byte array. `base64(sha1(input))` is always 28 bytes.
pub fn hash_key(key: &[u8]) -> [u8; 28] {
let hash = {
use sha1::Digest as _;
hasher.update(key);
hasher.update(WS_GUID.as_bytes());
let mut hasher = sha1::Sha1::new();
base64::encode(&hasher.finalize())
hasher.update(key);
hasher.update(WS_GUID);
hasher.finalize()
};
let mut hash_b64 = [0; 28];
let n = base64::encode_config_slice(&hash, base64::STANDARD, &mut hash_b64);
assert_eq!(n, 28);
hash_b64
}
#[cfg(test)]
@@ -289,11 +310,11 @@ mod test {
#[test]
fn test_hash_key() {
let hash = hash_key(b"hello actix-web");
assert_eq!(&hash, "cR1dlyUUJKp0s/Bel25u5TgvC3E=");
assert_eq!(&hash, b"cR1dlyUUJKp0s/Bel25u5TgvC3E=");
}
#[test]
fn closecode_from_u16() {
fn close_code_from_u16() {
assert_eq!(CloseCode::from(1000u16), CloseCode::Normal);
assert_eq!(CloseCode::from(1001u16), CloseCode::Away);
assert_eq!(CloseCode::from(1002u16), CloseCode::Protocol);
@@ -311,7 +332,7 @@ mod test {
}
#[test]
fn closecode_into_u16() {
fn close_code_into_u16() {
assert_eq!(1000u16, Into::<u16>::into(CloseCode::Normal));
assert_eq!(1001u16, Into::<u16>::into(CloseCode::Away));
assert_eq!(1002u16, Into::<u16>::into(CloseCode::Protocol));

View File

@@ -1,8 +1,11 @@
use actix_http::{http, HttpService, Request, Response};
use actix_http::{
error, http, http::StatusCode, HttpMessage, HttpService, Request, Response,
};
use actix_http_test::test_server;
use actix_service::ServiceFactoryExt;
use actix_utils::future;
use bytes::Bytes;
use futures_util::future::{self, ok};
use futures_util::StreamExt as _;
const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
Hello World Hello World Hello World Hello World Hello World \
@@ -38,7 +41,7 @@ async fn test_h1_v2() {
let response = srv.get("/").send().await.unwrap();
assert!(response.status().is_success());
let request = srv.get("/").header("x-test", "111").send();
let request = srv.get("/").insert_header(("x-test", "111")).send();
let mut response = request.await.unwrap();
assert!(response.status().is_success());
@@ -58,7 +61,7 @@ async fn test_h1_v2() {
async fn test_connection_close() {
let srv = test_server(move || {
HttpService::build()
.finish(|_| ok::<_, ()>(Response::Ok().body(STR)))
.finish(|_| future::ok::<_, ()>(Response::Ok().body(STR)))
.tcp()
.map(|_| ())
})
@@ -74,9 +77,9 @@ async fn test_with_query_parameter() {
HttpService::build()
.finish(|req: Request| {
if req.uri().query().unwrap().contains("qp=") {
ok::<_, ()>(Response::Ok().finish())
future::ok::<_, ()>(Response::Ok().finish())
} else {
ok::<_, ()>(Response::BadRequest().finish())
future::ok::<_, ()>(Response::BadRequest().finish())
}
})
.tcp()
@@ -88,3 +91,55 @@ async fn test_with_query_parameter() {
let response = request.send().await.unwrap();
assert!(response.status().is_success());
}
#[actix_rt::test]
async fn test_h1_expect() {
let srv = test_server(move || {
HttpService::build()
.expect(|req: Request| async {
if req.headers().contains_key("AUTH") {
Ok(req)
} else {
Err(error::ErrorExpectationFailed("expect failed"))
}
})
.h1(|req: Request| async move {
let (_, mut body) = req.into_parts();
let mut buf = Vec::new();
while let Some(Ok(chunk)) = body.next().await {
buf.extend_from_slice(&chunk);
}
let str = std::str::from_utf8(&buf).unwrap();
assert_eq!(str, "expect body");
Ok::<_, ()>(Response::Ok().finish())
})
.tcp()
})
.await;
// test expect without payload.
let request = srv
.request(http::Method::GET, srv.url("/"))
.insert_header(("Expect", "100-continue"));
let response = request.send().await;
assert!(response.is_err());
// test expect would fail to continue
let request = srv
.request(http::Method::GET, srv.url("/"))
.insert_header(("Expect", "100-continue"));
let response = request.send_body("expect body").await.unwrap();
assert_eq!(response.status(), StatusCode::EXPECTATION_FAILED);
// test exepct would continue
let request = srv
.request(http::Method::GET, srv.url("/"))
.insert_header(("Expect", "100-continue"))
.insert_header(("AUTH", "996"));
let response = request.send_body("expect body").await.unwrap();
assert!(response.status().is_success());
}

Some files were not shown because too many files have changed in this diff Show More